1 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
6 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
8 * src/frontends/xforms/GUIRunTime.C: new file
10 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
11 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
13 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
15 * src/frontends/kde/GUIRunTime.C: new file
17 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
18 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
20 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
22 * src/frontends/gnome/GUIRunTime.C: new file
24 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
27 * src/frontends/GUIRunTime.h: removed constructor and destructor,
28 small change to documetentation.
30 * src/frontends/GUIRunTime.C: removed file
32 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
34 * src/lyxparagraph.h: enable NEW_TABULAR as default
36 * src/lyxfunc.C (processKeySym): remove some commented code
38 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
39 NEW_TABULAR around the fd_form_table_options.
41 * src/lyx_gui.C (runTime): call the static member function as
42 GUIRunTime::runTime().
44 2000-08-21 Allan Rae <rae@lyx.org>
46 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
49 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
51 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
53 2000-08-21 Allan Rae <rae@lyx.org>
55 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
57 * src/frontends/xforms/FormPreferences.C (build): use setOK
58 * src/frontends/xforms/FormDocument.C (build): use setOK
59 (FormDocument): use the appropriate policy.
61 2000-08-21 Allan Rae <rae@lyx.org>
63 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
64 automatic [de]activation of arbitrary objects when in a read-only state.
66 * src/frontends/ButtonPolicies.h: More documentation
67 (isReadOnly): added to support the above.
69 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
71 2000-08-18 Juergen Vigna <jug@sad.it>
73 * src/insets/insettabular.C (getStatus): changed to return func_status.
75 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
76 display toggle menu entries if they are.
78 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
79 new document layout now.
81 * src/lyxfunc.C: ditto
83 * src/lyx_gui_misc.C: ditto
85 * src/lyx_gui.C: ditto
87 * lib/ui/default.ui: removed paper and quotes layout as they are now
88 all in the document layout tabbed folder.
90 * src/frontends/xforms/forms/form_document.fd: added Restore
91 button and callbacks for all inputs for Allan's ButtonPolicy.
93 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
94 (CheckChoiceClass): added missing params setting on class change.
95 (UpdateLayoutDocument): added for updating the layout on params.
96 (build): forgot to RETURN_ALWAYS input_doc_spacing.
97 (FormDocument): Implemented Allan's ButtonPolicy with the
100 2000-08-17 Allan Rae <rae@lyx.org>
102 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
103 so we can at least see the credits again.
105 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
106 controller calls for the appropriate callbacks. Note that since Ok
107 calls apply followed by cancel, and apply isn't a valid input for the
108 APPLIED state, the bc_ calls have to be made in the static callback not
109 within each of the real callbacks.
111 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
112 (setOk): renamed from setOkay()
114 2000-08-17 Juergen Vigna <jug@sad.it>
116 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
117 in the implementation part.
118 (composeUIInfo): don't show optional menu-items.
120 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
122 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
124 * src/bufferview_funcs.C (CurrentState): fixed to show also the
125 text-state when in a text-inset.
127 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
129 2000-08-17 Marko Vendelin <markov@ioc.ee>
130 * src/frontends/gnome/FormIndex.C
131 * src/frontends/gnome/FormIndex.h
132 * src/frontends/gnome/FormToc.C
133 * src/frontends/gnome/FormToc.h
134 * src/frontends/gnome/dialogs
135 * src/frontends/gnome/diatoc_callbacks.c
136 * src/frontends/gnome/diatoc_callbacks.h
137 * src/frontends/gnome/diainsertindex_callbacks.h
138 * src/frontends/gnome/diainsertindex_callbacks.c
139 * src/frontends/gnome/diainsertindex_interface.c
140 * src/frontends/gnome/diainsertindex_interface.h
141 * src/frontends/gnome/diatoc_interface.h
142 * src/frontends/gnome/diatoc_interface.c
143 * src/frontends/gnome/Makefile.am: Table of Contents and
144 Insert Index dialogs implementation for Gnome frontend
146 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
148 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
150 * src/frontends/gnome/diainserturl_interface.c: make the dialog
153 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
155 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
156 destructor. Don't definde if you don't need it
157 (processEvents): made static, non-blocking events processing for
159 (runTime): static method. event loop for xforms
160 * similar as above for kde and gnome.
162 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
164 (runTime): new method calss the real frontends runtime func.
166 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
168 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
170 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
172 2000-08-16 Juergen Vigna <jug@sad.it>
174 * src/lyx_gui.C (runTime): added GUII RunTime support.
176 * src/frontends/Makefile.am:
177 * src/frontends/GUIRunTime.[Ch]:
178 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
179 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
180 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
182 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
184 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
185 as this is already set in ${FRONTEND_INCLUDE} if needed.
187 * configure.in (CPPFLAGS): setting the include dir for the frontend
188 directory and don't set FRONTEND=xforms for now as this is executed
191 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
193 * src/frontends/kde/Makefile.am:
194 * src/frontends/kde/FormUrl.C:
195 * src/frontends/kde/FormUrl.h:
196 * src/frontends/kde/formurldialog.h:
197 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
199 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
201 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
203 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
205 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
208 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
210 * src/WorkArea.C (work_area_handler): more work to get te
211 FL_KEYBOARD to work with xforms 0.88 too, please test.
213 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
215 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
217 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
220 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
222 * src/Timeout.h: remove Qt::emit hack.
224 * several files: changes to allo doc++ compilation
226 * src/lyxfunc.C (processKeySym): new method
227 (processKeyEvent): comment out if FL_REVISION < 89
229 * src/WorkArea.C: change some debugging levels.
230 (WorkArea): set wantkey to FL_KEY_ALL
231 (work_area_handler): enable the FL_KEYBOARD clause, this enables
232 clearer code and the use of compose with XForms 0.89. Change to
233 use signals instead of calling methods in bufferview directly.
235 * src/Painter.C: change some debugging levels.
237 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
240 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
241 (workAreaKeyPress): new method
243 2000-08-14 Juergen Vigna <jug@sad.it>
245 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
247 * config/kde.m4: addes some features
249 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
250 include missing xforms dialogs.
252 * src/Timeout.h: a hack to be able to compile with qt/kde.
254 * sigc++/.cvsignore: added acinclude.m4
256 * lib/.cvsignore: added listerros
258 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
259 xforms tree as objects are needed for other frontends.
261 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
262 linking with not yet implemented xforms objects.
264 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
266 2000-08-14 Baruch Even <baruch.even@writeme.com>
268 * src/frontends/xforms/FormGraphics.h:
269 * src/frontends/xforms/FormGraphics.C:
270 * src/frontends/xforms/RadioButtonGroup.h:
271 * src/frontends/xforms/RadioButtonGroup.C:
272 * src/insets/insetgraphics.h:
273 * src/insets/insetgraphics.C:
274 * src/insets/insetgraphicsParams.h:
275 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
276 instead of spaces, and various other indentation issues to make the
277 sources more consistent.
279 2000-08-14 Marko Vendelin <markov@ioc.ee>
281 * src/frontends/gnome/dialogs/diaprint.glade
282 * src/frontends/gnome/FormPrint.C
283 * src/frontends/gnome/FormPrint.h
284 * src/frontends/gnome/diaprint_callbacks.c
285 * src/frontends/gnome/diaprint_callbacks.h
286 * src/frontends/gnome/diaprint_interface.c
287 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
290 * src/frontends/gnome/dialogs/diainserturl.glade
291 * src/frontends/gnome/FormUrl.C
292 * src/frontends/gnome/FormUrl.h
293 * src/frontends/gnome/diainserturl_callbacks.c
294 * src/frontends/gnome/diainserturl_callbacks.h
295 * src/frontends/gnome/diainserturl_interface.c
296 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
299 * src/frontends/gnome/Dialogs.C
300 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
301 all other dialogs. Copy all unimplemented dialogs from Xforms
304 * src/frontends/gnome/support.c
305 * src/frontends/gnome/support.h: support files generated by Glade
309 * config/gnome.m4: Gnome configuration scripts
311 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
312 configure --help message
314 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
315 only if there are no events pendling in Gnome/Gtk. This enhances
316 the performance of menus.
319 2000-08-14 Allan Rae <rae@lyx.org>
321 * lib/Makefile.am: listerrors cleaning
323 * lib/listerrors: removed -- generated file
324 * acinclude.m4: ditto
325 * sigc++/acinclude.m4: ditto
327 * src/frontends/xforms/forms/form_citation.fd:
328 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
331 * src/frontends/xforms/forms/makefile: I renamed the `install` target
332 `updatesrc` and now we have a `test` target that does what `updatesrc`
333 used to do. I didn't like having an install target that wasn't related
336 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
337 on all except FormGraphics. This may yet happen. Followed by a major
338 cleanup including using FL_TRANSIENT for most of the dialogs. More
339 changes to come when the ButtonController below is introduced.
341 * src/frontends/xforms/ButtonController.h: New file for managing up to
342 four buttons on a dialog according to an externally defined policy.
343 * src/frontends/xforms/Makefile.am: added above
345 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
346 Apply and Cancel/Close buttons and everything in between and beyond.
347 * src/frontends/Makefile.am: added above.
349 * src/frontends/xforms/forms/form_preferences.fd:
350 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
351 and removed variable 'status' as a result. Fixed the set_minsize thing.
352 Use the new screen-font-update after checking screen fonts were changed
353 Added a "Restore" button to restore the original lyxrc values while
354 editing. This restores everything not just the last input changed.
355 That's still a tricky one. As is the "LyX: this shouldn't happen..."
357 * src/LyXAction.C: screen-font-update added for updating buffers after
358 screen font settings have been changed.
359 * src/commandtags.h: ditto
360 * src/lyxfunc.C: ditto
362 * forms/lyx.fd: removed screen fonts dialog.
363 * src/lyx_gui.C: ditto
364 * src/menus.[Ch]: ditto
365 * src/lyx.[Ch]: ditto
366 * src/lyx_cb.C: ditto + code from here moved to make
367 screen-font-update. And people wonder why progress on GUII is
368 slow. Look at how scattered this stuff was! It takes forever
371 * forms/fdfix.sh: Fixup the spacing after commas.
372 * forms/makefile: Remove date from generated files. Fewer clashes now.
373 * forms/bullet_forms.C.patch: included someones handwritten changes
375 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
376 once I've discovered why LyXRC was made noncopyable.
377 * src/lyx_main.C: ditto
379 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
381 * src/frontends/xforms/forms/fdfix.sh:
382 * src/frontends/xforms/forms/fdfixh.sed:
383 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
384 * src/frontends/xforms/Form*.[hC]:
385 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
386 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
387 provide a destructor for the struct FD_form_xxxx. Another version of
388 the set_[max|min]size workaround and a few other cleanups. Actually,
389 Angus' patch from 20000809.
391 2000-08-13 Baruch Even <baruch.even@writeme.com>
393 * src/insets/insetgraphics.C (Clone): Added several fields that needed
396 2000-08-11 Juergen Vigna <jug@sad.it>
398 * src/insets/insetgraphics.C (InsetGraphics): changing init
399 order because of warnings.
401 * src/frontends/xforms/forms/makefile: adding patching .C with
404 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
405 from .C.patch to .c.patch
407 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
408 order because of warning.
410 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
412 * src/frontends/Liason.C (setMinibuffer): new helper function
414 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
416 * src/lyxfunc.C (Dispatch): calling new Document-Layout
418 * lib/ui/default.ui: commented out PaperLayout entry
420 * src/frontends/xforms/form_document.[Ch]: new added files
422 * src/frontends/xforms/FormDocument.[Ch]: ditto
424 * src/frontends/xforms/forms/form_document.fd: ditto
426 * src/frontends/xforms/forms/form_document.C.patch: ditto
428 2000-08-10 Juergen Vigna <jug@sad.it>
430 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
431 (InsetGraphics): initialized cacheHandle to 0.
432 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
434 2000-08-10 Baruch Even <baruch.even@writeme.com>
436 * src/graphics/GraphicsCache.h:
437 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
438 correctly as a cache.
440 * src/graphics/GraphicsCacheItem.h:
441 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
444 * src/graphics/GraphicsCacheItem_pimpl.h:
445 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
448 * src/insets/insetgraphics.h:
449 * src/insets/insetgraphics.C: Changed from using a signal notification
450 to polling when image is not loaded.
452 2000-08-10 Allan Rae <rae@lyx.org>
454 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
455 that there are two functions that have to been taken out of line by
456 hand and aren't taken care of in the script. (Just a reminder note)
458 * sigc++/macros/*.h.m4: Updated as above.
460 2000-08-09 Juergen Vigna <jug@sad.it>
462 * src/insets/insettext.C (draw): small fix for clearing rectangle.
464 * src/insets/insettabular.C: make drawing of single cell smarter.
466 2000-08-09 Marko Vendelin <markov@ioc.ee>
467 * src/frontends/gnome/Menubar_pimpl.C
468 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
469 implementation: new files
471 * src/frontends/gnome/mainapp.C
472 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
475 * src/main.C: create Gnome main window
477 * src/frontends/xforms/Menubar_pimpl.h
478 * src/frontends/Menubar.C
479 * src/frontends/Menubar.h: added method Menubar::update that calls
480 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
482 * src/LyXView.C: calls Menubar::update to update the state
485 * src/frontends/gnome/Makefile.am: added new files
487 * src/frontends/Makefile.am: added frontend compiler options
489 2000-08-08 Juergen Vigna <jug@sad.it>
491 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
493 * src/bufferlist.C (close):
494 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
495 documents if exiting without saving.
497 * src/buffer.C (save): use removeAutosaveFile()
499 * src/support/filetools.C (removeAutosaveFile): new function.
501 * src/lyx_cb.C (MenuWrite): returns a bool now.
502 (MenuWriteAs): check if file could really be saved and revert to the
504 (MenuWriteAs): removing old autosavefile if existant.
506 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
507 before Goto toggle declaration, because of compiler warning.
509 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
511 * src/lyxfunc.C (MenuNew): small fix.
513 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
515 * src/bufferlist.C (newFile):
516 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
518 * src/lyxrc.C: added new_ask_filename tag
520 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
522 * src/lyx.fd: removed code pertaining to form_ref
523 * src/lyx.[Ch]: ditto
524 * src/lyx_cb.C: ditto
525 * src/lyx_gui.C: ditto
526 * src/lyx_gui_misc.C: ditto
528 * src/BufferView_pimpl.C (restorePosition): update buffer only
531 * src/commandtags.h (LFUN_REFTOGGLE): removed
532 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
533 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
534 (LFUN_REFBACK): renamed LFUN_REF_BACK
536 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
538 * src/lyxfunc.C (Dispatch): ditto.
539 InsertRef dialog is now GUI-independent.
541 * src/texrow.C: added using std::endl;
543 * src/insets/insetref.[Ch]: strip out large amounts of code.
544 The inset is now a container and this functionality is now
545 managed by a new FormRef dialog
547 * src/frontends/Dialogs.h (showRef, createRef): new signals
549 * src/frontends/xforms/FormIndex.[Ch],
550 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
551 when setting dialog's min/max size
552 * src/frontends/xforms/FormIndex.[Ch]: ditto
554 * src/frontends/xforms/FormRef.[Ch],
555 src/frontends/xforms/forms/form_ref.fd: new xforms
556 implementation of an InsetRef dialog
558 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
561 * src/graphics/XPM_Renderer.C (isImageFormatOK):
562 ios::nocreate is not part of the standard. Removed.
564 2000-08-07 Baruch Even <baruch.even@writeme.com>
566 * src/graphics/Renderer.h:
567 * src/graphics/Renderer.C: Added base class for rendering of different
568 image formats into Pixmaps.
570 * src/graphics/XPM_Renderer.h:
571 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
572 in a different class.
574 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
575 easily add support for other formats.
577 * src/insets/figinset.C: plugged a leak of an X resource.
579 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
581 * src/CutAndPaste.[Ch]: make all metods static.
583 * development/Code_rules/Rules: more work, added section on
584 Exceptions, and a References section.
586 * a lot of header files: work to make doc++ able to generate the
587 source documentation, some workarounds of doc++ problems. Doc++ is
588 now able to generate the documentation.
590 2000-08-07 Juergen Vigna <jug@sad.it>
592 * src/insets/insettabular.C (recomputeTextInsets): removed function
594 * src/tabular.C (SetWidthOfMulticolCell):
596 (calculate_width_of_column_NMC): fixed return value so that it really
597 only returns true if the column-width has changed (there where
598 problems with muliticolumn-cells in this column).
600 2000-08-04 Juergen Vigna <jug@sad.it>
602 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
603 also on the scrollstatus of the inset.
604 (workAreaMotionNotify): ditto.
606 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
608 2000-08-01 Juergen Vigna <jug@sad.it>
610 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
613 * src/LyXAction.C (init):
614 * src/insets/inset.C (LocalDispatch): added support for
617 * src/insets/inset.C (scroll): new functions.
619 * src/insets/insettext.C (removeNewlines): new function.
620 (SetAutoBreakRows): removes forced newlines in the text of the
621 paragraph if autoBreakRows is set to false.
623 * src/tabular.C (Latex): generates a parbox around the cell contents
626 * src/frontends/xforms/FormTabular.C (local_update): removed
627 the radio_useparbox button.
629 * src/tabular.C (UseParbox): new function
631 2000-08-06 Baruch Even <baruch.even@writeme.com>
633 * src/graphics/GraphicsCache.h:
634 * src/graphics/GraphicsCache.C:
635 * src/graphics/GraphicsCacheItem.h:
636 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
639 * src/insets/insetgraphics.h:
640 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
641 drawing of the inline image.
643 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
644 into the wrong position.
646 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
649 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
651 * src/support/translator.h: move all typedefs to public section
653 * src/support/filetools.C (MakeLatexName): return string const
656 (FileOpenSearch): ditto
658 (LibFileSearch): ditto
659 (i18nLibFileSearch): ditto
662 (CreateTmpDir): ditto
663 (CreateBufferTmpDir): ditto
664 (CreateLyXTmpDir): ditto
669 (OnlyFilename): ditto
671 (NormalizePath): ditto
673 (GetFileContents): ditto
674 (ReplaceEnvironmentPath): ditto
677 (ChangeExtension): ditto
678 (MakeDisplayPath): ditto
679 (do_popen): return cmdret const
680 (findtexfile): return string const
682 * src/support/DebugStream.h: add some /// to please doc++
684 * src/frontends/DialogBase.h (endif): add some /// to please doc++
686 * src/texrow.C (same_rownumber): functor to use with find_if
687 (getIdFromRow): rewritten to use find_if and to not update the
688 positions. return true if row is found
689 (increasePos): new method, use to update positions
691 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
693 * src/lyxlex_pimpl.C (verifyTable): new method
696 (GetString): return string const
697 (pushTable): rewrite to use std::stack
699 (setFile): better check
702 * src/lyxlex.h: make LyXLex noncopyable
704 * src/lyxlex.C (text): return char const * const
705 (GetString): return string const
706 (getLongString): return string const
708 * src/lyx_gui_misc.C (askForText): return pair<...> const
710 * src/lastfiles.[Ch] (operator): return string const
712 * src/buffer.C (parseSingleLyXformat2Token): pass string to
713 istringstream not char const *.
714 move token.end() out of loop.
715 (readFile): move initializaton of token
717 * src/BufferView2.C (insertErrors): run texrow.increasePos if
718 getIdFromRow is successful.
720 * lib/bind/emacs.bind: don't include menus bind
722 * development/Code_rules/Rules: the beginnings of making this
723 better and covering more of the unwritten rules that we have.
725 * development/Code_rules/Recommendations: a couple of wording
728 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
730 * src/support/strerror.c: remove C++ comment.
732 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
734 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
735 LFUN_INDEX_INSERT_LAST
737 * src/texrow.C (getIdFromRow): changed from const_iterator to
738 iterator, allowing code to compile with DEC cxx
740 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
741 stores part of the class, as suggested by Allan. Will allow
743 (apply): test to apply uses InsetCommandParams operator!=
745 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
746 (apply): test to apply uses InsetCommandParams operator!=
748 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
749 stores part of the class.
750 (update): removed limits on min/max size.
752 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
753 (apply): test to apply uses InsetCommandParams operator!=
755 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
756 (Read, Write, scanCommand, getCommand): moved functionality
757 into InsetCommandParams.
759 (getScreenLabel): made pure virtual
760 new InsetCommandParams operators== and !=
762 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
763 c-tors based on InsetCommandParams. Removed others.
764 * src/insets/insetinclude.[Ch]: ditto
765 * src/insets/insetlabel.[Ch]: ditto
766 * src/insets/insetparent.[Ch]: ditto
767 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
769 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
770 insets derived from InsetCommand created using similar c-tors
771 based on InsetCommandParams
772 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
773 * src/menus.C (ShowRefsMenu): ditto
774 * src/paragraph.C (Clone): ditto
775 * src/text2.C (SetCounter): ditto
776 * src/lyxfunc.C (Dispatch) ditto
777 Also recreated old InsetIndex behaviour exactly. Can now
778 index-insert at the start of a paragraph and index-insert-last
779 without launching the pop-up.
781 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
783 * lib/lyxrc.example: mark te pdf options as non functional.
785 * src/support/lstrings.C (strToInt): move initalization of tmpstr
786 (isStrDbl): move tmpstr.end() out of loop.
787 (strToDbl): move intialization of tmpstr
788 (lowercase): return string const and move tmp.end() out of loop.
789 (uppercase): return string const and move tmp.edn() out of loop.
790 (prefixIs): add assertion
795 (containsOnly): ditto
796 (containsOnly): ditto
797 (containsOnly): ditto
798 (countChar): make last arg char not char const
799 (token): return string const
800 (subst): return string const, move tmp.end() out of loop.
801 (subst): return string const, add assertion
802 (strip): return string const
803 (frontStrip): return string const, add assertion
804 (frontStrip): return string const
809 * src/support/lstrings.C: add inclde "LAssert.h"
810 (isStrInt): move tmpstr.end() out of loop.
812 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
813 toollist.end() out of loop.
814 (deactivate): move toollist.end() out of loop.
815 (update): move toollist.end() out of loop.
816 (updateLayoutList): move tc.end() out of loop.
817 (add): move toollist.end() out of loop.
819 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
820 md.end() out of loop.
822 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
824 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
827 * src/paragraph.C (Erase): move fontlist.end() out of loop.
828 (Erase): move insetlist.end() out of loop.
830 * src/lyx_sendfax_main.C: make show_logfile static and to take a
831 ref to const string as first arg. Move initialization of some
832 variables, whitespace changes.
834 * src/kbmap.C (defkey): move table.end() out of loop.
835 (kb_keymap): move table.end() out of loop.
836 (findbinding): move table.end() out of loop.
838 * src/MenuBackend.C (hasMenu): move end() out of loop.
839 (getMenu): move end() out of loop.
840 (getMenu): move menulist_.end() out of loop.
842 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
844 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
847 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
848 (getFromLyXName): move infotab.end() out of loop.
850 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
851 -fvtable-thunks -ffunction-sections -fdata-sections
853 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
855 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
858 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
860 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
862 * src/frontends/xforms/FormCitation.[Ch],
863 src/frontends/xforms/FormIndex.[Ch],
864 src/frontends/xforms/FormToc.[Ch],
865 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
867 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
869 * src/commandtags.h: renamed, created some flags for citation
872 * src/lyx_gui_misc.C: stripped out old FD_index_form code
874 * src/lyxfunc.C (dispatch): use signals to insert index entry
876 * src/frontends/Dialogs.h: new signal createIndex
878 * src/frontends/xforms/FormCommand.[Ch],
879 src/frontends/xforms/FormCitation.[Ch],
880 src/frontends/xforms/FormToc.[Ch],
881 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
883 * src/insets/insetindex.[Ch]: GUI-independent
885 * src/frontends/xforms/FormIndex.[Ch],
886 * src/frontends/xforms/forms/form_index.fd: xforms implementation
889 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
891 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
892 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
894 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
896 * src/insets/insetref.C (Latex): rewrite so that there is now
897 question that a initialization is requested.
899 * src/insets/insetcommand.h: reenable the hide signal
901 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
903 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
904 fix handling of shortcuts (many bugs :)
905 (add_lastfiles): ditto.
907 * lib/ui/default.ui: fix a few shortcuts.
909 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
911 * Makefile.am: Fix ``rpmdist'' target to return the exit
912 status of the ``rpm'' command, instead of the last command in
913 the chain (the ``rm lyx.xpm'' command, which always returns
916 2000-08-02 Allan Rae <rae@lyx.org>
918 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
919 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
920 * src/frontends/xforms/FormToc.C (FormToc): ditto
922 * src/frontends/xforms/Makefile.am: A few forgotten files
924 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
925 Signals-not-copyable-problem Lars' started commenting out.
927 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
929 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
931 * src/insets/insetcommand.h: Signals is not copyable so anoter
932 scheme for automatic hiding of forms must be used.
934 * src/frontends/xforms/FormCitation.h: don't inerit from
935 noncopyable, FormCommand already does that.
936 * src/frontends/xforms/FormToc.h: ditto
937 * src/frontends/xforms/FormUrl.h: ditto
939 * src/frontends/xforms/FormCitation.C: add include <algorithm>
941 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
943 * src/insets/insetcommand.h (hide): new SigC::Signal0
944 (d-tor) new virtual destructor emits hide signal
946 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
947 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
949 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
950 LOF and LOT. Inset is now GUI-independent
952 * src/insets/insetloa.[Ch]: redundant
953 * src/insets/insetlof.[Ch]: ditto
954 * src/insets/insetlot.[Ch]: ditto
956 * src/frontends/xforms/forms/form_url.fd: tweaked!
957 * src/frontends/xforms/forms/form_citation.fd: ditto
959 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
960 dialogs dealing with InsetCommand insets
962 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
963 FormCommand base class
964 * src/frontends/xforms/FormUrl.[Ch]: ditto
966 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
968 * src/frontends/xforms/FormToc.[Ch]: ditto
970 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
971 passed a generic InsetCommand pointer
972 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
974 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
975 and modified InsetTOC class
976 * src/buffer.C: ditto
978 * forms/lyx.fd: strip out old FD_form_toc code
979 * src/lyx_gui_misc.C: ditto
980 * src/lyx_gui.C: ditto
981 * src/lyx_cb.C: ditto
982 * src/lyx.[Ch]: ditto
984 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
986 * src/support/utility.hpp: tr -d '\r'
988 2000-08-01 Juergen Vigna <jug@sad.it>
990 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
993 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
994 LFUN_TABULAR_FEATURES.
996 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
999 * src/insets/insettabular.C (getStatus): implemented helper function.
1001 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1003 2000-07-31 Juergen Vigna <jug@sad.it>
1005 * src/text.C (draw): fixed screen update problem for text-insets.
