1 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/MenuBackend.h (fulllabel): new method.
5 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
6 the menu shortcuts of a menu are unique and whether they
7 correspond to a letter of the label.
8 (expand): call checkShortcuts when debugging.
10 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
12 * src/insets/insettext.C (InsetButtonPress): shut off warning.
14 2000-11-02 Lior Silberman <lior@Princeton.EDU>
16 * lib/examples/*.lyx : '\language default' => '\language english'
18 * lib/examples/it_splash.lyx : except where it should be italian
20 * lib/templates/*.lyx : the same
22 * doc/*.lyx* : the same
24 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
26 * lib/bind/menus.bind: remove the Layout menu entries, which I
27 somehow forgot earlier.
29 2000-11-03 Rob Lahaye <lahaye@postech.edu>
31 * lib/ui/old-default.ui: keep the old one here for reference (to
34 * lib/ui/default.ui: update the menu layout
36 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
38 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
39 Can now Apply to different insets without closing the dialog.
41 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
42 Can't actually DO anything with them yet, but I'd like a little
45 * src/frontends/xforms/input_validators.[ch]
46 (fl_lowercase_filter): new.
48 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
50 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
51 of MATH_CODE. This fixes a bug with math-macros in RTL text.
53 * src/text.C (PrepareToPrint): Show math-macros block aligned.
55 2000-11-02 Juergen Vigna <jug@sad.it>
57 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
58 on char insertion as it has already be updated by bv->updateInset().
60 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
61 if an inset inside was updated.
63 * lib/configure.cmd: commented out fax-search code
65 2000-11-01 Yves Bastide <stid@acm.org>
67 * src/tabular.C (OldFormatRead): set tabular language to the
70 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
72 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
73 class names with non-letter characters (from Yves Bastide).
75 * lib/ui/default.ui: change Item to OptItem in import menu.
76 Comment out fax stuff.
78 * lib/configure.m4: comment out fax-related stuff.
80 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
82 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
83 useful xforms helper functions. At present contains only formatted().
84 Input a string and it returns it with line breaks so that in fits
87 * src/frontends/xforms/Makefile.am: add new files.
89 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
90 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
93 * src/frontends/xforms/FormPreferences.[Ch]:
94 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
95 but lots of little clean ups. Removed enum State. Make use of
96 formatted(). Constify lots of methods. Perhaps best of all: removed
97 requirement for that horrible reinterpret_cast from pointer to long in
100 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
102 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
103 conditionalize build on xforms < 0.89
105 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
107 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
109 * src/LyXAction.C (init): comment out fax
111 * src/lyxrc.h: comment out the fax enums
112 comment out the fax variables
114 * src/commandtags.h: comment out LFUN_FAX
116 * src/lyxrc.C: disable fax variables.
117 (read): disable parsing of fax variables
118 (output): disable writing of fax variables
119 (getFeedback): now description for fax variables
121 * src/lyxfunc.C: comment out MenuFax
122 (Dispatch): disable LFUN_FAX
124 * src/lyx_cb.C (MenuFax): comment out
126 * src/WorkArea.C: add <cctype>
127 (work_area_handler): better key handling, should be ok now.
128 for accented chars + etc
130 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
131 lyx_sendfax.h and lyx_sendfax_man.C
133 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
134 (show): don't call InitLyXLookup when using xforms 0.89
136 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
138 * src/trans.C (AddDeadkey): better fix, the other one could crash...
140 * src/support/filetools.C (GetFileContents): close to dummy change
142 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
144 * src/trans.C (AddDeadkey): workaround stupid compilers.
146 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
148 * src/frontends/xforms/FormDocument.C (class_update): fix setting
149 of two-sided document.
151 2000-10-31 Juergen Vigna <jug@sad.it>
153 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
155 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
156 xposition to the Edit call.
158 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
160 * src/trans.C (AddDeadkey): cast explicitly to char.
162 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
164 * src/tabular.C (AsciiBottomHLine): simplify?
165 (AsciiTopHLine): simplify?
166 (print_n_chars): simplify
167 (DocBook): remove most of the << endl; we should flush the stream
168 as seldom as possible.
170 (TeXBottomHLine): ditto
173 (write_attribute): try a templified version.
174 (set_row_column_number_info): lesson scope of variables
176 * src/support/lstrings.h (tostr): new specialization of tostr
178 * src/trans.C (AddDeadkey): slightly cleaner fix.
180 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
182 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
183 '%%' in Toc menu labels.
186 * src/insets/insetlatexaccent.C (draw): Correct rendering when
187 font_norm is iso10646-1.
189 * src/font.C (ascent): Fixed for 16bit fonts
190 (descent,lbearing,rbearing): ditto
192 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
194 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
195 (getFeedback): new static method.
197 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
198 Now use combox rather than choice to display languages.
199 Feedback is now output using a new timer callback mechanism, identical
200 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
202 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
204 * src/minibuffer.C: fix for older compilers
206 2000-10-30 Juergen Vigna <jug@sad.it>
208 * src/insets/insettext.C (InsertInset): fixed this as the cursor
209 has to be Left of the inset otherwise LyXText won't find it!
211 * src/BufferView2.C (open_new_inset): delete the inset if it can
214 2000-10-30 Rob Lahaye <lahaye@postech.edu>
218 2000-10-29 Marko Vendelin <markov@ioc.ee>
219 * src/frontends/gnome/FormCitation.C
220 * src/frontends/gnome/FormCitation.h
221 * src/frontends/gnome/FormCopyright.C
222 * src/frontends/gnome/FormCopyright.h
223 * src/frontends/gnome/FormError.C
224 * src/frontends/gnome/FormError.h
225 * src/frontends/gnome/FormIndex.C
226 * src/frontends/gnome/FormIndex.h
227 * src/frontends/gnome/FormPrint.C
228 * src/frontends/gnome/FormPrint.h
229 * src/frontends/gnome/FormRef.C
230 * src/frontends/gnome/FormRef.h
231 * src/frontends/gnome/FormToc.C
232 * src/frontends/gnome/FormToc.h
233 * src/frontends/gnome/FormUrl.C
234 * src/frontends/gnome/FormUrl.h
235 * src/frontends/gnome/Menubar_pimpl.C
236 * src/frontends/gnome/mainapp.C
237 * src/frontends/gnome/mainapp.h
238 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
239 changing update() to updateSlot() where appropriate
241 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
243 * src/frontends/xforms/FormPreferences.[Ch]:
244 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
247 2000-10-28 Juergen Vigna <jug@sad.it>
249 * src/insets/insettabular.C (draw): fixed drawing bug.
251 * src/insets/insettext.C (clear):
253 (SetParagraphData): clearing the TEXT buffers when deleting the
254 paragraphs used by it.
256 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
258 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
260 2000-10-27 Juergen Vigna <jug@sad.it>
262 * src/tabular.C (~LyXTabular): removed not needed anymore.
264 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
267 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
269 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
272 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
275 * src/frontends/xforms/FormPreferences.[Ch]:
276 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
277 Reorganised as modules based on tabs. Much easier to follow the
278 flow and to add new tabs. Added warning and feedback messages.
281 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
283 * src/tabular.h (DocBook): add std:: qualifier.
285 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
287 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
288 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
291 * insettabular.C (DocBook): uses the tabular methods to export
294 * src/insets/insettext.h
295 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
297 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
299 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
302 * src/lyxfunc.C (MenuNew): lessen the scope of fname
303 moved misplaced AllowInput two lines up.
305 * src/buffer.C (readFile): compare float with float, not with int
307 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
309 * src/minibuffer.C: add "using SigC::slot" statement.
311 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
313 * src/frontends/xforms/forms/README: updated section about make.
315 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
316 Tidied some forms up, made two of form_tabular's tabs more
317 self-consistent, fixed Jean-Marc's size problem in form_preferences,
318 fixed translation problem with "Column".
320 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
322 * src/minibuffer.h: use Timeout instead of the xforms timer
324 (setTimer) rewrite for the Timeout, change to unsigned arg
325 (set): change to unsigned timer arg
328 * src/minibuffer.C (TimerCB): removed func
329 (C_MiniBuffer_TimerCB): removed func
330 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
331 (peek_event): use a switch statement
332 (add): don't use fl_add_timer.
333 (Set): rewrite to use the Timeout
336 * src/Timeout.[Ch] (setType): return a Timeout &
337 (setTimeout): ditto, change to unsigned arg for timeout
339 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
341 * src/mathed/formula.C (mathed_string_width): Use string instead
342 of a constant size char array.
344 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
346 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
347 the two recently added operator<< for SMInput and State.
349 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
351 (OkCancelPolicy): ditto
352 (OkCancelReadOnlyPolicy): ditto
353 (NoRepeatedApplyReadOnlyPolicy): ditto
354 (OkApplyCancelReadOnlyPolicy): ditto
355 (OkApplyCancelPolicy): ditto
356 (NoRepeatedApplyPolicy): ditto
358 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
360 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
361 add the usual std:: qualifiers.
363 2000-10-25 Juergen Vigna <jug@sad.it>
365 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
367 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
369 * src/support/filetools.C (MakeRelPath): change some types to
372 * src/frontends/ButtonPolicies.h (operator<<): new operator for
373 ButtonPolicy::SMInput and ButtonPolicy::State.
375 * src/FontLoader.C (reset): small cleanup
376 (unload): small cleanup
378 * src/FontInfo.C (getFontname): initialize error to 10000.0
380 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
382 * src/frontends/xforms/FormPreferences.[Ch]:
383 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
384 TeX encoding and default paper size sections.
386 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
388 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
391 * src/frontends/xforms/FormError.C (disconnect): use erase() to
392 make the message_ empty.
393 (FormError): don't initialize message_ in initializer list.
395 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
397 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
399 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
401 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
403 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
405 * src/frontends/kde/*data.[Ch]: _("") is not
408 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
410 * src/buffer.C: removed redundant using directive.
412 * src/frontends/DialogBase.h: revert to original definition of
415 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
416 stuff into two classes, one for each dialog, requires a new
417 element in the dialogs vector, FormTabularCreate.
419 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
422 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
423 method. Continues Allan's idea, but means that derived classes
424 don't need to worry about "update or hide?".
426 * src/frontends/xforms/FormError.C (showInset): add connection
429 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
430 one for each dialog. FormTabular now contains main tabular dialog
433 * src/frontends/xforms/FormTabularCreate.[Ch]:
434 * src/frontends/xforms/forms/form_tabular_create.fd: the create
437 * src/frontends/xforms/FormGraphics.[Ch]:
438 * src/frontends/xforms/forms/form_graphics.fd
439 * src/frontends/xforms/FormTabular.[Ch]:
440 * src/frontends/xforms/forms/form_tabular.fd: made daughter
441 classes of FormInset.
443 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
444 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
446 * src/frontends/xforms/Makefile.am:
447 * src/frontends/xforms/forms/makefile: added new files.
449 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
450 variable. added Signal0 hide signal, in keeping with other GUI-I
453 * src/support/lstrings.h: removed redundant std:: qualifier as
454 it's already declared in Lsstream.h.
456 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
458 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
462 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
464 * src/tabular.C (Ascii): minimize scope of cell.
466 * src/BufferView2.C (nextWord): return string() instead of 0;
468 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
470 * src/converter.h: add a std:: qualifier
472 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
474 * src/importer.[Ch]: New files. Used for importing files into LyX.
476 * src/lyxfunc.C (doImport): Use the new Importer class.
478 * src/converter.h: Add shortcut member to the Format class.
479 Used for holding the menu shortcut.
481 * src/converter.C and other files: Made a distinction between
482 format name and format extension. New formats can be defined using
483 the \format lyxrc tag.
484 Added two new converter flags: latex and disable.
486 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
488 * src/support/lyxlib.h: unify namespace/struct implementation.
489 Remove extra declarations.
491 * src/support/chdir.C (chdir): remove version taking char const *
493 * src/support/rename.C: ditto.
494 * src/support/lyxsum.C: ditto.
496 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
498 * src/frontends/xforms/FormBase.[Ch]:
499 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
500 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
501 work only for the next call to fl_show_form(). The correct place to set
502 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
503 done. FormBase also stores minw_, minh_ itself. All dialogs derived
504 from FormBase have the minimum size set; no more stupid crashes with
507 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
509 * lib/ui/default.ui: fix shortcut for Insert->Include File.
511 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
513 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
515 * src/support/lyxlib.h: changed second argument of mkdir to
516 unsigned long int (unsigned int would probably have been enough,
517 but...). Removed <sys/types.h> header.
518 * src/support/mkdir.C (mkdir): ditto.
522 2000-10-19 Juergen Vigna <jug@sad.it>
524 * src/lyxfunc.C (MenuNew): small fix (form John)
526 * src/screen.C (Update): removed unneeded code.
528 * src/tabular.C (Ascii): refixed int != uint bug!
530 * src/support/lyxlib.h: added sys/types.h include for now permits
531 compiling, but I don't like this!
533 2000-10-18 Juergen Vigna <jug@sad.it>
535 * src/text2.C (ClearSelection): if we clear the selection we need
536 more refresh so set the status apropriately
538 * src/insets/insettext.C (draw): hopefully finally fixed draw
541 2000-10-12 Juergen Vigna <jug@sad.it>
543 * src/insets/insettext.C (draw): another small fix and make a block
544 so that variables are localized.
546 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
548 * src/support/lstrings.C (lowercase, uppercase):
549 use explicit casts to remove compiler warnings.
551 * src/support/LRegex.C (Impl):
552 * src/support/StrPool.C (add):
553 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
554 (AddPath, MakeDisplayPath):
555 * src/support/lstrings.C (prefixIs, subst):
556 use correct type to remove compiler warnings.
558 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
560 * src/support/lyxlib.h:
561 * src/support/mkdir.C (mkdir): change parameter to mode_t for
562 portability and to remove compiler warning with DEC cxx.
564 * src/support/FileInfo.[Ch] (flagRWX): ditto.
566 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
568 * src/minibuffer.C (peek_event): retun 1 when there has been a
569 mouseclick in the minibuffer.
573 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
575 * src/frontends/xforms/FormParagraph.C: more space above/below
578 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
580 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
581 a char only if real_current_font was changed.
583 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
585 * NEWS: update somewhat for 1.1.6
587 * lib/ui/default.ui: clean up.
589 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
591 * lib/CREDITS: clean up
593 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
595 * src/combox.[Ch] (select): changed argument back to int
596 * src/combox.C (peek_event): removed num_bytes as it is declared but
599 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
600 modified calls to Combox::select() to remove warnings about type
603 * src/insets/insetbutton.C (width): explicit cast to remove warning
604 about type conversion.
606 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
609 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
610 sel_pos_end, refering to cursor position are changed to
611 LyXParagraph::size_type.
613 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
614 consistent with LyXCursor::pos().
615 (inset_pos): changed to LyXParagraph::size_type for same reason.
617 * src/insets/insettext.C (resizeLyXText): changed some temporary
618 variables refing to cursor position to LyXParagraph::size_type.
620 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
622 * src/frontends/kde/<various>: The Great Renaming,
625 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
627 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
629 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
631 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
632 0 when there are no arguments.
634 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
636 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
637 to segfaults when pressing Ok in InsetBibtex dialog.
639 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
641 * forms/layout_forms.fd:
642 * src/layout_forms.C (create_form_form_character): small change to use
643 labelframe rather than engraved frame + text
645 * src/lyx_gui.C (create_forms): initialise choice_language with some
646 arbitrary value to prevent segfault when dialog is shown.
648 2000-10-16 Baruch Even <baruch.even@writeme.com>
650 * src/converter.C (runLaTeX, scanLog): Added a warning when there
651 is no resulting file. This pertains only to LaTeX output.
653 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
655 * src/text.C (Backspace): Make sure that the row of the cursor is
658 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
661 * src/lyx_gui.C (init): Prevent a crash when only one font from
662 menu/popup fonts is not found.
664 * lib/lyxrc.example: Add an example for binding a key for language
667 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
669 * src/converter.C (GetReachable): Changed the returned type to
671 (IsReachable): New method
673 * src/MenuBackend.C (expand): Handle formats that appear more
676 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
678 * src/frontends/support/Makefile.am
679 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
682 * lib/CREDITS: add Garst Reese.
684 * src/support/snprintf.h: add extern "C" {} around the definitions.
686 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
688 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
691 * src/frontends/xforms/FormDocument.C:
692 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
693 compile without "conversion to integral type of smaller size"
696 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
698 * src/text.C (GetColumnNearX): Fixed disabled code.
700 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
702 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
705 * src/support/snprintf.[ch]: new files
707 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
709 * src/frontends/kde/formprintdialog.C: add
710 file browser for selecting postscript output
712 * src/frontends/kde/formprintdialogdata.C:
713 * src/frontends/kde/formprintdialogdata.h: re-generate
716 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
718 * src/frontends/gnome/Makefile.am:
719 * src/frontends/kde/Makefile.am: FormCommand.C
720 disappeared from xforms
722 * src/frontends/kde/FormCitation.C:
723 * src/frontends/kde/FormIndex.C: read-only
726 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
728 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
731 * src/bufferlist.C: add using directive.
733 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
735 * src/support/lyxfunctional.h: version of class_fun for void
736 returns added, const versions of back_inseter_fun and compare_fun
739 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
741 * src/frontends/xforms/FormInset.C (showInset): fix typo.
743 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
745 * ChangeLog: cleanup.
747 * lib/CREDITS: update to add all the contributors we've forgotten.
748 I have obviously missed some, so tell me whether there were
751 2000-10-13 Marko Vendelin <markov@ioc.ee>
753 * src/frontends/gnome/FormCitation.C
754 * src/frontends/gnome/FormCitation.h
755 * src/frontends/gnome/FormError.C
756 * src/frontends/gnome/FormIndex.C
757 * src/frontends/gnome/FormRef.C
758 * src/frontends/gnome/FormRef.h
759 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
761 * src/frontends/gnome/FormCitation.C
762 * src/frontends/gnome/FormCopyright.C
763 * src/frontends/gnome/FormError.C
764 * src/frontends/gnome/FormIndex.C
765 * src/frontends/gnome/FormRef.C
766 * src/frontends/gnome/FormToc.C
767 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
770 * src/frontends/gnome/Menubar_pimpl.C
771 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
774 2000-10-11 Baruch Even <baruch.even@writeme.com>
777 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
778 to convey its real action.
780 * src/minibuffer.C (peek_event): Added action when mouse clicks to
781 clear the minibuffer and prepare to enter a command.
783 * src/mathed/formula.C (LocalDispatch): Changed to conform with
784 the rename from ExecCommand to PrepareForCommand.
785 * src/lyxfunc.C (Dispatch): ditto.
787 2000-10-11 Baruch Even <baruch.even@writeme.com>
789 * src/buffer.C (writeFile): Added test for errors on writing, this
790 catches all errors and not only file system full errors as intended.
792 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
794 * src/lyx_gui.C (create_forms): better fix for crash with
795 translated interface.
797 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
799 * src/frontends/kde/Makefile.am:
800 * src/frontends/kde/FormCopyright.C:
801 * src/frontends/kde/formcopyrightdialog.C:
802 * src/frontends/kde/formcopyrightdialog.h:
803 * src/frontends/kde/formcopyrightdialogdata.C:
804 * src/frontends/kde/formcopyrightdialogdata.h:
805 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
806 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
807 copyright to use qtarch
809 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
811 * src/encoding.C (read): Fixed bug that caused an error message at
814 * po/Makefile.in.in: Fixed rule for ext_l10n.h
816 * lib/lyxrc.example: Fixed hebrew example.
818 2000-10-13 Allan Rae <rae@lyx.org>
820 * src/frontends/xforms/FormPreferences.C (input): reworking the
822 (build, update, apply): New inputs in various tabfolders
824 * src/frontends/xforms/FormToc.C: use new button policy.
825 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
826 dialogs that either can't use any existing policy or where it just
829 * src/frontends/xforms/FormTabular.h: removed copyright notice that
832 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
833 added a bool parameter which is ignored.
835 * src/buffer.C (setReadonly):
836 * src/BufferView_pimpl.C (buffer):
837 * src/frontends/kde/FormCopyright.h (update):
838 * src/frontends/kde/FormCitation.[Ch] (update):
839 * src/frontends/kde/FormIndex.[Ch] (update):
840 * src/frontends/kde/FormPrint.[Ch] (update):
841 * src/frontends/kde/FormRef.[Ch] (update):
842 * src/frontends/kde/FormToc.[Ch] (update):
843 * src/frontends/kde/FormUrl.[Ch] (update):
844 * src/frontends/gnome/FormCopyright.h (update):
845 * src/frontends/gnome/FormCitation.[Ch] (update):
846 * src/frontends/gnome/FormError.[Ch] (update):
847 * src/frontends/gnome/FormIndex.[Ch] (update):
848 * src/frontends/gnome/FormPrint.[Ch] (update):
849 * src/frontends/gnome/FormRef.h (update):
850 * src/frontends/gnome/FormToc.[Ch] (update):
851 * src/frontends/gnome/FormUrl.[Ch] (update):
852 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
853 to updateBufferDependent and DialogBase
855 * src/frontends/xforms/FormCitation.[hC]:
856 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
857 * src/frontends/xforms/FormError.[Ch]:
858 * src/frontends/xforms/FormGraphics.[Ch]:
859 * src/frontends/xforms/FormIndex.[Ch]:
860 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
861 and fixed readOnly handling.
862 * src/frontends/xforms/FormPrint.[Ch]:
863 * src/frontends/xforms/FormRef.[Ch]:
864 * src/frontends/xforms/FormTabular.[Ch]:
865 * src/frontends/xforms/FormToc.[Ch]:
866 * src/frontends/xforms/FormUrl.[Ch]:
867 * src/frontends/xforms/FormInset.[Ch]:
868 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
869 form of updateBufferDependent.
871 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
872 if form()->visible just in case someone does stuff to the form in a
875 * src/frontends/DialogBase.h (enum): removed enum since we can now use
876 the buttoncontroller for everything the enum used to be used for.
877 (update) It would seem we need to force all dialogs to use a bool
878 parameter or have two update functions. I chose to go with one.
879 I did try removing update() from here and FormBase and defining the
880 appropriate update signatures in FormBaseB[DI] but then ran into the
881 problem of the update() call in FormBase::show(). Whatever I did
882 to get around that would require another function and that just
883 got more confusing. Hence the decision to make everyone have an
884 update(bool). An alternative might have been to override show() in
885 FormBaseB[DI] and that would allow the different and appropriate
888 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
889 true == buffer change occurred. I decided against using a default
890 template parameter since not all compilers support that at present.
892 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
894 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
895 army knife" by removing functionality.
896 (clearStore): removed. All such housekeeping on hide()ing the dialog
897 is to be carried out by overloaded disconnect() methods.
898 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
899 superceded by Baruch's neat test (FormGraphics) to update an existing
900 dialog if a new signal is recieved rather than block all new signals
902 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
903 only to Inset dialogs.
904 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
905 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
907 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
909 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
910 as a base class to all inset dialogs. Used solely to connect/disconnect
911 the Inset::hide signal and to define what action to take on receipt of
912 a UpdateBufferDependent signal.
913 (FormCommand): now derived from FormInset.
915 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
918 * src/frontends/xforms/FormCopyright.[Ch]:
919 * src/frontends/xforms/FormPreferences.[Ch]:
920 now derived from FormBaseBI.
922 * src/frontends/xforms/FormDocument.[Ch]:
923 * src/frontends/xforms/FormParagraph.[Ch]:
924 * src/frontends/xforms/FormPrint.[Ch]:
925 now derived from FormBaseBD.
927 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
929 * src/frontends/xforms/FormCitation.[Ch]:
930 * src/frontends/xforms/FormError.[Ch]:
931 * src/frontends/xforms/FormRef.[Ch]:
932 * src/frontends/xforms/FormToc.[Ch]:
933 (clearStore): reworked as disconnect().
935 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
938 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
940 * src/converter.C (runLaTeX): constify buffer argument
943 * src/frontends/support/Makefile.am (INCLUDES): fix.
945 * src/buffer.h: add std:: qualifier
946 * src/insets/figinset.C (addpidwait): ditto
947 * src/MenuBackend.C: ditto
948 * src/buffer.C: ditto
949 * src/bufferlist.C: ditto
950 * src/layout.C: ditto
951 * src/lyxfunc.C: ditto
953 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
955 * src/lyxtext.h (bidi_level): change return type to
956 LyXParagraph::size_type.
958 * src/lyxparagraph.h: change size_type to
959 TextContainer::difference_type. This should really be
960 TextContainer::size_type, but we need currently to support signed
963 2000-10-11 Marko Vendelin <markov@ioc.ee>
964 * src/frontends/gnome/FormError.h
965 * src/frontends/gnome/FormRef.C
966 * src/frontends/gnome/FormRef.h
967 * src/frontends/gnome/FormError.C
968 * src/frontends/gnome/Makefile.am
969 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
970 to Gnome frontend. Both dialogs use "action" area.
972 2000-10-12 Baruch Even <baruch.even@writeme.com>
974 * src/graphics/GraphicsCacheItem_pimpl.C:
975 * src/graphics/Renderer.C:
976 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
979 2000-10-12 Juergen Vigna <jug@sad.it>
981 * src/insets/insettext.C (draw): fixed drawing bug (specifically
982 visible when selecting).
984 * development/Code_rules/Rules: fixed some typos.
986 2000-10-09 Baruch Even <baruch.even@writeme.com>
988 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
989 compiling on egcs 1.1.2 possible.
991 * src/filedlg.C (comp_direntry::operator() ): ditto.
993 2000-08-31 Baruch Even <baruch.even@writeme.com>
995 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
998 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
999 transient it now only gets freed when the object is destructed.
1001 2000-08-24 Baruch Even <baruch.even@writeme.com>
1003 * src/frontends/FormGraphics.h:
1004 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1007 2000-08-20 Baruch Even <baruch.even@writeme.com>
1009 * src/insets/insetgraphics.C:
1010 (draw): Added messages to the drawn rectangle to report status.
1011 (updateInset): Disabled the use of the inline graphics,
1014 2000-08-17 Baruch Even <baruch.even@writeme.com>
1016 * src/frontends/support: Directory added for the support of GUII LyX.
1018 * src/frontends/support/LyXImage.h:
1019 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1022 * src/frontends/support/LyXImage_X.h:
1023 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1024 version of LyXImage, this uses the Xlib Pixmap.
1026 * src/PainterBase.h:
1027 * src/PainterBase.C:
1029 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1030 replacement to Pixmap.
1032 * src/insets/insetgraphics.h:
1033 * src/insets/insetgraphics.C:
1034 * src/graphics/GraphicsCacheItem.h:
1035 * src/graphics/GraphicsCacheItem.C:
1036 * src/graphics/GraphicsCacheItem_pimpl.h:
1037 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1040 * src/graphics/GraphicsCacheItem.h:
1041 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1042 another copy of the object.
1044 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1045 of cacheHandle, this fixed a bug that sent LyX crashing.
1047 * src/graphics/XPM_Renderer.h:
1048 * src/graphics/XPM_Renderer.C:
1049 * src/graphics/EPS_Renderer.h:
1050 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1052 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1054 * src/lyxfunc.C (processKeySym): only handle the
1055 lockinginset/inset stuff if we have a buffer and text loaded...
1057 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1059 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1061 * src/support/lyxfunctional.h: add operator= that takes a reference
1063 * src/lyxserver.C (mkfifo): make first arg const
1065 * src/layout.h: renamed name(...) to setName(...) to work around
1068 * src/buffer.C (setFileName): had to change name of function to
1069 work around bugs in egcs. (renamed from fileName)
1071 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1073 * src/support/translator.h: move helper template classes to
1074 lyxfunctional.h, include "support/lyxfunctional.h"
1076 * src/support/lyxmanip.h: add delaration of fmt
1078 * src/support/lyxfunctional.h: new file
1079 (class_fun_t): new template class
1080 (class_fun): helper template function
1081 (back_insert_fun_iterator): new template class
1082 (back_inserter_fun): helper template function
1083 (compare_memfun_t): new template class
1084 (compare_memfun): helper template function
1085 (equal_1st_in_pair): moved here from translator
1086 (equal_2nd_in_pair): moved here from translator
1088 * src/support/fmt.C: new file
1089 (fmt): new func, can be used for a printf substitute when still
1090 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1092 * src/support/StrPool.C: add some comments
1094 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1097 * src/insets/figinset.C (addpidwait): use std::copy with
1098 ostream_iterator to fill the pidwaitlist
1100 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1102 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1105 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1108 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1110 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1111 (class_update): ditto
1112 (BulletPanel): ditto
1113 (CheckChoiceClass): move initialization of tc and tct
1115 * src/tabular.C: remove current_view
1116 (OldFormatRead): similar to right below [istream::ignore]
1118 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1119 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1120 unused [istream::ignore]
1122 * src/lyxfunc.C: include "support/lyxfunctional.h"
1123 (getInsetByCode): use std::find_if and compare_memfun
1125 * src/lyxfont.C (stateText): remove c_str()
1127 * src/lyx_main.C (setDebuggingLevel): make static
1128 (commandLineHelp): make static
1130 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1131 Screen* together with fl_get_display() and fl_screen
1133 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1134 togheter with fl_get_display() and fl_screen
1135 (create_forms): remove c_str()
1137 * src/layout.C: include "support/lyxfunctional.h"
1138 (hasLayout): use std::find_if and compare_memfun
1139 (GetLayout): use std::find_if and comapre_memfun
1140 (delete_layout): use std::remove_if and compare_memfun
1141 (NumberOfClass): use std:.find_if and compare_memfun
1143 * src/gettext.h: change for the new functions
1145 * src/gettext.C: new file, make _(char const * str) and _(string
1146 const & str) real functions.
1148 * src/font.C (width): rewrite slightly to avoid one extra variable
1150 * src/debug.C: initialize Debug::ANY here
1152 * src/commandtags.h: update number comments
1154 * src/combox.h (get): make const func
1156 (getline): make const
1158 * src/combox.C (input_cb): handle case where fl_get_input can
1161 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1162 "support/lyxfunctional.h", remove current_view variable.
1163 (resize): use std::for_each with std::mem_fun
1164 (getFileNames): use std::copy with back_inserter_fun
1165 (getBuffer): change arg type to unsigned int
1166 (emergencyWriteAll): call emergencyWrite with std::for_each and
1168 (emergencyWrite): new method, the for loop in emergencyWriteAll
1170 (exists): use std::find_if with compare_memfun
1171 (getBuffer): use std::find_if and compare_memfun
1173 * src/buffer.h: add typedefs for iterator_category, value_type
1174 difference_type, pointer and reference for inset_iterator
1175 add postfix ++ for inset_iterator
1176 make inset_iterator::getPos() const
1178 * src/buffer.C: added support/lyxmanip.h
1179 (readFile): use lyxerr << fmt instead of printf
1180 (makeLaTeXFile): use std::copy to write out encodings
1182 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1184 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1185 free and the char * temp.
1186 (hasMenu): use std::find_if and compare_memfun
1189 * src/Makefile.am (lyx_SOURCES): added gettext.C
1191 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1192 string::insert small change to avoid temporary
1194 * src/LColor.C (getGUIName): remove c_str()
1196 * several files: change all occurrences of fl_display to
1199 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1200 that -pedantic is not used for gcc 2.97 (cvs gcc)
1202 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1204 2000-10-11 Allan Rae <rae@lyx.org>
1206 * src/frontends/xforms/FormPreferences.C (input): template path must be
1207 a readable directory. It doesn't need to be writeable.
1208 (build, delete, update, apply): New inputs in the various tabfolders
1210 * src/frontends/xforms/forms/form_preferences.fd:
1211 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1212 several new entries to existing folders. Shuffled some existing stuff
1215 * src/frontends/xforms/forms/form_print.fd:
1216 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1217 Should probably rework PrinterParams as well. Note that the switch to
1218 collated is effectively the same as !unsorted so changing PrinterParams
1219 will require a lot of fiddly changes to reverse the existing logic.
1221 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1223 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1225 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1227 2000-10-10 Allan Rae <rae@lyx.org>
1230 * src/lyxfunc.C (Dispatch):
1232 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1235 * src/lyxrc.C (output): Only write the differences between system lyxrc
1236 and the users settings.
1239 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1241 I'll rewrite this later, after 1.1.6 probably, to keep a single
1242 LyXRC but two instances of a LyXRCStruct.
1244 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1246 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1248 * src/tabular.h: add a few std:: qualifiers.
1250 * src/encoding.C: add using directive.
1251 * src/language.C: ditto.
1253 * src/insets/insetquotes.C (Validate): use languages->lang()
1254 instead of only language.
1256 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1258 * lib/languages: New file.
1260 * lib/encodings: New file.
1262 * src/language.C (Languages): New class.
1263 (read): New method. Reads the languages from the 'languages' file.
1265 * src/encoding.C (Encodings): New class.
1266 (read): New method. Reads the encodings from the 'encodings' file.
1268 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1271 * src/bufferparams.h and a lot of files: Deleted the member language,
1272 and renamed language_info to language
1274 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1275 * src/lyxfont.C (latexWriteStartChanges): ditto.
1276 * src/paragraph.C (validate,TeXOnePar): ditto.
1278 * src/lyxfont.C (update): Restored deleted code.
1280 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1282 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1284 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1286 * src/insets/figinset.[Ch]:
1287 * src/insets/insetinclude.[Ch]:
1288 * src/insets/insetinclude.[Ch]:
1289 * src/insets/insetparent.[Ch]:
1290 * src/insets/insetref.[Ch]:
1291 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1293 * src/insets/*.[Ch]:
1294 * src/mathed/formula.[Ch]:
1295 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1297 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1298 * src/lyx_cb.C (FigureApplyCB):
1299 * src/lyxfunc.C (getStatus, Dispatch):
1300 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1303 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1305 * src/converter.[Ch] (Formats::View):
1306 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1308 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1309 *current_view->buffer(). This will change later, but this patch is way
1312 2000-10-09 Juergen Vigna <jug@sad.it>
1314 * src/text.C (GetRow): small fix.
1316 * src/BufferView_pimpl.C (cursorPrevious):
1317 (cursorNext): added LyXText parameter to function.
1319 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1320 keypress depending on cursor position.
1322 2000-10-06 Juergen Vigna <jug@sad.it>
1324 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1325 (copySelection): redone this function and also copy ascii representa-
1328 * src/tabular.C (Ascii):
1332 (print_n_chars): new functions to realize the ascii export of tabulars.
1334 2000-10-05 Juergen Vigna <jug@sad.it>
1336 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1337 if we don't have a buffer.
1339 2000-10-10 Allan Rae <rae@lyx.org>
1341 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1342 with closing dialog. It seems that nested tabfolders require hiding
1343 of inner tabfolders before hiding the dialog itself. Actually all I
1344 did was hide the active outer folder.
1346 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1347 unless there really is a buffer. hideBufferDependent is called
1350 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1351 POTFILES.in stays in $(srcdir).
1353 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1355 * lib/lyxrc.example: Few changes.
1357 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1359 * src/BufferView_pimpl.C (buffer): only need one the
1360 updateBufferDependent signal to be emitted once! Moved to the end of
1361 the method to allow bv_->text to be updated first.
1363 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1364 and hSignal_ with Dialogs * and BufferDependency variables.
1365 New Buffer * parent_, initialised when the dialog is launched. Used to
1366 check whether to update() or hide() dialog in the new, private
1367 updateOrHide() method that is connected to the updateBufferDependent
1368 signal. Daughter classes dictate what to do using the
1369 ChangedBufferAction enum, passed to the c-tor.
1371 * src/frontends/xforms/FormCitation.C:
1372 * src/frontends/xforms/FormCommand.C:
1373 * src/frontends/xforms/FormCopyright.C:
1374 * src/frontends/xforms/FormDocument.C:
1375 * src/frontends/xforms/FormError.C:
1376 * src/frontends/xforms/FormIndex.C:
1377 * src/frontends/xforms/FormPreferences.C:
1378 * src/frontends/xforms/FormPrint.C:
1379 * src/frontends/xforms/FormRef.C:
1380 * src/frontends/xforms/FormToc.C:
1381 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1384 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1385 ChangedBufferAction enum.
1387 * src/frontends/xforms/FormParagraph.[Ch]
1388 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1391 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1393 * lib/bind/cua.bind: fix a bit.
1394 * lib/bind/emacs.bind: ditto.
