1 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
3 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
4 movement in inset in RTL text.
5 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
6 (workAreaButtonRelease): Do not open a float when there is a selection.
8 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
10 * src/spellchecker.C (RunSpellChecker): Open all floats before
13 * src/text.C (InsertChar): Consider "," as a part of a number
14 (for LTR numbers in RTL text code).
15 (IsBoundary): Fixed (and simplified).
16 (InsertChar): Recalculate cursor boundary.
19 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
21 * src/spellchecker.C: fix figures with pspell enabled
23 * src/insets/figinset.C: workaround for gs hang xforms bug
25 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
27 * lib/bind/??_menus.bind: comment out the entries corresponding to
28 real menus. They should be eventually removed, but I'll let the
29 language maintainers do that.
31 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
33 * src/frontends/kde/parageneraldlg.C:
34 * src/frontends/kde/parageneraldlg.h: don't use
35 a derived class for SpaceAbove/Below
37 * src/frontends/kde/dlg/README: add some info
39 * src/frontends/kde/dlg/*: update data files, update
42 * src/frontends/kde/dlg/moc/Makefile.am: add
45 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
47 * configure.in: add new KDE Makefiles
48 * src/vspace.h: return GlueLength not a normal one
49 * src/support/lstrings.h:
50 * src/support/lstrings.C: add isStrUnsignedInt(),
53 * src/frontends/kde/*: big reorganisation, update
54 FormParagraph, add FormTabCreate
56 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
58 * lib/ui/default.ui: small grammatical change.
60 * src/frontends/xforms/xform_macros.h: removed.
62 * src/frontends/xforms/FormBase.C:
63 * src/frontends/xforms/FormPreferences.C:
64 * src/frontends/xforms/Makefile.am: changes associated with removing
65 xform_macros.h. Should make Lars' debugging a little easier.
67 * src/frontends/xforms/FormPreferences.C:
68 * src/frontends/xforms/FormPreferences.h:
69 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
70 longer use X11 color name database. HSV and RGB dials/sliders.
71 Please let this be the end of this!
73 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
75 * Several files: Allow compilation when the compiler doesn't
78 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
81 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
84 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
86 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
87 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
90 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
92 * src/frontends/xforms/FormRef.C (updateBrowser):
93 * src/frontends/xforms/forms/form_ref.fd: try clicking on
94 different insets with the sort key active. Now apply this patch!
96 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
98 * src/frontends/xforms/FormPrint.C: set to valid()
99 when we update from the passed parameters.
101 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
103 * src/LColor.C (getFromGUIName): internationalise the comparison.
105 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
106 FormPreferences choice.
108 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
111 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
113 * src/lyxrc.C: more detail for the printer program config
116 * src/LColor.C: ert->latex text. LColor needs a big revamp
117 but will have to wait till after 1.1.6
119 * src/buffer.C: bring up a dialog if we load a document
120 with an un-installed text class, rather than just complain
123 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
125 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
126 the browser form for a combox in a tabbed folder. Bug fix courtesy of
127 Steve Lamont <spl@ncmir.ucsd.edu>.
129 * src/frontends/xforms/FormDocument.C (build):
130 * src/frontends/xforms/FormPreferences.C (Language::build):
131 pass tabfolders to Combox::add() in order to use this work around.
133 * src/frontends/xforms/FormCitation.C (connect): remove max size
135 (update): sort list of bibliography keys.
137 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
139 No max size limitation. Same popup for new and existing insets. Fixes
140 bugs reported by Rob Lahaye.
142 * src/frontends/xforms/FormCitation.C (c-tor):
143 * src/frontends/xforms/FormCopyright.C (c-tor):
144 * src/frontends/xforms/FormError.C (c-tor):
145 * src/frontends/xforms/FormGraphics.C (c-tor):
146 * src/frontends/xforms/FormIndex.C (c-tor):
147 * src/frontends/xforms/FormRef.C (c-tor):
148 * src/frontends/xforms/FormToc.C (c-tor):
149 * src/frontends/xforms/FormUrl.C (c-tor):
150 use correct policy for ButtonController.
152 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
154 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
157 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
159 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
160 Some resizing changes.
162 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
164 * configure.in: fix typo
166 * lib/languages: add ukraninian and change no to no_NO
168 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
170 * src/bufferview_funcs.C (FontSize): use setLyXSize
172 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
174 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
175 to check for systems where mkstemp() is available but not declared
176 in headers. The new autoconf macro lyx_CHECK_DECL can be used
177 to check for declarations in headers.
179 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
181 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
183 * forms/makefile: added bibforms.fd, include_form.fd.
184 Removed lyx_sendfax.fd.
186 * src/LaTeXLog.C (ShowLatexLog):
187 * src/LyXAction.C (init):
188 * src/bufferparams.C (readLanguage): altered messages as suggested by
191 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
194 * src/credits.C: made fd_form_credits non-static, so that it can be
195 redrawn should the xforms colors be re-mapped.
196 * src/spellchecker.C ditto fd_form_spell_options.
198 * src/filedlg.[Ch] (redraw):
199 * src/intl.[Ch] (redraw):
200 * src/lyxfr0.[Ch] (redraw):
201 * src/insets/figinset.[Ch] (redraw):
202 * src/insets/insetexternal.[Ch] (redraw):
203 new methods, connected to Dialogs::redrawGUI.
205 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
206 to be connected to Dialogs::redrawGUI.
208 * src/frontends/xforms/FormCitation.C (build):
209 * src/frontends/xforms/FormCopyright.C (build):
210 * src/frontends/xforms/FormError.C (build):
211 * src/frontends/xforms/FormGraphics.C (build):
212 * src/frontends/xforms/FormIndex.C (build):
213 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
214 * src/frontends/xforms/FormToc.C (build):
215 * src/frontends/xforms/FormUrl.C (build):
216 use the ButtonController correctly.
218 * src/frontends/xforms/FormCopyright.C (build):
219 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
220 the .fd file and into build().
222 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
224 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
226 * src/frontends/xforms/forms/form_citation.fd:
227 * src/frontends/xforms/forms/form_copyright.fd:
228 * src/frontends/xforms/forms/form_error.fd:
229 * src/frontends/xforms/forms/form_graphics.fd:
230 * src/frontends/xforms/forms/form_index.fd:
231 * src/frontends/xforms/forms/form_toc.fd:
232 * src/frontends/xforms/forms/form_url.fd:
233 renamed some of the objects. Named others explicitly for the first time.
234 Added Restore and Apply buttons where appropriate.
236 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
239 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
241 * src/version.h: try the pre2 again
243 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
245 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
247 * src/frontends/kde/FormParagraph.C: added using directive.
249 * src/frontends/kde/paradlg.C: added config.h and using directive.
251 * src/frontends/kde/paradlg.h: added std::qualifier.
253 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
255 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
257 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
259 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
261 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
263 * src/version.h: set back to 1.1.6cvs
265 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * src/version.h: set to 1.1.6pre2
269 2000-11-20 Marko Vendelin <markov@ioc.ee>
271 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
273 * src/frontends/gnome/Makefile.am: updated list of XForms object files
275 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
277 * src/LColor.C (init):
278 * src/lyxrc.C (getDescription): changed some comments as suggested by
281 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
282 disconnect the redrawGUI signal in best-practice fashion.
284 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
285 long_opts_tab to reflect the change in name of this tabfolder, as
286 suggested by John Levon.
287 (connect, disconnect): new methods. Don't do much at present other than
288 ensuring that we can't resize the dialog. This just makes xforms go
290 (lots of methods in Colors): made void rather than bool. The idea is
291 to have an isOk() function that keeps track of whether any input is
292 genuinely invalid and should therefore block Save, Apply.
293 Easier to manipulate the counters rapidly.
294 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
295 compiler will like this code. Much cleaner way of doing things.
297 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
299 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
300 rather than simple counters, following suggestion by John Levon.
302 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
303 than engraved frame + text.
305 * src/frontends/xforms/forms/makefile: removed spurious command.
307 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
309 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
311 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
314 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
316 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
317 see what Lars has changed and what is just white space!
318 Now used X directly to ascertain the RGB color associated with the
320 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
322 Added some sort capability.
323 The X11 color name database input is only displayed if the database
324 isn't found in the standard place.
325 Got rid of struct compare_converter; it wasn't used.
326 Probably some other stuff that I've forgotten.
328 * src/frontends/xforms/FormPreferences.h: changed the names of some
329 methods in the Colors struct. Added a couple of structs to help sort
330 colors by name and by RGBColor.
332 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
333 functions into a new class RWInfo.
335 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
336 The dialog is now almost navigable using the keyboard. Unfortunately,
337 the cursor has to be inside a browser for it to be activated. There is
338 no visual feedback for the key shortcuts to the arrow keys (use
339 Alt-appropriate arrow key, Alt-x).
341 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
344 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
345 xform_helpers.[Ch]. See above.
347 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
349 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
351 * src/screen.C (setCursorColor): new method. Sets the color of the
353 (ShowManualCursor): call it.
354 Constify some local variables.
356 * src/LColor.[Ch] (LColor): add entry for cursor
357 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
360 2000-11-19 Juergen Vigna <jug@sad.it>
362 * src/insets/insettabular.C (draw): fixed text border redraw problem.
363 (calculate_dimensions_of_cells): try to boost up when inserting chars.
365 2000-11-15 Rob Lahaye <lahaye@postech.edu>
367 * lib/ui/default.ui: OptItem used for Fax entry
369 2000-11-17 Matej Cepl <cepl@bigfoot.com>
371 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
373 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
375 * src/vspace.C (nextToken): fix so it can handle length phrases like
376 "10mm+-20mm", "40inplus16mmminus10cm" etc.
378 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
380 * src/frontends/xforms/FormPreferences.C: constify several variables
381 (BrowserLyX): rewrite to not need the choice variable
382 (Modify): rewrite to not need the choide variable
383 (compare_converter): make operator const
385 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
386 correct the writing of \set_color
387 (getDescription): return a const string
389 * src/kbsequence.[Ch] (addkey): remove dead code
391 * src/Painter.C (text): remove some commented code
393 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/ColorHandler.[Ch]: removed some header files from .h file.
396 Included LColor.h in .C file.
398 * src/LColor.[Ch]: made class copyable so that I could create a
399 system_lcolor instance.
401 * src/Painter.h: removed LColor.h.
403 * src/lyx_gui.C (create_forms): used AddName.
405 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
406 of user preferences/lyxrc file.
408 * src/lyxrc.C (output): output changes to lcolor.
410 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
412 Moved class xformColor to files xform_helpers.[Ch]. These files,
413 Color.[Ch], could now be moved into src if they would be useful to
416 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
417 Also moved FormPreferences::browseFile here as it can be used by any
418 xform dialog with a "Browse" button. FormGraphics is a perfect example.
420 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
421 ReadableFile): changed the FormPreferences methods a little and moved
422 them here as they'll be useful elsewhere also.
424 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
425 Removed some header files and used forward declarations instead.
427 Removed some methods as they'll be useful elsewhere (see above).
429 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
430 Can also now modify the LyX LColors. However, for reasons that I don't
431 yet understand, it appears that we can use
432 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
433 present. The problem appears to lie in ColorHandler, because I can
434 change the color using LColor.SetColor(). Similarly, when reading in a
435 preferences file with some set_color instances, I'll get a warning
436 like: Color sea green is undefined or may not be redefined
437 Bad lyxrc set_color for sea green
439 Once the buffer is loaded, however, I can happily change to this color.
441 Finally, it appears that I have to set the color of "inset frame"
442 explicitly, or it oscillates from "black" to "indian red" with each
445 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
447 * ANNOUNCE: corrected a spelling mistake.
449 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
452 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
454 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
456 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
459 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
460 match the requirements from the standard better. This is required
461 to work with gnu libstdc++-v3
463 * src/frontends/xforms/FormPreferences.C: add explict pair
464 arguments to browse calls. include support/lyxmanip.h remvoe
465 extern fmt. whitespace changes. reorder variables in
466 FormPreferences.h, to match initalizaton order.
468 * several files: constify more local variables.
470 * src/buffer.C: remove some commented functions.
472 * src/DepTable.C (remove_files_with_extension): temporary
473 work around for gcc 2.97
474 * src/filedlg.C (find): ditto
475 * src/Variables.C (set): ditto
476 * src/LyXAction.C (searchActionArg): ditto
477 (retrieveActionArg): ditto
479 * configure.in: check for mktemp too
481 * UPGRADING: prepare for 1.1.6
483 * Makefile.am (lgbtags): add backup tags for when etags are
484 different than usual.
486 * ANNOUNCE: prepare for 1.1.6
488 * src/support/tempname.C (make_tempfile): new function, wrapper
489 around mkstemp and mktemp. Only mkstemp has been tested.
492 2000-11-14 Rob Lahaye <lahaye@postech.edu>
494 * default.ui: capitalized some menu items to improve shortcuts.
496 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
498 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
500 * src/frontends/xforms/Dialogs.C: add "using" directive.
502 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
504 * src/filedlg.C (Select): highlight suggested file in browser, if
507 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
508 each tab folder is encapsulated in its own class.
509 The Language keymaps are now chosen using a text input and a
510 browser button, rather than a Combox.
511 All the browser buttons are now functional, although LyXFileDlg
512 still needs to be modified to make it straighhtforward to return a
513 directory if that is what is desired.
515 * src/frontends/xforms/forms/form_preferences.fd: use text input
516 and browse button to input the Language keymaps. Add a few
517 callbacks for the browse buttons.
519 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
521 * src/support/tempname.C (tempName): small changes to make it
522 safer. remove the '.' before XXXXXX
524 * src/support/filetools.C (TmpFileName): remove func
527 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
528 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
529 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
530 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
532 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
535 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
538 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
539 for bp (this fixes a reproducible hard crash)
541 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
544 * src/frontends/xforms/FormBase.h: make bp_ private
545 (FormBaseBI): remove default for bp
548 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
551 * src/frontends/xforms/Color.C (RGBColor): made several vars
552 const, changed initialization of j to allow it to be const
555 * several files: added const to local variables.
557 * src/lyx_cb.C: removed several function prototypes and moved them
561 (UpdateLayoutPreamble):
563 (MenuInsertLabel): add BufferView as arguemnt
564 (LayoutsCB): make tmp const
566 * src/layout_forms.h: regenerated
568 * src/debug.C: add Debug::FILES
569 (showLevel) (showTags): translate the desc
571 * src/debug.h: add FILES as debug target
573 * src/bufferlist.C: use current_view as an interim measure becuase
574 of added arguments to MenuWrite and MenuWriteAs
576 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
578 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
580 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
581 libstdc++ is compiled with.
583 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
585 * lib/layouts/docbook-book.layout
586 * lib/layouts/docbook.layout
587 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
588 those paragraphs are expresse as SGML comments <!-- -->.
590 * src/LaTeXFeatures.h
591 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
592 parameter, this allows to express all the include files as relative
593 paths to the master buffer. The verbatim insert works as the other
596 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
598 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
600 (MakeDocBookFile): top_element is always written. Some clean up, as
601 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
603 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
604 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
605 a reference is written instead of the name.
606 (Validate): use the relative path for the filename.
608 * src/insets/insetlabel.C (DocBook): write end tag, for XML
611 * src/support/filetools.h
612 * src/support/filetools.C (IsSGMLFilename): added.
615 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
617 * development/OS2/quick_fix.patch:
619 * README.OS2: quick update to the OS/2 port.
621 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
623 * src/converter.C: add "using" directive.
625 * src/frontends/xforms/FormPreferences.C: add "using" directive.
626 (compare_converter): add "int" as return type.
628 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
631 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
633 * src/lyx_gui.C (create_forms): map the xform colours, should a
634 mapping exist. Ie, call XformColor::read().
636 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
637 and struct HSV as HSVColor.
638 (XformColor::read, XformColor::write) : new methods that
639 input/output any changes to the cform GUI colors.
641 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
644 * src/frontends/xforms/FormPreferences.C Lots of little changes
645 associated with the changed name of the RGB and HSV structs. Can
646 now save changes to xforms GUI to file. Commented out
647 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
648 used currently anyway.
650 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
652 * src/converter.C: A lot of changes:
653 - It is no longer possible to choose between two or more ways to
654 export to some format (the new code uses only the shortest path).
655 However, it is still possible to choose between pdflatex/ps2pdf
656 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
657 - Added several methods that makes the FormPreferences code simpler.
658 - Changed the tokens $$FName and $$OutName to $$i and $$o.
660 * src/exporter.C (Export): lyxrc.use_pdf is set before
661 makeLaTeXFile is called. This works but not very nice.
663 * src/frontends/xforms/FormPreferences.C: The formats/converters
664 tabs are now fully functional.
666 * src/buffer.C (getTocList): Add numbers to the captions.
668 * lib/lyxrc.example: Removed fax section
670 * src/support/rename.C (rename): Delete the old file if lyx::copy
673 2000-11-13 Rob Lahaye <lahaye@postech.edu>
675 * lib/ui/default.ui: minor polishing.
677 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
679 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
682 * lib/Makefile.am (DOCINST): do not install everything in the
683 documentation directory.
685 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
687 * src/bufferlist.C (newFile): set the filename to the constructed
690 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
691 constructed "newfileXX.lyx" name to the dialog
693 * src/frontends/DialogBase.h: make update() non-abstract so
694 KDE doesn't need to implement two update methods for every form
696 * src/frontends/kde/Makefile.am: add missing xforms objects
699 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
701 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
703 * src/frontends/xforms/Color.[Ch]: new files, defining the color
704 structs RGB and HSV. May not be the best place for these files.
705 Perhaps move them into src ?
707 * src/frontends/xforms/Makefile.am: added new files.
709 * src/frontends/xforms/forms/form_preferences.fd:
710 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
711 replaced all instances of "colour" with "color"!
713 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
716 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
717 tab. Can now alter the colors of the xform's GUI on the fly. With
718 the aid of a single static Signal (see below), can "Apply" these
719 changes to all currently open dialogs. (Well, to all of the NEW
720 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
721 subsequently opened dialogs will, of course, also have the new
722 color scheme. Cannot yet save (or load) the choices to file, so
723 they are lost when exiting LyX.
725 * src/frontends/Dialogs.h:
726 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
727 Used to trigger a redraw of any dialogs connected to it because,
728 for example, the GUI colours have been re-mapped.
730 * src/frontends/xforms/FormBase.[Ch]:
731 * src/frontends/xforms/FormDocument.[Ch]:
732 * src/frontends/xforms/FormParagraph.[Ch]:
733 * src/frontends/xforms/FormPreferences.[Ch]:
734 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
735 method, to be connected to Dialogs::redrawGUI. Method must be
736 virtual, because dialogs with tabbed folders need to redraw the
737 forms of each tab folder.
739 * src/LyXView.C (d-tor):
740 * src/frontends/xforms/FormBase.C (d-tor): connected
741 Dialogs::redrawGUI signal to redraw().
743 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
744 removed Assert, because it is identical to that in FormBase.
746 2000-11-10 Rob Lahaye <lahaye@postech.edu>
748 * lib/ui/default.ui: minor polishing.
750 2000-11-10 Juergen Vigna <jug@sad.it>
752 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
753 (deleteLyXText): ditto
755 * src/insets/insettabular.C (InsetButtonPress): don't clear the
756 selection on mouse-button-3.
758 * src/insets/insettabular.h: new function clearSelection(), use this
759 functions inside insettabular.C.
761 * src/insets/insettabular.C (TabularFeatures): clear the selection
762 on remove_row/column.
764 * src/insets/inset.C (scroll): fixed some scroll stuff.
766 * src/insets/insettabular.C (draw): fixed another minor draw problem.
768 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
770 * lib/CREDITS: add Yves Bastide
772 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
774 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
775 check whether C library functions are in the global namespace.
777 * configure.in: calls it.
779 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
782 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
784 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
785 iterators to prevent crash.
787 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
789 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
791 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
792 shortcut for xforms CB to the preemptive or post-handler function.
794 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
795 removed the HIDDEN_TIMER as it's no longer used.
796 Various other small changes.
798 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
799 preemptive handler to obtain feedback, rather than the post-handler.
800 (ColoursLoadBrowser): find "black" and "white" based on RGB values
802 Formats tab is now complete. Converters tab is nearly so.
804 2000-11-09 Juergen Vigna <jug@sad.it>
806 * src/insets/insettext.C (~InsetText):
809 (SetParagraphData): set cache.second to 0 after deleting it!
810 (getLyXText): check if cache.second is not 0 if finding it.
812 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
814 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
815 lyxlex to parse the rgb.txt file.
818 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
819 replace the default '#' comment character.
821 * src/support/tempname.C: add "using" directive
822 * src/frontends/ButtonPolicies.C: ditto.
824 * src/support/filetools.C (DirList): add an explicit cast to avoid
825 a compile error (probably not the right fix)
827 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
829 * src/support/filetools.C (DirList): implement using system functions
831 * src/support/tempname.C: new file
833 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
835 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
837 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
840 * src/frontends/xforms/ButtonController.C: new file
842 * src/os2_defines.h: remove getcwd define
844 * src/lyxvc.C: include support/lyxlib.h
845 (showLog): use lyx::tempName
847 * src/lyx_cb.C: comment out includes that we don't need
848 (AutoSave): use lyx::tempName
850 * src/filedlg.C: include support/lyxlib.h
851 (Reread): use lyx::getcwd
853 * src/converter.C: include support/filetools.h
854 (add_options): change to static inline, make tail const
855 (Add): make old_viewer const
856 (GetAllFormats): make it a const method, use const_iterator
857 (enable): make static inline
858 (SplitFormat): make using_format const
860 * src/LaTeX.C (run): use lyx::getcwd
862 * configure.in: check for mkstemp as well
864 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
866 * src/converter.[Ch] (GetAllCommands): new method.
868 * src/support/filetools.[Ch] (DirList): new method.
870 * src/frontends/xforms/FormPreferences.C: started (just!) adding
871 functionality to the converters tab.
872 The formats tab is now nearly complete.
873 The kbmap choices in Languages tab now display the contents of
874 system_lyxdir/kbd/*.kmap in readable form.
876 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
877 Moved some variables into the class.
879 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
880 inactive tab folder to FL_COL1. Haven't yet worked out how to change
881 colour of active folder to lighter grey instead. Any takers?
882 (form_colours): added an "Apply" button.
883 (form_converters): added a "Flags" input field.
884 (form_formats): added a "Shortcut" input field. Note that we can't use
885 names such as "input_shortcut" as this buggers up the sed script stuff.
887 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
895 * src/lyx_sendfax_main.C:
898 * src/spellchecker.C:
899 * src/insets/figinset.C:
900 * src/insets/insetbib.C:
901 * src/insets/insetexternal.C:
902 * src/insets/insetinclude.C:
903 * src/insets/insetinfo.C:
904 * src/mathed/math_panel.C:
905 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
906 all "daughter" dialogs now have identical "feel".
908 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
910 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
911 used (and was only used in one place prior to this patch. Incorrectly!)
913 * src/frontends/xforms/FormDocument.C: changed some instances of
914 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
915 sense. Also added fl_set_input_return() for class_->input_doc_extra and
916 for options_->input_float_placement. This fixes a bug reported by
919 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
920 functionality into d-tor.
922 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
923 input of numerals also.
925 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
926 fl_set_form_atclose(). Can now close dialog from window manager,
927 fixing a bug reported by Rob Lahaye.
929 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
931 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
932 are no longer dark. Haven't yet worked out how to lighten the colour of
933 the active tabfolder. Any ideas anybody?
934 Adjusted Colours tab a little.
935 Added Shortcut field to converters tab. Note that we can't create an
936 fdesign label like "input_shortcut" as this buggers up the sed-script
939 * src/frontends/xforms/FormPreferences.[Ch]:
940 (feedback): fixed crash due to to ob=0.
941 (LanguagesXXX): the kbmap choices now contain the files
942 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
943 be replaced by an input with a file browse button, but since the browse
944 buttons don'y yet work, this'll do for the moment.
945 (FormatsXXX): think that this is now nearly fully functional.
946 Some points/questions though:
947 1. Does "Apply" remove formats if no longer present?
948 2. I think that the browser should list the GUI names rather than the
950 3. Must ensure that we can't delete Formats used by an existing
953 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
954 if this is the best way to do this.
956 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
958 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
960 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
961 for variable assignment.
963 2000-11-07 Rob Lahaye <lahaye@postech.edu>
965 * src/lib/ui/default.ui: added sub/superscripts to menu as
966 Insert->Special characters and cleaned-up the file a bit
968 2000-11-07 Allan Rae <rae@lyx.org>
970 * src/frontends/xforms/FormPreferences.C (feedback): make sure
971 ob isn't 0 before using it. See comments in function.
973 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
975 * src/frontends/xforms/form_*.C: regenerated
977 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
979 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
981 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
982 compiling with gcc-2.96
984 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
986 * src/support/lyxstring.C: add a couple "using" directives.
988 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
989 a .c_str() here too for good measure.
990 * src/Spacing.C (set): ditto.
991 * src/lyxfunc.C (Dispatch): ditto.
993 * src/insets/insettabular.C (copySelection): change .str() to
994 .str().c_str() to fix problems with lyxstring.
995 * src/support/filetools.C (GetFileContents): ditto.
996 * src/buffer.C (asciiParagraph): ditto.
997 * src/paragraph.C (String): ditto.
999 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1000 * lib/bind/sciword.bind: ditto.
1002 * src/LyXAction.C (init): remove "symbol-insert" function, which
1003 shared LFUN_INSERT_MATH with "math-insert".
1005 * lib/configure.m4: == is not a valid operator for command test.
1007 * src/lyxrc.C: add using directive.
1009 * src/converter.h: add std:: qualifier.
1011 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1013 * src/converter.[Ch] and other files: Change the Format class to a
1014 real class, and create two instances: formats and system_format.
1016 * src/lyxrc.C (output): Output the difference between formats and
1019 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1020 (buildFormats): Insert formats into browser.
1021 (inputFormats): Made the browser and add button functional.
1022 (applyFormats): Update formats from format_vec.
1024 * src/converter.C: Changed all (*it). to it->
1025 (Format::dummy): New method.
1026 (Format::importer): New format flag.
1027 (Formats::GetAllFormats): New method.
1028 (Formats::Add): Delete format from the map if prettyname is empty.
1029 (Converter::Convert): Print an error message if moving the file fails.
1030 (Converter::GetReachableTo): New method
1032 * src/MenuBackend.[Ch]: Add support for importformats tag.
1034 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1036 * lib/configure.m4: Add word->tex and ps->fax converters.
1038 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1039 Return fax to file menu.
1043 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1045 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1048 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1051 * src/lyxfunc.C (processKeyEvent): removed
1053 * src/bufferlist.C (emergencyWrite): removed the out commented
1054 emergency write code.
1056 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1058 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1060 * many files: change formatting to be a bit more uniform for
1061 if,while,for,switch statements, remove some parantesis not needed.
1064 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1066 * config/kde.m4: make config more robust when KDEDIR is set
1068 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1070 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1071 not returned a pixmap for "math-insert".
1073 * src/LyXAction.C (init): sort the entries a bit.
1075 2000-11-03 Juergen Vigna <jug@sad.it>
1077 * src/insets/insettabular.h: added fixed number to update codes so
1078 that update is only in one direction.
1080 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1083 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1084 before call to edit because of redraw.
1086 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1088 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1090 * lib/ui/default.ui: Populate "edit_float" menu
1092 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1094 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1095 "floats-operate". The name is ugly (and the func also), but this
1096 is just a band-aid until we switch to new insets.
1098 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1100 * lib/ui/default.ui: update again the menu layout (fix some
1103 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1105 * src/MenuBackend.h (fulllabel): new method.
1107 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1108 the menu shortcuts of a menu are unique and whether they
1109 correspond to a letter of the label.
1110 (expand): call checkShortcuts when debugging.
1112 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1114 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1116 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1118 * lib/examples/*.lyx : '\language default' => '\language english'
1120 * lib/examples/it_splash.lyx : except where it should be italian
1122 * lib/templates/*.lyx : the same
1124 * doc/*.lyx* : the same
1126 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1128 * lib/bind/menus.bind: remove the Layout menu entries, which I
1129 somehow forgot earlier.
1131 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1133 * lib/ui/old-default.ui: keep the old one here for reference (to
1136 * lib/ui/default.ui: update the menu layout
1138 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1140 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1141 Can now Apply to different insets without closing the dialog.
1143 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1144 Can't actually DO anything with them yet, but I'd like a little
1147 * src/frontends/xforms/input_validators.[ch]
1148 (fl_lowercase_filter): new.
1150 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1152 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1153 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1155 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1157 2000-11-02 Juergen Vigna <jug@sad.it>
1159 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1160 on char insertion as it has already be updated by bv->updateInset().
1162 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1163 if an inset inside was updated.
1165 * lib/configure.cmd: commented out fax-search code
1167 2000-11-01 Yves Bastide <stid@acm.org>
1169 * src/tabular.C (OldFormatRead): set tabular language to the
1172 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1175 class names with non-letter characters (from Yves Bastide).
1177 * lib/ui/default.ui: change Item to OptItem in import menu.
1178 Comment out fax stuff.
1180 * lib/configure.m4: comment out fax-related stuff.
1182 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1184 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1185 useful xforms helper functions. At present contains only formatted().
1186 Input a string and it returns it with line breaks so that in fits
1189 * src/frontends/xforms/Makefile.am: add new files.
1191 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1192 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1195 * src/frontends/xforms/FormPreferences.[Ch]:
1196 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1197 but lots of little clean ups. Removed enum State. Make use of
1198 formatted(). Constify lots of methods. Perhaps best of all: removed
1199 requirement for that horrible reinterpret_cast from pointer to long in
1202 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1204 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1205 conditionalize build on xforms < 0.89
1207 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1209 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1211 * src/LyXAction.C (init): comment out fax
1213 * src/lyxrc.h: comment out the fax enums
1214 comment out the fax variables
1216 * src/commandtags.h: comment out LFUN_FAX
1218 * src/lyxrc.C: disable fax variables.
1219 (read): disable parsing of fax variables
1220 (output): disable writing of fax variables
1221 (getFeedback): now description for fax variables
1223 * src/lyxfunc.C: comment out MenuFax
1224 (Dispatch): disable LFUN_FAX
1226 * src/lyx_cb.C (MenuFax): comment out
1228 * src/WorkArea.C: add <cctype>
1229 (work_area_handler): better key handling, should be ok now.
1230 for accented chars + etc
1232 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1233 lyx_sendfax.h and lyx_sendfax_man.C
1235 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1236 (show): don't call InitLyXLookup when using xforms 0.89
1238 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1240 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1242 * src/support/filetools.C (GetFileContents): close to dummy change
1244 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1246 * src/trans.C (AddDeadkey): workaround stupid compilers.
1248 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1250 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1251 of two-sided document.
1253 2000-10-31 Juergen Vigna <jug@sad.it>
1255 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1257 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1258 xposition to the Edit call.
1260 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1262 * src/trans.C (AddDeadkey): cast explicitly to char.
1264 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1266 * src/tabular.C (AsciiBottomHLine): simplify?
1267 (AsciiTopHLine): simplify?
1268 (print_n_chars): simplify
1269 (DocBook): remove most of the << endl; we should flush the stream
1270 as seldom as possible.
1272 (TeXBottomHLine): ditto
1273 (TeXTopHLine): ditto
1275 (write_attribute): try a templified version.
1276 (set_row_column_number_info): lesson scope of variables
1278 * src/support/lstrings.h (tostr): new specialization of tostr
1280 * src/trans.C (AddDeadkey): slightly cleaner fix.
1282 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1284 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1285 '%%' in Toc menu labels.
1288 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1289 font_norm is iso10646-1.
1291 * src/font.C (ascent): Fixed for 16bit fonts
1292 (descent,lbearing,rbearing): ditto
1294 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1296 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1297 (getFeedback): new static method.
1299 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1300 Now use combox rather than choice to display languages.
1301 Feedback is now output using a new timer callback mechanism, identical
1302 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1304 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1306 * src/minibuffer.C: fix for older compilers
1308 2000-10-30 Juergen Vigna <jug@sad.it>
1310 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1311 has to be Left of the inset otherwise LyXText won't find it!
1313 * src/BufferView2.C (open_new_inset): delete the inset if it can
1316 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1318 * lyx.man: fix typo.
1320 2000-10-29 Marko Vendelin <markov@ioc.ee>
1321 * src/frontends/gnome/FormCitation.C
1322 * src/frontends/gnome/FormCitation.h
1323 * src/frontends/gnome/FormCopyright.C
1324 * src/frontends/gnome/FormCopyright.h
1325 * src/frontends/gnome/FormError.C
1326 * src/frontends/gnome/FormError.h
1327 * src/frontends/gnome/FormIndex.C
1328 * src/frontends/gnome/FormIndex.h
1329 * src/frontends/gnome/FormPrint.C
1330 * src/frontends/gnome/FormPrint.h
1331 * src/frontends/gnome/FormRef.C
1332 * src/frontends/gnome/FormRef.h
1333 * src/frontends/gnome/FormToc.C
1334 * src/frontends/gnome/FormToc.h
1335 * src/frontends/gnome/FormUrl.C
1336 * src/frontends/gnome/FormUrl.h
1337 * src/frontends/gnome/Menubar_pimpl.C
1338 * src/frontends/gnome/mainapp.C
1339 * src/frontends/gnome/mainapp.h
1340 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1341 changing update() to updateSlot() where appropriate
1343 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1345 * src/frontends/xforms/FormPreferences.[Ch]:
1346 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1349 2000-10-28 Juergen Vigna <jug@sad.it>
1351 * src/insets/insettabular.C (draw): fixed drawing bug.
1353 * src/insets/insettext.C (clear):
1355 (SetParagraphData): clearing the TEXT buffers when deleting the
1356 paragraphs used by it.
1358 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1360 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1362 2000-10-27 Juergen Vigna <jug@sad.it>
1364 * src/tabular.C (~LyXTabular): removed not needed anymore.
1366 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1369 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1371 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1374 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1377 * src/frontends/xforms/FormPreferences.[Ch]:
1378 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1379 Reorganised as modules based on tabs. Much easier to follow the
1380 flow and to add new tabs. Added warning and feedback messages.
1383 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1385 * src/tabular.h (DocBook): add std:: qualifier.
1387 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1389 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1390 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1393 * insettabular.C (DocBook): uses the tabular methods to export
1396 * src/insets/insettext.h
1397 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1399 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1401 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1404 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1405 moved misplaced AllowInput two lines up.
1407 * src/buffer.C (readFile): compare float with float, not with int
1409 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1411 * src/minibuffer.C: add "using SigC::slot" statement.
1413 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1415 * src/frontends/xforms/forms/README: updated section about make.
1417 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1418 Tidied some forms up, made two of form_tabular's tabs more
1419 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1420 fixed translation problem with "Column".
1422 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1424 * src/minibuffer.h: use Timeout instead of the xforms timer
1426 (setTimer) rewrite for the Timeout, change to unsigned arg
1427 (set): change to unsigned timer arg
1430 * src/minibuffer.C (TimerCB): removed func
1431 (C_MiniBuffer_TimerCB): removed func
1432 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1433 (peek_event): use a switch statement
1434 (add): don't use fl_add_timer.
1435 (Set): rewrite to use the Timeout
1438 * src/Timeout.[Ch] (setType): return a Timeout &
1439 (setTimeout): ditto, change to unsigned arg for timeout
1441 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1443 * src/mathed/formula.C (mathed_string_width): Use string instead
1444 of a constant size char array.
1446 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1448 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1449 the two recently added operator<< for SMInput and State.
1451 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1453 (OkCancelPolicy): ditto
1454 (OkCancelReadOnlyPolicy): ditto
1455 (NoRepeatedApplyReadOnlyPolicy): ditto
1456 (OkApplyCancelReadOnlyPolicy): ditto
1457 (OkApplyCancelPolicy): ditto
1458 (NoRepeatedApplyPolicy): ditto
1460 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1462 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1463 add the usual std:: qualifiers.
1465 2000-10-25 Juergen Vigna <jug@sad.it>
1467 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1469 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1471 * src/support/filetools.C (MakeRelPath): change some types to
1474 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1475 ButtonPolicy::SMInput and ButtonPolicy::State.
1477 * src/FontLoader.C (reset): small cleanup
1478 (unload): small cleanup
1480 * src/FontInfo.C (getFontname): initialize error to 10000.0
1482 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1484 * src/frontends/xforms/FormPreferences.[Ch]:
1485 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1486 TeX encoding and default paper size sections.
1488 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1490 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1493 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1494 make the message_ empty.
1495 (FormError): don't initialize message_ in initializer list.
1497 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1499 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1501 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1503 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1505 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1507 * src/frontends/kde/*data.[Ch]: _("") is not
1510 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1512 * src/buffer.C: removed redundant using directive.
1514 * src/frontends/DialogBase.h: revert to original definition of
1517 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1518 stuff into two classes, one for each dialog, requires a new
1519 element in the dialogs vector, FormTabularCreate.
1521 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1524 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1525 method. Continues Allan's idea, but means that derived classes
1526 don't need to worry about "update or hide?".
1528 * src/frontends/xforms/FormError.C (showInset): add connection
1531 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1532 one for each dialog. FormTabular now contains main tabular dialog
1535 * src/frontends/xforms/FormTabularCreate.[Ch]:
1536 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1539 * src/frontends/xforms/FormGraphics.[Ch]:
1540 * src/frontends/xforms/forms/form_graphics.fd
1541 * src/frontends/xforms/FormTabular.[Ch]:
1542 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1543 classes of FormInset.
1545 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1546 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1548 * src/frontends/xforms/Makefile.am:
1549 * src/frontends/xforms/forms/makefile: added new files.
1551 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1552 variable. added Signal0 hide signal, in keeping with other GUI-I
1555 * src/support/lstrings.h: removed redundant std:: qualifier as
1556 it's already declared in Lsstream.h.
1558 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1560 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1564 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1566 * src/tabular.C (Ascii): minimize scope of cell.
1568 * src/BufferView2.C (nextWord): return string() instead of 0;
1570 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1572 * src/converter.h: add a std:: qualifier
1574 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1576 * src/importer.[Ch]: New files. Used for importing files into LyX.
1578 * src/lyxfunc.C (doImport): Use the new Importer class.
1580 * src/converter.h: Add shortcut member to the Format class.
1581 Used for holding the menu shortcut.
1583 * src/converter.C and other files: Made a distinction between
1584 format name and format extension. New formats can be defined using
1585 the \format lyxrc tag.
1586 Added two new converter flags: latex and disable.
1588 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1590 * src/support/lyxlib.h: unify namespace/struct implementation.
1591 Remove extra declarations.
1593 * src/support/chdir.C (chdir): remove version taking char const *
1595 * src/support/rename.C: ditto.
1596 * src/support/lyxsum.C: ditto.
1598 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1600 * src/frontends/xforms/FormBase.[Ch]:
1601 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1602 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1603 work only for the next call to fl_show_form(). The correct place to set
1604 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1605 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1606 from FormBase have the minimum size set; no more stupid crashes with
1609 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1611 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1613 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1615 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1617 * src/support/lyxlib.h: changed second argument of mkdir to
1618 unsigned long int (unsigned int would probably have been enough,
1619 but...). Removed <sys/types.h> header.
1620 * src/support/mkdir.C (mkdir): ditto.
1624 2000-10-19 Juergen Vigna <jug@sad.it>
1626 * src/lyxfunc.C (MenuNew): small fix (form John)
1628 * src/screen.C (Update): removed unneeded code.
1630 * src/tabular.C (Ascii): refixed int != uint bug!
1632 * src/support/lyxlib.h: added sys/types.h include for now permits
1633 compiling, but I don't like this!
