1 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4 so that code compiles with DEC cxx.
6 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
7 to work correctly! Also now supports the additional elements
10 2000-09-01 Allan Rae <rae@lyx.org>
12 * src/frontends/ButtonPolicies.C: renamed all the references to
13 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
15 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
16 since it's a const not a type.
18 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
20 2000-08-31 Juergen Vigna <jug@sad.it>
22 * src/insets/figinset.C: Various changes to look if the filename has
23 an extension and if not add it for inline previewing.
25 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
27 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
28 make buttonStatus and isReadOnly be const methods. (also reflect
29 this in derived classes.)
31 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
32 (nextState): change to be static inline, pass the StateMachine as
34 (PreferencesPolicy): remove casts
35 (OkCancelPolicy): remvoe casts
36 (OkCancelReadOnlyPolicy): remove casts
37 (NoRepeatedApplyReadOnlyPolicy): remove casts
38 (OkApplyCancelReadOnlyPolicy): remove casts
39 (OkApplyCancelPolicy): remove casts
40 (NoRepeatedApplyPolicy): remove casts
42 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
44 * src/converter.C: added some using directives
46 * src/frontends/ButtonPolicies.C: changes to overcome
47 "need lvalue" error with DEC c++
49 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
50 to WMHideCB for DEC c++
52 * src/frontends/xforms/Menubar_pimpl.C: added using directive
54 * src/frontends/xforms/forms/form_document.C.patch: use C callback
55 to BulletBMTableCB for DEC c++
57 2000-08-31 Allan Rae <rae@lyx.org>
59 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
60 character dialog separately from old document dialogs combo_language.
63 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
65 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
66 Removed LFUN_REF_CREATE.
68 * src/MenuBackend.C: Added new tags: toc and references
70 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
71 (add_lastfiles, add_documents, add_formats): Removed the unused smn
73 (add_toc, add_references): New methods.
74 (create_submenu): Handle correctly the case when there is a
75 seperator after optional menu items.
77 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
78 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
79 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
81 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
83 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
85 * src/converter.[Ch]: New file for converting between different
88 * src/export.[Ch]: New file for exporting a LyX file to different
91 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
92 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
93 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
94 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
95 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
96 RunDocBook, MenuExport.
98 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
99 Exporter::Preview methods if NEW_EXPORT is defined.
101 * src/buffer.C (Dispatch): Use Exporter::Export.
103 * src/lyxrc.C: Added new tags: \converter and \viewer.
106 * src/LyXAction.C: Define new lyx-function: buffer-update.
107 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
108 when NEW_EXPORT is defined.
110 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
112 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
114 * lib/ui/default.ui: Added submenus "view" and "update" to the
117 * src/filetools.C (GetExtension): New function.
119 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
121 2000-08-29 Allan Rae <rae@lyx.org>
123 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
125 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
126 (EnableDocumentLayout): removed
127 (DisableDocumentLayout): removed
128 (build): make use of ButtonController's read-only handling to
129 de/activate various objects. Replaces both of the above functions.
131 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
132 (readOnly): was read_only
133 (refresh): fixed dumb mistakes with read_only_ handling
135 * src/frontends/xforms/forms/form_document.fd:
136 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
137 tabbed dialogs so the tabs look more like tabs and so its easier to
138 work out which is the current tab.
140 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
141 segfault with form_table
143 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
145 2000-08-28 Juergen Vigna <jug@sad.it>
147 * acconfig.h: added USE_PSPELL.
149 * src/config.h.in: added USE_PSPELL.
151 * autogen.sh: added pspell.m4
153 * config/pspell.m4: new file.
155 * src/spellchecker.C: implemented support for pspell libary.
157 2000-08-25 Juergen Vigna <jug@sad.it>
159 * src/LyXAction.C (init): renamed LFUN_TABLE to
160 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
162 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
164 * src/lyxscreen.h: add force_clear variable and fuction to force
165 a clear area when redrawing in LyXText.
167 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
169 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
171 * some whitespace and comment changes.
173 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
175 * src/buffer.C: up te LYX_FORMAT to 2.17
177 2000-08-23 Juergen Vigna <jug@sad.it>
179 * src/BufferView_pimpl.C (tripleClick): disable this when in a
182 * src/insets/insettabular.C (pasteSelection): delete the insets
183 LyXText as it is not valid anymore.
184 (copySelection): new function.
185 (pasteSelection): new function.
186 (cutSelection): new function.
187 (LocalDispatch): implemented cut/copy/paste of cell selections.
189 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
190 don't have a LyXText.
192 * src/LyXAction.C (init): a NEW_TABULAR define too much.
194 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
197 2000-08-22 Juergen Vigna <jug@sad.it>
199 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
200 ifdef form_table out if NEW_TABULAR.
202 2000-08-21 Juergen Vigna <jug@sad.it>
204 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
205 (draw): fixed draw position so that the cursor is positioned in the
207 (InsetMotionNotify): hide/show cursor so the position is updated.
208 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
209 using cellstart() function where it should be used.
211 * src/insets/insettext.C (draw): ditto.
213 * src/tabular.C: fixed initialization of some missing variables and
214 made BoxType into an enum.
216 2000-08-22 Marko Vendelin <markov@ioc.ee>
217 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
218 stock menu item using action numerical value, not its string
222 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
224 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
225 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
227 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
229 * src/frontends/xforms/GUIRunTime.C: new file
231 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
232 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
234 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
236 * src/frontends/kde/GUIRunTime.C: new file
238 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
239 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
241 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
243 * src/frontends/gnome/GUIRunTime.C: new file
245 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
248 * src/frontends/GUIRunTime.h: removed constructor and destructor,
249 small change to documetentation.
251 * src/frontends/GUIRunTime.C: removed file
253 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
255 * src/lyxparagraph.h: enable NEW_TABULAR as default
257 * src/lyxfunc.C (processKeySym): remove some commented code
259 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
260 NEW_TABULAR around the fd_form_table_options.
262 * src/lyx_gui.C (runTime): call the static member function as
263 GUIRunTime::runTime().
265 2000-08-21 Allan Rae <rae@lyx.org>
267 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
270 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
272 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
274 2000-08-21 Allan Rae <rae@lyx.org>
276 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
278 * src/frontends/xforms/FormPreferences.C (build): use setOK
279 * src/frontends/xforms/FormDocument.C (build): use setOK
280 (FormDocument): use the appropriate policy.
282 2000-08-21 Allan Rae <rae@lyx.org>
284 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
285 automatic [de]activation of arbitrary objects when in a read-only state.
287 * src/frontends/ButtonPolicies.h: More documentation
288 (isReadOnly): added to support the above.
290 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
292 2000-08-18 Juergen Vigna <jug@sad.it>
294 * src/insets/insettabular.C (getStatus): changed to return func_status.
296 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
297 display toggle menu entries if they are.
299 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
300 new document layout now.
302 * src/lyxfunc.C: ditto
304 * src/lyx_gui_misc.C: ditto
306 * src/lyx_gui.C: ditto
308 * lib/ui/default.ui: removed paper and quotes layout as they are now
309 all in the document layout tabbed folder.
311 * src/frontends/xforms/forms/form_document.fd: added Restore
312 button and callbacks for all inputs for Allan's ButtonPolicy.
314 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
315 (CheckChoiceClass): added missing params setting on class change.
316 (UpdateLayoutDocument): added for updating the layout on params.
317 (build): forgot to RETURN_ALWAYS input_doc_spacing.
318 (FormDocument): Implemented Allan's ButtonPolicy with the
321 2000-08-17 Allan Rae <rae@lyx.org>
323 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
324 so we can at least see the credits again.
326 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
327 controller calls for the appropriate callbacks. Note that since Ok
328 calls apply followed by cancel, and apply isn't a valid input for the
329 APPLIED state, the bc_ calls have to be made in the static callback not
330 within each of the real callbacks.
332 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
333 (setOk): renamed from setOkay()
335 2000-08-17 Juergen Vigna <jug@sad.it>
337 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
338 in the implementation part.
339 (composeUIInfo): don't show optional menu-items.
341 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
343 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
345 * src/bufferview_funcs.C (CurrentState): fixed to show also the
346 text-state when in a text-inset.
348 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
350 2000-08-17 Marko Vendelin <markov@ioc.ee>
351 * src/frontends/gnome/FormIndex.C
352 * src/frontends/gnome/FormIndex.h
353 * src/frontends/gnome/FormToc.C
354 * src/frontends/gnome/FormToc.h
355 * src/frontends/gnome/dialogs
356 * src/frontends/gnome/diatoc_callbacks.c
357 * src/frontends/gnome/diatoc_callbacks.h
358 * src/frontends/gnome/diainsertindex_callbacks.h
359 * src/frontends/gnome/diainsertindex_callbacks.c
360 * src/frontends/gnome/diainsertindex_interface.c
361 * src/frontends/gnome/diainsertindex_interface.h
362 * src/frontends/gnome/diatoc_interface.h
363 * src/frontends/gnome/diatoc_interface.c
364 * src/frontends/gnome/Makefile.am: Table of Contents and
365 Insert Index dialogs implementation for Gnome frontend
367 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
369 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
371 * src/frontends/gnome/diainserturl_interface.c: make the dialog
374 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
376 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
377 destructor. Don't definde if you don't need it
378 (processEvents): made static, non-blocking events processing for
380 (runTime): static method. event loop for xforms
381 * similar as above for kde and gnome.
383 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
385 (runTime): new method calss the real frontends runtime func.
387 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
389 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
391 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
393 2000-08-16 Juergen Vigna <jug@sad.it>
395 * src/lyx_gui.C (runTime): added GUII RunTime support.
397 * src/frontends/Makefile.am:
398 * src/frontends/GUIRunTime.[Ch]:
399 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
400 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
401 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
403 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
405 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
406 as this is already set in ${FRONTEND_INCLUDE} if needed.
408 * configure.in (CPPFLAGS): setting the include dir for the frontend
409 directory and don't set FRONTEND=xforms for now as this is executed
412 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
414 * src/frontends/kde/Makefile.am:
415 * src/frontends/kde/FormUrl.C:
416 * src/frontends/kde/FormUrl.h:
417 * src/frontends/kde/formurldialog.h:
418 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
420 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
422 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
424 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
426 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
429 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
431 * src/WorkArea.C (work_area_handler): more work to get te
432 FL_KEYBOARD to work with xforms 0.88 too, please test.
434 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
436 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
438 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
441 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
443 * src/Timeout.h: remove Qt::emit hack.
445 * several files: changes to allo doc++ compilation
447 * src/lyxfunc.C (processKeySym): new method
448 (processKeyEvent): comment out if FL_REVISION < 89
450 * src/WorkArea.C: change some debugging levels.
451 (WorkArea): set wantkey to FL_KEY_ALL
452 (work_area_handler): enable the FL_KEYBOARD clause, this enables
453 clearer code and the use of compose with XForms 0.89. Change to
454 use signals instead of calling methods in bufferview directly.
456 * src/Painter.C: change some debugging levels.
458 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
461 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
462 (workAreaKeyPress): new method
464 2000-08-14 Juergen Vigna <jug@sad.it>
466 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
468 * config/kde.m4: addes some features
470 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
471 include missing xforms dialogs.
473 * src/Timeout.h: a hack to be able to compile with qt/kde.
475 * sigc++/.cvsignore: added acinclude.m4
477 * lib/.cvsignore: added listerros
479 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
480 xforms tree as objects are needed for other frontends.
482 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
483 linking with not yet implemented xforms objects.
485 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
487 2000-08-14 Baruch Even <baruch.even@writeme.com>
489 * src/frontends/xforms/FormGraphics.h:
490 * src/frontends/xforms/FormGraphics.C:
491 * src/frontends/xforms/RadioButtonGroup.h:
492 * src/frontends/xforms/RadioButtonGroup.C:
493 * src/insets/insetgraphics.h:
494 * src/insets/insetgraphics.C:
495 * src/insets/insetgraphicsParams.h:
496 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
497 instead of spaces, and various other indentation issues to make the
498 sources more consistent.
500 2000-08-14 Marko Vendelin <markov@ioc.ee>
502 * src/frontends/gnome/dialogs/diaprint.glade
503 * src/frontends/gnome/FormPrint.C
504 * src/frontends/gnome/FormPrint.h
505 * src/frontends/gnome/diaprint_callbacks.c
506 * src/frontends/gnome/diaprint_callbacks.h
507 * src/frontends/gnome/diaprint_interface.c
508 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
511 * src/frontends/gnome/dialogs/diainserturl.glade
512 * src/frontends/gnome/FormUrl.C
513 * src/frontends/gnome/FormUrl.h
514 * src/frontends/gnome/diainserturl_callbacks.c
515 * src/frontends/gnome/diainserturl_callbacks.h
516 * src/frontends/gnome/diainserturl_interface.c
517 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
520 * src/frontends/gnome/Dialogs.C
521 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
522 all other dialogs. Copy all unimplemented dialogs from Xforms
525 * src/frontends/gnome/support.c
526 * src/frontends/gnome/support.h: support files generated by Glade
530 * config/gnome.m4: Gnome configuration scripts
532 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
533 configure --help message
535 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
536 only if there are no events pendling in Gnome/Gtk. This enhances
537 the performance of menus.
540 2000-08-14 Allan Rae <rae@lyx.org>
542 * lib/Makefile.am: listerrors cleaning
544 * lib/listerrors: removed -- generated file
545 * acinclude.m4: ditto
546 * sigc++/acinclude.m4: ditto
548 * src/frontends/xforms/forms/form_citation.fd:
549 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
552 * src/frontends/xforms/forms/makefile: I renamed the `install` target
553 `updatesrc` and now we have a `test` target that does what `updatesrc`
554 used to do. I didn't like having an install target that wasn't related
557 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
558 on all except FormGraphics. This may yet happen. Followed by a major
559 cleanup including using FL_TRANSIENT for most of the dialogs. More
560 changes to come when the ButtonController below is introduced.
562 * src/frontends/xforms/ButtonController.h: New file for managing up to
563 four buttons on a dialog according to an externally defined policy.
564 * src/frontends/xforms/Makefile.am: added above
566 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
567 Apply and Cancel/Close buttons and everything in between and beyond.
568 * src/frontends/Makefile.am: added above.
570 * src/frontends/xforms/forms/form_preferences.fd:
571 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
572 and removed variable 'status' as a result. Fixed the set_minsize thing.
573 Use the new screen-font-update after checking screen fonts were changed
574 Added a "Restore" button to restore the original lyxrc values while
575 editing. This restores everything not just the last input changed.
576 That's still a tricky one. As is the "LyX: this shouldn't happen..."
578 * src/LyXAction.C: screen-font-update added for updating buffers after
579 screen font settings have been changed.
580 * src/commandtags.h: ditto
581 * src/lyxfunc.C: ditto
583 * forms/lyx.fd: removed screen fonts dialog.
584 * src/lyx_gui.C: ditto
585 * src/menus.[Ch]: ditto
586 * src/lyx.[Ch]: ditto
587 * src/lyx_cb.C: ditto + code from here moved to make
588 screen-font-update. And people wonder why progress on GUII is
589 slow. Look at how scattered this stuff was! It takes forever
592 * forms/fdfix.sh: Fixup the spacing after commas.
593 * forms/makefile: Remove date from generated files. Fewer clashes now.
594 * forms/bullet_forms.C.patch: included someones handwritten changes
596 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
597 once I've discovered why LyXRC was made noncopyable.
598 * src/lyx_main.C: ditto
600 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
602 * src/frontends/xforms/forms/fdfix.sh:
603 * src/frontends/xforms/forms/fdfixh.sed:
604 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
605 * src/frontends/xforms/Form*.[hC]:
606 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
607 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
608 provide a destructor for the struct FD_form_xxxx. Another version of
609 the set_[max|min]size workaround and a few other cleanups. Actually,
610 Angus' patch from 20000809.
612 2000-08-13 Baruch Even <baruch.even@writeme.com>
614 * src/insets/insetgraphics.C (Clone): Added several fields that needed
617 2000-08-11 Juergen Vigna <jug@sad.it>
619 * src/insets/insetgraphics.C (InsetGraphics): changing init
620 order because of warnings.
622 * src/frontends/xforms/forms/makefile: adding patching .C with
625 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
626 from .C.patch to .c.patch
628 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
629 order because of warning.
631 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
633 * src/frontends/Liason.C (setMinibuffer): new helper function
635 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
637 * src/lyxfunc.C (Dispatch): calling new Document-Layout
639 * lib/ui/default.ui: commented out PaperLayout entry
641 * src/frontends/xforms/form_document.[Ch]: new added files
643 * src/frontends/xforms/FormDocument.[Ch]: ditto
645 * src/frontends/xforms/forms/form_document.fd: ditto
647 * src/frontends/xforms/forms/form_document.C.patch: ditto
649 2000-08-10 Juergen Vigna <jug@sad.it>
651 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
652 (InsetGraphics): initialized cacheHandle to 0.
653 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
655 2000-08-10 Baruch Even <baruch.even@writeme.com>
657 * src/graphics/GraphicsCache.h:
658 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
659 correctly as a cache.
661 * src/graphics/GraphicsCacheItem.h:
662 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
665 * src/graphics/GraphicsCacheItem_pimpl.h:
666 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
669 * src/insets/insetgraphics.h:
670 * src/insets/insetgraphics.C: Changed from using a signal notification
671 to polling when image is not loaded.
673 2000-08-10 Allan Rae <rae@lyx.org>
675 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
676 that there are two functions that have to been taken out of line by
677 hand and aren't taken care of in the script. (Just a reminder note)
679 * sigc++/macros/*.h.m4: Updated as above.
681 2000-08-09 Juergen Vigna <jug@sad.it>
683 * src/insets/insettext.C (draw): small fix for clearing rectangle.
685 * src/insets/insettabular.C: make drawing of single cell smarter.
687 2000-08-09 Marko Vendelin <markov@ioc.ee>
688 * src/frontends/gnome/Menubar_pimpl.C
689 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
690 implementation: new files
692 * src/frontends/gnome/mainapp.C
693 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
696 * src/main.C: create Gnome main window
698 * src/frontends/xforms/Menubar_pimpl.h
699 * src/frontends/Menubar.C
700 * src/frontends/Menubar.h: added method Menubar::update that calls
701 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
703 * src/LyXView.C: calls Menubar::update to update the state
706 * src/frontends/gnome/Makefile.am: added new files
708 * src/frontends/Makefile.am: added frontend compiler options
710 2000-08-08 Juergen Vigna <jug@sad.it>
712 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
714 * src/bufferlist.C (close):
715 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
716 documents if exiting without saving.
718 * src/buffer.C (save): use removeAutosaveFile()
720 * src/support/filetools.C (removeAutosaveFile): new function.
722 * src/lyx_cb.C (MenuWrite): returns a bool now.
723 (MenuWriteAs): check if file could really be saved and revert to the
725 (MenuWriteAs): removing old autosavefile if existant.
727 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
728 before Goto toggle declaration, because of compiler warning.
730 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
732 * src/lyxfunc.C (MenuNew): small fix.
734 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
736 * src/bufferlist.C (newFile):
737 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
739 * src/lyxrc.C: added new_ask_filename tag
741 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
743 * src/lyx.fd: removed code pertaining to form_ref
744 * src/lyx.[Ch]: ditto
745 * src/lyx_cb.C: ditto
746 * src/lyx_gui.C: ditto
747 * src/lyx_gui_misc.C: ditto
749 * src/BufferView_pimpl.C (restorePosition): update buffer only
752 * src/commandtags.h (LFUN_REFTOGGLE): removed
753 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
754 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
755 (LFUN_REFBACK): renamed LFUN_REF_BACK
757 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
759 * src/lyxfunc.C (Dispatch): ditto.
760 InsertRef dialog is now GUI-independent.
762 * src/texrow.C: added using std::endl;
764 * src/insets/insetref.[Ch]: strip out large amounts of code.
765 The inset is now a container and this functionality is now
766 managed by a new FormRef dialog
768 * src/frontends/Dialogs.h (showRef, createRef): new signals
770 * src/frontends/xforms/FormIndex.[Ch],
771 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
772 when setting dialog's min/max size
773 * src/frontends/xforms/FormIndex.[Ch]: ditto
775 * src/frontends/xforms/FormRef.[Ch],
776 src/frontends/xforms/forms/form_ref.fd: new xforms
777 implementation of an InsetRef dialog
779 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
782 * src/graphics/XPM_Renderer.C (isImageFormatOK):
783 ios::nocreate is not part of the standard. Removed.
785 2000-08-07 Baruch Even <baruch.even@writeme.com>
787 * src/graphics/Renderer.h:
788 * src/graphics/Renderer.C: Added base class for rendering of different
789 image formats into Pixmaps.
791 * src/graphics/XPM_Renderer.h:
792 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
793 in a different class.
795 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
796 easily add support for other formats.
798 * src/insets/figinset.C: plugged a leak of an X resource.
800 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
802 * src/CutAndPaste.[Ch]: make all metods static.
804 * development/Code_rules/Rules: more work, added section on
805 Exceptions, and a References section.
807 * a lot of header files: work to make doc++ able to generate the
808 source documentation, some workarounds of doc++ problems. Doc++ is
809 now able to generate the documentation.
811 2000-08-07 Juergen Vigna <jug@sad.it>
813 * src/insets/insettabular.C (recomputeTextInsets): removed function
815 * src/tabular.C (SetWidthOfMulticolCell):
817 (calculate_width_of_column_NMC): fixed return value so that it really
818 only returns true if the column-width has changed (there where
819 problems with muliticolumn-cells in this column).
821 2000-08-04 Juergen Vigna <jug@sad.it>
823 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
824 also on the scrollstatus of the inset.
825 (workAreaMotionNotify): ditto.
827 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
829 2000-08-01 Juergen Vigna <jug@sad.it>
831 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
834 * src/LyXAction.C (init):
835 * src/insets/inset.C (LocalDispatch): added support for
838 * src/insets/inset.C (scroll): new functions.
840 * src/insets/insettext.C (removeNewlines): new function.
841 (SetAutoBreakRows): removes forced newlines in the text of the
842 paragraph if autoBreakRows is set to false.
844 * src/tabular.C (Latex): generates a parbox around the cell contents
847 * src/frontends/xforms/FormTabular.C (local_update): removed
848 the radio_useparbox button.
850 * src/tabular.C (UseParbox): new function
852 2000-08-06 Baruch Even <baruch.even@writeme.com>
854 * src/graphics/GraphicsCache.h:
855 * src/graphics/GraphicsCache.C:
856 * src/graphics/GraphicsCacheItem.h:
857 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
860 * src/insets/insetgraphics.h:
861 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
862 drawing of the inline image.
864 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
865 into the wrong position.
867 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
870 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
872 * src/support/translator.h: move all typedefs to public section
874 * src/support/filetools.C (MakeLatexName): return string const
877 (FileOpenSearch): ditto
879 (LibFileSearch): ditto
880 (i18nLibFileSearch): ditto
883 (CreateTmpDir): ditto
884 (CreateBufferTmpDir): ditto
885 (CreateLyXTmpDir): ditto
890 (OnlyFilename): ditto
892 (NormalizePath): ditto
894 (GetFileContents): ditto
895 (ReplaceEnvironmentPath): ditto
898 (ChangeExtension): ditto
899 (MakeDisplayPath): ditto
900 (do_popen): return cmdret const
901 (findtexfile): return string const
903 * src/support/DebugStream.h: add some /// to please doc++
905 * src/frontends/DialogBase.h (endif): add some /// to please doc++
907 * src/texrow.C (same_rownumber): functor to use with find_if
908 (getIdFromRow): rewritten to use find_if and to not update the
909 positions. return true if row is found
910 (increasePos): new method, use to update positions
912 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
914 * src/lyxlex_pimpl.C (verifyTable): new method
917 (GetString): return string const
918 (pushTable): rewrite to use std::stack
920 (setFile): better check
923 * src/lyxlex.h: make LyXLex noncopyable
925 * src/lyxlex.C (text): return char const * const
926 (GetString): return string const
927 (getLongString): return string const
929 * src/lyx_gui_misc.C (askForText): return pair<...> const
931 * src/lastfiles.[Ch] (operator): return string const
933 * src/buffer.C (parseSingleLyXformat2Token): pass string to
934 istringstream not char const *.
935 move token.end() out of loop.
936 (readFile): move initializaton of token
938 * src/BufferView2.C (insertErrors): run texrow.increasePos if
939 getIdFromRow is successful.
941 * lib/bind/emacs.bind: don't include menus bind
943 * development/Code_rules/Rules: the beginnings of making this
944 better and covering more of the unwritten rules that we have.
946 * development/Code_rules/Recommendations: a couple of wording
949 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
951 * src/support/strerror.c: remove C++ comment.
953 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
955 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
956 LFUN_INDEX_INSERT_LAST
958 * src/texrow.C (getIdFromRow): changed from const_iterator to
959 iterator, allowing code to compile with DEC cxx
961 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
962 stores part of the class, as suggested by Allan. Will allow
964 (apply): test to apply uses InsetCommandParams operator!=
966 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
967 (apply): test to apply uses InsetCommandParams operator!=
969 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
970 stores part of the class.
971 (update): removed limits on min/max size.
973 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
974 (apply): test to apply uses InsetCommandParams operator!=
976 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
977 (Read, Write, scanCommand, getCommand): moved functionality
978 into InsetCommandParams.
980 (getScreenLabel): made pure virtual
981 new InsetCommandParams operators== and !=
983 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
984 c-tors based on InsetCommandParams. Removed others.
985 * src/insets/insetinclude.[Ch]: ditto
986 * src/insets/insetlabel.[Ch]: ditto
987 * src/insets/insetparent.[Ch]: ditto
988 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
990 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
991 insets derived from InsetCommand created using similar c-tors
992 based on InsetCommandParams
993 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
994 * src/menus.C (ShowRefsMenu): ditto
995 * src/paragraph.C (Clone): ditto
996 * src/text2.C (SetCounter): ditto
997 * src/lyxfunc.C (Dispatch) ditto
998 Also recreated old InsetIndex behaviour exactly. Can now
999 index-insert at the start of a paragraph and index-insert-last
1000 without launching the pop-up.
1002 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1004 * lib/lyxrc.example: mark te pdf options as non functional.
1006 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1007 (isStrDbl): move tmpstr.end() out of loop.
1008 (strToDbl): move intialization of tmpstr
1009 (lowercase): return string const and move tmp.end() out of loop.
1010 (uppercase): return string const and move tmp.edn() out of loop.
1011 (prefixIs): add assertion
1016 (containsOnly): ditto
1017 (containsOnly): ditto
1018 (containsOnly): ditto
1019 (countChar): make last arg char not char const
1020 (token): return string const
1021 (subst): return string const, move tmp.end() out of loop.
1022 (subst): return string const, add assertion
1023 (strip): return string const
1024 (frontStrip): return string const, add assertion
1025 (frontStrip): return string const
1030 * src/support/lstrings.C: add inclde "LAssert.h"
1031 (isStrInt): move tmpstr.end() out of loop.
1033 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1034 toollist.end() out of loop.
1035 (deactivate): move toollist.end() out of loop.
1036 (update): move toollist.end() out of loop.
1037 (updateLayoutList): move tc.end() out of loop.
1038 (add): move toollist.end() out of loop.
1040 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1041 md.end() out of loop.
1043 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1045 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1048 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1049 (Erase): move insetlist.end() out of loop.