1007 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1008 something changed probably this has to be added in various other
1011 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1013 2000-07-31 Baruch Even <baruch.even@writeme.com>
1015 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1016 templates to satisfy compaq cxx.
1019 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1021 * src/support/translator.h (equal_1st_in_pair::operator()): take
1022 const ref pair_type as arg.
1023 (equal_2nd_in_pair::operator()): ditto
1024 (Translator::~Translator): remove empty d-tor.
1026 * src/graphics/GraphicsCache.C: move include config.h to top, also
1027 put initialization of GraphicsCache::singleton here.
1028 (~GraphicsCache): move here
1029 (addFile): take const ref as arg
1032 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1034 * src/BufferView2.C (insertLyXFile): change te with/without header
1037 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1039 * src/frontends/xforms/FormGraphics.C (apply): add some
1040 static_cast. Not very nice, but required by compaq cxx.
1042 * src/frontends/xforms/RadioButtonGroup.h: include header
1043 <utility> instead of <pair.h>
1045 * src/insets/insetgraphicsParams.C: add using directive.
1046 (readResize): change return type to void.
1047 (readOrigin): ditto.
1049 * src/lyxfunc.C (getStatus): add missing break for build-program
1050 function; add test for Literate for export functions.
1052 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1053 entries in Options menu.
1055 2000-07-31 Baruch Even <baruch.even@writeme.com>
1057 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1058 protect against auto-allocation; release icon when needed.
1060 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1062 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1063 on usual typewriter.
1065 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1066 earlier czech.kmap), useful only for programming.
1068 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1070 * src/frontends/xforms/FormCitation.h: fix conditioning around
1073 2000-07-31 Juergen Vigna <jug@sad.it>
1075 * src/frontends/xforms/FormTabular.C (local_update): changed
1076 radio_linebreaks to radio_useparbox and added radio_useminipage.
1078 * src/tabular.C: made support for using minipages/parboxes.
1080 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1082 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1084 (descent): so the cursor is in the middle.
1085 (width): bit smaller box.
1087 * src/insets/insetgraphics.h: added display() function.
1089 2000-07-31 Baruch Even <baruch.even@writeme.com>
1091 * src/frontends/Dialogs.h: Added showGraphics signals.
1093 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1094 xforms form definition of the graphics dialog.
1096 * src/frontends/xforms/FormGraphics.h:
1097 * src/frontends/xforms/FormGraphics.C: Added files, the
1098 GUIndependent code of InsetGraphics
1100 * src/insets/insetgraphics.h:
1101 * src/insets/insetgraphics.C: Major writing to make it work.
1103 * src/insets/insetgraphicsParams.h:
1104 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1105 struct between InsetGraphics and GUI.
1107 * src/LaTeXFeatures.h:
1108 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1109 support for graphicx package.
1111 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1112 for the graphics inset.
1114 * src/support/translator.h: Added file, used in
1115 InsetGraphicsParams. this is a template to translate between two
1118 * src/frontends/xforms/RadioButtonGroup.h:
1119 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1120 way to easily control a radio button group.
1122 2000-07-28 Juergen Vigna <jug@sad.it>
1124 * src/insets/insettabular.C (LocalDispatch):
1125 (TabularFeatures): added support for lyx-functions of tabular features.
1126 (cellstart): refixed this function after someone wrongly changed it.
1128 * src/commandtags.h:
1129 * src/LyXAction.C (init): added support for tabular-features
1131 2000-07-28 Allan Rae <rae@lyx.org>
1133 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1134 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1135 triggers the callback for input checking. As a result we sometimes get
1136 "LyX: This shouldn't happen..." printed to cerr.
1137 (input): Started using status variable since I only free() on
1138 destruction. Some input checking for paths and font sizes.
1140 * src/frontends/xforms/FormPreferences.h: Use status to control
1141 activation of Ok and Apply
1143 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1144 callback. Also resized to stop segfaults with 0.88. The problem is
1145 that xforms-0.88 requires the folder to be wide enough to fit all the
1146 tabs. If it isn't it causes all sorts of problems.
1148 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1150 * src/frontends/xforms/forms/README: Reflect reality.
1152 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1153 * src/frontends/xforms/forms/makefile: ditto.
1155 * src/commandtags.h: Get access to new Preferences dialog
1156 * src/LyXAction.C: ditto
1157 * src/lyxfunc.C: ditto
1158 * lib/ui/default.ui: ditto
1160 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1162 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1164 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1167 * src/frontends/xforms/form_url.[Ch]: added.
1169 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1171 * src/insets/insetbib.h: fixed bug in previous commit
1173 * src/frontends/xforms/FormUrl.h: ditto
1175 * src/frontends/xforms/FormPrint.h: ditto
1177 * src/frontends/xforms/FormPreferences.h: ditto
1179 * src/frontends/xforms/FormCopyright.h: ditto
1181 * src/frontends/xforms/FormCitation.C: ditto
1183 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1184 private copyconstructor and private default contructor
1186 * src/support/Makefile.am: add utility.hpp
1188 * src/support/utility.hpp: new file from boost
1190 * src/insets/insetbib.h: set owner in clone
1192 * src/frontends/xforms/FormCitation.C: added missing include
1195 * src/insets/form_url.[Ch]: removed
1197 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1199 * development/lyx.spec.in
1200 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1201 file/directory re-organization.
1203 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1205 * src/insets/insetcommand.[Ch]: moved the string data and
1206 associated manipulation methods into a new stand-alone class
1207 InsetCommandParams. This class has two additional methods
1208 getAsString() and setFromString() allowing the contents to be
1209 moved around as a single string.
1210 (addContents) method removed.
1211 (setContents) method no longer virtual.
1213 * src/buffer.C (readInset): made use of new InsetCitation,
1214 InsetUrl constructors based on InsetCommandParams.
1216 * src/commandtags.h: add LFUN_INSERT_URL
1218 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1219 independent InsetUrl and use InsetCommandParams to extract
1220 string info and create new Insets.
1222 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1224 * src/frontends/xforms/FormCitation.C (apply): uses
1227 * src/frontends/xforms/form_url.C
1228 * src/frontends/xforms/form_url.h
1229 * src/frontends/xforms/FormUrl.h
1230 * src/frontends/xforms/FormUrl.C
1231 * src/frontends/xforms/forms/form_url.fd: new files
1233 * src/insets/insetcite.[Ch]: removed unused constructors.
1235 * src/insets/insetinclude.[Ch]: no longer store filename
1237 * src/insets/inseturl.[Ch]: GUI-independent.
1239 2000-07-26 Juergen Vigna <jug@sad.it>
1240 * renamed frontend from gtk to gnome as it is that what is realized
1241 and did the necessary changes in the files.
1243 2000-07-26 Marko Vendelin <markov@ioc.ee>
1245 * configure.in: cleaning up gnome configuration scripts
1247 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1249 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1250 shortcuts syndrom by redrawing them explicitely (a better solution
1251 would be appreciated).
1253 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1255 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1258 * src/lyx_cb.C (MenuExport): change html export to do the right
1259 thing depending of the document type (instead of having
1260 html-linuxdoc and html-docbook).
1261 * src/lyxfunc.C (getStatus): update for html
1262 * lib/ui/default.ui: simplify due to the above change.
1263 * src/menus.C (ShowFileMenu): update too (in case we need it).
1265 * src/MenuBackend.C (read): if a menu is defined twice, add the
1266 new entries to the exiting one.
1268 2000-07-26 Juergen Vigna <jug@sad.it>
1270 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1272 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1273 and return a bool if it did actual save the file.
1274 (AutoSave): don't autosave a unnamed doc.
1276 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1277 check if this is an UNNAMED new file and react to it.
1278 (newFile): set buffer to unnamed and change to not mark a new
1279 buffer dirty if I didn't do anything with it.
1281 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1283 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1285 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1286 friend as per Angus's patch posted to lyx-devel.
1288 * src/ext_l10n.h: updated
1290 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1291 gettext on the style string right before inserting them into the
1294 * autogen.sh: add code to extract style strings form layout files,
1295 not good enough yet.
1297 * src/frontends/gtk/.cvsignore: add MAKEFILE
1299 * src/MenuBackend.C (read): run the label strings through gettext
1300 before storing them in the containers.
1302 * src/ext_l10n.h: new file
1304 * autogen.sh : generate the ext_l10n.h file here
1306 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1308 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1311 * lib/ui/default.ui: fix a couple of typos.
1313 * config/gnome/gtk.m4: added (and added to the list of files in
1316 * src/insets/insetinclude.C (unique_id): fix when we are using
1317 lyxstring instead of basic_string<>.
1318 * src/insets/insettext.C (LocalDispatch): ditto.
1319 * src/support/filetools.C: ditto.
1321 * lib/configure.m4: create the ui/ directory if necessary.
1323 * src/LyXView.[Ch] (updateToolbar): new method.
1325 * src/BufferView_pimpl.C (buffer): update the toolbar when
1326 opening/closing buffer.
1328 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/LyXAction.C (getActionName): enhance to return also the name
1331 and options of pseudo-actions.
1332 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1334 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1335 as an example of what is possible). Used in File->Build too (more
1336 useful) and in the import/export menus (to mimick the complicated
1337 handling of linuxdoc and friends). Try to update all the entries.
1339 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1342 * src/MenuBackend.C (read): Parse the new OptItem tag.
1344 * src/MenuBackend.h: Add a new optional_ data member (used if the
1345 entry should be omitted when the lyxfunc is disabled).
1347 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1348 function, used as a shortcut.
1349 (create_submenu): align correctly the shortcuts on the widest
1352 * src/MenuBackend.h: MenuItem.label() only returns the label of
1353 the menu without shortcut; new method shortcut().
1355 2000-07-14 Marko Vendelin <markov@ioc.ee>
1357 * src/frontends/gtk/Dialogs.C:
1358 * src/frontends/gtk/FormCopyright.C:
1359 * src/frontends/gtk/FormCopyright.h:
1360 * src/frontends/gtk/Makefile.am: added these source-files for the
1361 Gtk/Gnome support of the Copyright-Dialog.
1363 * src/main.C: added Gnome::Main initialization if using
1364 Gtk/Gnome frontend-GUI.
1366 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1368 * config/gnome/aclocal-include.m4
1369 * config/gnome/compiler-flags.m4
1370 * config/gnome/curses.m4
1371 * config/gnome/gnome--.m4
1372 * config/gnome/gnome-bonobo-check.m4
1373 * config/gnome/gnome-common.m4
1374 * config/gnome/gnome-fileutils.m4
1375 * config/gnome/gnome-ghttp-check.m4
1376 * config/gnome/gnome-gnorba-check.m4
1377 * config/gnome/gnome-guile-checks.m4
1378 * config/gnome/gnome-libgtop-check.m4
1379 * config/gnome/gnome-objc-checks.m4
1380 * config/gnome/gnome-orbit-check.m4
1381 * config/gnome/gnome-print-check.m4
1382 * config/gnome/gnome-pthread-check.m4
1383 * config/gnome/gnome-support.m4
1384 * config/gnome/gnome-undelfs.m4
1385 * config/gnome/gnome-vfs.m4
1386 * config/gnome/gnome-x-checks.m4
1387 * config/gnome/gnome-xml-check.m4
1388 * config/gnome/gnome.m4
1389 * config/gnome/gperf-check.m4
1390 * config/gnome/gtk--.m4
1391 * config/gnome/linger.m4
1392 * config/gnome/need-declaration.m4: added configuration scripts
1393 for Gtk/Gnome frontend-GUI
1395 * configure.in: added support for the --with-frontend=gtk option
1397 * autogen.sh: added config/gnome/* to list of config-files
1399 * acconfig.h: added define for GTKGUI-support
1401 * config/lyxinclude.m4: added --with-frontend[=value] option value
1402 for Gtk/Gnome frontend-GUI support.
1404 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1406 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1410 * src/paragraph.C (GetChar): remove non-const version
1412 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1413 (search_kw): use it.
1415 * src/lyx_main.C (init): if "preferences" exist, read that instead
1417 (ReadRcFile): return bool if the file could be read ok.
1418 (ReadUIFile): add a check to see if lex file is set ok.
1420 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1421 bastring can be used instead of lyxstring (still uses the old code
1422 if std::string is good enough or if lyxstring is used.)
1424 * src/encoding.C: make the arrays static, move ininle functions
1426 * src/encoding.h: from here.
1428 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1429 (parseSingleLyXformat2Token): move inset parsing to separate method
1430 (readInset): new private method
1432 * src/Variables.h: remove virtual from get().
1434 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1435 access to NEW_INSETS and NEW_TABULAR
1437 * src/MenuBackend.h: remove superfluous forward declaration of
1438 MenuItem. Add documentations tags "///", remove empty MenuItem
1439 destructor, remove private default contructor.
1441 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1443 (read): more string mlabel and mname to where they are used
1444 (read): remove unused variables mlabel and mname
1445 (defaults): unconditional clear, make menusetup take advantage of
1446 add returning Menu &.
1448 * src/LyXView.h: define NEW_MENUBAR as default
1450 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1451 to NEW_INSETS and NEW_TABULAR.
1452 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1453 defined. Change some of the "xxxx-inset-insert" functions names to
1456 * several files: more enahncements to NEW_INSETS and the resulting
1459 * lib/lyxrc.example (\date_insert_format): move to misc section
1461 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1462 bastring and use AC_CACHE_CHECK.
1463 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1464 the system have the newest methods. uses AC_CACHE_CHECK
1465 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1466 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1467 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1469 * configure.in: add LYX_CXX_GOOD_STD_STRING
1471 * acinclude.m4: recreated
1473 2000-07-24 Amir Karger
1475 * README: add Hebrew, Arabic kmaps
1478 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1480 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1483 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1485 * Lot of files: add pragma interface/implementation.
1487 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1489 * lib/ui/default.ui: new file (ans new directory). Contains the
1490 default menu and toolbar.
1492 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1493 global space. Toolbars are now read (as menus) in ui files.
1495 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1497 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1498 is disabled because the document is read-only. We want to have the
1499 toggle state of the function anyway.
1500 (getStatus): add code for LFUN_VC* functions (mimicking what is
1501 done in old-style menus)
1503 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1504 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1506 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1507 * src/BufferView_pimpl.C: ditto.
1508 * src/lyxfunc.C: ditto.
1510 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1511 default). This replaces old-style menus by new ones.
1513 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1514 MenuItem. Contain the data structure of a menu.
1516 * src/insets/insettext.C: use LyXView::setLayout instead of
1517 accessing directly the toolbar combox.
1518 * src/lyxfunc.C (Dispatch): ditto.
1520 * src/LyXView.C (setLayout): new method, which just calls
1521 Toolbar::setLayout().
1522 (updateLayoutChoice): move part of this method in Toolbar.
1524 * src/toolbar.[Ch]: removed.
1526 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1527 implementation the toolbar.
1529 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1530 the toolbar. It might make sense to merge it with ToolbarDefaults
1532 (setLayout): new function.
1533 (updateLayoutList): ditto.
1534 (openLayoutList): ditto.
1536 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1537 xforms implementation of the toolbar.
1538 (get_toolbar_func): comment out, since I do not
1539 know what it is good for.
1541 * src/ToolbarDefaults.h: Add the ItemType enum.
1543 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1544 for a list of allocated C strings. Used in Menubar xforms
1545 implementation to avoid memory leaks.
1547 * src/support/lstrings.[Ch] (uppercase): new version taking and
1551 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1552 * lib/bind/emacs.bind: ditto.
1554 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1556 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1557 forward decl of LyXView.
1559 * src/toolbar.C (toolbarItem): moved from toolbar.h
1560 (toolbarItem::clean): ditto
1561 (toolbarItem::~toolbarItem): ditto
1562 (toolbarItem::operator): ditto
1564 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1566 * src/paragraph.h: control the NEW_TABULAR define from here
1568 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1569 USE_TABULAR_INSETS to NEW_TABULAR
1571 * src/ToolbarDefaults.C: add include "lyxlex.h"
1573 * files using the old table/tabular: use NEW_TABULAR to control
1574 compilation of old tabular stuff.
1576 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1579 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1580 planemet in reading of old style floats, fix the \end_deeper
1581 problem when reading old style floats.
1583 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1585 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1587 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1589 * lib/bind/sciword.bind: updated.
1591 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1593 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1594 layout write problem
1596 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1598 * src/Makefile.am (INCLUDES): remove image directory from include
1601 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1602 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1604 * src/LyXView.C (create_form_form_main): read the application icon
1607 * lib/images/*.xpm: change the icons to use transparent color for
1610 * src/toolbar.C (update): change the color of the button when it
1613 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1615 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1616 setting explicitely the minibuffer.
1617 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1619 * src/LyXView.C (showState): new function. Shows font information
1620 in minibuffer and update toolbar state.
1621 (LyXView): call Toolbar::update after creating the
1624 * src/toolbar.C: change toollist to be a vector instead of a
1626 (BubbleTimerCB): get help string directly from the callback
1627 argument of the corresponding icon (which is the action)
1628 (set): remove unnecessary ugliness.
1629 (update): new function. update the icons (depressed, disabled)
1630 depending of the status of the corresponding action.
1632 * src/toolbar.h: remove help in toolbarItem
1634 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1636 * src/Painter.C (text): Added code for using symbol glyphs from
1637 iso10646 fonts. Currently diabled.
1639 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1642 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1643 magyar,turkish and usorbian.
1645 * src/paragraph.C (isMultiLingual): Made more efficient.
1647 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1650 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1651 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1652 Also changed the prototype to "bool math_insert_greek(char)".
1654 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1656 * lots of files: apply the NEW_INSETS on all code that will not be
1657 needed when we move to use the new insets. Enable the define in
1658 lyxparagrah.h to try it.
1660 * src/insets/insettabular.C (cellstart): change to be a static
1662 (InsetTabular): initialize buffer in the initializer list.
1664 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1666 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1667 form_print.h out of the header file. Replaced with forward
1668 declarations of the relevant struct.
1670 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1673 * src/commandtags.h: do not include "debug.h" which does not
1674 belong there. #include it in some other places because of this
1677 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1679 * src/insets/insetcaption.C: add a couple "using" directives.
1681 * src/toolbar.C (add): get the help text directly from lyxaction.
1683 (setPixmap): new function. Loads from disk and sets a pixmap on a
1684 botton; the name of the pixmap file is derived from the command
1687 * src/toolbar.h: remove members isBitmap and pixmap from
1690 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1691 * lib/images/: move many files from images/banner.xpm.
1693 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1695 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1696 * src/toolbar.C: ditto.
1697 * configure.in: ditto.
1698 * INSTALL: document.
1700 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1701 the spellchecker popup is closed from the WM.
1703 2000-07-19 Juergen Vigna <jug@sad.it>
1705 * src/insets/insetfloat.C (Write): small fix because we use the
1706 insetname for the type now!
1708 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1713 * src/frontends/Dialogs.h: removed hideCitation signal
1715 * src/insets/insetcite.h: added hide signal
1717 * src/insets/insetcite.C (~InsetCitation): emits new signal
1718 (getScreenLabel): "intelligent" label should now fit on the screen!
1720 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1722 * src/frontends/xforms/FormCitation.C (showInset): connects
1723 hide() to the inset's hide signal
1724 (show): modified to use fl_set_object_position rather than
1725 fl_set_object_geometry wherever possible
1727 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1729 * src/insets/lyxinset.h: add caption code
1731 * src/insets/insetfloat.C (type): new method
1733 * src/insets/insetcaption.C (Write): new method
1735 (LyxCode): new method
1737 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1738 to get it right together with using the FloatList.
1740 * src/commandtags.h: add LFUN_INSET_CAPTION
1741 * src/lyxfunc.C (Dispatch): handle it
1743 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1746 * src/Variables.[Ch]: make expand take a const reference, remove
1747 the destructor, some whitespace changes.
1749 * src/LyXAction.C (init): add caption-inset-insert
1751 * src/FloatList.C (FloatList): update the default floats a bit.
1753 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1755 * src/Variables.[Ch]: new files. Intended to be used for language
1756 specific strings (like \chaptername) and filename substitution in
1759 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1761 * lib/kbd/american.kmap: update
1763 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1765 * src/bufferparams.[Ch]: remove member allowAccents.
1767 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1769 * src/LaTeXLog.C: use the log_form.h header.
1770 * src/lyx_gui.C: ditto.
1771 * src/lyx_gui_misc.C: ditto.
1772 * src/lyxvc.h: ditto.
1774 * forms/log_form.fd: new file, created from latexoptions.fd. I
1775 kept the log popup and nuked the options form.
1777 * src/{la,}texoptions.[Ch]: removed.
1778 * src/lyx_cb.C (LaTeXOptions): ditto
1780 * src/lyx_gui.C (create_forms): do not handle the
1781 fd_latex_options form.
1783 2000-07-18 Juergen Vigna <jug@sad.it>
1785 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1786 name of the inset so that it can be requested outside (text2.C).
1788 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1791 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1793 * src/mathed/formula.h (ConvertFont): constify
1795 * src/mathed/formula.C (Read): add warning if \end_inset is not
1796 found on expected place.
1798 * src/insets/lyxinset.h (ConvertFont): consify
1800 * src/insets/insetquotes.C (ConvertFont): constify
1801 * src/insets/insetquotes.h: ditto
1803 * src/insets/insetinfo.h: add labelfont
1805 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1806 (ascent): use labelfont
1810 (Write): make .lyx file a bit nicer
1812 * src/insets/insetfloat.C (Write): simplify somewhat...
1813 (Read): add warning if arg is not found
1815 * src/insets/insetcollapsable.C: add using std::max
1816 (Read): move string token and add warning in arg is not found
1817 (draw): use std::max to get the right ty
1818 (getMaxWidth): simplify by using std::max
1820 * src/insets/insetsection.h: new file
1821 * src/insets/insetsection.C: new file
1822 * src/insets/insetcaption.h: new file
1823 * src/insets/insetcaption.C: new file
1825 * src/insets/inset.C (ConvertFont): constify signature
1827 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1828 insetcaption.[Ch] and insetsection.[Ch]
1830 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1831 uses to use LABEL_COUNTER_CHAPTER instead.
1832 * src/text2.C (SetCounter): here
1834 * src/counters.h: new file
1835 * src/counters.C: new file
1836 * src/Sectioning.h: new file
1837 * src/Sectioning.C: new file
1839 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1841 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1843 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1846 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1849 2000-07-17 Juergen Vigna <jug@sad.it>
1851 * src/tabular.C (Validate): check if array-package is needed.
1852 (SetVAlignment): added support for vertical alignment.
1853 (SetLTFoot): better support for longtable header/footers
1854 (Latex): modified to support added features.
1856 * src/LaTeXFeatures.[Ch]: added array-package.
1858 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1860 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1863 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1865 * configure.in: do not forget to put a space after -isystem.
1867 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1869 * lib/kbd/arabic.kmap: a few fixes.
1871 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1873 * some whitespace chagnes to a number of files.
1875 * src/support/DebugStream.h: change to make it easier for
1876 doc++ to parse correctly.
1877 * src/support/lyxstring.h: ditto
1879 * src/mathed/math_utils.C (compara): change to have only one
1881 (MathedLookupBOP): change because of the above.
1883 * src/mathed/math_delim.C (math_deco_compare): change to have only
1885 (search_deco): change becasue of the above.
1887 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1888 instead of manually coded one.
1890 * src/insets/insetquotes.C (Read): read the \end_inset too
1892 * src/insets/insetlatex.h: remove file
1893 * src/insets/insetlatex.C: remove file
1895 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1897 (InsetPrintIndex): remove destructor
1899 * src/insets/insetinclude.h: remove default constructor
1901 * src/insets/insetfloat.C: work to make it work better
1903 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1905 * src/insets/insetcite.h (InsetCitation): remove default constructor
1907 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1909 * src/text.C (GetColumnNearX): comment out some currently unused code.
1911 * src/paragraph.C (writeFile): move some initializations closer to
1913 (CutIntoMinibuffer): small change to use new matchIT operator
1917 (InsertInset): ditto
1920 (InsetIterator): ditto
1921 (Erase): small change to use new matchFT operator
1923 (GetFontSettings): ditto
1924 (HighestFontInRange): ditto
1927 * src/lyxparagraph.h: some chars changed to value_type
1928 (matchIT): because of some stronger checking (perhaps too strong)
1929 in SGI STL, the two operator() unified to one.
1932 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1934 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1935 the last inset read added
1936 (parseSingleLyXformat2Token): some more (future) compability code added
1937 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1938 (parseSingleLyXformat2Token): set last_inset_read
1939 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1940 (parseSingleLyXformat2Token): don't double intializw string next_token
1942 * src/TextCache.C (text_fits::operator()): add const's to the signature
1943 (has_buffer::operator()): ditto
1945 * src/Floating.h: add some comments on the class
1947 * src/FloatList.[Ch] (typeExist): new method
1950 * src/BackStack.h: added default constructor, wanted by Gcc.
1952 2000-07-14 Juergen Vigna <jug@sad.it>
1954 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1956 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1958 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1959 do a redraw when the window is resized!
1960 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1962 * src/insets/insettext.C (resizeLyXText): added function to correctly
1963 being able to resize the LyXWindow.
1965 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1967 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1969 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1970 crashes when closing dialog to a deleted inset.
1972 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1973 method! Now similar to other insets.
1975 2000-07-13 Juergen Vigna <jug@sad.it>
1977 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1979 * lib/examples/Literate.lyx: small patch!
1981 * src/insets/insetbib.C (Read): added this function because of wrong
1982 Write (without [begin|end]_inset).
1984 2000-07-11 Juergen Vigna <jug@sad.it>
1986 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1987 as the insertInset could not be good!
1989 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1990 the bool param should not be last.
1992 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1994 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1995 did submit that to Karl).
1997 * configure.in: use -isystem instead of -I for X headers. This
1998 fixes a problem on solaris with a recent gcc;
1999 put the front-end code after the X detection code;
2000 configure in sigc++ before lib/
2002 * src/lyx_main.C (commandLineHelp): remove -display from command
2005 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2007 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2008 Also put in Makefile rules for building the ``listerrors''
2009 program for parsing errors from literate programs written in LyX.
2011 * lib/build-listerrors: Added small shell script as part of compile
2012 process. This builds a working ``listerrors'' binary if noweb is
2013 installed and either 1) the VNC X server is installed on the machine,
2014 or 2) the user is compiling from within a GUI. The existence of a GUI
2015 is necessary to use the ``lyx --export'' feature for now. This
2016 hack can be removed once ``lyx --export'' no longer requires a GUI to
2019 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2021 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2022 now passed back correctly from gcc and placed "under" error
2023 buttons in a Literate LyX source.
2025 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2027 * src/text.C (GetColumnNearX): Better behavior when a RTL
2028 paragraph is ended by LTR text.
