1 2001-01-02 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
5 * src/tabular.C (TeXTopHLine):
6 (TeXBottomHLine): fixed Lars new code.
8 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
10 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
11 from this function and added a BufferView * parameter.
13 * src/mathed/math_symbols.C (math_insert_symbol): ditto
15 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
17 * src/version.h: set to pre3
19 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
21 * src/Makefile.am (lyx_SOURCES): added Floating.C
23 * src/Floating.h: moved all the inlines to Floating.C
25 * src/Floating.C: new file
27 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
29 * src/frontends/xforms/FormPreferences.C (feedback): fix
30 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
32 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
34 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
37 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
39 * src/mathed/math_inset.h: move LString.h to be included first
41 * src/insets/insetfloat.C: adjust for change in private variable names
43 * src/frontends/xforms/xform_helpers.h : don't include config.h
45 * src/frontends/xforms/xform_helpers.C: adjust the order of
46 includes, some whitespace changes.
48 * src/trans.C (Load): constify filename and res
50 * src/text2.C (SetCounter): call Floating::name()
52 * src/screen.C: change to not use owner from WorkArea, but from
55 * src/lyxfunc.C: adjust because of changes in Intl.
57 * src/intl.h: make trans a object instead of pointer, inlucd
58 trans_mgr.h in this file.
59 (getTrans): return a reference to TransManager
61 * src/intl.C: don't include trans_mgr.h here
62 modify calls to trans to work on object instead of on pointer
64 * src/WorkArea.h: add using for Signal1
65 comment out forward decl of BufferView.
67 remove class variable owner_ and getter method for this.
69 * src/WorkArea.C: don't include BufferView.h
70 (WorkArea): change to not take a BufferView.h, use signals
72 (scroll_cb): emit signal
74 * src/LaTeXFeatures.C: include Floatlist.h
75 (getPackages): only load float.sty when needed
76 (getMacros): prepare for outputting the correct code to preamble.
78 * src/Floating.h: make all variables private + rename to var_.
79 (Floating): default ctor
80 (Floating): complex ctor to set a complete Floating
86 * src/FloatList.C (FloatList): use Floating's constructor
89 (newFloat): call type()
90 (defaultPlacement): call placement()
91 (operator): new operator
93 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
94 (scrollUp): call pimpl's scrollCB
96 (pasteClipboard): constify clip
98 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
99 (insertErrors): constify desctext, errortext, msgtxt and errorrow
100 (open_new_inset): delete some commented code.
102 * src/BufferView.[Ch] (enterView): comment out
105 (workAreaMotionNotify): ditto
106 (workAreaButtonPress): ditto
109 (workAreaButtonRelease): ditto
110 (workAreaExpose): ditto
112 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
113 to compile with cvs gcc (2.97).
115 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
117 * lib/ui/default.ui: menu structure cleanup.
119 * lib/languages: add description of entries.
121 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
123 * src/insets/ExternalTemplate.C (readTemplates): change debug
125 (readTemplate): use lyxlex.printError to report read errors.
128 * src/insets/insetexternal.C (Read): suppress debug message when
131 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
133 * src/insets/insetinclude.C (Ascii): New method. Currently
134 supports only verbatim input.
136 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
138 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
140 2000-12-22 Juergen Vigna <jug@sad.it>
142 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
143 have a selection and button == 3.
144 (UpdateLocal): if what == INIT clear selection if existent!
145 (InsetButtonPress): don't activate the cell inset on button==3
147 (LocalDispatch): move curor up/down if exiting an inset which this
150 2000-12-20 Juergen Vigna <jug@sad.it>
152 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
153 calling for the math-panel (do not unlock the math-inset if locked)!
155 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
156 text-insets (with x-offset).
158 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
159 alignment of multicolumn-cells.
161 2000-12-19 Juergen Vigna <jug@sad.it>
163 * src/lyxfunc.C (Dispatch):
164 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
167 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
169 * src/WorkArea.C (work_area_handler): simplify the key/keysym
170 handling for XForms 0.89, this might have rendered some cases
171 unusable. I have at least deadkeys, accent-xxx and KP_x working.
172 Please report proplems.
174 * src/lyxfunc.C (processKeySym): make the self-insert handling
177 2000-12-18 Baruch Even <baruch.even@writeme.com>
179 * src/LaTeX.C (deplog): fix spelling errors
180 * src/text2.C (CutSelection): ditto
181 * src/lyxfunc.C (Dispatch): ditto
183 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
185 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
187 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
188 and h_align in default init.
189 adjust calls to MathedRowSt
191 * src/mathed/math_iter.C: adjust calls to MathedRowSt
192 * src/mathed/math_iter.h (getAD): ditto
194 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
195 methods setBaseline, ascent, descent
196 (class MathMatrixInset): remove method GetAlign, change h_align
199 * src/lyxfunc.C (processKeySym): discover the correct argument if
200 the action is LFUN_SELFINSERT
202 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
204 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
207 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
209 * src/support/copy.C: don't include filetools.h
211 * lib/images: revert to old banner, drop the cucumber.
213 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
215 * src/converter.C (Formats::View): Change the current directory to
216 the directory of the file.
218 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
220 * src/kbsequence.C (addkey): also clear sequence and modifiers if
223 * src/BufferView2.C (theLockingInset): return 0 if text is 0
225 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
227 * Many files: Fix RTL support for insettext.
229 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
231 * README: add mention of broken ghostscript versions, remove
232 reference to non-existent BUGS file
234 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
236 * src/support/lstrings.C (compare_no_case): small fix. When passed
237 length, should use it in the size comparison.
239 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
241 * src/insets/insetexternal.C (getScreenLabel): Return a default
242 value if the template label is empty.
244 * src/lyxlookup.C: do not condition on FL_REVISION.
247 * src/sp_form.C: fix the font size of some text entries
249 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
250 after TOC when there is no TOC.
252 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
253 bind file if it has not been done yet.
254 (read): remove local bindFile variable. Try to fix the handling of
255 RC_BIND and RC_BINDFILE.
257 * src/lyx_main.C (init): use readBindFileIfNeeded().
259 * lib/languages: Change description of german to "German (new
262 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
264 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
265 "Apply" buttons if arg is non-zero.
267 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
268 launching the popup if sufficient info is passed to
269 LFUN_CITATION_CREATE.
271 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
273 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
274 labels (disabled in 1.1.6).
276 * src/lyxrc.[Ch]: New variable label_init_length
278 * mathed/formula.C (LocalDispatch): Preserve the label when
279 changing from display math to eqnarray (however, the label
280 do not appear at the first line, as one might expects, but at the
282 (LocalDispatch): When inserting a label to a formula which already
283 have a label, the old label is used as default value.