1396 * lib/bind/menus.bind: remove real menu entries from there.
1398 * src/spellchecker.C: make sure we only include strings.h when
1401 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1403 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1404 function. It enlarges the maximum number of pup when needed.
1405 (add_toc2): Open a new menu if maximum number of items per menu has
1408 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1410 * src/frontends/kde/FormPrint.C: fix error reporting
1412 * src/frontends/xforms/FormDocument.C: fix compiler
1415 * lib/.cvsignore: add Literate.nw
1417 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1420 * bufferview_funcs.[Ch]
1423 * text2.C: Add support for numbers in RTL text.
1425 2000-10-06 Allan Rae <rae@lyx.org>
1427 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1428 to be gettext.m4 friendly again. ext_l10n.h is now
1429 generated into $top_srcdir instead of $top_builddir
1430 so that lyx.pot will be built correctly -- without
1431 duplicate parsing of ext_l10n.h.
1433 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1435 * src/frontends/kde/FormCitation.C: make the dialog
1436 behave more sensibly
1438 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1440 * config/kde.m4: fix consecutive ./configure runs,
1441 look for qtarch, fix library order
1443 * src/frontends/kde/Makefile.am: tidy up,
1444 add Print dialog, add .dlg dependencies
1446 * src/frontends/kde/FormPrint.C:
1447 * src/frontends/kde/FormPrint.h:
1448 * src/frontends/kde/formprintdialog.C:
1449 * src/frontends/kde/formprintdialog.h:
1450 * src/frontends/kde/formprintdialogdata.C:
1451 * src/frontends/kde/formprintdialogdata.h:
1452 * src/frontends/kde/dlg/formprintdialog.dlg: add
1455 * src/frontends/kde/dlg/README: Added explanatory readme
1457 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1458 script to double-check qtarch's output
1460 * src/frontends/kde/formindexdialog.C:
1461 * src/frontends/kde/formindexdialogdata.C:
1462 * src/frontends/kde/formindexdialogdata.h:
1463 * src/frontends/kde/dlg/formindexdialog.dlg: update
1464 for qtarch, minor fixes
1466 2000-10-05 Allan Rae <rae@lyx.org>
1468 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1469 dialogs when switching buffers update them instead. It's up to each
1470 dialog to decide if it should still be visible or not.
1471 update() should return a bool to control visiblity within show().
1472 Or perhaps better to set a member variable and use that to control
1475 * lib/build-listerrors: create an empty "listerrors" file just to stop
1476 make trying to regenerate it all the time if you don't have noweb
1479 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1481 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1482 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1483 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1484 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1485 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1487 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1489 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1491 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1492 deleting buffer. Closes all buffer-dependent dialogs.
1494 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1496 * src/frontends/xforms/FormCitation.[Ch]:
1497 * src/frontends/xforms/FormPreferences.[Ch]:
1498 * src/frontends/xforms/FormPrint.[Ch]:
1499 * src/frontends/xforms/FormRef.[Ch]:
1500 * src/frontends/xforms/FormUrl.[Ch]: ditto
1502 * src/frontends/xforms/FormDocument.[Ch]:
1503 * src/frontends/xforms/forms/form_document.C.patch:
1504 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1505 pass through a single input() function.
1507 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1509 * lib/build-listerrors: return status as OK
1511 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1513 * lib/lyxrc.example: Updated to new export code
1515 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1517 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1520 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1523 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1524 LyX-Code is defined.
1525 * lib/layouts/amsbook.layout: ditto.
1527 * boost/Makefile.am: fix typo.
1529 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1531 (add_lastfiles): removed.
1532 (add_documents): removed.
1533 (add_formats): removed.
1535 * src/frontends/Menubar.C: remove useless "using" directive.
1537 * src/MenuBackend.h: add a new MenuItem constructor.
1539 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1542 2000-10-04 Allan Rae <rae@lyx.org>
1544 * lib/Makefile.am (listerrors):
1545 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1546 I haven't got notangle installed so Kayvan please test. The output
1547 should end up in $builddir. This also allows people who don't have
1548 noweb installed to complete the make process without error.
1550 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1551 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1552 by JMarc's picky compiler.
1554 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1557 * src/insets/insettabular.C (setPos): change for loop to not use
1558 sequencing operator. Please check this Jürgen.
1560 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1562 * src/insets/insetcite.C (getScreenLabel): ditto
1563 * src/support/filetools.C (QuoteName): ditto
1564 (ChangeExtension): ditto
1566 * src/BufferView_pimpl.C (scrollCB): make heigt int
1568 * src/BufferView2.C (insertInset): comment out unused arg
1570 * boost/Makefile.am (EXTRADIST): new variable
1572 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1574 * src/exporter.C (IsExportable): Fixed
1576 * lib/configure.m4: Small fix
1578 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1580 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1581 * src/insets/insetbib.C (bibitemWidest): ditto.
1582 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1584 2000-10-03 Juergen Vigna <jug@sad.it>
1586 * src/BufferView2.C (theLockingInset): removed const because of
1587 Agnus's compile problems.
1589 * src/insets/insettext.C (LocalDispatch): set the language of the
1590 surronding paragraph on inserting the first character.
1592 * various files: changed use of BufferView::the_locking_inset.
1594 * src/BufferView2.C (theLockingInset):
1595 (theLockingInset): new functions.
1597 * src/BufferView.h: removed the_locking_inset.
1599 * src/lyxtext.h: added the_locking_inset
1601 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1603 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1605 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1607 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1608 * src/mathed/math_cursor.C (IsAlpha): ditto.
1609 * src/mathed/math_inset.C (strnew): ditto.
1610 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1611 (IMetrics): cxp set but never used; removed.
1612 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1613 that the variable in question has been removed also!
1616 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1617 using the Buffer * passed to Latex(), using the BufferView * passed to
1618 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1620 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1621 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1623 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1624 * src/buffer.C (readInset): used new InsetBibtex c-tor
1625 * (getBibkeyList): used new InsetBibtex::getKeys
1627 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1630 * lib/build-listerrors
1632 * src/exporter.C: Add literate programming support to the export code
1635 * src/lyx_cb.C: Remove old literate code.
1637 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1640 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1641 * src/converter.C (View, Convert): Use QuoteName.
1643 * src/insets/figinset.C (Preview): Use Formats::View.
1645 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1647 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1649 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1650 the top of the function, because compaq cxx complains that the
1651 "goto exit_with_message" when the function is disabled bypasses
1653 (MenuNew): try a better fix for the generation of new file names.
1654 This time, I used AddName() instead of AddPath(), hoping Juergen
1657 2000-10-03 Allan Rae <rae@lyx.org>
1659 * src/frontends/xforms/forms/form_preferences.fd:
1660 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1661 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1662 "Look and Feel"->"General" but will need to be split up further into
1663 general output and general input tabs. Current plan is for four outer
1664 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1665 stuff; "Inputs" for input and import configuration; "Outputs" for
1666 output and export configuration; and one more whatever is left over
1667 called "General". The leftovers at present look like being which
1668 viewers to use, spellchecker, language support and might be better
1669 named "Support". I've put "Paths" in "Inputs" for the moment as this
1670 seems reasonable for now at least.
1671 One problem remains: X error kills LyX when you close Preferences.
1673 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1675 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1676 qualifier from form()
1677 * src/frontends/xforms/FormCitation.[Ch]:
1678 * src/frontends/xforms/FormCopyright.[Ch]:
1679 * src/frontends/xforms/FormDocument.[Ch]:
1680 * src/frontends/xforms/FormError.[Ch]:
1681 * src/frontends/xforms/FormIndex.[Ch]:
1682 * src/frontends/xforms/FormPreferences.[Ch]:
1683 * src/frontends/xforms/FormPrint.[Ch]:
1684 * src/frontends/xforms/FormRef.[Ch]:
1685 * src/frontends/xforms/FormToc.[Ch]:
1686 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1688 * src/frontends/xforms/FormCitation.[Ch]:
1689 * src/frontends/xforms/FormIndex.[Ch]:
1690 * src/frontends/xforms/FormRef.[Ch]:
1691 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1692 with Allan's naming policy
1694 * src/frontends/xforms/FormCitation.C: some static casts to remove
1697 2000-10-02 Juergen Vigna <jug@sad.it>
1699 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1700 now you can type or do stuff inside the table-cell also when in dummy
1701 position, fixed visible cursor.
1703 * src/insets/insettext.C (Edit): fixing cursor-view position.
1705 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1706 be used for equal functions in lyxfunc and insettext.
1708 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1710 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1712 * src/frontends/gnome/FormCitation.h:
1713 * src/frontends/gnome/FormCopyright.h:
1714 * src/frontends/gnome/FormIndex.h:
1715 * src/frontends/gnome/FormPrint.h:
1716 * src/frontends/gnome/FormToc.h:
1717 * src/frontends/gnome/FormUrl.h:
1718 * src/frontends/kde/FormCitation.h:
1719 * src/frontends/kde/FormCopyright.h:
1720 * src/frontends/kde/FormIndex.h:
1721 * src/frontends/kde/FormRef.h:
1722 * src/frontends/kde/FormToc.h:
1723 * src/frontends/kde/FormUrl.h: fix remaining users of
1726 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1728 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1729 from depth argument.
1730 (DocBookHandleCaption): ditto.
1731 (DocBookHandleFootnote): ditto.
1732 (SimpleDocBookOnePar): ditto.
1734 * src/frontends/xforms/FormDocument.h (form): remove extra
1735 FormDocument:: qualifier.
1737 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1739 * sigc++/handle.h: ditto.
1741 * src/lyx_gui_misc.C: add "using" directive.
1743 * src/cheaders/cstddef: new file, needed by the boost library (for
1746 2000-10-02 Juergen Vigna <jug@sad.it>
1748 * src/insets/insettext.C (SetFont): better support.
1750 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1752 * src/screen.C (DrawOneRow): some uint refixes!
1754 2000-10-02 Allan Rae <rae@lyx.org>
1756 * boost/.cvsignore: ignore Makefile as well
1758 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1759 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1761 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1762 Left this one out by accident.
1764 * src/frontends/xforms/FormBase.h (restore): default to calling
1765 update() since that will restore the original/currently-applied values.
1766 Any input() triggered error messages will require the derived classes
1767 to redefine restore().
1769 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1770 avoid a segfault. combo_doc_class is the main concern.
1772 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1774 * Simplify build-listerrors in view of GUI-less export ability!
1776 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1778 * src/lyx_main.C (easyParse): Disable gui when exporting
1780 * src/insets/figinset.C:
1783 * src/lyx_gui_misc.C
1784 * src/tabular.C: Changes to allow no-gui.
1786 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1788 * src/support/utility.hpp: removed file
1789 * src/support/block.h: removed file
1791 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1794 * src/mathed/formula.C: add support/lyxlib.h
1795 * src/mathed/formulamacro.C: ditto
1797 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1798 * src/lyxparagraph.h: ditto
1800 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1801 * src/frontends/Makefile.am (INCLUDES): ditto
1802 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1803 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1804 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1805 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1806 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1807 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1809 * src/BufferView.h: use boost/utility.hpp
1810 * src/LColor.h: ditto
1811 * src/LaTeX.h: ditto
1812 * src/LyXAction.h: ditto
1813 * src/LyXView.h: ditto
1814 * src/bufferlist.h: ditto
1815 * src/lastfiles.h: ditto
1816 * src/layout.h: ditto
1817 * src/lyx_gui.h: ditto
1818 * src/lyx_main.h: ditto
1819 * src/lyxlex.h: ditto
1820 * src/lyxrc.h: ditto
1821 * src/frontends/ButtonPolicies.h: ditto
1822 * src/frontends/Dialogs.h: ditto
1823 * src/frontends/xforms/FormBase.h: ditto
1824 * src/frontends/xforms/FormGraphics.h: ditto
1825 * src/frontends/xforms/FormParagraph.h: ditto
1826 * src/frontends/xforms/FormTabular.h: ditto
1827 * src/graphics/GraphicsCache.h: ditto
1828 * src/graphics/Renderer.h: ditto
1829 * src/insets/ExternalTemplate.h: ditto
1830 * src/insets/insetcommand.h: ditto
1831 * src/support/path.h: ditto
1833 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1834 and introduce clause for 2.97.
1836 * boost/libs/README: new file
1838 * boost/boost/utility.hpp: new file
1840 * boost/boost/config.hpp: new file
1842 * boost/boost/array.hpp: new file
1844 * boost/Makefile.am: new file
1846 * boost/.cvsignore: new file
1848 * configure.in (AC_OUTPUT): add boost/Makefile
1850 * Makefile.am (SUBDIRS): add boost
1852 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1854 * src/support/lstrings.C (suffixIs): Fixed.
1856 2000-10-01 Allan Rae <rae@lyx.org>
1858 * src/PrinterParams.h: moved things around to avoid the "can't
1859 inline call" warning.
1861 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1862 into doc++ documentation.
1864 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1866 * src/frontends/xforms/FormRef.C: make use of button controller
1867 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1868 cleaned up button controller usage.
1869 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1870 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1871 use the button controller
1873 * src/frontends/xforms/forms/*.fd: and associated generated files
1874 updated to reflect changes to FormBase. Some other FormXxxx files
1875 also got minor updates to reflect changes to FormBase.
1877 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1878 (hide): made virtual.
1879 (input): return a bool. true == valid input
1880 (RestoreCB, restore): new
1881 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1882 Changes to allow derived dialogs to use a ButtonController and
1883 make sense when doing so: OK button calls ok() and so on.
1885 * src/frontends/xforms/ButtonController.h (class ButtonController):
1886 Switch from template implementation to taking Policy parameter.
1887 Allows FormBase to provide a ButtonController for any dialog.
1889 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1890 Probably should rename connect and disconnect.
1891 (apply): use the radio button groups
1892 (form): needed by FormBase
1893 (build): setup the radio button groups
1895 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1897 * several files: type changes to reduce the number of warnings and
1898 to unify type hangling a bit. Still much to do.
1900 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1902 * lib/images/*: rename a bunch of icons to match Dekel converter
1905 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1908 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1910 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1912 * sigc++/handle.h: ditto for class Handle.
1914 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1916 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1918 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1920 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1921 removal of the "default" language.
1923 * src/combox.h (getline): Check that sel > 0
1925 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1927 * lib/examples/docbook_example.lyx
1928 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1930 * lib/layouts/docbook-book.layout: new docbook book layout.
1932 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1934 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1936 * src/insets/figinset.C (DocBook):fixed small typo.
1938 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1940 * src/insets/insetinclude.h: string include_label doesn't need to be
1943 2000-09-29 Allan Rae <rae@lyx.org>
1945 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1946 Allow derived type to control connection and disconnection from signals
1947 of its choice if desired.
1949 2000-09-28 Juergen Vigna <jug@sad.it>
1951 * src/insets/insettabular.C (update): fixed cursor setting when
1952 the_locking_inset changed.
1953 (draw): made this a bit cleaner.
1954 (InsetButtonPress): fixed!
1956 * various files: added LyXText Parameter to fitCursor call.
1958 * src/BufferView.C (fitCursor): added LyXText parameter.
1960 * src/insets/insettabular.C (draw): small draw fix.
1962 * src/tabular.C: right setting of left/right celllines.
1964 * src/tabular.[Ch]: fixed various types in funcions and structures.
1965 * src/insets/insettabular.C: ditto
1966 * src/frontends/xforms/FormTabular.C: ditto
1968 2000-09-28 Allan Rae <rae@lyx.org>
1970 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1971 that the #ifdef's had been applied to part of what should have been
1972 a complete condition. It's possible there are other tests that
1973 were specific to tables that are also wrong now that InsetTabular is
1974 being used. Now we need to fix the output of '\n' after a table in a
1975 float for the same reason as the original condition:
1976 "don't insert this if we would be adding it before or after a table
1977 in a float. This little trick is needed in order to allow use of
1978 tables in \subfigures or \subtables."
1979 Juergen can you check this?
1981 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1983 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1984 output to the ostream.
1986 * several files: fixed types based on warnings from cxx
1988 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1990 * src/frontends/kde/Makefile.am: fix rule for
1991 formindexdialogdata_moc.C
1993 * src/.cvsignore: add ext_l10n.h to ignore
1995 * acconfig.h: stop messing with __STRICT_ANSI__
1996 * config/gnome.m4: remove option to set -ansi
1997 * config/kde.m4: remove option to set -ansi
1998 * config/lyxinclude.m4: don't set -ansi
2000 2000-09-27 Juergen Vigna <jug@sad.it>
2002 * various files: remove "default" language check.
2004 * src/insets/insetquotes.C: removed use of current_view.
2006 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2007 the one should have red ears by now!
2009 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2010 in more then one paragraph. Fixed cursor-movement/selection.
2012 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2013 paragraphs inside a text inset.
2015 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2016 text-inset if this owner is an inset.
2018 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2020 * src/Bullet.h: changed type of font, character and size to int
2022 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2024 * src/insets/inseturl.[Ch]:
2025 * src/insets/insetref.[Ch]:
2026 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2028 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2030 * src/buffer.C (readFile): block-if statement rearranged to minimise
2031 bloat. Patch does not reverse Jean-Marc's change ;-)
2033 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2034 Class rewritten to store pointers to hide/update signals directly,
2035 rather than Dialogs *. Also defined an enum to ease use. All xforms
2036 forms can now be derived from this class.
2038 * src/frontends/xforms/FormCommand.[Ch]
2039 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2041 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2044 * src/frontends/xforms/forms/form_citation.fd
2045 * src/frontends/xforms/forms/form_copyright.fd
2046 * src/frontends/xforms/forms/form_error.fd
2047 * src/frontends/xforms/forms/form_index.fd
2048 * src/frontends/xforms/forms/form_ref.fd
2049 * src/frontends/xforms/forms/form_toc.fd
2050 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2052 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2054 * src/insets/insetfoot.C: removed redundent using directive.
2056 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2058 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2059 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2061 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2062 created in the constructors in different groups. Then set() just
2063 have to show the groups as needed. This fixes the redraw problems
2064 (and is how the old menu code worked).
2066 * src/support/lyxlib.h: declare the methods as static when we do
2067 not have namespaces.
2069 2000-09-26 Juergen Vigna <jug@sad.it>
2071 * src/buffer.C (asciiParagraph): new function.
2072 (writeFileAscii): new function with parameter ostream.
2073 (writeFileAscii): use now asciiParagraph.
2075 * various inset files: added the linelen parameter to the Ascii-func.
2077 * src/tabular.C (Write): fixed error in writing file introduced by
2078 the last changes from Lars.
2080 * lib/bind/menus.bind: removed not supported functions.
2082 * src/insets/insettext.C (Ascii): implemented this function.
2084 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2086 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2087 (Write): use of the write_attribute functions.
2089 * src/bufferlist.C (close): fixed reasking question!
2091 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2093 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2094 new files use the everwhere possible.
2097 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2098 src/log_form.C src/lyx.C:
2101 * src/buffer.C (runLaTeX): remove func
2103 * src/PaperLayout.C: removed file
2104 * src/ParagraphExtra.C: likewise
2105 * src/bullet_forms.C: likewise
2106 * src/bullet_forms.h: likewise
2107 * src/bullet_forms_cb.C: likewise
2109 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2110 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2113 * several files: remove all traces of the old fd_form_paragraph,
2114 and functions belonging to that.
2116 * several files: remove all traces of the old fd_form_document,
2117 and functions belonging to that.
2119 * several files: constify local variables were possible.
2121 * several files: remove all code that was dead when NEW_EXPORT was
2124 * several files: removed string::c_str in as many places as
2127 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2128 (e): be a bit more outspoken when patching
2129 (updatesrc): only move files if changed.
2131 * forms/layout_forms.h.patch: regenerated
2133 * forms/layout_forms.fd: remove form_document and form_paragraph
2134 and form_quotes and form_paper and form_table_options and
2135 form_paragraph_extra
2137 * forms/form1.fd: remove form_table
2139 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2140 the fdui->... rewrite. Update some comments to xforms 0.88
2142 * forms/bullet_forms.C.patch: removed file
2143 * forms/bullet_forms.fd: likewise
2144 * forms/bullet_forms.h.patch: likewise
2146 * development/Code_rules/Rules: added a section on switch
2147 statements. Updated some comment to xforms 0.88.
2149 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2151 * src/buffer.C (readFile): make sure that the whole version number
2152 is read after \lyxformat (even when it contains a comma)
2154 * lib/ui/default.ui: change shortcut of math menu to M-a.
2156 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2158 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2161 * src/LyXView.C (updateWindowTitle): show the full files name in
2162 window title, limited to 30 characters.
2164 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2165 When a number of characters has been given, we should not assume
2166 that the string is 0-terminated.
2168 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2169 calls (fixes some memory leaks)
2171 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2172 trans member on exit.
2174 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2176 * src/converter.C (GetReachable): fix typo.
2178 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2179 understand ',' instead of '.'.
2180 (GetInteger): rewrite to use strToInt().
2182 2000-09-26 Juergen Vigna <jug@sad.it>
2184 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2185 better visibility and error-message on wrong VSpace input.
2187 * src/language.C (initL): added english again.
2189 2000-09-25 Juergen Vigna <jug@sad.it>
2191 * src/frontends/kde/Dialogs.C (Dialogs):
2192 * src/frontends/gnome/Dialogs.C (Dialogs):
2193 * src/frontends/kde/Makefile.am:
2194 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2196 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2198 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2200 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2202 * src/frontends/xforms/FormParagraph.C:
2203 * src/frontends/xforms/FormParagraph.h:
2204 * src/frontends/xforms/form_paragraph.C:
2205 * src/frontends/xforms/form_paragraph.h:
2206 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2209 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2211 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2212 Paragraph-Data after use.
2214 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2215 non breakable paragraphs.
2217 2000-09-25 Garst R. Reese <reese@isn.net>
2219 * src/language.C (initL): added missing language_country codes.
2221 2000-09-25 Juergen Vigna <jug@sad.it>
2223 * src/insets/insettext.C (InsetText):
2224 (deleteLyXText): remove the not released LyXText structure!
2226 2000-09-24 Marko Vendelin <markov@ioc.ee>
2228 * src/frontends/gnome/mainapp.C
2229 * src/frontends/gnome/mainapp.h: added support for keyboard
2232 * src/frontends/gnome/FormCitation.C
2233 * src/frontends/gnome/FormCitation.h
2234 * src/frontends/gnome/Makefile.am
2235 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2236 FormCitation to use "action area" in mainapp window
2238 * src/frontends/gnome/Menubar_pimpl.C
2239 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2242 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2244 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2245 width/descent/ascent values if name is empty.
2246 (mathed_string_height): Use std::max.
2248 2000-09-25 Allan Rae <rae@lyx.org>
2250 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2251 segfault. This will be completely redesigned soon.
2253 * sigc++: updated libsigc++. Fixes struct timespec bug.
2255 * development/tools/makeLyXsigc.sh: .cvsignore addition
2257 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2259 * several files: removed almost all traces of the old table
2262 * src/TableLayout.C: removed file
2264 2000-09-22 Juergen Vigna <jug@sad.it>
2266 * src/frontends/kde/Dialogs.C: added credits forms.
2268 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2270 * src/frontends/gnome/Dialogs.C: added some forms.
2272 * src/spellchecker.C (init_spell_checker): set language in pspell code
2273 (RunSpellChecker): some modifications for setting language string.
2275 * src/language.[Ch]: added language_country code.
2277 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2279 * src/frontends/Dialogs.h: added new signal showError.
2280 Rearranged existing signals in some sort of alphabetical order.
2282 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2283 FormError.[Ch], form_error.[Ch]
2284 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2285 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2287 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2288 dialogs. I think that this can be used as the base to all these
2291 * src/frontends/xforms/FormError.[Ch]
2292 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2293 implementation of InsetError dialog.
2295 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2297 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2298 * src/frontends/kde/Makefile.am: ditto
2300 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2302 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2303 macrobf. This fixes a bug of invisible text.
2305 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2307 * lib/doc/LaTeXConfig.lyx.in: updated.
2309 * src/language.C (initL): remove language "francais" and change a
2310 bit the names of the two other french variations.
2312 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2313 string that may not be 0-terminated.
2315 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2317 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2319 2000-09-20 Marko Vendelin <markov@ioc.ee>
2321 * src/frontends/gnome/FormCitation.C
2322 * src/frontends/gnome/FormIndex.C
2323 * src/frontends/gnome/FormToc.C
2324 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2325 the variable initialization to shut up the warnings
2327 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2329 * src/table.[Ch]: deleted files
2331 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2334 2000-09-18 Juergen Vigna <jug@sad.it>
2336 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2337 problems with selection. Inserted new LFUN_PASTESELECTION.
2338 (InsetButtonPress): inserted handling of middle mouse-button paste.
2340 * src/spellchecker.C: changed word to word.c_str().
2342 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2344 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2345 included in the ``make dist'' tarball.
2347 2000-09-15 Juergen Vigna <jug@sad.it>
2349 * src/CutAndPaste.C (cutSelection): small fix return the right
2350 end position after cut inside one paragraph only.
2352 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2353 we are locked as otherwise we don't have a valid cursor position!
2355 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2357 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2359 * src/frontends/kde/FormRef.C: added using directive.
2360 * src/frontends/kde/FormToc.C: ditto
2362 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2364 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2366 2000-09-19 Marko Vendelin <markov@ioc.ee>
2368 * src/frontends/gnome/Menubar_pimpl.C
2369 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2370 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2372 * src/frontends/gnome/mainapp.C
2373 * src/frontends/gnome/mainapp.h: support for menu update used
2376 * src/frontends/gnome/mainapp.C
2377 * src/frontends/gnome/mainapp.h: support for "action" area in the
2378 main window. This area is used by small simple dialogs, such as
2381 * src/frontends/gnome/FormIndex.C
2382 * src/frontends/gnome/FormIndex.h
2383 * src/frontends/gnome/FormUrl.C
2384 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2387 * src/frontends/gnome/FormCitation.C
2388 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2389 action area. Only "Insert new citation" is implemented.
2391 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2393 * src/buffer.C (Dispatch): fix call to Dispatch
2394 * src/insets/insetref.C (Edit): likewise
2395 * src/insets/insetparent.C (Edit): likewise
2396 * src/insets/insetinclude.C (include_cb): likewise
2397 * src/frontends/xforms/FormUrl.C (apply): likewise
2398 * src/frontends/xforms/FormToc.C (apply): likewise
2399 * src/frontends/xforms/FormRef.C (apply): likewise
2400 * src/frontends/xforms/FormIndex.C (apply): likewise
2401 * src/frontends/xforms/FormCitation.C (apply): likewise
2402 * src/lyxserver.C (callback): likewise
2403 * src/lyxfunc.C (processKeySym): likewise
2404 (Dispatch): likewise
2405 (Dispatch): likewise
2406 * src/lyx_cb.C (LayoutsCB): likewise
2408 * Makefile.am (sourcedoc): small change
2410 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2412 * src/main.C (main): Don't make an empty GUIRunTime object. all
2413 methods are static. constify a bit remove unneded using + headers.
2415 * src/tabular.C: some more const to local vars move some loop vars
2417 * src/spellchecker.C: added some c_str after some word for pspell
2419 * src/frontends/GUIRunTime.h: add new static method setDefaults
2420 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2421 * src/frontends/kde/GUIRunTime.C (setDefaults):
2422 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2424 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2425 with strnew in arg, use correct emptystring when calling SetName.
2427 * several files: remove all commented code with relation to
2428 HAVE_SSTREAM beeing false. We now only support stringstream and
2431 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2433 * src/lyxfunc.C: construct correctly the automatic new file
2436 * src/text2.C (IsStringInText): change type of variable i to shut
2439 * src/support/sstream.h: do not use namespaces if the compiler
2440 does not support them.
2442 2000-09-15 Marko Vendelin <markov@ioc.ee>
2443 * src/frontends/gnome/FormCitation.C
2444 * src/frontends/gnome/FormCitation.h
2445 * src/frontends/gnome/diainsertcitation_interface.c
2446 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2447 regexp support to FormCitation [Gnome].
2449 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2452 * configure.in: remove unused KDE/GTKGUI define
2454 * src/frontends/kde/FormRef.C
2455 * src/frontends/kde/FormRef.h
2456 * src/frontends/kde/formrefdialog.C
2457 * src/frontends/kde/formrefdialog.h: double click will
2458 go to reference, now it is possible to change a cross-ref
2461 * src/frontends/kde/FormToc.C
2462 * src/frontends/kde/FormToc.h
2463 * src/frontends/kde/formtocdialog.C
2464 * src/frontends/kde/formtocdialog.h: add a depth
2467 * src/frontends/kde/Makefile.am: add QtLyXView.h
2470 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2472 * src/frontends/kde/FormCitation.h: added some using directives.
2474 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2476 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2479 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2482 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2484 * src/buffer.C (pop_tag): revert for the second time a change by
2485 Lars, who seems to really hate having non-local loop variables :)
2487 * src/Lsstream.h: add "using" statements.
2489 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2490 * src/buffer.C (writeFile): ditto
2492 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2494 * src/buffer.C (writeFile): try to fix the locale modified format
2495 number to always be as we want it.
2497 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2498 in XForms 0.89. C-space is now working again.
2500 * src/Lsstream.h src/support/sstream.h: new files.
2502 * also commented out all cases where strstream were used.
2504 * src/Bullet.h (c_str): remove method.
2506 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2508 * a lot of files: get rid of "char const *" and "char *" is as
2509 many places as possible. We only want to use them in interaction
2510 with system of other libraries, not inside lyx.
2512 * a lot of files: return const object is not of pod type. This
2513 helps ensure that temporary objects is not modified. And fits well
2514 with "programming by contract".
2516 * configure.in: check for the locale header too
2518 * Makefile.am (sourcedoc): new tag for generation of doc++
2521 2000-09-14 Juergen Vigna <jug@sad.it>
2523 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2524 callback to check which combo called it and do the right action.
2526 * src/combox.C (combo_cb): added combo * to the callbacks.
2527 (Hide): moved call of callback after Ungrab of the pointer.
2529 * src/intl.h: removed LCombo2 function.
2531 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2532 function as this can now be handled in one function.
2534 * src/combox.h: added Combox * to callback prototype.
2536 * src/frontends/xforms/Toolbar_pimpl.C:
2537 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2539 2000-09-14 Garst Reese <reese@isn.net>
2541 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2542 moved usepackage{xxx}'s to beginning of file. Changed left margin
2543 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2544 underlining from title. Thanks to John Culleton for useful suggestions.
2546 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2548 * src/lyxlex_pimpl.C (setFile): change error message to debug
2551 2000-09-13 Juergen Vigna <jug@sad.it>
2553 * src/frontends/xforms/FormDocument.C: implemented choice_class
2554 as combox and give callback to combo_language so OK/Apply is activated
2557 * src/bufferlist.C (newFile): small fix so already named files
2558 (via an open call) are not requested to be named again on the
2561 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2563 * src/frontends/kde/Makefile.am
2564 * src/frontends/kde/FormRef.C
2565 * src/frontends/kde/FormRef.h
2566 * src/frontends/kde/formrefdialog.C
2567 * src/frontends/kde/formrefdialog.h: implement
2570 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2572 * src/frontends/kde/formtocdialog.C
2573 * src/frontends/kde/formtocdialog.h
2574 * src/frontends/kde/FormToc.C
2575 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2577 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2579 * src/frontends/kde/FormCitation.C: fix thinko
2580 where we didn't always display the reference text
2583 * src/frontends/kde/formurldialog.C
2584 * src/frontends/kde/formurldialog.h
2585 * src/frontends/kde/FormUrl.C
2586 * src/frontends/kde/FormUrl.h: minor cleanups
2588 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2590 * src/frontends/kde/Makefile.am
2591 * src/frontends/kde/FormToc.C
2592 * src/frontends/kde/FormToc.h
2593 * src/frontends/kde/FormCitation.C
2594 * src/frontends/kde/FormCitation.h
2595 * src/frontends/kde/FormIndex.C
2596 * src/frontends/kde/FormIndex.h
2597 * src/frontends/kde/formtocdialog.C
2598 * src/frontends/kde/formtocdialog.h
2599 * src/frontends/kde/formcitationdialog.C
2600 * src/frontends/kde/formcitationdialog.h
2601 * src/frontends/kde/formindexdialog.C
2602 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2604 2000-09-12 Juergen Vigna <jug@sad.it>
2606 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2609 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2611 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2614 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2616 * src/converter.C (Add, Convert): Added support for converter flags:
2617 needaux, resultdir, resultfile.
2618 (Convert): Added new parameter view_file.
2619 (dvips_options): Fixed letter paper option.
2621 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2622 (Export, GetExportableFormats, GetViewableFormats): Added support
2625 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2627 (easyParse): Fixed to work with new export code.
2629 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2632 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2634 * lib/bind/*.bind: Replaced
2635 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2636 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2638 2000-09-11 Juergen Vigna <jug@sad.it>
2640 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2642 * src/main.C (main): now GUII defines global guiruntime!
2644 * src/frontends/gnome/GUIRunTime.C (initApplication):
2645 * src/frontends/kde/GUIRunTime.C (initApplication):
2646 * src/frontends/xforms/GUIRunTime.C (initApplication):
2647 * src/frontends/GUIRunTime.h: added new function initApplication.
2649 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2651 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2653 2000-09-08 Juergen Vigna <jug@sad.it>
2655 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2656 we have already "Reset".
2658 * src/language.C (initL): inserted "default" language and made this
2659 THE default language (and not american!)
2661 * src/paragraph.C: inserted handling of "default" language!
2663 * src/lyxfont.C: ditto
2667 * src/paragraph.C: output the \\par only if we have a following
2668 paragraph otherwise it's not needed.
2670 2000-09-05 Juergen Vigna <jug@sad.it>
2672 * config/pspell.m4: added entry to lyx-flags
2674 * src/spellchecker.C: modified version from Kevin for using pspell
2676 2000-09-01 Marko Vendelin <markov@ioc.ee>
2677 * src/frontends/gnome/Makefile.am
2678 * src/frontends/gnome/FormCitation.C
2679 * src/frontends/gnome/FormCitation.h
2680 * src/frontends/gnome/diainsertcitation_callbacks.c
2681 * src/frontends/gnome/diainsertcitation_callbacks.h
2682 * src/frontends/gnome/diainsertcitation_interface.c
2683 * src/frontends/gnome/diainsertcitation_interface.h
2684 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2685 dialog for Gnome frontend
2687 * src/main.C: Gnome libraries require keeping application name
2688 and its version as strings
2690 * src/frontends/gnome/mainapp.C: Change the name of the main window
2691 from GnomeLyX to PACKAGE
2693 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2695 * src/frontends/Liason.C: add "using: declaration.
2697 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2699 * src/mathed/math_macro.C (Metrics): Set the size of the template
2701 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2703 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2705 * src/converter.C (add_options): New function.
2706 (SetViewer): Change $$FName into '$$FName'.
2707 (View): Add options when running xdvi
2708 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2709 (Convert): The 3rd parameter is now the desired filename. Converts
2710 calls to lyx::rename if necessary.
2711 Add options when running dvips.
2712 (dvi_papersize,dvips_options): New methods.
2714 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2716 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2717 using a call to Converter::dvips_options.
2718 Fixed to work with nex export code.
2720 * src/support/copy.C
2721 * src/support/rename.C: New files
2723 * src/support/syscall.h
2724 * src/support/syscall.C: Added Starttype SystemDontWait.
2726 * lib/ui/default.ui: Changed to work with new export code
2728 * lib/configure.m4: Changed to work with new export code
2730 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2732 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2734 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2735 so that code compiles with DEC cxx.
2737 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2738 to work correctly! Also now supports the additional elements
2741 2000-09-01 Allan Rae <rae@lyx.org>
2743 * src/frontends/ButtonPolicies.C: renamed all the references to
2744 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2746 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2747 since it's a const not a type.
2749 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2751 2000-08-31 Juergen Vigna <jug@sad.it>
2753 * src/insets/figinset.C: Various changes to look if the filename has
2754 an extension and if not add it for inline previewing.
2756 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2758 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2759 make buttonStatus and isReadOnly be const methods. (also reflect
2760 this in derived classes.)