1051 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1052 ref to const string as first arg. Move initialization of some
1053 variables, whitespace changes.
1055 * src/kbmap.C (defkey): move table.end() out of loop.
1056 (kb_keymap): move table.end() out of loop.
1057 (findbinding): move table.end() out of loop.
1059 * src/MenuBackend.C (hasMenu): move end() out of loop.
1060 (getMenu): move end() out of loop.
1061 (getMenu): move menulist_.end() out of loop.
1063 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1065 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1068 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1069 (getFromLyXName): move infotab.end() out of loop.
1071 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1072 -fvtable-thunks -ffunction-sections -fdata-sections
1074 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1076 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1079 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1081 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1083 * src/frontends/xforms/FormCitation.[Ch],
1084 src/frontends/xforms/FormIndex.[Ch],
1085 src/frontends/xforms/FormToc.[Ch],
1086 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1088 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1090 * src/commandtags.h: renamed, created some flags for citation
1093 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1095 * src/lyxfunc.C (dispatch): use signals to insert index entry
1097 * src/frontends/Dialogs.h: new signal createIndex
1099 * src/frontends/xforms/FormCommand.[Ch],
1100 src/frontends/xforms/FormCitation.[Ch],
1101 src/frontends/xforms/FormToc.[Ch],
1102 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1104 * src/insets/insetindex.[Ch]: GUI-independent
1106 * src/frontends/xforms/FormIndex.[Ch],
1107 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1110 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1112 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1113 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1115 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1117 * src/insets/insetref.C (Latex): rewrite so that there is now
1118 question that a initialization is requested.
1120 * src/insets/insetcommand.h: reenable the hide signal
1122 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1124 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1125 fix handling of shortcuts (many bugs :)
1126 (add_lastfiles): ditto.
1128 * lib/ui/default.ui: fix a few shortcuts.
1130 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1132 * Makefile.am: Fix ``rpmdist'' target to return the exit
1133 status of the ``rpm'' command, instead of the last command in
1134 the chain (the ``rm lyx.xpm'' command, which always returns
1137 2000-08-02 Allan Rae <rae@lyx.org>
1139 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1140 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1141 * src/frontends/xforms/FormToc.C (FormToc): ditto
1143 * src/frontends/xforms/Makefile.am: A few forgotten files
1145 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1146 Signals-not-copyable-problem Lars' started commenting out.
1148 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1150 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1152 * src/insets/insetcommand.h: Signals is not copyable so anoter
1153 scheme for automatic hiding of forms must be used.
1155 * src/frontends/xforms/FormCitation.h: don't inerit from
1156 noncopyable, FormCommand already does that.
1157 * src/frontends/xforms/FormToc.h: ditto
1158 * src/frontends/xforms/FormUrl.h: ditto
1160 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1162 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1164 * src/insets/insetcommand.h (hide): new SigC::Signal0
1165 (d-tor) new virtual destructor emits hide signal
1167 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1168 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1170 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1171 LOF and LOT. Inset is now GUI-independent
1173 * src/insets/insetloa.[Ch]: redundant
1174 * src/insets/insetlof.[Ch]: ditto
1175 * src/insets/insetlot.[Ch]: ditto
1177 * src/frontends/xforms/forms/form_url.fd: tweaked!
1178 * src/frontends/xforms/forms/form_citation.fd: ditto
1180 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1181 dialogs dealing with InsetCommand insets
1183 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1184 FormCommand base class
1185 * src/frontends/xforms/FormUrl.[Ch]: ditto
1187 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1189 * src/frontends/xforms/FormToc.[Ch]: ditto
1191 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1192 passed a generic InsetCommand pointer
1193 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1195 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1196 and modified InsetTOC class
1197 * src/buffer.C: ditto
1199 * forms/lyx.fd: strip out old FD_form_toc code
1200 * src/lyx_gui_misc.C: ditto
1201 * src/lyx_gui.C: ditto
1202 * src/lyx_cb.C: ditto
1203 * src/lyx.[Ch]: ditto
1205 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1207 * src/support/utility.hpp: tr -d '\r'
1209 2000-08-01 Juergen Vigna <jug@sad.it>
1211 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1213 * src/commandtags.h:
1214 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1215 LFUN_TABULAR_FEATURES.
1217 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1218 LFUN_LAYOUT_TABULAR.
1220 * src/insets/insettabular.C (getStatus): implemented helper function.
1222 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1224 2000-07-31 Juergen Vigna <jug@sad.it>
1226 * src/text.C (draw): fixed screen update problem for text-insets.
1228 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1229 something changed probably this has to be added in various other
1232 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1234 2000-07-31 Baruch Even <baruch.even@writeme.com>
1236 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1237 templates to satisfy compaq cxx.
1240 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1242 * src/support/translator.h (equal_1st_in_pair::operator()): take
1243 const ref pair_type as arg.
1244 (equal_2nd_in_pair::operator()): ditto
1245 (Translator::~Translator): remove empty d-tor.
1247 * src/graphics/GraphicsCache.C: move include config.h to top, also
1248 put initialization of GraphicsCache::singleton here.
1249 (~GraphicsCache): move here
1250 (addFile): take const ref as arg
1253 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1255 * src/BufferView2.C (insertLyXFile): change te with/without header
1258 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1260 * src/frontends/xforms/FormGraphics.C (apply): add some
1261 static_cast. Not very nice, but required by compaq cxx.
1263 * src/frontends/xforms/RadioButtonGroup.h: include header
1264 <utility> instead of <pair.h>
1266 * src/insets/insetgraphicsParams.C: add using directive.
1267 (readResize): change return type to void.
1268 (readOrigin): ditto.
1270 * src/lyxfunc.C (getStatus): add missing break for build-program
1271 function; add test for Literate for export functions.
1273 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1274 entries in Options menu.
1276 2000-07-31 Baruch Even <baruch.even@writeme.com>
1278 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1279 protect against auto-allocation; release icon when needed.
1281 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1283 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1284 on usual typewriter.
1286 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1287 earlier czech.kmap), useful only for programming.
1289 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1291 * src/frontends/xforms/FormCitation.h: fix conditioning around
1294 2000-07-31 Juergen Vigna <jug@sad.it>
1296 * src/frontends/xforms/FormTabular.C (local_update): changed
1297 radio_linebreaks to radio_useparbox and added radio_useminipage.
1299 * src/tabular.C: made support for using minipages/parboxes.
1301 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1303 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1305 (descent): so the cursor is in the middle.
1306 (width): bit smaller box.
1308 * src/insets/insetgraphics.h: added display() function.
1310 2000-07-31 Baruch Even <baruch.even@writeme.com>
1312 * src/frontends/Dialogs.h: Added showGraphics signals.
1314 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1315 xforms form definition of the graphics dialog.
1317 * src/frontends/xforms/FormGraphics.h:
1318 * src/frontends/xforms/FormGraphics.C: Added files, the
1319 GUIndependent code of InsetGraphics
1321 * src/insets/insetgraphics.h:
1322 * src/insets/insetgraphics.C: Major writing to make it work.
1324 * src/insets/insetgraphicsParams.h:
1325 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1326 struct between InsetGraphics and GUI.
1328 * src/LaTeXFeatures.h:
1329 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1330 support for graphicx package.
1332 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1333 for the graphics inset.
1335 * src/support/translator.h: Added file, used in
1336 InsetGraphicsParams. this is a template to translate between two
1339 * src/frontends/xforms/RadioButtonGroup.h:
1340 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1341 way to easily control a radio button group.
1343 2000-07-28 Juergen Vigna <jug@sad.it>
1345 * src/insets/insettabular.C (LocalDispatch):
1346 (TabularFeatures): added support for lyx-functions of tabular features.
1347 (cellstart): refixed this function after someone wrongly changed it.
1349 * src/commandtags.h:
1350 * src/LyXAction.C (init): added support for tabular-features
1352 2000-07-28 Allan Rae <rae@lyx.org>
1354 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1355 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1356 triggers the callback for input checking. As a result we sometimes get
1357 "LyX: This shouldn't happen..." printed to cerr.
1358 (input): Started using status variable since I only free() on
1359 destruction. Some input checking for paths and font sizes.
1361 * src/frontends/xforms/FormPreferences.h: Use status to control
1362 activation of Ok and Apply
1364 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1365 callback. Also resized to stop segfaults with 0.88. The problem is
1366 that xforms-0.88 requires the folder to be wide enough to fit all the
1367 tabs. If it isn't it causes all sorts of problems.
1369 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1371 * src/frontends/xforms/forms/README: Reflect reality.
1373 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1374 * src/frontends/xforms/forms/makefile: ditto.
1376 * src/commandtags.h: Get access to new Preferences dialog
1377 * src/LyXAction.C: ditto
1378 * src/lyxfunc.C: ditto
1379 * lib/ui/default.ui: ditto
1381 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1383 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1385 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1388 * src/frontends/xforms/form_url.[Ch]: added.
1390 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1392 * src/insets/insetbib.h: fixed bug in previous commit
1394 * src/frontends/xforms/FormUrl.h: ditto
1396 * src/frontends/xforms/FormPrint.h: ditto
1398 * src/frontends/xforms/FormPreferences.h: ditto
1400 * src/frontends/xforms/FormCopyright.h: ditto
1402 * src/frontends/xforms/FormCitation.C: ditto
1404 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1405 private copyconstructor and private default contructor
1407 * src/support/Makefile.am: add utility.hpp
1409 * src/support/utility.hpp: new file from boost
1411 * src/insets/insetbib.h: set owner in clone
1413 * src/frontends/xforms/FormCitation.C: added missing include
1416 * src/insets/form_url.[Ch]: removed
1418 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1420 * development/lyx.spec.in
1421 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1422 file/directory re-organization.
1424 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1426 * src/insets/insetcommand.[Ch]: moved the string data and
1427 associated manipulation methods into a new stand-alone class
1428 InsetCommandParams. This class has two additional methods
1429 getAsString() and setFromString() allowing the contents to be
1430 moved around as a single string.
1431 (addContents) method removed.
1432 (setContents) method no longer virtual.
1434 * src/buffer.C (readInset): made use of new InsetCitation,
1435 InsetUrl constructors based on InsetCommandParams.
1437 * src/commandtags.h: add LFUN_INSERT_URL
1439 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1440 independent InsetUrl and use InsetCommandParams to extract
1441 string info and create new Insets.
1443 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1445 * src/frontends/xforms/FormCitation.C (apply): uses
1448 * src/frontends/xforms/form_url.C
1449 * src/frontends/xforms/form_url.h
1450 * src/frontends/xforms/FormUrl.h
1451 * src/frontends/xforms/FormUrl.C
1452 * src/frontends/xforms/forms/form_url.fd: new files
1454 * src/insets/insetcite.[Ch]: removed unused constructors.
1456 * src/insets/insetinclude.[Ch]: no longer store filename
1458 * src/insets/inseturl.[Ch]: GUI-independent.
1460 2000-07-26 Juergen Vigna <jug@sad.it>
1461 * renamed frontend from gtk to gnome as it is that what is realized
1462 and did the necessary changes in the files.
1464 2000-07-26 Marko Vendelin <markov@ioc.ee>
1466 * configure.in: cleaning up gnome configuration scripts
1468 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1470 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1471 shortcuts syndrom by redrawing them explicitely (a better solution
1472 would be appreciated).
1474 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1476 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1479 * src/lyx_cb.C (MenuExport): change html export to do the right
1480 thing depending of the document type (instead of having
1481 html-linuxdoc and html-docbook).
1482 * src/lyxfunc.C (getStatus): update for html
1483 * lib/ui/default.ui: simplify due to the above change.
1484 * src/menus.C (ShowFileMenu): update too (in case we need it).
1486 * src/MenuBackend.C (read): if a menu is defined twice, add the
1487 new entries to the exiting one.
1489 2000-07-26 Juergen Vigna <jug@sad.it>
1491 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1493 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1494 and return a bool if it did actual save the file.
1495 (AutoSave): don't autosave a unnamed doc.
1497 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1498 check if this is an UNNAMED new file and react to it.
1499 (newFile): set buffer to unnamed and change to not mark a new
1500 buffer dirty if I didn't do anything with it.
1502 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1504 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1506 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1507 friend as per Angus's patch posted to lyx-devel.
1509 * src/ext_l10n.h: updated
1511 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1512 gettext on the style string right before inserting them into the
1515 * autogen.sh: add code to extract style strings form layout files,
1516 not good enough yet.
1518 * src/frontends/gtk/.cvsignore: add MAKEFILE
1520 * src/MenuBackend.C (read): run the label strings through gettext
1521 before storing them in the containers.
1523 * src/ext_l10n.h: new file
1525 * autogen.sh : generate the ext_l10n.h file here
1527 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1529 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1532 * lib/ui/default.ui: fix a couple of typos.
1534 * config/gnome/gtk.m4: added (and added to the list of files in
1537 * src/insets/insetinclude.C (unique_id): fix when we are using
1538 lyxstring instead of basic_string<>.
1539 * src/insets/insettext.C (LocalDispatch): ditto.
1540 * src/support/filetools.C: ditto.
1542 * lib/configure.m4: create the ui/ directory if necessary.
1544 * src/LyXView.[Ch] (updateToolbar): new method.
1546 * src/BufferView_pimpl.C (buffer): update the toolbar when
1547 opening/closing buffer.
1549 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1551 * src/LyXAction.C (getActionName): enhance to return also the name
1552 and options of pseudo-actions.
1553 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1555 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1556 as an example of what is possible). Used in File->Build too (more
1557 useful) and in the import/export menus (to mimick the complicated
1558 handling of linuxdoc and friends). Try to update all the entries.
1560 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1563 * src/MenuBackend.C (read): Parse the new OptItem tag.
1565 * src/MenuBackend.h: Add a new optional_ data member (used if the
1566 entry should be omitted when the lyxfunc is disabled).
1568 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1569 function, used as a shortcut.
1570 (create_submenu): align correctly the shortcuts on the widest
1573 * src/MenuBackend.h: MenuItem.label() only returns the label of
1574 the menu without shortcut; new method shortcut().
1576 2000-07-14 Marko Vendelin <markov@ioc.ee>
1578 * src/frontends/gtk/Dialogs.C:
1579 * src/frontends/gtk/FormCopyright.C:
1580 * src/frontends/gtk/FormCopyright.h:
1581 * src/frontends/gtk/Makefile.am: added these source-files for the
1582 Gtk/Gnome support of the Copyright-Dialog.
1584 * src/main.C: added Gnome::Main initialization if using
1585 Gtk/Gnome frontend-GUI.
1587 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1589 * config/gnome/aclocal-include.m4
1590 * config/gnome/compiler-flags.m4
1591 * config/gnome/curses.m4
1592 * config/gnome/gnome--.m4
1593 * config/gnome/gnome-bonobo-check.m4
1594 * config/gnome/gnome-common.m4
1595 * config/gnome/gnome-fileutils.m4
1596 * config/gnome/gnome-ghttp-check.m4
1597 * config/gnome/gnome-gnorba-check.m4
1598 * config/gnome/gnome-guile-checks.m4
1599 * config/gnome/gnome-libgtop-check.m4
1600 * config/gnome/gnome-objc-checks.m4
1601 * config/gnome/gnome-orbit-check.m4
1602 * config/gnome/gnome-print-check.m4
1603 * config/gnome/gnome-pthread-check.m4
1604 * config/gnome/gnome-support.m4
1605 * config/gnome/gnome-undelfs.m4
1606 * config/gnome/gnome-vfs.m4
1607 * config/gnome/gnome-x-checks.m4
1608 * config/gnome/gnome-xml-check.m4
1609 * config/gnome/gnome.m4
1610 * config/gnome/gperf-check.m4
1611 * config/gnome/gtk--.m4
1612 * config/gnome/linger.m4
1613 * config/gnome/need-declaration.m4: added configuration scripts
1614 for Gtk/Gnome frontend-GUI
1616 * configure.in: added support for the --with-frontend=gtk option
1618 * autogen.sh: added config/gnome/* to list of config-files
1620 * acconfig.h: added define for GTKGUI-support
1622 * config/lyxinclude.m4: added --with-frontend[=value] option value
1623 for Gtk/Gnome frontend-GUI support.
1625 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1627 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1631 * src/paragraph.C (GetChar): remove non-const version
1633 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1634 (search_kw): use it.
1636 * src/lyx_main.C (init): if "preferences" exist, read that instead
1638 (ReadRcFile): return bool if the file could be read ok.
1639 (ReadUIFile): add a check to see if lex file is set ok.
1641 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1642 bastring can be used instead of lyxstring (still uses the old code
1643 if std::string is good enough or if lyxstring is used.)
1645 * src/encoding.C: make the arrays static, move ininle functions
1647 * src/encoding.h: from here.
1649 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1650 (parseSingleLyXformat2Token): move inset parsing to separate method
1651 (readInset): new private method
1653 * src/Variables.h: remove virtual from get().
1655 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1656 access to NEW_INSETS and NEW_TABULAR
1658 * src/MenuBackend.h: remove superfluous forward declaration of
1659 MenuItem. Add documentations tags "///", remove empty MenuItem
1660 destructor, remove private default contructor.
1662 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1664 (read): more string mlabel and mname to where they are used
1665 (read): remove unused variables mlabel and mname
1666 (defaults): unconditional clear, make menusetup take advantage of
1667 add returning Menu &.
1669 * src/LyXView.h: define NEW_MENUBAR as default
1671 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1672 to NEW_INSETS and NEW_TABULAR.
1673 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1674 defined. Change some of the "xxxx-inset-insert" functions names to
1677 * several files: more enahncements to NEW_INSETS and the resulting
1680 * lib/lyxrc.example (\date_insert_format): move to misc section
1682 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1683 bastring and use AC_CACHE_CHECK.
1684 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1685 the system have the newest methods. uses AC_CACHE_CHECK
1686 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1687 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1688 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1690 * configure.in: add LYX_CXX_GOOD_STD_STRING
1692 * acinclude.m4: recreated
1694 2000-07-24 Amir Karger
1696 * README: add Hebrew, Arabic kmaps
1699 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1701 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1704 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1706 * Lot of files: add pragma interface/implementation.
1708 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1710 * lib/ui/default.ui: new file (ans new directory). Contains the
1711 default menu and toolbar.
1713 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1714 global space. Toolbars are now read (as menus) in ui files.
1716 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1718 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1719 is disabled because the document is read-only. We want to have the
1720 toggle state of the function anyway.
1721 (getStatus): add code for LFUN_VC* functions (mimicking what is
1722 done in old-style menus)
1724 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1725 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1727 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1728 * src/BufferView_pimpl.C: ditto.
1729 * src/lyxfunc.C: ditto.
1731 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1732 default). This replaces old-style menus by new ones.
1734 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1735 MenuItem. Contain the data structure of a menu.
1737 * src/insets/insettext.C: use LyXView::setLayout instead of
1738 accessing directly the toolbar combox.
1739 * src/lyxfunc.C (Dispatch): ditto.
1741 * src/LyXView.C (setLayout): new method, which just calls
1742 Toolbar::setLayout().
1743 (updateLayoutChoice): move part of this method in Toolbar.
1745 * src/toolbar.[Ch]: removed.
1747 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1748 implementation the toolbar.
1750 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1751 the toolbar. It might make sense to merge it with ToolbarDefaults
1753 (setLayout): new function.
1754 (updateLayoutList): ditto.
1755 (openLayoutList): ditto.
1757 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1758 xforms implementation of the toolbar.
1759 (get_toolbar_func): comment out, since I do not
1760 know what it is good for.
1762 * src/ToolbarDefaults.h: Add the ItemType enum.
1764 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1765 for a list of allocated C strings. Used in Menubar xforms
1766 implementation to avoid memory leaks.
1768 * src/support/lstrings.[Ch] (uppercase): new version taking and
1772 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1773 * lib/bind/emacs.bind: ditto.
1775 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1777 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1778 forward decl of LyXView.
1780 * src/toolbar.C (toolbarItem): moved from toolbar.h
1781 (toolbarItem::clean): ditto
1782 (toolbarItem::~toolbarItem): ditto
1783 (toolbarItem::operator): ditto
1785 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1787 * src/paragraph.h: control the NEW_TABULAR define from here
1789 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1790 USE_TABULAR_INSETS to NEW_TABULAR
1792 * src/ToolbarDefaults.C: add include "lyxlex.h"
1794 * files using the old table/tabular: use NEW_TABULAR to control
1795 compilation of old tabular stuff.
1797 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1800 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1801 planemet in reading of old style floats, fix the \end_deeper
1802 problem when reading old style floats.
1804 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1806 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1808 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1810 * lib/bind/sciword.bind: updated.
1812 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1814 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1815 layout write problem
1817 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1819 * src/Makefile.am (INCLUDES): remove image directory from include
1822 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1823 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1825 * src/LyXView.C (create_form_form_main): read the application icon
1828 * lib/images/*.xpm: change the icons to use transparent color for
1831 * src/toolbar.C (update): change the color of the button when it
1834 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1836 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1837 setting explicitely the minibuffer.
1838 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1840 * src/LyXView.C (showState): new function. Shows font information
1841 in minibuffer and update toolbar state.
1842 (LyXView): call Toolbar::update after creating the
1845 * src/toolbar.C: change toollist to be a vector instead of a
1847 (BubbleTimerCB): get help string directly from the callback
1848 argument of the corresponding icon (which is the action)
1849 (set): remove unnecessary ugliness.
1850 (update): new function. update the icons (depressed, disabled)
1851 depending of the status of the corresponding action.
1853 * src/toolbar.h: remove help in toolbarItem
1855 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1857 * src/Painter.C (text): Added code for using symbol glyphs from
1858 iso10646 fonts. Currently diabled.
1860 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1863 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1864 magyar,turkish and usorbian.
1866 * src/paragraph.C (isMultiLingual): Made more efficient.
1868 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1871 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1872 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1873 Also changed the prototype to "bool math_insert_greek(char)".
1875 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1877 * lots of files: apply the NEW_INSETS on all code that will not be
1878 needed when we move to use the new insets. Enable the define in
1879 lyxparagrah.h to try it.
1881 * src/insets/insettabular.C (cellstart): change to be a static
1883 (InsetTabular): initialize buffer in the initializer list.
1885 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1887 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1888 form_print.h out of the header file. Replaced with forward
1889 declarations of the relevant struct.
1891 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1894 * src/commandtags.h: do not include "debug.h" which does not
1895 belong there. #include it in some other places because of this
1898 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1900 * src/insets/insetcaption.C: add a couple "using" directives.
1902 * src/toolbar.C (add): get the help text directly from lyxaction.
1904 (setPixmap): new function. Loads from disk and sets a pixmap on a
1905 botton; the name of the pixmap file is derived from the command
1908 * src/toolbar.h: remove members isBitmap and pixmap from
1911 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1912 * lib/images/: move many files from images/banner.xpm.
1914 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1916 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1917 * src/toolbar.C: ditto.
1918 * configure.in: ditto.
1919 * INSTALL: document.
1921 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1922 the spellchecker popup is closed from the WM.
1924 2000-07-19 Juergen Vigna <jug@sad.it>
1926 * src/insets/insetfloat.C (Write): small fix because we use the
1927 insetname for the type now!
1929 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1931 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1934 * src/frontends/Dialogs.h: removed hideCitation signal
1936 * src/insets/insetcite.h: added hide signal
1938 * src/insets/insetcite.C (~InsetCitation): emits new signal
1939 (getScreenLabel): "intelligent" label should now fit on the screen!
1941 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1943 * src/frontends/xforms/FormCitation.C (showInset): connects
1944 hide() to the inset's hide signal
1945 (show): modified to use fl_set_object_position rather than
1946 fl_set_object_geometry wherever possible
1948 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1950 * src/insets/lyxinset.h: add caption code
1952 * src/insets/insetfloat.C (type): new method
1954 * src/insets/insetcaption.C (Write): new method
1956 (LyxCode): new method
1958 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1959 to get it right together with using the FloatList.
1961 * src/commandtags.h: add LFUN_INSET_CAPTION
1962 * src/lyxfunc.C (Dispatch): handle it
1964 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1967 * src/Variables.[Ch]: make expand take a const reference, remove
1968 the destructor, some whitespace changes.
1970 * src/LyXAction.C (init): add caption-inset-insert
1972 * src/FloatList.C (FloatList): update the default floats a bit.
1974 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1976 * src/Variables.[Ch]: new files. Intended to be used for language
1977 specific strings (like \chaptername) and filename substitution in
1980 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1982 * lib/kbd/american.kmap: update
1984 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1986 * src/bufferparams.[Ch]: remove member allowAccents.
1988 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1990 * src/LaTeXLog.C: use the log_form.h header.
1991 * src/lyx_gui.C: ditto.
1992 * src/lyx_gui_misc.C: ditto.
1993 * src/lyxvc.h: ditto.
1995 * forms/log_form.fd: new file, created from latexoptions.fd. I
1996 kept the log popup and nuked the options form.
1998 * src/{la,}texoptions.[Ch]: removed.
1999 * src/lyx_cb.C (LaTeXOptions): ditto
2001 * src/lyx_gui.C (create_forms): do not handle the
2002 fd_latex_options form.
2004 2000-07-18 Juergen Vigna <jug@sad.it>
2006 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2007 name of the inset so that it can be requested outside (text2.C).
2009 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2012 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2014 * src/mathed/formula.h (ConvertFont): constify
2016 * src/mathed/formula.C (Read): add warning if \end_inset is not
2017 found on expected place.
2019 * src/insets/lyxinset.h (ConvertFont): consify
2021 * src/insets/insetquotes.C (ConvertFont): constify
2022 * src/insets/insetquotes.h: ditto
2024 * src/insets/insetinfo.h: add labelfont
2026 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2027 (ascent): use labelfont
2031 (Write): make .lyx file a bit nicer
2033 * src/insets/insetfloat.C (Write): simplify somewhat...
2034 (Read): add warning if arg is not found
2036 * src/insets/insetcollapsable.C: add using std::max
2037 (Read): move string token and add warning in arg is not found
2038 (draw): use std::max to get the right ty
2039 (getMaxWidth): simplify by using std::max
2041 * src/insets/insetsection.h: new file
2042 * src/insets/insetsection.C: new file
2043 * src/insets/insetcaption.h: new file
2044 * src/insets/insetcaption.C: new file
2046 * src/insets/inset.C (ConvertFont): constify signature
2048 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2049 insetcaption.[Ch] and insetsection.[Ch]
2051 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2052 uses to use LABEL_COUNTER_CHAPTER instead.
2053 * src/text2.C (SetCounter): here
2055 * src/counters.h: new file
2056 * src/counters.C: new file
2057 * src/Sectioning.h: new file
2058 * src/Sectioning.C: new file
2060 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2062 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2064 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2067 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2070 2000-07-17 Juergen Vigna <jug@sad.it>
2072 * src/tabular.C (Validate): check if array-package is needed.
2073 (SetVAlignment): added support for vertical alignment.
2074 (SetLTFoot): better support for longtable header/footers
2075 (Latex): modified to support added features.
2077 * src/LaTeXFeatures.[Ch]: added array-package.
2079 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2081 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2084 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2086 * configure.in: do not forget to put a space after -isystem.
2088 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2090 * lib/kbd/arabic.kmap: a few fixes.
2092 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2094 * some whitespace chagnes to a number of files.
2096 * src/support/DebugStream.h: change to make it easier for
2097 doc++ to parse correctly.
