1 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/lyxfunc.C: construct correctly the automatic new file
6 * src/text2.C (IsStringInText): change type of variable i to shut
9 * src/support/sstream.h: do not use namespaces if the compiler
10 does not support them.
12 2000-09-15 Marko Vendelin <markov@ioc.ee>
13 * src/frontends/gnome/FormCitation.C
14 * src/frontends/gnome/FormCitation.h
15 * src/frontends/gnome/diainsertcitation_interface.c
16 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
17 regexp support to FormCitation [Gnome].
19 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
22 * configure.in: remove unused KDE/GTKGUI define
24 * src/frontends/kde/FormRef.C
25 * src/frontends/kde/FormRef.h
26 * src/frontends/kde/formrefdialog.C
27 * src/frontends/kde/formrefdialog.h: double click will
28 go to reference, now it is possible to change a cross-ref
31 * src/frontends/kde/FormToc.C
32 * src/frontends/kde/FormToc.h
33 * src/frontends/kde/formtocdialog.C
34 * src/frontends/kde/formtocdialog.h: add a depth
37 * src/frontends/kde/Makefile.am: add QtLyXView.h
40 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
42 * src/frontends/kde/FormCitation.h: added some using directives.
44 * src/frontends/kde/FormToc.h: corrected definition of doTree.
46 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
49 * src/mathed/math_defs.h: redefine SetAlign to use string rather
52 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
54 * src/buffer.C (pop_tag): revert for the second time a change by
55 Lars, who seems to really hate having non-local loop variables :)
57 * src/Lsstream.h: add "using" statements.
59 * src/support/copy.C (copy): add a bunch of std:: qualifiers
60 * src/buffer.C (writeFile): ditto
62 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
64 * src/buffer.C (writeFile): try to fix the locale modified format
65 number to always be as we want it.
67 * src/WorkArea.C (work_area_handler): try to workaround the bugs
68 in XForms 0.89. C-space is now working again.
70 * src/Lsstream.h src/support/sstream.h: new files.
72 * also commented out all cases where strstream were used.
74 * src/Bullet.h (c_str): remove method.
76 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
78 * a lot of files: get rid of "char const *" and "char *" is as
79 many places as possible. We only want to use them in interaction
80 with system of other libraries, not inside lyx.
82 * a lot of files: return const object is not of pod type. This
83 helps ensure that temporary objects is not modified. And fits well
84 with "programming by contract".
86 * configure.in: check for the locale header too
88 * Makefile.am (sourcedoc): new tag for generation of doc++
91 2000-09-14 Juergen Vigna <jug@sad.it>
93 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
94 callback to check which combo called it and do the right action.
96 * src/combox.C (combo_cb): added combo * to the callbacks.
97 (Hide): moved call of callback after Ungrab of the pointer.
99 * src/intl.h: removed LCombo2 function.
101 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
102 function as this can now be handled in one function.
104 * src/combox.h: added Combox * to callback prototype.
106 * src/frontends/xforms/Toolbar_pimpl.C:
107 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
109 2000-09-14 Garst Reese <reese@isn.net>
111 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
112 moved usepackage{xxx}'s to beginning of file. Changed left margin
113 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
114 underlining from title. Thanks to John Culleton for useful suggestions.
116 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
118 * src/lyxlex_pimpl.C (setFile): change error message to debug
121 2000-09-13 Juergen Vigna <jug@sad.it>
123 * src/frontends/xforms/FormDocument.C: implemented choice_class
124 as combox and give callback to combo_language so OK/Apply is activated
127 * src/bufferlist.C (newFile): small fix so already named files
128 (via an open call) are not requested to be named again on the
131 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
133 * src/frontends/kde/Makefile.am
134 * src/frontends/kde/FormRef.C
135 * src/frontends/kde/FormRef.h
136 * src/frontends/kde/formrefdialog.C
137 * src/frontends/kde/formrefdialog.h: implement
140 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
142 * src/frontends/kde/formtocdialog.C
143 * src/frontends/kde/formtocdialog.h
144 * src/frontends/kde/FormToc.C
145 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
147 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
149 * src/frontends/kde/FormCitation.C: fix thinko
150 where we didn't always display the reference text
153 * src/frontends/kde/formurldialog.C
154 * src/frontends/kde/formurldialog.h
155 * src/frontends/kde/FormUrl.C
156 * src/frontends/kde/FormUrl.h: minor cleanups
158 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
160 * src/frontends/kde/Makefile.am
161 * src/frontends/kde/FormToc.C
162 * src/frontends/kde/FormToc.h
163 * src/frontends/kde/FormCitation.C
164 * src/frontends/kde/FormCitation.h
165 * src/frontends/kde/FormIndex.C
166 * src/frontends/kde/FormIndex.h
167 * src/frontends/kde/formtocdialog.C
168 * src/frontends/kde/formtocdialog.h
169 * src/frontends/kde/formcitationdialog.C
170 * src/frontends/kde/formcitationdialog.h
171 * src/frontends/kde/formindexdialog.C
172 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
174 2000-09-12 Juergen Vigna <jug@sad.it>
176 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
179 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
181 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
184 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
186 * src/converter.C (Add, Convert): Added support for converter flags:
187 needaux, resultdir, resultfile.
188 (Convert): Added new parameter view_file.
189 (dvips_options): Fixed letter paper option.
191 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
192 (Export, GetExportableFormats, GetViewableFormats): Added support
195 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
197 (easyParse): Fixed to work with new export code.
199 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
202 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
204 * lib/bind/*.bind: Replaced
205 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
206 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
208 2000-09-11 Juergen Vigna <jug@sad.it>
210 * src/lyx_gui.C (runTime): uses global guiruntime variable.
212 * src/main.C (main): now GUII defines global guiruntime!
214 * src/frontends/gnome/GUIRunTime.C (initApplication):
215 * src/frontends/kde/GUIRunTime.C (initApplication):
216 * src/frontends/xforms/GUIRunTime.C (initApplication):
217 * src/frontends/GUIRunTime.h: added new function initApplication.
219 * src/spellchecker.C (sc_accept_word): change to add_to_session.
221 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
223 2000-09-08 Juergen Vigna <jug@sad.it>
225 * src/lyx_gui.C (create_forms): don't display the "default" entry as
226 we have already "Reset".
228 * src/language.C (initL): inserted "default" language and made this
229 THE default language (and not american!)
231 * src/paragraph.C: inserted handling of "default" language!
233 * src/lyxfont.C: ditto
237 * src/paragraph.C: output the \\par only if we have a following
238 paragraph otherwise it's not needed.
240 2000-09-05 Juergen Vigna <jug@sad.it>
242 * config/pspell.m4: added entry to lyx-flags
244 * src/spellchecker.C: modified version from Kevin for using pspell
246 2000-09-01 Marko Vendelin <markov@ioc.ee>
247 * src/frontends/gnome/Makefile.am
248 * src/frontends/gnome/FormCitation.C
249 * src/frontends/gnome/FormCitation.h
250 * src/frontends/gnome/diainsertcitation_callbacks.c
251 * src/frontends/gnome/diainsertcitation_callbacks.h
252 * src/frontends/gnome/diainsertcitation_interface.c
253 * src/frontends/gnome/diainsertcitation_interface.h
254 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
255 dialog for Gnome frontend
257 * src/main.C: Gnome libraries require keeping application name
258 and its version as strings
260 * src/frontends/gnome/mainapp.C: Change the name of the main window
261 from GnomeLyX to PACKAGE
263 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
265 * src/frontends/Liason.C: add "using: declaration.
267 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
269 * src/mathed/math_macro.C (Metrics): Set the size of the template
271 * src/mathed/formulamacro.C (Latex): Fixed the returned value
273 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
275 * src/converter.C (add_options): New function.
276 (SetViewer): Change $$FName into '$$FName'.
277 (View): Add options when running xdvi
278 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
279 (Convert): The 3rd parameter is now the desired filename. Converts
280 calls to lyx::rename if necessary.
281 Add options when running dvips.
282 (dvi_papersize,dvips_options): New methods.
284 * src/exporter.C (Export): Use getLatexName() instead of fileName().
286 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
287 using a call to Converter::dvips_options.
288 Fixed to work with nex export code.
291 * src/support/rename.C: New files
293 * src/support/syscall.h
294 * src/support/syscall.C: Added Starttype SystemDontWait.
296 * lib/ui/default.ui: Changed to work with new export code
298 * lib/configure.m4: Changed to work with new export code
300 * src/encoding.C: Changed latex name for iso8859_7 encoding.
302 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
304 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
305 so that code compiles with DEC cxx.
307 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
308 to work correctly! Also now supports the additional elements
311 2000-09-01 Allan Rae <rae@lyx.org>
313 * src/frontends/ButtonPolicies.C: renamed all the references to
314 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
316 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
317 since it's a const not a type.
319 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
321 2000-08-31 Juergen Vigna <jug@sad.it>
323 * src/insets/figinset.C: Various changes to look if the filename has
324 an extension and if not add it for inline previewing.
326 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
328 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
329 make buttonStatus and isReadOnly be const methods. (also reflect
330 this in derived classes.)
332 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
333 (nextState): change to be static inline, pass the StateMachine as
335 (PreferencesPolicy): remove casts
336 (OkCancelPolicy): remvoe casts
337 (OkCancelReadOnlyPolicy): remove casts
338 (NoRepeatedApplyReadOnlyPolicy): remove casts
339 (OkApplyCancelReadOnlyPolicy): remove casts
340 (OkApplyCancelPolicy): remove casts
341 (NoRepeatedApplyPolicy): remove casts
343 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
345 * src/converter.C: added some using directives
347 * src/frontends/ButtonPolicies.C: changes to overcome
348 "need lvalue" error with DEC c++
350 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
351 to WMHideCB for DEC c++
353 * src/frontends/xforms/Menubar_pimpl.C: added using directive
355 * src/frontends/xforms/forms/form_document.C.patch: use C callback
356 to BulletBMTableCB for DEC c++
358 2000-08-31 Allan Rae <rae@lyx.org>
360 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
361 character dialog separately from old document dialogs combo_language.
364 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
366 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
367 Removed LFUN_REF_CREATE.
369 * src/MenuBackend.C: Added new tags: toc and references
371 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
372 (add_lastfiles, add_documents, add_formats): Removed the unused smn
374 (add_toc, add_references): New methods.
375 (create_submenu): Handle correctly the case when there is a
376 seperator after optional menu items.
378 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
379 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
380 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
382 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
384 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
386 * src/converter.[Ch]: New file for converting between different
389 * src/export.[Ch]: New file for exporting a LyX file to different
392 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
393 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
394 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
395 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
396 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
397 RunDocBook, MenuExport.
399 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
400 Exporter::Preview methods if NEW_EXPORT is defined.
402 * src/buffer.C (Dispatch): Use Exporter::Export.
404 * src/lyxrc.C: Added new tags: \converter and \viewer.
407 * src/LyXAction.C: Define new lyx-function: buffer-update.
408 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
409 when NEW_EXPORT is defined.
411 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
413 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
415 * lib/ui/default.ui: Added submenus "view" and "update" to the
418 * src/filetools.C (GetExtension): New function.
420 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
422 2000-08-29 Allan Rae <rae@lyx.org>
424 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
426 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
427 (EnableDocumentLayout): removed
428 (DisableDocumentLayout): removed
429 (build): make use of ButtonController's read-only handling to
430 de/activate various objects. Replaces both of the above functions.
432 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
433 (readOnly): was read_only
434 (refresh): fixed dumb mistakes with read_only_ handling
436 * src/frontends/xforms/forms/form_document.fd:
437 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
438 tabbed dialogs so the tabs look more like tabs and so its easier to
439 work out which is the current tab.
441 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
442 segfault with form_table
444 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
446 2000-08-28 Juergen Vigna <jug@sad.it>
448 * acconfig.h: added USE_PSPELL.
450 * src/config.h.in: added USE_PSPELL.
452 * autogen.sh: added pspell.m4
454 * config/pspell.m4: new file.
456 * src/spellchecker.C: implemented support for pspell libary.
458 2000-08-25 Juergen Vigna <jug@sad.it>
460 * src/LyXAction.C (init): renamed LFUN_TABLE to
461 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
463 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
465 * src/lyxscreen.h: add force_clear variable and fuction to force
466 a clear area when redrawing in LyXText.
468 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
470 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
472 * some whitespace and comment changes.
474 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
476 * src/buffer.C: up te LYX_FORMAT to 2.17
478 2000-08-23 Juergen Vigna <jug@sad.it>
480 * src/BufferView_pimpl.C (tripleClick): disable this when in a
483 * src/insets/insettabular.C (pasteSelection): delete the insets
484 LyXText as it is not valid anymore.
485 (copySelection): new function.
486 (pasteSelection): new function.
487 (cutSelection): new function.
488 (LocalDispatch): implemented cut/copy/paste of cell selections.
490 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
491 don't have a LyXText.
493 * src/LyXAction.C (init): a NEW_TABULAR define too much.
495 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
498 2000-08-22 Juergen Vigna <jug@sad.it>
500 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
501 ifdef form_table out if NEW_TABULAR.
503 2000-08-21 Juergen Vigna <jug@sad.it>
505 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
506 (draw): fixed draw position so that the cursor is positioned in the
508 (InsetMotionNotify): hide/show cursor so the position is updated.
509 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
510 using cellstart() function where it should be used.
512 * src/insets/insettext.C (draw): ditto.
514 * src/tabular.C: fixed initialization of some missing variables and
515 made BoxType into an enum.
517 2000-08-22 Marko Vendelin <markov@ioc.ee>
518 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
519 stock menu item using action numerical value, not its string
523 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
525 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
526 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
528 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
530 * src/frontends/xforms/GUIRunTime.C: new file
532 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
533 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
535 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
537 * src/frontends/kde/GUIRunTime.C: new file
539 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
540 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
542 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
544 * src/frontends/gnome/GUIRunTime.C: new file
546 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
549 * src/frontends/GUIRunTime.h: removed constructor and destructor,
550 small change to documetentation.
552 * src/frontends/GUIRunTime.C: removed file
554 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
556 * src/lyxparagraph.h: enable NEW_TABULAR as default
558 * src/lyxfunc.C (processKeySym): remove some commented code
560 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
561 NEW_TABULAR around the fd_form_table_options.
563 * src/lyx_gui.C (runTime): call the static member function as
564 GUIRunTime::runTime().
566 2000-08-21 Allan Rae <rae@lyx.org>
568 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
571 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
573 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
575 2000-08-21 Allan Rae <rae@lyx.org>
577 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
579 * src/frontends/xforms/FormPreferences.C (build): use setOK
580 * src/frontends/xforms/FormDocument.C (build): use setOK
581 (FormDocument): use the appropriate policy.
583 2000-08-21 Allan Rae <rae@lyx.org>
585 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
586 automatic [de]activation of arbitrary objects when in a read-only state.
588 * src/frontends/ButtonPolicies.h: More documentation
589 (isReadOnly): added to support the above.
591 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
593 2000-08-18 Juergen Vigna <jug@sad.it>
595 * src/insets/insettabular.C (getStatus): changed to return func_status.
597 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
598 display toggle menu entries if they are.
600 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
601 new document layout now.
603 * src/lyxfunc.C: ditto
605 * src/lyx_gui_misc.C: ditto
607 * src/lyx_gui.C: ditto
609 * lib/ui/default.ui: removed paper and quotes layout as they are now
610 all in the document layout tabbed folder.
612 * src/frontends/xforms/forms/form_document.fd: added Restore
613 button and callbacks for all inputs for Allan's ButtonPolicy.
615 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
616 (CheckChoiceClass): added missing params setting on class change.
617 (UpdateLayoutDocument): added for updating the layout on params.
618 (build): forgot to RETURN_ALWAYS input_doc_spacing.
619 (FormDocument): Implemented Allan's ButtonPolicy with the
622 2000-08-17 Allan Rae <rae@lyx.org>
624 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
625 so we can at least see the credits again.
627 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
628 controller calls for the appropriate callbacks. Note that since Ok
629 calls apply followed by cancel, and apply isn't a valid input for the
630 APPLIED state, the bc_ calls have to be made in the static callback not
631 within each of the real callbacks.
633 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
634 (setOk): renamed from setOkay()
636 2000-08-17 Juergen Vigna <jug@sad.it>
638 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
639 in the implementation part.
640 (composeUIInfo): don't show optional menu-items.
642 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
644 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
646 * src/bufferview_funcs.C (CurrentState): fixed to show also the
647 text-state when in a text-inset.
649 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
651 2000-08-17 Marko Vendelin <markov@ioc.ee>
652 * src/frontends/gnome/FormIndex.C
653 * src/frontends/gnome/FormIndex.h
654 * src/frontends/gnome/FormToc.C
655 * src/frontends/gnome/FormToc.h
656 * src/frontends/gnome/dialogs
657 * src/frontends/gnome/diatoc_callbacks.c
658 * src/frontends/gnome/diatoc_callbacks.h
659 * src/frontends/gnome/diainsertindex_callbacks.h
660 * src/frontends/gnome/diainsertindex_callbacks.c
661 * src/frontends/gnome/diainsertindex_interface.c
662 * src/frontends/gnome/diainsertindex_interface.h
663 * src/frontends/gnome/diatoc_interface.h
664 * src/frontends/gnome/diatoc_interface.c
665 * src/frontends/gnome/Makefile.am: Table of Contents and
666 Insert Index dialogs implementation for Gnome frontend
668 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
670 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
672 * src/frontends/gnome/diainserturl_interface.c: make the dialog
675 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
677 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
678 destructor. Don't definde if you don't need it
679 (processEvents): made static, non-blocking events processing for
681 (runTime): static method. event loop for xforms
682 * similar as above for kde and gnome.
684 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
686 (runTime): new method calss the real frontends runtime func.
688 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
690 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
692 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
694 2000-08-16 Juergen Vigna <jug@sad.it>
696 * src/lyx_gui.C (runTime): added GUII RunTime support.
698 * src/frontends/Makefile.am:
699 * src/frontends/GUIRunTime.[Ch]:
700 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
701 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
702 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
704 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
706 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
707 as this is already set in ${FRONTEND_INCLUDE} if needed.
709 * configure.in (CPPFLAGS): setting the include dir for the frontend
710 directory and don't set FRONTEND=xforms for now as this is executed
713 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
715 * src/frontends/kde/Makefile.am:
716 * src/frontends/kde/FormUrl.C:
717 * src/frontends/kde/FormUrl.h:
718 * src/frontends/kde/formurldialog.h:
719 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
721 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
723 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
725 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
727 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
730 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
732 * src/WorkArea.C (work_area_handler): more work to get te
733 FL_KEYBOARD to work with xforms 0.88 too, please test.
735 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
737 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
739 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
742 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
744 * src/Timeout.h: remove Qt::emit hack.
746 * several files: changes to allo doc++ compilation
748 * src/lyxfunc.C (processKeySym): new method
749 (processKeyEvent): comment out if FL_REVISION < 89
751 * src/WorkArea.C: change some debugging levels.
752 (WorkArea): set wantkey to FL_KEY_ALL
753 (work_area_handler): enable the FL_KEYBOARD clause, this enables
754 clearer code and the use of compose with XForms 0.89. Change to
755 use signals instead of calling methods in bufferview directly.
757 * src/Painter.C: change some debugging levels.
759 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
762 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
763 (workAreaKeyPress): new method
765 2000-08-14 Juergen Vigna <jug@sad.it>
767 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
769 * config/kde.m4: addes some features
771 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
772 include missing xforms dialogs.
774 * src/Timeout.h: a hack to be able to compile with qt/kde.
776 * sigc++/.cvsignore: added acinclude.m4
778 * lib/.cvsignore: added listerros
780 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
781 xforms tree as objects are needed for other frontends.
783 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
784 linking with not yet implemented xforms objects.
786 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
788 2000-08-14 Baruch Even <baruch.even@writeme.com>
790 * src/frontends/xforms/FormGraphics.h:
791 * src/frontends/xforms/FormGraphics.C:
792 * src/frontends/xforms/RadioButtonGroup.h:
793 * src/frontends/xforms/RadioButtonGroup.C:
794 * src/insets/insetgraphics.h:
795 * src/insets/insetgraphics.C:
796 * src/insets/insetgraphicsParams.h:
797 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
798 instead of spaces, and various other indentation issues to make the
799 sources more consistent.
801 2000-08-14 Marko Vendelin <markov@ioc.ee>
803 * src/frontends/gnome/dialogs/diaprint.glade
804 * src/frontends/gnome/FormPrint.C
805 * src/frontends/gnome/FormPrint.h
806 * src/frontends/gnome/diaprint_callbacks.c
807 * src/frontends/gnome/diaprint_callbacks.h
808 * src/frontends/gnome/diaprint_interface.c
809 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
812 * src/frontends/gnome/dialogs/diainserturl.glade
813 * src/frontends/gnome/FormUrl.C
814 * src/frontends/gnome/FormUrl.h
815 * src/frontends/gnome/diainserturl_callbacks.c
816 * src/frontends/gnome/diainserturl_callbacks.h
817 * src/frontends/gnome/diainserturl_interface.c
818 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
821 * src/frontends/gnome/Dialogs.C
822 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
823 all other dialogs. Copy all unimplemented dialogs from Xforms
826 * src/frontends/gnome/support.c
827 * src/frontends/gnome/support.h: support files generated by Glade
831 * config/gnome.m4: Gnome configuration scripts
833 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
834 configure --help message
836 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
837 only if there are no events pendling in Gnome/Gtk. This enhances
838 the performance of menus.
841 2000-08-14 Allan Rae <rae@lyx.org>
843 * lib/Makefile.am: listerrors cleaning
845 * lib/listerrors: removed -- generated file
846 * acinclude.m4: ditto
847 * sigc++/acinclude.m4: ditto
849 * src/frontends/xforms/forms/form_citation.fd:
850 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
853 * src/frontends/xforms/forms/makefile: I renamed the `install` target
854 `updatesrc` and now we have a `test` target that does what `updatesrc`
855 used to do. I didn't like having an install target that wasn't related
858 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
859 on all except FormGraphics. This may yet happen. Followed by a major
860 cleanup including using FL_TRANSIENT for most of the dialogs. More
861 changes to come when the ButtonController below is introduced.
863 * src/frontends/xforms/ButtonController.h: New file for managing up to
864 four buttons on a dialog according to an externally defined policy.
865 * src/frontends/xforms/Makefile.am: added above
867 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
868 Apply and Cancel/Close buttons and everything in between and beyond.
869 * src/frontends/Makefile.am: added above.
871 * src/frontends/xforms/forms/form_preferences.fd:
872 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
873 and removed variable 'status' as a result. Fixed the set_minsize thing.
874 Use the new screen-font-update after checking screen fonts were changed
875 Added a "Restore" button to restore the original lyxrc values while
876 editing. This restores everything not just the last input changed.
877 That's still a tricky one. As is the "LyX: this shouldn't happen..."
879 * src/LyXAction.C: screen-font-update added for updating buffers after
880 screen font settings have been changed.
881 * src/commandtags.h: ditto
882 * src/lyxfunc.C: ditto
884 * forms/lyx.fd: removed screen fonts dialog.
885 * src/lyx_gui.C: ditto
886 * src/menus.[Ch]: ditto
887 * src/lyx.[Ch]: ditto
888 * src/lyx_cb.C: ditto + code from here moved to make
889 screen-font-update. And people wonder why progress on GUII is
890 slow. Look at how scattered this stuff was! It takes forever
893 * forms/fdfix.sh: Fixup the spacing after commas.
894 * forms/makefile: Remove date from generated files. Fewer clashes now.
895 * forms/bullet_forms.C.patch: included someones handwritten changes
897 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
898 once I've discovered why LyXRC was made noncopyable.
899 * src/lyx_main.C: ditto
901 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
903 * src/frontends/xforms/forms/fdfix.sh:
904 * src/frontends/xforms/forms/fdfixh.sed:
905 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
906 * src/frontends/xforms/Form*.[hC]:
907 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
908 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
909 provide a destructor for the struct FD_form_xxxx. Another version of
910 the set_[max|min]size workaround and a few other cleanups. Actually,
911 Angus' patch from 20000809.
913 2000-08-13 Baruch Even <baruch.even@writeme.com>
915 * src/insets/insetgraphics.C (Clone): Added several fields that needed
918 2000-08-11 Juergen Vigna <jug@sad.it>
920 * src/insets/insetgraphics.C (InsetGraphics): changing init
921 order because of warnings.
923 * src/frontends/xforms/forms/makefile: adding patching .C with
926 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
927 from .C.patch to .c.patch
929 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
930 order because of warning.
932 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
934 * src/frontends/Liason.C (setMinibuffer): new helper function
936 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
938 * src/lyxfunc.C (Dispatch): calling new Document-Layout
940 * lib/ui/default.ui: commented out PaperLayout entry
942 * src/frontends/xforms/form_document.[Ch]: new added files
944 * src/frontends/xforms/FormDocument.[Ch]: ditto
946 * src/frontends/xforms/forms/form_document.fd: ditto
948 * src/frontends/xforms/forms/form_document.C.patch: ditto
950 2000-08-10 Juergen Vigna <jug@sad.it>
952 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
953 (InsetGraphics): initialized cacheHandle to 0.
954 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
956 2000-08-10 Baruch Even <baruch.even@writeme.com>
958 * src/graphics/GraphicsCache.h:
959 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
960 correctly as a cache.
962 * src/graphics/GraphicsCacheItem.h:
963 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
966 * src/graphics/GraphicsCacheItem_pimpl.h:
967 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
970 * src/insets/insetgraphics.h:
971 * src/insets/insetgraphics.C: Changed from using a signal notification
972 to polling when image is not loaded.
974 2000-08-10 Allan Rae <rae@lyx.org>
976 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
977 that there are two functions that have to been taken out of line by
978 hand and aren't taken care of in the script. (Just a reminder note)
980 * sigc++/macros/*.h.m4: Updated as above.
982 2000-08-09 Juergen Vigna <jug@sad.it>
984 * src/insets/insettext.C (draw): small fix for clearing rectangle.
986 * src/insets/insettabular.C: make drawing of single cell smarter.
988 2000-08-09 Marko Vendelin <markov@ioc.ee>
989 * src/frontends/gnome/Menubar_pimpl.C
990 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
991 implementation: new files
993 * src/frontends/gnome/mainapp.C
994 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
997 * src/main.C: create Gnome main window
999 * src/frontends/xforms/Menubar_pimpl.h
1000 * src/frontends/Menubar.C
1001 * src/frontends/Menubar.h: added method Menubar::update that calls
1002 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1004 * src/LyXView.C: calls Menubar::update to update the state
1007 * src/frontends/gnome/Makefile.am: added new files
1009 * src/frontends/Makefile.am: added frontend compiler options
1011 2000-08-08 Juergen Vigna <jug@sad.it>
1013 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1015 * src/bufferlist.C (close):
1016 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1017 documents if exiting without saving.
1019 * src/buffer.C (save): use removeAutosaveFile()
1021 * src/support/filetools.C (removeAutosaveFile): new function.
1023 * src/lyx_cb.C (MenuWrite): returns a bool now.
1024 (MenuWriteAs): check if file could really be saved and revert to the
1026 (MenuWriteAs): removing old autosavefile if existant.
1028 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1029 before Goto toggle declaration, because of compiler warning.
1031 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1033 * src/lyxfunc.C (MenuNew): small fix.
1035 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1037 * src/bufferlist.C (newFile):
1038 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1040 * src/lyxrc.C: added new_ask_filename tag
1042 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1044 * src/lyx.fd: removed code pertaining to form_ref
1045 * src/lyx.[Ch]: ditto
1046 * src/lyx_cb.C: ditto
1047 * src/lyx_gui.C: ditto
1048 * src/lyx_gui_misc.C: ditto
1050 * src/BufferView_pimpl.C (restorePosition): update buffer only
1053 * src/commandtags.h (LFUN_REFTOGGLE): removed
1054 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1055 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1056 (LFUN_REFBACK): renamed LFUN_REF_BACK
1058 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1059 * src/menus.C: ditto
1060 * src/lyxfunc.C (Dispatch): ditto.
1061 InsertRef dialog is now GUI-independent.
1063 * src/texrow.C: added using std::endl;
1065 * src/insets/insetref.[Ch]: strip out large amounts of code.