1635 2000-10-18 Juergen Vigna <jug@sad.it>
1637 * src/text2.C (ClearSelection): if we clear the selection we need
1638 more refresh so set the status apropriately
1640 * src/insets/insettext.C (draw): hopefully finally fixed draw
1643 2000-10-12 Juergen Vigna <jug@sad.it>
1645 * src/insets/insettext.C (draw): another small fix and make a block
1646 so that variables are localized.
1648 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1650 * src/support/lstrings.C (lowercase, uppercase):
1651 use explicit casts to remove compiler warnings.
1653 * src/support/LRegex.C (Impl):
1654 * src/support/StrPool.C (add):
1655 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1656 (AddPath, MakeDisplayPath):
1657 * src/support/lstrings.C (prefixIs, subst):
1658 use correct type to remove compiler warnings.
1660 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1662 * src/support/lyxlib.h:
1663 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1664 portability and to remove compiler warning with DEC cxx.
1666 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1668 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1670 * src/minibuffer.C (peek_event): retun 1 when there has been a
1671 mouseclick in the minibuffer.
1675 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1677 * src/frontends/xforms/FormParagraph.C: more space above/below
1680 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1682 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1683 a char only if real_current_font was changed.
1685 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1687 * NEWS: update somewhat for 1.1.6
1689 * lib/ui/default.ui: clean up.
1691 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1693 * lib/CREDITS: clean up
1695 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1697 * src/combox.[Ch] (select): changed argument back to int
1698 * src/combox.C (peek_event): removed num_bytes as it is declared but
1701 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1702 modified calls to Combox::select() to remove warnings about type
1705 * src/insets/insetbutton.C (width): explicit cast to remove warning
1706 about type conversion.
1708 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1711 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1712 sel_pos_end, refering to cursor position are changed to
1713 LyXParagraph::size_type.
1715 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1716 consistent with LyXCursor::pos().
1717 (inset_pos): changed to LyXParagraph::size_type for same reason.
1719 * src/insets/insettext.C (resizeLyXText): changed some temporary
1720 variables refing to cursor position to LyXParagraph::size_type.
1722 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1724 * src/frontends/kde/<various>: The Great Renaming,
1727 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1729 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1731 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1733 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1734 0 when there are no arguments.
1736 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1738 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1739 to segfaults when pressing Ok in InsetBibtex dialog.
1741 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1743 * forms/layout_forms.fd:
1744 * src/layout_forms.C (create_form_form_character): small change to use
1745 labelframe rather than engraved frame + text
1747 * src/lyx_gui.C (create_forms): initialise choice_language with some
1748 arbitrary value to prevent segfault when dialog is shown.
1750 2000-10-16 Baruch Even <baruch.even@writeme.com>
1752 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1753 is no resulting file. This pertains only to LaTeX output.
1755 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1757 * src/text.C (Backspace): Make sure that the row of the cursor is
1760 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1763 * src/lyx_gui.C (init): Prevent a crash when only one font from
1764 menu/popup fonts is not found.
1766 * lib/lyxrc.example: Add an example for binding a key for language
1769 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1771 * src/converter.C (GetReachable): Changed the returned type to
1773 (IsReachable): New method
1775 * src/MenuBackend.C (expand): Handle formats that appear more
1778 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1780 * src/frontends/support/Makefile.am
1781 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1784 * lib/CREDITS: add Garst Reese.
1786 * src/support/snprintf.h: add extern "C" {} around the definitions.
1788 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1790 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1793 * src/frontends/xforms/FormDocument.C:
1794 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1795 compile without "conversion to integral type of smaller size"
1798 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1800 * src/text.C (GetColumnNearX): Fixed disabled code.
1802 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1804 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1807 * src/support/snprintf.[ch]: new files
1809 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1811 * src/frontends/kde/formprintdialog.C: add
1812 file browser for selecting postscript output
1814 * src/frontends/kde/formprintdialogdata.C:
1815 * src/frontends/kde/formprintdialogdata.h: re-generate
1818 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1820 * src/frontends/gnome/Makefile.am:
1821 * src/frontends/kde/Makefile.am: FormCommand.C
1822 disappeared from xforms
1824 * src/frontends/kde/FormCitation.C:
1825 * src/frontends/kde/FormIndex.C: read-only
1828 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1830 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1833 * src/bufferlist.C: add using directive.
1835 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1837 * src/support/lyxfunctional.h: version of class_fun for void
1838 returns added, const versions of back_inseter_fun and compare_fun
1841 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1843 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1845 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1847 * ChangeLog: cleanup.
1849 * lib/CREDITS: update to add all the contributors we've forgotten.
1850 I have obviously missed some, so tell me whether there were
1853 2000-10-13 Marko Vendelin <markov@ioc.ee>
1855 * src/frontends/gnome/FormCitation.C
1856 * src/frontends/gnome/FormCitation.h
1857 * src/frontends/gnome/FormError.C
1858 * src/frontends/gnome/FormIndex.C
1859 * src/frontends/gnome/FormRef.C
1860 * src/frontends/gnome/FormRef.h
1861 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1863 * src/frontends/gnome/FormCitation.C
1864 * src/frontends/gnome/FormCopyright.C
1865 * src/frontends/gnome/FormError.C
1866 * src/frontends/gnome/FormIndex.C
1867 * src/frontends/gnome/FormRef.C
1868 * src/frontends/gnome/FormToc.C
1869 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1872 * src/frontends/gnome/Menubar_pimpl.C
1873 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1876 2000-10-11 Baruch Even <baruch.even@writeme.com>
1879 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1880 to convey its real action.
1882 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1883 clear the minibuffer and prepare to enter a command.
1885 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1886 the rename from ExecCommand to PrepareForCommand.
1887 * src/lyxfunc.C (Dispatch): ditto.
1889 2000-10-11 Baruch Even <baruch.even@writeme.com>
1891 * src/buffer.C (writeFile): Added test for errors on writing, this
1892 catches all errors and not only file system full errors as intended.
1894 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1896 * src/lyx_gui.C (create_forms): better fix for crash with
1897 translated interface.
1899 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1901 * src/frontends/kde/Makefile.am:
1902 * src/frontends/kde/FormCopyright.C:
1903 * src/frontends/kde/formcopyrightdialog.C:
1904 * src/frontends/kde/formcopyrightdialog.h:
1905 * src/frontends/kde/formcopyrightdialogdata.C:
1906 * src/frontends/kde/formcopyrightdialogdata.h:
1907 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1908 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1909 copyright to use qtarch
1911 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1913 * src/encoding.C (read): Fixed bug that caused an error message at
1914 the end of the file.
1916 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1918 * lib/lyxrc.example: Fixed hebrew example.
1920 2000-10-13 Allan Rae <rae@lyx.org>
1922 * src/frontends/xforms/FormPreferences.C (input): reworking the
1924 (build, update, apply): New inputs in various tabfolders
1926 * src/frontends/xforms/FormToc.C: use new button policy.
1927 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1928 dialogs that either can't use any existing policy or where it just
1931 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1934 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1935 added a bool parameter which is ignored.
1937 * src/buffer.C (setReadonly):
1938 * src/BufferView_pimpl.C (buffer):
1939 * src/frontends/kde/FormCopyright.h (update):
1940 * src/frontends/kde/FormCitation.[Ch] (update):
1941 * src/frontends/kde/FormIndex.[Ch] (update):
1942 * src/frontends/kde/FormPrint.[Ch] (update):
1943 * src/frontends/kde/FormRef.[Ch] (update):
1944 * src/frontends/kde/FormToc.[Ch] (update):
1945 * src/frontends/kde/FormUrl.[Ch] (update):
1946 * src/frontends/gnome/FormCopyright.h (update):
1947 * src/frontends/gnome/FormCitation.[Ch] (update):
1948 * src/frontends/gnome/FormError.[Ch] (update):
1949 * src/frontends/gnome/FormIndex.[Ch] (update):
1950 * src/frontends/gnome/FormPrint.[Ch] (update):
1951 * src/frontends/gnome/FormRef.h (update):
1952 * src/frontends/gnome/FormToc.[Ch] (update):
1953 * src/frontends/gnome/FormUrl.[Ch] (update):
1954 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1955 to updateBufferDependent and DialogBase
1957 * src/frontends/xforms/FormCitation.[hC]:
1958 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1959 * src/frontends/xforms/FormError.[Ch]:
1960 * src/frontends/xforms/FormGraphics.[Ch]:
1961 * src/frontends/xforms/FormIndex.[Ch]:
1962 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1963 and fixed readOnly handling.
1964 * src/frontends/xforms/FormPrint.[Ch]:
1965 * src/frontends/xforms/FormRef.[Ch]:
1966 * src/frontends/xforms/FormTabular.[Ch]:
1967 * src/frontends/xforms/FormToc.[Ch]:
1968 * src/frontends/xforms/FormUrl.[Ch]:
1969 * src/frontends/xforms/FormInset.[Ch]:
1970 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1971 form of updateBufferDependent.
1973 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1974 if form()->visible just in case someone does stuff to the form in a
1977 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1978 the buttoncontroller for everything the enum used to be used for.
1979 (update) It would seem we need to force all dialogs to use a bool
1980 parameter or have two update functions. I chose to go with one.
1981 I did try removing update() from here and FormBase and defining the
1982 appropriate update signatures in FormBaseB[DI] but then ran into the
1983 problem of the update() call in FormBase::show(). Whatever I did
1984 to get around that would require another function and that just
1985 got more confusing. Hence the decision to make everyone have an
1986 update(bool). An alternative might have been to override show() in
1987 FormBaseB[DI] and that would allow the different and appropriate
1990 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1991 true == buffer change occurred. I decided against using a default
1992 template parameter since not all compilers support that at present.
1994 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1996 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1997 army knife" by removing functionality.
1998 (clearStore): removed. All such housekeeping on hide()ing the dialog
1999 is to be carried out by overloaded disconnect() methods.
2000 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2001 superceded by Baruch's neat test (FormGraphics) to update an existing
2002 dialog if a new signal is recieved rather than block all new signals
2004 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2005 only to Inset dialogs.
2006 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2007 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2009 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2011 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2012 as a base class to all inset dialogs. Used solely to connect/disconnect
2013 the Inset::hide signal and to define what action to take on receipt of
2014 a UpdateBufferDependent signal.
2015 (FormCommand): now derived from FormInset.
2017 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2020 * src/frontends/xforms/FormCopyright.[Ch]:
2021 * src/frontends/xforms/FormPreferences.[Ch]:
2022 now derived from FormBaseBI.
2024 * src/frontends/xforms/FormDocument.[Ch]:
2025 * src/frontends/xforms/FormParagraph.[Ch]:
2026 * src/frontends/xforms/FormPrint.[Ch]:
2027 now derived from FormBaseBD.
2029 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2031 * src/frontends/xforms/FormCitation.[Ch]:
2032 * src/frontends/xforms/FormError.[Ch]:
2033 * src/frontends/xforms/FormRef.[Ch]:
2034 * src/frontends/xforms/FormToc.[Ch]:
2035 (clearStore): reworked as disconnect().
2037 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2040 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2042 * src/converter.C (runLaTeX): constify buffer argument
2045 * src/frontends/support/Makefile.am (INCLUDES): fix.
2047 * src/buffer.h: add std:: qualifier
2048 * src/insets/figinset.C (addpidwait): ditto
2049 * src/MenuBackend.C: ditto
2050 * src/buffer.C: ditto
2051 * src/bufferlist.C: ditto
2052 * src/layout.C: ditto
2053 * src/lyxfunc.C: ditto
2055 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2057 * src/lyxtext.h (bidi_level): change return type to
2058 LyXParagraph::size_type.
2060 * src/lyxparagraph.h: change size_type to
2061 TextContainer::difference_type. This should really be
2062 TextContainer::size_type, but we need currently to support signed
2065 2000-10-11 Marko Vendelin <markov@ioc.ee>
2066 * src/frontends/gnome/FormError.h
2067 * src/frontends/gnome/FormRef.C
2068 * src/frontends/gnome/FormRef.h
2069 * src/frontends/gnome/FormError.C
2070 * src/frontends/gnome/Makefile.am
2071 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2072 to Gnome frontend. Both dialogs use "action" area.
2074 2000-10-12 Baruch Even <baruch.even@writeme.com>
2076 * src/graphics/GraphicsCacheItem_pimpl.C:
2077 * src/graphics/Renderer.C:
2078 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2081 2000-10-12 Juergen Vigna <jug@sad.it>
2083 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2084 visible when selecting).
2086 * development/Code_rules/Rules: fixed some typos.
2088 2000-10-09 Baruch Even <baruch.even@writeme.com>
2090 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2091 compiling on egcs 1.1.2 possible.
2093 * src/filedlg.C (comp_direntry::operator() ): ditto.
2095 2000-08-31 Baruch Even <baruch.even@writeme.com>
2097 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2100 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2101 transient it now only gets freed when the object is destructed.
2103 2000-08-24 Baruch Even <baruch.even@writeme.com>
2105 * src/frontends/FormGraphics.h:
2106 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2109 2000-08-20 Baruch Even <baruch.even@writeme.com>
2111 * src/insets/insetgraphics.C:
2112 (draw): Added messages to the drawn rectangle to report status.
2113 (updateInset): Disabled the use of the inline graphics,
2116 2000-08-17 Baruch Even <baruch.even@writeme.com>
2118 * src/frontends/support: Directory added for the support of GUII LyX.
2120 * src/frontends/support/LyXImage.h:
2121 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2124 * src/frontends/support/LyXImage_X.h:
2125 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2126 version of LyXImage, this uses the Xlib Pixmap.
2128 * src/PainterBase.h:
2129 * src/PainterBase.C:
2131 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2132 replacement to Pixmap.
2134 * src/insets/insetgraphics.h:
2135 * src/insets/insetgraphics.C:
2136 * src/graphics/GraphicsCacheItem.h:
2137 * src/graphics/GraphicsCacheItem.C:
2138 * src/graphics/GraphicsCacheItem_pimpl.h:
2139 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2142 * src/graphics/GraphicsCacheItem.h:
2143 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2144 another copy of the object.
2146 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2147 of cacheHandle, this fixed a bug that sent LyX crashing.
2149 * src/graphics/XPM_Renderer.h:
2150 * src/graphics/XPM_Renderer.C:
2151 * src/graphics/EPS_Renderer.h:
2152 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2154 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2156 * src/lyxfunc.C (processKeySym): only handle the
2157 lockinginset/inset stuff if we have a buffer and text loaded...
2159 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2161 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2163 * src/support/lyxfunctional.h: add operator= that takes a reference
2165 * src/lyxserver.C (mkfifo): make first arg const
2167 * src/layout.h: renamed name(...) to setName(...) to work around
2170 * src/buffer.C (setFileName): had to change name of function to
2171 work around bugs in egcs. (renamed from fileName)
2173 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2175 * src/support/translator.h: move helper template classes to
2176 lyxfunctional.h, include "support/lyxfunctional.h"
2178 * src/support/lyxmanip.h: add delaration of fmt
2180 * src/support/lyxfunctional.h: new file
2181 (class_fun_t): new template class
2182 (class_fun): helper template function
2183 (back_insert_fun_iterator): new template class
2184 (back_inserter_fun): helper template function
2185 (compare_memfun_t): new template class
2186 (compare_memfun): helper template function
2187 (equal_1st_in_pair): moved here from translator
2188 (equal_2nd_in_pair): moved here from translator
2190 * src/support/fmt.C: new file
2191 (fmt): new func, can be used for a printf substitute when still
2192 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2194 * src/support/StrPool.C: add some comments
2196 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2199 * src/insets/figinset.C (addpidwait): use std::copy with
2200 ostream_iterator to fill the pidwaitlist
2202 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2204 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2207 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2210 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2212 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2213 (class_update): ditto
2214 (BulletPanel): ditto
2215 (CheckChoiceClass): move initialization of tc and tct
2217 * src/tabular.C: remove current_view
2218 (OldFormatRead): similar to right below [istream::ignore]
2220 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2221 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2222 unused [istream::ignore]
2224 * src/lyxfunc.C: include "support/lyxfunctional.h"
2225 (getInsetByCode): use std::find_if and compare_memfun
2227 * src/lyxfont.C (stateText): remove c_str()
2229 * src/lyx_main.C (setDebuggingLevel): make static
2230 (commandLineHelp): make static
2232 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2233 Screen* together with fl_get_display() and fl_screen
2235 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2236 togheter with fl_get_display() and fl_screen
2237 (create_forms): remove c_str()
2239 * src/layout.C: include "support/lyxfunctional.h"
2240 (hasLayout): use std::find_if and compare_memfun
2241 (GetLayout): use std::find_if and comapre_memfun
2242 (delete_layout): use std::remove_if and compare_memfun
2243 (NumberOfClass): use std:.find_if and compare_memfun
2245 * src/gettext.h: change for the new functions
2247 * src/gettext.C: new file, make _(char const * str) and _(string
2248 const & str) real functions.
2250 * src/font.C (width): rewrite slightly to avoid one extra variable
2252 * src/debug.C: initialize Debug::ANY here
2254 * src/commandtags.h: update number comments
2256 * src/combox.h (get): make const func
2258 (getline): make const
2260 * src/combox.C (input_cb): handle case where fl_get_input can
2263 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2264 "support/lyxfunctional.h", remove current_view variable.
2265 (resize): use std::for_each with std::mem_fun
2266 (getFileNames): use std::copy with back_inserter_fun
2267 (getBuffer): change arg type to unsigned int
2268 (emergencyWriteAll): call emergencyWrite with std::for_each and
2270 (emergencyWrite): new method, the for loop in emergencyWriteAll
2272 (exists): use std::find_if with compare_memfun
2273 (getBuffer): use std::find_if and compare_memfun
2275 * src/buffer.h: add typedefs for iterator_category, value_type
2276 difference_type, pointer and reference for inset_iterator
2277 add postfix ++ for inset_iterator
2278 make inset_iterator::getPos() const
2280 * src/buffer.C: added support/lyxmanip.h
2281 (readFile): use lyxerr << fmt instead of printf
2282 (makeLaTeXFile): use std::copy to write out encodings
2284 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2286 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2287 free and the char * temp.
2288 (hasMenu): use std::find_if and compare_memfun
2291 * src/Makefile.am (lyx_SOURCES): added gettext.C
2293 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2294 string::insert small change to avoid temporary
2296 * src/LColor.C (getGUIName): remove c_str()
2298 * several files: change all occurrences of fl_display to
2301 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2302 that -pedantic is not used for gcc 2.97 (cvs gcc)
2304 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2306 2000-10-11 Allan Rae <rae@lyx.org>
2308 * src/frontends/xforms/FormPreferences.C (input): template path must be
2309 a readable directory. It doesn't need to be writeable.
2310 (build, delete, update, apply): New inputs in the various tabfolders
2312 * src/frontends/xforms/forms/form_preferences.fd:
2313 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2314 several new entries to existing folders. Shuffled some existing stuff
2317 * src/frontends/xforms/forms/form_print.fd:
2318 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2319 Should probably rework PrinterParams as well. Note that the switch to
2320 collated is effectively the same as !unsorted so changing PrinterParams
2321 will require a lot of fiddly changes to reverse the existing logic.
2323 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2325 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2327 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2329 2000-10-10 Allan Rae <rae@lyx.org>
2332 * src/lyxfunc.C (Dispatch):
2334 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2337 * src/lyxrc.C (output): Only write the differences between system lyxrc
2338 and the users settings.
2341 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2343 I'll rewrite this later, after 1.1.6 probably, to keep a single
2344 LyXRC but two instances of a LyXRCStruct.
2346 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2348 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2350 * src/tabular.h: add a few std:: qualifiers.
2352 * src/encoding.C: add using directive.
2353 * src/language.C: ditto.
2355 * src/insets/insetquotes.C (Validate): use languages->lang()
2356 instead of only language.
2358 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2360 * lib/languages: New file.
2362 * lib/encodings: New file.
2364 * src/language.C (Languages): New class.
2365 (read): New method. Reads the languages from the 'languages' file.
2367 * src/encoding.C (Encodings): New class.
2368 (read): New method. Reads the encodings from the 'encodings' file.
2370 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2373 * src/bufferparams.h and a lot of files: Deleted the member language,
2374 and renamed language_info to language
2376 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2377 * src/lyxfont.C (latexWriteStartChanges): ditto.
2378 * src/paragraph.C (validate,TeXOnePar): ditto.
2380 * src/lyxfont.C (update): Restored deleted code.
2382 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2384 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2386 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2388 * src/insets/figinset.[Ch]:
2389 * src/insets/insetinclude.[Ch]:
2390 * src/insets/insetinclude.[Ch]:
2391 * src/insets/insetparent.[Ch]:
2392 * src/insets/insetref.[Ch]:
2393 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2395 * src/insets/*.[Ch]:
2396 * src/mathed/formula.[Ch]:
2397 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2399 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2400 * src/lyx_cb.C (FigureApplyCB):
2401 * src/lyxfunc.C (getStatus, Dispatch):
2402 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2405 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2407 * src/converter.[Ch] (Formats::View):
2408 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2410 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2411 *current_view->buffer(). This will change later, but this patch is way
2414 2000-10-09 Juergen Vigna <jug@sad.it>
2416 * src/text.C (GetRow): small fix.
2418 * src/BufferView_pimpl.C (cursorPrevious):
2419 (cursorNext): added LyXText parameter to function.
2421 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2422 keypress depending on cursor position.
2424 2000-10-06 Juergen Vigna <jug@sad.it>
2426 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2427 (copySelection): redone this function and also copy ascii representa-
2430 * src/tabular.C (Ascii):
2434 (print_n_chars): new functions to realize the ascii export of tabulars.
2436 2000-10-05 Juergen Vigna <jug@sad.it>
2438 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2439 if we don't have a buffer.
2441 2000-10-10 Allan Rae <rae@lyx.org>
2443 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2444 with closing dialog. It seems that nested tabfolders require hiding
2445 of inner tabfolders before hiding the dialog itself. Actually all I
2446 did was hide the active outer folder.
2448 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2449 unless there really is a buffer. hideBufferDependent is called
2452 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2453 POTFILES.in stays in $(srcdir).
2455 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2457 * lib/lyxrc.example: Few changes.
2459 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2461 * src/BufferView_pimpl.C (buffer): only need one the
2462 updateBufferDependent signal to be emitted once! Moved to the end of
2463 the method to allow bv_->text to be updated first.
2465 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2466 and hSignal_ with Dialogs * and BufferDependency variables.
2467 New Buffer * parent_, initialised when the dialog is launched. Used to
2468 check whether to update() or hide() dialog in the new, private
2469 updateOrHide() method that is connected to the updateBufferDependent
2470 signal. Daughter classes dictate what to do using the
2471 ChangedBufferAction enum, passed to the c-tor.
2473 * src/frontends/xforms/FormCitation.C:
2474 * src/frontends/xforms/FormCommand.C:
2475 * src/frontends/xforms/FormCopyright.C:
2476 * src/frontends/xforms/FormDocument.C:
2477 * src/frontends/xforms/FormError.C:
2478 * src/frontends/xforms/FormIndex.C:
2479 * src/frontends/xforms/FormPreferences.C:
2480 * src/frontends/xforms/FormPrint.C:
2481 * src/frontends/xforms/FormRef.C:
2482 * src/frontends/xforms/FormToc.C:
2483 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2486 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2487 ChangedBufferAction enum.
2489 * src/frontends/xforms/FormParagraph.[Ch]
2490 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2493 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2495 * lib/bind/cua.bind: fix a bit.
2496 * lib/bind/emacs.bind: ditto.
2498 * lib/bind/menus.bind: remove real menu entries from there.
2500 * src/spellchecker.C: make sure we only include strings.h when
2503 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2505 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2506 function. It enlarges the maximum number of pup when needed.
2507 (add_toc2): Open a new menu if maximum number of items per menu has
2510 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2512 * src/frontends/kde/FormPrint.C: fix error reporting
2514 * src/frontends/xforms/FormDocument.C: fix compiler
2517 * lib/.cvsignore: add Literate.nw
2519 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2522 * bufferview_funcs.[Ch]
2525 * text2.C: Add support for numbers in RTL text.
2527 2000-10-06 Allan Rae <rae@lyx.org>
2529 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2530 to be gettext.m4 friendly again. ext_l10n.h is now
2531 generated into $top_srcdir instead of $top_builddir
2532 so that lyx.pot will be built correctly -- without
2533 duplicate parsing of ext_l10n.h.
2535 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2537 * src/frontends/kde/FormCitation.C: make the dialog
2538 behave more sensibly
2540 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2542 * config/kde.m4: fix consecutive ./configure runs,
2543 look for qtarch, fix library order
2545 * src/frontends/kde/Makefile.am: tidy up,
2546 add Print dialog, add .dlg dependencies
2548 * src/frontends/kde/FormPrint.C:
2549 * src/frontends/kde/FormPrint.h:
2550 * src/frontends/kde/formprintdialog.C:
2551 * src/frontends/kde/formprintdialog.h:
2552 * src/frontends/kde/formprintdialogdata.C:
2553 * src/frontends/kde/formprintdialogdata.h:
2554 * src/frontends/kde/dlg/formprintdialog.dlg: add
2557 * src/frontends/kde/dlg/README: Added explanatory readme
2559 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2560 script to double-check qtarch's output
2562 * src/frontends/kde/formindexdialog.C:
2563 * src/frontends/kde/formindexdialogdata.C:
2564 * src/frontends/kde/formindexdialogdata.h:
2565 * src/frontends/kde/dlg/formindexdialog.dlg: update
2566 for qtarch, minor fixes
2568 2000-10-05 Allan Rae <rae@lyx.org>
2570 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2571 dialogs when switching buffers update them instead. It's up to each
2572 dialog to decide if it should still be visible or not.
2573 update() should return a bool to control visiblity within show().
2574 Or perhaps better to set a member variable and use that to control
2577 * lib/build-listerrors: create an empty "listerrors" file just to stop
2578 make trying to regenerate it all the time if you don't have noweb
2581 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2583 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2584 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2585 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2586 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2587 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2589 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2591 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2593 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2594 deleting buffer. Closes all buffer-dependent dialogs.
2596 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2598 * src/frontends/xforms/FormCitation.[Ch]:
2599 * src/frontends/xforms/FormPreferences.[Ch]:
2600 * src/frontends/xforms/FormPrint.[Ch]:
2601 * src/frontends/xforms/FormRef.[Ch]:
2602 * src/frontends/xforms/FormUrl.[Ch]: ditto
2604 * src/frontends/xforms/FormDocument.[Ch]:
2605 * src/frontends/xforms/forms/form_document.C.patch:
2606 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2607 pass through a single input() function.
2609 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2611 * lib/build-listerrors: return status as OK
2613 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2615 * lib/lyxrc.example: Updated to new export code
2617 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2619 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2622 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2625 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2626 LyX-Code is defined.
2627 * lib/layouts/amsbook.layout: ditto.
2629 * boost/Makefile.am: fix typo.
2631 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2633 (add_lastfiles): removed.
2634 (add_documents): removed.
2635 (add_formats): removed.
2637 * src/frontends/Menubar.C: remove useless "using" directive.
2639 * src/MenuBackend.h: add a new MenuItem constructor.
2641 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2644 2000-10-04 Allan Rae <rae@lyx.org>
2646 * lib/Makefile.am (listerrors):
2647 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2648 I haven't got notangle installed so Kayvan please test. The output
2649 should end up in $builddir. This also allows people who don't have
2650 noweb installed to complete the make process without error.
2652 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2653 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2654 by JMarc's picky compiler.
2656 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2659 * src/insets/insettabular.C (setPos): change for loop to not use
2660 sequencing operator. Please check this Jürgen.
2662 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2664 * src/insets/insetcite.C (getScreenLabel): ditto
2665 * src/support/filetools.C (QuoteName): ditto
2666 (ChangeExtension): ditto
2668 * src/BufferView_pimpl.C (scrollCB): make heigt int
2670 * src/BufferView2.C (insertInset): comment out unused arg
2672 * boost/Makefile.am (EXTRADIST): new variable
2674 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2676 * src/exporter.C (IsExportable): Fixed
2678 * lib/configure.m4: Small fix
2680 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2682 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2683 * src/insets/insetbib.C (bibitemWidest): ditto.
2684 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2686 2000-10-03 Juergen Vigna <jug@sad.it>
2688 * src/BufferView2.C (theLockingInset): removed const because of
2689 Agnus's compile problems.
2691 * src/insets/insettext.C (LocalDispatch): set the language of the
2692 surronding paragraph on inserting the first character.
2694 * various files: changed use of BufferView::the_locking_inset.
2696 * src/BufferView2.C (theLockingInset):
2697 (theLockingInset): new functions.
2699 * src/BufferView.h: removed the_locking_inset.
2701 * src/lyxtext.h: added the_locking_inset
2703 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2705 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2707 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2709 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2710 * src/mathed/math_cursor.C (IsAlpha): ditto.
2711 * src/mathed/math_inset.C (strnew): ditto.
2712 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2713 (IMetrics): cxp set but never used; removed.
2714 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2715 that the variable in question has been removed also!
2718 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2719 using the Buffer * passed to Latex(), using the BufferView * passed to
2720 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2722 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2723 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2725 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2726 * src/buffer.C (readInset): used new InsetBibtex c-tor
2727 * (getBibkeyList): used new InsetBibtex::getKeys
2729 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2732 * lib/build-listerrors
2734 * src/exporter.C: Add literate programming support to the export code
2737 * src/lyx_cb.C: Remove old literate code.
2739 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2742 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2743 * src/converter.C (View, Convert): Use QuoteName.
2745 * src/insets/figinset.C (Preview): Use Formats::View.
2747 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2749 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2751 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2752 the top of the function, because compaq cxx complains that the
2753 "goto exit_with_message" when the function is disabled bypasses
2755 (MenuNew): try a better fix for the generation of new file names.
2756 This time, I used AddName() instead of AddPath(), hoping Juergen
2759 2000-10-03 Allan Rae <rae@lyx.org>
2761 * src/frontends/xforms/forms/form_preferences.fd:
2762 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2763 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2764 "Look and Feel"->"General" but will need to be split up further into
2765 general output and general input tabs. Current plan is for four outer
2766 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2767 stuff; "Inputs" for input and import configuration; "Outputs" for
2768 output and export configuration; and one more whatever is left over
2769 called "General". The leftovers at present look like being which
2770 viewers to use, spellchecker, language support and might be better
2771 named "Support". I've put "Paths" in "Inputs" for the moment as this
2772 seems reasonable for now at least.
2773 One problem remains: X error kills LyX when you close Preferences.
2775 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2777 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2778 qualifier from form()
2779 * src/frontends/xforms/FormCitation.[Ch]:
2780 * src/frontends/xforms/FormCopyright.[Ch]:
2781 * src/frontends/xforms/FormDocument.[Ch]:
2782 * src/frontends/xforms/FormError.[Ch]:
2783 * src/frontends/xforms/FormIndex.[Ch]:
2784 * src/frontends/xforms/FormPreferences.[Ch]:
2785 * src/frontends/xforms/FormPrint.[Ch]:
2786 * src/frontends/xforms/FormRef.[Ch]:
2787 * src/frontends/xforms/FormToc.[Ch]:
2788 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2790 * src/frontends/xforms/FormCitation.[Ch]:
2791 * src/frontends/xforms/FormIndex.[Ch]:
2792 * src/frontends/xforms/FormRef.[Ch]:
2793 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2794 with Allan's naming policy
2796 * src/frontends/xforms/FormCitation.C: some static casts to remove
2799 2000-10-02 Juergen Vigna <jug@sad.it>
2801 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2802 now you can type or do stuff inside the table-cell also when in dummy
2803 position, fixed visible cursor.
2805 * src/insets/insettext.C (Edit): fixing cursor-view position.
2807 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2808 be used for equal functions in lyxfunc and insettext.
2810 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2812 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2814 * src/frontends/gnome/FormCitation.h:
2815 * src/frontends/gnome/FormCopyright.h:
2816 * src/frontends/gnome/FormIndex.h:
2817 * src/frontends/gnome/FormPrint.h:
2818 * src/frontends/gnome/FormToc.h:
2819 * src/frontends/gnome/FormUrl.h:
2820 * src/frontends/kde/FormCitation.h:
2821 * src/frontends/kde/FormCopyright.h:
2822 * src/frontends/kde/FormIndex.h:
2823 * src/frontends/kde/FormRef.h:
2824 * src/frontends/kde/FormToc.h:
2825 * src/frontends/kde/FormUrl.h: fix remaining users of
2828 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2830 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2831 from depth argument.
2832 (DocBookHandleCaption): ditto.
2833 (DocBookHandleFootnote): ditto.
2834 (SimpleDocBookOnePar): ditto.
2836 * src/frontends/xforms/FormDocument.h (form): remove extra
2837 FormDocument:: qualifier.
2839 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2841 * sigc++/handle.h: ditto.
2843 * src/lyx_gui_misc.C: add "using" directive.
2845 * src/cheaders/cstddef: new file, needed by the boost library (for
2848 2000-10-02 Juergen Vigna <jug@sad.it>
2850 * src/insets/insettext.C (SetFont): better support.
2852 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2854 * src/screen.C (DrawOneRow): some uint refixes!
2856 2000-10-02 Allan Rae <rae@lyx.org>
2858 * boost/.cvsignore: ignore Makefile as well
2860 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2861 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2863 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2864 Left this one out by accident.
2866 * src/frontends/xforms/FormBase.h (restore): default to calling
2867 update() since that will restore the original/currently-applied values.
2868 Any input() triggered error messages will require the derived classes
2869 to redefine restore().
2871 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2872 avoid a segfault. combo_doc_class is the main concern.
2874 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2876 * Simplify build-listerrors in view of GUI-less export ability!
2878 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2880 * src/lyx_main.C (easyParse): Disable gui when exporting
2882 * src/insets/figinset.C:
2885 * src/lyx_gui_misc.C
2886 * src/tabular.C: Changes to allow no-gui.
2888 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2890 * src/support/utility.hpp: removed file
2891 * src/support/block.h: removed file
2893 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2896 * src/mathed/formula.C: add support/lyxlib.h
2897 * src/mathed/formulamacro.C: ditto
2899 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2900 * src/lyxparagraph.h: ditto
2902 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2903 * src/frontends/Makefile.am (INCLUDES): ditto
2904 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2905 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2906 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2907 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2908 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2909 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2911 * src/BufferView.h: use boost/utility.hpp
2912 * src/LColor.h: ditto
2913 * src/LaTeX.h: ditto
2914 * src/LyXAction.h: ditto
2915 * src/LyXView.h: ditto
2916 * src/bufferlist.h: ditto
2917 * src/lastfiles.h: ditto
2918 * src/layout.h: ditto
2919 * src/lyx_gui.h: ditto
2920 * src/lyx_main.h: ditto
2921 * src/lyxlex.h: ditto
2922 * src/lyxrc.h: ditto
2923 * src/frontends/ButtonPolicies.h: ditto
2924 * src/frontends/Dialogs.h: ditto
2925 * src/frontends/xforms/FormBase.h: ditto
2926 * src/frontends/xforms/FormGraphics.h: ditto
2927 * src/frontends/xforms/FormParagraph.h: ditto
2928 * src/frontends/xforms/FormTabular.h: ditto
2929 * src/graphics/GraphicsCache.h: ditto
2930 * src/graphics/Renderer.h: ditto
2931 * src/insets/ExternalTemplate.h: ditto
2932 * src/insets/insetcommand.h: ditto
2933 * src/support/path.h: ditto
2935 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2936 and introduce clause for 2.97.
2938 * boost/libs/README: new file
2940 * boost/boost/utility.hpp: new file
2942 * boost/boost/config.hpp: new file
2944 * boost/boost/array.hpp: new file
2946 * boost/Makefile.am: new file
2948 * boost/.cvsignore: new file
2950 * configure.in (AC_OUTPUT): add boost/Makefile
2952 * Makefile.am (SUBDIRS): add boost
2954 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2956 * src/support/lstrings.C (suffixIs): Fixed.
2958 2000-10-01 Allan Rae <rae@lyx.org>
2960 * src/PrinterParams.h: moved things around to avoid the "can't
2961 inline call" warning.
2963 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2964 into doc++ documentation.
2966 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2968 * src/frontends/xforms/FormRef.C: make use of button controller
2969 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2970 cleaned up button controller usage.
2971 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2972 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2973 use the button controller
2975 * src/frontends/xforms/forms/*.fd: and associated generated files
2976 updated to reflect changes to FormBase. Some other FormXxxx files
2977 also got minor updates to reflect changes to FormBase.
2979 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2980 (hide): made virtual.
2981 (input): return a bool. true == valid input
2982 (RestoreCB, restore): new
2983 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2984 Changes to allow derived dialogs to use a ButtonController and
2985 make sense when doing so: OK button calls ok() and so on.
2987 * src/frontends/xforms/ButtonController.h (class ButtonController):
2988 Switch from template implementation to taking Policy parameter.
2989 Allows FormBase to provide a ButtonController for any dialog.
2991 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2992 Probably should rename connect and disconnect.
2993 (apply): use the radio button groups
2994 (form): needed by FormBase
2995 (build): setup the radio button groups
2997 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2999 * several files: type changes to reduce the number of warnings and
3000 to unify type hangling a bit. Still much to do.
3002 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3004 * lib/images/*: rename a bunch of icons to match Dekel converter
3007 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3010 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3012 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3014 * sigc++/handle.h: ditto for class Handle.
3016 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3018 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3020 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3022 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3023 removal of the "default" language.
3025 * src/combox.h (getline): Check that sel > 0
3027 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3029 * lib/examples/docbook_example.lyx
3030 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3032 * lib/layouts/docbook-book.layout: new docbook book layout.
3034 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3036 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3038 * src/insets/figinset.C (DocBook):fixed small typo.
3040 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3042 * src/insets/insetinclude.h: string include_label doesn't need to be
3045 2000-09-29 Allan Rae <rae@lyx.org>
3047 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3048 Allow derived type to control connection and disconnection from signals
3049 of its choice if desired.
3051 2000-09-28 Juergen Vigna <jug@sad.it>
3053 * src/insets/insettabular.C (update): fixed cursor setting when
3054 the_locking_inset changed.
3055 (draw): made this a bit cleaner.
3056 (InsetButtonPress): fixed!
3058 * various files: added LyXText Parameter to fitCursor call.
3060 * src/BufferView.C (fitCursor): added LyXText parameter.
3062 * src/insets/insettabular.C (draw): small draw fix.
3064 * src/tabular.C: right setting of left/right celllines.
3066 * src/tabular.[Ch]: fixed various types in funcions and structures.
3067 * src/insets/insettabular.C: ditto
3068 * src/frontends/xforms/FormTabular.C: ditto
3070 2000-09-28 Allan Rae <rae@lyx.org>
3072 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3073 that the #ifdef's had been applied to part of what should have been
3074 a complete condition. It's possible there are other tests that
3075 were specific to tables that are also wrong now that InsetTabular is
3076 being used. Now we need to fix the output of '\n' after a table in a
3077 float for the same reason as the original condition:
3078 "don't insert this if we would be adding it before or after a table
3079 in a float. This little trick is needed in order to allow use of
3080 tables in \subfigures or \subtables."
3081 Juergen can you check this?
3083 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3085 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3086 output to the ostream.
3088 * several files: fixed types based on warnings from cxx
3090 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3092 * src/frontends/kde/Makefile.am: fix rule for
3093 formindexdialogdata_moc.C
3095 * src/.cvsignore: add ext_l10n.h to ignore
3097 * acconfig.h: stop messing with __STRICT_ANSI__
3098 * config/gnome.m4: remove option to set -ansi
3099 * config/kde.m4: remove option to set -ansi
3100 * config/lyxinclude.m4: don't set -ansi
3102 2000-09-27 Juergen Vigna <jug@sad.it>
3104 * various files: remove "default" language check.