2030 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2033 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2035 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2036 true when clipboard is empty.
2038 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2040 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2041 row of the paragraph.
2042 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2043 to prevent calculation of bidi tables
2045 2000-07-07 Juergen Vigna <jug@sad.it>
2047 * src/screen.C (ToggleSelection): added y_offset and x_offset
2050 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2053 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2055 * src/insets/insettext.C: fixed Layout-Display!
2057 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2059 * configure.in: add check for strings.h header.
2061 * src/spellchecker.C: include <strings.h> in order to have a
2062 definition for bzero().
2064 2000-07-07 Juergen Vigna <jug@sad.it>
2066 * src/insets/insettext.C (draw): set the status of the bv->text to
2067 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2069 * src/screen.C (DrawOneRow):
2070 (DrawFromTo): redraw the actual row if something has changed in it
2073 * src/text.C (draw): call an update of the toplevel-inset if something
2074 has changed inside while drawing.
2076 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2078 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2080 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2081 processing inside class.
2083 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2084 processing inside class.
2086 * src/insets/insetindex.h new struct Holder, consistent with other
2089 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2090 citation dialog from main code and placed it in src/frontends/xforms.
2091 Dialog launched through signals instead of callbacks
2093 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2095 * lyx.man: update the options description.
2097 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2099 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2100 handle neg values, set min width to 590, add doc about -display
2102 2000-07-05 Juergen Vigna <jug@sad.it>
2104 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2105 calls to BufferView *.
2107 * src/insets/insettext.C (checkAndActivateInset): small fix non
2108 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2110 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2111 their \end_inset token!
2113 2000-07-04 edscott <edscott@imp.mx>
2115 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2116 lib/lyxrc.example: added option \wheel_jump
2118 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2120 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2121 remove support for -width,-height,-xpos and -ypos.
2123 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2125 * src/encoding.[Ch]: New files.
2127 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2128 (text): Call to the underline() method only when needed.
2130 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2132 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2133 encoding(s) for the document.
2135 * src/bufferparams.C (BufferParams): Changed default value of
2138 * src/language.C (newLang): Removed.
2139 (items[]): Added encoding information for all defined languages.
2141 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2142 encoding choice button.
2144 * src/lyxrc.h (font_norm_type): New member variable.
2145 (set_font_norm_type): New method.
2147 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2148 paragraphs with different encodings.
2150 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2151 (TransformChar): Changed to work correctly with Arabic points.
2152 (draw): Added support for drawing Arabic points.
2153 (draw): Removed code for drawing underbars (this is done by
2156 * src/support/textutils.h (IsPrintableNonspace): New function.
2158 * src/BufferView_pimpl.h: Added "using SigC::Object".
2159 * src/LyXView.h: ditto.
2161 * src/insets/insetinclude.h (include_label): Changed to mutable.
2163 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2165 * src/mathed/math_iter.h: remove empty destructor
2167 * src/mathed/math_cursor.h: remove empty destructor
2169 * src/insets/lyxinset.h: add THEOREM_CODE
2171 * src/insets/insettheorem.[Ch]: new files
2173 * src/insets/insetminipage.C: (InsertInset): remove
2175 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2177 (InsertInset): remove
2179 * src/insets/insetlist.C: (InsertList): remove
2181 * src/insets/insetfootlike.[Ch]: new files
2183 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2186 (InsertInset): ditto
2188 * src/insets/insetert.C: remove include Painter.h, reindent
2189 (InsertInset): move to header
2191 * src/insets/insetcollapsable.h: remove explicit from default
2192 contructor, remove empty destructor, add InsertInset
2194 * src/insets/insetcollapsable.C (InsertInset): new func
2196 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2198 * src/vspace.h: add explicit to constructor
2200 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2201 \textcompwordmark, please test this.
2203 * src/lyxrc.C: set ascii_linelen to 65 by default
2205 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2207 * src/commandtags.h: add LFUN_INSET_THEOREM
2209 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2210 (makeLinuxDocFile): remove _some_ of the nice logic
2211 (makeDocBookFile): ditto
2213 * src/Painter.[Ch]: (~Painter): removed
2215 * src/LyXAction.C (init): entry for insettheorem added
2217 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2219 (deplog): code to detect files generated by LaTeX, needs testing
2222 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2224 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2226 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2228 * src/LaTeX.C (deplog): Add a check for files that are going to be
2229 created by the first latex run, part of the project to remove the
2232 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2233 contents to the extension list.
2235 2000-07-04 Juergen Vigna <jug@sad.it>
2237 * src/text.C (NextBreakPoint): added support for needFullRow()
2239 * src/insets/lyxinset.h: added needFullRow()
2241 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2244 * src/insets/insettext.C: lots of changes for update!
2246 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2248 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2250 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2252 * src/insets/insetinclude.C (InsetInclude): fixed
2253 initialization of include_label.
2254 (unique_id): now returns a string.
2256 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2258 * src/LaTeXFeatures.h: new member IncludedFiles, for
2259 a map of key, included file name.
2261 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2262 with the included files for inclusion in SGML preamble,
2263 i. e., linuxdoc and docbook.
2266 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2267 nice (is the generated linuxdoc code to be exported?), that
2268 allows to remove column, and only_body that will be true for
2269 slave documents. Insets are allowed inside SGML font type.
2270 New handling of the SGML preamble for included files.
2271 (makeDocBookFile): the same for docbook.
2273 * src/insets/insetinclude.h:
2274 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2276 (DocBook): new export methods.
2278 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2279 and makeDocBookFile.
2281 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2282 formats to export with command line argument -x.
2284 2000-06-29 Juergen Vigna <jug@sad.it>
2286 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2287 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2289 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2290 region could already been cleared by an inset!
2292 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2294 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2297 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2299 (cursorToggle): remove special handling of lyx focus.
2301 2000-06-28 Juergen Vigna <jug@sad.it>
2303 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2306 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2308 * src/insets/insetindex.C (Edit): add a callback when popup is
2311 * src/insets/insettext.C (LocalDispatch):
2312 * src/insets/insetmarginal.h:
2313 * src/insets/insetlist.h:
2314 * src/insets/insetfoot.h:
2315 * src/insets/insetfloat.h:
2316 * src/insets/insetert.h: add a missing std:: qualifier.
2318 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2320 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2323 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2325 * src/insets/insettext.C (Read): remove tmptok unused variable
2326 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2327 (InsertInset): change for new InsetInset code
2329 * src/insets/insettext.h: add TEXT inline method
2331 * src/insets/insettext.C: remove TEXT macro
2333 * src/insets/insetmarginal.C (Write): new method
2334 (Latex): change output slightly
2336 * src/insets/insetfoot.C (Write): new method
2337 (Latex): change output slightly (don't use endl when no need)
2339 * src/insets/insetert.C (Write): new method
2341 * src/insets/insetcollapsable.h: make button_length, button_top_y
2342 and button_bottm_y protected.
2344 * src/insets/insetcollapsable.C (Write): simplify code by using
2345 tostr. Also do not output the float name, the children class
2346 should to that to get control over own arguments
2348 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2349 src/insets/insetminipage.[Ch]:
2352 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2354 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2356 * src/Makefile.am (lyx_SOURCES): add the new files
2358 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2359 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2360 * src/commandtags.h: ditto
2362 * src/LaTeXFeatures.h: add a std::set of used floattypes
2364 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2366 * src/FloatList.[Ch] src/Floating.h: new files
2368 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2370 * src/lyx_cb.C (TableApplyCB): ditto
2372 * src/text2.C: ditto
2373 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2374 (parseSingleLyXformat2Token): ditto + add code for
2375 backwards compability for old float styles + add code for new insets
2377 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2379 (InsertInset(size_type, Inset *, LyXFont)): new method
2380 (InsetChar(size_type, char)): changed to use the other InsetChar
2381 with a LyXFont(ALL_INHERIT).
2382 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2383 insert the META_INSET.
2385 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2387 * sigc++/thread.h (Threads): from here
2389 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2390 definition out of line
2391 * sigc++/scope.h: from here
2393 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2395 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2396 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2398 * Makefile.am (bindist): new target.
2400 * INSTALL: add instructions for doing a binary distribution.
2402 * development/tools/README.bin.example: update a bit.
2404 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2407 * lib/lyxrc.example: new lyxrc tag \set_color.
2409 * src/lyxfunc.C (Dispatch):
2410 * src/commandtags.h:
2411 * src/LyXAction.C: new lyxfunc "set-color".
2413 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2414 and an x11name given as strings.
2416 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2417 cache when a color is changed.
2419 2000-06-26 Juergen Vigna <jug@sad.it>
2421 * src/lyxrow.C (width): added this functions and variable.
2423 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2426 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2428 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2430 * images/undo_bw.xpm: new icon.
2431 * images/redo_bw.xpm: ditto.
2433 * configure.in (INSTALL_SCRIPT): change value to
2434 ${INSTALL} to avoid failures of install-script target.
2435 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2437 * src/BufferView.h: add a magic "friend" declaration to please
2440 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2442 * forms/cite.fd: modified to allow resizing without messing
2445 * src/insetcite.C: Uses code from cite.fd almost without
2447 User can now resize dialog in the x-direction.
2448 Resizing the dialog in the y-direction is prevented, as the
2449 code does this intelligently already.
2451 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2453 * INSTALL: remove obsolete entry in "problems" section.
2455 * lib/examples/sl_*.lyx: update of the slovenian examples.
2457 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2459 2000-06-23 Juergen Vigna <jug@sad.it>
2461 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2463 * src/buffer.C (resize): delete the LyXText of textinsets.
2465 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2467 * src/insets/lyxinset.h: added another parameter 'cleared' to
2468 the draw() function.
2470 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2471 unlocking inset in inset.
2473 2000-06-22 Juergen Vigna <jug@sad.it>
2475 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2476 of insets and moved first to LyXText.
2478 * src/mathed/formulamacro.[Ch]:
2479 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2481 2000-06-21 Juergen Vigna <jug@sad.it>
2483 * src/text.C (GetVisibleRow): look if I should clear the area or not
2484 using Inset::doClearArea() function.
2486 * src/insets/lyxinset.h: added doClearArea() function and
2487 modified draw(Painter &, ...) to draw(BufferView *, ...)
2489 * src/text2.C (UpdateInset): return bool insted of int
2491 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2493 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2494 combox in the character popup
2496 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2497 BufferParams const & params
2499 2000-06-20 Juergen Vigna <jug@sad.it>
2501 * src/insets/insettext.C (SetParagraphData): set insetowner on
2504 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2506 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2507 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2509 (form_main_): remove
2511 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2512 (create_form_form_main): remove FD_form_main stuff, connect to
2513 autosave_timeout signal
2515 * src/LyXView.[Ch] (getMainForm): remove
2516 (UpdateTimerCB): remove
2517 * src/BufferView_pimpl.h: inherit from SigC::Object
2519 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2520 signal instead of callback
2522 * src/BufferView.[Ch] (cursorToggleCB): remove
2524 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2526 * src/BufferView_pimpl.C: changes because of the one below
2528 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2529 instead of storing a pointer to a LyXText.
2531 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2533 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2535 * src/lyxparagraph.h
2537 * src/paragraph.C: Changed fontlist to a sorted vector.
2539 2000-06-19 Juergen Vigna <jug@sad.it>
2541 * src/BufferView.h: added screen() function.
2543 * src/insets/insettext.C (LocalDispatch): some selection code
2546 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2548 * src/insets/insettext.C (SetParagraphData):
2550 (InsetText): fixes for multiple paragraphs.
2552 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2554 * development/lyx.spec.in: Call configure with ``--without-warnings''
2555 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2556 This should be fine, however, since we generally don't want to be
2557 verbose when making an RPM.
2559 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2561 * lib/scripts/fig2pstex.py: New file
2563 2000-06-16 Juergen Vigna <jug@sad.it>
2565 * src/insets/insettabular.C (UpdateLocal):
2566 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2567 (LocalDispatch): Changed all functions to use LyXText.
2569 2000-06-15 Juergen Vigna <jug@sad.it>
2571 * src/text.C (SetHeightOfRow): call inset::update before requesting
2574 * src/insets/insettext.C (update):
2575 * src/insets/insettabular.C (update): added implementation
2577 * src/insets/lyxinset.h: added update function
2579 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2581 * src/text.C (SelectNextWord): protect against null pointers with
2582 old-style string streams. (fix from Paul Theo Gonciari
2585 * src/cite.[Ch]: remove erroneous files.
2587 * lib/configure.m4: update the list of created directories.
2589 * src/lyxrow.C: include <config.h>
2590 * src/lyxcursor.C: ditto.
2592 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2594 * lib/examples/decimal.lyx: new example file from Mike.
2596 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2597 to find template definitions (from Dekel)
2599 * src/frontends/.cvsignore: add a few things.
2601 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2603 * src/Timeout.C (TimeOut): remove default argument.
2605 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2608 * src/insets/ExternalTemplate.C: add a "using" directive.
2610 * src/lyx_main.h: remove the act_ struct, which seems unused
2613 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2615 * LyX Developers Meeting: All files changed, due to random C++ (by
2616 coincidence) code generator script.
2618 - external inset (cool!)
2619 - initial online editing of preferences
2620 - insettabular breaks insettext(s contents)
2622 - some DocBook fixes
2623 - example files update
2624 - other cool stuff, create a diff and look for yourself.
2626 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2628 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2629 -1 this is a non-line-breaking textinset.
2631 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2632 if there is no width set.
2634 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2636 * Lots of files: Merged the dialogbase branch.
2638 2000-06-09 Allan Rae <rae@lyx.org>
2640 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2641 and the Dispatch methods that used it.
2643 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2644 access to functions formerly kept in Dispatch.
2646 2000-05-19 Allan Rae <rae@lyx.org>
2648 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2649 made to_page and count_copies integers again. from_page remains a
2650 string however because I want to allow entry of a print range like
2651 "1,4,22-25" using this field.
2653 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2654 and printer-params-get. These aren't useful from the minibuffer but
2655 could be used by a script/LyXServer app provided it passes a suitable
2656 auto_mem_buffer. I guess I should take a look at how the LyXServer
2657 works and make it support xtl buffers.
2659 * sigc++/: updated to libsigc++-1.0.1
2661 * src/xtl/: updated to xtl-1.3.pl.11
2663 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2664 those changes done to the files in src/ are actually recreated when
2665 they get regenerated. Please don't ever accept a patch that changes a
2666 dialog unless that patch includes the changes to the corresponding *.fd
2669 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2670 stringOnlyContains, renamed it and generalised it.
2672 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2673 branch. Removed the remaining old form_print code.
2675 2000-04-26 Allan Rae <rae@lyx.org>
2677 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2678 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2680 2000-04-25 Allan Rae <rae@lyx.org>
2682 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2683 against a base of xtl-1.3.pl.4
2685 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2686 filter the Id: entries so they still show the xtl version number
2689 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2690 into the src/xtl code. Patch still pending with José (XTL)
2692 2000-04-24 Allan Rae <rae@lyx.org>
2694 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2695 both more generic and much safer. Use the new template functions.
2696 * src/buffer.[Ch] (Dispatch): ditto.
2698 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2699 and mem buffer more intelligently. Also a little general cleanup.
2702 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2703 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2704 * src/xtl/Makefile.am: ditto.
2705 * src/xtl/.cvsignore: ditto.
2706 * src/Makefile.am: ditto.
2708 * src/PrinterParams.h: Removed the macros member functions. Added a
2709 testInvariant member function. A bit of tidying up and commenting.
2710 Included Angus's idea for fixing operation with egcs-1.1.2.
2712 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2713 cool expansion of XTL's mem_buffer to support automatic memory
2714 management within the buffer itself. Removed the various macros and
2715 replaced them with template functions that use either auto_mem_buffer
2716 or mem_buffer depending on a #define. The mem_buffer support will
2717 disappear as soon as the auto_mem_buffer is confirmed to be good on
2718 other platforms/compilers. That is, it's there so you've got something
2721 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2722 effectively forked XTL. However I expect José will include my code
2723 into the next major release. Also fixed a memory leak.
2724 * src/xtl/text.h: ditto.
2725 * src/xtl/xdr.h: ditto.
2726 * src/xtl/giop.h: ditto.
2728 2000-04-16 Allan Rae <rae@lyx.org>
2730 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2731 by autogen.sh and removed by maintainer-clean anyway.
2732 * .cvsignore, sigc++/.cvsignore: Support the above.
2734 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2736 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2738 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2739 macros, renamed static callback-target member functions to suit new
2740 scheme and made them public.
2741 * src/frontends/xforms/forms/form_print.fd: ditto.
2742 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2744 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2747 * src/xtl/: New directory containing a minimal distribution of XTL.
2748 This is XTL-1.3.pl.4.
2750 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2752 2000-04-15 Allan Rae <rae@lyx.org>
2754 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2756 * sigc++/: Updated to libsigc++-1.0.0
2758 2000-04-14 Allan Rae <rae@lyx.org>
2760 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2761 use the generic ones in future. I'll modify my conversion script.
2763 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2765 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2766 (CloseAllBufferRelatedDialogs): Renamed.
2767 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2769 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2770 of the generic ones. These are the same ones my conversion script
2773 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2774 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2775 * src/buffer.C (Dispatch): ditto
2777 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2778 functions for updating and hiding buffer dependent dialogs.
2779 * src/BufferView.C (buffer): ditto
2780 * src/buffer.C (setReadonly): ditto
2781 * src/lyxfunc.C (CloseBuffer): ditto
2783 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2784 Dialogs.h, and hence all the SigC stuff, into every file that includes
2785 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2787 * src/BufferView2.C: reduce the number of headers included by buffer.h
2789 2000-04-11 Allan Rae <rae@lyx.org>
2791 * src/frontends/xforms/xform_macros.h: A small collection of macros
2792 for building C callbacks.
2794 * src/frontends/xforms/Makefile.am: Added above file.
2796 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2797 scheme again. This time it should work for JMarc. If this is
2798 successful I'll revise my conversion script to automate some of this.
2799 The static member functions in the class also have to be public for
2800 this scheme will work. If the scheme works (it's almost identical to
2801 the way BufferView::cursorToggleCB is handled so it should work) then
2802 FormCopyright and FormPrint will be ready for inclusion into the main
2803 trunk immediately after 1.1.5 is released -- provided we're prepared
2804 for complaints about lame compilers not handling XTL.
2806 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2808 2000-04-07 Allan Rae <rae@lyx.org>
2810 * config/lyxinclude.m4: A bit more tidying up (Angus)
2812 * src/LString.h: JMarc's <string> header fix
2814 * src/PrinterParams.h: Used string for most data to remove some
2815 ugly code in the Print dialog and avoid even uglier code when
2816 appending the ints to a string for output.
2818 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2819 and moved "default:" back to the end of switch statement. Cleaned
2820 up the printing so it uses the right function calls and so the
2821 "print to file" option actually puts the file in the right directory.
2823 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2825 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2826 and Ok+Apply button control into a separate method: input (Angus).
2827 (input) Cleaned it up and improved it to be very thorough now.
2828 (All CB) static_cast used instead of C style cast (Angus). This will
2829 probably change again once we've worked out how to keep gcc-2.8.1 happy
2830 with real C callbacks.
2831 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2832 ignore some of the bool settings and has random numbers instead. Needs
2833 some more investigation. Added other input length checks and checking
2834 of file and printer names.
2836 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2837 would link (Angus). Seems the old code doesn't compile with the pragma
2838 statement either. Separated callback entries from internal methods.
2840 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2842 2000-03-17 Allan Rae <rae@lyx.org>
2844 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2845 need it? Maybe it could go in Dialogs instead? I could make it a
2846 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2847 values to get the bool return value.
2848 (Dispatch): New overloaded method for xtl support.
2850 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2851 extern "C" callback instead of static member functions. Hopefully,
2852 JMarc will be able to compile this. I haven't changed
2853 forms/form_copyright.fd yet. Breaking one of my own rules already.
2855 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2856 because they aren't useful from the minibuffer. Maybe a LyXServer
2857 might want a help message though?
2859 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2861 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2862 xtl which needs both rtti and exceptions.
2864 * src/support/Makefile.am:
2865 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2867 * src/frontends/xforms/input_validators.[ch]: input filters and
2868 validators. These conrol what keys are valid in input boxes.
2869 Use them and write some more. Much better idea than waiting till
2870 after the user has pressed Ok to say that the input fields don't make
2873 * src/frontends/xforms/Makefile.am:
2874 * src/frontends/xforms/forms/form_print.fd:
2875 * src/frontends/xforms/forms/makefile:
2876 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2877 new scheme. Still have to make sure I haven't missed anything from
2878 the current implementation.
2880 * src/Makefile.am, src/PrinterParams.h: New data store.
2882 * other files: Added a couple of copyright notices.
2884 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2886 * src/insets/insetbib.h: move Holder struct in public space.
2888 * src/frontends/include/DialogBase.h: use SigC:: only when
2889 SIGC_CXX_NAMESPACES is defined.
2890 * src/frontends/include/Dialogs.h: ditto.
2892 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2894 * src/frontends/xforms/FormCopyright.[Ch]: do not
2895 mention SigC:: explicitely.
2897 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2899 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2900 deals with testing KDE in main configure.in
2901 * configure.in: ditto.
2903 2000-02-22 Allan Rae <rae@lyx.org>
2905 * Lots of files: Merged from HEAD
2907 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2908 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2910 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2912 * sigc++/: new minidist.
2914 2000-02-14 Allan Rae <rae@lyx.org>
2916 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2918 2000-02-08 Juergen Vigna <jug@sad.it>
2920 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2921 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2923 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2924 for this port and so it is much easier for other people to port
2925 dialogs in a common development environment.
2927 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2928 the QT/KDE implementation.
2930 * src/frontends/kde/Dialogs.C:
2931 * src/frontends/kde/FormCopyright.C:
2932 * src/frontends/kde/FormCopyright.h:
2933 * src/frontends/kde/Makefile.am:
2934 * src/frontends/kde/formcopyrightdialog.C:
2935 * src/frontends/kde/formcopyrightdialog.h:
2936 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2937 for the kde support of the Copyright-Dialog.
2939 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2940 subdir-substitution instead of hardcoded 'xforms' as we now have also
2943 * src/frontends/include/DialogBase.h (Object): just commented the
2944 label after #endif (nasty warning and I don't like warnings ;)
2946 * src/main.C (main): added KApplication initialization if using
2949 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2950 For now only the KDE event-loop is added if frontend==kde.
2952 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2954 * configure.in: added support for the --with-frontend[=value] option
2956 * autogen.sh: added kde.m4 file to list of config-files
2958 * acconfig.h: added define for KDEGUI-support
2960 * config/kde.m4: added configuration functions for KDE-port
2962 * config/lyxinclude.m4: added --with-frontend[=value] option with
2963 support for xforms and KDE.
2965 2000-02-08 Allan Rae <rae@lyx.org>
2967 * all Makefile.am: Fixed up so the make targets dist, distclean,
2968 install and uninstall all work even if builddir != srcdir. Still
2969 have a new sigc++ minidist update to come.
2971 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2973 2000-02-01 Allan Rae <rae@lyx.org>
2975 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2976 Many mods to get builddir != srcdir working.
2978 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2979 for building on NT and so we can do the builddir != srcdir stuff.
2981 2000-01-30 Allan Rae <rae@lyx.org>
2983 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2984 This will stay in "rae" branch. We probably don't really need it in
2985 the main trunk as anyone who wants to help programming it should get
2986 a full library installed also. So they can check both included and
2987 system supplied library compilation.
2989 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2990 Added a 'mini' distribution of libsigc++. If you feel the urge to
2991 change something in these directories - Resist it. If you can't
2992 resist the urge then you should modify the following script and rebuild
2993 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2994 all happen. Still uses a hacked version of libsigc++'s configure.in.
2995 I'm quite happy with the results. I'm not sure the extra work to turn
2996 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2997 worth the trouble and would probably lead to extra maintenance
2999 I haven't tested the following important make targets: install, dist.
3000 Not ready for prime time but very close. Maybe 1.1.5.
3002 * development/tools/makeLyXsigc.sh: A shell script to automatically
3003 generate our mini-dist of libsigc++. It can only be used with a CVS
3004 checkout of libsigc++ not a tarball distribution. It's well commented.
3005 This will end up as part of the libsigc++ distribution so other apps
3006 can easily have an included mini-dist. If someone makes mods to the
3007 sigc++ subpackage without modifying this script to generate those
3008 changes I'll be very upset!
3010 * src/frontends/: Started the gui/system indep structure.
3012 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3013 to access the gui-indep dialogs are in this class. Much improved
3014 design compared to previous revision. Lars, please refrain from
3015 moving this header into src/ like you did with Popups.h last time.
3017 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3019 * src/frontends/xforms/: Started the gui-indep system with a single
3020 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3023 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3024 Here you'll find a very useful makefile and automated fdfix.sh that
3025 makes updating dailogs a no-brainer -- provided you follow the rules
3026 set out in the README. I'm thinking about adding another script to
3027 automatically generate skeleton code for a new dialog given just the
3030 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3031 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3032 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3034 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3036 * src/support/LSubstring.C (operator): simplify
3038 * src/lyxtext.h: removed bparams, use buffer_->params instead
3040 * src/lyxrow.h: make Row a real class, move all variables to
3041 private and use accessors.
3043 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3045 (isRightToLeftPar): ditto
3046 (ChangeLanguage): ditto
3047 (isMultiLingual): ditto
3050 (SimpleTeXOnePar): ditto
3051 (TeXEnvironment): ditto
3052 (GetEndLabel): ditto
3054 (SetOnlyLayout): ditto
3055 (BreakParagraph): ditto
3056 (BreakParagraphConservative): ditto
3057 (GetFontSettings): ditto
3059 (CopyIntoMinibuffer): ditto
3060 (CutIntoMinibuffer): ditto
3061 (PasteParagraph): ditto
3062 (SetPExtraType): ditto
3063 (UnsetPExtraType): ditto
3064 (DocBookContTableRows): ditto
3065 (SimpleDocBookOneTablePar): ditto
3067 (TeXFootnote): ditto
3068 (SimpleTeXOneTablePar): ditto
3069 (TeXContTableRows): ditto
3070 (SimpleTeXSpecialChars): ditto
3073 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3074 to private and use accessors.
3076 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3077 this, we did not use it anymore and has not been for ages. Just a
3078 waste of cpu cycles.
3080 * src/language.h: make Language a real class, move all variables
3081 to private and use accessors.
3083 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3084 (create_view): remove
3085 (update): some changes for new timer
3086 (cursorToggle): use new timer
3087 (beforeChange): change for new timer
3089 * src/BufferView.h (cursorToggleCB): removed last paramter because
3092 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3093 (cursorToggleCB): change because of new timer code
3095 * lib/CREDITS: updated own mailaddress
3097 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3099 * src/support/filetools.C (PutEnv): fix the code in case neither
3100 putenv() nor setenv() have been found.