1066 The inset is now a container and this functionality is now
1067 managed by a new FormRef dialog
1069 * src/frontends/Dialogs.h (showRef, createRef): new signals
1071 * src/frontends/xforms/FormIndex.[Ch],
1072 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1073 when setting dialog's min/max size
1074 * src/frontends/xforms/FormIndex.[Ch]: ditto
1076 * src/frontends/xforms/FormRef.[Ch],
1077 src/frontends/xforms/forms/form_ref.fd: new xforms
1078 implementation of an InsetRef dialog
1080 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1083 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1084 ios::nocreate is not part of the standard. Removed.
1086 2000-08-07 Baruch Even <baruch.even@writeme.com>
1088 * src/graphics/Renderer.h:
1089 * src/graphics/Renderer.C: Added base class for rendering of different
1090 image formats into Pixmaps.
1092 * src/graphics/XPM_Renderer.h:
1093 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1094 in a different class.
1096 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1097 easily add support for other formats.
1099 * src/insets/figinset.C: plugged a leak of an X resource.
1101 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1103 * src/CutAndPaste.[Ch]: make all metods static.
1105 * development/Code_rules/Rules: more work, added section on
1106 Exceptions, and a References section.
1108 * a lot of header files: work to make doc++ able to generate the
1109 source documentation, some workarounds of doc++ problems. Doc++ is
1110 now able to generate the documentation.
1112 2000-08-07 Juergen Vigna <jug@sad.it>
1114 * src/insets/insettabular.C (recomputeTextInsets): removed function
1116 * src/tabular.C (SetWidthOfMulticolCell):
1118 (calculate_width_of_column_NMC): fixed return value so that it really
1119 only returns true if the column-width has changed (there where
1120 problems with muliticolumn-cells in this column).
1122 2000-08-04 Juergen Vigna <jug@sad.it>
1124 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1125 also on the scrollstatus of the inset.
1126 (workAreaMotionNotify): ditto.
1128 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1130 2000-08-01 Juergen Vigna <jug@sad.it>
1132 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1134 * src/commandtags.h:
1135 * src/LyXAction.C (init):
1136 * src/insets/inset.C (LocalDispatch): added support for
1139 * src/insets/inset.C (scroll): new functions.
1141 * src/insets/insettext.C (removeNewlines): new function.
1142 (SetAutoBreakRows): removes forced newlines in the text of the
1143 paragraph if autoBreakRows is set to false.
1145 * src/tabular.C (Latex): generates a parbox around the cell contents
1148 * src/frontends/xforms/FormTabular.C (local_update): removed
1149 the radio_useparbox button.
1151 * src/tabular.C (UseParbox): new function
1153 2000-08-06 Baruch Even <baruch.even@writeme.com>
1155 * src/graphics/GraphicsCache.h:
1156 * src/graphics/GraphicsCache.C:
1157 * src/graphics/GraphicsCacheItem.h:
1158 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1161 * src/insets/insetgraphics.h:
1162 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1163 drawing of the inline image.
1165 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1166 into the wrong position.
1168 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1171 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1173 * src/support/translator.h: move all typedefs to public section
1175 * src/support/filetools.C (MakeLatexName): return string const
1177 (TmpFileName): ditto
1178 (FileOpenSearch): ditto
1180 (LibFileSearch): ditto
1181 (i18nLibFileSearch): ditto
1184 (CreateTmpDir): ditto
1185 (CreateBufferTmpDir): ditto
1186 (CreateLyXTmpDir): ditto
1189 (MakeAbsPath): ditto
1191 (OnlyFilename): ditto
1193 (NormalizePath): ditto
1194 (CleanupPath): ditto
1195 (GetFileContents): ditto
1196 (ReplaceEnvironmentPath): ditto
1197 (MakeRelPath): ditto
1199 (ChangeExtension): ditto
1200 (MakeDisplayPath): ditto
1201 (do_popen): return cmdret const
1202 (findtexfile): return string const
1204 * src/support/DebugStream.h: add some /// to please doc++
1206 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1208 * src/texrow.C (same_rownumber): functor to use with find_if
1209 (getIdFromRow): rewritten to use find_if and to not update the
1210 positions. return true if row is found
1211 (increasePos): new method, use to update positions
1213 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1215 * src/lyxlex_pimpl.C (verifyTable): new method
1218 (GetString): return string const
1219 (pushTable): rewrite to use std::stack
1221 (setFile): better check
1224 * src/lyxlex.h: make LyXLex noncopyable
1226 * src/lyxlex.C (text): return char const * const
1227 (GetString): return string const
1228 (getLongString): return string const
1230 * src/lyx_gui_misc.C (askForText): return pair<...> const
1232 * src/lastfiles.[Ch] (operator): return string const
1234 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1235 istringstream not char const *.
1236 move token.end() out of loop.
1237 (readFile): move initializaton of token
1239 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1240 getIdFromRow is successful.
1242 * lib/bind/emacs.bind: don't include menus bind
1244 * development/Code_rules/Rules: the beginnings of making this
1245 better and covering more of the unwritten rules that we have.
1247 * development/Code_rules/Recommendations: a couple of wording
1250 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1252 * src/support/strerror.c: remove C++ comment.
1254 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1256 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1257 LFUN_INDEX_INSERT_LAST
1259 * src/texrow.C (getIdFromRow): changed from const_iterator to
1260 iterator, allowing code to compile with DEC cxx
1262 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1263 stores part of the class, as suggested by Allan. Will allow
1265 (apply): test to apply uses InsetCommandParams operator!=
1267 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1268 (apply): test to apply uses InsetCommandParams operator!=
1270 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1271 stores part of the class.
1272 (update): removed limits on min/max size.
1274 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1275 (apply): test to apply uses InsetCommandParams operator!=
1277 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1278 (Read, Write, scanCommand, getCommand): moved functionality
1279 into InsetCommandParams.
1281 (getScreenLabel): made pure virtual
1282 new InsetCommandParams operators== and !=
1284 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1285 c-tors based on InsetCommandParams. Removed others.
1286 * src/insets/insetinclude.[Ch]: ditto
1287 * src/insets/insetlabel.[Ch]: ditto
1288 * src/insets/insetparent.[Ch]: ditto
1289 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1291 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1292 insets derived from InsetCommand created using similar c-tors
1293 based on InsetCommandParams
1294 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1295 * src/menus.C (ShowRefsMenu): ditto
1296 * src/paragraph.C (Clone): ditto
1297 * src/text2.C (SetCounter): ditto
1298 * src/lyxfunc.C (Dispatch) ditto
1299 Also recreated old InsetIndex behaviour exactly. Can now
1300 index-insert at the start of a paragraph and index-insert-last
1301 without launching the pop-up.
1303 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1305 * lib/lyxrc.example: mark te pdf options as non functional.
1307 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1308 (isStrDbl): move tmpstr.end() out of loop.
1309 (strToDbl): move intialization of tmpstr
1310 (lowercase): return string const and move tmp.end() out of loop.
1311 (uppercase): return string const and move tmp.edn() out of loop.
1312 (prefixIs): add assertion
1317 (containsOnly): ditto
1318 (containsOnly): ditto
1319 (containsOnly): ditto
1320 (countChar): make last arg char not char const
1321 (token): return string const
1322 (subst): return string const, move tmp.end() out of loop.
1323 (subst): return string const, add assertion
1324 (strip): return string const
1325 (frontStrip): return string const, add assertion
1326 (frontStrip): return string const
1331 * src/support/lstrings.C: add inclde "LAssert.h"
1332 (isStrInt): move tmpstr.end() out of loop.
1334 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1335 toollist.end() out of loop.
1336 (deactivate): move toollist.end() out of loop.
1337 (update): move toollist.end() out of loop.
1338 (updateLayoutList): move tc.end() out of loop.
1339 (add): move toollist.end() out of loop.
1341 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1342 md.end() out of loop.
1344 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1346 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1349 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1350 (Erase): move insetlist.end() out of loop.
1352 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1353 ref to const string as first arg. Move initialization of some
1354 variables, whitespace changes.
1356 * src/kbmap.C (defkey): move table.end() out of loop.
1357 (kb_keymap): move table.end() out of loop.
1358 (findbinding): move table.end() out of loop.
1360 * src/MenuBackend.C (hasMenu): move end() out of loop.
1361 (getMenu): move end() out of loop.
1362 (getMenu): move menulist_.end() out of loop.
1364 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1366 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1369 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1370 (getFromLyXName): move infotab.end() out of loop.
1372 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1373 -fvtable-thunks -ffunction-sections -fdata-sections
1375 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1377 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1380 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1382 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1384 * src/frontends/xforms/FormCitation.[Ch],
1385 src/frontends/xforms/FormIndex.[Ch],
1386 src/frontends/xforms/FormToc.[Ch],
1387 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1389 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1391 * src/commandtags.h: renamed, created some flags for citation
1394 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1396 * src/lyxfunc.C (dispatch): use signals to insert index entry
1398 * src/frontends/Dialogs.h: new signal createIndex
1400 * src/frontends/xforms/FormCommand.[Ch],
1401 src/frontends/xforms/FormCitation.[Ch],
1402 src/frontends/xforms/FormToc.[Ch],
1403 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1405 * src/insets/insetindex.[Ch]: GUI-independent
1407 * src/frontends/xforms/FormIndex.[Ch],
1408 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1411 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1413 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1414 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1416 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1418 * src/insets/insetref.C (Latex): rewrite so that there is now
1419 question that a initialization is requested.
1421 * src/insets/insetcommand.h: reenable the hide signal
1423 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1425 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1426 fix handling of shortcuts (many bugs :)
1427 (add_lastfiles): ditto.
1429 * lib/ui/default.ui: fix a few shortcuts.
1431 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1433 * Makefile.am: Fix ``rpmdist'' target to return the exit
1434 status of the ``rpm'' command, instead of the last command in
1435 the chain (the ``rm lyx.xpm'' command, which always returns
1438 2000-08-02 Allan Rae <rae@lyx.org>
1440 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1441 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1442 * src/frontends/xforms/FormToc.C (FormToc): ditto
1444 * src/frontends/xforms/Makefile.am: A few forgotten files
1446 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1447 Signals-not-copyable-problem Lars' started commenting out.
1449 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1451 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1453 * src/insets/insetcommand.h: Signals is not copyable so anoter
1454 scheme for automatic hiding of forms must be used.
1456 * src/frontends/xforms/FormCitation.h: don't inerit from
1457 noncopyable, FormCommand already does that.
1458 * src/frontends/xforms/FormToc.h: ditto
1459 * src/frontends/xforms/FormUrl.h: ditto
1461 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1463 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1465 * src/insets/insetcommand.h (hide): new SigC::Signal0
1466 (d-tor) new virtual destructor emits hide signal
1468 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1469 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1471 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1472 LOF and LOT. Inset is now GUI-independent
1474 * src/insets/insetloa.[Ch]: redundant
1475 * src/insets/insetlof.[Ch]: ditto
1476 * src/insets/insetlot.[Ch]: ditto
1478 * src/frontends/xforms/forms/form_url.fd: tweaked!
1479 * src/frontends/xforms/forms/form_citation.fd: ditto
1481 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1482 dialogs dealing with InsetCommand insets
1484 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1485 FormCommand base class
1486 * src/frontends/xforms/FormUrl.[Ch]: ditto
1488 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1490 * src/frontends/xforms/FormToc.[Ch]: ditto
1492 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1493 passed a generic InsetCommand pointer
1494 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1496 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1497 and modified InsetTOC class
1498 * src/buffer.C: ditto
1500 * forms/lyx.fd: strip out old FD_form_toc code
1501 * src/lyx_gui_misc.C: ditto
1502 * src/lyx_gui.C: ditto
1503 * src/lyx_cb.C: ditto
1504 * src/lyx.[Ch]: ditto
1506 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1508 * src/support/utility.hpp: tr -d '\r'
1510 2000-08-01 Juergen Vigna <jug@sad.it>
1512 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1514 * src/commandtags.h:
1515 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1516 LFUN_TABULAR_FEATURES.
1518 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1519 LFUN_LAYOUT_TABULAR.
1521 * src/insets/insettabular.C (getStatus): implemented helper function.
1523 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1525 2000-07-31 Juergen Vigna <jug@sad.it>
1527 * src/text.C (draw): fixed screen update problem for text-insets.
1529 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1530 something changed probably this has to be added in various other
1533 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1535 2000-07-31 Baruch Even <baruch.even@writeme.com>
1537 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1538 templates to satisfy compaq cxx.
1541 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1543 * src/support/translator.h (equal_1st_in_pair::operator()): take
1544 const ref pair_type as arg.
1545 (equal_2nd_in_pair::operator()): ditto
1546 (Translator::~Translator): remove empty d-tor.
1548 * src/graphics/GraphicsCache.C: move include config.h to top, also
1549 put initialization of GraphicsCache::singleton here.
1550 (~GraphicsCache): move here
1551 (addFile): take const ref as arg
1554 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1556 * src/BufferView2.C (insertLyXFile): change te with/without header
1559 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1561 * src/frontends/xforms/FormGraphics.C (apply): add some
1562 static_cast. Not very nice, but required by compaq cxx.
1564 * src/frontends/xforms/RadioButtonGroup.h: include header
1565 <utility> instead of <pair.h>
1567 * src/insets/insetgraphicsParams.C: add using directive.
1568 (readResize): change return type to void.
1569 (readOrigin): ditto.
1571 * src/lyxfunc.C (getStatus): add missing break for build-program
1572 function; add test for Literate for export functions.
1574 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1575 entries in Options menu.
1577 2000-07-31 Baruch Even <baruch.even@writeme.com>
1579 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1580 protect against auto-allocation; release icon when needed.
1582 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1584 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1585 on usual typewriter.
1587 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1588 earlier czech.kmap), useful only for programming.
1590 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1592 * src/frontends/xforms/FormCitation.h: fix conditioning around
1595 2000-07-31 Juergen Vigna <jug@sad.it>
1597 * src/frontends/xforms/FormTabular.C (local_update): changed
1598 radio_linebreaks to radio_useparbox and added radio_useminipage.
1600 * src/tabular.C: made support for using minipages/parboxes.
1602 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1604 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1606 (descent): so the cursor is in the middle.
1607 (width): bit smaller box.
1609 * src/insets/insetgraphics.h: added display() function.
1611 2000-07-31 Baruch Even <baruch.even@writeme.com>
1613 * src/frontends/Dialogs.h: Added showGraphics signals.
1615 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1616 xforms form definition of the graphics dialog.
1618 * src/frontends/xforms/FormGraphics.h:
1619 * src/frontends/xforms/FormGraphics.C: Added files, the
1620 GUIndependent code of InsetGraphics
1622 * src/insets/insetgraphics.h:
1623 * src/insets/insetgraphics.C: Major writing to make it work.
1625 * src/insets/insetgraphicsParams.h:
1626 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1627 struct between InsetGraphics and GUI.
1629 * src/LaTeXFeatures.h:
1630 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1631 support for graphicx package.
1633 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1634 for the graphics inset.
1636 * src/support/translator.h: Added file, used in
1637 InsetGraphicsParams. this is a template to translate between two
1640 * src/frontends/xforms/RadioButtonGroup.h:
1641 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1642 way to easily control a radio button group.
1644 2000-07-28 Juergen Vigna <jug@sad.it>
1646 * src/insets/insettabular.C (LocalDispatch):
1647 (TabularFeatures): added support for lyx-functions of tabular features.
1648 (cellstart): refixed this function after someone wrongly changed it.
1650 * src/commandtags.h:
1651 * src/LyXAction.C (init): added support for tabular-features
1653 2000-07-28 Allan Rae <rae@lyx.org>
1655 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1656 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1657 triggers the callback for input checking. As a result we sometimes get
1658 "LyX: This shouldn't happen..." printed to cerr.
1659 (input): Started using status variable since I only free() on
1660 destruction. Some input checking for paths and font sizes.
1662 * src/frontends/xforms/FormPreferences.h: Use status to control
1663 activation of Ok and Apply
1665 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1666 callback. Also resized to stop segfaults with 0.88. The problem is
1667 that xforms-0.88 requires the folder to be wide enough to fit all the
1668 tabs. If it isn't it causes all sorts of problems.
1670 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1672 * src/frontends/xforms/forms/README: Reflect reality.
1674 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1675 * src/frontends/xforms/forms/makefile: ditto.
1677 * src/commandtags.h: Get access to new Preferences dialog
1678 * src/LyXAction.C: ditto
1679 * src/lyxfunc.C: ditto
1680 * lib/ui/default.ui: ditto
1682 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1684 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1686 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1689 * src/frontends/xforms/form_url.[Ch]: added.
1691 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1693 * src/insets/insetbib.h: fixed bug in previous commit
1695 * src/frontends/xforms/FormUrl.h: ditto
1697 * src/frontends/xforms/FormPrint.h: ditto
1699 * src/frontends/xforms/FormPreferences.h: ditto
1701 * src/frontends/xforms/FormCopyright.h: ditto
1703 * src/frontends/xforms/FormCitation.C: ditto
1705 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1706 private copyconstructor and private default contructor
1708 * src/support/Makefile.am: add utility.hpp
1710 * src/support/utility.hpp: new file from boost
1712 * src/insets/insetbib.h: set owner in clone
1714 * src/frontends/xforms/FormCitation.C: added missing include
1717 * src/insets/form_url.[Ch]: removed
1719 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1721 * development/lyx.spec.in
1722 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1723 file/directory re-organization.
1725 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1727 * src/insets/insetcommand.[Ch]: moved the string data and
1728 associated manipulation methods into a new stand-alone class
1729 InsetCommandParams. This class has two additional methods
1730 getAsString() and setFromString() allowing the contents to be
1731 moved around as a single string.
1732 (addContents) method removed.
1733 (setContents) method no longer virtual.
1735 * src/buffer.C (readInset): made use of new InsetCitation,
1736 InsetUrl constructors based on InsetCommandParams.
1738 * src/commandtags.h: add LFUN_INSERT_URL
1740 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1741 independent InsetUrl and use InsetCommandParams to extract
1742 string info and create new Insets.
1744 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1746 * src/frontends/xforms/FormCitation.C (apply): uses
1749 * src/frontends/xforms/form_url.C
1750 * src/frontends/xforms/form_url.h
1751 * src/frontends/xforms/FormUrl.h
1752 * src/frontends/xforms/FormUrl.C
1753 * src/frontends/xforms/forms/form_url.fd: new files
1755 * src/insets/insetcite.[Ch]: removed unused constructors.
1757 * src/insets/insetinclude.[Ch]: no longer store filename
1759 * src/insets/inseturl.[Ch]: GUI-independent.
1761 2000-07-26 Juergen Vigna <jug@sad.it>
1762 * renamed frontend from gtk to gnome as it is that what is realized
1763 and did the necessary changes in the files.
1765 2000-07-26 Marko Vendelin <markov@ioc.ee>
1767 * configure.in: cleaning up gnome configuration scripts
1769 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1771 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1772 shortcuts syndrom by redrawing them explicitely (a better solution
1773 would be appreciated).
1775 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1777 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1780 * src/lyx_cb.C (MenuExport): change html export to do the right
1781 thing depending of the document type (instead of having
1782 html-linuxdoc and html-docbook).
1783 * src/lyxfunc.C (getStatus): update for html
1784 * lib/ui/default.ui: simplify due to the above change.
1785 * src/menus.C (ShowFileMenu): update too (in case we need it).
1787 * src/MenuBackend.C (read): if a menu is defined twice, add the
1788 new entries to the exiting one.
1790 2000-07-26 Juergen Vigna <jug@sad.it>
1792 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1794 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1795 and return a bool if it did actual save the file.
1796 (AutoSave): don't autosave a unnamed doc.
1798 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1799 check if this is an UNNAMED new file and react to it.
1800 (newFile): set buffer to unnamed and change to not mark a new
1801 buffer dirty if I didn't do anything with it.
1803 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1805 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1807 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1808 friend as per Angus's patch posted to lyx-devel.
1810 * src/ext_l10n.h: updated
1812 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1813 gettext on the style string right before inserting them into the
1816 * autogen.sh: add code to extract style strings form layout files,
1817 not good enough yet.
1819 * src/frontends/gtk/.cvsignore: add MAKEFILE
1821 * src/MenuBackend.C (read): run the label strings through gettext
1822 before storing them in the containers.
1824 * src/ext_l10n.h: new file
1826 * autogen.sh : generate the ext_l10n.h file here
1828 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1830 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1833 * lib/ui/default.ui: fix a couple of typos.
1835 * config/gnome/gtk.m4: added (and added to the list of files in
1838 * src/insets/insetinclude.C (unique_id): fix when we are using
1839 lyxstring instead of basic_string<>.
1840 * src/insets/insettext.C (LocalDispatch): ditto.
1841 * src/support/filetools.C: ditto.
1843 * lib/configure.m4: create the ui/ directory if necessary.
1845 * src/LyXView.[Ch] (updateToolbar): new method.
1847 * src/BufferView_pimpl.C (buffer): update the toolbar when
1848 opening/closing buffer.
1850 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1852 * src/LyXAction.C (getActionName): enhance to return also the name
1853 and options of pseudo-actions.
1854 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1856 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1857 as an example of what is possible). Used in File->Build too (more
1858 useful) and in the import/export menus (to mimick the complicated
1859 handling of linuxdoc and friends). Try to update all the entries.
1861 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1864 * src/MenuBackend.C (read): Parse the new OptItem tag.
1866 * src/MenuBackend.h: Add a new optional_ data member (used if the
1867 entry should be omitted when the lyxfunc is disabled).
1869 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1870 function, used as a shortcut.
1871 (create_submenu): align correctly the shortcuts on the widest
1874 * src/MenuBackend.h: MenuItem.label() only returns the label of
1875 the menu without shortcut; new method shortcut().
1877 2000-07-14 Marko Vendelin <markov@ioc.ee>
1879 * src/frontends/gtk/Dialogs.C:
1880 * src/frontends/gtk/FormCopyright.C:
1881 * src/frontends/gtk/FormCopyright.h:
1882 * src/frontends/gtk/Makefile.am: added these source-files for the
1883 Gtk/Gnome support of the Copyright-Dialog.
1885 * src/main.C: added Gnome::Main initialization if using
1886 Gtk/Gnome frontend-GUI.
1888 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1890 * config/gnome/aclocal-include.m4
1891 * config/gnome/compiler-flags.m4
1892 * config/gnome/curses.m4
1893 * config/gnome/gnome--.m4
1894 * config/gnome/gnome-bonobo-check.m4
1895 * config/gnome/gnome-common.m4
1896 * config/gnome/gnome-fileutils.m4
1897 * config/gnome/gnome-ghttp-check.m4
1898 * config/gnome/gnome-gnorba-check.m4
1899 * config/gnome/gnome-guile-checks.m4
1900 * config/gnome/gnome-libgtop-check.m4
1901 * config/gnome/gnome-objc-checks.m4
1902 * config/gnome/gnome-orbit-check.m4
1903 * config/gnome/gnome-print-check.m4
1904 * config/gnome/gnome-pthread-check.m4
1905 * config/gnome/gnome-support.m4
1906 * config/gnome/gnome-undelfs.m4
1907 * config/gnome/gnome-vfs.m4
1908 * config/gnome/gnome-x-checks.m4
1909 * config/gnome/gnome-xml-check.m4
1910 * config/gnome/gnome.m4
1911 * config/gnome/gperf-check.m4
1912 * config/gnome/gtk--.m4
1913 * config/gnome/linger.m4
1914 * config/gnome/need-declaration.m4: added configuration scripts
1915 for Gtk/Gnome frontend-GUI
1917 * configure.in: added support for the --with-frontend=gtk option
1919 * autogen.sh: added config/gnome/* to list of config-files
1921 * acconfig.h: added define for GTKGUI-support
1923 * config/lyxinclude.m4: added --with-frontend[=value] option value
1924 for Gtk/Gnome frontend-GUI support.
1926 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1928 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1932 * src/paragraph.C (GetChar): remove non-const version
1934 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1935 (search_kw): use it.
1937 * src/lyx_main.C (init): if "preferences" exist, read that instead
1939 (ReadRcFile): return bool if the file could be read ok.
1940 (ReadUIFile): add a check to see if lex file is set ok.
1942 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1943 bastring can be used instead of lyxstring (still uses the old code
1944 if std::string is good enough or if lyxstring is used.)
1946 * src/encoding.C: make the arrays static, move ininle functions
1948 * src/encoding.h: from here.
1950 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1951 (parseSingleLyXformat2Token): move inset parsing to separate method
1952 (readInset): new private method
1954 * src/Variables.h: remove virtual from get().
1956 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1957 access to NEW_INSETS and NEW_TABULAR
1959 * src/MenuBackend.h: remove superfluous forward declaration of
1960 MenuItem. Add documentations tags "///", remove empty MenuItem
1961 destructor, remove private default contructor.
1963 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1965 (read): more string mlabel and mname to where they are used
1966 (read): remove unused variables mlabel and mname
1967 (defaults): unconditional clear, make menusetup take advantage of
1968 add returning Menu &.
1970 * src/LyXView.h: define NEW_MENUBAR as default
1972 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1973 to NEW_INSETS and NEW_TABULAR.
1974 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1975 defined. Change some of the "xxxx-inset-insert" functions names to
1978 * several files: more enahncements to NEW_INSETS and the resulting
1981 * lib/lyxrc.example (\date_insert_format): move to misc section
1983 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1984 bastring and use AC_CACHE_CHECK.
1985 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1986 the system have the newest methods. uses AC_CACHE_CHECK
1987 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1988 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1989 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1991 * configure.in: add LYX_CXX_GOOD_STD_STRING
1993 * acinclude.m4: recreated
1995 2000-07-24 Amir Karger
1997 * README: add Hebrew, Arabic kmaps
2000 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2002 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2005 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2007 * Lot of files: add pragma interface/implementation.
2009 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2011 * lib/ui/default.ui: new file (ans new directory). Contains the
2012 default menu and toolbar.
2014 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2015 global space. Toolbars are now read (as menus) in ui files.
2017 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2019 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2020 is disabled because the document is read-only. We want to have the
2021 toggle state of the function anyway.
2022 (getStatus): add code for LFUN_VC* functions (mimicking what is
2023 done in old-style menus)
2025 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2026 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2028 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2029 * src/BufferView_pimpl.C: ditto.
2030 * src/lyxfunc.C: ditto.
2032 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2033 default). This replaces old-style menus by new ones.
2035 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2036 MenuItem. Contain the data structure of a menu.
2038 * src/insets/insettext.C: use LyXView::setLayout instead of
2039 accessing directly the toolbar combox.
2040 * src/lyxfunc.C (Dispatch): ditto.
2042 * src/LyXView.C (setLayout): new method, which just calls
2043 Toolbar::setLayout().
2044 (updateLayoutChoice): move part of this method in Toolbar.
2046 * src/toolbar.[Ch]: removed.
2048 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2049 implementation the toolbar.
2051 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2052 the toolbar. It might make sense to merge it with ToolbarDefaults
2054 (setLayout): new function.
2055 (updateLayoutList): ditto.
2056 (openLayoutList): ditto.
2058 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2059 xforms implementation of the toolbar.
2060 (get_toolbar_func): comment out, since I do not
2061 know what it is good for.
2063 * src/ToolbarDefaults.h: Add the ItemType enum.
2065 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2066 for a list of allocated C strings. Used in Menubar xforms
2067 implementation to avoid memory leaks.
2069 * src/support/lstrings.[Ch] (uppercase): new version taking and
2073 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2074 * lib/bind/emacs.bind: ditto.
2076 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2078 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2079 forward decl of LyXView.
2081 * src/toolbar.C (toolbarItem): moved from toolbar.h
2082 (toolbarItem::clean): ditto
2083 (toolbarItem::~toolbarItem): ditto
2084 (toolbarItem::operator): ditto
2086 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2088 * src/paragraph.h: control the NEW_TABULAR define from here
2090 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2091 USE_TABULAR_INSETS to NEW_TABULAR
2093 * src/ToolbarDefaults.C: add include "lyxlex.h"
2095 * files using the old table/tabular: use NEW_TABULAR to control
2096 compilation of old tabular stuff.
2098 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2101 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2102 planemet in reading of old style floats, fix the \end_deeper
2103 problem when reading old style floats.
2105 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2107 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2109 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2111 * lib/bind/sciword.bind: updated.
2113 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2115 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2116 layout write problem
2118 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2120 * src/Makefile.am (INCLUDES): remove image directory from include
2123 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2124 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2126 * src/LyXView.C (create_form_form_main): read the application icon
2129 * lib/images/*.xpm: change the icons to use transparent color for
2132 * src/toolbar.C (update): change the color of the button when it
2135 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2137 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2138 setting explicitely the minibuffer.