2098 * src/support/lyxstring.h: ditto
2100 * src/mathed/math_utils.C (compara): change to have only one
2102 (MathedLookupBOP): change because of the above.
2104 * src/mathed/math_delim.C (math_deco_compare): change to have only
2106 (search_deco): change becasue of the above.
2108 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2109 instead of manually coded one.
2111 * src/insets/insetquotes.C (Read): read the \end_inset too
2113 * src/insets/insetlatex.h: remove file
2114 * src/insets/insetlatex.C: remove file
2116 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2118 (InsetPrintIndex): remove destructor
2120 * src/insets/insetinclude.h: remove default constructor
2122 * src/insets/insetfloat.C: work to make it work better
2124 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2126 * src/insets/insetcite.h (InsetCitation): remove default constructor
2128 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2130 * src/text.C (GetColumnNearX): comment out some currently unused code.
2132 * src/paragraph.C (writeFile): move some initializations closer to
2134 (CutIntoMinibuffer): small change to use new matchIT operator
2138 (InsertInset): ditto
2141 (InsetIterator): ditto
2142 (Erase): small change to use new matchFT operator
2144 (GetFontSettings): ditto
2145 (HighestFontInRange): ditto
2148 * src/lyxparagraph.h: some chars changed to value_type
2149 (matchIT): because of some stronger checking (perhaps too strong)
2150 in SGI STL, the two operator() unified to one.
2153 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2155 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2156 the last inset read added
2157 (parseSingleLyXformat2Token): some more (future) compability code added
2158 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2159 (parseSingleLyXformat2Token): set last_inset_read
2160 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2161 (parseSingleLyXformat2Token): don't double intializw string next_token
2163 * src/TextCache.C (text_fits::operator()): add const's to the signature
2164 (has_buffer::operator()): ditto
2166 * src/Floating.h: add some comments on the class
2168 * src/FloatList.[Ch] (typeExist): new method
2171 * src/BackStack.h: added default constructor, wanted by Gcc.
2173 2000-07-14 Juergen Vigna <jug@sad.it>
2175 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2177 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2179 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2180 do a redraw when the window is resized!
2181 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2183 * src/insets/insettext.C (resizeLyXText): added function to correctly
2184 being able to resize the LyXWindow.
2186 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2188 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2190 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2191 crashes when closing dialog to a deleted inset.
2193 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2194 method! Now similar to other insets.
2196 2000-07-13 Juergen Vigna <jug@sad.it>
2198 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2200 * lib/examples/Literate.lyx: small patch!
2202 * src/insets/insetbib.C (Read): added this function because of wrong
2203 Write (without [begin|end]_inset).
2205 2000-07-11 Juergen Vigna <jug@sad.it>
2207 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2208 as the insertInset could not be good!
2210 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2211 the bool param should not be last.
2213 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2215 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2216 did submit that to Karl).
2218 * configure.in: use -isystem instead of -I for X headers. This
2219 fixes a problem on solaris with a recent gcc;
2220 put the front-end code after the X detection code;
2221 configure in sigc++ before lib/
2223 * src/lyx_main.C (commandLineHelp): remove -display from command
2226 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2228 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2229 Also put in Makefile rules for building the ``listerrors''
2230 program for parsing errors from literate programs written in LyX.
2232 * lib/build-listerrors: Added small shell script as part of compile
2233 process. This builds a working ``listerrors'' binary if noweb is
2234 installed and either 1) the VNC X server is installed on the machine,
2235 or 2) the user is compiling from within a GUI. The existence of a GUI
2236 is necessary to use the ``lyx --export'' feature for now. This
2237 hack can be removed once ``lyx --export'' no longer requires a GUI to
2240 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2242 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2243 now passed back correctly from gcc and placed "under" error
2244 buttons in a Literate LyX source.
2246 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2248 * src/text.C (GetColumnNearX): Better behavior when a RTL
2249 paragraph is ended by LTR text.
2251 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2254 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2256 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2257 true when clipboard is empty.
2259 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2261 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2262 row of the paragraph.
2263 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2264 to prevent calculation of bidi tables
2266 2000-07-07 Juergen Vigna <jug@sad.it>
2268 * src/screen.C (ToggleSelection): added y_offset and x_offset
2271 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2274 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2276 * src/insets/insettext.C: fixed Layout-Display!
2278 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2280 * configure.in: add check for strings.h header.
2282 * src/spellchecker.C: include <strings.h> in order to have a
2283 definition for bzero().
2285 2000-07-07 Juergen Vigna <jug@sad.it>
2287 * src/insets/insettext.C (draw): set the status of the bv->text to
2288 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2290 * src/screen.C (DrawOneRow):
2291 (DrawFromTo): redraw the actual row if something has changed in it
2294 * src/text.C (draw): call an update of the toplevel-inset if something
2295 has changed inside while drawing.
2297 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2299 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2301 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2302 processing inside class.
2304 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2305 processing inside class.
2307 * src/insets/insetindex.h new struct Holder, consistent with other
2310 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2311 citation dialog from main code and placed it in src/frontends/xforms.
2312 Dialog launched through signals instead of callbacks
2314 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2316 * lyx.man: update the options description.
2318 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2320 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2321 handle neg values, set min width to 590, add doc about -display
2323 2000-07-05 Juergen Vigna <jug@sad.it>
2325 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2326 calls to BufferView *.
2328 * src/insets/insettext.C (checkAndActivateInset): small fix non
2329 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2331 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2332 their \end_inset token!
2334 2000-07-04 edscott <edscott@imp.mx>
2336 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2337 lib/lyxrc.example: added option \wheel_jump
2339 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2341 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2342 remove support for -width,-height,-xpos and -ypos.
2344 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2346 * src/encoding.[Ch]: New files.
2348 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2349 (text): Call to the underline() method only when needed.
2351 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2353 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2354 encoding(s) for the document.
2356 * src/bufferparams.C (BufferParams): Changed default value of
2359 * src/language.C (newLang): Removed.
2360 (items[]): Added encoding information for all defined languages.
2362 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2363 encoding choice button.
2365 * src/lyxrc.h (font_norm_type): New member variable.
2366 (set_font_norm_type): New method.
2368 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2369 paragraphs with different encodings.
2371 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2372 (TransformChar): Changed to work correctly with Arabic points.
2373 (draw): Added support for drawing Arabic points.
2374 (draw): Removed code for drawing underbars (this is done by
2377 * src/support/textutils.h (IsPrintableNonspace): New function.
2379 * src/BufferView_pimpl.h: Added "using SigC::Object".
2380 * src/LyXView.h: ditto.
2382 * src/insets/insetinclude.h (include_label): Changed to mutable.
2384 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2386 * src/mathed/math_iter.h: remove empty destructor
2388 * src/mathed/math_cursor.h: remove empty destructor
2390 * src/insets/lyxinset.h: add THEOREM_CODE
2392 * src/insets/insettheorem.[Ch]: new files
2394 * src/insets/insetminipage.C: (InsertInset): remove
2396 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2398 (InsertInset): remove
2400 * src/insets/insetlist.C: (InsertList): remove
2402 * src/insets/insetfootlike.[Ch]: new files
2404 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2407 (InsertInset): ditto
2409 * src/insets/insetert.C: remove include Painter.h, reindent
2410 (InsertInset): move to header
2412 * src/insets/insetcollapsable.h: remove explicit from default
2413 contructor, remove empty destructor, add InsertInset
2415 * src/insets/insetcollapsable.C (InsertInset): new func
2417 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2419 * src/vspace.h: add explicit to constructor
2421 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2422 \textcompwordmark, please test this.
2424 * src/lyxrc.C: set ascii_linelen to 65 by default
2426 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2428 * src/commandtags.h: add LFUN_INSET_THEOREM
2430 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2431 (makeLinuxDocFile): remove _some_ of the nice logic
2432 (makeDocBookFile): ditto
2434 * src/Painter.[Ch]: (~Painter): removed
2436 * src/LyXAction.C (init): entry for insettheorem added
2438 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2440 (deplog): code to detect files generated by LaTeX, needs testing
2443 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2445 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2447 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2449 * src/LaTeX.C (deplog): Add a check for files that are going to be
2450 created by the first latex run, part of the project to remove the
2453 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2454 contents to the extension list.
2456 2000-07-04 Juergen Vigna <jug@sad.it>
2458 * src/text.C (NextBreakPoint): added support for needFullRow()
2460 * src/insets/lyxinset.h: added needFullRow()
2462 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2465 * src/insets/insettext.C: lots of changes for update!
2467 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2469 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2471 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2473 * src/insets/insetinclude.C (InsetInclude): fixed
2474 initialization of include_label.
2475 (unique_id): now returns a string.
2477 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2479 * src/LaTeXFeatures.h: new member IncludedFiles, for
2480 a map of key, included file name.
2482 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2483 with the included files for inclusion in SGML preamble,
2484 i. e., linuxdoc and docbook.
2487 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2488 nice (is the generated linuxdoc code to be exported?), that
2489 allows to remove column, and only_body that will be true for
2490 slave documents. Insets are allowed inside SGML font type.
2491 New handling of the SGML preamble for included files.
2492 (makeDocBookFile): the same for docbook.
2494 * src/insets/insetinclude.h:
2495 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2497 (DocBook): new export methods.
2499 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2500 and makeDocBookFile.
2502 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2503 formats to export with command line argument -x.
2505 2000-06-29 Juergen Vigna <jug@sad.it>
2507 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2508 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2510 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2511 region could already been cleared by an inset!
2513 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2515 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2518 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2520 (cursorToggle): remove special handling of lyx focus.
2522 2000-06-28 Juergen Vigna <jug@sad.it>
2524 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2527 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2529 * src/insets/insetindex.C (Edit): add a callback when popup is
2532 * src/insets/insettext.C (LocalDispatch):
2533 * src/insets/insetmarginal.h:
2534 * src/insets/insetlist.h:
2535 * src/insets/insetfoot.h:
2536 * src/insets/insetfloat.h:
2537 * src/insets/insetert.h: add a missing std:: qualifier.
2539 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2544 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2546 * src/insets/insettext.C (Read): remove tmptok unused variable
2547 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2548 (InsertInset): change for new InsetInset code
2550 * src/insets/insettext.h: add TEXT inline method
2552 * src/insets/insettext.C: remove TEXT macro
2554 * src/insets/insetmarginal.C (Write): new method
2555 (Latex): change output slightly
2557 * src/insets/insetfoot.C (Write): new method
2558 (Latex): change output slightly (don't use endl when no need)
2560 * src/insets/insetert.C (Write): new method
2562 * src/insets/insetcollapsable.h: make button_length, button_top_y
2563 and button_bottm_y protected.
2565 * src/insets/insetcollapsable.C (Write): simplify code by using
2566 tostr. Also do not output the float name, the children class
2567 should to that to get control over own arguments
2569 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2570 src/insets/insetminipage.[Ch]:
2573 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2575 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2577 * src/Makefile.am (lyx_SOURCES): add the new files
2579 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2580 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2581 * src/commandtags.h: ditto
2583 * src/LaTeXFeatures.h: add a std::set of used floattypes
2585 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2587 * src/FloatList.[Ch] src/Floating.h: new files
2589 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2591 * src/lyx_cb.C (TableApplyCB): ditto
2593 * src/text2.C: ditto
2594 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2595 (parseSingleLyXformat2Token): ditto + add code for
2596 backwards compability for old float styles + add code for new insets
2598 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2600 (InsertInset(size_type, Inset *, LyXFont)): new method
2601 (InsetChar(size_type, char)): changed to use the other InsetChar
2602 with a LyXFont(ALL_INHERIT).
2603 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2604 insert the META_INSET.
2606 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2608 * sigc++/thread.h (Threads): from here
2610 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2611 definition out of line
2612 * sigc++/scope.h: from here
2614 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2616 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2617 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2619 * Makefile.am (bindist): new target.
2621 * INSTALL: add instructions for doing a binary distribution.
2623 * development/tools/README.bin.example: update a bit.
2625 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2628 * lib/lyxrc.example: new lyxrc tag \set_color.
2630 * src/lyxfunc.C (Dispatch):
2631 * src/commandtags.h:
2632 * src/LyXAction.C: new lyxfunc "set-color".
2634 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2635 and an x11name given as strings.
2637 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2638 cache when a color is changed.
2640 2000-06-26 Juergen Vigna <jug@sad.it>
2642 * src/lyxrow.C (width): added this functions and variable.
2644 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2647 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2649 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2651 * images/undo_bw.xpm: new icon.
2652 * images/redo_bw.xpm: ditto.
2654 * configure.in (INSTALL_SCRIPT): change value to
2655 ${INSTALL} to avoid failures of install-script target.
2656 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2658 * src/BufferView.h: add a magic "friend" declaration to please
2661 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2663 * forms/cite.fd: modified to allow resizing without messing
2666 * src/insetcite.C: Uses code from cite.fd almost without
2668 User can now resize dialog in the x-direction.
2669 Resizing the dialog in the y-direction is prevented, as the
2670 code does this intelligently already.
2672 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2674 * INSTALL: remove obsolete entry in "problems" section.
2676 * lib/examples/sl_*.lyx: update of the slovenian examples.
2678 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2680 2000-06-23 Juergen Vigna <jug@sad.it>
2682 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2684 * src/buffer.C (resize): delete the LyXText of textinsets.
2686 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2688 * src/insets/lyxinset.h: added another parameter 'cleared' to
2689 the draw() function.
2691 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2692 unlocking inset in inset.
2694 2000-06-22 Juergen Vigna <jug@sad.it>
2696 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2697 of insets and moved first to LyXText.
2699 * src/mathed/formulamacro.[Ch]:
2700 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2702 2000-06-21 Juergen Vigna <jug@sad.it>
2704 * src/text.C (GetVisibleRow): look if I should clear the area or not
2705 using Inset::doClearArea() function.
2707 * src/insets/lyxinset.h: added doClearArea() function and
2708 modified draw(Painter &, ...) to draw(BufferView *, ...)
2710 * src/text2.C (UpdateInset): return bool insted of int
2712 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2714 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2715 combox in the character popup
2717 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2718 BufferParams const & params
2720 2000-06-20 Juergen Vigna <jug@sad.it>
2722 * src/insets/insettext.C (SetParagraphData): set insetowner on
2725 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2727 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2728 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2730 (form_main_): remove
2732 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2733 (create_form_form_main): remove FD_form_main stuff, connect to
2734 autosave_timeout signal
2736 * src/LyXView.[Ch] (getMainForm): remove
2737 (UpdateTimerCB): remove
2738 * src/BufferView_pimpl.h: inherit from SigC::Object
2740 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2741 signal instead of callback
2743 * src/BufferView.[Ch] (cursorToggleCB): remove
2745 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2747 * src/BufferView_pimpl.C: changes because of the one below
2749 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2750 instead of storing a pointer to a LyXText.
2752 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2754 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2756 * src/lyxparagraph.h
2758 * src/paragraph.C: Changed fontlist to a sorted vector.
2760 2000-06-19 Juergen Vigna <jug@sad.it>
2762 * src/BufferView.h: added screen() function.
2764 * src/insets/insettext.C (LocalDispatch): some selection code
2767 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2769 * src/insets/insettext.C (SetParagraphData):
2771 (InsetText): fixes for multiple paragraphs.
2773 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2775 * development/lyx.spec.in: Call configure with ``--without-warnings''
2776 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2777 This should be fine, however, since we generally don't want to be
2778 verbose when making an RPM.
2780 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2782 * lib/scripts/fig2pstex.py: New file
2784 2000-06-16 Juergen Vigna <jug@sad.it>
2786 * src/insets/insettabular.C (UpdateLocal):
2787 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2788 (LocalDispatch): Changed all functions to use LyXText.
2790 2000-06-15 Juergen Vigna <jug@sad.it>
2792 * src/text.C (SetHeightOfRow): call inset::update before requesting
2795 * src/insets/insettext.C (update):
2796 * src/insets/insettabular.C (update): added implementation
2798 * src/insets/lyxinset.h: added update function
2800 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2802 * src/text.C (SelectNextWord): protect against null pointers with
2803 old-style string streams. (fix from Paul Theo Gonciari
2806 * src/cite.[Ch]: remove erroneous files.
2808 * lib/configure.m4: update the list of created directories.
2810 * src/lyxrow.C: include <config.h>
2811 * src/lyxcursor.C: ditto.
2813 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2815 * lib/examples/decimal.lyx: new example file from Mike.
2817 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2818 to find template definitions (from Dekel)
2820 * src/frontends/.cvsignore: add a few things.
2822 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2824 * src/Timeout.C (TimeOut): remove default argument.
2826 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2829 * src/insets/ExternalTemplate.C: add a "using" directive.
2831 * src/lyx_main.h: remove the act_ struct, which seems unused
2834 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2836 * LyX Developers Meeting: All files changed, due to random C++ (by
2837 coincidence) code generator script.
2839 - external inset (cool!)
2840 - initial online editing of preferences
2841 - insettabular breaks insettext(s contents)
2843 - some DocBook fixes
2844 - example files update
2845 - other cool stuff, create a diff and look for yourself.
2847 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2849 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2850 -1 this is a non-line-breaking textinset.
2852 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2853 if there is no width set.
2855 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2857 * Lots of files: Merged the dialogbase branch.
2859 2000-06-09 Allan Rae <rae@lyx.org>
2861 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2862 and the Dispatch methods that used it.
2864 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2865 access to functions formerly kept in Dispatch.
2867 2000-05-19 Allan Rae <rae@lyx.org>
2869 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2870 made to_page and count_copies integers again. from_page remains a
2871 string however because I want to allow entry of a print range like
2872 "1,4,22-25" using this field.
2874 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2875 and printer-params-get. These aren't useful from the minibuffer but
2876 could be used by a script/LyXServer app provided it passes a suitable
2877 auto_mem_buffer. I guess I should take a look at how the LyXServer
2878 works and make it support xtl buffers.
2880 * sigc++/: updated to libsigc++-1.0.1
2882 * src/xtl/: updated to xtl-1.3.pl.11
2884 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2885 those changes done to the files in src/ are actually recreated when
2886 they get regenerated. Please don't ever accept a patch that changes a
2887 dialog unless that patch includes the changes to the corresponding *.fd
2890 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2891 stringOnlyContains, renamed it and generalised it.
2893 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2894 branch. Removed the remaining old form_print code.
2896 2000-04-26 Allan Rae <rae@lyx.org>
2898 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2899 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2901 2000-04-25 Allan Rae <rae@lyx.org>
2903 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2904 against a base of xtl-1.3.pl.4
2906 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2907 filter the Id: entries so they still show the xtl version number
2910 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2911 into the src/xtl code. Patch still pending with José (XTL)
2913 2000-04-24 Allan Rae <rae@lyx.org>
2915 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2916 both more generic and much safer. Use the new template functions.
2917 * src/buffer.[Ch] (Dispatch): ditto.
2919 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2920 and mem buffer more intelligently. Also a little general cleanup.
2923 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2924 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2925 * src/xtl/Makefile.am: ditto.
2926 * src/xtl/.cvsignore: ditto.
2927 * src/Makefile.am: ditto.
2929 * src/PrinterParams.h: Removed the macros member functions. Added a
2930 testInvariant member function. A bit of tidying up and commenting.
2931 Included Angus's idea for fixing operation with egcs-1.1.2.
2933 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2934 cool expansion of XTL's mem_buffer to support automatic memory
2935 management within the buffer itself. Removed the various macros and
2936 replaced them with template functions that use either auto_mem_buffer
2937 or mem_buffer depending on a #define. The mem_buffer support will
2938 disappear as soon as the auto_mem_buffer is confirmed to be good on
2939 other platforms/compilers. That is, it's there so you've got something
2942 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2943 effectively forked XTL. However I expect José will include my code
2944 into the next major release. Also fixed a memory leak.
2945 * src/xtl/text.h: ditto.
2946 * src/xtl/xdr.h: ditto.
2947 * src/xtl/giop.h: ditto.
2949 2000-04-16 Allan Rae <rae@lyx.org>
2951 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2952 by autogen.sh and removed by maintainer-clean anyway.
2953 * .cvsignore, sigc++/.cvsignore: Support the above.
2955 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2957 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2959 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2960 macros, renamed static callback-target member functions to suit new
2961 scheme and made them public.
2962 * src/frontends/xforms/forms/form_print.fd: ditto.
2963 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2965 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2968 * src/xtl/: New directory containing a minimal distribution of XTL.
2969 This is XTL-1.3.pl.4.
2971 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2973 2000-04-15 Allan Rae <rae@lyx.org>
2975 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2977 * sigc++/: Updated to libsigc++-1.0.0
2979 2000-04-14 Allan Rae <rae@lyx.org>
2981 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2982 use the generic ones in future. I'll modify my conversion script.
2984 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2986 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2987 (CloseAllBufferRelatedDialogs): Renamed.
2988 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2990 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2991 of the generic ones. These are the same ones my conversion script
2994 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2995 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2996 * src/buffer.C (Dispatch): ditto
2998 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2999 functions for updating and hiding buffer dependent dialogs.
3000 * src/BufferView.C (buffer): ditto
3001 * src/buffer.C (setReadonly): ditto
3002 * src/lyxfunc.C (CloseBuffer): ditto
3004 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3005 Dialogs.h, and hence all the SigC stuff, into every file that includes
3006 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3008 * src/BufferView2.C: reduce the number of headers included by buffer.h
3010 2000-04-11 Allan Rae <rae@lyx.org>
3012 * src/frontends/xforms/xform_macros.h: A small collection of macros
3013 for building C callbacks.
3015 * src/frontends/xforms/Makefile.am: Added above file.
3017 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3018 scheme again. This time it should work for JMarc. If this is
3019 successful I'll revise my conversion script to automate some of this.
3020 The static member functions in the class also have to be public for
3021 this scheme will work. If the scheme works (it's almost identical to
3022 the way BufferView::cursorToggleCB is handled so it should work) then
3023 FormCopyright and FormPrint will be ready for inclusion into the main
3024 trunk immediately after 1.1.5 is released -- provided we're prepared
3025 for complaints about lame compilers not handling XTL.
3027 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3029 2000-04-07 Allan Rae <rae@lyx.org>
3031 * config/lyxinclude.m4: A bit more tidying up (Angus)
3033 * src/LString.h: JMarc's <string> header fix
3035 * src/PrinterParams.h: Used string for most data to remove some
3036 ugly code in the Print dialog and avoid even uglier code when
3037 appending the ints to a string for output.
3039 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3040 and moved "default:" back to the end of switch statement. Cleaned
3041 up the printing so it uses the right function calls and so the
3042 "print to file" option actually puts the file in the right directory.
3044 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3046 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3047 and Ok+Apply button control into a separate method: input (Angus).
3048 (input) Cleaned it up and improved it to be very thorough now.
3049 (All CB) static_cast used instead of C style cast (Angus). This will
3050 probably change again once we've worked out how to keep gcc-2.8.1 happy
3051 with real C callbacks.
3052 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3053 ignore some of the bool settings and has random numbers instead. Needs
3054 some more investigation. Added other input length checks and checking
3055 of file and printer names.
3057 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3058 would link (Angus). Seems the old code doesn't compile with the pragma
3059 statement either. Separated callback entries from internal methods.
3061 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3063 2000-03-17 Allan Rae <rae@lyx.org>
3065 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3066 need it? Maybe it could go in Dialogs instead? I could make it a
3067 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3068 values to get the bool return value.
3069 (Dispatch): New overloaded method for xtl support.
3071 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3072 extern "C" callback instead of static member functions. Hopefully,
3073 JMarc will be able to compile this. I haven't changed
3074 forms/form_copyright.fd yet. Breaking one of my own rules already.
3076 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3077 because they aren't useful from the minibuffer. Maybe a LyXServer
3078 might want a help message though?
3080 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3082 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3083 xtl which needs both rtti and exceptions.
3085 * src/support/Makefile.am:
3086 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3088 * src/frontends/xforms/input_validators.[ch]: input filters and
3089 validators. These conrol what keys are valid in input boxes.
3090 Use them and write some more. Much better idea than waiting till
3091 after the user has pressed Ok to say that the input fields don't make
3094 * src/frontends/xforms/Makefile.am:
3095 * src/frontends/xforms/forms/form_print.fd:
3096 * src/frontends/xforms/forms/makefile:
3097 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3098 new scheme. Still have to make sure I haven't missed anything from
3099 the current implementation.
3101 * src/Makefile.am, src/PrinterParams.h: New data store.
3103 * other files: Added a couple of copyright notices.
3105 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3107 * src/insets/insetbib.h: move Holder struct in public space.
3109 * src/frontends/include/DialogBase.h: use SigC:: only when
3110 SIGC_CXX_NAMESPACES is defined.
3111 * src/frontends/include/Dialogs.h: ditto.
3113 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3115 * src/frontends/xforms/FormCopyright.[Ch]: do not
3116 mention SigC:: explicitely.
3118 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3120 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3121 deals with testing KDE in main configure.in
3122 * configure.in: ditto.
3124 2000-02-22 Allan Rae <rae@lyx.org>
3126 * Lots of files: Merged from HEAD
3128 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3129 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3131 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3133 * sigc++/: new minidist.
3135 2000-02-14 Allan Rae <rae@lyx.org>
3137 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3139 2000-02-08 Juergen Vigna <jug@sad.it>
3141 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3142 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3144 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3145 for this port and so it is much easier for other people to port
3146 dialogs in a common development environment.
3148 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3149 the QT/KDE implementation.
3151 * src/frontends/kde/Dialogs.C:
3152 * src/frontends/kde/FormCopyright.C:
3153 * src/frontends/kde/FormCopyright.h:
3154 * src/frontends/kde/Makefile.am:
3155 * src/frontends/kde/formcopyrightdialog.C:
3156 * src/frontends/kde/formcopyrightdialog.h:
3157 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3158 for the kde support of the Copyright-Dialog.
3160 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3161 subdir-substitution instead of hardcoded 'xforms' as we now have also
3164 * src/frontends/include/DialogBase.h (Object): just commented the
3165 label after #endif (nasty warning and I don't like warnings ;)
3167 * src/main.C (main): added KApplication initialization if using
3170 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3171 For now only the KDE event-loop is added if frontend==kde.
3173 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3175 * configure.in: added support for the --with-frontend[=value] option
3177 * autogen.sh: added kde.m4 file to list of config-files
3179 * acconfig.h: added define for KDEGUI-support
3181 * config/kde.m4: added configuration functions for KDE-port
3183 * config/lyxinclude.m4: added --with-frontend[=value] option with
3184 support for xforms and KDE.
3186 2000-02-08 Allan Rae <rae@lyx.org>
3188 * all Makefile.am: Fixed up so the make targets dist, distclean,
3189 install and uninstall all work even if builddir != srcdir. Still
3190 have a new sigc++ minidist update to come.
3192 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3194 2000-02-01 Allan Rae <rae@lyx.org>
3196 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3197 Many mods to get builddir != srcdir working.
3199 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3200 for building on NT and so we can do the builddir != srcdir stuff.
3202 2000-01-30 Allan Rae <rae@lyx.org>
3204 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3205 This will stay in "rae" branch. We probably don't really need it in
3206 the main trunk as anyone who wants to help programming it should get
3207 a full library installed also. So they can check both included and
3208 system supplied library compilation.