2762 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2763 (nextState): change to be static inline, pass the StateMachine as
2765 (PreferencesPolicy): remove casts
2766 (OkCancelPolicy): remvoe casts
2767 (OkCancelReadOnlyPolicy): remove casts
2768 (NoRepeatedApplyReadOnlyPolicy): remove casts
2769 (OkApplyCancelReadOnlyPolicy): remove casts
2770 (OkApplyCancelPolicy): remove casts
2771 (NoRepeatedApplyPolicy): remove casts
2773 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2775 * src/converter.C: added some using directives
2777 * src/frontends/ButtonPolicies.C: changes to overcome
2778 "need lvalue" error with DEC c++
2780 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2781 to WMHideCB for DEC c++
2783 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2785 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2786 to BulletBMTableCB for DEC c++
2788 2000-08-31 Allan Rae <rae@lyx.org>
2790 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2791 character dialog separately from old document dialogs combo_language.
2794 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2796 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2797 Removed LFUN_REF_CREATE.
2799 * src/MenuBackend.C: Added new tags: toc and references
2801 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2802 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2804 (add_toc, add_references): New methods.
2805 (create_submenu): Handle correctly the case when there is a
2806 seperator after optional menu items.
2808 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2809 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2810 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2812 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2814 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2816 * src/converter.[Ch]: New file for converting between different
2819 * src/export.[Ch]: New file for exporting a LyX file to different
2822 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2823 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2824 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2825 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2826 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2827 RunDocBook, MenuExport.
2829 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2830 Exporter::Preview methods if NEW_EXPORT is defined.
2832 * src/buffer.C (Dispatch): Use Exporter::Export.
2834 * src/lyxrc.C: Added new tags: \converter and \viewer.
2837 * src/LyXAction.C: Define new lyx-function: buffer-update.
2838 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2839 when NEW_EXPORT is defined.
2841 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2843 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2845 * lib/ui/default.ui: Added submenus "view" and "update" to the
2848 * src/filetools.C (GetExtension): New function.
2850 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2852 2000-08-29 Allan Rae <rae@lyx.org>
2854 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2856 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2857 (EnableDocumentLayout): removed
2858 (DisableDocumentLayout): removed
2859 (build): make use of ButtonController's read-only handling to
2860 de/activate various objects. Replaces both of the above functions.
2862 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2863 (readOnly): was read_only
2864 (refresh): fixed dumb mistakes with read_only_ handling
2866 * src/frontends/xforms/forms/form_document.fd:
2867 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2868 tabbed dialogs so the tabs look more like tabs and so its easier to
2869 work out which is the current tab.
2871 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2872 segfault with form_table
2874 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2876 2000-08-28 Juergen Vigna <jug@sad.it>
2878 * acconfig.h: added USE_PSPELL.
2880 * src/config.h.in: added USE_PSPELL.
2882 * autogen.sh: added pspell.m4
2884 * config/pspell.m4: new file.
2886 * src/spellchecker.C: implemented support for pspell libary.
2888 2000-08-25 Juergen Vigna <jug@sad.it>
2890 * src/LyXAction.C (init): renamed LFUN_TABLE to
2891 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2893 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2895 * src/lyxscreen.h: add force_clear variable and fuction to force
2896 a clear area when redrawing in LyXText.
2898 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2900 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2902 * some whitespace and comment changes.
2904 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2906 * src/buffer.C: up te LYX_FORMAT to 2.17
2908 2000-08-23 Juergen Vigna <jug@sad.it>
2910 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2913 * src/insets/insettabular.C (pasteSelection): delete the insets
2914 LyXText as it is not valid anymore.
2915 (copySelection): new function.
2916 (pasteSelection): new function.
2917 (cutSelection): new function.
2918 (LocalDispatch): implemented cut/copy/paste of cell selections.
2920 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2921 don't have a LyXText.
2923 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2925 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2928 2000-08-22 Juergen Vigna <jug@sad.it>
2930 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2931 ifdef form_table out if NEW_TABULAR.
2933 2000-08-21 Juergen Vigna <jug@sad.it>
2935 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2936 (draw): fixed draw position so that the cursor is positioned in the
2938 (InsetMotionNotify): hide/show cursor so the position is updated.
2939 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2940 using cellstart() function where it should be used.
2942 * src/insets/insettext.C (draw): ditto.
2944 * src/tabular.C: fixed initialization of some missing variables and
2945 made BoxType into an enum.
2947 2000-08-22 Marko Vendelin <markov@ioc.ee>
2948 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2949 stock menu item using action numerical value, not its string
2953 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2955 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2956 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2958 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2960 * src/frontends/xforms/GUIRunTime.C: new file
2962 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2963 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2965 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2967 * src/frontends/kde/GUIRunTime.C: new file
2969 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2970 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2972 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2974 * src/frontends/gnome/GUIRunTime.C: new file
2976 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2979 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2980 small change to documetentation.
2982 * src/frontends/GUIRunTime.C: removed file
2984 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2986 * src/lyxparagraph.h: enable NEW_TABULAR as default
2988 * src/lyxfunc.C (processKeySym): remove some commented code
2990 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2991 NEW_TABULAR around the fd_form_table_options.
2993 * src/lyx_gui.C (runTime): call the static member function as
2994 GUIRunTime::runTime().
2996 2000-08-21 Allan Rae <rae@lyx.org>
2998 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3001 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3003 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3005 2000-08-21 Allan Rae <rae@lyx.org>
3007 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3008 keep Garst happy ;-)
3009 * src/frontends/xforms/FormPreferences.C (build): use setOK
3010 * src/frontends/xforms/FormDocument.C (build): use setOK
3011 (FormDocument): use the appropriate policy.
3013 2000-08-21 Allan Rae <rae@lyx.org>
3015 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3016 automatic [de]activation of arbitrary objects when in a read-only state.
3018 * src/frontends/ButtonPolicies.h: More documentation
3019 (isReadOnly): added to support the above.
3021 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3023 2000-08-18 Juergen Vigna <jug@sad.it>
3025 * src/insets/insettabular.C (getStatus): changed to return func_status.
3027 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3028 display toggle menu entries if they are.
3030 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3031 new document layout now.
3033 * src/lyxfunc.C: ditto
3035 * src/lyx_gui_misc.C: ditto
3037 * src/lyx_gui.C: ditto
3039 * lib/ui/default.ui: removed paper and quotes layout as they are now
3040 all in the document layout tabbed folder.
3042 * src/frontends/xforms/forms/form_document.fd: added Restore
3043 button and callbacks for all inputs for Allan's ButtonPolicy.
3045 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3046 (CheckChoiceClass): added missing params setting on class change.
3047 (UpdateLayoutDocument): added for updating the layout on params.
3048 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3049 (FormDocument): Implemented Allan's ButtonPolicy with the
3052 2000-08-17 Allan Rae <rae@lyx.org>
3054 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3055 so we can at least see the credits again.
3057 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3058 controller calls for the appropriate callbacks. Note that since Ok
3059 calls apply followed by cancel, and apply isn't a valid input for the
3060 APPLIED state, the bc_ calls have to be made in the static callback not
3061 within each of the real callbacks.
3063 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3064 (setOk): renamed from setOkay()
3066 2000-08-17 Juergen Vigna <jug@sad.it>
3068 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3069 in the implementation part.
3070 (composeUIInfo): don't show optional menu-items.
3072 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3074 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3076 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3077 text-state when in a text-inset.
3079 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3081 2000-08-17 Marko Vendelin <markov@ioc.ee>
3082 * src/frontends/gnome/FormIndex.C
3083 * src/frontends/gnome/FormIndex.h
3084 * src/frontends/gnome/FormToc.C
3085 * src/frontends/gnome/FormToc.h
3086 * src/frontends/gnome/dialogs
3087 * src/frontends/gnome/diatoc_callbacks.c
3088 * src/frontends/gnome/diatoc_callbacks.h
3089 * src/frontends/gnome/diainsertindex_callbacks.h
3090 * src/frontends/gnome/diainsertindex_callbacks.c
3091 * src/frontends/gnome/diainsertindex_interface.c
3092 * src/frontends/gnome/diainsertindex_interface.h
3093 * src/frontends/gnome/diatoc_interface.h
3094 * src/frontends/gnome/diatoc_interface.c
3095 * src/frontends/gnome/Makefile.am: Table of Contents and
3096 Insert Index dialogs implementation for Gnome frontend
3098 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3100 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3102 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3105 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3107 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3108 destructor. Don't definde if you don't need it
3109 (processEvents): made static, non-blocking events processing for
3111 (runTime): static method. event loop for xforms
3112 * similar as above for kde and gnome.
3114 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3115 new Pimpl is correct
3116 (runTime): new method calss the real frontends runtime func.
3118 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3120 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3122 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3124 2000-08-16 Juergen Vigna <jug@sad.it>
3126 * src/lyx_gui.C (runTime): added GUII RunTime support.
3128 * src/frontends/Makefile.am:
3129 * src/frontends/GUIRunTime.[Ch]:
3130 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3131 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3132 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3134 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3136 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3137 as this is already set in ${FRONTEND_INCLUDE} if needed.
3139 * configure.in (CPPFLAGS): setting the include dir for the frontend
3140 directory and don't set FRONTEND=xforms for now as this is executed
3143 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3145 * src/frontends/kde/Makefile.am:
3146 * src/frontends/kde/FormUrl.C:
3147 * src/frontends/kde/FormUrl.h:
3148 * src/frontends/kde/formurldialog.h:
3149 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3151 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3153 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3155 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3157 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3160 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3162 * src/WorkArea.C (work_area_handler): more work to get te
3163 FL_KEYBOARD to work with xforms 0.88 too, please test.
3165 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3167 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3169 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3172 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3174 * src/Timeout.h: remove Qt::emit hack.
3176 * several files: changes to allo doc++ compilation
3178 * src/lyxfunc.C (processKeySym): new method
3179 (processKeyEvent): comment out if FL_REVISION < 89
3181 * src/WorkArea.C: change some debugging levels.
3182 (WorkArea): set wantkey to FL_KEY_ALL
3183 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3184 clearer code and the use of compose with XForms 0.89. Change to
3185 use signals instead of calling methods in bufferview directly.
3187 * src/Painter.C: change some debugging levels.
3189 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3192 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3193 (workAreaKeyPress): new method
3195 2000-08-14 Juergen Vigna <jug@sad.it>
3197 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3199 * config/kde.m4: addes some features
3201 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3202 include missing xforms dialogs.
3204 * src/Timeout.h: a hack to be able to compile with qt/kde.
3206 * sigc++/.cvsignore: added acinclude.m4
3208 * lib/.cvsignore: added listerros
3210 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3211 xforms tree as objects are needed for other frontends.
3213 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3214 linking with not yet implemented xforms objects.
3216 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3218 2000-08-14 Baruch Even <baruch.even@writeme.com>
3220 * src/frontends/xforms/FormGraphics.h:
3221 * src/frontends/xforms/FormGraphics.C:
3222 * src/frontends/xforms/RadioButtonGroup.h:
3223 * src/frontends/xforms/RadioButtonGroup.C:
3224 * src/insets/insetgraphics.h:
3225 * src/insets/insetgraphics.C:
3226 * src/insets/insetgraphicsParams.h:
3227 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3228 instead of spaces, and various other indentation issues to make the
3229 sources more consistent.
3231 2000-08-14 Marko Vendelin <markov@ioc.ee>
3233 * src/frontends/gnome/dialogs/diaprint.glade
3234 * src/frontends/gnome/FormPrint.C
3235 * src/frontends/gnome/FormPrint.h
3236 * src/frontends/gnome/diaprint_callbacks.c
3237 * src/frontends/gnome/diaprint_callbacks.h
3238 * src/frontends/gnome/diaprint_interface.c
3239 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3242 * src/frontends/gnome/dialogs/diainserturl.glade
3243 * src/frontends/gnome/FormUrl.C
3244 * src/frontends/gnome/FormUrl.h
3245 * src/frontends/gnome/diainserturl_callbacks.c
3246 * src/frontends/gnome/diainserturl_callbacks.h
3247 * src/frontends/gnome/diainserturl_interface.c
3248 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3249 Gnome implementation
3251 * src/frontends/gnome/Dialogs.C
3252 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3253 all other dialogs. Copy all unimplemented dialogs from Xforms
3256 * src/frontends/gnome/support.c
3257 * src/frontends/gnome/support.h: support files generated by Glade
3261 * config/gnome.m4: Gnome configuration scripts
3263 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3264 configure --help message
3266 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3267 only if there are no events pendling in Gnome/Gtk. This enhances
3268 the performance of menus.
3271 2000-08-14 Allan Rae <rae@lyx.org>
3273 * lib/Makefile.am: listerrors cleaning
3275 * lib/listerrors: removed -- generated file
3276 * acinclude.m4: ditto
3277 * sigc++/acinclude.m4: ditto
3279 * src/frontends/xforms/forms/form_citation.fd:
3280 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3283 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3284 `updatesrc` and now we have a `test` target that does what `updatesrc`
3285 used to do. I didn't like having an install target that wasn't related
3288 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3289 on all except FormGraphics. This may yet happen. Followed by a major
3290 cleanup including using FL_TRANSIENT for most of the dialogs. More
3291 changes to come when the ButtonController below is introduced.
3293 * src/frontends/xforms/ButtonController.h: New file for managing up to
3294 four buttons on a dialog according to an externally defined policy.
3295 * src/frontends/xforms/Makefile.am: added above
3297 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3298 Apply and Cancel/Close buttons and everything in between and beyond.
3299 * src/frontends/Makefile.am: added above.
3301 * src/frontends/xforms/forms/form_preferences.fd:
3302 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3303 and removed variable 'status' as a result. Fixed the set_minsize thing.
3304 Use the new screen-font-update after checking screen fonts were changed
3305 Added a "Restore" button to restore the original lyxrc values while
3306 editing. This restores everything not just the last input changed.
3307 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3309 * src/LyXAction.C: screen-font-update added for updating buffers after
3310 screen font settings have been changed.
3311 * src/commandtags.h: ditto
3312 * src/lyxfunc.C: ditto
3314 * forms/lyx.fd: removed screen fonts dialog.
3315 * src/lyx_gui.C: ditto
3316 * src/menus.[Ch]: ditto
3317 * src/lyx.[Ch]: ditto
3318 * src/lyx_cb.C: ditto + code from here moved to make
3319 screen-font-update. And people wonder why progress on GUII is
3320 slow. Look at how scattered this stuff was! It takes forever
3323 * forms/fdfix.sh: Fixup the spacing after commas.
3324 * forms/makefile: Remove date from generated files. Fewer clashes now.
3325 * forms/bullet_forms.C.patch: included someones handwritten changes
3327 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3328 once I've discovered why LyXRC was made noncopyable.
3329 * src/lyx_main.C: ditto
3331 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3333 * src/frontends/xforms/forms/fdfix.sh:
3334 * src/frontends/xforms/forms/fdfixh.sed:
3335 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3336 * src/frontends/xforms/Form*.[hC]:
3337 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3338 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3339 provide a destructor for the struct FD_form_xxxx. Another version of
3340 the set_[max|min]size workaround and a few other cleanups. Actually,
3341 Angus' patch from 20000809.
3343 2000-08-13 Baruch Even <baruch.even@writeme.com>
3345 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3348 2000-08-11 Juergen Vigna <jug@sad.it>
3350 * src/insets/insetgraphics.C (InsetGraphics): changing init
3351 order because of warnings.
3353 * src/frontends/xforms/forms/makefile: adding patching .C with
3356 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3357 from .C.patch to .c.patch
3359 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3360 order because of warning.
3362 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3364 * src/frontends/Liason.C (setMinibuffer): new helper function
3366 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3368 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3370 * lib/ui/default.ui: commented out PaperLayout entry
3372 * src/frontends/xforms/form_document.[Ch]: new added files
3374 * src/frontends/xforms/FormDocument.[Ch]: ditto
3376 * src/frontends/xforms/forms/form_document.fd: ditto
3378 * src/frontends/xforms/forms/form_document.C.patch: ditto
3380 2000-08-10 Juergen Vigna <jug@sad.it>
3382 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3383 (InsetGraphics): initialized cacheHandle to 0.
3384 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3386 2000-08-10 Baruch Even <baruch.even@writeme.com>
3388 * src/graphics/GraphicsCache.h:
3389 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3390 correctly as a cache.
3392 * src/graphics/GraphicsCacheItem.h:
3393 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3396 * src/graphics/GraphicsCacheItem_pimpl.h:
3397 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3400 * src/insets/insetgraphics.h:
3401 * src/insets/insetgraphics.C: Changed from using a signal notification
3402 to polling when image is not loaded.
3404 2000-08-10 Allan Rae <rae@lyx.org>
3406 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3407 that there are two functions that have to been taken out of line by
3408 hand and aren't taken care of in the script. (Just a reminder note)
3410 * sigc++/macros/*.h.m4: Updated as above.
3412 2000-08-09 Juergen Vigna <jug@sad.it>
3414 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3416 * src/insets/insettabular.C: make drawing of single cell smarter.
3418 2000-08-09 Marko Vendelin <markov@ioc.ee>
3419 * src/frontends/gnome/Menubar_pimpl.C
3420 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3421 implementation: new files
3423 * src/frontends/gnome/mainapp.C
3424 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3427 * src/main.C: create Gnome main window
3429 * src/frontends/xforms/Menubar_pimpl.h
3430 * src/frontends/Menubar.C
3431 * src/frontends/Menubar.h: added method Menubar::update that calls
3432 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3434 * src/LyXView.C: calls Menubar::update to update the state
3437 * src/frontends/gnome/Makefile.am: added new files
3439 * src/frontends/Makefile.am: added frontend compiler options
3441 2000-08-08 Juergen Vigna <jug@sad.it>
3443 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3445 * src/bufferlist.C (close):
3446 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3447 documents if exiting without saving.
3449 * src/buffer.C (save): use removeAutosaveFile()
3451 * src/support/filetools.C (removeAutosaveFile): new function.
3453 * src/lyx_cb.C (MenuWrite): returns a bool now.
3454 (MenuWriteAs): check if file could really be saved and revert to the
3456 (MenuWriteAs): removing old autosavefile if existant.
3458 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3459 before Goto toggle declaration, because of compiler warning.
3461 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3463 * src/lyxfunc.C (MenuNew): small fix.
3465 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3467 * src/bufferlist.C (newFile):
3468 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3470 * src/lyxrc.C: added new_ask_filename tag
3472 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3474 * src/lyx.fd: removed code pertaining to form_ref
3475 * src/lyx.[Ch]: ditto
3476 * src/lyx_cb.C: ditto
3477 * src/lyx_gui.C: ditto
3478 * src/lyx_gui_misc.C: ditto
3480 * src/BufferView_pimpl.C (restorePosition): update buffer only
3483 * src/commandtags.h (LFUN_REFTOGGLE): removed
3484 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3485 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3486 (LFUN_REFBACK): renamed LFUN_REF_BACK
3488 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3489 * src/menus.C: ditto
3490 * src/lyxfunc.C (Dispatch): ditto.
3491 InsertRef dialog is now GUI-independent.
3493 * src/texrow.C: added using std::endl;
3495 * src/insets/insetref.[Ch]: strip out large amounts of code.
3496 The inset is now a container and this functionality is now
3497 managed by a new FormRef dialog
3499 * src/frontends/Dialogs.h (showRef, createRef): new signals
3501 * src/frontends/xforms/FormIndex.[Ch],
3502 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3503 when setting dialog's min/max size
3504 * src/frontends/xforms/FormIndex.[Ch]: ditto
3506 * src/frontends/xforms/FormRef.[Ch],
3507 src/frontends/xforms/forms/form_ref.fd: new xforms
3508 implementation of an InsetRef dialog
3510 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3513 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3514 ios::nocreate is not part of the standard. Removed.
3516 2000-08-07 Baruch Even <baruch.even@writeme.com>
3518 * src/graphics/Renderer.h:
3519 * src/graphics/Renderer.C: Added base class for rendering of different
3520 image formats into Pixmaps.
3522 * src/graphics/XPM_Renderer.h:
3523 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3524 in a different class.
3526 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3527 easily add support for other formats.
3529 * src/insets/figinset.C: plugged a leak of an X resource.
3531 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3533 * src/CutAndPaste.[Ch]: make all metods static.
3535 * development/Code_rules/Rules: more work, added section on
3536 Exceptions, and a References section.
3538 * a lot of header files: work to make doc++ able to generate the
3539 source documentation, some workarounds of doc++ problems. Doc++ is
3540 now able to generate the documentation.
3542 2000-08-07 Juergen Vigna <jug@sad.it>
3544 * src/insets/insettabular.C (recomputeTextInsets): removed function
3546 * src/tabular.C (SetWidthOfMulticolCell):
3548 (calculate_width_of_column_NMC): fixed return value so that it really
3549 only returns true if the column-width has changed (there where
3550 problems with muliticolumn-cells in this column).
3552 2000-08-04 Juergen Vigna <jug@sad.it>
3554 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3555 also on the scrollstatus of the inset.
3556 (workAreaMotionNotify): ditto.
3558 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3560 2000-08-01 Juergen Vigna <jug@sad.it>
3562 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3564 * src/commandtags.h:
3565 * src/LyXAction.C (init):
3566 * src/insets/inset.C (LocalDispatch): added support for
3569 * src/insets/inset.C (scroll): new functions.
3571 * src/insets/insettext.C (removeNewlines): new function.
3572 (SetAutoBreakRows): removes forced newlines in the text of the
3573 paragraph if autoBreakRows is set to false.
3575 * src/tabular.C (Latex): generates a parbox around the cell contents
3578 * src/frontends/xforms/FormTabular.C (local_update): removed
3579 the radio_useparbox button.
3581 * src/tabular.C (UseParbox): new function
3583 2000-08-06 Baruch Even <baruch.even@writeme.com>
3585 * src/graphics/GraphicsCache.h:
3586 * src/graphics/GraphicsCache.C:
3587 * src/graphics/GraphicsCacheItem.h:
3588 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3591 * src/insets/insetgraphics.h:
3592 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3593 and the drawing of the inline image.
3595 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3596 loaded into the wrong position.
3598 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3601 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3603 * src/support/translator.h: move all typedefs to public section
3605 * src/support/filetools.C (MakeLatexName): return string const
3607 (TmpFileName): ditto
3608 (FileOpenSearch): ditto
3610 (LibFileSearch): ditto
3611 (i18nLibFileSearch): ditto
3614 (CreateTmpDir): ditto
3615 (CreateBufferTmpDir): ditto
3616 (CreateLyXTmpDir): ditto
3619 (MakeAbsPath): ditto
3621 (OnlyFilename): ditto
3623 (NormalizePath): ditto
3624 (CleanupPath): ditto
3625 (GetFileContents): ditto
3626 (ReplaceEnvironmentPath): ditto
3627 (MakeRelPath): ditto
3629 (ChangeExtension): ditto
3630 (MakeDisplayPath): ditto
3631 (do_popen): return cmdret const
3632 (findtexfile): return string const
3634 * src/support/DebugStream.h: add some /// to please doc++
3636 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3638 * src/texrow.C (same_rownumber): functor to use with find_if
3639 (getIdFromRow): rewritten to use find_if and to not update the
3640 positions. return true if row is found
3641 (increasePos): new method, use to update positions
3643 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3645 * src/lyxlex_pimpl.C (verifyTable): new method
3648 (GetString): return string const
3649 (pushTable): rewrite to use std::stack
3651 (setFile): better check
3654 * src/lyxlex.h: make LyXLex noncopyable
3656 * src/lyxlex.C (text): return char const * const
3657 (GetString): return string const
3658 (getLongString): return string const
3660 * src/lyx_gui_misc.C (askForText): return pair<...> const
3662 * src/lastfiles.[Ch] (operator): return string const
3664 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3665 istringstream not char const *.
3666 move token.end() out of loop.
3667 (readFile): move initializaton of token
3669 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3670 getIdFromRow is successful.
3672 * lib/bind/emacs.bind: don't include menus bind
3674 * development/Code_rules/Rules: the beginnings of making this
3675 better and covering more of the unwritten rules that we have.
3677 * development/Code_rules/Recommendations: a couple of wording
3680 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3682 * src/support/strerror.c: remove C++ comment.
3684 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3686 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3687 LFUN_INDEX_INSERT_LAST
3689 * src/texrow.C (getIdFromRow): changed from const_iterator to
3690 iterator, allowing code to compile with DEC cxx
3692 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3693 stores part of the class, as suggested by Allan. Will allow
3695 (apply): test to apply uses InsetCommandParams operator!=
3697 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3698 (apply): test to apply uses InsetCommandParams operator!=
3700 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3701 stores part of the class.
3702 (update): removed limits on min/max size.
3704 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3705 (apply): test to apply uses InsetCommandParams operator!=
3707 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3708 (Read, Write, scanCommand, getCommand): moved functionality
3709 into InsetCommandParams.
3711 (getScreenLabel): made pure virtual
3712 new InsetCommandParams operators== and !=
3714 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3715 c-tors based on InsetCommandParams. Removed others.
3716 * src/insets/insetinclude.[Ch]: ditto
3717 * src/insets/insetlabel.[Ch]: ditto
3718 * src/insets/insetparent.[Ch]: ditto
3719 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3721 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3722 insets derived from InsetCommand created using similar c-tors
3723 based on InsetCommandParams
3724 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3725 * src/menus.C (ShowRefsMenu): ditto
3726 * src/paragraph.C (Clone): ditto
3727 * src/text2.C (SetCounter): ditto
3728 * src/lyxfunc.C (Dispatch) ditto
3729 Also recreated old InsetIndex behaviour exactly. Can now
3730 index-insert at the start of a paragraph and index-insert-last
3731 without launching the pop-up.
3733 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3735 * lib/lyxrc.example: mark te pdf options as non functional.
3737 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3738 (isStrDbl): move tmpstr.end() out of loop.
3739 (strToDbl): move intialization of tmpstr
3740 (lowercase): return string const and move tmp.end() out of loop.
3741 (uppercase): return string const and move tmp.edn() out of loop.
3742 (prefixIs): add assertion
3747 (containsOnly): ditto
3748 (containsOnly): ditto
3749 (containsOnly): ditto
3750 (countChar): make last arg char not char const
3751 (token): return string const
3752 (subst): return string const, move tmp.end() out of loop.
3753 (subst): return string const, add assertion
3754 (strip): return string const
3755 (frontStrip): return string const, add assertion
3756 (frontStrip): return string const
3761 * src/support/lstrings.C: add inclde "LAssert.h"
3762 (isStrInt): move tmpstr.end() out of loop.
3764 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3765 toollist.end() out of loop.
3766 (deactivate): move toollist.end() out of loop.
3767 (update): move toollist.end() out of loop.
3768 (updateLayoutList): move tc.end() out of loop.
3769 (add): move toollist.end() out of loop.
3771 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3772 md.end() out of loop.
3774 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3776 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3779 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3780 (Erase): move insetlist.end() out of loop.
3782 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3783 ref to const string as first arg. Move initialization of some
3784 variables, whitespace changes.
3786 * src/kbmap.C (defkey): move table.end() out of loop.
3787 (kb_keymap): move table.end() out of loop.
3788 (findbinding): move table.end() out of loop.
3790 * src/MenuBackend.C (hasMenu): move end() out of loop.
3791 (getMenu): move end() out of loop.
3792 (getMenu): move menulist_.end() out of loop.
3794 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3796 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3799 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3800 (getFromLyXName): move infotab.end() out of loop.
3802 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3803 -fvtable-thunks -ffunction-sections -fdata-sections
3805 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3807 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3810 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3812 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3814 * src/frontends/xforms/FormCitation.[Ch],
3815 src/frontends/xforms/FormIndex.[Ch],
3816 src/frontends/xforms/FormToc.[Ch],
3817 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3819 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3821 * src/commandtags.h: renamed, created some flags for citation
3824 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3826 * src/lyxfunc.C (dispatch): use signals to insert index entry
3828 * src/frontends/Dialogs.h: new signal createIndex
3830 * src/frontends/xforms/FormCommand.[Ch],
3831 src/frontends/xforms/FormCitation.[Ch],
3832 src/frontends/xforms/FormToc.[Ch],
3833 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3835 * src/insets/insetindex.[Ch]: GUI-independent
3837 * src/frontends/xforms/FormIndex.[Ch],
3838 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3841 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3843 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3844 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3846 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3848 * src/insets/insetref.C (Latex): rewrite so that there is now
3849 question that a initialization is requested.
3851 * src/insets/insetcommand.h: reenable the hide signal
3853 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3855 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3856 fix handling of shortcuts (many bugs :)
3857 (add_lastfiles): ditto.
3859 * lib/ui/default.ui: fix a few shortcuts.
3861 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3863 * Makefile.am: Fix ``rpmdist'' target to return the exit
3864 status of the ``rpm'' command, instead of the last command in
3865 the chain (the ``rm lyx.xpm'' command, which always returns
3868 2000-08-02 Allan Rae <rae@lyx.org>
3870 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3871 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3872 * src/frontends/xforms/FormToc.C (FormToc): ditto
3874 * src/frontends/xforms/Makefile.am: A few forgotten files
3876 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3877 Signals-not-copyable-problem Lars' started commenting out.
3879 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3881 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3883 * src/insets/insetcommand.h: Signals is not copyable so anoter
3884 scheme for automatic hiding of forms must be used.
3886 * src/frontends/xforms/FormCitation.h: don't inerit from
3887 noncopyable, FormCommand already does that.
3888 * src/frontends/xforms/FormToc.h: ditto
3889 * src/frontends/xforms/FormUrl.h: ditto
3891 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3893 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3895 * src/insets/insetcommand.h (hide): new SigC::Signal0
3896 (d-tor) new virtual destructor emits hide signal
3898 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3899 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3901 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3902 LOF and LOT. Inset is now GUI-independent
3904 * src/insets/insetloa.[Ch]: redundant
3905 * src/insets/insetlof.[Ch]: ditto
3906 * src/insets/insetlot.[Ch]: ditto
3908 * src/frontends/xforms/forms/form_url.fd: tweaked!
3909 * src/frontends/xforms/forms/form_citation.fd: ditto
3911 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3912 dialogs dealing with InsetCommand insets
3914 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3915 FormCommand base class
3916 * src/frontends/xforms/FormUrl.[Ch]: ditto
3918 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3920 * src/frontends/xforms/FormToc.[Ch]: ditto
3922 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3923 passed a generic InsetCommand pointer
3924 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3926 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3927 and modified InsetTOC class
3928 * src/buffer.C: ditto
3930 * forms/lyx.fd: strip out old FD_form_toc code
3931 * src/lyx_gui_misc.C: ditto
3932 * src/lyx_gui.C: ditto
3933 * src/lyx_cb.C: ditto
3934 * src/lyx.[Ch]: ditto
3936 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3938 * src/support/utility.hpp: tr -d '\r'
3940 2000-08-01 Juergen Vigna <jug@sad.it>
3942 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3944 * src/commandtags.h:
3945 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3946 LFUN_TABULAR_FEATURES.
3948 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3949 LFUN_LAYOUT_TABULAR.
3951 * src/insets/insettabular.C (getStatus): implemented helper function.
3953 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3955 2000-07-31 Juergen Vigna <jug@sad.it>
3957 * src/text.C (draw): fixed screen update problem for text-insets.
3959 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3960 something changed probably this has to be added in various other
3963 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3965 2000-07-31 Baruch Even <baruch.even@writeme.com>
3967 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3968 templates to satisfy compaq cxx.
3971 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3973 * src/support/translator.h (equal_1st_in_pair::operator()): take
3974 const ref pair_type as arg.
3975 (equal_2nd_in_pair::operator()): ditto
3976 (Translator::~Translator): remove empty d-tor.
3978 * src/graphics/GraphicsCache.C: move include config.h to top, also
3979 put initialization of GraphicsCache::singleton here.
3980 (~GraphicsCache): move here
3981 (addFile): take const ref as arg
3984 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3986 * src/BufferView2.C (insertLyXFile): change te with/without header
3989 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3991 * src/frontends/xforms/FormGraphics.C (apply): add some
3992 static_cast. Not very nice, but required by compaq cxx.
3994 * src/frontends/xforms/RadioButtonGroup.h: include header
3995 <utility> instead of <pair.h>
3997 * src/insets/insetgraphicsParams.C: add using directive.
3998 (readResize): change return type to void.
3999 (readOrigin): ditto.
4001 * src/lyxfunc.C (getStatus): add missing break for build-program
4002 function; add test for Literate for export functions.
4004 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4005 entries in Options menu.
4007 2000-07-31 Baruch Even <baruch.even@writeme.com>
4009 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4010 protect against auto-allocation; release icon when needed.
4012 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4014 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4015 on usual typewriter.
4017 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4018 earlier czech.kmap), useful only for programming.
4020 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4022 * src/frontends/xforms/FormCitation.h: fix conditioning around
4025 2000-07-31 Juergen Vigna <jug@sad.it>
4027 * src/frontends/xforms/FormTabular.C (local_update): changed
4028 radio_linebreaks to radio_useparbox and added radio_useminipage.
4030 * src/tabular.C: made support for using minipages/parboxes.
4032 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4034 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4036 (descent): so the cursor is in the middle.
4037 (width): bit smaller box.
4039 * src/insets/insetgraphics.h: added display() function.
4041 2000-07-31 Baruch Even <baruch.even@writeme.com>
4043 * src/frontends/Dialogs.h: Added showGraphics signals.
4045 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4046 xforms form definition of the graphics dialog.
4048 * src/frontends/xforms/FormGraphics.h:
4049 * src/frontends/xforms/FormGraphics.C: Added files, the
4050 GUIndependent code of InsetGraphics
4052 * src/insets/insetgraphics.h:
4053 * src/insets/insetgraphics.C: Major writing to make it work.
4055 * src/insets/insetgraphicsParams.h:
4056 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4057 struct between InsetGraphics and GUI.
4059 * src/LaTeXFeatures.h:
4060 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4061 support for graphicx package.
4063 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4064 for the graphics inset.
4066 * src/support/translator.h: Added file, used in
4067 InsetGraphicsParams. this is a template to translate between two
4070 * src/frontends/xforms/RadioButtonGroup.h:
4071 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4072 way to easily control a radio button group.
4074 2000-07-28 Juergen Vigna <jug@sad.it>
4076 * src/insets/insettabular.C (LocalDispatch):
4077 (TabularFeatures): added support for lyx-functions of tabular features.
4078 (cellstart): refixed this function after someone wrongly changed it.
4080 * src/commandtags.h:
4081 * src/LyXAction.C (init): added support for tabular-features
4083 2000-07-28 Allan Rae <rae@lyx.org>
4085 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4086 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4087 triggers the callback for input checking. As a result we sometimes get
4088 "LyX: This shouldn't happen..." printed to cerr.
4089 (input): Started using status variable since I only free() on
4090 destruction. Some input checking for paths and font sizes.
4092 * src/frontends/xforms/FormPreferences.h: Use status to control
4093 activation of Ok and Apply
4095 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4096 callback. Also resized to stop segfaults with 0.88. The problem is
4097 that xforms-0.88 requires the folder to be wide enough to fit all the
4098 tabs. If it isn't it causes all sorts of problems.
4100 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4102 * src/frontends/xforms/forms/README: Reflect reality.
4104 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4105 * src/frontends/xforms/forms/makefile: ditto.
4107 * src/commandtags.h: Get access to new Preferences dialog
4108 * src/LyXAction.C: ditto
4109 * src/lyxfunc.C: ditto
4110 * lib/ui/default.ui: ditto
4112 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4114 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4116 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4119 * src/frontends/xforms/form_url.[Ch]: added.
4121 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4123 * src/insets/insetbib.h: fixed bug in previous commit
4125 * src/frontends/xforms/FormUrl.h: ditto
4127 * src/frontends/xforms/FormPrint.h: ditto
4129 * src/frontends/xforms/FormPreferences.h: ditto
4131 * src/frontends/xforms/FormCopyright.h: ditto
4133 * src/frontends/xforms/FormCitation.C: ditto
4135 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4136 private copyconstructor and private default contructor
4138 * src/support/Makefile.am: add utility.hpp
4140 * src/support/utility.hpp: new file from boost
4142 * src/insets/insetbib.h: set owner in clone
4144 * src/frontends/xforms/FormCitation.C: added missing include
4147 * src/insets/form_url.[Ch]: removed
4149 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4151 * development/lyx.spec.in
4152 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4153 file/directory re-organization.
4155 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4157 * src/insets/insetcommand.[Ch]: moved the string data and
4158 associated manipulation methods into a new stand-alone class
4159 InsetCommandParams. This class has two additional methods
4160 getAsString() and setFromString() allowing the contents to be
4161 moved around as a single string.