2139 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2141 * src/LyXView.C (showState): new function. Shows font information
2142 in minibuffer and update toolbar state.
2143 (LyXView): call Toolbar::update after creating the
2146 * src/toolbar.C: change toollist to be a vector instead of a
2148 (BubbleTimerCB): get help string directly from the callback
2149 argument of the corresponding icon (which is the action)
2150 (set): remove unnecessary ugliness.
2151 (update): new function. update the icons (depressed, disabled)
2152 depending of the status of the corresponding action.
2154 * src/toolbar.h: remove help in toolbarItem
2156 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2158 * src/Painter.C (text): Added code for using symbol glyphs from
2159 iso10646 fonts. Currently diabled.
2161 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2164 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2165 magyar,turkish and usorbian.
2167 * src/paragraph.C (isMultiLingual): Made more efficient.
2169 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2172 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2173 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2174 Also changed the prototype to "bool math_insert_greek(char)".
2176 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2178 * lots of files: apply the NEW_INSETS on all code that will not be
2179 needed when we move to use the new insets. Enable the define in
2180 lyxparagrah.h to try it.
2182 * src/insets/insettabular.C (cellstart): change to be a static
2184 (InsetTabular): initialize buffer in the initializer list.
2186 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2188 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2189 form_print.h out of the header file. Replaced with forward
2190 declarations of the relevant struct.
2192 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2195 * src/commandtags.h: do not include "debug.h" which does not
2196 belong there. #include it in some other places because of this
2199 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2201 * src/insets/insetcaption.C: add a couple "using" directives.
2203 * src/toolbar.C (add): get the help text directly from lyxaction.
2205 (setPixmap): new function. Loads from disk and sets a pixmap on a
2206 botton; the name of the pixmap file is derived from the command
2209 * src/toolbar.h: remove members isBitmap and pixmap from
2212 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2213 * lib/images/: move many files from images/banner.xpm.
2215 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2217 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2218 * src/toolbar.C: ditto.
2219 * configure.in: ditto.
2220 * INSTALL: document.
2222 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2223 the spellchecker popup is closed from the WM.
2225 2000-07-19 Juergen Vigna <jug@sad.it>
2227 * src/insets/insetfloat.C (Write): small fix because we use the
2228 insetname for the type now!
2230 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2232 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2235 * src/frontends/Dialogs.h: removed hideCitation signal
2237 * src/insets/insetcite.h: added hide signal
2239 * src/insets/insetcite.C (~InsetCitation): emits new signal
2240 (getScreenLabel): "intelligent" label should now fit on the screen!
2242 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2244 * src/frontends/xforms/FormCitation.C (showInset): connects
2245 hide() to the inset's hide signal
2246 (show): modified to use fl_set_object_position rather than
2247 fl_set_object_geometry wherever possible
2249 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2251 * src/insets/lyxinset.h: add caption code
2253 * src/insets/insetfloat.C (type): new method
2255 * src/insets/insetcaption.C (Write): new method
2257 (LyxCode): new method
2259 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2260 to get it right together with using the FloatList.
2262 * src/commandtags.h: add LFUN_INSET_CAPTION
2263 * src/lyxfunc.C (Dispatch): handle it
2265 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2268 * src/Variables.[Ch]: make expand take a const reference, remove
2269 the destructor, some whitespace changes.
2271 * src/LyXAction.C (init): add caption-inset-insert
2273 * src/FloatList.C (FloatList): update the default floats a bit.
2275 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2277 * src/Variables.[Ch]: new files. Intended to be used for language
2278 specific strings (like \chaptername) and filename substitution in
2281 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2283 * lib/kbd/american.kmap: update
2285 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2287 * src/bufferparams.[Ch]: remove member allowAccents.
2289 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2291 * src/LaTeXLog.C: use the log_form.h header.
2292 * src/lyx_gui.C: ditto.
2293 * src/lyx_gui_misc.C: ditto.
2294 * src/lyxvc.h: ditto.
2296 * forms/log_form.fd: new file, created from latexoptions.fd. I
2297 kept the log popup and nuked the options form.
2299 * src/{la,}texoptions.[Ch]: removed.
2300 * src/lyx_cb.C (LaTeXOptions): ditto
2302 * src/lyx_gui.C (create_forms): do not handle the
2303 fd_latex_options form.
2305 2000-07-18 Juergen Vigna <jug@sad.it>
2307 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2308 name of the inset so that it can be requested outside (text2.C).
2310 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2313 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2315 * src/mathed/formula.h (ConvertFont): constify
2317 * src/mathed/formula.C (Read): add warning if \end_inset is not
2318 found on expected place.
2320 * src/insets/lyxinset.h (ConvertFont): consify
2322 * src/insets/insetquotes.C (ConvertFont): constify
2323 * src/insets/insetquotes.h: ditto
2325 * src/insets/insetinfo.h: add labelfont
2327 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2328 (ascent): use labelfont
2332 (Write): make .lyx file a bit nicer
2334 * src/insets/insetfloat.C (Write): simplify somewhat...
2335 (Read): add warning if arg is not found
2337 * src/insets/insetcollapsable.C: add using std::max
2338 (Read): move string token and add warning in arg is not found
2339 (draw): use std::max to get the right ty
2340 (getMaxWidth): simplify by using std::max
2342 * src/insets/insetsection.h: new file
2343 * src/insets/insetsection.C: new file
2344 * src/insets/insetcaption.h: new file
2345 * src/insets/insetcaption.C: new file
2347 * src/insets/inset.C (ConvertFont): constify signature
2349 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2350 insetcaption.[Ch] and insetsection.[Ch]
2352 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2353 uses to use LABEL_COUNTER_CHAPTER instead.
2354 * src/text2.C (SetCounter): here
2356 * src/counters.h: new file
2357 * src/counters.C: new file
2358 * src/Sectioning.h: new file
2359 * src/Sectioning.C: new file
2361 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2363 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2365 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2368 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2371 2000-07-17 Juergen Vigna <jug@sad.it>
2373 * src/tabular.C (Validate): check if array-package is needed.
2374 (SetVAlignment): added support for vertical alignment.
2375 (SetLTFoot): better support for longtable header/footers
2376 (Latex): modified to support added features.
2378 * src/LaTeXFeatures.[Ch]: added array-package.
2380 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2382 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2385 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2387 * configure.in: do not forget to put a space after -isystem.
2389 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2391 * lib/kbd/arabic.kmap: a few fixes.
2393 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2395 * some whitespace chagnes to a number of files.
2397 * src/support/DebugStream.h: change to make it easier for
2398 doc++ to parse correctly.
2399 * src/support/lyxstring.h: ditto
2401 * src/mathed/math_utils.C (compara): change to have only one
2403 (MathedLookupBOP): change because of the above.
2405 * src/mathed/math_delim.C (math_deco_compare): change to have only
2407 (search_deco): change becasue of the above.
2409 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2410 instead of manually coded one.
2412 * src/insets/insetquotes.C (Read): read the \end_inset too
2414 * src/insets/insetlatex.h: remove file
2415 * src/insets/insetlatex.C: remove file
2417 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2419 (InsetPrintIndex): remove destructor
2421 * src/insets/insetinclude.h: remove default constructor
2423 * src/insets/insetfloat.C: work to make it work better
2425 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2427 * src/insets/insetcite.h (InsetCitation): remove default constructor
2429 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2431 * src/text.C (GetColumnNearX): comment out some currently unused code.
2433 * src/paragraph.C (writeFile): move some initializations closer to
2435 (CutIntoMinibuffer): small change to use new matchIT operator
2439 (InsertInset): ditto
2442 (InsetIterator): ditto
2443 (Erase): small change to use new matchFT operator
2445 (GetFontSettings): ditto
2446 (HighestFontInRange): ditto
2449 * src/lyxparagraph.h: some chars changed to value_type
2450 (matchIT): because of some stronger checking (perhaps too strong)
2451 in SGI STL, the two operator() unified to one.
2454 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2456 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2457 the last inset read added
2458 (parseSingleLyXformat2Token): some more (future) compability code added
2459 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2460 (parseSingleLyXformat2Token): set last_inset_read
2461 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2462 (parseSingleLyXformat2Token): don't double intializw string next_token
2464 * src/TextCache.C (text_fits::operator()): add const's to the signature
2465 (has_buffer::operator()): ditto
2467 * src/Floating.h: add some comments on the class
2469 * src/FloatList.[Ch] (typeExist): new method
2472 * src/BackStack.h: added default constructor, wanted by Gcc.
2474 2000-07-14 Juergen Vigna <jug@sad.it>
2476 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2478 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2480 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2481 do a redraw when the window is resized!
2482 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2484 * src/insets/insettext.C (resizeLyXText): added function to correctly
2485 being able to resize the LyXWindow.
2487 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2489 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2491 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2492 crashes when closing dialog to a deleted inset.
2494 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2495 method! Now similar to other insets.
2497 2000-07-13 Juergen Vigna <jug@sad.it>
2499 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2501 * lib/examples/Literate.lyx: small patch!
2503 * src/insets/insetbib.C (Read): added this function because of wrong
2504 Write (without [begin|end]_inset).
2506 2000-07-11 Juergen Vigna <jug@sad.it>
2508 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2509 as the insertInset could not be good!
2511 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2512 the bool param should not be last.
2514 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2516 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2517 did submit that to Karl).
2519 * configure.in: use -isystem instead of -I for X headers. This
2520 fixes a problem on solaris with a recent gcc;
2521 put the front-end code after the X detection code;
2522 configure in sigc++ before lib/
2524 * src/lyx_main.C (commandLineHelp): remove -display from command
2527 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2529 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2530 Also put in Makefile rules for building the ``listerrors''
2531 program for parsing errors from literate programs written in LyX.
2533 * lib/build-listerrors: Added small shell script as part of compile
2534 process. This builds a working ``listerrors'' binary if noweb is
2535 installed and either 1) the VNC X server is installed on the machine,
2536 or 2) the user is compiling from within a GUI. The existence of a GUI
2537 is necessary to use the ``lyx --export'' feature for now. This
2538 hack can be removed once ``lyx --export'' no longer requires a GUI to
2541 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2543 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2544 now passed back correctly from gcc and placed "under" error
2545 buttons in a Literate LyX source.
2547 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2549 * src/text.C (GetColumnNearX): Better behavior when a RTL
2550 paragraph is ended by LTR text.
2552 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2555 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2557 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2558 true when clipboard is empty.
2560 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2562 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2563 row of the paragraph.
2564 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2565 to prevent calculation of bidi tables
2567 2000-07-07 Juergen Vigna <jug@sad.it>
2569 * src/screen.C (ToggleSelection): added y_offset and x_offset
2572 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2575 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2577 * src/insets/insettext.C: fixed Layout-Display!
2579 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2581 * configure.in: add check for strings.h header.
2583 * src/spellchecker.C: include <strings.h> in order to have a
2584 definition for bzero().
2586 2000-07-07 Juergen Vigna <jug@sad.it>
2588 * src/insets/insettext.C (draw): set the status of the bv->text to
2589 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2591 * src/screen.C (DrawOneRow):
2592 (DrawFromTo): redraw the actual row if something has changed in it
2595 * src/text.C (draw): call an update of the toplevel-inset if something
2596 has changed inside while drawing.
2598 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2600 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2602 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2603 processing inside class.
2605 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2606 processing inside class.
2608 * src/insets/insetindex.h new struct Holder, consistent with other
2611 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2612 citation dialog from main code and placed it in src/frontends/xforms.
2613 Dialog launched through signals instead of callbacks
2615 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2617 * lyx.man: update the options description.
2619 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2621 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2622 handle neg values, set min width to 590, add doc about -display
2624 2000-07-05 Juergen Vigna <jug@sad.it>
2626 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2627 calls to BufferView *.
2629 * src/insets/insettext.C (checkAndActivateInset): small fix non
2630 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2632 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2633 their \end_inset token!
2635 2000-07-04 edscott <edscott@imp.mx>
2637 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2638 lib/lyxrc.example: added option \wheel_jump
2640 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2642 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2643 remove support for -width,-height,-xpos and -ypos.
2645 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2647 * src/encoding.[Ch]: New files.
2649 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2650 (text): Call to the underline() method only when needed.
2652 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2654 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2655 encoding(s) for the document.
2657 * src/bufferparams.C (BufferParams): Changed default value of
2660 * src/language.C (newLang): Removed.
2661 (items[]): Added encoding information for all defined languages.
2663 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2664 encoding choice button.
2666 * src/lyxrc.h (font_norm_type): New member variable.
2667 (set_font_norm_type): New method.
2669 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2670 paragraphs with different encodings.
2672 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2673 (TransformChar): Changed to work correctly with Arabic points.
2674 (draw): Added support for drawing Arabic points.
2675 (draw): Removed code for drawing underbars (this is done by
2678 * src/support/textutils.h (IsPrintableNonspace): New function.
2680 * src/BufferView_pimpl.h: Added "using SigC::Object".
2681 * src/LyXView.h: ditto.
2683 * src/insets/insetinclude.h (include_label): Changed to mutable.
2685 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2687 * src/mathed/math_iter.h: remove empty destructor
2689 * src/mathed/math_cursor.h: remove empty destructor
2691 * src/insets/lyxinset.h: add THEOREM_CODE
2693 * src/insets/insettheorem.[Ch]: new files
2695 * src/insets/insetminipage.C: (InsertInset): remove
2697 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2699 (InsertInset): remove
2701 * src/insets/insetlist.C: (InsertList): remove
2703 * src/insets/insetfootlike.[Ch]: new files
2705 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2708 (InsertInset): ditto
2710 * src/insets/insetert.C: remove include Painter.h, reindent
2711 (InsertInset): move to header
2713 * src/insets/insetcollapsable.h: remove explicit from default
2714 contructor, remove empty destructor, add InsertInset
2716 * src/insets/insetcollapsable.C (InsertInset): new func
2718 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2720 * src/vspace.h: add explicit to constructor
2722 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2723 \textcompwordmark, please test this.
2725 * src/lyxrc.C: set ascii_linelen to 65 by default
2727 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2729 * src/commandtags.h: add LFUN_INSET_THEOREM
2731 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2732 (makeLinuxDocFile): remove _some_ of the nice logic
2733 (makeDocBookFile): ditto
2735 * src/Painter.[Ch]: (~Painter): removed
2737 * src/LyXAction.C (init): entry for insettheorem added
2739 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2741 (deplog): code to detect files generated by LaTeX, needs testing
2744 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2746 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2748 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2750 * src/LaTeX.C (deplog): Add a check for files that are going to be
2751 created by the first latex run, part of the project to remove the
2754 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2755 contents to the extension list.
2757 2000-07-04 Juergen Vigna <jug@sad.it>
2759 * src/text.C (NextBreakPoint): added support for needFullRow()
2761 * src/insets/lyxinset.h: added needFullRow()
2763 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2766 * src/insets/insettext.C: lots of changes for update!
2768 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2770 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2772 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2774 * src/insets/insetinclude.C (InsetInclude): fixed
2775 initialization of include_label.
2776 (unique_id): now returns a string.
2778 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2780 * src/LaTeXFeatures.h: new member IncludedFiles, for
2781 a map of key, included file name.
2783 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2784 with the included files for inclusion in SGML preamble,
2785 i. e., linuxdoc and docbook.
2788 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2789 nice (is the generated linuxdoc code to be exported?), that
2790 allows to remove column, and only_body that will be true for
2791 slave documents. Insets are allowed inside SGML font type.
2792 New handling of the SGML preamble for included files.
2793 (makeDocBookFile): the same for docbook.
2795 * src/insets/insetinclude.h:
2796 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2798 (DocBook): new export methods.
2800 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2801 and makeDocBookFile.
2803 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2804 formats to export with command line argument -x.
2806 2000-06-29 Juergen Vigna <jug@sad.it>
2808 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2809 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2811 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2812 region could already been cleared by an inset!
2814 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2816 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2819 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2821 (cursorToggle): remove special handling of lyx focus.
2823 2000-06-28 Juergen Vigna <jug@sad.it>
2825 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2828 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2830 * src/insets/insetindex.C (Edit): add a callback when popup is
2833 * src/insets/insettext.C (LocalDispatch):
2834 * src/insets/insetmarginal.h:
2835 * src/insets/insetlist.h:
2836 * src/insets/insetfoot.h:
2837 * src/insets/insetfloat.h:
2838 * src/insets/insetert.h: add a missing std:: qualifier.
2840 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2842 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2845 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2847 * src/insets/insettext.C (Read): remove tmptok unused variable
2848 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2849 (InsertInset): change for new InsetInset code
2851 * src/insets/insettext.h: add TEXT inline method
2853 * src/insets/insettext.C: remove TEXT macro
2855 * src/insets/insetmarginal.C (Write): new method
2856 (Latex): change output slightly
2858 * src/insets/insetfoot.C (Write): new method
2859 (Latex): change output slightly (don't use endl when no need)
2861 * src/insets/insetert.C (Write): new method
2863 * src/insets/insetcollapsable.h: make button_length, button_top_y
2864 and button_bottm_y protected.
2866 * src/insets/insetcollapsable.C (Write): simplify code by using
2867 tostr. Also do not output the float name, the children class
2868 should to that to get control over own arguments
2870 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2871 src/insets/insetminipage.[Ch]:
2874 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2876 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2878 * src/Makefile.am (lyx_SOURCES): add the new files
2880 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2881 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2882 * src/commandtags.h: ditto
2884 * src/LaTeXFeatures.h: add a std::set of used floattypes
2886 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2888 * src/FloatList.[Ch] src/Floating.h: new files
2890 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2892 * src/lyx_cb.C (TableApplyCB): ditto
2894 * src/text2.C: ditto
2895 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2896 (parseSingleLyXformat2Token): ditto + add code for
2897 backwards compability for old float styles + add code for new insets
2899 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2901 (InsertInset(size_type, Inset *, LyXFont)): new method
2902 (InsetChar(size_type, char)): changed to use the other InsetChar
2903 with a LyXFont(ALL_INHERIT).
2904 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2905 insert the META_INSET.
2907 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2909 * sigc++/thread.h (Threads): from here
2911 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2912 definition out of line
2913 * sigc++/scope.h: from here
2915 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2917 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2918 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2920 * Makefile.am (bindist): new target.
2922 * INSTALL: add instructions for doing a binary distribution.
2924 * development/tools/README.bin.example: update a bit.
2926 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2929 * lib/lyxrc.example: new lyxrc tag \set_color.
2931 * src/lyxfunc.C (Dispatch):
2932 * src/commandtags.h:
2933 * src/LyXAction.C: new lyxfunc "set-color".
2935 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2936 and an x11name given as strings.
2938 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2939 cache when a color is changed.
2941 2000-06-26 Juergen Vigna <jug@sad.it>
2943 * src/lyxrow.C (width): added this functions and variable.
2945 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2948 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2950 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2952 * images/undo_bw.xpm: new icon.
2953 * images/redo_bw.xpm: ditto.
2955 * configure.in (INSTALL_SCRIPT): change value to
2956 ${INSTALL} to avoid failures of install-script target.
2957 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2959 * src/BufferView.h: add a magic "friend" declaration to please
2962 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2964 * forms/cite.fd: modified to allow resizing without messing
2967 * src/insetcite.C: Uses code from cite.fd almost without
2969 User can now resize dialog in the x-direction.
2970 Resizing the dialog in the y-direction is prevented, as the
2971 code does this intelligently already.
2973 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2975 * INSTALL: remove obsolete entry in "problems" section.
2977 * lib/examples/sl_*.lyx: update of the slovenian examples.
2979 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2981 2000-06-23 Juergen Vigna <jug@sad.it>
2983 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2985 * src/buffer.C (resize): delete the LyXText of textinsets.
2987 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2989 * src/insets/lyxinset.h: added another parameter 'cleared' to
2990 the draw() function.
2992 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2993 unlocking inset in inset.
2995 2000-06-22 Juergen Vigna <jug@sad.it>
2997 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2998 of insets and moved first to LyXText.
3000 * src/mathed/formulamacro.[Ch]:
3001 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3003 2000-06-21 Juergen Vigna <jug@sad.it>
3005 * src/text.C (GetVisibleRow): look if I should clear the area or not
3006 using Inset::doClearArea() function.
3008 * src/insets/lyxinset.h: added doClearArea() function and
3009 modified draw(Painter &, ...) to draw(BufferView *, ...)
3011 * src/text2.C (UpdateInset): return bool insted of int
3013 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3015 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3016 combox in the character popup
3018 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3019 BufferParams const & params
3021 2000-06-20 Juergen Vigna <jug@sad.it>
3023 * src/insets/insettext.C (SetParagraphData): set insetowner on
3026 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3028 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3029 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3031 (form_main_): remove
3033 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3034 (create_form_form_main): remove FD_form_main stuff, connect to
3035 autosave_timeout signal
3037 * src/LyXView.[Ch] (getMainForm): remove
3038 (UpdateTimerCB): remove
3039 * src/BufferView_pimpl.h: inherit from SigC::Object
3041 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3042 signal instead of callback
3044 * src/BufferView.[Ch] (cursorToggleCB): remove
3046 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3048 * src/BufferView_pimpl.C: changes because of the one below
3050 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3051 instead of storing a pointer to a LyXText.
3053 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3055 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3057 * src/lyxparagraph.h
3059 * src/paragraph.C: Changed fontlist to a sorted vector.
3061 2000-06-19 Juergen Vigna <jug@sad.it>
3063 * src/BufferView.h: added screen() function.
3065 * src/insets/insettext.C (LocalDispatch): some selection code
3068 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3070 * src/insets/insettext.C (SetParagraphData):
3072 (InsetText): fixes for multiple paragraphs.
3074 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3076 * development/lyx.spec.in: Call configure with ``--without-warnings''
3077 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3078 This should be fine, however, since we generally don't want to be
3079 verbose when making an RPM.
3081 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3083 * lib/scripts/fig2pstex.py: New file
3085 2000-06-16 Juergen Vigna <jug@sad.it>
3087 * src/insets/insettabular.C (UpdateLocal):
3088 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3089 (LocalDispatch): Changed all functions to use LyXText.
3091 2000-06-15 Juergen Vigna <jug@sad.it>
3093 * src/text.C (SetHeightOfRow): call inset::update before requesting
3096 * src/insets/insettext.C (update):
3097 * src/insets/insettabular.C (update): added implementation
3099 * src/insets/lyxinset.h: added update function
3101 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3103 * src/text.C (SelectNextWord): protect against null pointers with
3104 old-style string streams. (fix from Paul Theo Gonciari
3107 * src/cite.[Ch]: remove erroneous files.
3109 * lib/configure.m4: update the list of created directories.
3111 * src/lyxrow.C: include <config.h>
3112 * src/lyxcursor.C: ditto.
3114 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3116 * lib/examples/decimal.lyx: new example file from Mike.
3118 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3119 to find template definitions (from Dekel)
3121 * src/frontends/.cvsignore: add a few things.
3123 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3125 * src/Timeout.C (TimeOut): remove default argument.
3127 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3130 * src/insets/ExternalTemplate.C: add a "using" directive.
3132 * src/lyx_main.h: remove the act_ struct, which seems unused
3135 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3137 * LyX Developers Meeting: All files changed, due to random C++ (by
3138 coincidence) code generator script.
3140 - external inset (cool!)
3141 - initial online editing of preferences
3142 - insettabular breaks insettext(s contents)
3144 - some DocBook fixes
3145 - example files update
3146 - other cool stuff, create a diff and look for yourself.
3148 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3150 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3151 -1 this is a non-line-breaking textinset.
3153 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3154 if there is no width set.
3156 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3158 * Lots of files: Merged the dialogbase branch.
3160 2000-06-09 Allan Rae <rae@lyx.org>
3162 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3163 and the Dispatch methods that used it.
3165 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3166 access to functions formerly kept in Dispatch.
3168 2000-05-19 Allan Rae <rae@lyx.org>
3170 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3171 made to_page and count_copies integers again. from_page remains a
3172 string however because I want to allow entry of a print range like
3173 "1,4,22-25" using this field.
3175 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3176 and printer-params-get. These aren't useful from the minibuffer but
3177 could be used by a script/LyXServer app provided it passes a suitable
3178 auto_mem_buffer. I guess I should take a look at how the LyXServer
3179 works and make it support xtl buffers.
3181 * sigc++/: updated to libsigc++-1.0.1
3183 * src/xtl/: updated to xtl-1.3.pl.11
3185 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3186 those changes done to the files in src/ are actually recreated when
3187 they get regenerated. Please don't ever accept a patch that changes a
3188 dialog unless that patch includes the changes to the corresponding *.fd
3191 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3192 stringOnlyContains, renamed it and generalised it.
3194 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3195 branch. Removed the remaining old form_print code.
3197 2000-04-26 Allan Rae <rae@lyx.org>
3199 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3200 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3202 2000-04-25 Allan Rae <rae@lyx.org>
3204 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3205 against a base of xtl-1.3.pl.4
3207 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3208 filter the Id: entries so they still show the xtl version number
3211 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3212 into the src/xtl code. Patch still pending with José (XTL)
3214 2000-04-24 Allan Rae <rae@lyx.org>
3216 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3217 both more generic and much safer. Use the new template functions.
3218 * src/buffer.[Ch] (Dispatch): ditto.
3220 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3221 and mem buffer more intelligently. Also a little general cleanup.
3224 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3225 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3226 * src/xtl/Makefile.am: ditto.
3227 * src/xtl/.cvsignore: ditto.
3228 * src/Makefile.am: ditto.
3230 * src/PrinterParams.h: Removed the macros member functions. Added a
3231 testInvariant member function. A bit of tidying up and commenting.
3232 Included Angus's idea for fixing operation with egcs-1.1.2.
3234 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3235 cool expansion of XTL's mem_buffer to support automatic memory
3236 management within the buffer itself. Removed the various macros and
3237 replaced them with template functions that use either auto_mem_buffer
3238 or mem_buffer depending on a #define. The mem_buffer support will
3239 disappear as soon as the auto_mem_buffer is confirmed to be good on
3240 other platforms/compilers. That is, it's there so you've got something
3243 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3244 effectively forked XTL. However I expect José will include my code
3245 into the next major release. Also fixed a memory leak.
3246 * src/xtl/text.h: ditto.
3247 * src/xtl/xdr.h: ditto.
3248 * src/xtl/giop.h: ditto.
3250 2000-04-16 Allan Rae <rae@lyx.org>
3252 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3253 by autogen.sh and removed by maintainer-clean anyway.
3254 * .cvsignore, sigc++/.cvsignore: Support the above.
3256 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3258 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3260 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3261 macros, renamed static callback-target member functions to suit new
3262 scheme and made them public.
3263 * src/frontends/xforms/forms/form_print.fd: ditto.
3264 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3266 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3269 * src/xtl/: New directory containing a minimal distribution of XTL.
3270 This is XTL-1.3.pl.4.
3272 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3274 2000-04-15 Allan Rae <rae@lyx.org>
3276 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3278 * sigc++/: Updated to libsigc++-1.0.0
3280 2000-04-14 Allan Rae <rae@lyx.org>
3282 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3283 use the generic ones in future. I'll modify my conversion script.
3285 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3287 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3288 (CloseAllBufferRelatedDialogs): Renamed.
3289 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3291 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3292 of the generic ones. These are the same ones my conversion script
3295 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3296 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3297 * src/buffer.C (Dispatch): ditto
3299 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3300 functions for updating and hiding buffer dependent dialogs.
3301 * src/BufferView.C (buffer): ditto
3302 * src/buffer.C (setReadonly): ditto
3303 * src/lyxfunc.C (CloseBuffer): ditto
3305 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3306 Dialogs.h, and hence all the SigC stuff, into every file that includes
3307 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3309 * src/BufferView2.C: reduce the number of headers included by buffer.h
3311 2000-04-11 Allan Rae <rae@lyx.org>
3313 * src/frontends/xforms/xform_macros.h: A small collection of macros
3314 for building C callbacks.
3316 * src/frontends/xforms/Makefile.am: Added above file.
3318 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3319 scheme again. This time it should work for JMarc. If this is
3320 successful I'll revise my conversion script to automate some of this.
3321 The static member functions in the class also have to be public for
3322 this scheme will work. If the scheme works (it's almost identical to
3323 the way BufferView::cursorToggleCB is handled so it should work) then
3324 FormCopyright and FormPrint will be ready for inclusion into the main
3325 trunk immediately after 1.1.5 is released -- provided we're prepared
3326 for complaints about lame compilers not handling XTL.