3210 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3211 Added a 'mini' distribution of libsigc++. If you feel the urge to
3212 change something in these directories - Resist it. If you can't
3213 resist the urge then you should modify the following script and rebuild
3214 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3215 all happen. Still uses a hacked version of libsigc++'s configure.in.
3216 I'm quite happy with the results. I'm not sure the extra work to turn
3217 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3218 worth the trouble and would probably lead to extra maintenance
3220 I haven't tested the following important make targets: install, dist.
3221 Not ready for prime time but very close. Maybe 1.1.5.
3223 * development/tools/makeLyXsigc.sh: A shell script to automatically
3224 generate our mini-dist of libsigc++. It can only be used with a CVS
3225 checkout of libsigc++ not a tarball distribution. It's well commented.
3226 This will end up as part of the libsigc++ distribution so other apps
3227 can easily have an included mini-dist. If someone makes mods to the
3228 sigc++ subpackage without modifying this script to generate those
3229 changes I'll be very upset!
3231 * src/frontends/: Started the gui/system indep structure.
3233 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3234 to access the gui-indep dialogs are in this class. Much improved
3235 design compared to previous revision. Lars, please refrain from
3236 moving this header into src/ like you did with Popups.h last time.
3238 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3240 * src/frontends/xforms/: Started the gui-indep system with a single
3241 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3244 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3245 Here you'll find a very useful makefile and automated fdfix.sh that
3246 makes updating dailogs a no-brainer -- provided you follow the rules
3247 set out in the README. I'm thinking about adding another script to
3248 automatically generate skeleton code for a new dialog given just the
3251 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3252 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3253 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3255 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3257 * src/support/LSubstring.C (operator): simplify
3259 * src/lyxtext.h: removed bparams, use buffer_->params instead
3261 * src/lyxrow.h: make Row a real class, move all variables to
3262 private and use accessors.
3264 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3266 (isRightToLeftPar): ditto
3267 (ChangeLanguage): ditto
3268 (isMultiLingual): ditto
3271 (SimpleTeXOnePar): ditto
3272 (TeXEnvironment): ditto
3273 (GetEndLabel): ditto
3275 (SetOnlyLayout): ditto
3276 (BreakParagraph): ditto
3277 (BreakParagraphConservative): ditto
3278 (GetFontSettings): ditto
3280 (CopyIntoMinibuffer): ditto
3281 (CutIntoMinibuffer): ditto
3282 (PasteParagraph): ditto
3283 (SetPExtraType): ditto
3284 (UnsetPExtraType): ditto
3285 (DocBookContTableRows): ditto
3286 (SimpleDocBookOneTablePar): ditto
3288 (TeXFootnote): ditto
3289 (SimpleTeXOneTablePar): ditto
3290 (TeXContTableRows): ditto
3291 (SimpleTeXSpecialChars): ditto
3294 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3295 to private and use accessors.
3297 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3298 this, we did not use it anymore and has not been for ages. Just a
3299 waste of cpu cycles.
3301 * src/language.h: make Language a real class, move all variables
3302 to private and use accessors.
3304 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3305 (create_view): remove
3306 (update): some changes for new timer
3307 (cursorToggle): use new timer
3308 (beforeChange): change for new timer
3310 * src/BufferView.h (cursorToggleCB): removed last paramter because
3313 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3314 (cursorToggleCB): change because of new timer code
3316 * lib/CREDITS: updated own mailaddress
3318 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3320 * src/support/filetools.C (PutEnv): fix the code in case neither
3321 putenv() nor setenv() have been found.
3323 * INSTALL: mention the install-strip Makefile target.
3325 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3326 read-only documents.
3328 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3330 * lib/reLyX/configure.in (VERSION): avoid using a previously
3331 generated reLyX wrapper to find out $prefix.
3333 * lib/examples/eu_adibide_lyx-atua.lyx:
3334 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3335 translation of the Tutorial (Dooteo)
3337 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3339 * forms/cite.fd: new citation dialog
3341 * src/insetcite.[Ch]: the new citation dialog is moved into
3344 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3347 * src/insets/insetcommand.h: data members made private.
3349 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3351 * LyX 1.1.5 released
3353 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3355 * src/version.h (LYX_RELEASE): to 1.1.5
3357 * src/spellchecker.C (RunSpellChecker): return false if the
3358 spellchecker dies upon creation.
3360 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3362 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3363 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3367 * lib/CREDITS: update entry for Martin Vermeer.
3369 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3371 * src/text.C (draw): Draw foreign language bars at the bottom of
3372 the row instead of at the baseline.
3374 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3376 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3378 * lib/bind/de_menus.bind: updated
3380 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3382 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3384 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3386 * src/menus.C (Limit_string_length): New function
3387 (ShowTocMenu): Limit the number of items/length of items in the
3390 * src/paragraph.C (String): Correct result for a paragraph inside
3393 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3395 * src/bufferlist.C (close): test of buf->getuser() == NULL
3397 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3399 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3400 Do not call to SetCursor when the paragraph is a closed footnote!
3402 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3404 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3407 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3409 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3412 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3413 reference popup, that activates the reference-back action
3415 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3417 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3418 the menus. Also fixed a bug.
3420 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3421 the math panels when switching buffers (unless new buffer is readonly).
3423 * src/BufferView.C (NoSavedPositions)
3424 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3426 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3428 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3429 less of dvi dirty or not.
3431 * src/trans_mgr.[Ch] (insert): change first parameter to string
3434 * src/chset.[Ch] (encodeString): add const to first parameter
3436 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3438 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3442 * src/LaTeX.C (deplog): better searching for dependency files in
3443 the latex log. Uses now regexps.
3445 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3446 instead of the box hack or \hfill.
3448 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3450 * src/lyxfunc.C (doImportHelper): do not create the file before
3451 doing the actual import.
3452 (doImportASCIIasLines): create a new file before doing the insert.
3453 (doImportASCIIasParagraphs): ditto.
3455 * lib/lyxrc.example: remove mention of non-existing commands
3457 * lyx.man: remove mention of color-related switches.
3459 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3461 * src/lyx_gui.C: remove all the color-related ressources, which
3462 are not used anymore.
3464 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3467 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3469 * src/lyxrc.C (read): Add a missing break in the switch
3471 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3473 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3475 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3478 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3480 * src/text.C (draw): draw bars under foreign language words.
3482 * src/LColor.[Ch]: add LColor::language
3484 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3486 * src/lyxcursor.h (boundary): New member variable
3488 * src/text.C (IsBoundary): New methods
3490 * src/text.C: Use the above for currect cursor movement when there
3491 is both RTL & LTR text.
3493 * src/text2.C: ditto
3495 * src/bufferview_funcs.C (ToggleAndShow): ditto
3497 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3499 * src/text.C (DeleteLineForward): set selection to true to avoid
3500 that DeleteEmptyParagraphMechanism does some magic. This is how it
3501 is done in all other functions, and seems reasonable.
3502 (DeleteWordForward): do not jump over non-word stuff, since
3503 CursorRightOneWord() already does it.
3505 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3506 DeleteWordBackward, since they seem safe to me (since selection is
3507 set to "true") DeleteEmptyParagraphMechanism does nothing.
3509 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3511 * src/lyx_main.C (easyParse): simplify the code by factoring the
3512 part that removes parameters from the command line.
3513 (LyX): check wether wrong command line options have been given.
3515 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3517 * src/lyx_main.C : add support for specifying user LyX
3518 directory via command line option -userdir.
3520 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3522 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3523 the number of items per popup.
3524 (Add_to_refs_menu): Ditto.
3526 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3528 * src/lyxparagraph.h: renamed ClearParagraph() to
3529 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3530 textclass as parameter, and do nothing if free_spacing is
3531 true. This fixes part of the line-delete-forward problems.
3533 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3534 (pasteSelection): ditto.
3535 (SwitchLayoutsBetweenClasses): more translatable strings.
3537 * src/text2.C (CutSelection): use StripLeadingSpaces.
3538 (PasteSelection): ditto.
3539 (DeleteEmptyParagraphMechanism): ditto.
3541 2000-05-26 Juergen Vigna <jug@sad.it>
3543 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3544 is not needed in tabular insets.
3546 * src/insets/insettabular.C (TabularFeatures): added missing features.
3548 * src/tabular.C (DeleteColumn):
3550 (AppendRow): implemented this functions
3551 (cellsturct::operator=): clone the inset too;
3553 2000-05-23 Juergen Vigna <jug@sad.it>
3555 * src/insets/insettabular.C (LocalDispatch): better selection support
3556 when having multicolumn-cells.
3558 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3560 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3562 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3564 * src/ColorHandler.C (getGCForeground): put more test into _()
3566 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3569 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3572 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3574 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3575 there are no labels, or when buffer is readonly.
3577 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3578 there are no labels, buffer is SGML, or when buffer is readonly.
3580 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3582 * src/LColor.C (LColor): change a couple of grey40 to grey60
3583 (LColor): rewore initalization to make compiles go some magnitude
3585 (getGUIName): don't use gettext until we need the string.
3587 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3589 * src/Bullet.[Ch]: Fixed a small bug.
3591 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3593 * src/paragraph.C (String): Several fixes/improvements
3595 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3597 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3599 * src/paragraph.C (String): give more correct output.
3601 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3603 * src/lyxfont.C (stateText) Do not output the language if it is
3604 eqaul to the language of the document.
3606 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3607 between two paragraphs with the same language.
3609 * src/paragraph.C (getParLanguage) Return a correct answer for an
3610 empty dummy paragraph.
3612 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3615 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3618 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3619 the menus/popup, if requested fonts are unavailable.
3621 2000-05-22 Juergen Vigna <jug@sad.it>
3623 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3624 movement support (Up/Down/Tab/Shift-Tab).
3625 (LocalDispatch): added also preliminari cursor-selection.
3627 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3629 * src/paragraph.C (PasteParagraph): Hopefully now right!
3631 2000-05-22 Garst R. Reese <reese@isn.net>
3633 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3634 of list, change all references to Environment to Command
3635 * tex/hollywood.cls : rewrite environments as commands, add
3636 \uppercase to interiorshot and exteriorshot to force uppecase.
3637 * tex/broadway.cls : rewrite environments as commands. Tweak
3640 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3642 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3643 size of items: use a constant intead of the hardcoded 40, and more
3644 importantly do not remove the %m and %x tags added at the end.
3645 (Add_to_refs_menu): use vector::size_type instead of
3646 unsigned int as basic types for the variables. _Please_ do not
3647 assume that size_t is equal to unsigned int. On an alpha, this is
3648 unsigned long, which is _not_ the same.
3650 * src/language.C (initL): remove language "hungarian", since it
3651 seems that "magyar" is better.
3653 2000-05-22 Juergen Vigna <jug@sad.it>
3655 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3657 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3660 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3661 next was deleted but not set to 0.
3663 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3665 * src/language.C (initL): change the initialization of languages
3666 so that compiles goes _fast_.
3668 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3671 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3673 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3677 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3679 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3681 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3685 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3688 * src/insets/insetlo*.[Ch]: Made editable
3690 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3692 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3693 the current selection.
3695 * src/BufferView_pimpl.C (stuffClipboard): new method
3697 * src/BufferView.C (stuffClipboard): new method
3699 * src/paragraph.C (String): new method
3701 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3702 LColor::ignore when lyxname is not found.
3704 * src/BufferView.C (pasteSelection): new method
3706 * src/BufferView_pimpl.C (pasteSelection): new method
3708 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3710 * src/WorkArea.C (request_clipboard_cb): new static function
3711 (getClipboard): new method
3712 (putClipboard): new method
3714 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3716 * LyX 1.1.5pre2 released
3718 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3720 * src/vspace.C (operator=): removed
3721 (operator=): removed
3723 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3725 * src/layout.C (NumberOfClass): manually set the type in make_pair
3726 (NumberOfLayout): ditto
3728 * src/language.C: use the Language constructor for ignore_lang
3730 * src/language.h: add constructors to struct Language
3732 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3734 * src/text2.C (SetCursorIntern): comment out #warning
3736 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3738 * src/mathed/math_iter.h: initialize sx and sw to 0
3740 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3742 * forms/lyx.fd: Redesign of form_ref
3744 * src/LaTeXFeatures.[Ch]
3748 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3751 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3752 and Buffer::inset_iterator.
3754 * src/menus.C: Added new menus: TOC and Refs.
3756 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3758 * src/buffer.C (getTocList): New method.
3760 * src/BufferView2.C (ChangeRefs): New method.
3762 * src/buffer.C (getLabelList): New method. It replaces the old
3763 getReferenceList. The return type is vector<string> instead of
3766 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3767 the old getLabel() and GetNumberOfLabels() methods.
3768 * src/insets/insetlabel.C (getLabelList): ditto
3769 * src/mathed/formula.C (getLabelList): ditto
3771 * src/paragraph.C (String): New method.
3773 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3774 Uses the new getTocList() method.
3775 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3776 which automatically updates the contents of the browser.
3777 (RefUpdateCB): Use the new getLabelList method.
3779 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3781 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3783 * src/spellchecker.C: Added using std::reverse;
3785 2000-05-19 Juergen Vigna <jug@sad.it>
3787 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3789 * src/insets/insettext.C (computeTextRows): small fix for display of
3790 1 character after a newline.
3792 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3795 2000-05-18 Juergen Vigna <jug@sad.it>
3797 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3798 when changing width of column.
3800 * src/tabular.C (set_row_column_number_info): setting of
3801 autobreak rows if necessary.
3803 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3805 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3807 * src/vc-backend.*: renamed stat() to status() and vcstat to
3808 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3809 compilation broke. The new name seems more relevant, anyway.
3811 2000-05-17 Juergen Vigna <jug@sad.it>
3813 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3814 which was wrong if the removing caused removing of rows!
3816 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3817 (pushToken): new function.
3819 * src/text2.C (CutSelection): fix problem discovered with purify
3821 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3823 * src/debug.C (showTags): enlarge the first column, now that we
3824 have 6-digits debug codes.
3826 * lib/layouts/hollywood.layout:
3827 * lib/tex/hollywood.cls:
3828 * lib/tex/brodway.cls:
3829 * lib/layouts/brodway.layout: more commands and fewer
3830 environments. Preambles moved in the .cls files. Broadway now has
3831 more options on scene numbering and less whitespace (from Garst)
3833 * src/insets/insetbib.C (getKeys): make sure that we are in the
3834 document directory, in case the bib file is there.
3836 * src/insets/insetbib.C (Latex): revert bogus change.
3838 2000-05-16 Juergen Vigna <jug@sad.it>
3840 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3841 the TabularLayout on cursor move.
3843 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3845 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3848 (draw): fixed cursor position and drawing so that the cursor is
3849 visible when before the tabular-inset.
3851 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3852 when creating from old insettext.
3854 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3856 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3859 * lib/tex/brodway.cls: ditto
3861 * lib/layouts/brodway.layout: change alignment of parenthical
3864 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3866 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3867 versions 0.88 and 0.89 are supported.
3869 2000-05-15 Juergen Vigna <jug@sad.it>
3871 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3874 * src/insets/insettext.C (computeTextRows): redone completely this
3875 function in a much cleaner way, because of problems when having a
3877 (draw): added a frame border when the inset is locked.
3878 (SetDrawLockedFrame): this sets if we draw the border or not.
3879 (SetFrameColor): this sets the frame color (default=insetframe).
3881 * src/insets/lyxinset.h: added x() and y() functions which return
3882 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3883 function which is needed to see if we have a locking inset of some
3884 type in this inset (needed for now in insettabular).
3886 * src/vspace.C (inPixels): the same function also without a BufferView
3887 parameter as so it is easier to use it in some ocasions.
3889 * src/lyxfunc.C: changed all places where insertInset was used so
3890 that now if it couldn't be inserted it is deleted!
3892 * src/TabularLayout.C:
3893 * src/TableLayout.C: added support for new tabular-inset!
3895 * src/BufferView2.C (insertInset): this now returns a bool if the
3896 inset was really inserted!!!
3898 * src/tabular.C (GetLastCellInRow):
3899 (GetFirstCellInRow): new helper functions.
3900 (Latex): implemented for new tabular class.
3904 (TeXTopHLine): new Latex() helper functions.
3906 2000-05-12 Juergen Vigna <jug@sad.it>
3908 * src/mathed/formulamacro.C (Read):
3909 * src/mathed/formula.C (Read): read also the \end_inset here!
3911 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3913 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3914 crush when saving formulae with unbalanced parenthesis.
3916 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3918 * src/layout.C: Add new keyword "endlabelstring" to layout file
3920 * src/text.C (GetVisibleRow): Draw endlabel string.
3922 * lib/layouts/broadway.layout
3923 * lib/layouts/hollywood.layout: Added endlabel for the
3924 Parenthetical layout.
3926 * lib/layouts/heb-article.layout: Do not use slanted font shape
3927 for Theorem like environments.
3929 * src/buffer.C (makeLaTeXFile): Always add "american" to
3930 the UsedLanguages list if document language is RTL.
3932 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3934 * add addendum to README.OS2 and small patch (from SMiyata)
3936 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3938 * many files: correct the calls to ChangeExtension().
3940 * src/support/filetools.C (ChangeExtension): remove the no_path
3941 argument, which does not belong there. Use OnlyFileName() instead.
3943 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3944 files when LaTeXing a non-nice latex file.
3946 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3947 a chain of "if". Return false when deadkeys are not handled.
3949 * src/lyx_main.C (LyX): adapted the code for default bindings.
3951 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3952 bindings for basic functionality (except deadkeys).
3953 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3955 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3956 several methods: handle override_x_deadkeys.
3958 * src/lyxrc.h: remove the "bindings" map, which did not make much
3959 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3961 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3963 * src/lyxfont.C (stateText): use a saner method to determine
3964 whether the font is "default". Seems to fix the crash with DEC
3967 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3969 2000-05-08 Juergen Vigna <jug@sad.it>
3971 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3972 TabularLayoutMenu with mouse-button-3
3973 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3975 * src/TabularLayout.C: added this file for having a Layout for
3978 2000-05-05 Juergen Vigna <jug@sad.it>
3980 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3981 recalculating inset-widths.
3982 (TabularFeatures): activated this function so that I can change
3983 tabular-features via menu.
3985 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3986 that I can test some functions with the Table menu.
3988 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3990 * src/lyxfont.C (stateText): guard against stupid c++libs.
3992 * src/tabular.C: add using std::vector
3993 some whitespace changes, + removed som autogenerated code.
3995 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3997 2000-05-05 Juergen Vigna <jug@sad.it>
3999 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4000 row, columns and cellstructures.
4002 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4004 * lib/lyxrc.example: remove obsolete entries.
4006 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4007 reading of protected_separator for free_spacing.
4009 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4011 * src/text.C (draw): do not display an exclamation mark in the
4012 margin for margin notes. This is confusing, ugly and
4015 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4016 AMS math' is checked.
4018 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4019 name to see whether including the amsmath package is needed.
4021 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4023 * src/paragraph.C (validate): Compute UsedLanguages correctly
4024 (don't insert the american language if it doesn't appear in the
4027 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4028 The argument of \thanks{} command is considered moving argument
4030 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4033 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4035 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4036 for appendix/minipage/depth. The lines can be now both in the footnote
4037 frame, and outside the frame.
4039 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4042 2000-05-05 Juergen Vigna <jug@sad.it>
4044 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4045 neede only in tabular.[Ch].
4047 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4049 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4051 (Write): write '~' for PROTECTED_SEPARATOR
4053 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4055 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4058 * src/mathed/formula.C (drawStr): rename size to siz.
4060 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4061 possibly fix a bug by not changing the pflags = flags to piflags =
4064 2000-05-05 Juergen Vigna <jug@sad.it>
4066 * src/insets/insetbib.C: moved using directive
4068 * src/ImportNoweb.C: small fix for being able to compile (missing
4071 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4073 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4074 to use clear, since we don't depend on this in the code. Add test
4077 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4079 * (various *.C files): add using std::foo directives to please dec
4082 * replace calls to string::clear() to string::erase() (Angus)
4084 * src/cheaders/cmath: modified to provide std::abs.
4086 2000-05-04 Juergen Vigna <jug@sad.it>
4088 * src/insets/insettext.C: Prepared all for inserting of multiple
4089 paragraphs. Still display stuff to do (alignment and other things),
4090 but I would like to use LyXText to do this when we cleaned out the
4091 table-support stuff.
4093 * src/insets/insettabular.C: Changed lot of stuff and added lots
4094 of functionality still a lot to do.
4096 * src/tabular.C: Various functions changed name and moved to be
4097 const functions. Added new Read and Write functions and changed
4098 lots of things so it works good with tabular-insets (also removed
4099 some stuff which is not needed anymore * hacks *).
4101 * src/lyxcursor.h: added operators == and != which just look if
4102 par and pos are (not) equal.
4104 * src/buffer.C (latexParagraphs): inserted this function to latex
4105 all paragraphs form par to endpar as then I can use this too for
4108 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4109 so that I can call this to from text insets with their own cursor.
4111 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4112 output off all paragraphs (because of the fix below)!
4114 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4115 the very last paragraph (this could be also the last paragraph of an
4118 * src/texrow.h: added rows() call which returns the count-variable.
4120 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4122 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4124 * lib/configure.m4: better autodetection of DocBook tools.
4126 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4128 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4130 * src/lyx_cb.C: add using std::reverse;
4132 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4135 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4136 selected files. Should fix repeated errors from generated files.
4138 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4140 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4142 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4143 the spellchecker popup.
4145 * lib/lyxrc.example: Removed the \number_inset section
4147 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4149 * src/insets/figinset.C (various): Use IsFileReadable() to make
4150 sure that the file actually exist. Relying on ghostscripts errors
4151 is a bad idea since they can lead to X server crashes.
4153 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4155 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4158 * lib/lyxrc.example: smallish typo in description of
4159 \view_dvi_paper_option
4161 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4164 * src/lyxfunc.C: doImportHelper to factor out common code of the
4165 various import methods. New functions doImportASCIIasLines,
4166 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4167 doImportLinuxDoc for the format specific parts.
4170 * buffer.C: Dispatch returns now a bool to indicate success
4173 * lyx_gui.C: Add getLyXView() for member access
4175 * lyx_main.C: Change logic for batch commands: First try
4176 Buffer::Dispatch (possibly without GUI), if that fails, use
4179 * lyx_main.C: Add support for --import command line switch.
4180 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4181 Available Formats: Everything accepted by 'buffer-import <format>'
4183 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4185 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4188 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4189 documents will be reformatted upon reentry.
4191 2000-04-27 Juergen Vigna <jug@sad.it>
4193 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4194 correctly only last pos this was a bug.
4196 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4198 * release of lyx-1.1.5pre1
4200 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4202 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4204 * src/menus.C: revert the change of naming (Figure->Graphic...)
4205 from 2000-04-11. It was incomplete and bad.
4207 * src/LColor.[Ch]: add LColor::depthbar.
4208 * src/text.C (GetVisibleRow): use it.
4210 * README: update the languages list.
4212 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4214 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4217 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4219 * README: remove sections that were just wrong.
4221 * src/text2.C (GetRowNearY): remove currentrow code
4223 * src/text.C (GetRow): remove currentrow code
4225 * src/screen.C (Update): rewritten a bit.
4226 (SmallUpdate): removed func
4228 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4230 (FullRebreak): return bool
4231 (currentrow): remove var
4232 (currentrow_y): ditto
4234 * src/lyxscreen.h (Draw): change arg to unsigned long
4235 (FitCursor): return bool
4236 (FitManualCursor): ditto
4237 (Smallpdate): remove func
4238 (first): change to unsigned long
4239 (DrawOneRow): change second arg to long (from long &)
4240 (screen_refresh_y): remove var
4241 (scree_refresh_row): ditto
4243 * src/lyxrow.h: change baseline to usigned int from unsigned
4244 short, this brings some implicit/unsigned issues out in the open.
4246 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4248 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4249 instead of smallUpdate.
4251 * src/lyxcursor.h: change y to unsigned long
4253 * src/buffer.h: don't call updateScrollbar after fitcursor
4255 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4256 where they are used. Removed "\\direction", this was not present
4257 in 1.1.4 and is already obsolete. Commented out some code that I
4258 believe to never be called.
4259 (runLiterate): don't call updateScrollbar after fitCursor
4261 (buildProgram): ditto
4264 * src/WorkArea.h (workWidth): change return val to unsigned
4267 (redraw): remove the button redraws
4268 (setScrollbarValue): change for scrollbar
4269 (getScrollbarValue): change for scrollbar
4270 (getScrollbarBounds): change for scrollbar
4272 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4273 (C_WorkArea_down_cb): removed func
4274 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4275 (resize): change for scrollbar
4276 (setScrollbar): ditto
4277 (setScrollbarBounds): ditto
4278 (setScrollbarIncrements): ditto
4279 (up_cb): removed func
4280 (down_cb): removed func
4281 (scroll_cb): change for scrollbar
4282 (work_area_handler): ditto
4284 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4285 when FitCursor did something.
4286 (updateScrollbar): some unsigned changes
4287 (downCB): removed func
4288 (scrollUpOnePage): removed func
4289 (scrollDownOnePage): remvoed func
4290 (workAreaMotionNotify): don't call screen->FitCursor but use
4291 fitCursor instead. and bool return val
4292 (workAreaButtonPress): ditto
4293 (workAreaButtonRelease): some unsigned changes
4294 (checkInsetHit): ditto
4295 (workAreaExpose): ditto
4296 (update): parts rewritten, comments about the signed char arg added
4297 (smallUpdate): removed func
4298 (cursorPrevious): call needed updateScrollbar
4301 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4304 * src/BufferView.[Ch] (upCB): removed func
4305 (downCB): removed func
4306 (smallUpdate): removed func
4308 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4310 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4311 currentrow, currentrow_y optimization. This did not help a lot and
4312 if we want to do this kind of optimization we should rather use
4313 cursor.row instead of the currentrow.
4315 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4316 buffer spacing and klyx spacing support.
4318 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4320 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4323 2000-04-26 Juergen Vigna <jug@sad.it>
4325 * src/insets/figinset.C: fixes to Lars sstream changes!
4327 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4329 * A lot of files: Added Ascii(ostream &) methods to all inset
4330 classes. Used when exporting to ASCII.
4332 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4333 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4336 * src/text2.C (ToggleFree): Disabled implicit word selection when
4337 there is a change in the language
4339 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4340 no output was generated for end-of-sentence inset.
4342 * src/insets/lyxinset.h
4345 * src/paragraph.C: Removed the insetnumber code
4347 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4349 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4351 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4352 no_babel and no_epsfig completely from the file.
4353 (parseSingleLyXformat2Token): add handling for per-paragraph
4354 spacing as written by klyx.
4356 * src/insets/figinset.C: applied patch by Andre. Made it work with
4359 2000-04-20 Juergen Vigna <jug@sad.it>
4361 * src/insets/insettext.C (cutSelection):
4362 (copySelection): Fixed with selection from right to left.
4363 (draw): now the rows are not recalculated at every draw.
4364 (computeTextRows): for now reset the inset-owner here (this is
4365 important for an undo or copy where the inset-owner is not set
4368 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4369 motion to the_locking_inset screen->first was forgotten, this was
4370 not important till we got multiline insets.
4372 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4374 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4375 code seems to be alright (it is code changed by Dekel, and the
4376 intent is indeed that all macros should be defined \protect'ed)
4378 * NEWS: a bit of reorganisation of the new user-visible features.