4162 (addContents) method removed.
4163 (setContents) method no longer virtual.
4165 * src/buffer.C (readInset): made use of new InsetCitation,
4166 InsetUrl constructors based on InsetCommandParams.
4168 * src/commandtags.h: add LFUN_INSERT_URL
4170 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4171 independent InsetUrl and use InsetCommandParams to extract
4172 string info and create new Insets.
4174 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4176 * src/frontends/xforms/FormCitation.C (apply): uses
4179 * src/frontends/xforms/form_url.C
4180 * src/frontends/xforms/form_url.h
4181 * src/frontends/xforms/FormUrl.h
4182 * src/frontends/xforms/FormUrl.C
4183 * src/frontends/xforms/forms/form_url.fd: new files
4185 * src/insets/insetcite.[Ch]: removed unused constructors.
4187 * src/insets/insetinclude.[Ch]: no longer store filename
4189 * src/insets/inseturl.[Ch]: GUI-independent.
4191 2000-07-26 Juergen Vigna <jug@sad.it>
4192 * renamed frontend from gtk to gnome as it is that what is realized
4193 and did the necessary changes in the files.
4195 2000-07-26 Marko Vendelin <markov@ioc.ee>
4197 * configure.in: cleaning up gnome configuration scripts
4199 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4201 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4202 shortcuts syndrom by redrawing them explicitely (a better solution
4203 would be appreciated).
4205 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4207 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4210 * src/lyx_cb.C (MenuExport): change html export to do the right
4211 thing depending of the document type (instead of having
4212 html-linuxdoc and html-docbook).
4213 * src/lyxfunc.C (getStatus): update for html
4214 * lib/ui/default.ui: simplify due to the above change.
4215 * src/menus.C (ShowFileMenu): update too (in case we need it).
4217 * src/MenuBackend.C (read): if a menu is defined twice, add the
4218 new entries to the exiting one.
4220 2000-07-26 Juergen Vigna <jug@sad.it>
4222 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4224 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4225 and return a bool if it did actual save the file.
4226 (AutoSave): don't autosave a unnamed doc.
4228 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4229 check if this is an UNNAMED new file and react to it.
4230 (newFile): set buffer to unnamed and change to not mark a new
4231 buffer dirty if I didn't do anything with it.
4233 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4235 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4237 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4238 friend as per Angus's patch posted to lyx-devel.
4240 * src/ext_l10n.h: updated
4242 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4243 gettext on the style string right before inserting them into the
4246 * autogen.sh: add code to extract style strings form layout files,
4247 not good enough yet.
4249 * src/frontends/gtk/.cvsignore: add MAKEFILE
4251 * src/MenuBackend.C (read): run the label strings through gettext
4252 before storing them in the containers.
4254 * src/ext_l10n.h: new file
4256 * autogen.sh : generate the ext_l10n.h file here
4258 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4260 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4263 * lib/ui/default.ui: fix a couple of typos.
4265 * config/gnome/gtk.m4: added (and added to the list of files in
4268 * src/insets/insetinclude.C (unique_id): fix when we are using
4269 lyxstring instead of basic_string<>.
4270 * src/insets/insettext.C (LocalDispatch): ditto.
4271 * src/support/filetools.C: ditto.
4273 * lib/configure.m4: create the ui/ directory if necessary.
4275 * src/LyXView.[Ch] (updateToolbar): new method.
4277 * src/BufferView_pimpl.C (buffer): update the toolbar when
4278 opening/closing buffer.
4280 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4282 * src/LyXAction.C (getActionName): enhance to return also the name
4283 and options of pseudo-actions.
4284 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4286 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4287 as an example of what is possible). Used in File->Build too (more
4288 useful) and in the import/export menus (to mimick the complicated
4289 handling of linuxdoc and friends). Try to update all the entries.
4291 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4294 * src/MenuBackend.C (read): Parse the new OptItem tag.
4296 * src/MenuBackend.h: Add a new optional_ data member (used if the
4297 entry should be omitted when the lyxfunc is disabled).
4299 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4300 function, used as a shortcut.
4301 (create_submenu): align correctly the shortcuts on the widest
4304 * src/MenuBackend.h: MenuItem.label() only returns the label of
4305 the menu without shortcut; new method shortcut().
4307 2000-07-14 Marko Vendelin <markov@ioc.ee>
4309 * src/frontends/gtk/Dialogs.C:
4310 * src/frontends/gtk/FormCopyright.C:
4311 * src/frontends/gtk/FormCopyright.h:
4312 * src/frontends/gtk/Makefile.am: added these source-files for the
4313 Gtk/Gnome support of the Copyright-Dialog.
4315 * src/main.C: added Gnome::Main initialization if using
4316 Gtk/Gnome frontend-GUI.
4318 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4320 * config/gnome/aclocal-include.m4
4321 * config/gnome/compiler-flags.m4
4322 * config/gnome/curses.m4
4323 * config/gnome/gnome--.m4
4324 * config/gnome/gnome-bonobo-check.m4
4325 * config/gnome/gnome-common.m4
4326 * config/gnome/gnome-fileutils.m4
4327 * config/gnome/gnome-ghttp-check.m4
4328 * config/gnome/gnome-gnorba-check.m4
4329 * config/gnome/gnome-guile-checks.m4
4330 * config/gnome/gnome-libgtop-check.m4
4331 * config/gnome/gnome-objc-checks.m4
4332 * config/gnome/gnome-orbit-check.m4
4333 * config/gnome/gnome-print-check.m4
4334 * config/gnome/gnome-pthread-check.m4
4335 * config/gnome/gnome-support.m4
4336 * config/gnome/gnome-undelfs.m4
4337 * config/gnome/gnome-vfs.m4
4338 * config/gnome/gnome-x-checks.m4
4339 * config/gnome/gnome-xml-check.m4
4340 * config/gnome/gnome.m4
4341 * config/gnome/gperf-check.m4
4342 * config/gnome/gtk--.m4
4343 * config/gnome/linger.m4
4344 * config/gnome/need-declaration.m4: added configuration scripts
4345 for Gtk/Gnome frontend-GUI
4347 * configure.in: added support for the --with-frontend=gtk option
4349 * autogen.sh: added config/gnome/* to list of config-files
4351 * acconfig.h: added define for GTKGUI-support
4353 * config/lyxinclude.m4: added --with-frontend[=value] option value
4354 for Gtk/Gnome frontend-GUI support.
4356 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4358 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4362 * src/paragraph.C (GetChar): remove non-const version
4364 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4365 (search_kw): use it.
4367 * src/lyx_main.C (init): if "preferences" exist, read that instead
4369 (ReadRcFile): return bool if the file could be read ok.
4370 (ReadUIFile): add a check to see if lex file is set ok.
4372 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4373 bastring can be used instead of lyxstring (still uses the old code
4374 if std::string is good enough or if lyxstring is used.)
4376 * src/encoding.C: make the arrays static, move ininle functions
4378 * src/encoding.h: from here.
4380 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4381 (parseSingleLyXformat2Token): move inset parsing to separate method
4382 (readInset): new private method
4384 * src/Variables.h: remove virtual from get().
4386 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4387 access to NEW_INSETS and NEW_TABULAR
4389 * src/MenuBackend.h: remove superfluous forward declaration of
4390 MenuItem. Add documentations tags "///", remove empty MenuItem
4391 destructor, remove private default contructor.
4393 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4395 (read): more string mlabel and mname to where they are used
4396 (read): remove unused variables mlabel and mname
4397 (defaults): unconditional clear, make menusetup take advantage of
4398 add returning Menu &.
4400 * src/LyXView.h: define NEW_MENUBAR as default
4402 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4403 to NEW_INSETS and NEW_TABULAR.
4404 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4405 defined. Change some of the "xxxx-inset-insert" functions names to
4408 * several files: more enahncements to NEW_INSETS and the resulting
4411 * lib/lyxrc.example (\date_insert_format): move to misc section
4413 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4414 bastring and use AC_CACHE_CHECK.
4415 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4416 the system have the newest methods. uses AC_CACHE_CHECK
4417 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4418 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4419 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4421 * configure.in: add LYX_CXX_GOOD_STD_STRING
4423 * acinclude.m4: recreated
4425 2000-07-24 Amir Karger <karger@lyx.org>
4427 * README: add Hebrew, Arabic kmaps
4430 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4432 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4435 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4437 * Lot of files: add pragma interface/implementation.
4439 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4441 * lib/ui/default.ui: new file (ans new directory). Contains the
4442 default menu and toolbar.
4444 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4445 global space. Toolbars are now read (as menus) in ui files.
4447 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4449 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4450 is disabled because the document is read-only. We want to have the
4451 toggle state of the function anyway.
4452 (getStatus): add code for LFUN_VC* functions (mimicking what is
4453 done in old-style menus)
4455 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4456 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4458 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4459 * src/BufferView_pimpl.C: ditto.
4460 * src/lyxfunc.C: ditto.
4462 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4463 default). This replaces old-style menus by new ones.
4465 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4466 MenuItem. Contain the data structure of a menu.
4468 * src/insets/insettext.C: use LyXView::setLayout instead of
4469 accessing directly the toolbar combox.
4470 * src/lyxfunc.C (Dispatch): ditto.
4472 * src/LyXView.C (setLayout): new method, which just calls
4473 Toolbar::setLayout().
4474 (updateLayoutChoice): move part of this method in Toolbar.
4476 * src/toolbar.[Ch]: removed.
4478 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4479 implementation the toolbar.
4481 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4482 the toolbar. It might make sense to merge it with ToolbarDefaults
4484 (setLayout): new function.
4485 (updateLayoutList): ditto.
4486 (openLayoutList): ditto.
4488 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4489 xforms implementation of the toolbar.
4490 (get_toolbar_func): comment out, since I do not
4491 know what it is good for.
4493 * src/ToolbarDefaults.h: Add the ItemType enum.
4495 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4496 for a list of allocated C strings. Used in Menubar xforms
4497 implementation to avoid memory leaks.
4499 * src/support/lstrings.[Ch] (uppercase): new version taking and
4503 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4504 * lib/bind/emacs.bind: ditto.
4506 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4508 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4509 forward decl of LyXView.
4511 * src/toolbar.C (toolbarItem): moved from toolbar.h
4512 (toolbarItem::clean): ditto
4513 (toolbarItem::~toolbarItem): ditto
4514 (toolbarItem::operator): ditto
4516 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4518 * src/paragraph.h: control the NEW_TABULAR define from here
4520 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4521 USE_TABULAR_INSETS to NEW_TABULAR
4523 * src/ToolbarDefaults.C: add include "lyxlex.h"
4525 * files using the old table/tabular: use NEW_TABULAR to control
4526 compilation of old tabular stuff.
4528 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4531 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4532 planemet in reading of old style floats, fix the \end_deeper
4533 problem when reading old style floats.
4535 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4537 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4539 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4541 * lib/bind/sciword.bind: updated.
4543 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4545 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4546 layout write problem
4548 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4550 * src/Makefile.am (INCLUDES): remove image directory from include
4553 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4554 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4556 * src/LyXView.C (create_form_form_main): read the application icon
4559 * lib/images/*.xpm: change the icons to use transparent color for
4562 * src/toolbar.C (update): change the color of the button when it
4565 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4567 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4568 setting explicitely the minibuffer.
4569 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4571 * src/LyXView.C (showState): new function. Shows font information
4572 in minibuffer and update toolbar state.
4573 (LyXView): call Toolbar::update after creating the
4576 * src/toolbar.C: change toollist to be a vector instead of a
4578 (BubbleTimerCB): get help string directly from the callback
4579 argument of the corresponding icon (which is the action)
4580 (set): remove unnecessary ugliness.
4581 (update): new function. update the icons (depressed, disabled)
4582 depending of the status of the corresponding action.
4584 * src/toolbar.h: remove help in toolbarItem
4586 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4588 * src/Painter.C (text): Added code for using symbol glyphs from
4589 iso10646 fonts. Currently diabled.
4591 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4594 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4595 magyar,turkish and usorbian.
4597 * src/paragraph.C (isMultiLingual): Made more efficient.
4599 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4602 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4603 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4604 Also changed the prototype to "bool math_insert_greek(char)".
4606 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * lots of files: apply the NEW_INSETS on all code that will not be
4609 needed when we move to use the new insets. Enable the define in
4610 lyxparagrah.h to try it.
4612 * src/insets/insettabular.C (cellstart): change to be a static
4614 (InsetTabular): initialize buffer in the initializer list.
4616 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4618 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4619 form_print.h out of the header file. Replaced with forward
4620 declarations of the relevant struct.
4622 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4625 * src/commandtags.h: do not include "debug.h" which does not
4626 belong there. #include it in some other places because of this
4629 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4631 * src/insets/insetcaption.C: add a couple "using" directives.
4633 * src/toolbar.C (add): get the help text directly from lyxaction.
4635 (setPixmap): new function. Loads from disk and sets a pixmap on a
4636 botton; the name of the pixmap file is derived from the command
4639 * src/toolbar.h: remove members isBitmap and pixmap from
4642 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4643 * lib/images/: move many files from images/banner.xpm.
4645 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4647 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4648 * src/toolbar.C: ditto.
4649 * configure.in: ditto.
4650 * INSTALL: document.
4652 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4653 the spellchecker popup is closed from the WM.
4655 2000-07-19 Juergen Vigna <jug@sad.it>
4657 * src/insets/insetfloat.C (Write): small fix because we use the
4658 insetname for the type now!
4660 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4662 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4665 * src/frontends/Dialogs.h: removed hideCitation signal
4667 * src/insets/insetcite.h: added hide signal
4669 * src/insets/insetcite.C (~InsetCitation): emits new signal
4670 (getScreenLabel): "intelligent" label should now fit on the screen!
4672 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4674 * src/frontends/xforms/FormCitation.C (showInset): connects
4675 hide() to the inset's hide signal
4676 (show): modified to use fl_set_object_position rather than
4677 fl_set_object_geometry wherever possible
4679 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4681 * src/insets/lyxinset.h: add caption code
4683 * src/insets/insetfloat.C (type): new method
4685 * src/insets/insetcaption.C (Write): new method
4687 (LyxCode): new method
4689 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4690 to get it right together with using the FloatList.
4692 * src/commandtags.h: add LFUN_INSET_CAPTION
4693 * src/lyxfunc.C (Dispatch): handle it
4695 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4698 * src/Variables.[Ch]: make expand take a const reference, remove
4699 the destructor, some whitespace changes.
4701 * src/LyXAction.C (init): add caption-inset-insert
4703 * src/FloatList.C (FloatList): update the default floats a bit.
4705 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4707 * src/Variables.[Ch]: new files. Intended to be used for language
4708 specific strings (like \chaptername) and filename substitution in
4711 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4713 * lib/kbd/american.kmap: update
4715 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4717 * src/bufferparams.[Ch]: remove member allowAccents.
4719 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4721 * src/LaTeXLog.C: use the log_form.h header.
4722 * src/lyx_gui.C: ditto.
4723 * src/lyx_gui_misc.C: ditto.
4724 * src/lyxvc.h: ditto.
4726 * forms/log_form.fd: new file, created from latexoptions.fd. I
4727 kept the log popup and nuked the options form.
4729 * src/{la,}texoptions.[Ch]: removed.
4730 * src/lyx_cb.C (LaTeXOptions): ditto
4732 * src/lyx_gui.C (create_forms): do not handle the
4733 fd_latex_options form.
4735 2000-07-18 Juergen Vigna <jug@sad.it>
4737 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4738 name of the inset so that it can be requested outside (text2.C).
4740 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4743 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4745 * src/mathed/formula.h (ConvertFont): constify
4747 * src/mathed/formula.C (Read): add warning if \end_inset is not
4748 found on expected place.
4750 * src/insets/lyxinset.h (ConvertFont): consify
4752 * src/insets/insetquotes.C (ConvertFont): constify
4753 * src/insets/insetquotes.h: ditto
4755 * src/insets/insetinfo.h: add labelfont
4757 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4758 (ascent): use labelfont
4762 (Write): make .lyx file a bit nicer
4764 * src/insets/insetfloat.C (Write): simplify somewhat...
4765 (Read): add warning if arg is not found
4767 * src/insets/insetcollapsable.C: add using std::max
4768 (Read): move string token and add warning in arg is not found
4769 (draw): use std::max to get the right ty
4770 (getMaxWidth): simplify by using std::max
4772 * src/insets/insetsection.h: new file
4773 * src/insets/insetsection.C: new file
4774 * src/insets/insetcaption.h: new file
4775 * src/insets/insetcaption.C: new file
4777 * src/insets/inset.C (ConvertFont): constify signature
4779 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4780 insetcaption.[Ch] and insetsection.[Ch]
4782 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4783 uses to use LABEL_COUNTER_CHAPTER instead.
4784 * src/text2.C (SetCounter): here
4786 * src/counters.h: new file
4787 * src/counters.C: new file
4788 * src/Sectioning.h: new file
4789 * src/Sectioning.C: new file
4791 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4793 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4795 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4798 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4801 2000-07-17 Juergen Vigna <jug@sad.it>
4803 * src/tabular.C (Validate): check if array-package is needed.
4804 (SetVAlignment): added support for vertical alignment.
4805 (SetLTFoot): better support for longtable header/footers
4806 (Latex): modified to support added features.
4808 * src/LaTeXFeatures.[Ch]: added array-package.
4810 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4812 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4815 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4817 * configure.in: do not forget to put a space after -isystem.
4819 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4821 * lib/kbd/arabic.kmap: a few fixes.
4823 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4825 * some whitespace chagnes to a number of files.
4827 * src/support/DebugStream.h: change to make it easier for
4828 doc++ to parse correctly.
4829 * src/support/lyxstring.h: ditto
4831 * src/mathed/math_utils.C (compara): change to have only one
4833 (MathedLookupBOP): change because of the above.
4835 * src/mathed/math_delim.C (math_deco_compare): change to have only
4837 (search_deco): change becasue of the above.
4839 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4840 instead of manually coded one.
4842 * src/insets/insetquotes.C (Read): read the \end_inset too
4844 * src/insets/insetlatex.h: remove file
4845 * src/insets/insetlatex.C: remove file
4847 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4849 (InsetPrintIndex): remove destructor
4851 * src/insets/insetinclude.h: remove default constructor
4853 * src/insets/insetfloat.C: work to make it work better
4855 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4857 * src/insets/insetcite.h (InsetCitation): remove default constructor
4859 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4861 * src/text.C (GetColumnNearX): comment out some currently unused code.
4863 * src/paragraph.C (writeFile): move some initializations closer to
4865 (CutIntoMinibuffer): small change to use new matchIT operator
4869 (InsertInset): ditto
4872 (InsetIterator): ditto
4873 (Erase): small change to use new matchFT operator
4875 (GetFontSettings): ditto
4876 (HighestFontInRange): ditto
4879 * src/lyxparagraph.h: some chars changed to value_type
4880 (matchIT): because of some stronger checking (perhaps too strong)
4881 in SGI STL, the two operator() unified to one.
4884 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4886 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4887 the last inset read added
4888 (parseSingleLyXformat2Token): some more (future) compability code added
4889 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4890 (parseSingleLyXformat2Token): set last_inset_read
4891 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4892 (parseSingleLyXformat2Token): don't double intializw string next_token
4894 * src/TextCache.C (text_fits::operator()): add const's to the signature
4895 (has_buffer::operator()): ditto
4897 * src/Floating.h: add some comments on the class
4899 * src/FloatList.[Ch] (typeExist): new method
4902 * src/BackStack.h: added default constructor, wanted by Gcc.
4904 2000-07-14 Juergen Vigna <jug@sad.it>
4906 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4908 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4910 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4911 do a redraw when the window is resized!
4912 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4914 * src/insets/insettext.C (resizeLyXText): added function to correctly
4915 being able to resize the LyXWindow.
4917 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4919 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4921 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4922 crashes when closing dialog to a deleted inset.
4924 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4925 method! Now similar to other insets.
4927 2000-07-13 Juergen Vigna <jug@sad.it>
4929 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4931 * lib/examples/Literate.lyx: small patch!
4933 * src/insets/insetbib.C (Read): added this function because of wrong
4934 Write (without [begin|end]_inset).
4936 2000-07-11 Juergen Vigna <jug@sad.it>
4938 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4939 as the insertInset could not be good!
4941 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4942 the bool param should not be last.
4944 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4946 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4947 did submit that to Karl).
4949 * configure.in: use -isystem instead of -I for X headers. This
4950 fixes a problem on solaris with a recent gcc;
4951 put the front-end code after the X detection code;
4952 configure in sigc++ before lib/
4954 * src/lyx_main.C (commandLineHelp): remove -display from command
4957 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4959 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4960 Also put in Makefile rules for building the ``listerrors''
4961 program for parsing errors from literate programs written in LyX.
4963 * lib/build-listerrors: Added small shell script as part of compile
4964 process. This builds a working ``listerrors'' binary if noweb is
4965 installed and either 1) the VNC X server is installed on the machine,
4966 or 2) the user is compiling from within a GUI. The existence of a GUI
4967 is necessary to use the ``lyx --export'' feature for now. This
4968 hack can be removed once ``lyx --export'' no longer requires a GUI to
4971 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4973 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4974 now passed back correctly from gcc and placed "under" error
4975 buttons in a Literate LyX source.
4977 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4979 * src/text.C (GetColumnNearX): Better behavior when a RTL
4980 paragraph is ended by LTR text.
4982 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4985 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4987 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4988 true when clipboard is empty.
4990 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4992 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4993 row of the paragraph.
4994 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4995 to prevent calculation of bidi tables
4997 2000-07-07 Juergen Vigna <jug@sad.it>
4999 * src/screen.C (ToggleSelection): added y_offset and x_offset
5002 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5005 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5007 * src/insets/insettext.C: fixed Layout-Display!
5009 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5011 * configure.in: add check for strings.h header.
5013 * src/spellchecker.C: include <strings.h> in order to have a
5014 definition for bzero().
5016 2000-07-07 Juergen Vigna <jug@sad.it>
5018 * src/insets/insettext.C (draw): set the status of the bv->text to
5019 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5021 * src/screen.C (DrawOneRow):
5022 (DrawFromTo): redraw the actual row if something has changed in it
5025 * src/text.C (draw): call an update of the toplevel-inset if something
5026 has changed inside while drawing.
5028 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5030 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5032 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5033 processing inside class.
5035 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5036 processing inside class.
5038 * src/insets/insetindex.h new struct Holder, consistent with other
5041 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5042 citation dialog from main code and placed it in src/frontends/xforms.
5043 Dialog launched through signals instead of callbacks
5045 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5047 * lyx.man: update the options description.
5049 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5051 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5052 handle neg values, set min width to 590, add doc about -display
5054 2000-07-05 Juergen Vigna <jug@sad.it>
5056 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5057 calls to BufferView *.
5059 * src/insets/insettext.C (checkAndActivateInset): small fix non
5060 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5062 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5063 their \end_inset token!
5065 2000-07-04 edscott <edscott@imp.mx>
5067 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5068 lib/lyxrc.example: added option \wheel_jump
5070 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5072 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5073 remove support for -width,-height,-xpos and -ypos.
5075 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5077 * src/encoding.[Ch]: New files.
5079 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5080 (text): Call to the underline() method only when needed.
5082 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5084 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5085 encoding(s) for the document.
5087 * src/bufferparams.C (BufferParams): Changed default value of
5090 * src/language.C (newLang): Removed.
5091 (items[]): Added encoding information for all defined languages.
5093 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5094 encoding choice button.
5096 * src/lyxrc.h (font_norm_type): New member variable.
5097 (set_font_norm_type): New method.
5099 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5100 paragraphs with different encodings.
5102 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5103 (TransformChar): Changed to work correctly with Arabic points.
5104 (draw): Added support for drawing Arabic points.
5105 (draw): Removed code for drawing underbars (this is done by
5108 * src/support/textutils.h (IsPrintableNonspace): New function.
5110 * src/BufferView_pimpl.h: Added "using SigC::Object".
5111 * src/LyXView.h: ditto.
5113 * src/insets/insetinclude.h (include_label): Changed to mutable.
5115 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5117 * src/mathed/math_iter.h: remove empty destructor
5119 * src/mathed/math_cursor.h: remove empty destructor
5121 * src/insets/lyxinset.h: add THEOREM_CODE
5123 * src/insets/insettheorem.[Ch]: new files
5125 * src/insets/insetminipage.C: (InsertInset): remove
5127 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5129 (InsertInset): remove
5131 * src/insets/insetlist.C: (InsertList): remove
5133 * src/insets/insetfootlike.[Ch]: new files
5135 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5138 (InsertInset): ditto
5140 * src/insets/insetert.C: remove include Painter.h, reindent
5141 (InsertInset): move to header
5143 * src/insets/insetcollapsable.h: remove explicit from default
5144 contructor, remove empty destructor, add InsertInset
5146 * src/insets/insetcollapsable.C (InsertInset): new func
5148 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5150 * src/vspace.h: add explicit to constructor
5152 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5153 \textcompwordmark, please test this.
5155 * src/lyxrc.C: set ascii_linelen to 65 by default
5157 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5159 * src/commandtags.h: add LFUN_INSET_THEOREM
5161 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5162 (makeLinuxDocFile): remove _some_ of the nice logic
5163 (makeDocBookFile): ditto
5165 * src/Painter.[Ch]: (~Painter): removed
5167 * src/LyXAction.C (init): entry for insettheorem added
5169 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5171 (deplog): code to detect files generated by LaTeX, needs testing
5174 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5176 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5178 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5180 * src/LaTeX.C (deplog): Add a check for files that are going to be
5181 created by the first latex run, part of the project to remove the
5184 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5185 contents to the extension list.
5187 2000-07-04 Juergen Vigna <jug@sad.it>
5189 * src/text.C (NextBreakPoint): added support for needFullRow()
5191 * src/insets/lyxinset.h: added needFullRow()
5193 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5196 * src/insets/insettext.C: lots of changes for update!
5198 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5200 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5202 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5204 * src/insets/insetinclude.C (InsetInclude): fixed
5205 initialization of include_label.
5206 (unique_id): now returns a string.
5208 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5210 * src/LaTeXFeatures.h: new member IncludedFiles, for
5211 a map of key, included file name.
5213 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5214 with the included files for inclusion in SGML preamble,
5215 i. e., linuxdoc and docbook.
5218 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5219 nice (is the generated linuxdoc code to be exported?), that
5220 allows to remove column, and only_body that will be true for
5221 slave documents. Insets are allowed inside SGML font type.
5222 New handling of the SGML preamble for included files.
5223 (makeDocBookFile): the same for docbook.
5225 * src/insets/insetinclude.h:
5226 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5228 (DocBook): new export methods.
5230 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5231 and makeDocBookFile.
5233 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5234 formats to export with command line argument -x.
5236 2000-06-29 Juergen Vigna <jug@sad.it>
5238 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5239 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5241 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5242 region could already been cleared by an inset!
5244 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5246 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5249 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5251 (cursorToggle): remove special handling of lyx focus.
5253 2000-06-28 Juergen Vigna <jug@sad.it>
5255 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5258 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5260 * src/insets/insetindex.C (Edit): add a callback when popup is
5263 * src/insets/insettext.C (LocalDispatch):
5264 * src/insets/insetmarginal.h:
5265 * src/insets/insetlist.h:
5266 * src/insets/insetfoot.h:
5267 * src/insets/insetfloat.h:
5268 * src/insets/insetert.h: add a missing std:: qualifier.
5270 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5272 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5275 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5277 * src/insets/insettext.C (Read): remove tmptok unused variable
5278 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5279 (InsertInset): change for new InsetInset code
5281 * src/insets/insettext.h: add TEXT inline method
5283 * src/insets/insettext.C: remove TEXT macro
5285 * src/insets/insetmarginal.C (Write): new method
5286 (Latex): change output slightly
5288 * src/insets/insetfoot.C (Write): new method
5289 (Latex): change output slightly (don't use endl when no need)
5291 * src/insets/insetert.C (Write): new method
5293 * src/insets/insetcollapsable.h: make button_length, button_top_y
5294 and button_bottm_y protected.
5296 * src/insets/insetcollapsable.C (Write): simplify code by using
5297 tostr. Also do not output the float name, the children class
5298 should to that to get control over own arguments
5300 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5301 src/insets/insetminipage.[Ch]:
5304 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5306 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5308 * src/Makefile.am (lyx_SOURCES): add the new files
5310 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5311 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5312 * src/commandtags.h: ditto
5314 * src/LaTeXFeatures.h: add a std::set of used floattypes
5316 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5318 * src/FloatList.[Ch] src/Floating.h: new files
5320 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5322 * src/lyx_cb.C (TableApplyCB): ditto
5324 * src/text2.C: ditto
5325 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5326 (parseSingleLyXformat2Token): ditto + add code for
5327 backwards compability for old float styles + add code for new insets
5329 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5331 (InsertInset(size_type, Inset *, LyXFont)): new method
5332 (InsetChar(size_type, char)): changed to use the other InsetChar
5333 with a LyXFont(ALL_INHERIT).
5334 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5335 insert the META_INSET.
5337 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5339 * sigc++/thread.h (Threads): from here
5341 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5342 definition out of line
5343 * sigc++/scope.h: from here
5345 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5347 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5348 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5350 * Makefile.am (bindist): new target.
5352 * INSTALL: add instructions for doing a binary distribution.
5354 * development/tools/README.bin.example: update a bit.
5356 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5359 * lib/lyxrc.example: new lyxrc tag \set_color.
5361 * src/lyxfunc.C (Dispatch):
5362 * src/commandtags.h:
5363 * src/LyXAction.C: new lyxfunc "set-color".
5365 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5366 and an x11name given as strings.
5368 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5369 cache when a color is changed.
5371 2000-06-26 Juergen Vigna <jug@sad.it>
5373 * src/lyxrow.C (width): added this functions and variable.
5375 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5378 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5380 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5382 * images/undo_bw.xpm: new icon.
5383 * images/redo_bw.xpm: ditto.
5385 * configure.in (INSTALL_SCRIPT): change value to
5386 ${INSTALL} to avoid failures of install-script target.
5387 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5389 * src/BufferView.h: add a magic "friend" declaration to please
5392 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5394 * forms/cite.fd: modified to allow resizing without messing
5397 * src/insetcite.C: Uses code from cite.fd almost without
5399 User can now resize dialog in the x-direction.
5400 Resizing the dialog in the y-direction is prevented, as the
5401 code does this intelligently already.
5403 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5405 * INSTALL: remove obsolete entry in "problems" section.
5407 * lib/examples/sl_*.lyx: update of the slovenian examples.
5409 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5411 2000-06-23 Juergen Vigna <jug@sad.it>
5413 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5415 * src/buffer.C (resize): delete the LyXText of textinsets.
5417 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5419 * src/insets/lyxinset.h: added another parameter 'cleared' to
5420 the draw() function.
5422 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5423 unlocking inset in inset.
5425 2000-06-22 Juergen Vigna <jug@sad.it>
5427 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5428 of insets and moved first to LyXText.
5430 * src/mathed/formulamacro.[Ch]:
5431 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5433 2000-06-21 Juergen Vigna <jug@sad.it>
5435 * src/text.C (GetVisibleRow): look if I should clear the area or not
5436 using Inset::doClearArea() function.
5438 * src/insets/lyxinset.h: added doClearArea() function and
5439 modified draw(Painter &, ...) to draw(BufferView *, ...)
5441 * src/text2.C (UpdateInset): return bool insted of int
5443 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5445 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5446 combox in the character popup
5448 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5449 BufferParams const & params
5451 2000-06-20 Juergen Vigna <jug@sad.it>
5453 * src/insets/insettext.C (SetParagraphData): set insetowner on
5456 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5458 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5459 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5461 (form_main_): remove
5463 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5464 (create_form_form_main): remove FD_form_main stuff, connect to
5465 autosave_timeout signal
5467 * src/LyXView.[Ch] (getMainForm): remove
5468 (UpdateTimerCB): remove
5469 * src/BufferView_pimpl.h: inherit from SigC::Object
5471 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5472 signal instead of callback
5474 * src/BufferView.[Ch] (cursorToggleCB): remove
5476 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5478 * src/BufferView_pimpl.C: changes because of the one below
5480 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5481 instead of storing a pointer to a LyXText.
5483 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5485 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5487 * src/lyxparagraph.h
5489 * src/paragraph.C: Changed fontlist to a sorted vector.
5491 2000-06-19 Juergen Vigna <jug@sad.it>
5493 * src/BufferView.h: added screen() function.
5495 * src/insets/insettext.C (LocalDispatch): some selection code
5498 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5500 * src/insets/insettext.C (SetParagraphData):
5502 (InsetText): fixes for multiple paragraphs.
5504 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5506 * development/lyx.spec.in: Call configure with ``--without-warnings''
5507 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5508 This should be fine, however, since we generally don't want to be
5509 verbose when making an RPM.
5511 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5513 * lib/scripts/fig2pstex.py: New file
5515 2000-06-16 Juergen Vigna <jug@sad.it>
5517 * src/insets/insettabular.C (UpdateLocal):
5518 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5519 (LocalDispatch): Changed all functions to use LyXText.
5521 2000-06-15 Juergen Vigna <jug@sad.it>
5523 * src/text.C (SetHeightOfRow): call inset::update before requesting
5526 * src/insets/insettext.C (update):
5527 * src/insets/insettabular.C (update): added implementation
5529 * src/insets/lyxinset.h: added update function
5531 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5533 * src/text.C (SelectNextWord): protect against null pointers with
5534 old-style string streams. (fix from Paul Theo Gonciari
5537 * src/cite.[Ch]: remove erroneous files.
5539 * lib/configure.m4: update the list of created directories.
5541 * src/lyxrow.C: include <config.h>
5542 * src/lyxcursor.C: ditto.
5544 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5546 * lib/examples/decimal.lyx: new example file from Mike.
5548 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5549 to find template definitions (from Dekel)
5551 * src/frontends/.cvsignore: add a few things.
5553 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5555 * src/Timeout.C (TimeOut): remove default argument.
5557 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5560 * src/insets/ExternalTemplate.C: add a "using" directive.
5562 * src/lyx_main.h: remove the act_ struct, which seems unused
5565 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5567 * LyX Developers Meeting: All files changed, due to random C++ (by
5568 coincidence) code generator script.
5570 - external inset (cool!)
5571 - initial online editing of preferences
5572 - insettabular breaks insettext(s contents)
5574 - some DocBook fixes
5575 - example files update
5576 - other cool stuff, create a diff and look for yourself.
5578 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5580 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5581 -1 this is a non-line-breaking textinset.
5583 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5584 if there is no width set.
5586 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5588 * Lots of files: Merged the dialogbase branch.
5590 2000-06-09 Allan Rae <rae@lyx.org>
5592 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5593 and the Dispatch methods that used it.
5595 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5596 access to functions formerly kept in Dispatch.
5598 2000-05-19 Allan Rae <rae@lyx.org>
5600 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5601 made to_page and count_copies integers again. from_page remains a
5602 string however because I want to allow entry of a print range like
5603 "1,4,22-25" using this field.
5605 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5606 and printer-params-get. These aren't useful from the minibuffer but
5607 could be used by a script/LyXServer app provided it passes a suitable
5608 auto_mem_buffer. I guess I should take a look at how the LyXServer
5609 works and make it support xtl buffers.
5611 * sigc++/: updated to libsigc++-1.0.1
5613 * src/xtl/: updated to xtl-1.3.pl.11
5615 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5616 those changes done to the files in src/ are actually recreated when
5617 they get regenerated. Please don't ever accept a patch that changes a
5618 dialog unless that patch includes the changes to the corresponding *.fd
5621 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5622 stringOnlyContains, renamed it and generalised it.
5624 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5625 branch. Removed the remaining old form_print code.
5627 2000-04-26 Allan Rae <rae@lyx.org>
5629 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5630 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5632 2000-04-25 Allan Rae <rae@lyx.org>
5634 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5635 against a base of xtl-1.3.pl.4
5637 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5638 filter the Id: entries so they still show the xtl version number
5641 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5642 into the src/xtl code. Patch still pending with José (XTL)
5644 2000-04-24 Allan Rae <rae@lyx.org>
5646 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5647 both more generic and much safer. Use the new template functions.
5648 * src/buffer.[Ch] (Dispatch): ditto.