3328 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3330 2000-04-07 Allan Rae <rae@lyx.org>
3332 * config/lyxinclude.m4: A bit more tidying up (Angus)
3334 * src/LString.h: JMarc's <string> header fix
3336 * src/PrinterParams.h: Used string for most data to remove some
3337 ugly code in the Print dialog and avoid even uglier code when
3338 appending the ints to a string for output.
3340 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3341 and moved "default:" back to the end of switch statement. Cleaned
3342 up the printing so it uses the right function calls and so the
3343 "print to file" option actually puts the file in the right directory.
3345 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3347 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3348 and Ok+Apply button control into a separate method: input (Angus).
3349 (input) Cleaned it up and improved it to be very thorough now.
3350 (All CB) static_cast used instead of C style cast (Angus). This will
3351 probably change again once we've worked out how to keep gcc-2.8.1 happy
3352 with real C callbacks.
3353 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3354 ignore some of the bool settings and has random numbers instead. Needs
3355 some more investigation. Added other input length checks and checking
3356 of file and printer names.
3358 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3359 would link (Angus). Seems the old code doesn't compile with the pragma
3360 statement either. Separated callback entries from internal methods.
3362 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3364 2000-03-17 Allan Rae <rae@lyx.org>
3366 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3367 need it? Maybe it could go in Dialogs instead? I could make it a
3368 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3369 values to get the bool return value.
3370 (Dispatch): New overloaded method for xtl support.
3372 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3373 extern "C" callback instead of static member functions. Hopefully,
3374 JMarc will be able to compile this. I haven't changed
3375 forms/form_copyright.fd yet. Breaking one of my own rules already.
3377 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3378 because they aren't useful from the minibuffer. Maybe a LyXServer
3379 might want a help message though?
3381 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3383 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3384 xtl which needs both rtti and exceptions.
3386 * src/support/Makefile.am:
3387 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3389 * src/frontends/xforms/input_validators.[ch]: input filters and
3390 validators. These conrol what keys are valid in input boxes.
3391 Use them and write some more. Much better idea than waiting till
3392 after the user has pressed Ok to say that the input fields don't make
3395 * src/frontends/xforms/Makefile.am:
3396 * src/frontends/xforms/forms/form_print.fd:
3397 * src/frontends/xforms/forms/makefile:
3398 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3399 new scheme. Still have to make sure I haven't missed anything from
3400 the current implementation.
3402 * src/Makefile.am, src/PrinterParams.h: New data store.
3404 * other files: Added a couple of copyright notices.
3406 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3408 * src/insets/insetbib.h: move Holder struct in public space.
3410 * src/frontends/include/DialogBase.h: use SigC:: only when
3411 SIGC_CXX_NAMESPACES is defined.
3412 * src/frontends/include/Dialogs.h: ditto.
3414 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3416 * src/frontends/xforms/FormCopyright.[Ch]: do not
3417 mention SigC:: explicitely.
3419 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3421 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3422 deals with testing KDE in main configure.in
3423 * configure.in: ditto.
3425 2000-02-22 Allan Rae <rae@lyx.org>
3427 * Lots of files: Merged from HEAD
3429 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3430 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3432 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3434 * sigc++/: new minidist.
3436 2000-02-14 Allan Rae <rae@lyx.org>
3438 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3440 2000-02-08 Juergen Vigna <jug@sad.it>
3442 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3443 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3445 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3446 for this port and so it is much easier for other people to port
3447 dialogs in a common development environment.
3449 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3450 the QT/KDE implementation.
3452 * src/frontends/kde/Dialogs.C:
3453 * src/frontends/kde/FormCopyright.C:
3454 * src/frontends/kde/FormCopyright.h:
3455 * src/frontends/kde/Makefile.am:
3456 * src/frontends/kde/formcopyrightdialog.C:
3457 * src/frontends/kde/formcopyrightdialog.h:
3458 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3459 for the kde support of the Copyright-Dialog.
3461 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3462 subdir-substitution instead of hardcoded 'xforms' as we now have also
3465 * src/frontends/include/DialogBase.h (Object): just commented the
3466 label after #endif (nasty warning and I don't like warnings ;)
3468 * src/main.C (main): added KApplication initialization if using
3471 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3472 For now only the KDE event-loop is added if frontend==kde.
3474 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3476 * configure.in: added support for the --with-frontend[=value] option
3478 * autogen.sh: added kde.m4 file to list of config-files
3480 * acconfig.h: added define for KDEGUI-support
3482 * config/kde.m4: added configuration functions for KDE-port
3484 * config/lyxinclude.m4: added --with-frontend[=value] option with
3485 support for xforms and KDE.
3487 2000-02-08 Allan Rae <rae@lyx.org>
3489 * all Makefile.am: Fixed up so the make targets dist, distclean,
3490 install and uninstall all work even if builddir != srcdir. Still
3491 have a new sigc++ minidist update to come.
3493 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3495 2000-02-01 Allan Rae <rae@lyx.org>
3497 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3498 Many mods to get builddir != srcdir working.
3500 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3501 for building on NT and so we can do the builddir != srcdir stuff.
3503 2000-01-30 Allan Rae <rae@lyx.org>
3505 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3506 This will stay in "rae" branch. We probably don't really need it in
3507 the main trunk as anyone who wants to help programming it should get
3508 a full library installed also. So they can check both included and
3509 system supplied library compilation.
3511 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3512 Added a 'mini' distribution of libsigc++. If you feel the urge to
3513 change something in these directories - Resist it. If you can't
3514 resist the urge then you should modify the following script and rebuild
3515 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3516 all happen. Still uses a hacked version of libsigc++'s configure.in.
3517 I'm quite happy with the results. I'm not sure the extra work to turn
3518 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3519 worth the trouble and would probably lead to extra maintenance
3521 I haven't tested the following important make targets: install, dist.
3522 Not ready for prime time but very close. Maybe 1.1.5.
3524 * development/tools/makeLyXsigc.sh: A shell script to automatically
3525 generate our mini-dist of libsigc++. It can only be used with a CVS
3526 checkout of libsigc++ not a tarball distribution. It's well commented.
3527 This will end up as part of the libsigc++ distribution so other apps
3528 can easily have an included mini-dist. If someone makes mods to the
3529 sigc++ subpackage without modifying this script to generate those
3530 changes I'll be very upset!
3532 * src/frontends/: Started the gui/system indep structure.
3534 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3535 to access the gui-indep dialogs are in this class. Much improved
3536 design compared to previous revision. Lars, please refrain from
3537 moving this header into src/ like you did with Popups.h last time.
3539 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3541 * src/frontends/xforms/: Started the gui-indep system with a single
3542 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3545 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3546 Here you'll find a very useful makefile and automated fdfix.sh that
3547 makes updating dailogs a no-brainer -- provided you follow the rules
3548 set out in the README. I'm thinking about adding another script to
3549 automatically generate skeleton code for a new dialog given just the
3552 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3553 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3554 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3556 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3558 * src/support/LSubstring.C (operator): simplify
3560 * src/lyxtext.h: removed bparams, use buffer_->params instead
3562 * src/lyxrow.h: make Row a real class, move all variables to
3563 private and use accessors.
3565 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3567 (isRightToLeftPar): ditto
3568 (ChangeLanguage): ditto
3569 (isMultiLingual): ditto
3572 (SimpleTeXOnePar): ditto
3573 (TeXEnvironment): ditto
3574 (GetEndLabel): ditto
3576 (SetOnlyLayout): ditto
3577 (BreakParagraph): ditto
3578 (BreakParagraphConservative): ditto
3579 (GetFontSettings): ditto
3581 (CopyIntoMinibuffer): ditto
3582 (CutIntoMinibuffer): ditto
3583 (PasteParagraph): ditto
3584 (SetPExtraType): ditto
3585 (UnsetPExtraType): ditto
3586 (DocBookContTableRows): ditto
3587 (SimpleDocBookOneTablePar): ditto
3589 (TeXFootnote): ditto
3590 (SimpleTeXOneTablePar): ditto
3591 (TeXContTableRows): ditto
3592 (SimpleTeXSpecialChars): ditto
3595 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3596 to private and use accessors.
3598 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3599 this, we did not use it anymore and has not been for ages. Just a
3600 waste of cpu cycles.
3602 * src/language.h: make Language a real class, move all variables
3603 to private and use accessors.
3605 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3606 (create_view): remove
3607 (update): some changes for new timer
3608 (cursorToggle): use new timer
3609 (beforeChange): change for new timer
3611 * src/BufferView.h (cursorToggleCB): removed last paramter because
3614 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3615 (cursorToggleCB): change because of new timer code
3617 * lib/CREDITS: updated own mailaddress
3619 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3621 * src/support/filetools.C (PutEnv): fix the code in case neither
3622 putenv() nor setenv() have been found.
3624 * INSTALL: mention the install-strip Makefile target.
3626 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3627 read-only documents.
3629 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3631 * lib/reLyX/configure.in (VERSION): avoid using a previously
3632 generated reLyX wrapper to find out $prefix.
3634 * lib/examples/eu_adibide_lyx-atua.lyx:
3635 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3636 translation of the Tutorial (Dooteo)
3638 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3640 * forms/cite.fd: new citation dialog
3642 * src/insetcite.[Ch]: the new citation dialog is moved into
3645 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3648 * src/insets/insetcommand.h: data members made private.
3650 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3652 * LyX 1.1.5 released
3654 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3656 * src/version.h (LYX_RELEASE): to 1.1.5
3658 * src/spellchecker.C (RunSpellChecker): return false if the
3659 spellchecker dies upon creation.
3661 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3663 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3664 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3668 * lib/CREDITS: update entry for Martin Vermeer.
3670 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3672 * src/text.C (draw): Draw foreign language bars at the bottom of
3673 the row instead of at the baseline.
3675 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3677 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3679 * lib/bind/de_menus.bind: updated
3681 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3683 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3685 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3687 * src/menus.C (Limit_string_length): New function
3688 (ShowTocMenu): Limit the number of items/length of items in the
3691 * src/paragraph.C (String): Correct result for a paragraph inside
3694 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3696 * src/bufferlist.C (close): test of buf->getuser() == NULL
3698 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3700 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3701 Do not call to SetCursor when the paragraph is a closed footnote!
3703 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3705 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3708 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3710 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3713 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3714 reference popup, that activates the reference-back action
3716 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3718 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3719 the menus. Also fixed a bug.
3721 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3722 the math panels when switching buffers (unless new buffer is readonly).
3724 * src/BufferView.C (NoSavedPositions)
3725 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3727 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3729 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3730 less of dvi dirty or not.
3732 * src/trans_mgr.[Ch] (insert): change first parameter to string
3735 * src/chset.[Ch] (encodeString): add const to first parameter
3737 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3739 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3743 * src/LaTeX.C (deplog): better searching for dependency files in
3744 the latex log. Uses now regexps.
3746 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3747 instead of the box hack or \hfill.
3749 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3751 * src/lyxfunc.C (doImportHelper): do not create the file before
3752 doing the actual import.
3753 (doImportASCIIasLines): create a new file before doing the insert.
3754 (doImportASCIIasParagraphs): ditto.
3756 * lib/lyxrc.example: remove mention of non-existing commands
3758 * lyx.man: remove mention of color-related switches.
3760 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3762 * src/lyx_gui.C: remove all the color-related ressources, which
3763 are not used anymore.
3765 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3768 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3770 * src/lyxrc.C (read): Add a missing break in the switch
3772 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3774 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3776 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3779 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3781 * src/text.C (draw): draw bars under foreign language words.
3783 * src/LColor.[Ch]: add LColor::language
3785 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3787 * src/lyxcursor.h (boundary): New member variable
3789 * src/text.C (IsBoundary): New methods
3791 * src/text.C: Use the above for currect cursor movement when there
3792 is both RTL & LTR text.
3794 * src/text2.C: ditto
3796 * src/bufferview_funcs.C (ToggleAndShow): ditto
3798 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3800 * src/text.C (DeleteLineForward): set selection to true to avoid
3801 that DeleteEmptyParagraphMechanism does some magic. This is how it
3802 is done in all other functions, and seems reasonable.
3803 (DeleteWordForward): do not jump over non-word stuff, since
3804 CursorRightOneWord() already does it.
3806 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3807 DeleteWordBackward, since they seem safe to me (since selection is
3808 set to "true") DeleteEmptyParagraphMechanism does nothing.
3810 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3812 * src/lyx_main.C (easyParse): simplify the code by factoring the
3813 part that removes parameters from the command line.
3814 (LyX): check wether wrong command line options have been given.
3816 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3818 * src/lyx_main.C : add support for specifying user LyX
3819 directory via command line option -userdir.
3821 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3823 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3824 the number of items per popup.
3825 (Add_to_refs_menu): Ditto.
3827 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3829 * src/lyxparagraph.h: renamed ClearParagraph() to
3830 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3831 textclass as parameter, and do nothing if free_spacing is
3832 true. This fixes part of the line-delete-forward problems.
3834 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3835 (pasteSelection): ditto.
3836 (SwitchLayoutsBetweenClasses): more translatable strings.
3838 * src/text2.C (CutSelection): use StripLeadingSpaces.
3839 (PasteSelection): ditto.
3840 (DeleteEmptyParagraphMechanism): ditto.
3842 2000-05-26 Juergen Vigna <jug@sad.it>
3844 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3845 is not needed in tabular insets.
3847 * src/insets/insettabular.C (TabularFeatures): added missing features.
3849 * src/tabular.C (DeleteColumn):
3851 (AppendRow): implemented this functions
3852 (cellsturct::operator=): clone the inset too;
3854 2000-05-23 Juergen Vigna <jug@sad.it>
3856 * src/insets/insettabular.C (LocalDispatch): better selection support
3857 when having multicolumn-cells.
3859 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3861 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3863 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3865 * src/ColorHandler.C (getGCForeground): put more test into _()
3867 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3870 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3873 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3875 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3876 there are no labels, or when buffer is readonly.
3878 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3879 there are no labels, buffer is SGML, or when buffer is readonly.
3881 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3883 * src/LColor.C (LColor): change a couple of grey40 to grey60
3884 (LColor): rewore initalization to make compiles go some magnitude
3886 (getGUIName): don't use gettext until we need the string.
3888 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3890 * src/Bullet.[Ch]: Fixed a small bug.
3892 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3894 * src/paragraph.C (String): Several fixes/improvements
3896 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3898 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3900 * src/paragraph.C (String): give more correct output.
3902 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3904 * src/lyxfont.C (stateText) Do not output the language if it is
3905 eqaul to the language of the document.
3907 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3908 between two paragraphs with the same language.
3910 * src/paragraph.C (getParLanguage) Return a correct answer for an
3911 empty dummy paragraph.
3913 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3916 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3919 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3920 the menus/popup, if requested fonts are unavailable.
3922 2000-05-22 Juergen Vigna <jug@sad.it>
3924 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3925 movement support (Up/Down/Tab/Shift-Tab).
3926 (LocalDispatch): added also preliminari cursor-selection.
3928 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3930 * src/paragraph.C (PasteParagraph): Hopefully now right!
3932 2000-05-22 Garst R. Reese <reese@isn.net>
3934 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3935 of list, change all references to Environment to Command
3936 * tex/hollywood.cls : rewrite environments as commands, add
3937 \uppercase to interiorshot and exteriorshot to force uppecase.
3938 * tex/broadway.cls : rewrite environments as commands. Tweak
3941 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3943 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3944 size of items: use a constant intead of the hardcoded 40, and more
3945 importantly do not remove the %m and %x tags added at the end.
3946 (Add_to_refs_menu): use vector::size_type instead of
3947 unsigned int as basic types for the variables. _Please_ do not
3948 assume that size_t is equal to unsigned int. On an alpha, this is
3949 unsigned long, which is _not_ the same.
3951 * src/language.C (initL): remove language "hungarian", since it
3952 seems that "magyar" is better.
3954 2000-05-22 Juergen Vigna <jug@sad.it>
3956 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3958 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3961 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3962 next was deleted but not set to 0.
3964 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3966 * src/language.C (initL): change the initialization of languages
3967 so that compiles goes _fast_.
3969 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3972 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3974 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3978 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3982 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3986 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3989 * src/insets/insetlo*.[Ch]: Made editable
3991 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3993 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3994 the current selection.
3996 * src/BufferView_pimpl.C (stuffClipboard): new method
3998 * src/BufferView.C (stuffClipboard): new method
4000 * src/paragraph.C (String): new method
4002 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4003 LColor::ignore when lyxname is not found.
4005 * src/BufferView.C (pasteSelection): new method
4007 * src/BufferView_pimpl.C (pasteSelection): new method
4009 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4011 * src/WorkArea.C (request_clipboard_cb): new static function
4012 (getClipboard): new method
4013 (putClipboard): new method
4015 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4017 * LyX 1.1.5pre2 released
4019 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/vspace.C (operator=): removed
4022 (operator=): removed
4024 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4026 * src/layout.C (NumberOfClass): manually set the type in make_pair
4027 (NumberOfLayout): ditto
4029 * src/language.C: use the Language constructor for ignore_lang
4031 * src/language.h: add constructors to struct Language
4033 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4035 * src/text2.C (SetCursorIntern): comment out #warning
4037 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4039 * src/mathed/math_iter.h: initialize sx and sw to 0
4041 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4043 * forms/lyx.fd: Redesign of form_ref
4045 * src/LaTeXFeatures.[Ch]
4049 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4052 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4053 and Buffer::inset_iterator.
4055 * src/menus.C: Added new menus: TOC and Refs.
4057 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4059 * src/buffer.C (getTocList): New method.
4061 * src/BufferView2.C (ChangeRefs): New method.
4063 * src/buffer.C (getLabelList): New method. It replaces the old
4064 getReferenceList. The return type is vector<string> instead of
4067 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4068 the old getLabel() and GetNumberOfLabels() methods.
4069 * src/insets/insetlabel.C (getLabelList): ditto
4070 * src/mathed/formula.C (getLabelList): ditto
4072 * src/paragraph.C (String): New method.
4074 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4075 Uses the new getTocList() method.
4076 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4077 which automatically updates the contents of the browser.
4078 (RefUpdateCB): Use the new getLabelList method.
4080 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4082 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4084 * src/spellchecker.C: Added using std::reverse;
4086 2000-05-19 Juergen Vigna <jug@sad.it>
4088 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4090 * src/insets/insettext.C (computeTextRows): small fix for display of
4091 1 character after a newline.
4093 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4096 2000-05-18 Juergen Vigna <jug@sad.it>
4098 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4099 when changing width of column.
4101 * src/tabular.C (set_row_column_number_info): setting of
4102 autobreak rows if necessary.
4104 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4106 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4108 * src/vc-backend.*: renamed stat() to status() and vcstat to
4109 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4110 compilation broke. The new name seems more relevant, anyway.
4112 2000-05-17 Juergen Vigna <jug@sad.it>
4114 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4115 which was wrong if the removing caused removing of rows!
4117 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4118 (pushToken): new function.
4120 * src/text2.C (CutSelection): fix problem discovered with purify
4122 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4124 * src/debug.C (showTags): enlarge the first column, now that we
4125 have 6-digits debug codes.
4127 * lib/layouts/hollywood.layout:
4128 * lib/tex/hollywood.cls:
4129 * lib/tex/brodway.cls:
4130 * lib/layouts/brodway.layout: more commands and fewer
4131 environments. Preambles moved in the .cls files. Broadway now has
4132 more options on scene numbering and less whitespace (from Garst)
4134 * src/insets/insetbib.C (getKeys): make sure that we are in the
4135 document directory, in case the bib file is there.
4137 * src/insets/insetbib.C (Latex): revert bogus change.
4139 2000-05-16 Juergen Vigna <jug@sad.it>
4141 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4142 the TabularLayout on cursor move.
4144 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4146 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4149 (draw): fixed cursor position and drawing so that the cursor is
4150 visible when before the tabular-inset.
4152 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4153 when creating from old insettext.
4155 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4157 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4159 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4160 * lib/tex/brodway.cls: ditto
4162 * lib/layouts/brodway.layout: change alignment of parenthical
4165 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4167 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4168 versions 0.88 and 0.89 are supported.
4170 2000-05-15 Juergen Vigna <jug@sad.it>
4172 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4175 * src/insets/insettext.C (computeTextRows): redone completely this
4176 function in a much cleaner way, because of problems when having a
4178 (draw): added a frame border when the inset is locked.
4179 (SetDrawLockedFrame): this sets if we draw the border or not.
4180 (SetFrameColor): this sets the frame color (default=insetframe).
4182 * src/insets/lyxinset.h: added x() and y() functions which return
4183 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4184 function which is needed to see if we have a locking inset of some
4185 type in this inset (needed for now in insettabular).
4187 * src/vspace.C (inPixels): the same function also without a BufferView
4188 parameter as so it is easier to use it in some ocasions.
4190 * src/lyxfunc.C: changed all places where insertInset was used so
4191 that now if it couldn't be inserted it is deleted!
4193 * src/TabularLayout.C:
4194 * src/TableLayout.C: added support for new tabular-inset!
4196 * src/BufferView2.C (insertInset): this now returns a bool if the
4197 inset was really inserted!!!
4199 * src/tabular.C (GetLastCellInRow):
4200 (GetFirstCellInRow): new helper functions.
4201 (Latex): implemented for new tabular class.
4205 (TeXTopHLine): new Latex() helper functions.
4207 2000-05-12 Juergen Vigna <jug@sad.it>
4209 * src/mathed/formulamacro.C (Read):
4210 * src/mathed/formula.C (Read): read also the \end_inset here!
4212 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4214 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4215 crush when saving formulae with unbalanced parenthesis.
4217 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4219 * src/layout.C: Add new keyword "endlabelstring" to layout file
4221 * src/text.C (GetVisibleRow): Draw endlabel string.
4223 * lib/layouts/broadway.layout
4224 * lib/layouts/hollywood.layout: Added endlabel for the
4225 Parenthetical layout.
4227 * lib/layouts/heb-article.layout: Do not use slanted font shape
4228 for Theorem like environments.
4230 * src/buffer.C (makeLaTeXFile): Always add "american" to
4231 the UsedLanguages list if document language is RTL.
4233 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4235 * add addendum to README.OS2 and small patch (from SMiyata)
4237 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4239 * many files: correct the calls to ChangeExtension().
4241 * src/support/filetools.C (ChangeExtension): remove the no_path
4242 argument, which does not belong there. Use OnlyFileName() instead.
4244 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4245 files when LaTeXing a non-nice latex file.
4247 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4248 a chain of "if". Return false when deadkeys are not handled.
4250 * src/lyx_main.C (LyX): adapted the code for default bindings.
4252 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4253 bindings for basic functionality (except deadkeys).
4254 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4256 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4257 several methods: handle override_x_deadkeys.
4259 * src/lyxrc.h: remove the "bindings" map, which did not make much
4260 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4262 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4264 * src/lyxfont.C (stateText): use a saner method to determine
4265 whether the font is "default". Seems to fix the crash with DEC
4268 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4270 2000-05-08 Juergen Vigna <jug@sad.it>
4272 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4273 TabularLayoutMenu with mouse-button-3
4274 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4276 * src/TabularLayout.C: added this file for having a Layout for
4279 2000-05-05 Juergen Vigna <jug@sad.it>
4281 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4282 recalculating inset-widths.
4283 (TabularFeatures): activated this function so that I can change
4284 tabular-features via menu.
4286 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4287 that I can test some functions with the Table menu.
4289 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4291 * src/lyxfont.C (stateText): guard against stupid c++libs.
4293 * src/tabular.C: add using std::vector
4294 some whitespace changes, + removed som autogenerated code.
4296 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4298 2000-05-05 Juergen Vigna <jug@sad.it>
4300 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4301 row, columns and cellstructures.
4303 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4305 * lib/lyxrc.example: remove obsolete entries.
4307 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4308 reading of protected_separator for free_spacing.
4310 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4312 * src/text.C (draw): do not display an exclamation mark in the
4313 margin for margin notes. This is confusing, ugly and
4316 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4317 AMS math' is checked.
4319 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4320 name to see whether including the amsmath package is needed.
4322 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4324 * src/paragraph.C (validate): Compute UsedLanguages correctly
4325 (don't insert the american language if it doesn't appear in the
4328 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4329 The argument of \thanks{} command is considered moving argument
4331 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4334 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4336 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4337 for appendix/minipage/depth. The lines can be now both in the footnote
4338 frame, and outside the frame.
4340 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4343 2000-05-05 Juergen Vigna <jug@sad.it>
4345 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4346 neede only in tabular.[Ch].
4348 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4350 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4352 (Write): write '~' for PROTECTED_SEPARATOR
4354 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4356 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4359 * src/mathed/formula.C (drawStr): rename size to siz.
4361 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4362 possibly fix a bug by not changing the pflags = flags to piflags =
4365 2000-05-05 Juergen Vigna <jug@sad.it>
4367 * src/insets/insetbib.C: moved using directive
4369 * src/ImportNoweb.C: small fix for being able to compile (missing
4372 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4374 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4375 to use clear, since we don't depend on this in the code. Add test
4378 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4380 * (various *.C files): add using std::foo directives to please dec
4383 * replace calls to string::clear() to string::erase() (Angus)
4385 * src/cheaders/cmath: modified to provide std::abs.
4387 2000-05-04 Juergen Vigna <jug@sad.it>
4389 * src/insets/insettext.C: Prepared all for inserting of multiple
4390 paragraphs. Still display stuff to do (alignment and other things),
4391 but I would like to use LyXText to do this when we cleaned out the
4392 table-support stuff.
4394 * src/insets/insettabular.C: Changed lot of stuff and added lots
4395 of functionality still a lot to do.
4397 * src/tabular.C: Various functions changed name and moved to be
4398 const functions. Added new Read and Write functions and changed
4399 lots of things so it works good with tabular-insets (also removed
4400 some stuff which is not needed anymore * hacks *).
4402 * src/lyxcursor.h: added operators == and != which just look if
4403 par and pos are (not) equal.
4405 * src/buffer.C (latexParagraphs): inserted this function to latex
4406 all paragraphs form par to endpar as then I can use this too for
4409 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4410 so that I can call this to from text insets with their own cursor.
4412 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4413 output off all paragraphs (because of the fix below)!
4415 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4416 the very last paragraph (this could be also the last paragraph of an
4419 * src/texrow.h: added rows() call which returns the count-variable.
4421 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4423 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4425 * lib/configure.m4: better autodetection of DocBook tools.
4427 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4429 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4431 * src/lyx_cb.C: add using std::reverse;
4433 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4436 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4437 selected files. Should fix repeated errors from generated files.
4439 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4441 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4443 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4444 the spellchecker popup.
4446 * lib/lyxrc.example: Removed the \number_inset section
4448 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4450 * src/insets/figinset.C (various): Use IsFileReadable() to make
4451 sure that the file actually exist. Relying on ghostscripts errors
4452 is a bad idea since they can lead to X server crashes.
4454 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4456 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4459 * lib/lyxrc.example: smallish typo in description of
4460 \view_dvi_paper_option
4462 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4465 * src/lyxfunc.C: doImportHelper to factor out common code of the
4466 various import methods. New functions doImportASCIIasLines,
4467 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4468 doImportLinuxDoc for the format specific parts.
4471 * buffer.C: Dispatch returns now a bool to indicate success
4474 * lyx_gui.C: Add getLyXView() for member access
4476 * lyx_main.C: Change logic for batch commands: First try
4477 Buffer::Dispatch (possibly without GUI), if that fails, use
4480 * lyx_main.C: Add support for --import command line switch.
4481 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4482 Available Formats: Everything accepted by 'buffer-import <format>'
4484 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4486 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4489 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4490 documents will be reformatted upon reentry.
4492 2000-04-27 Juergen Vigna <jug@sad.it>
4494 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4495 correctly only last pos this was a bug.
4497 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4499 * release of lyx-1.1.5pre1
4501 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4503 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4505 * src/menus.C: revert the change of naming (Figure->Graphic...)
4506 from 2000-04-11. It was incomplete and bad.
4508 * src/LColor.[Ch]: add LColor::depthbar.
4509 * src/text.C (GetVisibleRow): use it.
4511 * README: update the languages list.
4513 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4515 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4518 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4520 * README: remove sections that were just wrong.