4380 2000-04-19 Juergen Vigna <jug@sad.it>
4382 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4383 position. Set the inset_owner of the used paragraph so that it knows
4384 that it is inside an inset. Fixed cursor handling with mouse and
4385 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4386 and cleanups to make TextInsets work better.
4388 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4389 Changed parameters of various functions and added LockInsetInInset().
4391 * src/insets/insettext.C:
4393 * src/insets/insetcollapsable.h:
4394 * src/insets/insetcollapsable.C:
4395 * src/insets/insetfoot.h:
4396 * src/insets/insetfoot.C:
4397 * src/insets/insetert.h:
4398 * src/insets/insetert.C: cleaned up the code so that it works now
4399 correctly with insettext.
4401 * src/insets/inset.C:
4402 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4403 that insets in insets are supported right.
4406 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4408 * src/paragraph.C: some small fixes
4410 * src/debug.h: inserted INSETS debug info
4412 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4413 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4415 * src/commandtags.h:
4416 * src/LyXAction.C: insert code for InsetTabular.
4418 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4419 not Button1MotionMask.
4420 (workAreaButtonRelease): send always a InsetButtonRelease event to
4422 (checkInsetHit): some setCursor fixes (always with insets).
4424 * src/BufferView2.C (lockInset): returns a bool now and extended for
4425 locking insets inside insets.
4426 (showLockedInsetCursor): it is important to have the cursor always
4427 before the locked inset.
4428 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4430 * src/BufferView.h: made lockInset return a bool.
4432 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4434 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4435 that is used also internally but can be called as public to have back
4436 a cursor pos which is not set internally.
4437 (SetCursorIntern): Changed to use above function.
4439 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4441 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4446 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4447 patches for things that should be in or should be changed.
4449 * src/* [insetfiles]: change "usigned char fragile" to bool
4450 fragile. There was only one point that could that be questioned
4451 and that is commented in formulamacro.C. Grep for "CHECK".
4453 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4454 (DeleteBuffer): take it out of CutAndPaste and make it static.
4456 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4458 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4459 output the spacing envir commands. Also the new commands used in
4460 the LaTeX output makes the result better.
4462 * src/Spacing.C (writeEnvirBegin): new method
4463 (writeEnvirEnd): new method
4465 2000-04-18 Juergen Vigna <jug@sad.it>
4467 * src/CutAndPaste.C: made textclass a static member of the class
4468 as otherwise it is not accesed right!!!
4470 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4472 * forms/layout_forms.fd
4473 * src/layout_forms.h
4474 * src/layout_forms.C (create_form_form_character)
4475 * src/lyx_cb.C (UserFreeFont)
4476 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4477 documents (in the layout->character popup).
4479 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4481 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4482 \spell_command was in fact not honored (from Kevin Atkinson).
4484 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4487 * src/lyx_gui.h: make lyxViews private (Angus)
4489 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4491 * src/mathed/math_write.C
4492 (MathMatrixInset::Write) Put \protect before \begin{array} and
4493 \end{array} if fragile
4494 (MathParInset::Write): Put \protect before \\ if fragile
4496 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4498 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4499 initialization if the LyXColorHandler must be done after the
4500 connections to the XServer has been established.
4502 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4503 get the background pixel from the lyxColorhandler so that the
4504 figures are rendered with the correct background color.
4505 (NextToken): removed functions.
4506 (GetPSSizes): use ifs >> string instead of NextToken.
4508 * src/Painter.[Ch]: the color cache moved out of this file.
4510 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4513 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4515 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4516 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4518 * src/BufferView.C (enterView): new func
4519 (leaveView): new func
4521 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4523 (leaveView): new func, undefines xterm cursor when approp.
4525 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4526 (AllowInput): delete the Workarea cursor handling from this func.
4528 * src/Painter.C (underline): draw a slimer underline in most cases.
4530 * src/lyx_main.C (error_handler): use extern "C"
4532 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4534 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4535 sent directly to me.
4537 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4538 to the list by Dekel.
4540 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4543 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4544 methods from lyx_cb.here.
4546 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4549 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4551 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4552 instead of using current_view directly.
4554 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4556 * src/LyXAction.C (init): add the paragraph-spacing command.
4558 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4560 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4562 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4563 different from the documents.
4565 * src/text.C (SetHeightOfRow): take paragraph spacing into
4566 account, paragraph spacing takes precedence over buffer spacing
4567 (GetVisibleRow): ditto
4569 * src/paragraph.C (writeFile): output the spacing parameter too.
4570 (validate): set the correct features if spacing is used in the
4572 (Clear): set spacing to default
4573 (MakeSameLayout): spacing too
4574 (HasSameLayout): spacing too
4575 (SetLayout): spacing too
4576 (TeXOnePar): output the spacing commands
4578 * src/lyxparagraph.h: added a spacing variable for use with
4579 per-paragraph spacing.
4581 * src/Spacing.h: add a Default spacing and a method to check if
4582 the current spacing is default. also added an operator==
4584 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4587 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4589 * src/lyxserver.C (callback): fix dispatch of functions
4591 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4592 printf() into lyxerr call.
4594 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4597 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4598 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4599 the "Float" from each of the subitems.
4600 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4602 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4603 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4604 documented the change so that the workaround can be nuked later.
4606 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4609 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4611 * src/buffer.C (getLatexName): ditto
4612 (setReadonly): ditto
4614 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4616 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4617 avoid some uses of current_view. Added also a bufferParams()
4618 method to get at this.
4620 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4622 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4624 * src/lyxparagraph.[Ch]: removed
4625 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4626 with operators used by lower_bound and
4627 upper_bound in InsetTable's
4628 Make struct InsetTable private again. Used matchpos.
4630 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4632 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4633 document, the language of existing text is changed (unless the
4634 document is multi-lingual)
4636 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4638 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4640 * A lot of files: A rewrite of the Right-to-Left support.
4642 2000-04-10 Juergen Vigna <jug@sad.it>
4644 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4645 misplaced cursor when inset in inset is locked.
4647 * src/insets/insettext.C (LocalDispatch): small fix so that a
4648 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4650 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4651 footnote font should be decreased in size twice when displaying.
4653 * src/insets/insettext.C (GetDrawFont): inserted this function as
4654 the drawing-font may differ from the real paragraph font.
4656 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4657 insets (inset in inset!).
4659 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4660 function here because we don't want footnotes inside footnotes.
4662 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4664 (init): now set the inset_owner in paragraph.C
4665 (LocalDispatch): added some resetPos() in the right position
4668 (pasteSelection): changed to use the new CutAndPaste-Class.
4670 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4671 which tells if it is allowed to insert another inset inside this one.
4673 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4674 SwitchLayoutsBetweenClasses.
4676 * src/text2.C (InsertInset): checking of the new paragraph-function
4678 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4679 is not needed anymore here!
4682 (PasteSelection): redone (also with #ifdef) so that now this uses
4683 the CutAndPaste-Class.
4684 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4687 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4688 from/to text/insets.
4690 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4691 so that the paragraph knows if it is inside an (text)-inset.
4692 (InsertFromMinibuffer): changed return-value to bool as now it
4693 may happen that an inset is not inserted in the paragraph.
4694 (InsertInsetAllowed): this checks if it is allowed to insert an
4695 inset in this paragraph.
4697 (BreakParagraphConservative):
4698 (BreakParagraph) : small change for the above change of the return
4699 value of InsertFromMinibuffer.
4701 * src/lyxparagraph.h: added inset_owner and the functions to handle
4702 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4704 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4706 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4707 functions from BufferView to BufferView::Pimpl to ease maintence.
4709 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4710 correctly. Also use SetCursorIntern instead of SetCursor.
4712 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4715 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4717 * src/WorkArea.C (belowMouse): manually implement below mouse.
4719 * src/*: Add "explicit" on several constructors, I added probably
4720 some unneeded ones. A couple of changes to code because of this.
4722 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4723 implementation and private parts from the users of BufferView. Not
4726 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4727 implementation and private parts from the users of LyXLex. Not
4730 * src/BufferView_pimpl.[Ch]: new files
4732 * src/lyxlex_pimpl.[Ch]: new files
4734 * src/LyXView.[Ch]: some inline functions move out-of-line
4736 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4738 * src/lyxparagraph.h: make struct InsetTable public.
4740 * src/support/lyxstring.h: change lyxstring::difference_type to be
4741 ptrdiff_t. Add std:: modifiers to streams.
4743 * src/font.C: include the <cctype> header, for islower() and
4746 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4748 * src/font.[Ch]: new files. Contains the metric functions for
4749 fonts, takes a LyXFont as parameter. Better separation of concepts.
4751 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4752 changes because of this.
4754 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4756 * src/*: compile with -Winline and move functions that don't
4759 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4762 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4764 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4765 (various files changed because of this)
4767 * src/Painter.C (text): fixed the drawing of smallcaps.
4769 * src/lyxfont.[Ch] (drawText): removed unused member func.
4772 * src/*.C: added needed "using" statements and "std::" qualifiers.
4774 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4776 * src/*.h: removed all use of "using" from header files use
4777 qualifier std:: instead.
4779 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4781 * src/text.C (Backspace): some additional cleanups (we already
4782 know whether cursor.pos is 0 or not).
4784 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4785 automake does not provide one).
4787 * src/bmtable.h: replace C++ comments with C comments.
4789 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4791 * src/screen.C (ShowCursor): Change the shape of the cursor if
4792 the current language is not equal to the language of the document.
4793 (If the cursor change its shape unexpectedly, then you've found a bug)
4795 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4798 * src/insets/insetnumber.[Ch]: New files.
4800 * src/LyXAction.C (init)
4801 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4804 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4806 * src/lyxparagraph.h
4807 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4808 (the vector is kept sorted).
4810 * src/text.C (GetVisibleRow): Draw selection correctly when there
4811 is both LTR and RTL text.
4813 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4814 which is much faster.
4816 * src/text.C (GetVisibleRow and other): Do not draw the last space
4817 in a row if the direction of the last letter is not equal to the
4818 direction of the paragraph.
4820 * src/lyxfont.C (latexWriteStartChanges):
4821 Check that font language is not equal to basefont language.
4822 (latexWriteEndChanges): ditto
4824 * src/lyx_cb.C (StyleReset): Don't change the language while using
4825 the font-default command.
4827 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4828 empty paragraph before a footnote.
4830 * src/insets/insetcommand.C (draw): Increase x correctly.
4832 * src/screen.C (ShowCursor): Change cursor shape if
4833 current language != document language.
4835 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4837 2000-03-31 Juergen Vigna <jug@sad.it>
4839 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4840 (Clone): changed mode how the paragraph-data is copied to the
4841 new clone-paragraph.
4843 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4844 GetInset(pos) with no inset anymore there (in inset UNDO)
4846 * src/insets/insetcommand.C (draw): small fix as here x is
4847 incremented not as much as width() returns (2 before, 2 behind = 4)
4849 2000-03-30 Juergen Vigna <jug@sad.it>
4851 * src/insets/insettext.C (InsetText): small fix in initialize
4852 widthOffset (should not be done in the init() function)
4854 2000-03-29 Amir Karger <karger@lyx.org>
4856 * lib/examples/it_ItemizeBullets.lyx: translation by
4859 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4861 2000-03-29 Juergen Vigna <jug@sad.it>
4863 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4865 * src/insets/insetfoot.C (Clone): small change as for the below
4866 new init function in the text-inset
4868 * src/insets/insettext.C (init): new function as I've seen that
4869 clone did not copy the Paragraph-Data!
4870 (LocalDispatch): Added code so that now we have some sort of Undo
4871 functionality (well actually we HAVE Undo ;)
4873 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4875 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4877 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4880 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4882 * src/main.C: added a runtime check that verifies that the xforms
4883 header used when building LyX and the library used when running
4884 LyX match. Exit with a message if they don't match. This is a
4885 version number check only.
4887 * src/buffer.C (save): Don't allocate memory on the heap for
4888 struct utimbuf times.
4890 * *: some using changes, use iosfwd instead of the real headers.
4892 * src/lyxfont.C use char const * instead of string for the static
4893 strings. Rewrite some functions to use sstream.
4895 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4897 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4900 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4902 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4903 of Geodesy (from Martin Vermeer)
4905 * lib/layouts/svjour.inc: include file for the Springer svjour
4906 class. It can be used to support journals other than JoG.
4908 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4909 Miskiewicz <misiek@pld.org.pl>)
4910 * lib/reLyX/Makefile.am: ditto.
4912 2000-03-27 Juergen Vigna <jug@sad.it>
4914 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4915 also some modifications with operations on selected text.
4917 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4918 problems with clicking on insets (last famous words ;)
4920 * src/insets/insetcommand.C (draw):
4921 (width): Changed to have a bit of space before and after the inset so
4922 that the blinking cursor can be seen (otherwise it was hidden)
4924 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4926 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4927 would not be added to the link list when an installed gettext (not
4928 part of libc) is found.
4930 2000-03-24 Juergen Vigna <jug@sad.it>
4932 * src/insets/insetcollapsable.C (Edit):
4933 * src/mathed/formula.C (InsetButtonRelease):
4934 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4937 * src/BufferView.C (workAreaButtonPress):
4938 (workAreaButtonRelease):
4939 (checkInsetHit): Finally fixed the clicking on insets be handled
4942 * src/insets/insetert.C (Edit): inserted this call so that ERT
4943 insets work always with LaTeX-font
4945 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4947 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4948 caused lyx to startup with no GUI in place, causing in a crash
4949 upon startup when called with arguments.
4951 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4953 * src/FontLoader.C: better initialization of dummyXFontStruct.
4955 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4957 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4958 for linuxdoc and docbook import and export format options.
4960 * lib/lyxrc.example Example of default values for the previous flags.
4962 * src/lyx_cb.C Use those flags instead of the hardwired values for
4963 linuxdoc and docbook export.
4965 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4968 * src/menus.C Added menus entries for the new import/exports formats.
4970 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4972 * src/lyxrc.*: Added support for running without Gui
4975 * src/FontLoader.C: sensible defaults if no fonts are needed
4977 * src/lyx_cb.C: New function ShowMessage (writes either to the
4978 minibuffer or cout in case of no gui
4979 New function AskOverwrite for common stuff
4980 Consequently various changes to call these functions
4982 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4983 wild guess at sensible screen resolution when having no gui
4985 * src/lyxfont.C: no gui, no fonts... set some defaults
4987 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4989 * src/LColor.C: made the command inset background a bit lighter.
4991 2000-03-20 Hartmut Goebel <goebel@noris.net>
4993 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4994 stdstruct.inc. Koma-Script added some title elements which
4995 otherwise have been listed below "bibliography". This split allows
4996 adding title elements to where they belong.
4998 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4999 define the additional tilte elements and then include
5002 * many other layout files: changed to include stdtitle.inc just
5003 before stdstruct.inc.
5005 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5007 * src/buffer.C: (save) Added the option to store all backup files
5008 in a single directory
5010 * src/lyxrc.[Ch]: Added variable \backupdir_path
5012 * lib/lyxrc.example: Added descriptions of recently added variables
5014 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5015 bibtex inset, not closing the bibtex popup when deleting the inset)
5017 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5019 * src/lyx_cb.C: add a couple using directives.
5021 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5022 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5023 import based on the filename.
5025 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5026 file would be imported at start, if the filename where of a sgml file.
5028 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5030 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5032 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5033 * src/lyxfont.h Replaced the member variable bits.direction by the
5034 member variable lang. Made many changes in other files.
5035 This allows having a multi-lingual document
5037 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5038 that change the current language to <l>.
5039 Removed the command "font-rtl"
5041 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5042 format for Hebrew documents)
5044 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5045 When auto_mathmode is "true", pressing a digit key in normal mode
5046 will cause entering into mathmode.
5047 If auto_mathmode is "rtl" then this behavior will be active only
5048 when writing right-to-left text.
5050 * src/text2.C (InsertStringA) The string is inserted using the
5053 * src/paragraph.C (GetEndLabel) Gives a correct result for
5054 footnote paragraphs.
5056 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5058 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5060 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5061 front of PasteParagraph. Never insert a ' '. This should at least
5062 fix some cause for the segfaults that we have been experiencing,
5063 it also fixes backspace behaviour slightly. (Phu!)
5065 * src/support/lstrings.C (compare_no_case): some change to make it
5066 compile with gcc 2.95.2 and stdlibc++-v3
5068 * src/text2.C (MeltFootnoteEnvironment): change type o
5069 first_footnote_par_is_not_empty to bool.
5071 * src/lyxparagraph.h: make text private. Changes in other files
5073 (fitToSize): new function
5074 (setContentsFromPar): new function
5075 (clearContents): new function
5076 (SetChar): new function
5078 * src/paragraph.C (readSimpleWholeFile): deleted.
5080 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5081 the file, just use a simple string instead. Also read the file in
5082 a more maintainable manner.
5084 * src/text2.C (InsertStringA): deleted.
5085 (InsertStringB): deleted.
5087 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5089 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5090 RedoParagraphs from the doublespace handling part, just set status
5091 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5092 done, but perhaps not like this.)
5094 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5096 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5097 character when inserting an inset.
5099 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5101 * src/bufferparams.C (readLanguage): now takes "default" into
5104 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5105 also initialize the toplevel_keymap with the default bindings from
5108 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5110 * all files using lyxrc: have lyxrc as a real variable and not a
5111 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5114 * src/lyxrc.C: remove double call to defaultKeyBindings
5116 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5117 toolbar defauls using lyxlex. Remove enums, structs, functions
5120 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5121 toolbar defaults. Also store default keybindings in a map.
5123 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5124 storing the toolbar defaults without any xforms dependencies.
5126 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5127 applied. Changed to use iterators.
5129 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5131 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5132 systems that don't have LINGUAS set to begin with.
5134 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5136 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5137 the list by Dekel Tsur.
5139 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5141 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5142 * src/insets/form_graphics.C: ditto.
5144 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5146 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5148 * src/bufferparams.C (readLanguage): use the new language map
5150 * src/intl.C (InitKeyMapper): use the new language map
5152 * src/lyx_gui.C (create_forms): use the new language map
5154 * src/language.[Ch]: New files. Used for holding the information
5155 about each language. Now! Use this new language map enhance it and
5156 make it really usable for our needs.
5158 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5160 * screen.C (ShowCursor): Removed duplicate code.
5161 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5162 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5164 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5167 * src/text.C Added TransformChar method. Used for rendering Arabic
5168 text correctly (change the glyphs of the letter according to the
5169 position in the word)
5174 * src/lyxrc.C Added lyxrc command {language_command_begin,
5175 language_command_end,language_command_ltr,language_command_rtl,
5176 language_package} which allows the use of either arabtex or Omega
5179 * src/lyx_gui.C (init)
5181 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5182 to use encoding for menu fonts which is different than the encoding
5185 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5186 do not load the babel package.
5187 To write an English document with Hebrew/Arabic, change the document
5188 language to "english".
5190 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5191 (alphaCounter): changed to return char
5192 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5194 * lib/lyxrc.example Added examples for Hebrew/Arabic
5197 * src/layout.C Added layout command endlabeltype
5199 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5201 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5203 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5205 * src/mathed/math_delim.C (search_deco): return a
5206 math_deco_struct* instead of index.
5208 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5210 * All files with a USE_OSTREAM_ONLY within: removed all code that
5211 was unused when USE_OSTREAM_ONLY is defined.
5213 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5214 of any less. Removed header and using.
5216 * src/text.C (GetVisibleRow): draw the string "Page Break
5217 (top/bottom)" on screen when drawing a pagebreak line.
5219 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5221 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5223 * src/mathed/math_macro.C (draw): do some cast magic.
5226 * src/mathed/math_defs.h: change byte* argument to byte const*.
5228 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5230 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5231 know it is right to return InsetFoot* too, but cxx does not like
5234 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5236 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5238 * src/mathed/math_delim.C: change == to proper assignment.
5240 2000-03-09 Juergen Vigna <jug@sad.it>
5242 * src/insets/insettext.C (setPos): fixed various cursor positioning
5243 problems (via mouse and cursor-keys)
5244 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5245 inset (still a small display problem but it works ;)
5247 * src/insets/insetcollapsable.C (draw): added button_top_y and
5248 button_bottom_y to have correct values for clicking on the inset.
5250 * src/support/lyxalgo.h: commented out 'using std::less'
5252 2000-03-08 Juergen Vigna <jug@sad.it>
5254 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5255 Button-Release event closes as it is alos the Release-Event
5258 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5260 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5262 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5263 can add multiple spaces in Scrap (literate programming) styles...
5264 which, by the way, is how I got hooked on LyX to begin with.
5266 * src/mathed/formula.C (Write): Added dummy variable to an
5267 inset::Latex() call.
5268 (Latex): Add free_spacing boolean to inset::Latex()
5270 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5272 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5273 virtual function to include the free_spacing boolean from
5274 the containing paragraph's style.
5276 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5277 Added free_spacing boolean arg to match inset.h
5279 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5280 Added free_spacing boolean arg to match inset.h
5282 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5283 Added free_spacing boolean and made sure that if in a free_spacing
5284 paragraph, that we output normal space if there is a protected space.
5286 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5287 Added free_spacing boolean arg to match inset.h
5289 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5290 Added free_spacing boolean arg to match inset.h
5292 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5293 Added free_spacing boolean arg to match inset.h
5295 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5296 Added free_spacing boolean arg to match inset.h
5298 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5299 Added free_spacing boolean arg to match inset.h
5301 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5302 free_spacing boolean arg to match inset.h
5304 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5305 Added free_spacing boolean arg to match inset.h
5307 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5308 Added free_spacing boolean arg to match inset.h
5310 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5311 Added free_spacing boolean arg to match inset.h
5313 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5314 Added free_spacing boolean arg to match inset.h
5316 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5317 Added free_spacing boolean arg to match inset.h
5319 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5320 free_spacing boolean arg to match inset.h
5322 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5323 free_spacing boolean arg to match inset.h
5325 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5326 ignore free_spacing paragraphs. The user's spaces are left
5329 * src/text.C (InsertChar): Fixed the free_spacing layout
5330 attribute behavior. Now, if free_spacing is set, you can
5331 add multiple spaces in a paragraph with impunity (and they
5332 get output verbatim).
5333 (SelectSelectedWord): Added dummy argument to inset::Latex()
5336 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5339 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5340 paragraph layouts now only input a simple space instead.
5341 Special character insets don't make any sense in free-spacing
5344 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5345 hard-spaces in the *input* file to simple spaces if the layout
5346 is free-spacing. This converts old files which had to have
5347 hard-spaces in free-spacing layouts where a simple space was
5349 (writeFileAscii): Added free_spacing check to pass to the newly
5350 reworked inset::Latex(...) methods. The inset::Latex() code
5351 ensures that hard-spaces in free-spacing paragraphs get output
5352 as spaces (rather than "~").
5354 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5356 * src/mathed/math_delim.C (draw): draw the empty placeholder
5357 delims with a onoffdash line.
5358 (struct math_deco_compare): struct that holds the "functors" used
5359 for the sort and the binary search in math_deco_table.
5360 (class init_deco_table): class used for initial sort of the
5362 (search_deco): use lower_bound to do a binary search in the
5365 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * src/lyxrc.C: a small secret thingie...
5369 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5370 and to not flush the stream as often as it used to.
5372 * src/support/lyxalgo.h: new file
5373 (sorted): template function used for checking if a sequence is
5374 sorted or not. Two versions with and without user supplied
5375 compare. Uses same compare as std::sort.
5377 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5378 it and give warning on lyxerr.
5380 (struct compare_tags): struct with function operators used for
5381 checking if sorted, sorting and lower_bound.
5382 (search_kw): use lower_bound instead of manually implemented
5385 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5387 * src/insets/insetcollapsable.h: fix Clone() declaration.
5388 * src/insets/insetfoot.h: ditto.
5390 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5392 2000-03-08 Juergen Vigna <jug@sad.it>
5394 * src/insets/lyxinset.h: added owner call which tells us if
5395 this inset is inside another inset. Changed also the return-type
5396 of Editable to an enum so it tells clearer what the return-value is.
5398 * src/insets/insettext.C (computeTextRows): fixed computing of
5399 textinsets which split automatically on more rows.
5401 * src/insets/insetert.[Ch]: changed this to be of BaseType
5404 * src/insets/insetfoot.[Ch]: added footnote inset
5406 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5407 collapsable insets (like footnote, ert, ...)
5409 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5411 * src/lyxdraw.h: remvoe file
5413 * src/lyxdraw.C: remove file
5415 * src/insets/insettext.C: added <algorithm>.
5417 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5420 (matrix_cb): case MM_OK use string stream
5422 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5425 * src/mathed/math_macro.C (draw): use string stream
5426 (Metrics): use string stream
5428 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5429 directly to the ostream.
5431 * src/vspace.C (asString): use string stream.
5432 (asString): use string stream
5433 (asLatexString): use string stream
5435 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5436 setting Spacing::Other.
5438 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5439 sprintf when creating the stretch vale.
5441 * src/text2.C (alphaCounter): changed to return a string and to
5442 not use a static variable internally. Also fixed a one-off bug.
5443 (SetCounter): changed the drawing of the labels to use string
5444 streams instead of sprintf.
5446 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5447 manipulator to use a scheme that does not require library support.
5448 This is also the way it is done in the new GNU libstdc++. Should
5449 work with DEC cxx now.
5451 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5453 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5454 end. This fixes a bug.
5456 * src/mathed (all files concerned with file writing): apply the
5457 USE_OSTREAM_ONLY changes to mathed too.
5459 * src/support/DebugStream.h: make the constructor explicit.
5461 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5462 count and ostream squashed.
5464 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5466 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5468 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5469 ostringstream uses STL strings, and we might not.
5471 * src/insets/insetspecialchar.C: add using directive.
5472 * src/insets/insettext.C: ditto.
5474 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5476 * lib/layouts/seminar.layout: feeble attempt at a layout for
5477 seminar.cls, far from completet and could really use some looking
5478 at from people used to write layout files.
5480 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5481 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5482 a lot nicer and works nicely with ostreams.
5484 * src/mathed/formula.C (draw): a slightly different solution that
5485 the one posted to the list, but I think this one works too. (font
5486 size wrong in headers.)
5488 * src/insets/insettext.C (computeTextRows): some fiddling on
5489 Jürgens turf, added some comments that he should read.
5491 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5492 used and it gave compiler warnings.
5493 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5496 * src/lyx_gui.C (create_forms): do the right thing when
5497 show_banner is true/false.
5499 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5500 show_banner is false.
5502 * most file writing files: Now use iostreams to do almost all of
5503 the writing. Also instead of passing string &, we now use
5504 stringstreams. mathed output is still not adapted to iostreams.
5505 This change can be turned off by commenting out all the occurences
5506 of the "#define USE_OSTREAM_ONLY 1" lines.
5508 * src/WorkArea.C (createPixmap): don't output debug messages.
5509 (WorkArea): don't output debug messages.
5511 * lib/lyxrc.example: added a comment about the new variable
5514 * development/Code_rules/Rules: Added some more commente about how
5515 to build class interfaces and on how better encapsulation can be
5518 2000-03-03 Juergen Vigna <jug@sad.it>
5520 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5521 automatically with the width of the LyX-Window
5523 * src/insets/insettext.C (computeTextRows): fixed update bug in
5524 displaying text-insets (scrollvalues where not initialized!)
