1 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * several files: removed almost all traces of the old table
6 * src/TableLayout.C: removed file
8 2000-09-22 Juergen Vigna <jug@sad.it>
10 * src/frontends/kde/Dialogs.C: added credits forms.
12 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
14 * src/frontends/gnome/Dialogs.C: added some forms.
16 * src/spellchecker.C (init_spell_checker): set language in pspell code
17 (RunSpellChecker): some modifications for setting language string.
19 * src/language.[Ch]: added language_country code.
21 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
23 * src/frontends/Dialogs.h: added new signal showError.
24 Rearranged existing signals in some sort of alphabetical order.
26 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
27 FormError.[Ch], form_error.[Ch]
28 * src/frontends/xforms/forms/makefile: added new file form_error.fd
29 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
31 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
32 dialogs. I think that this can be used as the base to all these
35 * src/frontends/xforms/FormError.[Ch]
36 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
37 implementation of InsetError dialog.
39 * src/insets/inseterror.[Ch]: rendered GUI-independent.
41 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
42 * src/frontends/kde/Makefile.am: ditto
44 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
46 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
47 macrobf. This fixes a bug of invisible text.
49 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
51 * lib/doc/LaTeXConfig.lyx.in: updated.
53 * src/language.C (initL): remove language "francais" and change a
54 bit the names of the two other french variations.
56 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
57 string that may not be 0-terminated.
59 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
61 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
63 2000-09-20 Marko Vendelin <markov@ioc.ee>
65 * src/frontends/gnome/FormCitation.C
66 * src/frontends/gnome/FormIndex.C
67 * src/frontends/gnome/FormToc.C
68 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
69 the variable initialization to shut up the warnings
71 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
73 * src/table.[Ch]: deleted files
75 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
78 2000-09-18 Juergen Vigna <jug@sad.it>
80 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
81 problems with selection. Inserted new LFUN_PASTESELECTION.
82 (InsetButtonPress): inserted handling of middle mouse-button paste.
84 * src/spellchecker.C: changed word to word.c_str().
86 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
88 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
89 included in the ``make dist'' tarball.
91 2000-09-15 Juergen Vigna <jug@sad.it>
93 * src/CutAndPaste.C (cutSelection): small fix return the right
94 end position after cut inside one paragraph only.
96 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
97 we are locked as otherwise we don't have a valid cursor position!
99 * src/insets/figinset.C (draw): small bugfix but why is this needed???
101 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
103 * src/frontends/kde/FormRef.C: added using directive.
104 * src/frontends/kde/FormToc.C: ditto
106 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
108 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
111 2000-09-19 Marko Vendelin <markov@ioc.ee>
113 * src/frontends/gnome/Menubar_pimpl.C
114 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
115 Toc, ViewFormats, UpdateFormats, and ExportFormats.
117 * src/frontends/gnome/mainapp.C
118 * src/frontends/gnome/mainapp.h: support for menu update used
121 * src/frontends/gnome/mainapp.C
122 * src/frontends/gnome/mainapp.h: support for "action" area in the
123 main window. This area is used by small simple dialogs, such as
126 * src/frontends/gnome/FormIndex.C
127 * src/frontends/gnome/FormIndex.h
128 * src/frontends/gnome/FormUrl.C
129 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
132 * src/frontends/gnome/FormCitation.C
133 * src/frontends/gnome/FormCitation.h: rewrite to use main window
134 action area. Only "Insert new citation" is implemented.
138 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
140 * src/buffer.C (Dispatch): fix call to Dispatch
141 * src/insets/insetref.C (Edit): likewise
142 * src/insets/insetparent.C (Edit): likewise
143 * src/insets/insetinclude.C (include_cb): likewise
144 * src/frontends/xforms/FormUrl.C (apply): likewise
145 * src/frontends/xforms/FormToc.C (apply): likewise
146 * src/frontends/xforms/FormRef.C (apply): likewise
147 * src/frontends/xforms/FormIndex.C (apply): likewise
148 * src/frontends/xforms/FormCitation.C (apply): likewise
149 * src/lyxserver.C (callback): likewise
150 * src/lyxfunc.C (processKeySym): likewise
153 * src/lyx_cb.C (LayoutsCB): likewise
155 * Makefile.am (sourcedoc): small change
157 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
159 * src/main.C (main): Don't make an empty GUIRunTime object. all
160 methods are static. constify a bit remove unneded using + headers.
162 * src/tabular.C: some more const to local vars move some loop vars
164 * src/spellchecker.C: added some c_str after some word for pspell
166 * src/frontends/GUIRunTime.h: add new static method setDefaults
167 * src/frontends/xforms/GUIRunTime.C (setDefaults):
168 * src/frontends/kde/GUIRunTime.C (setDefaults):
169 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
171 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
172 with strnew in arg, use correct emptystring when calling SetName.
174 * several files: remove all commented code with relation to
175 HAVE_SSTREAM beeing false. We now only support stringstream and
178 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
180 * src/lyxfunc.C: construct correctly the automatic new file
183 * src/text2.C (IsStringInText): change type of variable i to shut
186 * src/support/sstream.h: do not use namespaces if the compiler
187 does not support them.
189 2000-09-15 Marko Vendelin <markov@ioc.ee>
190 * src/frontends/gnome/FormCitation.C
191 * src/frontends/gnome/FormCitation.h
192 * src/frontends/gnome/diainsertcitation_interface.c
193 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
194 regexp support to FormCitation [Gnome].
196 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
199 * configure.in: remove unused KDE/GTKGUI define
201 * src/frontends/kde/FormRef.C
202 * src/frontends/kde/FormRef.h
203 * src/frontends/kde/formrefdialog.C
204 * src/frontends/kde/formrefdialog.h: double click will
205 go to reference, now it is possible to change a cross-ref
208 * src/frontends/kde/FormToc.C
209 * src/frontends/kde/FormToc.h
210 * src/frontends/kde/formtocdialog.C
211 * src/frontends/kde/formtocdialog.h: add a depth
214 * src/frontends/kde/Makefile.am: add QtLyXView.h
217 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
219 * src/frontends/kde/FormCitation.h: added some using directives.
221 * src/frontends/kde/FormToc.h: corrected definition of doTree.
223 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
226 * src/mathed/math_defs.h: redefine SetAlign to use string rather
229 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
231 * src/buffer.C (pop_tag): revert for the second time a change by
232 Lars, who seems to really hate having non-local loop variables :)
234 * src/Lsstream.h: add "using" statements.
236 * src/support/copy.C (copy): add a bunch of std:: qualifiers
237 * src/buffer.C (writeFile): ditto
239 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
241 * src/buffer.C (writeFile): try to fix the locale modified format
242 number to always be as we want it.
244 * src/WorkArea.C (work_area_handler): try to workaround the bugs
245 in XForms 0.89. C-space is now working again.
247 * src/Lsstream.h src/support/sstream.h: new files.
249 * also commented out all cases where strstream were used.
251 * src/Bullet.h (c_str): remove method.
253 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
255 * a lot of files: get rid of "char const *" and "char *" is as
256 many places as possible. We only want to use them in interaction
257 with system of other libraries, not inside lyx.
259 * a lot of files: return const object is not of pod type. This
260 helps ensure that temporary objects is not modified. And fits well
261 with "programming by contract".
263 * configure.in: check for the locale header too
265 * Makefile.am (sourcedoc): new tag for generation of doc++
268 2000-09-14 Juergen Vigna <jug@sad.it>
270 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
271 callback to check which combo called it and do the right action.
273 * src/combox.C (combo_cb): added combo * to the callbacks.
274 (Hide): moved call of callback after Ungrab of the pointer.
276 * src/intl.h: removed LCombo2 function.
278 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
279 function as this can now be handled in one function.
281 * src/combox.h: added Combox * to callback prototype.
283 * src/frontends/xforms/Toolbar_pimpl.C:
284 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
286 2000-09-14 Garst Reese <reese@isn.net>
288 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
289 moved usepackage{xxx}'s to beginning of file. Changed left margin
290 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
291 underlining from title. Thanks to John Culleton for useful suggestions.
293 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
295 * src/lyxlex_pimpl.C (setFile): change error message to debug
298 2000-09-13 Juergen Vigna <jug@sad.it>
300 * src/frontends/xforms/FormDocument.C: implemented choice_class
301 as combox and give callback to combo_language so OK/Apply is activated
304 * src/bufferlist.C (newFile): small fix so already named files
305 (via an open call) are not requested to be named again on the
308 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
310 * src/frontends/kde/Makefile.am
311 * src/frontends/kde/FormRef.C
312 * src/frontends/kde/FormRef.h
313 * src/frontends/kde/formrefdialog.C
314 * src/frontends/kde/formrefdialog.h: implement
317 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
319 * src/frontends/kde/formtocdialog.C
320 * src/frontends/kde/formtocdialog.h
321 * src/frontends/kde/FormToc.C
322 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
324 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
326 * src/frontends/kde/FormCitation.C: fix thinko
327 where we didn't always display the reference text
330 * src/frontends/kde/formurldialog.C
331 * src/frontends/kde/formurldialog.h
332 * src/frontends/kde/FormUrl.C
333 * src/frontends/kde/FormUrl.h: minor cleanups
335 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
337 * src/frontends/kde/Makefile.am
338 * src/frontends/kde/FormToc.C
339 * src/frontends/kde/FormToc.h
340 * src/frontends/kde/FormCitation.C
341 * src/frontends/kde/FormCitation.h
342 * src/frontends/kde/FormIndex.C
343 * src/frontends/kde/FormIndex.h
344 * src/frontends/kde/formtocdialog.C
345 * src/frontends/kde/formtocdialog.h
346 * src/frontends/kde/formcitationdialog.C
347 * src/frontends/kde/formcitationdialog.h
348 * src/frontends/kde/formindexdialog.C
349 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
351 2000-09-12 Juergen Vigna <jug@sad.it>
353 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
356 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
358 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
361 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
363 * src/converter.C (Add, Convert): Added support for converter flags:
364 needaux, resultdir, resultfile.
365 (Convert): Added new parameter view_file.
366 (dvips_options): Fixed letter paper option.
368 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
369 (Export, GetExportableFormats, GetViewableFormats): Added support
372 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
374 (easyParse): Fixed to work with new export code.
376 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
379 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
381 * lib/bind/*.bind: Replaced
382 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
383 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
385 2000-09-11 Juergen Vigna <jug@sad.it>
387 * src/lyx_gui.C (runTime): uses global guiruntime variable.
389 * src/main.C (main): now GUII defines global guiruntime!
391 * src/frontends/gnome/GUIRunTime.C (initApplication):
392 * src/frontends/kde/GUIRunTime.C (initApplication):
393 * src/frontends/xforms/GUIRunTime.C (initApplication):
394 * src/frontends/GUIRunTime.h: added new function initApplication.
396 * src/spellchecker.C (sc_accept_word): change to add_to_session.
398 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
400 2000-09-08 Juergen Vigna <jug@sad.it>
402 * src/lyx_gui.C (create_forms): don't display the "default" entry as
403 we have already "Reset".
405 * src/language.C (initL): inserted "default" language and made this
406 THE default language (and not american!)
408 * src/paragraph.C: inserted handling of "default" language!
410 * src/lyxfont.C: ditto
414 * src/paragraph.C: output the \\par only if we have a following
415 paragraph otherwise it's not needed.
417 2000-09-05 Juergen Vigna <jug@sad.it>
419 * config/pspell.m4: added entry to lyx-flags
421 * src/spellchecker.C: modified version from Kevin for using pspell
423 2000-09-01 Marko Vendelin <markov@ioc.ee>
424 * src/frontends/gnome/Makefile.am
425 * src/frontends/gnome/FormCitation.C
426 * src/frontends/gnome/FormCitation.h
427 * src/frontends/gnome/diainsertcitation_callbacks.c
428 * src/frontends/gnome/diainsertcitation_callbacks.h
429 * src/frontends/gnome/diainsertcitation_interface.c
430 * src/frontends/gnome/diainsertcitation_interface.h
431 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
432 dialog for Gnome frontend
434 * src/main.C: Gnome libraries require keeping application name
435 and its version as strings
437 * src/frontends/gnome/mainapp.C: Change the name of the main window
438 from GnomeLyX to PACKAGE
440 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
442 * src/frontends/Liason.C: add "using: declaration.
444 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
446 * src/mathed/math_macro.C (Metrics): Set the size of the template
448 * src/mathed/formulamacro.C (Latex): Fixed the returned value
450 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
452 * src/converter.C (add_options): New function.
453 (SetViewer): Change $$FName into '$$FName'.
454 (View): Add options when running xdvi
455 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
456 (Convert): The 3rd parameter is now the desired filename. Converts
457 calls to lyx::rename if necessary.
458 Add options when running dvips.
459 (dvi_papersize,dvips_options): New methods.
461 * src/exporter.C (Export): Use getLatexName() instead of fileName().
463 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
464 using a call to Converter::dvips_options.
465 Fixed to work with nex export code.
468 * src/support/rename.C: New files
470 * src/support/syscall.h
471 * src/support/syscall.C: Added Starttype SystemDontWait.
473 * lib/ui/default.ui: Changed to work with new export code
475 * lib/configure.m4: Changed to work with new export code
477 * src/encoding.C: Changed latex name for iso8859_7 encoding.
479 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
481 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
482 so that code compiles with DEC cxx.
484 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
485 to work correctly! Also now supports the additional elements
488 2000-09-01 Allan Rae <rae@lyx.org>
490 * src/frontends/ButtonPolicies.C: renamed all the references to
491 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
493 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
494 since it's a const not a type.
496 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
498 2000-08-31 Juergen Vigna <jug@sad.it>
500 * src/insets/figinset.C: Various changes to look if the filename has
501 an extension and if not add it for inline previewing.
503 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
505 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
506 make buttonStatus and isReadOnly be const methods. (also reflect
507 this in derived classes.)
509 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
510 (nextState): change to be static inline, pass the StateMachine as
512 (PreferencesPolicy): remove casts
513 (OkCancelPolicy): remvoe casts
514 (OkCancelReadOnlyPolicy): remove casts
515 (NoRepeatedApplyReadOnlyPolicy): remove casts
516 (OkApplyCancelReadOnlyPolicy): remove casts
517 (OkApplyCancelPolicy): remove casts
518 (NoRepeatedApplyPolicy): remove casts
520 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
522 * src/converter.C: added some using directives
524 * src/frontends/ButtonPolicies.C: changes to overcome
525 "need lvalue" error with DEC c++
527 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
528 to WMHideCB for DEC c++
530 * src/frontends/xforms/Menubar_pimpl.C: added using directive
532 * src/frontends/xforms/forms/form_document.C.patch: use C callback
533 to BulletBMTableCB for DEC c++
535 2000-08-31 Allan Rae <rae@lyx.org>
537 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
538 character dialog separately from old document dialogs combo_language.
541 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
543 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
544 Removed LFUN_REF_CREATE.
546 * src/MenuBackend.C: Added new tags: toc and references
548 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
549 (add_lastfiles, add_documents, add_formats): Removed the unused smn
551 (add_toc, add_references): New methods.
552 (create_submenu): Handle correctly the case when there is a
553 seperator after optional menu items.
555 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
556 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
557 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
559 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
561 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
563 * src/converter.[Ch]: New file for converting between different
566 * src/export.[Ch]: New file for exporting a LyX file to different
569 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
570 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
571 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
572 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
573 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
574 RunDocBook, MenuExport.
576 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
577 Exporter::Preview methods if NEW_EXPORT is defined.
579 * src/buffer.C (Dispatch): Use Exporter::Export.
581 * src/lyxrc.C: Added new tags: \converter and \viewer.
584 * src/LyXAction.C: Define new lyx-function: buffer-update.
585 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
586 when NEW_EXPORT is defined.
588 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
590 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
592 * lib/ui/default.ui: Added submenus "view" and "update" to the
595 * src/filetools.C (GetExtension): New function.
597 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
599 2000-08-29 Allan Rae <rae@lyx.org>
601 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
603 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
604 (EnableDocumentLayout): removed
605 (DisableDocumentLayout): removed
606 (build): make use of ButtonController's read-only handling to
607 de/activate various objects. Replaces both of the above functions.
609 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
610 (readOnly): was read_only
611 (refresh): fixed dumb mistakes with read_only_ handling
613 * src/frontends/xforms/forms/form_document.fd:
614 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
615 tabbed dialogs so the tabs look more like tabs and so its easier to
616 work out which is the current tab.
618 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
619 segfault with form_table
621 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
623 2000-08-28 Juergen Vigna <jug@sad.it>
625 * acconfig.h: added USE_PSPELL.
627 * src/config.h.in: added USE_PSPELL.
629 * autogen.sh: added pspell.m4
631 * config/pspell.m4: new file.
633 * src/spellchecker.C: implemented support for pspell libary.
635 2000-08-25 Juergen Vigna <jug@sad.it>
637 * src/LyXAction.C (init): renamed LFUN_TABLE to
638 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
640 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
642 * src/lyxscreen.h: add force_clear variable and fuction to force
643 a clear area when redrawing in LyXText.
645 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
647 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
649 * some whitespace and comment changes.
651 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
653 * src/buffer.C: up te LYX_FORMAT to 2.17
655 2000-08-23 Juergen Vigna <jug@sad.it>
657 * src/BufferView_pimpl.C (tripleClick): disable this when in a
660 * src/insets/insettabular.C (pasteSelection): delete the insets
661 LyXText as it is not valid anymore.
662 (copySelection): new function.
663 (pasteSelection): new function.
664 (cutSelection): new function.
665 (LocalDispatch): implemented cut/copy/paste of cell selections.
667 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
668 don't have a LyXText.
670 * src/LyXAction.C (init): a NEW_TABULAR define too much.
672 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
675 2000-08-22 Juergen Vigna <jug@sad.it>
677 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
678 ifdef form_table out if NEW_TABULAR.
680 2000-08-21 Juergen Vigna <jug@sad.it>
682 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
683 (draw): fixed draw position so that the cursor is positioned in the
685 (InsetMotionNotify): hide/show cursor so the position is updated.
686 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
687 using cellstart() function where it should be used.
689 * src/insets/insettext.C (draw): ditto.
691 * src/tabular.C: fixed initialization of some missing variables and
692 made BoxType into an enum.
694 2000-08-22 Marko Vendelin <markov@ioc.ee>
695 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
696 stock menu item using action numerical value, not its string
700 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
702 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
703 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
705 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
707 * src/frontends/xforms/GUIRunTime.C: new file
709 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
710 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
712 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
714 * src/frontends/kde/GUIRunTime.C: new file
716 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
717 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
719 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
721 * src/frontends/gnome/GUIRunTime.C: new file
723 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
726 * src/frontends/GUIRunTime.h: removed constructor and destructor,
727 small change to documetentation.
729 * src/frontends/GUIRunTime.C: removed file
731 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
733 * src/lyxparagraph.h: enable NEW_TABULAR as default
735 * src/lyxfunc.C (processKeySym): remove some commented code
737 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
738 NEW_TABULAR around the fd_form_table_options.
740 * src/lyx_gui.C (runTime): call the static member function as
741 GUIRunTime::runTime().
743 2000-08-21 Allan Rae <rae@lyx.org>
745 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
748 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
750 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
752 2000-08-21 Allan Rae <rae@lyx.org>
754 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
756 * src/frontends/xforms/FormPreferences.C (build): use setOK
757 * src/frontends/xforms/FormDocument.C (build): use setOK
758 (FormDocument): use the appropriate policy.
760 2000-08-21 Allan Rae <rae@lyx.org>
762 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
763 automatic [de]activation of arbitrary objects when in a read-only state.
765 * src/frontends/ButtonPolicies.h: More documentation
766 (isReadOnly): added to support the above.
768 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
770 2000-08-18 Juergen Vigna <jug@sad.it>
772 * src/insets/insettabular.C (getStatus): changed to return func_status.
774 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
775 display toggle menu entries if they are.
777 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
778 new document layout now.
780 * src/lyxfunc.C: ditto
782 * src/lyx_gui_misc.C: ditto
784 * src/lyx_gui.C: ditto
786 * lib/ui/default.ui: removed paper and quotes layout as they are now
787 all in the document layout tabbed folder.
789 * src/frontends/xforms/forms/form_document.fd: added Restore
790 button and callbacks for all inputs for Allan's ButtonPolicy.
792 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
793 (CheckChoiceClass): added missing params setting on class change.
794 (UpdateLayoutDocument): added for updating the layout on params.
795 (build): forgot to RETURN_ALWAYS input_doc_spacing.
796 (FormDocument): Implemented Allan's ButtonPolicy with the
799 2000-08-17 Allan Rae <rae@lyx.org>
801 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
802 so we can at least see the credits again.
804 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
805 controller calls for the appropriate callbacks. Note that since Ok
806 calls apply followed by cancel, and apply isn't a valid input for the
807 APPLIED state, the bc_ calls have to be made in the static callback not
808 within each of the real callbacks.
810 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
811 (setOk): renamed from setOkay()
813 2000-08-17 Juergen Vigna <jug@sad.it>
815 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
816 in the implementation part.
817 (composeUIInfo): don't show optional menu-items.
819 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
821 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
823 * src/bufferview_funcs.C (CurrentState): fixed to show also the
824 text-state when in a text-inset.
826 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
828 2000-08-17 Marko Vendelin <markov@ioc.ee>
829 * src/frontends/gnome/FormIndex.C
830 * src/frontends/gnome/FormIndex.h
831 * src/frontends/gnome/FormToc.C
832 * src/frontends/gnome/FormToc.h
833 * src/frontends/gnome/dialogs
834 * src/frontends/gnome/diatoc_callbacks.c
835 * src/frontends/gnome/diatoc_callbacks.h
836 * src/frontends/gnome/diainsertindex_callbacks.h
837 * src/frontends/gnome/diainsertindex_callbacks.c
838 * src/frontends/gnome/diainsertindex_interface.c
839 * src/frontends/gnome/diainsertindex_interface.h
840 * src/frontends/gnome/diatoc_interface.h
841 * src/frontends/gnome/diatoc_interface.c
842 * src/frontends/gnome/Makefile.am: Table of Contents and
843 Insert Index dialogs implementation for Gnome frontend
845 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
847 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
849 * src/frontends/gnome/diainserturl_interface.c: make the dialog
852 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
854 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
855 destructor. Don't definde if you don't need it
856 (processEvents): made static, non-blocking events processing for
858 (runTime): static method. event loop for xforms
859 * similar as above for kde and gnome.
861 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
863 (runTime): new method calss the real frontends runtime func.
865 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
867 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
869 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
871 2000-08-16 Juergen Vigna <jug@sad.it>
873 * src/lyx_gui.C (runTime): added GUII RunTime support.
875 * src/frontends/Makefile.am:
876 * src/frontends/GUIRunTime.[Ch]:
877 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
878 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
879 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
881 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
883 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
884 as this is already set in ${FRONTEND_INCLUDE} if needed.
886 * configure.in (CPPFLAGS): setting the include dir for the frontend
887 directory and don't set FRONTEND=xforms for now as this is executed
890 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
892 * src/frontends/kde/Makefile.am:
893 * src/frontends/kde/FormUrl.C:
894 * src/frontends/kde/FormUrl.h:
895 * src/frontends/kde/formurldialog.h:
896 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
898 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
900 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
902 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
904 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
907 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
909 * src/WorkArea.C (work_area_handler): more work to get te
910 FL_KEYBOARD to work with xforms 0.88 too, please test.
912 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
914 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
916 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
919 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
921 * src/Timeout.h: remove Qt::emit hack.
923 * several files: changes to allo doc++ compilation
925 * src/lyxfunc.C (processKeySym): new method
926 (processKeyEvent): comment out if FL_REVISION < 89
928 * src/WorkArea.C: change some debugging levels.
929 (WorkArea): set wantkey to FL_KEY_ALL
930 (work_area_handler): enable the FL_KEYBOARD clause, this enables
931 clearer code and the use of compose with XForms 0.89. Change to
932 use signals instead of calling methods in bufferview directly.
934 * src/Painter.C: change some debugging levels.
936 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
939 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
940 (workAreaKeyPress): new method
942 2000-08-14 Juergen Vigna <jug@sad.it>
944 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
946 * config/kde.m4: addes some features
948 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
949 include missing xforms dialogs.
951 * src/Timeout.h: a hack to be able to compile with qt/kde.
953 * sigc++/.cvsignore: added acinclude.m4
955 * lib/.cvsignore: added listerros
957 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
958 xforms tree as objects are needed for other frontends.
960 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
961 linking with not yet implemented xforms objects.
963 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
965 2000-08-14 Baruch Even <baruch.even@writeme.com>
967 * src/frontends/xforms/FormGraphics.h:
968 * src/frontends/xforms/FormGraphics.C:
969 * src/frontends/xforms/RadioButtonGroup.h:
970 * src/frontends/xforms/RadioButtonGroup.C:
971 * src/insets/insetgraphics.h:
972 * src/insets/insetgraphics.C:
973 * src/insets/insetgraphicsParams.h:
974 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
975 instead of spaces, and various other indentation issues to make the
976 sources more consistent.
978 2000-08-14 Marko Vendelin <markov@ioc.ee>
980 * src/frontends/gnome/dialogs/diaprint.glade
981 * src/frontends/gnome/FormPrint.C
982 * src/frontends/gnome/FormPrint.h
983 * src/frontends/gnome/diaprint_callbacks.c
984 * src/frontends/gnome/diaprint_callbacks.h
985 * src/frontends/gnome/diaprint_interface.c
986 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
989 * src/frontends/gnome/dialogs/diainserturl.glade
990 * src/frontends/gnome/FormUrl.C
991 * src/frontends/gnome/FormUrl.h
992 * src/frontends/gnome/diainserturl_callbacks.c
993 * src/frontends/gnome/diainserturl_callbacks.h
994 * src/frontends/gnome/diainserturl_interface.c
995 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
998 * src/frontends/gnome/Dialogs.C
999 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1000 all other dialogs. Copy all unimplemented dialogs from Xforms
1003 * src/frontends/gnome/support.c
1004 * src/frontends/gnome/support.h: support files generated by Glade
1008 * config/gnome.m4: Gnome configuration scripts
1010 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1011 configure --help message
1013 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1014 only if there are no events pendling in Gnome/Gtk. This enhances
1015 the performance of menus.
1018 2000-08-14 Allan Rae <rae@lyx.org>
1020 * lib/Makefile.am: listerrors cleaning
1022 * lib/listerrors: removed -- generated file
1023 * acinclude.m4: ditto
1024 * sigc++/acinclude.m4: ditto
1026 * src/frontends/xforms/forms/form_citation.fd:
1027 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1030 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1031 `updatesrc` and now we have a `test` target that does what `updatesrc`
1032 used to do. I didn't like having an install target that wasn't related
1035 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1036 on all except FormGraphics. This may yet happen. Followed by a major
1037 cleanup including using FL_TRANSIENT for most of the dialogs. More
1038 changes to come when the ButtonController below is introduced.
1040 * src/frontends/xforms/ButtonController.h: New file for managing up to
1041 four buttons on a dialog according to an externally defined policy.
1042 * src/frontends/xforms/Makefile.am: added above
1044 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1045 Apply and Cancel/Close buttons and everything in between and beyond.
1046 * src/frontends/Makefile.am: added above.
1048 * src/frontends/xforms/forms/form_preferences.fd:
1049 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1050 and removed variable 'status' as a result. Fixed the set_minsize thing.
1051 Use the new screen-font-update after checking screen fonts were changed
1052 Added a "Restore" button to restore the original lyxrc values while
1053 editing. This restores everything not just the last input changed.
1054 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1056 * src/LyXAction.C: screen-font-update added for updating buffers after
1057 screen font settings have been changed.
1058 * src/commandtags.h: ditto
1059 * src/lyxfunc.C: ditto
1061 * forms/lyx.fd: removed screen fonts dialog.
1062 * src/lyx_gui.C: ditto
1063 * src/menus.[Ch]: ditto
1064 * src/lyx.[Ch]: ditto
1065 * src/lyx_cb.C: ditto + code from here moved to make
1066 screen-font-update. And people wonder why progress on GUII is
1067 slow. Look at how scattered this stuff was! It takes forever
1070 * forms/fdfix.sh: Fixup the spacing after commas.
1071 * forms/makefile: Remove date from generated files. Fewer clashes now.
1072 * forms/bullet_forms.C.patch: included someones handwritten changes
1074 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1075 once I've discovered why LyXRC was made noncopyable.
1076 * src/lyx_main.C: ditto
1078 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1080 * src/frontends/xforms/forms/fdfix.sh:
1081 * src/frontends/xforms/forms/fdfixh.sed:
1082 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1083 * src/frontends/xforms/Form*.[hC]:
1084 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1085 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1086 provide a destructor for the struct FD_form_xxxx. Another version of
1087 the set_[max|min]size workaround and a few other cleanups. Actually,
1088 Angus' patch from 20000809.
1090 2000-08-13 Baruch Even <baruch.even@writeme.com>
1092 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1095 2000-08-11 Juergen Vigna <jug@sad.it>
1097 * src/insets/insetgraphics.C (InsetGraphics): changing init
1098 order because of warnings.