3102 * INSTALL: mention the install-strip Makefile target.
3104 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3105 read-only documents.
3107 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3109 * lib/reLyX/configure.in (VERSION): avoid using a previously
3110 generated reLyX wrapper to find out $prefix.
3112 * lib/examples/eu_adibide_lyx-atua.lyx:
3113 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3114 translation of the Tutorial (Dooteo)
3116 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3118 * forms/cite.fd: new citation dialog
3120 * src/insetcite.[Ch]: the new citation dialog is moved into
3123 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3126 * src/insets/insetcommand.h: data members made private.
3128 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3130 * LyX 1.1.5 released
3132 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3134 * src/version.h (LYX_RELEASE): to 1.1.5
3136 * src/spellchecker.C (RunSpellChecker): return false if the
3137 spellchecker dies upon creation.
3139 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3141 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3142 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3146 * lib/CREDITS: update entry for Martin Vermeer.
3148 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3150 * src/text.C (draw): Draw foreign language bars at the bottom of
3151 the row instead of at the baseline.
3153 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3155 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3157 * lib/bind/de_menus.bind: updated
3159 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3161 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3163 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3165 * src/menus.C (Limit_string_length): New function
3166 (ShowTocMenu): Limit the number of items/length of items in the
3169 * src/paragraph.C (String): Correct result for a paragraph inside
3172 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3174 * src/bufferlist.C (close): test of buf->getuser() == NULL
3176 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3178 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3179 Do not call to SetCursor when the paragraph is a closed footnote!
3181 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3183 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3186 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3188 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3191 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3192 reference popup, that activates the reference-back action
3194 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3196 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3197 the menus. Also fixed a bug.
3199 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3200 the math panels when switching buffers (unless new buffer is readonly).
3202 * src/BufferView.C (NoSavedPositions)
3203 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3205 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3207 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3208 less of dvi dirty or not.
3210 * src/trans_mgr.[Ch] (insert): change first parameter to string
3213 * src/chset.[Ch] (encodeString): add const to first parameter
3215 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3217 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3221 * src/LaTeX.C (deplog): better searching for dependency files in
3222 the latex log. Uses now regexps.
3224 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3225 instead of the box hack or \hfill.
3227 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3229 * src/lyxfunc.C (doImportHelper): do not create the file before
3230 doing the actual import.
3231 (doImportASCIIasLines): create a new file before doing the insert.
3232 (doImportASCIIasParagraphs): ditto.
3234 * lib/lyxrc.example: remove mention of non-existing commands
3236 * lyx.man: remove mention of color-related switches.
3238 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3240 * src/lyx_gui.C: remove all the color-related ressources, which
3241 are not used anymore.
3243 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3246 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3248 * src/lyxrc.C (read): Add a missing break in the switch
3250 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3252 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3254 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3257 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3259 * src/text.C (draw): draw bars under foreign language words.
3261 * src/LColor.[Ch]: add LColor::language
3263 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3265 * src/lyxcursor.h (boundary): New member variable
3267 * src/text.C (IsBoundary): New methods
3269 * src/text.C: Use the above for currect cursor movement when there
3270 is both RTL & LTR text.
3272 * src/text2.C: ditto
3274 * src/bufferview_funcs.C (ToggleAndShow): ditto
3276 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3278 * src/text.C (DeleteLineForward): set selection to true to avoid
3279 that DeleteEmptyParagraphMechanism does some magic. This is how it
3280 is done in all other functions, and seems reasonable.
3281 (DeleteWordForward): do not jump over non-word stuff, since
3282 CursorRightOneWord() already does it.
3284 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3285 DeleteWordBackward, since they seem safe to me (since selection is
3286 set to "true") DeleteEmptyParagraphMechanism does nothing.
3288 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3290 * src/lyx_main.C (easyParse): simplify the code by factoring the
3291 part that removes parameters from the command line.
3292 (LyX): check wether wrong command line options have been given.
3294 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3296 * src/lyx_main.C : add support for specifying user LyX
3297 directory via command line option -userdir.
3299 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3301 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3302 the number of items per popup.
3303 (Add_to_refs_menu): Ditto.
3305 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3307 * src/lyxparagraph.h: renamed ClearParagraph() to
3308 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3309 textclass as parameter, and do nothing if free_spacing is
3310 true. This fixes part of the line-delete-forward problems.
3312 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3313 (pasteSelection): ditto.
3314 (SwitchLayoutsBetweenClasses): more translatable strings.
3316 * src/text2.C (CutSelection): use StripLeadingSpaces.
3317 (PasteSelection): ditto.
3318 (DeleteEmptyParagraphMechanism): ditto.
3320 2000-05-26 Juergen Vigna <jug@sad.it>
3322 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3323 is not needed in tabular insets.
3325 * src/insets/insettabular.C (TabularFeatures): added missing features.
3327 * src/tabular.C (DeleteColumn):
3329 (AppendRow): implemented this functions
3330 (cellsturct::operator=): clone the inset too;
3332 2000-05-23 Juergen Vigna <jug@sad.it>
3334 * src/insets/insettabular.C (LocalDispatch): better selection support
3335 when having multicolumn-cells.
3337 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3339 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3341 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3343 * src/ColorHandler.C (getGCForeground): put more test into _()
3345 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3348 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3351 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3353 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3354 there are no labels, or when buffer is readonly.
3356 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3357 there are no labels, buffer is SGML, or when buffer is readonly.
3359 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3361 * src/LColor.C (LColor): change a couple of grey40 to grey60
3362 (LColor): rewore initalization to make compiles go some magnitude
3364 (getGUIName): don't use gettext until we need the string.
3366 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3368 * src/Bullet.[Ch]: Fixed a small bug.
3370 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3372 * src/paragraph.C (String): Several fixes/improvements
3374 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3376 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3378 * src/paragraph.C (String): give more correct output.
3380 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3382 * src/lyxfont.C (stateText) Do not output the language if it is
3383 eqaul to the language of the document.
3385 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3386 between two paragraphs with the same language.
3388 * src/paragraph.C (getParLanguage) Return a correct answer for an
3389 empty dummy paragraph.
3391 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3394 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3397 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3398 the menus/popup, if requested fonts are unavailable.
3400 2000-05-22 Juergen Vigna <jug@sad.it>
3402 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3403 movement support (Up/Down/Tab/Shift-Tab).
3404 (LocalDispatch): added also preliminari cursor-selection.
3406 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3408 * src/paragraph.C (PasteParagraph): Hopefully now right!
3410 2000-05-22 Garst R. Reese <reese@isn.net>
3412 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3413 of list, change all references to Environment to Command
3414 * tex/hollywood.cls : rewrite environments as commands, add
3415 \uppercase to interiorshot and exteriorshot to force uppecase.
3416 * tex/broadway.cls : rewrite environments as commands. Tweak
3419 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3421 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3422 size of items: use a constant intead of the hardcoded 40, and more
3423 importantly do not remove the %m and %x tags added at the end.
3424 (Add_to_refs_menu): use vector::size_type instead of
3425 unsigned int as basic types for the variables. _Please_ do not
3426 assume that size_t is equal to unsigned int. On an alpha, this is
3427 unsigned long, which is _not_ the same.
3429 * src/language.C (initL): remove language "hungarian", since it
3430 seems that "magyar" is better.
3432 2000-05-22 Juergen Vigna <jug@sad.it>
3434 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3436 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3439 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3440 next was deleted but not set to 0.
3442 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3444 * src/language.C (initL): change the initialization of languages
3445 so that compiles goes _fast_.
3447 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3450 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3452 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3456 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3458 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3460 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3464 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3467 * src/insets/insetlo*.[Ch]: Made editable
3469 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3471 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3472 the current selection.
3474 * src/BufferView_pimpl.C (stuffClipboard): new method
3476 * src/BufferView.C (stuffClipboard): new method
3478 * src/paragraph.C (String): new method
3480 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3481 LColor::ignore when lyxname is not found.
3483 * src/BufferView.C (pasteSelection): new method
3485 * src/BufferView_pimpl.C (pasteSelection): new method
3487 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3489 * src/WorkArea.C (request_clipboard_cb): new static function
3490 (getClipboard): new method
3491 (putClipboard): new method
3493 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3495 * LyX 1.1.5pre2 released
3497 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3499 * src/vspace.C (operator=): removed
3500 (operator=): removed
3502 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3504 * src/layout.C (NumberOfClass): manually set the type in make_pair
3505 (NumberOfLayout): ditto
3507 * src/language.C: use the Language constructor for ignore_lang
3509 * src/language.h: add constructors to struct Language
3511 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3513 * src/text2.C (SetCursorIntern): comment out #warning
3515 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3517 * src/mathed/math_iter.h: initialize sx and sw to 0
3519 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3521 * forms/lyx.fd: Redesign of form_ref
3523 * src/LaTeXFeatures.[Ch]
3527 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3530 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3531 and Buffer::inset_iterator.
3533 * src/menus.C: Added new menus: TOC and Refs.
3535 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3537 * src/buffer.C (getTocList): New method.
3539 * src/BufferView2.C (ChangeRefs): New method.
3541 * src/buffer.C (getLabelList): New method. It replaces the old
3542 getReferenceList. The return type is vector<string> instead of
3545 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3546 the old getLabel() and GetNumberOfLabels() methods.
3547 * src/insets/insetlabel.C (getLabelList): ditto
3548 * src/mathed/formula.C (getLabelList): ditto
3550 * src/paragraph.C (String): New method.
3552 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3553 Uses the new getTocList() method.
3554 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3555 which automatically updates the contents of the browser.
3556 (RefUpdateCB): Use the new getLabelList method.
3558 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3560 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3562 * src/spellchecker.C: Added using std::reverse;
3564 2000-05-19 Juergen Vigna <jug@sad.it>
3566 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3568 * src/insets/insettext.C (computeTextRows): small fix for display of
3569 1 character after a newline.
3571 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3574 2000-05-18 Juergen Vigna <jug@sad.it>
3576 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3577 when changing width of column.
3579 * src/tabular.C (set_row_column_number_info): setting of
3580 autobreak rows if necessary.
3582 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3584 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3586 * src/vc-backend.*: renamed stat() to status() and vcstat to
3587 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3588 compilation broke. The new name seems more relevant, anyway.
3590 2000-05-17 Juergen Vigna <jug@sad.it>
3592 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3593 which was wrong if the removing caused removing of rows!
3595 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3596 (pushToken): new function.
3598 * src/text2.C (CutSelection): fix problem discovered with purify
3600 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3602 * src/debug.C (showTags): enlarge the first column, now that we
3603 have 6-digits debug codes.
3605 * lib/layouts/hollywood.layout:
3606 * lib/tex/hollywood.cls:
3607 * lib/tex/brodway.cls:
3608 * lib/layouts/brodway.layout: more commands and fewer
3609 environments. Preambles moved in the .cls files. Broadway now has
3610 more options on scene numbering and less whitespace (from Garst)
3612 * src/insets/insetbib.C (getKeys): make sure that we are in the
3613 document directory, in case the bib file is there.
3615 * src/insets/insetbib.C (Latex): revert bogus change.
3617 2000-05-16 Juergen Vigna <jug@sad.it>
3619 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3620 the TabularLayout on cursor move.
3622 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3624 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3627 (draw): fixed cursor position and drawing so that the cursor is
3628 visible when before the tabular-inset.
3630 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3631 when creating from old insettext.
3633 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3635 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3637 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3638 * lib/tex/brodway.cls: ditto
3640 * lib/layouts/brodway.layout: change alignment of parenthical
3643 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3645 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3646 versions 0.88 and 0.89 are supported.
3648 2000-05-15 Juergen Vigna <jug@sad.it>
3650 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3653 * src/insets/insettext.C (computeTextRows): redone completely this
3654 function in a much cleaner way, because of problems when having a
3656 (draw): added a frame border when the inset is locked.
3657 (SetDrawLockedFrame): this sets if we draw the border or not.
3658 (SetFrameColor): this sets the frame color (default=insetframe).
3660 * src/insets/lyxinset.h: added x() and y() functions which return
3661 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3662 function which is needed to see if we have a locking inset of some
3663 type in this inset (needed for now in insettabular).
3665 * src/vspace.C (inPixels): the same function also without a BufferView
3666 parameter as so it is easier to use it in some ocasions.
3668 * src/lyxfunc.C: changed all places where insertInset was used so
3669 that now if it couldn't be inserted it is deleted!
3671 * src/TabularLayout.C:
3672 * src/TableLayout.C: added support for new tabular-inset!
3674 * src/BufferView2.C (insertInset): this now returns a bool if the
3675 inset was really inserted!!!
3677 * src/tabular.C (GetLastCellInRow):
3678 (GetFirstCellInRow): new helper functions.
3679 (Latex): implemented for new tabular class.
3683 (TeXTopHLine): new Latex() helper functions.
3685 2000-05-12 Juergen Vigna <jug@sad.it>
3687 * src/mathed/formulamacro.C (Read):
3688 * src/mathed/formula.C (Read): read also the \end_inset here!
3690 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3692 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3693 crush when saving formulae with unbalanced parenthesis.
3695 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3697 * src/layout.C: Add new keyword "endlabelstring" to layout file
3699 * src/text.C (GetVisibleRow): Draw endlabel string.
3701 * lib/layouts/broadway.layout
3702 * lib/layouts/hollywood.layout: Added endlabel for the
3703 Parenthetical layout.
3705 * lib/layouts/heb-article.layout: Do not use slanted font shape
3706 for Theorem like environments.
3708 * src/buffer.C (makeLaTeXFile): Always add "american" to
3709 the UsedLanguages list if document language is RTL.
3711 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3713 * add addendum to README.OS2 and small patch (from SMiyata)
3715 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3717 * many files: correct the calls to ChangeExtension().
3719 * src/support/filetools.C (ChangeExtension): remove the no_path
3720 argument, which does not belong there. Use OnlyFileName() instead.
3722 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3723 files when LaTeXing a non-nice latex file.
3725 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3726 a chain of "if". Return false when deadkeys are not handled.
3728 * src/lyx_main.C (LyX): adapted the code for default bindings.
3730 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3731 bindings for basic functionality (except deadkeys).
3732 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3734 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3735 several methods: handle override_x_deadkeys.
3737 * src/lyxrc.h: remove the "bindings" map, which did not make much
3738 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3740 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3742 * src/lyxfont.C (stateText): use a saner method to determine
3743 whether the font is "default". Seems to fix the crash with DEC
3746 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3748 2000-05-08 Juergen Vigna <jug@sad.it>
3750 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3751 TabularLayoutMenu with mouse-button-3
3752 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3754 * src/TabularLayout.C: added this file for having a Layout for
3757 2000-05-05 Juergen Vigna <jug@sad.it>
3759 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3760 recalculating inset-widths.
3761 (TabularFeatures): activated this function so that I can change
3762 tabular-features via menu.
3764 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3765 that I can test some functions with the Table menu.
3767 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3769 * src/lyxfont.C (stateText): guard against stupid c++libs.
3771 * src/tabular.C: add using std::vector
3772 some whitespace changes, + removed som autogenerated code.
3774 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3776 2000-05-05 Juergen Vigna <jug@sad.it>
3778 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3779 row, columns and cellstructures.
3781 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3783 * lib/lyxrc.example: remove obsolete entries.
3785 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3786 reading of protected_separator for free_spacing.
3788 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3790 * src/text.C (draw): do not display an exclamation mark in the
3791 margin for margin notes. This is confusing, ugly and
3794 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3795 AMS math' is checked.
3797 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3798 name to see whether including the amsmath package is needed.
3800 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3802 * src/paragraph.C (validate): Compute UsedLanguages correctly
3803 (don't insert the american language if it doesn't appear in the
3806 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3807 The argument of \thanks{} command is considered moving argument
3809 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3812 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3814 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3815 for appendix/minipage/depth. The lines can be now both in the footnote
3816 frame, and outside the frame.
3818 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3821 2000-05-05 Juergen Vigna <jug@sad.it>
3823 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3824 neede only in tabular.[Ch].
3826 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3828 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3830 (Write): write '~' for PROTECTED_SEPARATOR
3832 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3834 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3837 * src/mathed/formula.C (drawStr): rename size to siz.
3839 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3840 possibly fix a bug by not changing the pflags = flags to piflags =
3843 2000-05-05 Juergen Vigna <jug@sad.it>
3845 * src/insets/insetbib.C: moved using directive
3847 * src/ImportNoweb.C: small fix for being able to compile (missing
3850 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3852 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3853 to use clear, since we don't depend on this in the code. Add test
3856 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * (various *.C files): add using std::foo directives to please dec
3861 * replace calls to string::clear() to string::erase() (Angus)
3863 * src/cheaders/cmath: modified to provide std::abs.
3865 2000-05-04 Juergen Vigna <jug@sad.it>
3867 * src/insets/insettext.C: Prepared all for inserting of multiple
3868 paragraphs. Still display stuff to do (alignment and other things),
3869 but I would like to use LyXText to do this when we cleaned out the
3870 table-support stuff.
3872 * src/insets/insettabular.C: Changed lot of stuff and added lots
3873 of functionality still a lot to do.
3875 * src/tabular.C: Various functions changed name and moved to be
3876 const functions. Added new Read and Write functions and changed
3877 lots of things so it works good with tabular-insets (also removed
3878 some stuff which is not needed anymore * hacks *).
3880 * src/lyxcursor.h: added operators == and != which just look if
3881 par and pos are (not) equal.
3883 * src/buffer.C (latexParagraphs): inserted this function to latex
3884 all paragraphs form par to endpar as then I can use this too for
3887 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3888 so that I can call this to from text insets with their own cursor.
3890 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3891 output off all paragraphs (because of the fix below)!
3893 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3894 the very last paragraph (this could be also the last paragraph of an
3897 * src/texrow.h: added rows() call which returns the count-variable.
3899 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3901 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3903 * lib/configure.m4: better autodetection of DocBook tools.
3905 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3907 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3909 * src/lyx_cb.C: add using std::reverse;
3911 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3914 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3915 selected files. Should fix repeated errors from generated files.
3917 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3919 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3921 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3922 the spellchecker popup.
3924 * lib/lyxrc.example: Removed the \number_inset section
3926 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3928 * src/insets/figinset.C (various): Use IsFileReadable() to make
3929 sure that the file actually exist. Relying on ghostscripts errors
3930 is a bad idea since they can lead to X server crashes.
3932 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3934 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3937 * lib/lyxrc.example: smallish typo in description of
3938 \view_dvi_paper_option
3940 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3943 * src/lyxfunc.C: doImportHelper to factor out common code of the
3944 various import methods. New functions doImportASCIIasLines,
3945 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3946 doImportLinuxDoc for the format specific parts.
3949 * buffer.C: Dispatch returns now a bool to indicate success
3952 * lyx_gui.C: Add getLyXView() for member access
3954 * lyx_main.C: Change logic for batch commands: First try
3955 Buffer::Dispatch (possibly without GUI), if that fails, use
3958 * lyx_main.C: Add support for --import command line switch.
3959 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3960 Available Formats: Everything accepted by 'buffer-import <format>'
3962 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3964 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3967 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3968 documents will be reformatted upon reentry.
3970 2000-04-27 Juergen Vigna <jug@sad.it>
3972 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3973 correctly only last pos this was a bug.
3975 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3977 * release of lyx-1.1.5pre1
3979 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3981 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3983 * src/menus.C: revert the change of naming (Figure->Graphic...)
3984 from 2000-04-11. It was incomplete and bad.
3986 * src/LColor.[Ch]: add LColor::depthbar.
3987 * src/text.C (GetVisibleRow): use it.
3989 * README: update the languages list.
3991 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3993 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3996 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3998 * README: remove sections that were just wrong.
4000 * src/text2.C (GetRowNearY): remove currentrow code
4002 * src/text.C (GetRow): remove currentrow code
4004 * src/screen.C (Update): rewritten a bit.
4005 (SmallUpdate): removed func
4007 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4009 (FullRebreak): return bool
4010 (currentrow): remove var
4011 (currentrow_y): ditto
4013 * src/lyxscreen.h (Draw): change arg to unsigned long
4014 (FitCursor): return bool
4015 (FitManualCursor): ditto
4016 (Smallpdate): remove func
4017 (first): change to unsigned long
4018 (DrawOneRow): change second arg to long (from long &)
4019 (screen_refresh_y): remove var
4020 (scree_refresh_row): ditto
4022 * src/lyxrow.h: change baseline to usigned int from unsigned
4023 short, this brings some implicit/unsigned issues out in the open.
4025 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4027 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4028 instead of smallUpdate.
4030 * src/lyxcursor.h: change y to unsigned long
4032 * src/buffer.h: don't call updateScrollbar after fitcursor
4034 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4035 where they are used. Removed "\\direction", this was not present
4036 in 1.1.4 and is already obsolete. Commented out some code that I
4037 believe to never be called.
4038 (runLiterate): don't call updateScrollbar after fitCursor
4040 (buildProgram): ditto
4043 * src/WorkArea.h (workWidth): change return val to unsigned
4046 (redraw): remove the button redraws
4047 (setScrollbarValue): change for scrollbar
4048 (getScrollbarValue): change for scrollbar
4049 (getScrollbarBounds): change for scrollbar
4051 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4052 (C_WorkArea_down_cb): removed func
4053 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4054 (resize): change for scrollbar
4055 (setScrollbar): ditto
4056 (setScrollbarBounds): ditto
4057 (setScrollbarIncrements): ditto
4058 (up_cb): removed func
4059 (down_cb): removed func
4060 (scroll_cb): change for scrollbar
4061 (work_area_handler): ditto
4063 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4064 when FitCursor did something.
4065 (updateScrollbar): some unsigned changes
4066 (downCB): removed func
4067 (scrollUpOnePage): removed func
4068 (scrollDownOnePage): remvoed func
4069 (workAreaMotionNotify): don't call screen->FitCursor but use
4070 fitCursor instead. and bool return val
4071 (workAreaButtonPress): ditto
4072 (workAreaButtonRelease): some unsigned changes
4073 (checkInsetHit): ditto
4074 (workAreaExpose): ditto
4075 (update): parts rewritten, comments about the signed char arg added
4076 (smallUpdate): removed func
4077 (cursorPrevious): call needed updateScrollbar
4080 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4083 * src/BufferView.[Ch] (upCB): removed func
4084 (downCB): removed func
4085 (smallUpdate): removed func
4087 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4089 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4090 currentrow, currentrow_y optimization. This did not help a lot and
4091 if we want to do this kind of optimization we should rather use
4092 cursor.row instead of the currentrow.
4094 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4095 buffer spacing and klyx spacing support.
4097 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4099 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4102 2000-04-26 Juergen Vigna <jug@sad.it>
4104 * src/insets/figinset.C: fixes to Lars sstream changes!
4106 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4108 * A lot of files: Added Ascii(ostream &) methods to all inset
4109 classes. Used when exporting to ASCII.
4111 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4112 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4115 * src/text2.C (ToggleFree): Disabled implicit word selection when
4116 there is a change in the language
4118 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4119 no output was generated for end-of-sentence inset.
4121 * src/insets/lyxinset.h
4124 * src/paragraph.C: Removed the insetnumber code
4126 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4128 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4130 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4131 no_babel and no_epsfig completely from the file.
4132 (parseSingleLyXformat2Token): add handling for per-paragraph
4133 spacing as written by klyx.
4135 * src/insets/figinset.C: applied patch by Andre. Made it work with
4138 2000-04-20 Juergen Vigna <jug@sad.it>
4140 * src/insets/insettext.C (cutSelection):
4141 (copySelection): Fixed with selection from right to left.
4142 (draw): now the rows are not recalculated at every draw.
4143 (computeTextRows): for now reset the inset-owner here (this is
4144 important for an undo or copy where the inset-owner is not set
4147 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4148 motion to the_locking_inset screen->first was forgotten, this was
4149 not important till we got multiline insets.
4151 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4153 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4154 code seems to be alright (it is code changed by Dekel, and the
4155 intent is indeed that all macros should be defined \protect'ed)
4157 * NEWS: a bit of reorganisation of the new user-visible features.
4159 2000-04-19 Juergen Vigna <jug@sad.it>
4161 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4162 position. Set the inset_owner of the used paragraph so that it knows
4163 that it is inside an inset. Fixed cursor handling with mouse and
4164 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4165 and cleanups to make TextInsets work better.
4167 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4168 Changed parameters of various functions and added LockInsetInInset().
4170 * src/insets/insettext.C:
4172 * src/insets/insetcollapsable.h:
4173 * src/insets/insetcollapsable.C:
4174 * src/insets/insetfoot.h:
4175 * src/insets/insetfoot.C:
4176 * src/insets/insetert.h:
4177 * src/insets/insetert.C: cleaned up the code so that it works now
4178 correctly with insettext.
4180 * src/insets/inset.C:
4181 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4182 that insets in insets are supported right.
4185 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4187 * src/paragraph.C: some small fixes
4189 * src/debug.h: inserted INSETS debug info
4191 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4192 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4194 * src/commandtags.h:
4195 * src/LyXAction.C: insert code for InsetTabular.
4197 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4198 not Button1MotionMask.
4199 (workAreaButtonRelease): send always a InsetButtonRelease event to
4201 (checkInsetHit): some setCursor fixes (always with insets).
4203 * src/BufferView2.C (lockInset): returns a bool now and extended for
4204 locking insets inside insets.
4205 (showLockedInsetCursor): it is important to have the cursor always
4206 before the locked inset.
4207 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4209 * src/BufferView.h: made lockInset return a bool.
4211 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4213 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4214 that is used also internally but can be called as public to have back
4215 a cursor pos which is not set internally.
4216 (SetCursorIntern): Changed to use above function.
4218 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4220 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4225 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4226 patches for things that should be in or should be changed.
4228 * src/* [insetfiles]: change "usigned char fragile" to bool
4229 fragile. There was only one point that could that be questioned
4230 and that is commented in formulamacro.C. Grep for "CHECK".
4232 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4233 (DeleteBuffer): take it out of CutAndPaste and make it static.
4235 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4237 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4238 output the spacing envir commands. Also the new commands used in
4239 the LaTeX output makes the result better.
4241 * src/Spacing.C (writeEnvirBegin): new method
4242 (writeEnvirEnd): new method
4244 2000-04-18 Juergen Vigna <jug@sad.it>
4246 * src/CutAndPaste.C: made textclass a static member of the class
4247 as otherwise it is not accesed right!!!
4249 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4251 * forms/layout_forms.fd
4252 * src/layout_forms.h
4253 * src/layout_forms.C (create_form_form_character)
4254 * src/lyx_cb.C (UserFreeFont)
4255 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4256 documents (in the layout->character popup).