4522 * src/text2.C (GetRowNearY): remove currentrow code
4524 * src/text.C (GetRow): remove currentrow code
4526 * src/screen.C (Update): rewritten a bit.
4527 (SmallUpdate): removed func
4529 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4531 (FullRebreak): return bool
4532 (currentrow): remove var
4533 (currentrow_y): ditto
4535 * src/lyxscreen.h (Draw): change arg to unsigned long
4536 (FitCursor): return bool
4537 (FitManualCursor): ditto
4538 (Smallpdate): remove func
4539 (first): change to unsigned long
4540 (DrawOneRow): change second arg to long (from long &)
4541 (screen_refresh_y): remove var
4542 (scree_refresh_row): ditto
4544 * src/lyxrow.h: change baseline to usigned int from unsigned
4545 short, this brings some implicit/unsigned issues out in the open.
4547 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4549 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4550 instead of smallUpdate.
4552 * src/lyxcursor.h: change y to unsigned long
4554 * src/buffer.h: don't call updateScrollbar after fitcursor
4556 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4557 where they are used. Removed "\\direction", this was not present
4558 in 1.1.4 and is already obsolete. Commented out some code that I
4559 believe to never be called.
4560 (runLiterate): don't call updateScrollbar after fitCursor
4562 (buildProgram): ditto
4565 * src/WorkArea.h (workWidth): change return val to unsigned
4568 (redraw): remove the button redraws
4569 (setScrollbarValue): change for scrollbar
4570 (getScrollbarValue): change for scrollbar
4571 (getScrollbarBounds): change for scrollbar
4573 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4574 (C_WorkArea_down_cb): removed func
4575 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4576 (resize): change for scrollbar
4577 (setScrollbar): ditto
4578 (setScrollbarBounds): ditto
4579 (setScrollbarIncrements): ditto
4580 (up_cb): removed func
4581 (down_cb): removed func
4582 (scroll_cb): change for scrollbar
4583 (work_area_handler): ditto
4585 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4586 when FitCursor did something.
4587 (updateScrollbar): some unsigned changes
4588 (downCB): removed func
4589 (scrollUpOnePage): removed func
4590 (scrollDownOnePage): remvoed func
4591 (workAreaMotionNotify): don't call screen->FitCursor but use
4592 fitCursor instead. and bool return val
4593 (workAreaButtonPress): ditto
4594 (workAreaButtonRelease): some unsigned changes
4595 (checkInsetHit): ditto
4596 (workAreaExpose): ditto
4597 (update): parts rewritten, comments about the signed char arg added
4598 (smallUpdate): removed func
4599 (cursorPrevious): call needed updateScrollbar
4602 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4605 * src/BufferView.[Ch] (upCB): removed func
4606 (downCB): removed func
4607 (smallUpdate): removed func
4609 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4611 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4612 currentrow, currentrow_y optimization. This did not help a lot and
4613 if we want to do this kind of optimization we should rather use
4614 cursor.row instead of the currentrow.
4616 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4617 buffer spacing and klyx spacing support.
4619 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4621 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4624 2000-04-26 Juergen Vigna <jug@sad.it>
4626 * src/insets/figinset.C: fixes to Lars sstream changes!
4628 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4630 * A lot of files: Added Ascii(ostream &) methods to all inset
4631 classes. Used when exporting to ASCII.
4633 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4634 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4637 * src/text2.C (ToggleFree): Disabled implicit word selection when
4638 there is a change in the language
4640 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4641 no output was generated for end-of-sentence inset.
4643 * src/insets/lyxinset.h
4646 * src/paragraph.C: Removed the insetnumber code
4648 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4650 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4652 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4653 no_babel and no_epsfig completely from the file.
4654 (parseSingleLyXformat2Token): add handling for per-paragraph
4655 spacing as written by klyx.
4657 * src/insets/figinset.C: applied patch by Andre. Made it work with
4660 2000-04-20 Juergen Vigna <jug@sad.it>
4662 * src/insets/insettext.C (cutSelection):
4663 (copySelection): Fixed with selection from right to left.
4664 (draw): now the rows are not recalculated at every draw.
4665 (computeTextRows): for now reset the inset-owner here (this is
4666 important for an undo or copy where the inset-owner is not set
4669 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4670 motion to the_locking_inset screen->first was forgotten, this was
4671 not important till we got multiline insets.
4673 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4675 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4676 code seems to be alright (it is code changed by Dekel, and the
4677 intent is indeed that all macros should be defined \protect'ed)
4679 * NEWS: a bit of reorganisation of the new user-visible features.
4681 2000-04-19 Juergen Vigna <jug@sad.it>
4683 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4684 position. Set the inset_owner of the used paragraph so that it knows
4685 that it is inside an inset. Fixed cursor handling with mouse and
4686 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4687 and cleanups to make TextInsets work better.
4689 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4690 Changed parameters of various functions and added LockInsetInInset().
4692 * src/insets/insettext.C:
4694 * src/insets/insetcollapsable.h:
4695 * src/insets/insetcollapsable.C:
4696 * src/insets/insetfoot.h:
4697 * src/insets/insetfoot.C:
4698 * src/insets/insetert.h:
4699 * src/insets/insetert.C: cleaned up the code so that it works now
4700 correctly with insettext.
4702 * src/insets/inset.C:
4703 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4704 that insets in insets are supported right.
4707 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4709 * src/paragraph.C: some small fixes
4711 * src/debug.h: inserted INSETS debug info
4713 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4714 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4716 * src/commandtags.h:
4717 * src/LyXAction.C: insert code for InsetTabular.
4719 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4720 not Button1MotionMask.
4721 (workAreaButtonRelease): send always a InsetButtonRelease event to
4723 (checkInsetHit): some setCursor fixes (always with insets).
4725 * src/BufferView2.C (lockInset): returns a bool now and extended for
4726 locking insets inside insets.
4727 (showLockedInsetCursor): it is important to have the cursor always
4728 before the locked inset.
4729 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4731 * src/BufferView.h: made lockInset return a bool.
4733 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4735 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4736 that is used also internally but can be called as public to have back
4737 a cursor pos which is not set internally.
4738 (SetCursorIntern): Changed to use above function.
4740 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4742 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4747 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4748 patches for things that should be in or should be changed.
4750 * src/* [insetfiles]: change "usigned char fragile" to bool
4751 fragile. There was only one point that could that be questioned
4752 and that is commented in formulamacro.C. Grep for "CHECK".
4754 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4755 (DeleteBuffer): take it out of CutAndPaste and make it static.
4757 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4759 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4760 output the spacing envir commands. Also the new commands used in
4761 the LaTeX output makes the result better.
4763 * src/Spacing.C (writeEnvirBegin): new method
4764 (writeEnvirEnd): new method
4766 2000-04-18 Juergen Vigna <jug@sad.it>
4768 * src/CutAndPaste.C: made textclass a static member of the class
4769 as otherwise it is not accesed right!!!
4771 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4773 * forms/layout_forms.fd
4774 * src/layout_forms.h
4775 * src/layout_forms.C (create_form_form_character)
4776 * src/lyx_cb.C (UserFreeFont)
4777 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4778 documents (in the layout->character popup).
4780 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4782 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4783 \spell_command was in fact not honored (from Kevin Atkinson).
4785 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4788 * src/lyx_gui.h: make lyxViews private (Angus)
4790 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4792 * src/mathed/math_write.C
4793 (MathMatrixInset::Write) Put \protect before \begin{array} and
4794 \end{array} if fragile
4795 (MathParInset::Write): Put \protect before \\ if fragile
4797 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4799 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4800 initialization if the LyXColorHandler must be done after the
4801 connections to the XServer has been established.
4803 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4804 get the background pixel from the lyxColorhandler so that the
4805 figures are rendered with the correct background color.
4806 (NextToken): removed functions.
4807 (GetPSSizes): use ifs >> string instead of NextToken.
4809 * src/Painter.[Ch]: the color cache moved out of this file.
4811 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4814 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4816 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4817 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4819 * src/BufferView.C (enterView): new func
4820 (leaveView): new func
4822 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4824 (leaveView): new func, undefines xterm cursor when approp.
4826 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4827 (AllowInput): delete the Workarea cursor handling from this func.
4829 * src/Painter.C (underline): draw a slimer underline in most cases.
4831 * src/lyx_main.C (error_handler): use extern "C"
4833 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4835 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4836 sent directly to me.
4838 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4839 to the list by Dekel.
4841 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4844 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4845 methods from lyx_cb.here.
4847 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4850 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4852 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4853 instead of using current_view directly.
4855 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4857 * src/LyXAction.C (init): add the paragraph-spacing command.
4859 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4861 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4863 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4864 different from the documents.
4866 * src/text.C (SetHeightOfRow): take paragraph spacing into
4867 account, paragraph spacing takes precedence over buffer spacing
4868 (GetVisibleRow): ditto
4870 * src/paragraph.C (writeFile): output the spacing parameter too.
4871 (validate): set the correct features if spacing is used in the
4873 (Clear): set spacing to default
4874 (MakeSameLayout): spacing too
4875 (HasSameLayout): spacing too
4876 (SetLayout): spacing too
4877 (TeXOnePar): output the spacing commands
4879 * src/lyxparagraph.h: added a spacing variable for use with
4880 per-paragraph spacing.
4882 * src/Spacing.h: add a Default spacing and a method to check if
4883 the current spacing is default. also added an operator==
4885 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4888 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4890 * src/lyxserver.C (callback): fix dispatch of functions
4892 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4893 printf() into lyxerr call.
4895 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4898 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4899 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4900 the "Float" from each of the subitems.
4901 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4903 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4904 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4905 documented the change so that the workaround can be nuked later.
4907 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4910 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4912 * src/buffer.C (getLatexName): ditto
4913 (setReadonly): ditto
4915 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4917 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4918 avoid some uses of current_view. Added also a bufferParams()
4919 method to get at this.
4921 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4923 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4925 * src/lyxparagraph.[Ch]: removed
4926 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4927 with operators used by lower_bound and
4928 upper_bound in InsetTable's
4929 Make struct InsetTable private again. Used matchpos.
4931 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4933 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4934 document, the language of existing text is changed (unless the
4935 document is multi-lingual)
4937 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4939 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4941 * A lot of files: A rewrite of the Right-to-Left support.
4943 2000-04-10 Juergen Vigna <jug@sad.it>
4945 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4946 misplaced cursor when inset in inset is locked.
4948 * src/insets/insettext.C (LocalDispatch): small fix so that a
4949 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4951 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4952 footnote font should be decreased in size twice when displaying.
4954 * src/insets/insettext.C (GetDrawFont): inserted this function as
4955 the drawing-font may differ from the real paragraph font.
4957 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4958 insets (inset in inset!).
4960 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4961 function here because we don't want footnotes inside footnotes.
4963 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4965 (init): now set the inset_owner in paragraph.C
4966 (LocalDispatch): added some resetPos() in the right position
4969 (pasteSelection): changed to use the new CutAndPaste-Class.
4971 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4972 which tells if it is allowed to insert another inset inside this one.
4974 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4975 SwitchLayoutsBetweenClasses.
4977 * src/text2.C (InsertInset): checking of the new paragraph-function
4979 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4980 is not needed anymore here!
4983 (PasteSelection): redone (also with #ifdef) so that now this uses
4984 the CutAndPaste-Class.
4985 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4988 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4989 from/to text/insets.
4991 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4992 so that the paragraph knows if it is inside an (text)-inset.
4993 (InsertFromMinibuffer): changed return-value to bool as now it
4994 may happen that an inset is not inserted in the paragraph.
4995 (InsertInsetAllowed): this checks if it is allowed to insert an
4996 inset in this paragraph.
4998 (BreakParagraphConservative):
4999 (BreakParagraph) : small change for the above change of the return
5000 value of InsertFromMinibuffer.
5002 * src/lyxparagraph.h: added inset_owner and the functions to handle
5003 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5005 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5007 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5008 functions from BufferView to BufferView::Pimpl to ease maintence.
5010 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5011 correctly. Also use SetCursorIntern instead of SetCursor.
5013 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5016 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5018 * src/WorkArea.C (belowMouse): manually implement below mouse.
5020 * src/*: Add "explicit" on several constructors, I added probably
5021 some unneeded ones. A couple of changes to code because of this.
5023 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5024 implementation and private parts from the users of BufferView. Not
5027 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5028 implementation and private parts from the users of LyXLex. Not
5031 * src/BufferView_pimpl.[Ch]: new files
5033 * src/lyxlex_pimpl.[Ch]: new files
5035 * src/LyXView.[Ch]: some inline functions move out-of-line
5037 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5039 * src/lyxparagraph.h: make struct InsetTable public.
5041 * src/support/lyxstring.h: change lyxstring::difference_type to be
5042 ptrdiff_t. Add std:: modifiers to streams.
5044 * src/font.C: include the <cctype> header, for islower() and
5047 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5049 * src/font.[Ch]: new files. Contains the metric functions for
5050 fonts, takes a LyXFont as parameter. Better separation of concepts.
5052 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5053 changes because of this.
5055 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5057 * src/*: compile with -Winline and move functions that don't
5060 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5063 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5066 (various files changed because of this)
5068 * src/Painter.C (text): fixed the drawing of smallcaps.
5070 * src/lyxfont.[Ch] (drawText): removed unused member func.
5073 * src/*.C: added needed "using" statements and "std::" qualifiers.
5075 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5077 * src/*.h: removed all use of "using" from header files use
5078 qualifier std:: instead.
5080 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5082 * src/text.C (Backspace): some additional cleanups (we already
5083 know whether cursor.pos is 0 or not).
5085 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5086 automake does not provide one).
5088 * src/bmtable.h: replace C++ comments with C comments.
5090 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5092 * src/screen.C (ShowCursor): Change the shape of the cursor if
5093 the current language is not equal to the language of the document.
5094 (If the cursor change its shape unexpectedly, then you've found a bug)
5096 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5099 * src/insets/insetnumber.[Ch]: New files.
5101 * src/LyXAction.C (init)
5102 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5105 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5107 * src/lyxparagraph.h
5108 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5109 (the vector is kept sorted).
5111 * src/text.C (GetVisibleRow): Draw selection correctly when there
5112 is both LTR and RTL text.
5114 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5115 which is much faster.
5117 * src/text.C (GetVisibleRow and other): Do not draw the last space
5118 in a row if the direction of the last letter is not equal to the
5119 direction of the paragraph.
5121 * src/lyxfont.C (latexWriteStartChanges):
5122 Check that font language is not equal to basefont language.
5123 (latexWriteEndChanges): ditto
5125 * src/lyx_cb.C (StyleReset): Don't change the language while using
5126 the font-default command.
5128 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5129 empty paragraph before a footnote.
5131 * src/insets/insetcommand.C (draw): Increase x correctly.
5133 * src/screen.C (ShowCursor): Change cursor shape if
5134 current language != document language.
5136 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5138 2000-03-31 Juergen Vigna <jug@sad.it>
5140 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5141 (Clone): changed mode how the paragraph-data is copied to the
5142 new clone-paragraph.
5144 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5145 GetInset(pos) with no inset anymore there (in inset UNDO)
5147 * src/insets/insetcommand.C (draw): small fix as here x is
5148 incremented not as much as width() returns (2 before, 2 behind = 4)
5150 2000-03-30 Juergen Vigna <jug@sad.it>
5152 * src/insets/insettext.C (InsetText): small fix in initialize
5153 widthOffset (should not be done in the init() function)
5155 2000-03-29 Amir Karger <karger@lyx.org>
5157 * lib/examples/it_ItemizeBullets.lyx: translation by
5160 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5162 2000-03-29 Juergen Vigna <jug@sad.it>
5164 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5166 * src/insets/insetfoot.C (Clone): small change as for the below
5167 new init function in the text-inset
5169 * src/insets/insettext.C (init): new function as I've seen that
5170 clone did not copy the Paragraph-Data!
5171 (LocalDispatch): Added code so that now we have some sort of Undo
5172 functionality (well actually we HAVE Undo ;)
5174 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5176 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5178 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5181 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5183 * src/main.C: added a runtime check that verifies that the xforms
5184 header used when building LyX and the library used when running
5185 LyX match. Exit with a message if they don't match. This is a
5186 version number check only.
5188 * src/buffer.C (save): Don't allocate memory on the heap for
5189 struct utimbuf times.
5191 * *: some using changes, use iosfwd instead of the real headers.
5193 * src/lyxfont.C use char const * instead of string for the static
5194 strings. Rewrite some functions to use sstream.
5196 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5198 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5201 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5203 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5204 of Geodesy (from Martin Vermeer)
5206 * lib/layouts/svjour.inc: include file for the Springer svjour
5207 class. It can be used to support journals other than JoG.
5209 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5210 Miskiewicz <misiek@pld.org.pl>)
5211 * lib/reLyX/Makefile.am: ditto.
5213 2000-03-27 Juergen Vigna <jug@sad.it>
5215 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5216 also some modifications with operations on selected text.
5218 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5219 problems with clicking on insets (last famous words ;)
5221 * src/insets/insetcommand.C (draw):
5222 (width): Changed to have a bit of space before and after the inset so
5223 that the blinking cursor can be seen (otherwise it was hidden)
5225 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5227 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5228 would not be added to the link list when an installed gettext (not
5229 part of libc) is found.
5231 2000-03-24 Juergen Vigna <jug@sad.it>
5233 * src/insets/insetcollapsable.C (Edit):
5234 * src/mathed/formula.C (InsetButtonRelease):
5235 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5238 * src/BufferView.C (workAreaButtonPress):
5239 (workAreaButtonRelease):
5240 (checkInsetHit): Finally fixed the clicking on insets be handled
5243 * src/insets/insetert.C (Edit): inserted this call so that ERT
5244 insets work always with LaTeX-font
5246 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5248 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5249 caused lyx to startup with no GUI in place, causing in a crash
5250 upon startup when called with arguments.
5252 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5254 * src/FontLoader.C: better initialization of dummyXFontStruct.
5256 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5258 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5259 for linuxdoc and docbook import and export format options.
5261 * lib/lyxrc.example Example of default values for the previous flags.
5263 * src/lyx_cb.C Use those flags instead of the hardwired values for
5264 linuxdoc and docbook export.
5266 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5269 * src/menus.C Added menus entries for the new import/exports formats.
5271 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5273 * src/lyxrc.*: Added support for running without Gui
5276 * src/FontLoader.C: sensible defaults if no fonts are needed
5278 * src/lyx_cb.C: New function ShowMessage (writes either to the
5279 minibuffer or cout in case of no gui
5280 New function AskOverwrite for common stuff
5281 Consequently various changes to call these functions
5283 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5284 wild guess at sensible screen resolution when having no gui
5286 * src/lyxfont.C: no gui, no fonts... set some defaults
5288 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5290 * src/LColor.C: made the command inset background a bit lighter.
5292 2000-03-20 Hartmut Goebel <goebel@noris.net>
5294 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5295 stdstruct.inc. Koma-Script added some title elements which
5296 otherwise have been listed below "bibliography". This split allows
5297 adding title elements to where they belong.
5299 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5300 define the additional tilte elements and then include
5303 * many other layout files: changed to include stdtitle.inc just
5304 before stdstruct.inc.
5306 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5308 * src/buffer.C: (save) Added the option to store all backup files
5309 in a single directory
5311 * src/lyxrc.[Ch]: Added variable \backupdir_path
5313 * lib/lyxrc.example: Added descriptions of recently added variables
5315 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5316 bibtex inset, not closing the bibtex popup when deleting the inset)
5318 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5320 * src/lyx_cb.C: add a couple using directives.
5322 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5323 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5324 import based on the filename.
5326 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5327 file would be imported at start, if the filename where of a sgml file.
5329 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5331 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5333 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5334 * src/lyxfont.h Replaced the member variable bits.direction by the
5335 member variable lang. Made many changes in other files.
5336 This allows having a multi-lingual document
5338 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5339 that change the current language to <l>.
5340 Removed the command "font-rtl"
5342 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5343 format for Hebrew documents)
5345 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5346 When auto_mathmode is "true", pressing a digit key in normal mode
5347 will cause entering into mathmode.
5348 If auto_mathmode is "rtl" then this behavior will be active only
5349 when writing right-to-left text.
5351 * src/text2.C (InsertStringA) The string is inserted using the
5354 * src/paragraph.C (GetEndLabel) Gives a correct result for
5355 footnote paragraphs.
5357 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5359 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5361 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5362 front of PasteParagraph. Never insert a ' '. This should at least
5363 fix some cause for the segfaults that we have been experiencing,
5364 it also fixes backspace behaviour slightly. (Phu!)
5366 * src/support/lstrings.C (compare_no_case): some change to make it
5367 compile with gcc 2.95.2 and stdlibc++-v3
5369 * src/text2.C (MeltFootnoteEnvironment): change type o
5370 first_footnote_par_is_not_empty to bool.
5372 * src/lyxparagraph.h: make text private. Changes in other files
5374 (fitToSize): new function
5375 (setContentsFromPar): new function
5376 (clearContents): new function
5377 (SetChar): new function
5379 * src/paragraph.C (readSimpleWholeFile): deleted.
5381 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5382 the file, just use a simple string instead. Also read the file in
5383 a more maintainable manner.
5385 * src/text2.C (InsertStringA): deleted.
5386 (InsertStringB): deleted.
5388 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5390 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5391 RedoParagraphs from the doublespace handling part, just set status
5392 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5393 done, but perhaps not like this.)
5395 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5397 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5398 character when inserting an inset.
5400 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5402 * src/bufferparams.C (readLanguage): now takes "default" into
5405 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5406 also initialize the toplevel_keymap with the default bindings from
5409 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5411 * all files using lyxrc: have lyxrc as a real variable and not a
5412 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5415 * src/lyxrc.C: remove double call to defaultKeyBindings
5417 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5418 toolbar defauls using lyxlex. Remove enums, structs, functions
5421 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5422 toolbar defaults. Also store default keybindings in a map.
5424 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5425 storing the toolbar defaults without any xforms dependencies.
5427 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5428 applied. Changed to use iterators.
5430 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5432 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5433 systems that don't have LINGUAS set to begin with.
5435 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5437 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5438 the list by Dekel Tsur.
5440 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5442 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5443 * src/insets/form_graphics.C: ditto.
5445 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5447 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5449 * src/bufferparams.C (readLanguage): use the new language map
5451 * src/intl.C (InitKeyMapper): use the new language map
5453 * src/lyx_gui.C (create_forms): use the new language map
5455 * src/language.[Ch]: New files. Used for holding the information
5456 about each language. Now! Use this new language map enhance it and
5457 make it really usable for our needs.
5459 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5461 * screen.C (ShowCursor): Removed duplicate code.
5462 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5463 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5465 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5468 * src/text.C Added TransformChar method. Used for rendering Arabic
5469 text correctly (change the glyphs of the letter according to the
5470 position in the word)
5475 * src/lyxrc.C Added lyxrc command {language_command_begin,
5476 language_command_end,language_command_ltr,language_command_rtl,
5477 language_package} which allows the use of either arabtex or Omega
5480 * src/lyx_gui.C (init)
5482 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5483 to use encoding for menu fonts which is different than the encoding
5486 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5487 do not load the babel package.
5488 To write an English document with Hebrew/Arabic, change the document
5489 language to "english".
5491 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5492 (alphaCounter): changed to return char
5493 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5495 * lib/lyxrc.example Added examples for Hebrew/Arabic
5498 * src/layout.C Added layout command endlabeltype
5500 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5502 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5504 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5506 * src/mathed/math_delim.C (search_deco): return a
5507 math_deco_struct* instead of index.
5509 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * All files with a USE_OSTREAM_ONLY within: removed all code that
5512 was unused when USE_OSTREAM_ONLY is defined.
5514 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5515 of any less. Removed header and using.
5517 * src/text.C (GetVisibleRow): draw the string "Page Break
5518 (top/bottom)" on screen when drawing a pagebreak line.
5520 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5522 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5524 * src/mathed/math_macro.C (draw): do some cast magic.
5527 * src/mathed/math_defs.h: change byte* argument to byte const*.
5529 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5531 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5532 know it is right to return InsetFoot* too, but cxx does not like
5535 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5537 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5539 * src/mathed/math_delim.C: change == to proper assignment.
5541 2000-03-09 Juergen Vigna <jug@sad.it>
5543 * src/insets/insettext.C (setPos): fixed various cursor positioning
5544 problems (via mouse and cursor-keys)
5545 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5546 inset (still a small display problem but it works ;)
5548 * src/insets/insetcollapsable.C (draw): added button_top_y and
5549 button_bottom_y to have correct values for clicking on the inset.
5551 * src/support/lyxalgo.h: commented out 'using std::less'
5553 2000-03-08 Juergen Vigna <jug@sad.it>
5555 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5556 Button-Release event closes as it is alos the Release-Event
5559 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5561 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5563 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5564 can add multiple spaces in Scrap (literate programming) styles...
5565 which, by the way, is how I got hooked on LyX to begin with.
5567 * src/mathed/formula.C (Write): Added dummy variable to an
5568 inset::Latex() call.
5569 (Latex): Add free_spacing boolean to inset::Latex()
5571 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5573 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5574 virtual function to include the free_spacing boolean from
5575 the containing paragraph's style.
5577 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5578 Added free_spacing boolean arg to match inset.h
5580 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5581 Added free_spacing boolean arg to match inset.h
5583 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5584 Added free_spacing boolean and made sure that if in a free_spacing
5585 paragraph, that we output normal space if there is a protected space.
5587 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5588 Added free_spacing boolean arg to match inset.h
5590 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5591 Added free_spacing boolean arg to match inset.h
5593 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5594 Added free_spacing boolean arg to match inset.h
5596 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5597 Added free_spacing boolean arg to match inset.h
5599 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5600 Added free_spacing boolean arg to match inset.h
5602 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5603 free_spacing boolean arg to match inset.h
5605 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5606 Added free_spacing boolean arg to match inset.h
5608 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5609 Added free_spacing boolean arg to match inset.h
5611 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5612 Added free_spacing boolean arg to match inset.h
5614 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5615 Added free_spacing boolean arg to match inset.h
5617 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5618 Added free_spacing boolean arg to match inset.h
5620 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5621 free_spacing boolean arg to match inset.h
5623 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5624 free_spacing boolean arg to match inset.h
5626 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5627 ignore free_spacing paragraphs. The user's spaces are left
5630 * src/text.C (InsertChar): Fixed the free_spacing layout
5631 attribute behavior. Now, if free_spacing is set, you can
5632 add multiple spaces in a paragraph with impunity (and they
5633 get output verbatim).
5634 (SelectSelectedWord): Added dummy argument to inset::Latex()
5637 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5640 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5641 paragraph layouts now only input a simple space instead.
5642 Special character insets don't make any sense in free-spacing
5645 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5646 hard-spaces in the *input* file to simple spaces if the layout
5647 is free-spacing. This converts old files which had to have
5648 hard-spaces in free-spacing layouts where a simple space was
5650 (writeFileAscii): Added free_spacing check to pass to the newly
5651 reworked inset::Latex(...) methods. The inset::Latex() code
5652 ensures that hard-spaces in free-spacing paragraphs get output
5653 as spaces (rather than "~").
5655 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/mathed/math_delim.C (draw): draw the empty placeholder
5658 delims with a onoffdash line.
5659 (struct math_deco_compare): struct that holds the "functors" used
5660 for the sort and the binary search in math_deco_table.
5661 (class init_deco_table): class used for initial sort of the
5663 (search_deco): use lower_bound to do a binary search in the
5666 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5668 * src/lyxrc.C: a small secret thingie...
5670 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5671 and to not flush the stream as often as it used to.
5673 * src/support/lyxalgo.h: new file
5674 (sorted): template function used for checking if a sequence is
5675 sorted or not. Two versions with and without user supplied
5676 compare. Uses same compare as std::sort.
5678 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5679 it and give warning on lyxerr.
5681 (struct compare_tags): struct with function operators used for
5682 checking if sorted, sorting and lower_bound.
5683 (search_kw): use lower_bound instead of manually implemented
5686 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5688 * src/insets/insetcollapsable.h: fix Clone() declaration.
5689 * src/insets/insetfoot.h: ditto.
5691 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5693 2000-03-08 Juergen Vigna <jug@sad.it>
5695 * src/insets/lyxinset.h: added owner call which tells us if
5696 this inset is inside another inset. Changed also the return-type
5697 of Editable to an enum so it tells clearer what the return-value is.
5699 * src/insets/insettext.C (computeTextRows): fixed computing of
5700 textinsets which split automatically on more rows.