1100 * src/frontends/xforms/forms/makefile: adding patching .C with
1103 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1104 from .C.patch to .c.patch
1106 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1107 order because of warning.
1109 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1111 * src/frontends/Liason.C (setMinibuffer): new helper function
1113 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1115 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1117 * lib/ui/default.ui: commented out PaperLayout entry
1119 * src/frontends/xforms/form_document.[Ch]: new added files
1121 * src/frontends/xforms/FormDocument.[Ch]: ditto
1123 * src/frontends/xforms/forms/form_document.fd: ditto
1125 * src/frontends/xforms/forms/form_document.C.patch: ditto
1127 2000-08-10 Juergen Vigna <jug@sad.it>
1129 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1130 (InsetGraphics): initialized cacheHandle to 0.
1131 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1133 2000-08-10 Baruch Even <baruch.even@writeme.com>
1135 * src/graphics/GraphicsCache.h:
1136 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1137 correctly as a cache.
1139 * src/graphics/GraphicsCacheItem.h:
1140 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1143 * src/graphics/GraphicsCacheItem_pimpl.h:
1144 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1147 * src/insets/insetgraphics.h:
1148 * src/insets/insetgraphics.C: Changed from using a signal notification
1149 to polling when image is not loaded.
1151 2000-08-10 Allan Rae <rae@lyx.org>
1153 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1154 that there are two functions that have to been taken out of line by
1155 hand and aren't taken care of in the script. (Just a reminder note)
1157 * sigc++/macros/*.h.m4: Updated as above.
1159 2000-08-09 Juergen Vigna <jug@sad.it>
1161 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1163 * src/insets/insettabular.C: make drawing of single cell smarter.
1165 2000-08-09 Marko Vendelin <markov@ioc.ee>
1166 * src/frontends/gnome/Menubar_pimpl.C
1167 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1168 implementation: new files
1170 * src/frontends/gnome/mainapp.C
1171 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1174 * src/main.C: create Gnome main window
1176 * src/frontends/xforms/Menubar_pimpl.h
1177 * src/frontends/Menubar.C
1178 * src/frontends/Menubar.h: added method Menubar::update that calls
1179 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1181 * src/LyXView.C: calls Menubar::update to update the state
1184 * src/frontends/gnome/Makefile.am: added new files
1186 * src/frontends/Makefile.am: added frontend compiler options
1188 2000-08-08 Juergen Vigna <jug@sad.it>
1190 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1192 * src/bufferlist.C (close):
1193 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1194 documents if exiting without saving.
1196 * src/buffer.C (save): use removeAutosaveFile()
1198 * src/support/filetools.C (removeAutosaveFile): new function.
1200 * src/lyx_cb.C (MenuWrite): returns a bool now.
1201 (MenuWriteAs): check if file could really be saved and revert to the
1203 (MenuWriteAs): removing old autosavefile if existant.
1205 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1206 before Goto toggle declaration, because of compiler warning.
1208 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1210 * src/lyxfunc.C (MenuNew): small fix.
1212 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1214 * src/bufferlist.C (newFile):
1215 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1217 * src/lyxrc.C: added new_ask_filename tag
1219 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1221 * src/lyx.fd: removed code pertaining to form_ref
1222 * src/lyx.[Ch]: ditto
1223 * src/lyx_cb.C: ditto
1224 * src/lyx_gui.C: ditto
1225 * src/lyx_gui_misc.C: ditto
1227 * src/BufferView_pimpl.C (restorePosition): update buffer only
1230 * src/commandtags.h (LFUN_REFTOGGLE): removed
1231 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1232 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1233 (LFUN_REFBACK): renamed LFUN_REF_BACK
1235 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1236 * src/menus.C: ditto
1237 * src/lyxfunc.C (Dispatch): ditto.
1238 InsertRef dialog is now GUI-independent.
1240 * src/texrow.C: added using std::endl;
1242 * src/insets/insetref.[Ch]: strip out large amounts of code.
1243 The inset is now a container and this functionality is now
1244 managed by a new FormRef dialog
1246 * src/frontends/Dialogs.h (showRef, createRef): new signals
1248 * src/frontends/xforms/FormIndex.[Ch],
1249 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1250 when setting dialog's min/max size
1251 * src/frontends/xforms/FormIndex.[Ch]: ditto
1253 * src/frontends/xforms/FormRef.[Ch],
1254 src/frontends/xforms/forms/form_ref.fd: new xforms
1255 implementation of an InsetRef dialog
1257 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1260 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1261 ios::nocreate is not part of the standard. Removed.
1263 2000-08-07 Baruch Even <baruch.even@writeme.com>
1265 * src/graphics/Renderer.h:
1266 * src/graphics/Renderer.C: Added base class for rendering of different
1267 image formats into Pixmaps.
1269 * src/graphics/XPM_Renderer.h:
1270 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1271 in a different class.
1273 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1274 easily add support for other formats.
1276 * src/insets/figinset.C: plugged a leak of an X resource.
1278 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1280 * src/CutAndPaste.[Ch]: make all metods static.
1282 * development/Code_rules/Rules: more work, added section on
1283 Exceptions, and a References section.
1285 * a lot of header files: work to make doc++ able to generate the
1286 source documentation, some workarounds of doc++ problems. Doc++ is
1287 now able to generate the documentation.
1289 2000-08-07 Juergen Vigna <jug@sad.it>
1291 * src/insets/insettabular.C (recomputeTextInsets): removed function
1293 * src/tabular.C (SetWidthOfMulticolCell):
1295 (calculate_width_of_column_NMC): fixed return value so that it really
1296 only returns true if the column-width has changed (there where
1297 problems with muliticolumn-cells in this column).
1299 2000-08-04 Juergen Vigna <jug@sad.it>
1301 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1302 also on the scrollstatus of the inset.
1303 (workAreaMotionNotify): ditto.
1305 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1307 2000-08-01 Juergen Vigna <jug@sad.it>
1309 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1311 * src/commandtags.h:
1312 * src/LyXAction.C (init):
1313 * src/insets/inset.C (LocalDispatch): added support for
1316 * src/insets/inset.C (scroll): new functions.
1318 * src/insets/insettext.C (removeNewlines): new function.
1319 (SetAutoBreakRows): removes forced newlines in the text of the
1320 paragraph if autoBreakRows is set to false.
1322 * src/tabular.C (Latex): generates a parbox around the cell contents
1325 * src/frontends/xforms/FormTabular.C (local_update): removed
1326 the radio_useparbox button.
1328 * src/tabular.C (UseParbox): new function
1330 2000-08-06 Baruch Even <baruch.even@writeme.com>
1332 * src/graphics/GraphicsCache.h:
1333 * src/graphics/GraphicsCache.C:
1334 * src/graphics/GraphicsCacheItem.h:
1335 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1338 * src/insets/insetgraphics.h:
1339 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1340 drawing of the inline image.
1342 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1343 into the wrong position.
1345 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1348 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1350 * src/support/translator.h: move all typedefs to public section
1352 * src/support/filetools.C (MakeLatexName): return string const
1354 (TmpFileName): ditto
1355 (FileOpenSearch): ditto
1357 (LibFileSearch): ditto
1358 (i18nLibFileSearch): ditto
1361 (CreateTmpDir): ditto
1362 (CreateBufferTmpDir): ditto
1363 (CreateLyXTmpDir): ditto
1366 (MakeAbsPath): ditto
1368 (OnlyFilename): ditto
1370 (NormalizePath): ditto
1371 (CleanupPath): ditto
1372 (GetFileContents): ditto
1373 (ReplaceEnvironmentPath): ditto
1374 (MakeRelPath): ditto
1376 (ChangeExtension): ditto
1377 (MakeDisplayPath): ditto
1378 (do_popen): return cmdret const
1379 (findtexfile): return string const
1381 * src/support/DebugStream.h: add some /// to please doc++
1383 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1385 * src/texrow.C (same_rownumber): functor to use with find_if
1386 (getIdFromRow): rewritten to use find_if and to not update the
1387 positions. return true if row is found
1388 (increasePos): new method, use to update positions
1390 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1392 * src/lyxlex_pimpl.C (verifyTable): new method
1395 (GetString): return string const
1396 (pushTable): rewrite to use std::stack
1398 (setFile): better check
1401 * src/lyxlex.h: make LyXLex noncopyable
1403 * src/lyxlex.C (text): return char const * const
1404 (GetString): return string const
1405 (getLongString): return string const
1407 * src/lyx_gui_misc.C (askForText): return pair<...> const
1409 * src/lastfiles.[Ch] (operator): return string const
1411 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1412 istringstream not char const *.
1413 move token.end() out of loop.
1414 (readFile): move initializaton of token
1416 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1417 getIdFromRow is successful.
1419 * lib/bind/emacs.bind: don't include menus bind
1421 * development/Code_rules/Rules: the beginnings of making this
1422 better and covering more of the unwritten rules that we have.
1424 * development/Code_rules/Recommendations: a couple of wording
1427 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1429 * src/support/strerror.c: remove C++ comment.
1431 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1433 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1434 LFUN_INDEX_INSERT_LAST
1436 * src/texrow.C (getIdFromRow): changed from const_iterator to
1437 iterator, allowing code to compile with DEC cxx
1439 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1440 stores part of the class, as suggested by Allan. Will allow
1442 (apply): test to apply uses InsetCommandParams operator!=
1444 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1445 (apply): test to apply uses InsetCommandParams operator!=
1447 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1448 stores part of the class.
1449 (update): removed limits on min/max size.
1451 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1452 (apply): test to apply uses InsetCommandParams operator!=
1454 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1455 (Read, Write, scanCommand, getCommand): moved functionality
1456 into InsetCommandParams.
1458 (getScreenLabel): made pure virtual
1459 new InsetCommandParams operators== and !=
1461 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1462 c-tors based on InsetCommandParams. Removed others.
1463 * src/insets/insetinclude.[Ch]: ditto
1464 * src/insets/insetlabel.[Ch]: ditto
1465 * src/insets/insetparent.[Ch]: ditto
1466 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1468 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1469 insets derived from InsetCommand created using similar c-tors
1470 based on InsetCommandParams
1471 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1472 * src/menus.C (ShowRefsMenu): ditto
1473 * src/paragraph.C (Clone): ditto
1474 * src/text2.C (SetCounter): ditto
1475 * src/lyxfunc.C (Dispatch) ditto
1476 Also recreated old InsetIndex behaviour exactly. Can now
1477 index-insert at the start of a paragraph and index-insert-last
1478 without launching the pop-up.
1480 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1482 * lib/lyxrc.example: mark te pdf options as non functional.
1484 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1485 (isStrDbl): move tmpstr.end() out of loop.
1486 (strToDbl): move intialization of tmpstr
1487 (lowercase): return string const and move tmp.end() out of loop.
1488 (uppercase): return string const and move tmp.edn() out of loop.
1489 (prefixIs): add assertion
1494 (containsOnly): ditto
1495 (containsOnly): ditto
1496 (containsOnly): ditto
1497 (countChar): make last arg char not char const
1498 (token): return string const
1499 (subst): return string const, move tmp.end() out of loop.
1500 (subst): return string const, add assertion
1501 (strip): return string const
1502 (frontStrip): return string const, add assertion
1503 (frontStrip): return string const
1508 * src/support/lstrings.C: add inclde "LAssert.h"
1509 (isStrInt): move tmpstr.end() out of loop.
1511 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1512 toollist.end() out of loop.
1513 (deactivate): move toollist.end() out of loop.
1514 (update): move toollist.end() out of loop.
1515 (updateLayoutList): move tc.end() out of loop.
1516 (add): move toollist.end() out of loop.
1518 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1519 md.end() out of loop.
1521 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1523 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1526 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1527 (Erase): move insetlist.end() out of loop.
1529 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1530 ref to const string as first arg. Move initialization of some
1531 variables, whitespace changes.
1533 * src/kbmap.C (defkey): move table.end() out of loop.
1534 (kb_keymap): move table.end() out of loop.
1535 (findbinding): move table.end() out of loop.
1537 * src/MenuBackend.C (hasMenu): move end() out of loop.
1538 (getMenu): move end() out of loop.
1539 (getMenu): move menulist_.end() out of loop.
1541 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1543 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1546 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1547 (getFromLyXName): move infotab.end() out of loop.
1549 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1550 -fvtable-thunks -ffunction-sections -fdata-sections
1552 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1554 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1557 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1559 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1561 * src/frontends/xforms/FormCitation.[Ch],
1562 src/frontends/xforms/FormIndex.[Ch],
1563 src/frontends/xforms/FormToc.[Ch],
1564 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1566 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1568 * src/commandtags.h: renamed, created some flags for citation
1571 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1573 * src/lyxfunc.C (dispatch): use signals to insert index entry
1575 * src/frontends/Dialogs.h: new signal createIndex
1577 * src/frontends/xforms/FormCommand.[Ch],
1578 src/frontends/xforms/FormCitation.[Ch],
1579 src/frontends/xforms/FormToc.[Ch],
1580 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1582 * src/insets/insetindex.[Ch]: GUI-independent
1584 * src/frontends/xforms/FormIndex.[Ch],
1585 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1588 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1590 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1591 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1593 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1595 * src/insets/insetref.C (Latex): rewrite so that there is now
1596 question that a initialization is requested.
1598 * src/insets/insetcommand.h: reenable the hide signal
1600 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1602 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1603 fix handling of shortcuts (many bugs :)
1604 (add_lastfiles): ditto.
1606 * lib/ui/default.ui: fix a few shortcuts.
1608 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1610 * Makefile.am: Fix ``rpmdist'' target to return the exit
1611 status of the ``rpm'' command, instead of the last command in
1612 the chain (the ``rm lyx.xpm'' command, which always returns
1615 2000-08-02 Allan Rae <rae@lyx.org>
1617 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1618 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1619 * src/frontends/xforms/FormToc.C (FormToc): ditto
1621 * src/frontends/xforms/Makefile.am: A few forgotten files
1623 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1624 Signals-not-copyable-problem Lars' started commenting out.
1626 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1628 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1630 * src/insets/insetcommand.h: Signals is not copyable so anoter
1631 scheme for automatic hiding of forms must be used.
1633 * src/frontends/xforms/FormCitation.h: don't inerit from
1634 noncopyable, FormCommand already does that.
1635 * src/frontends/xforms/FormToc.h: ditto
1636 * src/frontends/xforms/FormUrl.h: ditto
1638 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1640 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1642 * src/insets/insetcommand.h (hide): new SigC::Signal0
1643 (d-tor) new virtual destructor emits hide signal
1645 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1646 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1648 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1649 LOF and LOT. Inset is now GUI-independent
1651 * src/insets/insetloa.[Ch]: redundant
1652 * src/insets/insetlof.[Ch]: ditto
1653 * src/insets/insetlot.[Ch]: ditto
1655 * src/frontends/xforms/forms/form_url.fd: tweaked!
1656 * src/frontends/xforms/forms/form_citation.fd: ditto
1658 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1659 dialogs dealing with InsetCommand insets
1661 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1662 FormCommand base class
1663 * src/frontends/xforms/FormUrl.[Ch]: ditto
1665 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1667 * src/frontends/xforms/FormToc.[Ch]: ditto
1669 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1670 passed a generic InsetCommand pointer
1671 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1673 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1674 and modified InsetTOC class
1675 * src/buffer.C: ditto
1677 * forms/lyx.fd: strip out old FD_form_toc code
1678 * src/lyx_gui_misc.C: ditto
1679 * src/lyx_gui.C: ditto
1680 * src/lyx_cb.C: ditto
1681 * src/lyx.[Ch]: ditto
1683 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1685 * src/support/utility.hpp: tr -d '\r'
1687 2000-08-01 Juergen Vigna <jug@sad.it>
1689 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1691 * src/commandtags.h:
1692 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1693 LFUN_TABULAR_FEATURES.
1695 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1696 LFUN_LAYOUT_TABULAR.
1698 * src/insets/insettabular.C (getStatus): implemented helper function.
1700 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1702 2000-07-31 Juergen Vigna <jug@sad.it>
1704 * src/text.C (draw): fixed screen update problem for text-insets.
1706 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1707 something changed probably this has to be added in various other
1710 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1712 2000-07-31 Baruch Even <baruch.even@writeme.com>
1714 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1715 templates to satisfy compaq cxx.
1718 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1720 * src/support/translator.h (equal_1st_in_pair::operator()): take
1721 const ref pair_type as arg.
1722 (equal_2nd_in_pair::operator()): ditto
1723 (Translator::~Translator): remove empty d-tor.
1725 * src/graphics/GraphicsCache.C: move include config.h to top, also
1726 put initialization of GraphicsCache::singleton here.
1727 (~GraphicsCache): move here
1728 (addFile): take const ref as arg
1731 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1733 * src/BufferView2.C (insertLyXFile): change te with/without header
1736 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1738 * src/frontends/xforms/FormGraphics.C (apply): add some
1739 static_cast. Not very nice, but required by compaq cxx.
1741 * src/frontends/xforms/RadioButtonGroup.h: include header
1742 <utility> instead of <pair.h>
1744 * src/insets/insetgraphicsParams.C: add using directive.
1745 (readResize): change return type to void.
1746 (readOrigin): ditto.
1748 * src/lyxfunc.C (getStatus): add missing break for build-program
1749 function; add test for Literate for export functions.
1751 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1752 entries in Options menu.
1754 2000-07-31 Baruch Even <baruch.even@writeme.com>
1756 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1757 protect against auto-allocation; release icon when needed.
1759 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1761 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1762 on usual typewriter.
1764 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1765 earlier czech.kmap), useful only for programming.
1767 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1769 * src/frontends/xforms/FormCitation.h: fix conditioning around
1772 2000-07-31 Juergen Vigna <jug@sad.it>
1774 * src/frontends/xforms/FormTabular.C (local_update): changed
1775 radio_linebreaks to radio_useparbox and added radio_useminipage.
1777 * src/tabular.C: made support for using minipages/parboxes.
1779 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1781 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1783 (descent): so the cursor is in the middle.
1784 (width): bit smaller box.
1786 * src/insets/insetgraphics.h: added display() function.
1788 2000-07-31 Baruch Even <baruch.even@writeme.com>
1790 * src/frontends/Dialogs.h: Added showGraphics signals.
1792 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1793 xforms form definition of the graphics dialog.
1795 * src/frontends/xforms/FormGraphics.h:
1796 * src/frontends/xforms/FormGraphics.C: Added files, the
1797 GUIndependent code of InsetGraphics
1799 * src/insets/insetgraphics.h:
1800 * src/insets/insetgraphics.C: Major writing to make it work.
1802 * src/insets/insetgraphicsParams.h:
1803 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1804 struct between InsetGraphics and GUI.
1806 * src/LaTeXFeatures.h:
1807 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1808 support for graphicx package.
1810 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1811 for the graphics inset.
1813 * src/support/translator.h: Added file, used in
1814 InsetGraphicsParams. this is a template to translate between two
1817 * src/frontends/xforms/RadioButtonGroup.h:
1818 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1819 way to easily control a radio button group.
1821 2000-07-28 Juergen Vigna <jug@sad.it>
1823 * src/insets/insettabular.C (LocalDispatch):
1824 (TabularFeatures): added support for lyx-functions of tabular features.
1825 (cellstart): refixed this function after someone wrongly changed it.
1827 * src/commandtags.h:
1828 * src/LyXAction.C (init): added support for tabular-features
1830 2000-07-28 Allan Rae <rae@lyx.org>
1832 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1833 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1834 triggers the callback for input checking. As a result we sometimes get
1835 "LyX: This shouldn't happen..." printed to cerr.
1836 (input): Started using status variable since I only free() on
1837 destruction. Some input checking for paths and font sizes.
1839 * src/frontends/xforms/FormPreferences.h: Use status to control
1840 activation of Ok and Apply
1842 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1843 callback. Also resized to stop segfaults with 0.88. The problem is
1844 that xforms-0.88 requires the folder to be wide enough to fit all the
1845 tabs. If it isn't it causes all sorts of problems.
1847 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1849 * src/frontends/xforms/forms/README: Reflect reality.
1851 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1852 * src/frontends/xforms/forms/makefile: ditto.
1854 * src/commandtags.h: Get access to new Preferences dialog
1855 * src/LyXAction.C: ditto
1856 * src/lyxfunc.C: ditto
1857 * lib/ui/default.ui: ditto
1859 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1861 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1863 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1866 * src/frontends/xforms/form_url.[Ch]: added.
1868 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1870 * src/insets/insetbib.h: fixed bug in previous commit
1872 * src/frontends/xforms/FormUrl.h: ditto
1874 * src/frontends/xforms/FormPrint.h: ditto
1876 * src/frontends/xforms/FormPreferences.h: ditto
1878 * src/frontends/xforms/FormCopyright.h: ditto
1880 * src/frontends/xforms/FormCitation.C: ditto
1882 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1883 private copyconstructor and private default contructor
1885 * src/support/Makefile.am: add utility.hpp
1887 * src/support/utility.hpp: new file from boost
1889 * src/insets/insetbib.h: set owner in clone
1891 * src/frontends/xforms/FormCitation.C: added missing include
1894 * src/insets/form_url.[Ch]: removed
1896 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1898 * development/lyx.spec.in
1899 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1900 file/directory re-organization.
1902 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1904 * src/insets/insetcommand.[Ch]: moved the string data and
1905 associated manipulation methods into a new stand-alone class
1906 InsetCommandParams. This class has two additional methods
1907 getAsString() and setFromString() allowing the contents to be
1908 moved around as a single string.
1909 (addContents) method removed.
1910 (setContents) method no longer virtual.
1912 * src/buffer.C (readInset): made use of new InsetCitation,
1913 InsetUrl constructors based on InsetCommandParams.
1915 * src/commandtags.h: add LFUN_INSERT_URL
1917 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1918 independent InsetUrl and use InsetCommandParams to extract
1919 string info and create new Insets.
1921 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1923 * src/frontends/xforms/FormCitation.C (apply): uses
1926 * src/frontends/xforms/form_url.C
1927 * src/frontends/xforms/form_url.h
1928 * src/frontends/xforms/FormUrl.h
1929 * src/frontends/xforms/FormUrl.C
1930 * src/frontends/xforms/forms/form_url.fd: new files
1932 * src/insets/insetcite.[Ch]: removed unused constructors.
1934 * src/insets/insetinclude.[Ch]: no longer store filename
1936 * src/insets/inseturl.[Ch]: GUI-independent.
1938 2000-07-26 Juergen Vigna <jug@sad.it>
1939 * renamed frontend from gtk to gnome as it is that what is realized
1940 and did the necessary changes in the files.
1942 2000-07-26 Marko Vendelin <markov@ioc.ee>
1944 * configure.in: cleaning up gnome configuration scripts
1946 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1948 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1949 shortcuts syndrom by redrawing them explicitely (a better solution
1950 would be appreciated).
1952 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1954 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1957 * src/lyx_cb.C (MenuExport): change html export to do the right
1958 thing depending of the document type (instead of having
1959 html-linuxdoc and html-docbook).
1960 * src/lyxfunc.C (getStatus): update for html
1961 * lib/ui/default.ui: simplify due to the above change.
1962 * src/menus.C (ShowFileMenu): update too (in case we need it).
1964 * src/MenuBackend.C (read): if a menu is defined twice, add the
1965 new entries to the exiting one.
1967 2000-07-26 Juergen Vigna <jug@sad.it>
1969 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1971 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1972 and return a bool if it did actual save the file.
1973 (AutoSave): don't autosave a unnamed doc.
1975 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1976 check if this is an UNNAMED new file and react to it.
1977 (newFile): set buffer to unnamed and change to not mark a new
1978 buffer dirty if I didn't do anything with it.
1980 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1982 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1984 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1985 friend as per Angus's patch posted to lyx-devel.
1987 * src/ext_l10n.h: updated
1989 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1990 gettext on the style string right before inserting them into the
1993 * autogen.sh: add code to extract style strings form layout files,
1994 not good enough yet.
1996 * src/frontends/gtk/.cvsignore: add MAKEFILE
1998 * src/MenuBackend.C (read): run the label strings through gettext
1999 before storing them in the containers.
2001 * src/ext_l10n.h: new file
2003 * autogen.sh : generate the ext_l10n.h file here
2005 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2007 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2010 * lib/ui/default.ui: fix a couple of typos.
2012 * config/gnome/gtk.m4: added (and added to the list of files in
2015 * src/insets/insetinclude.C (unique_id): fix when we are using
2016 lyxstring instead of basic_string<>.
2017 * src/insets/insettext.C (LocalDispatch): ditto.
2018 * src/support/filetools.C: ditto.
2020 * lib/configure.m4: create the ui/ directory if necessary.
2022 * src/LyXView.[Ch] (updateToolbar): new method.
2024 * src/BufferView_pimpl.C (buffer): update the toolbar when
2025 opening/closing buffer.
2027 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2029 * src/LyXAction.C (getActionName): enhance to return also the name
2030 and options of pseudo-actions.
2031 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2033 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2034 as an example of what is possible). Used in File->Build too (more
2035 useful) and in the import/export menus (to mimick the complicated
2036 handling of linuxdoc and friends). Try to update all the entries.
2038 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2041 * src/MenuBackend.C (read): Parse the new OptItem tag.
2043 * src/MenuBackend.h: Add a new optional_ data member (used if the
2044 entry should be omitted when the lyxfunc is disabled).
2046 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2047 function, used as a shortcut.
2048 (create_submenu): align correctly the shortcuts on the widest
2051 * src/MenuBackend.h: MenuItem.label() only returns the label of
2052 the menu without shortcut; new method shortcut().
2054 2000-07-14 Marko Vendelin <markov@ioc.ee>
2056 * src/frontends/gtk/Dialogs.C:
2057 * src/frontends/gtk/FormCopyright.C:
2058 * src/frontends/gtk/FormCopyright.h:
2059 * src/frontends/gtk/Makefile.am: added these source-files for the
2060 Gtk/Gnome support of the Copyright-Dialog.
2062 * src/main.C: added Gnome::Main initialization if using
2063 Gtk/Gnome frontend-GUI.
2065 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2067 * config/gnome/aclocal-include.m4
2068 * config/gnome/compiler-flags.m4
2069 * config/gnome/curses.m4
2070 * config/gnome/gnome--.m4
2071 * config/gnome/gnome-bonobo-check.m4
2072 * config/gnome/gnome-common.m4
2073 * config/gnome/gnome-fileutils.m4
2074 * config/gnome/gnome-ghttp-check.m4
2075 * config/gnome/gnome-gnorba-check.m4
2076 * config/gnome/gnome-guile-checks.m4
2077 * config/gnome/gnome-libgtop-check.m4
2078 * config/gnome/gnome-objc-checks.m4
2079 * config/gnome/gnome-orbit-check.m4
2080 * config/gnome/gnome-print-check.m4
2081 * config/gnome/gnome-pthread-check.m4
2082 * config/gnome/gnome-support.m4
2083 * config/gnome/gnome-undelfs.m4
2084 * config/gnome/gnome-vfs.m4
2085 * config/gnome/gnome-x-checks.m4
2086 * config/gnome/gnome-xml-check.m4
2087 * config/gnome/gnome.m4
2088 * config/gnome/gperf-check.m4
2089 * config/gnome/gtk--.m4
2090 * config/gnome/linger.m4
2091 * config/gnome/need-declaration.m4: added configuration scripts
2092 for Gtk/Gnome frontend-GUI
2094 * configure.in: added support for the --with-frontend=gtk option
2096 * autogen.sh: added config/gnome/* to list of config-files
2098 * acconfig.h: added define for GTKGUI-support
2100 * config/lyxinclude.m4: added --with-frontend[=value] option value
2101 for Gtk/Gnome frontend-GUI support.
2103 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2105 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2109 * src/paragraph.C (GetChar): remove non-const version
2111 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2112 (search_kw): use it.
2114 * src/lyx_main.C (init): if "preferences" exist, read that instead
2116 (ReadRcFile): return bool if the file could be read ok.
2117 (ReadUIFile): add a check to see if lex file is set ok.
2119 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2120 bastring can be used instead of lyxstring (still uses the old code
2121 if std::string is good enough or if lyxstring is used.)
2123 * src/encoding.C: make the arrays static, move ininle functions
2125 * src/encoding.h: from here.
2127 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2128 (parseSingleLyXformat2Token): move inset parsing to separate method
2129 (readInset): new private method
2131 * src/Variables.h: remove virtual from get().
2133 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2134 access to NEW_INSETS and NEW_TABULAR
2136 * src/MenuBackend.h: remove superfluous forward declaration of
2137 MenuItem. Add documentations tags "///", remove empty MenuItem
2138 destructor, remove private default contructor.
2140 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2142 (read): more string mlabel and mname to where they are used
2143 (read): remove unused variables mlabel and mname
2144 (defaults): unconditional clear, make menusetup take advantage of
2145 add returning Menu &.