4258 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4260 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4261 \spell_command was in fact not honored (from Kevin Atkinson).
4263 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4266 * src/lyx_gui.h: make lyxViews private (Angus)
4268 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4270 * src/mathed/math_write.C
4271 (MathMatrixInset::Write) Put \protect before \begin{array} and
4272 \end{array} if fragile
4273 (MathParInset::Write): Put \protect before \\ if fragile
4275 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4277 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4278 initialization if the LyXColorHandler must be done after the
4279 connections to the XServer has been established.
4281 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4282 get the background pixel from the lyxColorhandler so that the
4283 figures are rendered with the correct background color.
4284 (NextToken): removed functions.
4285 (GetPSSizes): use ifs >> string instead of NextToken.
4287 * src/Painter.[Ch]: the color cache moved out of this file.
4289 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4292 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4294 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4295 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4297 * src/BufferView.C (enterView): new func
4298 (leaveView): new func
4300 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4302 (leaveView): new func, undefines xterm cursor when approp.
4304 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4305 (AllowInput): delete the Workarea cursor handling from this func.
4307 * src/Painter.C (underline): draw a slimer underline in most cases.
4309 * src/lyx_main.C (error_handler): use extern "C"
4311 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4313 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4314 sent directly to me.
4316 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4317 to the list by Dekel.
4319 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4322 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4323 methods from lyx_cb.here.
4325 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4328 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4330 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4331 instead of using current_view directly.
4333 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4335 * src/LyXAction.C (init): add the paragraph-spacing command.
4337 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4339 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4341 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4342 different from the documents.
4344 * src/text.C (SetHeightOfRow): take paragraph spacing into
4345 account, paragraph spacing takes precedence over buffer spacing
4346 (GetVisibleRow): ditto
4348 * src/paragraph.C (writeFile): output the spacing parameter too.
4349 (validate): set the correct features if spacing is used in the
4351 (Clear): set spacing to default
4352 (MakeSameLayout): spacing too
4353 (HasSameLayout): spacing too
4354 (SetLayout): spacing too
4355 (TeXOnePar): output the spacing commands
4357 * src/lyxparagraph.h: added a spacing variable for use with
4358 per-paragraph spacing.
4360 * src/Spacing.h: add a Default spacing and a method to check if
4361 the current spacing is default. also added an operator==
4363 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4366 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4368 * src/lyxserver.C (callback): fix dispatch of functions
4370 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4371 printf() into lyxerr call.
4373 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4376 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4377 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4378 the "Float" from each of the subitems.
4379 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4381 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4382 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4383 documented the change so that the workaround can be nuked later.
4385 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4388 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4390 * src/buffer.C (getLatexName): ditto
4391 (setReadonly): ditto
4393 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4396 avoid some uses of current_view. Added also a bufferParams()
4397 method to get at this.
4399 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4401 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4403 * src/lyxparagraph.[Ch]: removed
4404 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4405 with operators used by lower_bound and
4406 upper_bound in InsetTable's
4407 Make struct InsetTable private again. Used matchpos.
4409 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4411 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4412 document, the language of existing text is changed (unless the
4413 document is multi-lingual)
4415 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4417 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4419 * A lot of files: A rewrite of the Right-to-Left support.
4421 2000-04-10 Juergen Vigna <jug@sad.it>
4423 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4424 misplaced cursor when inset in inset is locked.
4426 * src/insets/insettext.C (LocalDispatch): small fix so that a
4427 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4429 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4430 footnote font should be decreased in size twice when displaying.
4432 * src/insets/insettext.C (GetDrawFont): inserted this function as
4433 the drawing-font may differ from the real paragraph font.
4435 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4436 insets (inset in inset!).
4438 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4439 function here because we don't want footnotes inside footnotes.
4441 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4443 (init): now set the inset_owner in paragraph.C
4444 (LocalDispatch): added some resetPos() in the right position
4447 (pasteSelection): changed to use the new CutAndPaste-Class.
4449 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4450 which tells if it is allowed to insert another inset inside this one.
4452 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4453 SwitchLayoutsBetweenClasses.
4455 * src/text2.C (InsertInset): checking of the new paragraph-function
4457 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4458 is not needed anymore here!
4461 (PasteSelection): redone (also with #ifdef) so that now this uses
4462 the CutAndPaste-Class.
4463 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4466 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4467 from/to text/insets.
4469 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4470 so that the paragraph knows if it is inside an (text)-inset.
4471 (InsertFromMinibuffer): changed return-value to bool as now it
4472 may happen that an inset is not inserted in the paragraph.
4473 (InsertInsetAllowed): this checks if it is allowed to insert an
4474 inset in this paragraph.
4476 (BreakParagraphConservative):
4477 (BreakParagraph) : small change for the above change of the return
4478 value of InsertFromMinibuffer.
4480 * src/lyxparagraph.h: added inset_owner and the functions to handle
4481 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4483 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4486 functions from BufferView to BufferView::Pimpl to ease maintence.
4488 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4489 correctly. Also use SetCursorIntern instead of SetCursor.
4491 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4494 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4496 * src/WorkArea.C (belowMouse): manually implement below mouse.
4498 * src/*: Add "explicit" on several constructors, I added probably
4499 some unneeded ones. A couple of changes to code because of this.
4501 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4502 implementation and private parts from the users of BufferView. Not
4505 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4506 implementation and private parts from the users of LyXLex. Not
4509 * src/BufferView_pimpl.[Ch]: new files
4511 * src/lyxlex_pimpl.[Ch]: new files
4513 * src/LyXView.[Ch]: some inline functions move out-of-line
4515 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4517 * src/lyxparagraph.h: make struct InsetTable public.
4519 * src/support/lyxstring.h: change lyxstring::difference_type to be
4520 ptrdiff_t. Add std:: modifiers to streams.
4522 * src/font.C: include the <cctype> header, for islower() and
4525 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4527 * src/font.[Ch]: new files. Contains the metric functions for
4528 fonts, takes a LyXFont as parameter. Better separation of concepts.
4530 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4531 changes because of this.
4533 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4535 * src/*: compile with -Winline and move functions that don't
4538 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4541 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4543 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4544 (various files changed because of this)
4546 * src/Painter.C (text): fixed the drawing of smallcaps.
4548 * src/lyxfont.[Ch] (drawText): removed unused member func.
4551 * src/*.C: added needed "using" statements and "std::" qualifiers.
4553 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4555 * src/*.h: removed all use of "using" from header files use
4556 qualifier std:: instead.
4558 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4560 * src/text.C (Backspace): some additional cleanups (we already
4561 know whether cursor.pos is 0 or not).
4563 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4564 automake does not provide one).
4566 * src/bmtable.h: replace C++ comments with C comments.
4568 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4570 * src/screen.C (ShowCursor): Change the shape of the cursor if
4571 the current language is not equal to the language of the document.
4572 (If the cursor change its shape unexpectedly, then you've found a bug)
4574 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4577 * src/insets/insetnumber.[Ch]: New files.
4579 * src/LyXAction.C (init)
4580 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4583 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4585 * src/lyxparagraph.h
4586 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4587 (the vector is kept sorted).
4589 * src/text.C (GetVisibleRow): Draw selection correctly when there
4590 is both LTR and RTL text.
4592 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4593 which is much faster.
4595 * src/text.C (GetVisibleRow and other): Do not draw the last space
4596 in a row if the direction of the last letter is not equal to the
4597 direction of the paragraph.
4599 * src/lyxfont.C (latexWriteStartChanges):
4600 Check that font language is not equal to basefont language.
4601 (latexWriteEndChanges): ditto
4603 * src/lyx_cb.C (StyleReset): Don't change the language while using
4604 the font-default command.
4606 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4607 empty paragraph before a footnote.
4609 * src/insets/insetcommand.C (draw): Increase x correctly.
4611 * src/screen.C (ShowCursor): Change cursor shape if
4612 current language != document language.
4614 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4616 2000-03-31 Juergen Vigna <jug@sad.it>
4618 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4619 (Clone): changed mode how the paragraph-data is copied to the
4620 new clone-paragraph.
4622 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4623 GetInset(pos) with no inset anymore there (in inset UNDO)
4625 * src/insets/insetcommand.C (draw): small fix as here x is
4626 incremented not as much as width() returns (2 before, 2 behind = 4)
4628 2000-03-30 Juergen Vigna <jug@sad.it>
4630 * src/insets/insettext.C (InsetText): small fix in initialize
4631 widthOffset (should not be done in the init() function)
4633 2000-03-29 Amir Karger <karger@lyx.org>
4635 * lib/examples/it_ItemizeBullets.lyx: translation by
4638 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4640 2000-03-29 Juergen Vigna <jug@sad.it>
4642 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4644 * src/insets/insetfoot.C (Clone): small change as for the below
4645 new init function in the text-inset
4647 * src/insets/insettext.C (init): new function as I've seen that
4648 clone did not copy the Paragraph-Data!
4649 (LocalDispatch): Added code so that now we have some sort of Undo
4650 functionality (well actually we HAVE Undo ;)
4652 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4654 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4656 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4659 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4661 * src/main.C: added a runtime check that verifies that the xforms
4662 header used when building LyX and the library used when running
4663 LyX match. Exit with a message if they don't match. This is a
4664 version number check only.
4666 * src/buffer.C (save): Don't allocate memory on the heap for
4667 struct utimbuf times.
4669 * *: some using changes, use iosfwd instead of the real headers.
4671 * src/lyxfont.C use char const * instead of string for the static
4672 strings. Rewrite some functions to use sstream.
4674 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4676 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4679 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4681 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4682 of Geodesy (from Martin Vermeer)
4684 * lib/layouts/svjour.inc: include file for the Springer svjour
4685 class. It can be used to support journals other than JoG.
4687 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4688 Miskiewicz <misiek@pld.org.pl>)
4689 * lib/reLyX/Makefile.am: ditto.
4691 2000-03-27 Juergen Vigna <jug@sad.it>
4693 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4694 also some modifications with operations on selected text.
4696 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4697 problems with clicking on insets (last famous words ;)
4699 * src/insets/insetcommand.C (draw):
4700 (width): Changed to have a bit of space before and after the inset so
4701 that the blinking cursor can be seen (otherwise it was hidden)
4703 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4705 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4706 would not be added to the link list when an installed gettext (not
4707 part of libc) is found.
4709 2000-03-24 Juergen Vigna <jug@sad.it>
4711 * src/insets/insetcollapsable.C (Edit):
4712 * src/mathed/formula.C (InsetButtonRelease):
4713 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4716 * src/BufferView.C (workAreaButtonPress):
4717 (workAreaButtonRelease):
4718 (checkInsetHit): Finally fixed the clicking on insets be handled
4721 * src/insets/insetert.C (Edit): inserted this call so that ERT
4722 insets work always with LaTeX-font
4724 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4726 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4727 caused lyx to startup with no GUI in place, causing in a crash
4728 upon startup when called with arguments.
4730 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4732 * src/FontLoader.C: better initialization of dummyXFontStruct.
4734 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4736 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4737 for linuxdoc and docbook import and export format options.
4739 * lib/lyxrc.example Example of default values for the previous flags.
4741 * src/lyx_cb.C Use those flags instead of the hardwired values for
4742 linuxdoc and docbook export.
4744 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4747 * src/menus.C Added menus entries for the new import/exports formats.
4749 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4751 * src/lyxrc.*: Added support for running without Gui
4754 * src/FontLoader.C: sensible defaults if no fonts are needed
4756 * src/lyx_cb.C: New function ShowMessage (writes either to the
4757 minibuffer or cout in case of no gui
4758 New function AskOverwrite for common stuff
4759 Consequently various changes to call these functions
4761 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4762 wild guess at sensible screen resolution when having no gui
4764 * src/lyxfont.C: no gui, no fonts... set some defaults
4766 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4768 * src/LColor.C: made the command inset background a bit lighter.
4770 2000-03-20 Hartmut Goebel <goebel@noris.net>
4772 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4773 stdstruct.inc. Koma-Script added some title elements which
4774 otherwise have been listed below "bibliography". This split allows
4775 adding title elements to where they belong.
4777 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4778 define the additional tilte elements and then include
4781 * many other layout files: changed to include stdtitle.inc just
4782 before stdstruct.inc.
4784 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4786 * src/buffer.C: (save) Added the option to store all backup files
4787 in a single directory
4789 * src/lyxrc.[Ch]: Added variable \backupdir_path
4791 * lib/lyxrc.example: Added descriptions of recently added variables
4793 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4794 bibtex inset, not closing the bibtex popup when deleting the inset)
4796 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4798 * src/lyx_cb.C: add a couple using directives.
4800 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4801 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4802 import based on the filename.
4804 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4805 file would be imported at start, if the filename where of a sgml file.
4807 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4809 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4811 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4812 * src/lyxfont.h Replaced the member variable bits.direction by the
4813 member variable lang. Made many changes in other files.
4814 This allows having a multi-lingual document
4816 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4817 that change the current language to <l>.
4818 Removed the command "font-rtl"
4820 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4821 format for Hebrew documents)
4823 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4824 When auto_mathmode is "true", pressing a digit key in normal mode
4825 will cause entering into mathmode.
4826 If auto_mathmode is "rtl" then this behavior will be active only
4827 when writing right-to-left text.
4829 * src/text2.C (InsertStringA) The string is inserted using the
4832 * src/paragraph.C (GetEndLabel) Gives a correct result for
4833 footnote paragraphs.
4835 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4837 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4839 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4840 front of PasteParagraph. Never insert a ' '. This should at least
4841 fix some cause for the segfaults that we have been experiencing,
4842 it also fixes backspace behaviour slightly. (Phu!)
4844 * src/support/lstrings.C (compare_no_case): some change to make it
4845 compile with gcc 2.95.2 and stdlibc++-v3
4847 * src/text2.C (MeltFootnoteEnvironment): change type o
4848 first_footnote_par_is_not_empty to bool.
4850 * src/lyxparagraph.h: make text private. Changes in other files
4852 (fitToSize): new function
4853 (setContentsFromPar): new function
4854 (clearContents): new function
4855 (SetChar): new function
4857 * src/paragraph.C (readSimpleWholeFile): deleted.
4859 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4860 the file, just use a simple string instead. Also read the file in
4861 a more maintainable manner.
4863 * src/text2.C (InsertStringA): deleted.
4864 (InsertStringB): deleted.
4866 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4868 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4869 RedoParagraphs from the doublespace handling part, just set status
4870 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4871 done, but perhaps not like this.)
4873 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4875 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4876 character when inserting an inset.
4878 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4880 * src/bufferparams.C (readLanguage): now takes "default" into
4883 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4884 also initialize the toplevel_keymap with the default bindings from
4887 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4889 * all files using lyxrc: have lyxrc as a real variable and not a
4890 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4893 * src/lyxrc.C: remove double call to defaultKeyBindings
4895 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4896 toolbar defauls using lyxlex. Remove enums, structs, functions
4899 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4900 toolbar defaults. Also store default keybindings in a map.
4902 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4903 storing the toolbar defaults without any xforms dependencies.
4905 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4906 applied. Changed to use iterators.
4908 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4910 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4911 systems that don't have LINGUAS set to begin with.
4913 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4915 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4916 the list by Dekel Tsur.
4918 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4920 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4921 * src/insets/form_graphics.C: ditto.
4923 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4925 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4927 * src/bufferparams.C (readLanguage): use the new language map
4929 * src/intl.C (InitKeyMapper): use the new language map
4931 * src/lyx_gui.C (create_forms): use the new language map
4933 * src/language.[Ch]: New files. Used for holding the information
4934 about each language. Now! Use this new language map enhance it and
4935 make it really usable for our needs.
4937 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4939 * screen.C (ShowCursor): Removed duplicate code.
4940 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4941 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4943 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4946 * src/text.C Added TransformChar method. Used for rendering Arabic
4947 text correctly (change the glyphs of the letter according to the
4948 position in the word)
4953 * src/lyxrc.C Added lyxrc command {language_command_begin,
4954 language_command_end,language_command_ltr,language_command_rtl,
4955 language_package} which allows the use of either arabtex or Omega
4958 * src/lyx_gui.C (init)
4960 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4961 to use encoding for menu fonts which is different than the encoding
4964 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4965 do not load the babel package.
4966 To write an English document with Hebrew/Arabic, change the document
4967 language to "english".
4969 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4970 (alphaCounter): changed to return char
4971 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4973 * lib/lyxrc.example Added examples for Hebrew/Arabic
4976 * src/layout.C Added layout command endlabeltype
4978 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4980 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4982 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4984 * src/mathed/math_delim.C (search_deco): return a
4985 math_deco_struct* instead of index.
4987 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4989 * All files with a USE_OSTREAM_ONLY within: removed all code that
4990 was unused when USE_OSTREAM_ONLY is defined.
4992 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4993 of any less. Removed header and using.
4995 * src/text.C (GetVisibleRow): draw the string "Page Break
4996 (top/bottom)" on screen when drawing a pagebreak line.
4998 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5000 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5002 * src/mathed/math_macro.C (draw): do some cast magic.
5005 * src/mathed/math_defs.h: change byte* argument to byte const*.
5007 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5009 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5010 know it is right to return InsetFoot* too, but cxx does not like
5013 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5015 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5017 * src/mathed/math_delim.C: change == to proper assignment.
5019 2000-03-09 Juergen Vigna <jug@sad.it>
5021 * src/insets/insettext.C (setPos): fixed various cursor positioning
5022 problems (via mouse and cursor-keys)
5023 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5024 inset (still a small display problem but it works ;)
5026 * src/insets/insetcollapsable.C (draw): added button_top_y and
5027 button_bottom_y to have correct values for clicking on the inset.
5029 * src/support/lyxalgo.h: commented out 'using std::less'
5031 2000-03-08 Juergen Vigna <jug@sad.it>
5033 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5034 Button-Release event closes as it is alos the Release-Event
5037 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5039 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5041 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5042 can add multiple spaces in Scrap (literate programming) styles...
5043 which, by the way, is how I got hooked on LyX to begin with.
5045 * src/mathed/formula.C (Write): Added dummy variable to an
5046 inset::Latex() call.
5047 (Latex): Add free_spacing boolean to inset::Latex()
5049 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5051 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5052 virtual function to include the free_spacing boolean from
5053 the containing paragraph's style.
5055 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5056 Added free_spacing boolean arg to match inset.h
5058 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5059 Added free_spacing boolean arg to match inset.h
5061 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5062 Added free_spacing boolean and made sure that if in a free_spacing
5063 paragraph, that we output normal space if there is a protected space.
5065 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5066 Added free_spacing boolean arg to match inset.h
5068 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5069 Added free_spacing boolean arg to match inset.h
5071 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5072 Added free_spacing boolean arg to match inset.h
5074 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5075 Added free_spacing boolean arg to match inset.h
5077 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5078 Added free_spacing boolean arg to match inset.h
5080 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5081 free_spacing boolean arg to match inset.h
5083 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5084 Added free_spacing boolean arg to match inset.h
5086 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5087 Added free_spacing boolean arg to match inset.h
5089 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5090 Added free_spacing boolean arg to match inset.h
5092 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5093 Added free_spacing boolean arg to match inset.h
5095 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5096 Added free_spacing boolean arg to match inset.h
5098 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5099 free_spacing boolean arg to match inset.h
5101 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5102 free_spacing boolean arg to match inset.h
5104 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5105 ignore free_spacing paragraphs. The user's spaces are left
5108 * src/text.C (InsertChar): Fixed the free_spacing layout
5109 attribute behavior. Now, if free_spacing is set, you can
5110 add multiple spaces in a paragraph with impunity (and they
5111 get output verbatim).
5112 (SelectSelectedWord): Added dummy argument to inset::Latex()
5115 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5118 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5119 paragraph layouts now only input a simple space instead.
5120 Special character insets don't make any sense in free-spacing
5123 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5124 hard-spaces in the *input* file to simple spaces if the layout
5125 is free-spacing. This converts old files which had to have
5126 hard-spaces in free-spacing layouts where a simple space was
5128 (writeFileAscii): Added free_spacing check to pass to the newly
5129 reworked inset::Latex(...) methods. The inset::Latex() code
5130 ensures that hard-spaces in free-spacing paragraphs get output
5131 as spaces (rather than "~").
5133 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5135 * src/mathed/math_delim.C (draw): draw the empty placeholder
5136 delims with a onoffdash line.
5137 (struct math_deco_compare): struct that holds the "functors" used
5138 for the sort and the binary search in math_deco_table.
5139 (class init_deco_table): class used for initial sort of the
5141 (search_deco): use lower_bound to do a binary search in the
5144 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5146 * src/lyxrc.C: a small secret thingie...
5148 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5149 and to not flush the stream as often as it used to.
5151 * src/support/lyxalgo.h: new file
5152 (sorted): template function used for checking if a sequence is
5153 sorted or not. Two versions with and without user supplied
5154 compare. Uses same compare as std::sort.
5156 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5157 it and give warning on lyxerr.
5159 (struct compare_tags): struct with function operators used for
5160 checking if sorted, sorting and lower_bound.
5161 (search_kw): use lower_bound instead of manually implemented
5164 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5166 * src/insets/insetcollapsable.h: fix Clone() declaration.
5167 * src/insets/insetfoot.h: ditto.
5169 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5171 2000-03-08 Juergen Vigna <jug@sad.it>
5173 * src/insets/lyxinset.h: added owner call which tells us if
5174 this inset is inside another inset. Changed also the return-type
5175 of Editable to an enum so it tells clearer what the return-value is.
5177 * src/insets/insettext.C (computeTextRows): fixed computing of
5178 textinsets which split automatically on more rows.
5180 * src/insets/insetert.[Ch]: changed this to be of BaseType
5183 * src/insets/insetfoot.[Ch]: added footnote inset
5185 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5186 collapsable insets (like footnote, ert, ...)
5188 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5190 * src/lyxdraw.h: remvoe file
5192 * src/lyxdraw.C: remove file
5194 * src/insets/insettext.C: added <algorithm>.
5196 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5198 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5199 (matrix_cb): case MM_OK use string stream
5201 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5204 * src/mathed/math_macro.C (draw): use string stream
5205 (Metrics): use string stream
5207 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5208 directly to the ostream.
5210 * src/vspace.C (asString): use string stream.
5211 (asString): use string stream
5212 (asLatexString): use string stream
5214 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5215 setting Spacing::Other.
5217 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5218 sprintf when creating the stretch vale.
5220 * src/text2.C (alphaCounter): changed to return a string and to
5221 not use a static variable internally. Also fixed a one-off bug.
5222 (SetCounter): changed the drawing of the labels to use string
5223 streams instead of sprintf.
5225 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5226 manipulator to use a scheme that does not require library support.
5227 This is also the way it is done in the new GNU libstdc++. Should
5228 work with DEC cxx now.
5230 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5233 end. This fixes a bug.
5235 * src/mathed (all files concerned with file writing): apply the
5236 USE_OSTREAM_ONLY changes to mathed too.
5238 * src/support/DebugStream.h: make the constructor explicit.
5240 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5241 count and ostream squashed.
5243 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5245 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5247 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5248 ostringstream uses STL strings, and we might not.
5250 * src/insets/insetspecialchar.C: add using directive.
5251 * src/insets/insettext.C: ditto.
5253 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5255 * lib/layouts/seminar.layout: feeble attempt at a layout for
5256 seminar.cls, far from completet and could really use some looking
5257 at from people used to write layout files.
5259 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5260 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5261 a lot nicer and works nicely with ostreams.
5263 * src/mathed/formula.C (draw): a slightly different solution that
5264 the one posted to the list, but I think this one works too. (font
5265 size wrong in headers.)
5267 * src/insets/insettext.C (computeTextRows): some fiddling on
5268 Jürgens turf, added some comments that he should read.
5270 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5271 used and it gave compiler warnings.
5272 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5275 * src/lyx_gui.C (create_forms): do the right thing when
5276 show_banner is true/false.
5278 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5279 show_banner is false.
5281 * most file writing files: Now use iostreams to do almost all of
5282 the writing. Also instead of passing string &, we now use
5283 stringstreams. mathed output is still not adapted to iostreams.
5284 This change can be turned off by commenting out all the occurences
5285 of the "#define USE_OSTREAM_ONLY 1" lines.
5287 * src/WorkArea.C (createPixmap): don't output debug messages.
5288 (WorkArea): don't output debug messages.
5290 * lib/lyxrc.example: added a comment about the new variable
5293 * development/Code_rules/Rules: Added some more commente about how
5294 to build class interfaces and on how better encapsulation can be
5297 2000-03-03 Juergen Vigna <jug@sad.it>
5299 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5300 automatically with the width of the LyX-Window
5302 * src/insets/insettext.C (computeTextRows): fixed update bug in
5303 displaying text-insets (scrollvalues where not initialized!)
5305 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5307 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5308 id in the check of the result from lower_bound is not enough since
5309 lower_bound can return last too, and then res->id will not be a
5312 * all insets and some code that use them: I have conditionalized
5313 removed the Latex(string & out, ...) this means that only the
5314 Latex(ostream &, ...) will be used. This is a work in progress to
5315 move towards using streams for all output of files.
5317 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5320 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5322 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5323 routine (this fixes bug where greek letters were surrounded by too
5326 * src/support/filetools.C (findtexfile): change a bit the search
5327 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5328 no longer passed to kpsewhich, we may have to change that later.
5330 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5331 warning options to avoid problems with X header files (from Angus
5333 * acinclude.m4: regenerated.
5335 2000-03-02 Juergen Vigna <jug@sad.it>
5337 * src/insets/insettext.C (WriteParagraphData): Using the
5338 par->writeFile() function for writing paragraph-data.
5339 (Read): Using buffer->parseSingleLyXformat2Token()-function
5340 for parsing paragraph data!
5342 * src/buffer.C (readLyXformat2): removed all parse data and using
5343 the new parseSingleLyXformat2Token()-function.
5344 (parseSingleLyXformat2Token): added this function to parse (read)
5345 lyx-file-format (this is called also from text-insets now!)
5347 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5349 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5352 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5353 directly instead of going through a func. One very bad thing: a
5354 static LyXFindReplace, but I don't know where to place it.
5356 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5357 string instead of char[]. Also changed to static.
5358 (GetSelectionOrWordAtCursor): changed to static inline
5359 (SetSelectionOverLenChars): ditto.
5361 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5362 current_view and global variables. both classes has changed names
5363 and LyXFindReplace is not inherited from SearchForm.
5365 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5366 fl_form_search form.
5368 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5370 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5372 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5373 bound (from Kayvan).