3106 * src/insets/insetquotes.C: removed use of current_view.
3108 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3109 the one should have red ears by now!
3111 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3112 in more then one paragraph. Fixed cursor-movement/selection.
3114 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3115 paragraphs inside a text inset.
3117 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3118 text-inset if this owner is an inset.
3120 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3122 * src/Bullet.h: changed type of font, character and size to int
3124 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3126 * src/insets/inseturl.[Ch]:
3127 * src/insets/insetref.[Ch]:
3128 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3130 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3132 * src/buffer.C (readFile): block-if statement rearranged to minimise
3133 bloat. Patch does not reverse Jean-Marc's change ;-)
3135 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3136 Class rewritten to store pointers to hide/update signals directly,
3137 rather than Dialogs *. Also defined an enum to ease use. All xforms
3138 forms can now be derived from this class.
3140 * src/frontends/xforms/FormCommand.[Ch]
3141 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3143 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3146 * src/frontends/xforms/forms/form_citation.fd
3147 * src/frontends/xforms/forms/form_copyright.fd
3148 * src/frontends/xforms/forms/form_error.fd
3149 * src/frontends/xforms/forms/form_index.fd
3150 * src/frontends/xforms/forms/form_ref.fd
3151 * src/frontends/xforms/forms/form_toc.fd
3152 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3154 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3156 * src/insets/insetfoot.C: removed redundent using directive.
3158 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3160 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3161 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3163 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3164 created in the constructors in different groups. Then set() just
3165 have to show the groups as needed. This fixes the redraw problems
3166 (and is how the old menu code worked).
3168 * src/support/lyxlib.h: declare the methods as static when we do
3169 not have namespaces.
3171 2000-09-26 Juergen Vigna <jug@sad.it>
3173 * src/buffer.C (asciiParagraph): new function.
3174 (writeFileAscii): new function with parameter ostream.
3175 (writeFileAscii): use now asciiParagraph.
3177 * various inset files: added the linelen parameter to the Ascii-func.
3179 * src/tabular.C (Write): fixed error in writing file introduced by
3180 the last changes from Lars.
3182 * lib/bind/menus.bind: removed not supported functions.
3184 * src/insets/insettext.C (Ascii): implemented this function.
3186 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3188 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3189 (Write): use of the write_attribute functions.
3191 * src/bufferlist.C (close): fixed reasking question!
3193 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3195 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3196 new files use the everwhere possible.
3199 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3200 src/log_form.C src/lyx.C:
3203 * src/buffer.C (runLaTeX): remove func
3205 * src/PaperLayout.C: removed file
3206 * src/ParagraphExtra.C: likewise
3207 * src/bullet_forms.C: likewise
3208 * src/bullet_forms.h: likewise
3209 * src/bullet_forms_cb.C: likewise
3211 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3212 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3215 * several files: remove all traces of the old fd_form_paragraph,
3216 and functions belonging to that.
3218 * several files: remove all traces of the old fd_form_document,
3219 and functions belonging to that.
3221 * several files: constify local variables were possible.
3223 * several files: remove all code that was dead when NEW_EXPORT was
3226 * several files: removed string::c_str in as many places as
3229 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3230 (e): be a bit more outspoken when patching
3231 (updatesrc): only move files if changed.
3233 * forms/layout_forms.h.patch: regenerated
3235 * forms/layout_forms.fd: remove form_document and form_paragraph
3236 and form_quotes and form_paper and form_table_options and
3237 form_paragraph_extra
3239 * forms/form1.fd: remove form_table
3241 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3242 the fdui->... rewrite. Update some comments to xforms 0.88
3244 * forms/bullet_forms.C.patch: removed file
3245 * forms/bullet_forms.fd: likewise
3246 * forms/bullet_forms.h.patch: likewise
3248 * development/Code_rules/Rules: added a section on switch
3249 statements. Updated some comment to xforms 0.88.
3251 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3253 * src/buffer.C (readFile): make sure that the whole version number
3254 is read after \lyxformat (even when it contains a comma)
3256 * lib/ui/default.ui: change shortcut of math menu to M-a.
3258 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3260 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3263 * src/LyXView.C (updateWindowTitle): show the full files name in
3264 window title, limited to 30 characters.
3266 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3267 When a number of characters has been given, we should not assume
3268 that the string is 0-terminated.
3270 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3271 calls (fixes some memory leaks)
3273 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3274 trans member on exit.
3276 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3278 * src/converter.C (GetReachable): fix typo.
3280 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3281 understand ',' instead of '.'.
3282 (GetInteger): rewrite to use strToInt().
3284 2000-09-26 Juergen Vigna <jug@sad.it>
3286 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3287 better visibility and error-message on wrong VSpace input.
3289 * src/language.C (initL): added english again.
3291 2000-09-25 Juergen Vigna <jug@sad.it>
3293 * src/frontends/kde/Dialogs.C (Dialogs):
3294 * src/frontends/gnome/Dialogs.C (Dialogs):
3295 * src/frontends/kde/Makefile.am:
3296 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3298 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3300 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3302 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3304 * src/frontends/xforms/FormParagraph.C:
3305 * src/frontends/xforms/FormParagraph.h:
3306 * src/frontends/xforms/form_paragraph.C:
3307 * src/frontends/xforms/form_paragraph.h:
3308 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3311 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3313 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3314 Paragraph-Data after use.
3316 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3317 non breakable paragraphs.
3319 2000-09-25 Garst R. Reese <reese@isn.net>
3321 * src/language.C (initL): added missing language_country codes.
3323 2000-09-25 Juergen Vigna <jug@sad.it>
3325 * src/insets/insettext.C (InsetText):
3326 (deleteLyXText): remove the not released LyXText structure!
3328 2000-09-24 Marko Vendelin <markov@ioc.ee>
3330 * src/frontends/gnome/mainapp.C
3331 * src/frontends/gnome/mainapp.h: added support for keyboard
3334 * src/frontends/gnome/FormCitation.C
3335 * src/frontends/gnome/FormCitation.h
3336 * src/frontends/gnome/Makefile.am
3337 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3338 FormCitation to use "action area" in mainapp window
3340 * src/frontends/gnome/Menubar_pimpl.C
3341 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3344 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3346 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3347 width/descent/ascent values if name is empty.
3348 (mathed_string_height): Use std::max.
3350 2000-09-25 Allan Rae <rae@lyx.org>
3352 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3353 segfault. This will be completely redesigned soon.
3355 * sigc++: updated libsigc++. Fixes struct timespec bug.
3357 * development/tools/makeLyXsigc.sh: .cvsignore addition
3359 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3361 * several files: removed almost all traces of the old table
3364 * src/TableLayout.C: removed file
3366 2000-09-22 Juergen Vigna <jug@sad.it>
3368 * src/frontends/kde/Dialogs.C: added credits forms.
3370 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3372 * src/frontends/gnome/Dialogs.C: added some forms.
3374 * src/spellchecker.C (init_spell_checker): set language in pspell code
3375 (RunSpellChecker): some modifications for setting language string.
3377 * src/language.[Ch]: added language_country code.
3379 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3381 * src/frontends/Dialogs.h: added new signal showError.
3382 Rearranged existing signals in some sort of alphabetical order.
3384 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3385 FormError.[Ch], form_error.[Ch]
3386 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3387 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3389 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3390 dialogs. I think that this can be used as the base to all these
3393 * src/frontends/xforms/FormError.[Ch]
3394 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3395 implementation of InsetError dialog.
3397 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3399 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3400 * src/frontends/kde/Makefile.am: ditto
3402 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3404 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3405 macrobf. This fixes a bug of invisible text.
3407 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3409 * lib/doc/LaTeXConfig.lyx.in: updated.
3411 * src/language.C (initL): remove language "francais" and change a
3412 bit the names of the two other french variations.
3414 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3415 string that may not be 0-terminated.
3417 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3419 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3421 2000-09-20 Marko Vendelin <markov@ioc.ee>
3423 * src/frontends/gnome/FormCitation.C
3424 * src/frontends/gnome/FormIndex.C
3425 * src/frontends/gnome/FormToc.C
3426 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3427 the variable initialization to shut up the warnings
3429 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3431 * src/table.[Ch]: deleted files
3433 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3436 2000-09-18 Juergen Vigna <jug@sad.it>
3438 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3439 problems with selection. Inserted new LFUN_PASTESELECTION.
3440 (InsetButtonPress): inserted handling of middle mouse-button paste.
3442 * src/spellchecker.C: changed word to word.c_str().
3444 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3446 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3447 included in the ``make dist'' tarball.
3449 2000-09-15 Juergen Vigna <jug@sad.it>
3451 * src/CutAndPaste.C (cutSelection): small fix return the right
3452 end position after cut inside one paragraph only.
3454 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3455 we are locked as otherwise we don't have a valid cursor position!
3457 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3459 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3461 * src/frontends/kde/FormRef.C: added using directive.
3462 * src/frontends/kde/FormToc.C: ditto
3464 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3466 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3468 2000-09-19 Marko Vendelin <markov@ioc.ee>
3470 * src/frontends/gnome/Menubar_pimpl.C
3471 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3472 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3474 * src/frontends/gnome/mainapp.C
3475 * src/frontends/gnome/mainapp.h: support for menu update used
3478 * src/frontends/gnome/mainapp.C
3479 * src/frontends/gnome/mainapp.h: support for "action" area in the
3480 main window. This area is used by small simple dialogs, such as
3483 * src/frontends/gnome/FormIndex.C
3484 * src/frontends/gnome/FormIndex.h
3485 * src/frontends/gnome/FormUrl.C
3486 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3489 * src/frontends/gnome/FormCitation.C
3490 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3491 action area. Only "Insert new citation" is implemented.
3493 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3495 * src/buffer.C (Dispatch): fix call to Dispatch
3496 * src/insets/insetref.C (Edit): likewise
3497 * src/insets/insetparent.C (Edit): likewise
3498 * src/insets/insetinclude.C (include_cb): likewise
3499 * src/frontends/xforms/FormUrl.C (apply): likewise
3500 * src/frontends/xforms/FormToc.C (apply): likewise
3501 * src/frontends/xforms/FormRef.C (apply): likewise
3502 * src/frontends/xforms/FormIndex.C (apply): likewise
3503 * src/frontends/xforms/FormCitation.C (apply): likewise
3504 * src/lyxserver.C (callback): likewise
3505 * src/lyxfunc.C (processKeySym): likewise
3506 (Dispatch): likewise
3507 (Dispatch): likewise
3508 * src/lyx_cb.C (LayoutsCB): likewise
3510 * Makefile.am (sourcedoc): small change
3512 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3514 * src/main.C (main): Don't make an empty GUIRunTime object. all
3515 methods are static. constify a bit remove unneded using + headers.
3517 * src/tabular.C: some more const to local vars move some loop vars
3519 * src/spellchecker.C: added some c_str after some word for pspell
3521 * src/frontends/GUIRunTime.h: add new static method setDefaults
3522 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3523 * src/frontends/kde/GUIRunTime.C (setDefaults):
3524 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3526 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3527 with strnew in arg, use correct emptystring when calling SetName.
3529 * several files: remove all commented code with relation to
3530 HAVE_SSTREAM beeing false. We now only support stringstream and
3533 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3535 * src/lyxfunc.C: construct correctly the automatic new file
3538 * src/text2.C (IsStringInText): change type of variable i to shut
3541 * src/support/sstream.h: do not use namespaces if the compiler
3542 does not support them.
3544 2000-09-15 Marko Vendelin <markov@ioc.ee>
3545 * src/frontends/gnome/FormCitation.C
3546 * src/frontends/gnome/FormCitation.h
3547 * src/frontends/gnome/diainsertcitation_interface.c
3548 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3549 regexp support to FormCitation [Gnome].
3551 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3554 * configure.in: remove unused KDE/GTKGUI define
3556 * src/frontends/kde/FormRef.C
3557 * src/frontends/kde/FormRef.h
3558 * src/frontends/kde/formrefdialog.C
3559 * src/frontends/kde/formrefdialog.h: double click will
3560 go to reference, now it is possible to change a cross-ref
3563 * src/frontends/kde/FormToc.C
3564 * src/frontends/kde/FormToc.h
3565 * src/frontends/kde/formtocdialog.C
3566 * src/frontends/kde/formtocdialog.h: add a depth
3569 * src/frontends/kde/Makefile.am: add QtLyXView.h
3572 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3574 * src/frontends/kde/FormCitation.h: added some using directives.
3576 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3578 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3581 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3584 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3586 * src/buffer.C (pop_tag): revert for the second time a change by
3587 Lars, who seems to really hate having non-local loop variables :)
3589 * src/Lsstream.h: add "using" statements.
3591 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3592 * src/buffer.C (writeFile): ditto
3594 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3596 * src/buffer.C (writeFile): try to fix the locale modified format
3597 number to always be as we want it.
3599 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3600 in XForms 0.89. C-space is now working again.
3602 * src/Lsstream.h src/support/sstream.h: new files.
3604 * also commented out all cases where strstream were used.
3606 * src/Bullet.h (c_str): remove method.
3608 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3610 * a lot of files: get rid of "char const *" and "char *" is as
3611 many places as possible. We only want to use them in interaction
3612 with system of other libraries, not inside lyx.
3614 * a lot of files: return const object is not of pod type. This
3615 helps ensure that temporary objects is not modified. And fits well
3616 with "programming by contract".
3618 * configure.in: check for the locale header too
3620 * Makefile.am (sourcedoc): new tag for generation of doc++
3623 2000-09-14 Juergen Vigna <jug@sad.it>
3625 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3626 callback to check which combo called it and do the right action.
3628 * src/combox.C (combo_cb): added combo * to the callbacks.
3629 (Hide): moved call of callback after Ungrab of the pointer.
3631 * src/intl.h: removed LCombo2 function.
3633 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3634 function as this can now be handled in one function.
3636 * src/combox.h: added Combox * to callback prototype.
3638 * src/frontends/xforms/Toolbar_pimpl.C:
3639 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3641 2000-09-14 Garst Reese <reese@isn.net>
3643 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3644 moved usepackage{xxx}'s to beginning of file. Changed left margin
3645 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3646 underlining from title. Thanks to John Culleton for useful suggestions.
3648 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3650 * src/lyxlex_pimpl.C (setFile): change error message to debug
3653 2000-09-13 Juergen Vigna <jug@sad.it>
3655 * src/frontends/xforms/FormDocument.C: implemented choice_class
3656 as combox and give callback to combo_language so OK/Apply is activated
3659 * src/bufferlist.C (newFile): small fix so already named files
3660 (via an open call) are not requested to be named again on the
3663 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3665 * src/frontends/kde/Makefile.am
3666 * src/frontends/kde/FormRef.C
3667 * src/frontends/kde/FormRef.h
3668 * src/frontends/kde/formrefdialog.C
3669 * src/frontends/kde/formrefdialog.h: implement
3672 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3674 * src/frontends/kde/formtocdialog.C
3675 * src/frontends/kde/formtocdialog.h
3676 * src/frontends/kde/FormToc.C
3677 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3679 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3681 * src/frontends/kde/FormCitation.C: fix thinko
3682 where we didn't always display the reference text
3685 * src/frontends/kde/formurldialog.C
3686 * src/frontends/kde/formurldialog.h
3687 * src/frontends/kde/FormUrl.C
3688 * src/frontends/kde/FormUrl.h: minor cleanups
3690 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3692 * src/frontends/kde/Makefile.am
3693 * src/frontends/kde/FormToc.C
3694 * src/frontends/kde/FormToc.h
3695 * src/frontends/kde/FormCitation.C
3696 * src/frontends/kde/FormCitation.h
3697 * src/frontends/kde/FormIndex.C
3698 * src/frontends/kde/FormIndex.h
3699 * src/frontends/kde/formtocdialog.C
3700 * src/frontends/kde/formtocdialog.h
3701 * src/frontends/kde/formcitationdialog.C
3702 * src/frontends/kde/formcitationdialog.h
3703 * src/frontends/kde/formindexdialog.C
3704 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3706 2000-09-12 Juergen Vigna <jug@sad.it>
3708 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3711 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3713 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3716 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3718 * src/converter.C (Add, Convert): Added support for converter flags:
3719 needaux, resultdir, resultfile.
3720 (Convert): Added new parameter view_file.
3721 (dvips_options): Fixed letter paper option.
3723 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3724 (Export, GetExportableFormats, GetViewableFormats): Added support
3727 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3729 (easyParse): Fixed to work with new export code.
3731 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3734 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3736 * lib/bind/*.bind: Replaced
3737 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3738 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3740 2000-09-11 Juergen Vigna <jug@sad.it>
3742 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3744 * src/main.C (main): now GUII defines global guiruntime!
3746 * src/frontends/gnome/GUIRunTime.C (initApplication):
3747 * src/frontends/kde/GUIRunTime.C (initApplication):
3748 * src/frontends/xforms/GUIRunTime.C (initApplication):
3749 * src/frontends/GUIRunTime.h: added new function initApplication.
3751 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3753 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3755 2000-09-08 Juergen Vigna <jug@sad.it>
3757 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3758 we have already "Reset".
3760 * src/language.C (initL): inserted "default" language and made this
3761 THE default language (and not american!)
3763 * src/paragraph.C: inserted handling of "default" language!
3765 * src/lyxfont.C: ditto
3769 * src/paragraph.C: output the \\par only if we have a following
3770 paragraph otherwise it's not needed.
3772 2000-09-05 Juergen Vigna <jug@sad.it>
3774 * config/pspell.m4: added entry to lyx-flags
3776 * src/spellchecker.C: modified version from Kevin for using pspell
3778 2000-09-01 Marko Vendelin <markov@ioc.ee>
3779 * src/frontends/gnome/Makefile.am
3780 * src/frontends/gnome/FormCitation.C
3781 * src/frontends/gnome/FormCitation.h
3782 * src/frontends/gnome/diainsertcitation_callbacks.c
3783 * src/frontends/gnome/diainsertcitation_callbacks.h
3784 * src/frontends/gnome/diainsertcitation_interface.c
3785 * src/frontends/gnome/diainsertcitation_interface.h
3786 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3787 dialog for Gnome frontend
3789 * src/main.C: Gnome libraries require keeping application name
3790 and its version as strings
3792 * src/frontends/gnome/mainapp.C: Change the name of the main window
3793 from GnomeLyX to PACKAGE
3795 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3797 * src/frontends/Liason.C: add "using: declaration.
3799 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3801 * src/mathed/math_macro.C (Metrics): Set the size of the template
3803 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3805 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3807 * src/converter.C (add_options): New function.
3808 (SetViewer): Change $$FName into '$$FName'.
3809 (View): Add options when running xdvi
3810 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3811 (Convert): The 3rd parameter is now the desired filename. Converts
3812 calls to lyx::rename if necessary.
3813 Add options when running dvips.
3814 (dvi_papersize,dvips_options): New methods.
3816 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3818 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3819 using a call to Converter::dvips_options.
3820 Fixed to work with nex export code.
3822 * src/support/copy.C
3823 * src/support/rename.C: New files
3825 * src/support/syscall.h
3826 * src/support/syscall.C: Added Starttype SystemDontWait.
3828 * lib/ui/default.ui: Changed to work with new export code
3830 * lib/configure.m4: Changed to work with new export code
3832 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3834 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3836 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3837 so that code compiles with DEC cxx.
3839 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3840 to work correctly! Also now supports the additional elements
3843 2000-09-01 Allan Rae <rae@lyx.org>
3845 * src/frontends/ButtonPolicies.C: renamed all the references to
3846 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3848 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3849 since it's a const not a type.
3851 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3853 2000-08-31 Juergen Vigna <jug@sad.it>
3855 * src/insets/figinset.C: Various changes to look if the filename has
3856 an extension and if not add it for inline previewing.
3858 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3860 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3861 make buttonStatus and isReadOnly be const methods. (also reflect
3862 this in derived classes.)
3864 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3865 (nextState): change to be static inline, pass the StateMachine as
3867 (PreferencesPolicy): remove casts
3868 (OkCancelPolicy): remvoe casts
3869 (OkCancelReadOnlyPolicy): remove casts
3870 (NoRepeatedApplyReadOnlyPolicy): remove casts
3871 (OkApplyCancelReadOnlyPolicy): remove casts
3872 (OkApplyCancelPolicy): remove casts
3873 (NoRepeatedApplyPolicy): remove casts
3875 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3877 * src/converter.C: added some using directives
3879 * src/frontends/ButtonPolicies.C: changes to overcome
3880 "need lvalue" error with DEC c++
3882 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3883 to WMHideCB for DEC c++
3885 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3887 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3888 to BulletBMTableCB for DEC c++
3890 2000-08-31 Allan Rae <rae@lyx.org>
3892 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3893 character dialog separately from old document dialogs combo_language.
3896 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3898 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3899 Removed LFUN_REF_CREATE.
3901 * src/MenuBackend.C: Added new tags: toc and references
3903 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3904 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3906 (add_toc, add_references): New methods.
3907 (create_submenu): Handle correctly the case when there is a
3908 seperator after optional menu items.
3910 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3911 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3912 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3914 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3916 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3918 * src/converter.[Ch]: New file for converting between different
3921 * src/export.[Ch]: New file for exporting a LyX file to different
3924 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3925 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3926 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3927 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3928 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3929 RunDocBook, MenuExport.
3931 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3932 Exporter::Preview methods if NEW_EXPORT is defined.
3934 * src/buffer.C (Dispatch): Use Exporter::Export.
3936 * src/lyxrc.C: Added new tags: \converter and \viewer.
3939 * src/LyXAction.C: Define new lyx-function: buffer-update.
3940 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3941 when NEW_EXPORT is defined.
3943 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3945 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3947 * lib/ui/default.ui: Added submenus "view" and "update" to the
3950 * src/filetools.C (GetExtension): New function.
3952 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3954 2000-08-29 Allan Rae <rae@lyx.org>
3956 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3958 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3959 (EnableDocumentLayout): removed
3960 (DisableDocumentLayout): removed
3961 (build): make use of ButtonController's read-only handling to
3962 de/activate various objects. Replaces both of the above functions.
3964 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3965 (readOnly): was read_only
3966 (refresh): fixed dumb mistakes with read_only_ handling
3968 * src/frontends/xforms/forms/form_document.fd:
3969 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3970 tabbed dialogs so the tabs look more like tabs and so its easier to
3971 work out which is the current tab.
3973 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3974 segfault with form_table
3976 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3978 2000-08-28 Juergen Vigna <jug@sad.it>
3980 * acconfig.h: added USE_PSPELL.
3982 * src/config.h.in: added USE_PSPELL.
3984 * autogen.sh: added pspell.m4
3986 * config/pspell.m4: new file.
3988 * src/spellchecker.C: implemented support for pspell libary.
3990 2000-08-25 Juergen Vigna <jug@sad.it>
3992 * src/LyXAction.C (init): renamed LFUN_TABLE to
3993 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3995 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3997 * src/lyxscreen.h: add force_clear variable and fuction to force
3998 a clear area when redrawing in LyXText.
4000 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4002 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4004 * some whitespace and comment changes.
4006 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4008 * src/buffer.C: up te LYX_FORMAT to 2.17
4010 2000-08-23 Juergen Vigna <jug@sad.it>
4012 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4015 * src/insets/insettabular.C (pasteSelection): delete the insets
4016 LyXText as it is not valid anymore.
4017 (copySelection): new function.
4018 (pasteSelection): new function.
4019 (cutSelection): new function.
4020 (LocalDispatch): implemented cut/copy/paste of cell selections.
4022 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4023 don't have a LyXText.
4025 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4027 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4030 2000-08-22 Juergen Vigna <jug@sad.it>
4032 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4033 ifdef form_table out if NEW_TABULAR.
4035 2000-08-21 Juergen Vigna <jug@sad.it>
4037 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4038 (draw): fixed draw position so that the cursor is positioned in the
4040 (InsetMotionNotify): hide/show cursor so the position is updated.
4041 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4042 using cellstart() function where it should be used.
4044 * src/insets/insettext.C (draw): ditto.
4046 * src/tabular.C: fixed initialization of some missing variables and
4047 made BoxType into an enum.
4049 2000-08-22 Marko Vendelin <markov@ioc.ee>
4050 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4051 stock menu item using action numerical value, not its string
4055 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4057 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4058 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4060 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4062 * src/frontends/xforms/GUIRunTime.C: new file
4064 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4065 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4067 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4069 * src/frontends/kde/GUIRunTime.C: new file
4071 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4072 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4074 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4076 * src/frontends/gnome/GUIRunTime.C: new file
4078 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4081 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4082 small change to documetentation.
4084 * src/frontends/GUIRunTime.C: removed file
4086 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4088 * src/lyxparagraph.h: enable NEW_TABULAR as default
4090 * src/lyxfunc.C (processKeySym): remove some commented code
4092 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4093 NEW_TABULAR around the fd_form_table_options.
4095 * src/lyx_gui.C (runTime): call the static member function as
4096 GUIRunTime::runTime().
4098 2000-08-21 Allan Rae <rae@lyx.org>
4100 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4103 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4105 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4107 2000-08-21 Allan Rae <rae@lyx.org>
4109 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4110 keep Garst happy ;-)
4111 * src/frontends/xforms/FormPreferences.C (build): use setOK
4112 * src/frontends/xforms/FormDocument.C (build): use setOK
4113 (FormDocument): use the appropriate policy.
4115 2000-08-21 Allan Rae <rae@lyx.org>
4117 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4118 automatic [de]activation of arbitrary objects when in a read-only state.
4120 * src/frontends/ButtonPolicies.h: More documentation
4121 (isReadOnly): added to support the above.
4123 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4125 2000-08-18 Juergen Vigna <jug@sad.it>
4127 * src/insets/insettabular.C (getStatus): changed to return func_status.
4129 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4130 display toggle menu entries if they are.
4132 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4133 new document layout now.
4135 * src/lyxfunc.C: ditto
4137 * src/lyx_gui_misc.C: ditto
4139 * src/lyx_gui.C: ditto
4141 * lib/ui/default.ui: removed paper and quotes layout as they are now
4142 all in the document layout tabbed folder.
4144 * src/frontends/xforms/forms/form_document.fd: added Restore
4145 button and callbacks for all inputs for Allan's ButtonPolicy.
4147 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4148 (CheckChoiceClass): added missing params setting on class change.
4149 (UpdateLayoutDocument): added for updating the layout on params.
4150 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4151 (FormDocument): Implemented Allan's ButtonPolicy with the
4154 2000-08-17 Allan Rae <rae@lyx.org>
4156 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4157 so we can at least see the credits again.
4159 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4160 controller calls for the appropriate callbacks. Note that since Ok
4161 calls apply followed by cancel, and apply isn't a valid input for the
4162 APPLIED state, the bc_ calls have to be made in the static callback not
4163 within each of the real callbacks.
4165 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4166 (setOk): renamed from setOkay()
4168 2000-08-17 Juergen Vigna <jug@sad.it>
4170 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4171 in the implementation part.
4172 (composeUIInfo): don't show optional menu-items.
4174 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4176 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4178 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4179 text-state when in a text-inset.
4181 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4183 2000-08-17 Marko Vendelin <markov@ioc.ee>
4184 * src/frontends/gnome/FormIndex.C
4185 * src/frontends/gnome/FormIndex.h
4186 * src/frontends/gnome/FormToc.C
4187 * src/frontends/gnome/FormToc.h
4188 * src/frontends/gnome/dialogs
4189 * src/frontends/gnome/diatoc_callbacks.c
4190 * src/frontends/gnome/diatoc_callbacks.h
4191 * src/frontends/gnome/diainsertindex_callbacks.h
4192 * src/frontends/gnome/diainsertindex_callbacks.c
4193 * src/frontends/gnome/diainsertindex_interface.c
4194 * src/frontends/gnome/diainsertindex_interface.h
4195 * src/frontends/gnome/diatoc_interface.h
4196 * src/frontends/gnome/diatoc_interface.c
4197 * src/frontends/gnome/Makefile.am: Table of Contents and
4198 Insert Index dialogs implementation for Gnome frontend
4200 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4202 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4204 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4207 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4209 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4210 destructor. Don't definde if you don't need it
4211 (processEvents): made static, non-blocking events processing for
4213 (runTime): static method. event loop for xforms
4214 * similar as above for kde and gnome.
4216 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4217 new Pimpl is correct
4218 (runTime): new method calss the real frontends runtime func.
4220 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4222 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4224 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4226 2000-08-16 Juergen Vigna <jug@sad.it>
4228 * src/lyx_gui.C (runTime): added GUII RunTime support.
4230 * src/frontends/Makefile.am:
4231 * src/frontends/GUIRunTime.[Ch]:
4232 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4233 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4234 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4236 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4238 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4239 as this is already set in ${FRONTEND_INCLUDE} if needed.
4241 * configure.in (CPPFLAGS): setting the include dir for the frontend
4242 directory and don't set FRONTEND=xforms for now as this is executed
4245 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4247 * src/frontends/kde/Makefile.am:
4248 * src/frontends/kde/FormUrl.C:
4249 * src/frontends/kde/FormUrl.h:
4250 * src/frontends/kde/formurldialog.h:
4251 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4253 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4255 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4257 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4259 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4262 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4264 * src/WorkArea.C (work_area_handler): more work to get te
4265 FL_KEYBOARD to work with xforms 0.88 too, please test.
4267 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4269 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4271 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4274 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4276 * src/Timeout.h: remove Qt::emit hack.
4278 * several files: changes to allo doc++ compilation
4280 * src/lyxfunc.C (processKeySym): new method
4281 (processKeyEvent): comment out if FL_REVISION < 89
4283 * src/WorkArea.C: change some debugging levels.
4284 (WorkArea): set wantkey to FL_KEY_ALL
4285 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4286 clearer code and the use of compose with XForms 0.89. Change to
4287 use signals instead of calling methods in bufferview directly.
4289 * src/Painter.C: change some debugging levels.
4291 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4294 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4295 (workAreaKeyPress): new method
4297 2000-08-14 Juergen Vigna <jug@sad.it>
4299 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4301 * config/kde.m4: addes some features
4303 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4304 include missing xforms dialogs.
4306 * src/Timeout.h: a hack to be able to compile with qt/kde.
4308 * sigc++/.cvsignore: added acinclude.m4
4310 * lib/.cvsignore: added listerros
4312 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4313 xforms tree as objects are needed for other frontends.
4315 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4316 linking with not yet implemented xforms objects.
4318 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4320 2000-08-14 Baruch Even <baruch.even@writeme.com>
4322 * src/frontends/xforms/FormGraphics.h:
4323 * src/frontends/xforms/FormGraphics.C:
4324 * src/frontends/xforms/RadioButtonGroup.h:
4325 * src/frontends/xforms/RadioButtonGroup.C:
4326 * src/insets/insetgraphics.h:
4327 * src/insets/insetgraphics.C:
4328 * src/insets/insetgraphicsParams.h:
4329 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4330 instead of spaces, and various other indentation issues to make the
4331 sources more consistent.
4333 2000-08-14 Marko Vendelin <markov@ioc.ee>
4335 * src/frontends/gnome/dialogs/diaprint.glade
4336 * src/frontends/gnome/FormPrint.C
4337 * src/frontends/gnome/FormPrint.h
4338 * src/frontends/gnome/diaprint_callbacks.c
4339 * src/frontends/gnome/diaprint_callbacks.h
4340 * src/frontends/gnome/diaprint_interface.c
4341 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4344 * src/frontends/gnome/dialogs/diainserturl.glade
4345 * src/frontends/gnome/FormUrl.C
4346 * src/frontends/gnome/FormUrl.h
4347 * src/frontends/gnome/diainserturl_callbacks.c
4348 * src/frontends/gnome/diainserturl_callbacks.h
4349 * src/frontends/gnome/diainserturl_interface.c
4350 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4351 Gnome implementation
4353 * src/frontends/gnome/Dialogs.C
4354 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4355 all other dialogs. Copy all unimplemented dialogs from Xforms
4358 * src/frontends/gnome/support.c
4359 * src/frontends/gnome/support.h: support files generated by Glade
4363 * config/gnome.m4: Gnome configuration scripts
4365 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4366 configure --help message
4368 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4369 only if there are no events pendling in Gnome/Gtk. This enhances
4370 the performance of menus.
4373 2000-08-14 Allan Rae <rae@lyx.org>
4375 * lib/Makefile.am: listerrors cleaning
4377 * lib/listerrors: removed -- generated file
4378 * acinclude.m4: ditto
4379 * sigc++/acinclude.m4: ditto
4381 * src/frontends/xforms/forms/form_citation.fd:
4382 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4385 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4386 `updatesrc` and now we have a `test` target that does what `updatesrc`
4387 used to do. I didn't like having an install target that wasn't related
4390 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4391 on all except FormGraphics. This may yet happen. Followed by a major
4392 cleanup including using FL_TRANSIENT for most of the dialogs. More
4393 changes to come when the ButtonController below is introduced.
4395 * src/frontends/xforms/ButtonController.h: New file for managing up to
4396 four buttons on a dialog according to an externally defined policy.
4397 * src/frontends/xforms/Makefile.am: added above
4399 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4400 Apply and Cancel/Close buttons and everything in between and beyond.
4401 * src/frontends/Makefile.am: added above.
4403 * src/frontends/xforms/forms/form_preferences.fd:
4404 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4405 and removed variable 'status' as a result. Fixed the set_minsize thing.
4406 Use the new screen-font-update after checking screen fonts were changed
4407 Added a "Restore" button to restore the original lyxrc values while
4408 editing. This restores everything not just the last input changed.
4409 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4411 * src/LyXAction.C: screen-font-update added for updating buffers after
4412 screen font settings have been changed.
4413 * src/commandtags.h: ditto
4414 * src/lyxfunc.C: ditto
4416 * forms/lyx.fd: removed screen fonts dialog.
4417 * src/lyx_gui.C: ditto
4418 * src/menus.[Ch]: ditto
4419 * src/lyx.[Ch]: ditto
4420 * src/lyx_cb.C: ditto + code from here moved to make
4421 screen-font-update. And people wonder why progress on GUII is
4422 slow. Look at how scattered this stuff was! It takes forever
4425 * forms/fdfix.sh: Fixup the spacing after commas.
4426 * forms/makefile: Remove date from generated files. Fewer clashes now.
4427 * forms/bullet_forms.C.patch: included someones handwritten changes
4429 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4430 once I've discovered why LyXRC was made noncopyable.
4431 * src/lyx_main.C: ditto
4433 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4435 * src/frontends/xforms/forms/fdfix.sh:
4436 * src/frontends/xforms/forms/fdfixh.sed:
4437 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4438 * src/frontends/xforms/Form*.[hC]:
4439 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4440 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4441 provide a destructor for the struct FD_form_xxxx. Another version of
4442 the set_[max|min]size workaround and a few other cleanups. Actually,
4443 Angus' patch from 20000809.
4445 2000-08-13 Baruch Even <baruch.even@writeme.com>
4447 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4450 2000-08-11 Juergen Vigna <jug@sad.it>
4452 * src/insets/insetgraphics.C (InsetGraphics): changing init
4453 order because of warnings.
4455 * src/frontends/xforms/forms/makefile: adding patching .C with
4458 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4459 from .C.patch to .c.patch
4461 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4462 order because of warning.
4464 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4466 * src/frontends/Liason.C (setMinibuffer): new helper function
4468 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4470 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4472 * lib/ui/default.ui: commented out PaperLayout entry
4474 * src/frontends/xforms/form_document.[Ch]: new added files
4476 * src/frontends/xforms/FormDocument.[Ch]: ditto
4478 * src/frontends/xforms/forms/form_document.fd: ditto
4480 * src/frontends/xforms/forms/form_document.C.patch: ditto
4482 2000-08-10 Juergen Vigna <jug@sad.it>
4484 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4485 (InsetGraphics): initialized cacheHandle to 0.
4486 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4488 2000-08-10 Baruch Even <baruch.even@writeme.com>
4490 * src/graphics/GraphicsCache.h:
4491 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4492 correctly as a cache.
4494 * src/graphics/GraphicsCacheItem.h:
4495 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4498 * src/graphics/GraphicsCacheItem_pimpl.h:
4499 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4502 * src/insets/insetgraphics.h:
4503 * src/insets/insetgraphics.C: Changed from using a signal notification
4504 to polling when image is not loaded.
4506 2000-08-10 Allan Rae <rae@lyx.org>
4508 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4509 that there are two functions that have to been taken out of line by
4510 hand and aren't taken care of in the script. (Just a reminder note)
4512 * sigc++/macros/*.h.m4: Updated as above.
4514 2000-08-09 Juergen Vigna <jug@sad.it>
4516 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4518 * src/insets/insettabular.C: make drawing of single cell smarter.
4520 2000-08-09 Marko Vendelin <markov@ioc.ee>
4521 * src/frontends/gnome/Menubar_pimpl.C
4522 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4523 implementation: new files
4525 * src/frontends/gnome/mainapp.C
4526 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4529 * src/main.C: create Gnome main window
4531 * src/frontends/xforms/Menubar_pimpl.h
4532 * src/frontends/Menubar.C
4533 * src/frontends/Menubar.h: added method Menubar::update that calls
4534 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4536 * src/LyXView.C: calls Menubar::update to update the state
4539 * src/frontends/gnome/Makefile.am: added new files
4541 * src/frontends/Makefile.am: added frontend compiler options
4543 2000-08-08 Juergen Vigna <jug@sad.it>
4545 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4547 * src/bufferlist.C (close):
4548 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4549 documents if exiting without saving.
4551 * src/buffer.C (save): use removeAutosaveFile()
4553 * src/support/filetools.C (removeAutosaveFile): new function.
4555 * src/lyx_cb.C (MenuWrite): returns a bool now.
4556 (MenuWriteAs): check if file could really be saved and revert to the
4558 (MenuWriteAs): removing old autosavefile if existant.
4560 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4561 before Goto toggle declaration, because of compiler warning.
4563 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4565 * src/lyxfunc.C (MenuNew): small fix.
4567 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4569 * src/bufferlist.C (newFile):
4570 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4572 * src/lyxrc.C: added new_ask_filename tag
4574 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4576 * src/lyx.fd: removed code pertaining to form_ref
4577 * src/lyx.[Ch]: ditto
4578 * src/lyx_cb.C: ditto
4579 * src/lyx_gui.C: ditto
4580 * src/lyx_gui_misc.C: ditto
4582 * src/BufferView_pimpl.C (restorePosition): update buffer only
4585 * src/commandtags.h (LFUN_REFTOGGLE): removed
4586 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4587 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4588 (LFUN_REFBACK): renamed LFUN_REF_BACK
4590 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4591 * src/menus.C: ditto
4592 * src/lyxfunc.C (Dispatch): ditto.
4593 InsertRef dialog is now GUI-independent.
4595 * src/texrow.C: added using std::endl;
4597 * src/insets/insetref.[Ch]: strip out large amounts of code.
4598 The inset is now a container and this functionality is now
4599 managed by a new FormRef dialog
4601 * src/frontends/Dialogs.h (showRef, createRef): new signals
4603 * src/frontends/xforms/FormIndex.[Ch],
4604 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4605 when setting dialog's min/max size
4606 * src/frontends/xforms/FormIndex.[Ch]: ditto
4608 * src/frontends/xforms/FormRef.[Ch],
4609 src/frontends/xforms/forms/form_ref.fd: new xforms
4610 implementation of an InsetRef dialog
4612 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4615 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4616 ios::nocreate is not part of the standard. Removed.
4618 2000-08-07 Baruch Even <baruch.even@writeme.com>
4620 * src/graphics/Renderer.h:
4621 * src/graphics/Renderer.C: Added base class for rendering of different
4622 image formats into Pixmaps.