5526 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5528 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5529 id in the check of the result from lower_bound is not enough since
5530 lower_bound can return last too, and then res->id will not be a
5533 * all insets and some code that use them: I have conditionalized
5534 removed the Latex(string & out, ...) this means that only the
5535 Latex(ostream &, ...) will be used. This is a work in progress to
5536 move towards using streams for all output of files.
5538 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5541 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5543 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5544 routine (this fixes bug where greek letters were surrounded by too
5547 * src/support/filetools.C (findtexfile): change a bit the search
5548 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5549 no longer passed to kpsewhich, we may have to change that later.
5551 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5552 warning options to avoid problems with X header files (from Angus
5554 * acinclude.m4: regenerated.
5556 2000-03-02 Juergen Vigna <jug@sad.it>
5558 * src/insets/insettext.C (WriteParagraphData): Using the
5559 par->writeFile() function for writing paragraph-data.
5560 (Read): Using buffer->parseSingleLyXformat2Token()-function
5561 for parsing paragraph data!
5563 * src/buffer.C (readLyXformat2): removed all parse data and using
5564 the new parseSingleLyXformat2Token()-function.
5565 (parseSingleLyXformat2Token): added this function to parse (read)
5566 lyx-file-format (this is called also from text-insets now!)
5568 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5570 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5573 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5574 directly instead of going through a func. One very bad thing: a
5575 static LyXFindReplace, but I don't know where to place it.
5577 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5578 string instead of char[]. Also changed to static.
5579 (GetSelectionOrWordAtCursor): changed to static inline
5580 (SetSelectionOverLenChars): ditto.
5582 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5583 current_view and global variables. both classes has changed names
5584 and LyXFindReplace is not inherited from SearchForm.
5586 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5587 fl_form_search form.
5589 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5591 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5593 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5594 bound (from Kayvan).
5596 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5598 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5600 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5602 * some things that I should comment but the local pub says head to
5605 * comment out all code that belongs to the Roff code for Ascii
5606 export of tables. (this is unused)
5608 * src/LyXView.C: use correct type for global variable
5609 current_layout. (LyXTextClass::size_type)
5611 * some code to get the new insetgraphics closer to working I'd be
5612 grateful for any help.
5614 * src/BufferView2.C (insertInset): use the return type of
5615 NumberOfLayout properly. (also changes in other files)
5617 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5618 this as a test. I want to know what breaks because of this.
5620 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5622 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5624 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5625 to use a \makebox in the label, this allows proper justification
5626 with out using protected spaces or multiple hfills. Now it is
5627 "label" for left justified, "\hfill label\hfill" for center, and
5628 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5629 should be changed accordingly.
5631 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5633 * src/lyxtext.h: change SetLayout() to take a
5634 LyXTextClass::size_type instead of a char (when there is more than
5635 127 layouts in a class); also change type of copylayouttype.
5636 * src/text2.C (SetLayout): ditto.
5637 * src/LyXView.C (updateLayoutChoice): ditto.
5639 * src/LaTeX.C (scanLogFile): errors where the line number was not
5640 given just after the '!'-line were ignored (from Dekel Tsur).
5642 * lib/lyxrc.example: fix description of \date_insert_format
5644 * lib/layouts/llncs.layout: new layout, contributed by Martin
5647 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5649 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5650 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5651 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5652 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5653 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5654 paragraph.C, text.C, text2.C)
5656 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5658 * src/insets/insettext.C (LocalDispatch): remove extra break
5661 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5662 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5664 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5665 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5667 * src/insets/insetbib.h: move InsetBibkey::Holder and
5668 InsetCitation::Holder in public space.
5670 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5672 * src/insets/insettext.h: small change to get the new files from
5673 Juergen to compile (use "string", not "class string").
5675 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5676 const & as parameter to LocalDispatch, use LyXFont const & as
5677 paramter to some other func. This also had impacto on lyxinsets.h
5678 and the two mathed insets.
5680 2000-02-24 Juergen Vigna <jug@sad.it>
5683 * src/commandtags.h:
5685 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5689 * src/BufferView2.C: added/updated code for various inset-functions
5691 * src/insets/insetert.[Ch]: added implementation of InsetERT
5693 * src/insets/insettext.[Ch]: added implementation of InsetText
5695 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5696 (draw): added preliminary code for inset scrolling not finshed yet
5698 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5699 as it is in lyxfunc.C now
5701 * src/insets/lyxinset.h: Added functions for text-insets
5703 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5705 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5706 BufferView and reimplement the list as a queue put inside its own
5709 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5711 * several files: use the new interface to the "updateinsetlist"
5713 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5715 (work_area_handler): call BufferView::trippleClick on trippleclick.
5717 * src/BufferView.C (doubleClick): new function, selects word on
5719 (trippleClick): new function, selects line on trippleclick.
5721 2000-02-22 Allan Rae <rae@lyx.org>
5723 * lib/bind/xemacs.bind: buffer-previous not supported
5725 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5727 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5730 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5732 * src/bufferlist.C: get rid of current_view from this file
5734 * src/spellchecker.C: get rid of current_view from this file
5736 * src/vspace.C: get rid of current_view from this file
5737 (inPixels): added BufferView parameter for this func
5738 (asLatexCommand): added a BufferParams for this func
5740 * src/text.C src/text2.C: get rid of current_view from these
5743 * src/lyxfont.C (getFontDirection): move this function here from
5746 * src/bufferparams.C (getDocumentDirection): move this function
5749 * src/paragraph.C (getParDirection): move this function here from
5751 (getLetterDirection): ditto
5753 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5755 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5756 resize due to wrong pixmap beeing used. Also took the opurtunity
5757 to make the LyXScreen stateless on regard to WorkArea and some
5758 general cleanup in the same files.
5760 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5762 * src/Makefile.am: add missing direction.h
5764 * src/PainterBase.h: made the width functions const.
5766 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5769 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5771 * src/insets/insetlatexaccent.C (draw): make the accents draw
5772 better, at present this will only work well with iso8859-1.
5774 * several files: remove the old drawing code, now we use the new
5777 * several files: remove support for mono_video, reverse_video and
5780 2000-02-17 Juergen Vigna <jug@sad.it>
5782 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5783 int ** as we have to return the pointer, otherwise we have only
5784 NULL pointers in the returning function.
5786 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5788 * src/LaTeX.C (operator()): quote file name when running latex.
5790 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5793 (bubble tip), this removes our special handling of this.
5795 * Remove all code that is unused now that we have the new
5796 workarea. (Code that are not active when NEW_WA is defined.)
5798 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5800 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5802 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5803 nonexisting layout; correctly redirect obsoleted layouts.
5805 * lib/lyxrc.example: document \view_dvi_paper_option
5807 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5810 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5811 (PreviewDVI): handle the view_dvi_paper_option variable.
5812 [Both from Roland Krause]
5814 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5816 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5817 char const *, int, LyXFont)
5818 (text(int, int, string, LyXFont)): ditto
5820 * src/text.C (InsertCharInTable): attempt to fix the double-space
5821 feature in tables too.
5822 (BackspaceInTable): ditto.
5823 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5825 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5829 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5830 newly found text in textcache to this.
5831 (buffer): set the owner of the text put into the textcache to 0
5833 * src/insets/figinset.C (draw): fixed the drawing of figures with
5836 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5837 drawing of mathframe, hfills, protected space, table lines. I have
5838 now no outstanding drawing problems with the new Painter code.
5840 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5842 * src/PainterBase.C (ellipse, circle): do not specify the default
5845 * src/LColor.h: add using directive.
5847 * src/Painter.[Ch]: change return type of methods from Painter& to
5848 PainterBase&. Add a using directive.
5850 * src/WorkArea.C: wrap xforms callbacks in C functions
5853 * lib/layouts/foils.layout: font fix and simplifications from Carl
5856 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5858 * a lot of files: The Painter, LColor and WorkArea from the old
5859 devel branch has been ported to lyx-devel. Some new files and a
5860 lot of #ifdeffed code. The new workarea is enabled by default, but
5861 if you want to test the new Painter and LColor you have to compile
5862 with USE_PAINTER defined (do this in config.h f.ex.) There are
5863 still some rought edges, and I'd like some help to clear those
5864 out. It looks stable (loads and displays the Userguide very well).
5867 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5869 * src/buffer.C (pop_tag): revert to the previous implementation
5870 (use a global variable for both loops).
5872 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5874 * src/lyxrc.C (LyXRC): change slightly default date format.
5876 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5877 there is an English text with a footnote that starts with a Hebrew
5878 paragraph, or vice versa.
5879 (TeXFootnote): ditto.
5881 * src/text.C (LeftMargin): allow for negative values for
5882 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5885 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5886 for input encoding (cyrillic)
5888 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5890 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5893 * src/toolbar.C (set): ditto
5894 * src/insets/insetbib.C (create_form_citation_form): ditto
5896 * lib/CREDITS: added Dekel Tsur.
5898 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5899 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5900 hebrew supports files from Dekel Tsur.
5902 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5903 <tzafrir@technion.ac.il>
5905 * src/lyxrc.C: put \date_insert_format at the right place.
5907 * src/buffer.C (makeLaTeXFile): fix the handling of
5908 BufferParams::sides when writing out latex files.
5910 * src/BufferView2.C: add a "using" directive.
5912 * src/support/lyxsum.C (sum): when we use lyxstring,
5913 ostringstream::str needs an additional .c_str().
5915 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5917 * src/support/filetools.C (ChangeExtension): patch from Etienne
5920 * src/TextCache.C (show): remove const_cast and make second
5921 parameter non-const LyXText *.
5923 * src/TextCache.h: use non const LyXText in show.
5925 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5928 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5930 * src/support/lyxsum.C: rework to be more flexible.
5932 * several places: don't check if a pointer is 0 if you are going
5935 * src/text.C: remove some dead code.
5937 * src/insets/figinset.C: remove some dead code
5939 * src/buffer.C: move the BufferView funcs to BufferView2.C
5940 remove all support for insetlatexdel
5941 remove support for oldpapersize stuff
5942 made some member funcs const
5944 * src/kbmap.C: use a std::list to store the bindings in.
5946 * src/BufferView2.C: new file
5948 * src/kbsequence.[Ch]: new files
5950 * src/LyXAction.C + others: remove all trace of buffer-previous
5952 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5953 only have one copy in the binary of this table.
5955 * hebrew patch: moved some functions from LyXText to more
5956 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5958 * several files: remove support for XForms older than 0.88
5960 remove some #if 0 #endif code
5962 * src/TextCache.[Ch]: new file. Holds the textcache.
5964 * src/BufferView.C: changes to use the new TextCache interface.
5965 (waitForX): remove the now unused code.
5967 * src/BackStack.h: remove some commented code
5969 * lib/bind/emacs.bind: remove binding for buffer-previous
5971 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5973 * applied the hebrew patch.
5975 * src/lyxrow.h: make sure that all Row variables are initialized.
5977 * src/text2.C (TextHandleUndo): comment out a delete, this might
5978 introduce a memory leak, but should also help us to not try to
5979 read freed memory. We need to look at this one.
5981 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5982 (LyXParagraph): initalize footnotekind.
5984 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5985 forgot this when applying the patch. Please heed the warnings.
5987 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5988 (aka. reformat problem)
5990 * src/bufferlist.C (exists): made const, and use const_iterator
5991 (isLoaded): new func.
5992 (release): use std::find to find the correct buffer.
5994 * src/bufferlist.h: made getState a const func.
5995 made empty a const func.
5996 made exists a const func.
5999 2000-02-01 Juergen Vigna <jug@sad.it>
6001 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6003 * po/it.po: updated a bit the italian po file and also changed the
6004 'file nuovo' for newfile to 'filenuovo' without a space, this did
6007 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6008 for the new insert_date command.
6010 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6011 from jdblair, to insert a date into the current text conforming to
6012 a strftime format (for now only considering the locale-set and not
6013 the document-language).
6015 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6017 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6018 Bounds Read error seen by purify. The problem was that islower is
6019 a macros which takes an unsigned char and uses it as an index for
6020 in array of characters properties (and is thus subject to the
6024 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6025 correctly the paper sides radio buttons.
6026 (UpdateDocumentButtons): ditto.
6028 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6030 * src/kbmap.C (getsym + others): change to return unsigned int,
6031 returning a long can give problems on 64 bit systems. (I assume
6032 that int is 32bit on 64bit systems)
6034 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6036 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6037 LyXLookupString to be zero-terminated. Really fixes problems seen
6040 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6042 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6043 write a (char*)0 to the lyxerr stream.
6045 * src/lastfiles.C: move algorithm before the using statemets.
6047 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6049 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6050 complains otherwise).
6051 * src/table.C: ditto
6053 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6056 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6057 that I removed earlier... It is really needed.
6059 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6061 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6063 * INSTALL: update xforms home page URL.
6065 * lib/configure.m4: fix a bug with unreadable layout files.
6067 * src/table.C (calculate_width_of_column): add "using std::max"
6070 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6072 * several files: marked several lines with "DEL LINE", this is
6073 lines that can be deleted without changing anything.
6074 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6075 checks this anyway */
6078 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6080 * src/DepTable.C (update): add a "+" at the end when the checksum
6081 is different. (debugging string only)
6083 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6084 the next inset to not be displayed. This should also fix the list
6085 of labels in the "Insert Crossreference" dialog.
6087 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6089 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6090 when regex was not found.
6092 * src/support/lstrings.C (lowercase): use handcoded transform always.
6095 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6096 old_cursor.par->prev could be 0.
6098 * several files: changed post inc/dec to pre inc/dec
6100 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6101 write the lastfiles to file.
6103 * src/BufferView.C (buffer): only show TextCache info when debugging
6105 (resizeCurrentBuffer): ditto
6106 (workAreaExpose): ditto
6108 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6110 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6112 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6113 a bit better by removing the special case for \i and \j.
6115 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6117 * src/lyx_main.C (easyParse): remove test for bad comand line
6118 options, since this broke all xforms-related parsing.
6120 * src/kbmap.C (getsym): set return type to unsigned long, as
6121 declared in header. On an alpha, long is _not_ the same as int.
6123 * src/support/LOstream.h: add a "using std::flush;"
6125 * src/insets/figinset.C: ditto.
6127 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6129 * src/bufferlist.C (write): use blinding fast file copy instead of
6130 "a char at a time", now we are doing it the C++ way.
6132 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6133 std::list<int> instead.
6134 (addpidwait): reflect move to std::list<int>
6135 (sigchldchecker): ditto
6137 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6140 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6141 that obviously was wrong...
6143 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6144 c, this avoids warnings with purify and islower.
6146 * src/insets/figinset.C: rename struct queue to struct
6147 queue_element and rewrite to use a std::queue. gsqueue is now a
6148 std::queue<queue_element>
6149 (runqueue): reflect move to std::queue
6152 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6153 we would get "1" "0" instead of "true" "false. Also make the tostr
6156 2000-01-21 Juergen Vigna <jug@sad.it>
6158 * src/buffer.C (writeFileAscii): Disabled code for special groff
6159 handling of tabulars till I fix this in table.C
6161 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6163 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6165 * src/support/lyxlib.h: ditto.
6167 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6169 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6170 and 'j' look better. This might fix the "macron" bug that has been
6173 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6174 functions as one template function. Delete the old versions.
6176 * src/support/lyxsum.C: move using std::ifstream inside
6179 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6182 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6184 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6186 * src/insets/figinset.C (InitFigures): use new instead of malloc
6187 to allocate memory for figures and bitmaps.
6188 (DoneFigures): use delete[] instead of free to deallocate memory
6189 for figures and bitmaps.
6190 (runqueue): use new to allocate
6191 (getfigdata): use new/delete[] instead of malloc/free
6192 (RegisterFigure): ditto
6194 * some files: moved some declarations closer to first use, small
6195 whitespace changes use preincrement instead of postincrement where
6196 it does not make a difference.
6198 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6199 step on the way to use stl::containers for key maps.
6201 * src/bufferlist.h: add a typedef for const_iterator and const
6202 versions of begin and end.
6204 * src/bufferlist.[Ch]: change name of member variable _state to
6205 state_. (avoid reserved names)
6207 (getFileNames): returns the filenames of the buffers in a vector.
6209 * configure.in (ALL_LINGUAS): added ro
6211 * src/support/putenv.C: new file
6213 * src/support/mkdir.C: new file
6215 2000-01-20 Allan Rae <rae@lyx.org>
6217 * lib/layouts/IEEEtran.layout: Added several theorem environments
6219 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6220 couple of minor additions.
6222 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6223 (except for those in footnotes of course)
6225 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6227 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6229 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6230 std::sort and std::lower_bound instead of qsort and handwritten
6232 (struct compara): struct that holds the functors used by std::sort
6233 and std::lower_bound in MathedLookupBOP.
6235 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6237 * src/support/LAssert.h: do not do partial specialization. We do
6240 * src/support/lyxlib.h: note that lyx::getUserName() and
6241 lyx::date() are not in use right now. Should these be suppressed?
6243 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6244 (makeLinuxDocFile): do not put date and user name in linuxdoc
6247 * src/support/lyxlib.h (kill): change first argument to long int,
6248 since that's what solaris uses.
6250 * src/support/kill.C (kill): fix declaration to match prototype.
6252 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6253 actually check whether namespaces are supported. This is not what
6256 * src/support/lyxsum.C: add a using directive.
6258 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6260 * src/support/kill.C: if we have namespace support we don't have
6261 to include lyxlib.h.
6263 * src/support/lyxlib.h: use namespace lyx if supported.
6265 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6267 * src/support/date.C: new file
6269 * src/support/chdir.C: new file
6271 * src/support/getUserName.C: new file
6273 * src/support/getcwd.C: new file
6275 * src/support/abort.C: new file
6277 * src/support/kill.C: new file
6279 * src/support/lyxlib.h: moved all the functions in this file
6280 insede struct lyx. Added also kill and abort to this struct. This
6281 is a way to avoid the "kill is not defined in <csignal>", we make
6282 C++ wrappers for functions that are not ANSI C or ANSI C++.
6284 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6285 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6286 lyx it has been renamed to sum.
6288 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6290 * src/text.C: add using directives for std::min and std::max.
6292 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6294 * src/texrow.C (getIdFromRow): actually return something useful in
6295 id and pos. Hopefully fixes the bug with positionning of errorbox
6298 * src/lyx_main.C (easyParse): output an error and exit if an
6299 incorrect command line option has been given.
6301 * src/spellchecker.C (ispell_check_word): document a memory leak.
6303 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6304 where a "struct utimbuf" is allocated with "new" and deleted with
6307 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6309 * src/text2.C (CutSelection): don't delete double spaces.
6310 (PasteSelection): ditto
6311 (CopySelection): ditto
6313 * src/text.C (Backspace): don't delete double spaces.
6315 * src/lyxlex.C (next): fix a bug that were only present with
6316 conformant std::istream::get to read comment lines, use
6317 std::istream::getline instead. This seems to fix the problem.
6319 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6321 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6322 allowed to insert space before space" editing problem. Please read
6323 commends at the beginning of the function. Comments about usage
6326 * src/text.C (InsertChar): fix for the "not allowed to insert
6327 space before space" editing problem.
6329 * src/text2.C (DeleteEmptyParagraphMechanism): when
6330 IsEmptyTableRow can only return false this last "else if" will
6331 always be a no-op. Commented out.
6333 * src/text.C (RedoParagraph): As far as I can understand tmp
6334 cursor is not really needed.
6336 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6337 present it could only return false anyway.
6338 (several functions): Did something not so smart...added a const
6339 specifier on a lot of methods.
6341 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6342 and add a tmp->text.resize. The LyXParagraph constructor does the
6344 (BreakParagraphConservative): ditto
6346 * src/support/path.h (Path): add a define so that the wrong usage
6347 "Path("/tmp") will be flagged as a compilation error:
6348 "`unnamed_Path' undeclared (first use this function)"
6350 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6352 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6353 which was bogus for several reasons.
6355 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6359 * autogen.sh: do not use "type -path" (what's that anyway?).
6361 * src/support/filetools.C (findtexfile): remove extraneous space
6362 which caused a kpsewhich warning (at least with kpathsea version
6365 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6367 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6369 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6371 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6373 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/paragraph.C (BreakParagraph): do not reserve space on text
6376 if we don't need to (otherwise, if pos_end < pos, we end up
6377 reserving huge amounts of memory due to bad unsigned karma).
6378 (BreakParagraphConservative): ditto, although I have not seen
6379 evidence the bug can happen here.
6381 * src/lyxparagraph.h: add a using std::list.
6383 2000-01-11 Juergen Vigna <jug@sad.it>
6385 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6388 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6390 * src/vc-backend.C (doVCCommand): change to be static and take one
6391 more parameter: the path to chdir too be fore executing the command.
6392 (retrive): new function equiv to "co -r"
6394 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6395 file_not_found_hook is true.
6397 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6399 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6400 if a file is readwrite,readonly...anything else.
6402 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6404 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6405 (CreatePostscript): name change from MenuRunDVIPS (or something)
6406 (PreviewPostscript): name change from MenuPreviewPS
6407 (PreviewDVI): name change from MenuPreviewDVI
6409 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6410 \view_pdf_command., \pdf_to_ps_command
6412 * lib/configure.m4: added search for PDF viewer, and search for
6413 PDF to PS converter.
6414 (lyxrc.defaults output): add \pdflatex_command,
6415 \view_pdf_command and \pdf_to_ps_command.
6417 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6419 * src/bufferlist.C (write): we don't use blocksize for anything so
6422 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6424 * src/support/block.h: disable operator T* (), since it causes
6425 problems with both compilers I tried. See comments in the file.
6427 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6430 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6431 variable LYX_DIR_10x to LYX_DIR_11x.
6433 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6435 * INSTALL: document --with-lyxname.
6438 * configure.in: new configure flag --with-lyxname which allows to
6439 choose the name under which lyx is installed. Default is "lyx", of
6440 course. It used to be possible to do this with --program-suffix,
6441 but the later has in fact a different meaning for autoconf.
6443 * src/support/lstrings.h (lstrchr): reformat a bit.
6445 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6446 * src/mathed/math_defs.h: ditto.
6448 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6450 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6451 true, decides if we create a backup file or not when saving. New
6452 tag and variable \pdf_mode, defaults to false. New tag and
6453 variable \pdflatex_command, defaults to pdflatex. New tag and
6454 variable \view_pdf_command, defaults to xpdf. New tag and variable
6455 \pdf_to_ps_command, defaults to pdf2ps.
6457 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6459 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6460 does not have a BufferView.
6461 (unlockInset): ditto + don't access the_locking_inset if the
6462 buffer does not have a BufferView.
6464 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6465 certain circumstances so that we don't continue a keyboard
6466 operation long after the key was released. Try f.ex. to load a
6467 large document, press PageDown for some seconds and then release
6468 it. Before this change the document would contine to scroll for
6469 some time, with this change it stops imidiatly.
6471 * src/support/block.h: don't allocate more space than needed. As
6472 long as we don't try to write to the arr[x] in a array_type arr[x]
6473 it is perfectly ok. (if you write to it you might segfault).
6474 added operator value_type*() so that is possible to pass the array
6475 to functions expecting a C-pointer.
6477 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6480 * intl/*: updated to gettext 0.10.35, tried to add our own
6481 required modifications. Please verify.
6483 * po/*: updated to gettext 0.10.35, tried to add our own required
6484 modifications. Please verify.
6486 * src/support/lstrings.C (tostr): go at fixing the problem with
6487 cxx and stringstream. When stringstream is used return
6488 oss.str().c_str() so that problems with lyxstring and basic_string
6489 are avoided. Note that the best solution would be for cxx to use
6490 basic_string all the way, but it is not conformant yet. (it seems)
6492 * src/lyx_cb.C + other files: moved several global functions to
6493 class BufferView, some have been moved to BufferView.[Ch] others
6494 are still located in lyx_cb.C. Code changes because of this. (part
6495 of "get rid of current_view project".)
6497 * src/buffer.C + other files: moved several Buffer functions to
6498 class BufferView, the functions are still present in buffer.C.
6499 Code changes because of this.
6501 * config/lcmessage.m4: updated to most recent. used when creating
6504 * config/progtest.m4: updated to most recent. used when creating
6507 * config/gettext.m4: updated to most recent. applied patch for
6510 * config/gettext.m4.patch: new file that shows what changes we
6511 have done to the local copy of gettext.m4.
6513 * config/libtool.m4: new file, used in creation of acinclude.m4
6515 * config/lyxinclude.m4: new file, this is the lyx created m4
6516 macros, used in making acinclude.m4.
6518 * autogen.sh: GNU m4 discovered as a separate task not as part of
6519 the lib/configure creation.
6520 Generate acinlucde from files in config. Actually cat
6521 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6522 easier to upgrade .m4 files that really are external.
6524 * src/Spacing.h: moved using std::istringstream to right after
6525 <sstream>. This should fix the problem seen with some compilers.
6527 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6529 * src/lyx_cb.C: began some work to remove the dependency a lot of
6530 functions have on BufferView::text, even if not really needed.
6531 (GetCurrentTextClass): removed this func, it only hid the
6534 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6535 forgot this in last commit.
6537 * src/Bullet.C (bulletEntry): use static char const *[] for the
6538 tables, becuase of this the return arg had to change to string.
6540 (~Bullet): removed unneeded destructor
6542 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6543 (insetSleep): moved from Buffer
6544 (insetWakeup): moved from Buffer
6545 (insetUnlock): moved from Buffer
6547 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6548 from Buffer to BufferView.
6550 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6552 * config/ltmain.sh: updated to version 1.3.4 of libtool
6554 * config/ltconfig: updated to version 1.3.4 of libtool
6556 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6560 Did I get that right?
6562 * src/lyxlex.h: add a "using" directive or two.
6563 * src/Spacing.h: ditto.
6564 * src/insets/figinset.C: ditto.
6565 * src/support/filetools.C: ditto.
6566 * src/support/lstrings.C: ditto.
6567 * src/BufferView.C: ditto.
6568 * src/bufferlist.C: ditto.
6569 * src/lyx_cb.C: ditto.
6570 * src/lyxlex.C: ditto.
6572 * NEWS: add some changes for 1.1.4.
6574 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * src/BufferView.C: first go at a TextCache to speed up switching
6579 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6581 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6582 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6583 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6584 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6587 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6588 members of the struct are correctly initialized to 0 (detected by
6590 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6591 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6593 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6594 pidwait, since it was allocated with "new". This was potentially
6595 very bad. Thanks to Michael Schmitt for running purify for us.
6598 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6600 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6602 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6604 1999-12-30 Allan Rae <rae@lyx.org>
6606 * lib/templates/IEEEtran.lyx: minor change
6608 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6609 src/mathed/formula.C (LocalDispatch): askForText changes
6611 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6612 know when a user has cancelled input. Fixes annoying problems with
6613 inserting labels and version control.
6615 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6617 * src/support/lstrings.C (tostr): rewritten to use strstream and
6620 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6622 * src/support/filetools.C (IsFileWriteable): use fstream to check
6623 (IsDirWriteable): use fileinfo to check
6625 * src/support/filetools.h (FilePtr): whole class deleted
6627 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6629 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6631 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6633 * src/bufferlist.C (write): use ifstream and ofstream instead of
6636 * src/Spacing.h: use istrstream instead of sscanf
6638 * src/mathed/math_defs.h: change first arg to istream from FILE*
6640 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6642 * src/mathed/math_parser.C: have yyis to be an istream
6643 (LexGetArg): use istream (yyis)
6645 (mathed_parse): ditto
6646 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6648 * src/mathed/formula.C (Read): rewritten to use istream
6650 * src/mathed/formulamacro.C (Read): rewritten to use istream
6652 * src/lyxlex.h (~LyXLex): deleted desturctor
6653 (getStream): new function, returns an istream
6654 (getFile): deleted funtion
6655 (IsOK): return is.good();
6657 * src/lyxlex.C (LyXLex): delete file and owns_file
6658 (setFile): open an filebuf and assign that to a istream instead of
6660 (setStream): new function, takes an istream as arg.