5702 * src/insets/insetert.[Ch]: changed this to be of BaseType
5705 * src/insets/insetfoot.[Ch]: added footnote inset
5707 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5708 collapsable insets (like footnote, ert, ...)
5710 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5712 * src/lyxdraw.h: remvoe file
5714 * src/lyxdraw.C: remove file
5716 * src/insets/insettext.C: added <algorithm>.
5718 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5720 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5721 (matrix_cb): case MM_OK use string stream
5723 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5726 * src/mathed/math_macro.C (draw): use string stream
5727 (Metrics): use string stream
5729 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5730 directly to the ostream.
5732 * src/vspace.C (asString): use string stream.
5733 (asString): use string stream
5734 (asLatexString): use string stream
5736 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5737 setting Spacing::Other.
5739 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5740 sprintf when creating the stretch vale.
5742 * src/text2.C (alphaCounter): changed to return a string and to
5743 not use a static variable internally. Also fixed a one-off bug.
5744 (SetCounter): changed the drawing of the labels to use string
5745 streams instead of sprintf.
5747 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5748 manipulator to use a scheme that does not require library support.
5749 This is also the way it is done in the new GNU libstdc++. Should
5750 work with DEC cxx now.
5752 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5754 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5755 end. This fixes a bug.
5757 * src/mathed (all files concerned with file writing): apply the
5758 USE_OSTREAM_ONLY changes to mathed too.
5760 * src/support/DebugStream.h: make the constructor explicit.
5762 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5763 count and ostream squashed.
5765 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5767 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5769 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5770 ostringstream uses STL strings, and we might not.
5772 * src/insets/insetspecialchar.C: add using directive.
5773 * src/insets/insettext.C: ditto.
5775 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5777 * lib/layouts/seminar.layout: feeble attempt at a layout for
5778 seminar.cls, far from completet and could really use some looking
5779 at from people used to write layout files.
5781 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5782 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5783 a lot nicer and works nicely with ostreams.
5785 * src/mathed/formula.C (draw): a slightly different solution that
5786 the one posted to the list, but I think this one works too. (font
5787 size wrong in headers.)
5789 * src/insets/insettext.C (computeTextRows): some fiddling on
5790 Jürgens turf, added some comments that he should read.
5792 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5793 used and it gave compiler warnings.
5794 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5797 * src/lyx_gui.C (create_forms): do the right thing when
5798 show_banner is true/false.
5800 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5801 show_banner is false.
5803 * most file writing files: Now use iostreams to do almost all of
5804 the writing. Also instead of passing string &, we now use
5805 stringstreams. mathed output is still not adapted to iostreams.
5806 This change can be turned off by commenting out all the occurences
5807 of the "#define USE_OSTREAM_ONLY 1" lines.
5809 * src/WorkArea.C (createPixmap): don't output debug messages.
5810 (WorkArea): don't output debug messages.
5812 * lib/lyxrc.example: added a comment about the new variable
5815 * development/Code_rules/Rules: Added some more commente about how
5816 to build class interfaces and on how better encapsulation can be
5819 2000-03-03 Juergen Vigna <jug@sad.it>
5821 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5822 automatically with the width of the LyX-Window
5824 * src/insets/insettext.C (computeTextRows): fixed update bug in
5825 displaying text-insets (scrollvalues where not initialized!)
5827 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5829 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5830 id in the check of the result from lower_bound is not enough since
5831 lower_bound can return last too, and then res->id will not be a
5834 * all insets and some code that use them: I have conditionalized
5835 removed the Latex(string & out, ...) this means that only the
5836 Latex(ostream &, ...) will be used. This is a work in progress to
5837 move towards using streams for all output of files.
5839 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5842 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5844 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5845 routine (this fixes bug where greek letters were surrounded by too
5848 * src/support/filetools.C (findtexfile): change a bit the search
5849 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5850 no longer passed to kpsewhich, we may have to change that later.
5852 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5853 warning options to avoid problems with X header files (from Angus
5855 * acinclude.m4: regenerated.
5857 2000-03-02 Juergen Vigna <jug@sad.it>
5859 * src/insets/insettext.C (WriteParagraphData): Using the
5860 par->writeFile() function for writing paragraph-data.
5861 (Read): Using buffer->parseSingleLyXformat2Token()-function
5862 for parsing paragraph data!
5864 * src/buffer.C (readLyXformat2): removed all parse data and using
5865 the new parseSingleLyXformat2Token()-function.
5866 (parseSingleLyXformat2Token): added this function to parse (read)
5867 lyx-file-format (this is called also from text-insets now!)
5869 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5871 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5874 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5875 directly instead of going through a func. One very bad thing: a
5876 static LyXFindReplace, but I don't know where to place it.
5878 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5879 string instead of char[]. Also changed to static.
5880 (GetSelectionOrWordAtCursor): changed to static inline
5881 (SetSelectionOverLenChars): ditto.
5883 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5884 current_view and global variables. both classes has changed names
5885 and LyXFindReplace is not inherited from SearchForm.
5887 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5888 fl_form_search form.
5890 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5892 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5894 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5895 bound (from Kayvan).
5897 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5899 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5901 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5903 * some things that I should comment but the local pub says head to
5906 * comment out all code that belongs to the Roff code for Ascii
5907 export of tables. (this is unused)
5909 * src/LyXView.C: use correct type for global variable
5910 current_layout. (LyXTextClass::size_type)
5912 * some code to get the new insetgraphics closer to working I'd be
5913 grateful for any help.
5915 * src/BufferView2.C (insertInset): use the return type of
5916 NumberOfLayout properly. (also changes in other files)
5918 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5919 this as a test. I want to know what breaks because of this.
5921 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5923 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5925 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5926 to use a \makebox in the label, this allows proper justification
5927 with out using protected spaces or multiple hfills. Now it is
5928 "label" for left justified, "\hfill label\hfill" for center, and
5929 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5930 should be changed accordingly.
5932 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5934 * src/lyxtext.h: change SetLayout() to take a
5935 LyXTextClass::size_type instead of a char (when there is more than
5936 127 layouts in a class); also change type of copylayouttype.
5937 * src/text2.C (SetLayout): ditto.
5938 * src/LyXView.C (updateLayoutChoice): ditto.
5940 * src/LaTeX.C (scanLogFile): errors where the line number was not
5941 given just after the '!'-line were ignored (from Dekel Tsur).
5943 * lib/lyxrc.example: fix description of \date_insert_format
5945 * lib/layouts/llncs.layout: new layout, contributed by Martin
5948 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5950 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5951 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5952 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5953 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5954 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5955 paragraph.C, text.C, text2.C)
5957 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5959 * src/insets/insettext.C (LocalDispatch): remove extra break
5962 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5963 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5965 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5966 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5968 * src/insets/insetbib.h: move InsetBibkey::Holder and
5969 InsetCitation::Holder in public space.
5971 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5973 * src/insets/insettext.h: small change to get the new files from
5974 Juergen to compile (use "string", not "class string").
5976 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5977 const & as parameter to LocalDispatch, use LyXFont const & as
5978 paramter to some other func. This also had impacto on lyxinsets.h
5979 and the two mathed insets.
5981 2000-02-24 Juergen Vigna <jug@sad.it>
5984 * src/commandtags.h:
5986 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5990 * src/BufferView2.C: added/updated code for various inset-functions
5992 * src/insets/insetert.[Ch]: added implementation of InsetERT
5994 * src/insets/insettext.[Ch]: added implementation of InsetText
5996 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5997 (draw): added preliminary code for inset scrolling not finshed yet
5999 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6000 as it is in lyxfunc.C now
6002 * src/insets/lyxinset.h: Added functions for text-insets
6004 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6007 BufferView and reimplement the list as a queue put inside its own
6010 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6012 * several files: use the new interface to the "updateinsetlist"
6014 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6016 (work_area_handler): call BufferView::trippleClick on trippleclick.
6018 * src/BufferView.C (doubleClick): new function, selects word on
6020 (trippleClick): new function, selects line on trippleclick.
6022 2000-02-22 Allan Rae <rae@lyx.org>
6024 * lib/bind/xemacs.bind: buffer-previous not supported
6026 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6028 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6031 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6033 * src/bufferlist.C: get rid of current_view from this file
6035 * src/spellchecker.C: get rid of current_view from this file
6037 * src/vspace.C: get rid of current_view from this file
6038 (inPixels): added BufferView parameter for this func
6039 (asLatexCommand): added a BufferParams for this func
6041 * src/text.C src/text2.C: get rid of current_view from these
6044 * src/lyxfont.C (getFontDirection): move this function here from
6047 * src/bufferparams.C (getDocumentDirection): move this function
6050 * src/paragraph.C (getParDirection): move this function here from
6052 (getLetterDirection): ditto
6054 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6056 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6057 resize due to wrong pixmap beeing used. Also took the opurtunity
6058 to make the LyXScreen stateless on regard to WorkArea and some
6059 general cleanup in the same files.
6061 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6063 * src/Makefile.am: add missing direction.h
6065 * src/PainterBase.h: made the width functions const.
6067 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6070 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6072 * src/insets/insetlatexaccent.C (draw): make the accents draw
6073 better, at present this will only work well with iso8859-1.
6075 * several files: remove the old drawing code, now we use the new
6078 * several files: remove support for mono_video, reverse_video and
6081 2000-02-17 Juergen Vigna <jug@sad.it>
6083 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6084 int ** as we have to return the pointer, otherwise we have only
6085 NULL pointers in the returning function.
6087 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6089 * src/LaTeX.C (operator()): quote file name when running latex.
6091 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6093 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6094 (bubble tip), this removes our special handling of this.
6096 * Remove all code that is unused now that we have the new
6097 workarea. (Code that are not active when NEW_WA is defined.)
6099 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6101 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6103 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6104 nonexisting layout; correctly redirect obsoleted layouts.
6106 * lib/lyxrc.example: document \view_dvi_paper_option
6108 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6111 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6112 (PreviewDVI): handle the view_dvi_paper_option variable.
6113 [Both from Roland Krause]
6115 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6118 char const *, int, LyXFont)
6119 (text(int, int, string, LyXFont)): ditto
6121 * src/text.C (InsertCharInTable): attempt to fix the double-space
6122 feature in tables too.
6123 (BackspaceInTable): ditto.
6124 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6126 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6128 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6130 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6131 newly found text in textcache to this.
6132 (buffer): set the owner of the text put into the textcache to 0
6134 * src/insets/figinset.C (draw): fixed the drawing of figures with
6137 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6138 drawing of mathframe, hfills, protected space, table lines. I have
6139 now no outstanding drawing problems with the new Painter code.
6141 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * src/PainterBase.C (ellipse, circle): do not specify the default
6146 * src/LColor.h: add using directive.
6148 * src/Painter.[Ch]: change return type of methods from Painter& to
6149 PainterBase&. Add a using directive.
6151 * src/WorkArea.C: wrap xforms callbacks in C functions
6154 * lib/layouts/foils.layout: font fix and simplifications from Carl
6157 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6159 * a lot of files: The Painter, LColor and WorkArea from the old
6160 devel branch has been ported to lyx-devel. Some new files and a
6161 lot of #ifdeffed code. The new workarea is enabled by default, but
6162 if you want to test the new Painter and LColor you have to compile
6163 with USE_PAINTER defined (do this in config.h f.ex.) There are
6164 still some rought edges, and I'd like some help to clear those
6165 out. It looks stable (loads and displays the Userguide very well).
6168 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6170 * src/buffer.C (pop_tag): revert to the previous implementation
6171 (use a global variable for both loops).
6173 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6175 * src/lyxrc.C (LyXRC): change slightly default date format.
6177 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6178 there is an English text with a footnote that starts with a Hebrew
6179 paragraph, or vice versa.
6180 (TeXFootnote): ditto.
6182 * src/text.C (LeftMargin): allow for negative values for
6183 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6186 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6187 for input encoding (cyrillic)
6189 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6194 * src/toolbar.C (set): ditto
6195 * src/insets/insetbib.C (create_form_citation_form): ditto
6197 * lib/CREDITS: added Dekel Tsur.
6199 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6200 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6201 hebrew supports files from Dekel Tsur.
6203 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6204 <tzafrir@technion.ac.il>
6206 * src/lyxrc.C: put \date_insert_format at the right place.
6208 * src/buffer.C (makeLaTeXFile): fix the handling of
6209 BufferParams::sides when writing out latex files.
6211 * src/BufferView2.C: add a "using" directive.
6213 * src/support/lyxsum.C (sum): when we use lyxstring,
6214 ostringstream::str needs an additional .c_str().
6216 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6218 * src/support/filetools.C (ChangeExtension): patch from Etienne
6221 * src/TextCache.C (show): remove const_cast and make second
6222 parameter non-const LyXText *.
6224 * src/TextCache.h: use non const LyXText in show.
6226 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6229 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6231 * src/support/lyxsum.C: rework to be more flexible.
6233 * several places: don't check if a pointer is 0 if you are going
6236 * src/text.C: remove some dead code.
6238 * src/insets/figinset.C: remove some dead code
6240 * src/buffer.C: move the BufferView funcs to BufferView2.C
6241 remove all support for insetlatexdel
6242 remove support for oldpapersize stuff
6243 made some member funcs const
6245 * src/kbmap.C: use a std::list to store the bindings in.
6247 * src/BufferView2.C: new file
6249 * src/kbsequence.[Ch]: new files
6251 * src/LyXAction.C + others: remove all trace of buffer-previous
6253 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6254 only have one copy in the binary of this table.
6256 * hebrew patch: moved some functions from LyXText to more
6257 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6259 * several files: remove support for XForms older than 0.88
6261 remove some #if 0 #endif code
6263 * src/TextCache.[Ch]: new file. Holds the textcache.
6265 * src/BufferView.C: changes to use the new TextCache interface.
6266 (waitForX): remove the now unused code.
6268 * src/BackStack.h: remove some commented code
6270 * lib/bind/emacs.bind: remove binding for buffer-previous
6272 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6274 * applied the hebrew patch.
6276 * src/lyxrow.h: make sure that all Row variables are initialized.
6278 * src/text2.C (TextHandleUndo): comment out a delete, this might
6279 introduce a memory leak, but should also help us to not try to
6280 read freed memory. We need to look at this one.
6282 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6283 (LyXParagraph): initalize footnotekind.
6285 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6286 forgot this when applying the patch. Please heed the warnings.
6288 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6289 (aka. reformat problem)
6291 * src/bufferlist.C (exists): made const, and use const_iterator
6292 (isLoaded): new func.
6293 (release): use std::find to find the correct buffer.
6295 * src/bufferlist.h: made getState a const func.
6296 made empty a const func.
6297 made exists a const func.
6300 2000-02-01 Juergen Vigna <jug@sad.it>
6302 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6304 * po/it.po: updated a bit the italian po file and also changed the
6305 'file nuovo' for newfile to 'filenuovo' without a space, this did
6308 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6309 for the new insert_date command.
6311 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6312 from jdblair, to insert a date into the current text conforming to
6313 a strftime format (for now only considering the locale-set and not
6314 the document-language).
6316 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6318 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6319 Bounds Read error seen by purify. The problem was that islower is
6320 a macros which takes an unsigned char and uses it as an index for
6321 in array of characters properties (and is thus subject to the
6325 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6326 correctly the paper sides radio buttons.
6327 (UpdateDocumentButtons): ditto.
6329 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6331 * src/kbmap.C (getsym + others): change to return unsigned int,
6332 returning a long can give problems on 64 bit systems. (I assume
6333 that int is 32bit on 64bit systems)
6335 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6337 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6338 LyXLookupString to be zero-terminated. Really fixes problems seen
6341 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6343 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6344 write a (char*)0 to the lyxerr stream.
6346 * src/lastfiles.C: move algorithm before the using statemets.
6348 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6351 complains otherwise).
6352 * src/table.C: ditto
6354 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6357 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6358 that I removed earlier... It is really needed.
6360 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6362 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6364 * INSTALL: update xforms home page URL.
6366 * lib/configure.m4: fix a bug with unreadable layout files.
6368 * src/table.C (calculate_width_of_column): add "using std::max"
6371 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * several files: marked several lines with "DEL LINE", this is
6374 lines that can be deleted without changing anything.
6375 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6376 checks this anyway */
6379 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6381 * src/DepTable.C (update): add a "+" at the end when the checksum
6382 is different. (debugging string only)
6384 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6385 the next inset to not be displayed. This should also fix the list
6386 of labels in the "Insert Crossreference" dialog.
6388 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6390 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6391 when regex was not found.
6393 * src/support/lstrings.C (lowercase): use handcoded transform always.
6396 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6397 old_cursor.par->prev could be 0.
6399 * several files: changed post inc/dec to pre inc/dec
6401 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6402 write the lastfiles to file.
6404 * src/BufferView.C (buffer): only show TextCache info when debugging
6406 (resizeCurrentBuffer): ditto
6407 (workAreaExpose): ditto
6409 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6411 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6413 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6414 a bit better by removing the special case for \i and \j.
6416 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6418 * src/lyx_main.C (easyParse): remove test for bad comand line
6419 options, since this broke all xforms-related parsing.
6421 * src/kbmap.C (getsym): set return type to unsigned long, as
6422 declared in header. On an alpha, long is _not_ the same as int.
6424 * src/support/LOstream.h: add a "using std::flush;"
6426 * src/insets/figinset.C: ditto.
6428 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6430 * src/bufferlist.C (write): use blinding fast file copy instead of
6431 "a char at a time", now we are doing it the C++ way.
6433 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6434 std::list<int> instead.
6435 (addpidwait): reflect move to std::list<int>
6436 (sigchldchecker): ditto
6438 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6441 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6442 that obviously was wrong...
6444 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6445 c, this avoids warnings with purify and islower.
6447 * src/insets/figinset.C: rename struct queue to struct
6448 queue_element and rewrite to use a std::queue. gsqueue is now a
6449 std::queue<queue_element>
6450 (runqueue): reflect move to std::queue
6453 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6454 we would get "1" "0" instead of "true" "false. Also make the tostr
6457 2000-01-21 Juergen Vigna <jug@sad.it>
6459 * src/buffer.C (writeFileAscii): Disabled code for special groff
6460 handling of tabulars till I fix this in table.C
6462 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6464 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6466 * src/support/lyxlib.h: ditto.
6468 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6470 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6471 and 'j' look better. This might fix the "macron" bug that has been
6474 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6475 functions as one template function. Delete the old versions.
6477 * src/support/lyxsum.C: move using std::ifstream inside
6480 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6483 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6485 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6487 * src/insets/figinset.C (InitFigures): use new instead of malloc
6488 to allocate memory for figures and bitmaps.
6489 (DoneFigures): use delete[] instead of free to deallocate memory
6490 for figures and bitmaps.
6491 (runqueue): use new to allocate
6492 (getfigdata): use new/delete[] instead of malloc/free
6493 (RegisterFigure): ditto
6495 * some files: moved some declarations closer to first use, small
6496 whitespace changes use preincrement instead of postincrement where
6497 it does not make a difference.
6499 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6500 step on the way to use stl::containers for key maps.
6502 * src/bufferlist.h: add a typedef for const_iterator and const
6503 versions of begin and end.
6505 * src/bufferlist.[Ch]: change name of member variable _state to
6506 state_. (avoid reserved names)
6508 (getFileNames): returns the filenames of the buffers in a vector.
6510 * configure.in (ALL_LINGUAS): added ro
6512 * src/support/putenv.C: new file
6514 * src/support/mkdir.C: new file
6516 2000-01-20 Allan Rae <rae@lyx.org>
6518 * lib/layouts/IEEEtran.layout: Added several theorem environments
6520 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6521 couple of minor additions.
6523 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6524 (except for those in footnotes of course)
6526 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6528 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6530 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6531 std::sort and std::lower_bound instead of qsort and handwritten
6533 (struct compara): struct that holds the functors used by std::sort
6534 and std::lower_bound in MathedLookupBOP.
6536 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6538 * src/support/LAssert.h: do not do partial specialization. We do
6541 * src/support/lyxlib.h: note that lyx::getUserName() and
6542 lyx::date() are not in use right now. Should these be suppressed?
6544 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6545 (makeLinuxDocFile): do not put date and user name in linuxdoc
6548 * src/support/lyxlib.h (kill): change first argument to long int,
6549 since that's what solaris uses.
6551 * src/support/kill.C (kill): fix declaration to match prototype.
6553 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6554 actually check whether namespaces are supported. This is not what
6557 * src/support/lyxsum.C: add a using directive.
6559 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6561 * src/support/kill.C: if we have namespace support we don't have
6562 to include lyxlib.h.
6564 * src/support/lyxlib.h: use namespace lyx if supported.
6566 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6568 * src/support/date.C: new file
6570 * src/support/chdir.C: new file
6572 * src/support/getUserName.C: new file
6574 * src/support/getcwd.C: new file
6576 * src/support/abort.C: new file
6578 * src/support/kill.C: new file
6580 * src/support/lyxlib.h: moved all the functions in this file
6581 insede struct lyx. Added also kill and abort to this struct. This
6582 is a way to avoid the "kill is not defined in <csignal>", we make
6583 C++ wrappers for functions that are not ANSI C or ANSI C++.
6585 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6586 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6587 lyx it has been renamed to sum.
6589 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6591 * src/text.C: add using directives for std::min and std::max.
6593 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6595 * src/texrow.C (getIdFromRow): actually return something useful in
6596 id and pos. Hopefully fixes the bug with positionning of errorbox
6599 * src/lyx_main.C (easyParse): output an error and exit if an
6600 incorrect command line option has been given.
6602 * src/spellchecker.C (ispell_check_word): document a memory leak.
6604 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6605 where a "struct utimbuf" is allocated with "new" and deleted with
6608 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6610 * src/text2.C (CutSelection): don't delete double spaces.
6611 (PasteSelection): ditto
6612 (CopySelection): ditto
6614 * src/text.C (Backspace): don't delete double spaces.
6616 * src/lyxlex.C (next): fix a bug that were only present with
6617 conformant std::istream::get to read comment lines, use
6618 std::istream::getline instead. This seems to fix the problem.
6620 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6622 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6623 allowed to insert space before space" editing problem. Please read
6624 commends at the beginning of the function. Comments about usage
6627 * src/text.C (InsertChar): fix for the "not allowed to insert
6628 space before space" editing problem.
6630 * src/text2.C (DeleteEmptyParagraphMechanism): when
6631 IsEmptyTableRow can only return false this last "else if" will
6632 always be a no-op. Commented out.
6634 * src/text.C (RedoParagraph): As far as I can understand tmp
6635 cursor is not really needed.
6637 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6638 present it could only return false anyway.
6639 (several functions): Did something not so smart...added a const
6640 specifier on a lot of methods.
6642 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6643 and add a tmp->text.resize. The LyXParagraph constructor does the
6645 (BreakParagraphConservative): ditto
6647 * src/support/path.h (Path): add a define so that the wrong usage
6648 "Path("/tmp") will be flagged as a compilation error:
6649 "`unnamed_Path' undeclared (first use this function)"
6651 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6653 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6654 which was bogus for several reasons.
6656 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6660 * autogen.sh: do not use "type -path" (what's that anyway?).
6662 * src/support/filetools.C (findtexfile): remove extraneous space
6663 which caused a kpsewhich warning (at least with kpathsea version
6666 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6668 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6670 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6672 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6674 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6676 * src/paragraph.C (BreakParagraph): do not reserve space on text
6677 if we don't need to (otherwise, if pos_end < pos, we end up
6678 reserving huge amounts of memory due to bad unsigned karma).
6679 (BreakParagraphConservative): ditto, although I have not seen
6680 evidence the bug can happen here.
6682 * src/lyxparagraph.h: add a using std::list.
6684 2000-01-11 Juergen Vigna <jug@sad.it>
6686 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6689 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6691 * src/vc-backend.C (doVCCommand): change to be static and take one
6692 more parameter: the path to chdir too be fore executing the command.
6693 (retrive): new function equiv to "co -r"
6695 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6696 file_not_found_hook is true.
6698 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6700 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6701 if a file is readwrite,readonly...anything else.
6703 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6705 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6706 (CreatePostscript): name change from MenuRunDVIPS (or something)
6707 (PreviewPostscript): name change from MenuPreviewPS
6708 (PreviewDVI): name change from MenuPreviewDVI
6710 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6711 \view_pdf_command., \pdf_to_ps_command
6713 * lib/configure.m4: added search for PDF viewer, and search for
6714 PDF to PS converter.
6715 (lyxrc.defaults output): add \pdflatex_command,
6716 \view_pdf_command and \pdf_to_ps_command.
6718 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6720 * src/bufferlist.C (write): we don't use blocksize for anything so
6723 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6725 * src/support/block.h: disable operator T* (), since it causes
6726 problems with both compilers I tried. See comments in the file.
6728 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6731 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6732 variable LYX_DIR_10x to LYX_DIR_11x.
6734 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6736 * INSTALL: document --with-lyxname.
6739 * configure.in: new configure flag --with-lyxname which allows to
6740 choose the name under which lyx is installed. Default is "lyx", of
6741 course. It used to be possible to do this with --program-suffix,
6742 but the later has in fact a different meaning for autoconf.
6744 * src/support/lstrings.h (lstrchr): reformat a bit.
6746 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6747 * src/mathed/math_defs.h: ditto.
6749 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6752 true, decides if we create a backup file or not when saving. New
6753 tag and variable \pdf_mode, defaults to false. New tag and
6754 variable \pdflatex_command, defaults to pdflatex. New tag and
6755 variable \view_pdf_command, defaults to xpdf. New tag and variable
6756 \pdf_to_ps_command, defaults to pdf2ps.
6758 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6760 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6761 does not have a BufferView.
6762 (unlockInset): ditto + don't access the_locking_inset if the
6763 buffer does not have a BufferView.
6765 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6766 certain circumstances so that we don't continue a keyboard
6767 operation long after the key was released. Try f.ex. to load a
6768 large document, press PageDown for some seconds and then release
6769 it. Before this change the document would contine to scroll for
6770 some time, with this change it stops imidiatly.
6772 * src/support/block.h: don't allocate more space than needed. As
6773 long as we don't try to write to the arr[x] in a array_type arr[x]
6774 it is perfectly ok. (if you write to it you might segfault).
6775 added operator value_type*() so that is possible to pass the array
6776 to functions expecting a C-pointer.
6778 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6781 * intl/*: updated to gettext 0.10.35, tried to add our own
6782 required modifications. Please verify.
6784 * po/*: updated to gettext 0.10.35, tried to add our own required
6785 modifications. Please verify.
6787 * src/support/lstrings.C (tostr): go at fixing the problem with
6788 cxx and stringstream. When stringstream is used return
6789 oss.str().c_str() so that problems with lyxstring and basic_string
6790 are avoided. Note that the best solution would be for cxx to use
6791 basic_string all the way, but it is not conformant yet. (it seems)
6793 * src/lyx_cb.C + other files: moved several global functions to
6794 class BufferView, some have been moved to BufferView.[Ch] others
6795 are still located in lyx_cb.C. Code changes because of this. (part
6796 of "get rid of current_view project".)
6798 * src/buffer.C + other files: moved several Buffer functions to
6799 class BufferView, the functions are still present in buffer.C.
6800 Code changes because of this.
6802 * config/lcmessage.m4: updated to most recent. used when creating
6805 * config/progtest.m4: updated to most recent. used when creating
6808 * config/gettext.m4: updated to most recent. applied patch for
6811 * config/gettext.m4.patch: new file that shows what changes we
6812 have done to the local copy of gettext.m4.
6814 * config/libtool.m4: new file, used in creation of acinclude.m4
6816 * config/lyxinclude.m4: new file, this is the lyx created m4
6817 macros, used in making acinclude.m4.
6819 * autogen.sh: GNU m4 discovered as a separate task not as part of
6820 the lib/configure creation.
6821 Generate acinlucde from files in config. Actually cat
6822 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6823 easier to upgrade .m4 files that really are external.
6825 * src/Spacing.h: moved using std::istringstream to right after
6826 <sstream>. This should fix the problem seen with some compilers.
6828 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6830 * src/lyx_cb.C: began some work to remove the dependency a lot of
6831 functions have on BufferView::text, even if not really needed.
6832 (GetCurrentTextClass): removed this func, it only hid the
6835 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6836 forgot this in last commit.
6838 * src/Bullet.C (bulletEntry): use static char const *[] for the
6839 tables, becuase of this the return arg had to change to string.