5375 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5377 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5379 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5381 * some things that I should comment but the local pub says head to
5384 * comment out all code that belongs to the Roff code for Ascii
5385 export of tables. (this is unused)
5387 * src/LyXView.C: use correct type for global variable
5388 current_layout. (LyXTextClass::size_type)
5390 * some code to get the new insetgraphics closer to working I'd be
5391 grateful for any help.
5393 * src/BufferView2.C (insertInset): use the return type of
5394 NumberOfLayout properly. (also changes in other files)
5396 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5397 this as a test. I want to know what breaks because of this.
5399 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5401 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5403 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5404 to use a \makebox in the label, this allows proper justification
5405 with out using protected spaces or multiple hfills. Now it is
5406 "label" for left justified, "\hfill label\hfill" for center, and
5407 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5408 should be changed accordingly.
5410 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5412 * src/lyxtext.h: change SetLayout() to take a
5413 LyXTextClass::size_type instead of a char (when there is more than
5414 127 layouts in a class); also change type of copylayouttype.
5415 * src/text2.C (SetLayout): ditto.
5416 * src/LyXView.C (updateLayoutChoice): ditto.
5418 * src/LaTeX.C (scanLogFile): errors where the line number was not
5419 given just after the '!'-line were ignored (from Dekel Tsur).
5421 * lib/lyxrc.example: fix description of \date_insert_format
5423 * lib/layouts/llncs.layout: new layout, contributed by Martin
5426 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5428 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5429 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5430 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5431 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5432 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5433 paragraph.C, text.C, text2.C)
5435 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5437 * src/insets/insettext.C (LocalDispatch): remove extra break
5440 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5441 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5443 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5444 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5446 * src/insets/insetbib.h: move InsetBibkey::Holder and
5447 InsetCitation::Holder in public space.
5449 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5451 * src/insets/insettext.h: small change to get the new files from
5452 Juergen to compile (use "string", not "class string").
5454 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5455 const & as parameter to LocalDispatch, use LyXFont const & as
5456 paramter to some other func. This also had impacto on lyxinsets.h
5457 and the two mathed insets.
5459 2000-02-24 Juergen Vigna <jug@sad.it>
5462 * src/commandtags.h:
5464 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5468 * src/BufferView2.C: added/updated code for various inset-functions
5470 * src/insets/insetert.[Ch]: added implementation of InsetERT
5472 * src/insets/insettext.[Ch]: added implementation of InsetText
5474 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5475 (draw): added preliminary code for inset scrolling not finshed yet
5477 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5478 as it is in lyxfunc.C now
5480 * src/insets/lyxinset.h: Added functions for text-insets
5482 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5484 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5485 BufferView and reimplement the list as a queue put inside its own
5488 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5490 * several files: use the new interface to the "updateinsetlist"
5492 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5494 (work_area_handler): call BufferView::trippleClick on trippleclick.
5496 * src/BufferView.C (doubleClick): new function, selects word on
5498 (trippleClick): new function, selects line on trippleclick.
5500 2000-02-22 Allan Rae <rae@lyx.org>
5502 * lib/bind/xemacs.bind: buffer-previous not supported
5504 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5506 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5509 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * src/bufferlist.C: get rid of current_view from this file
5513 * src/spellchecker.C: get rid of current_view from this file
5515 * src/vspace.C: get rid of current_view from this file
5516 (inPixels): added BufferView parameter for this func
5517 (asLatexCommand): added a BufferParams for this func
5519 * src/text.C src/text2.C: get rid of current_view from these
5522 * src/lyxfont.C (getFontDirection): move this function here from
5525 * src/bufferparams.C (getDocumentDirection): move this function
5528 * src/paragraph.C (getParDirection): move this function here from
5530 (getLetterDirection): ditto
5532 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5534 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5535 resize due to wrong pixmap beeing used. Also took the opurtunity
5536 to make the LyXScreen stateless on regard to WorkArea and some
5537 general cleanup in the same files.
5539 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5541 * src/Makefile.am: add missing direction.h
5543 * src/PainterBase.h: made the width functions const.
5545 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5548 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5550 * src/insets/insetlatexaccent.C (draw): make the accents draw
5551 better, at present this will only work well with iso8859-1.
5553 * several files: remove the old drawing code, now we use the new
5556 * several files: remove support for mono_video, reverse_video and
5559 2000-02-17 Juergen Vigna <jug@sad.it>
5561 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5562 int ** as we have to return the pointer, otherwise we have only
5563 NULL pointers in the returning function.
5565 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5567 * src/LaTeX.C (operator()): quote file name when running latex.
5569 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5571 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5572 (bubble tip), this removes our special handling of this.
5574 * Remove all code that is unused now that we have the new
5575 workarea. (Code that are not active when NEW_WA is defined.)
5577 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5579 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5581 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5582 nonexisting layout; correctly redirect obsoleted layouts.
5584 * lib/lyxrc.example: document \view_dvi_paper_option
5586 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5589 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5590 (PreviewDVI): handle the view_dvi_paper_option variable.
5591 [Both from Roland Krause]
5593 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5595 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5596 char const *, int, LyXFont)
5597 (text(int, int, string, LyXFont)): ditto
5599 * src/text.C (InsertCharInTable): attempt to fix the double-space
5600 feature in tables too.
5601 (BackspaceInTable): ditto.
5602 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5604 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5606 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5608 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5609 newly found text in textcache to this.
5610 (buffer): set the owner of the text put into the textcache to 0
5612 * src/insets/figinset.C (draw): fixed the drawing of figures with
5615 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5616 drawing of mathframe, hfills, protected space, table lines. I have
5617 now no outstanding drawing problems with the new Painter code.
5619 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5621 * src/PainterBase.C (ellipse, circle): do not specify the default
5624 * src/LColor.h: add using directive.
5626 * src/Painter.[Ch]: change return type of methods from Painter& to
5627 PainterBase&. Add a using directive.
5629 * src/WorkArea.C: wrap xforms callbacks in C functions
5632 * lib/layouts/foils.layout: font fix and simplifications from Carl
5635 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5637 * a lot of files: The Painter, LColor and WorkArea from the old
5638 devel branch has been ported to lyx-devel. Some new files and a
5639 lot of #ifdeffed code. The new workarea is enabled by default, but
5640 if you want to test the new Painter and LColor you have to compile
5641 with USE_PAINTER defined (do this in config.h f.ex.) There are
5642 still some rought edges, and I'd like some help to clear those
5643 out. It looks stable (loads and displays the Userguide very well).
5646 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5648 * src/buffer.C (pop_tag): revert to the previous implementation
5649 (use a global variable for both loops).
5651 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5653 * src/lyxrc.C (LyXRC): change slightly default date format.
5655 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5656 there is an English text with a footnote that starts with a Hebrew
5657 paragraph, or vice versa.
5658 (TeXFootnote): ditto.
5660 * src/text.C (LeftMargin): allow for negative values for
5661 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5664 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5665 for input encoding (cyrillic)
5667 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5669 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5672 * src/toolbar.C (set): ditto
5673 * src/insets/insetbib.C (create_form_citation_form): ditto
5675 * lib/CREDITS: added Dekel Tsur.
5677 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5678 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5679 hebrew supports files from Dekel Tsur.
5681 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5682 <tzafrir@technion.ac.il>
5684 * src/lyxrc.C: put \date_insert_format at the right place.
5686 * src/buffer.C (makeLaTeXFile): fix the handling of
5687 BufferParams::sides when writing out latex files.
5689 * src/BufferView2.C: add a "using" directive.
5691 * src/support/lyxsum.C (sum): when we use lyxstring,
5692 ostringstream::str needs an additional .c_str().
5694 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5696 * src/support/filetools.C (ChangeExtension): patch from Etienne
5699 * src/TextCache.C (show): remove const_cast and make second
5700 parameter non-const LyXText *.
5702 * src/TextCache.h: use non const LyXText in show.
5704 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5707 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5709 * src/support/lyxsum.C: rework to be more flexible.
5711 * several places: don't check if a pointer is 0 if you are going
5714 * src/text.C: remove some dead code.
5716 * src/insets/figinset.C: remove some dead code
5718 * src/buffer.C: move the BufferView funcs to BufferView2.C
5719 remove all support for insetlatexdel
5720 remove support for oldpapersize stuff
5721 made some member funcs const
5723 * src/kbmap.C: use a std::list to store the bindings in.
5725 * src/BufferView2.C: new file
5727 * src/kbsequence.[Ch]: new files
5729 * src/LyXAction.C + others: remove all trace of buffer-previous
5731 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5732 only have one copy in the binary of this table.
5734 * hebrew patch: moved some functions from LyXText to more
5735 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5737 * several files: remove support for XForms older than 0.88
5739 remove some #if 0 #endif code
5741 * src/TextCache.[Ch]: new file. Holds the textcache.
5743 * src/BufferView.C: changes to use the new TextCache interface.
5744 (waitForX): remove the now unused code.
5746 * src/BackStack.h: remove some commented code
5748 * lib/bind/emacs.bind: remove binding for buffer-previous
5750 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * applied the hebrew patch.
5754 * src/lyxrow.h: make sure that all Row variables are initialized.
5756 * src/text2.C (TextHandleUndo): comment out a delete, this might
5757 introduce a memory leak, but should also help us to not try to
5758 read freed memory. We need to look at this one.
5760 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5761 (LyXParagraph): initalize footnotekind.
5763 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5764 forgot this when applying the patch. Please heed the warnings.
5766 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5767 (aka. reformat problem)
5769 * src/bufferlist.C (exists): made const, and use const_iterator
5770 (isLoaded): new func.
5771 (release): use std::find to find the correct buffer.
5773 * src/bufferlist.h: made getState a const func.
5774 made empty a const func.
5775 made exists a const func.
5778 2000-02-01 Juergen Vigna <jug@sad.it>
5780 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5782 * po/it.po: updated a bit the italian po file and also changed the
5783 'file nuovo' for newfile to 'filenuovo' without a space, this did
5786 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5787 for the new insert_date command.
5789 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5790 from jdblair, to insert a date into the current text conforming to
5791 a strftime format (for now only considering the locale-set and not
5792 the document-language).
5794 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5796 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5797 Bounds Read error seen by purify. The problem was that islower is
5798 a macros which takes an unsigned char and uses it as an index for
5799 in array of characters properties (and is thus subject to the
5803 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5804 correctly the paper sides radio buttons.
5805 (UpdateDocumentButtons): ditto.
5807 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5809 * src/kbmap.C (getsym + others): change to return unsigned int,
5810 returning a long can give problems on 64 bit systems. (I assume
5811 that int is 32bit on 64bit systems)
5813 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5815 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5816 LyXLookupString to be zero-terminated. Really fixes problems seen
5819 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5821 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5822 write a (char*)0 to the lyxerr stream.
5824 * src/lastfiles.C: move algorithm before the using statemets.
5826 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5828 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5829 complains otherwise).
5830 * src/table.C: ditto
5832 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5835 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5836 that I removed earlier... It is really needed.
5838 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5840 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5842 * INSTALL: update xforms home page URL.
5844 * lib/configure.m4: fix a bug with unreadable layout files.
5846 * src/table.C (calculate_width_of_column): add "using std::max"
5849 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5851 * several files: marked several lines with "DEL LINE", this is
5852 lines that can be deleted without changing anything.
5853 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5854 checks this anyway */
5857 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5859 * src/DepTable.C (update): add a "+" at the end when the checksum
5860 is different. (debugging string only)
5862 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5863 the next inset to not be displayed. This should also fix the list
5864 of labels in the "Insert Crossreference" dialog.
5866 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5868 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5869 when regex was not found.
5871 * src/support/lstrings.C (lowercase): use handcoded transform always.
5874 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5875 old_cursor.par->prev could be 0.
5877 * several files: changed post inc/dec to pre inc/dec
5879 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5880 write the lastfiles to file.
5882 * src/BufferView.C (buffer): only show TextCache info when debugging
5884 (resizeCurrentBuffer): ditto
5885 (workAreaExpose): ditto
5887 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5889 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5891 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5892 a bit better by removing the special case for \i and \j.
5894 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5896 * src/lyx_main.C (easyParse): remove test for bad comand line
5897 options, since this broke all xforms-related parsing.
5899 * src/kbmap.C (getsym): set return type to unsigned long, as
5900 declared in header. On an alpha, long is _not_ the same as int.
5902 * src/support/LOstream.h: add a "using std::flush;"
5904 * src/insets/figinset.C: ditto.
5906 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5908 * src/bufferlist.C (write): use blinding fast file copy instead of
5909 "a char at a time", now we are doing it the C++ way.
5911 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5912 std::list<int> instead.
5913 (addpidwait): reflect move to std::list<int>
5914 (sigchldchecker): ditto
5916 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5919 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5920 that obviously was wrong...
5922 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5923 c, this avoids warnings with purify and islower.
5925 * src/insets/figinset.C: rename struct queue to struct
5926 queue_element and rewrite to use a std::queue. gsqueue is now a
5927 std::queue<queue_element>
5928 (runqueue): reflect move to std::queue
5931 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5932 we would get "1" "0" instead of "true" "false. Also make the tostr
5935 2000-01-21 Juergen Vigna <jug@sad.it>
5937 * src/buffer.C (writeFileAscii): Disabled code for special groff
5938 handling of tabulars till I fix this in table.C
5940 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5942 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5944 * src/support/lyxlib.h: ditto.
5946 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5948 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5949 and 'j' look better. This might fix the "macron" bug that has been
5952 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5953 functions as one template function. Delete the old versions.
5955 * src/support/lyxsum.C: move using std::ifstream inside
5958 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5961 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5963 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5965 * src/insets/figinset.C (InitFigures): use new instead of malloc
5966 to allocate memory for figures and bitmaps.
5967 (DoneFigures): use delete[] instead of free to deallocate memory
5968 for figures and bitmaps.
5969 (runqueue): use new to allocate
5970 (getfigdata): use new/delete[] instead of malloc/free
5971 (RegisterFigure): ditto
5973 * some files: moved some declarations closer to first use, small
5974 whitespace changes use preincrement instead of postincrement where
5975 it does not make a difference.
5977 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5978 step on the way to use stl::containers for key maps.
5980 * src/bufferlist.h: add a typedef for const_iterator and const
5981 versions of begin and end.
5983 * src/bufferlist.[Ch]: change name of member variable _state to
5984 state_. (avoid reserved names)
5986 (getFileNames): returns the filenames of the buffers in a vector.
5988 * configure.in (ALL_LINGUAS): added ro
5990 * src/support/putenv.C: new file
5992 * src/support/mkdir.C: new file
5994 2000-01-20 Allan Rae <rae@lyx.org>
5996 * lib/layouts/IEEEtran.layout: Added several theorem environments
5998 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5999 couple of minor additions.
6001 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6002 (except for those in footnotes of course)
6004 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6008 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6009 std::sort and std::lower_bound instead of qsort and handwritten
6011 (struct compara): struct that holds the functors used by std::sort
6012 and std::lower_bound in MathedLookupBOP.
6014 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6016 * src/support/LAssert.h: do not do partial specialization. We do
6019 * src/support/lyxlib.h: note that lyx::getUserName() and
6020 lyx::date() are not in use right now. Should these be suppressed?
6022 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6023 (makeLinuxDocFile): do not put date and user name in linuxdoc
6026 * src/support/lyxlib.h (kill): change first argument to long int,
6027 since that's what solaris uses.
6029 * src/support/kill.C (kill): fix declaration to match prototype.
6031 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6032 actually check whether namespaces are supported. This is not what
6035 * src/support/lyxsum.C: add a using directive.
6037 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6039 * src/support/kill.C: if we have namespace support we don't have
6040 to include lyxlib.h.
6042 * src/support/lyxlib.h: use namespace lyx if supported.
6044 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6046 * src/support/date.C: new file
6048 * src/support/chdir.C: new file
6050 * src/support/getUserName.C: new file
6052 * src/support/getcwd.C: new file
6054 * src/support/abort.C: new file
6056 * src/support/kill.C: new file
6058 * src/support/lyxlib.h: moved all the functions in this file
6059 insede struct lyx. Added also kill and abort to this struct. This
6060 is a way to avoid the "kill is not defined in <csignal>", we make
6061 C++ wrappers for functions that are not ANSI C or ANSI C++.
6063 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6064 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6065 lyx it has been renamed to sum.
6067 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6069 * src/text.C: add using directives for std::min and std::max.
6071 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6073 * src/texrow.C (getIdFromRow): actually return something useful in
6074 id and pos. Hopefully fixes the bug with positionning of errorbox
6077 * src/lyx_main.C (easyParse): output an error and exit if an
6078 incorrect command line option has been given.
6080 * src/spellchecker.C (ispell_check_word): document a memory leak.
6082 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6083 where a "struct utimbuf" is allocated with "new" and deleted with
6086 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6088 * src/text2.C (CutSelection): don't delete double spaces.
6089 (PasteSelection): ditto
6090 (CopySelection): ditto
6092 * src/text.C (Backspace): don't delete double spaces.
6094 * src/lyxlex.C (next): fix a bug that were only present with
6095 conformant std::istream::get to read comment lines, use
6096 std::istream::getline instead. This seems to fix the problem.
6098 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6100 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6101 allowed to insert space before space" editing problem. Please read
6102 commends at the beginning of the function. Comments about usage
6105 * src/text.C (InsertChar): fix for the "not allowed to insert
6106 space before space" editing problem.
6108 * src/text2.C (DeleteEmptyParagraphMechanism): when
6109 IsEmptyTableRow can only return false this last "else if" will
6110 always be a no-op. Commented out.
6112 * src/text.C (RedoParagraph): As far as I can understand tmp
6113 cursor is not really needed.
6115 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6116 present it could only return false anyway.
6117 (several functions): Did something not so smart...added a const
6118 specifier on a lot of methods.
6120 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6121 and add a tmp->text.resize. The LyXParagraph constructor does the
6123 (BreakParagraphConservative): ditto
6125 * src/support/path.h (Path): add a define so that the wrong usage
6126 "Path("/tmp") will be flagged as a compilation error:
6127 "`unnamed_Path' undeclared (first use this function)"
6129 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6131 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6132 which was bogus for several reasons.
6134 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6138 * autogen.sh: do not use "type -path" (what's that anyway?).
6140 * src/support/filetools.C (findtexfile): remove extraneous space
6141 which caused a kpsewhich warning (at least with kpathsea version
6144 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6146 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6148 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6150 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6152 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6154 * src/paragraph.C (BreakParagraph): do not reserve space on text
6155 if we don't need to (otherwise, if pos_end < pos, we end up
6156 reserving huge amounts of memory due to bad unsigned karma).
6157 (BreakParagraphConservative): ditto, although I have not seen
6158 evidence the bug can happen here.
6160 * src/lyxparagraph.h: add a using std::list.
6162 2000-01-11 Juergen Vigna <jug@sad.it>
6164 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6167 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6169 * src/vc-backend.C (doVCCommand): change to be static and take one
6170 more parameter: the path to chdir too be fore executing the command.
6171 (retrive): new function equiv to "co -r"
6173 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6174 file_not_found_hook is true.
6176 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6178 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6179 if a file is readwrite,readonly...anything else.
6181 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6184 (CreatePostscript): name change from MenuRunDVIPS (or something)
6185 (PreviewPostscript): name change from MenuPreviewPS
6186 (PreviewDVI): name change from MenuPreviewDVI
6188 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6189 \view_pdf_command., \pdf_to_ps_command
6191 * lib/configure.m4: added search for PDF viewer, and search for
6192 PDF to PS converter.
6193 (lyxrc.defaults output): add \pdflatex_command,
6194 \view_pdf_command and \pdf_to_ps_command.
6196 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6198 * src/bufferlist.C (write): we don't use blocksize for anything so
6201 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6203 * src/support/block.h: disable operator T* (), since it causes
6204 problems with both compilers I tried. See comments in the file.
6206 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6209 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6210 variable LYX_DIR_10x to LYX_DIR_11x.
6212 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6214 * INSTALL: document --with-lyxname.
6217 * configure.in: new configure flag --with-lyxname which allows to
6218 choose the name under which lyx is installed. Default is "lyx", of
6219 course. It used to be possible to do this with --program-suffix,
6220 but the later has in fact a different meaning for autoconf.
6222 * src/support/lstrings.h (lstrchr): reformat a bit.
6224 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6225 * src/mathed/math_defs.h: ditto.
6227 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6230 true, decides if we create a backup file or not when saving. New
6231 tag and variable \pdf_mode, defaults to false. New tag and
6232 variable \pdflatex_command, defaults to pdflatex. New tag and
6233 variable \view_pdf_command, defaults to xpdf. New tag and variable
6234 \pdf_to_ps_command, defaults to pdf2ps.
6236 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6238 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6239 does not have a BufferView.
6240 (unlockInset): ditto + don't access the_locking_inset if the
6241 buffer does not have a BufferView.
6243 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6244 certain circumstances so that we don't continue a keyboard
6245 operation long after the key was released. Try f.ex. to load a
6246 large document, press PageDown for some seconds and then release
6247 it. Before this change the document would contine to scroll for
6248 some time, with this change it stops imidiatly.
6250 * src/support/block.h: don't allocate more space than needed. As
6251 long as we don't try to write to the arr[x] in a array_type arr[x]
6252 it is perfectly ok. (if you write to it you might segfault).
6253 added operator value_type*() so that is possible to pass the array
6254 to functions expecting a C-pointer.
6256 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6259 * intl/*: updated to gettext 0.10.35, tried to add our own
6260 required modifications. Please verify.
6262 * po/*: updated to gettext 0.10.35, tried to add our own required
6263 modifications. Please verify.
6265 * src/support/lstrings.C (tostr): go at fixing the problem with
6266 cxx and stringstream. When stringstream is used return
6267 oss.str().c_str() so that problems with lyxstring and basic_string
6268 are avoided. Note that the best solution would be for cxx to use
6269 basic_string all the way, but it is not conformant yet. (it seems)
6271 * src/lyx_cb.C + other files: moved several global functions to
6272 class BufferView, some have been moved to BufferView.[Ch] others
6273 are still located in lyx_cb.C. Code changes because of this. (part
6274 of "get rid of current_view project".)
6276 * src/buffer.C + other files: moved several Buffer functions to
6277 class BufferView, the functions are still present in buffer.C.
6278 Code changes because of this.
6280 * config/lcmessage.m4: updated to most recent. used when creating
6283 * config/progtest.m4: updated to most recent. used when creating
6286 * config/gettext.m4: updated to most recent. applied patch for
6289 * config/gettext.m4.patch: new file that shows what changes we
6290 have done to the local copy of gettext.m4.
6292 * config/libtool.m4: new file, used in creation of acinclude.m4
6294 * config/lyxinclude.m4: new file, this is the lyx created m4
6295 macros, used in making acinclude.m4.
6297 * autogen.sh: GNU m4 discovered as a separate task not as part of
6298 the lib/configure creation.
6299 Generate acinlucde from files in config. Actually cat
6300 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6301 easier to upgrade .m4 files that really are external.
6303 * src/Spacing.h: moved using std::istringstream to right after
6304 <sstream>. This should fix the problem seen with some compilers.
6306 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6308 * src/lyx_cb.C: began some work to remove the dependency a lot of
6309 functions have on BufferView::text, even if not really needed.
6310 (GetCurrentTextClass): removed this func, it only hid the
6313 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6314 forgot this in last commit.
6316 * src/Bullet.C (bulletEntry): use static char const *[] for the
6317 tables, becuase of this the return arg had to change to string.
6319 (~Bullet): removed unneeded destructor
6321 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6322 (insetSleep): moved from Buffer
6323 (insetWakeup): moved from Buffer
6324 (insetUnlock): moved from Buffer
6326 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6327 from Buffer to BufferView.
6329 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6331 * config/ltmain.sh: updated to version 1.3.4 of libtool
6333 * config/ltconfig: updated to version 1.3.4 of libtool
6335 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6338 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6339 Did I get that right?
6341 * src/lyxlex.h: add a "using" directive or two.
6342 * src/Spacing.h: ditto.
6343 * src/insets/figinset.C: ditto.
6344 * src/support/filetools.C: ditto.
6345 * src/support/lstrings.C: ditto.
6346 * src/BufferView.C: ditto.
6347 * src/bufferlist.C: ditto.
6348 * src/lyx_cb.C: ditto.
6349 * src/lyxlex.C: ditto.
6351 * NEWS: add some changes for 1.1.4.
6353 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6355 * src/BufferView.C: first go at a TextCache to speed up switching
6358 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6360 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6361 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6362 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6363 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6366 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6367 members of the struct are correctly initialized to 0 (detected by
6369 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6370 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6372 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6373 pidwait, since it was allocated with "new". This was potentially
6374 very bad. Thanks to Michael Schmitt for running purify for us.
6377 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6379 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6381 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6383 1999-12-30 Allan Rae <rae@lyx.org>
6385 * lib/templates/IEEEtran.lyx: minor change
6387 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6388 src/mathed/formula.C (LocalDispatch): askForText changes
6390 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6391 know when a user has cancelled input. Fixes annoying problems with
6392 inserting labels and version control.
6394 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6396 * src/support/lstrings.C (tostr): rewritten to use strstream and
6399 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * src/support/filetools.C (IsFileWriteable): use fstream to check
6402 (IsDirWriteable): use fileinfo to check
6404 * src/support/filetools.h (FilePtr): whole class deleted
6406 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6408 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6410 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6412 * src/bufferlist.C (write): use ifstream and ofstream instead of
6415 * src/Spacing.h: use istrstream instead of sscanf
6417 * src/mathed/math_defs.h: change first arg to istream from FILE*
6419 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6421 * src/mathed/math_parser.C: have yyis to be an istream
6422 (LexGetArg): use istream (yyis)
6424 (mathed_parse): ditto
6425 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6427 * src/mathed/formula.C (Read): rewritten to use istream
6429 * src/mathed/formulamacro.C (Read): rewritten to use istream
6431 * src/lyxlex.h (~LyXLex): deleted desturctor
6432 (getStream): new function, returns an istream
6433 (getFile): deleted funtion
6434 (IsOK): return is.good();
6436 * src/lyxlex.C (LyXLex): delete file and owns_file
6437 (setFile): open an filebuf and assign that to a istream instead of
6439 (setStream): new function, takes an istream as arg.
6440 (setFile): deleted function
6441 (EatLine): rewritten us use istream instead of FILE*
6445 * src/table.C (LyXTable): use istream instead of FILE*
6446 (Read): rewritten to take an istream instead of FILE*
6448 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6450 * src/buffer.C (Dispatch): remove an extraneous break statement.
6452 * src/support/filetools.C (QuoteName): change to do simple
6453 'quoting'. More work is necessary. Also changed to do nothing
6454 under emx (needs fix too).
6455 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6457 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6458 config.h.in to the AC_DEFINE_UNQUOTED() call.
6459 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6460 needs char * as argument (because Solaris 7 declares it like
6463 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6464 remove definition of BZERO.