4624 * src/graphics/XPM_Renderer.h:
4625 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4626 in a different class.
4628 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4629 easily add support for other formats.
4631 * src/insets/figinset.C: plugged a leak of an X resource.
4633 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4635 * src/CutAndPaste.[Ch]: make all metods static.
4637 * development/Code_rules/Rules: more work, added section on
4638 Exceptions, and a References section.
4640 * a lot of header files: work to make doc++ able to generate the
4641 source documentation, some workarounds of doc++ problems. Doc++ is
4642 now able to generate the documentation.
4644 2000-08-07 Juergen Vigna <jug@sad.it>
4646 * src/insets/insettabular.C (recomputeTextInsets): removed function
4648 * src/tabular.C (SetWidthOfMulticolCell):
4650 (calculate_width_of_column_NMC): fixed return value so that it really
4651 only returns true if the column-width has changed (there where
4652 problems with muliticolumn-cells in this column).
4654 2000-08-04 Juergen Vigna <jug@sad.it>
4656 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4657 also on the scrollstatus of the inset.
4658 (workAreaMotionNotify): ditto.
4660 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4662 2000-08-01 Juergen Vigna <jug@sad.it>
4664 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4666 * src/commandtags.h:
4667 * src/LyXAction.C (init):
4668 * src/insets/inset.C (LocalDispatch): added support for
4671 * src/insets/inset.C (scroll): new functions.
4673 * src/insets/insettext.C (removeNewlines): new function.
4674 (SetAutoBreakRows): removes forced newlines in the text of the
4675 paragraph if autoBreakRows is set to false.
4677 * src/tabular.C (Latex): generates a parbox around the cell contents
4680 * src/frontends/xforms/FormTabular.C (local_update): removed
4681 the radio_useparbox button.
4683 * src/tabular.C (UseParbox): new function
4685 2000-08-06 Baruch Even <baruch.even@writeme.com>
4687 * src/graphics/GraphicsCache.h:
4688 * src/graphics/GraphicsCache.C:
4689 * src/graphics/GraphicsCacheItem.h:
4690 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4693 * src/insets/insetgraphics.h:
4694 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4695 and the drawing of the inline image.
4697 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4698 loaded into the wrong position.
4700 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4703 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4705 * src/support/translator.h: move all typedefs to public section
4707 * src/support/filetools.C (MakeLatexName): return string const
4709 (TmpFileName): ditto
4710 (FileOpenSearch): ditto
4712 (LibFileSearch): ditto
4713 (i18nLibFileSearch): ditto
4716 (CreateTmpDir): ditto
4717 (CreateBufferTmpDir): ditto
4718 (CreateLyXTmpDir): ditto
4721 (MakeAbsPath): ditto
4723 (OnlyFilename): ditto
4725 (NormalizePath): ditto
4726 (CleanupPath): ditto
4727 (GetFileContents): ditto
4728 (ReplaceEnvironmentPath): ditto
4729 (MakeRelPath): ditto
4731 (ChangeExtension): ditto
4732 (MakeDisplayPath): ditto
4733 (do_popen): return cmdret const
4734 (findtexfile): return string const
4736 * src/support/DebugStream.h: add some /// to please doc++
4738 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4740 * src/texrow.C (same_rownumber): functor to use with find_if
4741 (getIdFromRow): rewritten to use find_if and to not update the
4742 positions. return true if row is found
4743 (increasePos): new method, use to update positions
4745 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4747 * src/lyxlex_pimpl.C (verifyTable): new method
4750 (GetString): return string const
4751 (pushTable): rewrite to use std::stack
4753 (setFile): better check
4756 * src/lyxlex.h: make LyXLex noncopyable
4758 * src/lyxlex.C (text): return char const * const
4759 (GetString): return string const
4760 (getLongString): return string const
4762 * src/lyx_gui_misc.C (askForText): return pair<...> const
4764 * src/lastfiles.[Ch] (operator): return string const
4766 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4767 istringstream not char const *.
4768 move token.end() out of loop.
4769 (readFile): move initializaton of token
4771 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4772 getIdFromRow is successful.
4774 * lib/bind/emacs.bind: don't include menus bind
4776 * development/Code_rules/Rules: the beginnings of making this
4777 better and covering more of the unwritten rules that we have.
4779 * development/Code_rules/Recommendations: a couple of wording
4782 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4784 * src/support/strerror.c: remove C++ comment.
4786 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4788 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4789 LFUN_INDEX_INSERT_LAST
4791 * src/texrow.C (getIdFromRow): changed from const_iterator to
4792 iterator, allowing code to compile with DEC cxx
4794 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4795 stores part of the class, as suggested by Allan. Will allow
4797 (apply): test to apply uses InsetCommandParams operator!=
4799 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4800 (apply): test to apply uses InsetCommandParams operator!=
4802 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4803 stores part of the class.
4804 (update): removed limits on min/max size.
4806 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4807 (apply): test to apply uses InsetCommandParams operator!=
4809 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4810 (Read, Write, scanCommand, getCommand): moved functionality
4811 into InsetCommandParams.
4813 (getScreenLabel): made pure virtual
4814 new InsetCommandParams operators== and !=
4816 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4817 c-tors based on InsetCommandParams. Removed others.
4818 * src/insets/insetinclude.[Ch]: ditto
4819 * src/insets/insetlabel.[Ch]: ditto
4820 * src/insets/insetparent.[Ch]: ditto
4821 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4823 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4824 insets derived from InsetCommand created using similar c-tors
4825 based on InsetCommandParams
4826 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4827 * src/menus.C (ShowRefsMenu): ditto
4828 * src/paragraph.C (Clone): ditto
4829 * src/text2.C (SetCounter): ditto
4830 * src/lyxfunc.C (Dispatch) ditto
4831 Also recreated old InsetIndex behaviour exactly. Can now
4832 index-insert at the start of a paragraph and index-insert-last
4833 without launching the pop-up.
4835 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * lib/lyxrc.example: mark te pdf options as non functional.
4839 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4840 (isStrDbl): move tmpstr.end() out of loop.
4841 (strToDbl): move intialization of tmpstr
4842 (lowercase): return string const and move tmp.end() out of loop.
4843 (uppercase): return string const and move tmp.edn() out of loop.
4844 (prefixIs): add assertion
4849 (containsOnly): ditto
4850 (containsOnly): ditto
4851 (containsOnly): ditto
4852 (countChar): make last arg char not char const
4853 (token): return string const
4854 (subst): return string const, move tmp.end() out of loop.
4855 (subst): return string const, add assertion
4856 (strip): return string const
4857 (frontStrip): return string const, add assertion
4858 (frontStrip): return string const
4863 * src/support/lstrings.C: add inclde "LAssert.h"
4864 (isStrInt): move tmpstr.end() out of loop.
4866 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4867 toollist.end() out of loop.
4868 (deactivate): move toollist.end() out of loop.
4869 (update): move toollist.end() out of loop.
4870 (updateLayoutList): move tc.end() out of loop.
4871 (add): move toollist.end() out of loop.
4873 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4874 md.end() out of loop.
4876 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4878 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4881 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4882 (Erase): move insetlist.end() out of loop.
4884 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4885 ref to const string as first arg. Move initialization of some
4886 variables, whitespace changes.
4888 * src/kbmap.C (defkey): move table.end() out of loop.
4889 (kb_keymap): move table.end() out of loop.
4890 (findbinding): move table.end() out of loop.
4892 * src/MenuBackend.C (hasMenu): move end() out of loop.
4893 (getMenu): move end() out of loop.
4894 (getMenu): move menulist_.end() out of loop.
4896 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4898 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4901 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4902 (getFromLyXName): move infotab.end() out of loop.
4904 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4905 -fvtable-thunks -ffunction-sections -fdata-sections
4907 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4909 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4912 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4914 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4916 * src/frontends/xforms/FormCitation.[Ch],
4917 src/frontends/xforms/FormIndex.[Ch],
4918 src/frontends/xforms/FormToc.[Ch],
4919 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4921 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4923 * src/commandtags.h: renamed, created some flags for citation
4926 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4928 * src/lyxfunc.C (dispatch): use signals to insert index entry
4930 * src/frontends/Dialogs.h: new signal createIndex
4932 * src/frontends/xforms/FormCommand.[Ch],
4933 src/frontends/xforms/FormCitation.[Ch],
4934 src/frontends/xforms/FormToc.[Ch],
4935 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4937 * src/insets/insetindex.[Ch]: GUI-independent
4939 * src/frontends/xforms/FormIndex.[Ch],
4940 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4943 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4945 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4946 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4948 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4950 * src/insets/insetref.C (Latex): rewrite so that there is now
4951 question that a initialization is requested.
4953 * src/insets/insetcommand.h: reenable the hide signal
4955 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4957 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4958 fix handling of shortcuts (many bugs :)
4959 (add_lastfiles): ditto.
4961 * lib/ui/default.ui: fix a few shortcuts.
4963 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4965 * Makefile.am: Fix ``rpmdist'' target to return the exit
4966 status of the ``rpm'' command, instead of the last command in
4967 the chain (the ``rm lyx.xpm'' command, which always returns
4970 2000-08-02 Allan Rae <rae@lyx.org>
4972 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4973 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4974 * src/frontends/xforms/FormToc.C (FormToc): ditto
4976 * src/frontends/xforms/Makefile.am: A few forgotten files
4978 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4979 Signals-not-copyable-problem Lars' started commenting out.
4981 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4983 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4985 * src/insets/insetcommand.h: Signals is not copyable so anoter
4986 scheme for automatic hiding of forms must be used.
4988 * src/frontends/xforms/FormCitation.h: don't inerit from
4989 noncopyable, FormCommand already does that.
4990 * src/frontends/xforms/FormToc.h: ditto
4991 * src/frontends/xforms/FormUrl.h: ditto
4993 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4995 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4997 * src/insets/insetcommand.h (hide): new SigC::Signal0
4998 (d-tor) new virtual destructor emits hide signal
5000 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5001 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5003 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5004 LOF and LOT. Inset is now GUI-independent
5006 * src/insets/insetloa.[Ch]: redundant
5007 * src/insets/insetlof.[Ch]: ditto
5008 * src/insets/insetlot.[Ch]: ditto
5010 * src/frontends/xforms/forms/form_url.fd: tweaked!
5011 * src/frontends/xforms/forms/form_citation.fd: ditto
5013 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5014 dialogs dealing with InsetCommand insets
5016 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5017 FormCommand base class
5018 * src/frontends/xforms/FormUrl.[Ch]: ditto
5020 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5022 * src/frontends/xforms/FormToc.[Ch]: ditto
5024 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5025 passed a generic InsetCommand pointer
5026 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5028 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5029 and modified InsetTOC class
5030 * src/buffer.C: ditto
5032 * forms/lyx.fd: strip out old FD_form_toc code
5033 * src/lyx_gui_misc.C: ditto
5034 * src/lyx_gui.C: ditto
5035 * src/lyx_cb.C: ditto
5036 * src/lyx.[Ch]: ditto
5038 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5040 * src/support/utility.hpp: tr -d '\r'
5042 2000-08-01 Juergen Vigna <jug@sad.it>
5044 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5046 * src/commandtags.h:
5047 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5048 LFUN_TABULAR_FEATURES.
5050 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5051 LFUN_LAYOUT_TABULAR.
5053 * src/insets/insettabular.C (getStatus): implemented helper function.
5055 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5057 2000-07-31 Juergen Vigna <jug@sad.it>
5059 * src/text.C (draw): fixed screen update problem for text-insets.
5061 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5062 something changed probably this has to be added in various other
5065 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5067 2000-07-31 Baruch Even <baruch.even@writeme.com>
5069 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5070 templates to satisfy compaq cxx.
5073 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5075 * src/support/translator.h (equal_1st_in_pair::operator()): take
5076 const ref pair_type as arg.
5077 (equal_2nd_in_pair::operator()): ditto
5078 (Translator::~Translator): remove empty d-tor.
5080 * src/graphics/GraphicsCache.C: move include config.h to top, also
5081 put initialization of GraphicsCache::singleton here.
5082 (~GraphicsCache): move here
5083 (addFile): take const ref as arg
5086 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5088 * src/BufferView2.C (insertLyXFile): change te with/without header
5091 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5093 * src/frontends/xforms/FormGraphics.C (apply): add some
5094 static_cast. Not very nice, but required by compaq cxx.
5096 * src/frontends/xforms/RadioButtonGroup.h: include header
5097 <utility> instead of <pair.h>
5099 * src/insets/insetgraphicsParams.C: add using directive.
5100 (readResize): change return type to void.
5101 (readOrigin): ditto.
5103 * src/lyxfunc.C (getStatus): add missing break for build-program
5104 function; add test for Literate for export functions.
5106 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5107 entries in Options menu.
5109 2000-07-31 Baruch Even <baruch.even@writeme.com>
5111 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5112 protect against auto-allocation; release icon when needed.
5114 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5116 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5117 on usual typewriter.
5119 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5120 earlier czech.kmap), useful only for programming.
5122 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5124 * src/frontends/xforms/FormCitation.h: fix conditioning around
5127 2000-07-31 Juergen Vigna <jug@sad.it>
5129 * src/frontends/xforms/FormTabular.C (local_update): changed
5130 radio_linebreaks to radio_useparbox and added radio_useminipage.
5132 * src/tabular.C: made support for using minipages/parboxes.
5134 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5136 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5138 (descent): so the cursor is in the middle.
5139 (width): bit smaller box.
5141 * src/insets/insetgraphics.h: added display() function.
5143 2000-07-31 Baruch Even <baruch.even@writeme.com>
5145 * src/frontends/Dialogs.h: Added showGraphics signals.
5147 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5148 xforms form definition of the graphics dialog.
5150 * src/frontends/xforms/FormGraphics.h:
5151 * src/frontends/xforms/FormGraphics.C: Added files, the
5152 GUIndependent code of InsetGraphics
5154 * src/insets/insetgraphics.h:
5155 * src/insets/insetgraphics.C: Major writing to make it work.
5157 * src/insets/insetgraphicsParams.h:
5158 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5159 struct between InsetGraphics and GUI.
5161 * src/LaTeXFeatures.h:
5162 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5163 support for graphicx package.
5165 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5166 for the graphics inset.
5168 * src/support/translator.h: Added file, used in
5169 InsetGraphicsParams. this is a template to translate between two
5172 * src/frontends/xforms/RadioButtonGroup.h:
5173 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5174 way to easily control a radio button group.
5176 2000-07-28 Juergen Vigna <jug@sad.it>
5178 * src/insets/insettabular.C (LocalDispatch):
5179 (TabularFeatures): added support for lyx-functions of tabular features.
5180 (cellstart): refixed this function after someone wrongly changed it.
5182 * src/commandtags.h:
5183 * src/LyXAction.C (init): added support for tabular-features
5185 2000-07-28 Allan Rae <rae@lyx.org>
5187 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5188 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5189 triggers the callback for input checking. As a result we sometimes get
5190 "LyX: This shouldn't happen..." printed to cerr.
5191 (input): Started using status variable since I only free() on
5192 destruction. Some input checking for paths and font sizes.
5194 * src/frontends/xforms/FormPreferences.h: Use status to control
5195 activation of Ok and Apply
5197 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5198 callback. Also resized to stop segfaults with 0.88. The problem is
5199 that xforms-0.88 requires the folder to be wide enough to fit all the
5200 tabs. If it isn't it causes all sorts of problems.
5202 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5204 * src/frontends/xforms/forms/README: Reflect reality.
5206 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5207 * src/frontends/xforms/forms/makefile: ditto.
5209 * src/commandtags.h: Get access to new Preferences dialog
5210 * src/LyXAction.C: ditto
5211 * src/lyxfunc.C: ditto
5212 * lib/ui/default.ui: ditto
5214 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5216 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5218 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5221 * src/frontends/xforms/form_url.[Ch]: added.
5223 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5225 * src/insets/insetbib.h: fixed bug in previous commit
5227 * src/frontends/xforms/FormUrl.h: ditto
5229 * src/frontends/xforms/FormPrint.h: ditto
5231 * src/frontends/xforms/FormPreferences.h: ditto
5233 * src/frontends/xforms/FormCopyright.h: ditto
5235 * src/frontends/xforms/FormCitation.C: ditto
5237 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5238 private copyconstructor and private default contructor
5240 * src/support/Makefile.am: add utility.hpp
5242 * src/support/utility.hpp: new file from boost
5244 * src/insets/insetbib.h: set owner in clone
5246 * src/frontends/xforms/FormCitation.C: added missing include
5249 * src/insets/form_url.[Ch]: removed
5251 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5253 * development/lyx.spec.in
5254 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5255 file/directory re-organization.
5257 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5259 * src/insets/insetcommand.[Ch]: moved the string data and
5260 associated manipulation methods into a new stand-alone class
5261 InsetCommandParams. This class has two additional methods
5262 getAsString() and setFromString() allowing the contents to be
5263 moved around as a single string.
5264 (addContents) method removed.
5265 (setContents) method no longer virtual.
5267 * src/buffer.C (readInset): made use of new InsetCitation,
5268 InsetUrl constructors based on InsetCommandParams.
5270 * src/commandtags.h: add LFUN_INSERT_URL
5272 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5273 independent InsetUrl and use InsetCommandParams to extract
5274 string info and create new Insets.
5276 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5278 * src/frontends/xforms/FormCitation.C (apply): uses
5281 * src/frontends/xforms/form_url.C
5282 * src/frontends/xforms/form_url.h
5283 * src/frontends/xforms/FormUrl.h
5284 * src/frontends/xforms/FormUrl.C
5285 * src/frontends/xforms/forms/form_url.fd: new files
5287 * src/insets/insetcite.[Ch]: removed unused constructors.
5289 * src/insets/insetinclude.[Ch]: no longer store filename
5291 * src/insets/inseturl.[Ch]: GUI-independent.
5293 2000-07-26 Juergen Vigna <jug@sad.it>
5294 * renamed frontend from gtk to gnome as it is that what is realized
5295 and did the necessary changes in the files.
5297 2000-07-26 Marko Vendelin <markov@ioc.ee>
5299 * configure.in: cleaning up gnome configuration scripts
5301 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5303 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5304 shortcuts syndrom by redrawing them explicitely (a better solution
5305 would be appreciated).
5307 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5309 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5312 * src/lyx_cb.C (MenuExport): change html export to do the right
5313 thing depending of the document type (instead of having
5314 html-linuxdoc and html-docbook).
5315 * src/lyxfunc.C (getStatus): update for html
5316 * lib/ui/default.ui: simplify due to the above change.
5317 * src/menus.C (ShowFileMenu): update too (in case we need it).
5319 * src/MenuBackend.C (read): if a menu is defined twice, add the
5320 new entries to the exiting one.
5322 2000-07-26 Juergen Vigna <jug@sad.it>
5324 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5326 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5327 and return a bool if it did actual save the file.
5328 (AutoSave): don't autosave a unnamed doc.
5330 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5331 check if this is an UNNAMED new file and react to it.
5332 (newFile): set buffer to unnamed and change to not mark a new
5333 buffer dirty if I didn't do anything with it.
5335 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5337 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5339 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5340 friend as per Angus's patch posted to lyx-devel.
5342 * src/ext_l10n.h: updated
5344 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5345 gettext on the style string right before inserting them into the
5348 * autogen.sh: add code to extract style strings form layout files,
5349 not good enough yet.
5351 * src/frontends/gtk/.cvsignore: add MAKEFILE
5353 * src/MenuBackend.C (read): run the label strings through gettext
5354 before storing them in the containers.
5356 * src/ext_l10n.h: new file
5358 * autogen.sh : generate the ext_l10n.h file here
5360 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5362 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5365 * lib/ui/default.ui: fix a couple of typos.
5367 * config/gnome/gtk.m4: added (and added to the list of files in
5370 * src/insets/insetinclude.C (unique_id): fix when we are using
5371 lyxstring instead of basic_string<>.
5372 * src/insets/insettext.C (LocalDispatch): ditto.
5373 * src/support/filetools.C: ditto.
5375 * lib/configure.m4: create the ui/ directory if necessary.
5377 * src/LyXView.[Ch] (updateToolbar): new method.
5379 * src/BufferView_pimpl.C (buffer): update the toolbar when
5380 opening/closing buffer.
5382 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5384 * src/LyXAction.C (getActionName): enhance to return also the name
5385 and options of pseudo-actions.
5386 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5388 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5389 as an example of what is possible). Used in File->Build too (more
5390 useful) and in the import/export menus (to mimick the complicated
5391 handling of linuxdoc and friends). Try to update all the entries.
5393 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5396 * src/MenuBackend.C (read): Parse the new OptItem tag.
5398 * src/MenuBackend.h: Add a new optional_ data member (used if the
5399 entry should be omitted when the lyxfunc is disabled).
5401 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5402 function, used as a shortcut.
5403 (create_submenu): align correctly the shortcuts on the widest
5406 * src/MenuBackend.h: MenuItem.label() only returns the label of
5407 the menu without shortcut; new method shortcut().
5409 2000-07-14 Marko Vendelin <markov@ioc.ee>
5411 * src/frontends/gtk/Dialogs.C:
5412 * src/frontends/gtk/FormCopyright.C:
5413 * src/frontends/gtk/FormCopyright.h:
5414 * src/frontends/gtk/Makefile.am: added these source-files for the
5415 Gtk/Gnome support of the Copyright-Dialog.
5417 * src/main.C: added Gnome::Main initialization if using
5418 Gtk/Gnome frontend-GUI.
5420 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5422 * config/gnome/aclocal-include.m4
5423 * config/gnome/compiler-flags.m4
5424 * config/gnome/curses.m4
5425 * config/gnome/gnome--.m4
5426 * config/gnome/gnome-bonobo-check.m4
5427 * config/gnome/gnome-common.m4
5428 * config/gnome/gnome-fileutils.m4
5429 * config/gnome/gnome-ghttp-check.m4
5430 * config/gnome/gnome-gnorba-check.m4
5431 * config/gnome/gnome-guile-checks.m4
5432 * config/gnome/gnome-libgtop-check.m4
5433 * config/gnome/gnome-objc-checks.m4
5434 * config/gnome/gnome-orbit-check.m4
5435 * config/gnome/gnome-print-check.m4
5436 * config/gnome/gnome-pthread-check.m4
5437 * config/gnome/gnome-support.m4
5438 * config/gnome/gnome-undelfs.m4
5439 * config/gnome/gnome-vfs.m4
5440 * config/gnome/gnome-x-checks.m4
5441 * config/gnome/gnome-xml-check.m4
5442 * config/gnome/gnome.m4
5443 * config/gnome/gperf-check.m4
5444 * config/gnome/gtk--.m4
5445 * config/gnome/linger.m4
5446 * config/gnome/need-declaration.m4: added configuration scripts
5447 for Gtk/Gnome frontend-GUI
5449 * configure.in: added support for the --with-frontend=gtk option
5451 * autogen.sh: added config/gnome/* to list of config-files
5453 * acconfig.h: added define for GTKGUI-support
5455 * config/lyxinclude.m4: added --with-frontend[=value] option value
5456 for Gtk/Gnome frontend-GUI support.
5458 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5460 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5464 * src/paragraph.C (GetChar): remove non-const version
5466 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5467 (search_kw): use it.
5469 * src/lyx_main.C (init): if "preferences" exist, read that instead
5471 (ReadRcFile): return bool if the file could be read ok.
5472 (ReadUIFile): add a check to see if lex file is set ok.
5474 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5475 bastring can be used instead of lyxstring (still uses the old code
5476 if std::string is good enough or if lyxstring is used.)
5478 * src/encoding.C: make the arrays static, move ininle functions
5480 * src/encoding.h: from here.
5482 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5483 (parseSingleLyXformat2Token): move inset parsing to separate method
5484 (readInset): new private method
5486 * src/Variables.h: remove virtual from get().
5488 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5489 access to NEW_INSETS and NEW_TABULAR
5491 * src/MenuBackend.h: remove superfluous forward declaration of
5492 MenuItem. Add documentations tags "///", remove empty MenuItem
5493 destructor, remove private default contructor.
5495 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5497 (read): more string mlabel and mname to where they are used
5498 (read): remove unused variables mlabel and mname
5499 (defaults): unconditional clear, make menusetup take advantage of
5500 add returning Menu &.
5502 * src/LyXView.h: define NEW_MENUBAR as default
5504 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5505 to NEW_INSETS and NEW_TABULAR.
5506 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5507 defined. Change some of the "xxxx-inset-insert" functions names to
5510 * several files: more enahncements to NEW_INSETS and the resulting
5513 * lib/lyxrc.example (\date_insert_format): move to misc section
5515 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5516 bastring and use AC_CACHE_CHECK.
5517 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5518 the system have the newest methods. uses AC_CACHE_CHECK
5519 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5520 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5521 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5523 * configure.in: add LYX_CXX_GOOD_STD_STRING
5525 * acinclude.m4: recreated
5527 2000-07-24 Amir Karger <karger@lyx.org>
5529 * README: add Hebrew, Arabic kmaps
5532 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5534 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5537 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5539 * Lot of files: add pragma interface/implementation.
5541 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5543 * lib/ui/default.ui: new file (ans new directory). Contains the
5544 default menu and toolbar.
5546 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5547 global space. Toolbars are now read (as menus) in ui files.
5549 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5551 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5552 is disabled because the document is read-only. We want to have the
5553 toggle state of the function anyway.
5554 (getStatus): add code for LFUN_VC* functions (mimicking what is
5555 done in old-style menus)
5557 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5558 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5560 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5561 * src/BufferView_pimpl.C: ditto.
5562 * src/lyxfunc.C: ditto.
5564 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5565 default). This replaces old-style menus by new ones.
5567 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5568 MenuItem. Contain the data structure of a menu.
5570 * src/insets/insettext.C: use LyXView::setLayout instead of
5571 accessing directly the toolbar combox.
5572 * src/lyxfunc.C (Dispatch): ditto.
5574 * src/LyXView.C (setLayout): new method, which just calls
5575 Toolbar::setLayout().
5576 (updateLayoutChoice): move part of this method in Toolbar.
5578 * src/toolbar.[Ch]: removed.
5580 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5581 implementation the toolbar.
5583 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5584 the toolbar. It might make sense to merge it with ToolbarDefaults
5586 (setLayout): new function.
5587 (updateLayoutList): ditto.
5588 (openLayoutList): ditto.
5590 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5591 xforms implementation of the toolbar.
5592 (get_toolbar_func): comment out, since I do not
5593 know what it is good for.
5595 * src/ToolbarDefaults.h: Add the ItemType enum.
5597 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5598 for a list of allocated C strings. Used in Menubar xforms
5599 implementation to avoid memory leaks.
5601 * src/support/lstrings.[Ch] (uppercase): new version taking and
5605 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5606 * lib/bind/emacs.bind: ditto.
5608 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5610 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5611 forward decl of LyXView.
5613 * src/toolbar.C (toolbarItem): moved from toolbar.h
5614 (toolbarItem::clean): ditto
5615 (toolbarItem::~toolbarItem): ditto
5616 (toolbarItem::operator): ditto
5618 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5620 * src/paragraph.h: control the NEW_TABULAR define from here
5622 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5623 USE_TABULAR_INSETS to NEW_TABULAR
5625 * src/ToolbarDefaults.C: add include "lyxlex.h"
5627 * files using the old table/tabular: use NEW_TABULAR to control
5628 compilation of old tabular stuff.
5630 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5633 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5634 planemet in reading of old style floats, fix the \end_deeper
5635 problem when reading old style floats.
5637 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5639 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5641 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5643 * lib/bind/sciword.bind: updated.
5645 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5647 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5648 layout write problem
5650 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5652 * src/Makefile.am (INCLUDES): remove image directory from include
5655 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5656 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5658 * src/LyXView.C (create_form_form_main): read the application icon
5661 * lib/images/*.xpm: change the icons to use transparent color for
5664 * src/toolbar.C (update): change the color of the button when it
5667 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5669 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5670 setting explicitely the minibuffer.
5671 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5673 * src/LyXView.C (showState): new function. Shows font information
5674 in minibuffer and update toolbar state.
5675 (LyXView): call Toolbar::update after creating the
5678 * src/toolbar.C: change toollist to be a vector instead of a
5680 (BubbleTimerCB): get help string directly from the callback
5681 argument of the corresponding icon (which is the action)
5682 (set): remove unnecessary ugliness.
5683 (update): new function. update the icons (depressed, disabled)
5684 depending of the status of the corresponding action.
5686 * src/toolbar.h: remove help in toolbarItem
5688 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5690 * src/Painter.C (text): Added code for using symbol glyphs from
5691 iso10646 fonts. Currently diabled.
5693 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5696 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5697 magyar,turkish and usorbian.
5699 * src/paragraph.C (isMultiLingual): Made more efficient.
5701 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5704 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5705 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5706 Also changed the prototype to "bool math_insert_greek(char)".
5708 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5710 * lots of files: apply the NEW_INSETS on all code that will not be
5711 needed when we move to use the new insets. Enable the define in
5712 lyxparagrah.h to try it.
5714 * src/insets/insettabular.C (cellstart): change to be a static
5716 (InsetTabular): initialize buffer in the initializer list.
5718 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5720 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5721 form_print.h out of the header file. Replaced with forward
5722 declarations of the relevant struct.
5724 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5727 * src/commandtags.h: do not include "debug.h" which does not
5728 belong there. #include it in some other places because of this
5731 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5733 * src/insets/insetcaption.C: add a couple "using" directives.
5735 * src/toolbar.C (add): get the help text directly from lyxaction.
5737 (setPixmap): new function. Loads from disk and sets a pixmap on a
5738 botton; the name of the pixmap file is derived from the command
5741 * src/toolbar.h: remove members isBitmap and pixmap from
5744 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5745 * lib/images/: move many files from images/banner.xpm.
5747 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5749 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5750 * src/toolbar.C: ditto.
5751 * configure.in: ditto.
5752 * INSTALL: document.
5754 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5755 the spellchecker popup is closed from the WM.
5757 2000-07-19 Juergen Vigna <jug@sad.it>
5759 * src/insets/insetfloat.C (Write): small fix because we use the
5760 insetname for the type now!
5762 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5764 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5767 * src/frontends/Dialogs.h: removed hideCitation signal
5769 * src/insets/insetcite.h: added hide signal
5771 * src/insets/insetcite.C (~InsetCitation): emits new signal
5772 (getScreenLabel): "intelligent" label should now fit on the screen!
5774 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5776 * src/frontends/xforms/FormCitation.C (showInset): connects
5777 hide() to the inset's hide signal
5778 (show): modified to use fl_set_object_position rather than
5779 fl_set_object_geometry wherever possible
5781 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5783 * src/insets/lyxinset.h: add caption code
5785 * src/insets/insetfloat.C (type): new method
5787 * src/insets/insetcaption.C (Write): new method
5789 (LyxCode): new method
5791 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5792 to get it right together with using the FloatList.
5794 * src/commandtags.h: add LFUN_INSET_CAPTION
5795 * src/lyxfunc.C (Dispatch): handle it
5797 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5800 * src/Variables.[Ch]: make expand take a const reference, remove
5801 the destructor, some whitespace changes.
5803 * src/LyXAction.C (init): add caption-inset-insert
5805 * src/FloatList.C (FloatList): update the default floats a bit.
5807 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5809 * src/Variables.[Ch]: new files. Intended to be used for language
5810 specific strings (like \chaptername) and filename substitution in
5813 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5815 * lib/kbd/american.kmap: update
5817 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5819 * src/bufferparams.[Ch]: remove member allowAccents.
5821 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5823 * src/LaTeXLog.C: use the log_form.h header.
5824 * src/lyx_gui.C: ditto.
5825 * src/lyx_gui_misc.C: ditto.
5826 * src/lyxvc.h: ditto.
5828 * forms/log_form.fd: new file, created from latexoptions.fd. I
5829 kept the log popup and nuked the options form.
5831 * src/{la,}texoptions.[Ch]: removed.
5832 * src/lyx_cb.C (LaTeXOptions): ditto
5834 * src/lyx_gui.C (create_forms): do not handle the
5835 fd_latex_options form.
5837 2000-07-18 Juergen Vigna <jug@sad.it>
5839 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5840 name of the inset so that it can be requested outside (text2.C).
5842 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5845 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5847 * src/mathed/formula.h (ConvertFont): constify
5849 * src/mathed/formula.C (Read): add warning if \end_inset is not
5850 found on expected place.
5852 * src/insets/lyxinset.h (ConvertFont): consify
5854 * src/insets/insetquotes.C (ConvertFont): constify
5855 * src/insets/insetquotes.h: ditto
5857 * src/insets/insetinfo.h: add labelfont
5859 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5860 (ascent): use labelfont
5864 (Write): make .lyx file a bit nicer
5866 * src/insets/insetfloat.C (Write): simplify somewhat...
5867 (Read): add warning if arg is not found
5869 * src/insets/insetcollapsable.C: add using std::max
5870 (Read): move string token and add warning in arg is not found
5871 (draw): use std::max to get the right ty
5872 (getMaxWidth): simplify by using std::max
5874 * src/insets/insetsection.h: new file
5875 * src/insets/insetsection.C: new file
5876 * src/insets/insetcaption.h: new file
5877 * src/insets/insetcaption.C: new file
5879 * src/insets/inset.C (ConvertFont): constify signature
5881 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5882 insetcaption.[Ch] and insetsection.[Ch]
5884 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5885 uses to use LABEL_COUNTER_CHAPTER instead.
5886 * src/text2.C (SetCounter): here
5888 * src/counters.h: new file
5889 * src/counters.C: new file
5890 * src/Sectioning.h: new file
5891 * src/Sectioning.C: new file
5893 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5895 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5897 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5900 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5903 2000-07-17 Juergen Vigna <jug@sad.it>
5905 * src/tabular.C (Validate): check if array-package is needed.
5906 (SetVAlignment): added support for vertical alignment.
5907 (SetLTFoot): better support for longtable header/footers
5908 (Latex): modified to support added features.
5910 * src/LaTeXFeatures.[Ch]: added array-package.
5912 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5914 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5917 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5919 * configure.in: do not forget to put a space after -isystem.
5921 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5923 * lib/kbd/arabic.kmap: a few fixes.
5925 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5927 * some whitespace chagnes to a number of files.
5929 * src/support/DebugStream.h: change to make it easier for
5930 doc++ to parse correctly.
5931 * src/support/lyxstring.h: ditto
5933 * src/mathed/math_utils.C (compara): change to have only one
5935 (MathedLookupBOP): change because of the above.
5937 * src/mathed/math_delim.C (math_deco_compare): change to have only
5939 (search_deco): change becasue of the above.
5941 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5942 instead of manually coded one.
5944 * src/insets/insetquotes.C (Read): read the \end_inset too
5946 * src/insets/insetlatex.h: remove file
5947 * src/insets/insetlatex.C: remove file
5949 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5951 (InsetPrintIndex): remove destructor
5953 * src/insets/insetinclude.h: remove default constructor
5955 * src/insets/insetfloat.C: work to make it work better
5957 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5959 * src/insets/insetcite.h (InsetCitation): remove default constructor
5961 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5963 * src/text.C (GetColumnNearX): comment out some currently unused code.
5965 * src/paragraph.C (writeFile): move some initializations closer to
5967 (CutIntoMinibuffer): small change to use new matchIT operator
5971 (InsertInset): ditto
5974 (InsetIterator): ditto
5975 (Erase): small change to use new matchFT operator
5977 (GetFontSettings): ditto
5978 (HighestFontInRange): ditto
5981 * src/lyxparagraph.h: some chars changed to value_type
5982 (matchIT): because of some stronger checking (perhaps too strong)
5983 in SGI STL, the two operator() unified to one.
5986 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5988 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5989 the last inset read added
5990 (parseSingleLyXformat2Token): some more (future) compability code added
5991 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5992 (parseSingleLyXformat2Token): set last_inset_read
5993 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5994 (parseSingleLyXformat2Token): don't double intializw string next_token
5996 * src/TextCache.C (text_fits::operator()): add const's to the signature
5997 (has_buffer::operator()): ditto
5999 * src/Floating.h: add some comments on the class
6001 * src/FloatList.[Ch] (typeExist): new method
6004 * src/BackStack.h: added default constructor, wanted by Gcc.
6006 2000-07-14 Juergen Vigna <jug@sad.it>
6008 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6010 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6012 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6013 do a redraw when the window is resized!
6014 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6016 * src/insets/insettext.C (resizeLyXText): added function to correctly
6017 being able to resize the LyXWindow.
6019 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6021 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6023 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6024 crashes when closing dialog to a deleted inset.
6026 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6027 method! Now similar to other insets.
6029 2000-07-13 Juergen Vigna <jug@sad.it>
6031 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6033 * lib/examples/Literate.lyx: small patch!
6035 * src/insets/insetbib.C (Read): added this function because of wrong
6036 Write (without [begin|end]_inset).
6038 2000-07-11 Juergen Vigna <jug@sad.it>
6040 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6041 as the insertInset could not be good!
6043 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6044 the bool param should not be last.
6046 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6048 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6049 did submit that to Karl).
6051 * configure.in: use -isystem instead of -I for X headers. This
6052 fixes a problem on solaris with a recent gcc;
6053 put the front-end code after the X detection code;
6054 configure in sigc++ before lib/
6056 * src/lyx_main.C (commandLineHelp): remove -display from command
6059 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6061 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6062 Also put in Makefile rules for building the ``listerrors''
6063 program for parsing errors from literate programs written in LyX.
6065 * lib/build-listerrors: Added small shell script as part of compile
6066 process. This builds a working ``listerrors'' binary if noweb is
6067 installed and either 1) the VNC X server is installed on the machine,
6068 or 2) the user is compiling from within a GUI. The existence of a GUI
6069 is necessary to use the ``lyx --export'' feature for now. This
6070 hack can be removed once ``lyx --export'' no longer requires a GUI to
6073 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6075 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6076 now passed back correctly from gcc and placed "under" error
6077 buttons in a Literate LyX source.
6079 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6081 * src/text.C (GetColumnNearX): Better behavior when a RTL
6082 paragraph is ended by LTR text.
6084 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6087 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6089 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6090 true when clipboard is empty.
6092 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6094 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6095 row of the paragraph.
6096 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6097 to prevent calculation of bidi tables
6099 2000-07-07 Juergen Vigna <jug@sad.it>
6101 * src/screen.C (ToggleSelection): added y_offset and x_offset
6104 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6107 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6109 * src/insets/insettext.C: fixed Layout-Display!
6111 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6113 * configure.in: add check for strings.h header.
6115 * src/spellchecker.C: include <strings.h> in order to have a
6116 definition for bzero().
6118 2000-07-07 Juergen Vigna <jug@sad.it>
6120 * src/insets/insettext.C (draw): set the status of the bv->text to
6121 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6123 * src/screen.C (DrawOneRow):
6124 (DrawFromTo): redraw the actual row if something has changed in it
6127 * src/text.C (draw): call an update of the toplevel-inset if something
6128 has changed inside while drawing.
6130 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6132 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6134 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6135 processing inside class.
6137 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6138 processing inside class.
6140 * src/insets/insetindex.h new struct Holder, consistent with other
6143 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6144 citation dialog from main code and placed it in src/frontends/xforms.
6145 Dialog launched through signals instead of callbacks
6147 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6149 * lyx.man: update the options description.
6151 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6153 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6154 handle neg values, set min width to 590, add doc about -display
6156 2000-07-05 Juergen Vigna <jug@sad.it>
6158 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6159 calls to BufferView *.
6161 * src/insets/insettext.C (checkAndActivateInset): small fix non
6162 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6164 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6165 their \end_inset token!