2147 * src/LyXView.h: define NEW_MENUBAR as default
2149 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2150 to NEW_INSETS and NEW_TABULAR.
2151 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2152 defined. Change some of the "xxxx-inset-insert" functions names to
2155 * several files: more enahncements to NEW_INSETS and the resulting
2158 * lib/lyxrc.example (\date_insert_format): move to misc section
2160 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2161 bastring and use AC_CACHE_CHECK.
2162 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2163 the system have the newest methods. uses AC_CACHE_CHECK
2164 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2165 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2166 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2168 * configure.in: add LYX_CXX_GOOD_STD_STRING
2170 * acinclude.m4: recreated
2172 2000-07-24 Amir Karger
2174 * README: add Hebrew, Arabic kmaps
2177 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2179 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2182 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2184 * Lot of files: add pragma interface/implementation.
2186 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2188 * lib/ui/default.ui: new file (ans new directory). Contains the
2189 default menu and toolbar.
2191 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2192 global space. Toolbars are now read (as menus) in ui files.
2194 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2196 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2197 is disabled because the document is read-only. We want to have the
2198 toggle state of the function anyway.
2199 (getStatus): add code for LFUN_VC* functions (mimicking what is
2200 done in old-style menus)
2202 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2203 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2205 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2206 * src/BufferView_pimpl.C: ditto.
2207 * src/lyxfunc.C: ditto.
2209 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2210 default). This replaces old-style menus by new ones.
2212 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2213 MenuItem. Contain the data structure of a menu.
2215 * src/insets/insettext.C: use LyXView::setLayout instead of
2216 accessing directly the toolbar combox.
2217 * src/lyxfunc.C (Dispatch): ditto.
2219 * src/LyXView.C (setLayout): new method, which just calls
2220 Toolbar::setLayout().
2221 (updateLayoutChoice): move part of this method in Toolbar.
2223 * src/toolbar.[Ch]: removed.
2225 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2226 implementation the toolbar.
2228 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2229 the toolbar. It might make sense to merge it with ToolbarDefaults
2231 (setLayout): new function.
2232 (updateLayoutList): ditto.
2233 (openLayoutList): ditto.
2235 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2236 xforms implementation of the toolbar.
2237 (get_toolbar_func): comment out, since I do not
2238 know what it is good for.
2240 * src/ToolbarDefaults.h: Add the ItemType enum.
2242 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2243 for a list of allocated C strings. Used in Menubar xforms
2244 implementation to avoid memory leaks.
2246 * src/support/lstrings.[Ch] (uppercase): new version taking and
2250 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2251 * lib/bind/emacs.bind: ditto.
2253 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2255 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2256 forward decl of LyXView.
2258 * src/toolbar.C (toolbarItem): moved from toolbar.h
2259 (toolbarItem::clean): ditto
2260 (toolbarItem::~toolbarItem): ditto
2261 (toolbarItem::operator): ditto
2263 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2265 * src/paragraph.h: control the NEW_TABULAR define from here
2267 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2268 USE_TABULAR_INSETS to NEW_TABULAR
2270 * src/ToolbarDefaults.C: add include "lyxlex.h"
2272 * files using the old table/tabular: use NEW_TABULAR to control
2273 compilation of old tabular stuff.
2275 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2278 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2279 planemet in reading of old style floats, fix the \end_deeper
2280 problem when reading old style floats.
2282 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2284 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2286 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2288 * lib/bind/sciword.bind: updated.
2290 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2292 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2293 layout write problem
2295 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2297 * src/Makefile.am (INCLUDES): remove image directory from include
2300 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2301 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2303 * src/LyXView.C (create_form_form_main): read the application icon
2306 * lib/images/*.xpm: change the icons to use transparent color for
2309 * src/toolbar.C (update): change the color of the button when it
2312 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2314 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2315 setting explicitely the minibuffer.
2316 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2318 * src/LyXView.C (showState): new function. Shows font information
2319 in minibuffer and update toolbar state.
2320 (LyXView): call Toolbar::update after creating the
2323 * src/toolbar.C: change toollist to be a vector instead of a
2325 (BubbleTimerCB): get help string directly from the callback
2326 argument of the corresponding icon (which is the action)
2327 (set): remove unnecessary ugliness.
2328 (update): new function. update the icons (depressed, disabled)
2329 depending of the status of the corresponding action.
2331 * src/toolbar.h: remove help in toolbarItem
2333 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2335 * src/Painter.C (text): Added code for using symbol glyphs from
2336 iso10646 fonts. Currently diabled.
2338 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2341 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2342 magyar,turkish and usorbian.
2344 * src/paragraph.C (isMultiLingual): Made more efficient.
2346 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2349 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2350 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2351 Also changed the prototype to "bool math_insert_greek(char)".
2353 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2355 * lots of files: apply the NEW_INSETS on all code that will not be
2356 needed when we move to use the new insets. Enable the define in
2357 lyxparagrah.h to try it.
2359 * src/insets/insettabular.C (cellstart): change to be a static
2361 (InsetTabular): initialize buffer in the initializer list.
2363 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2365 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2366 form_print.h out of the header file. Replaced with forward
2367 declarations of the relevant struct.
2369 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2372 * src/commandtags.h: do not include "debug.h" which does not
2373 belong there. #include it in some other places because of this
2376 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2378 * src/insets/insetcaption.C: add a couple "using" directives.
2380 * src/toolbar.C (add): get the help text directly from lyxaction.
2382 (setPixmap): new function. Loads from disk and sets a pixmap on a
2383 botton; the name of the pixmap file is derived from the command
2386 * src/toolbar.h: remove members isBitmap and pixmap from
2389 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2390 * lib/images/: move many files from images/banner.xpm.
2392 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2394 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2395 * src/toolbar.C: ditto.
2396 * configure.in: ditto.
2397 * INSTALL: document.
2399 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2400 the spellchecker popup is closed from the WM.
2402 2000-07-19 Juergen Vigna <jug@sad.it>
2404 * src/insets/insetfloat.C (Write): small fix because we use the
2405 insetname for the type now!
2407 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2409 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2412 * src/frontends/Dialogs.h: removed hideCitation signal
2414 * src/insets/insetcite.h: added hide signal
2416 * src/insets/insetcite.C (~InsetCitation): emits new signal
2417 (getScreenLabel): "intelligent" label should now fit on the screen!
2419 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2421 * src/frontends/xforms/FormCitation.C (showInset): connects
2422 hide() to the inset's hide signal
2423 (show): modified to use fl_set_object_position rather than
2424 fl_set_object_geometry wherever possible
2426 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2428 * src/insets/lyxinset.h: add caption code
2430 * src/insets/insetfloat.C (type): new method
2432 * src/insets/insetcaption.C (Write): new method
2434 (LyxCode): new method
2436 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2437 to get it right together with using the FloatList.
2439 * src/commandtags.h: add LFUN_INSET_CAPTION
2440 * src/lyxfunc.C (Dispatch): handle it
2442 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2445 * src/Variables.[Ch]: make expand take a const reference, remove
2446 the destructor, some whitespace changes.
2448 * src/LyXAction.C (init): add caption-inset-insert
2450 * src/FloatList.C (FloatList): update the default floats a bit.
2452 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2454 * src/Variables.[Ch]: new files. Intended to be used for language
2455 specific strings (like \chaptername) and filename substitution in
2458 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2460 * lib/kbd/american.kmap: update
2462 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2464 * src/bufferparams.[Ch]: remove member allowAccents.
2466 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2468 * src/LaTeXLog.C: use the log_form.h header.
2469 * src/lyx_gui.C: ditto.
2470 * src/lyx_gui_misc.C: ditto.
2471 * src/lyxvc.h: ditto.
2473 * forms/log_form.fd: new file, created from latexoptions.fd. I
2474 kept the log popup and nuked the options form.
2476 * src/{la,}texoptions.[Ch]: removed.
2477 * src/lyx_cb.C (LaTeXOptions): ditto
2479 * src/lyx_gui.C (create_forms): do not handle the
2480 fd_latex_options form.
2482 2000-07-18 Juergen Vigna <jug@sad.it>
2484 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2485 name of the inset so that it can be requested outside (text2.C).
2487 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2490 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2492 * src/mathed/formula.h (ConvertFont): constify
2494 * src/mathed/formula.C (Read): add warning if \end_inset is not
2495 found on expected place.
2497 * src/insets/lyxinset.h (ConvertFont): consify
2499 * src/insets/insetquotes.C (ConvertFont): constify
2500 * src/insets/insetquotes.h: ditto
2502 * src/insets/insetinfo.h: add labelfont
2504 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2505 (ascent): use labelfont
2509 (Write): make .lyx file a bit nicer
2511 * src/insets/insetfloat.C (Write): simplify somewhat...
2512 (Read): add warning if arg is not found
2514 * src/insets/insetcollapsable.C: add using std::max
2515 (Read): move string token and add warning in arg is not found
2516 (draw): use std::max to get the right ty
2517 (getMaxWidth): simplify by using std::max
2519 * src/insets/insetsection.h: new file
2520 * src/insets/insetsection.C: new file
2521 * src/insets/insetcaption.h: new file
2522 * src/insets/insetcaption.C: new file
2524 * src/insets/inset.C (ConvertFont): constify signature
2526 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2527 insetcaption.[Ch] and insetsection.[Ch]
2529 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2530 uses to use LABEL_COUNTER_CHAPTER instead.
2531 * src/text2.C (SetCounter): here
2533 * src/counters.h: new file
2534 * src/counters.C: new file
2535 * src/Sectioning.h: new file
2536 * src/Sectioning.C: new file
2538 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2540 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2542 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2545 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2548 2000-07-17 Juergen Vigna <jug@sad.it>
2550 * src/tabular.C (Validate): check if array-package is needed.
2551 (SetVAlignment): added support for vertical alignment.
2552 (SetLTFoot): better support for longtable header/footers
2553 (Latex): modified to support added features.
2555 * src/LaTeXFeatures.[Ch]: added array-package.
2557 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2559 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2562 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2564 * configure.in: do not forget to put a space after -isystem.
2566 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2568 * lib/kbd/arabic.kmap: a few fixes.
2570 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2572 * some whitespace chagnes to a number of files.
2574 * src/support/DebugStream.h: change to make it easier for
2575 doc++ to parse correctly.
2576 * src/support/lyxstring.h: ditto
2578 * src/mathed/math_utils.C (compara): change to have only one
2580 (MathedLookupBOP): change because of the above.
2582 * src/mathed/math_delim.C (math_deco_compare): change to have only
2584 (search_deco): change becasue of the above.
2586 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2587 instead of manually coded one.
2589 * src/insets/insetquotes.C (Read): read the \end_inset too
2591 * src/insets/insetlatex.h: remove file
2592 * src/insets/insetlatex.C: remove file
2594 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2596 (InsetPrintIndex): remove destructor
2598 * src/insets/insetinclude.h: remove default constructor
2600 * src/insets/insetfloat.C: work to make it work better
2602 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2604 * src/insets/insetcite.h (InsetCitation): remove default constructor
2606 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2608 * src/text.C (GetColumnNearX): comment out some currently unused code.
2610 * src/paragraph.C (writeFile): move some initializations closer to
2612 (CutIntoMinibuffer): small change to use new matchIT operator
2616 (InsertInset): ditto
2619 (InsetIterator): ditto
2620 (Erase): small change to use new matchFT operator
2622 (GetFontSettings): ditto
2623 (HighestFontInRange): ditto
2626 * src/lyxparagraph.h: some chars changed to value_type
2627 (matchIT): because of some stronger checking (perhaps too strong)
2628 in SGI STL, the two operator() unified to one.
2631 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2633 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2634 the last inset read added
2635 (parseSingleLyXformat2Token): some more (future) compability code added
2636 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2637 (parseSingleLyXformat2Token): set last_inset_read
2638 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2639 (parseSingleLyXformat2Token): don't double intializw string next_token
2641 * src/TextCache.C (text_fits::operator()): add const's to the signature
2642 (has_buffer::operator()): ditto
2644 * src/Floating.h: add some comments on the class
2646 * src/FloatList.[Ch] (typeExist): new method
2649 * src/BackStack.h: added default constructor, wanted by Gcc.
2651 2000-07-14 Juergen Vigna <jug@sad.it>
2653 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2655 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2657 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2658 do a redraw when the window is resized!
2659 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2661 * src/insets/insettext.C (resizeLyXText): added function to correctly
2662 being able to resize the LyXWindow.
2664 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2666 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2668 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2669 crashes when closing dialog to a deleted inset.
2671 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2672 method! Now similar to other insets.
2674 2000-07-13 Juergen Vigna <jug@sad.it>
2676 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2678 * lib/examples/Literate.lyx: small patch!
2680 * src/insets/insetbib.C (Read): added this function because of wrong
2681 Write (without [begin|end]_inset).
2683 2000-07-11 Juergen Vigna <jug@sad.it>
2685 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2686 as the insertInset could not be good!
2688 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2689 the bool param should not be last.
2691 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2693 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2694 did submit that to Karl).
2696 * configure.in: use -isystem instead of -I for X headers. This
2697 fixes a problem on solaris with a recent gcc;
2698 put the front-end code after the X detection code;
2699 configure in sigc++ before lib/
2701 * src/lyx_main.C (commandLineHelp): remove -display from command
2704 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2706 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2707 Also put in Makefile rules for building the ``listerrors''
2708 program for parsing errors from literate programs written in LyX.
2710 * lib/build-listerrors: Added small shell script as part of compile
2711 process. This builds a working ``listerrors'' binary if noweb is
2712 installed and either 1) the VNC X server is installed on the machine,
2713 or 2) the user is compiling from within a GUI. The existence of a GUI
2714 is necessary to use the ``lyx --export'' feature for now. This
2715 hack can be removed once ``lyx --export'' no longer requires a GUI to
2718 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2720 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2721 now passed back correctly from gcc and placed "under" error
2722 buttons in a Literate LyX source.
2724 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2726 * src/text.C (GetColumnNearX): Better behavior when a RTL
2727 paragraph is ended by LTR text.
2729 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2732 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2734 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2735 true when clipboard is empty.
2737 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2739 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2740 row of the paragraph.
2741 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2742 to prevent calculation of bidi tables
2744 2000-07-07 Juergen Vigna <jug@sad.it>
2746 * src/screen.C (ToggleSelection): added y_offset and x_offset
2749 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2752 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2754 * src/insets/insettext.C: fixed Layout-Display!
2756 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2758 * configure.in: add check for strings.h header.
2760 * src/spellchecker.C: include <strings.h> in order to have a
2761 definition for bzero().
2763 2000-07-07 Juergen Vigna <jug@sad.it>
2765 * src/insets/insettext.C (draw): set the status of the bv->text to
2766 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2768 * src/screen.C (DrawOneRow):
2769 (DrawFromTo): redraw the actual row if something has changed in it
2772 * src/text.C (draw): call an update of the toplevel-inset if something
2773 has changed inside while drawing.
2775 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2777 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2779 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2780 processing inside class.
2782 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2783 processing inside class.
2785 * src/insets/insetindex.h new struct Holder, consistent with other
2788 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2789 citation dialog from main code and placed it in src/frontends/xforms.
2790 Dialog launched through signals instead of callbacks
2792 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2794 * lyx.man: update the options description.
2796 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2798 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2799 handle neg values, set min width to 590, add doc about -display
2801 2000-07-05 Juergen Vigna <jug@sad.it>
2803 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2804 calls to BufferView *.
2806 * src/insets/insettext.C (checkAndActivateInset): small fix non
2807 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2809 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2810 their \end_inset token!
2812 2000-07-04 edscott <edscott@imp.mx>
2814 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2815 lib/lyxrc.example: added option \wheel_jump
2817 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2819 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2820 remove support for -width,-height,-xpos and -ypos.
2822 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2824 * src/encoding.[Ch]: New files.
2826 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2827 (text): Call to the underline() method only when needed.
2829 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2831 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2832 encoding(s) for the document.
2834 * src/bufferparams.C (BufferParams): Changed default value of
2837 * src/language.C (newLang): Removed.
2838 (items[]): Added encoding information for all defined languages.
2840 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2841 encoding choice button.
2843 * src/lyxrc.h (font_norm_type): New member variable.
2844 (set_font_norm_type): New method.
2846 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2847 paragraphs with different encodings.
2849 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2850 (TransformChar): Changed to work correctly with Arabic points.
2851 (draw): Added support for drawing Arabic points.
2852 (draw): Removed code for drawing underbars (this is done by
2855 * src/support/textutils.h (IsPrintableNonspace): New function.
2857 * src/BufferView_pimpl.h: Added "using SigC::Object".
2858 * src/LyXView.h: ditto.
2860 * src/insets/insetinclude.h (include_label): Changed to mutable.
2862 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2864 * src/mathed/math_iter.h: remove empty destructor
2866 * src/mathed/math_cursor.h: remove empty destructor
2868 * src/insets/lyxinset.h: add THEOREM_CODE
2870 * src/insets/insettheorem.[Ch]: new files
2872 * src/insets/insetminipage.C: (InsertInset): remove
2874 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2876 (InsertInset): remove
2878 * src/insets/insetlist.C: (InsertList): remove
2880 * src/insets/insetfootlike.[Ch]: new files
2882 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2885 (InsertInset): ditto
2887 * src/insets/insetert.C: remove include Painter.h, reindent
2888 (InsertInset): move to header
2890 * src/insets/insetcollapsable.h: remove explicit from default
2891 contructor, remove empty destructor, add InsertInset
2893 * src/insets/insetcollapsable.C (InsertInset): new func
2895 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2897 * src/vspace.h: add explicit to constructor
2899 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2900 \textcompwordmark, please test this.
2902 * src/lyxrc.C: set ascii_linelen to 65 by default
2904 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2906 * src/commandtags.h: add LFUN_INSET_THEOREM
2908 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2909 (makeLinuxDocFile): remove _some_ of the nice logic
2910 (makeDocBookFile): ditto
2912 * src/Painter.[Ch]: (~Painter): removed
2914 * src/LyXAction.C (init): entry for insettheorem added
2916 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2918 (deplog): code to detect files generated by LaTeX, needs testing
2921 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2923 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2925 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2927 * src/LaTeX.C (deplog): Add a check for files that are going to be
2928 created by the first latex run, part of the project to remove the
2931 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2932 contents to the extension list.
2934 2000-07-04 Juergen Vigna <jug@sad.it>
2936 * src/text.C (NextBreakPoint): added support for needFullRow()
2938 * src/insets/lyxinset.h: added needFullRow()
2940 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2943 * src/insets/insettext.C: lots of changes for update!
2945 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2947 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2949 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2951 * src/insets/insetinclude.C (InsetInclude): fixed
2952 initialization of include_label.
2953 (unique_id): now returns a string.
2955 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2957 * src/LaTeXFeatures.h: new member IncludedFiles, for
2958 a map of key, included file name.
2960 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2961 with the included files for inclusion in SGML preamble,
2962 i. e., linuxdoc and docbook.
2965 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2966 nice (is the generated linuxdoc code to be exported?), that
2967 allows to remove column, and only_body that will be true for
2968 slave documents. Insets are allowed inside SGML font type.
2969 New handling of the SGML preamble for included files.
2970 (makeDocBookFile): the same for docbook.
2972 * src/insets/insetinclude.h:
2973 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2975 (DocBook): new export methods.
2977 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2978 and makeDocBookFile.
2980 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2981 formats to export with command line argument -x.
2983 2000-06-29 Juergen Vigna <jug@sad.it>
2985 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2986 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2988 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2989 region could already been cleared by an inset!
2991 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2993 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2996 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2998 (cursorToggle): remove special handling of lyx focus.
3000 2000-06-28 Juergen Vigna <jug@sad.it>
3002 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3005 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3007 * src/insets/insetindex.C (Edit): add a callback when popup is
3010 * src/insets/insettext.C (LocalDispatch):
3011 * src/insets/insetmarginal.h:
3012 * src/insets/insetlist.h:
3013 * src/insets/insetfoot.h:
3014 * src/insets/insetfloat.h:
3015 * src/insets/insetert.h: add a missing std:: qualifier.
3017 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3019 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3022 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3024 * src/insets/insettext.C (Read): remove tmptok unused variable
3025 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3026 (InsertInset): change for new InsetInset code
3028 * src/insets/insettext.h: add TEXT inline method
3030 * src/insets/insettext.C: remove TEXT macro
3032 * src/insets/insetmarginal.C (Write): new method
3033 (Latex): change output slightly
3035 * src/insets/insetfoot.C (Write): new method
3036 (Latex): change output slightly (don't use endl when no need)
3038 * src/insets/insetert.C (Write): new method
3040 * src/insets/insetcollapsable.h: make button_length, button_top_y
3041 and button_bottm_y protected.
3043 * src/insets/insetcollapsable.C (Write): simplify code by using
3044 tostr. Also do not output the float name, the children class
3045 should to that to get control over own arguments
3047 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3048 src/insets/insetminipage.[Ch]:
3051 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3053 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3055 * src/Makefile.am (lyx_SOURCES): add the new files
3057 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3058 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3059 * src/commandtags.h: ditto
3061 * src/LaTeXFeatures.h: add a std::set of used floattypes
3063 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3065 * src/FloatList.[Ch] src/Floating.h: new files
3067 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3069 * src/lyx_cb.C (TableApplyCB): ditto
3071 * src/text2.C: ditto
3072 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3073 (parseSingleLyXformat2Token): ditto + add code for
3074 backwards compability for old float styles + add code for new insets
3076 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3078 (InsertInset(size_type, Inset *, LyXFont)): new method
3079 (InsetChar(size_type, char)): changed to use the other InsetChar
3080 with a LyXFont(ALL_INHERIT).
3081 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3082 insert the META_INSET.
3084 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3086 * sigc++/thread.h (Threads): from here
3088 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3089 definition out of line
3090 * sigc++/scope.h: from here
3092 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3094 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3095 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3097 * Makefile.am (bindist): new target.
3099 * INSTALL: add instructions for doing a binary distribution.
3101 * development/tools/README.bin.example: update a bit.
3103 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3106 * lib/lyxrc.example: new lyxrc tag \set_color.
3108 * src/lyxfunc.C (Dispatch):
3109 * src/commandtags.h:
3110 * src/LyXAction.C: new lyxfunc "set-color".
3112 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3113 and an x11name given as strings.
3115 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3116 cache when a color is changed.
3118 2000-06-26 Juergen Vigna <jug@sad.it>
3120 * src/lyxrow.C (width): added this functions and variable.
3122 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3125 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3127 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3129 * images/undo_bw.xpm: new icon.
3130 * images/redo_bw.xpm: ditto.
3132 * configure.in (INSTALL_SCRIPT): change value to
3133 ${INSTALL} to avoid failures of install-script target.
3134 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3136 * src/BufferView.h: add a magic "friend" declaration to please
3139 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3141 * forms/cite.fd: modified to allow resizing without messing
3144 * src/insetcite.C: Uses code from cite.fd almost without
3146 User can now resize dialog in the x-direction.
3147 Resizing the dialog in the y-direction is prevented, as the
3148 code does this intelligently already.
3150 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3152 * INSTALL: remove obsolete entry in "problems" section.
3154 * lib/examples/sl_*.lyx: update of the slovenian examples.
3156 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3158 2000-06-23 Juergen Vigna <jug@sad.it>
3160 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3162 * src/buffer.C (resize): delete the LyXText of textinsets.
3164 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3166 * src/insets/lyxinset.h: added another parameter 'cleared' to
3167 the draw() function.
3169 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3170 unlocking inset in inset.
3172 2000-06-22 Juergen Vigna <jug@sad.it>
3174 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3175 of insets and moved first to LyXText.
3177 * src/mathed/formulamacro.[Ch]:
3178 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3180 2000-06-21 Juergen Vigna <jug@sad.it>
3182 * src/text.C (GetVisibleRow): look if I should clear the area or not
3183 using Inset::doClearArea() function.
3185 * src/insets/lyxinset.h: added doClearArea() function and
3186 modified draw(Painter &, ...) to draw(BufferView *, ...)
3188 * src/text2.C (UpdateInset): return bool insted of int
3190 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3192 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3193 combox in the character popup
3195 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3196 BufferParams const & params
3198 2000-06-20 Juergen Vigna <jug@sad.it>
3200 * src/insets/insettext.C (SetParagraphData): set insetowner on
3203 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3205 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3206 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3208 (form_main_): remove
3210 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3211 (create_form_form_main): remove FD_form_main stuff, connect to
3212 autosave_timeout signal
3214 * src/LyXView.[Ch] (getMainForm): remove
3215 (UpdateTimerCB): remove
3216 * src/BufferView_pimpl.h: inherit from SigC::Object
3218 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3219 signal instead of callback
3221 * src/BufferView.[Ch] (cursorToggleCB): remove
3223 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3225 * src/BufferView_pimpl.C: changes because of the one below
3227 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3228 instead of storing a pointer to a LyXText.
3230 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3232 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3234 * src/lyxparagraph.h
3236 * src/paragraph.C: Changed fontlist to a sorted vector.
3238 2000-06-19 Juergen Vigna <jug@sad.it>
3240 * src/BufferView.h: added screen() function.
3242 * src/insets/insettext.C (LocalDispatch): some selection code
3245 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3247 * src/insets/insettext.C (SetParagraphData):
3249 (InsetText): fixes for multiple paragraphs.
3251 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3253 * development/lyx.spec.in: Call configure with ``--without-warnings''
3254 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3255 This should be fine, however, since we generally don't want to be
3256 verbose when making an RPM.
3258 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3260 * lib/scripts/fig2pstex.py: New file
3262 2000-06-16 Juergen Vigna <jug@sad.it>
3264 * src/insets/insettabular.C (UpdateLocal):
3265 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3266 (LocalDispatch): Changed all functions to use LyXText.
3268 2000-06-15 Juergen Vigna <jug@sad.it>
3270 * src/text.C (SetHeightOfRow): call inset::update before requesting
3273 * src/insets/insettext.C (update):
3274 * src/insets/insettabular.C (update): added implementation
3276 * src/insets/lyxinset.h: added update function
3278 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3280 * src/text.C (SelectNextWord): protect against null pointers with
3281 old-style string streams. (fix from Paul Theo Gonciari
3284 * src/cite.[Ch]: remove erroneous files.
3286 * lib/configure.m4: update the list of created directories.
3288 * src/lyxrow.C: include <config.h>
3289 * src/lyxcursor.C: ditto.
3291 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3293 * lib/examples/decimal.lyx: new example file from Mike.
3295 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3296 to find template definitions (from Dekel)
3298 * src/frontends/.cvsignore: add a few things.
3300 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3302 * src/Timeout.C (TimeOut): remove default argument.
3304 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3307 * src/insets/ExternalTemplate.C: add a "using" directive.
3309 * src/lyx_main.h: remove the act_ struct, which seems unused
3312 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3314 * LyX Developers Meeting: All files changed, due to random C++ (by
3315 coincidence) code generator script.
3317 - external inset (cool!)
3318 - initial online editing of preferences
3319 - insettabular breaks insettext(s contents)
3321 - some DocBook fixes
3322 - example files update
3323 - other cool stuff, create a diff and look for yourself.
3325 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3327 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3328 -1 this is a non-line-breaking textinset.
3330 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3331 if there is no width set.
3333 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3335 * Lots of files: Merged the dialogbase branch.
3337 2000-06-09 Allan Rae <rae@lyx.org>
3339 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3340 and the Dispatch methods that used it.
3342 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3343 access to functions formerly kept in Dispatch.
3345 2000-05-19 Allan Rae <rae@lyx.org>
3347 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3348 made to_page and count_copies integers again. from_page remains a
3349 string however because I want to allow entry of a print range like
3350 "1,4,22-25" using this field.
3352 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3353 and printer-params-get. These aren't useful from the minibuffer but
3354 could be used by a script/LyXServer app provided it passes a suitable
3355 auto_mem_buffer. I guess I should take a look at how the LyXServer
3356 works and make it support xtl buffers.
3358 * sigc++/: updated to libsigc++-1.0.1
3360 * src/xtl/: updated to xtl-1.3.pl.11
3362 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3363 those changes done to the files in src/ are actually recreated when
3364 they get regenerated. Please don't ever accept a patch that changes a
3365 dialog unless that patch includes the changes to the corresponding *.fd
3368 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3369 stringOnlyContains, renamed it and generalised it.
3371 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3372 branch. Removed the remaining old form_print code.
3374 2000-04-26 Allan Rae <rae@lyx.org>
3376 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3377 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3379 2000-04-25 Allan Rae <rae@lyx.org>
3381 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3382 against a base of xtl-1.3.pl.4
3384 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3385 filter the Id: entries so they still show the xtl version number
3388 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3389 into the src/xtl code. Patch still pending with José (XTL)
3391 2000-04-24 Allan Rae <rae@lyx.org>
3393 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3394 both more generic and much safer. Use the new template functions.
3395 * src/buffer.[Ch] (Dispatch): ditto.
3397 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3398 and mem buffer more intelligently. Also a little general cleanup.
3401 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3402 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3403 * src/xtl/Makefile.am: ditto.