284 Also, if the label is changed, then all references to the label
287 * src/mathed/math_iter.C (setLabel): Allow to set the label
288 even if it is empty. This is needed to allow deletion of a label
291 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
292 refernces only if the old label appears once in the document.
294 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
296 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
297 <gehlert@Rcs1.urz.tu-dresden.de>
299 * src/frontends/xforms/FormBase.C: comment out debug.h
301 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
302 code in xform_helpers instead.
303 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
305 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
306 Use N_(), rather than _() when creating strings to pass to browseFile()
307 because browseFile calls gettext() itself now.
309 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
310 display the filename correctly.
312 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
314 * src/converter.C (Move): New method. Used to move file or files
315 from temp dir to the output dir. (this fixes the bug that
316 exporting linuxdoc/docbook document to html would not move all
317 html file from temp directory).
319 * src/support/filetools.C (DirList): Fixed.
321 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
323 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
325 * src/converter.C (Add): Remove $$i when setting latex_command.
327 * src/text.C (IsBoundary): Return false when pos = 0.
329 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
331 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
333 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
335 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
336 need to empty the fields to turn off use of the geometry package!
338 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
340 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
341 (Buffer const &), not a (BufferParams const &) and so fix a crash
342 caused by using current_view before it had been initialised. Not
343 the best way to do this, but much easier than changing
344 Inset::Clone(Buffer const &) to Inset::Clone().
347 * src/tabular.C: changed call to CopyIntoMinibuffer().
349 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
351 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
353 * src/lyxfunc.C (getStatus): disable insertion of floats in a
356 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
358 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
359 changed filter for screen fonts input filter from int to float
361 * src/frontends/xforms/input_validators.c: removed.
362 * src/frontends/xforms/input_validators.C: new file. Can now call C++
363 functions from within the filter functions.
365 * src/frontends/xforms/input_validators.[Ch]
366 (fl_unsigned_float_filter): new filter function.
368 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
369 confused now! And if you think I'm going to do this in
370 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
372 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
374 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
376 * src/WorkArea.C (work_area_handler): don't handle button requests
377 if xbutton.button == 0
379 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
381 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
382 It creates a lot of interesting problems.
384 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
386 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
387 the menu exists in the current menubar before opening it.
389 * src/MenuBackend.C (hasSubmenu): new method.
391 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
392 action value by offsetting actions by a large constant (so that
393 bogs choice result will be less than this constant).
395 * lib/bind/fi_menus.bind: more cleanup to menus.
396 * lib/bind/sciword.bind: ditto.
397 * lib/bind/xemacs.bind: ditto.
398 * lib/bind/emacs.bind: ditto.
399 * lib/bind/pt_menus.bind: ditto.
400 * lib/bind/hu_menus.bind: ditto.
402 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
404 * INSTALL: update PROBLEMS section.
406 * src/lyxlookup.h: remove condition on xforms version, since we
407 should not include it if not appropriate.
409 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
411 * src/LColor.C: "latex text" -> "latex inset" (from
414 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
416 * src/frontends/kde/FormTabularCreate.C:
417 * src/frontends/kde/citationdlg.C:
418 * src/frontends/kde/copyrightdlg.C:
419 * src/frontends/kde/paradlg.C:
420 * src/frontends/kde/paraextradlg.C:
421 * src/frontends/kde/parageneraldlg.C:
422 * src/frontends/kde/printdlg.C:
423 * src/frontends/kde/refdlg.C:
424 * src/frontends/kde/tabcreatedlg.C:
425 * src/frontends/kde/tocdlg.C:
426 * src/frontends/kde/urldlg.C: add necessary headers
429 * src/frontends/kde/dlg/emptytable.C:
430 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
431 default parameters (from Angus Leeming)
433 * src/frontends/kde/dlg/moc/.cvsignore:
434 * src/frontends/kde/dlg/.cvsignore:
435 * src/frontends/kde/moc/.cvsignore: fix the library name
438 * src/frontends/kde/paradlg.C:
439 * src/frontends/kde/parageneraldlg.C:
440 * src/frontends/kde/dlg/para.dlg:
441 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
443 * src/frontends/kde/dlg/README: clarified qtarch version
445 * src/frontends/kde/dlg/Makefile.am: removed the
446 dlg rules as they created spontaneous rebuilds
447 (not a good idea as it requires qtarch)
449 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
451 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
452 fixlevel along with xforms version.
454 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
455 xforms version is strictly less than 0.89.5.
456 * src/lyx_gui.C (LyXGUI): ditto.
457 * src/LyXView.C (show): ditto.
459 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
461 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
462 movement in inset in RTL text.
463 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
464 (workAreaButtonRelease): Do not open a float when there is a selection.
466 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
468 * src/spellchecker.C (RunSpellChecker): Open all floats before
471 * src/text.C (InsertChar): Consider "," as a part of a number
472 (for LTR numbers in RTL text code).
473 (IsBoundary): Fixed (and simplified).
474 (InsertChar): Recalculate cursor boundary.
477 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
479 * src/spellchecker.C: fix figures with pspell enabled
481 * src/insets/figinset.C: workaround for gs hang xforms bug
483 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
485 * lib/bind/??_menus.bind: comment out the entries corresponding to
486 real menus. They should be eventually removed, but I'll let the
487 language maintainers do that.
489 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
491 * src/frontends/kde/parageneraldlg.C:
492 * src/frontends/kde/parageneraldlg.h: don't use
493 a derived class for SpaceAbove/Below
495 * src/frontends/kde/dlg/README: add some info
497 * src/frontends/kde/dlg/*: update data files, update
500 * src/frontends/kde/dlg/moc/Makefile.am: add
503 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
505 * configure.in: add new KDE Makefiles
506 * src/vspace.h: return GlueLength not a normal one
507 * src/support/lstrings.h:
508 * src/support/lstrings.C: add isStrUnsignedInt(),
511 * src/frontends/kde/*: big reorganisation, update
512 FormParagraph, add FormTabCreate
514 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
516 * lib/ui/default.ui: small grammatical change.
518 * src/frontends/xforms/xform_macros.h: removed.
520 * src/frontends/xforms/FormBase.C:
521 * src/frontends/xforms/FormPreferences.C:
522 * src/frontends/xforms/Makefile.am: changes associated with removing
523 xform_macros.h. Should make Lars' debugging a little easier.
525 * src/frontends/xforms/FormPreferences.C:
526 * src/frontends/xforms/FormPreferences.h:
527 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
528 longer use X11 color name database. HSV and RGB dials/sliders.
529 Please let this be the end of this!
531 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
533 * Several files: Allow compilation when the compiler doesn't
536 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
539 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
540 command line options.