6466 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6468 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6469 defined, "lyxregex.h" if not.
6471 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6473 (REGEX): new variable that is set to regex.c lyxregex.h when
6474 AM_CONDITIONAL USE_REGEX is set.
6475 (libsupport_la_SOURCES): add $(REGEX)
6477 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6480 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6483 * configure.in: add call to LYX_REGEX
6485 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6486 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6488 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6490 * lib/bind/fi_menus.bind: new file, from
6491 pauli.virtanen@saunalahti.fi.
6493 * src/buffer.C (getBibkeyList): pass the parameter delim to
6494 InsetInclude::getKeys and InsetBibtex::getKeys.
6496 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6497 is passed to Buffer::getBibkeyList
6499 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6500 instead of the hardcoded comma.
6502 * src/insets/insetbib.C (getKeys): make sure that there are not
6503 leading blanks in bibtex keys. Normal latex does not care, but
6504 harvard.sty seems to dislike blanks at the beginning of citation
6505 keys. In particular, the retturn value of the function is
6507 * INSTALL: make it clear that libstdc++ is needed and that gcc
6508 2.7.x probably does not work.
6510 * src/support/filetools.C (findtexfile): make debug message go to
6512 * src/insets/insetbib.C (getKeys): ditto
6514 * src/debug.C (showTags): make sure that the output is correctly
6517 * configure.in: add a comment for TWO_COLOR_ICON define.
6519 * acconfig.h: remove all the entries that already defined in
6520 configure.in or acinclude.m4.
6522 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6523 to avoid user name, date and copyright.
6525 1999-12-21 Juergen Vigna <jug@sad.it>
6527 * src/table.C (Read): Now read bogus row format informations
6528 if the format is < 5 so that afterwards the table can
6529 be read by lyx but without any format-info. Fixed the
6530 crash we experienced when not doing this.
6532 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6534 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6535 (RedoDrawingOfParagraph): ditto
6536 (RedoParagraphs): ditto
6537 (RemoveTableRow): ditto
6539 * src/text.C (Fill): rename arg paperwidth -> paper_width
6541 * src/buffer.C (insertLyXFile): rename var filename -> fname
6542 (writeFile): rename arg filename -> fname
6543 (writeFileAscii): ditto
6544 (makeLaTeXFile): ditto
6545 (makeLinuxDocFile): ditto
6546 (makeDocBookFile): ditto
6548 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6551 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6553 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6556 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6557 compiled by a C compiler not C++.
6559 * src/layout.h (LyXTextClass): added typedef for const_iterator
6560 (LyXTextClassList): added typedef for const_iterator + member
6561 functions begin and end.
6563 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6564 iterators to fill the choice_class.
6565 (updateLayoutChoice): rewritten to use iterators to fill the
6566 layoutlist in the toolbar.
6568 * src/BufferView.h (BufferView::work_area_width): removed unused
6571 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6573 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6574 (sgmlCloseTag): ditto
6576 * src/support/lstrings.h: return type of countChar changed to
6579 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6580 what version of this func to use. Also made to return unsigned int.
6582 * configure.in: call LYX_STD_COUNT
6584 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6585 conforming std::count.
6587 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6590 and a subscript would give bad display (patch from Dekel Tsur
6591 <dekel@math.tau.ac.il>).
6593 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6595 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6598 * src/chset.h: add a few 'using' directives
6600 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6601 triggered when no buffer is active
6603 * src/layout.C: removed `break' after `return' in switch(), since
6606 * src/lyx_main.C (init): make sure LyX can be ran in place even
6607 when libtool has done its magic with shared libraries. Fix the
6608 test for the case when the system directory has not been found.
6610 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6611 name for the latex file.
6612 (MenuMakeHTML): ditto
6614 * src/buffer.h: add an optional boolean argument, which is passed
6617 1999-12-20 Allan Rae <rae@lyx.org>
6619 * lib/templates/IEEEtran.lyx: small correction and update.
6621 * configure.in: Attempted to use LYX_PATH_HEADER
6623 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6625 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6626 input from JMarc. Now use preprocessor to find the header.
6627 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6628 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6629 LYX_STL_STRING_FWD. See comments in file.
6631 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6633 * The global MiniBuffer * minibuffer variable is dead.
6635 * The global FD_form_main * fd_form_main variable is dead.
6637 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6639 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6641 * src/table.h: add the LOstream.h header
6642 * src/debug.h: ditto
6644 * src/LyXAction.h: change the explaination of the ReadOnly
6645 attribute: is indicates that the function _can_ be used.
6647 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6650 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6652 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6658 * src/paragraph.C (GetWord): assert on pos>=0
6661 * src/support/lyxstring.C: condition the use of an invariant on
6663 * src/support/lyxstring.h: ditto
6665 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6666 Use LAssert.h instead of plain assert().
6668 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6670 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6671 * src/support/filetools.C: ditto
6673 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6676 * INSTALL: document the new configure flags
6678 * configure.in: suppress --with-debug; add --enable-assertions
6680 * acinclude.m4: various changes in alignment of help strings.
6682 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6684 * src/kbmap.C: commented out the use of the hash map in kb_map,
6685 beginning of movement to a stl::container.
6687 * several files: removed code that was not in effect when
6688 MOVE_TEXT was defined.
6690 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6691 for escaping should not be used. We can discuss if the string
6692 should be enclosed in f.ex. [] instead of "".
6694 * src/trans_mgr.C (insert): use the new returned value from
6695 encodeString to get deadkeys and keymaps done correctly.
6697 * src/chset.C (encodeString): changed to return a pair, to tell
6698 what to use if we know the string.
6700 * src/lyxscreen.h (fillArc): new function.
6702 * src/FontInfo.C (resize): rewritten to use more std::string like
6703 structore, especially string::replace.
6705 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6708 * configure.in (chmod +x some scripts): remove config/gcc-hack
6710 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6712 * src/buffer.C (writeFile): change once again the top comment in a
6713 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6714 instead of an hardcoded version number.
6715 (makeDocBookFile): ditto
6717 * src/version.h: add new define LYX_DOCVERSION
6719 * po/de.po: update from Pit Sütterlin
6720 * lib/bind/de_menus.bind: ditto.
6722 * src/lyxfunc.C (Dispatch): call MenuExport()
6723 * src/buffer.C (Dispatch): ditto
6725 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6726 LyXFunc::Dispatch().
6727 (MenuExport): new function, moved from
6728 LyXFunc::Dispatch().
6730 * src/trans_mgr.C (insert): small cleanup
6731 * src/chset.C (loadFile): ditto
6733 * lib/kbd/iso8859-1.cdef: add missing backslashes
6735 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6737 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6738 help with placing the manually drawn accents better.
6740 (Draw): x2 and hg changed to float to minimize rounding errors and
6741 help place the accents better.
6743 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6744 unsigned short to char is just wrong...cast the char to unsigned
6745 char instead so that the two values can compare sanely. This
6746 should also make the display of insetlatexaccents better and
6747 perhaps also some other insets.
6749 (lbearing): new function
6752 1999-12-15 Allan Rae <rae@lyx.org>
6754 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6755 header that provides a wrapper around the very annoying SGI STL header
6758 * src/support/lyxstring.C, src/LString.h:
6759 removed old SGI-STL-compatability attempts.
6761 * configure.in: Use LYX_STL_STRING_FWD.
6763 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6764 stl_string_fwd.h is around and try to determine it's location.
6765 Major improvement over previous SGI STL 3.2 compatability.
6766 Three small problems remain with this function due to my zero
6767 knowledge of autoconf. JMarc and lgb see the comments in the code.
6769 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6771 * src/broken_const.h, config/hack-gcc, config/README: removed
6773 * configure.in: remove --with-gcc-hack option; do not call
6776 * INSTALL: remove documentation of --with-broken-const and
6779 * acconfig.h: remove all trace of BROKEN_CONST define
6781 * src/buffer.C (makeDocBookFile): update version number in output
6783 (SimpleDocBookOnePar): fix an assert when trying to a character
6784 access beyond string length
6787 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6789 * po/de.po: fix the Export menu
6791 * lyx.man: update the description of -dbg
6793 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6794 (commandLineHelp): updated
6795 (easyParse): show list of available debug levels if -dbg is passed
6798 * src/Makefile.am: add debug.C
6800 * src/debug.h: moved some code to debug.C
6802 * src/debug.C: new file. Contains code to set and show debug
6805 * src/layout.C: remove 'break' after 'continue' in switch
6806 statements, since these cannot be reached.
6808 1999-12-13 Allan Rae <rae@lyx.org>
6810 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6811 (in_word_set): hash() -> math_hash()
6813 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6815 * acconfig.h: Added a test for whether we are using exceptions in the
6816 current compilation run. If so USING_EXCEPTIONS is defined.
6818 * config.in: Check for existance of stl_string_fwd.h
6819 * src/LString.h: If compiling --with-included-string and SGI's
6820 STL version 3.2 is present (see above test) we need to block their
6821 forward declaration of string and supply a __get_c_string().
6822 However, it turns out this is only necessary if compiling with
6823 exceptions enabled so I've a bit more to add yet.
6825 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6826 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6827 src/support/LRegex.h, src/undo.h:
6828 Shuffle the order of the included files a little to ensure that
6829 LString.h gets included before anything that includes stl_string_fwd.h
6831 * src/support/lyxstring.C: We need to #include LString.h instead of
6832 lyxstring.h to get the necessary definition of __get_c_string.
6833 (__get_c_string): New function. This is defined static just like SGI's
6834 although why they need to do this I'm not sure. Perhaps it should be
6835 in lstrings.C instead.
6837 * lib/templates/IEEEtran.lyx: New template file.
6839 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6841 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6842 * intl/Makefile.in (MKINSTALLDIRS): ditto
6844 * src/LyXAction.C (init): changed to hold the LFUN data in a
6845 automatic array in stead of in callso to newFunc, this speeds up
6846 compilation a lot. Also all the memory used by the array is
6847 returned when the init is completed.
6849 * a lot of files: compiled with -Wold-style-cast, changed most of
6850 the reported offenders to C++ style casts. Did not change the
6851 offenders in C files.
6853 * src/trans.h (Match): change argument type to unsigned int.
6855 * src/support/DebugStream.C: fix some types on the streambufs so
6856 that it works on a conforming implementation.
6858 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6860 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6862 * src/support/lyxstring.C: remove the inline added earlier since
6863 they cause a bunch of unsatisfied symbols when linking with dec
6864 cxx. Cxx likes to have the body of inlines at the place where they
6867 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6868 accessing negative bounds in array. This fixes the crash when
6869 inserting accented characters.
6870 * src/trans.h (Match): ditto
6872 * src/buffer.C (Dispatch): since this is a void, it should not try
6873 to return anything...
6875 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6877 * src/buffer.h: removed the two friends from Buffer. Some changes
6878 because of this. Buffer::getFileName and Buffer::setFileName
6879 renamed to Buffer::fileName() and Buffer::fileName(...).
6881 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6883 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6884 and Buffer::update(short) to BufferView. This move is currently
6885 controlled by a define MOVE_TEXT, this will be removed when all
6886 shows to be ok. This move paves the way for better separation
6887 between buffer contents and buffer view. One side effect is that
6888 the BufferView needs a rebreak when swiching buffers, if we want
6889 to avoid this we can add a cache that holds pointers to LyXText's
6890 that is not currently in use.
6892 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6895 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6897 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6899 * lyx_main.C: new command line option -x (or --execute) and
6900 -e (or --export). Now direct conversion from .lyx to .tex
6901 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6902 Unfortunately, X is still needed and the GUI pops up during the
6905 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6907 * src/Spacing.C: add a using directive to bring stream stuff into
6909 * src/paragraph.C: ditto
6910 * src/buffer.C: ditto
6912 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6913 from Lars' announcement).
6915 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6916 example files from Tino Meinen.
6918 1999-12-06 Allan Rae <rae@lyx.org>
6920 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6922 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6924 * src/support/lyxstring.C: added a lot of inline for no good
6927 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6928 latexWriteEndChanges, they were not used.
6930 * src/layout.h (operator<<): output operator for PageSides
6932 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6934 * some example files: loaded in LyX 1.0.4 and saved again to update
6935 certain constructs (table format)
6937 * a lot of files: did the change to use fstream/iostream for all
6938 writing of files. Done with a close look at Andre Poenitz's patch.
6940 * some files: whitespace changes.
6942 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6944 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6945 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6946 architecture, we provide our own. It is used unconditionnally, but
6947 I do not think this is a performance problem. Thanks to Angus
6948 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6949 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6951 (GetInset): use my_memcpy.
6955 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6956 it is easier to understand, but it uses less TeX-only constructs now.
6958 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6959 elements contain spaces
6961 * lib/configure: regenerated
6963 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6964 elements contain spaces; display the list of programs that are
6967 * autogen.sh: make sure lib/configure is executable
6969 * lib/examples/*: rename the tutorial examples to begin with the
6970 two-letters language code.
6972 * src/lyxfunc.C (getStatus): do not query current font if no
6975 * src/lyx_cb.C (RunScript): use QuoteName
6976 (MenuRunDvips): ditto
6977 (PrintApplyCB): ditto
6979 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6980 around argument, so that it works well with the current shell.
6981 Does not work properly with OS/2 shells currently.
6983 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6984 * src/LyXSendto.C (SendtoApplyCB): ditto
6985 * src/lyxfunc.C (Dispatch): ditto
6986 * src/buffer.C (runLaTeX): ditto
6987 (runLiterate): ditto
6988 (buildProgram): ditto
6990 * src/lyx_cb.C (RunScript): ditto
6991 (MenuMakeLaTeX): ditto
6993 * src/buffer.h (getLatexName): new method
6995 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6997 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6999 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7000 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7001 (create_math_panel): ditto
7003 * src/lyxfunc.C (getStatus): re-activate the code which gets
7004 current font and cursor; add test for export to html.
7006 * src/lyxrc.C (read): remove unreachable break statements; add a
7009 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7011 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7013 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7014 introduced by faulty regex.
7015 * src/buffer.C: ditto
7016 * src/lastfiles.C: ditto
7017 * src/paragraph.C: ditto
7018 * src/table.C: ditto
7019 * src/vspace.C: ditto
7020 * src/insets/figinset.C: ditto
7021 Note: most of these is absolutely harmless, except the one in
7022 src/mathed formula.C.
7024 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7026 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7027 operation, yielding correct results for the reLyX command.
7029 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7031 * src/support/filetools.C (ExpandPath): removed an over eager
7033 (ReplaceEnvironmentPath): ditto
7035 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7036 shows that we are doing something fishy in our code...
7040 * src/lyxrc.C (read): use a double switch trick to get more help
7041 from the compiler. (the same trick is used in layout.C)
7042 (write): new function. opens a ofstream and pass that to output
7043 (output): new function, takes a ostream and writes the lyxrc
7044 elemts to it. uses a dummy switch to make sure no elements are
7047 * src/lyxlex.h: added a struct pushpophelper for use in functions
7048 with more than one exit point.
7050 * src/lyxlex.[Ch] (GetInteger): made it const
7054 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7056 * src/layout.[hC] : LayoutTags splitted into several enums, new
7057 methods created, better error handling cleaner use of lyxlex. Read
7060 * src/bmtable.[Ch]: change some member prototypes because of the
7061 image const changes.
7063 * commandtags.h, src/LyXAction.C (init): new function:
7064 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7065 This file is not read automatically but you can add \input
7066 preferences to your lyxrc if you want to. We need to discuss how
7069 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7070 in .aux, also remove .bib and .bst files from dependencies when
7073 * src/BufferView.C, src/LyXView.C: add const_cast several places
7074 because of changes to images.
7076 * lib/images/*: same change as for images/*
7078 * lib/lyxrc.example: Default for accept_compound is false not no.
7080 * images/*: changed to be const, however I have som misgivings
7081 about this change so it might be changed back.
7083 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7085 * lib/configure, po/POTFILES.in: regenerated
7087 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7089 * config/lib_configure.m4: removed
7091 * lib/configure.m4: new file (was config/lib_configure.m4)
7093 * configure.in: do not test for rtti, since we do not use it.
7095 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7098 doubling of allocated space scheme. This makes it faster for large
7099 strings end to use less memory for small strings. xtra rememoved.
7101 * src/insets/figinset.C (waitalarm): commented out.
7102 (GhostscriptMsg): use static_cast
7103 (GhostscriptMsg): use new instead of malloc to allocate memory for
7104 cmap. also delete the memory after use.
7106 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7108 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7109 for changes in bibtex database or style.
7110 (runBibTeX): remove all .bib and .bst files from dep before we
7112 (run): use scanAuc in when dep file already exist.
7114 * src/DepTable.C (remove_files_with_extension): new method
7117 * src/DepTable.[Ch]: made many of the methods const.
7119 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7121 * src/bufferparams.C: make sure that the default textclass is
7122 "article". It used to be the first one by description order, but
7123 now the first one is "docbook".
7125 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7126 string; call Debug::value.
7127 (easyParse): pass complete argument to setDebuggingLevel().
7129 * src/debug.h (value): fix the code that parses debug levels.
7131 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7134 * src/LyXAction.C: use Debug::ACTION as debug channel.
7136 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7138 * NEWS: updated for the future 1.1.3 release.
7140 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7141 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7142 it should. This is of course a controversial change (since many
7143 people will find that their lyx workscreen is suddenly full of
7144 red), but done for the sake of correctness.
7146 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7147 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7149 * src/insets/inseterror.h, src/insets/inseturl.h,
7150 src/insets/insetinfo.h, src/insets/figinset.h,
7151 src/mathed/formulamacro.h, src/mathed/math_macro.h
7152 (EditMessage): add a missing const and add _() to make sure that
7155 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7156 src/insets/insetbib.C, src/support/filetools.C: add `using'
7159 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7160 doing 'Insert index of last word' at the beginning of a paragraph.
7162 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * several files: white-space changes.
7166 * src/mathed/formula.C: removed IsAlpha and IsDigit
7168 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7169 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7172 * src/insets/figinset.C (GetPSSizes): don't break when
7173 "EndComments" is seen. But break when a boundingbox is read.
7175 * all classes inherited from Inset: return value of Clone
7176 changed back to Inset *.
7178 * all classes inherited form MathInset: return value of Clone
7179 changed back to MathedInset *.
7181 * src/insets/figinset.C (runqueue): use a ofstream to output the
7182 gs/ps file. Might need some setpresicion or setw. However I can
7183 see no problem with the current code.
7184 (runqueue): use sleep instead of the alarm/signal code. I just
7185 can't see the difference.
7187 * src/paragraph.C (LyXParagraph): reserve space in the new
7188 paragraph and resize the inserted paragraph to just fit.
7190 * src/lyxfunc.h (operator|=): added operator for func_status.
7192 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7193 check for readable file.
7195 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7196 check for readable file.
7197 (MenuMakeLinuxDoc): ditto
7198 (MenuMakeDocBook): ditto
7199 (MenuMakeAscii): ditto
7200 (InsertAsciiFile): split the test for openable and readable
7202 * src/bmtable.C (draw_bitmaptable): use
7203 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7205 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7206 findtexfile from LaTeX to filetools.
7208 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7209 instead of FilePtr. Needs to be verified by a literate user.
7211 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7213 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7214 (EditMessage): likewise.
7216 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7217 respectively as \textasciitilde and \textasciicircum.
7219 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7221 * src/support/lyxstring.h: made the methods that take iterators
7224 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7225 (regexMatch): made is use the real regex class.
7227 * src/support/Makefile.am: changed to use libtool
7229 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7231 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7233 (MathIsInset ++): changed several macros to be inline functions
7236 * src/mathed/Makefile.am: changed to use libtool
7238 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7240 * src/insets/inset* : Clone changed to const and return type is
7241 the true insettype not just Inset*.
7243 * src/insets/Makefile.am: changed to use libtool
7245 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7247 * src/undo.[Ch] : added empty() and changed some of the method
7250 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7252 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7253 setID use block<> for the bullets array, added const several places.
7255 * src/lyxfunc.C (getStatus): new function
7257 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7258 LyXAction, added const to several funtions.
7260 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7261 a std::map, and to store the dir items in a vector.
7263 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7266 * src/LyXView.[Ch] + other files : changed currentView to view.
7268 * src/LyXAction.[Ch] : ported from the old devel branch.
7270 * src/.cvsignore: added .libs and a.out
7272 * configure.in : changes to use libtool.
7274 * acinclude.m4 : inserted libtool.m4
7276 * .cvsignore: added libtool
7278 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7280 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7281 file name in insets and mathed directories (otherwise the
7282 dependency is not taken in account under cygwin).
7284 * src/text2.C (InsertString[AB]): make sure that we do not try to
7285 read characters past the string length.
7287 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7289 * lib/doc/LaTeXConfig.lyx.in,
7290 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7292 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7293 file saying who created them and when this heppened; this is
7294 useless and annoys tools like cvs.
7296 * lib/layouts/g-brief-{en,de}.layout,
7297 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7298 from Thomas Hartkens <thomas@hartkens.de>.
7300 * src/{insets,mathed}/Makefile.am: do not declare an empty
7301 LDFLAGS, so that it can be set at configure time (useful on Irix
7304 * lib/reLyX/configure.in: make sure that the prefix is set
7305 correctly in LYX_DIR.
7307 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7309 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7310 be used by 'command-sequence' this allows to bind a key to a
7311 sequence of LyX-commands
7312 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7314 * src/LyXAction.C: add "command-sequence"
7316 * src/LyXFunction.C: handling of "command-sequence"
7318 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7319 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7321 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7323 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7325 * src/buffer.C (writeFile): Do not output a comment giving user
7326 and date at the beginning of a .lyx file. This is useless and
7327 annoys cvs anyway; update version number to 1.1.
7329 * src/Makefile.am (LYX_DIR): add this definition, so that a
7330 default path is hardcoded in LyX.
7332 * configure.in: Use LYX_GNU_GETTEXT.
7334 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7335 AM_GNU_GETTEXT with a bug fixed.
7337 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7339 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7341 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7342 which is used to point to LyX data is now LYX_DIR_11x.
7344 * lyx.man: convert to a unix text file; small updates.
7346 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7348 * src/support/LSubstring.[Ch]: made the second arg of most of the
7349 constructors be a const reference.
7351 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7354 * src/support/lyxstring.[Ch] (swap): added missing member function
7355 and specialization of swap(str, str);
7357 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7359 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7360 trace of the old one.
7362 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7363 put the member definitions in undo.C.
7365 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7366 NEW_TEXT and have now only code that was included when this was
7369 * src/intl.C (LCombo): use static_cast
7371 (DispatchCallback): ditto
7373 * src/definitions.h: removed whole file
7375 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7377 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7378 parsing and stores in a std:map. a regex defines the file format.
7379 removed unneeded members.
7381 * src/bufferparams.h: added several enums from definitions.h here.
7382 Removed unsused destructor. Changed some types to use proper enum
7383 types. use block to have the temp_bullets and user_defined_bullets
7384 and to make the whole class assignable.
7386 * src/bufferparams.C (Copy): removed this functions, use a default
7389 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7392 * src/buffer.C (readLyXformat2): commend out all that have with
7393 oldpapersize to do. also comment out all that hve to do with
7394 insetlatex and insetlatexdel.
7395 (setOldPaperStuff): commented out
7397 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7399 * src/LyXAction.C: remove use of inset-latex-insert
7401 * src/mathed/math_panel.C (button_cb): use static_cast
7403 * src/insets/Makefile.am (insets_o_SOURCES): removed
7406 * src/support/lyxstring.C (helper): use the unsigned long
7407 specifier, UL, instead of a static_cast.
7409 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7411 * src/support/block.h: new file. to be used as a c-style array in
7412 classes, so that the class can be assignable.
7414 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7416 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7417 NULL, make sure to return an empty string (it is not possible to
7418 set a string to NULL).
7420 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7422 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7424 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7426 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7427 link line, so that Irix users (for example) can set it explicitely to
7430 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7431 it can be overidden at make time (static or dynamic link, for
7434 * src/vc-backend.C, src/LaTeXFeatures.h,
7435 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7436 statements to bring templates to global namespace.
7438 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7440 * src/support/lyxstring.C (operator[] const): make it standard
7443 * src/minibuffer.C (Init): changed to reflect that more
7444 information is given from the lyxvc and need not be provided here.
7446 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7448 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7450 * src/LyXView.C (UpdateTimerCB): use static_cast
7451 (KeyPressMask_raw_callback): ditto
7453 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7454 buffer_, a lot of changes because of this. currentBuffer() ->
7455 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7456 also changes to other files because of this.
7458 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7460 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7461 have no support for RCS and partial support for CVS, will be
7464 * src/insets/ several files: changes because of function name
7465 changes in Bufferview and LyXView.
7467 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7469 * src/support/LSubstring.[Ch]: new files. These implement a
7470 Substring that can be very convenient to use. i.e. is this
7472 string a = "Mary had a little sheep";
7473 Substring(a, "sheep") = "lamb";
7474 a is now "Mary has a little lamb".
7476 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7477 out patterns and subpatterns of strings. It is used by LSubstring
7478 and also by vc-backend.C
7480 * src/support/lyxstring.C: went over all the assertions used and
7481 tried to correct the wrong ones and flag which of them is required
7482 by the standard. some bugs found because of this. Also removed a
7483 couple of assertions.
7485 * src/support/Makefile.am (libsupport_a_SOURCES): added
7486 LSubstring.[Ch] and LRegex.[Ch]
7488 * src/support/FileInfo.h: have struct stat buf as an object and
7489 not a pointer to one, some changes because of this.
7491 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7492 information in layout when adding the layouts preamble to the
7495 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7498 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7499 because of bug in OS/2.
7501 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7503 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7504 \verbatim@font instead of \ttfamily, so that it can be redefined.
7506 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7507 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7508 src/layout.h, src/text2.C: add 'using' directive to bring the
7509 STL templates we need from the std:: namespace to the global one.
7510 Needed by DEC cxx in strict ansi mode.
7512 * src/support/LIstream.h,src/support/LOstream.h,
7513 src/support/lyxstring.h,src/table.h,
7514 src/lyxlookup.h: do not include <config.h> in header
7515 files. This should be done in the .C files only.
7517 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7521 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7523 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7524 from Kayvan to fix the tth invokation.
7526 * development/lyx.spec.in: updates from Kayvan to reflect the
7527 changes of file names.
7529 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7531 * src/text2.C (InsertStringB): use std::copy
7532 (InsertStringA): use std::copy
7534 * src/bufferlist.C: use a vector to store the buffers in. This is
7535 an internal change and should not affect any other thing.
7537 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7540 * src/text.C (Fill): fix potential bug, one off bug.
7542 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7544 * src/Makefile.am (lyx_main.o): add more files it depends on.