6841 (~Bullet): removed unneeded destructor
6843 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6844 (insetSleep): moved from Buffer
6845 (insetWakeup): moved from Buffer
6846 (insetUnlock): moved from Buffer
6848 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6849 from Buffer to BufferView.
6851 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6853 * config/ltmain.sh: updated to version 1.3.4 of libtool
6855 * config/ltconfig: updated to version 1.3.4 of libtool
6857 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6860 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6861 Did I get that right?
6863 * src/lyxlex.h: add a "using" directive or two.
6864 * src/Spacing.h: ditto.
6865 * src/insets/figinset.C: ditto.
6866 * src/support/filetools.C: ditto.
6867 * src/support/lstrings.C: ditto.
6868 * src/BufferView.C: ditto.
6869 * src/bufferlist.C: ditto.
6870 * src/lyx_cb.C: ditto.
6871 * src/lyxlex.C: ditto.
6873 * NEWS: add some changes for 1.1.4.
6875 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6877 * src/BufferView.C: first go at a TextCache to speed up switching
6880 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6882 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6883 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6884 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6885 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6888 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6889 members of the struct are correctly initialized to 0 (detected by
6891 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6892 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6894 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6895 pidwait, since it was allocated with "new". This was potentially
6896 very bad. Thanks to Michael Schmitt for running purify for us.
6899 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6901 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6903 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6905 1999-12-30 Allan Rae <rae@lyx.org>
6907 * lib/templates/IEEEtran.lyx: minor change
6909 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6910 src/mathed/formula.C (LocalDispatch): askForText changes
6912 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6913 know when a user has cancelled input. Fixes annoying problems with
6914 inserting labels and version control.
6916 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6918 * src/support/lstrings.C (tostr): rewritten to use strstream and
6921 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6923 * src/support/filetools.C (IsFileWriteable): use fstream to check
6924 (IsDirWriteable): use fileinfo to check
6926 * src/support/filetools.h (FilePtr): whole class deleted
6928 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6930 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6932 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6934 * src/bufferlist.C (write): use ifstream and ofstream instead of
6937 * src/Spacing.h: use istrstream instead of sscanf
6939 * src/mathed/math_defs.h: change first arg to istream from FILE*
6941 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6943 * src/mathed/math_parser.C: have yyis to be an istream
6944 (LexGetArg): use istream (yyis)
6946 (mathed_parse): ditto
6947 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6949 * src/mathed/formula.C (Read): rewritten to use istream
6951 * src/mathed/formulamacro.C (Read): rewritten to use istream
6953 * src/lyxlex.h (~LyXLex): deleted desturctor
6954 (getStream): new function, returns an istream
6955 (getFile): deleted funtion
6956 (IsOK): return is.good();
6958 * src/lyxlex.C (LyXLex): delete file and owns_file
6959 (setFile): open an filebuf and assign that to a istream instead of
6961 (setStream): new function, takes an istream as arg.
6962 (setFile): deleted function
6963 (EatLine): rewritten us use istream instead of FILE*
6967 * src/table.C (LyXTable): use istream instead of FILE*
6968 (Read): rewritten to take an istream instead of FILE*
6970 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6972 * src/buffer.C (Dispatch): remove an extraneous break statement.
6974 * src/support/filetools.C (QuoteName): change to do simple
6975 'quoting'. More work is necessary. Also changed to do nothing
6976 under emx (needs fix too).
6977 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6979 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6980 config.h.in to the AC_DEFINE_UNQUOTED() call.
6981 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6982 needs char * as argument (because Solaris 7 declares it like
6985 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6986 remove definition of BZERO.
6988 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6990 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6991 defined, "lyxregex.h" if not.
6993 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6995 (REGEX): new variable that is set to regex.c lyxregex.h when
6996 AM_CONDITIONAL USE_REGEX is set.
6997 (libsupport_la_SOURCES): add $(REGEX)
6999 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7002 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7005 * configure.in: add call to LYX_REGEX
7007 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7008 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7010 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7012 * lib/bind/fi_menus.bind: new file, from
7013 pauli.virtanen@saunalahti.fi.
7015 * src/buffer.C (getBibkeyList): pass the parameter delim to
7016 InsetInclude::getKeys and InsetBibtex::getKeys.
7018 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7019 is passed to Buffer::getBibkeyList
7021 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7022 instead of the hardcoded comma.
7024 * src/insets/insetbib.C (getKeys): make sure that there are not
7025 leading blanks in bibtex keys. Normal latex does not care, but
7026 harvard.sty seems to dislike blanks at the beginning of citation
7027 keys. In particular, the retturn value of the function is
7029 * INSTALL: make it clear that libstdc++ is needed and that gcc
7030 2.7.x probably does not work.
7032 * src/support/filetools.C (findtexfile): make debug message go to
7034 * src/insets/insetbib.C (getKeys): ditto
7036 * src/debug.C (showTags): make sure that the output is correctly
7039 * configure.in: add a comment for TWO_COLOR_ICON define.
7041 * acconfig.h: remove all the entries that already defined in
7042 configure.in or acinclude.m4.
7044 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7045 to avoid user name, date and copyright.
7047 1999-12-21 Juergen Vigna <jug@sad.it>
7049 * src/table.C (Read): Now read bogus row format informations
7050 if the format is < 5 so that afterwards the table can
7051 be read by lyx but without any format-info. Fixed the
7052 crash we experienced when not doing this.
7054 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7057 (RedoDrawingOfParagraph): ditto
7058 (RedoParagraphs): ditto
7059 (RemoveTableRow): ditto
7061 * src/text.C (Fill): rename arg paperwidth -> paper_width
7063 * src/buffer.C (insertLyXFile): rename var filename -> fname
7064 (writeFile): rename arg filename -> fname
7065 (writeFileAscii): ditto
7066 (makeLaTeXFile): ditto
7067 (makeLinuxDocFile): ditto
7068 (makeDocBookFile): ditto
7070 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7073 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7075 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7078 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7079 compiled by a C compiler not C++.
7081 * src/layout.h (LyXTextClass): added typedef for const_iterator
7082 (LyXTextClassList): added typedef for const_iterator + member
7083 functions begin and end.
7085 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7086 iterators to fill the choice_class.
7087 (updateLayoutChoice): rewritten to use iterators to fill the
7088 layoutlist in the toolbar.
7090 * src/BufferView.h (BufferView::work_area_width): removed unused
7093 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7095 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7096 (sgmlCloseTag): ditto
7098 * src/support/lstrings.h: return type of countChar changed to
7101 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7102 what version of this func to use. Also made to return unsigned int.
7104 * configure.in: call LYX_STD_COUNT
7106 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7107 conforming std::count.
7109 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7112 and a subscript would give bad display (patch from Dekel Tsur
7113 <dekel@math.tau.ac.il>).
7115 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7117 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7120 * src/chset.h: add a few 'using' directives
7122 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7123 triggered when no buffer is active
7125 * src/layout.C: removed `break' after `return' in switch(), since
7128 * src/lyx_main.C (init): make sure LyX can be ran in place even
7129 when libtool has done its magic with shared libraries. Fix the
7130 test for the case when the system directory has not been found.
7132 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7133 name for the latex file.
7134 (MenuMakeHTML): ditto
7136 * src/buffer.h: add an optional boolean argument, which is passed
7139 1999-12-20 Allan Rae <rae@lyx.org>
7141 * lib/templates/IEEEtran.lyx: small correction and update.
7143 * configure.in: Attempted to use LYX_PATH_HEADER
7145 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7147 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7148 input from JMarc. Now use preprocessor to find the header.
7149 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7150 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7151 LYX_STL_STRING_FWD. See comments in file.
7153 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7155 * The global MiniBuffer * minibuffer variable is dead.
7157 * The global FD_form_main * fd_form_main variable is dead.
7159 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7161 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7163 * src/table.h: add the LOstream.h header
7164 * src/debug.h: ditto
7166 * src/LyXAction.h: change the explaination of the ReadOnly
7167 attribute: is indicates that the function _can_ be used.
7169 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7172 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7174 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7180 * src/paragraph.C (GetWord): assert on pos>=0
7183 * src/support/lyxstring.C: condition the use of an invariant on
7185 * src/support/lyxstring.h: ditto
7187 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7188 Use LAssert.h instead of plain assert().
7190 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7192 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7193 * src/support/filetools.C: ditto
7195 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7198 * INSTALL: document the new configure flags
7200 * configure.in: suppress --with-debug; add --enable-assertions
7202 * acinclude.m4: various changes in alignment of help strings.
7204 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7206 * src/kbmap.C: commented out the use of the hash map in kb_map,
7207 beginning of movement to a stl::container.
7209 * several files: removed code that was not in effect when
7210 MOVE_TEXT was defined.
7212 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7213 for escaping should not be used. We can discuss if the string
7214 should be enclosed in f.ex. [] instead of "".
7216 * src/trans_mgr.C (insert): use the new returned value from
7217 encodeString to get deadkeys and keymaps done correctly.
7219 * src/chset.C (encodeString): changed to return a pair, to tell
7220 what to use if we know the string.
7222 * src/lyxscreen.h (fillArc): new function.
7224 * src/FontInfo.C (resize): rewritten to use more std::string like
7225 structore, especially string::replace.
7227 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7230 * configure.in (chmod +x some scripts): remove config/gcc-hack
7232 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7234 * src/buffer.C (writeFile): change once again the top comment in a
7235 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7236 instead of an hardcoded version number.
7237 (makeDocBookFile): ditto
7239 * src/version.h: add new define LYX_DOCVERSION
7241 * po/de.po: update from Pit Sütterlin
7242 * lib/bind/de_menus.bind: ditto.
7244 * src/lyxfunc.C (Dispatch): call MenuExport()
7245 * src/buffer.C (Dispatch): ditto
7247 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7248 LyXFunc::Dispatch().
7249 (MenuExport): new function, moved from
7250 LyXFunc::Dispatch().
7252 * src/trans_mgr.C (insert): small cleanup
7253 * src/chset.C (loadFile): ditto
7255 * lib/kbd/iso8859-1.cdef: add missing backslashes
7257 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7259 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7260 help with placing the manually drawn accents better.
7262 (Draw): x2 and hg changed to float to minimize rounding errors and
7263 help place the accents better.
7265 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7266 unsigned short to char is just wrong...cast the char to unsigned
7267 char instead so that the two values can compare sanely. This
7268 should also make the display of insetlatexaccents better and
7269 perhaps also some other insets.
7271 (lbearing): new function
7274 1999-12-15 Allan Rae <rae@lyx.org>
7276 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7277 header that provides a wrapper around the very annoying SGI STL header
7280 * src/support/lyxstring.C, src/LString.h:
7281 removed old SGI-STL-compatability attempts.
7283 * configure.in: Use LYX_STL_STRING_FWD.
7285 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7286 stl_string_fwd.h is around and try to determine it's location.
7287 Major improvement over previous SGI STL 3.2 compatability.
7288 Three small problems remain with this function due to my zero
7289 knowledge of autoconf. JMarc and lgb see the comments in the code.
7291 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7293 * src/broken_const.h, config/hack-gcc, config/README: removed
7295 * configure.in: remove --with-gcc-hack option; do not call
7298 * INSTALL: remove documentation of --with-broken-const and
7301 * acconfig.h: remove all trace of BROKEN_CONST define
7303 * src/buffer.C (makeDocBookFile): update version number in output
7305 (SimpleDocBookOnePar): fix an assert when trying to a character
7306 access beyond string length
7309 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7311 * po/de.po: fix the Export menu
7313 * lyx.man: update the description of -dbg
7315 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7316 (commandLineHelp): updated
7317 (easyParse): show list of available debug levels if -dbg is passed
7320 * src/Makefile.am: add debug.C
7322 * src/debug.h: moved some code to debug.C
7324 * src/debug.C: new file. Contains code to set and show debug
7327 * src/layout.C: remove 'break' after 'continue' in switch
7328 statements, since these cannot be reached.
7330 1999-12-13 Allan Rae <rae@lyx.org>
7332 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7333 (in_word_set): hash() -> math_hash()
7335 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7337 * acconfig.h: Added a test for whether we are using exceptions in the
7338 current compilation run. If so USING_EXCEPTIONS is defined.
7340 * config.in: Check for existance of stl_string_fwd.h
7341 * src/LString.h: If compiling --with-included-string and SGI's
7342 STL version 3.2 is present (see above test) we need to block their
7343 forward declaration of string and supply a __get_c_string().
7344 However, it turns out this is only necessary if compiling with
7345 exceptions enabled so I've a bit more to add yet.
7347 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7348 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7349 src/support/LRegex.h, src/undo.h:
7350 Shuffle the order of the included files a little to ensure that
7351 LString.h gets included before anything that includes stl_string_fwd.h
7353 * src/support/lyxstring.C: We need to #include LString.h instead of
7354 lyxstring.h to get the necessary definition of __get_c_string.
7355 (__get_c_string): New function. This is defined static just like SGI's
7356 although why they need to do this I'm not sure. Perhaps it should be
7357 in lstrings.C instead.
7359 * lib/templates/IEEEtran.lyx: New template file.
7361 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7363 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7364 * intl/Makefile.in (MKINSTALLDIRS): ditto
7366 * src/LyXAction.C (init): changed to hold the LFUN data in a
7367 automatic array in stead of in callso to newFunc, this speeds up
7368 compilation a lot. Also all the memory used by the array is
7369 returned when the init is completed.
7371 * a lot of files: compiled with -Wold-style-cast, changed most of
7372 the reported offenders to C++ style casts. Did not change the
7373 offenders in C files.
7375 * src/trans.h (Match): change argument type to unsigned int.
7377 * src/support/DebugStream.C: fix some types on the streambufs so
7378 that it works on a conforming implementation.
7380 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7382 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7384 * src/support/lyxstring.C: remove the inline added earlier since
7385 they cause a bunch of unsatisfied symbols when linking with dec
7386 cxx. Cxx likes to have the body of inlines at the place where they
7389 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7390 accessing negative bounds in array. This fixes the crash when
7391 inserting accented characters.
7392 * src/trans.h (Match): ditto
7394 * src/buffer.C (Dispatch): since this is a void, it should not try
7395 to return anything...
7397 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7399 * src/buffer.h: removed the two friends from Buffer. Some changes
7400 because of this. Buffer::getFileName and Buffer::setFileName
7401 renamed to Buffer::fileName() and Buffer::fileName(...).
7403 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7405 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7406 and Buffer::update(short) to BufferView. This move is currently
7407 controlled by a define MOVE_TEXT, this will be removed when all
7408 shows to be ok. This move paves the way for better separation
7409 between buffer contents and buffer view. One side effect is that
7410 the BufferView needs a rebreak when swiching buffers, if we want
7411 to avoid this we can add a cache that holds pointers to LyXText's
7412 that is not currently in use.
7414 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7417 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7419 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7421 * lyx_main.C: new command line option -x (or --execute) and
7422 -e (or --export). Now direct conversion from .lyx to .tex
7423 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7424 Unfortunately, X is still needed and the GUI pops up during the
7427 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7429 * src/Spacing.C: add a using directive to bring stream stuff into
7431 * src/paragraph.C: ditto
7432 * src/buffer.C: ditto
7434 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7435 from Lars' announcement).
7437 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7438 example files from Tino Meinen.
7440 1999-12-06 Allan Rae <rae@lyx.org>
7442 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7444 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7446 * src/support/lyxstring.C: added a lot of inline for no good
7449 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7450 latexWriteEndChanges, they were not used.
7452 * src/layout.h (operator<<): output operator for PageSides
7454 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7456 * some example files: loaded in LyX 1.0.4 and saved again to update
7457 certain constructs (table format)
7459 * a lot of files: did the change to use fstream/iostream for all
7460 writing of files. Done with a close look at Andre Poenitz's patch.
7462 * some files: whitespace changes.
7464 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7466 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7467 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7468 architecture, we provide our own. It is used unconditionnally, but
7469 I do not think this is a performance problem. Thanks to Angus
7470 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7471 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7473 (GetInset): use my_memcpy.
7477 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7478 it is easier to understand, but it uses less TeX-only constructs now.
7480 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7481 elements contain spaces
7483 * lib/configure: regenerated
7485 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7486 elements contain spaces; display the list of programs that are
7489 * autogen.sh: make sure lib/configure is executable
7491 * lib/examples/*: rename the tutorial examples to begin with the
7492 two-letters language code.
7494 * src/lyxfunc.C (getStatus): do not query current font if no
7497 * src/lyx_cb.C (RunScript): use QuoteName
7498 (MenuRunDvips): ditto
7499 (PrintApplyCB): ditto
7501 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7502 around argument, so that it works well with the current shell.
7503 Does not work properly with OS/2 shells currently.
7505 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7506 * src/LyXSendto.C (SendtoApplyCB): ditto
7507 * src/lyxfunc.C (Dispatch): ditto
7508 * src/buffer.C (runLaTeX): ditto
7509 (runLiterate): ditto
7510 (buildProgram): ditto
7512 * src/lyx_cb.C (RunScript): ditto
7513 (MenuMakeLaTeX): ditto
7515 * src/buffer.h (getLatexName): new method
7517 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7519 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7521 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7522 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7523 (create_math_panel): ditto
7525 * src/lyxfunc.C (getStatus): re-activate the code which gets
7526 current font and cursor; add test for export to html.
7528 * src/lyxrc.C (read): remove unreachable break statements; add a
7531 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7533 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7535 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7536 introduced by faulty regex.
7537 * src/buffer.C: ditto
7538 * src/lastfiles.C: ditto
7539 * src/paragraph.C: ditto
7540 * src/table.C: ditto
7541 * src/vspace.C: ditto
7542 * src/insets/figinset.C: ditto
7543 Note: most of these is absolutely harmless, except the one in
7544 src/mathed formula.C.
7546 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7548 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7549 operation, yielding correct results for the reLyX command.
7551 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * src/support/filetools.C (ExpandPath): removed an over eager
7555 (ReplaceEnvironmentPath): ditto
7557 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7558 shows that we are doing something fishy in our code...
7562 * src/lyxrc.C (read): use a double switch trick to get more help
7563 from the compiler. (the same trick is used in layout.C)
7564 (write): new function. opens a ofstream and pass that to output
7565 (output): new function, takes a ostream and writes the lyxrc
7566 elemts to it. uses a dummy switch to make sure no elements are
7569 * src/lyxlex.h: added a struct pushpophelper for use in functions
7570 with more than one exit point.
7572 * src/lyxlex.[Ch] (GetInteger): made it const
7576 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7578 * src/layout.[hC] : LayoutTags splitted into several enums, new
7579 methods created, better error handling cleaner use of lyxlex. Read
7582 * src/bmtable.[Ch]: change some member prototypes because of the
7583 image const changes.
7585 * commandtags.h, src/LyXAction.C (init): new function:
7586 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7587 This file is not read automatically but you can add \input
7588 preferences to your lyxrc if you want to. We need to discuss how
7591 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7592 in .aux, also remove .bib and .bst files from dependencies when
7595 * src/BufferView.C, src/LyXView.C: add const_cast several places
7596 because of changes to images.
7598 * lib/images/*: same change as for images/*
7600 * lib/lyxrc.example: Default for accept_compound is false not no.
7602 * images/*: changed to be const, however I have som misgivings
7603 about this change so it might be changed back.
7605 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7607 * lib/configure, po/POTFILES.in: regenerated
7609 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7611 * config/lib_configure.m4: removed
7613 * lib/configure.m4: new file (was config/lib_configure.m4)
7615 * configure.in: do not test for rtti, since we do not use it.
7617 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7619 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7620 doubling of allocated space scheme. This makes it faster for large
7621 strings end to use less memory for small strings. xtra rememoved.
7623 * src/insets/figinset.C (waitalarm): commented out.
7624 (GhostscriptMsg): use static_cast
7625 (GhostscriptMsg): use new instead of malloc to allocate memory for
7626 cmap. also delete the memory after use.
7628 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7630 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7631 for changes in bibtex database or style.
7632 (runBibTeX): remove all .bib and .bst files from dep before we
7634 (run): use scanAuc in when dep file already exist.
7636 * src/DepTable.C (remove_files_with_extension): new method
7639 * src/DepTable.[Ch]: made many of the methods const.
7641 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7643 * src/bufferparams.C: make sure that the default textclass is
7644 "article". It used to be the first one by description order, but
7645 now the first one is "docbook".
7647 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7648 string; call Debug::value.
7649 (easyParse): pass complete argument to setDebuggingLevel().
7651 * src/debug.h (value): fix the code that parses debug levels.
7653 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7656 * src/LyXAction.C: use Debug::ACTION as debug channel.
7658 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7660 * NEWS: updated for the future 1.1.3 release.
7662 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7663 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7664 it should. This is of course a controversial change (since many
7665 people will find that their lyx workscreen is suddenly full of
7666 red), but done for the sake of correctness.
7668 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7669 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7671 * src/insets/inseterror.h, src/insets/inseturl.h,
7672 src/insets/insetinfo.h, src/insets/figinset.h,
7673 src/mathed/formulamacro.h, src/mathed/math_macro.h
7674 (EditMessage): add a missing const and add _() to make sure that
7677 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7678 src/insets/insetbib.C, src/support/filetools.C: add `using'
7681 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7682 doing 'Insert index of last word' at the beginning of a paragraph.
7684 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7686 * several files: white-space changes.
7688 * src/mathed/formula.C: removed IsAlpha and IsDigit
7690 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7691 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7694 * src/insets/figinset.C (GetPSSizes): don't break when
7695 "EndComments" is seen. But break when a boundingbox is read.
7697 * all classes inherited from Inset: return value of Clone
7698 changed back to Inset *.
7700 * all classes inherited form MathInset: return value of Clone
7701 changed back to MathedInset *.
7703 * src/insets/figinset.C (runqueue): use a ofstream to output the
7704 gs/ps file. Might need some setpresicion or setw. However I can
7705 see no problem with the current code.
7706 (runqueue): use sleep instead of the alarm/signal code. I just
7707 can't see the difference.
7709 * src/paragraph.C (LyXParagraph): reserve space in the new
7710 paragraph and resize the inserted paragraph to just fit.
7712 * src/lyxfunc.h (operator|=): added operator for func_status.
7714 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7715 check for readable file.
7717 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7718 check for readable file.
7719 (MenuMakeLinuxDoc): ditto
7720 (MenuMakeDocBook): ditto
7721 (MenuMakeAscii): ditto
7722 (InsertAsciiFile): split the test for openable and readable
7724 * src/bmtable.C (draw_bitmaptable): use
7725 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7727 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7728 findtexfile from LaTeX to filetools.
7730 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7731 instead of FilePtr. Needs to be verified by a literate user.
7733 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7735 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7736 (EditMessage): likewise.
7738 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7739 respectively as \textasciitilde and \textasciicircum.
7741 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7743 * src/support/lyxstring.h: made the methods that take iterators
7746 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7747 (regexMatch): made is use the real regex class.
7749 * src/support/Makefile.am: changed to use libtool
7751 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7753 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7755 (MathIsInset ++): changed several macros to be inline functions
7758 * src/mathed/Makefile.am: changed to use libtool
7760 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7762 * src/insets/inset* : Clone changed to const and return type is
7763 the true insettype not just Inset*.
7765 * src/insets/Makefile.am: changed to use libtool
7767 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7769 * src/undo.[Ch] : added empty() and changed some of the method
7772 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7774 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7775 setID use block<> for the bullets array, added const several places.
7777 * src/lyxfunc.C (getStatus): new function
7779 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7780 LyXAction, added const to several funtions.
7782 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7783 a std::map, and to store the dir items in a vector.
7785 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7788 * src/LyXView.[Ch] + other files : changed currentView to view.
7790 * src/LyXAction.[Ch] : ported from the old devel branch.
7792 * src/.cvsignore: added .libs and a.out
7794 * configure.in : changes to use libtool.
7796 * acinclude.m4 : inserted libtool.m4
7798 * .cvsignore: added libtool
7800 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7802 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7803 file name in insets and mathed directories (otherwise the
7804 dependency is not taken in account under cygwin).
7806 * src/text2.C (InsertString[AB]): make sure that we do not try to
7807 read characters past the string length.
7809 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7811 * lib/doc/LaTeXConfig.lyx.in,
7812 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7814 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7815 file saying who created them and when this heppened; this is
7816 useless and annoys tools like cvs.
7818 * lib/layouts/g-brief-{en,de}.layout,
7819 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7820 from Thomas Hartkens <thomas@hartkens.de>.
7822 * src/{insets,mathed}/Makefile.am: do not declare an empty
7823 LDFLAGS, so that it can be set at configure time (useful on Irix
7826 * lib/reLyX/configure.in: make sure that the prefix is set
7827 correctly in LYX_DIR.
7829 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7831 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7832 be used by 'command-sequence' this allows to bind a key to a
7833 sequence of LyX-commands
7834 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7836 * src/LyXAction.C: add "command-sequence"
7838 * src/LyXFunction.C: handling of "command-sequence"
7840 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7841 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7843 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7845 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7847 * src/buffer.C (writeFile): Do not output a comment giving user
7848 and date at the beginning of a .lyx file. This is useless and
7849 annoys cvs anyway; update version number to 1.1.
7851 * src/Makefile.am (LYX_DIR): add this definition, so that a
7852 default path is hardcoded in LyX.
7854 * configure.in: Use LYX_GNU_GETTEXT.
7856 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7857 AM_GNU_GETTEXT with a bug fixed.
7859 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7861 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7863 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7864 which is used to point to LyX data is now LYX_DIR_11x.
7866 * lyx.man: convert to a unix text file; small updates.
7868 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7870 * src/support/LSubstring.[Ch]: made the second arg of most of the
7871 constructors be a const reference.
7873 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7876 * src/support/lyxstring.[Ch] (swap): added missing member function
7877 and specialization of swap(str, str);
7879 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7881 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7882 trace of the old one.
7884 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7885 put the member definitions in undo.C.
7887 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7888 NEW_TEXT and have now only code that was included when this was
7891 * src/intl.C (LCombo): use static_cast
7893 (DispatchCallback): ditto
7895 * src/definitions.h: removed whole file
7897 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7899 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7900 parsing and stores in a std:map. a regex defines the file format.
7901 removed unneeded members.
7903 * src/bufferparams.h: added several enums from definitions.h here.
7904 Removed unsused destructor. Changed some types to use proper enum
7905 types. use block to have the temp_bullets and user_defined_bullets
7906 and to make the whole class assignable.
7908 * src/bufferparams.C (Copy): removed this functions, use a default
7911 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7914 * src/buffer.C (readLyXformat2): commend out all that have with
7915 oldpapersize to do. also comment out all that hve to do with
7916 insetlatex and insetlatexdel.
7917 (setOldPaperStuff): commented out
7919 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7921 * src/LyXAction.C: remove use of inset-latex-insert
7923 * src/mathed/math_panel.C (button_cb): use static_cast
7925 * src/insets/Makefile.am (insets_o_SOURCES): removed
7928 * src/support/lyxstring.C (helper): use the unsigned long
7929 specifier, UL, instead of a static_cast.
7931 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7933 * src/support/block.h: new file. to be used as a c-style array in
7934 classes, so that the class can be assignable.
7936 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7938 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7939 NULL, make sure to return an empty string (it is not possible to
7940 set a string to NULL).
7942 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7944 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7946 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7948 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7949 link line, so that Irix users (for example) can set it explicitely to
7952 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7953 it can be overidden at make time (static or dynamic link, for
7956 * src/vc-backend.C, src/LaTeXFeatures.h,
7957 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7958 statements to bring templates to global namespace.
7960 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/support/lyxstring.C (operator[] const): make it standard
7965 * src/minibuffer.C (Init): changed to reflect that more
7966 information is given from the lyxvc and need not be provided here.
7968 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7970 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7972 * src/LyXView.C (UpdateTimerCB): use static_cast
7973 (KeyPressMask_raw_callback): ditto
7975 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7976 buffer_, a lot of changes because of this. currentBuffer() ->
7977 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7978 also changes to other files because of this.
7980 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7982 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7983 have no support for RCS and partial support for CVS, will be
7986 * src/insets/ several files: changes because of function name
7987 changes in Bufferview and LyXView.
7989 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7991 * src/support/LSubstring.[Ch]: new files. These implement a
7992 Substring that can be very convenient to use. i.e. is this
7994 string a = "Mary had a little sheep";
7995 Substring(a, "sheep") = "lamb";
7996 a is now "Mary has a little lamb".