542 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
544 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
545 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
548 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
550 * src/frontends/xforms/FormRef.C (updateBrowser):
551 * src/frontends/xforms/forms/form_ref.fd: try clicking on
552 different insets with the sort key active. Now apply this patch!
554 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
556 * src/frontends/xforms/FormPrint.C: set to valid()
557 when we update from the passed parameters.
559 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
561 * src/LColor.C (getFromGUIName): internationalise the comparison.
563 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
564 FormPreferences choice.
566 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
569 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
571 * src/lyxrc.C: more detail for the printer program config
574 * src/LColor.C: ert->latex text. LColor needs a big revamp
575 but will have to wait till after 1.1.6
577 * src/buffer.C: bring up a dialog if we load a document
578 with an un-installed text class, rather than just complain
581 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
583 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
584 the browser form for a combox in a tabbed folder. Bug fix courtesy of
585 Steve Lamont <spl@ncmir.ucsd.edu>.
587 * src/frontends/xforms/FormDocument.C (build):
588 * src/frontends/xforms/FormPreferences.C (Language::build):
589 pass tabfolders to Combox::add() in order to use this work around.
591 * src/frontends/xforms/FormCitation.C (connect): remove max size
593 (update): sort list of bibliography keys.
595 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
597 No max size limitation. Same popup for new and existing insets. Fixes
598 bugs reported by Rob Lahaye.
600 * src/frontends/xforms/FormCitation.C (c-tor):
601 * src/frontends/xforms/FormCopyright.C (c-tor):
602 * src/frontends/xforms/FormError.C (c-tor):
603 * src/frontends/xforms/FormGraphics.C (c-tor):
604 * src/frontends/xforms/FormIndex.C (c-tor):
605 * src/frontends/xforms/FormRef.C (c-tor):
606 * src/frontends/xforms/FormToc.C (c-tor):
607 * src/frontends/xforms/FormUrl.C (c-tor):
608 use correct policy for ButtonController.
610 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
612 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
615 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
617 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
618 Some resizing changes.
620 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
622 * configure.in: fix typo
624 * lib/languages: add ukraninian and change no to no_NO
626 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
628 * src/bufferview_funcs.C (FontSize): use setLyXSize
630 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
632 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
633 to check for systems where mkstemp() is available but not declared
634 in headers. The new autoconf macro lyx_CHECK_DECL can be used
635 to check for declarations in headers.
637 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
639 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
641 * forms/makefile: added bibforms.fd, include_form.fd.
642 Removed lyx_sendfax.fd.
644 * src/LaTeXLog.C (ShowLatexLog):
645 * src/LyXAction.C (init):
646 * src/bufferparams.C (readLanguage): altered messages as suggested by
649 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
652 * src/credits.C: made fd_form_credits non-static, so that it can be
653 redrawn should the xforms colors be re-mapped.
654 * src/spellchecker.C ditto fd_form_spell_options.
656 * src/filedlg.[Ch] (redraw):
657 * src/intl.[Ch] (redraw):
658 * src/lyxfr0.[Ch] (redraw):
659 * src/insets/figinset.[Ch] (redraw):
660 * src/insets/insetexternal.[Ch] (redraw):
661 new methods, connected to Dialogs::redrawGUI.
663 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
664 to be connected to Dialogs::redrawGUI.
666 * src/frontends/xforms/FormCitation.C (build):
667 * src/frontends/xforms/FormCopyright.C (build):
668 * src/frontends/xforms/FormError.C (build):
669 * src/frontends/xforms/FormGraphics.C (build):
670 * src/frontends/xforms/FormIndex.C (build):
671 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
672 * src/frontends/xforms/FormToc.C (build):
673 * src/frontends/xforms/FormUrl.C (build):
674 use the ButtonController correctly.
676 * src/frontends/xforms/FormCopyright.C (build):
677 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
678 the .fd file and into build().
680 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
682 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
684 * src/frontends/xforms/forms/form_citation.fd:
685 * src/frontends/xforms/forms/form_copyright.fd:
686 * src/frontends/xforms/forms/form_error.fd:
687 * src/frontends/xforms/forms/form_graphics.fd:
688 * src/frontends/xforms/forms/form_index.fd:
689 * src/frontends/xforms/forms/form_toc.fd:
690 * src/frontends/xforms/forms/form_url.fd:
691 renamed some of the objects. Named others explicitly for the first time.
692 Added Restore and Apply buttons where appropriate.
694 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
697 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
699 * src/version.h: try the pre2 again
701 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
703 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
705 * src/frontends/kde/FormParagraph.C: added using directive.
707 * src/frontends/kde/paradlg.C: added config.h and using directive.
709 * src/frontends/kde/paradlg.h: added std::qualifier.
711 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
713 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
715 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
717 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
719 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
721 * src/version.h: set back to 1.1.6cvs
723 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
725 * src/version.h: set to 1.1.6pre2
727 2000-11-20 Marko Vendelin <markov@ioc.ee>
729 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
731 * src/frontends/gnome/Makefile.am: updated list of XForms object files
733 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
735 * src/LColor.C (init):
736 * src/lyxrc.C (getDescription): changed some comments as suggested by
739 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
740 disconnect the redrawGUI signal in best-practice fashion.
742 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
743 long_opts_tab to reflect the change in name of this tabfolder, as
744 suggested by John Levon.
745 (connect, disconnect): new methods. Don't do much at present other than
746 ensuring that we can't resize the dialog. This just makes xforms go
748 (lots of methods in Colors): made void rather than bool. The idea is
749 to have an isOk() function that keeps track of whether any input is
750 genuinely invalid and should therefore block Save, Apply.
751 Easier to manipulate the counters rapidly.
752 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
753 compiler will like this code. Much cleaner way of doing things.
755 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
757 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
758 rather than simple counters, following suggestion by John Levon.
760 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
761 than engraved frame + text.
763 * src/frontends/xforms/forms/makefile: removed spurious command.
765 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
767 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
769 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
772 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
774 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
775 see what Lars has changed and what is just white space!
776 Now used X directly to ascertain the RGB color associated with the
778 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
780 Added some sort capability.
781 The X11 color name database input is only displayed if the database
782 isn't found in the standard place.
783 Got rid of struct compare_converter; it wasn't used.
784 Probably some other stuff that I've forgotten.
786 * src/frontends/xforms/FormPreferences.h: changed the names of some
787 methods in the Colors struct. Added a couple of structs to help sort
788 colors by name and by RGBColor.
790 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
791 functions into a new class RWInfo.