6167 2000-07-04 edscott <edscott@imp.mx>
6169 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6170 lib/lyxrc.example: added option \wheel_jump
6172 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6174 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6175 remove support for -width,-height,-xpos and -ypos.
6177 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6179 * src/encoding.[Ch]: New files.
6181 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6182 (text): Call to the underline() method only when needed.
6184 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6186 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6187 encoding(s) for the document.
6189 * src/bufferparams.C (BufferParams): Changed default value of
6192 * src/language.C (newLang): Removed.
6193 (items[]): Added encoding information for all defined languages.
6195 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6196 encoding choice button.
6198 * src/lyxrc.h (font_norm_type): New member variable.
6199 (set_font_norm_type): New method.
6201 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6202 paragraphs with different encodings.
6204 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6205 (TransformChar): Changed to work correctly with Arabic points.
6206 (draw): Added support for drawing Arabic points.
6207 (draw): Removed code for drawing underbars (this is done by
6210 * src/support/textutils.h (IsPrintableNonspace): New function.
6212 * src/BufferView_pimpl.h: Added "using SigC::Object".
6213 * src/LyXView.h: ditto.
6215 * src/insets/insetinclude.h (include_label): Changed to mutable.
6217 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6219 * src/mathed/math_iter.h: remove empty destructor
6221 * src/mathed/math_cursor.h: remove empty destructor
6223 * src/insets/lyxinset.h: add THEOREM_CODE
6225 * src/insets/insettheorem.[Ch]: new files
6227 * src/insets/insetminipage.C: (InsertInset): remove
6229 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6231 (InsertInset): remove
6233 * src/insets/insetlist.C: (InsertList): remove
6235 * src/insets/insetfootlike.[Ch]: new files
6237 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6240 (InsertInset): ditto
6242 * src/insets/insetert.C: remove include Painter.h, reindent
6243 (InsertInset): move to header
6245 * src/insets/insetcollapsable.h: remove explicit from default
6246 contructor, remove empty destructor, add InsertInset
6248 * src/insets/insetcollapsable.C (InsertInset): new func
6250 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6252 * src/vspace.h: add explicit to constructor
6254 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6255 \textcompwordmark, please test this.
6257 * src/lyxrc.C: set ascii_linelen to 65 by default
6259 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6261 * src/commandtags.h: add LFUN_INSET_THEOREM
6263 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6264 (makeLinuxDocFile): remove _some_ of the nice logic
6265 (makeDocBookFile): ditto
6267 * src/Painter.[Ch]: (~Painter): removed
6269 * src/LyXAction.C (init): entry for insettheorem added
6271 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6273 (deplog): code to detect files generated by LaTeX, needs testing
6276 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6280 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6282 * src/LaTeX.C (deplog): Add a check for files that are going to be
6283 created by the first latex run, part of the project to remove the
6286 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6287 contents to the extension list.
6289 2000-07-04 Juergen Vigna <jug@sad.it>
6291 * src/text.C (NextBreakPoint): added support for needFullRow()
6293 * src/insets/lyxinset.h: added needFullRow()
6295 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6298 * src/insets/insettext.C: lots of changes for update!
6300 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6302 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6304 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6306 * src/insets/insetinclude.C (InsetInclude): fixed
6307 initialization of include_label.
6308 (unique_id): now returns a string.
6310 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6312 * src/LaTeXFeatures.h: new member IncludedFiles, for
6313 a map of key, included file name.
6315 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6316 with the included files for inclusion in SGML preamble,
6317 i. e., linuxdoc and docbook.
6320 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6321 nice (is the generated linuxdoc code to be exported?), that
6322 allows to remove column, and only_body that will be true for
6323 slave documents. Insets are allowed inside SGML font type.
6324 New handling of the SGML preamble for included files.
6325 (makeDocBookFile): the same for docbook.
6327 * src/insets/insetinclude.h:
6328 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6330 (DocBook): new export methods.
6332 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6333 and makeDocBookFile.
6335 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6336 formats to export with command line argument -x.
6338 2000-06-29 Juergen Vigna <jug@sad.it>
6340 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6341 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6343 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6344 region could already been cleared by an inset!
6346 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6348 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6351 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6353 (cursorToggle): remove special handling of lyx focus.
6355 2000-06-28 Juergen Vigna <jug@sad.it>
6357 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6360 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6362 * src/insets/insetindex.C (Edit): add a callback when popup is
6365 * src/insets/insettext.C (LocalDispatch):
6366 * src/insets/insetmarginal.h:
6367 * src/insets/insetlist.h:
6368 * src/insets/insetfoot.h:
6369 * src/insets/insetfloat.h:
6370 * src/insets/insetert.h: add a missing std:: qualifier.
6372 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6374 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6377 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6379 * src/insets/insettext.C (Read): remove tmptok unused variable
6380 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6381 (InsertInset): change for new InsetInset code
6383 * src/insets/insettext.h: add TEXT inline method
6385 * src/insets/insettext.C: remove TEXT macro
6387 * src/insets/insetmarginal.C (Write): new method
6388 (Latex): change output slightly
6390 * src/insets/insetfoot.C (Write): new method
6391 (Latex): change output slightly (don't use endl when no need)
6393 * src/insets/insetert.C (Write): new method
6395 * src/insets/insetcollapsable.h: make button_length, button_top_y
6396 and button_bottm_y protected.
6398 * src/insets/insetcollapsable.C (Write): simplify code by using
6399 tostr. Also do not output the float name, the children class
6400 should to that to get control over own arguments
6402 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6403 src/insets/insetminipage.[Ch]:
6406 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6408 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6410 * src/Makefile.am (lyx_SOURCES): add the new files
6412 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6413 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6414 * src/commandtags.h: ditto
6416 * src/LaTeXFeatures.h: add a std::set of used floattypes
6418 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6420 * src/FloatList.[Ch] src/Floating.h: new files
6422 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6424 * src/lyx_cb.C (TableApplyCB): ditto
6426 * src/text2.C: ditto
6427 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6428 (parseSingleLyXformat2Token): ditto + add code for
6429 backwards compability for old float styles + add code for new insets
6431 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6433 (InsertInset(size_type, Inset *, LyXFont)): new method
6434 (InsetChar(size_type, char)): changed to use the other InsetChar
6435 with a LyXFont(ALL_INHERIT).
6436 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6437 insert the META_INSET.
6439 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6441 * sigc++/thread.h (Threads): from here
6443 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6444 definition out of line
6445 * sigc++/scope.h: from here
6447 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6449 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6450 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6452 * Makefile.am (bindist): new target.
6454 * INSTALL: add instructions for doing a binary distribution.
6456 * development/tools/README.bin.example: update a bit.
6458 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6461 * lib/lyxrc.example: new lyxrc tag \set_color.
6463 * src/lyxfunc.C (Dispatch):
6464 * src/commandtags.h:
6465 * src/LyXAction.C: new lyxfunc "set-color".
6467 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6468 and an x11name given as strings.
6470 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6471 cache when a color is changed.
6473 2000-06-26 Juergen Vigna <jug@sad.it>
6475 * src/lyxrow.C (width): added this functions and variable.
6477 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6480 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6482 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6484 * images/undo_bw.xpm: new icon.
6485 * images/redo_bw.xpm: ditto.
6487 * configure.in (INSTALL_SCRIPT): change value to
6488 ${INSTALL} to avoid failures of install-script target.
6489 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6491 * src/BufferView.h: add a magic "friend" declaration to please
6494 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6496 * forms/cite.fd: modified to allow resizing without messing
6499 * src/insetcite.C: Uses code from cite.fd almost without
6501 User can now resize dialog in the x-direction.
6502 Resizing the dialog in the y-direction is prevented, as the
6503 code does this intelligently already.
6505 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6507 * INSTALL: remove obsolete entry in "problems" section.
6509 * lib/examples/sl_*.lyx: update of the slovenian examples.
6511 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6513 2000-06-23 Juergen Vigna <jug@sad.it>
6515 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6517 * src/buffer.C (resize): delete the LyXText of textinsets.
6519 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6521 * src/insets/lyxinset.h: added another parameter 'cleared' to
6522 the draw() function.
6524 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6525 unlocking inset in inset.
6527 2000-06-22 Juergen Vigna <jug@sad.it>
6529 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6530 of insets and moved first to LyXText.
6532 * src/mathed/formulamacro.[Ch]:
6533 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6535 2000-06-21 Juergen Vigna <jug@sad.it>
6537 * src/text.C (GetVisibleRow): look if I should clear the area or not
6538 using Inset::doClearArea() function.
6540 * src/insets/lyxinset.h: added doClearArea() function and
6541 modified draw(Painter &, ...) to draw(BufferView *, ...)
6543 * src/text2.C (UpdateInset): return bool insted of int
6545 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6547 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6548 combox in the character popup
6550 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6551 BufferParams const & params
6553 2000-06-20 Juergen Vigna <jug@sad.it>
6555 * src/insets/insettext.C (SetParagraphData): set insetowner on
6558 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6560 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6561 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6563 (form_main_): remove
6565 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6566 (create_form_form_main): remove FD_form_main stuff, connect to
6567 autosave_timeout signal
6569 * src/LyXView.[Ch] (getMainForm): remove
6570 (UpdateTimerCB): remove
6571 * src/BufferView_pimpl.h: inherit from SigC::Object
6573 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6574 signal instead of callback
6576 * src/BufferView.[Ch] (cursorToggleCB): remove
6578 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * src/BufferView_pimpl.C: changes because of the one below
6582 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6583 instead of storing a pointer to a LyXText.
6585 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6587 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6589 * src/lyxparagraph.h
6591 * src/paragraph.C: Changed fontlist to a sorted vector.
6593 2000-06-19 Juergen Vigna <jug@sad.it>
6595 * src/BufferView.h: added screen() function.
6597 * src/insets/insettext.C (LocalDispatch): some selection code
6600 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6602 * src/insets/insettext.C (SetParagraphData):
6604 (InsetText): fixes for multiple paragraphs.
6606 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6608 * development/lyx.spec.in: Call configure with ``--without-warnings''
6609 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6610 This should be fine, however, since we generally don't want to be
6611 verbose when making an RPM.
6613 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6615 * lib/scripts/fig2pstex.py: New file
6617 2000-06-16 Juergen Vigna <jug@sad.it>
6619 * src/insets/insettabular.C (UpdateLocal):
6620 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6621 (LocalDispatch): Changed all functions to use LyXText.
6623 2000-06-15 Juergen Vigna <jug@sad.it>
6625 * src/text.C (SetHeightOfRow): call inset::update before requesting
6628 * src/insets/insettext.C (update):
6629 * src/insets/insettabular.C (update): added implementation
6631 * src/insets/lyxinset.h: added update function
6633 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6635 * src/text.C (SelectNextWord): protect against null pointers with
6636 old-style string streams. (fix from Paul Theo Gonciari
6639 * src/cite.[Ch]: remove erroneous files.
6641 * lib/configure.m4: update the list of created directories.
6643 * src/lyxrow.C: include <config.h>
6644 * src/lyxcursor.C: ditto.
6646 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6648 * lib/examples/decimal.lyx: new example file from Mike.
6650 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6651 to find template definitions (from Dekel)
6653 * src/frontends/.cvsignore: add a few things.
6655 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6657 * src/Timeout.C (TimeOut): remove default argument.
6659 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6662 * src/insets/ExternalTemplate.C: add a "using" directive.
6664 * src/lyx_main.h: remove the act_ struct, which seems unused
6667 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6669 * LyX Developers Meeting: All files changed, due to random C++ (by
6670 coincidence) code generator script.
6672 - external inset (cool!)
6673 - initial online editing of preferences
6674 - insettabular breaks insettext(s contents)
6676 - some DocBook fixes
6677 - example files update
6678 - other cool stuff, create a diff and look for yourself.
6680 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6682 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6683 -1 this is a non-line-breaking textinset.
6685 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6686 if there is no width set.
6688 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6690 * Lots of files: Merged the dialogbase branch.
6692 2000-06-09 Allan Rae <rae@lyx.org>
6694 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6695 and the Dispatch methods that used it.
6697 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6698 access to functions formerly kept in Dispatch.
6700 2000-05-19 Allan Rae <rae@lyx.org>
6702 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6703 made to_page and count_copies integers again. from_page remains a
6704 string however because I want to allow entry of a print range like
6705 "1,4,22-25" using this field.
6707 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6708 and printer-params-get. These aren't useful from the minibuffer but
6709 could be used by a script/LyXServer app provided it passes a suitable
6710 auto_mem_buffer. I guess I should take a look at how the LyXServer
6711 works and make it support xtl buffers.
6713 * sigc++/: updated to libsigc++-1.0.1
6715 * src/xtl/: updated to xtl-1.3.pl.11
6717 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6718 those changes done to the files in src/ are actually recreated when
6719 they get regenerated. Please don't ever accept a patch that changes a
6720 dialog unless that patch includes the changes to the corresponding *.fd
6723 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6724 stringOnlyContains, renamed it and generalised it.
6726 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6727 branch. Removed the remaining old form_print code.
6729 2000-04-26 Allan Rae <rae@lyx.org>
6731 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6732 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6734 2000-04-25 Allan Rae <rae@lyx.org>
6736 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6737 against a base of xtl-1.3.pl.4
6739 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6740 filter the Id: entries so they still show the xtl version number
6743 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6744 into the src/xtl code. Patch still pending with José (XTL)
6746 2000-04-24 Allan Rae <rae@lyx.org>
6748 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6749 both more generic and much safer. Use the new template functions.
6750 * src/buffer.[Ch] (Dispatch): ditto.
6752 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6753 and mem buffer more intelligently. Also a little general cleanup.
6756 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6757 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6758 * src/xtl/Makefile.am: ditto.
6759 * src/xtl/.cvsignore: ditto.
6760 * src/Makefile.am: ditto.
6762 * src/PrinterParams.h: Removed the macros member functions. Added a
6763 testInvariant member function. A bit of tidying up and commenting.
6764 Included Angus's idea for fixing operation with egcs-1.1.2.
6766 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6767 cool expansion of XTL's mem_buffer to support automatic memory
6768 management within the buffer itself. Removed the various macros and
6769 replaced them with template functions that use either auto_mem_buffer
6770 or mem_buffer depending on a #define. The mem_buffer support will
6771 disappear as soon as the auto_mem_buffer is confirmed to be good on
6772 other platforms/compilers. That is, it's there so you've got something
6775 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6776 effectively forked XTL. However I expect José will include my code
6777 into the next major release. Also fixed a memory leak.
6778 * src/xtl/text.h: ditto.
6779 * src/xtl/xdr.h: ditto.
6780 * src/xtl/giop.h: ditto.
6782 2000-04-16 Allan Rae <rae@lyx.org>
6784 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6785 by autogen.sh and removed by maintainer-clean anyway.
6786 * .cvsignore, sigc++/.cvsignore: Support the above.
6788 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6790 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6792 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6793 macros, renamed static callback-target member functions to suit new
6794 scheme and made them public.
6795 * src/frontends/xforms/forms/form_print.fd: ditto.
6796 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6798 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6801 * src/xtl/: New directory containing a minimal distribution of XTL.
6802 This is XTL-1.3.pl.4.
6804 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6806 2000-04-15 Allan Rae <rae@lyx.org>
6808 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6810 * sigc++/: Updated to libsigc++-1.0.0
6812 2000-04-14 Allan Rae <rae@lyx.org>
6814 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6815 use the generic ones in future. I'll modify my conversion script.
6817 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6819 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6820 (CloseAllBufferRelatedDialogs): Renamed.
6821 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6823 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6824 of the generic ones. These are the same ones my conversion script
6827 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6828 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6829 * src/buffer.C (Dispatch): ditto
6831 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6832 functions for updating and hiding buffer dependent dialogs.
6833 * src/BufferView.C (buffer): ditto
6834 * src/buffer.C (setReadonly): ditto
6835 * src/lyxfunc.C (CloseBuffer): ditto
6837 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6838 Dialogs.h, and hence all the SigC stuff, into every file that includes
6839 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6841 * src/BufferView2.C: reduce the number of headers included by buffer.h
6843 2000-04-11 Allan Rae <rae@lyx.org>
6845 * src/frontends/xforms/xform_macros.h: A small collection of macros
6846 for building C callbacks.
6848 * src/frontends/xforms/Makefile.am: Added above file.
6850 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6851 scheme again. This time it should work for JMarc. If this is
6852 successful I'll revise my conversion script to automate some of this.
6853 The static member functions in the class also have to be public for
6854 this scheme will work. If the scheme works (it's almost identical to
6855 the way BufferView::cursorToggleCB is handled so it should work) then
6856 FormCopyright and FormPrint will be ready for inclusion into the main
6857 trunk immediately after 1.1.5 is released -- provided we're prepared
6858 for complaints about lame compilers not handling XTL.
6860 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6862 2000-04-07 Allan Rae <rae@lyx.org>
6864 * config/lyxinclude.m4: A bit more tidying up (Angus)
6866 * src/LString.h: JMarc's <string> header fix
6868 * src/PrinterParams.h: Used string for most data to remove some
6869 ugly code in the Print dialog and avoid even uglier code when
6870 appending the ints to a string for output.
6872 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6873 and moved "default:" back to the end of switch statement. Cleaned
6874 up the printing so it uses the right function calls and so the
6875 "print to file" option actually puts the file in the right directory.
6877 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6879 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6880 and Ok+Apply button control into a separate method: input (Angus).
6881 (input) Cleaned it up and improved it to be very thorough now.
6882 (All CB) static_cast used instead of C style cast (Angus). This will
6883 probably change again once we've worked out how to keep gcc-2.8.1 happy
6884 with real C callbacks.
6885 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6886 ignore some of the bool settings and has random numbers instead. Needs
6887 some more investigation. Added other input length checks and checking
6888 of file and printer names.
6890 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6891 would link (Angus). Seems the old code doesn't compile with the pragma
6892 statement either. Separated callback entries from internal methods.
6894 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6896 2000-03-17 Allan Rae <rae@lyx.org>
6898 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6899 need it? Maybe it could go in Dialogs instead? I could make it a
6900 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6901 values to get the bool return value.
6902 (Dispatch): New overloaded method for xtl support.
6904 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6905 extern "C" callback instead of static member functions. Hopefully,
6906 JMarc will be able to compile this. I haven't changed
6907 forms/form_copyright.fd yet. Breaking one of my own rules already.
6909 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6910 because they aren't useful from the minibuffer. Maybe a LyXServer
6911 might want a help message though?
6913 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6915 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6916 xtl which needs both rtti and exceptions.
6918 * src/support/Makefile.am:
6919 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6921 * src/frontends/xforms/input_validators.[ch]: input filters and
6922 validators. These conrol what keys are valid in input boxes.
6923 Use them and write some more. Much better idea than waiting till
6924 after the user has pressed Ok to say that the input fields don't make
6927 * src/frontends/xforms/Makefile.am:
6928 * src/frontends/xforms/forms/form_print.fd:
6929 * src/frontends/xforms/forms/makefile:
6930 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6931 new scheme. Still have to make sure I haven't missed anything from
6932 the current implementation.
6934 * src/Makefile.am, src/PrinterParams.h: New data store.
6936 * other files: Added a couple of copyright notices.
6938 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6940 * src/insets/insetbib.h: move Holder struct in public space.
6942 * src/frontends/include/DialogBase.h: use SigC:: only when
6943 SIGC_CXX_NAMESPACES is defined.
6944 * src/frontends/include/Dialogs.h: ditto.
6946 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6948 * src/frontends/xforms/FormCopyright.[Ch]: do not
6949 mention SigC:: explicitely.
6951 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6953 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6954 deals with testing KDE in main configure.in
6955 * configure.in: ditto.
6957 2000-02-22 Allan Rae <rae@lyx.org>
6959 * Lots of files: Merged from HEAD
6961 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6962 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6964 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6966 * sigc++/: new minidist.
6968 2000-02-14 Allan Rae <rae@lyx.org>
6970 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6972 2000-02-08 Juergen Vigna <jug@sad.it>
6974 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6975 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6977 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6978 for this port and so it is much easier for other people to port
6979 dialogs in a common development environment.
6981 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6982 the QT/KDE implementation.
6984 * src/frontends/kde/Dialogs.C:
6985 * src/frontends/kde/FormCopyright.C:
6986 * src/frontends/kde/FormCopyright.h:
6987 * src/frontends/kde/Makefile.am:
6988 * src/frontends/kde/formcopyrightdialog.C:
6989 * src/frontends/kde/formcopyrightdialog.h:
6990 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6991 for the kde support of the Copyright-Dialog.
6993 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6994 subdir-substitution instead of hardcoded 'xforms' as we now have also
6997 * src/frontends/include/DialogBase.h (Object): just commented the
6998 label after #endif (nasty warning and I don't like warnings ;)
7000 * src/main.C (main): added KApplication initialization if using
7003 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7004 For now only the KDE event-loop is added if frontend==kde.
7006 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7008 * configure.in: added support for the --with-frontend[=value] option
7010 * autogen.sh: added kde.m4 file to list of config-files
7012 * acconfig.h: added define for KDEGUI-support
7014 * config/kde.m4: added configuration functions for KDE-port
7016 * config/lyxinclude.m4: added --with-frontend[=value] option with
7017 support for xforms and KDE.
7019 2000-02-08 Allan Rae <rae@lyx.org>
7021 * all Makefile.am: Fixed up so the make targets dist, distclean,
7022 install and uninstall all work even if builddir != srcdir. Still
7023 have a new sigc++ minidist update to come.
7025 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7027 2000-02-01 Allan Rae <rae@lyx.org>
7029 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7030 Many mods to get builddir != srcdir working.
7032 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7033 for building on NT and so we can do the builddir != srcdir stuff.
7035 2000-01-30 Allan Rae <rae@lyx.org>
7037 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7038 This will stay in "rae" branch. We probably don't really need it in
7039 the main trunk as anyone who wants to help programming it should get
7040 a full library installed also. So they can check both included and
7041 system supplied library compilation.
7043 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7044 Added a 'mini' distribution of libsigc++. If you feel the urge to
7045 change something in these directories - Resist it. If you can't
7046 resist the urge then you should modify the following script and rebuild
7047 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7048 all happen. Still uses a hacked version of libsigc++'s configure.in.
7049 I'm quite happy with the results. I'm not sure the extra work to turn
7050 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7051 worth the trouble and would probably lead to extra maintenance
7053 I haven't tested the following important make targets: install, dist.
7054 Not ready for prime time but very close. Maybe 1.1.5.
7056 * development/tools/makeLyXsigc.sh: A shell script to automatically
7057 generate our mini-dist of libsigc++. It can only be used with a CVS
7058 checkout of libsigc++ not a tarball distribution. It's well commented.
7059 This will end up as part of the libsigc++ distribution so other apps
7060 can easily have an included mini-dist. If someone makes mods to the
7061 sigc++ subpackage without modifying this script to generate those
7062 changes I'll be very upset!
7064 * src/frontends/: Started the gui/system indep structure.
7066 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7067 to access the gui-indep dialogs are in this class. Much improved
7068 design compared to previous revision. Lars, please refrain from
7069 moving this header into src/ like you did with Popups.h last time.
7071 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7073 * src/frontends/xforms/: Started the gui-indep system with a single
7074 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7077 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7078 Here you'll find a very useful makefile and automated fdfix.sh that
7079 makes updating dailogs a no-brainer -- provided you follow the rules
7080 set out in the README. I'm thinking about adding another script to
7081 automatically generate skeleton code for a new dialog given just the
7084 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7085 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7086 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7088 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7090 * src/support/LSubstring.C (operator): simplify
7092 * src/lyxtext.h: removed bparams, use buffer_->params instead
7094 * src/lyxrow.h: make Row a real class, move all variables to
7095 private and use accessors.
7097 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7099 (isRightToLeftPar): ditto
7100 (ChangeLanguage): ditto
7101 (isMultiLingual): ditto
7104 (SimpleTeXOnePar): ditto
7105 (TeXEnvironment): ditto
7106 (GetEndLabel): ditto
7108 (SetOnlyLayout): ditto
7109 (BreakParagraph): ditto
7110 (BreakParagraphConservative): ditto
7111 (GetFontSettings): ditto
7113 (CopyIntoMinibuffer): ditto
7114 (CutIntoMinibuffer): ditto
7115 (PasteParagraph): ditto
7116 (SetPExtraType): ditto
7117 (UnsetPExtraType): ditto
7118 (DocBookContTableRows): ditto
7119 (SimpleDocBookOneTablePar): ditto
7121 (TeXFootnote): ditto
7122 (SimpleTeXOneTablePar): ditto
7123 (TeXContTableRows): ditto
7124 (SimpleTeXSpecialChars): ditto
7127 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7128 to private and use accessors.
7130 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7131 this, we did not use it anymore and has not been for ages. Just a
7132 waste of cpu cycles.
7134 * src/language.h: make Language a real class, move all variables
7135 to private and use accessors.
7137 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7138 (create_view): remove
7139 (update): some changes for new timer
7140 (cursorToggle): use new timer
7141 (beforeChange): change for new timer
7143 * src/BufferView.h (cursorToggleCB): removed last paramter because
7146 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7147 (cursorToggleCB): change because of new timer code
7149 * lib/CREDITS: updated own mailaddress
7151 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7153 * src/support/filetools.C (PutEnv): fix the code in case neither
7154 putenv() nor setenv() have been found.
7156 * INSTALL: mention the install-strip Makefile target.
7158 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7159 read-only documents.
7161 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * lib/reLyX/configure.in (VERSION): avoid using a previously
7164 generated reLyX wrapper to find out $prefix.
7166 * lib/examples/eu_adibide_lyx-atua.lyx:
7167 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7168 translation of the Tutorial (Dooteo)
7170 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7172 * forms/cite.fd: new citation dialog
7174 * src/insetcite.[Ch]: the new citation dialog is moved into
7177 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7180 * src/insets/insetcommand.h: data members made private.
7182 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7184 * LyX 1.1.5 released
7186 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7188 * src/version.h (LYX_RELEASE): to 1.1.5
7190 * src/spellchecker.C (RunSpellChecker): return false if the
7191 spellchecker dies upon creation.
7193 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7195 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7196 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7200 * lib/CREDITS: update entry for Martin Vermeer.
7202 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7204 * src/text.C (draw): Draw foreign language bars at the bottom of
7205 the row instead of at the baseline.
7207 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7209 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7211 * lib/bind/de_menus.bind: updated
7213 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7215 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7217 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7219 * src/menus.C (Limit_string_length): New function
7220 (ShowTocMenu): Limit the number of items/length of items in the
7223 * src/paragraph.C (String): Correct result for a paragraph inside
7226 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7228 * src/bufferlist.C (close): test of buf->getuser() == NULL
7230 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7232 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7233 Do not call to SetCursor when the paragraph is a closed footnote!
7235 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7237 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7240 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7242 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7245 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7246 reference popup, that activates the reference-back action
7248 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7250 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7251 the menus. Also fixed a bug.
7253 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7254 the math panels when switching buffers (unless new buffer is readonly).
7256 * src/BufferView.C (NoSavedPositions)
7257 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7259 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7261 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7262 less of dvi dirty or not.
7264 * src/trans_mgr.[Ch] (insert): change first parameter to string
7267 * src/chset.[Ch] (encodeString): add const to first parameter
7269 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7271 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7275 * src/LaTeX.C (deplog): better searching for dependency files in
7276 the latex log. Uses now regexps.
7278 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7279 instead of the box hack or \hfill.
7281 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7283 * src/lyxfunc.C (doImportHelper): do not create the file before
7284 doing the actual import.
7285 (doImportASCIIasLines): create a new file before doing the insert.
7286 (doImportASCIIasParagraphs): ditto.
7288 * lib/lyxrc.example: remove mention of non-existing commands
7290 * lyx.man: remove mention of color-related switches.
7292 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7294 * src/lyx_gui.C: remove all the color-related ressources, which
7295 are not used anymore.
7297 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7300 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7302 * src/lyxrc.C (read): Add a missing break in the switch
7304 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7306 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7308 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7311 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7313 * src/text.C (draw): draw bars under foreign language words.
7315 * src/LColor.[Ch]: add LColor::language
7317 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7319 * src/lyxcursor.h (boundary): New member variable
7321 * src/text.C (IsBoundary): New methods
7323 * src/text.C: Use the above for currect cursor movement when there
7324 is both RTL & LTR text.
7326 * src/text2.C: ditto
7328 * src/bufferview_funcs.C (ToggleAndShow): ditto
7330 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7332 * src/text.C (DeleteLineForward): set selection to true to avoid
7333 that DeleteEmptyParagraphMechanism does some magic. This is how it
7334 is done in all other functions, and seems reasonable.
7335 (DeleteWordForward): do not jump over non-word stuff, since
7336 CursorRightOneWord() already does it.
7338 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7339 DeleteWordBackward, since they seem safe to me (since selection is
7340 set to "true") DeleteEmptyParagraphMechanism does nothing.
7342 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7344 * src/lyx_main.C (easyParse): simplify the code by factoring the
7345 part that removes parameters from the command line.
7346 (LyX): check wether wrong command line options have been given.
7348 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7350 * src/lyx_main.C : add support for specifying user LyX
7351 directory via command line option -userdir.
7353 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7355 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7356 the number of items per popup.
7357 (Add_to_refs_menu): Ditto.
7359 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7361 * src/lyxparagraph.h: renamed ClearParagraph() to
7362 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7363 textclass as parameter, and do nothing if free_spacing is
7364 true. This fixes part of the line-delete-forward problems.
7366 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7367 (pasteSelection): ditto.
7368 (SwitchLayoutsBetweenClasses): more translatable strings.
7370 * src/text2.C (CutSelection): use StripLeadingSpaces.
7371 (PasteSelection): ditto.
7372 (DeleteEmptyParagraphMechanism): ditto.
7374 2000-05-26 Juergen Vigna <jug@sad.it>
7376 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7377 is not needed in tabular insets.
7379 * src/insets/insettabular.C (TabularFeatures): added missing features.
7381 * src/tabular.C (DeleteColumn):
7383 (AppendRow): implemented this functions
7384 (cellsturct::operator=): clone the inset too;
7386 2000-05-23 Juergen Vigna <jug@sad.it>
7388 * src/insets/insettabular.C (LocalDispatch): better selection support
7389 when having multicolumn-cells.
7391 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7393 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7395 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7397 * src/ColorHandler.C (getGCForeground): put more test into _()
7399 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7402 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7405 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7407 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7408 there are no labels, or when buffer is readonly.
7410 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7411 there are no labels, buffer is SGML, or when buffer is readonly.
7413 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7415 * src/LColor.C (LColor): change a couple of grey40 to grey60
7416 (LColor): rewore initalization to make compiles go some magnitude
7418 (getGUIName): don't use gettext until we need the string.
7420 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7422 * src/Bullet.[Ch]: Fixed a small bug.
7424 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7426 * src/paragraph.C (String): Several fixes/improvements
7428 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7430 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7432 * src/paragraph.C (String): give more correct output.
7434 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7436 * src/lyxfont.C (stateText) Do not output the language if it is
7437 eqaul to the language of the document.
7439 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7440 between two paragraphs with the same language.
7442 * src/paragraph.C (getParLanguage) Return a correct answer for an
7443 empty dummy paragraph.
7445 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7448 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7451 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7452 the menus/popup, if requested fonts are unavailable.
7454 2000-05-22 Juergen Vigna <jug@sad.it>
7456 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7457 movement support (Up/Down/Tab/Shift-Tab).
7458 (LocalDispatch): added also preliminari cursor-selection.
7460 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7462 * src/paragraph.C (PasteParagraph): Hopefully now right!
7464 2000-05-22 Garst R. Reese <reese@isn.net>
7466 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7467 of list, change all references to Environment to Command
7468 * tex/hollywood.cls : rewrite environments as commands, add
7469 \uppercase to interiorshot and exteriorshot to force uppecase.
7470 * tex/broadway.cls : rewrite environments as commands. Tweak
7473 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7475 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7476 size of items: use a constant intead of the hardcoded 40, and more
7477 importantly do not remove the %m and %x tags added at the end.
7478 (Add_to_refs_menu): use vector::size_type instead of
7479 unsigned int as basic types for the variables. _Please_ do not
7480 assume that size_t is equal to unsigned int. On an alpha, this is
7481 unsigned long, which is _not_ the same.
7483 * src/language.C (initL): remove language "hungarian", since it
7484 seems that "magyar" is better.
7486 2000-05-22 Juergen Vigna <jug@sad.it>
7488 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7490 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7493 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7494 next was deleted but not set to 0.
7496 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7498 * src/language.C (initL): change the initialization of languages
7499 so that compiles goes _fast_.
7501 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7504 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7506 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7510 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7512 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7514 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7518 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7521 * src/insets/insetlo*.[Ch]: Made editable
7523 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7526 the current selection.
7528 * src/BufferView_pimpl.C (stuffClipboard): new method
7530 * src/BufferView.C (stuffClipboard): new method
7532 * src/paragraph.C (String): new method
7534 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7535 LColor::ignore when lyxname is not found.
7537 * src/BufferView.C (pasteSelection): new method
7539 * src/BufferView_pimpl.C (pasteSelection): new method
7541 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7543 * src/WorkArea.C (request_clipboard_cb): new static function
7544 (getClipboard): new method
7545 (putClipboard): new method
7547 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7549 * LyX 1.1.5pre2 released
7551 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * src/vspace.C (operator=): removed
7554 (operator=): removed
7556 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7558 * src/layout.C (NumberOfClass): manually set the type in make_pair
7559 (NumberOfLayout): ditto
7561 * src/language.C: use the Language constructor for ignore_lang
7563 * src/language.h: add constructors to struct Language
7565 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7567 * src/text2.C (SetCursorIntern): comment out #warning
7569 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7571 * src/mathed/math_iter.h: initialize sx and sw to 0
7573 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7575 * forms/lyx.fd: Redesign of form_ref
7577 * src/LaTeXFeatures.[Ch]
7581 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7584 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7585 and Buffer::inset_iterator.
7587 * src/menus.C: Added new menus: TOC and Refs.
7589 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7591 * src/buffer.C (getTocList): New method.
7593 * src/BufferView2.C (ChangeRefs): New method.
7595 * src/buffer.C (getLabelList): New method. It replaces the old
7596 getReferenceList. The return type is vector<string> instead of
7599 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7600 the old getLabel() and GetNumberOfLabels() methods.
7601 * src/insets/insetlabel.C (getLabelList): ditto
7602 * src/mathed/formula.C (getLabelList): ditto
7604 * src/paragraph.C (String): New method.
7606 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7607 Uses the new getTocList() method.
7608 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7609 which automatically updates the contents of the browser.
7610 (RefUpdateCB): Use the new getLabelList method.
7612 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7614 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7616 * src/spellchecker.C: Added using std::reverse;
7618 2000-05-19 Juergen Vigna <jug@sad.it>
7620 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7622 * src/insets/insettext.C (computeTextRows): small fix for display of
7623 1 character after a newline.
7625 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7628 2000-05-18 Juergen Vigna <jug@sad.it>
7630 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7631 when changing width of column.
7633 * src/tabular.C (set_row_column_number_info): setting of
7634 autobreak rows if necessary.
7636 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7638 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7640 * src/vc-backend.*: renamed stat() to status() and vcstat to
7641 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7642 compilation broke. The new name seems more relevant, anyway.
7644 2000-05-17 Juergen Vigna <jug@sad.it>
7646 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7647 which was wrong if the removing caused removing of rows!
7649 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7650 (pushToken): new function.
7652 * src/text2.C (CutSelection): fix problem discovered with purify
7654 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7656 * src/debug.C (showTags): enlarge the first column, now that we
7657 have 6-digits debug codes.
7659 * lib/layouts/hollywood.layout:
7660 * lib/tex/hollywood.cls:
7661 * lib/tex/brodway.cls:
7662 * lib/layouts/brodway.layout: more commands and fewer
7663 environments. Preambles moved in the .cls files. Broadway now has
7664 more options on scene numbering and less whitespace (from Garst)
7666 * src/insets/insetbib.C (getKeys): make sure that we are in the
7667 document directory, in case the bib file is there.
7669 * src/insets/insetbib.C (Latex): revert bogus change.
7671 2000-05-16 Juergen Vigna <jug@sad.it>
7673 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7674 the TabularLayout on cursor move.
7676 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7678 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7681 (draw): fixed cursor position and drawing so that the cursor is
7682 visible when before the tabular-inset.
7684 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7685 when creating from old insettext.
7687 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7689 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7691 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7692 * lib/tex/brodway.cls: ditto
7694 * lib/layouts/brodway.layout: change alignment of parenthical
7697 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7699 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7700 versions 0.88 and 0.89 are supported.
7702 2000-05-15 Juergen Vigna <jug@sad.it>
7704 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7707 * src/insets/insettext.C (computeTextRows): redone completely this
7708 function in a much cleaner way, because of problems when having a
7710 (draw): added a frame border when the inset is locked.
7711 (SetDrawLockedFrame): this sets if we draw the border or not.
7712 (SetFrameColor): this sets the frame color (default=insetframe).
7714 * src/insets/lyxinset.h: added x() and y() functions which return
7715 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7716 function which is needed to see if we have a locking inset of some
7717 type in this inset (needed for now in insettabular).
7719 * src/vspace.C (inPixels): the same function also without a BufferView
7720 parameter as so it is easier to use it in some ocasions.
7722 * src/lyxfunc.C: changed all places where insertInset was used so
7723 that now if it couldn't be inserted it is deleted!
7725 * src/TabularLayout.C:
7726 * src/TableLayout.C: added support for new tabular-inset!
7728 * src/BufferView2.C (insertInset): this now returns a bool if the
7729 inset was really inserted!!!
7731 * src/tabular.C (GetLastCellInRow):
7732 (GetFirstCellInRow): new helper functions.
7733 (Latex): implemented for new tabular class.
7737 (TeXTopHLine): new Latex() helper functions.
7739 2000-05-12 Juergen Vigna <jug@sad.it>
7741 * src/mathed/formulamacro.C (Read):
7742 * src/mathed/formula.C (Read): read also the \end_inset here!
7744 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7746 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7747 crush when saving formulae with unbalanced parenthesis.
7749 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7751 * src/layout.C: Add new keyword "endlabelstring" to layout file
7753 * src/text.C (GetVisibleRow): Draw endlabel string.
7755 * lib/layouts/broadway.layout
7756 * lib/layouts/hollywood.layout: Added endlabel for the
7757 Parenthetical layout.
7759 * lib/layouts/heb-article.layout: Do not use slanted font shape
7760 for Theorem like environments.
7762 * src/buffer.C (makeLaTeXFile): Always add "american" to
7763 the UsedLanguages list if document language is RTL.
7765 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7767 * add addendum to README.OS2 and small patch (from SMiyata)
7769 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7771 * many files: correct the calls to ChangeExtension().
7773 * src/support/filetools.C (ChangeExtension): remove the no_path
7774 argument, which does not belong there. Use OnlyFileName() instead.
7776 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7777 files when LaTeXing a non-nice latex file.
7779 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7780 a chain of "if". Return false when deadkeys are not handled.
7782 * src/lyx_main.C (LyX): adapted the code for default bindings.
7784 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7785 bindings for basic functionality (except deadkeys).
7786 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7788 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7789 several methods: handle override_x_deadkeys.
7791 * src/lyxrc.h: remove the "bindings" map, which did not make much
7792 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7794 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7796 * src/lyxfont.C (stateText): use a saner method to determine
7797 whether the font is "default". Seems to fix the crash with DEC
7800 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7802 2000-05-08 Juergen Vigna <jug@sad.it>
7804 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7805 TabularLayoutMenu with mouse-button-3
7806 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7808 * src/TabularLayout.C: added this file for having a Layout for
7811 2000-05-05 Juergen Vigna <jug@sad.it>
7813 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7814 recalculating inset-widths.