3404 * src/xtl/.cvsignore: ditto.
3405 * src/Makefile.am: ditto.
3407 * src/PrinterParams.h: Removed the macros member functions. Added a
3408 testInvariant member function. A bit of tidying up and commenting.
3409 Included Angus's idea for fixing operation with egcs-1.1.2.
3411 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3412 cool expansion of XTL's mem_buffer to support automatic memory
3413 management within the buffer itself. Removed the various macros and
3414 replaced them with template functions that use either auto_mem_buffer
3415 or mem_buffer depending on a #define. The mem_buffer support will
3416 disappear as soon as the auto_mem_buffer is confirmed to be good on
3417 other platforms/compilers. That is, it's there so you've got something
3420 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3421 effectively forked XTL. However I expect José will include my code
3422 into the next major release. Also fixed a memory leak.
3423 * src/xtl/text.h: ditto.
3424 * src/xtl/xdr.h: ditto.
3425 * src/xtl/giop.h: ditto.
3427 2000-04-16 Allan Rae <rae@lyx.org>
3429 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3430 by autogen.sh and removed by maintainer-clean anyway.
3431 * .cvsignore, sigc++/.cvsignore: Support the above.
3433 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3435 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3437 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3438 macros, renamed static callback-target member functions to suit new
3439 scheme and made them public.
3440 * src/frontends/xforms/forms/form_print.fd: ditto.
3441 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3443 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3446 * src/xtl/: New directory containing a minimal distribution of XTL.
3447 This is XTL-1.3.pl.4.
3449 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3451 2000-04-15 Allan Rae <rae@lyx.org>
3453 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3455 * sigc++/: Updated to libsigc++-1.0.0
3457 2000-04-14 Allan Rae <rae@lyx.org>
3459 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3460 use the generic ones in future. I'll modify my conversion script.
3462 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3464 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3465 (CloseAllBufferRelatedDialogs): Renamed.
3466 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3468 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3469 of the generic ones. These are the same ones my conversion script
3472 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3473 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3474 * src/buffer.C (Dispatch): ditto
3476 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3477 functions for updating and hiding buffer dependent dialogs.
3478 * src/BufferView.C (buffer): ditto
3479 * src/buffer.C (setReadonly): ditto
3480 * src/lyxfunc.C (CloseBuffer): ditto
3482 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3483 Dialogs.h, and hence all the SigC stuff, into every file that includes
3484 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3486 * src/BufferView2.C: reduce the number of headers included by buffer.h
3488 2000-04-11 Allan Rae <rae@lyx.org>
3490 * src/frontends/xforms/xform_macros.h: A small collection of macros
3491 for building C callbacks.
3493 * src/frontends/xforms/Makefile.am: Added above file.
3495 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3496 scheme again. This time it should work for JMarc. If this is
3497 successful I'll revise my conversion script to automate some of this.
3498 The static member functions in the class also have to be public for
3499 this scheme will work. If the scheme works (it's almost identical to
3500 the way BufferView::cursorToggleCB is handled so it should work) then
3501 FormCopyright and FormPrint will be ready for inclusion into the main
3502 trunk immediately after 1.1.5 is released -- provided we're prepared
3503 for complaints about lame compilers not handling XTL.
3505 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3507 2000-04-07 Allan Rae <rae@lyx.org>
3509 * config/lyxinclude.m4: A bit more tidying up (Angus)
3511 * src/LString.h: JMarc's <string> header fix
3513 * src/PrinterParams.h: Used string for most data to remove some
3514 ugly code in the Print dialog and avoid even uglier code when
3515 appending the ints to a string for output.
3517 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3518 and moved "default:" back to the end of switch statement. Cleaned
3519 up the printing so it uses the right function calls and so the
3520 "print to file" option actually puts the file in the right directory.
3522 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3524 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3525 and Ok+Apply button control into a separate method: input (Angus).
3526 (input) Cleaned it up and improved it to be very thorough now.
3527 (All CB) static_cast used instead of C style cast (Angus). This will
3528 probably change again once we've worked out how to keep gcc-2.8.1 happy
3529 with real C callbacks.
3530 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3531 ignore some of the bool settings and has random numbers instead. Needs
3532 some more investigation. Added other input length checks and checking
3533 of file and printer names.
3535 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3536 would link (Angus). Seems the old code doesn't compile with the pragma
3537 statement either. Separated callback entries from internal methods.
3539 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3541 2000-03-17 Allan Rae <rae@lyx.org>
3543 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3544 need it? Maybe it could go in Dialogs instead? I could make it a
3545 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3546 values to get the bool return value.
3547 (Dispatch): New overloaded method for xtl support.
3549 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3550 extern "C" callback instead of static member functions. Hopefully,
3551 JMarc will be able to compile this. I haven't changed
3552 forms/form_copyright.fd yet. Breaking one of my own rules already.
3554 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3555 because they aren't useful from the minibuffer. Maybe a LyXServer
3556 might want a help message though?
3558 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3560 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3561 xtl which needs both rtti and exceptions.
3563 * src/support/Makefile.am:
3564 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3566 * src/frontends/xforms/input_validators.[ch]: input filters and
3567 validators. These conrol what keys are valid in input boxes.
3568 Use them and write some more. Much better idea than waiting till
3569 after the user has pressed Ok to say that the input fields don't make
3572 * src/frontends/xforms/Makefile.am:
3573 * src/frontends/xforms/forms/form_print.fd:
3574 * src/frontends/xforms/forms/makefile:
3575 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3576 new scheme. Still have to make sure I haven't missed anything from
3577 the current implementation.
3579 * src/Makefile.am, src/PrinterParams.h: New data store.
3581 * other files: Added a couple of copyright notices.
3583 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3585 * src/insets/insetbib.h: move Holder struct in public space.
3587 * src/frontends/include/DialogBase.h: use SigC:: only when
3588 SIGC_CXX_NAMESPACES is defined.
3589 * src/frontends/include/Dialogs.h: ditto.
3591 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3593 * src/frontends/xforms/FormCopyright.[Ch]: do not
3594 mention SigC:: explicitely.
3596 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3598 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3599 deals with testing KDE in main configure.in
3600 * configure.in: ditto.
3602 2000-02-22 Allan Rae <rae@lyx.org>
3604 * Lots of files: Merged from HEAD
3606 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3607 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3609 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3611 * sigc++/: new minidist.
3613 2000-02-14 Allan Rae <rae@lyx.org>
3615 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3617 2000-02-08 Juergen Vigna <jug@sad.it>
3619 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3620 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3622 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3623 for this port and so it is much easier for other people to port
3624 dialogs in a common development environment.
3626 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3627 the QT/KDE implementation.
3629 * src/frontends/kde/Dialogs.C:
3630 * src/frontends/kde/FormCopyright.C:
3631 * src/frontends/kde/FormCopyright.h:
3632 * src/frontends/kde/Makefile.am:
3633 * src/frontends/kde/formcopyrightdialog.C:
3634 * src/frontends/kde/formcopyrightdialog.h:
3635 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3636 for the kde support of the Copyright-Dialog.
3638 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3639 subdir-substitution instead of hardcoded 'xforms' as we now have also
3642 * src/frontends/include/DialogBase.h (Object): just commented the
3643 label after #endif (nasty warning and I don't like warnings ;)
3645 * src/main.C (main): added KApplication initialization if using
3648 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3649 For now only the KDE event-loop is added if frontend==kde.
3651 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3653 * configure.in: added support for the --with-frontend[=value] option
3655 * autogen.sh: added kde.m4 file to list of config-files
3657 * acconfig.h: added define for KDEGUI-support
3659 * config/kde.m4: added configuration functions for KDE-port
3661 * config/lyxinclude.m4: added --with-frontend[=value] option with
3662 support for xforms and KDE.
3664 2000-02-08 Allan Rae <rae@lyx.org>
3666 * all Makefile.am: Fixed up so the make targets dist, distclean,
3667 install and uninstall all work even if builddir != srcdir. Still
3668 have a new sigc++ minidist update to come.
3670 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3672 2000-02-01 Allan Rae <rae@lyx.org>
3674 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3675 Many mods to get builddir != srcdir working.
3677 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3678 for building on NT and so we can do the builddir != srcdir stuff.
3680 2000-01-30 Allan Rae <rae@lyx.org>
3682 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3683 This will stay in "rae" branch. We probably don't really need it in
3684 the main trunk as anyone who wants to help programming it should get
3685 a full library installed also. So they can check both included and
3686 system supplied library compilation.
3688 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3689 Added a 'mini' distribution of libsigc++. If you feel the urge to
3690 change something in these directories - Resist it. If you can't
3691 resist the urge then you should modify the following script and rebuild
3692 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3693 all happen. Still uses a hacked version of libsigc++'s configure.in.
3694 I'm quite happy with the results. I'm not sure the extra work to turn
3695 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3696 worth the trouble and would probably lead to extra maintenance
3698 I haven't tested the following important make targets: install, dist.
3699 Not ready for prime time but very close. Maybe 1.1.5.
3701 * development/tools/makeLyXsigc.sh: A shell script to automatically
3702 generate our mini-dist of libsigc++. It can only be used with a CVS
3703 checkout of libsigc++ not a tarball distribution. It's well commented.
3704 This will end up as part of the libsigc++ distribution so other apps
3705 can easily have an included mini-dist. If someone makes mods to the
3706 sigc++ subpackage without modifying this script to generate those
3707 changes I'll be very upset!
3709 * src/frontends/: Started the gui/system indep structure.
3711 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3712 to access the gui-indep dialogs are in this class. Much improved
3713 design compared to previous revision. Lars, please refrain from
3714 moving this header into src/ like you did with Popups.h last time.
3716 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3718 * src/frontends/xforms/: Started the gui-indep system with a single
3719 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3722 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3723 Here you'll find a very useful makefile and automated fdfix.sh that
3724 makes updating dailogs a no-brainer -- provided you follow the rules
3725 set out in the README. I'm thinking about adding another script to
3726 automatically generate skeleton code for a new dialog given just the
3729 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3730 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3731 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3733 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3735 * src/support/LSubstring.C (operator): simplify
3737 * src/lyxtext.h: removed bparams, use buffer_->params instead
3739 * src/lyxrow.h: make Row a real class, move all variables to
3740 private and use accessors.
3742 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3744 (isRightToLeftPar): ditto
3745 (ChangeLanguage): ditto
3746 (isMultiLingual): ditto
3749 (SimpleTeXOnePar): ditto
3750 (TeXEnvironment): ditto
3751 (GetEndLabel): ditto
3753 (SetOnlyLayout): ditto
3754 (BreakParagraph): ditto
3755 (BreakParagraphConservative): ditto
3756 (GetFontSettings): ditto
3758 (CopyIntoMinibuffer): ditto
3759 (CutIntoMinibuffer): ditto
3760 (PasteParagraph): ditto
3761 (SetPExtraType): ditto
3762 (UnsetPExtraType): ditto
3763 (DocBookContTableRows): ditto
3764 (SimpleDocBookOneTablePar): ditto
3766 (TeXFootnote): ditto
3767 (SimpleTeXOneTablePar): ditto
3768 (TeXContTableRows): ditto
3769 (SimpleTeXSpecialChars): ditto
3772 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3773 to private and use accessors.
3775 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3776 this, we did not use it anymore and has not been for ages. Just a
3777 waste of cpu cycles.
3779 * src/language.h: make Language a real class, move all variables
3780 to private and use accessors.
3782 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3783 (create_view): remove
3784 (update): some changes for new timer
3785 (cursorToggle): use new timer
3786 (beforeChange): change for new timer
3788 * src/BufferView.h (cursorToggleCB): removed last paramter because
3791 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3792 (cursorToggleCB): change because of new timer code
3794 * lib/CREDITS: updated own mailaddress
3796 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3798 * src/support/filetools.C (PutEnv): fix the code in case neither
3799 putenv() nor setenv() have been found.
3801 * INSTALL: mention the install-strip Makefile target.
3803 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3804 read-only documents.
3806 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3808 * lib/reLyX/configure.in (VERSION): avoid using a previously
3809 generated reLyX wrapper to find out $prefix.
3811 * lib/examples/eu_adibide_lyx-atua.lyx:
3812 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3813 translation of the Tutorial (Dooteo)
3815 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3817 * forms/cite.fd: new citation dialog
3819 * src/insetcite.[Ch]: the new citation dialog is moved into
3822 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3825 * src/insets/insetcommand.h: data members made private.
3827 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3829 * LyX 1.1.5 released
3831 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3833 * src/version.h (LYX_RELEASE): to 1.1.5
3835 * src/spellchecker.C (RunSpellChecker): return false if the
3836 spellchecker dies upon creation.
3838 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3840 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3841 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3845 * lib/CREDITS: update entry for Martin Vermeer.
3847 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3849 * src/text.C (draw): Draw foreign language bars at the bottom of
3850 the row instead of at the baseline.
3852 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3854 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3856 * lib/bind/de_menus.bind: updated
3858 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3860 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3862 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3864 * src/menus.C (Limit_string_length): New function
3865 (ShowTocMenu): Limit the number of items/length of items in the
3868 * src/paragraph.C (String): Correct result for a paragraph inside
3871 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3873 * src/bufferlist.C (close): test of buf->getuser() == NULL
3875 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3877 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3878 Do not call to SetCursor when the paragraph is a closed footnote!
3880 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3882 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3885 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3887 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3890 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3891 reference popup, that activates the reference-back action
3893 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3895 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3896 the menus. Also fixed a bug.
3898 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3899 the math panels when switching buffers (unless new buffer is readonly).
3901 * src/BufferView.C (NoSavedPositions)
3902 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3904 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3906 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3907 less of dvi dirty or not.
3909 * src/trans_mgr.[Ch] (insert): change first parameter to string
3912 * src/chset.[Ch] (encodeString): add const to first parameter
3914 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3916 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3920 * src/LaTeX.C (deplog): better searching for dependency files in
3921 the latex log. Uses now regexps.
3923 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3924 instead of the box hack or \hfill.
3926 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3928 * src/lyxfunc.C (doImportHelper): do not create the file before
3929 doing the actual import.
3930 (doImportASCIIasLines): create a new file before doing the insert.
3931 (doImportASCIIasParagraphs): ditto.
3933 * lib/lyxrc.example: remove mention of non-existing commands
3935 * lyx.man: remove mention of color-related switches.
3937 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3939 * src/lyx_gui.C: remove all the color-related ressources, which
3940 are not used anymore.
3942 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3945 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3947 * src/lyxrc.C (read): Add a missing break in the switch
3949 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3951 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3953 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3956 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3958 * src/text.C (draw): draw bars under foreign language words.
3960 * src/LColor.[Ch]: add LColor::language
3962 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3964 * src/lyxcursor.h (boundary): New member variable
3966 * src/text.C (IsBoundary): New methods
3968 * src/text.C: Use the above for currect cursor movement when there
3969 is both RTL & LTR text.
3971 * src/text2.C: ditto
3973 * src/bufferview_funcs.C (ToggleAndShow): ditto
3975 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3977 * src/text.C (DeleteLineForward): set selection to true to avoid
3978 that DeleteEmptyParagraphMechanism does some magic. This is how it
3979 is done in all other functions, and seems reasonable.
3980 (DeleteWordForward): do not jump over non-word stuff, since
3981 CursorRightOneWord() already does it.
3983 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3984 DeleteWordBackward, since they seem safe to me (since selection is
3985 set to "true") DeleteEmptyParagraphMechanism does nothing.
3987 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3989 * src/lyx_main.C (easyParse): simplify the code by factoring the
3990 part that removes parameters from the command line.
3991 (LyX): check wether wrong command line options have been given.
3993 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3995 * src/lyx_main.C : add support for specifying user LyX
3996 directory via command line option -userdir.
3998 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4000 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4001 the number of items per popup.
4002 (Add_to_refs_menu): Ditto.
4004 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4006 * src/lyxparagraph.h: renamed ClearParagraph() to
4007 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4008 textclass as parameter, and do nothing if free_spacing is
4009 true. This fixes part of the line-delete-forward problems.
4011 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4012 (pasteSelection): ditto.
4013 (SwitchLayoutsBetweenClasses): more translatable strings.
4015 * src/text2.C (CutSelection): use StripLeadingSpaces.
4016 (PasteSelection): ditto.
4017 (DeleteEmptyParagraphMechanism): ditto.
4019 2000-05-26 Juergen Vigna <jug@sad.it>
4021 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4022 is not needed in tabular insets.
4024 * src/insets/insettabular.C (TabularFeatures): added missing features.
4026 * src/tabular.C (DeleteColumn):
4028 (AppendRow): implemented this functions
4029 (cellsturct::operator=): clone the inset too;
4031 2000-05-23 Juergen Vigna <jug@sad.it>
4033 * src/insets/insettabular.C (LocalDispatch): better selection support
4034 when having multicolumn-cells.
4036 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4038 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4040 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4042 * src/ColorHandler.C (getGCForeground): put more test into _()
4044 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4047 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4050 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4052 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4053 there are no labels, or when buffer is readonly.
4055 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4056 there are no labels, buffer is SGML, or when buffer is readonly.
4058 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4060 * src/LColor.C (LColor): change a couple of grey40 to grey60
4061 (LColor): rewore initalization to make compiles go some magnitude
4063 (getGUIName): don't use gettext until we need the string.
4065 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4067 * src/Bullet.[Ch]: Fixed a small bug.
4069 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4071 * src/paragraph.C (String): Several fixes/improvements
4073 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4075 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4077 * src/paragraph.C (String): give more correct output.
4079 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4081 * src/lyxfont.C (stateText) Do not output the language if it is
4082 eqaul to the language of the document.
4084 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4085 between two paragraphs with the same language.
4087 * src/paragraph.C (getParLanguage) Return a correct answer for an
4088 empty dummy paragraph.
4090 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4093 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4096 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4097 the menus/popup, if requested fonts are unavailable.
4099 2000-05-22 Juergen Vigna <jug@sad.it>
4101 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4102 movement support (Up/Down/Tab/Shift-Tab).
4103 (LocalDispatch): added also preliminari cursor-selection.
4105 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4107 * src/paragraph.C (PasteParagraph): Hopefully now right!
4109 2000-05-22 Garst R. Reese <reese@isn.net>
4111 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4112 of list, change all references to Environment to Command
4113 * tex/hollywood.cls : rewrite environments as commands, add
4114 \uppercase to interiorshot and exteriorshot to force uppecase.
4115 * tex/broadway.cls : rewrite environments as commands. Tweak
4118 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4120 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4121 size of items: use a constant intead of the hardcoded 40, and more
4122 importantly do not remove the %m and %x tags added at the end.
4123 (Add_to_refs_menu): use vector::size_type instead of
4124 unsigned int as basic types for the variables. _Please_ do not
4125 assume that size_t is equal to unsigned int. On an alpha, this is
4126 unsigned long, which is _not_ the same.
4128 * src/language.C (initL): remove language "hungarian", since it
4129 seems that "magyar" is better.
4131 2000-05-22 Juergen Vigna <jug@sad.it>
4133 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4135 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4138 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4139 next was deleted but not set to 0.
4141 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4143 * src/language.C (initL): change the initialization of languages
4144 so that compiles goes _fast_.
4146 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4149 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4151 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4155 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4157 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4159 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4163 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4166 * src/insets/insetlo*.[Ch]: Made editable
4168 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4170 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4171 the current selection.
4173 * src/BufferView_pimpl.C (stuffClipboard): new method
4175 * src/BufferView.C (stuffClipboard): new method
4177 * src/paragraph.C (String): new method
4179 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4180 LColor::ignore when lyxname is not found.
4182 * src/BufferView.C (pasteSelection): new method
4184 * src/BufferView_pimpl.C (pasteSelection): new method
4186 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4188 * src/WorkArea.C (request_clipboard_cb): new static function
4189 (getClipboard): new method
4190 (putClipboard): new method
4192 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4194 * LyX 1.1.5pre2 released
4196 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4198 * src/vspace.C (operator=): removed
4199 (operator=): removed
4201 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4203 * src/layout.C (NumberOfClass): manually set the type in make_pair
4204 (NumberOfLayout): ditto
4206 * src/language.C: use the Language constructor for ignore_lang
4208 * src/language.h: add constructors to struct Language
4210 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4212 * src/text2.C (SetCursorIntern): comment out #warning
4214 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4216 * src/mathed/math_iter.h: initialize sx and sw to 0
4218 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4220 * forms/lyx.fd: Redesign of form_ref
4222 * src/LaTeXFeatures.[Ch]
4226 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4229 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4230 and Buffer::inset_iterator.
4232 * src/menus.C: Added new menus: TOC and Refs.
4234 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4236 * src/buffer.C (getTocList): New method.
4238 * src/BufferView2.C (ChangeRefs): New method.
4240 * src/buffer.C (getLabelList): New method. It replaces the old
4241 getReferenceList. The return type is vector<string> instead of
4244 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4245 the old getLabel() and GetNumberOfLabels() methods.
4246 * src/insets/insetlabel.C (getLabelList): ditto
4247 * src/mathed/formula.C (getLabelList): ditto
4249 * src/paragraph.C (String): New method.
4251 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4252 Uses the new getTocList() method.
4253 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4254 which automatically updates the contents of the browser.
4255 (RefUpdateCB): Use the new getLabelList method.
4257 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4259 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4261 * src/spellchecker.C: Added using std::reverse;
4263 2000-05-19 Juergen Vigna <jug@sad.it>
4265 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4267 * src/insets/insettext.C (computeTextRows): small fix for display of
4268 1 character after a newline.
4270 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4273 2000-05-18 Juergen Vigna <jug@sad.it>
4275 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4276 when changing width of column.
4278 * src/tabular.C (set_row_column_number_info): setting of
4279 autobreak rows if necessary.
4281 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4283 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4285 * src/vc-backend.*: renamed stat() to status() and vcstat to
4286 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4287 compilation broke. The new name seems more relevant, anyway.
4289 2000-05-17 Juergen Vigna <jug@sad.it>
4291 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4292 which was wrong if the removing caused removing of rows!
4294 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4295 (pushToken): new function.
4297 * src/text2.C (CutSelection): fix problem discovered with purify
4299 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4301 * src/debug.C (showTags): enlarge the first column, now that we
4302 have 6-digits debug codes.
4304 * lib/layouts/hollywood.layout:
4305 * lib/tex/hollywood.cls:
4306 * lib/tex/brodway.cls:
4307 * lib/layouts/brodway.layout: more commands and fewer
4308 environments. Preambles moved in the .cls files. Broadway now has
4309 more options on scene numbering and less whitespace (from Garst)
4311 * src/insets/insetbib.C (getKeys): make sure that we are in the
4312 document directory, in case the bib file is there.
4314 * src/insets/insetbib.C (Latex): revert bogus change.
4316 2000-05-16 Juergen Vigna <jug@sad.it>
4318 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4319 the TabularLayout on cursor move.
4321 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4323 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4326 (draw): fixed cursor position and drawing so that the cursor is
4327 visible when before the tabular-inset.
4329 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4330 when creating from old insettext.
4332 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4334 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4336 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4337 * lib/tex/brodway.cls: ditto
4339 * lib/layouts/brodway.layout: change alignment of parenthical
4342 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4344 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4345 versions 0.88 and 0.89 are supported.
4347 2000-05-15 Juergen Vigna <jug@sad.it>
4349 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4352 * src/insets/insettext.C (computeTextRows): redone completely this
4353 function in a much cleaner way, because of problems when having a
4355 (draw): added a frame border when the inset is locked.
4356 (SetDrawLockedFrame): this sets if we draw the border or not.
4357 (SetFrameColor): this sets the frame color (default=insetframe).
4359 * src/insets/lyxinset.h: added x() and y() functions which return
4360 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4361 function which is needed to see if we have a locking inset of some
4362 type in this inset (needed for now in insettabular).
4364 * src/vspace.C (inPixels): the same function also without a BufferView
4365 parameter as so it is easier to use it in some ocasions.
4367 * src/lyxfunc.C: changed all places where insertInset was used so
4368 that now if it couldn't be inserted it is deleted!
4370 * src/TabularLayout.C:
4371 * src/TableLayout.C: added support for new tabular-inset!
4373 * src/BufferView2.C (insertInset): this now returns a bool if the
4374 inset was really inserted!!!
4376 * src/tabular.C (GetLastCellInRow):
4377 (GetFirstCellInRow): new helper functions.
4378 (Latex): implemented for new tabular class.
4382 (TeXTopHLine): new Latex() helper functions.
4384 2000-05-12 Juergen Vigna <jug@sad.it>
4386 * src/mathed/formulamacro.C (Read):
4387 * src/mathed/formula.C (Read): read also the \end_inset here!
4389 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4391 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4392 crush when saving formulae with unbalanced parenthesis.
4394 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4396 * src/layout.C: Add new keyword "endlabelstring" to layout file
4398 * src/text.C (GetVisibleRow): Draw endlabel string.
4400 * lib/layouts/broadway.layout
4401 * lib/layouts/hollywood.layout: Added endlabel for the
4402 Parenthetical layout.
4404 * lib/layouts/heb-article.layout: Do not use slanted font shape
4405 for Theorem like environments.
4407 * src/buffer.C (makeLaTeXFile): Always add "american" to
4408 the UsedLanguages list if document language is RTL.
4410 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4412 * add addendum to README.OS2 and small patch (from SMiyata)
4414 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4416 * many files: correct the calls to ChangeExtension().
4418 * src/support/filetools.C (ChangeExtension): remove the no_path
4419 argument, which does not belong there. Use OnlyFileName() instead.
4421 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4422 files when LaTeXing a non-nice latex file.
4424 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4425 a chain of "if". Return false when deadkeys are not handled.
4427 * src/lyx_main.C (LyX): adapted the code for default bindings.
4429 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4430 bindings for basic functionality (except deadkeys).
4431 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4433 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4434 several methods: handle override_x_deadkeys.
4436 * src/lyxrc.h: remove the "bindings" map, which did not make much
4437 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4439 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4441 * src/lyxfont.C (stateText): use a saner method to determine
4442 whether the font is "default". Seems to fix the crash with DEC
4445 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4447 2000-05-08 Juergen Vigna <jug@sad.it>
4449 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4450 TabularLayoutMenu with mouse-button-3
4451 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4453 * src/TabularLayout.C: added this file for having a Layout for
4456 2000-05-05 Juergen Vigna <jug@sad.it>
4458 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4459 recalculating inset-widths.
4460 (TabularFeatures): activated this function so that I can change
4461 tabular-features via menu.
4463 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4464 that I can test some functions with the Table menu.
4466 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/lyxfont.C (stateText): guard against stupid c++libs.
4470 * src/tabular.C: add using std::vector
4471 some whitespace changes, + removed som autogenerated code.
4473 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4475 2000-05-05 Juergen Vigna <jug@sad.it>
4477 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4478 row, columns and cellstructures.
4480 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4482 * lib/lyxrc.example: remove obsolete entries.
4484 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4485 reading of protected_separator for free_spacing.
4487 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * src/text.C (draw): do not display an exclamation mark in the
4490 margin for margin notes. This is confusing, ugly and
4493 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4494 AMS math' is checked.
4496 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4497 name to see whether including the amsmath package is needed.
4499 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4501 * src/paragraph.C (validate): Compute UsedLanguages correctly
4502 (don't insert the american language if it doesn't appear in the
4505 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4506 The argument of \thanks{} command is considered moving argument
4508 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4511 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4513 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4514 for appendix/minipage/depth. The lines can be now both in the footnote
4515 frame, and outside the frame.
4517 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4520 2000-05-05 Juergen Vigna <jug@sad.it>
4522 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4523 neede only in tabular.[Ch].
4525 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4527 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4529 (Write): write '~' for PROTECTED_SEPARATOR
4531 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4533 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4536 * src/mathed/formula.C (drawStr): rename size to siz.
4538 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4539 possibly fix a bug by not changing the pflags = flags to piflags =
4542 2000-05-05 Juergen Vigna <jug@sad.it>
4544 * src/insets/insetbib.C: moved using directive
4546 * src/ImportNoweb.C: small fix for being able to compile (missing
4549 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4551 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4552 to use clear, since we don't depend on this in the code. Add test
4555 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4557 * (various *.C files): add using std::foo directives to please dec
4560 * replace calls to string::clear() to string::erase() (Angus)
4562 * src/cheaders/cmath: modified to provide std::abs.
4564 2000-05-04 Juergen Vigna <jug@sad.it>
4566 * src/insets/insettext.C: Prepared all for inserting of multiple
4567 paragraphs. Still display stuff to do (alignment and other things),
4568 but I would like to use LyXText to do this when we cleaned out the
4569 table-support stuff.
4571 * src/insets/insettabular.C: Changed lot of stuff and added lots
4572 of functionality still a lot to do.
4574 * src/tabular.C: Various functions changed name and moved to be
4575 const functions. Added new Read and Write functions and changed
4576 lots of things so it works good with tabular-insets (also removed
4577 some stuff which is not needed anymore * hacks *).
4579 * src/lyxcursor.h: added operators == and != which just look if
4580 par and pos are (not) equal.