793 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
794 The dialog is now almost navigable using the keyboard. Unfortunately,
795 the cursor has to be inside a browser for it to be activated. There is
796 no visual feedback for the key shortcuts to the arrow keys (use
797 Alt-appropriate arrow key, Alt-x).
799 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
802 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
803 xform_helpers.[Ch]. See above.
805 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
807 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
809 * src/screen.C (setCursorColor): new method. Sets the color of the
811 (ShowManualCursor): call it.
812 Constify some local variables.
814 * src/LColor.[Ch] (LColor): add entry for cursor
815 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
818 2000-11-19 Juergen Vigna <jug@sad.it>
820 * src/insets/insettabular.C (draw): fixed text border redraw problem.
821 (calculate_dimensions_of_cells): try to boost up when inserting chars.
823 2000-11-15 Rob Lahaye <lahaye@postech.edu>
825 * lib/ui/default.ui: OptItem used for Fax entry
827 2000-11-17 Matej Cepl <cepl@bigfoot.com>
829 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
831 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
833 * src/vspace.C (nextToken): fix so it can handle length phrases like
834 "10mm+-20mm", "40inplus16mmminus10cm" etc.
836 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
838 * src/frontends/xforms/FormPreferences.C: constify several variables
839 (BrowserLyX): rewrite to not need the choice variable
840 (Modify): rewrite to not need the choide variable
841 (compare_converter): make operator const
843 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
844 correct the writing of \set_color
845 (getDescription): return a const string
847 * src/kbsequence.[Ch] (addkey): remove dead code
849 * src/Painter.C (text): remove some commented code
851 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
853 * src/ColorHandler.[Ch]: removed some header files from .h file.
854 Included LColor.h in .C file.
856 * src/LColor.[Ch]: made class copyable so that I could create a
857 system_lcolor instance.
859 * src/Painter.h: removed LColor.h.
861 * src/lyx_gui.C (create_forms): used AddName.
863 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
864 of user preferences/lyxrc file.
866 * src/lyxrc.C (output): output changes to lcolor.
868 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
870 Moved class xformColor to files xform_helpers.[Ch]. These files,
871 Color.[Ch], could now be moved into src if they would be useful to
874 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
875 Also moved FormPreferences::browseFile here as it can be used by any
876 xform dialog with a "Browse" button. FormGraphics is a perfect example.
878 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
879 ReadableFile): changed the FormPreferences methods a little and moved
880 them here as they'll be useful elsewhere also.
882 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
883 Removed some header files and used forward declarations instead.
885 Removed some methods as they'll be useful elsewhere (see above).
887 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
888 Can also now modify the LyX LColors. However, for reasons that I don't
889 yet understand, it appears that we can use
890 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
891 present. The problem appears to lie in ColorHandler, because I can
892 change the color using LColor.SetColor(). Similarly, when reading in a
893 preferences file with some set_color instances, I'll get a warning
894 like: Color sea green is undefined or may not be redefined
895 Bad lyxrc set_color for sea green
897 Once the buffer is loaded, however, I can happily change to this color.
899 Finally, it appears that I have to set the color of "inset frame"
900 explicitly, or it oscillates from "black" to "indian red" with each
903 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
905 * ANNOUNCE: corrected a spelling mistake.
907 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
910 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
912 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
914 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
917 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
918 match the requirements from the standard better. This is required
919 to work with gnu libstdc++-v3
921 * src/frontends/xforms/FormPreferences.C: add explict pair
922 arguments to browse calls. include support/lyxmanip.h remvoe
923 extern fmt. whitespace changes. reorder variables in
924 FormPreferences.h, to match initalizaton order.
926 * several files: constify more local variables.
928 * src/buffer.C: remove some commented functions.
930 * src/DepTable.C (remove_files_with_extension): temporary
931 work around for gcc 2.97
932 * src/filedlg.C (find): ditto
933 * src/Variables.C (set): ditto
934 * src/LyXAction.C (searchActionArg): ditto
935 (retrieveActionArg): ditto
937 * configure.in: check for mktemp too
939 * UPGRADING: prepare for 1.1.6
941 * Makefile.am (lgbtags): add backup tags for when etags are
942 different than usual.
944 * ANNOUNCE: prepare for 1.1.6
946 * src/support/tempname.C (make_tempfile): new function, wrapper
947 around mkstemp and mktemp. Only mkstemp has been tested.
950 2000-11-14 Rob Lahaye <lahaye@postech.edu>
952 * default.ui: capitalized some menu items to improve shortcuts.
954 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
956 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
958 * src/frontends/xforms/Dialogs.C: add "using" directive.
960 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
962 * src/filedlg.C (Select): highlight suggested file in browser, if
965 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
966 each tab folder is encapsulated in its own class.
967 The Language keymaps are now chosen using a text input and a
968 browser button, rather than a Combox.
969 All the browser buttons are now functional, although LyXFileDlg
970 still needs to be modified to make it straighhtforward to return a
971 directory if that is what is desired.
973 * src/frontends/xforms/forms/form_preferences.fd: use text input
974 and browse button to input the Language keymaps. Add a few
975 callbacks for the browse buttons.
977 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
979 * src/support/tempname.C (tempName): small changes to make it
980 safer. remove the '.' before XXXXXX
982 * src/support/filetools.C (TmpFileName): remove func
985 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
986 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
987 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
988 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
990 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
993 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
996 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
997 for bp (this fixes a reproducible hard crash)
999 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1002 * src/frontends/xforms/FormBase.h: make bp_ private
1003 (FormBaseBI): remove default for bp
1006 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1009 * src/frontends/xforms/Color.C (RGBColor): made several vars
1010 const, changed initialization of j to allow it to be const
1013 * several files: added const to local variables.
1015 * src/lyx_cb.C: removed several function prototypes and moved them
1019 (UpdateLayoutPreamble):
1021 (MenuInsertLabel): add BufferView as arguemnt
1022 (LayoutsCB): make tmp const
1024 * src/layout_forms.h: regenerated
1026 * src/debug.C: add Debug::FILES
1027 (showLevel) (showTags): translate the desc
1029 * src/debug.h: add FILES as debug target
1031 * src/bufferlist.C: use current_view as an interim measure becuase
1032 of added arguments to MenuWrite and MenuWriteAs
1034 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1036 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1038 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1039 libstdc++ is compiled with.
1041 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1043 * lib/layouts/docbook-book.layout
1044 * lib/layouts/docbook.layout
1045 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1046 those paragraphs are expresse as SGML comments <!-- -->.
1048 * src/LaTeXFeatures.h
1049 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1050 parameter, this allows to express all the include files as relative
1051 paths to the master buffer. The verbatim insert works as the other
1054 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1056 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1058 (MakeDocBookFile): top_element is always written. Some clean up, as
1059 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1061 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1062 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1063 a reference is written instead of the name.