7815 (TabularFeatures): activated this function so that I can change
7816 tabular-features via menu.
7818 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7819 that I can test some functions with the Table menu.
7821 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * src/lyxfont.C (stateText): guard against stupid c++libs.
7825 * src/tabular.C: add using std::vector
7826 some whitespace changes, + removed som autogenerated code.
7828 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7830 2000-05-05 Juergen Vigna <jug@sad.it>
7832 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7833 row, columns and cellstructures.
7835 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7837 * lib/lyxrc.example: remove obsolete entries.
7839 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7840 reading of protected_separator for free_spacing.
7842 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * src/text.C (draw): do not display an exclamation mark in the
7845 margin for margin notes. This is confusing, ugly and
7848 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7849 AMS math' is checked.
7851 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7852 name to see whether including the amsmath package is needed.
7854 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7856 * src/paragraph.C (validate): Compute UsedLanguages correctly
7857 (don't insert the american language if it doesn't appear in the
7860 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7861 The argument of \thanks{} command is considered moving argument
7863 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7866 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7868 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7869 for appendix/minipage/depth. The lines can be now both in the footnote
7870 frame, and outside the frame.
7872 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7875 2000-05-05 Juergen Vigna <jug@sad.it>
7877 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7878 neede only in tabular.[Ch].
7880 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7882 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7884 (Write): write '~' for PROTECTED_SEPARATOR
7886 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7888 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7891 * src/mathed/formula.C (drawStr): rename size to siz.
7893 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7894 possibly fix a bug by not changing the pflags = flags to piflags =
7897 2000-05-05 Juergen Vigna <jug@sad.it>
7899 * src/insets/insetbib.C: moved using directive
7901 * src/ImportNoweb.C: small fix for being able to compile (missing
7904 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7906 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7907 to use clear, since we don't depend on this in the code. Add test
7910 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7912 * (various *.C files): add using std::foo directives to please dec
7915 * replace calls to string::clear() to string::erase() (Angus)
7917 * src/cheaders/cmath: modified to provide std::abs.
7919 2000-05-04 Juergen Vigna <jug@sad.it>
7921 * src/insets/insettext.C: Prepared all for inserting of multiple
7922 paragraphs. Still display stuff to do (alignment and other things),
7923 but I would like to use LyXText to do this when we cleaned out the
7924 table-support stuff.
7926 * src/insets/insettabular.C: Changed lot of stuff and added lots
7927 of functionality still a lot to do.
7929 * src/tabular.C: Various functions changed name and moved to be
7930 const functions. Added new Read and Write functions and changed
7931 lots of things so it works good with tabular-insets (also removed
7932 some stuff which is not needed anymore * hacks *).
7934 * src/lyxcursor.h: added operators == and != which just look if
7935 par and pos are (not) equal.
7937 * src/buffer.C (latexParagraphs): inserted this function to latex
7938 all paragraphs form par to endpar as then I can use this too for
7941 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7942 so that I can call this to from text insets with their own cursor.
7944 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7945 output off all paragraphs (because of the fix below)!
7947 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7948 the very last paragraph (this could be also the last paragraph of an
7951 * src/texrow.h: added rows() call which returns the count-variable.
7953 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7955 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7957 * lib/configure.m4: better autodetection of DocBook tools.
7959 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7961 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7963 * src/lyx_cb.C: add using std::reverse;
7965 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7968 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7969 selected files. Should fix repeated errors from generated files.
7971 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7973 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7975 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7976 the spellchecker popup.
7978 * lib/lyxrc.example: Removed the \number_inset section
7980 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7982 * src/insets/figinset.C (various): Use IsFileReadable() to make
7983 sure that the file actually exist. Relying on ghostscripts errors
7984 is a bad idea since they can lead to X server crashes.
7986 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7988 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7991 * lib/lyxrc.example: smallish typo in description of
7992 \view_dvi_paper_option
7994 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7997 * src/lyxfunc.C: doImportHelper to factor out common code of the
7998 various import methods. New functions doImportASCIIasLines,
7999 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8000 doImportLinuxDoc for the format specific parts.
8003 * buffer.C: Dispatch returns now a bool to indicate success
8006 * lyx_gui.C: Add getLyXView() for member access
8008 * lyx_main.C: Change logic for batch commands: First try
8009 Buffer::Dispatch (possibly without GUI), if that fails, use
8012 * lyx_main.C: Add support for --import command line switch.
8013 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8014 Available Formats: Everything accepted by 'buffer-import <format>'
8016 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8018 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8021 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8022 documents will be reformatted upon reentry.
8024 2000-04-27 Juergen Vigna <jug@sad.it>
8026 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8027 correctly only last pos this was a bug.
8029 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8031 * release of lyx-1.1.5pre1
8033 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8035 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8037 * src/menus.C: revert the change of naming (Figure->Graphic...)
8038 from 2000-04-11. It was incomplete and bad.
8040 * src/LColor.[Ch]: add LColor::depthbar.
8041 * src/text.C (GetVisibleRow): use it.
8043 * README: update the languages list.
8045 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8047 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8050 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8052 * README: remove sections that were just wrong.
8054 * src/text2.C (GetRowNearY): remove currentrow code
8056 * src/text.C (GetRow): remove currentrow code
8058 * src/screen.C (Update): rewritten a bit.
8059 (SmallUpdate): removed func
8061 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8063 (FullRebreak): return bool
8064 (currentrow): remove var
8065 (currentrow_y): ditto
8067 * src/lyxscreen.h (Draw): change arg to unsigned long
8068 (FitCursor): return bool
8069 (FitManualCursor): ditto
8070 (Smallpdate): remove func
8071 (first): change to unsigned long
8072 (DrawOneRow): change second arg to long (from long &)
8073 (screen_refresh_y): remove var
8074 (scree_refresh_row): ditto
8076 * src/lyxrow.h: change baseline to usigned int from unsigned
8077 short, this brings some implicit/unsigned issues out in the open.
8079 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8081 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8082 instead of smallUpdate.
8084 * src/lyxcursor.h: change y to unsigned long
8086 * src/buffer.h: don't call updateScrollbar after fitcursor
8088 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8089 where they are used. Removed "\\direction", this was not present
8090 in 1.1.4 and is already obsolete. Commented out some code that I
8091 believe to never be called.
8092 (runLiterate): don't call updateScrollbar after fitCursor
8094 (buildProgram): ditto
8097 * src/WorkArea.h (workWidth): change return val to unsigned
8100 (redraw): remove the button redraws
8101 (setScrollbarValue): change for scrollbar
8102 (getScrollbarValue): change for scrollbar
8103 (getScrollbarBounds): change for scrollbar
8105 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8106 (C_WorkArea_down_cb): removed func
8107 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8108 (resize): change for scrollbar
8109 (setScrollbar): ditto
8110 (setScrollbarBounds): ditto
8111 (setScrollbarIncrements): ditto
8112 (up_cb): removed func
8113 (down_cb): removed func
8114 (scroll_cb): change for scrollbar
8115 (work_area_handler): ditto
8117 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8118 when FitCursor did something.
8119 (updateScrollbar): some unsigned changes
8120 (downCB): removed func
8121 (scrollUpOnePage): removed func
8122 (scrollDownOnePage): remvoed func
8123 (workAreaMotionNotify): don't call screen->FitCursor but use
8124 fitCursor instead. and bool return val
8125 (workAreaButtonPress): ditto
8126 (workAreaButtonRelease): some unsigned changes
8127 (checkInsetHit): ditto
8128 (workAreaExpose): ditto
8129 (update): parts rewritten, comments about the signed char arg added
8130 (smallUpdate): removed func
8131 (cursorPrevious): call needed updateScrollbar
8134 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8137 * src/BufferView.[Ch] (upCB): removed func
8138 (downCB): removed func
8139 (smallUpdate): removed func
8141 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8144 currentrow, currentrow_y optimization. This did not help a lot and
8145 if we want to do this kind of optimization we should rather use
8146 cursor.row instead of the currentrow.
8148 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8149 buffer spacing and klyx spacing support.
8151 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8153 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8156 2000-04-26 Juergen Vigna <jug@sad.it>
8158 * src/insets/figinset.C: fixes to Lars sstream changes!
8160 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8162 * A lot of files: Added Ascii(ostream &) methods to all inset
8163 classes. Used when exporting to ASCII.
8165 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8166 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8169 * src/text2.C (ToggleFree): Disabled implicit word selection when
8170 there is a change in the language
8172 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8173 no output was generated for end-of-sentence inset.
8175 * src/insets/lyxinset.h
8178 * src/paragraph.C: Removed the insetnumber code
8180 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8182 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8185 no_babel and no_epsfig completely from the file.
8186 (parseSingleLyXformat2Token): add handling for per-paragraph
8187 spacing as written by klyx.
8189 * src/insets/figinset.C: applied patch by Andre. Made it work with
8192 2000-04-20 Juergen Vigna <jug@sad.it>
8194 * src/insets/insettext.C (cutSelection):
8195 (copySelection): Fixed with selection from right to left.
8196 (draw): now the rows are not recalculated at every draw.
8197 (computeTextRows): for now reset the inset-owner here (this is
8198 important for an undo or copy where the inset-owner is not set
8201 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8202 motion to the_locking_inset screen->first was forgotten, this was
8203 not important till we got multiline insets.
8205 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8207 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8208 code seems to be alright (it is code changed by Dekel, and the
8209 intent is indeed that all macros should be defined \protect'ed)
8211 * NEWS: a bit of reorganisation of the new user-visible features.
8213 2000-04-19 Juergen Vigna <jug@sad.it>
8215 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8216 position. Set the inset_owner of the used paragraph so that it knows
8217 that it is inside an inset. Fixed cursor handling with mouse and
8218 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8219 and cleanups to make TextInsets work better.
8221 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8222 Changed parameters of various functions and added LockInsetInInset().
8224 * src/insets/insettext.C:
8226 * src/insets/insetcollapsable.h:
8227 * src/insets/insetcollapsable.C:
8228 * src/insets/insetfoot.h:
8229 * src/insets/insetfoot.C:
8230 * src/insets/insetert.h:
8231 * src/insets/insetert.C: cleaned up the code so that it works now
8232 correctly with insettext.
8234 * src/insets/inset.C:
8235 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8236 that insets in insets are supported right.
8239 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8241 * src/paragraph.C: some small fixes
8243 * src/debug.h: inserted INSETS debug info
8245 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8246 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8248 * src/commandtags.h:
8249 * src/LyXAction.C: insert code for InsetTabular.
8251 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8252 not Button1MotionMask.
8253 (workAreaButtonRelease): send always a InsetButtonRelease event to
8255 (checkInsetHit): some setCursor fixes (always with insets).
8257 * src/BufferView2.C (lockInset): returns a bool now and extended for
8258 locking insets inside insets.
8259 (showLockedInsetCursor): it is important to have the cursor always
8260 before the locked inset.
8261 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8263 * src/BufferView.h: made lockInset return a bool.
8265 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8267 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8268 that is used also internally but can be called as public to have back
8269 a cursor pos which is not set internally.
8270 (SetCursorIntern): Changed to use above function.
8272 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8274 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8280 patches for things that should be in or should be changed.
8282 * src/* [insetfiles]: change "usigned char fragile" to bool
8283 fragile. There was only one point that could that be questioned
8284 and that is commented in formulamacro.C. Grep for "CHECK".
8286 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8287 (DeleteBuffer): take it out of CutAndPaste and make it static.
8289 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8291 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8292 output the spacing envir commands. Also the new commands used in
8293 the LaTeX output makes the result better.
8295 * src/Spacing.C (writeEnvirBegin): new method
8296 (writeEnvirEnd): new method
8298 2000-04-18 Juergen Vigna <jug@sad.it>
8300 * src/CutAndPaste.C: made textclass a static member of the class
8301 as otherwise it is not accesed right!!!
8303 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8305 * forms/layout_forms.fd
8306 * src/layout_forms.h
8307 * src/layout_forms.C (create_form_form_character)
8308 * src/lyx_cb.C (UserFreeFont)
8309 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8310 documents (in the layout->character popup).
8312 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8314 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8315 \spell_command was in fact not honored (from Kevin Atkinson).
8317 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8320 * src/lyx_gui.h: make lyxViews private (Angus)
8322 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8324 * src/mathed/math_write.C
8325 (MathMatrixInset::Write) Put \protect before \begin{array} and
8326 \end{array} if fragile
8327 (MathParInset::Write): Put \protect before \\ if fragile
8329 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8332 initialization if the LyXColorHandler must be done after the
8333 connections to the XServer has been established.
8335 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8336 get the background pixel from the lyxColorhandler so that the
8337 figures are rendered with the correct background color.
8338 (NextToken): removed functions.
8339 (GetPSSizes): use ifs >> string instead of NextToken.
8341 * src/Painter.[Ch]: the color cache moved out of this file.
8343 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8346 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8348 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8349 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8351 * src/BufferView.C (enterView): new func
8352 (leaveView): new func
8354 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8356 (leaveView): new func, undefines xterm cursor when approp.
8358 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8359 (AllowInput): delete the Workarea cursor handling from this func.
8361 * src/Painter.C (underline): draw a slimer underline in most cases.
8363 * src/lyx_main.C (error_handler): use extern "C"
8365 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8367 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8368 sent directly to me.
8370 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8371 to the list by Dekel.
8373 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8376 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8377 methods from lyx_cb.here.
8379 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8382 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8384 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8385 instead of using current_view directly.
8387 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8389 * src/LyXAction.C (init): add the paragraph-spacing command.
8391 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8393 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8395 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8396 different from the documents.
8398 * src/text.C (SetHeightOfRow): take paragraph spacing into
8399 account, paragraph spacing takes precedence over buffer spacing
8400 (GetVisibleRow): ditto
8402 * src/paragraph.C (writeFile): output the spacing parameter too.
8403 (validate): set the correct features if spacing is used in the
8405 (Clear): set spacing to default
8406 (MakeSameLayout): spacing too
8407 (HasSameLayout): spacing too
8408 (SetLayout): spacing too
8409 (TeXOnePar): output the spacing commands
8411 * src/lyxparagraph.h: added a spacing variable for use with
8412 per-paragraph spacing.
8414 * src/Spacing.h: add a Default spacing and a method to check if
8415 the current spacing is default. also added an operator==
8417 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8420 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/lyxserver.C (callback): fix dispatch of functions
8424 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8425 printf() into lyxerr call.
8427 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8430 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8431 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8432 the "Float" from each of the subitems.
8433 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8435 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8436 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8437 documented the change so that the workaround can be nuked later.
8439 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8442 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8444 * src/buffer.C (getLatexName): ditto
8445 (setReadonly): ditto
8447 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8449 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8450 avoid some uses of current_view. Added also a bufferParams()
8451 method to get at this.
8453 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8455 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8457 * src/lyxparagraph.[Ch]: removed
8458 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8459 with operators used by lower_bound and
8460 upper_bound in InsetTable's
8461 Make struct InsetTable private again. Used matchpos.
8463 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8465 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8466 document, the language of existing text is changed (unless the
8467 document is multi-lingual)
8469 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8471 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8473 * A lot of files: A rewrite of the Right-to-Left support.
8475 2000-04-10 Juergen Vigna <jug@sad.it>
8477 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8478 misplaced cursor when inset in inset is locked.
8480 * src/insets/insettext.C (LocalDispatch): small fix so that a
8481 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8483 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8484 footnote font should be decreased in size twice when displaying.
8486 * src/insets/insettext.C (GetDrawFont): inserted this function as
8487 the drawing-font may differ from the real paragraph font.
8489 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8490 insets (inset in inset!).
8492 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8493 function here because we don't want footnotes inside footnotes.
8495 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8497 (init): now set the inset_owner in paragraph.C
8498 (LocalDispatch): added some resetPos() in the right position
8501 (pasteSelection): changed to use the new CutAndPaste-Class.
8503 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8504 which tells if it is allowed to insert another inset inside this one.
8506 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8507 SwitchLayoutsBetweenClasses.
8509 * src/text2.C (InsertInset): checking of the new paragraph-function
8511 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8512 is not needed anymore here!
8515 (PasteSelection): redone (also with #ifdef) so that now this uses
8516 the CutAndPaste-Class.
8517 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8520 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8521 from/to text/insets.
8523 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8524 so that the paragraph knows if it is inside an (text)-inset.
8525 (InsertFromMinibuffer): changed return-value to bool as now it
8526 may happen that an inset is not inserted in the paragraph.
8527 (InsertInsetAllowed): this checks if it is allowed to insert an
8528 inset in this paragraph.
8530 (BreakParagraphConservative):
8531 (BreakParagraph) : small change for the above change of the return
8532 value of InsertFromMinibuffer.
8534 * src/lyxparagraph.h: added inset_owner and the functions to handle
8535 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8537 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8539 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8540 functions from BufferView to BufferView::Pimpl to ease maintence.
8542 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8543 correctly. Also use SetCursorIntern instead of SetCursor.
8545 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8548 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8550 * src/WorkArea.C (belowMouse): manually implement below mouse.
8552 * src/*: Add "explicit" on several constructors, I added probably
8553 some unneeded ones. A couple of changes to code because of this.
8555 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8556 implementation and private parts from the users of BufferView. Not
8559 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8560 implementation and private parts from the users of LyXLex. Not
8563 * src/BufferView_pimpl.[Ch]: new files
8565 * src/lyxlex_pimpl.[Ch]: new files
8567 * src/LyXView.[Ch]: some inline functions move out-of-line
8569 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8571 * src/lyxparagraph.h: make struct InsetTable public.
8573 * src/support/lyxstring.h: change lyxstring::difference_type to be
8574 ptrdiff_t. Add std:: modifiers to streams.
8576 * src/font.C: include the <cctype> header, for islower() and
8579 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8581 * src/font.[Ch]: new files. Contains the metric functions for
8582 fonts, takes a LyXFont as parameter. Better separation of concepts.
8584 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8585 changes because of this.
8587 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8589 * src/*: compile with -Winline and move functions that don't
8592 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8595 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8598 (various files changed because of this)
8600 * src/Painter.C (text): fixed the drawing of smallcaps.
8602 * src/lyxfont.[Ch] (drawText): removed unused member func.
8605 * src/*.C: added needed "using" statements and "std::" qualifiers.
8607 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8609 * src/*.h: removed all use of "using" from header files use
8610 qualifier std:: instead.
8612 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8614 * src/text.C (Backspace): some additional cleanups (we already
8615 know whether cursor.pos is 0 or not).
8617 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8618 automake does not provide one).
8620 * src/bmtable.h: replace C++ comments with C comments.
8622 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8624 * src/screen.C (ShowCursor): Change the shape of the cursor if
8625 the current language is not equal to the language of the document.
8626 (If the cursor change its shape unexpectedly, then you've found a bug)
8628 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8631 * src/insets/insetnumber.[Ch]: New files.
8633 * src/LyXAction.C (init)
8634 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8637 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8639 * src/lyxparagraph.h
8640 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8641 (the vector is kept sorted).
8643 * src/text.C (GetVisibleRow): Draw selection correctly when there
8644 is both LTR and RTL text.
8646 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8647 which is much faster.
8649 * src/text.C (GetVisibleRow and other): Do not draw the last space
8650 in a row if the direction of the last letter is not equal to the
8651 direction of the paragraph.
8653 * src/lyxfont.C (latexWriteStartChanges):
8654 Check that font language is not equal to basefont language.
8655 (latexWriteEndChanges): ditto
8657 * src/lyx_cb.C (StyleReset): Don't change the language while using
8658 the font-default command.
8660 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8661 empty paragraph before a footnote.
8663 * src/insets/insetcommand.C (draw): Increase x correctly.
8665 * src/screen.C (ShowCursor): Change cursor shape if
8666 current language != document language.
8668 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8670 2000-03-31 Juergen Vigna <jug@sad.it>
8672 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8673 (Clone): changed mode how the paragraph-data is copied to the
8674 new clone-paragraph.
8676 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8677 GetInset(pos) with no inset anymore there (in inset UNDO)
8679 * src/insets/insetcommand.C (draw): small fix as here x is
8680 incremented not as much as width() returns (2 before, 2 behind = 4)
8682 2000-03-30 Juergen Vigna <jug@sad.it>
8684 * src/insets/insettext.C (InsetText): small fix in initialize
8685 widthOffset (should not be done in the init() function)
8687 2000-03-29 Amir Karger <karger@lyx.org>
8689 * lib/examples/it_ItemizeBullets.lyx: translation by
8692 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8694 2000-03-29 Juergen Vigna <jug@sad.it>
8696 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8698 * src/insets/insetfoot.C (Clone): small change as for the below
8699 new init function in the text-inset
8701 * src/insets/insettext.C (init): new function as I've seen that
8702 clone did not copy the Paragraph-Data!
8703 (LocalDispatch): Added code so that now we have some sort of Undo
8704 functionality (well actually we HAVE Undo ;)
8706 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8708 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8710 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8713 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8715 * src/main.C: added a runtime check that verifies that the xforms
8716 header used when building LyX and the library used when running
8717 LyX match. Exit with a message if they don't match. This is a
8718 version number check only.
8720 * src/buffer.C (save): Don't allocate memory on the heap for
8721 struct utimbuf times.
8723 * *: some using changes, use iosfwd instead of the real headers.
8725 * src/lyxfont.C use char const * instead of string for the static
8726 strings. Rewrite some functions to use sstream.
8728 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8730 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8733 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8735 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8736 of Geodesy (from Martin Vermeer)
8738 * lib/layouts/svjour.inc: include file for the Springer svjour
8739 class. It can be used to support journals other than JoG.
8741 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8742 Miskiewicz <misiek@pld.org.pl>)
8743 * lib/reLyX/Makefile.am: ditto.
8745 2000-03-27 Juergen Vigna <jug@sad.it>
8747 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8748 also some modifications with operations on selected text.
8750 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8751 problems with clicking on insets (last famous words ;)
8753 * src/insets/insetcommand.C (draw):
8754 (width): Changed to have a bit of space before and after the inset so
8755 that the blinking cursor can be seen (otherwise it was hidden)
8757 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8759 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8760 would not be added to the link list when an installed gettext (not
8761 part of libc) is found.
8763 2000-03-24 Juergen Vigna <jug@sad.it>
8765 * src/insets/insetcollapsable.C (Edit):
8766 * src/mathed/formula.C (InsetButtonRelease):
8767 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8770 * src/BufferView.C (workAreaButtonPress):
8771 (workAreaButtonRelease):
8772 (checkInsetHit): Finally fixed the clicking on insets be handled
8775 * src/insets/insetert.C (Edit): inserted this call so that ERT
8776 insets work always with LaTeX-font
8778 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8780 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8781 caused lyx to startup with no GUI in place, causing in a crash
8782 upon startup when called with arguments.
8784 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8786 * src/FontLoader.C: better initialization of dummyXFontStruct.
8788 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8790 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8791 for linuxdoc and docbook import and export format options.
8793 * lib/lyxrc.example Example of default values for the previous flags.
8795 * src/lyx_cb.C Use those flags instead of the hardwired values for
8796 linuxdoc and docbook export.
8798 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8801 * src/menus.C Added menus entries for the new import/exports formats.
8803 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8805 * src/lyxrc.*: Added support for running without Gui
8808 * src/FontLoader.C: sensible defaults if no fonts are needed
8810 * src/lyx_cb.C: New function ShowMessage (writes either to the
8811 minibuffer or cout in case of no gui
8812 New function AskOverwrite for common stuff
8813 Consequently various changes to call these functions
8815 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8816 wild guess at sensible screen resolution when having no gui
8818 * src/lyxfont.C: no gui, no fonts... set some defaults
8820 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8822 * src/LColor.C: made the command inset background a bit lighter.
8824 2000-03-20 Hartmut Goebel <goebel@noris.net>
8826 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8827 stdstruct.inc. Koma-Script added some title elements which
8828 otherwise have been listed below "bibliography". This split allows
8829 adding title elements to where they belong.
8831 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8832 define the additional title elements and then include
8835 * many other layout files: changed to include stdtitle.inc just
8836 before stdstruct.inc.
8838 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8840 * src/buffer.C: (save) Added the option to store all backup files
8841 in a single directory
8843 * src/lyxrc.[Ch]: Added variable \backupdir_path
8845 * lib/lyxrc.example: Added descriptions of recently added variables
8847 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8848 bibtex inset, not closing the bibtex popup when deleting the inset)
8850 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8852 * src/lyx_cb.C: add a couple using directives.
8854 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8855 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8856 import based on the filename.
8858 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8859 file would be imported at start, if the filename where of a sgml file.
8861 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8863 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8865 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8866 * src/lyxfont.h Replaced the member variable bits.direction by the
8867 member variable lang. Made many changes in other files.
8868 This allows having a multi-lingual document
8870 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8871 that change the current language to <l>.
8872 Removed the command "font-rtl"
8874 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8875 format for Hebrew documents)
8877 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8878 When auto_mathmode is "true", pressing a digit key in normal mode
8879 will cause entering into mathmode.
8880 If auto_mathmode is "rtl" then this behavior will be active only
8881 when writing right-to-left text.
8883 * src/text2.C (InsertStringA) The string is inserted using the
8886 * src/paragraph.C (GetEndLabel) Gives a correct result for
8887 footnote paragraphs.
8889 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8891 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8893 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8894 front of PasteParagraph. Never insert a ' '. This should at least
8895 fix some cause for the segfaults that we have been experiencing,
8896 it also fixes backspace behaviour slightly. (Phu!)
8898 * src/support/lstrings.C (compare_no_case): some change to make it
8899 compile with gcc 2.95.2 and stdlibc++-v3
8901 * src/text2.C (MeltFootnoteEnvironment): change type o
8902 first_footnote_par_is_not_empty to bool.
8904 * src/lyxparagraph.h: make text private. Changes in other files
8906 (fitToSize): new function
8907 (setContentsFromPar): new function
8908 (clearContents): new function
8909 (SetChar): new function
8911 * src/paragraph.C (readSimpleWholeFile): deleted.
8913 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8914 the file, just use a simple string instead. Also read the file in
8915 a more maintainable manner.
8917 * src/text2.C (InsertStringA): deleted.
8918 (InsertStringB): deleted.
8920 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8923 RedoParagraphs from the doublespace handling part, just set status
8924 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8925 done, but perhaps not like this.)
8927 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8929 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8930 character when inserting an inset.
8932 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8934 * src/bufferparams.C (readLanguage): now takes "default" into
8937 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8938 also initialize the toplevel_keymap with the default bindings from
8941 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8943 * all files using lyxrc: have lyxrc as a real variable and not a
8944 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8947 * src/lyxrc.C: remove double call to defaultKeyBindings
8949 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8950 toolbar defauls using lyxlex. Remove enums, structs, functions
8953 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8954 toolbar defaults. Also store default keybindings in a map.
8956 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8957 storing the toolbar defaults without any xforms dependencies.
8959 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8960 applied. Changed to use iterators.
8962 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8964 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8965 systems that don't have LINGUAS set to begin with.
8967 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8969 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8970 the list by Dekel Tsur.
8972 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8974 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8975 * src/insets/form_graphics.C: ditto.
8977 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8979 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8981 * src/bufferparams.C (readLanguage): use the new language map
8983 * src/intl.C (InitKeyMapper): use the new language map
8985 * src/lyx_gui.C (create_forms): use the new language map
8987 * src/language.[Ch]: New files. Used for holding the information
8988 about each language. Now! Use this new language map enhance it and
8989 make it really usable for our needs.
8991 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8993 * screen.C (ShowCursor): Removed duplicate code.
8994 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8995 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8997 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9000 * src/text.C Added TransformChar method. Used for rendering Arabic
9001 text correctly (change the glyphs of the letter according to the
9002 position in the word)
9007 * src/lyxrc.C Added lyxrc command {language_command_begin,
9008 language_command_end,language_command_ltr,language_command_rtl,
9009 language_package} which allows the use of either arabtex or Omega
9012 * src/lyx_gui.C (init)
9014 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9015 to use encoding for menu fonts which is different than the encoding
9018 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9019 do not load the babel package.
9020 To write an English document with Hebrew/Arabic, change the document
9021 language to "english".
9023 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9024 (alphaCounter): changed to return char
9025 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9027 * lib/lyxrc.example Added examples for Hebrew/Arabic
9030 * src/layout.C Added layout command endlabeltype
9032 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9034 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9036 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9038 * src/mathed/math_delim.C (search_deco): return a
9039 math_deco_struct* instead of index.
9041 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9043 * All files with a USE_OSTREAM_ONLY within: removed all code that
9044 was unused when USE_OSTREAM_ONLY is defined.
9046 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9047 of any less. Removed header and using.
9049 * src/text.C (GetVisibleRow): draw the string "Page Break
9050 (top/bottom)" on screen when drawing a pagebreak line.
9052 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9054 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9056 * src/mathed/math_macro.C (draw): do some cast magic.
9059 * src/mathed/math_defs.h: change byte* argument to byte const*.
9061 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9063 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9064 know it is right to return InsetFoot* too, but cxx does not like
9067 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9069 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9071 * src/mathed/math_delim.C: change == to proper assignment.
9073 2000-03-09 Juergen Vigna <jug@sad.it>
9075 * src/insets/insettext.C (setPos): fixed various cursor positioning
9076 problems (via mouse and cursor-keys)
9077 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9078 inset (still a small display problem but it works ;)
9080 * src/insets/insetcollapsable.C (draw): added button_top_y and
9081 button_bottom_y to have correct values for clicking on the inset.
9083 * src/support/lyxalgo.h: commented out 'using std::less'
9085 2000-03-08 Juergen Vigna <jug@sad.it>
9087 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9088 Button-Release event closes as it is alos the Release-Event
9091 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9093 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9095 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9096 can add multiple spaces in Scrap (literate programming) styles...
9097 which, by the way, is how I got hooked on LyX to begin with.
9099 * src/mathed/formula.C (Write): Added dummy variable to an
9100 inset::Latex() call.
9101 (Latex): Add free_spacing boolean to inset::Latex()
9103 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9105 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9106 virtual function to include the free_spacing boolean from
9107 the containing paragraph's style.
9109 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9110 Added free_spacing boolean arg to match inset.h
9112 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9113 Added free_spacing boolean arg to match inset.h
9115 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9116 Added free_spacing boolean and made sure that if in a free_spacing
9117 paragraph, that we output normal space if there is a protected space.
9119 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9120 Added free_spacing boolean arg to match inset.h
9122 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9123 Added free_spacing boolean arg to match inset.h
9125 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9126 Added free_spacing boolean arg to match inset.h
9128 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9129 Added free_spacing boolean arg to match inset.h
9131 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9132 Added free_spacing boolean arg to match inset.h
9134 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9135 free_spacing boolean arg to match inset.h
9137 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9138 Added free_spacing boolean arg to match inset.h
9140 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9141 Added free_spacing boolean arg to match inset.h
9143 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9144 Added free_spacing boolean arg to match inset.h
9146 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9147 Added free_spacing boolean arg to match inset.h
9149 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9150 Added free_spacing boolean arg to match inset.h
9152 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9153 free_spacing boolean arg to match inset.h
9155 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9156 free_spacing boolean arg to match inset.h
9158 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9159 ignore free_spacing paragraphs. The user's spaces are left
9162 * src/text.C (InsertChar): Fixed the free_spacing layout
9163 attribute behavior. Now, if free_spacing is set, you can
9164 add multiple spaces in a paragraph with impunity (and they
9165 get output verbatim).
9166 (SelectSelectedWord): Added dummy argument to inset::Latex()
9169 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9172 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9173 paragraph layouts now only input a simple space instead.
9174 Special character insets don't make any sense in free-spacing
9177 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9178 hard-spaces in the *input* file to simple spaces if the layout
9179 is free-spacing. This converts old files which had to have
9180 hard-spaces in free-spacing layouts where a simple space was
9182 (writeFileAscii): Added free_spacing check to pass to the newly
9183 reworked inset::Latex(...) methods. The inset::Latex() code
9184 ensures that hard-spaces in free-spacing paragraphs get output
9185 as spaces (rather than "~").
9187 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9189 * src/mathed/math_delim.C (draw): draw the empty placeholder
9190 delims with a onoffdash line.
9191 (struct math_deco_compare): struct that holds the "functors" used
9192 for the sort and the binary search in math_deco_table.
9193 (class init_deco_table): class used for initial sort of the
9195 (search_deco): use lower_bound to do a binary search in the
9198 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/lyxrc.C: a small secret thingie...
9202 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9203 and to not flush the stream as often as it used to.
9205 * src/support/lyxalgo.h: new file
9206 (sorted): template function used for checking if a sequence is
9207 sorted or not. Two versions with and without user supplied
9208 compare. Uses same compare as std::sort.
9210 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9211 it and give warning on lyxerr.
9213 (struct compare_tags): struct with function operators used for
9214 checking if sorted, sorting and lower_bound.
9215 (search_kw): use lower_bound instead of manually implemented
9218 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9220 * src/insets/insetcollapsable.h: fix Clone() declaration.
9221 * src/insets/insetfoot.h: ditto.
9223 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9225 2000-03-08 Juergen Vigna <jug@sad.it>
9227 * src/insets/lyxinset.h: added owner call which tells us if
9228 this inset is inside another inset. Changed also the return-type
9229 of Editable to an enum so it tells clearer what the return-value is.
9231 * src/insets/insettext.C (computeTextRows): fixed computing of
9232 textinsets which split automatically on more rows.
9234 * src/insets/insetert.[Ch]: changed this to be of BaseType
9237 * src/insets/insetfoot.[Ch]: added footnote inset
9239 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9240 collapsable insets (like footnote, ert, ...)
9242 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * src/lyxdraw.h: remvoe file
9246 * src/lyxdraw.C: remove file
9248 * src/insets/insettext.C: added <algorithm>.
9250 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9252 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9253 (matrix_cb): case MM_OK use string stream
9255 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9258 * src/mathed/math_macro.C (draw): use string stream
9259 (Metrics): use string stream
9261 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9262 directly to the ostream.
9264 * src/vspace.C (asString): use string stream.
9265 (asString): use string stream
9266 (asLatexString): use string stream
9268 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9269 setting Spacing::Other.
9271 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9272 sprintf when creating the stretch vale.
9274 * src/text2.C (alphaCounter): changed to return a string and to
9275 not use a static variable internally. Also fixed a one-off bug.
9276 (SetCounter): changed the drawing of the labels to use string
9277 streams instead of sprintf.
9279 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9280 manipulator to use a scheme that does not require library support.
9281 This is also the way it is done in the new GNU libstdc++. Should
9282 work with DEC cxx now.
9284 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9286 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9287 end. This fixes a bug.
9289 * src/mathed (all files concerned with file writing): apply the
9290 USE_OSTREAM_ONLY changes to mathed too.
9292 * src/support/DebugStream.h: make the constructor explicit.
9294 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9295 count and ostream squashed.
9297 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9299 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9301 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9302 ostringstream uses STL strings, and we might not.
9304 * src/insets/insetspecialchar.C: add using directive.
9305 * src/insets/insettext.C: ditto.
9307 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9309 * lib/layouts/seminar.layout: feeble attempt at a layout for
9310 seminar.cls, far from completet and could really use some looking
9311 at from people used to write layout files.
9313 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9314 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9315 a lot nicer and works nicely with ostreams.
9317 * src/mathed/formula.C (draw): a slightly different solution that
9318 the one posted to the list, but I think this one works too. (font
9319 size wrong in headers.)
9321 * src/insets/insettext.C (computeTextRows): some fiddling on
9322 Jürgens turf, added some comments that he should read.
9324 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9325 used and it gave compiler warnings.
9326 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9329 * src/lyx_gui.C (create_forms): do the right thing when
9330 show_banner is true/false.
9332 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9333 show_banner is false.
9335 * most file writing files: Now use iostreams to do almost all of
9336 the writing. Also instead of passing string &, we now use
9337 stringstreams. mathed output is still not adapted to iostreams.
9338 This change can be turned off by commenting out all the occurences
9339 of the "#define USE_OSTREAM_ONLY 1" lines.
9341 * src/WorkArea.C (createPixmap): don't output debug messages.
9342 (WorkArea): don't output debug messages.
9344 * lib/lyxrc.example: added a comment about the new variable
9347 * development/Code_rules/Rules: Added some more commente about how
9348 to build class interfaces and on how better encapsulation can be
9351 2000-03-03 Juergen Vigna <jug@sad.it>
9353 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9354 automatically with the width of the LyX-Window
9356 * src/insets/insettext.C (computeTextRows): fixed update bug in
9357 displaying text-insets (scrollvalues where not initialized!)
9359 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9361 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9362 id in the check of the result from lower_bound is not enough since
9363 lower_bound can return last too, and then res->id will not be a
9366 * all insets and some code that use them: I have conditionalized
9367 removed the Latex(string & out, ...) this means that only the
9368 Latex(ostream &, ...) will be used. This is a work in progress to
9369 move towards using streams for all output of files.
9371 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9374 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9376 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9377 routine (this fixes bug where greek letters were surrounded by too
9380 * src/support/filetools.C (findtexfile): change a bit the search
9381 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9382 no longer passed to kpsewhich, we may have to change that later.
9384 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9385 warning options to avoid problems with X header files (from Angus
9387 * acinclude.m4: regenerated.
9389 2000-03-02 Juergen Vigna <jug@sad.it>
9391 * src/insets/insettext.C (WriteParagraphData): Using the
9392 par->writeFile() function for writing paragraph-data.
9393 (Read): Using buffer->parseSingleLyXformat2Token()-function
9394 for parsing paragraph data!
9396 * src/buffer.C (readLyXformat2): removed all parse data and using
9397 the new parseSingleLyXformat2Token()-function.
9398 (parseSingleLyXformat2Token): added this function to parse (read)
9399 lyx-file-format (this is called also from text-insets now!)
9401 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9403 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9406 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9407 directly instead of going through a func. One very bad thing: a
9408 static LyXFindReplace, but I don't know where to place it.
9410 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9411 string instead of char[]. Also changed to static.
9412 (GetSelectionOrWordAtCursor): changed to static inline
9413 (SetSelectionOverLenChars): ditto.
9415 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9416 current_view and global variables. both classes has changed names
9417 and LyXFindReplace is not inherited from SearchForm.
9419 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9420 fl_form_search form.
9422 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9424 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9426 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9427 bound (from Kayvan).
9429 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9431 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9433 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9435 * some things that I should comment but the local pub says head to
9438 * comment out all code that belongs to the Roff code for Ascii
9439 export of tables. (this is unused)
9441 * src/LyXView.C: use correct type for global variable
9442 current_layout. (LyXTextClass::size_type)
9444 * some code to get the new insetgraphics closer to working I'd be
9445 grateful for any help.
9447 * src/BufferView2.C (insertInset): use the return type of
9448 NumberOfLayout properly. (also changes in other files)
9450 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9451 this as a test. I want to know what breaks because of this.
9453 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9455 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9457 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9458 to use a \makebox in the label, this allows proper justification
9459 with out using protected spaces or multiple hfills. Now it is
9460 "label" for left justified, "\hfill label\hfill" for center, and
9461 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9462 should be changed accordingly.
9464 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9466 * src/lyxtext.h: change SetLayout() to take a
9467 LyXTextClass::size_type instead of a char (when there is more than
9468 127 layouts in a class); also change type of copylayouttype.
9469 * src/text2.C (SetLayout): ditto.
9470 * src/LyXView.C (updateLayoutChoice): ditto.
9472 * src/LaTeX.C (scanLogFile): errors where the line number was not
9473 given just after the '!'-line were ignored (from Dekel Tsur).