6661 (setFile): deleted function
6662 (EatLine): rewritten us use istream instead of FILE*
6666 * src/table.C (LyXTable): use istream instead of FILE*
6667 (Read): rewritten to take an istream instead of FILE*
6669 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6671 * src/buffer.C (Dispatch): remove an extraneous break statement.
6673 * src/support/filetools.C (QuoteName): change to do simple
6674 'quoting'. More work is necessary. Also changed to do nothing
6675 under emx (needs fix too).
6676 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6678 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6679 config.h.in to the AC_DEFINE_UNQUOTED() call.
6680 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6681 needs char * as argument (because Solaris 7 declares it like
6684 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6685 remove definition of BZERO.
6687 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6689 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6690 defined, "lyxregex.h" if not.
6692 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6694 (REGEX): new variable that is set to regex.c lyxregex.h when
6695 AM_CONDITIONAL USE_REGEX is set.
6696 (libsupport_la_SOURCES): add $(REGEX)
6698 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6701 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6704 * configure.in: add call to LYX_REGEX
6706 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6707 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6709 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6711 * lib/bind/fi_menus.bind: new file, from
6712 pauli.virtanen@saunalahti.fi.
6714 * src/buffer.C (getBibkeyList): pass the parameter delim to
6715 InsetInclude::getKeys and InsetBibtex::getKeys.
6717 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6718 is passed to Buffer::getBibkeyList
6720 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6721 instead of the hardcoded comma.
6723 * src/insets/insetbib.C (getKeys): make sure that there are not
6724 leading blanks in bibtex keys. Normal latex does not care, but
6725 harvard.sty seems to dislike blanks at the beginning of citation
6726 keys. In particular, the retturn value of the function is
6728 * INSTALL: make it clear that libstdc++ is needed and that gcc
6729 2.7.x probably does not work.
6731 * src/support/filetools.C (findtexfile): make debug message go to
6733 * src/insets/insetbib.C (getKeys): ditto
6735 * src/debug.C (showTags): make sure that the output is correctly
6738 * configure.in: add a comment for TWO_COLOR_ICON define.
6740 * acconfig.h: remove all the entries that already defined in
6741 configure.in or acinclude.m4.
6743 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6744 to avoid user name, date and copyright.
6746 1999-12-21 Juergen Vigna <jug@sad.it>
6748 * src/table.C (Read): Now read bogus row format informations
6749 if the format is < 5 so that afterwards the table can
6750 be read by lyx but without any format-info. Fixed the
6751 crash we experienced when not doing this.
6753 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6755 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6756 (RedoDrawingOfParagraph): ditto
6757 (RedoParagraphs): ditto
6758 (RemoveTableRow): ditto
6760 * src/text.C (Fill): rename arg paperwidth -> paper_width
6762 * src/buffer.C (insertLyXFile): rename var filename -> fname
6763 (writeFile): rename arg filename -> fname
6764 (writeFileAscii): ditto
6765 (makeLaTeXFile): ditto
6766 (makeLinuxDocFile): ditto
6767 (makeDocBookFile): ditto
6769 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6772 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6774 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6777 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6778 compiled by a C compiler not C++.
6780 * src/layout.h (LyXTextClass): added typedef for const_iterator
6781 (LyXTextClassList): added typedef for const_iterator + member
6782 functions begin and end.
6784 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6785 iterators to fill the choice_class.
6786 (updateLayoutChoice): rewritten to use iterators to fill the
6787 layoutlist in the toolbar.
6789 * src/BufferView.h (BufferView::work_area_width): removed unused
6792 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6794 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6795 (sgmlCloseTag): ditto
6797 * src/support/lstrings.h: return type of countChar changed to
6800 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6801 what version of this func to use. Also made to return unsigned int.
6803 * configure.in: call LYX_STD_COUNT
6805 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6806 conforming std::count.
6808 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6810 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6811 and a subscript would give bad display (patch from Dekel Tsur
6812 <dekel@math.tau.ac.il>).
6814 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6816 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6819 * src/chset.h: add a few 'using' directives
6821 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6822 triggered when no buffer is active
6824 * src/layout.C: removed `break' after `return' in switch(), since
6827 * src/lyx_main.C (init): make sure LyX can be ran in place even
6828 when libtool has done its magic with shared libraries. Fix the
6829 test for the case when the system directory has not been found.
6831 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6832 name for the latex file.
6833 (MenuMakeHTML): ditto
6835 * src/buffer.h: add an optional boolean argument, which is passed
6838 1999-12-20 Allan Rae <rae@lyx.org>
6840 * lib/templates/IEEEtran.lyx: small correction and update.
6842 * configure.in: Attempted to use LYX_PATH_HEADER
6844 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6846 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6847 input from JMarc. Now use preprocessor to find the header.
6848 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6849 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6850 LYX_STL_STRING_FWD. See comments in file.
6852 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6854 * The global MiniBuffer * minibuffer variable is dead.
6856 * The global FD_form_main * fd_form_main variable is dead.
6858 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6860 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6862 * src/table.h: add the LOstream.h header
6863 * src/debug.h: ditto
6865 * src/LyXAction.h: change the explaination of the ReadOnly
6866 attribute: is indicates that the function _can_ be used.
6868 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6871 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6873 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6879 * src/paragraph.C (GetWord): assert on pos>=0
6882 * src/support/lyxstring.C: condition the use of an invariant on
6884 * src/support/lyxstring.h: ditto
6886 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6887 Use LAssert.h instead of plain assert().
6889 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6891 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6892 * src/support/filetools.C: ditto
6894 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6897 * INSTALL: document the new configure flags
6899 * configure.in: suppress --with-debug; add --enable-assertions
6901 * acinclude.m4: various changes in alignment of help strings.
6903 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6905 * src/kbmap.C: commented out the use of the hash map in kb_map,
6906 beginning of movement to a stl::container.
6908 * several files: removed code that was not in effect when
6909 MOVE_TEXT was defined.
6911 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6912 for escaping should not be used. We can discuss if the string
6913 should be enclosed in f.ex. [] instead of "".
6915 * src/trans_mgr.C (insert): use the new returned value from
6916 encodeString to get deadkeys and keymaps done correctly.
6918 * src/chset.C (encodeString): changed to return a pair, to tell
6919 what to use if we know the string.
6921 * src/lyxscreen.h (fillArc): new function.
6923 * src/FontInfo.C (resize): rewritten to use more std::string like
6924 structore, especially string::replace.
6926 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6929 * configure.in (chmod +x some scripts): remove config/gcc-hack
6931 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6933 * src/buffer.C (writeFile): change once again the top comment in a
6934 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6935 instead of an hardcoded version number.
6936 (makeDocBookFile): ditto
6938 * src/version.h: add new define LYX_DOCVERSION
6940 * po/de.po: update from Pit Sütterlin
6941 * lib/bind/de_menus.bind: ditto.
6943 * src/lyxfunc.C (Dispatch): call MenuExport()
6944 * src/buffer.C (Dispatch): ditto
6946 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6947 LyXFunc::Dispatch().
6948 (MenuExport): new function, moved from
6949 LyXFunc::Dispatch().
6951 * src/trans_mgr.C (insert): small cleanup
6952 * src/chset.C (loadFile): ditto
6954 * lib/kbd/iso8859-1.cdef: add missing backslashes
6956 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6958 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6959 help with placing the manually drawn accents better.
6961 (Draw): x2 and hg changed to float to minimize rounding errors and
6962 help place the accents better.
6964 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6965 unsigned short to char is just wrong...cast the char to unsigned
6966 char instead so that the two values can compare sanely. This
6967 should also make the display of insetlatexaccents better and
6968 perhaps also some other insets.
6970 (lbearing): new function
6973 1999-12-15 Allan Rae <rae@lyx.org>
6975 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6976 header that provides a wrapper around the very annoying SGI STL header
6979 * src/support/lyxstring.C, src/LString.h:
6980 removed old SGI-STL-compatability attempts.
6982 * configure.in: Use LYX_STL_STRING_FWD.
6984 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6985 stl_string_fwd.h is around and try to determine it's location.
6986 Major improvement over previous SGI STL 3.2 compatability.
6987 Three small problems remain with this function due to my zero
6988 knowledge of autoconf. JMarc and lgb see the comments in the code.
6990 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6992 * src/broken_const.h, config/hack-gcc, config/README: removed
6994 * configure.in: remove --with-gcc-hack option; do not call
6997 * INSTALL: remove documentation of --with-broken-const and
7000 * acconfig.h: remove all trace of BROKEN_CONST define
7002 * src/buffer.C (makeDocBookFile): update version number in output
7004 (SimpleDocBookOnePar): fix an assert when trying to a character
7005 access beyond string length
7008 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7010 * po/de.po: fix the Export menu
7012 * lyx.man: update the description of -dbg
7014 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7015 (commandLineHelp): updated
7016 (easyParse): show list of available debug levels if -dbg is passed
7019 * src/Makefile.am: add debug.C
7021 * src/debug.h: moved some code to debug.C
7023 * src/debug.C: new file. Contains code to set and show debug
7026 * src/layout.C: remove 'break' after 'continue' in switch
7027 statements, since these cannot be reached.
7029 1999-12-13 Allan Rae <rae@lyx.org>
7031 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7032 (in_word_set): hash() -> math_hash()
7034 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7036 * acconfig.h: Added a test for whether we are using exceptions in the
7037 current compilation run. If so USING_EXCEPTIONS is defined.
7039 * config.in: Check for existance of stl_string_fwd.h
7040 * src/LString.h: If compiling --with-included-string and SGI's
7041 STL version 3.2 is present (see above test) we need to block their
7042 forward declaration of string and supply a __get_c_string().
7043 However, it turns out this is only necessary if compiling with
7044 exceptions enabled so I've a bit more to add yet.
7046 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7047 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7048 src/support/LRegex.h, src/undo.h:
7049 Shuffle the order of the included files a little to ensure that
7050 LString.h gets included before anything that includes stl_string_fwd.h
7052 * src/support/lyxstring.C: We need to #include LString.h instead of
7053 lyxstring.h to get the necessary definition of __get_c_string.
7054 (__get_c_string): New function. This is defined static just like SGI's
7055 although why they need to do this I'm not sure. Perhaps it should be
7056 in lstrings.C instead.
7058 * lib/templates/IEEEtran.lyx: New template file.
7060 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7062 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7063 * intl/Makefile.in (MKINSTALLDIRS): ditto
7065 * src/LyXAction.C (init): changed to hold the LFUN data in a
7066 automatic array in stead of in callso to newFunc, this speeds up
7067 compilation a lot. Also all the memory used by the array is
7068 returned when the init is completed.
7070 * a lot of files: compiled with -Wold-style-cast, changed most of
7071 the reported offenders to C++ style casts. Did not change the
7072 offenders in C files.
7074 * src/trans.h (Match): change argument type to unsigned int.
7076 * src/support/DebugStream.C: fix some types on the streambufs so
7077 that it works on a conforming implementation.
7079 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7081 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7083 * src/support/lyxstring.C: remove the inline added earlier since
7084 they cause a bunch of unsatisfied symbols when linking with dec
7085 cxx. Cxx likes to have the body of inlines at the place where they
7088 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7089 accessing negative bounds in array. This fixes the crash when
7090 inserting accented characters.
7091 * src/trans.h (Match): ditto
7093 * src/buffer.C (Dispatch): since this is a void, it should not try
7094 to return anything...
7096 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7098 * src/buffer.h: removed the two friends from Buffer. Some changes
7099 because of this. Buffer::getFileName and Buffer::setFileName
7100 renamed to Buffer::fileName() and Buffer::fileName(...).
7102 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7104 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7105 and Buffer::update(short) to BufferView. This move is currently
7106 controlled by a define MOVE_TEXT, this will be removed when all
7107 shows to be ok. This move paves the way for better separation
7108 between buffer contents and buffer view. One side effect is that
7109 the BufferView needs a rebreak when swiching buffers, if we want
7110 to avoid this we can add a cache that holds pointers to LyXText's
7111 that is not currently in use.
7113 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7116 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7118 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7120 * lyx_main.C: new command line option -x (or --execute) and
7121 -e (or --export). Now direct conversion from .lyx to .tex
7122 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7123 Unfortunately, X is still needed and the GUI pops up during the
7126 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7128 * src/Spacing.C: add a using directive to bring stream stuff into
7130 * src/paragraph.C: ditto
7131 * src/buffer.C: ditto
7133 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7134 from Lars' announcement).
7136 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7137 example files from Tino Meinen.
7139 1999-12-06 Allan Rae <rae@lyx.org>
7141 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7143 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7145 * src/support/lyxstring.C: added a lot of inline for no good
7148 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7149 latexWriteEndChanges, they were not used.
7151 * src/layout.h (operator<<): output operator for PageSides
7153 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7155 * some example files: loaded in LyX 1.0.4 and saved again to update
7156 certain constructs (table format)
7158 * a lot of files: did the change to use fstream/iostream for all
7159 writing of files. Done with a close look at Andre Poenitz's patch.
7161 * some files: whitespace changes.
7163 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7166 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7167 architecture, we provide our own. It is used unconditionnally, but
7168 I do not think this is a performance problem. Thanks to Angus
7169 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7170 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7172 (GetInset): use my_memcpy.
7176 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7177 it is easier to understand, but it uses less TeX-only constructs now.
7179 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7180 elements contain spaces
7182 * lib/configure: regenerated
7184 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7185 elements contain spaces; display the list of programs that are
7188 * autogen.sh: make sure lib/configure is executable
7190 * lib/examples/*: rename the tutorial examples to begin with the
7191 two-letters language code.
7193 * src/lyxfunc.C (getStatus): do not query current font if no
7196 * src/lyx_cb.C (RunScript): use QuoteName
7197 (MenuRunDvips): ditto
7198 (PrintApplyCB): ditto
7200 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7201 around argument, so that it works well with the current shell.
7202 Does not work properly with OS/2 shells currently.
7204 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7205 * src/LyXSendto.C (SendtoApplyCB): ditto
7206 * src/lyxfunc.C (Dispatch): ditto
7207 * src/buffer.C (runLaTeX): ditto
7208 (runLiterate): ditto
7209 (buildProgram): ditto
7211 * src/lyx_cb.C (RunScript): ditto
7212 (MenuMakeLaTeX): ditto
7214 * src/buffer.h (getLatexName): new method
7216 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7218 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7220 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7221 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7222 (create_math_panel): ditto
7224 * src/lyxfunc.C (getStatus): re-activate the code which gets
7225 current font and cursor; add test for export to html.
7227 * src/lyxrc.C (read): remove unreachable break statements; add a
7230 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7232 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7234 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7235 introduced by faulty regex.
7236 * src/buffer.C: ditto
7237 * src/lastfiles.C: ditto
7238 * src/paragraph.C: ditto
7239 * src/table.C: ditto
7240 * src/vspace.C: ditto
7241 * src/insets/figinset.C: ditto
7242 Note: most of these is absolutely harmless, except the one in
7243 src/mathed formula.C.
7245 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7247 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7248 operation, yielding correct results for the reLyX command.
7250 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7252 * src/support/filetools.C (ExpandPath): removed an over eager
7254 (ReplaceEnvironmentPath): ditto
7256 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7257 shows that we are doing something fishy in our code...
7261 * src/lyxrc.C (read): use a double switch trick to get more help
7262 from the compiler. (the same trick is used in layout.C)
7263 (write): new function. opens a ofstream and pass that to output
7264 (output): new function, takes a ostream and writes the lyxrc
7265 elemts to it. uses a dummy switch to make sure no elements are
7268 * src/lyxlex.h: added a struct pushpophelper for use in functions
7269 with more than one exit point.
7271 * src/lyxlex.[Ch] (GetInteger): made it const
7275 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7277 * src/layout.[hC] : LayoutTags splitted into several enums, new
7278 methods created, better error handling cleaner use of lyxlex. Read
7281 * src/bmtable.[Ch]: change some member prototypes because of the
7282 image const changes.
7284 * commandtags.h, src/LyXAction.C (init): new function:
7285 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7286 This file is not read automatically but you can add \input
7287 preferences to your lyxrc if you want to. We need to discuss how
7290 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7291 in .aux, also remove .bib and .bst files from dependencies when
7294 * src/BufferView.C, src/LyXView.C: add const_cast several places
7295 because of changes to images.
7297 * lib/images/*: same change as for images/*
7299 * lib/lyxrc.example: Default for accept_compound is false not no.
7301 * images/*: changed to be const, however I have som misgivings
7302 about this change so it might be changed back.
7304 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7306 * lib/configure, po/POTFILES.in: regenerated
7308 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7310 * config/lib_configure.m4: removed
7312 * lib/configure.m4: new file (was config/lib_configure.m4)
7314 * configure.in: do not test for rtti, since we do not use it.
7316 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7318 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7319 doubling of allocated space scheme. This makes it faster for large
7320 strings end to use less memory for small strings. xtra rememoved.
7322 * src/insets/figinset.C (waitalarm): commented out.
7323 (GhostscriptMsg): use static_cast
7324 (GhostscriptMsg): use new instead of malloc to allocate memory for
7325 cmap. also delete the memory after use.
7327 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7329 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7330 for changes in bibtex database or style.
7331 (runBibTeX): remove all .bib and .bst files from dep before we
7333 (run): use scanAuc in when dep file already exist.
7335 * src/DepTable.C (remove_files_with_extension): new method
7338 * src/DepTable.[Ch]: made many of the methods const.
7340 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7342 * src/bufferparams.C: make sure that the default textclass is
7343 "article". It used to be the first one by description order, but
7344 now the first one is "docbook".
7346 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7347 string; call Debug::value.
7348 (easyParse): pass complete argument to setDebuggingLevel().
7350 * src/debug.h (value): fix the code that parses debug levels.
7352 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7355 * src/LyXAction.C: use Debug::ACTION as debug channel.
7357 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7359 * NEWS: updated for the future 1.1.3 release.
7361 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7362 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7363 it should. This is of course a controversial change (since many
7364 people will find that their lyx workscreen is suddenly full of
7365 red), but done for the sake of correctness.
7367 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7368 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7370 * src/insets/inseterror.h, src/insets/inseturl.h,
7371 src/insets/insetinfo.h, src/insets/figinset.h,
7372 src/mathed/formulamacro.h, src/mathed/math_macro.h
7373 (EditMessage): add a missing const and add _() to make sure that
7376 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7377 src/insets/insetbib.C, src/support/filetools.C: add `using'
7380 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7381 doing 'Insert index of last word' at the beginning of a paragraph.
7383 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7385 * several files: white-space changes.
7387 * src/mathed/formula.C: removed IsAlpha and IsDigit
7389 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7390 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7393 * src/insets/figinset.C (GetPSSizes): don't break when
7394 "EndComments" is seen. But break when a boundingbox is read.
7396 * all classes inherited from Inset: return value of Clone
7397 changed back to Inset *.
7399 * all classes inherited form MathInset: return value of Clone
7400 changed back to MathedInset *.
7402 * src/insets/figinset.C (runqueue): use a ofstream to output the
7403 gs/ps file. Might need some setpresicion or setw. However I can
7404 see no problem with the current code.
7405 (runqueue): use sleep instead of the alarm/signal code. I just
7406 can't see the difference.
7408 * src/paragraph.C (LyXParagraph): reserve space in the new
7409 paragraph and resize the inserted paragraph to just fit.
7411 * src/lyxfunc.h (operator|=): added operator for func_status.
7413 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7414 check for readable file.
7416 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7417 check for readable file.
7418 (MenuMakeLinuxDoc): ditto
7419 (MenuMakeDocBook): ditto
7420 (MenuMakeAscii): ditto
7421 (InsertAsciiFile): split the test for openable and readable
7423 * src/bmtable.C (draw_bitmaptable): use
7424 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7426 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7427 findtexfile from LaTeX to filetools.
7429 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7430 instead of FilePtr. Needs to be verified by a literate user.
7432 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7434 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7435 (EditMessage): likewise.
7437 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7438 respectively as \textasciitilde and \textasciicircum.
7440 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7442 * src/support/lyxstring.h: made the methods that take iterators
7445 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7446 (regexMatch): made is use the real regex class.
7448 * src/support/Makefile.am: changed to use libtool
7450 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7452 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7454 (MathIsInset ++): changed several macros to be inline functions
7457 * src/mathed/Makefile.am: changed to use libtool
7459 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7461 * src/insets/inset* : Clone changed to const and return type is
7462 the true insettype not just Inset*.
7464 * src/insets/Makefile.am: changed to use libtool
7466 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7468 * src/undo.[Ch] : added empty() and changed some of the method
7471 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7473 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7474 setID use block<> for the bullets array, added const several places.
7476 * src/lyxfunc.C (getStatus): new function
7478 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7479 LyXAction, added const to several funtions.
7481 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7482 a std::map, and to store the dir items in a vector.
7484 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7487 * src/LyXView.[Ch] + other files : changed currentView to view.
7489 * src/LyXAction.[Ch] : ported from the old devel branch.
7491 * src/.cvsignore: added .libs and a.out
7493 * configure.in : changes to use libtool.
7495 * acinclude.m4 : inserted libtool.m4
7497 * .cvsignore: added libtool
7499 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7501 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7502 file name in insets and mathed directories (otherwise the
7503 dependency is not taken in account under cygwin).
7505 * src/text2.C (InsertString[AB]): make sure that we do not try to
7506 read characters past the string length.
7508 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7510 * lib/doc/LaTeXConfig.lyx.in,
7511 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7513 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7514 file saying who created them and when this heppened; this is
7515 useless and annoys tools like cvs.
7517 * lib/layouts/g-brief-{en,de}.layout,
7518 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7519 from Thomas Hartkens <thomas@hartkens.de>.
7521 * src/{insets,mathed}/Makefile.am: do not declare an empty
7522 LDFLAGS, so that it can be set at configure time (useful on Irix
7525 * lib/reLyX/configure.in: make sure that the prefix is set
7526 correctly in LYX_DIR.
7528 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7530 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7531 be used by 'command-sequence' this allows to bind a key to a
7532 sequence of LyX-commands
7533 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7535 * src/LyXAction.C: add "command-sequence"
7537 * src/LyXFunction.C: handling of "command-sequence"
7539 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7540 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7542 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7544 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7546 * src/buffer.C (writeFile): Do not output a comment giving user
7547 and date at the beginning of a .lyx file. This is useless and
7548 annoys cvs anyway; update version number to 1.1.
7550 * src/Makefile.am (LYX_DIR): add this definition, so that a
7551 default path is hardcoded in LyX.
7553 * configure.in: Use LYX_GNU_GETTEXT.
7555 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7556 AM_GNU_GETTEXT with a bug fixed.
7558 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7560 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7562 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7563 which is used to point to LyX data is now LYX_DIR_11x.
7565 * lyx.man: convert to a unix text file; small updates.
7567 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7569 * src/support/LSubstring.[Ch]: made the second arg of most of the
7570 constructors be a const reference.
7572 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7575 * src/support/lyxstring.[Ch] (swap): added missing member function
7576 and specialization of swap(str, str);
7578 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7580 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7581 trace of the old one.
7583 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7584 put the member definitions in undo.C.
7586 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7587 NEW_TEXT and have now only code that was included when this was
7590 * src/intl.C (LCombo): use static_cast
7592 (DispatchCallback): ditto
7594 * src/definitions.h: removed whole file
7596 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7598 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7599 parsing and stores in a std:map. a regex defines the file format.
7600 removed unneeded members.
7602 * src/bufferparams.h: added several enums from definitions.h here.
7603 Removed unsused destructor. Changed some types to use proper enum
7604 types. use block to have the temp_bullets and user_defined_bullets
7605 and to make the whole class assignable.
7607 * src/bufferparams.C (Copy): removed this functions, use a default
7610 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7613 * src/buffer.C (readLyXformat2): commend out all that have with
7614 oldpapersize to do. also comment out all that hve to do with
7615 insetlatex and insetlatexdel.
7616 (setOldPaperStuff): commented out
7618 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7620 * src/LyXAction.C: remove use of inset-latex-insert
7622 * src/mathed/math_panel.C (button_cb): use static_cast
7624 * src/insets/Makefile.am (insets_o_SOURCES): removed
7627 * src/support/lyxstring.C (helper): use the unsigned long
7628 specifier, UL, instead of a static_cast.
7630 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7632 * src/support/block.h: new file. to be used as a c-style array in
7633 classes, so that the class can be assignable.
7635 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7637 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7638 NULL, make sure to return an empty string (it is not possible to
7639 set a string to NULL).
7641 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7643 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7645 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7647 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7648 link line, so that Irix users (for example) can set it explicitely to
7651 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7652 it can be overidden at make time (static or dynamic link, for
7655 * src/vc-backend.C, src/LaTeXFeatures.h,
7656 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7657 statements to bring templates to global namespace.
7659 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7661 * src/support/lyxstring.C (operator[] const): make it standard
7664 * src/minibuffer.C (Init): changed to reflect that more
7665 information is given from the lyxvc and need not be provided here.
7667 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7669 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7671 * src/LyXView.C (UpdateTimerCB): use static_cast
7672 (KeyPressMask_raw_callback): ditto
7674 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7675 buffer_, a lot of changes because of this. currentBuffer() ->
7676 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7677 also changes to other files because of this.
7679 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7681 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7682 have no support for RCS and partial support for CVS, will be
7685 * src/insets/ several files: changes because of function name
7686 changes in Bufferview and LyXView.
7688 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7690 * src/support/LSubstring.[Ch]: new files. These implement a
7691 Substring that can be very convenient to use. i.e. is this
7693 string a = "Mary had a little sheep";
7694 Substring(a, "sheep") = "lamb";
7695 a is now "Mary has a little lamb".
7697 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7698 out patterns and subpatterns of strings. It is used by LSubstring
7699 and also by vc-backend.C
7701 * src/support/lyxstring.C: went over all the assertions used and
7702 tried to correct the wrong ones and flag which of them is required
7703 by the standard. some bugs found because of this. Also removed a
7704 couple of assertions.
7706 * src/support/Makefile.am (libsupport_a_SOURCES): added
7707 LSubstring.[Ch] and LRegex.[Ch]
7709 * src/support/FileInfo.h: have struct stat buf as an object and
7710 not a pointer to one, some changes because of this.
7712 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7713 information in layout when adding the layouts preamble to the
7716 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7719 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7720 because of bug in OS/2.
7722 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7724 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7725 \verbatim@font instead of \ttfamily, so that it can be redefined.
7727 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7728 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7729 src/layout.h, src/text2.C: add 'using' directive to bring the
7730 STL templates we need from the std:: namespace to the global one.
7731 Needed by DEC cxx in strict ansi mode.
7733 * src/support/LIstream.h,src/support/LOstream.h,
7734 src/support/lyxstring.h,src/table.h,
7735 src/lyxlookup.h: do not include <config.h> in header
7736 files. This should be done in the .C files only.