5650 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5651 and mem buffer more intelligently. Also a little general cleanup.
5654 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5655 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5656 * src/xtl/Makefile.am: ditto.
5657 * src/xtl/.cvsignore: ditto.
5658 * src/Makefile.am: ditto.
5660 * src/PrinterParams.h: Removed the macros member functions. Added a
5661 testInvariant member function. A bit of tidying up and commenting.
5662 Included Angus's idea for fixing operation with egcs-1.1.2.
5664 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5665 cool expansion of XTL's mem_buffer to support automatic memory
5666 management within the buffer itself. Removed the various macros and
5667 replaced them with template functions that use either auto_mem_buffer
5668 or mem_buffer depending on a #define. The mem_buffer support will
5669 disappear as soon as the auto_mem_buffer is confirmed to be good on
5670 other platforms/compilers. That is, it's there so you've got something
5673 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5674 effectively forked XTL. However I expect José will include my code
5675 into the next major release. Also fixed a memory leak.
5676 * src/xtl/text.h: ditto.
5677 * src/xtl/xdr.h: ditto.
5678 * src/xtl/giop.h: ditto.
5680 2000-04-16 Allan Rae <rae@lyx.org>
5682 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5683 by autogen.sh and removed by maintainer-clean anyway.
5684 * .cvsignore, sigc++/.cvsignore: Support the above.
5686 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5688 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5690 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5691 macros, renamed static callback-target member functions to suit new
5692 scheme and made them public.
5693 * src/frontends/xforms/forms/form_print.fd: ditto.
5694 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5696 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5699 * src/xtl/: New directory containing a minimal distribution of XTL.
5700 This is XTL-1.3.pl.4.
5702 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5704 2000-04-15 Allan Rae <rae@lyx.org>
5706 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5708 * sigc++/: Updated to libsigc++-1.0.0
5710 2000-04-14 Allan Rae <rae@lyx.org>
5712 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5713 use the generic ones in future. I'll modify my conversion script.
5715 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5717 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5718 (CloseAllBufferRelatedDialogs): Renamed.
5719 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5721 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5722 of the generic ones. These are the same ones my conversion script
5725 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5726 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5727 * src/buffer.C (Dispatch): ditto
5729 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5730 functions for updating and hiding buffer dependent dialogs.
5731 * src/BufferView.C (buffer): ditto
5732 * src/buffer.C (setReadonly): ditto
5733 * src/lyxfunc.C (CloseBuffer): ditto
5735 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5736 Dialogs.h, and hence all the SigC stuff, into every file that includes
5737 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5739 * src/BufferView2.C: reduce the number of headers included by buffer.h
5741 2000-04-11 Allan Rae <rae@lyx.org>
5743 * src/frontends/xforms/xform_macros.h: A small collection of macros
5744 for building C callbacks.
5746 * src/frontends/xforms/Makefile.am: Added above file.
5748 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5749 scheme again. This time it should work for JMarc. If this is
5750 successful I'll revise my conversion script to automate some of this.
5751 The static member functions in the class also have to be public for
5752 this scheme will work. If the scheme works (it's almost identical to
5753 the way BufferView::cursorToggleCB is handled so it should work) then
5754 FormCopyright and FormPrint will be ready for inclusion into the main
5755 trunk immediately after 1.1.5 is released -- provided we're prepared
5756 for complaints about lame compilers not handling XTL.
5758 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5760 2000-04-07 Allan Rae <rae@lyx.org>
5762 * config/lyxinclude.m4: A bit more tidying up (Angus)
5764 * src/LString.h: JMarc's <string> header fix
5766 * src/PrinterParams.h: Used string for most data to remove some
5767 ugly code in the Print dialog and avoid even uglier code when
5768 appending the ints to a string for output.
5770 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5771 and moved "default:" back to the end of switch statement. Cleaned
5772 up the printing so it uses the right function calls and so the
5773 "print to file" option actually puts the file in the right directory.
5775 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5777 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5778 and Ok+Apply button control into a separate method: input (Angus).
5779 (input) Cleaned it up and improved it to be very thorough now.
5780 (All CB) static_cast used instead of C style cast (Angus). This will
5781 probably change again once we've worked out how to keep gcc-2.8.1 happy
5782 with real C callbacks.
5783 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5784 ignore some of the bool settings and has random numbers instead. Needs
5785 some more investigation. Added other input length checks and checking
5786 of file and printer names.
5788 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5789 would link (Angus). Seems the old code doesn't compile with the pragma
5790 statement either. Separated callback entries from internal methods.
5792 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5794 2000-03-17 Allan Rae <rae@lyx.org>
5796 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5797 need it? Maybe it could go in Dialogs instead? I could make it a
5798 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5799 values to get the bool return value.
5800 (Dispatch): New overloaded method for xtl support.
5802 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5803 extern "C" callback instead of static member functions. Hopefully,
5804 JMarc will be able to compile this. I haven't changed
5805 forms/form_copyright.fd yet. Breaking one of my own rules already.
5807 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5808 because they aren't useful from the minibuffer. Maybe a LyXServer
5809 might want a help message though?
5811 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5813 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5814 xtl which needs both rtti and exceptions.
5816 * src/support/Makefile.am:
5817 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5819 * src/frontends/xforms/input_validators.[ch]: input filters and
5820 validators. These conrol what keys are valid in input boxes.
5821 Use them and write some more. Much better idea than waiting till
5822 after the user has pressed Ok to say that the input fields don't make
5825 * src/frontends/xforms/Makefile.am:
5826 * src/frontends/xforms/forms/form_print.fd:
5827 * src/frontends/xforms/forms/makefile:
5828 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5829 new scheme. Still have to make sure I haven't missed anything from
5830 the current implementation.
5832 * src/Makefile.am, src/PrinterParams.h: New data store.
5834 * other files: Added a couple of copyright notices.
5836 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5838 * src/insets/insetbib.h: move Holder struct in public space.
5840 * src/frontends/include/DialogBase.h: use SigC:: only when
5841 SIGC_CXX_NAMESPACES is defined.
5842 * src/frontends/include/Dialogs.h: ditto.
5844 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5846 * src/frontends/xforms/FormCopyright.[Ch]: do not
5847 mention SigC:: explicitely.
5849 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5851 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5852 deals with testing KDE in main configure.in
5853 * configure.in: ditto.
5855 2000-02-22 Allan Rae <rae@lyx.org>
5857 * Lots of files: Merged from HEAD
5859 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5860 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5862 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5864 * sigc++/: new minidist.
5866 2000-02-14 Allan Rae <rae@lyx.org>
5868 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5870 2000-02-08 Juergen Vigna <jug@sad.it>
5872 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5873 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5875 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5876 for this port and so it is much easier for other people to port
5877 dialogs in a common development environment.
5879 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5880 the QT/KDE implementation.
5882 * src/frontends/kde/Dialogs.C:
5883 * src/frontends/kde/FormCopyright.C:
5884 * src/frontends/kde/FormCopyright.h:
5885 * src/frontends/kde/Makefile.am:
5886 * src/frontends/kde/formcopyrightdialog.C:
5887 * src/frontends/kde/formcopyrightdialog.h:
5888 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5889 for the kde support of the Copyright-Dialog.
5891 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5892 subdir-substitution instead of hardcoded 'xforms' as we now have also
5895 * src/frontends/include/DialogBase.h (Object): just commented the
5896 label after #endif (nasty warning and I don't like warnings ;)
5898 * src/main.C (main): added KApplication initialization if using
5901 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5902 For now only the KDE event-loop is added if frontend==kde.
5904 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5906 * configure.in: added support for the --with-frontend[=value] option
5908 * autogen.sh: added kde.m4 file to list of config-files
5910 * acconfig.h: added define for KDEGUI-support
5912 * config/kde.m4: added configuration functions for KDE-port
5914 * config/lyxinclude.m4: added --with-frontend[=value] option with
5915 support for xforms and KDE.
5917 2000-02-08 Allan Rae <rae@lyx.org>
5919 * all Makefile.am: Fixed up so the make targets dist, distclean,
5920 install and uninstall all work even if builddir != srcdir. Still
5921 have a new sigc++ minidist update to come.
5923 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5925 2000-02-01 Allan Rae <rae@lyx.org>
5927 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5928 Many mods to get builddir != srcdir working.
5930 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5931 for building on NT and so we can do the builddir != srcdir stuff.
5933 2000-01-30 Allan Rae <rae@lyx.org>
5935 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5936 This will stay in "rae" branch. We probably don't really need it in
5937 the main trunk as anyone who wants to help programming it should get
5938 a full library installed also. So they can check both included and
5939 system supplied library compilation.
5941 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5942 Added a 'mini' distribution of libsigc++. If you feel the urge to
5943 change something in these directories - Resist it. If you can't
5944 resist the urge then you should modify the following script and rebuild
5945 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5946 all happen. Still uses a hacked version of libsigc++'s configure.in.
5947 I'm quite happy with the results. I'm not sure the extra work to turn
5948 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5949 worth the trouble and would probably lead to extra maintenance
5951 I haven't tested the following important make targets: install, dist.
5952 Not ready for prime time but very close. Maybe 1.1.5.
5954 * development/tools/makeLyXsigc.sh: A shell script to automatically
5955 generate our mini-dist of libsigc++. It can only be used with a CVS
5956 checkout of libsigc++ not a tarball distribution. It's well commented.
5957 This will end up as part of the libsigc++ distribution so other apps
5958 can easily have an included mini-dist. If someone makes mods to the
5959 sigc++ subpackage without modifying this script to generate those
5960 changes I'll be very upset!
5962 * src/frontends/: Started the gui/system indep structure.
5964 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5965 to access the gui-indep dialogs are in this class. Much improved
5966 design compared to previous revision. Lars, please refrain from
5967 moving this header into src/ like you did with Popups.h last time.
5969 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5971 * src/frontends/xforms/: Started the gui-indep system with a single
5972 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5975 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5976 Here you'll find a very useful makefile and automated fdfix.sh that
5977 makes updating dailogs a no-brainer -- provided you follow the rules
5978 set out in the README. I'm thinking about adding another script to
5979 automatically generate skeleton code for a new dialog given just the
5982 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5983 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5984 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5986 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5988 * src/support/LSubstring.C (operator): simplify
5990 * src/lyxtext.h: removed bparams, use buffer_->params instead
5992 * src/lyxrow.h: make Row a real class, move all variables to
5993 private and use accessors.
5995 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5997 (isRightToLeftPar): ditto
5998 (ChangeLanguage): ditto
5999 (isMultiLingual): ditto
6002 (SimpleTeXOnePar): ditto
6003 (TeXEnvironment): ditto
6004 (GetEndLabel): ditto
6006 (SetOnlyLayout): ditto
6007 (BreakParagraph): ditto
6008 (BreakParagraphConservative): ditto
6009 (GetFontSettings): ditto
6011 (CopyIntoMinibuffer): ditto
6012 (CutIntoMinibuffer): ditto
6013 (PasteParagraph): ditto
6014 (SetPExtraType): ditto
6015 (UnsetPExtraType): ditto
6016 (DocBookContTableRows): ditto
6017 (SimpleDocBookOneTablePar): ditto
6019 (TeXFootnote): ditto
6020 (SimpleTeXOneTablePar): ditto
6021 (TeXContTableRows): ditto
6022 (SimpleTeXSpecialChars): ditto
6025 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6026 to private and use accessors.
6028 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6029 this, we did not use it anymore and has not been for ages. Just a
6030 waste of cpu cycles.
6032 * src/language.h: make Language a real class, move all variables
6033 to private and use accessors.
6035 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6036 (create_view): remove
6037 (update): some changes for new timer
6038 (cursorToggle): use new timer
6039 (beforeChange): change for new timer
6041 * src/BufferView.h (cursorToggleCB): removed last paramter because
6044 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6045 (cursorToggleCB): change because of new timer code
6047 * lib/CREDITS: updated own mailaddress
6049 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6051 * src/support/filetools.C (PutEnv): fix the code in case neither
6052 putenv() nor setenv() have been found.
6054 * INSTALL: mention the install-strip Makefile target.
6056 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6057 read-only documents.
6059 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6061 * lib/reLyX/configure.in (VERSION): avoid using a previously
6062 generated reLyX wrapper to find out $prefix.
6064 * lib/examples/eu_adibide_lyx-atua.lyx:
6065 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6066 translation of the Tutorial (Dooteo)
6068 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6070 * forms/cite.fd: new citation dialog
6072 * src/insetcite.[Ch]: the new citation dialog is moved into
6075 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6078 * src/insets/insetcommand.h: data members made private.
6080 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6082 * LyX 1.1.5 released
6084 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6086 * src/version.h (LYX_RELEASE): to 1.1.5
6088 * src/spellchecker.C (RunSpellChecker): return false if the
6089 spellchecker dies upon creation.
6091 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6093 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6094 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6098 * lib/CREDITS: update entry for Martin Vermeer.
6100 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6102 * src/text.C (draw): Draw foreign language bars at the bottom of
6103 the row instead of at the baseline.
6105 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6107 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6109 * lib/bind/de_menus.bind: updated
6111 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6113 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6115 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6117 * src/menus.C (Limit_string_length): New function
6118 (ShowTocMenu): Limit the number of items/length of items in the
6121 * src/paragraph.C (String): Correct result for a paragraph inside
6124 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6126 * src/bufferlist.C (close): test of buf->getuser() == NULL
6128 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6130 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6131 Do not call to SetCursor when the paragraph is a closed footnote!
6133 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6135 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6138 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6140 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6143 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6144 reference popup, that activates the reference-back action
6146 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6148 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6149 the menus. Also fixed a bug.
6151 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6152 the math panels when switching buffers (unless new buffer is readonly).
6154 * src/BufferView.C (NoSavedPositions)
6155 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6157 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6159 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6160 less of dvi dirty or not.
6162 * src/trans_mgr.[Ch] (insert): change first parameter to string
6165 * src/chset.[Ch] (encodeString): add const to first parameter
6167 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6169 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6173 * src/LaTeX.C (deplog): better searching for dependency files in
6174 the latex log. Uses now regexps.
6176 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6177 instead of the box hack or \hfill.
6179 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6181 * src/lyxfunc.C (doImportHelper): do not create the file before
6182 doing the actual import.
6183 (doImportASCIIasLines): create a new file before doing the insert.
6184 (doImportASCIIasParagraphs): ditto.
6186 * lib/lyxrc.example: remove mention of non-existing commands
6188 * lyx.man: remove mention of color-related switches.
6190 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6192 * src/lyx_gui.C: remove all the color-related ressources, which
6193 are not used anymore.
6195 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6198 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6200 * src/lyxrc.C (read): Add a missing break in the switch
6202 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6204 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6206 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6209 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6211 * src/text.C (draw): draw bars under foreign language words.
6213 * src/LColor.[Ch]: add LColor::language
6215 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6217 * src/lyxcursor.h (boundary): New member variable
6219 * src/text.C (IsBoundary): New methods
6221 * src/text.C: Use the above for currect cursor movement when there
6222 is both RTL & LTR text.
6224 * src/text2.C: ditto
6226 * src/bufferview_funcs.C (ToggleAndShow): ditto
6228 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6230 * src/text.C (DeleteLineForward): set selection to true to avoid
6231 that DeleteEmptyParagraphMechanism does some magic. This is how it
6232 is done in all other functions, and seems reasonable.
6233 (DeleteWordForward): do not jump over non-word stuff, since
6234 CursorRightOneWord() already does it.
6236 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6237 DeleteWordBackward, since they seem safe to me (since selection is
6238 set to "true") DeleteEmptyParagraphMechanism does nothing.
6240 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6242 * src/lyx_main.C (easyParse): simplify the code by factoring the
6243 part that removes parameters from the command line.
6244 (LyX): check wether wrong command line options have been given.
6246 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6248 * src/lyx_main.C : add support for specifying user LyX
6249 directory via command line option -userdir.
6251 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6253 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6254 the number of items per popup.
6255 (Add_to_refs_menu): Ditto.
6257 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6259 * src/lyxparagraph.h: renamed ClearParagraph() to
6260 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6261 textclass as parameter, and do nothing if free_spacing is
6262 true. This fixes part of the line-delete-forward problems.
6264 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6265 (pasteSelection): ditto.
6266 (SwitchLayoutsBetweenClasses): more translatable strings.
6268 * src/text2.C (CutSelection): use StripLeadingSpaces.
6269 (PasteSelection): ditto.
6270 (DeleteEmptyParagraphMechanism): ditto.
6272 2000-05-26 Juergen Vigna <jug@sad.it>
6274 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6275 is not needed in tabular insets.
6277 * src/insets/insettabular.C (TabularFeatures): added missing features.
6279 * src/tabular.C (DeleteColumn):
6281 (AppendRow): implemented this functions
6282 (cellsturct::operator=): clone the inset too;
6284 2000-05-23 Juergen Vigna <jug@sad.it>
6286 * src/insets/insettabular.C (LocalDispatch): better selection support
6287 when having multicolumn-cells.
6289 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6291 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6293 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6295 * src/ColorHandler.C (getGCForeground): put more test into _()
6297 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6300 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6303 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6305 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6306 there are no labels, or when buffer is readonly.
6308 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6309 there are no labels, buffer is SGML, or when buffer is readonly.
6311 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6313 * src/LColor.C (LColor): change a couple of grey40 to grey60
6314 (LColor): rewore initalization to make compiles go some magnitude
6316 (getGUIName): don't use gettext until we need the string.
6318 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6320 * src/Bullet.[Ch]: Fixed a small bug.
6322 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6324 * src/paragraph.C (String): Several fixes/improvements
6326 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6328 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6330 * src/paragraph.C (String): give more correct output.
6332 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6334 * src/lyxfont.C (stateText) Do not output the language if it is
6335 eqaul to the language of the document.
6337 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6338 between two paragraphs with the same language.
6340 * src/paragraph.C (getParLanguage) Return a correct answer for an
6341 empty dummy paragraph.
6343 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6346 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6349 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6350 the menus/popup, if requested fonts are unavailable.
6352 2000-05-22 Juergen Vigna <jug@sad.it>
6354 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6355 movement support (Up/Down/Tab/Shift-Tab).
6356 (LocalDispatch): added also preliminari cursor-selection.
6358 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6360 * src/paragraph.C (PasteParagraph): Hopefully now right!
6362 2000-05-22 Garst R. Reese <reese@isn.net>
6364 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6365 of list, change all references to Environment to Command
6366 * tex/hollywood.cls : rewrite environments as commands, add
6367 \uppercase to interiorshot and exteriorshot to force uppecase.
6368 * tex/broadway.cls : rewrite environments as commands. Tweak
6371 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6373 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6374 size of items: use a constant intead of the hardcoded 40, and more
6375 importantly do not remove the %m and %x tags added at the end.
6376 (Add_to_refs_menu): use vector::size_type instead of
6377 unsigned int as basic types for the variables. _Please_ do not
6378 assume that size_t is equal to unsigned int. On an alpha, this is
6379 unsigned long, which is _not_ the same.
6381 * src/language.C (initL): remove language "hungarian", since it
6382 seems that "magyar" is better.
6384 2000-05-22 Juergen Vigna <jug@sad.it>
6386 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6388 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6391 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6392 next was deleted but not set to 0.
6394 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6396 * src/language.C (initL): change the initialization of languages
6397 so that compiles goes _fast_.
6399 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6402 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6404 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6408 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6410 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6412 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6416 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6419 * src/insets/insetlo*.[Ch]: Made editable
6421 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6423 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6424 the current selection.
6426 * src/BufferView_pimpl.C (stuffClipboard): new method
6428 * src/BufferView.C (stuffClipboard): new method
6430 * src/paragraph.C (String): new method
6432 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6433 LColor::ignore when lyxname is not found.
6435 * src/BufferView.C (pasteSelection): new method
6437 * src/BufferView_pimpl.C (pasteSelection): new method
6439 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6441 * src/WorkArea.C (request_clipboard_cb): new static function
6442 (getClipboard): new method
6443 (putClipboard): new method
6445 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6447 * LyX 1.1.5pre2 released
6449 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6451 * src/vspace.C (operator=): removed
6452 (operator=): removed
6454 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6456 * src/layout.C (NumberOfClass): manually set the type in make_pair
6457 (NumberOfLayout): ditto
6459 * src/language.C: use the Language constructor for ignore_lang
6461 * src/language.h: add constructors to struct Language
6463 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6465 * src/text2.C (SetCursorIntern): comment out #warning
6467 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6469 * src/mathed/math_iter.h: initialize sx and sw to 0
6471 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6473 * forms/lyx.fd: Redesign of form_ref
6475 * src/LaTeXFeatures.[Ch]
6479 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6482 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6483 and Buffer::inset_iterator.
6485 * src/menus.C: Added new menus: TOC and Refs.
6487 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6489 * src/buffer.C (getTocList): New method.
6491 * src/BufferView2.C (ChangeRefs): New method.
6493 * src/buffer.C (getLabelList): New method. It replaces the old
6494 getReferenceList. The return type is vector<string> instead of
6497 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6498 the old getLabel() and GetNumberOfLabels() methods.
6499 * src/insets/insetlabel.C (getLabelList): ditto
6500 * src/mathed/formula.C (getLabelList): ditto
6502 * src/paragraph.C (String): New method.
6504 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6505 Uses the new getTocList() method.
6506 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6507 which automatically updates the contents of the browser.
6508 (RefUpdateCB): Use the new getLabelList method.
6510 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6512 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6514 * src/spellchecker.C: Added using std::reverse;
6516 2000-05-19 Juergen Vigna <jug@sad.it>
6518 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6520 * src/insets/insettext.C (computeTextRows): small fix for display of
6521 1 character after a newline.
6523 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6526 2000-05-18 Juergen Vigna <jug@sad.it>
6528 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6529 when changing width of column.
6531 * src/tabular.C (set_row_column_number_info): setting of
6532 autobreak rows if necessary.
6534 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6536 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6538 * src/vc-backend.*: renamed stat() to status() and vcstat to
6539 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6540 compilation broke. The new name seems more relevant, anyway.
6542 2000-05-17 Juergen Vigna <jug@sad.it>
6544 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6545 which was wrong if the removing caused removing of rows!
6547 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6548 (pushToken): new function.
6550 * src/text2.C (CutSelection): fix problem discovered with purify
6552 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6554 * src/debug.C (showTags): enlarge the first column, now that we
6555 have 6-digits debug codes.
6557 * lib/layouts/hollywood.layout:
6558 * lib/tex/hollywood.cls:
6559 * lib/tex/brodway.cls:
6560 * lib/layouts/brodway.layout: more commands and fewer
6561 environments. Preambles moved in the .cls files. Broadway now has
6562 more options on scene numbering and less whitespace (from Garst)
6564 * src/insets/insetbib.C (getKeys): make sure that we are in the
6565 document directory, in case the bib file is there.
6567 * src/insets/insetbib.C (Latex): revert bogus change.
6569 2000-05-16 Juergen Vigna <jug@sad.it>
6571 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6572 the TabularLayout on cursor move.
6574 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6576 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6579 (draw): fixed cursor position and drawing so that the cursor is
6580 visible when before the tabular-inset.
6582 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6583 when creating from old insettext.
6585 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6587 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6590 * lib/tex/brodway.cls: ditto
6592 * lib/layouts/brodway.layout: change alignment of parenthical
6595 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6597 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6598 versions 0.88 and 0.89 are supported.
6600 2000-05-15 Juergen Vigna <jug@sad.it>
6602 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6605 * src/insets/insettext.C (computeTextRows): redone completely this
6606 function in a much cleaner way, because of problems when having a
6608 (draw): added a frame border when the inset is locked.
6609 (SetDrawLockedFrame): this sets if we draw the border or not.
6610 (SetFrameColor): this sets the frame color (default=insetframe).
6612 * src/insets/lyxinset.h: added x() and y() functions which return
6613 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6614 function which is needed to see if we have a locking inset of some
6615 type in this inset (needed for now in insettabular).
6617 * src/vspace.C (inPixels): the same function also without a BufferView
6618 parameter as so it is easier to use it in some ocasions.
6620 * src/lyxfunc.C: changed all places where insertInset was used so
6621 that now if it couldn't be inserted it is deleted!
6623 * src/TabularLayout.C:
6624 * src/TableLayout.C: added support for new tabular-inset!
6626 * src/BufferView2.C (insertInset): this now returns a bool if the
6627 inset was really inserted!!!
6629 * src/tabular.C (GetLastCellInRow):
6630 (GetFirstCellInRow): new helper functions.
6631 (Latex): implemented for new tabular class.
6635 (TeXTopHLine): new Latex() helper functions.
6637 2000-05-12 Juergen Vigna <jug@sad.it>
6639 * src/mathed/formulamacro.C (Read):
6640 * src/mathed/formula.C (Read): read also the \end_inset here!
6642 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6644 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6645 crush when saving formulae with unbalanced parenthesis.
6647 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6649 * src/layout.C: Add new keyword "endlabelstring" to layout file
6651 * src/text.C (GetVisibleRow): Draw endlabel string.
6653 * lib/layouts/broadway.layout
6654 * lib/layouts/hollywood.layout: Added endlabel for the
6655 Parenthetical layout.
6657 * lib/layouts/heb-article.layout: Do not use slanted font shape
6658 for Theorem like environments.
6660 * src/buffer.C (makeLaTeXFile): Always add "american" to
6661 the UsedLanguages list if document language is RTL.
6663 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6665 * add addendum to README.OS2 and small patch (from SMiyata)
6667 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6669 * many files: correct the calls to ChangeExtension().
6671 * src/support/filetools.C (ChangeExtension): remove the no_path
6672 argument, which does not belong there. Use OnlyFileName() instead.
6674 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6675 files when LaTeXing a non-nice latex file.
6677 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6678 a chain of "if". Return false when deadkeys are not handled.
6680 * src/lyx_main.C (LyX): adapted the code for default bindings.
6682 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6683 bindings for basic functionality (except deadkeys).
6684 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6686 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6687 several methods: handle override_x_deadkeys.
6689 * src/lyxrc.h: remove the "bindings" map, which did not make much
6690 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6692 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6694 * src/lyxfont.C (stateText): use a saner method to determine
6695 whether the font is "default". Seems to fix the crash with DEC
6698 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6700 2000-05-08 Juergen Vigna <jug@sad.it>
6702 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6703 TabularLayoutMenu with mouse-button-3
6704 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6706 * src/TabularLayout.C: added this file for having a Layout for
6709 2000-05-05 Juergen Vigna <jug@sad.it>
6711 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6712 recalculating inset-widths.
6713 (TabularFeatures): activated this function so that I can change
6714 tabular-features via menu.
6716 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6717 that I can test some functions with the Table menu.
6719 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6721 * src/lyxfont.C (stateText): guard against stupid c++libs.
6723 * src/tabular.C: add using std::vector
6724 some whitespace changes, + removed som autogenerated code.
6726 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6728 2000-05-05 Juergen Vigna <jug@sad.it>
6730 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6731 row, columns and cellstructures.
6733 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6735 * lib/lyxrc.example: remove obsolete entries.
6737 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6738 reading of protected_separator for free_spacing.
6740 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6742 * src/text.C (draw): do not display an exclamation mark in the
6743 margin for margin notes. This is confusing, ugly and
6746 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6747 AMS math' is checked.
6749 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6750 name to see whether including the amsmath package is needed.
6752 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6754 * src/paragraph.C (validate): Compute UsedLanguages correctly
6755 (don't insert the american language if it doesn't appear in the
6758 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6759 The argument of \thanks{} command is considered moving argument
6761 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6764 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6766 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6767 for appendix/minipage/depth. The lines can be now both in the footnote
6768 frame, and outside the frame.
6770 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6773 2000-05-05 Juergen Vigna <jug@sad.it>
6775 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6776 neede only in tabular.[Ch].
6778 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6782 (Write): write '~' for PROTECTED_SEPARATOR
6784 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6786 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6789 * src/mathed/formula.C (drawStr): rename size to siz.
6791 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6792 possibly fix a bug by not changing the pflags = flags to piflags =
6795 2000-05-05 Juergen Vigna <jug@sad.it>
6797 * src/insets/insetbib.C: moved using directive
6799 * src/ImportNoweb.C: small fix for being able to compile (missing
6802 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6804 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6805 to use clear, since we don't depend on this in the code. Add test
6808 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6810 * (various *.C files): add using std::foo directives to please dec
6813 * replace calls to string::clear() to string::erase() (Angus)
6815 * src/cheaders/cmath: modified to provide std::abs.
6817 2000-05-04 Juergen Vigna <jug@sad.it>
6819 * src/insets/insettext.C: Prepared all for inserting of multiple
6820 paragraphs. Still display stuff to do (alignment and other things),
6821 but I would like to use LyXText to do this when we cleaned out the
6822 table-support stuff.
6824 * src/insets/insettabular.C: Changed lot of stuff and added lots
6825 of functionality still a lot to do.
6827 * src/tabular.C: Various functions changed name and moved to be
6828 const functions. Added new Read and Write functions and changed
6829 lots of things so it works good with tabular-insets (also removed
6830 some stuff which is not needed anymore * hacks *).
6832 * src/lyxcursor.h: added operators == and != which just look if
6833 par and pos are (not) equal.
6835 * src/buffer.C (latexParagraphs): inserted this function to latex
6836 all paragraphs form par to endpar as then I can use this too for
6839 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6840 so that I can call this to from text insets with their own cursor.
6842 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6843 output off all paragraphs (because of the fix below)!
6845 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6846 the very last paragraph (this could be also the last paragraph of an
6849 * src/texrow.h: added rows() call which returns the count-variable.
6851 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6853 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6855 * lib/configure.m4: better autodetection of DocBook tools.
6857 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6859 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6861 * src/lyx_cb.C: add using std::reverse;
6863 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6866 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6867 selected files. Should fix repeated errors from generated files.
6869 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6871 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6873 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6874 the spellchecker popup.
6876 * lib/lyxrc.example: Removed the \number_inset section
6878 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6880 * src/insets/figinset.C (various): Use IsFileReadable() to make
6881 sure that the file actually exist. Relying on ghostscripts errors
6882 is a bad idea since they can lead to X server crashes.
6884 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6886 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6889 * lib/lyxrc.example: smallish typo in description of
6890 \view_dvi_paper_option
6892 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6895 * src/lyxfunc.C: doImportHelper to factor out common code of the
6896 various import methods. New functions doImportASCIIasLines,
6897 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6898 doImportLinuxDoc for the format specific parts.
6901 * buffer.C: Dispatch returns now a bool to indicate success
6904 * lyx_gui.C: Add getLyXView() for member access
6906 * lyx_main.C: Change logic for batch commands: First try
6907 Buffer::Dispatch (possibly without GUI), if that fails, use
6910 * lyx_main.C: Add support for --import command line switch.
6911 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6912 Available Formats: Everything accepted by 'buffer-import <format>'
6914 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6916 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6919 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6920 documents will be reformatted upon reentry.
6922 2000-04-27 Juergen Vigna <jug@sad.it>
6924 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6925 correctly only last pos this was a bug.
6927 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6929 * release of lyx-1.1.5pre1
6931 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6933 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6935 * src/menus.C: revert the change of naming (Figure->Graphic...)
6936 from 2000-04-11. It was incomplete and bad.
6938 * src/LColor.[Ch]: add LColor::depthbar.
6939 * src/text.C (GetVisibleRow): use it.
6941 * README: update the languages list.
6943 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6945 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6948 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6950 * README: remove sections that were just wrong.
6952 * src/text2.C (GetRowNearY): remove currentrow code
6954 * src/text.C (GetRow): remove currentrow code
6956 * src/screen.C (Update): rewritten a bit.
6957 (SmallUpdate): removed func
6959 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6961 (FullRebreak): return bool
6962 (currentrow): remove var
6963 (currentrow_y): ditto
6965 * src/lyxscreen.h (Draw): change arg to unsigned long
6966 (FitCursor): return bool
6967 (FitManualCursor): ditto
6968 (Smallpdate): remove func
6969 (first): change to unsigned long
6970 (DrawOneRow): change second arg to long (from long &)
6971 (screen_refresh_y): remove var
6972 (scree_refresh_row): ditto
6974 * src/lyxrow.h: change baseline to usigned int from unsigned
6975 short, this brings some implicit/unsigned issues out in the open.
6977 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6979 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6980 instead of smallUpdate.
6982 * src/lyxcursor.h: change y to unsigned long
6984 * src/buffer.h: don't call updateScrollbar after fitcursor
6986 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6987 where they are used. Removed "\\direction", this was not present
6988 in 1.1.4 and is already obsolete. Commented out some code that I
6989 believe to never be called.
6990 (runLiterate): don't call updateScrollbar after fitCursor
6992 (buildProgram): ditto
6995 * src/WorkArea.h (workWidth): change return val to unsigned
6998 (redraw): remove the button redraws
6999 (setScrollbarValue): change for scrollbar
7000 (getScrollbarValue): change for scrollbar
7001 (getScrollbarBounds): change for scrollbar
7003 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7004 (C_WorkArea_down_cb): removed func
7005 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7006 (resize): change for scrollbar
7007 (setScrollbar): ditto
7008 (setScrollbarBounds): ditto
7009 (setScrollbarIncrements): ditto
7010 (up_cb): removed func
7011 (down_cb): removed func
7012 (scroll_cb): change for scrollbar
7013 (work_area_handler): ditto
7015 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7016 when FitCursor did something.
7017 (updateScrollbar): some unsigned changes
7018 (downCB): removed func
7019 (scrollUpOnePage): removed func
7020 (scrollDownOnePage): remvoed func
7021 (workAreaMotionNotify): don't call screen->FitCursor but use
7022 fitCursor instead. and bool return val
7023 (workAreaButtonPress): ditto
7024 (workAreaButtonRelease): some unsigned changes
7025 (checkInsetHit): ditto
7026 (workAreaExpose): ditto
7027 (update): parts rewritten, comments about the signed char arg added
7028 (smallUpdate): removed func
7029 (cursorPrevious): call needed updateScrollbar
7032 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7035 * src/BufferView.[Ch] (upCB): removed func
7036 (downCB): removed func
7037 (smallUpdate): removed func
7039 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7041 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7042 currentrow, currentrow_y optimization. This did not help a lot and
7043 if we want to do this kind of optimization we should rather use
7044 cursor.row instead of the currentrow.
7046 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7047 buffer spacing and klyx spacing support.
7049 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7051 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7054 2000-04-26 Juergen Vigna <jug@sad.it>
7056 * src/insets/figinset.C: fixes to Lars sstream changes!
7058 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7060 * A lot of files: Added Ascii(ostream &) methods to all inset
7061 classes. Used when exporting to ASCII.
7063 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7064 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7067 * src/text2.C (ToggleFree): Disabled implicit word selection when
7068 there is a change in the language
7070 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7071 no output was generated for end-of-sentence inset.
7073 * src/insets/lyxinset.h
7076 * src/paragraph.C: Removed the insetnumber code
7078 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7080 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7082 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7083 no_babel and no_epsfig completely from the file.
7084 (parseSingleLyXformat2Token): add handling for per-paragraph
7085 spacing as written by klyx.
7087 * src/insets/figinset.C: applied patch by Andre. Made it work with
7090 2000-04-20 Juergen Vigna <jug@sad.it>
7092 * src/insets/insettext.C (cutSelection):
7093 (copySelection): Fixed with selection from right to left.
7094 (draw): now the rows are not recalculated at every draw.
7095 (computeTextRows): for now reset the inset-owner here (this is
7096 important for an undo or copy where the inset-owner is not set
7099 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7100 motion to the_locking_inset screen->first was forgotten, this was
7101 not important till we got multiline insets.
7103 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7105 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7106 code seems to be alright (it is code changed by Dekel, and the
7107 intent is indeed that all macros should be defined \protect'ed)
7109 * NEWS: a bit of reorganisation of the new user-visible features.
7111 2000-04-19 Juergen Vigna <jug@sad.it>
7113 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7114 position. Set the inset_owner of the used paragraph so that it knows
7115 that it is inside an inset. Fixed cursor handling with mouse and
7116 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7117 and cleanups to make TextInsets work better.
7119 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7120 Changed parameters of various functions and added LockInsetInInset().
7122 * src/insets/insettext.C:
7124 * src/insets/insetcollapsable.h:
7125 * src/insets/insetcollapsable.C:
7126 * src/insets/insetfoot.h:
7127 * src/insets/insetfoot.C:
7128 * src/insets/insetert.h:
7129 * src/insets/insetert.C: cleaned up the code so that it works now
7130 correctly with insettext.