4582 * src/buffer.C (latexParagraphs): inserted this function to latex
4583 all paragraphs form par to endpar as then I can use this too for
4586 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4587 so that I can call this to from text insets with their own cursor.
4589 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4590 output off all paragraphs (because of the fix below)!
4592 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4593 the very last paragraph (this could be also the last paragraph of an
4596 * src/texrow.h: added rows() call which returns the count-variable.
4598 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4600 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4602 * lib/configure.m4: better autodetection of DocBook tools.
4604 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4606 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4608 * src/lyx_cb.C: add using std::reverse;
4610 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4613 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4614 selected files. Should fix repeated errors from generated files.
4616 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4618 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4620 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4621 the spellchecker popup.
4623 * lib/lyxrc.example: Removed the \number_inset section
4625 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4627 * src/insets/figinset.C (various): Use IsFileReadable() to make
4628 sure that the file actually exist. Relying on ghostscripts errors
4629 is a bad idea since they can lead to X server crashes.
4631 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4633 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4636 * lib/lyxrc.example: smallish typo in description of
4637 \view_dvi_paper_option
4639 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4642 * src/lyxfunc.C: doImportHelper to factor out common code of the
4643 various import methods. New functions doImportASCIIasLines,
4644 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4645 doImportLinuxDoc for the format specific parts.
4648 * buffer.C: Dispatch returns now a bool to indicate success
4651 * lyx_gui.C: Add getLyXView() for member access
4653 * lyx_main.C: Change logic for batch commands: First try
4654 Buffer::Dispatch (possibly without GUI), if that fails, use
4657 * lyx_main.C: Add support for --import command line switch.
4658 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4659 Available Formats: Everything accepted by 'buffer-import <format>'
4661 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4663 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4666 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4667 documents will be reformatted upon reentry.
4669 2000-04-27 Juergen Vigna <jug@sad.it>
4671 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4672 correctly only last pos this was a bug.
4674 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4676 * release of lyx-1.1.5pre1
4678 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4680 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4682 * src/menus.C: revert the change of naming (Figure->Graphic...)
4683 from 2000-04-11. It was incomplete and bad.
4685 * src/LColor.[Ch]: add LColor::depthbar.
4686 * src/text.C (GetVisibleRow): use it.
4688 * README: update the languages list.
4690 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4692 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4695 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4697 * README: remove sections that were just wrong.
4699 * src/text2.C (GetRowNearY): remove currentrow code
4701 * src/text.C (GetRow): remove currentrow code
4703 * src/screen.C (Update): rewritten a bit.
4704 (SmallUpdate): removed func
4706 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4708 (FullRebreak): return bool
4709 (currentrow): remove var
4710 (currentrow_y): ditto
4712 * src/lyxscreen.h (Draw): change arg to unsigned long
4713 (FitCursor): return bool
4714 (FitManualCursor): ditto
4715 (Smallpdate): remove func
4716 (first): change to unsigned long
4717 (DrawOneRow): change second arg to long (from long &)
4718 (screen_refresh_y): remove var
4719 (scree_refresh_row): ditto
4721 * src/lyxrow.h: change baseline to usigned int from unsigned
4722 short, this brings some implicit/unsigned issues out in the open.
4724 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4726 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4727 instead of smallUpdate.
4729 * src/lyxcursor.h: change y to unsigned long
4731 * src/buffer.h: don't call updateScrollbar after fitcursor
4733 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4734 where they are used. Removed "\\direction", this was not present
4735 in 1.1.4 and is already obsolete. Commented out some code that I
4736 believe to never be called.
4737 (runLiterate): don't call updateScrollbar after fitCursor
4739 (buildProgram): ditto
4742 * src/WorkArea.h (workWidth): change return val to unsigned
4745 (redraw): remove the button redraws
4746 (setScrollbarValue): change for scrollbar
4747 (getScrollbarValue): change for scrollbar
4748 (getScrollbarBounds): change for scrollbar
4750 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4751 (C_WorkArea_down_cb): removed func
4752 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4753 (resize): change for scrollbar
4754 (setScrollbar): ditto
4755 (setScrollbarBounds): ditto
4756 (setScrollbarIncrements): ditto
4757 (up_cb): removed func
4758 (down_cb): removed func
4759 (scroll_cb): change for scrollbar
4760 (work_area_handler): ditto
4762 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4763 when FitCursor did something.
4764 (updateScrollbar): some unsigned changes
4765 (downCB): removed func
4766 (scrollUpOnePage): removed func
4767 (scrollDownOnePage): remvoed func
4768 (workAreaMotionNotify): don't call screen->FitCursor but use
4769 fitCursor instead. and bool return val
4770 (workAreaButtonPress): ditto
4771 (workAreaButtonRelease): some unsigned changes
4772 (checkInsetHit): ditto
4773 (workAreaExpose): ditto
4774 (update): parts rewritten, comments about the signed char arg added
4775 (smallUpdate): removed func
4776 (cursorPrevious): call needed updateScrollbar
4779 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4782 * src/BufferView.[Ch] (upCB): removed func
4783 (downCB): removed func
4784 (smallUpdate): removed func
4786 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4788 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4789 currentrow, currentrow_y optimization. This did not help a lot and
4790 if we want to do this kind of optimization we should rather use
4791 cursor.row instead of the currentrow.
4793 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4794 buffer spacing and klyx spacing support.
4796 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4798 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4801 2000-04-26 Juergen Vigna <jug@sad.it>
4803 * src/insets/figinset.C: fixes to Lars sstream changes!
4805 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4807 * A lot of files: Added Ascii(ostream &) methods to all inset
4808 classes. Used when exporting to ASCII.
4810 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4811 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4814 * src/text2.C (ToggleFree): Disabled implicit word selection when
4815 there is a change in the language
4817 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4818 no output was generated for end-of-sentence inset.
4820 * src/insets/lyxinset.h
4823 * src/paragraph.C: Removed the insetnumber code
4825 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4827 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4829 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4830 no_babel and no_epsfig completely from the file.
4831 (parseSingleLyXformat2Token): add handling for per-paragraph
4832 spacing as written by klyx.
4834 * src/insets/figinset.C: applied patch by Andre. Made it work with
4837 2000-04-20 Juergen Vigna <jug@sad.it>
4839 * src/insets/insettext.C (cutSelection):
4840 (copySelection): Fixed with selection from right to left.
4841 (draw): now the rows are not recalculated at every draw.
4842 (computeTextRows): for now reset the inset-owner here (this is
4843 important for an undo or copy where the inset-owner is not set
4846 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4847 motion to the_locking_inset screen->first was forgotten, this was
4848 not important till we got multiline insets.
4850 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4852 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4853 code seems to be alright (it is code changed by Dekel, and the
4854 intent is indeed that all macros should be defined \protect'ed)
4856 * NEWS: a bit of reorganisation of the new user-visible features.
4858 2000-04-19 Juergen Vigna <jug@sad.it>
4860 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4861 position. Set the inset_owner of the used paragraph so that it knows
4862 that it is inside an inset. Fixed cursor handling with mouse and
4863 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4864 and cleanups to make TextInsets work better.
4866 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4867 Changed parameters of various functions and added LockInsetInInset().
4869 * src/insets/insettext.C:
4871 * src/insets/insetcollapsable.h:
4872 * src/insets/insetcollapsable.C:
4873 * src/insets/insetfoot.h:
4874 * src/insets/insetfoot.C:
4875 * src/insets/insetert.h:
4876 * src/insets/insetert.C: cleaned up the code so that it works now
4877 correctly with insettext.
4879 * src/insets/inset.C:
4880 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4881 that insets in insets are supported right.
4884 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4886 * src/paragraph.C: some small fixes
4888 * src/debug.h: inserted INSETS debug info
4890 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4891 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4893 * src/commandtags.h:
4894 * src/LyXAction.C: insert code for InsetTabular.
4896 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4897 not Button1MotionMask.
4898 (workAreaButtonRelease): send always a InsetButtonRelease event to
4900 (checkInsetHit): some setCursor fixes (always with insets).
4902 * src/BufferView2.C (lockInset): returns a bool now and extended for
4903 locking insets inside insets.
4904 (showLockedInsetCursor): it is important to have the cursor always
4905 before the locked inset.
4906 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4908 * src/BufferView.h: made lockInset return a bool.
4910 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4912 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4913 that is used also internally but can be called as public to have back
4914 a cursor pos which is not set internally.
4915 (SetCursorIntern): Changed to use above function.
4917 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4919 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4924 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4925 patches for things that should be in or should be changed.
4927 * src/* [insetfiles]: change "usigned char fragile" to bool
4928 fragile. There was only one point that could that be questioned
4929 and that is commented in formulamacro.C. Grep for "CHECK".
4931 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4932 (DeleteBuffer): take it out of CutAndPaste and make it static.
4934 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4936 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4937 output the spacing envir commands. Also the new commands used in
4938 the LaTeX output makes the result better.
4940 * src/Spacing.C (writeEnvirBegin): new method
4941 (writeEnvirEnd): new method
4943 2000-04-18 Juergen Vigna <jug@sad.it>
4945 * src/CutAndPaste.C: made textclass a static member of the class
4946 as otherwise it is not accesed right!!!
4948 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4950 * forms/layout_forms.fd
4951 * src/layout_forms.h
4952 * src/layout_forms.C (create_form_form_character)
4953 * src/lyx_cb.C (UserFreeFont)
4954 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4955 documents (in the layout->character popup).
4957 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4959 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4960 \spell_command was in fact not honored (from Kevin Atkinson).
4962 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4965 * src/lyx_gui.h: make lyxViews private (Angus)
4967 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4969 * src/mathed/math_write.C
4970 (MathMatrixInset::Write) Put \protect before \begin{array} and
4971 \end{array} if fragile
4972 (MathParInset::Write): Put \protect before \\ if fragile
4974 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4977 initialization if the LyXColorHandler must be done after the
4978 connections to the XServer has been established.
4980 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4981 get the background pixel from the lyxColorhandler so that the
4982 figures are rendered with the correct background color.
4983 (NextToken): removed functions.
4984 (GetPSSizes): use ifs >> string instead of NextToken.
4986 * src/Painter.[Ch]: the color cache moved out of this file.
4988 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4991 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4993 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4994 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4996 * src/BufferView.C (enterView): new func
4997 (leaveView): new func
4999 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5001 (leaveView): new func, undefines xterm cursor when approp.
5003 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5004 (AllowInput): delete the Workarea cursor handling from this func.
5006 * src/Painter.C (underline): draw a slimer underline in most cases.
5008 * src/lyx_main.C (error_handler): use extern "C"
5010 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5012 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5013 sent directly to me.
5015 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5016 to the list by Dekel.
5018 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5021 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5022 methods from lyx_cb.here.
5024 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5027 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5029 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5030 instead of using current_view directly.
5032 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5034 * src/LyXAction.C (init): add the paragraph-spacing command.
5036 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5038 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5040 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5041 different from the documents.
5043 * src/text.C (SetHeightOfRow): take paragraph spacing into
5044 account, paragraph spacing takes precedence over buffer spacing
5045 (GetVisibleRow): ditto
5047 * src/paragraph.C (writeFile): output the spacing parameter too.
5048 (validate): set the correct features if spacing is used in the
5050 (Clear): set spacing to default
5051 (MakeSameLayout): spacing too
5052 (HasSameLayout): spacing too
5053 (SetLayout): spacing too
5054 (TeXOnePar): output the spacing commands
5056 * src/lyxparagraph.h: added a spacing variable for use with
5057 per-paragraph spacing.
5059 * src/Spacing.h: add a Default spacing and a method to check if
5060 the current spacing is default. also added an operator==
5062 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5065 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5067 * src/lyxserver.C (callback): fix dispatch of functions
5069 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5070 printf() into lyxerr call.
5072 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5075 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5076 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5077 the "Float" from each of the subitems.
5078 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5080 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5081 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5082 documented the change so that the workaround can be nuked later.
5084 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5087 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5089 * src/buffer.C (getLatexName): ditto
5090 (setReadonly): ditto
5092 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5094 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5095 avoid some uses of current_view. Added also a bufferParams()
5096 method to get at this.
5098 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5100 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5102 * src/lyxparagraph.[Ch]: removed
5103 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5104 with operators used by lower_bound and
5105 upper_bound in InsetTable's
5106 Make struct InsetTable private again. Used matchpos.
5108 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5110 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5111 document, the language of existing text is changed (unless the
5112 document is multi-lingual)
5114 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5116 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5118 * A lot of files: A rewrite of the Right-to-Left support.
5120 2000-04-10 Juergen Vigna <jug@sad.it>
5122 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5123 misplaced cursor when inset in inset is locked.
5125 * src/insets/insettext.C (LocalDispatch): small fix so that a
5126 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5128 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5129 footnote font should be decreased in size twice when displaying.
5131 * src/insets/insettext.C (GetDrawFont): inserted this function as
5132 the drawing-font may differ from the real paragraph font.
5134 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5135 insets (inset in inset!).
5137 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5138 function here because we don't want footnotes inside footnotes.
5140 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5142 (init): now set the inset_owner in paragraph.C
5143 (LocalDispatch): added some resetPos() in the right position
5146 (pasteSelection): changed to use the new CutAndPaste-Class.
5148 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5149 which tells if it is allowed to insert another inset inside this one.
5151 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5152 SwitchLayoutsBetweenClasses.
5154 * src/text2.C (InsertInset): checking of the new paragraph-function
5156 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5157 is not needed anymore here!
5160 (PasteSelection): redone (also with #ifdef) so that now this uses
5161 the CutAndPaste-Class.
5162 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5165 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5166 from/to text/insets.
5168 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5169 so that the paragraph knows if it is inside an (text)-inset.
5170 (InsertFromMinibuffer): changed return-value to bool as now it
5171 may happen that an inset is not inserted in the paragraph.
5172 (InsertInsetAllowed): this checks if it is allowed to insert an
5173 inset in this paragraph.
5175 (BreakParagraphConservative):
5176 (BreakParagraph) : small change for the above change of the return
5177 value of InsertFromMinibuffer.
5179 * src/lyxparagraph.h: added inset_owner and the functions to handle
5180 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5182 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5184 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5185 functions from BufferView to BufferView::Pimpl to ease maintence.
5187 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5188 correctly. Also use SetCursorIntern instead of SetCursor.
5190 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5193 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * src/WorkArea.C (belowMouse): manually implement below mouse.
5197 * src/*: Add "explicit" on several constructors, I added probably
5198 some unneeded ones. A couple of changes to code because of this.
5200 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5201 implementation and private parts from the users of BufferView. Not
5204 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5205 implementation and private parts from the users of LyXLex. Not
5208 * src/BufferView_pimpl.[Ch]: new files
5210 * src/lyxlex_pimpl.[Ch]: new files
5212 * src/LyXView.[Ch]: some inline functions move out-of-line
5214 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5216 * src/lyxparagraph.h: make struct InsetTable public.
5218 * src/support/lyxstring.h: change lyxstring::difference_type to be
5219 ptrdiff_t. Add std:: modifiers to streams.
5221 * src/font.C: include the <cctype> header, for islower() and
5224 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5226 * src/font.[Ch]: new files. Contains the metric functions for
5227 fonts, takes a LyXFont as parameter. Better separation of concepts.
5229 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5230 changes because of this.
5232 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5234 * src/*: compile with -Winline and move functions that don't
5237 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5240 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5242 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5243 (various files changed because of this)
5245 * src/Painter.C (text): fixed the drawing of smallcaps.
5247 * src/lyxfont.[Ch] (drawText): removed unused member func.
5250 * src/*.C: added needed "using" statements and "std::" qualifiers.
5252 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5254 * src/*.h: removed all use of "using" from header files use
5255 qualifier std:: instead.
5257 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5259 * src/text.C (Backspace): some additional cleanups (we already
5260 know whether cursor.pos is 0 or not).
5262 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5263 automake does not provide one).
5265 * src/bmtable.h: replace C++ comments with C comments.
5267 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5269 * src/screen.C (ShowCursor): Change the shape of the cursor if
5270 the current language is not equal to the language of the document.
5271 (If the cursor change its shape unexpectedly, then you've found a bug)
5273 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5276 * src/insets/insetnumber.[Ch]: New files.
5278 * src/LyXAction.C (init)
5279 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5282 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5284 * src/lyxparagraph.h
5285 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5286 (the vector is kept sorted).
5288 * src/text.C (GetVisibleRow): Draw selection correctly when there
5289 is both LTR and RTL text.
5291 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5292 which is much faster.
5294 * src/text.C (GetVisibleRow and other): Do not draw the last space
5295 in a row if the direction of the last letter is not equal to the
5296 direction of the paragraph.
5298 * src/lyxfont.C (latexWriteStartChanges):
5299 Check that font language is not equal to basefont language.
5300 (latexWriteEndChanges): ditto
5302 * src/lyx_cb.C (StyleReset): Don't change the language while using
5303 the font-default command.
5305 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5306 empty paragraph before a footnote.
5308 * src/insets/insetcommand.C (draw): Increase x correctly.
5310 * src/screen.C (ShowCursor): Change cursor shape if
5311 current language != document language.
5313 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5315 2000-03-31 Juergen Vigna <jug@sad.it>
5317 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5318 (Clone): changed mode how the paragraph-data is copied to the
5319 new clone-paragraph.
5321 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5322 GetInset(pos) with no inset anymore there (in inset UNDO)
5324 * src/insets/insetcommand.C (draw): small fix as here x is
5325 incremented not as much as width() returns (2 before, 2 behind = 4)
5327 2000-03-30 Juergen Vigna <jug@sad.it>
5329 * src/insets/insettext.C (InsetText): small fix in initialize
5330 widthOffset (should not be done in the init() function)
5332 2000-03-29 Amir Karger <karger@lyx.org>
5334 * lib/examples/it_ItemizeBullets.lyx: translation by
5337 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5339 2000-03-29 Juergen Vigna <jug@sad.it>
5341 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5343 * src/insets/insetfoot.C (Clone): small change as for the below
5344 new init function in the text-inset
5346 * src/insets/insettext.C (init): new function as I've seen that
5347 clone did not copy the Paragraph-Data!
5348 (LocalDispatch): Added code so that now we have some sort of Undo
5349 functionality (well actually we HAVE Undo ;)
5351 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5353 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5355 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5358 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5360 * src/main.C: added a runtime check that verifies that the xforms
5361 header used when building LyX and the library used when running
5362 LyX match. Exit with a message if they don't match. This is a
5363 version number check only.
5365 * src/buffer.C (save): Don't allocate memory on the heap for
5366 struct utimbuf times.
5368 * *: some using changes, use iosfwd instead of the real headers.
5370 * src/lyxfont.C use char const * instead of string for the static
5371 strings. Rewrite some functions to use sstream.
5373 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5375 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5378 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5380 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5381 of Geodesy (from Martin Vermeer)
5383 * lib/layouts/svjour.inc: include file for the Springer svjour
5384 class. It can be used to support journals other than JoG.
5386 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5387 Miskiewicz <misiek@pld.org.pl>)
5388 * lib/reLyX/Makefile.am: ditto.
5390 2000-03-27 Juergen Vigna <jug@sad.it>
5392 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5393 also some modifications with operations on selected text.
5395 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5396 problems with clicking on insets (last famous words ;)
5398 * src/insets/insetcommand.C (draw):
5399 (width): Changed to have a bit of space before and after the inset so
5400 that the blinking cursor can be seen (otherwise it was hidden)
5402 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5404 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5405 would not be added to the link list when an installed gettext (not
5406 part of libc) is found.
5408 2000-03-24 Juergen Vigna <jug@sad.it>
5410 * src/insets/insetcollapsable.C (Edit):
5411 * src/mathed/formula.C (InsetButtonRelease):
5412 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5415 * src/BufferView.C (workAreaButtonPress):
5416 (workAreaButtonRelease):
5417 (checkInsetHit): Finally fixed the clicking on insets be handled
5420 * src/insets/insetert.C (Edit): inserted this call so that ERT
5421 insets work always with LaTeX-font
5423 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5425 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5426 caused lyx to startup with no GUI in place, causing in a crash
5427 upon startup when called with arguments.
5429 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5431 * src/FontLoader.C: better initialization of dummyXFontStruct.
5433 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5435 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5436 for linuxdoc and docbook import and export format options.
5438 * lib/lyxrc.example Example of default values for the previous flags.
5440 * src/lyx_cb.C Use those flags instead of the hardwired values for
5441 linuxdoc and docbook export.
5443 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5446 * src/menus.C Added menus entries for the new import/exports formats.
5448 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5450 * src/lyxrc.*: Added support for running without Gui
5453 * src/FontLoader.C: sensible defaults if no fonts are needed
5455 * src/lyx_cb.C: New function ShowMessage (writes either to the
5456 minibuffer or cout in case of no gui
5457 New function AskOverwrite for common stuff
5458 Consequently various changes to call these functions
5460 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5461 wild guess at sensible screen resolution when having no gui
5463 * src/lyxfont.C: no gui, no fonts... set some defaults
5465 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5467 * src/LColor.C: made the command inset background a bit lighter.
5469 2000-03-20 Hartmut Goebel <goebel@noris.net>
5471 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5472 stdstruct.inc. Koma-Script added some title elements which
5473 otherwise have been listed below "bibliography". This split allows
5474 adding title elements to where they belong.
5476 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5477 define the additional tilte elements and then include
5480 * many other layout files: changed to include stdtitle.inc just
5481 before stdstruct.inc.
5483 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5485 * src/buffer.C: (save) Added the option to store all backup files
5486 in a single directory
5488 * src/lyxrc.[Ch]: Added variable \backupdir_path
5490 * lib/lyxrc.example: Added descriptions of recently added variables
5492 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5493 bibtex inset, not closing the bibtex popup when deleting the inset)
5495 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/lyx_cb.C: add a couple using directives.
5499 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5500 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5501 import based on the filename.
5503 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5504 file would be imported at start, if the filename where of a sgml file.
5506 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5508 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5510 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5511 * src/lyxfont.h Replaced the member variable bits.direction by the
5512 member variable lang. Made many changes in other files.
5513 This allows having a multi-lingual document
5515 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5516 that change the current language to <l>.
5517 Removed the command "font-rtl"
5519 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5520 format for Hebrew documents)
5522 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5523 When auto_mathmode is "true", pressing a digit key in normal mode
5524 will cause entering into mathmode.
5525 If auto_mathmode is "rtl" then this behavior will be active only
5526 when writing right-to-left text.
5528 * src/text2.C (InsertStringA) The string is inserted using the
5531 * src/paragraph.C (GetEndLabel) Gives a correct result for
5532 footnote paragraphs.
5534 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5536 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5539 front of PasteParagraph. Never insert a ' '. This should at least
5540 fix some cause for the segfaults that we have been experiencing,
5541 it also fixes backspace behaviour slightly. (Phu!)
5543 * src/support/lstrings.C (compare_no_case): some change to make it
5544 compile with gcc 2.95.2 and stdlibc++-v3
5546 * src/text2.C (MeltFootnoteEnvironment): change type o
5547 first_footnote_par_is_not_empty to bool.
5549 * src/lyxparagraph.h: make text private. Changes in other files
5551 (fitToSize): new function
5552 (setContentsFromPar): new function
5553 (clearContents): new function
5554 (SetChar): new function
5556 * src/paragraph.C (readSimpleWholeFile): deleted.
5558 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5559 the file, just use a simple string instead. Also read the file in
5560 a more maintainable manner.
5562 * src/text2.C (InsertStringA): deleted.
5563 (InsertStringB): deleted.
5565 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5567 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5568 RedoParagraphs from the doublespace handling part, just set status
5569 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5570 done, but perhaps not like this.)
5572 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5574 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5575 character when inserting an inset.
5577 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5579 * src/bufferparams.C (readLanguage): now takes "default" into
5582 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5583 also initialize the toplevel_keymap with the default bindings from
5586 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5588 * all files using lyxrc: have lyxrc as a real variable and not a
5589 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5592 * src/lyxrc.C: remove double call to defaultKeyBindings
5594 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5595 toolbar defauls using lyxlex. Remove enums, structs, functions
5598 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5599 toolbar defaults. Also store default keybindings in a map.
5601 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5602 storing the toolbar defaults without any xforms dependencies.
5604 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5605 applied. Changed to use iterators.
5607 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5609 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5610 systems that don't have LINGUAS set to begin with.
5612 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5614 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5615 the list by Dekel Tsur.
5617 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5620 * src/insets/form_graphics.C: ditto.
5622 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5624 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5626 * src/bufferparams.C (readLanguage): use the new language map
5628 * src/intl.C (InitKeyMapper): use the new language map
5630 * src/lyx_gui.C (create_forms): use the new language map
5632 * src/language.[Ch]: New files. Used for holding the information
5633 about each language. Now! Use this new language map enhance it and
5634 make it really usable for our needs.
5636 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5638 * screen.C (ShowCursor): Removed duplicate code.
5639 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5640 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5642 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5645 * src/text.C Added TransformChar method. Used for rendering Arabic
5646 text correctly (change the glyphs of the letter according to the
5647 position in the word)
5652 * src/lyxrc.C Added lyxrc command {language_command_begin,
5653 language_command_end,language_command_ltr,language_command_rtl,
5654 language_package} which allows the use of either arabtex or Omega
5657 * src/lyx_gui.C (init)
5659 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5660 to use encoding for menu fonts which is different than the encoding
5663 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5664 do not load the babel package.
5665 To write an English document with Hebrew/Arabic, change the document
5666 language to "english".
5668 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5669 (alphaCounter): changed to return char
5670 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5672 * lib/lyxrc.example Added examples for Hebrew/Arabic
5675 * src/layout.C Added layout command endlabeltype
5677 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5679 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5681 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5683 * src/mathed/math_delim.C (search_deco): return a
5684 math_deco_struct* instead of index.
5686 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5688 * All files with a USE_OSTREAM_ONLY within: removed all code that
5689 was unused when USE_OSTREAM_ONLY is defined.
5691 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5692 of any less. Removed header and using.
5694 * src/text.C (GetVisibleRow): draw the string "Page Break
5695 (top/bottom)" on screen when drawing a pagebreak line.
5697 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5699 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5701 * src/mathed/math_macro.C (draw): do some cast magic.
5704 * src/mathed/math_defs.h: change byte* argument to byte const*.
5706 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5708 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5709 know it is right to return InsetFoot* too, but cxx does not like
5712 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5714 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5716 * src/mathed/math_delim.C: change == to proper assignment.
5718 2000-03-09 Juergen Vigna <jug@sad.it>
5720 * src/insets/insettext.C (setPos): fixed various cursor positioning
5721 problems (via mouse and cursor-keys)
5722 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5723 inset (still a small display problem but it works ;)
5725 * src/insets/insetcollapsable.C (draw): added button_top_y and
5726 button_bottom_y to have correct values for clicking on the inset.
5728 * src/support/lyxalgo.h: commented out 'using std::less'
5730 2000-03-08 Juergen Vigna <jug@sad.it>
5732 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5733 Button-Release event closes as it is alos the Release-Event
5736 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5738 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5740 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5741 can add multiple spaces in Scrap (literate programming) styles...
5742 which, by the way, is how I got hooked on LyX to begin with.
5744 * src/mathed/formula.C (Write): Added dummy variable to an
5745 inset::Latex() call.
5746 (Latex): Add free_spacing boolean to inset::Latex()
5748 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5750 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5751 virtual function to include the free_spacing boolean from
5752 the containing paragraph's style.
5754 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5755 Added free_spacing boolean arg to match inset.h
5757 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5758 Added free_spacing boolean arg to match inset.h
5760 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5761 Added free_spacing boolean and made sure that if in a free_spacing
5762 paragraph, that we output normal space if there is a protected space.
5764 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5765 Added free_spacing boolean arg to match inset.h
5767 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5768 Added free_spacing boolean arg to match inset.h
5770 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5771 Added free_spacing boolean arg to match inset.h
5773 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5774 Added free_spacing boolean arg to match inset.h
5776 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5777 Added free_spacing boolean arg to match inset.h
5779 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5780 free_spacing boolean arg to match inset.h
5782 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5783 Added free_spacing boolean arg to match inset.h
5785 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5786 Added free_spacing boolean arg to match inset.h
5788 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5789 Added free_spacing boolean arg to match inset.h
5791 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5792 Added free_spacing boolean arg to match inset.h
5794 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5795 Added free_spacing boolean arg to match inset.h
5797 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5798 free_spacing boolean arg to match inset.h
5800 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5801 free_spacing boolean arg to match inset.h
5803 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5804 ignore free_spacing paragraphs. The user's spaces are left
5807 * src/text.C (InsertChar): Fixed the free_spacing layout
5808 attribute behavior. Now, if free_spacing is set, you can
5809 add multiple spaces in a paragraph with impunity (and they
5810 get output verbatim).
5811 (SelectSelectedWord): Added dummy argument to inset::Latex()
5814 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5817 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5818 paragraph layouts now only input a simple space instead.