7738 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7742 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7744 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7745 from Kayvan to fix the tth invokation.
7747 * development/lyx.spec.in: updates from Kayvan to reflect the
7748 changes of file names.
7750 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7752 * src/text2.C (InsertStringB): use std::copy
7753 (InsertStringA): use std::copy
7755 * src/bufferlist.C: use a vector to store the buffers in. This is
7756 an internal change and should not affect any other thing.
7758 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7761 * src/text.C (Fill): fix potential bug, one off bug.
7763 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7765 * src/Makefile.am (lyx_main.o): add more files it depends on.
7767 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7769 * src/support/lyxstring.C: use size_t for the reference count,
7770 size, reserved memory and xtra.
7771 (internal_compare): new private member function. Now the compare
7772 functions should work for std::strings that have embedded '\0'
7774 (compare): all compare functions rewritten to use
7777 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/support/lyxstring.C (compare): pass c_str()
7780 (compare): pass c_str
7781 (compare): pass c_str
7783 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7785 * src/support/DebugStream.C: <config.h> was not included correctly.
7787 * lib/configure: forgot to re-generate it :( I'll make this file
7788 auto generated soon.
7790 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7792 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7795 * src/support/lyxstring.C: some changes from length() to rep->sz.
7796 avoids a function call.
7798 * src/support/filetools.C (SpaceLess): yet another version of the
7799 algorithm...now per Jean-Marc's suggestions.
7801 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7803 * src/layout.C (less_textclass_desc): functor for use in sorting
7805 (LyXTextClass::Read): sort the textclasses after reading.
7807 * src/support/filetools.C (SpaceLess): new version of the
7808 SpaceLess functions. What problems does this one give? Please
7811 * images/banner_bw.xbm: made the arrays unsigned char *
7813 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7815 * src/support/lyxstring.C (find): remove bogus assertion in the
7816 two versions of find where this has not been done yet.
7818 * src/support/lyxlib.h: add missing int return type to
7821 * src/menus.C (ShowFileMenu): disable exporting to html if no
7822 html export command is present.
7824 * config/lib_configure.m4: add a test for an HTML converter. The
7825 programs checked for are, in this order: tth, latex2html and
7828 * lib/configure: generated from config/lib_configure.m4.
7830 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7831 html converter. The parameters are now passed through $$FName and
7832 $$OutName, instead of standard input/output.
7834 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7836 * lib/lyxrc.example: update description of \html_command.
7837 add "quotes" around \screen_font_xxx font setting examples to help
7838 people who use fonts with spaces in their names.
7840 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7842 * Distribution files: updates for v1.1.2
7844 * src/support/lyxstring.C (find): remove bogus assert and return
7845 npos for the same condition.
7847 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7849 * added patch for OS/2 from SMiyata.
7851 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7853 * src/text2.C (CutSelection): make space_wrapped a bool
7854 (CutSelection): dont declare int i until we have to.
7855 (alphaCounter): return a char const *.
7857 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7859 * src/support/syscall.C (Systemcalls::kill):
7860 src/support/filetools.C (PutEnv, PutEnvPath):
7861 src/lyx_cb.C (addNewlineAndDepth):
7862 src/FontInfo.C (FontInfo::resize): condition some #warning
7863 directives with WITH_WARNINGS.
7866 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7868 * src/layout.[Ch] + several files: access to class variables
7869 limited and made accessor functions instead a lot of code changed
7870 becuase of this. Also instead of returning pointers often a const
7871 reference is returned instead.
7873 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7875 * src/Makefile.am (dist-hook): added used to remove the CVS from
7876 cheaders upon creating a dist
7877 (EXTRA_DIST): added cheaders
7879 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7880 a character not as a small integer.
7882 * src/support/lyxstring.C (find): removed Assert and added i >=
7883 rep->sz to the first if.
7885 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7887 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7888 src/LyXView.C src/buffer.C src/bufferparams.C
7889 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7890 src/text2.C src/insets/insetinclude.C:
7891 lyxlayout renamed to textclasslist.
7893 * src/layout.C: some lyxerr changes.
7895 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7896 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7897 (LyXLayoutList): removed all traces of this class.
7898 (LyXTextClass::Read): rewrote LT_STYLE
7899 (LyXTextClass::hasLayout): new function
7900 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7901 both const and nonconst version.
7902 (LyXTextClass::delete_layout): new function.
7903 (LyXTextClassList::Style): bug fix. do the right thing if layout
7905 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7906 (LyXTextClassList::NameOfLayout): ditto
7907 (LyXTextClassList::Load): ditto
7909 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7911 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7913 * src/LyXAction.C (LookupFunc): added a workaround for sun
7914 compiler, on the other hand...we don't know if the current code
7915 compiles on sun at all...
7917 * src/support/filetools.C (CleanupPath): subst fix
7919 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7922 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7923 complained about this one?
7925 * src/insets/insetinclude.C (Latex): subst fix
7927 * src/insets/insetbib.C (getKeys): subst fix
7929 * src/LyXSendto.C (SendtoApplyCB): subst fix
7931 * src/lyx_main.C (init): subst fix
7933 * src/layout.C (Read): subst fix
7935 * src/lyx_sendfax_main.C (button_send): subst fix
7937 * src/buffer.C (RoffAsciiTable): subst fix
7939 * src/lyx_cb.C (MenuFax): subst fix
7940 (PrintApplyCB): subst fix
7942 1999-10-26 Juergen Vigna <jug@sad.it>
7944 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7946 (Read): Cleaned up this code so now we read only format vestion >= 5
7948 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7950 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7951 come nobody has complained about this one?
7953 * src/insets/insetinclude.C (Latex): subst fix
7955 * src/insets/insetbib.C (getKeys): subst fix
7957 * src/lyx_main.C (init): subst fix
7959 * src/layout.C (Read): subst fix
7961 * src/buffer.C (RoffAsciiTable): subst fix
7963 * src/lyx_cb.C (MenuFax): subst fix.
7965 * src/layout.[hC] + some other files: rewrote to use
7966 std::container to store textclasses and layouts in.
7967 Simplified, removed a lot of code. Make all classes
7968 assignable. Further simplifications and review of type
7969 use still to be one.
7971 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7972 lastfiles to create the lastfiles partr of the menu.
7974 * src/lastfiles.[Ch]: rewritten to use deque to store the
7975 lastfiles in. Uses fstream for reading and writing. Simplifies
7978 * src/support/syscall.C: remove explicit cast.
7980 * src/BufferView.C (CursorToggleCB): removed code snippets that
7982 use explicat C++ style casts instead of C style casts. also use
7983 u_vdata instea of passing pointers in longs.
7985 * src/PaperLayout.C: removed code snippets that were commented out.
7987 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7989 * src/lyx_main.C: removed code snippets that wer commented out.
7991 * src/paragraph.C: removed code snippets that were commented out.
7993 * src/lyxvc.C (logClose): use static_cast
7995 (viewLog): remove explicit cast to void*
7996 (showLog): removed old commented code
7998 * src/menus.C: use static_cast instead of C style casts. use
7999 u_vdata instead of u_ldata. remove explicit cast to (long) for
8000 pointers. Removed old code that was commented out.
8002 * src/insets/inset.C: removed old commented func
8004 * src/insets/insetref.C (InsetRef): removed old code that had been
8005 commented out for a long time.
8007 (escape): removed C style cast
8009 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8011 * src/insets/insetlatex.C (Draw): removed old commented code
8012 (Read): rewritten to use string
8014 * src/insets/insetlabel.C (escape): removed C style cast
8016 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8018 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8021 * src/insets/insetinclude.h: removed a couple of stupid bools
8023 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8024 (Clone): remove C style cast
8025 (getKeys): changed list to lst because of std::list
8027 * src/insets/inseterror.C (Draw): removed som old commented code.
8029 * src/insets/insetcommand.C (Draw): removed some old commented code.
8031 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8032 commented out forever.
8033 (bibitem_cb): use static_cast instead of C style cast
8034 use of vdata changed to u_vdata.
8036 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8038 (CloseUrlCB): use static_cast instead of C style cast.
8039 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8041 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8042 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8043 (CloseInfoCB): static_cast from ob->u_vdata instead.
8044 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8047 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8048 (C_InsetError_CloseErrorCB): forward the ob parameter
8049 (CloseErrorCB): static_cast from ob->u_vdata instead.
8051 * src/vspace.h: include LString.h since we use string in this class.
8053 * src/vspace.C (lyx_advance): changed name from advance because of
8054 nameclash with stl. And since we cannot use namespaces yet...I
8055 used a lyx_ prefix instead. Expect this to change when we begin
8058 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8060 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8061 and removed now defunct constructor and deconstructor.
8063 * src/BufferView.h: have backstack as a object not as a pointer.
8064 removed initialization from constructor. added include for BackStack
8066 * development/lyx.spec.in (%build): add CFLAGS also.
8068 * src/screen.C (drawFrame): removed another warning.
8070 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8072 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8073 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8074 README and ANNOUNCE a bit for the next release. More work is
8077 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8078 unbreakable if we are in freespacing mode (LyX-Code), but not in
8081 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8083 * src/BackStack.h: fixed initialization order in constructor
8085 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8087 * acinclude.m4 (VERSION): new rules for when a version is
8088 development, added also a variable for prerelease.
8089 (warnings): we set with_warnings=yes for prereleases
8090 (lyx_opt): prereleases compile with same optimization as development
8091 (CXXFLAGS): only use pedantic if we are a development version
8093 * src/BufferView.C (restorePosition): don't do anything if the
8096 * src/BackStack.h: added member empty, use this to test if there
8097 is anything to pop...
8099 1999-10-25 Juergen Vigna <jug@sad.it>
8102 * forms/layout_forms.fd +
8103 * forms/latexoptions.fd +
8104 * lyx.fd: changed for various form resize issues
8106 * src/mathed/math_panel.C +
8107 * src/insets/inseterror.C +
8108 * src/insets/insetinfo.C +
8109 * src/insets/inseturl.C +
8110 * src/insets/inseturl.h +
8113 * src/PaperLayout.C +
8114 * src/ParagraphExtra.C +
8115 * src/TableLayout.C +
8117 * src/layout_forms.C +
8124 * src/menus.C: fixed various resize issues. So now forms can be
8125 resized savely or not be resized at all.
8127 * forms/form_url.fd +
8128 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8131 * src/insets/Makefile.am: added files form_url.[Ch]
8133 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8135 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8136 (and presumably 6.2).
8138 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8139 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8140 remaining static member callbacks.
8142 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8145 * src/support/lyxstring.h: declare struct Srep as friend of
8146 lyxstring, since DEC cxx complains otherwise.
8148 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8150 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8152 * src/LaTeX.C (run): made run_bibtex also depend on files with
8154 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8155 are put into the dependency file.
8157 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8158 the code has shown itself to work
8159 (create_ispell_pipe): removed another warning, added a comment
8162 * src/minibuffer.C (ExecutingCB): removed code that has been
8163 commented out a long time
8165 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8166 out code + a warning.
8168 * src/support/lyxstring.h: comment out the three private
8169 operators, when compiling with string ansi conforming compilers
8172 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8174 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8175 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8178 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8181 * src/mathed/math_panel.C (create_math_panel): remove explicit
8184 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8187 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8188 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8189 to XCreatePixmapFromBitmapData
8190 (fl_set_bmtable_data): change the last argument to be unsigned
8192 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8193 and bh to be unsigned int, remove explicit casts in call to
8194 XReadBitmapFileData.
8196 * images/arrows.xbm: made the arrays unsigned char *
8197 * images/varsz.xbm: ditto
8198 * images/misc.xbm: ditto
8199 * images/greek.xbm: ditto
8200 * images/dots.xbm: ditto
8201 * images/brel.xbm: ditto
8202 * images/bop.xbm: ditto
8204 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8206 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8207 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8208 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8210 (LYX_CXX_CHEADERS): added <clocale> to the test.
8212 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8214 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8216 * src/support/lyxstring.C (append): fixed something that must be a
8217 bug, rep->assign was used instead of rep->append.
8219 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8222 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8223 lyx insert double chars. Fix spotted by Kayvan.
8225 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8227 * Fixed the tth support. I messed up with the Emacs patch apply feature
8228 and omitted the changes in lyxrc.C.
8230 1999-10-22 Juergen Vigna <jug@sad.it>
8232 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8234 * src/lyx_cb.C (MenuInsertRef) +
8235 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8236 the form cannot be resized under it limits (fixes a segfault)
8238 * src/lyx.C (create_form_form_ref) +
8239 * forms/lyx.fd: Changed Gravity on name input field so that it is
8242 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8244 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8245 <ostream> and <istream>.
8247 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8248 whether <fstream> provides the latest standard features, or if we
8249 have an oldstyle library (like in egcs).
8250 (LYX_CXX_STL_STRING): fix the test.
8252 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8253 code on MODERN_STL_STREAM.
8255 * src/support/lyxstring.h: use L{I,O}stream.h.
8257 * src/support/L{I,O}stream.h: new files, designed to setup
8258 correctly streams for our use
8259 - includes the right header depending on STL capabilities
8260 - puts std::ostream and std::endl (for LOStream.h) or
8261 std::istream (LIStream.h) in toplevel namespace.
8263 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8265 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8266 was a bib file that had been changed we ensure that bibtex is run.
8267 (runBibTeX): enhanced to extract the names of the bib files and
8268 getting their absolute path and enter them into the dep file.
8269 (findtexfile): static func that is used to look for tex-files,
8270 checks for absolute patchs and tries also with kpsewhich.
8271 Alternative ways of finding the correct files are wanted. Will
8273 (do_popen): function that runs a command using popen and returns
8274 the whole output of that command in a string. Should be moved to
8277 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8278 file with extension ext has changed.
8280 * src/insets/figinset.C: added ifdef guards around the fl_free
8281 code that jug commented out. Now it is commented out when
8282 compiling with XForms == 0.89.
8284 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8285 to lyxstring.C, and only keep a forward declaration in
8286 lyxstring.h. Simplifies the header file a bit and should help a
8287 bit on compile time too. Also changes to Srep will not mandate a
8288 recompile of code just using string.
8289 (~lyxstring): definition moved here since it uses srep.
8290 (size): definition moved here since it uses srep.
8292 * src/support/lyxstring.h: removed a couple of "inline" that should
8295 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8297 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8300 1999-10-21 Juergen Vigna <jug@sad.it>
8302 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8303 set to left if I just remove the width entry (or it is empty).
8305 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8306 paragraph when having dummy paragraphs.
8308 1999-10-20 Juergen Vigna <jug@sad.it>
8310 * src/insets/figinset.C: just commented some fl_free_form calls
8311 and added warnings so that this calls should be activated later
8312 again. This avoids for now a segfault, but we have a memory leak!
8314 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8315 'const char * argument' to 'string argument', this should
8316 fix some Asserts() in lyxstring.C.
8318 * src/lyxfunc.h: Removed the function argAsString(const char *)
8319 as it is not used anymore.
8321 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8326 * src/Literate.h: some funcs moved from public to private to make
8327 interface clearer. Unneeded args removed.
8329 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8331 (scanBuildLogFile): ditto
8333 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8334 normal TeX Error. Still room for improvement.
8336 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8338 * src/buffer.C (insertErrors): changes to make the error
8339 desctription show properly.
8341 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8344 * src/support/lyxstring.C (helper): changed to use
8345 sizeof(object->rep->ref).
8346 (operator>>): changed to use a pointer instead.
8348 * src/support/lyxstring.h: changed const reference & to value_type
8349 const & lets see if that helps.
8351 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8353 * Makefile.am (rpmdist): fixed to have non static package and
8356 * src/support/lyxstring.C: removed the compilation guards
8358 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8361 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8362 conditional compile of lyxstring.Ch
8364 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8365 stupid check, but it is a lot better than the bastring hack.
8366 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8368 * several files: changed string::erase into string::clear. Not
8371 * src/chset.C (encodeString): use a char temporary instead
8373 * src/table.C (TexEndOfCell): added tostr around
8374 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8375 (TexEndOfCell): ditto
8376 (TexEndOfCell): ditto
8377 (TexEndOfCell): ditto
8378 (DocBookEndOfCell): ditto
8379 (DocBookEndOfCell): ditto
8380 (DocBookEndOfCell): ditto
8381 (DocBookEndOfCell): ditto
8383 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8385 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8387 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8388 (MenuBuildProg): added tostr around ret
8389 (MenuRunChktex): added tostr around ret
8390 (DocumentApplyCB): added tostr around ret
8392 * src/chset.C (encodeString): added tostr around t->ic
8394 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8395 (makeLaTeXFile): added tostr around tocdepth
8396 (makeLaTeXFile): added tostr around ftcound - 1
8398 * src/insets/insetbib.C (setCounter): added tostr around counter.
8400 * src/support/lyxstring.h: added an operator+=(int) to catch more
8403 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8404 (lyxstring): We DON'T allow NULL pointers.
8406 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8408 * src/mathed/math_macro.C (MathMacroArgument::Write,
8409 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8410 when writing them out.
8412 * src/LString.C: remove, since it is not used anymore.
8414 * src/support/lyxstring.C: condition the content to
8415 USE_INCLUDED_STRING macro.
8417 * src/mathed/math_symbols.C, src/support/lstrings.C,
8418 src/support/lyxstring.C: add `using' directive to specify what
8419 we need in <algorithm>. I do not think that we need to
8420 conditionalize this, but any thought is appreciated.
8422 * many files: change all callback functions to "C" linkage
8423 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8424 strict_ansi. Those who were static are now global.
8425 The case of callbacks which are static class members is
8426 trickier, since we have to make C wrappers around them (see
8427 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8428 did not finish this yet, since it defeats the purpose of
8429 encapsulation, and I am not sure what the best route is.
8431 1999-10-19 Juergen Vigna <jug@sad.it>
8433 * src/support/lyxstring.C (lyxstring): we permit to have a null
8434 pointer as assignment value and just don't assign it.
8436 * src/vspace.C (nextToken): corrected this function substituting
8437 find_first(_not)_of with find_last_of.
8439 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8440 (TableOptCloseCB) (TableSpeCloseCB):
8441 inserted fl_set_focus call for problem with fl_hide_form() in
8444 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8446 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8449 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8451 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8452 LyXLex::next() and not eatline() to get its argument.
8454 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8457 instead, use fstreams for io of the depfile, removed unneeded
8458 functions and variables.
8460 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8461 vector instead, removed all functions and variables that is not in
8464 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8466 * src/buffer.C (insertErrors): use new interface to TeXError
8468 * Makefile.am (rpmdist): added a rpmdist target
8470 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8471 per Kayvan's instructions.
8473 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8475 * src/Makefile.am: add a definition for localedir, so that locales
8476 are found after installation (Kayvan)
8478 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8480 * development/.cvsignore: new file.
8482 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8484 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8485 C++ compiler provides wrappers for C headers and use our alternate
8488 * configure.in: use LYX_CXX_CHEADERS.
8490 * src/cheader/: new directory, populated with cname headers from
8491 libstdc++-2.8.1. They are a bit old, but probably good enough for
8492 what we want (support compilers who lack them).
8494 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8495 from includes. It turns out is was stupid.
8497 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8499 * lib/Makefile.am (install-data-local): forgot a ';'
8500 (install-data-local): forgot a '\'
8501 (libinstalldirs): needed after all. reintroduced.
8503 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8505 * configure.in (AC_OUTPUT): added lyx.spec
8507 * development/lyx.spec: removed file
8509 * development/lyx.spec.in: new file
8511 * po/*.po: merged with lyx.pot becuase of make distcheck
8513 * lib/Makefile.am (dist-hook): added dist-hook so that
8514 documentation files will be included when doing a make
8515 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8516 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8518 more: tried to make install do the right thing, exclude CVS dirs
8521 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8522 Path would fit in more nicely.
8524 * all files that used to use pathstack: uses now Path instead.
8525 This change was a lot easier than expected.
8527 * src/support/path.h: new file
8529 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8531 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8533 * src/support/lyxstring.C (getline): Default arg was given for
8536 * Configure.cmd: removed file
8538 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8540 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8541 streams classes and types, add the proper 'using' statements when
8542 MODERN_STL is defined.
8544 * src/debug.h: move the << operator definition after the inclusion
8547 * src/support/filetools.C: include "LAssert.h", which is needed
8550 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8553 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8554 include "debug.h" to define a proper ostream.
8556 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8558 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8559 method to the SystemCall class which can kill a process, but it's
8560 not fully implemented yet.
8562 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8564 * src/support/FileInfo.h: Better documentation
8566 * src/lyxfunc.C: Added support for buffer-export html
8568 * src/menus.C: Added Export->As HTML...
8570 * lib/bind/*.bind: Added short-cut for buffer-export html
8572 * src/lyxrc.*: Added support for new \tth_command
8574 * lib/lyxrc.example: Added stuff for new \tth_command
8576 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8578 * lib/Makefile.am (IMAGES): removed images/README
8579 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8580 installes in correct place. Check permisions is installed
8583 * src/LaTeX.C: some no-op changes moved declaration of some
8586 * src/LaTeX.h (LATEX_H): changed include guard name
8588 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8590 * lib/reLyX/Makefile.am: install noweb2lyx.
8592 * lib/Makefile.am: install configure.
8594 * lib/reLyX/configure.in: declare a config aux dir; set package
8595 name to lyx (not sure what the best solution is); generate noweb2lyx.
8597 * lib/layouts/egs.layout: fix the bibliography layout.
8599 1999-10-08 Jürgen Vigna <jug@sad.it>
8601 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8602 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8603 it returned without continuing to search the path.
8605 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8608 also fixes a bug. It is not allowed to do tricks with std::strings
8609 like: string a("hei"); &a[e]; this will not give what you
8610 think... Any reason for the complexity in this func?
8612 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8614 * Updated README and INSTALL a bit, mostly to check that my
8615 CVS rights are correctly set up.
8617 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8619 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8620 does not allow '\0' chars but lyxstring and std::string does.
8622 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * autogen.sh (AUTOCONF): let the autogen script create the
8625 POTFILES.in file too. POTFILES.in should perhaps now not be
8626 included in the cvs module.
8628 * some more files changed to use C++ includes instead of C ones.
8630 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8632 (Reread): added tostr to nlink. buggy output otherwise.
8633 (Reread): added a string() around szMode when assigning to Buffer,
8634 without this I got a log of garbled info strings.
8636 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8639 * I have added several ostream & operator<<(ostream &, some_type)
8640 functions. This has been done to avoid casting and warnings when
8641 outputting enums to lyxerr. This as thus eliminated a lot of
8642 explicit casts and has made the code clearer. Among the enums
8643 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8644 mathed enums, some font enum the Debug::type enum.
8646 * src/support/lyxstring.h (clear): missing method. equivalent of
8649 * all files that contained "stderr": rewrote constructs that used
8650 stderr to use lyxerr instead. (except bmtable)
8652 * src/support/DebugStream.h (level): and the passed t with
8653 Debug::ANY to avoid spurious bits set.
8655 * src/debug.h (Debug::type value): made it accept strings of the
8658 * configure.in (Check for programs): Added a check for kpsewhich,
8659 the latex generation will use this later to better the dicovery of
8662 * src/BufferView.C (create_view): we don't need to cast this to
8663 (void*) that is done automatically.
8664 (WorkAreaButtonPress): removed some dead code.
8666 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8668 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8669 is not overwritten when translated (David Sua'rez de Lis).
8671 * lib/CREDITS: Added David Sua'rez de Lis
8673 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8675 * src/bufferparams.C (BufferParams): default input encoding is now
8678 * acinclude.m4 (cross_compiling): comment out macro
8679 LYX_GXX_STRENGTH_REDUCE.
8681 * acconfig.h: make sure that const is not defined (to empty) when
8682 we are compiling C++. Remove commented out code using SIZEOF_xx
8685 * configure.in : move the test for const and inline as late as
8686 possible so that these C tests do not interefere with C++ ones.
8687 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8688 has not been proven.
8690 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8692 * src/table.C (getDocBookAlign): remove bad default value for
8695 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8697 (ShowFileMenu2): ditto.
8699 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8702 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8704 * Most files: finished the change from the old error code to use
8705 DebugStream for all lyxerr debugging. Only minor changes remain
8706 (e.g. the setting of debug levels using strings instead of number)
8708 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8710 * src/layout.C (Add): Changed to use compare_no_case instead of
8713 * src/FontInfo.C: changed loop variable type too string::size_type.
8715 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8717 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8718 set ETAGS_ARGS to --c++
8720 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8722 * src/table.C (DocBookEndOfCell): commented out two unused variables
8724 * src/paragraph.C: commented out four unused variables.
8726 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8727 insed a if clause with type string::size_type.
8729 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8732 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8734 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8735 variable, also changed loop to go from 0 to lenght + 1, instead of
8736 -1 to length. This should be correct.
8738 * src/LaTeX.C (scanError): use string::size_type as loop variable
8741 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8742 (l.896) since y_tmp and row was not used anyway.
8744 * src/insets/insetref.C (escape): use string::size_type as loop
8747 * src/insets/insetquotes.C (Width): use string::size_type as loop
8749 (Draw): use string::size_type as loop variable type.
8751 * src/insets/insetlatexaccent.C (checkContents): use
8752 string::size_type as loop variable type.
8754 * src/insets/insetlabel.C (escape): use string::size_type as loop
8757 * src/insets/insetinfo.C: added an extern for current_view.
8759 * src/insets/insetcommand.C (scanCommand): use string::size_type
8760 as loop variable type.
8762 * most files: removed the RCS tags. With them we had to recompile
8763 a lot of files after a simple cvs commit. Also we have never used
8764 them for anything meaningful.
8766 * most files: tags-query-replace NULL 0. As adviced several plases
8767 we now use "0" instead of "NULL" in our code.
8769 * src/support/filetools.C (SpaceLess): use string::size_type as
8772 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8774 * src/paragraph.C: fixed up some more string stuff.
8776 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * src/support/filetools.h: make modestr a std::string.
8780 * src/filetools.C (GetEnv): made ch really const.
8782 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8783 made code that used these use max/min from <algorithm> instead.
8785 * changed several c library include files to their equivalent c++
8786 library include files. All is not changed yet.
8788 * created a support subdir in src, put lyxstring and lstrings
8789 there + the extra files atexit, fileblock, strerror. Created
8790 Makefile.am. edited configure.in and src/Makefile.am to use this
8791 new subdir. More files moved to support.
8793 * imported som of the functions from repository lyx, filetools
8795 * ran tags-query-replace on LString -> string, corrected the bogus
8796 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8797 is still some errors in there. This is errors where too much or
8798 too litle get deleted from strings (string::erase, string::substr,
8799 string::replace), there can also be some off by one errors, or
8800 just plain wrong use of functions from lstrings. Viewing of quotes
8803 * LyX is now running fairly well with string, but there are
8804 certainly some bugs yet (see above) also string is quite different
8805 from LString among others in that it does not allow null pointers
8806 passed in and will abort if it gets any.
8808 * Added the revtex4 files I forgot when setting up the repository.
8810 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8812 * All over: Tried to clean everything up so that only the files
8813 that we really need are included in the cvs repository.
8814 * Switched to use automake.
8815 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8816 * Install has not been checked.
8818 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8820 * po/pt.po: Three errors:
8821 l.533 and l.538 format specification error
8822 l. 402 duplicate entry, I just deleted it.