1064 (Validate): use the relative path for the filename.
1066 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1069 * src/support/filetools.h
1070 * src/support/filetools.C (IsSGMLFilename): added.
1073 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1075 * development/OS2/quick_fix.patch:
1076 * lib/configure.cmd:
1077 * README.OS2: quick update to the OS/2 port.
1079 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1081 * src/converter.C: add "using" directive.
1083 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1084 (compare_converter): add "int" as return type.
1086 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1089 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1091 * src/lyx_gui.C (create_forms): map the xform colours, should a
1092 mapping exist. Ie, call XformColor::read().
1094 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1095 and struct HSV as HSVColor.
1096 (XformColor::read, XformColor::write) : new methods that
1097 input/output any changes to the cform GUI colors.
1099 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1102 * src/frontends/xforms/FormPreferences.C Lots of little changes
1103 associated with the changed name of the RGB and HSV structs. Can
1104 now save changes to xforms GUI to file. Commented out
1105 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1106 used currently anyway.
1108 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1110 * src/converter.C: A lot of changes:
1111 - It is no longer possible to choose between two or more ways to
1112 export to some format (the new code uses only the shortest path).
1113 However, it is still possible to choose between pdflatex/ps2pdf
1114 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1115 - Added several methods that makes the FormPreferences code simpler.
1116 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1118 * src/exporter.C (Export): lyxrc.use_pdf is set before
1119 makeLaTeXFile is called. This works but not very nice.
1121 * src/frontends/xforms/FormPreferences.C: The formats/converters
1122 tabs are now fully functional.
1124 * src/buffer.C (getTocList): Add numbers to the captions.
1126 * lib/lyxrc.example: Removed fax section
1128 * src/support/rename.C (rename): Delete the old file if lyx::copy
1131 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1133 * lib/ui/default.ui: minor polishing.
1135 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1137 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1140 * lib/Makefile.am (DOCINST): do not install everything in the
1141 documentation directory.
1143 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1145 * src/bufferlist.C (newFile): set the filename to the constructed
1148 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1149 constructed "newfileXX.lyx" name to the dialog
1151 * src/frontends/DialogBase.h: make update() non-abstract so
1152 KDE doesn't need to implement two update methods for every form
1154 * src/frontends/kde/Makefile.am: add missing xforms objects
1157 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1159 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1161 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1162 structs RGB and HSV. May not be the best place for these files.
1163 Perhaps move them into src ?
1165 * src/frontends/xforms/Makefile.am: added new files.
1167 * src/frontends/xforms/forms/form_preferences.fd:
1168 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1169 replaced all instances of "colour" with "color"!
1171 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1174 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1175 tab. Can now alter the colors of the xform's GUI on the fly. With
1176 the aid of a single static Signal (see below), can "Apply" these
1177 changes to all currently open dialogs. (Well, to all of the NEW
1178 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1179 subsequently opened dialogs will, of course, also have the new
1180 color scheme. Cannot yet save (or load) the choices to file, so
1181 they are lost when exiting LyX.
1183 * src/frontends/Dialogs.h:
1184 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1185 Used to trigger a redraw of any dialogs connected to it because,
1186 for example, the GUI colours have been re-mapped.
1188 * src/frontends/xforms/FormBase.[Ch]:
1189 * src/frontends/xforms/FormDocument.[Ch]:
1190 * src/frontends/xforms/FormParagraph.[Ch]:
1191 * src/frontends/xforms/FormPreferences.[Ch]:
1192 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1193 method, to be connected to Dialogs::redrawGUI. Method must be
1194 virtual, because dialogs with tabbed folders need to redraw the
1195 forms of each tab folder.
1197 * src/LyXView.C (d-tor):
1198 * src/frontends/xforms/FormBase.C (d-tor): connected
1199 Dialogs::redrawGUI signal to redraw().
1201 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1202 removed Assert, because it is identical to that in FormBase.
1204 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1206 * lib/ui/default.ui: minor polishing.
1208 2000-11-10 Juergen Vigna <jug@sad.it>
1210 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1211 (deleteLyXText): ditto
1213 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1214 selection on mouse-button-3.
1216 * src/insets/insettabular.h: new function clearSelection(), use this
1217 functions inside insettabular.C.
1219 * src/insets/insettabular.C (TabularFeatures): clear the selection
1220 on remove_row/column.
1222 * src/insets/inset.C (scroll): fixed some scroll stuff.
1224 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1226 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1228 * lib/CREDITS: add Yves Bastide
1230 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1232 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1233 check whether C library functions are in the global namespace.
1235 * configure.in: calls it.
1237 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1238 #ifndef __GLIBCPP__.
1240 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1242 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1243 iterators to prevent crash.
1245 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1247 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1249 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1250 shortcut for xforms CB to the preemptive or post-handler function.
1252 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1253 removed the HIDDEN_TIMER as it's no longer used.
1254 Various other small changes.
1256 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1257 preemptive handler to obtain feedback, rather than the post-handler.
1258 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1260 Formats tab is now complete. Converters tab is nearly so.
1262 2000-11-09 Juergen Vigna <jug@sad.it>
1264 * src/insets/insettext.C (~InsetText):
1267 (SetParagraphData): set cache.second to 0 after deleting it!
1268 (getLyXText): check if cache.second is not 0 if finding it.
1270 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1272 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1273 lyxlex to parse the rgb.txt file.
1276 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1277 replace the default '#' comment character.
1279 * src/support/tempname.C: add "using" directive
1280 * src/frontends/ButtonPolicies.C: ditto.
1282 * src/support/filetools.C (DirList): add an explicit cast to avoid
1283 a compile error (probably not the right fix)
1285 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1287 * src/support/filetools.C (DirList): implement using system functions
1289 * src/support/tempname.C: new file
1291 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1293 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1295 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1298 * src/frontends/xforms/ButtonController.C: new file
1300 * src/os2_defines.h: remove getcwd define
1302 * src/lyxvc.C: include support/lyxlib.h
1303 (showLog): use lyx::tempName
1305 * src/lyx_cb.C: comment out includes that we don't need
1306 (AutoSave): use lyx::tempName
1308 * src/filedlg.C: include support/lyxlib.h
1309 (Reread): use lyx::getcwd
1311 * src/converter.C: include support/filetools.h
1312 (add_options): change to static inline, make tail const
1313 (Add): make old_viewer const
1314 (GetAllFormats): make it a const method, use const_iterator
1315 (enable): make static inline
1316 (SplitFormat): make using_format const
1318 * src/LaTeX.C (run): use lyx::getcwd
1320 * configure.in: check for mkstemp as well
1322 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1324 * src/converter.[Ch] (GetAllCommands): new method.