5819 Special character insets don't make any sense in free-spacing
5822 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5823 hard-spaces in the *input* file to simple spaces if the layout
5824 is free-spacing. This converts old files which had to have
5825 hard-spaces in free-spacing layouts where a simple space was
5827 (writeFileAscii): Added free_spacing check to pass to the newly
5828 reworked inset::Latex(...) methods. The inset::Latex() code
5829 ensures that hard-spaces in free-spacing paragraphs get output
5830 as spaces (rather than "~").
5832 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5834 * src/mathed/math_delim.C (draw): draw the empty placeholder
5835 delims with a onoffdash line.
5836 (struct math_deco_compare): struct that holds the "functors" used
5837 for the sort and the binary search in math_deco_table.
5838 (class init_deco_table): class used for initial sort of the
5840 (search_deco): use lower_bound to do a binary search in the
5843 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5845 * src/lyxrc.C: a small secret thingie...
5847 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5848 and to not flush the stream as often as it used to.
5850 * src/support/lyxalgo.h: new file
5851 (sorted): template function used for checking if a sequence is
5852 sorted or not. Two versions with and without user supplied
5853 compare. Uses same compare as std::sort.
5855 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5856 it and give warning on lyxerr.
5858 (struct compare_tags): struct with function operators used for
5859 checking if sorted, sorting and lower_bound.
5860 (search_kw): use lower_bound instead of manually implemented
5863 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5865 * src/insets/insetcollapsable.h: fix Clone() declaration.
5866 * src/insets/insetfoot.h: ditto.
5868 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5870 2000-03-08 Juergen Vigna <jug@sad.it>
5872 * src/insets/lyxinset.h: added owner call which tells us if
5873 this inset is inside another inset. Changed also the return-type
5874 of Editable to an enum so it tells clearer what the return-value is.
5876 * src/insets/insettext.C (computeTextRows): fixed computing of
5877 textinsets which split automatically on more rows.
5879 * src/insets/insetert.[Ch]: changed this to be of BaseType
5882 * src/insets/insetfoot.[Ch]: added footnote inset
5884 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5885 collapsable insets (like footnote, ert, ...)
5887 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5889 * src/lyxdraw.h: remvoe file
5891 * src/lyxdraw.C: remove file
5893 * src/insets/insettext.C: added <algorithm>.
5895 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5897 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5898 (matrix_cb): case MM_OK use string stream
5900 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5903 * src/mathed/math_macro.C (draw): use string stream
5904 (Metrics): use string stream
5906 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5907 directly to the ostream.
5909 * src/vspace.C (asString): use string stream.
5910 (asString): use string stream
5911 (asLatexString): use string stream
5913 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5914 setting Spacing::Other.
5916 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5917 sprintf when creating the stretch vale.
5919 * src/text2.C (alphaCounter): changed to return a string and to
5920 not use a static variable internally. Also fixed a one-off bug.
5921 (SetCounter): changed the drawing of the labels to use string
5922 streams instead of sprintf.
5924 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5925 manipulator to use a scheme that does not require library support.
5926 This is also the way it is done in the new GNU libstdc++. Should
5927 work with DEC cxx now.
5929 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5931 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5932 end. This fixes a bug.
5934 * src/mathed (all files concerned with file writing): apply the
5935 USE_OSTREAM_ONLY changes to mathed too.
5937 * src/support/DebugStream.h: make the constructor explicit.
5939 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5940 count and ostream squashed.
5942 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5944 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5946 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5947 ostringstream uses STL strings, and we might not.
5949 * src/insets/insetspecialchar.C: add using directive.
5950 * src/insets/insettext.C: ditto.
5952 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * lib/layouts/seminar.layout: feeble attempt at a layout for
5955 seminar.cls, far from completet and could really use some looking
5956 at from people used to write layout files.
5958 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5959 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5960 a lot nicer and works nicely with ostreams.
5962 * src/mathed/formula.C (draw): a slightly different solution that
5963 the one posted to the list, but I think this one works too. (font
5964 size wrong in headers.)
5966 * src/insets/insettext.C (computeTextRows): some fiddling on
5967 Jürgens turf, added some comments that he should read.
5969 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5970 used and it gave compiler warnings.
5971 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5974 * src/lyx_gui.C (create_forms): do the right thing when
5975 show_banner is true/false.
5977 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5978 show_banner is false.
5980 * most file writing files: Now use iostreams to do almost all of
5981 the writing. Also instead of passing string &, we now use
5982 stringstreams. mathed output is still not adapted to iostreams.
5983 This change can be turned off by commenting out all the occurences
5984 of the "#define USE_OSTREAM_ONLY 1" lines.
5986 * src/WorkArea.C (createPixmap): don't output debug messages.
5987 (WorkArea): don't output debug messages.
5989 * lib/lyxrc.example: added a comment about the new variable
5992 * development/Code_rules/Rules: Added some more commente about how
5993 to build class interfaces and on how better encapsulation can be
5996 2000-03-03 Juergen Vigna <jug@sad.it>
5998 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5999 automatically with the width of the LyX-Window
6001 * src/insets/insettext.C (computeTextRows): fixed update bug in
6002 displaying text-insets (scrollvalues where not initialized!)
6004 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6007 id in the check of the result from lower_bound is not enough since
6008 lower_bound can return last too, and then res->id will not be a
6011 * all insets and some code that use them: I have conditionalized
6012 removed the Latex(string & out, ...) this means that only the
6013 Latex(ostream &, ...) will be used. This is a work in progress to
6014 move towards using streams for all output of files.
6016 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6019 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6021 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6022 routine (this fixes bug where greek letters were surrounded by too
6025 * src/support/filetools.C (findtexfile): change a bit the search
6026 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6027 no longer passed to kpsewhich, we may have to change that later.
6029 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6030 warning options to avoid problems with X header files (from Angus
6032 * acinclude.m4: regenerated.
6034 2000-03-02 Juergen Vigna <jug@sad.it>
6036 * src/insets/insettext.C (WriteParagraphData): Using the
6037 par->writeFile() function for writing paragraph-data.
6038 (Read): Using buffer->parseSingleLyXformat2Token()-function
6039 for parsing paragraph data!
6041 * src/buffer.C (readLyXformat2): removed all parse data and using
6042 the new parseSingleLyXformat2Token()-function.
6043 (parseSingleLyXformat2Token): added this function to parse (read)
6044 lyx-file-format (this is called also from text-insets now!)
6046 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6048 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6051 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6052 directly instead of going through a func. One very bad thing: a
6053 static LyXFindReplace, but I don't know where to place it.
6055 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6056 string instead of char[]. Also changed to static.
6057 (GetSelectionOrWordAtCursor): changed to static inline
6058 (SetSelectionOverLenChars): ditto.
6060 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6061 current_view and global variables. both classes has changed names
6062 and LyXFindReplace is not inherited from SearchForm.
6064 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6065 fl_form_search form.
6067 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6069 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6071 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6072 bound (from Kayvan).
6074 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6076 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6078 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6080 * some things that I should comment but the local pub says head to
6083 * comment out all code that belongs to the Roff code for Ascii
6084 export of tables. (this is unused)
6086 * src/LyXView.C: use correct type for global variable
6087 current_layout. (LyXTextClass::size_type)
6089 * some code to get the new insetgraphics closer to working I'd be
6090 grateful for any help.
6092 * src/BufferView2.C (insertInset): use the return type of
6093 NumberOfLayout properly. (also changes in other files)
6095 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6096 this as a test. I want to know what breaks because of this.
6098 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6100 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6102 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6103 to use a \makebox in the label, this allows proper justification
6104 with out using protected spaces or multiple hfills. Now it is
6105 "label" for left justified, "\hfill label\hfill" for center, and
6106 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6107 should be changed accordingly.
6109 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6111 * src/lyxtext.h: change SetLayout() to take a
6112 LyXTextClass::size_type instead of a char (when there is more than
6113 127 layouts in a class); also change type of copylayouttype.
6114 * src/text2.C (SetLayout): ditto.
6115 * src/LyXView.C (updateLayoutChoice): ditto.
6117 * src/LaTeX.C (scanLogFile): errors where the line number was not
6118 given just after the '!'-line were ignored (from Dekel Tsur).
6120 * lib/lyxrc.example: fix description of \date_insert_format
6122 * lib/layouts/llncs.layout: new layout, contributed by Martin
6125 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6127 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6128 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6129 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6130 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6131 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6132 paragraph.C, text.C, text2.C)
6134 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6136 * src/insets/insettext.C (LocalDispatch): remove extra break
6139 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6140 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6142 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6143 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6145 * src/insets/insetbib.h: move InsetBibkey::Holder and
6146 InsetCitation::Holder in public space.
6148 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6150 * src/insets/insettext.h: small change to get the new files from
6151 Juergen to compile (use "string", not "class string").
6153 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6154 const & as parameter to LocalDispatch, use LyXFont const & as
6155 paramter to some other func. This also had impacto on lyxinsets.h
6156 and the two mathed insets.
6158 2000-02-24 Juergen Vigna <jug@sad.it>
6161 * src/commandtags.h:
6163 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6167 * src/BufferView2.C: added/updated code for various inset-functions
6169 * src/insets/insetert.[Ch]: added implementation of InsetERT
6171 * src/insets/insettext.[Ch]: added implementation of InsetText
6173 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6174 (draw): added preliminary code for inset scrolling not finshed yet
6176 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6177 as it is in lyxfunc.C now
6179 * src/insets/lyxinset.h: Added functions for text-insets
6181 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6184 BufferView and reimplement the list as a queue put inside its own
6187 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6189 * several files: use the new interface to the "updateinsetlist"
6191 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6193 (work_area_handler): call BufferView::trippleClick on trippleclick.
6195 * src/BufferView.C (doubleClick): new function, selects word on
6197 (trippleClick): new function, selects line on trippleclick.
6199 2000-02-22 Allan Rae <rae@lyx.org>
6201 * lib/bind/xemacs.bind: buffer-previous not supported
6203 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6205 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6208 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6210 * src/bufferlist.C: get rid of current_view from this file
6212 * src/spellchecker.C: get rid of current_view from this file
6214 * src/vspace.C: get rid of current_view from this file
6215 (inPixels): added BufferView parameter for this func
6216 (asLatexCommand): added a BufferParams for this func
6218 * src/text.C src/text2.C: get rid of current_view from these
6221 * src/lyxfont.C (getFontDirection): move this function here from
6224 * src/bufferparams.C (getDocumentDirection): move this function
6227 * src/paragraph.C (getParDirection): move this function here from
6229 (getLetterDirection): ditto
6231 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6234 resize due to wrong pixmap beeing used. Also took the opurtunity
6235 to make the LyXScreen stateless on regard to WorkArea and some
6236 general cleanup in the same files.
6238 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6240 * src/Makefile.am: add missing direction.h
6242 * src/PainterBase.h: made the width functions const.
6244 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6247 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6249 * src/insets/insetlatexaccent.C (draw): make the accents draw
6250 better, at present this will only work well with iso8859-1.
6252 * several files: remove the old drawing code, now we use the new
6255 * several files: remove support for mono_video, reverse_video and
6258 2000-02-17 Juergen Vigna <jug@sad.it>
6260 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6261 int ** as we have to return the pointer, otherwise we have only
6262 NULL pointers in the returning function.
6264 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6266 * src/LaTeX.C (operator()): quote file name when running latex.
6268 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6270 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6271 (bubble tip), this removes our special handling of this.
6273 * Remove all code that is unused now that we have the new
6274 workarea. (Code that are not active when NEW_WA is defined.)
6276 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6278 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6280 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6281 nonexisting layout; correctly redirect obsoleted layouts.
6283 * lib/lyxrc.example: document \view_dvi_paper_option
6285 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6288 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6289 (PreviewDVI): handle the view_dvi_paper_option variable.
6290 [Both from Roland Krause]
6292 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6294 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6295 char const *, int, LyXFont)
6296 (text(int, int, string, LyXFont)): ditto
6298 * src/text.C (InsertCharInTable): attempt to fix the double-space
6299 feature in tables too.
6300 (BackspaceInTable): ditto.
6301 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6303 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6305 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6307 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6308 newly found text in textcache to this.
6309 (buffer): set the owner of the text put into the textcache to 0
6311 * src/insets/figinset.C (draw): fixed the drawing of figures with
6314 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6315 drawing of mathframe, hfills, protected space, table lines. I have
6316 now no outstanding drawing problems with the new Painter code.
6318 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6320 * src/PainterBase.C (ellipse, circle): do not specify the default
6323 * src/LColor.h: add using directive.
6325 * src/Painter.[Ch]: change return type of methods from Painter& to
6326 PainterBase&. Add a using directive.
6328 * src/WorkArea.C: wrap xforms callbacks in C functions
6331 * lib/layouts/foils.layout: font fix and simplifications from Carl
6334 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6336 * a lot of files: The Painter, LColor and WorkArea from the old
6337 devel branch has been ported to lyx-devel. Some new files and a
6338 lot of #ifdeffed code. The new workarea is enabled by default, but
6339 if you want to test the new Painter and LColor you have to compile
6340 with USE_PAINTER defined (do this in config.h f.ex.) There are
6341 still some rought edges, and I'd like some help to clear those
6342 out. It looks stable (loads and displays the Userguide very well).
6345 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6347 * src/buffer.C (pop_tag): revert to the previous implementation
6348 (use a global variable for both loops).
6350 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6352 * src/lyxrc.C (LyXRC): change slightly default date format.
6354 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6355 there is an English text with a footnote that starts with a Hebrew
6356 paragraph, or vice versa.
6357 (TeXFootnote): ditto.
6359 * src/text.C (LeftMargin): allow for negative values for
6360 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6363 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6364 for input encoding (cyrillic)
6366 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6368 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6371 * src/toolbar.C (set): ditto
6372 * src/insets/insetbib.C (create_form_citation_form): ditto
6374 * lib/CREDITS: added Dekel Tsur.
6376 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6377 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6378 hebrew supports files from Dekel Tsur.
6380 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6381 <tzafrir@technion.ac.il>
6383 * src/lyxrc.C: put \date_insert_format at the right place.
6385 * src/buffer.C (makeLaTeXFile): fix the handling of
6386 BufferParams::sides when writing out latex files.
6388 * src/BufferView2.C: add a "using" directive.
6390 * src/support/lyxsum.C (sum): when we use lyxstring,
6391 ostringstream::str needs an additional .c_str().
6393 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * src/support/filetools.C (ChangeExtension): patch from Etienne
6398 * src/TextCache.C (show): remove const_cast and make second
6399 parameter non-const LyXText *.
6401 * src/TextCache.h: use non const LyXText in show.
6403 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6406 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6408 * src/support/lyxsum.C: rework to be more flexible.
6410 * several places: don't check if a pointer is 0 if you are going
6413 * src/text.C: remove some dead code.
6415 * src/insets/figinset.C: remove some dead code
6417 * src/buffer.C: move the BufferView funcs to BufferView2.C
6418 remove all support for insetlatexdel
6419 remove support for oldpapersize stuff
6420 made some member funcs const
6422 * src/kbmap.C: use a std::list to store the bindings in.
6424 * src/BufferView2.C: new file
6426 * src/kbsequence.[Ch]: new files
6428 * src/LyXAction.C + others: remove all trace of buffer-previous
6430 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6431 only have one copy in the binary of this table.
6433 * hebrew patch: moved some functions from LyXText to more
6434 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6436 * several files: remove support for XForms older than 0.88
6438 remove some #if 0 #endif code
6440 * src/TextCache.[Ch]: new file. Holds the textcache.
6442 * src/BufferView.C: changes to use the new TextCache interface.
6443 (waitForX): remove the now unused code.
6445 * src/BackStack.h: remove some commented code
6447 * lib/bind/emacs.bind: remove binding for buffer-previous
6449 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6451 * applied the hebrew patch.
6453 * src/lyxrow.h: make sure that all Row variables are initialized.
6455 * src/text2.C (TextHandleUndo): comment out a delete, this might
6456 introduce a memory leak, but should also help us to not try to
6457 read freed memory. We need to look at this one.
6459 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6460 (LyXParagraph): initalize footnotekind.
6462 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6463 forgot this when applying the patch. Please heed the warnings.
6465 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6466 (aka. reformat problem)
6468 * src/bufferlist.C (exists): made const, and use const_iterator
6469 (isLoaded): new func.
6470 (release): use std::find to find the correct buffer.
6472 * src/bufferlist.h: made getState a const func.
6473 made empty a const func.
6474 made exists a const func.
6477 2000-02-01 Juergen Vigna <jug@sad.it>
6479 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6481 * po/it.po: updated a bit the italian po file and also changed the
6482 'file nuovo' for newfile to 'filenuovo' without a space, this did
6485 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6486 for the new insert_date command.
6488 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6489 from jdblair, to insert a date into the current text conforming to
6490 a strftime format (for now only considering the locale-set and not
6491 the document-language).
6493 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6495 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6496 Bounds Read error seen by purify. The problem was that islower is
6497 a macros which takes an unsigned char and uses it as an index for
6498 in array of characters properties (and is thus subject to the
6502 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6503 correctly the paper sides radio buttons.
6504 (UpdateDocumentButtons): ditto.
6506 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 * src/kbmap.C (getsym + others): change to return unsigned int,
6509 returning a long can give problems on 64 bit systems. (I assume
6510 that int is 32bit on 64bit systems)
6512 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6514 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6515 LyXLookupString to be zero-terminated. Really fixes problems seen
6518 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6520 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6521 write a (char*)0 to the lyxerr stream.
6523 * src/lastfiles.C: move algorithm before the using statemets.
6525 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6527 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6528 complains otherwise).
6529 * src/table.C: ditto
6531 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6534 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6535 that I removed earlier... It is really needed.
6537 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6539 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6541 * INSTALL: update xforms home page URL.
6543 * lib/configure.m4: fix a bug with unreadable layout files.
6545 * src/table.C (calculate_width_of_column): add "using std::max"
6548 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6550 * several files: marked several lines with "DEL LINE", this is
6551 lines that can be deleted without changing anything.
6552 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6553 checks this anyway */
6556 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6558 * src/DepTable.C (update): add a "+" at the end when the checksum
6559 is different. (debugging string only)
6561 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6562 the next inset to not be displayed. This should also fix the list
6563 of labels in the "Insert Crossreference" dialog.
6565 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6567 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6568 when regex was not found.
6570 * src/support/lstrings.C (lowercase): use handcoded transform always.
6573 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6574 old_cursor.par->prev could be 0.
6576 * several files: changed post inc/dec to pre inc/dec
6578 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6579 write the lastfiles to file.
6581 * src/BufferView.C (buffer): only show TextCache info when debugging
6583 (resizeCurrentBuffer): ditto
6584 (workAreaExpose): ditto
6586 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6588 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6590 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6591 a bit better by removing the special case for \i and \j.
6593 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6595 * src/lyx_main.C (easyParse): remove test for bad comand line
6596 options, since this broke all xforms-related parsing.
6598 * src/kbmap.C (getsym): set return type to unsigned long, as
6599 declared in header. On an alpha, long is _not_ the same as int.
6601 * src/support/LOstream.h: add a "using std::flush;"
6603 * src/insets/figinset.C: ditto.
6605 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6607 * src/bufferlist.C (write): use blinding fast file copy instead of
6608 "a char at a time", now we are doing it the C++ way.
6610 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6611 std::list<int> instead.
6612 (addpidwait): reflect move to std::list<int>
6613 (sigchldchecker): ditto
6615 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6618 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6619 that obviously was wrong...
6621 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6622 c, this avoids warnings with purify and islower.
6624 * src/insets/figinset.C: rename struct queue to struct
6625 queue_element and rewrite to use a std::queue. gsqueue is now a
6626 std::queue<queue_element>
6627 (runqueue): reflect move to std::queue
6630 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6631 we would get "1" "0" instead of "true" "false. Also make the tostr
6634 2000-01-21 Juergen Vigna <jug@sad.it>
6636 * src/buffer.C (writeFileAscii): Disabled code for special groff
6637 handling of tabulars till I fix this in table.C
6639 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6641 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6643 * src/support/lyxlib.h: ditto.
6645 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6647 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6648 and 'j' look better. This might fix the "macron" bug that has been
6651 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6652 functions as one template function. Delete the old versions.
6654 * src/support/lyxsum.C: move using std::ifstream inside
6657 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6660 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6662 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6664 * src/insets/figinset.C (InitFigures): use new instead of malloc
6665 to allocate memory for figures and bitmaps.
6666 (DoneFigures): use delete[] instead of free to deallocate memory
6667 for figures and bitmaps.
6668 (runqueue): use new to allocate
6669 (getfigdata): use new/delete[] instead of malloc/free
6670 (RegisterFigure): ditto
6672 * some files: moved some declarations closer to first use, small
6673 whitespace changes use preincrement instead of postincrement where
6674 it does not make a difference.
6676 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6677 step on the way to use stl::containers for key maps.
6679 * src/bufferlist.h: add a typedef for const_iterator and const
6680 versions of begin and end.
6682 * src/bufferlist.[Ch]: change name of member variable _state to
6683 state_. (avoid reserved names)
6685 (getFileNames): returns the filenames of the buffers in a vector.
6687 * configure.in (ALL_LINGUAS): added ro
6689 * src/support/putenv.C: new file
6691 * src/support/mkdir.C: new file
6693 2000-01-20 Allan Rae <rae@lyx.org>
6695 * lib/layouts/IEEEtran.layout: Added several theorem environments
6697 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6698 couple of minor additions.
6700 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6701 (except for those in footnotes of course)
6703 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6705 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6707 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6708 std::sort and std::lower_bound instead of qsort and handwritten
6710 (struct compara): struct that holds the functors used by std::sort
6711 and std::lower_bound in MathedLookupBOP.
6713 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6715 * src/support/LAssert.h: do not do partial specialization. We do
6718 * src/support/lyxlib.h: note that lyx::getUserName() and
6719 lyx::date() are not in use right now. Should these be suppressed?
6721 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6722 (makeLinuxDocFile): do not put date and user name in linuxdoc
6725 * src/support/lyxlib.h (kill): change first argument to long int,
6726 since that's what solaris uses.
6728 * src/support/kill.C (kill): fix declaration to match prototype.
6730 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6731 actually check whether namespaces are supported. This is not what
6734 * src/support/lyxsum.C: add a using directive.
6736 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * src/support/kill.C: if we have namespace support we don't have
6739 to include lyxlib.h.
6741 * src/support/lyxlib.h: use namespace lyx if supported.
6743 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6745 * src/support/date.C: new file
6747 * src/support/chdir.C: new file
6749 * src/support/getUserName.C: new file
6751 * src/support/getcwd.C: new file
6753 * src/support/abort.C: new file
6755 * src/support/kill.C: new file
6757 * src/support/lyxlib.h: moved all the functions in this file
6758 insede struct lyx. Added also kill and abort to this struct. This
6759 is a way to avoid the "kill is not defined in <csignal>", we make
6760 C++ wrappers for functions that are not ANSI C or ANSI C++.
6762 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6763 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6764 lyx it has been renamed to sum.
6766 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6768 * src/text.C: add using directives for std::min and std::max.
6770 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6772 * src/texrow.C (getIdFromRow): actually return something useful in
6773 id and pos. Hopefully fixes the bug with positionning of errorbox
6776 * src/lyx_main.C (easyParse): output an error and exit if an
6777 incorrect command line option has been given.
6779 * src/spellchecker.C (ispell_check_word): document a memory leak.
6781 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6782 where a "struct utimbuf" is allocated with "new" and deleted with
6785 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6787 * src/text2.C (CutSelection): don't delete double spaces.
6788 (PasteSelection): ditto
6789 (CopySelection): ditto
6791 * src/text.C (Backspace): don't delete double spaces.
6793 * src/lyxlex.C (next): fix a bug that were only present with
6794 conformant std::istream::get to read comment lines, use
6795 std::istream::getline instead. This seems to fix the problem.
6797 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6799 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6800 allowed to insert space before space" editing problem. Please read
6801 commends at the beginning of the function. Comments about usage
6804 * src/text.C (InsertChar): fix for the "not allowed to insert
6805 space before space" editing problem.
6807 * src/text2.C (DeleteEmptyParagraphMechanism): when
6808 IsEmptyTableRow can only return false this last "else if" will
6809 always be a no-op. Commented out.
6811 * src/text.C (RedoParagraph): As far as I can understand tmp
6812 cursor is not really needed.
6814 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6815 present it could only return false anyway.
6816 (several functions): Did something not so smart...added a const
6817 specifier on a lot of methods.
6819 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6820 and add a tmp->text.resize. The LyXParagraph constructor does the
6822 (BreakParagraphConservative): ditto
6824 * src/support/path.h (Path): add a define so that the wrong usage
6825 "Path("/tmp") will be flagged as a compilation error:
6826 "`unnamed_Path' undeclared (first use this function)"
6828 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6830 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6831 which was bogus for several reasons.
6833 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6837 * autogen.sh: do not use "type -path" (what's that anyway?).
6839 * src/support/filetools.C (findtexfile): remove extraneous space
6840 which caused a kpsewhich warning (at least with kpathsea version
6843 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6845 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6847 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6849 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6851 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6853 * src/paragraph.C (BreakParagraph): do not reserve space on text
6854 if we don't need to (otherwise, if pos_end < pos, we end up
6855 reserving huge amounts of memory due to bad unsigned karma).
6856 (BreakParagraphConservative): ditto, although I have not seen
6857 evidence the bug can happen here.
6859 * src/lyxparagraph.h: add a using std::list.
6861 2000-01-11 Juergen Vigna <jug@sad.it>
6863 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6866 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6868 * src/vc-backend.C (doVCCommand): change to be static and take one
6869 more parameter: the path to chdir too be fore executing the command.
6870 (retrive): new function equiv to "co -r"
6872 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6873 file_not_found_hook is true.
6875 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6877 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6878 if a file is readwrite,readonly...anything else.
6880 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6882 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6883 (CreatePostscript): name change from MenuRunDVIPS (or something)
6884 (PreviewPostscript): name change from MenuPreviewPS
6885 (PreviewDVI): name change from MenuPreviewDVI
6887 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6888 \view_pdf_command., \pdf_to_ps_command
6890 * lib/configure.m4: added search for PDF viewer, and search for
6891 PDF to PS converter.
6892 (lyxrc.defaults output): add \pdflatex_command,
6893 \view_pdf_command and \pdf_to_ps_command.
6895 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6897 * src/bufferlist.C (write): we don't use blocksize for anything so
6900 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6902 * src/support/block.h: disable operator T* (), since it causes
6903 problems with both compilers I tried. See comments in the file.
6905 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6908 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6909 variable LYX_DIR_10x to LYX_DIR_11x.
6911 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6913 * INSTALL: document --with-lyxname.
6916 * configure.in: new configure flag --with-lyxname which allows to
6917 choose the name under which lyx is installed. Default is "lyx", of
6918 course. It used to be possible to do this with --program-suffix,
6919 but the later has in fact a different meaning for autoconf.
6921 * src/support/lstrings.h (lstrchr): reformat a bit.
6923 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6924 * src/mathed/math_defs.h: ditto.
6926 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6928 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6929 true, decides if we create a backup file or not when saving. New
6930 tag and variable \pdf_mode, defaults to false. New tag and
6931 variable \pdflatex_command, defaults to pdflatex. New tag and
6932 variable \view_pdf_command, defaults to xpdf. New tag and variable
6933 \pdf_to_ps_command, defaults to pdf2ps.
6935 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6937 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6938 does not have a BufferView.
6939 (unlockInset): ditto + don't access the_locking_inset if the
6940 buffer does not have a BufferView.
6942 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6943 certain circumstances so that we don't continue a keyboard
6944 operation long after the key was released. Try f.ex. to load a
6945 large document, press PageDown for some seconds and then release
6946 it. Before this change the document would contine to scroll for
6947 some time, with this change it stops imidiatly.
6949 * src/support/block.h: don't allocate more space than needed. As
6950 long as we don't try to write to the arr[x] in a array_type arr[x]
6951 it is perfectly ok. (if you write to it you might segfault).
6952 added operator value_type*() so that is possible to pass the array
6953 to functions expecting a C-pointer.
6955 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6958 * intl/*: updated to gettext 0.10.35, tried to add our own
6959 required modifications. Please verify.
6961 * po/*: updated to gettext 0.10.35, tried to add our own required
6962 modifications. Please verify.
6964 * src/support/lstrings.C (tostr): go at fixing the problem with
6965 cxx and stringstream. When stringstream is used return
6966 oss.str().c_str() so that problems with lyxstring and basic_string
6967 are avoided. Note that the best solution would be for cxx to use
6968 basic_string all the way, but it is not conformant yet. (it seems)
6970 * src/lyx_cb.C + other files: moved several global functions to
6971 class BufferView, some have been moved to BufferView.[Ch] others
6972 are still located in lyx_cb.C. Code changes because of this. (part
6973 of "get rid of current_view project".)
6975 * src/buffer.C + other files: moved several Buffer functions to
6976 class BufferView, the functions are still present in buffer.C.