9475 * lib/lyxrc.example: fix description of \date_insert_format
9477 * lib/layouts/llncs.layout: new layout, contributed by Martin
9480 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9483 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9484 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9485 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9486 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9487 paragraph.C, text.C, text2.C)
9489 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9491 * src/insets/insettext.C (LocalDispatch): remove extra break
9494 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9495 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9497 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9498 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9500 * src/insets/insetbib.h: move InsetBibkey::Holder and
9501 InsetCitation::Holder in public space.
9503 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9505 * src/insets/insettext.h: small change to get the new files from
9506 Juergen to compile (use "string", not "class string").
9508 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9509 const & as parameter to LocalDispatch, use LyXFont const & as
9510 paramter to some other func. This also had impacto on lyxinsets.h
9511 and the two mathed insets.
9513 2000-02-24 Juergen Vigna <jug@sad.it>
9516 * src/commandtags.h:
9518 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9522 * src/BufferView2.C: added/updated code for various inset-functions
9524 * src/insets/insetert.[Ch]: added implementation of InsetERT
9526 * src/insets/insettext.[Ch]: added implementation of InsetText
9528 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9529 (draw): added preliminary code for inset scrolling not finshed yet
9531 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9532 as it is in lyxfunc.C now
9534 * src/insets/lyxinset.h: Added functions for text-insets
9536 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9538 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9539 BufferView and reimplement the list as a queue put inside its own
9542 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9544 * several files: use the new interface to the "updateinsetlist"
9546 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9548 (work_area_handler): call BufferView::trippleClick on trippleclick.
9550 * src/BufferView.C (doubleClick): new function, selects word on
9552 (trippleClick): new function, selects line on trippleclick.
9554 2000-02-22 Allan Rae <rae@lyx.org>
9556 * lib/bind/xemacs.bind: buffer-previous not supported
9558 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9560 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9563 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9565 * src/bufferlist.C: get rid of current_view from this file
9567 * src/spellchecker.C: get rid of current_view from this file
9569 * src/vspace.C: get rid of current_view from this file
9570 (inPixels): added BufferView parameter for this func
9571 (asLatexCommand): added a BufferParams for this func
9573 * src/text.C src/text2.C: get rid of current_view from these
9576 * src/lyxfont.C (getFontDirection): move this function here from
9579 * src/bufferparams.C (getDocumentDirection): move this function
9582 * src/paragraph.C (getParDirection): move this function here from
9584 (getLetterDirection): ditto
9586 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9588 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9589 resize due to wrong pixmap beeing used. Also took the opurtunity
9590 to make the LyXScreen stateless on regard to WorkArea and some
9591 general cleanup in the same files.
9593 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9595 * src/Makefile.am: add missing direction.h
9597 * src/PainterBase.h: made the width functions const.
9599 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9602 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9604 * src/insets/insetlatexaccent.C (draw): make the accents draw
9605 better, at present this will only work well with iso8859-1.
9607 * several files: remove the old drawing code, now we use the new
9610 * several files: remove support for mono_video, reverse_video and
9613 2000-02-17 Juergen Vigna <jug@sad.it>
9615 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9616 int ** as we have to return the pointer, otherwise we have only
9617 NULL pointers in the returning function.
9619 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9621 * src/LaTeX.C (operator()): quote file name when running latex.
9623 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9625 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9626 (bubble tip), this removes our special handling of this.
9628 * Remove all code that is unused now that we have the new
9629 workarea. (Code that are not active when NEW_WA is defined.)
9631 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9633 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9635 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9636 nonexisting layout; correctly redirect obsoleted layouts.
9638 * lib/lyxrc.example: document \view_dvi_paper_option
9640 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9643 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9644 (PreviewDVI): handle the view_dvi_paper_option variable.
9645 [Both from Roland Krause]
9647 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9649 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9650 char const *, int, LyXFont)
9651 (text(int, int, string, LyXFont)): ditto
9653 * src/text.C (InsertCharInTable): attempt to fix the double-space
9654 feature in tables too.
9655 (BackspaceInTable): ditto.
9656 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9658 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9660 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9662 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9663 newly found text in textcache to this.
9664 (buffer): set the owner of the text put into the textcache to 0
9666 * src/insets/figinset.C (draw): fixed the drawing of figures with
9669 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9670 drawing of mathframe, hfills, protected space, table lines. I have
9671 now no outstanding drawing problems with the new Painter code.
9673 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9675 * src/PainterBase.C (ellipse, circle): do not specify the default
9678 * src/LColor.h: add using directive.
9680 * src/Painter.[Ch]: change return type of methods from Painter& to
9681 PainterBase&. Add a using directive.
9683 * src/WorkArea.C: wrap xforms callbacks in C functions
9686 * lib/layouts/foils.layout: font fix and simplifications from Carl
9689 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9691 * a lot of files: The Painter, LColor and WorkArea from the old
9692 devel branch has been ported to lyx-devel. Some new files and a
9693 lot of #ifdeffed code. The new workarea is enabled by default, but
9694 if you want to test the new Painter and LColor you have to compile
9695 with USE_PAINTER defined (do this in config.h f.ex.) There are
9696 still some rought edges, and I'd like some help to clear those
9697 out. It looks stable (loads and displays the Userguide very well).
9700 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9702 * src/buffer.C (pop_tag): revert to the previous implementation
9703 (use a global variable for both loops).
9705 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9707 * src/lyxrc.C (LyXRC): change slightly default date format.
9709 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9710 there is an English text with a footnote that starts with a Hebrew
9711 paragraph, or vice versa.
9712 (TeXFootnote): ditto.
9714 * src/text.C (LeftMargin): allow for negative values for
9715 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9718 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9719 for input encoding (cyrillic)
9721 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9723 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9726 * src/toolbar.C (set): ditto
9727 * src/insets/insetbib.C (create_form_citation_form): ditto
9729 * lib/CREDITS: added Dekel Tsur.
9731 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9732 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9733 hebrew supports files from Dekel Tsur.
9735 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9736 <tzafrir@technion.ac.il>
9738 * src/lyxrc.C: put \date_insert_format at the right place.
9740 * src/buffer.C (makeLaTeXFile): fix the handling of
9741 BufferParams::sides when writing out latex files.
9743 * src/BufferView2.C: add a "using" directive.
9745 * src/support/lyxsum.C (sum): when we use lyxstring,
9746 ostringstream::str needs an additional .c_str().
9748 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9750 * src/support/filetools.C (ChangeExtension): patch from Etienne
9753 * src/TextCache.C (show): remove const_cast and make second
9754 parameter non-const LyXText *.
9756 * src/TextCache.h: use non const LyXText in show.
9758 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9761 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9763 * src/support/lyxsum.C: rework to be more flexible.
9765 * several places: don't check if a pointer is 0 if you are going
9768 * src/text.C: remove some dead code.
9770 * src/insets/figinset.C: remove some dead code
9772 * src/buffer.C: move the BufferView funcs to BufferView2.C
9773 remove all support for insetlatexdel
9774 remove support for oldpapersize stuff
9775 made some member funcs const
9777 * src/kbmap.C: use a std::list to store the bindings in.
9779 * src/BufferView2.C: new file
9781 * src/kbsequence.[Ch]: new files
9783 * src/LyXAction.C + others: remove all trace of buffer-previous
9785 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9786 only have one copy in the binary of this table.
9788 * hebrew patch: moved some functions from LyXText to more
9789 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9791 * several files: remove support for XForms older than 0.88
9793 remove some #if 0 #endif code
9795 * src/TextCache.[Ch]: new file. Holds the textcache.
9797 * src/BufferView.C: changes to use the new TextCache interface.
9798 (waitForX): remove the now unused code.
9800 * src/BackStack.h: remove some commented code
9802 * lib/bind/emacs.bind: remove binding for buffer-previous
9804 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9806 * applied the hebrew patch.
9808 * src/lyxrow.h: make sure that all Row variables are initialized.
9810 * src/text2.C (TextHandleUndo): comment out a delete, this might
9811 introduce a memory leak, but should also help us to not try to
9812 read freed memory. We need to look at this one.
9814 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9815 (LyXParagraph): initalize footnotekind.
9817 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9818 forgot this when applying the patch. Please heed the warnings.
9820 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9821 (aka. reformat problem)
9823 * src/bufferlist.C (exists): made const, and use const_iterator
9824 (isLoaded): new func.
9825 (release): use std::find to find the correct buffer.
9827 * src/bufferlist.h: made getState a const func.
9828 made empty a const func.
9829 made exists a const func.
9832 2000-02-01 Juergen Vigna <jug@sad.it>
9834 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9836 * po/it.po: updated a bit the italian po file and also changed the
9837 'file nuovo' for newfile to 'filenuovo' without a space, this did
9840 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9841 for the new insert_date command.
9843 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9844 from jdblair, to insert a date into the current text conforming to
9845 a strftime format (for now only considering the locale-set and not
9846 the document-language).
9848 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9850 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9851 Bounds Read error seen by purify. The problem was that islower is
9852 a macros which takes an unsigned char and uses it as an index for
9853 in array of characters properties (and is thus subject to the
9857 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9858 correctly the paper sides radio buttons.
9859 (UpdateDocumentButtons): ditto.
9861 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9863 * src/kbmap.C (getsym + others): change to return unsigned int,
9864 returning a long can give problems on 64 bit systems. (I assume
9865 that int is 32bit on 64bit systems)
9867 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9869 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9870 LyXLookupString to be zero-terminated. Really fixes problems seen
9873 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9875 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9876 write a (char*)0 to the lyxerr stream.
9878 * src/lastfiles.C: move algorithm before the using statemets.
9880 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9882 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9883 complains otherwise).
9884 * src/table.C: ditto
9886 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9889 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9890 that I removed earlier... It is really needed.
9892 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9894 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9896 * INSTALL: update xforms home page URL.
9898 * lib/configure.m4: fix a bug with unreadable layout files.
9900 * src/table.C (calculate_width_of_column): add "using std::max"
9903 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9905 * several files: marked several lines with "DEL LINE", this is
9906 lines that can be deleted without changing anything.
9907 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9908 checks this anyway */
9911 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9913 * src/DepTable.C (update): add a "+" at the end when the checksum
9914 is different. (debugging string only)
9916 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9917 the next inset to not be displayed. This should also fix the list
9918 of labels in the "Insert Crossreference" dialog.
9920 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9922 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9923 when regex was not found.
9925 * src/support/lstrings.C (lowercase): use handcoded transform always.
9928 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9929 old_cursor.par->prev could be 0.
9931 * several files: changed post inc/dec to pre inc/dec
9933 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9934 write the lastfiles to file.
9936 * src/BufferView.C (buffer): only show TextCache info when debugging
9938 (resizeCurrentBuffer): ditto
9939 (workAreaExpose): ditto
9941 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9943 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9945 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9946 a bit better by removing the special case for \i and \j.
9948 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9950 * src/lyx_main.C (easyParse): remove test for bad comand line
9951 options, since this broke all xforms-related parsing.
9953 * src/kbmap.C (getsym): set return type to unsigned long, as
9954 declared in header. On an alpha, long is _not_ the same as int.
9956 * src/support/LOstream.h: add a "using std::flush;"
9958 * src/insets/figinset.C: ditto.
9960 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9962 * src/bufferlist.C (write): use blinding fast file copy instead of
9963 "a char at a time", now we are doing it the C++ way.
9965 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9966 std::list<int> instead.
9967 (addpidwait): reflect move to std::list<int>
9968 (sigchldchecker): ditto
9970 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9973 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9974 that obviously was wrong...
9976 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9977 c, this avoids warnings with purify and islower.
9979 * src/insets/figinset.C: rename struct queue to struct
9980 queue_element and rewrite to use a std::queue. gsqueue is now a
9981 std::queue<queue_element>
9982 (runqueue): reflect move to std::queue
9985 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9986 we would get "1" "0" instead of "true" "false. Also make the tostr
9989 2000-01-21 Juergen Vigna <jug@sad.it>
9991 * src/buffer.C (writeFileAscii): Disabled code for special groff
9992 handling of tabulars till I fix this in table.C
9994 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9996 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9998 * src/support/lyxlib.h: ditto.
10000 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10002 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10003 and 'j' look better. This might fix the "macron" bug that has been
10006 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10007 functions as one template function. Delete the old versions.
10009 * src/support/lyxsum.C: move using std::ifstream inside
10012 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10015 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10017 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10019 * src/insets/figinset.C (InitFigures): use new instead of malloc
10020 to allocate memory for figures and bitmaps.
10021 (DoneFigures): use delete[] instead of free to deallocate memory
10022 for figures and bitmaps.
10023 (runqueue): use new to allocate
10024 (getfigdata): use new/delete[] instead of malloc/free
10025 (RegisterFigure): ditto
10027 * some files: moved some declarations closer to first use, small
10028 whitespace changes use preincrement instead of postincrement where
10029 it does not make a difference.
10031 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10032 step on the way to use stl::containers for key maps.
10034 * src/bufferlist.h: add a typedef for const_iterator and const
10035 versions of begin and end.
10037 * src/bufferlist.[Ch]: change name of member variable _state to
10038 state_. (avoid reserved names)
10040 (getFileNames): returns the filenames of the buffers in a vector.
10042 * configure.in (ALL_LINGUAS): added ro
10044 * src/support/putenv.C: new file
10046 * src/support/mkdir.C: new file
10048 2000-01-20 Allan Rae <rae@lyx.org>
10050 * lib/layouts/IEEEtran.layout: Added several theorem environments
10052 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10053 couple of minor additions.
10055 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10056 (except for those in footnotes of course)
10058 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10060 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10062 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10063 std::sort and std::lower_bound instead of qsort and handwritten
10065 (struct compara): struct that holds the functors used by std::sort
10066 and std::lower_bound in MathedLookupBOP.
10068 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10070 * src/support/LAssert.h: do not do partial specialization. We do
10071 not really need it.
10073 * src/support/lyxlib.h: note that lyx::getUserName() and
10074 lyx::date() are not in use right now. Should these be suppressed?
10076 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10077 (makeLinuxDocFile): do not put date and user name in linuxdoc
10080 * src/support/lyxlib.h (kill): change first argument to long int,
10081 since that's what solaris uses.
10083 * src/support/kill.C (kill): fix declaration to match prototype.
10085 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10086 actually check whether namespaces are supported. This is not what
10089 * src/support/lyxsum.C: add a using directive.
10091 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10093 * src/support/kill.C: if we have namespace support we don't have
10094 to include lyxlib.h.
10096 * src/support/lyxlib.h: use namespace lyx if supported.
10098 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10100 * src/support/date.C: new file
10102 * src/support/chdir.C: new file
10104 * src/support/getUserName.C: new file
10106 * src/support/getcwd.C: new file
10108 * src/support/abort.C: new file
10110 * src/support/kill.C: new file
10112 * src/support/lyxlib.h: moved all the functions in this file
10113 insede struct lyx. Added also kill and abort to this struct. This
10114 is a way to avoid the "kill is not defined in <csignal>", we make
10115 C++ wrappers for functions that are not ANSI C or ANSI C++.
10117 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10118 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10119 lyx it has been renamed to sum.
10121 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10123 * src/text.C: add using directives for std::min and std::max.
10125 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10127 * src/texrow.C (getIdFromRow): actually return something useful in
10128 id and pos. Hopefully fixes the bug with positionning of errorbox
10131 * src/lyx_main.C (easyParse): output an error and exit if an
10132 incorrect command line option has been given.
10134 * src/spellchecker.C (ispell_check_word): document a memory leak.
10136 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10137 where a "struct utimbuf" is allocated with "new" and deleted with
10140 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10142 * src/text2.C (CutSelection): don't delete double spaces.
10143 (PasteSelection): ditto
10144 (CopySelection): ditto
10146 * src/text.C (Backspace): don't delete double spaces.
10148 * src/lyxlex.C (next): fix a bug that were only present with
10149 conformant std::istream::get to read comment lines, use
10150 std::istream::getline instead. This seems to fix the problem.
10152 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10154 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10155 allowed to insert space before space" editing problem. Please read
10156 commends at the beginning of the function. Comments about usage
10159 * src/text.C (InsertChar): fix for the "not allowed to insert
10160 space before space" editing problem.
10162 * src/text2.C (DeleteEmptyParagraphMechanism): when
10163 IsEmptyTableRow can only return false this last "else if" will
10164 always be a no-op. Commented out.
10166 * src/text.C (RedoParagraph): As far as I can understand tmp
10167 cursor is not really needed.
10169 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10170 present it could only return false anyway.
10171 (several functions): Did something not so smart...added a const
10172 specifier on a lot of methods.
10174 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10175 and add a tmp->text.resize. The LyXParagraph constructor does the
10177 (BreakParagraphConservative): ditto
10179 * src/support/path.h (Path): add a define so that the wrong usage
10180 "Path("/tmp") will be flagged as a compilation error:
10181 "`unnamed_Path' undeclared (first use this function)"
10183 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10185 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10186 which was bogus for several reasons.
10188 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10190 (runBibTeX): ditto.
10192 * autogen.sh: do not use "type -path" (what's that anyway?).
10194 * src/support/filetools.C (findtexfile): remove extraneous space
10195 which caused a kpsewhich warning (at least with kpathsea version
10198 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10200 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10202 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10204 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10206 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10208 * src/paragraph.C (BreakParagraph): do not reserve space on text
10209 if we don't need to (otherwise, if pos_end < pos, we end up
10210 reserving huge amounts of memory due to bad unsigned karma).
10211 (BreakParagraphConservative): ditto, although I have not seen
10212 evidence the bug can happen here.
10214 * src/lyxparagraph.h: add a using std::list.
10216 2000-01-11 Juergen Vigna <jug@sad.it>
10218 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10219 could not be found.
10221 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10223 * src/vc-backend.C (doVCCommand): change to be static and take one
10224 more parameter: the path to chdir too be fore executing the command.
10225 (retrive): new function equiv to "co -r"
10227 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10228 file_not_found_hook is true.
10230 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10232 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10233 if a file is readwrite,readonly...anything else.
10235 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10237 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10238 (CreatePostscript): name change from MenuRunDVIPS (or something)
10239 (PreviewPostscript): name change from MenuPreviewPS
10240 (PreviewDVI): name change from MenuPreviewDVI
10242 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10243 \view_pdf_command., \pdf_to_ps_command
10245 * lib/configure.m4: added search for PDF viewer, and search for
10246 PDF to PS converter.
10247 (lyxrc.defaults output): add \pdflatex_command,
10248 \view_pdf_command and \pdf_to_ps_command.
10250 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10252 * src/bufferlist.C (write): we don't use blocksize for anything so
10255 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10257 * src/support/block.h: disable operator T* (), since it causes
10258 problems with both compilers I tried. See comments in the file.
10260 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10263 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10264 variable LYX_DIR_10x to LYX_DIR_11x.
10266 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10268 * INSTALL: document --with-lyxname.
10271 * configure.in: new configure flag --with-lyxname which allows to
10272 choose the name under which lyx is installed. Default is "lyx", of
10273 course. It used to be possible to do this with --program-suffix,
10274 but the later has in fact a different meaning for autoconf.
10276 * src/support/lstrings.h (lstrchr): reformat a bit.
10278 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10279 * src/mathed/math_defs.h: ditto.
10281 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10283 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10284 true, decides if we create a backup file or not when saving. New
10285 tag and variable \pdf_mode, defaults to false. New tag and
10286 variable \pdflatex_command, defaults to pdflatex. New tag and
10287 variable \view_pdf_command, defaults to xpdf. New tag and variable
10288 \pdf_to_ps_command, defaults to pdf2ps.
10290 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10292 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10293 does not have a BufferView.
10294 (unlockInset): ditto + don't access the_locking_inset if the
10295 buffer does not have a BufferView.
10297 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10298 certain circumstances so that we don't continue a keyboard
10299 operation long after the key was released. Try f.ex. to load a
10300 large document, press PageDown for some seconds and then release
10301 it. Before this change the document would contine to scroll for
10302 some time, with this change it stops imidiatly.
10304 * src/support/block.h: don't allocate more space than needed. As
10305 long as we don't try to write to the arr[x] in a array_type arr[x]
10306 it is perfectly ok. (if you write to it you might segfault).
10307 added operator value_type*() so that is possible to pass the array
10308 to functions expecting a C-pointer.
10310 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10313 * intl/*: updated to gettext 0.10.35, tried to add our own
10314 required modifications. Please verify.
10316 * po/*: updated to gettext 0.10.35, tried to add our own required
10317 modifications. Please verify.
10319 * src/support/lstrings.C (tostr): go at fixing the problem with
10320 cxx and stringstream. When stringstream is used return
10321 oss.str().c_str() so that problems with lyxstring and basic_string
10322 are avoided. Note that the best solution would be for cxx to use
10323 basic_string all the way, but it is not conformant yet. (it seems)
10325 * src/lyx_cb.C + other files: moved several global functions to
10326 class BufferView, some have been moved to BufferView.[Ch] others
10327 are still located in lyx_cb.C. Code changes because of this. (part
10328 of "get rid of current_view project".)
10330 * src/buffer.C + other files: moved several Buffer functions to
10331 class BufferView, the functions are still present in buffer.C.
10332 Code changes because of this.
10334 * config/lcmessage.m4: updated to most recent. used when creating
10337 * config/progtest.m4: updated to most recent. used when creating
10340 * config/gettext.m4: updated to most recent. applied patch for
10343 * config/gettext.m4.patch: new file that shows what changes we
10344 have done to the local copy of gettext.m4.
10346 * config/libtool.m4: new file, used in creation of acinclude.m4
10348 * config/lyxinclude.m4: new file, this is the lyx created m4
10349 macros, used in making acinclude.m4.
10351 * autogen.sh: GNU m4 discovered as a separate task not as part of
10352 the lib/configure creation.
10353 Generate acinlucde from files in config. Actually cat
10354 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10355 easier to upgrade .m4 files that really are external.
10357 * src/Spacing.h: moved using std::istringstream to right after
10358 <sstream>. This should fix the problem seen with some compilers.
10360 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10362 * src/lyx_cb.C: began some work to remove the dependency a lot of
10363 functions have on BufferView::text, even if not really needed.
10364 (GetCurrentTextClass): removed this func, it only hid the
10367 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10368 forgot this in last commit.
10370 * src/Bullet.C (bulletEntry): use static char const *[] for the
10371 tables, becuase of this the return arg had to change to string.
10372 (bulletSize): ditto
10373 (~Bullet): removed unneeded destructor
10375 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10376 (insetSleep): moved from Buffer
10377 (insetWakeup): moved from Buffer
10378 (insetUnlock): moved from Buffer
10380 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10381 from Buffer to BufferView.
10383 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10385 * config/ltmain.sh: updated to version 1.3.4 of libtool
10387 * config/ltconfig: updated to version 1.3.4 of libtool
10389 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10392 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10393 Did I get that right?
10395 * src/lyxlex.h: add a "using" directive or two.
10396 * src/Spacing.h: ditto.
10397 * src/insets/figinset.C: ditto.
10398 * src/support/filetools.C: ditto.
10399 * src/support/lstrings.C: ditto.
10400 * src/BufferView.C: ditto.
10401 * src/bufferlist.C: ditto.
10402 * src/lyx_cb.C: ditto.
10403 * src/lyxlex.C: ditto.
10405 * NEWS: add some changes for 1.1.4.
10407 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10409 * src/BufferView.C: first go at a TextCache to speed up switching
10412 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10414 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10415 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10416 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10417 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10420 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10421 members of the struct are correctly initialized to 0 (detected by
10423 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10424 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10426 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10427 pidwait, since it was allocated with "new". This was potentially
10428 very bad. Thanks to Michael Schmitt for running purify for us.
10431 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10433 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10435 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10437 1999-12-30 Allan Rae <rae@lyx.org>
10439 * lib/templates/IEEEtran.lyx: minor change
10441 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10442 src/mathed/formula.C (LocalDispatch): askForText changes
10444 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10445 know when a user has cancelled input. Fixes annoying problems with
10446 inserting labels and version control.
10448 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10450 * src/support/lstrings.C (tostr): rewritten to use strstream and
10453 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10455 * src/support/filetools.C (IsFileWriteable): use fstream to check
10456 (IsDirWriteable): use fileinfo to check
10458 * src/support/filetools.h (FilePtr): whole class deleted
10460 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10462 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10464 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10466 * src/bufferlist.C (write): use ifstream and ofstream instead of
10469 * src/Spacing.h: use istrstream instead of sscanf
10471 * src/mathed/math_defs.h: change first arg to istream from FILE*
10473 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10475 * src/mathed/math_parser.C: have yyis to be an istream
10476 (LexGetArg): use istream (yyis)
10478 (mathed_parse): ditto
10479 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10481 * src/mathed/formula.C (Read): rewritten to use istream
10483 * src/mathed/formulamacro.C (Read): rewritten to use istream
10485 * src/lyxlex.h (~LyXLex): deleted desturctor
10486 (getStream): new function, returns an istream
10487 (getFile): deleted funtion
10488 (IsOK): return is.good();
10490 * src/lyxlex.C (LyXLex): delete file and owns_file
10491 (setFile): open an filebuf and assign that to a istream instead of
10493 (setStream): new function, takes an istream as arg.
10494 (setFile): deleted function
10495 (EatLine): rewritten us use istream instead of FILE*
10499 * src/table.C (LyXTable): use istream instead of FILE*
10500 (Read): rewritten to take an istream instead of FILE*
10502 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10504 * src/buffer.C (Dispatch): remove an extraneous break statement.
10506 * src/support/filetools.C (QuoteName): change to do simple
10507 'quoting'. More work is necessary. Also changed to do nothing
10508 under emx (needs fix too).
10509 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10511 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10512 config.h.in to the AC_DEFINE_UNQUOTED() call.
10513 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10514 needs char * as argument (because Solaris 7 declares it like
10517 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10518 remove definition of BZERO.
10520 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10522 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10523 defined, "lyxregex.h" if not.
10525 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10527 (REGEX): new variable that is set to regex.c lyxregex.h when
10528 AM_CONDITIONAL USE_REGEX is set.
10529 (libsupport_la_SOURCES): add $(REGEX)
10531 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10534 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10537 * configure.in: add call to LYX_REGEX
10539 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10540 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10542 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10544 * lib/bind/fi_menus.bind: new file, from
10545 pauli.virtanen@saunalahti.fi.
10547 * src/buffer.C (getBibkeyList): pass the parameter delim to
10548 InsetInclude::getKeys and InsetBibtex::getKeys.
10550 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10551 is passed to Buffer::getBibkeyList
10553 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10554 instead of the hardcoded comma.
10556 * src/insets/insetbib.C (getKeys): make sure that there are not
10557 leading blanks in bibtex keys. Normal latex does not care, but
10558 harvard.sty seems to dislike blanks at the beginning of citation
10559 keys. In particular, the retturn value of the function is
10561 * INSTALL: make it clear that libstdc++ is needed and that gcc
10562 2.7.x probably does not work.
10564 * src/support/filetools.C (findtexfile): make debug message go to
10566 * src/insets/insetbib.C (getKeys): ditto
10568 * src/debug.C (showTags): make sure that the output is correctly
10571 * configure.in: add a comment for TWO_COLOR_ICON define.
10573 * acconfig.h: remove all the entries that already defined in
10574 configure.in or acinclude.m4.
10576 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10577 to avoid user name, date and copyright.
10579 1999-12-21 Juergen Vigna <jug@sad.it>
10581 * src/table.C (Read): Now read bogus row format informations
10582 if the format is < 5 so that afterwards the table can
10583 be read by lyx but without any format-info. Fixed the
10584 crash we experienced when not doing this.
10586 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10588 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10589 (RedoDrawingOfParagraph): ditto
10590 (RedoParagraphs): ditto
10591 (RemoveTableRow): ditto
10593 * src/text.C (Fill): rename arg paperwidth -> paper_width
10595 * src/buffer.C (insertLyXFile): rename var filename -> fname
10596 (writeFile): rename arg filename -> fname
10597 (writeFileAscii): ditto
10598 (makeLaTeXFile): ditto
10599 (makeLinuxDocFile): ditto
10600 (makeDocBookFile): ditto
10602 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10605 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10607 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10610 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10611 compiled by a C compiler not C++.
10613 * src/layout.h (LyXTextClass): added typedef for const_iterator
10614 (LyXTextClassList): added typedef for const_iterator + member
10615 functions begin and end.
10617 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10618 iterators to fill the choice_class.
10619 (updateLayoutChoice): rewritten to use iterators to fill the
10620 layoutlist in the toolbar.
10622 * src/BufferView.h (BufferView::work_area_width): removed unused
10625 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10627 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10628 (sgmlCloseTag): ditto
10630 * src/support/lstrings.h: return type of countChar changed to
10633 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10634 what version of this func to use. Also made to return unsigned int.
10636 * configure.in: call LYX_STD_COUNT
10638 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10639 conforming std::count.
10641 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10643 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10644 and a subscript would give bad display (patch from Dekel Tsur
10645 <dekel@math.tau.ac.il>).
10647 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10649 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10652 * src/chset.h: add a few 'using' directives
10654 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10655 triggered when no buffer is active
10657 * src/layout.C: removed `break' after `return' in switch(), since
10660 * src/lyx_main.C (init): make sure LyX can be ran in place even
10661 when libtool has done its magic with shared libraries. Fix the
10662 test for the case when the system directory has not been found.
10664 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10665 name for the latex file.
10666 (MenuMakeHTML): ditto
10668 * src/buffer.h: add an optional boolean argument, which is passed
10669 to ChangeExtension.
10671 1999-12-20 Allan Rae <rae@lyx.org>
10673 * lib/templates/IEEEtran.lyx: small correction and update.
10675 * configure.in: Attempted to use LYX_PATH_HEADER
10677 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10679 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10680 input from JMarc. Now use preprocessor to find the header.
10681 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10682 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10683 LYX_STL_STRING_FWD. See comments in file.
10685 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10687 * The global MiniBuffer * minibuffer variable is dead.
10689 * The global FD_form_main * fd_form_main variable is dead.
10691 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10695 * src/table.h: add the LOstream.h header
10696 * src/debug.h: ditto
10698 * src/LyXAction.h: change the explaination of the ReadOnly
10699 attribute: is indicates that the function _can_ be used.
10701 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10704 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10706 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10712 * src/paragraph.C (GetWord): assert on pos>=0
10715 * src/support/lyxstring.C: condition the use of an invariant on
10717 * src/support/lyxstring.h: ditto
10719 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10720 Use LAssert.h instead of plain assert().
10722 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10724 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10725 * src/support/filetools.C: ditto
10727 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10730 * INSTALL: document the new configure flags
10732 * configure.in: suppress --with-debug; add --enable-assertions
10734 * acinclude.m4: various changes in alignment of help strings.
10736 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10738 * src/kbmap.C: commented out the use of the hash map in kb_map,
10739 beginning of movement to a stl::container.
10741 * several files: removed code that was not in effect when
10742 MOVE_TEXT was defined.
10744 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10745 for escaping should not be used. We can discuss if the string
10746 should be enclosed in f.ex. [] instead of "".
10748 * src/trans_mgr.C (insert): use the new returned value from
10749 encodeString to get deadkeys and keymaps done correctly.
10751 * src/chset.C (encodeString): changed to return a pair, to tell
10752 what to use if we know the string.
10754 * src/lyxscreen.h (fillArc): new function.
10756 * src/FontInfo.C (resize): rewritten to use more std::string like
10757 structore, especially string::replace.
10759 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10762 * configure.in (chmod +x some scripts): remove config/gcc-hack
10764 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10766 * src/buffer.C (writeFile): change once again the top comment in a
10767 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10768 instead of an hardcoded version number.
10769 (makeDocBookFile): ditto
10771 * src/version.h: add new define LYX_DOCVERSION
10773 * po/de.po: update from Pit Sütterlin
10774 * lib/bind/de_menus.bind: ditto.
10776 * src/lyxfunc.C (Dispatch): call MenuExport()
10777 * src/buffer.C (Dispatch): ditto
10779 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10780 LyXFunc::Dispatch().
10781 (MenuExport): new function, moved from
10782 LyXFunc::Dispatch().
10784 * src/trans_mgr.C (insert): small cleanup
10785 * src/chset.C (loadFile): ditto
10787 * lib/kbd/iso8859-1.cdef: add missing backslashes
10789 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10791 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10792 help with placing the manually drawn accents better.
10794 (Draw): x2 and hg changed to float to minimize rounding errors and
10795 help place the accents better.
10797 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10798 unsigned short to char is just wrong...cast the char to unsigned
10799 char instead so that the two values can compare sanely. This
10800 should also make the display of insetlatexaccents better and
10801 perhaps also some other insets.
10803 (lbearing): new function
10806 1999-12-15 Allan Rae <rae@lyx.org>
10808 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10809 header that provides a wrapper around the very annoying SGI STL header
10812 * src/support/lyxstring.C, src/LString.h:
10813 removed old SGI-STL-compatability attempts.
10815 * configure.in: Use LYX_STL_STRING_FWD.
10817 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10818 stl_string_fwd.h is around and try to determine it's location.
10819 Major improvement over previous SGI STL 3.2 compatability.
10820 Three small problems remain with this function due to my zero
10821 knowledge of autoconf. JMarc and lgb see the comments in the code.
10823 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10825 * src/broken_const.h, config/hack-gcc, config/README: removed
10827 * configure.in: remove --with-gcc-hack option; do not call
10830 * INSTALL: remove documentation of --with-broken-const and
10833 * acconfig.h: remove all trace of BROKEN_CONST define
10835 * src/buffer.C (makeDocBookFile): update version number in output
10837 (SimpleDocBookOnePar): fix an assert when trying to a character
10838 access beyond string length
10841 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10843 * po/de.po: fix the Export menu
10845 * lyx.man: update the description of -dbg
10847 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10848 (commandLineHelp): updated
10849 (easyParse): show list of available debug levels if -dbg is passed
10852 * src/Makefile.am: add debug.C
10854 * src/debug.h: moved some code to debug.C
10856 * src/debug.C: new file. Contains code to set and show debug
10859 * src/layout.C: remove 'break' after 'continue' in switch
10860 statements, since these cannot be reached.
10862 1999-12-13 Allan Rae <rae@lyx.org>
10864 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10865 (in_word_set): hash() -> math_hash()
10867 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10869 * acconfig.h: Added a test for whether we are using exceptions in the
10870 current compilation run. If so USING_EXCEPTIONS is defined.
10872 * config.in: Check for existance of stl_string_fwd.h
10873 * src/LString.h: If compiling --with-included-string and SGI's
10874 STL version 3.2 is present (see above test) we need to block their
10875 forward declaration of string and supply a __get_c_string().
10876 However, it turns out this is only necessary if compiling with
10877 exceptions enabled so I've a bit more to add yet.
10879 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10880 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10881 src/support/LRegex.h, src/undo.h:
10882 Shuffle the order of the included files a little to ensure that
10883 LString.h gets included before anything that includes stl_string_fwd.h
10885 * src/support/lyxstring.C: We need to #include LString.h instead of
10886 lyxstring.h to get the necessary definition of __get_c_string.
10887 (__get_c_string): New function. This is defined static just like SGI's
10888 although why they need to do this I'm not sure. Perhaps it should be
10889 in lstrings.C instead.
10891 * lib/templates/IEEEtran.lyx: New template file.
10893 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10895 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10896 * intl/Makefile.in (MKINSTALLDIRS): ditto
10898 * src/LyXAction.C (init): changed to hold the LFUN data in a
10899 automatic array in stead of in callso to newFunc, this speeds up
10900 compilation a lot. Also all the memory used by the array is
10901 returned when the init is completed.
10903 * a lot of files: compiled with -Wold-style-cast, changed most of
10904 the reported offenders to C++ style casts. Did not change the
10905 offenders in C files.
10907 * src/trans.h (Match): change argument type to unsigned int.
10909 * src/support/DebugStream.C: fix some types on the streambufs so
10910 that it works on a conforming implementation.
10912 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10914 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10916 * src/support/lyxstring.C: remove the inline added earlier since
10917 they cause a bunch of unsatisfied symbols when linking with dec
10918 cxx. Cxx likes to have the body of inlines at the place where they
10921 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10922 accessing negative bounds in array. This fixes the crash when
10923 inserting accented characters.
10924 * src/trans.h (Match): ditto
10926 * src/buffer.C (Dispatch): since this is a void, it should not try
10927 to return anything...
10929 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10931 * src/buffer.h: removed the two friends from Buffer. Some changes
10932 because of this. Buffer::getFileName and Buffer::setFileName
10933 renamed to Buffer::fileName() and Buffer::fileName(...).
10935 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10937 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10938 and Buffer::update(short) to BufferView. This move is currently
10939 controlled by a define MOVE_TEXT, this will be removed when all
10940 shows to be ok. This move paves the way for better separation
10941 between buffer contents and buffer view. One side effect is that
10942 the BufferView needs a rebreak when swiching buffers, if we want
10943 to avoid this we can add a cache that holds pointers to LyXText's
10944 that is not currently in use.
10946 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10949 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10951 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10953 * lyx_main.C: new command line option -x (or --execute) and
10954 -e (or --export). Now direct conversion from .lyx to .tex
10955 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10956 Unfortunately, X is still needed and the GUI pops up during the
10959 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10961 * src/Spacing.C: add a using directive to bring stream stuff into
10963 * src/paragraph.C: ditto
10964 * src/buffer.C: ditto
10966 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10967 from Lars' announcement).
10969 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10970 example files from Tino Meinen.
10972 1999-12-06 Allan Rae <rae@lyx.org>
10974 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10976 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10978 * src/support/lyxstring.C: added a lot of inline for no good
10981 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10982 latexWriteEndChanges, they were not used.
10984 * src/layout.h (operator<<): output operator for PageSides
10986 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10988 * some example files: loaded in LyX 1.0.4 and saved again to update
10989 certain constructs (table format)
10991 * a lot of files: did the change to use fstream/iostream for all
10992 writing of files. Done with a close look at Andre Poenitz's patch.
10994 * some files: whitespace changes.
10996 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10998 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10999 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11000 architecture, we provide our own. It is used unconditionnally, but
11001 I do not think this is a performance problem. Thanks to Angus
11002 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11003 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11005 (GetInset): use my_memcpy.
11009 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11010 it is easier to understand, but it uses less TeX-only constructs now.
11012 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11013 elements contain spaces
11015 * lib/configure: regenerated
11017 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11018 elements contain spaces; display the list of programs that are
11021 * autogen.sh: make sure lib/configure is executable
11023 * lib/examples/*: rename the tutorial examples to begin with the
11024 two-letters language code.
11026 * src/lyxfunc.C (getStatus): do not query current font if no
11029 * src/lyx_cb.C (RunScript): use QuoteName
11030 (MenuRunDvips): ditto
11031 (PrintApplyCB): ditto
11033 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11034 around argument, so that it works well with the current shell.
11035 Does not work properly with OS/2 shells currently.
11037 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11038 * src/LyXSendto.C (SendtoApplyCB): ditto
11039 * src/lyxfunc.C (Dispatch): ditto
11040 * src/buffer.C (runLaTeX): ditto
11041 (runLiterate): ditto
11042 (buildProgram): ditto
11044 * src/lyx_cb.C (RunScript): ditto
11045 (MenuMakeLaTeX): ditto
11047 * src/buffer.h (getLatexName): new method
11049 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11051 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11053 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11054 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11055 (create_math_panel): ditto
11057 * src/lyxfunc.C (getStatus): re-activate the code which gets
11058 current font and cursor; add test for export to html.
11060 * src/lyxrc.C (read): remove unreachable break statements; add a
11063 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11065 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11067 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11068 introduced by faulty regex.
11069 * src/buffer.C: ditto
11070 * src/lastfiles.C: ditto
11071 * src/paragraph.C: ditto
11072 * src/table.C: ditto
11073 * src/vspace.C: ditto
11074 * src/insets/figinset.C: ditto
11075 Note: most of these is absolutely harmless, except the one in
11076 src/mathed formula.C.