7132 * src/insets/inset.C:
7133 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7134 that insets in insets are supported right.
7137 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7139 * src/paragraph.C: some small fixes
7141 * src/debug.h: inserted INSETS debug info
7143 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7144 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7146 * src/commandtags.h:
7147 * src/LyXAction.C: insert code for InsetTabular.
7149 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7150 not Button1MotionMask.
7151 (workAreaButtonRelease): send always a InsetButtonRelease event to
7153 (checkInsetHit): some setCursor fixes (always with insets).
7155 * src/BufferView2.C (lockInset): returns a bool now and extended for
7156 locking insets inside insets.
7157 (showLockedInsetCursor): it is important to have the cursor always
7158 before the locked inset.
7159 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7161 * src/BufferView.h: made lockInset return a bool.
7163 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7165 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7166 that is used also internally but can be called as public to have back
7167 a cursor pos which is not set internally.
7168 (SetCursorIntern): Changed to use above function.
7170 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7172 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7177 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7178 patches for things that should be in or should be changed.
7180 * src/* [insetfiles]: change "usigned char fragile" to bool
7181 fragile. There was only one point that could that be questioned
7182 and that is commented in formulamacro.C. Grep for "CHECK".
7184 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7185 (DeleteBuffer): take it out of CutAndPaste and make it static.
7187 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7189 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7190 output the spacing envir commands. Also the new commands used in
7191 the LaTeX output makes the result better.
7193 * src/Spacing.C (writeEnvirBegin): new method
7194 (writeEnvirEnd): new method
7196 2000-04-18 Juergen Vigna <jug@sad.it>
7198 * src/CutAndPaste.C: made textclass a static member of the class
7199 as otherwise it is not accesed right!!!
7201 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7203 * forms/layout_forms.fd
7204 * src/layout_forms.h
7205 * src/layout_forms.C (create_form_form_character)
7206 * src/lyx_cb.C (UserFreeFont)
7207 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7208 documents (in the layout->character popup).
7210 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7212 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7213 \spell_command was in fact not honored (from Kevin Atkinson).
7215 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7218 * src/lyx_gui.h: make lyxViews private (Angus)
7220 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7222 * src/mathed/math_write.C
7223 (MathMatrixInset::Write) Put \protect before \begin{array} and
7224 \end{array} if fragile
7225 (MathParInset::Write): Put \protect before \\ if fragile
7227 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7230 initialization if the LyXColorHandler must be done after the
7231 connections to the XServer has been established.
7233 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7234 get the background pixel from the lyxColorhandler so that the
7235 figures are rendered with the correct background color.
7236 (NextToken): removed functions.
7237 (GetPSSizes): use ifs >> string instead of NextToken.
7239 * src/Painter.[Ch]: the color cache moved out of this file.
7241 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7244 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7246 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7247 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7249 * src/BufferView.C (enterView): new func
7250 (leaveView): new func
7252 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7254 (leaveView): new func, undefines xterm cursor when approp.
7256 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7257 (AllowInput): delete the Workarea cursor handling from this func.
7259 * src/Painter.C (underline): draw a slimer underline in most cases.
7261 * src/lyx_main.C (error_handler): use extern "C"
7263 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7265 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7266 sent directly to me.
7268 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7269 to the list by Dekel.
7271 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7274 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7275 methods from lyx_cb.here.
7277 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7280 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7282 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7283 instead of using current_view directly.
7285 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7287 * src/LyXAction.C (init): add the paragraph-spacing command.
7289 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7291 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7293 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7294 different from the documents.
7296 * src/text.C (SetHeightOfRow): take paragraph spacing into
7297 account, paragraph spacing takes precedence over buffer spacing
7298 (GetVisibleRow): ditto
7300 * src/paragraph.C (writeFile): output the spacing parameter too.
7301 (validate): set the correct features if spacing is used in the
7303 (Clear): set spacing to default
7304 (MakeSameLayout): spacing too
7305 (HasSameLayout): spacing too
7306 (SetLayout): spacing too
7307 (TeXOnePar): output the spacing commands
7309 * src/lyxparagraph.h: added a spacing variable for use with
7310 per-paragraph spacing.
7312 * src/Spacing.h: add a Default spacing and a method to check if
7313 the current spacing is default. also added an operator==
7315 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7318 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7320 * src/lyxserver.C (callback): fix dispatch of functions
7322 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7323 printf() into lyxerr call.
7325 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7328 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7329 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7330 the "Float" from each of the subitems.
7331 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7333 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7334 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7335 documented the change so that the workaround can be nuked later.
7337 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7340 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7342 * src/buffer.C (getLatexName): ditto
7343 (setReadonly): ditto
7345 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7347 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7348 avoid some uses of current_view. Added also a bufferParams()
7349 method to get at this.
7351 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7353 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7355 * src/lyxparagraph.[Ch]: removed
7356 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7357 with operators used by lower_bound and
7358 upper_bound in InsetTable's
7359 Make struct InsetTable private again. Used matchpos.
7361 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7363 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7364 document, the language of existing text is changed (unless the
7365 document is multi-lingual)
7367 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7369 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7371 * A lot of files: A rewrite of the Right-to-Left support.
7373 2000-04-10 Juergen Vigna <jug@sad.it>
7375 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7376 misplaced cursor when inset in inset is locked.
7378 * src/insets/insettext.C (LocalDispatch): small fix so that a
7379 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7381 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7382 footnote font should be decreased in size twice when displaying.
7384 * src/insets/insettext.C (GetDrawFont): inserted this function as
7385 the drawing-font may differ from the real paragraph font.
7387 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7388 insets (inset in inset!).
7390 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7391 function here because we don't want footnotes inside footnotes.
7393 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7395 (init): now set the inset_owner in paragraph.C
7396 (LocalDispatch): added some resetPos() in the right position
7399 (pasteSelection): changed to use the new CutAndPaste-Class.
7401 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7402 which tells if it is allowed to insert another inset inside this one.
7404 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7405 SwitchLayoutsBetweenClasses.
7407 * src/text2.C (InsertInset): checking of the new paragraph-function
7409 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7410 is not needed anymore here!
7413 (PasteSelection): redone (also with #ifdef) so that now this uses
7414 the CutAndPaste-Class.
7415 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7418 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7419 from/to text/insets.
7421 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7422 so that the paragraph knows if it is inside an (text)-inset.
7423 (InsertFromMinibuffer): changed return-value to bool as now it
7424 may happen that an inset is not inserted in the paragraph.
7425 (InsertInsetAllowed): this checks if it is allowed to insert an
7426 inset in this paragraph.
7428 (BreakParagraphConservative):
7429 (BreakParagraph) : small change for the above change of the return
7430 value of InsertFromMinibuffer.
7432 * src/lyxparagraph.h: added inset_owner and the functions to handle
7433 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7435 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7437 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7438 functions from BufferView to BufferView::Pimpl to ease maintence.
7440 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7441 correctly. Also use SetCursorIntern instead of SetCursor.
7443 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7446 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7448 * src/WorkArea.C (belowMouse): manually implement below mouse.
7450 * src/*: Add "explicit" on several constructors, I added probably
7451 some unneeded ones. A couple of changes to code because of this.
7453 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7454 implementation and private parts from the users of BufferView. Not
7457 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7458 implementation and private parts from the users of LyXLex. Not
7461 * src/BufferView_pimpl.[Ch]: new files
7463 * src/lyxlex_pimpl.[Ch]: new files
7465 * src/LyXView.[Ch]: some inline functions move out-of-line
7467 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7469 * src/lyxparagraph.h: make struct InsetTable public.
7471 * src/support/lyxstring.h: change lyxstring::difference_type to be
7472 ptrdiff_t. Add std:: modifiers to streams.
7474 * src/font.C: include the <cctype> header, for islower() and
7477 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7479 * src/font.[Ch]: new files. Contains the metric functions for
7480 fonts, takes a LyXFont as parameter. Better separation of concepts.
7482 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7483 changes because of this.
7485 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7487 * src/*: compile with -Winline and move functions that don't
7490 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7493 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7495 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7496 (various files changed because of this)
7498 * src/Painter.C (text): fixed the drawing of smallcaps.
7500 * src/lyxfont.[Ch] (drawText): removed unused member func.
7503 * src/*.C: added needed "using" statements and "std::" qualifiers.
7505 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/*.h: removed all use of "using" from header files use
7508 qualifier std:: instead.
7510 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7512 * src/text.C (Backspace): some additional cleanups (we already
7513 know whether cursor.pos is 0 or not).
7515 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7516 automake does not provide one).
7518 * src/bmtable.h: replace C++ comments with C comments.
7520 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7522 * src/screen.C (ShowCursor): Change the shape of the cursor if
7523 the current language is not equal to the language of the document.
7524 (If the cursor change its shape unexpectedly, then you've found a bug)
7526 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7529 * src/insets/insetnumber.[Ch]: New files.
7531 * src/LyXAction.C (init)
7532 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7535 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7537 * src/lyxparagraph.h
7538 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7539 (the vector is kept sorted).
7541 * src/text.C (GetVisibleRow): Draw selection correctly when there
7542 is both LTR and RTL text.
7544 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7545 which is much faster.
7547 * src/text.C (GetVisibleRow and other): Do not draw the last space
7548 in a row if the direction of the last letter is not equal to the
7549 direction of the paragraph.
7551 * src/lyxfont.C (latexWriteStartChanges):
7552 Check that font language is not equal to basefont language.
7553 (latexWriteEndChanges): ditto
7555 * src/lyx_cb.C (StyleReset): Don't change the language while using
7556 the font-default command.
7558 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7559 empty paragraph before a footnote.
7561 * src/insets/insetcommand.C (draw): Increase x correctly.
7563 * src/screen.C (ShowCursor): Change cursor shape if
7564 current language != document language.
7566 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7568 2000-03-31 Juergen Vigna <jug@sad.it>
7570 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7571 (Clone): changed mode how the paragraph-data is copied to the
7572 new clone-paragraph.
7574 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7575 GetInset(pos) with no inset anymore there (in inset UNDO)
7577 * src/insets/insetcommand.C (draw): small fix as here x is
7578 incremented not as much as width() returns (2 before, 2 behind = 4)
7580 2000-03-30 Juergen Vigna <jug@sad.it>
7582 * src/insets/insettext.C (InsetText): small fix in initialize
7583 widthOffset (should not be done in the init() function)
7585 2000-03-29 Amir Karger <karger@lyx.org>
7587 * lib/examples/it_ItemizeBullets.lyx: translation by
7590 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7592 2000-03-29 Juergen Vigna <jug@sad.it>
7594 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7596 * src/insets/insetfoot.C (Clone): small change as for the below
7597 new init function in the text-inset
7599 * src/insets/insettext.C (init): new function as I've seen that
7600 clone did not copy the Paragraph-Data!
7601 (LocalDispatch): Added code so that now we have some sort of Undo
7602 functionality (well actually we HAVE Undo ;)
7604 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7606 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7608 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7611 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7613 * src/main.C: added a runtime check that verifies that the xforms
7614 header used when building LyX and the library used when running
7615 LyX match. Exit with a message if they don't match. This is a
7616 version number check only.
7618 * src/buffer.C (save): Don't allocate memory on the heap for
7619 struct utimbuf times.
7621 * *: some using changes, use iosfwd instead of the real headers.
7623 * src/lyxfont.C use char const * instead of string for the static
7624 strings. Rewrite some functions to use sstream.
7626 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7628 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7631 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7633 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7634 of Geodesy (from Martin Vermeer)
7636 * lib/layouts/svjour.inc: include file for the Springer svjour
7637 class. It can be used to support journals other than JoG.
7639 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7640 Miskiewicz <misiek@pld.org.pl>)
7641 * lib/reLyX/Makefile.am: ditto.
7643 2000-03-27 Juergen Vigna <jug@sad.it>
7645 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7646 also some modifications with operations on selected text.
7648 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7649 problems with clicking on insets (last famous words ;)
7651 * src/insets/insetcommand.C (draw):
7652 (width): Changed to have a bit of space before and after the inset so
7653 that the blinking cursor can be seen (otherwise it was hidden)
7655 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7657 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7658 would not be added to the link list when an installed gettext (not
7659 part of libc) is found.
7661 2000-03-24 Juergen Vigna <jug@sad.it>
7663 * src/insets/insetcollapsable.C (Edit):
7664 * src/mathed/formula.C (InsetButtonRelease):
7665 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7668 * src/BufferView.C (workAreaButtonPress):
7669 (workAreaButtonRelease):
7670 (checkInsetHit): Finally fixed the clicking on insets be handled
7673 * src/insets/insetert.C (Edit): inserted this call so that ERT
7674 insets work always with LaTeX-font
7676 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7678 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7679 caused lyx to startup with no GUI in place, causing in a crash
7680 upon startup when called with arguments.
7682 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7684 * src/FontLoader.C: better initialization of dummyXFontStruct.
7686 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7688 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7689 for linuxdoc and docbook import and export format options.
7691 * lib/lyxrc.example Example of default values for the previous flags.
7693 * src/lyx_cb.C Use those flags instead of the hardwired values for
7694 linuxdoc and docbook export.
7696 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7699 * src/menus.C Added menus entries for the new import/exports formats.
7701 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7703 * src/lyxrc.*: Added support for running without Gui
7706 * src/FontLoader.C: sensible defaults if no fonts are needed
7708 * src/lyx_cb.C: New function ShowMessage (writes either to the
7709 minibuffer or cout in case of no gui
7710 New function AskOverwrite for common stuff
7711 Consequently various changes to call these functions
7713 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7714 wild guess at sensible screen resolution when having no gui
7716 * src/lyxfont.C: no gui, no fonts... set some defaults
7718 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7720 * src/LColor.C: made the command inset background a bit lighter.
7722 2000-03-20 Hartmut Goebel <goebel@noris.net>
7724 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7725 stdstruct.inc. Koma-Script added some title elements which
7726 otherwise have been listed below "bibliography". This split allows
7727 adding title elements to where they belong.
7729 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7730 define the additional title elements and then include
7733 * many other layout files: changed to include stdtitle.inc just
7734 before stdstruct.inc.
7736 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7738 * src/buffer.C: (save) Added the option to store all backup files
7739 in a single directory
7741 * src/lyxrc.[Ch]: Added variable \backupdir_path
7743 * lib/lyxrc.example: Added descriptions of recently added variables
7745 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7746 bibtex inset, not closing the bibtex popup when deleting the inset)
7748 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7750 * src/lyx_cb.C: add a couple using directives.
7752 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7753 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7754 import based on the filename.
7756 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7757 file would be imported at start, if the filename where of a sgml file.
7759 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7761 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7763 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7764 * src/lyxfont.h Replaced the member variable bits.direction by the
7765 member variable lang. Made many changes in other files.
7766 This allows having a multi-lingual document
7768 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7769 that change the current language to <l>.
7770 Removed the command "font-rtl"
7772 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7773 format for Hebrew documents)
7775 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7776 When auto_mathmode is "true", pressing a digit key in normal mode
7777 will cause entering into mathmode.
7778 If auto_mathmode is "rtl" then this behavior will be active only
7779 when writing right-to-left text.
7781 * src/text2.C (InsertStringA) The string is inserted using the
7784 * src/paragraph.C (GetEndLabel) Gives a correct result for
7785 footnote paragraphs.
7787 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7789 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7791 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7792 front of PasteParagraph. Never insert a ' '. This should at least
7793 fix some cause for the segfaults that we have been experiencing,
7794 it also fixes backspace behaviour slightly. (Phu!)
7796 * src/support/lstrings.C (compare_no_case): some change to make it
7797 compile with gcc 2.95.2 and stdlibc++-v3
7799 * src/text2.C (MeltFootnoteEnvironment): change type o
7800 first_footnote_par_is_not_empty to bool.
7802 * src/lyxparagraph.h: make text private. Changes in other files
7804 (fitToSize): new function
7805 (setContentsFromPar): new function
7806 (clearContents): new function
7807 (SetChar): new function
7809 * src/paragraph.C (readSimpleWholeFile): deleted.
7811 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7812 the file, just use a simple string instead. Also read the file in
7813 a more maintainable manner.
7815 * src/text2.C (InsertStringA): deleted.
7816 (InsertStringB): deleted.
7818 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7820 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7821 RedoParagraphs from the doublespace handling part, just set status
7822 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7823 done, but perhaps not like this.)
7825 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7827 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7828 character when inserting an inset.
7830 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7832 * src/bufferparams.C (readLanguage): now takes "default" into
7835 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7836 also initialize the toplevel_keymap with the default bindings from
7839 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7841 * all files using lyxrc: have lyxrc as a real variable and not a
7842 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7845 * src/lyxrc.C: remove double call to defaultKeyBindings
7847 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7848 toolbar defauls using lyxlex. Remove enums, structs, functions
7851 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7852 toolbar defaults. Also store default keybindings in a map.
7854 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7855 storing the toolbar defaults without any xforms dependencies.
7857 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7858 applied. Changed to use iterators.
7860 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7862 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7863 systems that don't have LINGUAS set to begin with.
7865 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7867 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7868 the list by Dekel Tsur.
7870 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7872 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7873 * src/insets/form_graphics.C: ditto.
7875 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7877 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7879 * src/bufferparams.C (readLanguage): use the new language map
7881 * src/intl.C (InitKeyMapper): use the new language map
7883 * src/lyx_gui.C (create_forms): use the new language map
7885 * src/language.[Ch]: New files. Used for holding the information
7886 about each language. Now! Use this new language map enhance it and
7887 make it really usable for our needs.
7889 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7891 * screen.C (ShowCursor): Removed duplicate code.
7892 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7893 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7895 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7898 * src/text.C Added TransformChar method. Used for rendering Arabic
7899 text correctly (change the glyphs of the letter according to the
7900 position in the word)
7905 * src/lyxrc.C Added lyxrc command {language_command_begin,
7906 language_command_end,language_command_ltr,language_command_rtl,
7907 language_package} which allows the use of either arabtex or Omega
7910 * src/lyx_gui.C (init)
7912 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7913 to use encoding for menu fonts which is different than the encoding
7916 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7917 do not load the babel package.
7918 To write an English document with Hebrew/Arabic, change the document
7919 language to "english".
7921 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7922 (alphaCounter): changed to return char
7923 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7925 * lib/lyxrc.example Added examples for Hebrew/Arabic
7928 * src/layout.C Added layout command endlabeltype
7930 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7932 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7934 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7936 * src/mathed/math_delim.C (search_deco): return a
7937 math_deco_struct* instead of index.
7939 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * All files with a USE_OSTREAM_ONLY within: removed all code that
7942 was unused when USE_OSTREAM_ONLY is defined.
7944 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7945 of any less. Removed header and using.
7947 * src/text.C (GetVisibleRow): draw the string "Page Break
7948 (top/bottom)" on screen when drawing a pagebreak line.
7950 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7952 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7954 * src/mathed/math_macro.C (draw): do some cast magic.
7957 * src/mathed/math_defs.h: change byte* argument to byte const*.
7959 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7961 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7962 know it is right to return InsetFoot* too, but cxx does not like
7965 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7967 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7969 * src/mathed/math_delim.C: change == to proper assignment.
7971 2000-03-09 Juergen Vigna <jug@sad.it>
7973 * src/insets/insettext.C (setPos): fixed various cursor positioning
7974 problems (via mouse and cursor-keys)
7975 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7976 inset (still a small display problem but it works ;)
7978 * src/insets/insetcollapsable.C (draw): added button_top_y and
7979 button_bottom_y to have correct values for clicking on the inset.
7981 * src/support/lyxalgo.h: commented out 'using std::less'
7983 2000-03-08 Juergen Vigna <jug@sad.it>
7985 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7986 Button-Release event closes as it is alos the Release-Event
7989 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7991 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7993 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7994 can add multiple spaces in Scrap (literate programming) styles...
7995 which, by the way, is how I got hooked on LyX to begin with.
7997 * src/mathed/formula.C (Write): Added dummy variable to an
7998 inset::Latex() call.
7999 (Latex): Add free_spacing boolean to inset::Latex()
8001 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8003 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8004 virtual function to include the free_spacing boolean from
8005 the containing paragraph's style.
8007 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8008 Added free_spacing boolean arg to match inset.h
8010 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8011 Added free_spacing boolean arg to match inset.h
8013 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8014 Added free_spacing boolean and made sure that if in a free_spacing
8015 paragraph, that we output normal space if there is a protected space.
8017 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8018 Added free_spacing boolean arg to match inset.h
8020 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8021 Added free_spacing boolean arg to match inset.h
8023 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8024 Added free_spacing boolean arg to match inset.h
8026 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8027 Added free_spacing boolean arg to match inset.h
8029 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8030 Added free_spacing boolean arg to match inset.h
8032 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8033 free_spacing boolean arg to match inset.h
8035 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8036 Added free_spacing boolean arg to match inset.h
8038 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8039 Added free_spacing boolean arg to match inset.h
8041 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8042 Added free_spacing boolean arg to match inset.h
8044 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8045 Added free_spacing boolean arg to match inset.h
8047 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8048 Added free_spacing boolean arg to match inset.h
8050 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8051 free_spacing boolean arg to match inset.h
8053 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8054 free_spacing boolean arg to match inset.h
8056 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8057 ignore free_spacing paragraphs. The user's spaces are left
8060 * src/text.C (InsertChar): Fixed the free_spacing layout
8061 attribute behavior. Now, if free_spacing is set, you can
8062 add multiple spaces in a paragraph with impunity (and they
8063 get output verbatim).
8064 (SelectSelectedWord): Added dummy argument to inset::Latex()
8067 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8070 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8071 paragraph layouts now only input a simple space instead.
8072 Special character insets don't make any sense in free-spacing
8075 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8076 hard-spaces in the *input* file to simple spaces if the layout
8077 is free-spacing. This converts old files which had to have
8078 hard-spaces in free-spacing layouts where a simple space was
8080 (writeFileAscii): Added free_spacing check to pass to the newly
8081 reworked inset::Latex(...) methods. The inset::Latex() code
8082 ensures that hard-spaces in free-spacing paragraphs get output
8083 as spaces (rather than "~").
8085 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8087 * src/mathed/math_delim.C (draw): draw the empty placeholder
8088 delims with a onoffdash line.
8089 (struct math_deco_compare): struct that holds the "functors" used
8090 for the sort and the binary search in math_deco_table.
8091 (class init_deco_table): class used for initial sort of the
8093 (search_deco): use lower_bound to do a binary search in the
8096 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8098 * src/lyxrc.C: a small secret thingie...
8100 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8101 and to not flush the stream as often as it used to.
8103 * src/support/lyxalgo.h: new file
8104 (sorted): template function used for checking if a sequence is
8105 sorted or not. Two versions with and without user supplied
8106 compare. Uses same compare as std::sort.
8108 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8109 it and give warning on lyxerr.
8111 (struct compare_tags): struct with function operators used for
8112 checking if sorted, sorting and lower_bound.
8113 (search_kw): use lower_bound instead of manually implemented
8116 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8118 * src/insets/insetcollapsable.h: fix Clone() declaration.
8119 * src/insets/insetfoot.h: ditto.
8121 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8123 2000-03-08 Juergen Vigna <jug@sad.it>
8125 * src/insets/lyxinset.h: added owner call which tells us if
8126 this inset is inside another inset. Changed also the return-type
8127 of Editable to an enum so it tells clearer what the return-value is.
8129 * src/insets/insettext.C (computeTextRows): fixed computing of
8130 textinsets which split automatically on more rows.
8132 * src/insets/insetert.[Ch]: changed this to be of BaseType
8135 * src/insets/insetfoot.[Ch]: added footnote inset
8137 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8138 collapsable insets (like footnote, ert, ...)
8140 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * src/lyxdraw.h: remvoe file
8144 * src/lyxdraw.C: remove file
8146 * src/insets/insettext.C: added <algorithm>.
8148 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8150 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8151 (matrix_cb): case MM_OK use string stream
8153 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8156 * src/mathed/math_macro.C (draw): use string stream
8157 (Metrics): use string stream
8159 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8160 directly to the ostream.
8162 * src/vspace.C (asString): use string stream.
8163 (asString): use string stream
8164 (asLatexString): use string stream
8166 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8167 setting Spacing::Other.
8169 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8170 sprintf when creating the stretch vale.
8172 * src/text2.C (alphaCounter): changed to return a string and to
8173 not use a static variable internally. Also fixed a one-off bug.
8174 (SetCounter): changed the drawing of the labels to use string
8175 streams instead of sprintf.
8177 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8178 manipulator to use a scheme that does not require library support.
8179 This is also the way it is done in the new GNU libstdc++. Should
8180 work with DEC cxx now.
8182 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8185 end. This fixes a bug.
8187 * src/mathed (all files concerned with file writing): apply the
8188 USE_OSTREAM_ONLY changes to mathed too.
8190 * src/support/DebugStream.h: make the constructor explicit.
8192 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8193 count and ostream squashed.
8195 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8197 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8199 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8200 ostringstream uses STL strings, and we might not.
8202 * src/insets/insetspecialchar.C: add using directive.
8203 * src/insets/insettext.C: ditto.
8205 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8207 * lib/layouts/seminar.layout: feeble attempt at a layout for
8208 seminar.cls, far from completet and could really use some looking
8209 at from people used to write layout files.
8211 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8212 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8213 a lot nicer and works nicely with ostreams.
8215 * src/mathed/formula.C (draw): a slightly different solution that
8216 the one posted to the list, but I think this one works too. (font
8217 size wrong in headers.)
8219 * src/insets/insettext.C (computeTextRows): some fiddling on
8220 Jürgens turf, added some comments that he should read.
8222 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8223 used and it gave compiler warnings.
8224 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8227 * src/lyx_gui.C (create_forms): do the right thing when
8228 show_banner is true/false.
8230 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8231 show_banner is false.
8233 * most file writing files: Now use iostreams to do almost all of
8234 the writing. Also instead of passing string &, we now use
8235 stringstreams. mathed output is still not adapted to iostreams.
8236 This change can be turned off by commenting out all the occurences
8237 of the "#define USE_OSTREAM_ONLY 1" lines.
8239 * src/WorkArea.C (createPixmap): don't output debug messages.
8240 (WorkArea): don't output debug messages.
8242 * lib/lyxrc.example: added a comment about the new variable
8245 * development/Code_rules/Rules: Added some more commente about how
8246 to build class interfaces and on how better encapsulation can be
8249 2000-03-03 Juergen Vigna <jug@sad.it>
8251 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8252 automatically with the width of the LyX-Window
8254 * src/insets/insettext.C (computeTextRows): fixed update bug in
8255 displaying text-insets (scrollvalues where not initialized!)
8257 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8259 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8260 id in the check of the result from lower_bound is not enough since
8261 lower_bound can return last too, and then res->id will not be a
8264 * all insets and some code that use them: I have conditionalized
8265 removed the Latex(string & out, ...) this means that only the
8266 Latex(ostream &, ...) will be used. This is a work in progress to
8267 move towards using streams for all output of files.
8269 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8272 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8275 routine (this fixes bug where greek letters were surrounded by too
8278 * src/support/filetools.C (findtexfile): change a bit the search
8279 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8280 no longer passed to kpsewhich, we may have to change that later.
8282 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8283 warning options to avoid problems with X header files (from Angus
8285 * acinclude.m4: regenerated.
8287 2000-03-02 Juergen Vigna <jug@sad.it>
8289 * src/insets/insettext.C (WriteParagraphData): Using the
8290 par->writeFile() function for writing paragraph-data.
8291 (Read): Using buffer->parseSingleLyXformat2Token()-function
8292 for parsing paragraph data!
8294 * src/buffer.C (readLyXformat2): removed all parse data and using
8295 the new parseSingleLyXformat2Token()-function.
8296 (parseSingleLyXformat2Token): added this function to parse (read)
8297 lyx-file-format (this is called also from text-insets now!)
8299 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8301 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8304 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8305 directly instead of going through a func. One very bad thing: a
8306 static LyXFindReplace, but I don't know where to place it.
8308 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8309 string instead of char[]. Also changed to static.
8310 (GetSelectionOrWordAtCursor): changed to static inline
8311 (SetSelectionOverLenChars): ditto.
8313 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8314 current_view and global variables. both classes has changed names
8315 and LyXFindReplace is not inherited from SearchForm.
8317 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8318 fl_form_search form.
8320 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8322 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8324 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8325 bound (from Kayvan).
8327 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8329 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8331 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8333 * some things that I should comment but the local pub says head to
8336 * comment out all code that belongs to the Roff code for Ascii
8337 export of tables. (this is unused)
8339 * src/LyXView.C: use correct type for global variable
8340 current_layout. (LyXTextClass::size_type)
8342 * some code to get the new insetgraphics closer to working I'd be
8343 grateful for any help.
8345 * src/BufferView2.C (insertInset): use the return type of
8346 NumberOfLayout properly. (also changes in other files)
8348 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8349 this as a test. I want to know what breaks because of this.
8351 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8353 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8355 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8356 to use a \makebox in the label, this allows proper justification
8357 with out using protected spaces or multiple hfills. Now it is
8358 "label" for left justified, "\hfill label\hfill" for center, and
8359 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8360 should be changed accordingly.
8362 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * src/lyxtext.h: change SetLayout() to take a
8365 LyXTextClass::size_type instead of a char (when there is more than
8366 127 layouts in a class); also change type of copylayouttype.
8367 * src/text2.C (SetLayout): ditto.
8368 * src/LyXView.C (updateLayoutChoice): ditto.
8370 * src/LaTeX.C (scanLogFile): errors where the line number was not
8371 given just after the '!'-line were ignored (from Dekel Tsur).
8373 * lib/lyxrc.example: fix description of \date_insert_format
8375 * lib/layouts/llncs.layout: new layout, contributed by Martin
8378 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8380 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8381 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8382 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8383 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8384 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8385 paragraph.C, text.C, text2.C)
8387 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8389 * src/insets/insettext.C (LocalDispatch): remove extra break
8392 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8393 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8395 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8396 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8398 * src/insets/insetbib.h: move InsetBibkey::Holder and
8399 InsetCitation::Holder in public space.
8401 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8403 * src/insets/insettext.h: small change to get the new files from
8404 Juergen to compile (use "string", not "class string").
8406 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8407 const & as parameter to LocalDispatch, use LyXFont const & as
8408 paramter to some other func. This also had impacto on lyxinsets.h
8409 and the two mathed insets.
8411 2000-02-24 Juergen Vigna <jug@sad.it>
8414 * src/commandtags.h:
8416 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8420 * src/BufferView2.C: added/updated code for various inset-functions
8422 * src/insets/insetert.[Ch]: added implementation of InsetERT
8424 * src/insets/insettext.[Ch]: added implementation of InsetText
8426 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8427 (draw): added preliminary code for inset scrolling not finshed yet
8429 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8430 as it is in lyxfunc.C now
8432 * src/insets/lyxinset.h: Added functions for text-insets
8434 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8436 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8437 BufferView and reimplement the list as a queue put inside its own
8440 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8442 * several files: use the new interface to the "updateinsetlist"
8444 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8446 (work_area_handler): call BufferView::trippleClick on trippleclick.
8448 * src/BufferView.C (doubleClick): new function, selects word on
8450 (trippleClick): new function, selects line on trippleclick.
8452 2000-02-22 Allan Rae <rae@lyx.org>
8454 * lib/bind/xemacs.bind: buffer-previous not supported
8456 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8458 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8461 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * src/bufferlist.C: get rid of current_view from this file
8465 * src/spellchecker.C: get rid of current_view from this file
8467 * src/vspace.C: get rid of current_view from this file
8468 (inPixels): added BufferView parameter for this func
8469 (asLatexCommand): added a BufferParams for this func
8471 * src/text.C src/text2.C: get rid of current_view from these
8474 * src/lyxfont.C (getFontDirection): move this function here from
8477 * src/bufferparams.C (getDocumentDirection): move this function
8480 * src/paragraph.C (getParDirection): move this function here from
8482 (getLetterDirection): ditto
8484 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8487 resize due to wrong pixmap beeing used. Also took the opurtunity
8488 to make the LyXScreen stateless on regard to WorkArea and some
8489 general cleanup in the same files.
8491 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8493 * src/Makefile.am: add missing direction.h
8495 * src/PainterBase.h: made the width functions const.
8497 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8500 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8502 * src/insets/insetlatexaccent.C (draw): make the accents draw
8503 better, at present this will only work well with iso8859-1.
8505 * several files: remove the old drawing code, now we use the new
8508 * several files: remove support for mono_video, reverse_video and
8511 2000-02-17 Juergen Vigna <jug@sad.it>
8513 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8514 int ** as we have to return the pointer, otherwise we have only
8515 NULL pointers in the returning function.
8517 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8519 * src/LaTeX.C (operator()): quote file name when running latex.
8521 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8523 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8524 (bubble tip), this removes our special handling of this.
8526 * Remove all code that is unused now that we have the new
8527 workarea. (Code that are not active when NEW_WA is defined.)
8529 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8531 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8533 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8534 nonexisting layout; correctly redirect obsoleted layouts.
8536 * lib/lyxrc.example: document \view_dvi_paper_option
8538 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8541 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8542 (PreviewDVI): handle the view_dvi_paper_option variable.
8543 [Both from Roland Krause]
8545 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8548 char const *, int, LyXFont)
8549 (text(int, int, string, LyXFont)): ditto
8551 * src/text.C (InsertCharInTable): attempt to fix the double-space
8552 feature in tables too.
8553 (BackspaceInTable): ditto.
8554 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8556 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8558 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8560 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8561 newly found text in textcache to this.
8562 (buffer): set the owner of the text put into the textcache to 0
8564 * src/insets/figinset.C (draw): fixed the drawing of figures with
8567 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8568 drawing of mathframe, hfills, protected space, table lines. I have
8569 now no outstanding drawing problems with the new Painter code.
8571 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8573 * src/PainterBase.C (ellipse, circle): do not specify the default
8576 * src/LColor.h: add using directive.
8578 * src/Painter.[Ch]: change return type of methods from Painter& to
8579 PainterBase&. Add a using directive.
8581 * src/WorkArea.C: wrap xforms callbacks in C functions
8584 * lib/layouts/foils.layout: font fix and simplifications from Carl
8587 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8589 * a lot of files: The Painter, LColor and WorkArea from the old
8590 devel branch has been ported to lyx-devel. Some new files and a
8591 lot of #ifdeffed code. The new workarea is enabled by default, but
8592 if you want to test the new Painter and LColor you have to compile
8593 with USE_PAINTER defined (do this in config.h f.ex.) There are
8594 still some rought edges, and I'd like some help to clear those
8595 out. It looks stable (loads and displays the Userguide very well).
8598 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8600 * src/buffer.C (pop_tag): revert to the previous implementation
8601 (use a global variable for both loops).
8603 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8605 * src/lyxrc.C (LyXRC): change slightly default date format.
8607 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8608 there is an English text with a footnote that starts with a Hebrew
8609 paragraph, or vice versa.
8610 (TeXFootnote): ditto.
8612 * src/text.C (LeftMargin): allow for negative values for
8613 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8616 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8617 for input encoding (cyrillic)
8619 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8621 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8624 * src/toolbar.C (set): ditto
8625 * src/insets/insetbib.C (create_form_citation_form): ditto
8627 * lib/CREDITS: added Dekel Tsur.
8629 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8630 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8631 hebrew supports files from Dekel Tsur.
8633 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8634 <tzafrir@technion.ac.il>
8636 * src/lyxrc.C: put \date_insert_format at the right place.
8638 * src/buffer.C (makeLaTeXFile): fix the handling of
8639 BufferParams::sides when writing out latex files.
8641 * src/BufferView2.C: add a "using" directive.
8643 * src/support/lyxsum.C (sum): when we use lyxstring,
8644 ostringstream::str needs an additional .c_str().
8646 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8648 * src/support/filetools.C (ChangeExtension): patch from Etienne
8651 * src/TextCache.C (show): remove const_cast and make second
8652 parameter non-const LyXText *.
8654 * src/TextCache.h: use non const LyXText in show.
8656 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8659 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8661 * src/support/lyxsum.C: rework to be more flexible.
8663 * several places: don't check if a pointer is 0 if you are going
8666 * src/text.C: remove some dead code.