6977 Code changes because of this.
6979 * config/lcmessage.m4: updated to most recent. used when creating
6982 * config/progtest.m4: updated to most recent. used when creating
6985 * config/gettext.m4: updated to most recent. applied patch for
6988 * config/gettext.m4.patch: new file that shows what changes we
6989 have done to the local copy of gettext.m4.
6991 * config/libtool.m4: new file, used in creation of acinclude.m4
6993 * config/lyxinclude.m4: new file, this is the lyx created m4
6994 macros, used in making acinclude.m4.
6996 * autogen.sh: GNU m4 discovered as a separate task not as part of
6997 the lib/configure creation.
6998 Generate acinlucde from files in config. Actually cat
6999 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7000 easier to upgrade .m4 files that really are external.
7002 * src/Spacing.h: moved using std::istringstream to right after
7003 <sstream>. This should fix the problem seen with some compilers.
7005 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7007 * src/lyx_cb.C: began some work to remove the dependency a lot of
7008 functions have on BufferView::text, even if not really needed.
7009 (GetCurrentTextClass): removed this func, it only hid the
7012 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7013 forgot this in last commit.
7015 * src/Bullet.C (bulletEntry): use static char const *[] for the
7016 tables, becuase of this the return arg had to change to string.
7018 (~Bullet): removed unneeded destructor
7020 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7021 (insetSleep): moved from Buffer
7022 (insetWakeup): moved from Buffer
7023 (insetUnlock): moved from Buffer
7025 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7026 from Buffer to BufferView.
7028 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7030 * config/ltmain.sh: updated to version 1.3.4 of libtool
7032 * config/ltconfig: updated to version 1.3.4 of libtool
7034 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7037 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7038 Did I get that right?
7040 * src/lyxlex.h: add a "using" directive or two.
7041 * src/Spacing.h: ditto.
7042 * src/insets/figinset.C: ditto.
7043 * src/support/filetools.C: ditto.
7044 * src/support/lstrings.C: ditto.
7045 * src/BufferView.C: ditto.
7046 * src/bufferlist.C: ditto.
7047 * src/lyx_cb.C: ditto.
7048 * src/lyxlex.C: ditto.
7050 * NEWS: add some changes for 1.1.4.
7052 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7054 * src/BufferView.C: first go at a TextCache to speed up switching
7057 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7059 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7060 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7061 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7062 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7065 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7066 members of the struct are correctly initialized to 0 (detected by
7068 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7069 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7071 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7072 pidwait, since it was allocated with "new". This was potentially
7073 very bad. Thanks to Michael Schmitt for running purify for us.
7076 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7078 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7080 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7082 1999-12-30 Allan Rae <rae@lyx.org>
7084 * lib/templates/IEEEtran.lyx: minor change
7086 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7087 src/mathed/formula.C (LocalDispatch): askForText changes
7089 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7090 know when a user has cancelled input. Fixes annoying problems with
7091 inserting labels and version control.
7093 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7095 * src/support/lstrings.C (tostr): rewritten to use strstream and
7098 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7100 * src/support/filetools.C (IsFileWriteable): use fstream to check
7101 (IsDirWriteable): use fileinfo to check
7103 * src/support/filetools.h (FilePtr): whole class deleted
7105 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7107 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7109 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7111 * src/bufferlist.C (write): use ifstream and ofstream instead of
7114 * src/Spacing.h: use istrstream instead of sscanf
7116 * src/mathed/math_defs.h: change first arg to istream from FILE*
7118 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7120 * src/mathed/math_parser.C: have yyis to be an istream
7121 (LexGetArg): use istream (yyis)
7123 (mathed_parse): ditto
7124 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7126 * src/mathed/formula.C (Read): rewritten to use istream
7128 * src/mathed/formulamacro.C (Read): rewritten to use istream
7130 * src/lyxlex.h (~LyXLex): deleted desturctor
7131 (getStream): new function, returns an istream
7132 (getFile): deleted funtion
7133 (IsOK): return is.good();
7135 * src/lyxlex.C (LyXLex): delete file and owns_file
7136 (setFile): open an filebuf and assign that to a istream instead of
7138 (setStream): new function, takes an istream as arg.
7139 (setFile): deleted function
7140 (EatLine): rewritten us use istream instead of FILE*
7144 * src/table.C (LyXTable): use istream instead of FILE*
7145 (Read): rewritten to take an istream instead of FILE*
7147 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7149 * src/buffer.C (Dispatch): remove an extraneous break statement.
7151 * src/support/filetools.C (QuoteName): change to do simple
7152 'quoting'. More work is necessary. Also changed to do nothing
7153 under emx (needs fix too).
7154 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7156 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7157 config.h.in to the AC_DEFINE_UNQUOTED() call.
7158 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7159 needs char * as argument (because Solaris 7 declares it like
7162 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7163 remove definition of BZERO.
7165 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7167 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7168 defined, "lyxregex.h" if not.
7170 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7172 (REGEX): new variable that is set to regex.c lyxregex.h when
7173 AM_CONDITIONAL USE_REGEX is set.
7174 (libsupport_la_SOURCES): add $(REGEX)
7176 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7179 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7182 * configure.in: add call to LYX_REGEX
7184 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7185 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7187 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7189 * lib/bind/fi_menus.bind: new file, from
7190 pauli.virtanen@saunalahti.fi.
7192 * src/buffer.C (getBibkeyList): pass the parameter delim to
7193 InsetInclude::getKeys and InsetBibtex::getKeys.
7195 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7196 is passed to Buffer::getBibkeyList
7198 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7199 instead of the hardcoded comma.
7201 * src/insets/insetbib.C (getKeys): make sure that there are not
7202 leading blanks in bibtex keys. Normal latex does not care, but
7203 harvard.sty seems to dislike blanks at the beginning of citation
7204 keys. In particular, the retturn value of the function is
7206 * INSTALL: make it clear that libstdc++ is needed and that gcc
7207 2.7.x probably does not work.
7209 * src/support/filetools.C (findtexfile): make debug message go to
7211 * src/insets/insetbib.C (getKeys): ditto
7213 * src/debug.C (showTags): make sure that the output is correctly
7216 * configure.in: add a comment for TWO_COLOR_ICON define.
7218 * acconfig.h: remove all the entries that already defined in
7219 configure.in or acinclude.m4.
7221 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7222 to avoid user name, date and copyright.
7224 1999-12-21 Juergen Vigna <jug@sad.it>
7226 * src/table.C (Read): Now read bogus row format informations
7227 if the format is < 5 so that afterwards the table can
7228 be read by lyx but without any format-info. Fixed the
7229 crash we experienced when not doing this.
7231 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7233 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7234 (RedoDrawingOfParagraph): ditto
7235 (RedoParagraphs): ditto
7236 (RemoveTableRow): ditto
7238 * src/text.C (Fill): rename arg paperwidth -> paper_width
7240 * src/buffer.C (insertLyXFile): rename var filename -> fname
7241 (writeFile): rename arg filename -> fname
7242 (writeFileAscii): ditto
7243 (makeLaTeXFile): ditto
7244 (makeLinuxDocFile): ditto
7245 (makeDocBookFile): ditto
7247 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7250 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7252 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7255 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7256 compiled by a C compiler not C++.
7258 * src/layout.h (LyXTextClass): added typedef for const_iterator
7259 (LyXTextClassList): added typedef for const_iterator + member
7260 functions begin and end.
7262 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7263 iterators to fill the choice_class.
7264 (updateLayoutChoice): rewritten to use iterators to fill the
7265 layoutlist in the toolbar.
7267 * src/BufferView.h (BufferView::work_area_width): removed unused
7270 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7272 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7273 (sgmlCloseTag): ditto
7275 * src/support/lstrings.h: return type of countChar changed to
7278 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7279 what version of this func to use. Also made to return unsigned int.
7281 * configure.in: call LYX_STD_COUNT
7283 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7284 conforming std::count.
7286 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7288 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7289 and a subscript would give bad display (patch from Dekel Tsur
7290 <dekel@math.tau.ac.il>).
7292 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7294 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7297 * src/chset.h: add a few 'using' directives
7299 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7300 triggered when no buffer is active
7302 * src/layout.C: removed `break' after `return' in switch(), since
7305 * src/lyx_main.C (init): make sure LyX can be ran in place even
7306 when libtool has done its magic with shared libraries. Fix the
7307 test for the case when the system directory has not been found.
7309 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7310 name for the latex file.
7311 (MenuMakeHTML): ditto
7313 * src/buffer.h: add an optional boolean argument, which is passed
7316 1999-12-20 Allan Rae <rae@lyx.org>
7318 * lib/templates/IEEEtran.lyx: small correction and update.
7320 * configure.in: Attempted to use LYX_PATH_HEADER
7322 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7324 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7325 input from JMarc. Now use preprocessor to find the header.
7326 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7327 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7328 LYX_STL_STRING_FWD. See comments in file.
7330 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7332 * The global MiniBuffer * minibuffer variable is dead.
7334 * The global FD_form_main * fd_form_main variable is dead.
7336 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7338 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7340 * src/table.h: add the LOstream.h header
7341 * src/debug.h: ditto
7343 * src/LyXAction.h: change the explaination of the ReadOnly
7344 attribute: is indicates that the function _can_ be used.
7346 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7349 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7351 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7357 * src/paragraph.C (GetWord): assert on pos>=0
7360 * src/support/lyxstring.C: condition the use of an invariant on
7362 * src/support/lyxstring.h: ditto
7364 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7365 Use LAssert.h instead of plain assert().
7367 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7369 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7370 * src/support/filetools.C: ditto
7372 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7375 * INSTALL: document the new configure flags
7377 * configure.in: suppress --with-debug; add --enable-assertions
7379 * acinclude.m4: various changes in alignment of help strings.
7381 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/kbmap.C: commented out the use of the hash map in kb_map,
7384 beginning of movement to a stl::container.
7386 * several files: removed code that was not in effect when
7387 MOVE_TEXT was defined.
7389 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7390 for escaping should not be used. We can discuss if the string
7391 should be enclosed in f.ex. [] instead of "".
7393 * src/trans_mgr.C (insert): use the new returned value from
7394 encodeString to get deadkeys and keymaps done correctly.
7396 * src/chset.C (encodeString): changed to return a pair, to tell
7397 what to use if we know the string.
7399 * src/lyxscreen.h (fillArc): new function.
7401 * src/FontInfo.C (resize): rewritten to use more std::string like
7402 structore, especially string::replace.
7404 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7407 * configure.in (chmod +x some scripts): remove config/gcc-hack
7409 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7411 * src/buffer.C (writeFile): change once again the top comment in a
7412 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7413 instead of an hardcoded version number.
7414 (makeDocBookFile): ditto
7416 * src/version.h: add new define LYX_DOCVERSION
7418 * po/de.po: update from Pit Sütterlin
7419 * lib/bind/de_menus.bind: ditto.
7421 * src/lyxfunc.C (Dispatch): call MenuExport()
7422 * src/buffer.C (Dispatch): ditto
7424 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7425 LyXFunc::Dispatch().
7426 (MenuExport): new function, moved from
7427 LyXFunc::Dispatch().
7429 * src/trans_mgr.C (insert): small cleanup
7430 * src/chset.C (loadFile): ditto
7432 * lib/kbd/iso8859-1.cdef: add missing backslashes
7434 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7437 help with placing the manually drawn accents better.
7439 (Draw): x2 and hg changed to float to minimize rounding errors and
7440 help place the accents better.
7442 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7443 unsigned short to char is just wrong...cast the char to unsigned
7444 char instead so that the two values can compare sanely. This
7445 should also make the display of insetlatexaccents better and
7446 perhaps also some other insets.
7448 (lbearing): new function
7451 1999-12-15 Allan Rae <rae@lyx.org>
7453 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7454 header that provides a wrapper around the very annoying SGI STL header
7457 * src/support/lyxstring.C, src/LString.h:
7458 removed old SGI-STL-compatability attempts.
7460 * configure.in: Use LYX_STL_STRING_FWD.
7462 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7463 stl_string_fwd.h is around and try to determine it's location.
7464 Major improvement over previous SGI STL 3.2 compatability.
7465 Three small problems remain with this function due to my zero
7466 knowledge of autoconf. JMarc and lgb see the comments in the code.
7468 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7470 * src/broken_const.h, config/hack-gcc, config/README: removed
7472 * configure.in: remove --with-gcc-hack option; do not call
7475 * INSTALL: remove documentation of --with-broken-const and
7478 * acconfig.h: remove all trace of BROKEN_CONST define
7480 * src/buffer.C (makeDocBookFile): update version number in output
7482 (SimpleDocBookOnePar): fix an assert when trying to a character
7483 access beyond string length
7486 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7488 * po/de.po: fix the Export menu
7490 * lyx.man: update the description of -dbg
7492 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7493 (commandLineHelp): updated
7494 (easyParse): show list of available debug levels if -dbg is passed
7497 * src/Makefile.am: add debug.C
7499 * src/debug.h: moved some code to debug.C
7501 * src/debug.C: new file. Contains code to set and show debug
7504 * src/layout.C: remove 'break' after 'continue' in switch
7505 statements, since these cannot be reached.
7507 1999-12-13 Allan Rae <rae@lyx.org>
7509 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7510 (in_word_set): hash() -> math_hash()
7512 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7514 * acconfig.h: Added a test for whether we are using exceptions in the
7515 current compilation run. If so USING_EXCEPTIONS is defined.
7517 * config.in: Check for existance of stl_string_fwd.h
7518 * src/LString.h: If compiling --with-included-string and SGI's
7519 STL version 3.2 is present (see above test) we need to block their
7520 forward declaration of string and supply a __get_c_string().
7521 However, it turns out this is only necessary if compiling with
7522 exceptions enabled so I've a bit more to add yet.
7524 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7525 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7526 src/support/LRegex.h, src/undo.h:
7527 Shuffle the order of the included files a little to ensure that
7528 LString.h gets included before anything that includes stl_string_fwd.h
7530 * src/support/lyxstring.C: We need to #include LString.h instead of
7531 lyxstring.h to get the necessary definition of __get_c_string.
7532 (__get_c_string): New function. This is defined static just like SGI's
7533 although why they need to do this I'm not sure. Perhaps it should be
7534 in lstrings.C instead.
7536 * lib/templates/IEEEtran.lyx: New template file.
7538 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7540 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7541 * intl/Makefile.in (MKINSTALLDIRS): ditto
7543 * src/LyXAction.C (init): changed to hold the LFUN data in a
7544 automatic array in stead of in callso to newFunc, this speeds up
7545 compilation a lot. Also all the memory used by the array is
7546 returned when the init is completed.
7548 * a lot of files: compiled with -Wold-style-cast, changed most of
7549 the reported offenders to C++ style casts. Did not change the
7550 offenders in C files.
7552 * src/trans.h (Match): change argument type to unsigned int.
7554 * src/support/DebugStream.C: fix some types on the streambufs so
7555 that it works on a conforming implementation.
7557 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7559 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7561 * src/support/lyxstring.C: remove the inline added earlier since
7562 they cause a bunch of unsatisfied symbols when linking with dec
7563 cxx. Cxx likes to have the body of inlines at the place where they
7566 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7567 accessing negative bounds in array. This fixes the crash when
7568 inserting accented characters.
7569 * src/trans.h (Match): ditto
7571 * src/buffer.C (Dispatch): since this is a void, it should not try
7572 to return anything...
7574 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7576 * src/buffer.h: removed the two friends from Buffer. Some changes
7577 because of this. Buffer::getFileName and Buffer::setFileName
7578 renamed to Buffer::fileName() and Buffer::fileName(...).
7580 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7582 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7583 and Buffer::update(short) to BufferView. This move is currently
7584 controlled by a define MOVE_TEXT, this will be removed when all
7585 shows to be ok. This move paves the way for better separation
7586 between buffer contents and buffer view. One side effect is that
7587 the BufferView needs a rebreak when swiching buffers, if we want
7588 to avoid this we can add a cache that holds pointers to LyXText's
7589 that is not currently in use.
7591 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7594 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7596 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7598 * lyx_main.C: new command line option -x (or --execute) and
7599 -e (or --export). Now direct conversion from .lyx to .tex
7600 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7601 Unfortunately, X is still needed and the GUI pops up during the
7604 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7606 * src/Spacing.C: add a using directive to bring stream stuff into
7608 * src/paragraph.C: ditto
7609 * src/buffer.C: ditto
7611 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7612 from Lars' announcement).
7614 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7615 example files from Tino Meinen.
7617 1999-12-06 Allan Rae <rae@lyx.org>
7619 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7621 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7623 * src/support/lyxstring.C: added a lot of inline for no good
7626 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7627 latexWriteEndChanges, they were not used.
7629 * src/layout.h (operator<<): output operator for PageSides
7631 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7633 * some example files: loaded in LyX 1.0.4 and saved again to update
7634 certain constructs (table format)
7636 * a lot of files: did the change to use fstream/iostream for all
7637 writing of files. Done with a close look at Andre Poenitz's patch.
7639 * some files: whitespace changes.
7641 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7643 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7644 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7645 architecture, we provide our own. It is used unconditionnally, but
7646 I do not think this is a performance problem. Thanks to Angus
7647 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7648 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7650 (GetInset): use my_memcpy.
7654 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7655 it is easier to understand, but it uses less TeX-only constructs now.
7657 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7658 elements contain spaces
7660 * lib/configure: regenerated
7662 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7663 elements contain spaces; display the list of programs that are
7666 * autogen.sh: make sure lib/configure is executable
7668 * lib/examples/*: rename the tutorial examples to begin with the
7669 two-letters language code.
7671 * src/lyxfunc.C (getStatus): do not query current font if no
7674 * src/lyx_cb.C (RunScript): use QuoteName
7675 (MenuRunDvips): ditto
7676 (PrintApplyCB): ditto
7678 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7679 around argument, so that it works well with the current shell.
7680 Does not work properly with OS/2 shells currently.
7682 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7683 * src/LyXSendto.C (SendtoApplyCB): ditto
7684 * src/lyxfunc.C (Dispatch): ditto
7685 * src/buffer.C (runLaTeX): ditto
7686 (runLiterate): ditto
7687 (buildProgram): ditto
7689 * src/lyx_cb.C (RunScript): ditto
7690 (MenuMakeLaTeX): ditto
7692 * src/buffer.h (getLatexName): new method
7694 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7696 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7698 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7699 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7700 (create_math_panel): ditto
7702 * src/lyxfunc.C (getStatus): re-activate the code which gets
7703 current font and cursor; add test for export to html.
7705 * src/lyxrc.C (read): remove unreachable break statements; add a
7708 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7710 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7712 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7713 introduced by faulty regex.
7714 * src/buffer.C: ditto
7715 * src/lastfiles.C: ditto
7716 * src/paragraph.C: ditto
7717 * src/table.C: ditto
7718 * src/vspace.C: ditto
7719 * src/insets/figinset.C: ditto
7720 Note: most of these is absolutely harmless, except the one in
7721 src/mathed formula.C.
7723 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7725 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7726 operation, yielding correct results for the reLyX command.
7728 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7730 * src/support/filetools.C (ExpandPath): removed an over eager
7732 (ReplaceEnvironmentPath): ditto
7734 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7735 shows that we are doing something fishy in our code...
7739 * src/lyxrc.C (read): use a double switch trick to get more help
7740 from the compiler. (the same trick is used in layout.C)
7741 (write): new function. opens a ofstream and pass that to output
7742 (output): new function, takes a ostream and writes the lyxrc
7743 elemts to it. uses a dummy switch to make sure no elements are
7746 * src/lyxlex.h: added a struct pushpophelper for use in functions
7747 with more than one exit point.
7749 * src/lyxlex.[Ch] (GetInteger): made it const
7753 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7755 * src/layout.[hC] : LayoutTags splitted into several enums, new
7756 methods created, better error handling cleaner use of lyxlex. Read
7759 * src/bmtable.[Ch]: change some member prototypes because of the
7760 image const changes.
7762 * commandtags.h, src/LyXAction.C (init): new function:
7763 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7764 This file is not read automatically but you can add \input
7765 preferences to your lyxrc if you want to. We need to discuss how
7768 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7769 in .aux, also remove .bib and .bst files from dependencies when
7772 * src/BufferView.C, src/LyXView.C: add const_cast several places
7773 because of changes to images.
7775 * lib/images/*: same change as for images/*
7777 * lib/lyxrc.example: Default for accept_compound is false not no.
7779 * images/*: changed to be const, however I have som misgivings
7780 about this change so it might be changed back.
7782 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7784 * lib/configure, po/POTFILES.in: regenerated
7786 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7788 * config/lib_configure.m4: removed
7790 * lib/configure.m4: new file (was config/lib_configure.m4)
7792 * configure.in: do not test for rtti, since we do not use it.
7794 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7796 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7797 doubling of allocated space scheme. This makes it faster for large
7798 strings end to use less memory for small strings. xtra rememoved.
7800 * src/insets/figinset.C (waitalarm): commented out.
7801 (GhostscriptMsg): use static_cast
7802 (GhostscriptMsg): use new instead of malloc to allocate memory for
7803 cmap. also delete the memory after use.
7805 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7807 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7808 for changes in bibtex database or style.
7809 (runBibTeX): remove all .bib and .bst files from dep before we
7811 (run): use scanAuc in when dep file already exist.
7813 * src/DepTable.C (remove_files_with_extension): new method
7816 * src/DepTable.[Ch]: made many of the methods const.
7818 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7820 * src/bufferparams.C: make sure that the default textclass is
7821 "article". It used to be the first one by description order, but
7822 now the first one is "docbook".
7824 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7825 string; call Debug::value.
7826 (easyParse): pass complete argument to setDebuggingLevel().
7828 * src/debug.h (value): fix the code that parses debug levels.
7830 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7833 * src/LyXAction.C: use Debug::ACTION as debug channel.
7835 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7837 * NEWS: updated for the future 1.1.3 release.
7839 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7840 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7841 it should. This is of course a controversial change (since many
7842 people will find that their lyx workscreen is suddenly full of
7843 red), but done for the sake of correctness.
7845 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7846 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7848 * src/insets/inseterror.h, src/insets/inseturl.h,
7849 src/insets/insetinfo.h, src/insets/figinset.h,
7850 src/mathed/formulamacro.h, src/mathed/math_macro.h
7851 (EditMessage): add a missing const and add _() to make sure that
7854 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7855 src/insets/insetbib.C, src/support/filetools.C: add `using'
7858 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7859 doing 'Insert index of last word' at the beginning of a paragraph.
7861 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7863 * several files: white-space changes.
7865 * src/mathed/formula.C: removed IsAlpha and IsDigit
7867 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7868 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7871 * src/insets/figinset.C (GetPSSizes): don't break when
7872 "EndComments" is seen. But break when a boundingbox is read.
7874 * all classes inherited from Inset: return value of Clone
7875 changed back to Inset *.
7877 * all classes inherited form MathInset: return value of Clone
7878 changed back to MathedInset *.
7880 * src/insets/figinset.C (runqueue): use a ofstream to output the
7881 gs/ps file. Might need some setpresicion or setw. However I can
7882 see no problem with the current code.
7883 (runqueue): use sleep instead of the alarm/signal code. I just
7884 can't see the difference.
7886 * src/paragraph.C (LyXParagraph): reserve space in the new
7887 paragraph and resize the inserted paragraph to just fit.
7889 * src/lyxfunc.h (operator|=): added operator for func_status.
7891 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7892 check for readable file.
7894 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7895 check for readable file.
7896 (MenuMakeLinuxDoc): ditto
7897 (MenuMakeDocBook): ditto
7898 (MenuMakeAscii): ditto
7899 (InsertAsciiFile): split the test for openable and readable
7901 * src/bmtable.C (draw_bitmaptable): use
7902 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7904 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7905 findtexfile from LaTeX to filetools.
7907 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7908 instead of FilePtr. Needs to be verified by a literate user.
7910 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7912 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7913 (EditMessage): likewise.
7915 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7916 respectively as \textasciitilde and \textasciicircum.
7918 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * src/support/lyxstring.h: made the methods that take iterators
7923 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7924 (regexMatch): made is use the real regex class.
7926 * src/support/Makefile.am: changed to use libtool
7928 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7930 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7932 (MathIsInset ++): changed several macros to be inline functions
7935 * src/mathed/Makefile.am: changed to use libtool
7937 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7939 * src/insets/inset* : Clone changed to const and return type is
7940 the true insettype not just Inset*.
7942 * src/insets/Makefile.am: changed to use libtool
7944 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7946 * src/undo.[Ch] : added empty() and changed some of the method
7949 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7951 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7952 setID use block<> for the bullets array, added const several places.
7954 * src/lyxfunc.C (getStatus): new function
7956 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7957 LyXAction, added const to several funtions.
7959 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7960 a std::map, and to store the dir items in a vector.
7962 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7965 * src/LyXView.[Ch] + other files : changed currentView to view.
7967 * src/LyXAction.[Ch] : ported from the old devel branch.
7969 * src/.cvsignore: added .libs and a.out
7971 * configure.in : changes to use libtool.
7973 * acinclude.m4 : inserted libtool.m4
7975 * .cvsignore: added libtool
7977 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7979 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7980 file name in insets and mathed directories (otherwise the
7981 dependency is not taken in account under cygwin).
7983 * src/text2.C (InsertString[AB]): make sure that we do not try to
7984 read characters past the string length.
7986 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7988 * lib/doc/LaTeXConfig.lyx.in,
7989 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7991 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7992 file saying who created them and when this heppened; this is
7993 useless and annoys tools like cvs.
7995 * lib/layouts/g-brief-{en,de}.layout,
7996 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7997 from Thomas Hartkens <thomas@hartkens.de>.
7999 * src/{insets,mathed}/Makefile.am: do not declare an empty
8000 LDFLAGS, so that it can be set at configure time (useful on Irix
8003 * lib/reLyX/configure.in: make sure that the prefix is set
8004 correctly in LYX_DIR.
8006 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8008 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8009 be used by 'command-sequence' this allows to bind a key to a
8010 sequence of LyX-commands
8011 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8013 * src/LyXAction.C: add "command-sequence"
8015 * src/LyXFunction.C: handling of "command-sequence"
8017 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8018 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8020 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8022 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8024 * src/buffer.C (writeFile): Do not output a comment giving user
8025 and date at the beginning of a .lyx file. This is useless and
8026 annoys cvs anyway; update version number to 1.1.
8028 * src/Makefile.am (LYX_DIR): add this definition, so that a
8029 default path is hardcoded in LyX.
8031 * configure.in: Use LYX_GNU_GETTEXT.
8033 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8034 AM_GNU_GETTEXT with a bug fixed.
8036 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8038 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8040 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8041 which is used to point to LyX data is now LYX_DIR_11x.
8043 * lyx.man: convert to a unix text file; small updates.
8045 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8047 * src/support/LSubstring.[Ch]: made the second arg of most of the
8048 constructors be a const reference.
8050 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8053 * src/support/lyxstring.[Ch] (swap): added missing member function
8054 and specialization of swap(str, str);
8056 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8058 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8059 trace of the old one.
8061 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8062 put the member definitions in undo.C.
8064 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8065 NEW_TEXT and have now only code that was included when this was
8068 * src/intl.C (LCombo): use static_cast
8070 (DispatchCallback): ditto
8072 * src/definitions.h: removed whole file
8074 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8076 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8077 parsing and stores in a std:map. a regex defines the file format.
8078 removed unneeded members.
8080 * src/bufferparams.h: added several enums from definitions.h here.
8081 Removed unsused destructor. Changed some types to use proper enum
8082 types. use block to have the temp_bullets and user_defined_bullets
8083 and to make the whole class assignable.
8085 * src/bufferparams.C (Copy): removed this functions, use a default
8088 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8091 * src/buffer.C (readLyXformat2): commend out all that have with
8092 oldpapersize to do. also comment out all that hve to do with
8093 insetlatex and insetlatexdel.
8094 (setOldPaperStuff): commented out
8096 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8098 * src/LyXAction.C: remove use of inset-latex-insert
8100 * src/mathed/math_panel.C (button_cb): use static_cast
8102 * src/insets/Makefile.am (insets_o_SOURCES): removed
8105 * src/support/lyxstring.C (helper): use the unsigned long
8106 specifier, UL, instead of a static_cast.
8108 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8110 * src/support/block.h: new file. to be used as a c-style array in
8111 classes, so that the class can be assignable.
8113 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8116 NULL, make sure to return an empty string (it is not possible to
8117 set a string to NULL).
8119 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8121 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8123 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8125 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8126 link line, so that Irix users (for example) can set it explicitely to
8129 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8130 it can be overidden at make time (static or dynamic link, for
8133 * src/vc-backend.C, src/LaTeXFeatures.h,
8134 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8135 statements to bring templates to global namespace.
8137 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * src/support/lyxstring.C (operator[] const): make it standard
8142 * src/minibuffer.C (Init): changed to reflect that more
8143 information is given from the lyxvc and need not be provided here.
8145 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8147 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8149 * src/LyXView.C (UpdateTimerCB): use static_cast
8150 (KeyPressMask_raw_callback): ditto
8152 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8153 buffer_, a lot of changes because of this. currentBuffer() ->
8154 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8155 also changes to other files because of this.