7998 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7999 out patterns and subpatterns of strings. It is used by LSubstring
8000 and also by vc-backend.C
8002 * src/support/lyxstring.C: went over all the assertions used and
8003 tried to correct the wrong ones and flag which of them is required
8004 by the standard. some bugs found because of this. Also removed a
8005 couple of assertions.
8007 * src/support/Makefile.am (libsupport_a_SOURCES): added
8008 LSubstring.[Ch] and LRegex.[Ch]
8010 * src/support/FileInfo.h: have struct stat buf as an object and
8011 not a pointer to one, some changes because of this.
8013 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8014 information in layout when adding the layouts preamble to the
8017 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8020 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8021 because of bug in OS/2.
8023 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8025 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8026 \verbatim@font instead of \ttfamily, so that it can be redefined.
8028 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8029 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8030 src/layout.h, src/text2.C: add 'using' directive to bring the
8031 STL templates we need from the std:: namespace to the global one.
8032 Needed by DEC cxx in strict ansi mode.
8034 * src/support/LIstream.h,src/support/LOstream.h,
8035 src/support/lyxstring.h,src/table.h,
8036 src/lyxlookup.h: do not include <config.h> in header
8037 files. This should be done in the .C files only.
8039 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8043 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8045 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8046 from Kayvan to fix the tth invokation.
8048 * development/lyx.spec.in: updates from Kayvan to reflect the
8049 changes of file names.
8051 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * src/text2.C (InsertStringB): use std::copy
8054 (InsertStringA): use std::copy
8056 * src/bufferlist.C: use a vector to store the buffers in. This is
8057 an internal change and should not affect any other thing.
8059 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8062 * src/text.C (Fill): fix potential bug, one off bug.
8064 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8066 * src/Makefile.am (lyx_main.o): add more files it depends on.
8068 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8070 * src/support/lyxstring.C: use size_t for the reference count,
8071 size, reserved memory and xtra.
8072 (internal_compare): new private member function. Now the compare
8073 functions should work for std::strings that have embedded '\0'
8075 (compare): all compare functions rewritten to use
8078 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8080 * src/support/lyxstring.C (compare): pass c_str()
8081 (compare): pass c_str
8082 (compare): pass c_str
8084 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8086 * src/support/DebugStream.C: <config.h> was not included correctly.
8088 * lib/configure: forgot to re-generate it :( I'll make this file
8089 auto generated soon.
8091 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8096 * src/support/lyxstring.C: some changes from length() to rep->sz.
8097 avoids a function call.
8099 * src/support/filetools.C (SpaceLess): yet another version of the
8100 algorithm...now per Jean-Marc's suggestions.
8102 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8104 * src/layout.C (less_textclass_desc): functor for use in sorting
8106 (LyXTextClass::Read): sort the textclasses after reading.
8108 * src/support/filetools.C (SpaceLess): new version of the
8109 SpaceLess functions. What problems does this one give? Please
8112 * images/banner_bw.xbm: made the arrays unsigned char *
8114 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8116 * src/support/lyxstring.C (find): remove bogus assertion in the
8117 two versions of find where this has not been done yet.
8119 * src/support/lyxlib.h: add missing int return type to
8122 * src/menus.C (ShowFileMenu): disable exporting to html if no
8123 html export command is present.
8125 * config/lib_configure.m4: add a test for an HTML converter. The
8126 programs checked for are, in this order: tth, latex2html and
8129 * lib/configure: generated from config/lib_configure.m4.
8131 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8132 html converter. The parameters are now passed through $$FName and
8133 $$OutName, instead of standard input/output.
8135 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8137 * lib/lyxrc.example: update description of \html_command.
8138 add "quotes" around \screen_font_xxx font setting examples to help
8139 people who use fonts with spaces in their names.
8141 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * Distribution files: updates for v1.1.2
8145 * src/support/lyxstring.C (find): remove bogus assert and return
8146 npos for the same condition.
8148 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8150 * added patch for OS/2 from SMiyata.
8152 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8154 * src/text2.C (CutSelection): make space_wrapped a bool
8155 (CutSelection): dont declare int i until we have to.
8156 (alphaCounter): return a char const *.
8158 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8160 * src/support/syscall.C (Systemcalls::kill):
8161 src/support/filetools.C (PutEnv, PutEnvPath):
8162 src/lyx_cb.C (addNewlineAndDepth):
8163 src/FontInfo.C (FontInfo::resize): condition some #warning
8164 directives with WITH_WARNINGS.
8167 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8169 * src/layout.[Ch] + several files: access to class variables
8170 limited and made accessor functions instead a lot of code changed
8171 becuase of this. Also instead of returning pointers often a const
8172 reference is returned instead.
8174 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8176 * src/Makefile.am (dist-hook): added used to remove the CVS from
8177 cheaders upon creating a dist
8178 (EXTRA_DIST): added cheaders
8180 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8181 a character not as a small integer.
8183 * src/support/lyxstring.C (find): removed Assert and added i >=
8184 rep->sz to the first if.
8186 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8188 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8189 src/LyXView.C src/buffer.C src/bufferparams.C
8190 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8191 src/text2.C src/insets/insetinclude.C:
8192 lyxlayout renamed to textclasslist.
8194 * src/layout.C: some lyxerr changes.
8196 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8197 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8198 (LyXLayoutList): removed all traces of this class.
8199 (LyXTextClass::Read): rewrote LT_STYLE
8200 (LyXTextClass::hasLayout): new function
8201 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8202 both const and nonconst version.
8203 (LyXTextClass::delete_layout): new function.
8204 (LyXTextClassList::Style): bug fix. do the right thing if layout
8206 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8207 (LyXTextClassList::NameOfLayout): ditto
8208 (LyXTextClassList::Load): ditto
8210 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8212 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8214 * src/LyXAction.C (LookupFunc): added a workaround for sun
8215 compiler, on the other hand...we don't know if the current code
8216 compiles on sun at all...
8218 * src/support/filetools.C (CleanupPath): subst fix
8220 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8223 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8224 complained about this one?
8226 * src/insets/insetinclude.C (Latex): subst fix
8228 * src/insets/insetbib.C (getKeys): subst fix
8230 * src/LyXSendto.C (SendtoApplyCB): subst fix
8232 * src/lyx_main.C (init): subst fix
8234 * src/layout.C (Read): subst fix
8236 * src/lyx_sendfax_main.C (button_send): subst fix
8238 * src/buffer.C (RoffAsciiTable): subst fix
8240 * src/lyx_cb.C (MenuFax): subst fix
8241 (PrintApplyCB): subst fix
8243 1999-10-26 Juergen Vigna <jug@sad.it>
8245 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8247 (Read): Cleaned up this code so now we read only format vestion >= 5
8249 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8251 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8252 come nobody has complained about this one?
8254 * src/insets/insetinclude.C (Latex): subst fix
8256 * src/insets/insetbib.C (getKeys): subst fix
8258 * src/lyx_main.C (init): subst fix
8260 * src/layout.C (Read): subst fix
8262 * src/buffer.C (RoffAsciiTable): subst fix
8264 * src/lyx_cb.C (MenuFax): subst fix.
8266 * src/layout.[hC] + some other files: rewrote to use
8267 std::container to store textclasses and layouts in.
8268 Simplified, removed a lot of code. Make all classes
8269 assignable. Further simplifications and review of type
8270 use still to be one.
8272 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8273 lastfiles to create the lastfiles partr of the menu.
8275 * src/lastfiles.[Ch]: rewritten to use deque to store the
8276 lastfiles in. Uses fstream for reading and writing. Simplifies
8279 * src/support/syscall.C: remove explicit cast.
8281 * src/BufferView.C (CursorToggleCB): removed code snippets that
8283 use explicat C++ style casts instead of C style casts. also use
8284 u_vdata instea of passing pointers in longs.
8286 * src/PaperLayout.C: removed code snippets that were commented out.
8288 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8290 * src/lyx_main.C: removed code snippets that wer commented out.
8292 * src/paragraph.C: removed code snippets that were commented out.
8294 * src/lyxvc.C (logClose): use static_cast
8296 (viewLog): remove explicit cast to void*
8297 (showLog): removed old commented code
8299 * src/menus.C: use static_cast instead of C style casts. use
8300 u_vdata instead of u_ldata. remove explicit cast to (long) for
8301 pointers. Removed old code that was commented out.
8303 * src/insets/inset.C: removed old commented func
8305 * src/insets/insetref.C (InsetRef): removed old code that had been
8306 commented out for a long time.
8308 (escape): removed C style cast
8310 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8312 * src/insets/insetlatex.C (Draw): removed old commented code
8313 (Read): rewritten to use string
8315 * src/insets/insetlabel.C (escape): removed C style cast
8317 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8319 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8322 * src/insets/insetinclude.h: removed a couple of stupid bools
8324 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8325 (Clone): remove C style cast
8326 (getKeys): changed list to lst because of std::list
8328 * src/insets/inseterror.C (Draw): removed som old commented code.
8330 * src/insets/insetcommand.C (Draw): removed some old commented code.
8332 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8333 commented out forever.
8334 (bibitem_cb): use static_cast instead of C style cast
8335 use of vdata changed to u_vdata.
8337 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8339 (CloseUrlCB): use static_cast instead of C style cast.
8340 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8342 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8343 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8344 (CloseInfoCB): static_cast from ob->u_vdata instead.
8345 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8348 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8349 (C_InsetError_CloseErrorCB): forward the ob parameter
8350 (CloseErrorCB): static_cast from ob->u_vdata instead.
8352 * src/vspace.h: include LString.h since we use string in this class.
8354 * src/vspace.C (lyx_advance): changed name from advance because of
8355 nameclash with stl. And since we cannot use namespaces yet...I
8356 used a lyx_ prefix instead. Expect this to change when we begin
8359 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8361 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8362 and removed now defunct constructor and deconstructor.
8364 * src/BufferView.h: have backstack as a object not as a pointer.
8365 removed initialization from constructor. added include for BackStack
8367 * development/lyx.spec.in (%build): add CFLAGS also.
8369 * src/screen.C (drawFrame): removed another warning.
8371 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8373 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8374 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8375 README and ANNOUNCE a bit for the next release. More work is
8378 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8379 unbreakable if we are in freespacing mode (LyX-Code), but not in
8382 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8384 * src/BackStack.h: fixed initialization order in constructor
8386 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8388 * acinclude.m4 (VERSION): new rules for when a version is
8389 development, added also a variable for prerelease.
8390 (warnings): we set with_warnings=yes for prereleases
8391 (lyx_opt): prereleases compile with same optimization as development
8392 (CXXFLAGS): only use pedantic if we are a development version
8394 * src/BufferView.C (restorePosition): don't do anything if the
8397 * src/BackStack.h: added member empty, use this to test if there
8398 is anything to pop...
8400 1999-10-25 Juergen Vigna <jug@sad.it>
8403 * forms/layout_forms.fd +
8404 * forms/latexoptions.fd +
8405 * lyx.fd: changed for various form resize issues
8407 * src/mathed/math_panel.C +
8408 * src/insets/inseterror.C +
8409 * src/insets/insetinfo.C +
8410 * src/insets/inseturl.C +
8411 * src/insets/inseturl.h +
8414 * src/PaperLayout.C +
8415 * src/ParagraphExtra.C +
8416 * src/TableLayout.C +
8418 * src/layout_forms.C +
8425 * src/menus.C: fixed various resize issues. So now forms can be
8426 resized savely or not be resized at all.
8428 * forms/form_url.fd +
8429 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8432 * src/insets/Makefile.am: added files form_url.[Ch]
8434 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8436 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8437 (and presumably 6.2).
8439 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8440 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8441 remaining static member callbacks.
8443 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8446 * src/support/lyxstring.h: declare struct Srep as friend of
8447 lyxstring, since DEC cxx complains otherwise.
8449 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8451 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8453 * src/LaTeX.C (run): made run_bibtex also depend on files with
8455 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8456 are put into the dependency file.
8458 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8459 the code has shown itself to work
8460 (create_ispell_pipe): removed another warning, added a comment
8463 * src/minibuffer.C (ExecutingCB): removed code that has been
8464 commented out a long time
8466 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8467 out code + a warning.
8469 * src/support/lyxstring.h: comment out the three private
8470 operators, when compiling with string ansi conforming compilers
8473 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8475 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8476 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8479 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8482 * src/mathed/math_panel.C (create_math_panel): remove explicit
8485 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8488 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8489 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8490 to XCreatePixmapFromBitmapData
8491 (fl_set_bmtable_data): change the last argument to be unsigned
8493 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8494 and bh to be unsigned int, remove explicit casts in call to
8495 XReadBitmapFileData.
8497 * images/arrows.xbm: made the arrays unsigned char *
8498 * images/varsz.xbm: ditto
8499 * images/misc.xbm: ditto
8500 * images/greek.xbm: ditto
8501 * images/dots.xbm: ditto
8502 * images/brel.xbm: ditto
8503 * images/bop.xbm: ditto
8505 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8507 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8508 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8509 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8511 (LYX_CXX_CHEADERS): added <clocale> to the test.
8513 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8517 * src/support/lyxstring.C (append): fixed something that must be a
8518 bug, rep->assign was used instead of rep->append.
8520 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8523 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8524 lyx insert double chars. Fix spotted by Kayvan.
8526 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8528 * Fixed the tth support. I messed up with the Emacs patch apply feature
8529 and omitted the changes in lyxrc.C.
8531 1999-10-22 Juergen Vigna <jug@sad.it>
8533 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8535 * src/lyx_cb.C (MenuInsertRef) +
8536 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8537 the form cannot be resized under it limits (fixes a segfault)
8539 * src/lyx.C (create_form_form_ref) +
8540 * forms/lyx.fd: Changed Gravity on name input field so that it is
8543 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8545 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8546 <ostream> and <istream>.
8548 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8549 whether <fstream> provides the latest standard features, or if we
8550 have an oldstyle library (like in egcs).
8551 (LYX_CXX_STL_STRING): fix the test.
8553 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8554 code on MODERN_STL_STREAM.
8556 * src/support/lyxstring.h: use L{I,O}stream.h.
8558 * src/support/L{I,O}stream.h: new files, designed to setup
8559 correctly streams for our use
8560 - includes the right header depending on STL capabilities
8561 - puts std::ostream and std::endl (for LOStream.h) or
8562 std::istream (LIStream.h) in toplevel namespace.
8564 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8567 was a bib file that had been changed we ensure that bibtex is run.
8568 (runBibTeX): enhanced to extract the names of the bib files and
8569 getting their absolute path and enter them into the dep file.
8570 (findtexfile): static func that is used to look for tex-files,
8571 checks for absolute patchs and tries also with kpsewhich.
8572 Alternative ways of finding the correct files are wanted. Will
8574 (do_popen): function that runs a command using popen and returns
8575 the whole output of that command in a string. Should be moved to
8578 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8579 file with extension ext has changed.
8581 * src/insets/figinset.C: added ifdef guards around the fl_free
8582 code that jug commented out. Now it is commented out when
8583 compiling with XForms == 0.89.
8585 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8586 to lyxstring.C, and only keep a forward declaration in
8587 lyxstring.h. Simplifies the header file a bit and should help a
8588 bit on compile time too. Also changes to Srep will not mandate a
8589 recompile of code just using string.
8590 (~lyxstring): definition moved here since it uses srep.
8591 (size): definition moved here since it uses srep.
8593 * src/support/lyxstring.h: removed a couple of "inline" that should
8596 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8598 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8601 1999-10-21 Juergen Vigna <jug@sad.it>
8603 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8604 set to left if I just remove the width entry (or it is empty).
8606 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8607 paragraph when having dummy paragraphs.
8609 1999-10-20 Juergen Vigna <jug@sad.it>
8611 * src/insets/figinset.C: just commented some fl_free_form calls
8612 and added warnings so that this calls should be activated later
8613 again. This avoids for now a segfault, but we have a memory leak!
8615 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8616 'const char * argument' to 'string argument', this should
8617 fix some Asserts() in lyxstring.C.
8619 * src/lyxfunc.h: Removed the function argAsString(const char *)
8620 as it is not used anymore.
8622 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8627 * src/Literate.h: some funcs moved from public to private to make
8628 interface clearer. Unneeded args removed.
8630 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8632 (scanBuildLogFile): ditto
8634 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8635 normal TeX Error. Still room for improvement.
8637 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8639 * src/buffer.C (insertErrors): changes to make the error
8640 desctription show properly.
8642 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8645 * src/support/lyxstring.C (helper): changed to use
8646 sizeof(object->rep->ref).
8647 (operator>>): changed to use a pointer instead.
8649 * src/support/lyxstring.h: changed const reference & to value_type
8650 const & lets see if that helps.
8652 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * Makefile.am (rpmdist): fixed to have non static package and
8657 * src/support/lyxstring.C: removed the compilation guards
8659 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8662 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8663 conditional compile of lyxstring.Ch
8665 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8666 stupid check, but it is a lot better than the bastring hack.
8667 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8669 * several files: changed string::erase into string::clear. Not
8672 * src/chset.C (encodeString): use a char temporary instead
8674 * src/table.C (TexEndOfCell): added tostr around
8675 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8676 (TexEndOfCell): ditto
8677 (TexEndOfCell): ditto
8678 (TexEndOfCell): ditto
8679 (DocBookEndOfCell): ditto
8680 (DocBookEndOfCell): ditto
8681 (DocBookEndOfCell): ditto
8682 (DocBookEndOfCell): ditto
8684 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8686 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8688 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8689 (MenuBuildProg): added tostr around ret
8690 (MenuRunChktex): added tostr around ret
8691 (DocumentApplyCB): added tostr around ret
8693 * src/chset.C (encodeString): added tostr around t->ic
8695 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8696 (makeLaTeXFile): added tostr around tocdepth
8697 (makeLaTeXFile): added tostr around ftcound - 1
8699 * src/insets/insetbib.C (setCounter): added tostr around counter.
8701 * src/support/lyxstring.h: added an operator+=(int) to catch more
8704 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8705 (lyxstring): We DON'T allow NULL pointers.
8707 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8709 * src/mathed/math_macro.C (MathMacroArgument::Write,
8710 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8711 when writing them out.
8713 * src/LString.C: remove, since it is not used anymore.
8715 * src/support/lyxstring.C: condition the content to
8716 USE_INCLUDED_STRING macro.
8718 * src/mathed/math_symbols.C, src/support/lstrings.C,
8719 src/support/lyxstring.C: add `using' directive to specify what
8720 we need in <algorithm>. I do not think that we need to
8721 conditionalize this, but any thought is appreciated.
8723 * many files: change all callback functions to "C" linkage
8724 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8725 strict_ansi. Those who were static are now global.
8726 The case of callbacks which are static class members is
8727 trickier, since we have to make C wrappers around them (see
8728 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8729 did not finish this yet, since it defeats the purpose of
8730 encapsulation, and I am not sure what the best route is.
8732 1999-10-19 Juergen Vigna <jug@sad.it>
8734 * src/support/lyxstring.C (lyxstring): we permit to have a null
8735 pointer as assignment value and just don't assign it.
8737 * src/vspace.C (nextToken): corrected this function substituting
8738 find_first(_not)_of with find_last_of.
8740 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8741 (TableOptCloseCB) (TableSpeCloseCB):
8742 inserted fl_set_focus call for problem with fl_hide_form() in
8745 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8747 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8750 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8752 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8753 LyXLex::next() and not eatline() to get its argument.
8755 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8757 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8758 instead, use fstreams for io of the depfile, removed unneeded
8759 functions and variables.
8761 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8762 vector instead, removed all functions and variables that is not in
8765 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8767 * src/buffer.C (insertErrors): use new interface to TeXError
8769 * Makefile.am (rpmdist): added a rpmdist target
8771 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8772 per Kayvan's instructions.
8774 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8776 * src/Makefile.am: add a definition for localedir, so that locales
8777 are found after installation (Kayvan)
8779 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8781 * development/.cvsignore: new file.
8783 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8785 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8786 C++ compiler provides wrappers for C headers and use our alternate
8789 * configure.in: use LYX_CXX_CHEADERS.
8791 * src/cheader/: new directory, populated with cname headers from
8792 libstdc++-2.8.1. They are a bit old, but probably good enough for
8793 what we want (support compilers who lack them).
8795 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8796 from includes. It turns out is was stupid.
8798 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8800 * lib/Makefile.am (install-data-local): forgot a ';'
8801 (install-data-local): forgot a '\'
8802 (libinstalldirs): needed after all. reintroduced.
8804 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8806 * configure.in (AC_OUTPUT): added lyx.spec
8808 * development/lyx.spec: removed file
8810 * development/lyx.spec.in: new file
8812 * po/*.po: merged with lyx.pot becuase of make distcheck
8814 * lib/Makefile.am (dist-hook): added dist-hook so that
8815 documentation files will be included when doing a make
8816 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8817 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8819 more: tried to make install do the right thing, exclude CVS dirs
8822 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8823 Path would fit in more nicely.
8825 * all files that used to use pathstack: uses now Path instead.
8826 This change was a lot easier than expected.
8828 * src/support/path.h: new file
8830 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8832 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8834 * src/support/lyxstring.C (getline): Default arg was given for
8837 * Configure.cmd: removed file
8839 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8841 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8842 streams classes and types, add the proper 'using' statements when
8843 MODERN_STL is defined.
8845 * src/debug.h: move the << operator definition after the inclusion
8848 * src/support/filetools.C: include "LAssert.h", which is needed
8851 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8854 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8855 include "debug.h" to define a proper ostream.
8857 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8859 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8860 method to the SystemCall class which can kill a process, but it's
8861 not fully implemented yet.
8863 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8865 * src/support/FileInfo.h: Better documentation
8867 * src/lyxfunc.C: Added support for buffer-export html
8869 * src/menus.C: Added Export->As HTML...
8871 * lib/bind/*.bind: Added short-cut for buffer-export html
8873 * src/lyxrc.*: Added support for new \tth_command
8875 * lib/lyxrc.example: Added stuff for new \tth_command
8877 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8879 * lib/Makefile.am (IMAGES): removed images/README
8880 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8881 installes in correct place. Check permisions is installed
8884 * src/LaTeX.C: some no-op changes moved declaration of some
8887 * src/LaTeX.h (LATEX_H): changed include guard name
8889 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8891 * lib/reLyX/Makefile.am: install noweb2lyx.
8893 * lib/Makefile.am: install configure.
8895 * lib/reLyX/configure.in: declare a config aux dir; set package
8896 name to lyx (not sure what the best solution is); generate noweb2lyx.
8898 * lib/layouts/egs.layout: fix the bibliography layout.
8900 1999-10-08 Jürgen Vigna <jug@sad.it>
8902 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8903 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8904 it returned without continuing to search the path.
8906 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8909 also fixes a bug. It is not allowed to do tricks with std::strings
8910 like: string a("hei"); &a[e]; this will not give what you
8911 think... Any reason for the complexity in this func?
8913 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8915 * Updated README and INSTALL a bit, mostly to check that my
8916 CVS rights are correctly set up.
8918 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8921 does not allow '\0' chars but lyxstring and std::string does.
8923 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8925 * autogen.sh (AUTOCONF): let the autogen script create the
8926 POTFILES.in file too. POTFILES.in should perhaps now not be
8927 included in the cvs module.
8929 * some more files changed to use C++ includes instead of C ones.
8931 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8933 (Reread): added tostr to nlink. buggy output otherwise.
8934 (Reread): added a string() around szMode when assigning to Buffer,
8935 without this I got a log of garbled info strings.
8937 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8940 * I have added several ostream & operator<<(ostream &, some_type)
8941 functions. This has been done to avoid casting and warnings when
8942 outputting enums to lyxerr. This as thus eliminated a lot of
8943 explicit casts and has made the code clearer. Among the enums
8944 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8945 mathed enums, some font enum the Debug::type enum.
8947 * src/support/lyxstring.h (clear): missing method. equivalent of
8950 * all files that contained "stderr": rewrote constructs that used
8951 stderr to use lyxerr instead. (except bmtable)
8953 * src/support/DebugStream.h (level): and the passed t with
8954 Debug::ANY to avoid spurious bits set.
8956 * src/debug.h (Debug::type value): made it accept strings of the
8959 * configure.in (Check for programs): Added a check for kpsewhich,
8960 the latex generation will use this later to better the dicovery of
8963 * src/BufferView.C (create_view): we don't need to cast this to
8964 (void*) that is done automatically.
8965 (WorkAreaButtonPress): removed some dead code.
8967 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8969 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8970 is not overwritten when translated (David Sua'rez de Lis).
8972 * lib/CREDITS: Added David Sua'rez de Lis
8974 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8976 * src/bufferparams.C (BufferParams): default input encoding is now
8979 * acinclude.m4 (cross_compiling): comment out macro
8980 LYX_GXX_STRENGTH_REDUCE.
8982 * acconfig.h: make sure that const is not defined (to empty) when
8983 we are compiling C++. Remove commented out code using SIZEOF_xx
8986 * configure.in : move the test for const and inline as late as
8987 possible so that these C tests do not interefere with C++ ones.
8988 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8989 has not been proven.
8991 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8993 * src/table.C (getDocBookAlign): remove bad default value for
8996 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8998 (ShowFileMenu2): ditto.
9000 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9003 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9005 * Most files: finished the change from the old error code to use
9006 DebugStream for all lyxerr debugging. Only minor changes remain
9007 (e.g. the setting of debug levels using strings instead of number)
9009 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9011 * src/layout.C (Add): Changed to use compare_no_case instead of
9014 * src/FontInfo.C: changed loop variable type too string::size_type.
9016 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9018 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9019 set ETAGS_ARGS to --c++
9021 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9023 * src/table.C (DocBookEndOfCell): commented out two unused variables
9025 * src/paragraph.C: commented out four unused variables.
9027 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9028 insed a if clause with type string::size_type.
9030 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9033 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9035 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9036 variable, also changed loop to go from 0 to lenght + 1, instead of
9037 -1 to length. This should be correct.
9039 * src/LaTeX.C (scanError): use string::size_type as loop variable
9042 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9043 (l.896) since y_tmp and row was not used anyway.
9045 * src/insets/insetref.C (escape): use string::size_type as loop
9048 * src/insets/insetquotes.C (Width): use string::size_type as loop
9050 (Draw): use string::size_type as loop variable type.
9052 * src/insets/insetlatexaccent.C (checkContents): use
9053 string::size_type as loop variable type.
9055 * src/insets/insetlabel.C (escape): use string::size_type as loop
9058 * src/insets/insetinfo.C: added an extern for current_view.
9060 * src/insets/insetcommand.C (scanCommand): use string::size_type
9061 as loop variable type.
9063 * most files: removed the RCS tags. With them we had to recompile
9064 a lot of files after a simple cvs commit. Also we have never used
9065 them for anything meaningful.
9067 * most files: tags-query-replace NULL 0. As adviced several plases
9068 we now use "0" instead of "NULL" in our code.
9070 * src/support/filetools.C (SpaceLess): use string::size_type as
9073 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9075 * src/paragraph.C: fixed up some more string stuff.
9077 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9079 * src/support/filetools.h: make modestr a std::string.
9081 * src/filetools.C (GetEnv): made ch really const.
9083 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9084 made code that used these use max/min from <algorithm> instead.
9086 * changed several c library include files to their equivalent c++
9087 library include files. All is not changed yet.
9089 * created a support subdir in src, put lyxstring and lstrings
9090 there + the extra files atexit, fileblock, strerror. Created
9091 Makefile.am. edited configure.in and src/Makefile.am to use this
9092 new subdir. More files moved to support.
9094 * imported som of the functions from repository lyx, filetools
9096 * ran tags-query-replace on LString -> string, corrected the bogus
9097 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9098 is still some errors in there. This is errors where too much or
9099 too litle get deleted from strings (string::erase, string::substr,
9100 string::replace), there can also be some off by one errors, or
9101 just plain wrong use of functions from lstrings. Viewing of quotes
9104 * LyX is now running fairly well with string, but there are
9105 certainly some bugs yet (see above) also string is quite different
9106 from LString among others in that it does not allow null pointers
9107 passed in and will abort if it gets any.
9109 * Added the revtex4 files I forgot when setting up the repository.
9111 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9113 * All over: Tried to clean everything up so that only the files
9114 that we really need are included in the cvs repository.
9115 * Switched to use automake.
9116 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9117 * Install has not been checked.
9119 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9121 * po/pt.po: Three errors:
9122 l.533 and l.538 format specification error
9123 l. 402 duplicate entry, I just deleted it.