7546 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7548 * src/support/lyxstring.C: use size_t for the reference count,
7549 size, reserved memory and xtra.
7550 (internal_compare): new private member function. Now the compare
7551 functions should work for std::strings that have embedded '\0'
7553 (compare): all compare functions rewritten to use
7556 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7558 * src/support/lyxstring.C (compare): pass c_str()
7559 (compare): pass c_str
7560 (compare): pass c_str
7562 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7564 * src/support/DebugStream.C: <config.h> was not included correctly.
7566 * lib/configure: forgot to re-generate it :( I'll make this file
7567 auto generated soon.
7569 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7571 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7574 * src/support/lyxstring.C: some changes from length() to rep->sz.
7575 avoids a function call.
7577 * src/support/filetools.C (SpaceLess): yet another version of the
7578 algorithm...now per Jean-Marc's suggestions.
7580 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7582 * src/layout.C (less_textclass_desc): functor for use in sorting
7584 (LyXTextClass::Read): sort the textclasses after reading.
7586 * src/support/filetools.C (SpaceLess): new version of the
7587 SpaceLess functions. What problems does this one give? Please
7590 * images/banner_bw.xbm: made the arrays unsigned char *
7592 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7594 * src/support/lyxstring.C (find): remove bogus assertion in the
7595 two versions of find where this has not been done yet.
7597 * src/support/lyxlib.h: add missing int return type to
7600 * src/menus.C (ShowFileMenu): disable exporting to html if no
7601 html export command is present.
7603 * config/lib_configure.m4: add a test for an HTML converter. The
7604 programs checked for are, in this order: tth, latex2html and
7607 * lib/configure: generated from config/lib_configure.m4.
7609 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7610 html converter. The parameters are now passed through $$FName and
7611 $$OutName, instead of standard input/output.
7613 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7615 * lib/lyxrc.example: update description of \html_command.
7616 add "quotes" around \screen_font_xxx font setting examples to help
7617 people who use fonts with spaces in their names.
7619 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7621 * Distribution files: updates for v1.1.2
7623 * src/support/lyxstring.C (find): remove bogus assert and return
7624 npos for the same condition.
7626 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7628 * added patch for OS/2 from SMiyata.
7630 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7632 * src/text2.C (CutSelection): make space_wrapped a bool
7633 (CutSelection): dont declare int i until we have to.
7634 (alphaCounter): return a char const *.
7636 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7638 * src/support/syscall.C (Systemcalls::kill):
7639 src/support/filetools.C (PutEnv, PutEnvPath):
7640 src/lyx_cb.C (addNewlineAndDepth):
7641 src/FontInfo.C (FontInfo::resize): condition some #warning
7642 directives with WITH_WARNINGS.
7645 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7647 * src/layout.[Ch] + several files: access to class variables
7648 limited and made accessor functions instead a lot of code changed
7649 becuase of this. Also instead of returning pointers often a const
7650 reference is returned instead.
7652 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7654 * src/Makefile.am (dist-hook): added used to remove the CVS from
7655 cheaders upon creating a dist
7656 (EXTRA_DIST): added cheaders
7658 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7659 a character not as a small integer.
7661 * src/support/lyxstring.C (find): removed Assert and added i >=
7662 rep->sz to the first if.
7664 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7666 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7667 src/LyXView.C src/buffer.C src/bufferparams.C
7668 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7669 src/text2.C src/insets/insetinclude.C:
7670 lyxlayout renamed to textclasslist.
7672 * src/layout.C: some lyxerr changes.
7674 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7675 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7676 (LyXLayoutList): removed all traces of this class.
7677 (LyXTextClass::Read): rewrote LT_STYLE
7678 (LyXTextClass::hasLayout): new function
7679 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7680 both const and nonconst version.
7681 (LyXTextClass::delete_layout): new function.
7682 (LyXTextClassList::Style): bug fix. do the right thing if layout
7684 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7685 (LyXTextClassList::NameOfLayout): ditto
7686 (LyXTextClassList::Load): ditto
7688 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7690 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7692 * src/LyXAction.C (LookupFunc): added a workaround for sun
7693 compiler, on the other hand...we don't know if the current code
7694 compiles on sun at all...
7696 * src/support/filetools.C (CleanupPath): subst fix
7698 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7701 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7702 complained about this one?
7704 * src/insets/insetinclude.C (Latex): subst fix
7706 * src/insets/insetbib.C (getKeys): subst fix
7708 * src/LyXSendto.C (SendtoApplyCB): subst fix
7710 * src/lyx_main.C (init): subst fix
7712 * src/layout.C (Read): subst fix
7714 * src/lyx_sendfax_main.C (button_send): subst fix
7716 * src/buffer.C (RoffAsciiTable): subst fix
7718 * src/lyx_cb.C (MenuFax): subst fix
7719 (PrintApplyCB): subst fix
7721 1999-10-26 Juergen Vigna <jug@sad.it>
7723 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7725 (Read): Cleaned up this code so now we read only format vestion >= 5
7727 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7729 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7730 come nobody has complained about this one?
7732 * src/insets/insetinclude.C (Latex): subst fix
7734 * src/insets/insetbib.C (getKeys): subst fix
7736 * src/lyx_main.C (init): subst fix
7738 * src/layout.C (Read): subst fix
7740 * src/buffer.C (RoffAsciiTable): subst fix
7742 * src/lyx_cb.C (MenuFax): subst fix.
7744 * src/layout.[hC] + some other files: rewrote to use
7745 std::container to store textclasses and layouts in.
7746 Simplified, removed a lot of code. Make all classes
7747 assignable. Further simplifications and review of type
7748 use still to be one.
7750 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7751 lastfiles to create the lastfiles partr of the menu.
7753 * src/lastfiles.[Ch]: rewritten to use deque to store the
7754 lastfiles in. Uses fstream for reading and writing. Simplifies
7757 * src/support/syscall.C: remove explicit cast.
7759 * src/BufferView.C (CursorToggleCB): removed code snippets that
7761 use explicat C++ style casts instead of C style casts. also use
7762 u_vdata instea of passing pointers in longs.
7764 * src/PaperLayout.C: removed code snippets that were commented out.
7766 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7768 * src/lyx_main.C: removed code snippets that wer commented out.
7770 * src/paragraph.C: removed code snippets that were commented out.
7772 * src/lyxvc.C (logClose): use static_cast
7774 (viewLog): remove explicit cast to void*
7775 (showLog): removed old commented code
7777 * src/menus.C: use static_cast instead of C style casts. use
7778 u_vdata instead of u_ldata. remove explicit cast to (long) for
7779 pointers. Removed old code that was commented out.
7781 * src/insets/inset.C: removed old commented func
7783 * src/insets/insetref.C (InsetRef): removed old code that had been
7784 commented out for a long time.
7786 (escape): removed C style cast
7788 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7790 * src/insets/insetlatex.C (Draw): removed old commented code
7791 (Read): rewritten to use string
7793 * src/insets/insetlabel.C (escape): removed C style cast
7795 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7797 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7800 * src/insets/insetinclude.h: removed a couple of stupid bools
7802 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7803 (Clone): remove C style cast
7804 (getKeys): changed list to lst because of std::list
7806 * src/insets/inseterror.C (Draw): removed som old commented code.
7808 * src/insets/insetcommand.C (Draw): removed some old commented code.
7810 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7811 commented out forever.
7812 (bibitem_cb): use static_cast instead of C style cast
7813 use of vdata changed to u_vdata.
7815 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7817 (CloseUrlCB): use static_cast instead of C style cast.
7818 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7820 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7821 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7822 (CloseInfoCB): static_cast from ob->u_vdata instead.
7823 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7826 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7827 (C_InsetError_CloseErrorCB): forward the ob parameter
7828 (CloseErrorCB): static_cast from ob->u_vdata instead.
7830 * src/vspace.h: include LString.h since we use string in this class.
7832 * src/vspace.C (lyx_advance): changed name from advance because of
7833 nameclash with stl. And since we cannot use namespaces yet...I
7834 used a lyx_ prefix instead. Expect this to change when we begin
7837 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7839 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7840 and removed now defunct constructor and deconstructor.
7842 * src/BufferView.h: have backstack as a object not as a pointer.
7843 removed initialization from constructor. added include for BackStack
7845 * development/lyx.spec.in (%build): add CFLAGS also.
7847 * src/screen.C (drawFrame): removed another warning.
7849 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7851 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7852 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7853 README and ANNOUNCE a bit for the next release. More work is
7856 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7857 unbreakable if we are in freespacing mode (LyX-Code), but not in
7860 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7862 * src/BackStack.h: fixed initialization order in constructor
7864 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7866 * acinclude.m4 (VERSION): new rules for when a version is
7867 development, added also a variable for prerelease.
7868 (warnings): we set with_warnings=yes for prereleases
7869 (lyx_opt): prereleases compile with same optimization as development
7870 (CXXFLAGS): only use pedantic if we are a development version
7872 * src/BufferView.C (restorePosition): don't do anything if the
7875 * src/BackStack.h: added member empty, use this to test if there
7876 is anything to pop...
7878 1999-10-25 Juergen Vigna <jug@sad.it>
7881 * forms/layout_forms.fd +
7882 * forms/latexoptions.fd +
7883 * lyx.fd: changed for various form resize issues
7885 * src/mathed/math_panel.C +
7886 * src/insets/inseterror.C +
7887 * src/insets/insetinfo.C +
7888 * src/insets/inseturl.C +
7889 * src/insets/inseturl.h +
7892 * src/PaperLayout.C +
7893 * src/ParagraphExtra.C +
7894 * src/TableLayout.C +
7896 * src/layout_forms.C +
7903 * src/menus.C: fixed various resize issues. So now forms can be
7904 resized savely or not be resized at all.
7906 * forms/form_url.fd +
7907 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7910 * src/insets/Makefile.am: added files form_url.[Ch]
7912 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7914 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7915 (and presumably 6.2).
7917 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7918 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7919 remaining static member callbacks.
7921 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7924 * src/support/lyxstring.h: declare struct Srep as friend of
7925 lyxstring, since DEC cxx complains otherwise.
7927 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7929 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7931 * src/LaTeX.C (run): made run_bibtex also depend on files with
7933 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7934 are put into the dependency file.
7936 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7937 the code has shown itself to work
7938 (create_ispell_pipe): removed another warning, added a comment
7941 * src/minibuffer.C (ExecutingCB): removed code that has been
7942 commented out a long time
7944 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7945 out code + a warning.
7947 * src/support/lyxstring.h: comment out the three private
7948 operators, when compiling with string ansi conforming compilers
7951 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7953 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7954 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7957 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7960 * src/mathed/math_panel.C (create_math_panel): remove explicit
7963 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7966 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7967 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7968 to XCreatePixmapFromBitmapData
7969 (fl_set_bmtable_data): change the last argument to be unsigned
7971 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7972 and bh to be unsigned int, remove explicit casts in call to
7973 XReadBitmapFileData.
7975 * images/arrows.xbm: made the arrays unsigned char *
7976 * images/varsz.xbm: ditto
7977 * images/misc.xbm: ditto
7978 * images/greek.xbm: ditto
7979 * images/dots.xbm: ditto
7980 * images/brel.xbm: ditto
7981 * images/bop.xbm: ditto
7983 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7985 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7986 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7987 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7989 (LYX_CXX_CHEADERS): added <clocale> to the test.
7991 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7995 * src/support/lyxstring.C (append): fixed something that must be a
7996 bug, rep->assign was used instead of rep->append.
7998 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8001 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8002 lyx insert double chars. Fix spotted by Kayvan.
8004 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8006 * Fixed the tth support. I messed up with the Emacs patch apply feature
8007 and omitted the changes in lyxrc.C.
8009 1999-10-22 Juergen Vigna <jug@sad.it>
8011 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8013 * src/lyx_cb.C (MenuInsertRef) +
8014 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8015 the form cannot be resized under it limits (fixes a segfault)
8017 * src/lyx.C (create_form_form_ref) +
8018 * forms/lyx.fd: Changed Gravity on name input field so that it is
8021 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8023 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8024 <ostream> and <istream>.
8026 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8027 whether <fstream> provides the latest standard features, or if we
8028 have an oldstyle library (like in egcs).
8029 (LYX_CXX_STL_STRING): fix the test.
8031 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8032 code on MODERN_STL_STREAM.
8034 * src/support/lyxstring.h: use L{I,O}stream.h.
8036 * src/support/L{I,O}stream.h: new files, designed to setup
8037 correctly streams for our use
8038 - includes the right header depending on STL capabilities
8039 - puts std::ostream and std::endl (for LOStream.h) or
8040 std::istream (LIStream.h) in toplevel namespace.
8042 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8044 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8045 was a bib file that had been changed we ensure that bibtex is run.
8046 (runBibTeX): enhanced to extract the names of the bib files and
8047 getting their absolute path and enter them into the dep file.
8048 (findtexfile): static func that is used to look for tex-files,
8049 checks for absolute patchs and tries also with kpsewhich.
8050 Alternative ways of finding the correct files are wanted. Will
8052 (do_popen): function that runs a command using popen and returns
8053 the whole output of that command in a string. Should be moved to
8056 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8057 file with extension ext has changed.
8059 * src/insets/figinset.C: added ifdef guards around the fl_free
8060 code that jug commented out. Now it is commented out when
8061 compiling with XForms == 0.89.
8063 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8064 to lyxstring.C, and only keep a forward declaration in
8065 lyxstring.h. Simplifies the header file a bit and should help a
8066 bit on compile time too. Also changes to Srep will not mandate a
8067 recompile of code just using string.
8068 (~lyxstring): definition moved here since it uses srep.
8069 (size): definition moved here since it uses srep.
8071 * src/support/lyxstring.h: removed a couple of "inline" that should
8074 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8076 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8079 1999-10-21 Juergen Vigna <jug@sad.it>
8081 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8082 set to left if I just remove the width entry (or it is empty).
8084 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8085 paragraph when having dummy paragraphs.
8087 1999-10-20 Juergen Vigna <jug@sad.it>
8089 * src/insets/figinset.C: just commented some fl_free_form calls
8090 and added warnings so that this calls should be activated later
8091 again. This avoids for now a segfault, but we have a memory leak!
8093 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8094 'const char * argument' to 'string argument', this should
8095 fix some Asserts() in lyxstring.C.
8097 * src/lyxfunc.h: Removed the function argAsString(const char *)
8098 as it is not used anymore.
8100 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8102 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8105 * src/Literate.h: some funcs moved from public to private to make
8106 interface clearer. Unneeded args removed.
8108 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8110 (scanBuildLogFile): ditto
8112 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8113 normal TeX Error. Still room for improvement.
8115 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8117 * src/buffer.C (insertErrors): changes to make the error
8118 desctription show properly.
8120 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8123 * src/support/lyxstring.C (helper): changed to use
8124 sizeof(object->rep->ref).
8125 (operator>>): changed to use a pointer instead.
8127 * src/support/lyxstring.h: changed const reference & to value_type
8128 const & lets see if that helps.
8130 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * Makefile.am (rpmdist): fixed to have non static package and
8135 * src/support/lyxstring.C: removed the compilation guards
8137 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8140 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8141 conditional compile of lyxstring.Ch
8143 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8144 stupid check, but it is a lot better than the bastring hack.
8145 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8147 * several files: changed string::erase into string::clear. Not
8150 * src/chset.C (encodeString): use a char temporary instead
8152 * src/table.C (TexEndOfCell): added tostr around
8153 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8154 (TexEndOfCell): ditto
8155 (TexEndOfCell): ditto
8156 (TexEndOfCell): ditto
8157 (DocBookEndOfCell): ditto
8158 (DocBookEndOfCell): ditto
8159 (DocBookEndOfCell): ditto
8160 (DocBookEndOfCell): ditto
8162 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8164 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8166 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8167 (MenuBuildProg): added tostr around ret
8168 (MenuRunChktex): added tostr around ret
8169 (DocumentApplyCB): added tostr around ret
8171 * src/chset.C (encodeString): added tostr around t->ic
8173 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8174 (makeLaTeXFile): added tostr around tocdepth
8175 (makeLaTeXFile): added tostr around ftcound - 1
8177 * src/insets/insetbib.C (setCounter): added tostr around counter.
8179 * src/support/lyxstring.h: added an operator+=(int) to catch more
8182 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8183 (lyxstring): We DON'T allow NULL pointers.
8185 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8187 * src/mathed/math_macro.C (MathMacroArgument::Write,
8188 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8189 when writing them out.
8191 * src/LString.C: remove, since it is not used anymore.
8193 * src/support/lyxstring.C: condition the content to
8194 USE_INCLUDED_STRING macro.
8196 * src/mathed/math_symbols.C, src/support/lstrings.C,
8197 src/support/lyxstring.C: add `using' directive to specify what
8198 we need in <algorithm>. I do not think that we need to
8199 conditionalize this, but any thought is appreciated.
8201 * many files: change all callback functions to "C" linkage
8202 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8203 strict_ansi. Those who were static are now global.
8204 The case of callbacks which are static class members is
8205 trickier, since we have to make C wrappers around them (see
8206 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8207 did not finish this yet, since it defeats the purpose of
8208 encapsulation, and I am not sure what the best route is.
8210 1999-10-19 Juergen Vigna <jug@sad.it>
8212 * src/support/lyxstring.C (lyxstring): we permit to have a null
8213 pointer as assignment value and just don't assign it.
8215 * src/vspace.C (nextToken): corrected this function substituting
8216 find_first(_not)_of with find_last_of.
8218 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8219 (TableOptCloseCB) (TableSpeCloseCB):
8220 inserted fl_set_focus call for problem with fl_hide_form() in
8223 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8228 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8230 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8231 LyXLex::next() and not eatline() to get its argument.
8233 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8236 instead, use fstreams for io of the depfile, removed unneeded
8237 functions and variables.
8239 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8240 vector instead, removed all functions and variables that is not in
8243 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8245 * src/buffer.C (insertErrors): use new interface to TeXError
8247 * Makefile.am (rpmdist): added a rpmdist target
8249 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8250 per Kayvan's instructions.
8252 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8254 * src/Makefile.am: add a definition for localedir, so that locales
8255 are found after installation (Kayvan)
8257 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8259 * development/.cvsignore: new file.
8261 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8263 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8264 C++ compiler provides wrappers for C headers and use our alternate
8267 * configure.in: use LYX_CXX_CHEADERS.
8269 * src/cheader/: new directory, populated with cname headers from
8270 libstdc++-2.8.1. They are a bit old, but probably good enough for
8271 what we want (support compilers who lack them).
8273 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8274 from includes. It turns out is was stupid.
8276 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8278 * lib/Makefile.am (install-data-local): forgot a ';'
8279 (install-data-local): forgot a '\'
8280 (libinstalldirs): needed after all. reintroduced.
8282 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8284 * configure.in (AC_OUTPUT): added lyx.spec
8286 * development/lyx.spec: removed file
8288 * development/lyx.spec.in: new file
8290 * po/*.po: merged with lyx.pot becuase of make distcheck
8292 * lib/Makefile.am (dist-hook): added dist-hook so that
8293 documentation files will be included when doing a make
8294 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8295 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8297 more: tried to make install do the right thing, exclude CVS dirs
8300 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8301 Path would fit in more nicely.
8303 * all files that used to use pathstack: uses now Path instead.
8304 This change was a lot easier than expected.
8306 * src/support/path.h: new file
8308 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8310 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8312 * src/support/lyxstring.C (getline): Default arg was given for
8315 * Configure.cmd: removed file
8317 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8320 streams classes and types, add the proper 'using' statements when
8321 MODERN_STL is defined.
8323 * src/debug.h: move the << operator definition after the inclusion
8326 * src/support/filetools.C: include "LAssert.h", which is needed
8329 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8332 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8333 include "debug.h" to define a proper ostream.
8335 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8337 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8338 method to the SystemCall class which can kill a process, but it's
8339 not fully implemented yet.
8341 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8343 * src/support/FileInfo.h: Better documentation
8345 * src/lyxfunc.C: Added support for buffer-export html
8347 * src/menus.C: Added Export->As HTML...
8349 * lib/bind/*.bind: Added short-cut for buffer-export html
8351 * src/lyxrc.*: Added support for new \tth_command
8353 * lib/lyxrc.example: Added stuff for new \tth_command
8355 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8357 * lib/Makefile.am (IMAGES): removed images/README
8358 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8359 installes in correct place. Check permisions is installed
8362 * src/LaTeX.C: some no-op changes moved declaration of some
8365 * src/LaTeX.h (LATEX_H): changed include guard name
8367 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8369 * lib/reLyX/Makefile.am: install noweb2lyx.
8371 * lib/Makefile.am: install configure.
8373 * lib/reLyX/configure.in: declare a config aux dir; set package
8374 name to lyx (not sure what the best solution is); generate noweb2lyx.
8376 * lib/layouts/egs.layout: fix the bibliography layout.
8378 1999-10-08 Jürgen Vigna <jug@sad.it>
8380 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8381 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8382 it returned without continuing to search the path.
8384 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8386 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8387 also fixes a bug. It is not allowed to do tricks with std::strings
8388 like: string a("hei"); &a[e]; this will not give what you
8389 think... Any reason for the complexity in this func?
8391 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8393 * Updated README and INSTALL a bit, mostly to check that my
8394 CVS rights are correctly set up.
8396 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8399 does not allow '\0' chars but lyxstring and std::string does.
8401 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8403 * autogen.sh (AUTOCONF): let the autogen script create the
8404 POTFILES.in file too. POTFILES.in should perhaps now not be
8405 included in the cvs module.
8407 * some more files changed to use C++ includes instead of C ones.
8409 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8411 (Reread): added tostr to nlink. buggy output otherwise.
8412 (Reread): added a string() around szMode when assigning to Buffer,
8413 without this I got a log of garbled info strings.
8415 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8418 * I have added several ostream & operator<<(ostream &, some_type)
8419 functions. This has been done to avoid casting and warnings when
8420 outputting enums to lyxerr. This as thus eliminated a lot of
8421 explicit casts and has made the code clearer. Among the enums
8422 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8423 mathed enums, some font enum the Debug::type enum.
8425 * src/support/lyxstring.h (clear): missing method. equivalent of
8428 * all files that contained "stderr": rewrote constructs that used
8429 stderr to use lyxerr instead. (except bmtable)
8431 * src/support/DebugStream.h (level): and the passed t with
8432 Debug::ANY to avoid spurious bits set.
8434 * src/debug.h (Debug::type value): made it accept strings of the
8437 * configure.in (Check for programs): Added a check for kpsewhich,
8438 the latex generation will use this later to better the dicovery of
8441 * src/BufferView.C (create_view): we don't need to cast this to
8442 (void*) that is done automatically.
8443 (WorkAreaButtonPress): removed some dead code.
8445 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8447 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8448 is not overwritten when translated (David Sua'rez de Lis).
8450 * lib/CREDITS: Added David Sua'rez de Lis
8452 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8454 * src/bufferparams.C (BufferParams): default input encoding is now
8457 * acinclude.m4 (cross_compiling): comment out macro
8458 LYX_GXX_STRENGTH_REDUCE.
8460 * acconfig.h: make sure that const is not defined (to empty) when
8461 we are compiling C++. Remove commented out code using SIZEOF_xx
8464 * configure.in : move the test for const and inline as late as
8465 possible so that these C tests do not interefere with C++ ones.
8466 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8467 has not been proven.
8469 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8471 * src/table.C (getDocBookAlign): remove bad default value for
8474 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8476 (ShowFileMenu2): ditto.
8478 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8481 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8483 * Most files: finished the change from the old error code to use
8484 DebugStream for all lyxerr debugging. Only minor changes remain
8485 (e.g. the setting of debug levels using strings instead of number)
8487 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8489 * src/layout.C (Add): Changed to use compare_no_case instead of
8492 * src/FontInfo.C: changed loop variable type too string::size_type.
8494 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8497 set ETAGS_ARGS to --c++
8499 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8501 * src/table.C (DocBookEndOfCell): commented out two unused variables
8503 * src/paragraph.C: commented out four unused variables.
8505 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8506 insed a if clause with type string::size_type.
8508 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8511 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8513 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8514 variable, also changed loop to go from 0 to lenght + 1, instead of
8515 -1 to length. This should be correct.
8517 * src/LaTeX.C (scanError): use string::size_type as loop variable
8520 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8521 (l.896) since y_tmp and row was not used anyway.
8523 * src/insets/insetref.C (escape): use string::size_type as loop
8526 * src/insets/insetquotes.C (Width): use string::size_type as loop
8528 (Draw): use string::size_type as loop variable type.
8530 * src/insets/insetlatexaccent.C (checkContents): use
8531 string::size_type as loop variable type.
8533 * src/insets/insetlabel.C (escape): use string::size_type as loop
8536 * src/insets/insetinfo.C: added an extern for current_view.
8538 * src/insets/insetcommand.C (scanCommand): use string::size_type
8539 as loop variable type.
8541 * most files: removed the RCS tags. With them we had to recompile
8542 a lot of files after a simple cvs commit. Also we have never used
8543 them for anything meaningful.
8545 * most files: tags-query-replace NULL 0. As adviced several plases
8546 we now use "0" instead of "NULL" in our code.
8548 * src/support/filetools.C (SpaceLess): use string::size_type as
8551 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/paragraph.C: fixed up some more string stuff.
8555 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * src/support/filetools.h: make modestr a std::string.
8559 * src/filetools.C (GetEnv): made ch really const.
8561 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8562 made code that used these use max/min from <algorithm> instead.
8564 * changed several c library include files to their equivalent c++
8565 library include files. All is not changed yet.
8567 * created a support subdir in src, put lyxstring and lstrings
8568 there + the extra files atexit, fileblock, strerror. Created
8569 Makefile.am. edited configure.in and src/Makefile.am to use this
8570 new subdir. More files moved to support.
8572 * imported som of the functions from repository lyx, filetools
8574 * ran tags-query-replace on LString -> string, corrected the bogus
8575 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8576 is still some errors in there. This is errors where too much or
8577 too litle get deleted from strings (string::erase, string::substr,
8578 string::replace), there can also be some off by one errors, or
8579 just plain wrong use of functions from lstrings. Viewing of quotes
8582 * LyX is now running fairly well with string, but there are
8583 certainly some bugs yet (see above) also string is quite different
8584 from LString among others in that it does not allow null pointers
8585 passed in and will abort if it gets any.
8587 * Added the revtex4 files I forgot when setting up the repository.
8589 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8591 * All over: Tried to clean everything up so that only the files
8592 that we really need are included in the cvs repository.
8593 * Switched to use automake.
8594 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8595 * Install has not been checked.
8597 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8599 * po/pt.po: Three errors:
8600 l.533 and l.538 format specification error
8601 l. 402 duplicate entry, I just deleted it.