1326 * src/support/filetools.[Ch] (DirList): new method.
1328 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1329 functionality to the converters tab.
1330 The formats tab is now nearly complete.
1331 The kbmap choices in Languages tab now display the contents of
1332 system_lyxdir/kbd/*.kmap in readable form.
1334 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1335 Moved some variables into the class.
1337 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1338 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1339 colour of active folder to lighter grey instead. Any takers?
1340 (form_colours): added an "Apply" button.
1341 (form_converters): added a "Flags" input field.
1342 (form_formats): added a "Shortcut" input field. Note that we can't use
1343 names such as "input_shortcut" as this buggers up the sed script stuff.
1345 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1353 * src/lyx_sendfax_main.C:
1356 * src/spellchecker.C:
1357 * src/insets/figinset.C:
1358 * src/insets/insetbib.C:
1359 * src/insets/insetexternal.C:
1360 * src/insets/insetinclude.C:
1361 * src/insets/insetinfo.C:
1362 * src/mathed/math_panel.C:
1363 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1364 all "daughter" dialogs now have identical "feel".
1366 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1368 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1369 used (and was only used in one place prior to this patch. Incorrectly!)
1371 * src/frontends/xforms/FormDocument.C: changed some instances of
1372 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1373 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1374 for options_->input_float_placement. This fixes a bug reported by
1377 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1378 functionality into d-tor.
1380 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1381 input of numerals also.
1383 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1384 fl_set_form_atclose(). Can now close dialog from window manager,
1385 fixing a bug reported by Rob Lahaye.
1387 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1389 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1390 are no longer dark. Haven't yet worked out how to lighten the colour of
1391 the active tabfolder. Any ideas anybody?
1392 Adjusted Colours tab a little.
1393 Added Shortcut field to converters tab. Note that we can't create an
1394 fdesign label like "input_shortcut" as this buggers up the sed-script
1397 * src/frontends/xforms/FormPreferences.[Ch]:
1398 (feedback): fixed crash due to to ob=0.
1399 (LanguagesXXX): the kbmap choices now contain the files
1400 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1401 be replaced by an input with a file browse button, but since the browse
1402 buttons don'y yet work, this'll do for the moment.
1403 (FormatsXXX): think that this is now nearly fully functional.
1404 Some points/questions though:
1405 1. Does "Apply" remove formats if no longer present?
1406 2. I think that the browser should list the GUI names rather than the
1408 3. Must ensure that we can't delete Formats used by an existing
1411 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1412 if this is the best way to do this.
1414 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1416 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1418 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1419 for variable assignment.
1421 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1423 * src/lib/ui/default.ui: added sub/superscripts to menu as
1424 Insert->Special characters and cleaned-up the file a bit
1426 2000-11-07 Allan Rae <rae@lyx.org>
1428 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1429 ob isn't 0 before using it. See comments in function.
1431 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1433 * src/frontends/xforms/form_*.C: regenerated
1435 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1437 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1439 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1440 compiling with gcc-2.96
1442 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1444 * src/support/lyxstring.C: add a couple "using" directives.
1446 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1447 a .c_str() here too for good measure.
1448 * src/Spacing.C (set): ditto.
1449 * src/lyxfunc.C (Dispatch): ditto.
1451 * src/insets/insettabular.C (copySelection): change .str() to
1452 .str().c_str() to fix problems with lyxstring.
1453 * src/support/filetools.C (GetFileContents): ditto.
1454 * src/buffer.C (asciiParagraph): ditto.
1455 * src/paragraph.C (String): ditto.
1457 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1458 * lib/bind/sciword.bind: ditto.
1460 * src/LyXAction.C (init): remove "symbol-insert" function, which
1461 shared LFUN_INSERT_MATH with "math-insert".
1463 * lib/configure.m4: == is not a valid operator for command test.
1465 * src/lyxrc.C: add using directive.
1467 * src/converter.h: add std:: qualifier.
1469 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1471 * src/converter.[Ch] and other files: Change the Format class to a
1472 real class, and create two instances: formats and system_format.
1474 * src/lyxrc.C (output): Output the difference between formats and
1477 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1478 (buildFormats): Insert formats into browser.
1479 (inputFormats): Made the browser and add button functional.
1480 (applyFormats): Update formats from format_vec.
1482 * src/converter.C: Changed all (*it). to it->
1483 (Format::dummy): New method.
1484 (Format::importer): New format flag.
1485 (Formats::GetAllFormats): New method.
1486 (Formats::Add): Delete format from the map if prettyname is empty.
1487 (Converter::Convert): Print an error message if moving the file fails.
1488 (Converter::GetReachableTo): New method
1490 * src/MenuBackend.[Ch]: Add support for importformats tag.
1492 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1494 * lib/configure.m4: Add word->tex and ps->fax converters.
1496 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1497 Return fax to file menu.
1501 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1503 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1506 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1509 * src/lyxfunc.C (processKeyEvent): removed
1511 * src/bufferlist.C (emergencyWrite): removed the out commented
1512 emergency write code.
1514 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1516 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1518 * many files: change formatting to be a bit more uniform for
1519 if,while,for,switch statements, remove some parantesis not needed.
1522 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1524 * config/kde.m4: make config more robust when KDEDIR is set
1526 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1528 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1529 not returned a pixmap for "math-insert".
1531 * src/LyXAction.C (init): sort the entries a bit.
1533 2000-11-03 Juergen Vigna <jug@sad.it>
1535 * src/insets/insettabular.h: added fixed number to update codes so
1536 that update is only in one direction.
1538 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1541 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1542 before call to edit because of redraw.
1544 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1546 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1548 * lib/ui/default.ui: Populate "edit_float" menu
1550 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1552 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1553 "floats-operate". The name is ugly (and the func also), but this
1554 is just a band-aid until we switch to new insets.
1556 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1558 * lib/ui/default.ui: update again the menu layout (fix some
1561 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1563 * src/MenuBackend.h (fulllabel): new method.
1565 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1566 the menu shortcuts of a menu are unique and whether they
1567 correspond to a letter of the label.
1568 (expand): call checkShortcuts when debugging.
1570 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1572 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1574 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1576 * lib/examples/*.lyx : '\language default' => '\language english'
1578 * lib/examples/it_splash.lyx : except where it should be italian
1580 * lib/templates/*.lyx : the same
1582 * doc/*.lyx* : the same
1584 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1586 * lib/bind/menus.bind: remove the Layout menu entries, which I
1587 somehow forgot earlier.