8157 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8159 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8160 have no support for RCS and partial support for CVS, will be
8163 * src/insets/ several files: changes because of function name
8164 changes in Bufferview and LyXView.
8166 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8168 * src/support/LSubstring.[Ch]: new files. These implement a
8169 Substring that can be very convenient to use. i.e. is this
8171 string a = "Mary had a little sheep";
8172 Substring(a, "sheep") = "lamb";
8173 a is now "Mary has a little lamb".
8175 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8176 out patterns and subpatterns of strings. It is used by LSubstring
8177 and also by vc-backend.C
8179 * src/support/lyxstring.C: went over all the assertions used and
8180 tried to correct the wrong ones and flag which of them is required
8181 by the standard. some bugs found because of this. Also removed a
8182 couple of assertions.
8184 * src/support/Makefile.am (libsupport_a_SOURCES): added
8185 LSubstring.[Ch] and LRegex.[Ch]
8187 * src/support/FileInfo.h: have struct stat buf as an object and
8188 not a pointer to one, some changes because of this.
8190 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8191 information in layout when adding the layouts preamble to the
8194 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8197 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8198 because of bug in OS/2.
8200 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8202 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8203 \verbatim@font instead of \ttfamily, so that it can be redefined.
8205 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8206 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8207 src/layout.h, src/text2.C: add 'using' directive to bring the
8208 STL templates we need from the std:: namespace to the global one.
8209 Needed by DEC cxx in strict ansi mode.
8211 * src/support/LIstream.h,src/support/LOstream.h,
8212 src/support/lyxstring.h,src/table.h,
8213 src/lyxlookup.h: do not include <config.h> in header
8214 files. This should be done in the .C files only.
8216 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8220 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8222 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8223 from Kayvan to fix the tth invokation.
8225 * development/lyx.spec.in: updates from Kayvan to reflect the
8226 changes of file names.
8228 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8230 * src/text2.C (InsertStringB): use std::copy
8231 (InsertStringA): use std::copy
8233 * src/bufferlist.C: use a vector to store the buffers in. This is
8234 an internal change and should not affect any other thing.
8236 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8239 * src/text.C (Fill): fix potential bug, one off bug.
8241 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8243 * src/Makefile.am (lyx_main.o): add more files it depends on.
8245 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8247 * src/support/lyxstring.C: use size_t for the reference count,
8248 size, reserved memory and xtra.
8249 (internal_compare): new private member function. Now the compare
8250 functions should work for std::strings that have embedded '\0'
8252 (compare): all compare functions rewritten to use
8255 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8257 * src/support/lyxstring.C (compare): pass c_str()
8258 (compare): pass c_str
8259 (compare): pass c_str
8261 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8263 * src/support/DebugStream.C: <config.h> was not included correctly.
8265 * lib/configure: forgot to re-generate it :( I'll make this file
8266 auto generated soon.
8268 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8270 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8273 * src/support/lyxstring.C: some changes from length() to rep->sz.
8274 avoids a function call.
8276 * src/support/filetools.C (SpaceLess): yet another version of the
8277 algorithm...now per Jean-Marc's suggestions.
8279 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8281 * src/layout.C (less_textclass_desc): functor for use in sorting
8283 (LyXTextClass::Read): sort the textclasses after reading.
8285 * src/support/filetools.C (SpaceLess): new version of the
8286 SpaceLess functions. What problems does this one give? Please
8289 * images/banner_bw.xbm: made the arrays unsigned char *
8291 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8293 * src/support/lyxstring.C (find): remove bogus assertion in the
8294 two versions of find where this has not been done yet.
8296 * src/support/lyxlib.h: add missing int return type to
8299 * src/menus.C (ShowFileMenu): disable exporting to html if no
8300 html export command is present.
8302 * config/lib_configure.m4: add a test for an HTML converter. The
8303 programs checked for are, in this order: tth, latex2html and
8306 * lib/configure: generated from config/lib_configure.m4.
8308 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8309 html converter. The parameters are now passed through $$FName and
8310 $$OutName, instead of standard input/output.
8312 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8314 * lib/lyxrc.example: update description of \html_command.
8315 add "quotes" around \screen_font_xxx font setting examples to help
8316 people who use fonts with spaces in their names.
8318 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8320 * Distribution files: updates for v1.1.2
8322 * src/support/lyxstring.C (find): remove bogus assert and return
8323 npos for the same condition.
8325 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8327 * added patch for OS/2 from SMiyata.
8329 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * src/text2.C (CutSelection): make space_wrapped a bool
8332 (CutSelection): dont declare int i until we have to.
8333 (alphaCounter): return a char const *.
8335 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8337 * src/support/syscall.C (Systemcalls::kill):
8338 src/support/filetools.C (PutEnv, PutEnvPath):
8339 src/lyx_cb.C (addNewlineAndDepth):
8340 src/FontInfo.C (FontInfo::resize): condition some #warning
8341 directives with WITH_WARNINGS.
8344 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * src/layout.[Ch] + several files: access to class variables
8347 limited and made accessor functions instead a lot of code changed
8348 becuase of this. Also instead of returning pointers often a const
8349 reference is returned instead.
8351 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8353 * src/Makefile.am (dist-hook): added used to remove the CVS from
8354 cheaders upon creating a dist
8355 (EXTRA_DIST): added cheaders
8357 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8358 a character not as a small integer.
8360 * src/support/lyxstring.C (find): removed Assert and added i >=
8361 rep->sz to the first if.
8363 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8365 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8366 src/LyXView.C src/buffer.C src/bufferparams.C
8367 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8368 src/text2.C src/insets/insetinclude.C:
8369 lyxlayout renamed to textclasslist.
8371 * src/layout.C: some lyxerr changes.
8373 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8374 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8375 (LyXLayoutList): removed all traces of this class.
8376 (LyXTextClass::Read): rewrote LT_STYLE
8377 (LyXTextClass::hasLayout): new function
8378 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8379 both const and nonconst version.
8380 (LyXTextClass::delete_layout): new function.
8381 (LyXTextClassList::Style): bug fix. do the right thing if layout
8383 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8384 (LyXTextClassList::NameOfLayout): ditto
8385 (LyXTextClassList::Load): ditto
8387 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8389 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8391 * src/LyXAction.C (LookupFunc): added a workaround for sun
8392 compiler, on the other hand...we don't know if the current code
8393 compiles on sun at all...
8395 * src/support/filetools.C (CleanupPath): subst fix
8397 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8400 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8401 complained about this one?
8403 * src/insets/insetinclude.C (Latex): subst fix
8405 * src/insets/insetbib.C (getKeys): subst fix
8407 * src/LyXSendto.C (SendtoApplyCB): subst fix
8409 * src/lyx_main.C (init): subst fix
8411 * src/layout.C (Read): subst fix
8413 * src/lyx_sendfax_main.C (button_send): subst fix
8415 * src/buffer.C (RoffAsciiTable): subst fix
8417 * src/lyx_cb.C (MenuFax): subst fix
8418 (PrintApplyCB): subst fix
8420 1999-10-26 Juergen Vigna <jug@sad.it>
8422 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8424 (Read): Cleaned up this code so now we read only format vestion >= 5
8426 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8428 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8429 come nobody has complained about this one?
8431 * src/insets/insetinclude.C (Latex): subst fix
8433 * src/insets/insetbib.C (getKeys): subst fix
8435 * src/lyx_main.C (init): subst fix
8437 * src/layout.C (Read): subst fix
8439 * src/buffer.C (RoffAsciiTable): subst fix
8441 * src/lyx_cb.C (MenuFax): subst fix.
8443 * src/layout.[hC] + some other files: rewrote to use
8444 std::container to store textclasses and layouts in.
8445 Simplified, removed a lot of code. Make all classes
8446 assignable. Further simplifications and review of type
8447 use still to be one.
8449 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8450 lastfiles to create the lastfiles partr of the menu.
8452 * src/lastfiles.[Ch]: rewritten to use deque to store the
8453 lastfiles in. Uses fstream for reading and writing. Simplifies
8456 * src/support/syscall.C: remove explicit cast.
8458 * src/BufferView.C (CursorToggleCB): removed code snippets that
8460 use explicat C++ style casts instead of C style casts. also use
8461 u_vdata instea of passing pointers in longs.
8463 * src/PaperLayout.C: removed code snippets that were commented out.
8465 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8467 * src/lyx_main.C: removed code snippets that wer commented out.
8469 * src/paragraph.C: removed code snippets that were commented out.
8471 * src/lyxvc.C (logClose): use static_cast
8473 (viewLog): remove explicit cast to void*
8474 (showLog): removed old commented code
8476 * src/menus.C: use static_cast instead of C style casts. use
8477 u_vdata instead of u_ldata. remove explicit cast to (long) for
8478 pointers. Removed old code that was commented out.
8480 * src/insets/inset.C: removed old commented func
8482 * src/insets/insetref.C (InsetRef): removed old code that had been
8483 commented out for a long time.
8485 (escape): removed C style cast
8487 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8489 * src/insets/insetlatex.C (Draw): removed old commented code
8490 (Read): rewritten to use string
8492 * src/insets/insetlabel.C (escape): removed C style cast
8494 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8496 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8499 * src/insets/insetinclude.h: removed a couple of stupid bools
8501 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8502 (Clone): remove C style cast
8503 (getKeys): changed list to lst because of std::list
8505 * src/insets/inseterror.C (Draw): removed som old commented code.
8507 * src/insets/insetcommand.C (Draw): removed some old commented code.
8509 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8510 commented out forever.
8511 (bibitem_cb): use static_cast instead of C style cast
8512 use of vdata changed to u_vdata.
8514 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8516 (CloseUrlCB): use static_cast instead of C style cast.
8517 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8519 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8520 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8521 (CloseInfoCB): static_cast from ob->u_vdata instead.
8522 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8525 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8526 (C_InsetError_CloseErrorCB): forward the ob parameter
8527 (CloseErrorCB): static_cast from ob->u_vdata instead.
8529 * src/vspace.h: include LString.h since we use string in this class.
8531 * src/vspace.C (lyx_advance): changed name from advance because of
8532 nameclash with stl. And since we cannot use namespaces yet...I
8533 used a lyx_ prefix instead. Expect this to change when we begin
8536 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8538 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8539 and removed now defunct constructor and deconstructor.
8541 * src/BufferView.h: have backstack as a object not as a pointer.
8542 removed initialization from constructor. added include for BackStack
8544 * development/lyx.spec.in (%build): add CFLAGS also.
8546 * src/screen.C (drawFrame): removed another warning.
8548 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8550 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8551 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8552 README and ANNOUNCE a bit for the next release. More work is
8555 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8556 unbreakable if we are in freespacing mode (LyX-Code), but not in
8559 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * src/BackStack.h: fixed initialization order in constructor
8563 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8565 * acinclude.m4 (VERSION): new rules for when a version is
8566 development, added also a variable for prerelease.
8567 (warnings): we set with_warnings=yes for prereleases
8568 (lyx_opt): prereleases compile with same optimization as development
8569 (CXXFLAGS): only use pedantic if we are a development version
8571 * src/BufferView.C (restorePosition): don't do anything if the
8574 * src/BackStack.h: added member empty, use this to test if there
8575 is anything to pop...
8577 1999-10-25 Juergen Vigna <jug@sad.it>
8580 * forms/layout_forms.fd +
8581 * forms/latexoptions.fd +
8582 * lyx.fd: changed for various form resize issues
8584 * src/mathed/math_panel.C +
8585 * src/insets/inseterror.C +
8586 * src/insets/insetinfo.C +
8587 * src/insets/inseturl.C +
8588 * src/insets/inseturl.h +
8591 * src/PaperLayout.C +
8592 * src/ParagraphExtra.C +
8593 * src/TableLayout.C +
8595 * src/layout_forms.C +
8602 * src/menus.C: fixed various resize issues. So now forms can be
8603 resized savely or not be resized at all.
8605 * forms/form_url.fd +
8606 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8609 * src/insets/Makefile.am: added files form_url.[Ch]
8611 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8613 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8614 (and presumably 6.2).
8616 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8617 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8618 remaining static member callbacks.
8620 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8623 * src/support/lyxstring.h: declare struct Srep as friend of
8624 lyxstring, since DEC cxx complains otherwise.
8626 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8628 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8630 * src/LaTeX.C (run): made run_bibtex also depend on files with
8632 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8633 are put into the dependency file.
8635 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8636 the code has shown itself to work
8637 (create_ispell_pipe): removed another warning, added a comment
8640 * src/minibuffer.C (ExecutingCB): removed code that has been
8641 commented out a long time
8643 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8644 out code + a warning.
8646 * src/support/lyxstring.h: comment out the three private
8647 operators, when compiling with string ansi conforming compilers
8650 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8652 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8653 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8656 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8659 * src/mathed/math_panel.C (create_math_panel): remove explicit
8662 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8665 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8666 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8667 to XCreatePixmapFromBitmapData
8668 (fl_set_bmtable_data): change the last argument to be unsigned
8670 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8671 and bh to be unsigned int, remove explicit casts in call to
8672 XReadBitmapFileData.
8674 * images/arrows.xbm: made the arrays unsigned char *
8675 * images/varsz.xbm: ditto
8676 * images/misc.xbm: ditto
8677 * images/greek.xbm: ditto
8678 * images/dots.xbm: ditto
8679 * images/brel.xbm: ditto
8680 * images/bop.xbm: ditto
8682 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8684 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8685 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8686 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8688 (LYX_CXX_CHEADERS): added <clocale> to the test.
8690 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8694 * src/support/lyxstring.C (append): fixed something that must be a
8695 bug, rep->assign was used instead of rep->append.
8697 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8700 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8701 lyx insert double chars. Fix spotted by Kayvan.
8703 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8705 * Fixed the tth support. I messed up with the Emacs patch apply feature
8706 and omitted the changes in lyxrc.C.
8708 1999-10-22 Juergen Vigna <jug@sad.it>
8710 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8712 * src/lyx_cb.C (MenuInsertRef) +
8713 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8714 the form cannot be resized under it limits (fixes a segfault)
8716 * src/lyx.C (create_form_form_ref) +
8717 * forms/lyx.fd: Changed Gravity on name input field so that it is
8720 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8722 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8723 <ostream> and <istream>.
8725 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8726 whether <fstream> provides the latest standard features, or if we
8727 have an oldstyle library (like in egcs).
8728 (LYX_CXX_STL_STRING): fix the test.
8730 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8731 code on MODERN_STL_STREAM.
8733 * src/support/lyxstring.h: use L{I,O}stream.h.
8735 * src/support/L{I,O}stream.h: new files, designed to setup
8736 correctly streams for our use
8737 - includes the right header depending on STL capabilities
8738 - puts std::ostream and std::endl (for LOStream.h) or
8739 std::istream (LIStream.h) in toplevel namespace.
8741 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8743 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8744 was a bib file that had been changed we ensure that bibtex is run.
8745 (runBibTeX): enhanced to extract the names of the bib files and
8746 getting their absolute path and enter them into the dep file.
8747 (findtexfile): static func that is used to look for tex-files,
8748 checks for absolute patchs and tries also with kpsewhich.
8749 Alternative ways of finding the correct files are wanted. Will
8751 (do_popen): function that runs a command using popen and returns
8752 the whole output of that command in a string. Should be moved to
8755 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8756 file with extension ext has changed.
8758 * src/insets/figinset.C: added ifdef guards around the fl_free
8759 code that jug commented out. Now it is commented out when
8760 compiling with XForms == 0.89.
8762 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8763 to lyxstring.C, and only keep a forward declaration in
8764 lyxstring.h. Simplifies the header file a bit and should help a
8765 bit on compile time too. Also changes to Srep will not mandate a
8766 recompile of code just using string.
8767 (~lyxstring): definition moved here since it uses srep.
8768 (size): definition moved here since it uses srep.
8770 * src/support/lyxstring.h: removed a couple of "inline" that should
8773 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8775 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8778 1999-10-21 Juergen Vigna <jug@sad.it>
8780 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8781 set to left if I just remove the width entry (or it is empty).
8783 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8784 paragraph when having dummy paragraphs.
8786 1999-10-20 Juergen Vigna <jug@sad.it>
8788 * src/insets/figinset.C: just commented some fl_free_form calls
8789 and added warnings so that this calls should be activated later
8790 again. This avoids for now a segfault, but we have a memory leak!
8792 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8793 'const char * argument' to 'string argument', this should
8794 fix some Asserts() in lyxstring.C.
8796 * src/lyxfunc.h: Removed the function argAsString(const char *)
8797 as it is not used anymore.
8799 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8804 * src/Literate.h: some funcs moved from public to private to make
8805 interface clearer. Unneeded args removed.
8807 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8809 (scanBuildLogFile): ditto
8811 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8812 normal TeX Error. Still room for improvement.
8814 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8816 * src/buffer.C (insertErrors): changes to make the error
8817 desctription show properly.
8819 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8822 * src/support/lyxstring.C (helper): changed to use
8823 sizeof(object->rep->ref).
8824 (operator>>): changed to use a pointer instead.
8826 * src/support/lyxstring.h: changed const reference & to value_type
8827 const & lets see if that helps.
8829 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * Makefile.am (rpmdist): fixed to have non static package and
8834 * src/support/lyxstring.C: removed the compilation guards
8836 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8839 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8840 conditional compile of lyxstring.Ch
8842 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8843 stupid check, but it is a lot better than the bastring hack.
8844 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8846 * several files: changed string::erase into string::clear. Not
8849 * src/chset.C (encodeString): use a char temporary instead
8851 * src/table.C (TexEndOfCell): added tostr around
8852 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8853 (TexEndOfCell): ditto
8854 (TexEndOfCell): ditto
8855 (TexEndOfCell): ditto
8856 (DocBookEndOfCell): ditto
8857 (DocBookEndOfCell): ditto
8858 (DocBookEndOfCell): ditto
8859 (DocBookEndOfCell): ditto
8861 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8863 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8865 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8866 (MenuBuildProg): added tostr around ret
8867 (MenuRunChktex): added tostr around ret
8868 (DocumentApplyCB): added tostr around ret
8870 * src/chset.C (encodeString): added tostr around t->ic
8872 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8873 (makeLaTeXFile): added tostr around tocdepth
8874 (makeLaTeXFile): added tostr around ftcound - 1
8876 * src/insets/insetbib.C (setCounter): added tostr around counter.
8878 * src/support/lyxstring.h: added an operator+=(int) to catch more
8881 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8882 (lyxstring): We DON'T allow NULL pointers.
8884 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8886 * src/mathed/math_macro.C (MathMacroArgument::Write,
8887 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8888 when writing them out.
8890 * src/LString.C: remove, since it is not used anymore.
8892 * src/support/lyxstring.C: condition the content to
8893 USE_INCLUDED_STRING macro.
8895 * src/mathed/math_symbols.C, src/support/lstrings.C,
8896 src/support/lyxstring.C: add `using' directive to specify what
8897 we need in <algorithm>. I do not think that we need to
8898 conditionalize this, but any thought is appreciated.
8900 * many files: change all callback functions to "C" linkage
8901 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8902 strict_ansi. Those who were static are now global.
8903 The case of callbacks which are static class members is
8904 trickier, since we have to make C wrappers around them (see
8905 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8906 did not finish this yet, since it defeats the purpose of
8907 encapsulation, and I am not sure what the best route is.
8909 1999-10-19 Juergen Vigna <jug@sad.it>
8911 * src/support/lyxstring.C (lyxstring): we permit to have a null
8912 pointer as assignment value and just don't assign it.
8914 * src/vspace.C (nextToken): corrected this function substituting
8915 find_first(_not)_of with find_last_of.
8917 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8918 (TableOptCloseCB) (TableSpeCloseCB):
8919 inserted fl_set_focus call for problem with fl_hide_form() in
8922 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8924 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8927 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8929 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8930 LyXLex::next() and not eatline() to get its argument.
8932 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8934 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8935 instead, use fstreams for io of the depfile, removed unneeded
8936 functions and variables.
8938 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8939 vector instead, removed all functions and variables that is not in
8942 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/buffer.C (insertErrors): use new interface to TeXError
8946 * Makefile.am (rpmdist): added a rpmdist target
8948 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8949 per Kayvan's instructions.
8951 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8953 * src/Makefile.am: add a definition for localedir, so that locales
8954 are found after installation (Kayvan)
8956 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8958 * development/.cvsignore: new file.
8960 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8962 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8963 C++ compiler provides wrappers for C headers and use our alternate
8966 * configure.in: use LYX_CXX_CHEADERS.
8968 * src/cheader/: new directory, populated with cname headers from
8969 libstdc++-2.8.1. They are a bit old, but probably good enough for
8970 what we want (support compilers who lack them).
8972 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8973 from includes. It turns out is was stupid.
8975 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8977 * lib/Makefile.am (install-data-local): forgot a ';'
8978 (install-data-local): forgot a '\'
8979 (libinstalldirs): needed after all. reintroduced.
8981 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * configure.in (AC_OUTPUT): added lyx.spec
8985 * development/lyx.spec: removed file
8987 * development/lyx.spec.in: new file
8989 * po/*.po: merged with lyx.pot becuase of make distcheck
8991 * lib/Makefile.am (dist-hook): added dist-hook so that
8992 documentation files will be included when doing a make
8993 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8994 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8996 more: tried to make install do the right thing, exclude CVS dirs
8999 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9000 Path would fit in more nicely.
9002 * all files that used to use pathstack: uses now Path instead.
9003 This change was a lot easier than expected.
9005 * src/support/path.h: new file
9007 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9009 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9011 * src/support/lyxstring.C (getline): Default arg was given for
9014 * Configure.cmd: removed file
9016 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9018 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9019 streams classes and types, add the proper 'using' statements when
9020 MODERN_STL is defined.
9022 * src/debug.h: move the << operator definition after the inclusion
9025 * src/support/filetools.C: include "LAssert.h", which is needed
9028 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9031 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9032 include "debug.h" to define a proper ostream.
9034 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9036 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9037 method to the SystemCall class which can kill a process, but it's
9038 not fully implemented yet.
9040 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9042 * src/support/FileInfo.h: Better documentation
9044 * src/lyxfunc.C: Added support for buffer-export html
9046 * src/menus.C: Added Export->As HTML...
9048 * lib/bind/*.bind: Added short-cut for buffer-export html
9050 * src/lyxrc.*: Added support for new \tth_command
9052 * lib/lyxrc.example: Added stuff for new \tth_command
9054 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9056 * lib/Makefile.am (IMAGES): removed images/README
9057 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9058 installes in correct place. Check permisions is installed
9061 * src/LaTeX.C: some no-op changes moved declaration of some
9064 * src/LaTeX.h (LATEX_H): changed include guard name
9066 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9068 * lib/reLyX/Makefile.am: install noweb2lyx.
9070 * lib/Makefile.am: install configure.
9072 * lib/reLyX/configure.in: declare a config aux dir; set package
9073 name to lyx (not sure what the best solution is); generate noweb2lyx.
9075 * lib/layouts/egs.layout: fix the bibliography layout.
9077 1999-10-08 Jürgen Vigna <jug@sad.it>
9079 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9080 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9081 it returned without continuing to search the path.
9083 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9085 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9086 also fixes a bug. It is not allowed to do tricks with std::strings
9087 like: string a("hei"); &a[e]; this will not give what you
9088 think... Any reason for the complexity in this func?
9090 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9092 * Updated README and INSTALL a bit, mostly to check that my
9093 CVS rights are correctly set up.
9095 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9097 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9098 does not allow '\0' chars but lyxstring and std::string does.
9100 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * autogen.sh (AUTOCONF): let the autogen script create the
9103 POTFILES.in file too. POTFILES.in should perhaps now not be
9104 included in the cvs module.
9106 * some more files changed to use C++ includes instead of C ones.
9108 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9110 (Reread): added tostr to nlink. buggy output otherwise.
9111 (Reread): added a string() around szMode when assigning to Buffer,
9112 without this I got a log of garbled info strings.
9114 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9117 * I have added several ostream & operator<<(ostream &, some_type)
9118 functions. This has been done to avoid casting and warnings when
9119 outputting enums to lyxerr. This as thus eliminated a lot of
9120 explicit casts and has made the code clearer. Among the enums
9121 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9122 mathed enums, some font enum the Debug::type enum.
9124 * src/support/lyxstring.h (clear): missing method. equivalent of
9127 * all files that contained "stderr": rewrote constructs that used
9128 stderr to use lyxerr instead. (except bmtable)
9130 * src/support/DebugStream.h (level): and the passed t with
9131 Debug::ANY to avoid spurious bits set.
9133 * src/debug.h (Debug::type value): made it accept strings of the
9136 * configure.in (Check for programs): Added a check for kpsewhich,
9137 the latex generation will use this later to better the dicovery of
9140 * src/BufferView.C (create_view): we don't need to cast this to
9141 (void*) that is done automatically.
9142 (WorkAreaButtonPress): removed some dead code.
9144 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9146 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9147 is not overwritten when translated (David Sua'rez de Lis).
9149 * lib/CREDITS: Added David Sua'rez de Lis
9151 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9153 * src/bufferparams.C (BufferParams): default input encoding is now
9156 * acinclude.m4 (cross_compiling): comment out macro
9157 LYX_GXX_STRENGTH_REDUCE.
9159 * acconfig.h: make sure that const is not defined (to empty) when
9160 we are compiling C++. Remove commented out code using SIZEOF_xx
9163 * configure.in : move the test for const and inline as late as
9164 possible so that these C tests do not interefere with C++ ones.
9165 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9166 has not been proven.
9168 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9170 * src/table.C (getDocBookAlign): remove bad default value for
9173 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9175 (ShowFileMenu2): ditto.
9177 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9180 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9182 * Most files: finished the change from the old error code to use
9183 DebugStream for all lyxerr debugging. Only minor changes remain
9184 (e.g. the setting of debug levels using strings instead of number)
9186 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9188 * src/layout.C (Add): Changed to use compare_no_case instead of
9191 * src/FontInfo.C: changed loop variable type too string::size_type.
9193 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9195 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9196 set ETAGS_ARGS to --c++
9198 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/table.C (DocBookEndOfCell): commented out two unused variables
9202 * src/paragraph.C: commented out four unused variables.
9204 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9205 insed a if clause with type string::size_type.
9207 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9210 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9212 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9213 variable, also changed loop to go from 0 to lenght + 1, instead of
9214 -1 to length. This should be correct.
9216 * src/LaTeX.C (scanError): use string::size_type as loop variable
9219 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9220 (l.896) since y_tmp and row was not used anyway.
9222 * src/insets/insetref.C (escape): use string::size_type as loop
9225 * src/insets/insetquotes.C (Width): use string::size_type as loop
9227 (Draw): use string::size_type as loop variable type.
9229 * src/insets/insetlatexaccent.C (checkContents): use
9230 string::size_type as loop variable type.
9232 * src/insets/insetlabel.C (escape): use string::size_type as loop
9235 * src/insets/insetinfo.C: added an extern for current_view.
9237 * src/insets/insetcommand.C (scanCommand): use string::size_type
9238 as loop variable type.
9240 * most files: removed the RCS tags. With them we had to recompile
9241 a lot of files after a simple cvs commit. Also we have never used
9242 them for anything meaningful.
9244 * most files: tags-query-replace NULL 0. As adviced several plases
9245 we now use "0" instead of "NULL" in our code.
9247 * src/support/filetools.C (SpaceLess): use string::size_type as
9250 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9252 * src/paragraph.C: fixed up some more string stuff.
9254 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9256 * src/support/filetools.h: make modestr a std::string.
9258 * src/filetools.C (GetEnv): made ch really const.
9260 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9261 made code that used these use max/min from <algorithm> instead.
9263 * changed several c library include files to their equivalent c++
9264 library include files. All is not changed yet.
9266 * created a support subdir in src, put lyxstring and lstrings
9267 there + the extra files atexit, fileblock, strerror. Created
9268 Makefile.am. edited configure.in and src/Makefile.am to use this
9269 new subdir. More files moved to support.
9271 * imported som of the functions from repository lyx, filetools
9273 * ran tags-query-replace on LString -> string, corrected the bogus
9274 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9275 is still some errors in there. This is errors where too much or
9276 too litle get deleted from strings (string::erase, string::substr,
9277 string::replace), there can also be some off by one errors, or
9278 just plain wrong use of functions from lstrings. Viewing of quotes
9281 * LyX is now running fairly well with string, but there are
9282 certainly some bugs yet (see above) also string is quite different
9283 from LString among others in that it does not allow null pointers
9284 passed in and will abort if it gets any.
9286 * Added the revtex4 files I forgot when setting up the repository.
9288 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9290 * All over: Tried to clean everything up so that only the files
9291 that we really need are included in the cvs repository.
9292 * Switched to use automake.
9293 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9294 * Install has not been checked.
9296 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9298 * po/pt.po: Three errors:
9299 l.533 and l.538 format specification error
9300 l. 402 duplicate entry, I just deleted it.