8668 * src/insets/figinset.C: remove some dead code
8670 * src/buffer.C: move the BufferView funcs to BufferView2.C
8671 remove all support for insetlatexdel
8672 remove support for oldpapersize stuff
8673 made some member funcs const
8675 * src/kbmap.C: use a std::list to store the bindings in.
8677 * src/BufferView2.C: new file
8679 * src/kbsequence.[Ch]: new files
8681 * src/LyXAction.C + others: remove all trace of buffer-previous
8683 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8684 only have one copy in the binary of this table.
8686 * hebrew patch: moved some functions from LyXText to more
8687 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8689 * several files: remove support for XForms older than 0.88
8691 remove some #if 0 #endif code
8693 * src/TextCache.[Ch]: new file. Holds the textcache.
8695 * src/BufferView.C: changes to use the new TextCache interface.
8696 (waitForX): remove the now unused code.
8698 * src/BackStack.h: remove some commented code
8700 * lib/bind/emacs.bind: remove binding for buffer-previous
8702 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8704 * applied the hebrew patch.
8706 * src/lyxrow.h: make sure that all Row variables are initialized.
8708 * src/text2.C (TextHandleUndo): comment out a delete, this might
8709 introduce a memory leak, but should also help us to not try to
8710 read freed memory. We need to look at this one.
8712 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8713 (LyXParagraph): initalize footnotekind.
8715 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8716 forgot this when applying the patch. Please heed the warnings.
8718 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8719 (aka. reformat problem)
8721 * src/bufferlist.C (exists): made const, and use const_iterator
8722 (isLoaded): new func.
8723 (release): use std::find to find the correct buffer.
8725 * src/bufferlist.h: made getState a const func.
8726 made empty a const func.
8727 made exists a const func.
8730 2000-02-01 Juergen Vigna <jug@sad.it>
8732 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8734 * po/it.po: updated a bit the italian po file and also changed the
8735 'file nuovo' for newfile to 'filenuovo' without a space, this did
8738 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8739 for the new insert_date command.
8741 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8742 from jdblair, to insert a date into the current text conforming to
8743 a strftime format (for now only considering the locale-set and not
8744 the document-language).
8746 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8748 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8749 Bounds Read error seen by purify. The problem was that islower is
8750 a macros which takes an unsigned char and uses it as an index for
8751 in array of characters properties (and is thus subject to the
8755 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8756 correctly the paper sides radio buttons.
8757 (UpdateDocumentButtons): ditto.
8759 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8761 * src/kbmap.C (getsym + others): change to return unsigned int,
8762 returning a long can give problems on 64 bit systems. (I assume
8763 that int is 32bit on 64bit systems)
8765 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8767 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8768 LyXLookupString to be zero-terminated. Really fixes problems seen
8771 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8773 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8774 write a (char*)0 to the lyxerr stream.
8776 * src/lastfiles.C: move algorithm before the using statemets.
8778 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8780 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8781 complains otherwise).
8782 * src/table.C: ditto
8784 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8787 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8788 that I removed earlier... It is really needed.
8790 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8792 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8794 * INSTALL: update xforms home page URL.
8796 * lib/configure.m4: fix a bug with unreadable layout files.
8798 * src/table.C (calculate_width_of_column): add "using std::max"
8801 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8803 * several files: marked several lines with "DEL LINE", this is
8804 lines that can be deleted without changing anything.
8805 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8806 checks this anyway */
8809 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8811 * src/DepTable.C (update): add a "+" at the end when the checksum
8812 is different. (debugging string only)
8814 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8815 the next inset to not be displayed. This should also fix the list
8816 of labels in the "Insert Crossreference" dialog.
8818 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8820 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8821 when regex was not found.
8823 * src/support/lstrings.C (lowercase): use handcoded transform always.
8826 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8827 old_cursor.par->prev could be 0.
8829 * several files: changed post inc/dec to pre inc/dec
8831 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8832 write the lastfiles to file.
8834 * src/BufferView.C (buffer): only show TextCache info when debugging
8836 (resizeCurrentBuffer): ditto
8837 (workAreaExpose): ditto
8839 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8841 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8843 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8844 a bit better by removing the special case for \i and \j.
8846 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8848 * src/lyx_main.C (easyParse): remove test for bad comand line
8849 options, since this broke all xforms-related parsing.
8851 * src/kbmap.C (getsym): set return type to unsigned long, as
8852 declared in header. On an alpha, long is _not_ the same as int.
8854 * src/support/LOstream.h: add a "using std::flush;"
8856 * src/insets/figinset.C: ditto.
8858 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8860 * src/bufferlist.C (write): use blinding fast file copy instead of
8861 "a char at a time", now we are doing it the C++ way.
8863 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8864 std::list<int> instead.
8865 (addpidwait): reflect move to std::list<int>
8866 (sigchldchecker): ditto
8868 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8871 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8872 that obviously was wrong...
8874 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8875 c, this avoids warnings with purify and islower.
8877 * src/insets/figinset.C: rename struct queue to struct
8878 queue_element and rewrite to use a std::queue. gsqueue is now a
8879 std::queue<queue_element>
8880 (runqueue): reflect move to std::queue
8883 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8884 we would get "1" "0" instead of "true" "false. Also make the tostr
8887 2000-01-21 Juergen Vigna <jug@sad.it>
8889 * src/buffer.C (writeFileAscii): Disabled code for special groff
8890 handling of tabulars till I fix this in table.C
8892 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8894 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8896 * src/support/lyxlib.h: ditto.
8898 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8900 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8901 and 'j' look better. This might fix the "macron" bug that has been
8904 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8905 functions as one template function. Delete the old versions.
8907 * src/support/lyxsum.C: move using std::ifstream inside
8910 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8913 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8915 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8917 * src/insets/figinset.C (InitFigures): use new instead of malloc
8918 to allocate memory for figures and bitmaps.
8919 (DoneFigures): use delete[] instead of free to deallocate memory
8920 for figures and bitmaps.
8921 (runqueue): use new to allocate
8922 (getfigdata): use new/delete[] instead of malloc/free
8923 (RegisterFigure): ditto
8925 * some files: moved some declarations closer to first use, small
8926 whitespace changes use preincrement instead of postincrement where
8927 it does not make a difference.
8929 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8930 step on the way to use stl::containers for key maps.
8932 * src/bufferlist.h: add a typedef for const_iterator and const
8933 versions of begin and end.
8935 * src/bufferlist.[Ch]: change name of member variable _state to
8936 state_. (avoid reserved names)
8938 (getFileNames): returns the filenames of the buffers in a vector.
8940 * configure.in (ALL_LINGUAS): added ro
8942 * src/support/putenv.C: new file
8944 * src/support/mkdir.C: new file
8946 2000-01-20 Allan Rae <rae@lyx.org>
8948 * lib/layouts/IEEEtran.layout: Added several theorem environments
8950 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8951 couple of minor additions.
8953 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8954 (except for those in footnotes of course)
8956 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8958 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8960 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8961 std::sort and std::lower_bound instead of qsort and handwritten
8963 (struct compara): struct that holds the functors used by std::sort
8964 and std::lower_bound in MathedLookupBOP.
8966 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8968 * src/support/LAssert.h: do not do partial specialization. We do
8971 * src/support/lyxlib.h: note that lyx::getUserName() and
8972 lyx::date() are not in use right now. Should these be suppressed?
8974 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8975 (makeLinuxDocFile): do not put date and user name in linuxdoc
8978 * src/support/lyxlib.h (kill): change first argument to long int,
8979 since that's what solaris uses.
8981 * src/support/kill.C (kill): fix declaration to match prototype.
8983 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8984 actually check whether namespaces are supported. This is not what
8987 * src/support/lyxsum.C: add a using directive.
8989 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8991 * src/support/kill.C: if we have namespace support we don't have
8992 to include lyxlib.h.
8994 * src/support/lyxlib.h: use namespace lyx if supported.
8996 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8998 * src/support/date.C: new file
9000 * src/support/chdir.C: new file
9002 * src/support/getUserName.C: new file
9004 * src/support/getcwd.C: new file
9006 * src/support/abort.C: new file
9008 * src/support/kill.C: new file
9010 * src/support/lyxlib.h: moved all the functions in this file
9011 insede struct lyx. Added also kill and abort to this struct. This
9012 is a way to avoid the "kill is not defined in <csignal>", we make
9013 C++ wrappers for functions that are not ANSI C or ANSI C++.
9015 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9016 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9017 lyx it has been renamed to sum.
9019 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9021 * src/text.C: add using directives for std::min and std::max.
9023 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9025 * src/texrow.C (getIdFromRow): actually return something useful in
9026 id and pos. Hopefully fixes the bug with positionning of errorbox
9029 * src/lyx_main.C (easyParse): output an error and exit if an
9030 incorrect command line option has been given.
9032 * src/spellchecker.C (ispell_check_word): document a memory leak.
9034 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9035 where a "struct utimbuf" is allocated with "new" and deleted with
9038 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9040 * src/text2.C (CutSelection): don't delete double spaces.
9041 (PasteSelection): ditto
9042 (CopySelection): ditto
9044 * src/text.C (Backspace): don't delete double spaces.
9046 * src/lyxlex.C (next): fix a bug that were only present with
9047 conformant std::istream::get to read comment lines, use
9048 std::istream::getline instead. This seems to fix the problem.
9050 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9052 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9053 allowed to insert space before space" editing problem. Please read
9054 commends at the beginning of the function. Comments about usage
9057 * src/text.C (InsertChar): fix for the "not allowed to insert
9058 space before space" editing problem.
9060 * src/text2.C (DeleteEmptyParagraphMechanism): when
9061 IsEmptyTableRow can only return false this last "else if" will
9062 always be a no-op. Commented out.
9064 * src/text.C (RedoParagraph): As far as I can understand tmp
9065 cursor is not really needed.
9067 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9068 present it could only return false anyway.
9069 (several functions): Did something not so smart...added a const
9070 specifier on a lot of methods.
9072 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9073 and add a tmp->text.resize. The LyXParagraph constructor does the
9075 (BreakParagraphConservative): ditto
9077 * src/support/path.h (Path): add a define so that the wrong usage
9078 "Path("/tmp") will be flagged as a compilation error:
9079 "`unnamed_Path' undeclared (first use this function)"
9081 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9083 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9084 which was bogus for several reasons.
9086 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9090 * autogen.sh: do not use "type -path" (what's that anyway?).
9092 * src/support/filetools.C (findtexfile): remove extraneous space
9093 which caused a kpsewhich warning (at least with kpathsea version
9096 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9098 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9100 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9102 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9104 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9106 * src/paragraph.C (BreakParagraph): do not reserve space on text
9107 if we don't need to (otherwise, if pos_end < pos, we end up
9108 reserving huge amounts of memory due to bad unsigned karma).
9109 (BreakParagraphConservative): ditto, although I have not seen
9110 evidence the bug can happen here.
9112 * src/lyxparagraph.h: add a using std::list.
9114 2000-01-11 Juergen Vigna <jug@sad.it>
9116 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9119 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9121 * src/vc-backend.C (doVCCommand): change to be static and take one
9122 more parameter: the path to chdir too be fore executing the command.
9123 (retrive): new function equiv to "co -r"
9125 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9126 file_not_found_hook is true.
9128 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9130 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9131 if a file is readwrite,readonly...anything else.
9133 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9136 (CreatePostscript): name change from MenuRunDVIPS (or something)
9137 (PreviewPostscript): name change from MenuPreviewPS
9138 (PreviewDVI): name change from MenuPreviewDVI
9140 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9141 \view_pdf_command., \pdf_to_ps_command
9143 * lib/configure.m4: added search for PDF viewer, and search for
9144 PDF to PS converter.
9145 (lyxrc.defaults output): add \pdflatex_command,
9146 \view_pdf_command and \pdf_to_ps_command.
9148 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9150 * src/bufferlist.C (write): we don't use blocksize for anything so
9153 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9155 * src/support/block.h: disable operator T* (), since it causes
9156 problems with both compilers I tried. See comments in the file.
9158 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9161 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9162 variable LYX_DIR_10x to LYX_DIR_11x.
9164 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9166 * INSTALL: document --with-lyxname.
9169 * configure.in: new configure flag --with-lyxname which allows to
9170 choose the name under which lyx is installed. Default is "lyx", of
9171 course. It used to be possible to do this with --program-suffix,
9172 but the later has in fact a different meaning for autoconf.
9174 * src/support/lstrings.h (lstrchr): reformat a bit.
9176 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9177 * src/mathed/math_defs.h: ditto.
9179 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9182 true, decides if we create a backup file or not when saving. New
9183 tag and variable \pdf_mode, defaults to false. New tag and
9184 variable \pdflatex_command, defaults to pdflatex. New tag and
9185 variable \view_pdf_command, defaults to xpdf. New tag and variable
9186 \pdf_to_ps_command, defaults to pdf2ps.
9188 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9191 does not have a BufferView.
9192 (unlockInset): ditto + don't access the_locking_inset if the
9193 buffer does not have a BufferView.
9195 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9196 certain circumstances so that we don't continue a keyboard
9197 operation long after the key was released. Try f.ex. to load a
9198 large document, press PageDown for some seconds and then release
9199 it. Before this change the document would contine to scroll for
9200 some time, with this change it stops imidiatly.
9202 * src/support/block.h: don't allocate more space than needed. As
9203 long as we don't try to write to the arr[x] in a array_type arr[x]
9204 it is perfectly ok. (if you write to it you might segfault).
9205 added operator value_type*() so that is possible to pass the array
9206 to functions expecting a C-pointer.
9208 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9211 * intl/*: updated to gettext 0.10.35, tried to add our own
9212 required modifications. Please verify.
9214 * po/*: updated to gettext 0.10.35, tried to add our own required
9215 modifications. Please verify.
9217 * src/support/lstrings.C (tostr): go at fixing the problem with
9218 cxx and stringstream. When stringstream is used return
9219 oss.str().c_str() so that problems with lyxstring and basic_string
9220 are avoided. Note that the best solution would be for cxx to use
9221 basic_string all the way, but it is not conformant yet. (it seems)
9223 * src/lyx_cb.C + other files: moved several global functions to
9224 class BufferView, some have been moved to BufferView.[Ch] others
9225 are still located in lyx_cb.C. Code changes because of this. (part
9226 of "get rid of current_view project".)
9228 * src/buffer.C + other files: moved several Buffer functions to
9229 class BufferView, the functions are still present in buffer.C.
9230 Code changes because of this.
9232 * config/lcmessage.m4: updated to most recent. used when creating
9235 * config/progtest.m4: updated to most recent. used when creating
9238 * config/gettext.m4: updated to most recent. applied patch for
9241 * config/gettext.m4.patch: new file that shows what changes we
9242 have done to the local copy of gettext.m4.
9244 * config/libtool.m4: new file, used in creation of acinclude.m4
9246 * config/lyxinclude.m4: new file, this is the lyx created m4
9247 macros, used in making acinclude.m4.
9249 * autogen.sh: GNU m4 discovered as a separate task not as part of
9250 the lib/configure creation.
9251 Generate acinlucde from files in config. Actually cat
9252 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9253 easier to upgrade .m4 files that really are external.
9255 * src/Spacing.h: moved using std::istringstream to right after
9256 <sstream>. This should fix the problem seen with some compilers.
9258 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9260 * src/lyx_cb.C: began some work to remove the dependency a lot of
9261 functions have on BufferView::text, even if not really needed.
9262 (GetCurrentTextClass): removed this func, it only hid the
9265 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9266 forgot this in last commit.
9268 * src/Bullet.C (bulletEntry): use static char const *[] for the
9269 tables, becuase of this the return arg had to change to string.
9271 (~Bullet): removed unneeded destructor
9273 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9274 (insetSleep): moved from Buffer
9275 (insetWakeup): moved from Buffer
9276 (insetUnlock): moved from Buffer
9278 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9279 from Buffer to BufferView.
9281 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9283 * config/ltmain.sh: updated to version 1.3.4 of libtool
9285 * config/ltconfig: updated to version 1.3.4 of libtool
9287 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9290 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9291 Did I get that right?
9293 * src/lyxlex.h: add a "using" directive or two.
9294 * src/Spacing.h: ditto.
9295 * src/insets/figinset.C: ditto.
9296 * src/support/filetools.C: ditto.
9297 * src/support/lstrings.C: ditto.
9298 * src/BufferView.C: ditto.
9299 * src/bufferlist.C: ditto.
9300 * src/lyx_cb.C: ditto.
9301 * src/lyxlex.C: ditto.
9303 * NEWS: add some changes for 1.1.4.
9305 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9307 * src/BufferView.C: first go at a TextCache to speed up switching
9310 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9312 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9313 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9314 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9315 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9318 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9319 members of the struct are correctly initialized to 0 (detected by
9321 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9322 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9324 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9325 pidwait, since it was allocated with "new". This was potentially
9326 very bad. Thanks to Michael Schmitt for running purify for us.
9329 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9331 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9333 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9335 1999-12-30 Allan Rae <rae@lyx.org>
9337 * lib/templates/IEEEtran.lyx: minor change
9339 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9340 src/mathed/formula.C (LocalDispatch): askForText changes
9342 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9343 know when a user has cancelled input. Fixes annoying problems with
9344 inserting labels and version control.
9346 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9348 * src/support/lstrings.C (tostr): rewritten to use strstream and
9351 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9353 * src/support/filetools.C (IsFileWriteable): use fstream to check
9354 (IsDirWriteable): use fileinfo to check
9356 * src/support/filetools.h (FilePtr): whole class deleted
9358 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9360 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9362 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9364 * src/bufferlist.C (write): use ifstream and ofstream instead of
9367 * src/Spacing.h: use istrstream instead of sscanf
9369 * src/mathed/math_defs.h: change first arg to istream from FILE*
9371 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9373 * src/mathed/math_parser.C: have yyis to be an istream
9374 (LexGetArg): use istream (yyis)
9376 (mathed_parse): ditto
9377 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9379 * src/mathed/formula.C (Read): rewritten to use istream
9381 * src/mathed/formulamacro.C (Read): rewritten to use istream
9383 * src/lyxlex.h (~LyXLex): deleted desturctor
9384 (getStream): new function, returns an istream
9385 (getFile): deleted funtion
9386 (IsOK): return is.good();
9388 * src/lyxlex.C (LyXLex): delete file and owns_file
9389 (setFile): open an filebuf and assign that to a istream instead of
9391 (setStream): new function, takes an istream as arg.
9392 (setFile): deleted function
9393 (EatLine): rewritten us use istream instead of FILE*
9397 * src/table.C (LyXTable): use istream instead of FILE*
9398 (Read): rewritten to take an istream instead of FILE*
9400 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9402 * src/buffer.C (Dispatch): remove an extraneous break statement.
9404 * src/support/filetools.C (QuoteName): change to do simple
9405 'quoting'. More work is necessary. Also changed to do nothing
9406 under emx (needs fix too).
9407 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9409 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9410 config.h.in to the AC_DEFINE_UNQUOTED() call.
9411 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9412 needs char * as argument (because Solaris 7 declares it like
9415 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9416 remove definition of BZERO.
9418 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9420 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9421 defined, "lyxregex.h" if not.
9423 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9425 (REGEX): new variable that is set to regex.c lyxregex.h when
9426 AM_CONDITIONAL USE_REGEX is set.
9427 (libsupport_la_SOURCES): add $(REGEX)
9429 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9432 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9435 * configure.in: add call to LYX_REGEX
9437 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9438 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9440 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9442 * lib/bind/fi_menus.bind: new file, from
9443 pauli.virtanen@saunalahti.fi.
9445 * src/buffer.C (getBibkeyList): pass the parameter delim to
9446 InsetInclude::getKeys and InsetBibtex::getKeys.
9448 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9449 is passed to Buffer::getBibkeyList
9451 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9452 instead of the hardcoded comma.
9454 * src/insets/insetbib.C (getKeys): make sure that there are not
9455 leading blanks in bibtex keys. Normal latex does not care, but
9456 harvard.sty seems to dislike blanks at the beginning of citation
9457 keys. In particular, the retturn value of the function is
9459 * INSTALL: make it clear that libstdc++ is needed and that gcc
9460 2.7.x probably does not work.
9462 * src/support/filetools.C (findtexfile): make debug message go to
9464 * src/insets/insetbib.C (getKeys): ditto
9466 * src/debug.C (showTags): make sure that the output is correctly
9469 * configure.in: add a comment for TWO_COLOR_ICON define.
9471 * acconfig.h: remove all the entries that already defined in
9472 configure.in or acinclude.m4.
9474 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9475 to avoid user name, date and copyright.
9477 1999-12-21 Juergen Vigna <jug@sad.it>
9479 * src/table.C (Read): Now read bogus row format informations
9480 if the format is < 5 so that afterwards the table can
9481 be read by lyx but without any format-info. Fixed the
9482 crash we experienced when not doing this.
9484 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9486 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9487 (RedoDrawingOfParagraph): ditto
9488 (RedoParagraphs): ditto
9489 (RemoveTableRow): ditto
9491 * src/text.C (Fill): rename arg paperwidth -> paper_width
9493 * src/buffer.C (insertLyXFile): rename var filename -> fname
9494 (writeFile): rename arg filename -> fname
9495 (writeFileAscii): ditto
9496 (makeLaTeXFile): ditto
9497 (makeLinuxDocFile): ditto
9498 (makeDocBookFile): ditto
9500 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9503 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9505 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9508 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9509 compiled by a C compiler not C++.
9511 * src/layout.h (LyXTextClass): added typedef for const_iterator
9512 (LyXTextClassList): added typedef for const_iterator + member
9513 functions begin and end.
9515 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9516 iterators to fill the choice_class.
9517 (updateLayoutChoice): rewritten to use iterators to fill the
9518 layoutlist in the toolbar.
9520 * src/BufferView.h (BufferView::work_area_width): removed unused
9523 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9525 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9526 (sgmlCloseTag): ditto
9528 * src/support/lstrings.h: return type of countChar changed to
9531 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9532 what version of this func to use. Also made to return unsigned int.
9534 * configure.in: call LYX_STD_COUNT
9536 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9537 conforming std::count.
9539 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9541 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9542 and a subscript would give bad display (patch from Dekel Tsur
9543 <dekel@math.tau.ac.il>).
9545 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9547 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9550 * src/chset.h: add a few 'using' directives
9552 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9553 triggered when no buffer is active
9555 * src/layout.C: removed `break' after `return' in switch(), since
9558 * src/lyx_main.C (init): make sure LyX can be ran in place even
9559 when libtool has done its magic with shared libraries. Fix the
9560 test for the case when the system directory has not been found.
9562 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9563 name for the latex file.
9564 (MenuMakeHTML): ditto
9566 * src/buffer.h: add an optional boolean argument, which is passed
9569 1999-12-20 Allan Rae <rae@lyx.org>
9571 * lib/templates/IEEEtran.lyx: small correction and update.
9573 * configure.in: Attempted to use LYX_PATH_HEADER
9575 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9577 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9578 input from JMarc. Now use preprocessor to find the header.
9579 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9580 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9581 LYX_STL_STRING_FWD. See comments in file.
9583 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9585 * The global MiniBuffer * minibuffer variable is dead.
9587 * The global FD_form_main * fd_form_main variable is dead.
9589 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9591 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9593 * src/table.h: add the LOstream.h header
9594 * src/debug.h: ditto
9596 * src/LyXAction.h: change the explaination of the ReadOnly
9597 attribute: is indicates that the function _can_ be used.
9599 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9602 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9604 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9610 * src/paragraph.C (GetWord): assert on pos>=0
9613 * src/support/lyxstring.C: condition the use of an invariant on
9615 * src/support/lyxstring.h: ditto
9617 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9618 Use LAssert.h instead of plain assert().
9620 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9622 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9623 * src/support/filetools.C: ditto
9625 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9628 * INSTALL: document the new configure flags
9630 * configure.in: suppress --with-debug; add --enable-assertions
9632 * acinclude.m4: various changes in alignment of help strings.
9634 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9636 * src/kbmap.C: commented out the use of the hash map in kb_map,
9637 beginning of movement to a stl::container.
9639 * several files: removed code that was not in effect when
9640 MOVE_TEXT was defined.
9642 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9643 for escaping should not be used. We can discuss if the string
9644 should be enclosed in f.ex. [] instead of "".
9646 * src/trans_mgr.C (insert): use the new returned value from
9647 encodeString to get deadkeys and keymaps done correctly.
9649 * src/chset.C (encodeString): changed to return a pair, to tell
9650 what to use if we know the string.
9652 * src/lyxscreen.h (fillArc): new function.
9654 * src/FontInfo.C (resize): rewritten to use more std::string like
9655 structore, especially string::replace.
9657 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9660 * configure.in (chmod +x some scripts): remove config/gcc-hack
9662 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9664 * src/buffer.C (writeFile): change once again the top comment in a
9665 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9666 instead of an hardcoded version number.
9667 (makeDocBookFile): ditto
9669 * src/version.h: add new define LYX_DOCVERSION
9671 * po/de.po: update from Pit Sütterlin
9672 * lib/bind/de_menus.bind: ditto.
9674 * src/lyxfunc.C (Dispatch): call MenuExport()
9675 * src/buffer.C (Dispatch): ditto
9677 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9678 LyXFunc::Dispatch().
9679 (MenuExport): new function, moved from
9680 LyXFunc::Dispatch().
9682 * src/trans_mgr.C (insert): small cleanup
9683 * src/chset.C (loadFile): ditto
9685 * lib/kbd/iso8859-1.cdef: add missing backslashes
9687 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9689 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9690 help with placing the manually drawn accents better.
9692 (Draw): x2 and hg changed to float to minimize rounding errors and
9693 help place the accents better.
9695 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9696 unsigned short to char is just wrong...cast the char to unsigned
9697 char instead so that the two values can compare sanely. This
9698 should also make the display of insetlatexaccents better and
9699 perhaps also some other insets.
9701 (lbearing): new function
9704 1999-12-15 Allan Rae <rae@lyx.org>
9706 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9707 header that provides a wrapper around the very annoying SGI STL header
9710 * src/support/lyxstring.C, src/LString.h:
9711 removed old SGI-STL-compatability attempts.
9713 * configure.in: Use LYX_STL_STRING_FWD.
9715 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9716 stl_string_fwd.h is around and try to determine it's location.
9717 Major improvement over previous SGI STL 3.2 compatability.
9718 Three small problems remain with this function due to my zero
9719 knowledge of autoconf. JMarc and lgb see the comments in the code.
9721 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9723 * src/broken_const.h, config/hack-gcc, config/README: removed
9725 * configure.in: remove --with-gcc-hack option; do not call
9728 * INSTALL: remove documentation of --with-broken-const and
9731 * acconfig.h: remove all trace of BROKEN_CONST define
9733 * src/buffer.C (makeDocBookFile): update version number in output
9735 (SimpleDocBookOnePar): fix an assert when trying to a character
9736 access beyond string length
9739 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9741 * po/de.po: fix the Export menu
9743 * lyx.man: update the description of -dbg
9745 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9746 (commandLineHelp): updated
9747 (easyParse): show list of available debug levels if -dbg is passed
9750 * src/Makefile.am: add debug.C
9752 * src/debug.h: moved some code to debug.C
9754 * src/debug.C: new file. Contains code to set and show debug
9757 * src/layout.C: remove 'break' after 'continue' in switch
9758 statements, since these cannot be reached.
9760 1999-12-13 Allan Rae <rae@lyx.org>
9762 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9763 (in_word_set): hash() -> math_hash()
9765 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9767 * acconfig.h: Added a test for whether we are using exceptions in the
9768 current compilation run. If so USING_EXCEPTIONS is defined.
9770 * config.in: Check for existance of stl_string_fwd.h
9771 * src/LString.h: If compiling --with-included-string and SGI's
9772 STL version 3.2 is present (see above test) we need to block their
9773 forward declaration of string and supply a __get_c_string().
9774 However, it turns out this is only necessary if compiling with
9775 exceptions enabled so I've a bit more to add yet.
9777 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9778 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9779 src/support/LRegex.h, src/undo.h:
9780 Shuffle the order of the included files a little to ensure that
9781 LString.h gets included before anything that includes stl_string_fwd.h
9783 * src/support/lyxstring.C: We need to #include LString.h instead of
9784 lyxstring.h to get the necessary definition of __get_c_string.
9785 (__get_c_string): New function. This is defined static just like SGI's
9786 although why they need to do this I'm not sure. Perhaps it should be
9787 in lstrings.C instead.
9789 * lib/templates/IEEEtran.lyx: New template file.
9791 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9793 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9794 * intl/Makefile.in (MKINSTALLDIRS): ditto
9796 * src/LyXAction.C (init): changed to hold the LFUN data in a
9797 automatic array in stead of in callso to newFunc, this speeds up
9798 compilation a lot. Also all the memory used by the array is
9799 returned when the init is completed.
9801 * a lot of files: compiled with -Wold-style-cast, changed most of
9802 the reported offenders to C++ style casts. Did not change the
9803 offenders in C files.
9805 * src/trans.h (Match): change argument type to unsigned int.
9807 * src/support/DebugStream.C: fix some types on the streambufs so
9808 that it works on a conforming implementation.
9810 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9812 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9814 * src/support/lyxstring.C: remove the inline added earlier since
9815 they cause a bunch of unsatisfied symbols when linking with dec
9816 cxx. Cxx likes to have the body of inlines at the place where they
9819 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9820 accessing negative bounds in array. This fixes the crash when
9821 inserting accented characters.
9822 * src/trans.h (Match): ditto
9824 * src/buffer.C (Dispatch): since this is a void, it should not try
9825 to return anything...
9827 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9829 * src/buffer.h: removed the two friends from Buffer. Some changes
9830 because of this. Buffer::getFileName and Buffer::setFileName
9831 renamed to Buffer::fileName() and Buffer::fileName(...).
9833 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9835 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9836 and Buffer::update(short) to BufferView. This move is currently
9837 controlled by a define MOVE_TEXT, this will be removed when all
9838 shows to be ok. This move paves the way for better separation
9839 between buffer contents and buffer view. One side effect is that
9840 the BufferView needs a rebreak when swiching buffers, if we want
9841 to avoid this we can add a cache that holds pointers to LyXText's
9842 that is not currently in use.
9844 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9847 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9849 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9851 * lyx_main.C: new command line option -x (or --execute) and
9852 -e (or --export). Now direct conversion from .lyx to .tex
9853 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9854 Unfortunately, X is still needed and the GUI pops up during the
9857 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9859 * src/Spacing.C: add a using directive to bring stream stuff into
9861 * src/paragraph.C: ditto
9862 * src/buffer.C: ditto
9864 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9865 from Lars' announcement).
9867 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9868 example files from Tino Meinen.
9870 1999-12-06 Allan Rae <rae@lyx.org>
9872 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9874 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9876 * src/support/lyxstring.C: added a lot of inline for no good
9879 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9880 latexWriteEndChanges, they were not used.
9882 * src/layout.h (operator<<): output operator for PageSides
9884 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9886 * some example files: loaded in LyX 1.0.4 and saved again to update
9887 certain constructs (table format)
9889 * a lot of files: did the change to use fstream/iostream for all
9890 writing of files. Done with a close look at Andre Poenitz's patch.
9892 * some files: whitespace changes.
9894 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9896 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9897 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9898 architecture, we provide our own. It is used unconditionnally, but
9899 I do not think this is a performance problem. Thanks to Angus
9900 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9901 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9903 (GetInset): use my_memcpy.
9907 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9908 it is easier to understand, but it uses less TeX-only constructs now.
9910 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9911 elements contain spaces
9913 * lib/configure: regenerated
9915 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9916 elements contain spaces; display the list of programs that are
9919 * autogen.sh: make sure lib/configure is executable
9921 * lib/examples/*: rename the tutorial examples to begin with the
9922 two-letters language code.
9924 * src/lyxfunc.C (getStatus): do not query current font if no
9927 * src/lyx_cb.C (RunScript): use QuoteName
9928 (MenuRunDvips): ditto
9929 (PrintApplyCB): ditto
9931 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9932 around argument, so that it works well with the current shell.
9933 Does not work properly with OS/2 shells currently.
9935 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9936 * src/LyXSendto.C (SendtoApplyCB): ditto
9937 * src/lyxfunc.C (Dispatch): ditto
9938 * src/buffer.C (runLaTeX): ditto
9939 (runLiterate): ditto
9940 (buildProgram): ditto
9942 * src/lyx_cb.C (RunScript): ditto
9943 (MenuMakeLaTeX): ditto
9945 * src/buffer.h (getLatexName): new method
9947 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9949 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9951 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9952 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9953 (create_math_panel): ditto
9955 * src/lyxfunc.C (getStatus): re-activate the code which gets
9956 current font and cursor; add test for export to html.
9958 * src/lyxrc.C (read): remove unreachable break statements; add a
9961 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9963 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9965 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9966 introduced by faulty regex.
9967 * src/buffer.C: ditto
9968 * src/lastfiles.C: ditto
9969 * src/paragraph.C: ditto
9970 * src/table.C: ditto
9971 * src/vspace.C: ditto
9972 * src/insets/figinset.C: ditto
9973 Note: most of these is absolutely harmless, except the one in
9974 src/mathed formula.C.
9976 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9978 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9979 operation, yielding correct results for the reLyX command.
9981 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9983 * src/support/filetools.C (ExpandPath): removed an over eager
9985 (ReplaceEnvironmentPath): ditto
9987 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9988 shows that we are doing something fishy in our code...
9992 * src/lyxrc.C (read): use a double switch trick to get more help
9993 from the compiler. (the same trick is used in layout.C)
9994 (write): new function. opens a ofstream and pass that to output
9995 (output): new function, takes a ostream and writes the lyxrc
9996 elemts to it. uses a dummy switch to make sure no elements are
9999 * src/lyxlex.h: added a struct pushpophelper for use in functions
10000 with more than one exit point.
10002 * src/lyxlex.[Ch] (GetInteger): made it const
10006 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10008 * src/layout.[hC] : LayoutTags splitted into several enums, new
10009 methods created, better error handling cleaner use of lyxlex. Read
10012 * src/bmtable.[Ch]: change some member prototypes because of the
10013 image const changes.
10015 * commandtags.h, src/LyXAction.C (init): new function:
10016 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10017 This file is not read automatically but you can add \input
10018 preferences to your lyxrc if you want to. We need to discuss how
10021 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10022 in .aux, also remove .bib and .bst files from dependencies when
10025 * src/BufferView.C, src/LyXView.C: add const_cast several places
10026 because of changes to images.
10028 * lib/images/*: same change as for images/*
10030 * lib/lyxrc.example: Default for accept_compound is false not no.
10032 * images/*: changed to be const, however I have som misgivings
10033 about this change so it might be changed back.
10035 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10037 * lib/configure, po/POTFILES.in: regenerated
10039 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10041 * config/lib_configure.m4: removed
10043 * lib/configure.m4: new file (was config/lib_configure.m4)
10045 * configure.in: do not test for rtti, since we do not use it.
10047 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10049 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10050 doubling of allocated space scheme. This makes it faster for large
10051 strings end to use less memory for small strings. xtra rememoved.
10053 * src/insets/figinset.C (waitalarm): commented out.
10054 (GhostscriptMsg): use static_cast
10055 (GhostscriptMsg): use new instead of malloc to allocate memory for
10056 cmap. also delete the memory after use.
10058 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10060 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10061 for changes in bibtex database or style.
10062 (runBibTeX): remove all .bib and .bst files from dep before we
10064 (run): use scanAuc in when dep file already exist.
10066 * src/DepTable.C (remove_files_with_extension): new method
10067 (exist): new method
10069 * src/DepTable.[Ch]: made many of the methods const.
10071 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10073 * src/bufferparams.C: make sure that the default textclass is
10074 "article". It used to be the first one by description order, but
10075 now the first one is "docbook".
10077 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10078 string; call Debug::value.
10079 (easyParse): pass complete argument to setDebuggingLevel().
10081 * src/debug.h (value): fix the code that parses debug levels.
10083 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10086 * src/LyXAction.C: use Debug::ACTION as debug channel.
10088 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10090 * NEWS: updated for the future 1.1.3 release.
10092 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10093 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10094 it should. This is of course a controversial change (since many
10095 people will find that their lyx workscreen is suddenly full of
10096 red), but done for the sake of correctness.