1589 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1591 * lib/ui/old-default.ui: keep the old one here for reference (to
1594 * lib/ui/default.ui: update the menu layout
1596 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1598 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1599 Can now Apply to different insets without closing the dialog.
1601 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1602 Can't actually DO anything with them yet, but I'd like a little
1605 * src/frontends/xforms/input_validators.[ch]
1606 (fl_lowercase_filter): new.
1608 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1610 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1611 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1613 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1615 2000-11-02 Juergen Vigna <jug@sad.it>
1617 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1618 on char insertion as it has already be updated by bv->updateInset().
1620 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1621 if an inset inside was updated.
1623 * lib/configure.cmd: commented out fax-search code
1625 2000-11-01 Yves Bastide <stid@acm.org>
1627 * src/tabular.C (OldFormatRead): set tabular language to the
1630 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1632 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1633 class names with non-letter characters (from Yves Bastide).
1635 * lib/ui/default.ui: change Item to OptItem in import menu.
1636 Comment out fax stuff.
1638 * lib/configure.m4: comment out fax-related stuff.
1640 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1642 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1643 useful xforms helper functions. At present contains only formatted().
1644 Input a string and it returns it with line breaks so that in fits
1647 * src/frontends/xforms/Makefile.am: add new files.
1649 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1650 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1653 * src/frontends/xforms/FormPreferences.[Ch]:
1654 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1655 but lots of little clean ups. Removed enum State. Make use of
1656 formatted(). Constify lots of methods. Perhaps best of all: removed
1657 requirement for that horrible reinterpret_cast from pointer to long in
1660 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1662 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1663 conditionalize build on xforms < 0.89
1665 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1667 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1669 * src/LyXAction.C (init): comment out fax
1671 * src/lyxrc.h: comment out the fax enums
1672 comment out the fax variables
1674 * src/commandtags.h: comment out LFUN_FAX
1676 * src/lyxrc.C: disable fax variables.
1677 (read): disable parsing of fax variables
1678 (output): disable writing of fax variables
1679 (getFeedback): now description for fax variables
1681 * src/lyxfunc.C: comment out MenuFax
1682 (Dispatch): disable LFUN_FAX
1684 * src/lyx_cb.C (MenuFax): comment out
1686 * src/WorkArea.C: add <cctype>
1687 (work_area_handler): better key handling, should be ok now.
1688 for accented chars + etc
1690 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1691 lyx_sendfax.h and lyx_sendfax_man.C
1693 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1694 (show): don't call InitLyXLookup when using xforms 0.89
1696 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1698 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1700 * src/support/filetools.C (GetFileContents): close to dummy change
1702 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1704 * src/trans.C (AddDeadkey): workaround stupid compilers.
1706 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1708 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1709 of two-sided document.
1711 2000-10-31 Juergen Vigna <jug@sad.it>
1713 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1715 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1716 xposition to the Edit call.
1718 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1720 * src/trans.C (AddDeadkey): cast explicitly to char.
1722 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1724 * src/tabular.C (AsciiBottomHLine): simplify?
1725 (AsciiTopHLine): simplify?
1726 (print_n_chars): simplify
1727 (DocBook): remove most of the << endl; we should flush the stream
1728 as seldom as possible.
1730 (TeXBottomHLine): ditto
1731 (TeXTopHLine): ditto
1733 (write_attribute): try a templified version.
1734 (set_row_column_number_info): lesson scope of variables
1736 * src/support/lstrings.h (tostr): new specialization of tostr
1738 * src/trans.C (AddDeadkey): slightly cleaner fix.
1740 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1742 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1743 '%%' in Toc menu labels.
1746 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1747 font_norm is iso10646-1.
1749 * src/font.C (ascent): Fixed for 16bit fonts
1750 (descent,lbearing,rbearing): ditto
1752 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1754 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1755 (getFeedback): new static method.
1757 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1758 Now use combox rather than choice to display languages.
1759 Feedback is now output using a new timer callback mechanism, identical
1760 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1762 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1764 * src/minibuffer.C: fix for older compilers
1766 2000-10-30 Juergen Vigna <jug@sad.it>
1768 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1769 has to be Left of the inset otherwise LyXText won't find it!
1771 * src/BufferView2.C (open_new_inset): delete the inset if it can
1774 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1776 * lyx.man: fix typo.
1778 2000-10-29 Marko Vendelin <markov@ioc.ee>
1779 * src/frontends/gnome/FormCitation.C
1780 * src/frontends/gnome/FormCitation.h
1781 * src/frontends/gnome/FormCopyright.C
1782 * src/frontends/gnome/FormCopyright.h
1783 * src/frontends/gnome/FormError.C
1784 * src/frontends/gnome/FormError.h
1785 * src/frontends/gnome/FormIndex.C
1786 * src/frontends/gnome/FormIndex.h
1787 * src/frontends/gnome/FormPrint.C
1788 * src/frontends/gnome/FormPrint.h
1789 * src/frontends/gnome/FormRef.C
1790 * src/frontends/gnome/FormRef.h
1791 * src/frontends/gnome/FormToc.C
1792 * src/frontends/gnome/FormToc.h
1793 * src/frontends/gnome/FormUrl.C
1794 * src/frontends/gnome/FormUrl.h
1795 * src/frontends/gnome/Menubar_pimpl.C
1796 * src/frontends/gnome/mainapp.C
1797 * src/frontends/gnome/mainapp.h
1798 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1799 changing update() to updateSlot() where appropriate
1801 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1803 * src/frontends/xforms/FormPreferences.[Ch]:
1804 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1807 2000-10-28 Juergen Vigna <jug@sad.it>
1809 * src/insets/insettabular.C (draw): fixed drawing bug.
1811 * src/insets/insettext.C (clear):
1813 (SetParagraphData): clearing the TEXT buffers when deleting the
1814 paragraphs used by it.
1816 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1818 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1820 2000-10-27 Juergen Vigna <jug@sad.it>
1822 * src/tabular.C (~LyXTabular): removed not needed anymore.
1824 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1827 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1829 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1832 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1835 * src/frontends/xforms/FormPreferences.[Ch]:
1836 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1837 Reorganised as modules based on tabs. Much easier to follow the
1838 flow and to add new tabs. Added warning and feedback messages.
1841 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1843 * src/tabular.h (DocBook): add std:: qualifier.
1845 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1847 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1848 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1851 * insettabular.C (DocBook): uses the tabular methods to export
1854 * src/insets/insettext.h
1855 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1857 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1859 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1862 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1863 moved misplaced AllowInput two lines up.
1865 * src/buffer.C (readFile): compare float with float, not with int
1867 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1869 * src/minibuffer.C: add "using SigC::slot" statement.