11078 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11080 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11081 operation, yielding correct results for the reLyX command.
11083 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11085 * src/support/filetools.C (ExpandPath): removed an over eager
11087 (ReplaceEnvironmentPath): ditto
11089 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11090 shows that we are doing something fishy in our code...
11091 (BubblePost): ditto
11094 * src/lyxrc.C (read): use a double switch trick to get more help
11095 from the compiler. (the same trick is used in layout.C)
11096 (write): new function. opens a ofstream and pass that to output
11097 (output): new function, takes a ostream and writes the lyxrc
11098 elemts to it. uses a dummy switch to make sure no elements are
11101 * src/lyxlex.h: added a struct pushpophelper for use in functions
11102 with more than one exit point.
11104 * src/lyxlex.[Ch] (GetInteger): made it const
11108 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11110 * src/layout.[hC] : LayoutTags splitted into several enums, new
11111 methods created, better error handling cleaner use of lyxlex. Read
11114 * src/bmtable.[Ch]: change some member prototypes because of the
11115 image const changes.
11117 * commandtags.h, src/LyXAction.C (init): new function:
11118 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11119 This file is not read automatically but you can add \input
11120 preferences to your lyxrc if you want to. We need to discuss how
11123 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11124 in .aux, also remove .bib and .bst files from dependencies when
11127 * src/BufferView.C, src/LyXView.C: add const_cast several places
11128 because of changes to images.
11130 * lib/images/*: same change as for images/*
11132 * lib/lyxrc.example: Default for accept_compound is false not no.
11134 * images/*: changed to be const, however I have som misgivings
11135 about this change so it might be changed back.
11137 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11139 * lib/configure, po/POTFILES.in: regenerated
11141 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11143 * config/lib_configure.m4: removed
11145 * lib/configure.m4: new file (was config/lib_configure.m4)
11147 * configure.in: do not test for rtti, since we do not use it.
11149 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11151 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11152 doubling of allocated space scheme. This makes it faster for large
11153 strings end to use less memory for small strings. xtra rememoved.
11155 * src/insets/figinset.C (waitalarm): commented out.
11156 (GhostscriptMsg): use static_cast
11157 (GhostscriptMsg): use new instead of malloc to allocate memory for
11158 cmap. also delete the memory after use.
11160 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11162 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11163 for changes in bibtex database or style.
11164 (runBibTeX): remove all .bib and .bst files from dep before we
11166 (run): use scanAuc in when dep file already exist.
11168 * src/DepTable.C (remove_files_with_extension): new method
11169 (exist): new method
11171 * src/DepTable.[Ch]: made many of the methods const.
11173 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11175 * src/bufferparams.C: make sure that the default textclass is
11176 "article". It used to be the first one by description order, but
11177 now the first one is "docbook".
11179 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11180 string; call Debug::value.
11181 (easyParse): pass complete argument to setDebuggingLevel().
11183 * src/debug.h (value): fix the code that parses debug levels.
11185 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11188 * src/LyXAction.C: use Debug::ACTION as debug channel.
11190 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11192 * NEWS: updated for the future 1.1.3 release.
11194 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11195 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11196 it should. This is of course a controversial change (since many
11197 people will find that their lyx workscreen is suddenly full of
11198 red), but done for the sake of correctness.
11200 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11201 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11203 * src/insets/inseterror.h, src/insets/inseturl.h,
11204 src/insets/insetinfo.h, src/insets/figinset.h,
11205 src/mathed/formulamacro.h, src/mathed/math_macro.h
11206 (EditMessage): add a missing const and add _() to make sure that
11207 translation happens
11209 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11210 src/insets/insetbib.C, src/support/filetools.C: add `using'
11211 directives for cxx.
11213 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11214 doing 'Insert index of last word' at the beginning of a paragraph.
11216 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11218 * several files: white-space changes.
11220 * src/mathed/formula.C: removed IsAlpha and IsDigit
11222 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11223 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11226 * src/insets/figinset.C (GetPSSizes): don't break when
11227 "EndComments" is seen. But break when a boundingbox is read.
11229 * all classes inherited from Inset: return value of Clone
11230 changed back to Inset *.
11232 * all classes inherited form MathInset: return value of Clone
11233 changed back to MathedInset *.
11235 * src/insets/figinset.C (runqueue): use a ofstream to output the
11236 gs/ps file. Might need some setpresicion or setw. However I can
11237 see no problem with the current code.
11238 (runqueue): use sleep instead of the alarm/signal code. I just
11239 can't see the difference.
11241 * src/paragraph.C (LyXParagraph): reserve space in the new
11242 paragraph and resize the inserted paragraph to just fit.
11244 * src/lyxfunc.h (operator|=): added operator for func_status.
11246 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11247 check for readable file.
11249 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11250 check for readable file.
11251 (MenuMakeLinuxDoc): ditto
11252 (MenuMakeDocBook): ditto
11253 (MenuMakeAscii): ditto
11254 (InsertAsciiFile): split the test for openable and readable
11256 * src/bmtable.C (draw_bitmaptable): use
11257 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11259 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11260 findtexfile from LaTeX to filetools.
11262 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11263 instead of FilePtr. Needs to be verified by a literate user.
11265 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11267 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11268 (EditMessage): likewise.
11270 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11271 respectively as \textasciitilde and \textasciicircum.
11273 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11275 * src/support/lyxstring.h: made the methods that take iterators
11276 use const_iterator.
11278 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11279 (regexMatch): made is use the real regex class.
11281 * src/support/Makefile.am: changed to use libtool
11283 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11285 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11287 (MathIsInset ++): changed several macros to be inline functions
11290 * src/mathed/Makefile.am: changed to use libtool
11292 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11294 * src/insets/inset* : Clone changed to const and return type is
11295 the true insettype not just Inset*.
11297 * src/insets/Makefile.am: changed to use libtool
11299 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11301 * src/undo.[Ch] : added empty() and changed some of the method
11304 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11306 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11307 setID use block<> for the bullets array, added const several places.
11309 * src/lyxfunc.C (getStatus): new function
11311 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11312 LyXAction, added const to several funtions.
11314 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11315 a std::map, and to store the dir items in a vector.
11317 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11320 * src/LyXView.[Ch] + other files : changed currentView to view.
11322 * src/LyXAction.[Ch] : ported from the old devel branch.
11324 * src/.cvsignore: added .libs and a.out
11326 * configure.in : changes to use libtool.
11328 * acinclude.m4 : inserted libtool.m4
11330 * .cvsignore: added libtool
11332 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11334 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11335 file name in insets and mathed directories (otherwise the
11336 dependency is not taken in account under cygwin).
11338 * src/text2.C (InsertString[AB]): make sure that we do not try to
11339 read characters past the string length.
11341 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11343 * lib/doc/LaTeXConfig.lyx.in,
11344 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11346 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11347 file saying who created them and when this heppened; this is
11348 useless and annoys tools like cvs.
11350 * lib/layouts/g-brief-{en,de}.layout,
11351 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11352 from Thomas Hartkens <thomas@hartkens.de>.
11354 * src/{insets,mathed}/Makefile.am: do not declare an empty
11355 LDFLAGS, so that it can be set at configure time (useful on Irix
11358 * lib/reLyX/configure.in: make sure that the prefix is set
11359 correctly in LYX_DIR.
11361 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11363 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11364 be used by 'command-sequence' this allows to bind a key to a
11365 sequence of LyX-commands
11366 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11368 * src/LyXAction.C: add "command-sequence"
11370 * src/LyXFunction.C: handling of "command-sequence"
11372 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11373 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11375 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11377 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11379 * src/buffer.C (writeFile): Do not output a comment giving user
11380 and date at the beginning of a .lyx file. This is useless and
11381 annoys cvs anyway; update version number to 1.1.
11383 * src/Makefile.am (LYX_DIR): add this definition, so that a
11384 default path is hardcoded in LyX.
11386 * configure.in: Use LYX_GNU_GETTEXT.
11388 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11389 AM_GNU_GETTEXT with a bug fixed.
11391 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11393 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11395 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11396 which is used to point to LyX data is now LYX_DIR_11x.
11398 * lyx.man: convert to a unix text file; small updates.
11400 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11402 * src/support/LSubstring.[Ch]: made the second arg of most of the
11403 constructors be a const reference.
11405 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11408 * src/support/lyxstring.[Ch] (swap): added missing member function
11409 and specialization of swap(str, str);
11411 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11413 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11414 trace of the old one.
11416 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11417 put the member definitions in undo.C.
11419 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11420 NEW_TEXT and have now only code that was included when this was
11423 * src/intl.C (LCombo): use static_cast
11425 (DispatchCallback): ditto
11427 * src/definitions.h: removed whole file
11429 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11431 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11432 parsing and stores in a std:map. a regex defines the file format.
11433 removed unneeded members.
11435 * src/bufferparams.h: added several enums from definitions.h here.
11436 Removed unsused destructor. Changed some types to use proper enum
11437 types. use block to have the temp_bullets and user_defined_bullets
11438 and to make the whole class assignable.
11440 * src/bufferparams.C (Copy): removed this functions, use a default
11441 assignment instead.
11443 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11446 * src/buffer.C (readLyXformat2): commend out all that have with
11447 oldpapersize to do. also comment out all that hve to do with
11448 insetlatex and insetlatexdel.
11449 (setOldPaperStuff): commented out
11451 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11453 * src/LyXAction.C: remove use of inset-latex-insert
11455 * src/mathed/math_panel.C (button_cb): use static_cast
11457 * src/insets/Makefile.am (insets_o_SOURCES): removed
11460 * src/support/lyxstring.C (helper): use the unsigned long
11461 specifier, UL, instead of a static_cast.
11463 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11465 * src/support/block.h: new file. to be used as a c-style array in
11466 classes, so that the class can be assignable.
11468 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11470 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11471 NULL, make sure to return an empty string (it is not possible to
11472 set a string to NULL).
11474 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11476 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11478 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11480 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11481 link line, so that Irix users (for example) can set it explicitely to
11484 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11485 it can be overidden at make time (static or dynamic link, for
11488 * src/vc-backend.C, src/LaTeXFeatures.h,
11489 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11490 statements to bring templates to global namespace.
11492 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11494 * src/support/lyxstring.C (operator[] const): make it standard
11497 * src/minibuffer.C (Init): changed to reflect that more
11498 information is given from the lyxvc and need not be provided here.
11500 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11502 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11504 * src/LyXView.C (UpdateTimerCB): use static_cast
11505 (KeyPressMask_raw_callback): ditto
11507 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11508 buffer_, a lot of changes because of this. currentBuffer() ->
11509 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11510 also changes to other files because of this.
11512 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11514 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11515 have no support for RCS and partial support for CVS, will be
11518 * src/insets/ several files: changes because of function name
11519 changes in Bufferview and LyXView.
11521 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11523 * src/support/LSubstring.[Ch]: new files. These implement a
11524 Substring that can be very convenient to use. i.e. is this
11526 string a = "Mary had a little sheep";
11527 Substring(a, "sheep") = "lamb";
11528 a is now "Mary has a little lamb".
11530 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11531 out patterns and subpatterns of strings. It is used by LSubstring
11532 and also by vc-backend.C
11534 * src/support/lyxstring.C: went over all the assertions used and
11535 tried to correct the wrong ones and flag which of them is required
11536 by the standard. some bugs found because of this. Also removed a
11537 couple of assertions.
11539 * src/support/Makefile.am (libsupport_a_SOURCES): added
11540 LSubstring.[Ch] and LRegex.[Ch]
11542 * src/support/FileInfo.h: have struct stat buf as an object and
11543 not a pointer to one, some changes because of this.
11545 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11546 information in layout when adding the layouts preamble to the
11547 textclass preamble.
11549 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11552 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11553 because of bug in OS/2.
11555 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11557 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11558 \verbatim@font instead of \ttfamily, so that it can be redefined.
11560 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11561 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11562 src/layout.h, src/text2.C: add 'using' directive to bring the
11563 STL templates we need from the std:: namespace to the global one.
11564 Needed by DEC cxx in strict ansi mode.
11566 * src/support/LIstream.h,src/support/LOstream.h,
11567 src/support/lyxstring.h,src/table.h,
11568 src/lyxlookup.h: do not include <config.h> in header
11569 files. This should be done in the .C files only.
11571 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11575 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11577 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11578 from Kayvan to fix the tth invokation.
11580 * development/lyx.spec.in: updates from Kayvan to reflect the
11581 changes of file names.
11583 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11585 * src/text2.C (InsertStringB): use std::copy
11586 (InsertStringA): use std::copy
11588 * src/bufferlist.C: use a vector to store the buffers in. This is
11589 an internal change and should not affect any other thing.
11591 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11594 * src/text.C (Fill): fix potential bug, one off bug.
11596 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11598 * src/Makefile.am (lyx_main.o): add more files it depends on.
11600 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11602 * src/support/lyxstring.C: use size_t for the reference count,
11603 size, reserved memory and xtra.
11604 (internal_compare): new private member function. Now the compare
11605 functions should work for std::strings that have embedded '\0'
11607 (compare): all compare functions rewritten to use
11610 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11612 * src/support/lyxstring.C (compare): pass c_str()
11613 (compare): pass c_str
11614 (compare): pass c_str
11616 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11618 * src/support/DebugStream.C: <config.h> was not included correctly.
11620 * lib/configure: forgot to re-generate it :( I'll make this file
11621 auto generated soon.
11623 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11625 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11628 * src/support/lyxstring.C: some changes from length() to rep->sz.
11629 avoids a function call.
11631 * src/support/filetools.C (SpaceLess): yet another version of the
11632 algorithm...now per Jean-Marc's suggestions.
11634 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11636 * src/layout.C (less_textclass_desc): functor for use in sorting
11638 (LyXTextClass::Read): sort the textclasses after reading.
11640 * src/support/filetools.C (SpaceLess): new version of the
11641 SpaceLess functions. What problems does this one give? Please
11644 * images/banner_bw.xbm: made the arrays unsigned char *
11646 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11648 * src/support/lyxstring.C (find): remove bogus assertion in the
11649 two versions of find where this has not been done yet.
11651 * src/support/lyxlib.h: add missing int return type to
11654 * src/menus.C (ShowFileMenu): disable exporting to html if no
11655 html export command is present.
11657 * config/lib_configure.m4: add a test for an HTML converter. The
11658 programs checked for are, in this order: tth, latex2html and
11661 * lib/configure: generated from config/lib_configure.m4.
11663 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11664 html converter. The parameters are now passed through $$FName and
11665 $$OutName, instead of standard input/output.
11667 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11669 * lib/lyxrc.example: update description of \html_command.
11670 add "quotes" around \screen_font_xxx font setting examples to help
11671 people who use fonts with spaces in their names.
11673 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11675 * Distribution files: updates for v1.1.2
11677 * src/support/lyxstring.C (find): remove bogus assert and return
11678 npos for the same condition.
11680 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11682 * added patch for OS/2 from SMiyata.
11684 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11686 * src/text2.C (CutSelection): make space_wrapped a bool
11687 (CutSelection): dont declare int i until we have to.
11688 (alphaCounter): return a char const *.
11690 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11692 * src/support/syscall.C (Systemcalls::kill):
11693 src/support/filetools.C (PutEnv, PutEnvPath):
11694 src/lyx_cb.C (addNewlineAndDepth):
11695 src/FontInfo.C (FontInfo::resize): condition some #warning
11696 directives with WITH_WARNINGS.
11699 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11701 * src/layout.[Ch] + several files: access to class variables
11702 limited and made accessor functions instead a lot of code changed
11703 becuase of this. Also instead of returning pointers often a const
11704 reference is returned instead.
11706 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11708 * src/Makefile.am (dist-hook): added used to remove the CVS from
11709 cheaders upon creating a dist
11710 (EXTRA_DIST): added cheaders
11712 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11713 a character not as a small integer.
11715 * src/support/lyxstring.C (find): removed Assert and added i >=
11716 rep->sz to the first if.
11718 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11720 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11721 src/LyXView.C src/buffer.C src/bufferparams.C
11722 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11723 src/text2.C src/insets/insetinclude.C:
11724 lyxlayout renamed to textclasslist.
11726 * src/layout.C: some lyxerr changes.
11728 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11729 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11730 (LyXLayoutList): removed all traces of this class.
11731 (LyXTextClass::Read): rewrote LT_STYLE
11732 (LyXTextClass::hasLayout): new function
11733 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11734 both const and nonconst version.
11735 (LyXTextClass::delete_layout): new function.
11736 (LyXTextClassList::Style): bug fix. do the right thing if layout
11738 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11739 (LyXTextClassList::NameOfLayout): ditto
11740 (LyXTextClassList::Load): ditto
11742 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11744 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11746 * src/LyXAction.C (LookupFunc): added a workaround for sun
11747 compiler, on the other hand...we don't know if the current code
11748 compiles on sun at all...
11750 * src/support/filetools.C (CleanupPath): subst fix
11752 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11755 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11756 complained about this one?
11758 * src/insets/insetinclude.C (Latex): subst fix
11760 * src/insets/insetbib.C (getKeys): subst fix
11762 * src/LyXSendto.C (SendtoApplyCB): subst fix
11764 * src/lyx_main.C (init): subst fix
11766 * src/layout.C (Read): subst fix
11768 * src/lyx_sendfax_main.C (button_send): subst fix
11770 * src/buffer.C (RoffAsciiTable): subst fix
11772 * src/lyx_cb.C (MenuFax): subst fix
11773 (PrintApplyCB): subst fix
11775 1999-10-26 Juergen Vigna <jug@sad.it>
11777 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11779 (Read): Cleaned up this code so now we read only format vestion >= 5
11781 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11783 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11784 come nobody has complained about this one?
11786 * src/insets/insetinclude.C (Latex): subst fix
11788 * src/insets/insetbib.C (getKeys): subst fix
11790 * src/lyx_main.C (init): subst fix
11792 * src/layout.C (Read): subst fix
11794 * src/buffer.C (RoffAsciiTable): subst fix
11796 * src/lyx_cb.C (MenuFax): subst fix.
11798 * src/layout.[hC] + some other files: rewrote to use
11799 std::container to store textclasses and layouts in.
11800 Simplified, removed a lot of code. Make all classes
11801 assignable. Further simplifications and review of type
11802 use still to be one.
11804 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11805 lastfiles to create the lastfiles partr of the menu.
11807 * src/lastfiles.[Ch]: rewritten to use deque to store the
11808 lastfiles in. Uses fstream for reading and writing. Simplifies
11811 * src/support/syscall.C: remove explicit cast.
11813 * src/BufferView.C (CursorToggleCB): removed code snippets that
11814 were commented out.
11815 use explicat C++ style casts instead of C style casts. also use
11816 u_vdata instea of passing pointers in longs.
11818 * src/PaperLayout.C: removed code snippets that were commented out.
11820 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11822 * src/lyx_main.C: removed code snippets that wer commented out.
11824 * src/paragraph.C: removed code snippets that were commented out.
11826 * src/lyxvc.C (logClose): use static_cast
11828 (viewLog): remove explicit cast to void*
11829 (showLog): removed old commented code
11831 * src/menus.C: use static_cast instead of C style casts. use
11832 u_vdata instead of u_ldata. remove explicit cast to (long) for
11833 pointers. Removed old code that was commented out.
11835 * src/insets/inset.C: removed old commented func
11837 * src/insets/insetref.C (InsetRef): removed old code that had been
11838 commented out for a long time.
11840 (escape): removed C style cast
11842 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11844 * src/insets/insetlatex.C (Draw): removed old commented code
11845 (Read): rewritten to use string
11847 * src/insets/insetlabel.C (escape): removed C style cast
11849 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11851 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11852 old commented code.
11854 * src/insets/insetinclude.h: removed a couple of stupid bools
11856 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11857 (Clone): remove C style cast
11858 (getKeys): changed list to lst because of std::list
11860 * src/insets/inseterror.C (Draw): removed som old commented code.
11862 * src/insets/insetcommand.C (Draw): removed some old commented code.
11864 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11865 commented out forever.
11866 (bibitem_cb): use static_cast instead of C style cast
11867 use of vdata changed to u_vdata.
11869 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11871 (CloseUrlCB): use static_cast instead of C style cast.
11872 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11874 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11875 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11876 (CloseInfoCB): static_cast from ob->u_vdata instead.
11877 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11880 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11881 (C_InsetError_CloseErrorCB): forward the ob parameter
11882 (CloseErrorCB): static_cast from ob->u_vdata instead.
11884 * src/vspace.h: include LString.h since we use string in this class.
11886 * src/vspace.C (lyx_advance): changed name from advance because of
11887 nameclash with stl. And since we cannot use namespaces yet...I
11888 used a lyx_ prefix instead. Expect this to change when we begin
11891 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11893 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11894 and removed now defunct constructor and deconstructor.
11896 * src/BufferView.h: have backstack as a object not as a pointer.
11897 removed initialization from constructor. added include for BackStack
11899 * development/lyx.spec.in (%build): add CFLAGS also.
11901 * src/screen.C (drawFrame): removed another warning.
11903 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11905 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11906 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11907 README and ANNOUNCE a bit for the next release. More work is
11910 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11911 unbreakable if we are in freespacing mode (LyX-Code), but not in
11914 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11916 * src/BackStack.h: fixed initialization order in constructor
11918 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11920 * acinclude.m4 (VERSION): new rules for when a version is
11921 development, added also a variable for prerelease.
11922 (warnings): we set with_warnings=yes for prereleases
11923 (lyx_opt): prereleases compile with same optimization as development
11924 (CXXFLAGS): only use pedantic if we are a development version
11926 * src/BufferView.C (restorePosition): don't do anything if the
11927 backstack is empty.
11929 * src/BackStack.h: added member empty, use this to test if there
11930 is anything to pop...
11932 1999-10-25 Juergen Vigna <jug@sad.it>
11935 * forms/layout_forms.fd +
11936 * forms/latexoptions.fd +
11937 * lyx.fd: changed for various form resize issues
11939 * src/mathed/math_panel.C +
11940 * src/insets/inseterror.C +
11941 * src/insets/insetinfo.C +
11942 * src/insets/inseturl.C +
11943 * src/insets/inseturl.h +
11945 * src/LyXSendto.C +
11946 * src/PaperLayout.C +
11947 * src/ParagraphExtra.C +
11948 * src/TableLayout.C +
11950 * src/layout_forms.C +
11957 * src/menus.C: fixed various resize issues. So now forms can be
11958 resized savely or not be resized at all.
11960 * forms/form_url.fd +
11961 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11964 * src/insets/Makefile.am: added files form_url.[Ch]
11966 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11968 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11969 (and presumably 6.2).
11971 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11972 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11973 remaining static member callbacks.
11975 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11978 * src/support/lyxstring.h: declare struct Srep as friend of
11979 lyxstring, since DEC cxx complains otherwise.
11981 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11983 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11985 * src/LaTeX.C (run): made run_bibtex also depend on files with
11987 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11988 are put into the dependency file.
11990 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11991 the code has shown itself to work
11992 (create_ispell_pipe): removed another warning, added a comment
11995 * src/minibuffer.C (ExecutingCB): removed code that has been
11996 commented out a long time
11998 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11999 out code + a warning.
12001 * src/support/lyxstring.h: comment out the three private
12002 operators, when compiling with string ansi conforming compilers
12003 they make problems.
12005 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12007 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12008 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12011 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12014 * src/mathed/math_panel.C (create_math_panel): remove explicit
12017 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12020 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12021 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12022 to XCreatePixmapFromBitmapData
12023 (fl_set_bmtable_data): change the last argument to be unsigned
12025 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12026 and bh to be unsigned int, remove explicit casts in call to
12027 XReadBitmapFileData.
12029 * images/arrows.xbm: made the arrays unsigned char *
12030 * images/varsz.xbm: ditto
12031 * images/misc.xbm: ditto
12032 * images/greek.xbm: ditto
12033 * images/dots.xbm: ditto
12034 * images/brel.xbm: ditto
12035 * images/bop.xbm: ditto
12037 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12039 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12040 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12041 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12043 (LYX_CXX_CHEADERS): added <clocale> to the test.
12045 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12047 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12049 * src/support/lyxstring.C (append): fixed something that must be a
12050 bug, rep->assign was used instead of rep->append.
12052 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12055 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12056 lyx insert double chars. Fix spotted by Kayvan.
12058 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12060 * Fixed the tth support. I messed up with the Emacs patch apply feature
12061 and omitted the changes in lyxrc.C.
12063 1999-10-22 Juergen Vigna <jug@sad.it>
12065 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12067 * src/lyx_cb.C (MenuInsertRef) +
12068 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12069 the form cannot be resized under it limits (fixes a segfault)
12071 * src/lyx.C (create_form_form_ref) +
12072 * forms/lyx.fd: Changed Gravity on name input field so that it is
12075 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12077 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12078 <ostream> and <istream>.
12080 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12081 whether <fstream> provides the latest standard features, or if we
12082 have an oldstyle library (like in egcs).
12083 (LYX_CXX_STL_STRING): fix the test.
12085 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12086 code on MODERN_STL_STREAM.
12088 * src/support/lyxstring.h: use L{I,O}stream.h.
12090 * src/support/L{I,O}stream.h: new files, designed to setup
12091 correctly streams for our use
12092 - includes the right header depending on STL capabilities
12093 - puts std::ostream and std::endl (for LOStream.h) or
12094 std::istream (LIStream.h) in toplevel namespace.
12096 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12098 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12099 was a bib file that had been changed we ensure that bibtex is run.
12100 (runBibTeX): enhanced to extract the names of the bib files and
12101 getting their absolute path and enter them into the dep file.
12102 (findtexfile): static func that is used to look for tex-files,
12103 checks for absolute patchs and tries also with kpsewhich.
12104 Alternative ways of finding the correct files are wanted. Will
12106 (do_popen): function that runs a command using popen and returns
12107 the whole output of that command in a string. Should be moved to
12110 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12111 file with extension ext has changed.
12113 * src/insets/figinset.C: added ifdef guards around the fl_free
12114 code that jug commented out. Now it is commented out when
12115 compiling with XForms == 0.89.
12117 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12118 to lyxstring.C, and only keep a forward declaration in
12119 lyxstring.h. Simplifies the header file a bit and should help a
12120 bit on compile time too. Also changes to Srep will not mandate a
12121 recompile of code just using string.
12122 (~lyxstring): definition moved here since it uses srep.
12123 (size): definition moved here since it uses srep.
12125 * src/support/lyxstring.h: removed a couple of "inline" that should
12128 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12130 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12133 1999-10-21 Juergen Vigna <jug@sad.it>
12135 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12136 set to left if I just remove the width entry (or it is empty).
12138 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12139 paragraph when having dummy paragraphs.
12141 1999-10-20 Juergen Vigna <jug@sad.it>
12143 * src/insets/figinset.C: just commented some fl_free_form calls
12144 and added warnings so that this calls should be activated later
12145 again. This avoids for now a segfault, but we have a memory leak!
12147 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12148 'const char * argument' to 'string argument', this should
12149 fix some Asserts() in lyxstring.C.
12151 * src/lyxfunc.h: Removed the function argAsString(const char *)
12152 as it is not used anymore.
12154 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12156 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12159 * src/Literate.h: some funcs moved from public to private to make
12160 interface clearer. Unneeded args removed.
12162 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12164 (scanBuildLogFile): ditto
12166 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12167 normal TeX Error. Still room for improvement.
12169 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12171 * src/buffer.C (insertErrors): changes to make the error
12172 desctription show properly.
12174 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12177 * src/support/lyxstring.C (helper): changed to use
12178 sizeof(object->rep->ref).
12179 (operator>>): changed to use a pointer instead.
12181 * src/support/lyxstring.h: changed const reference & to value_type
12182 const & lets see if that helps.
12184 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12186 * Makefile.am (rpmdist): fixed to have non static package and
12189 * src/support/lyxstring.C: removed the compilation guards
12191 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12194 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12195 conditional compile of lyxstring.Ch
12197 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12198 stupid check, but it is a lot better than the bastring hack.
12199 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12201 * several files: changed string::erase into string::clear. Not
12204 * src/chset.C (encodeString): use a char temporary instead
12206 * src/table.C (TexEndOfCell): added tostr around
12207 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12208 (TexEndOfCell): ditto
12209 (TexEndOfCell): ditto
12210 (TexEndOfCell): ditto
12211 (DocBookEndOfCell): ditto
12212 (DocBookEndOfCell): ditto
12213 (DocBookEndOfCell): ditto
12214 (DocBookEndOfCell): ditto
12216 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12218 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12220 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12221 (MenuBuildProg): added tostr around ret
12222 (MenuRunChktex): added tostr around ret
12223 (DocumentApplyCB): added tostr around ret
12225 * src/chset.C (encodeString): added tostr around t->ic
12227 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12228 (makeLaTeXFile): added tostr around tocdepth
12229 (makeLaTeXFile): added tostr around ftcound - 1
12231 * src/insets/insetbib.C (setCounter): added tostr around counter.
12233 * src/support/lyxstring.h: added an operator+=(int) to catch more
12236 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12237 (lyxstring): We DON'T allow NULL pointers.
12239 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12241 * src/mathed/math_macro.C (MathMacroArgument::Write,
12242 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12243 when writing them out.
12245 * src/LString.C: remove, since it is not used anymore.
12247 * src/support/lyxstring.C: condition the content to
12248 USE_INCLUDED_STRING macro.
12250 * src/mathed/math_symbols.C, src/support/lstrings.C,
12251 src/support/lyxstring.C: add `using' directive to specify what
12252 we need in <algorithm>. I do not think that we need to
12253 conditionalize this, but any thought is appreciated.
12255 * many files: change all callback functions to "C" linkage
12256 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12257 strict_ansi. Those who were static are now global.
12258 The case of callbacks which are static class members is
12259 trickier, since we have to make C wrappers around them (see
12260 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12261 did not finish this yet, since it defeats the purpose of
12262 encapsulation, and I am not sure what the best route is.
12264 1999-10-19 Juergen Vigna <jug@sad.it>
12266 * src/support/lyxstring.C (lyxstring): we permit to have a null
12267 pointer as assignment value and just don't assign it.
12269 * src/vspace.C (nextToken): corrected this function substituting
12270 find_first(_not)_of with find_last_of.
12272 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12273 (TableOptCloseCB) (TableSpeCloseCB):
12274 inserted fl_set_focus call for problem with fl_hide_form() in
12277 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12279 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12282 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12284 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12285 LyXLex::next() and not eatline() to get its argument.
12287 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12289 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12290 instead, use fstreams for io of the depfile, removed unneeded
12291 functions and variables.
12293 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12294 vector instead, removed all functions and variables that is not in
12297 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12299 * src/buffer.C (insertErrors): use new interface to TeXError
12301 * Makefile.am (rpmdist): added a rpmdist target
12303 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12304 per Kayvan's instructions.
12306 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12308 * src/Makefile.am: add a definition for localedir, so that locales
12309 are found after installation (Kayvan)
12311 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12313 * development/.cvsignore: new file.
12315 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12317 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12318 C++ compiler provides wrappers for C headers and use our alternate
12321 * configure.in: use LYX_CXX_CHEADERS.
12323 * src/cheader/: new directory, populated with cname headers from
12324 libstdc++-2.8.1. They are a bit old, but probably good enough for
12325 what we want (support compilers who lack them).
12327 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12328 from includes. It turns out is was stupid.
12330 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12332 * lib/Makefile.am (install-data-local): forgot a ';'
12333 (install-data-local): forgot a '\'
12334 (libinstalldirs): needed after all. reintroduced.
12336 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12338 * configure.in (AC_OUTPUT): added lyx.spec
12340 * development/lyx.spec: removed file
12342 * development/lyx.spec.in: new file
12344 * po/*.po: merged with lyx.pot becuase of make distcheck
12346 * lib/Makefile.am (dist-hook): added dist-hook so that
12347 documentation files will be included when doing a make
12348 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12349 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12351 more: tried to make install do the right thing, exclude CVS dirs
12354 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12355 Path would fit in more nicely.
12357 * all files that used to use pathstack: uses now Path instead.
12358 This change was a lot easier than expected.
12360 * src/support/path.h: new file
12362 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12364 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12366 * src/support/lyxstring.C (getline): Default arg was given for
12369 * Configure.cmd: removed file
12371 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12373 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12374 streams classes and types, add the proper 'using' statements when
12375 MODERN_STL is defined.
12377 * src/debug.h: move the << operator definition after the inclusion
12380 * src/support/filetools.C: include "LAssert.h", which is needed
12383 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12386 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12387 include "debug.h" to define a proper ostream.
12389 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12391 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12392 method to the SystemCall class which can kill a process, but it's
12393 not fully implemented yet.
12395 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12397 * src/support/FileInfo.h: Better documentation
12399 * src/lyxfunc.C: Added support for buffer-export html
12401 * src/menus.C: Added Export->As HTML...
12403 * lib/bind/*.bind: Added short-cut for buffer-export html
12405 * src/lyxrc.*: Added support for new \tth_command
12407 * lib/lyxrc.example: Added stuff for new \tth_command
12409 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12411 * lib/Makefile.am (IMAGES): removed images/README
12412 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12413 installes in correct place. Check permisions is installed
12416 * src/LaTeX.C: some no-op changes moved declaration of some
12419 * src/LaTeX.h (LATEX_H): changed include guard name
12421 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12423 * lib/reLyX/Makefile.am: install noweb2lyx.
12425 * lib/Makefile.am: install configure.
12427 * lib/reLyX/configure.in: declare a config aux dir; set package
12428 name to lyx (not sure what the best solution is); generate noweb2lyx.
12430 * lib/layouts/egs.layout: fix the bibliography layout.
12432 1999-10-08 Jürgen Vigna <jug@sad.it>
12434 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12435 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12436 it returned without continuing to search the path.
12438 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12440 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12441 also fixes a bug. It is not allowed to do tricks with std::strings
12442 like: string a("hei"); &a[e]; this will not give what you
12443 think... Any reason for the complexity in this func?
12445 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12447 * Updated README and INSTALL a bit, mostly to check that my
12448 CVS rights are correctly set up.
12450 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12452 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12453 does not allow '\0' chars but lyxstring and std::string does.
12455 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12457 * autogen.sh (AUTOCONF): let the autogen script create the
12458 POTFILES.in file too. POTFILES.in should perhaps now not be
12459 included in the cvs module.
12461 * some more files changed to use C++ includes instead of C ones.
12463 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12465 (Reread): added tostr to nlink. buggy output otherwise.
12466 (Reread): added a string() around szMode when assigning to Buffer,
12467 without this I got a log of garbled info strings.
12469 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12472 * I have added several ostream & operator<<(ostream &, some_type)
12473 functions. This has been done to avoid casting and warnings when
12474 outputting enums to lyxerr. This as thus eliminated a lot of
12475 explicit casts and has made the code clearer. Among the enums
12476 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12477 mathed enums, some font enum the Debug::type enum.
12479 * src/support/lyxstring.h (clear): missing method. equivalent of
12482 * all files that contained "stderr": rewrote constructs that used
12483 stderr to use lyxerr instead. (except bmtable)
12485 * src/support/DebugStream.h (level): and the passed t with
12486 Debug::ANY to avoid spurious bits set.
12488 * src/debug.h (Debug::type value): made it accept strings of the
12489 type INFO,INIT,KEY.
12491 * configure.in (Check for programs): Added a check for kpsewhich,
12492 the latex generation will use this later to better the dicovery of
12495 * src/BufferView.C (create_view): we don't need to cast this to
12496 (void*) that is done automatically.
12497 (WorkAreaButtonPress): removed some dead code.
12499 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12501 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12502 is not overwritten when translated (David Sua'rez de Lis).
12504 * lib/CREDITS: Added David Sua'rez de Lis
12506 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12508 * src/bufferparams.C (BufferParams): default input encoding is now
12511 * acinclude.m4 (cross_compiling): comment out macro
12512 LYX_GXX_STRENGTH_REDUCE.
12514 * acconfig.h: make sure that const is not defined (to empty) when
12515 we are compiling C++. Remove commented out code using SIZEOF_xx
12518 * configure.in : move the test for const and inline as late as
12519 possible so that these C tests do not interefere with C++ ones.
12520 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12521 has not been proven.
12523 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12525 * src/table.C (getDocBookAlign): remove bad default value for
12526 isColumn parameter.
12528 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12530 (ShowFileMenu2): ditto.
12532 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12533 of files to ignore.
12535 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12537 * Most files: finished the change from the old error code to use
12538 DebugStream for all lyxerr debugging. Only minor changes remain
12539 (e.g. the setting of debug levels using strings instead of number)
12541 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12543 * src/layout.C (Add): Changed to use compare_no_case instead of
12546 * src/FontInfo.C: changed loop variable type too string::size_type.
12548 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12550 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12551 set ETAGS_ARGS to --c++
12553 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12555 * src/table.C (DocBookEndOfCell): commented out two unused variables
12557 * src/paragraph.C: commented out four unused variables.
12559 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12560 insed a if clause with type string::size_type.
12562 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12565 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12567 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12568 variable, also changed loop to go from 0 to lenght + 1, instead of
12569 -1 to length. This should be correct.
12571 * src/LaTeX.C (scanError): use string::size_type as loop variable
12574 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12575 (l.896) since y_tmp and row was not used anyway.
12577 * src/insets/insetref.C (escape): use string::size_type as loop
12580 * src/insets/insetquotes.C (Width): use string::size_type as loop
12582 (Draw): use string::size_type as loop variable type.
12584 * src/insets/insetlatexaccent.C (checkContents): use
12585 string::size_type as loop variable type.
12587 * src/insets/insetlabel.C (escape): use string::size_type as loop
12590 * src/insets/insetinfo.C: added an extern for current_view.
12592 * src/insets/insetcommand.C (scanCommand): use string::size_type
12593 as loop variable type.
12595 * most files: removed the RCS tags. With them we had to recompile
12596 a lot of files after a simple cvs commit. Also we have never used
12597 them for anything meaningful.
12599 * most files: tags-query-replace NULL 0. As adviced several plases
12600 we now use "0" instead of "NULL" in our code.
12602 * src/support/filetools.C (SpaceLess): use string::size_type as
12603 loop variable type.
12605 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12607 * src/paragraph.C: fixed up some more string stuff.
12609 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12611 * src/support/filetools.h: make modestr a std::string.
12613 * src/filetools.C (GetEnv): made ch really const.
12615 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12616 made code that used these use max/min from <algorithm> instead.
12618 * changed several c library include files to their equivalent c++
12619 library include files. All is not changed yet.
12621 * created a support subdir in src, put lyxstring and lstrings
12622 there + the extra files atexit, fileblock, strerror. Created
12623 Makefile.am. edited configure.in and src/Makefile.am to use this
12624 new subdir. More files moved to support.
12626 * imported som of the functions from repository lyx, filetools
12628 * ran tags-query-replace on LString -> string, corrected the bogus
12629 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12630 is still some errors in there. This is errors where too much or
12631 too litle get deleted from strings (string::erase, string::substr,
12632 string::replace), there can also be some off by one errors, or
12633 just plain wrong use of functions from lstrings. Viewing of quotes
12636 * LyX is now running fairly well with string, but there are
12637 certainly some bugs yet (see above) also string is quite different
12638 from LString among others in that it does not allow null pointers
12639 passed in and will abort if it gets any.
12641 * Added the revtex4 files I forgot when setting up the repository.
12643 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12645 * All over: Tried to clean everything up so that only the files
12646 that we really need are included in the cvs repository.
12647 * Switched to use automake.
12648 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12649 * Install has not been checked.
12651 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12653 * po/pt.po: Three errors:
12654 l.533 and l.538 format specification error
12655 l. 402 duplicate entry, I just deleted it.