10098 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10099 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10101 * src/insets/inseterror.h, src/insets/inseturl.h,
10102 src/insets/insetinfo.h, src/insets/figinset.h,
10103 src/mathed/formulamacro.h, src/mathed/math_macro.h
10104 (EditMessage): add a missing const and add _() to make sure that
10105 translation happens
10107 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10108 src/insets/insetbib.C, src/support/filetools.C: add `using'
10109 directives for cxx.
10111 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10112 doing 'Insert index of last word' at the beginning of a paragraph.
10114 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10116 * several files: white-space changes.
10118 * src/mathed/formula.C: removed IsAlpha and IsDigit
10120 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10121 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10124 * src/insets/figinset.C (GetPSSizes): don't break when
10125 "EndComments" is seen. But break when a boundingbox is read.
10127 * all classes inherited from Inset: return value of Clone
10128 changed back to Inset *.
10130 * all classes inherited form MathInset: return value of Clone
10131 changed back to MathedInset *.
10133 * src/insets/figinset.C (runqueue): use a ofstream to output the
10134 gs/ps file. Might need some setpresicion or setw. However I can
10135 see no problem with the current code.
10136 (runqueue): use sleep instead of the alarm/signal code. I just
10137 can't see the difference.
10139 * src/paragraph.C (LyXParagraph): reserve space in the new
10140 paragraph and resize the inserted paragraph to just fit.
10142 * src/lyxfunc.h (operator|=): added operator for func_status.
10144 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10145 check for readable file.
10147 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10148 check for readable file.
10149 (MenuMakeLinuxDoc): ditto
10150 (MenuMakeDocBook): ditto
10151 (MenuMakeAscii): ditto
10152 (InsertAsciiFile): split the test for openable and readable
10154 * src/bmtable.C (draw_bitmaptable): use
10155 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10157 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10158 findtexfile from LaTeX to filetools.
10160 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10161 instead of FilePtr. Needs to be verified by a literate user.
10163 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10165 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10166 (EditMessage): likewise.
10168 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10169 respectively as \textasciitilde and \textasciicircum.
10171 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10173 * src/support/lyxstring.h: made the methods that take iterators
10174 use const_iterator.
10176 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10177 (regexMatch): made is use the real regex class.
10179 * src/support/Makefile.am: changed to use libtool
10181 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10183 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10185 (MathIsInset ++): changed several macros to be inline functions
10188 * src/mathed/Makefile.am: changed to use libtool
10190 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10192 * src/insets/inset* : Clone changed to const and return type is
10193 the true insettype not just Inset*.
10195 * src/insets/Makefile.am: changed to use libtool
10197 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10199 * src/undo.[Ch] : added empty() and changed some of the method
10202 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10204 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10205 setID use block<> for the bullets array, added const several places.
10207 * src/lyxfunc.C (getStatus): new function
10209 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10210 LyXAction, added const to several funtions.
10212 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10213 a std::map, and to store the dir items in a vector.
10215 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10218 * src/LyXView.[Ch] + other files : changed currentView to view.
10220 * src/LyXAction.[Ch] : ported from the old devel branch.
10222 * src/.cvsignore: added .libs and a.out
10224 * configure.in : changes to use libtool.
10226 * acinclude.m4 : inserted libtool.m4
10228 * .cvsignore: added libtool
10230 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10232 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10233 file name in insets and mathed directories (otherwise the
10234 dependency is not taken in account under cygwin).
10236 * src/text2.C (InsertString[AB]): make sure that we do not try to
10237 read characters past the string length.
10239 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10241 * lib/doc/LaTeXConfig.lyx.in,
10242 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10244 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10245 file saying who created them and when this heppened; this is
10246 useless and annoys tools like cvs.
10248 * lib/layouts/g-brief-{en,de}.layout,
10249 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10250 from Thomas Hartkens <thomas@hartkens.de>.
10252 * src/{insets,mathed}/Makefile.am: do not declare an empty
10253 LDFLAGS, so that it can be set at configure time (useful on Irix
10256 * lib/reLyX/configure.in: make sure that the prefix is set
10257 correctly in LYX_DIR.
10259 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10261 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10262 be used by 'command-sequence' this allows to bind a key to a
10263 sequence of LyX-commands
10264 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10266 * src/LyXAction.C: add "command-sequence"
10268 * src/LyXFunction.C: handling of "command-sequence"
10270 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10271 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10273 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10275 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10277 * src/buffer.C (writeFile): Do not output a comment giving user
10278 and date at the beginning of a .lyx file. This is useless and
10279 annoys cvs anyway; update version number to 1.1.
10281 * src/Makefile.am (LYX_DIR): add this definition, so that a
10282 default path is hardcoded in LyX.
10284 * configure.in: Use LYX_GNU_GETTEXT.
10286 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10287 AM_GNU_GETTEXT with a bug fixed.
10289 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10291 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10293 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10294 which is used to point to LyX data is now LYX_DIR_11x.
10296 * lyx.man: convert to a unix text file; small updates.
10298 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10300 * src/support/LSubstring.[Ch]: made the second arg of most of the
10301 constructors be a const reference.
10303 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10306 * src/support/lyxstring.[Ch] (swap): added missing member function
10307 and specialization of swap(str, str);
10309 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10311 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10312 trace of the old one.
10314 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10315 put the member definitions in undo.C.
10317 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10318 NEW_TEXT and have now only code that was included when this was
10321 * src/intl.C (LCombo): use static_cast
10323 (DispatchCallback): ditto
10325 * src/definitions.h: removed whole file
10327 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10329 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10330 parsing and stores in a std:map. a regex defines the file format.
10331 removed unneeded members.
10333 * src/bufferparams.h: added several enums from definitions.h here.
10334 Removed unsused destructor. Changed some types to use proper enum
10335 types. use block to have the temp_bullets and user_defined_bullets
10336 and to make the whole class assignable.
10338 * src/bufferparams.C (Copy): removed this functions, use a default
10339 assignment instead.
10341 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10344 * src/buffer.C (readLyXformat2): commend out all that have with
10345 oldpapersize to do. also comment out all that hve to do with
10346 insetlatex and insetlatexdel.
10347 (setOldPaperStuff): commented out
10349 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10351 * src/LyXAction.C: remove use of inset-latex-insert
10353 * src/mathed/math_panel.C (button_cb): use static_cast
10355 * src/insets/Makefile.am (insets_o_SOURCES): removed
10358 * src/support/lyxstring.C (helper): use the unsigned long
10359 specifier, UL, instead of a static_cast.
10361 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10363 * src/support/block.h: new file. to be used as a c-style array in
10364 classes, so that the class can be assignable.
10366 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10368 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10369 NULL, make sure to return an empty string (it is not possible to
10370 set a string to NULL).
10372 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10374 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10376 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10378 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10379 link line, so that Irix users (for example) can set it explicitely to
10382 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10383 it can be overidden at make time (static or dynamic link, for
10386 * src/vc-backend.C, src/LaTeXFeatures.h,
10387 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10388 statements to bring templates to global namespace.
10390 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10392 * src/support/lyxstring.C (operator[] const): make it standard
10395 * src/minibuffer.C (Init): changed to reflect that more
10396 information is given from the lyxvc and need not be provided here.
10398 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10400 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10402 * src/LyXView.C (UpdateTimerCB): use static_cast
10403 (KeyPressMask_raw_callback): ditto
10405 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10406 buffer_, a lot of changes because of this. currentBuffer() ->
10407 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10408 also changes to other files because of this.
10410 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10412 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10413 have no support for RCS and partial support for CVS, will be
10416 * src/insets/ several files: changes because of function name
10417 changes in Bufferview and LyXView.
10419 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10421 * src/support/LSubstring.[Ch]: new files. These implement a
10422 Substring that can be very convenient to use. i.e. is this
10424 string a = "Mary had a little sheep";
10425 Substring(a, "sheep") = "lamb";
10426 a is now "Mary has a little lamb".
10428 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10429 out patterns and subpatterns of strings. It is used by LSubstring
10430 and also by vc-backend.C
10432 * src/support/lyxstring.C: went over all the assertions used and
10433 tried to correct the wrong ones and flag which of them is required
10434 by the standard. some bugs found because of this. Also removed a
10435 couple of assertions.
10437 * src/support/Makefile.am (libsupport_a_SOURCES): added
10438 LSubstring.[Ch] and LRegex.[Ch]
10440 * src/support/FileInfo.h: have struct stat buf as an object and
10441 not a pointer to one, some changes because of this.
10443 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10444 information in layout when adding the layouts preamble to the
10445 textclass preamble.
10447 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10450 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10451 because of bug in OS/2.
10453 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10455 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10456 \verbatim@font instead of \ttfamily, so that it can be redefined.
10458 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10459 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10460 src/layout.h, src/text2.C: add 'using' directive to bring the
10461 STL templates we need from the std:: namespace to the global one.
10462 Needed by DEC cxx in strict ansi mode.
10464 * src/support/LIstream.h,src/support/LOstream.h,
10465 src/support/lyxstring.h,src/table.h,
10466 src/lyxlookup.h: do not include <config.h> in header
10467 files. This should be done in the .C files only.
10469 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10473 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10475 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10476 from Kayvan to fix the tth invokation.
10478 * development/lyx.spec.in: updates from Kayvan to reflect the
10479 changes of file names.
10481 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10483 * src/text2.C (InsertStringB): use std::copy
10484 (InsertStringA): use std::copy
10486 * src/bufferlist.C: use a vector to store the buffers in. This is
10487 an internal change and should not affect any other thing.
10489 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10492 * src/text.C (Fill): fix potential bug, one off bug.
10494 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10496 * src/Makefile.am (lyx_main.o): add more files it depends on.
10498 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10500 * src/support/lyxstring.C: use size_t for the reference count,
10501 size, reserved memory and xtra.
10502 (internal_compare): new private member function. Now the compare
10503 functions should work for std::strings that have embedded '\0'
10505 (compare): all compare functions rewritten to use
10508 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10510 * src/support/lyxstring.C (compare): pass c_str()
10511 (compare): pass c_str
10512 (compare): pass c_str
10514 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10516 * src/support/DebugStream.C: <config.h> was not included correctly.
10518 * lib/configure: forgot to re-generate it :( I'll make this file
10519 auto generated soon.
10521 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10523 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10526 * src/support/lyxstring.C: some changes from length() to rep->sz.
10527 avoids a function call.
10529 * src/support/filetools.C (SpaceLess): yet another version of the
10530 algorithm...now per Jean-Marc's suggestions.
10532 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10534 * src/layout.C (less_textclass_desc): functor for use in sorting
10536 (LyXTextClass::Read): sort the textclasses after reading.
10538 * src/support/filetools.C (SpaceLess): new version of the
10539 SpaceLess functions. What problems does this one give? Please
10542 * images/banner_bw.xbm: made the arrays unsigned char *
10544 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10546 * src/support/lyxstring.C (find): remove bogus assertion in the
10547 two versions of find where this has not been done yet.
10549 * src/support/lyxlib.h: add missing int return type to
10552 * src/menus.C (ShowFileMenu): disable exporting to html if no
10553 html export command is present.
10555 * config/lib_configure.m4: add a test for an HTML converter. The
10556 programs checked for are, in this order: tth, latex2html and
10559 * lib/configure: generated from config/lib_configure.m4.
10561 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10562 html converter. The parameters are now passed through $$FName and
10563 $$OutName, instead of standard input/output.
10565 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10567 * lib/lyxrc.example: update description of \html_command.
10568 add "quotes" around \screen_font_xxx font setting examples to help
10569 people who use fonts with spaces in their names.
10571 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10573 * Distribution files: updates for v1.1.2
10575 * src/support/lyxstring.C (find): remove bogus assert and return
10576 npos for the same condition.
10578 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10580 * added patch for OS/2 from SMiyata.
10582 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10584 * src/text2.C (CutSelection): make space_wrapped a bool
10585 (CutSelection): dont declare int i until we have to.
10586 (alphaCounter): return a char const *.
10588 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10590 * src/support/syscall.C (Systemcalls::kill):
10591 src/support/filetools.C (PutEnv, PutEnvPath):
10592 src/lyx_cb.C (addNewlineAndDepth):
10593 src/FontInfo.C (FontInfo::resize): condition some #warning
10594 directives with WITH_WARNINGS.
10597 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10599 * src/layout.[Ch] + several files: access to class variables
10600 limited and made accessor functions instead a lot of code changed
10601 becuase of this. Also instead of returning pointers often a const
10602 reference is returned instead.
10604 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10606 * src/Makefile.am (dist-hook): added used to remove the CVS from
10607 cheaders upon creating a dist
10608 (EXTRA_DIST): added cheaders
10610 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10611 a character not as a small integer.
10613 * src/support/lyxstring.C (find): removed Assert and added i >=
10614 rep->sz to the first if.
10616 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10618 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10619 src/LyXView.C src/buffer.C src/bufferparams.C
10620 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10621 src/text2.C src/insets/insetinclude.C:
10622 lyxlayout renamed to textclasslist.
10624 * src/layout.C: some lyxerr changes.
10626 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10627 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10628 (LyXLayoutList): removed all traces of this class.
10629 (LyXTextClass::Read): rewrote LT_STYLE
10630 (LyXTextClass::hasLayout): new function
10631 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10632 both const and nonconst version.
10633 (LyXTextClass::delete_layout): new function.
10634 (LyXTextClassList::Style): bug fix. do the right thing if layout
10636 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10637 (LyXTextClassList::NameOfLayout): ditto
10638 (LyXTextClassList::Load): ditto
10640 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10642 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10644 * src/LyXAction.C (LookupFunc): added a workaround for sun
10645 compiler, on the other hand...we don't know if the current code
10646 compiles on sun at all...
10648 * src/support/filetools.C (CleanupPath): subst fix
10650 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10653 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10654 complained about this one?
10656 * src/insets/insetinclude.C (Latex): subst fix
10658 * src/insets/insetbib.C (getKeys): subst fix
10660 * src/LyXSendto.C (SendtoApplyCB): subst fix
10662 * src/lyx_main.C (init): subst fix
10664 * src/layout.C (Read): subst fix
10666 * src/lyx_sendfax_main.C (button_send): subst fix
10668 * src/buffer.C (RoffAsciiTable): subst fix
10670 * src/lyx_cb.C (MenuFax): subst fix
10671 (PrintApplyCB): subst fix
10673 1999-10-26 Juergen Vigna <jug@sad.it>
10675 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10677 (Read): Cleaned up this code so now we read only format vestion >= 5
10679 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10681 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10682 come nobody has complained about this one?
10684 * src/insets/insetinclude.C (Latex): subst fix
10686 * src/insets/insetbib.C (getKeys): subst fix
10688 * src/lyx_main.C (init): subst fix
10690 * src/layout.C (Read): subst fix
10692 * src/buffer.C (RoffAsciiTable): subst fix
10694 * src/lyx_cb.C (MenuFax): subst fix.
10696 * src/layout.[hC] + some other files: rewrote to use
10697 std::container to store textclasses and layouts in.
10698 Simplified, removed a lot of code. Make all classes
10699 assignable. Further simplifications and review of type
10700 use still to be one.
10702 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10703 lastfiles to create the lastfiles partr of the menu.
10705 * src/lastfiles.[Ch]: rewritten to use deque to store the
10706 lastfiles in. Uses fstream for reading and writing. Simplifies
10709 * src/support/syscall.C: remove explicit cast.
10711 * src/BufferView.C (CursorToggleCB): removed code snippets that
10712 were commented out.
10713 use explicat C++ style casts instead of C style casts. also use
10714 u_vdata instea of passing pointers in longs.
10716 * src/PaperLayout.C: removed code snippets that were commented out.
10718 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10720 * src/lyx_main.C: removed code snippets that wer commented out.
10722 * src/paragraph.C: removed code snippets that were commented out.
10724 * src/lyxvc.C (logClose): use static_cast
10726 (viewLog): remove explicit cast to void*
10727 (showLog): removed old commented code
10729 * src/menus.C: use static_cast instead of C style casts. use
10730 u_vdata instead of u_ldata. remove explicit cast to (long) for
10731 pointers. Removed old code that was commented out.
10733 * src/insets/inset.C: removed old commented func
10735 * src/insets/insetref.C (InsetRef): removed old code that had been
10736 commented out for a long time.
10738 (escape): removed C style cast
10740 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10742 * src/insets/insetlatex.C (Draw): removed old commented code
10743 (Read): rewritten to use string
10745 * src/insets/insetlabel.C (escape): removed C style cast
10747 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10749 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10750 old commented code.
10752 * src/insets/insetinclude.h: removed a couple of stupid bools
10754 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10755 (Clone): remove C style cast
10756 (getKeys): changed list to lst because of std::list
10758 * src/insets/inseterror.C (Draw): removed som old commented code.
10760 * src/insets/insetcommand.C (Draw): removed some old commented code.
10762 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10763 commented out forever.
10764 (bibitem_cb): use static_cast instead of C style cast
10765 use of vdata changed to u_vdata.
10767 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10769 (CloseUrlCB): use static_cast instead of C style cast.
10770 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10772 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10773 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10774 (CloseInfoCB): static_cast from ob->u_vdata instead.
10775 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10778 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10779 (C_InsetError_CloseErrorCB): forward the ob parameter
10780 (CloseErrorCB): static_cast from ob->u_vdata instead.
10782 * src/vspace.h: include LString.h since we use string in this class.
10784 * src/vspace.C (lyx_advance): changed name from advance because of
10785 nameclash with stl. And since we cannot use namespaces yet...I
10786 used a lyx_ prefix instead. Expect this to change when we begin
10789 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10791 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10792 and removed now defunct constructor and deconstructor.
10794 * src/BufferView.h: have backstack as a object not as a pointer.
10795 removed initialization from constructor. added include for BackStack
10797 * development/lyx.spec.in (%build): add CFLAGS also.
10799 * src/screen.C (drawFrame): removed another warning.
10801 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10803 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10804 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10805 README and ANNOUNCE a bit for the next release. More work is
10808 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10809 unbreakable if we are in freespacing mode (LyX-Code), but not in
10812 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10814 * src/BackStack.h: fixed initialization order in constructor
10816 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10818 * acinclude.m4 (VERSION): new rules for when a version is
10819 development, added also a variable for prerelease.
10820 (warnings): we set with_warnings=yes for prereleases
10821 (lyx_opt): prereleases compile with same optimization as development
10822 (CXXFLAGS): only use pedantic if we are a development version
10824 * src/BufferView.C (restorePosition): don't do anything if the
10825 backstack is empty.
10827 * src/BackStack.h: added member empty, use this to test if there
10828 is anything to pop...
10830 1999-10-25 Juergen Vigna <jug@sad.it>
10833 * forms/layout_forms.fd +
10834 * forms/latexoptions.fd +
10835 * lyx.fd: changed for various form resize issues
10837 * src/mathed/math_panel.C +
10838 * src/insets/inseterror.C +
10839 * src/insets/insetinfo.C +
10840 * src/insets/inseturl.C +
10841 * src/insets/inseturl.h +
10843 * src/LyXSendto.C +
10844 * src/PaperLayout.C +
10845 * src/ParagraphExtra.C +
10846 * src/TableLayout.C +
10848 * src/layout_forms.C +
10855 * src/menus.C: fixed various resize issues. So now forms can be
10856 resized savely or not be resized at all.
10858 * forms/form_url.fd +
10859 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10862 * src/insets/Makefile.am: added files form_url.[Ch]
10864 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10866 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10867 (and presumably 6.2).
10869 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10870 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10871 remaining static member callbacks.
10873 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10876 * src/support/lyxstring.h: declare struct Srep as friend of
10877 lyxstring, since DEC cxx complains otherwise.
10879 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10881 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * src/LaTeX.C (run): made run_bibtex also depend on files with
10885 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10886 are put into the dependency file.
10888 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10889 the code has shown itself to work
10890 (create_ispell_pipe): removed another warning, added a comment
10893 * src/minibuffer.C (ExecutingCB): removed code that has been
10894 commented out a long time
10896 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10897 out code + a warning.
10899 * src/support/lyxstring.h: comment out the three private
10900 operators, when compiling with string ansi conforming compilers
10901 they make problems.
10903 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10905 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10906 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10909 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10912 * src/mathed/math_panel.C (create_math_panel): remove explicit
10915 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10918 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10919 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10920 to XCreatePixmapFromBitmapData
10921 (fl_set_bmtable_data): change the last argument to be unsigned
10923 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10924 and bh to be unsigned int, remove explicit casts in call to
10925 XReadBitmapFileData.
10927 * images/arrows.xbm: made the arrays unsigned char *
10928 * images/varsz.xbm: ditto
10929 * images/misc.xbm: ditto
10930 * images/greek.xbm: ditto
10931 * images/dots.xbm: ditto
10932 * images/brel.xbm: ditto
10933 * images/bop.xbm: ditto
10935 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10937 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10938 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10939 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10941 (LYX_CXX_CHEADERS): added <clocale> to the test.
10943 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10945 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10947 * src/support/lyxstring.C (append): fixed something that must be a
10948 bug, rep->assign was used instead of rep->append.
10950 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10953 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10954 lyx insert double chars. Fix spotted by Kayvan.
10956 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10958 * Fixed the tth support. I messed up with the Emacs patch apply feature
10959 and omitted the changes in lyxrc.C.
10961 1999-10-22 Juergen Vigna <jug@sad.it>
10963 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10965 * src/lyx_cb.C (MenuInsertRef) +
10966 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10967 the form cannot be resized under it limits (fixes a segfault)
10969 * src/lyx.C (create_form_form_ref) +
10970 * forms/lyx.fd: Changed Gravity on name input field so that it is
10973 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10975 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10976 <ostream> and <istream>.
10978 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10979 whether <fstream> provides the latest standard features, or if we
10980 have an oldstyle library (like in egcs).
10981 (LYX_CXX_STL_STRING): fix the test.
10983 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10984 code on MODERN_STL_STREAM.
10986 * src/support/lyxstring.h: use L{I,O}stream.h.
10988 * src/support/L{I,O}stream.h: new files, designed to setup
10989 correctly streams for our use
10990 - includes the right header depending on STL capabilities
10991 - puts std::ostream and std::endl (for LOStream.h) or
10992 std::istream (LIStream.h) in toplevel namespace.
10994 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10996 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10997 was a bib file that had been changed we ensure that bibtex is run.
10998 (runBibTeX): enhanced to extract the names of the bib files and
10999 getting their absolute path and enter them into the dep file.
11000 (findtexfile): static func that is used to look for tex-files,
11001 checks for absolute patchs and tries also with kpsewhich.
11002 Alternative ways of finding the correct files are wanted. Will
11004 (do_popen): function that runs a command using popen and returns
11005 the whole output of that command in a string. Should be moved to
11008 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11009 file with extension ext has changed.
11011 * src/insets/figinset.C: added ifdef guards around the fl_free
11012 code that jug commented out. Now it is commented out when
11013 compiling with XForms == 0.89.
11015 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11016 to lyxstring.C, and only keep a forward declaration in
11017 lyxstring.h. Simplifies the header file a bit and should help a
11018 bit on compile time too. Also changes to Srep will not mandate a
11019 recompile of code just using string.
11020 (~lyxstring): definition moved here since it uses srep.
11021 (size): definition moved here since it uses srep.
11023 * src/support/lyxstring.h: removed a couple of "inline" that should
11026 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11028 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11031 1999-10-21 Juergen Vigna <jug@sad.it>
11033 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11034 set to left if I just remove the width entry (or it is empty).
11036 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11037 paragraph when having dummy paragraphs.
11039 1999-10-20 Juergen Vigna <jug@sad.it>
11041 * src/insets/figinset.C: just commented some fl_free_form calls
11042 and added warnings so that this calls should be activated later
11043 again. This avoids for now a segfault, but we have a memory leak!
11045 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11046 'const char * argument' to 'string argument', this should
11047 fix some Asserts() in lyxstring.C.
11049 * src/lyxfunc.h: Removed the function argAsString(const char *)
11050 as it is not used anymore.
11052 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11054 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11057 * src/Literate.h: some funcs moved from public to private to make
11058 interface clearer. Unneeded args removed.
11060 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11062 (scanBuildLogFile): ditto
11064 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11065 normal TeX Error. Still room for improvement.
11067 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11069 * src/buffer.C (insertErrors): changes to make the error
11070 desctription show properly.
11072 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11075 * src/support/lyxstring.C (helper): changed to use
11076 sizeof(object->rep->ref).
11077 (operator>>): changed to use a pointer instead.
11079 * src/support/lyxstring.h: changed const reference & to value_type
11080 const & lets see if that helps.
11082 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11084 * Makefile.am (rpmdist): fixed to have non static package and
11087 * src/support/lyxstring.C: removed the compilation guards
11089 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11092 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11093 conditional compile of lyxstring.Ch
11095 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11096 stupid check, but it is a lot better than the bastring hack.
11097 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11099 * several files: changed string::erase into string::clear. Not
11102 * src/chset.C (encodeString): use a char temporary instead
11104 * src/table.C (TexEndOfCell): added tostr around
11105 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11106 (TexEndOfCell): ditto
11107 (TexEndOfCell): ditto
11108 (TexEndOfCell): ditto
11109 (DocBookEndOfCell): ditto
11110 (DocBookEndOfCell): ditto
11111 (DocBookEndOfCell): ditto
11112 (DocBookEndOfCell): ditto
11114 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11116 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11118 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11119 (MenuBuildProg): added tostr around ret
11120 (MenuRunChktex): added tostr around ret
11121 (DocumentApplyCB): added tostr around ret
11123 * src/chset.C (encodeString): added tostr around t->ic
11125 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11126 (makeLaTeXFile): added tostr around tocdepth
11127 (makeLaTeXFile): added tostr around ftcound - 1
11129 * src/insets/insetbib.C (setCounter): added tostr around counter.
11131 * src/support/lyxstring.h: added an operator+=(int) to catch more
11134 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11135 (lyxstring): We DON'T allow NULL pointers.
11137 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11139 * src/mathed/math_macro.C (MathMacroArgument::Write,
11140 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11141 when writing them out.
11143 * src/LString.C: remove, since it is not used anymore.
11145 * src/support/lyxstring.C: condition the content to
11146 USE_INCLUDED_STRING macro.
11148 * src/mathed/math_symbols.C, src/support/lstrings.C,
11149 src/support/lyxstring.C: add `using' directive to specify what
11150 we need in <algorithm>. I do not think that we need to
11151 conditionalize this, but any thought is appreciated.
11153 * many files: change all callback functions to "C" linkage
11154 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11155 strict_ansi. Those who were static are now global.
11156 The case of callbacks which are static class members is
11157 trickier, since we have to make C wrappers around them (see
11158 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11159 did not finish this yet, since it defeats the purpose of
11160 encapsulation, and I am not sure what the best route is.
11162 1999-10-19 Juergen Vigna <jug@sad.it>
11164 * src/support/lyxstring.C (lyxstring): we permit to have a null
11165 pointer as assignment value and just don't assign it.
11167 * src/vspace.C (nextToken): corrected this function substituting
11168 find_first(_not)_of with find_last_of.
11170 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11171 (TableOptCloseCB) (TableSpeCloseCB):
11172 inserted fl_set_focus call for problem with fl_hide_form() in
11175 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11177 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11180 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11182 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11183 LyXLex::next() and not eatline() to get its argument.
11185 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11188 instead, use fstreams for io of the depfile, removed unneeded
11189 functions and variables.
11191 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11192 vector instead, removed all functions and variables that is not in
11195 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11197 * src/buffer.C (insertErrors): use new interface to TeXError
11199 * Makefile.am (rpmdist): added a rpmdist target
11201 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11202 per Kayvan's instructions.
11204 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11206 * src/Makefile.am: add a definition for localedir, so that locales
11207 are found after installation (Kayvan)
11209 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11211 * development/.cvsignore: new file.
11213 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11215 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11216 C++ compiler provides wrappers for C headers and use our alternate
11219 * configure.in: use LYX_CXX_CHEADERS.
11221 * src/cheader/: new directory, populated with cname headers from
11222 libstdc++-2.8.1. They are a bit old, but probably good enough for
11223 what we want (support compilers who lack them).
11225 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11226 from includes. It turns out is was stupid.
11228 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11230 * lib/Makefile.am (install-data-local): forgot a ';'
11231 (install-data-local): forgot a '\'
11232 (libinstalldirs): needed after all. reintroduced.
11234 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11236 * configure.in (AC_OUTPUT): added lyx.spec
11238 * development/lyx.spec: removed file
11240 * development/lyx.spec.in: new file
11242 * po/*.po: merged with lyx.pot becuase of make distcheck
11244 * lib/Makefile.am (dist-hook): added dist-hook so that
11245 documentation files will be included when doing a make
11246 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11247 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11249 more: tried to make install do the right thing, exclude CVS dirs
11252 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11253 Path would fit in more nicely.
11255 * all files that used to use pathstack: uses now Path instead.
11256 This change was a lot easier than expected.
11258 * src/support/path.h: new file
11260 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11262 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11264 * src/support/lyxstring.C (getline): Default arg was given for
11267 * Configure.cmd: removed file
11269 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11271 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11272 streams classes and types, add the proper 'using' statements when
11273 MODERN_STL is defined.
11275 * src/debug.h: move the << operator definition after the inclusion
11278 * src/support/filetools.C: include "LAssert.h", which is needed
11281 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11284 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11285 include "debug.h" to define a proper ostream.
11287 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11289 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11290 method to the SystemCall class which can kill a process, but it's
11291 not fully implemented yet.
11293 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11295 * src/support/FileInfo.h: Better documentation
11297 * src/lyxfunc.C: Added support for buffer-export html
11299 * src/menus.C: Added Export->As HTML...
11301 * lib/bind/*.bind: Added short-cut for buffer-export html
11303 * src/lyxrc.*: Added support for new \tth_command
11305 * lib/lyxrc.example: Added stuff for new \tth_command
11307 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11309 * lib/Makefile.am (IMAGES): removed images/README
11310 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11311 installes in correct place. Check permisions is installed
11314 * src/LaTeX.C: some no-op changes moved declaration of some
11317 * src/LaTeX.h (LATEX_H): changed include guard name
11319 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11321 * lib/reLyX/Makefile.am: install noweb2lyx.
11323 * lib/Makefile.am: install configure.
11325 * lib/reLyX/configure.in: declare a config aux dir; set package
11326 name to lyx (not sure what the best solution is); generate noweb2lyx.
11328 * lib/layouts/egs.layout: fix the bibliography layout.
11330 1999-10-08 Jürgen Vigna <jug@sad.it>
11332 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11333 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11334 it returned without continuing to search the path.
11336 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11338 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11339 also fixes a bug. It is not allowed to do tricks with std::strings
11340 like: string a("hei"); &a[e]; this will not give what you
11341 think... Any reason for the complexity in this func?
11343 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11345 * Updated README and INSTALL a bit, mostly to check that my
11346 CVS rights are correctly set up.
11348 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11350 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11351 does not allow '\0' chars but lyxstring and std::string does.
11353 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11355 * autogen.sh (AUTOCONF): let the autogen script create the
11356 POTFILES.in file too. POTFILES.in should perhaps now not be
11357 included in the cvs module.
11359 * some more files changed to use C++ includes instead of C ones.
11361 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11363 (Reread): added tostr to nlink. buggy output otherwise.
11364 (Reread): added a string() around szMode when assigning to Buffer,
11365 without this I got a log of garbled info strings.
11367 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11370 * I have added several ostream & operator<<(ostream &, some_type)
11371 functions. This has been done to avoid casting and warnings when
11372 outputting enums to lyxerr. This as thus eliminated a lot of
11373 explicit casts and has made the code clearer. Among the enums
11374 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11375 mathed enums, some font enum the Debug::type enum.
11377 * src/support/lyxstring.h (clear): missing method. equivalent of
11380 * all files that contained "stderr": rewrote constructs that used
11381 stderr to use lyxerr instead. (except bmtable)
11383 * src/support/DebugStream.h (level): and the passed t with
11384 Debug::ANY to avoid spurious bits set.
11386 * src/debug.h (Debug::type value): made it accept strings of the
11387 type INFO,INIT,KEY.
11389 * configure.in (Check for programs): Added a check for kpsewhich,
11390 the latex generation will use this later to better the dicovery of
11393 * src/BufferView.C (create_view): we don't need to cast this to
11394 (void*) that is done automatically.
11395 (WorkAreaButtonPress): removed some dead code.
11397 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11399 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11400 is not overwritten when translated (David Sua'rez de Lis).
11402 * lib/CREDITS: Added David Sua'rez de Lis
11404 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11406 * src/bufferparams.C (BufferParams): default input encoding is now
11409 * acinclude.m4 (cross_compiling): comment out macro
11410 LYX_GXX_STRENGTH_REDUCE.
11412 * acconfig.h: make sure that const is not defined (to empty) when
11413 we are compiling C++. Remove commented out code using SIZEOF_xx
11416 * configure.in : move the test for const and inline as late as
11417 possible so that these C tests do not interefere with C++ ones.
11418 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11419 has not been proven.
11421 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11423 * src/table.C (getDocBookAlign): remove bad default value for
11424 isColumn parameter.
11426 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11428 (ShowFileMenu2): ditto.
11430 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11431 of files to ignore.
11433 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11435 * Most files: finished the change from the old error code to use
11436 DebugStream for all lyxerr debugging. Only minor changes remain
11437 (e.g. the setting of debug levels using strings instead of number)
11439 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11441 * src/layout.C (Add): Changed to use compare_no_case instead of
11444 * src/FontInfo.C: changed loop variable type too string::size_type.
11446 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11448 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11449 set ETAGS_ARGS to --c++
11451 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11453 * src/table.C (DocBookEndOfCell): commented out two unused variables
11455 * src/paragraph.C: commented out four unused variables.
11457 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11458 insed a if clause with type string::size_type.
11460 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11463 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11465 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11466 variable, also changed loop to go from 0 to lenght + 1, instead of
11467 -1 to length. This should be correct.
11469 * src/LaTeX.C (scanError): use string::size_type as loop variable
11472 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11473 (l.896) since y_tmp and row was not used anyway.
11475 * src/insets/insetref.C (escape): use string::size_type as loop
11478 * src/insets/insetquotes.C (Width): use string::size_type as loop
11480 (Draw): use string::size_type as loop variable type.
11482 * src/insets/insetlatexaccent.C (checkContents): use
11483 string::size_type as loop variable type.
11485 * src/insets/insetlabel.C (escape): use string::size_type as loop
11488 * src/insets/insetinfo.C: added an extern for current_view.
11490 * src/insets/insetcommand.C (scanCommand): use string::size_type
11491 as loop variable type.
11493 * most files: removed the RCS tags. With them we had to recompile
11494 a lot of files after a simple cvs commit. Also we have never used
11495 them for anything meaningful.
11497 * most files: tags-query-replace NULL 0. As adviced several plases
11498 we now use "0" instead of "NULL" in our code.
11500 * src/support/filetools.C (SpaceLess): use string::size_type as
11501 loop variable type.
11503 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11505 * src/paragraph.C: fixed up some more string stuff.
11507 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11509 * src/support/filetools.h: make modestr a std::string.
11511 * src/filetools.C (GetEnv): made ch really const.
11513 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11514 made code that used these use max/min from <algorithm> instead.
11516 * changed several c library include files to their equivalent c++
11517 library include files. All is not changed yet.
11519 * created a support subdir in src, put lyxstring and lstrings
11520 there + the extra files atexit, fileblock, strerror. Created
11521 Makefile.am. edited configure.in and src/Makefile.am to use this
11522 new subdir. More files moved to support.
11524 * imported som of the functions from repository lyx, filetools
11526 * ran tags-query-replace on LString -> string, corrected the bogus
11527 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11528 is still some errors in there. This is errors where too much or
11529 too litle get deleted from strings (string::erase, string::substr,
11530 string::replace), there can also be some off by one errors, or
11531 just plain wrong use of functions from lstrings. Viewing of quotes
11534 * LyX is now running fairly well with string, but there are
11535 certainly some bugs yet (see above) also string is quite different
11536 from LString among others in that it does not allow null pointers
11537 passed in and will abort if it gets any.
11539 * Added the revtex4 files I forgot when setting up the repository.
11541 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11543 * All over: Tried to clean everything up so that only the files
11544 that we really need are included in the cvs repository.
11545 * Switched to use automake.
11546 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11547 * Install has not been checked.
11549 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11551 * po/pt.po: Three errors:
11552 l.533 and l.538 format specification error
11553 l. 402 duplicate entry, I just deleted it.