1871 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1873 * src/frontends/xforms/forms/README: updated section about make.
1875 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1876 Tidied some forms up, made two of form_tabular's tabs more
1877 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1878 fixed translation problem with "Column".
1880 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1882 * src/minibuffer.h: use Timeout instead of the xforms timer
1884 (setTimer) rewrite for the Timeout, change to unsigned arg
1885 (set): change to unsigned timer arg
1888 * src/minibuffer.C (TimerCB): removed func
1889 (C_MiniBuffer_TimerCB): removed func
1890 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1891 (peek_event): use a switch statement
1892 (add): don't use fl_add_timer.
1893 (Set): rewrite to use the Timeout
1896 * src/Timeout.[Ch] (setType): return a Timeout &
1897 (setTimeout): ditto, change to unsigned arg for timeout
1899 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1901 * src/mathed/formula.C (mathed_string_width): Use string instead
1902 of a constant size char array.
1904 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1906 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1907 the two recently added operator<< for SMInput and State.
1909 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1911 (OkCancelPolicy): ditto
1912 (OkCancelReadOnlyPolicy): ditto
1913 (NoRepeatedApplyReadOnlyPolicy): ditto
1914 (OkApplyCancelReadOnlyPolicy): ditto
1915 (OkApplyCancelPolicy): ditto
1916 (NoRepeatedApplyPolicy): ditto
1918 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1920 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1921 add the usual std:: qualifiers.
1923 2000-10-25 Juergen Vigna <jug@sad.it>
1925 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1927 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1929 * src/support/filetools.C (MakeRelPath): change some types to
1932 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1933 ButtonPolicy::SMInput and ButtonPolicy::State.
1935 * src/FontLoader.C (reset): small cleanup
1936 (unload): small cleanup
1938 * src/FontInfo.C (getFontname): initialize error to 10000.0
1940 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1942 * src/frontends/xforms/FormPreferences.[Ch]:
1943 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1944 TeX encoding and default paper size sections.
1946 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1948 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1951 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1952 make the message_ empty.
1953 (FormError): don't initialize message_ in initializer list.
1955 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1957 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1959 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1961 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1963 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1965 * src/frontends/kde/*data.[Ch]: _("") is not
1968 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1970 * src/buffer.C: removed redundant using directive.
1972 * src/frontends/DialogBase.h: revert to original definition of
1975 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1976 stuff into two classes, one for each dialog, requires a new
1977 element in the dialogs vector, FormTabularCreate.
1979 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1982 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1983 method. Continues Allan's idea, but means that derived classes
1984 don't need to worry about "update or hide?".
1986 * src/frontends/xforms/FormError.C (showInset): add connection
1989 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1990 one for each dialog. FormTabular now contains main tabular dialog
1993 * src/frontends/xforms/FormTabularCreate.[Ch]:
1994 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1997 * src/frontends/xforms/FormGraphics.[Ch]:
1998 * src/frontends/xforms/forms/form_graphics.fd
1999 * src/frontends/xforms/FormTabular.[Ch]:
2000 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2001 classes of FormInset.
2003 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2004 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2006 * src/frontends/xforms/Makefile.am:
2007 * src/frontends/xforms/forms/makefile: added new files.
2009 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2010 variable. added Signal0 hide signal, in keeping with other GUI-I
2013 * src/support/lstrings.h: removed redundant std:: qualifier as
2014 it's already declared in Lsstream.h.
2016 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2018 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2022 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2024 * src/tabular.C (Ascii): minimize scope of cell.
2026 * src/BufferView2.C (nextWord): return string() instead of 0;
2028 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2030 * src/converter.h: add a std:: qualifier
2032 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2034 * src/importer.[Ch]: New files. Used for importing files into LyX.
2036 * src/lyxfunc.C (doImport): Use the new Importer class.
2038 * src/converter.h: Add shortcut member to the Format class.
2039 Used for holding the menu shortcut.
2041 * src/converter.C and other files: Made a distinction between
2042 format name and format extension. New formats can be defined using
2043 the \format lyxrc tag.
2044 Added two new converter flags: latex and disable.
2046 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2048 * src/support/lyxlib.h: unify namespace/struct implementation.
2049 Remove extra declarations.
2051 * src/support/chdir.C (chdir): remove version taking char const *
2053 * src/support/rename.C: ditto.
2054 * src/support/lyxsum.C: ditto.
2056 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2058 * src/frontends/xforms/FormBase.[Ch]:
2059 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2060 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2061 work only for the next call to fl_show_form(). The correct place to set
2062 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2063 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2064 from FormBase have the minimum size set; no more stupid crashes with
2067 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2069 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2071 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2073 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2075 * src/support/lyxlib.h: changed second argument of mkdir to
2076 unsigned long int (unsigned int would probably have been enough,
2077 but...). Removed <sys/types.h> header.
2078 * src/support/mkdir.C (mkdir): ditto.
2082 2000-10-19 Juergen Vigna <jug@sad.it>
2084 * src/lyxfunc.C (MenuNew): small fix (form John)
2086 * src/screen.C (Update): removed unneeded code.
2088 * src/tabular.C (Ascii): refixed int != uint bug!
2090 * src/support/lyxlib.h: added sys/types.h include for now permits
2091 compiling, but I don't like this!
2093 2000-10-18 Juergen Vigna <jug@sad.it>
2095 * src/text2.C (ClearSelection): if we clear the selection we need
2096 more refresh so set the status apropriately
2098 * src/insets/insettext.C (draw): hopefully finally fixed draw
2101 2000-10-12 Juergen Vigna <jug@sad.it>
2103 * src/insets/insettext.C (draw): another small fix and make a block
2104 so that variables are localized.
2106 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2108 * src/support/lstrings.C (lowercase, uppercase):
2109 use explicit casts to remove compiler warnings.
2111 * src/support/LRegex.C (Impl):
2112 * src/support/StrPool.C (add):
2113 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2114 (AddPath, MakeDisplayPath):
2115 * src/support/lstrings.C (prefixIs, subst):
2116 use correct type to remove compiler warnings.
2118 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2120 * src/support/lyxlib.h:
2121 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2122 portability and to remove compiler warning with DEC cxx.
2124 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2126 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2128 * src/minibuffer.C (peek_event): retun 1 when there has been a
2129 mouseclick in the minibuffer.
2133 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2135 * src/frontends/xforms/FormParagraph.C: more space above/below
2138 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2140 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2141 a char only if real_current_font was changed.
2143 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2145 * NEWS: update somewhat for 1.1.6
2147 * lib/ui/default.ui: clean up.
2149 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2151 * lib/CREDITS: clean up
2153 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2155 * src/combox.[Ch] (select): changed argument back to int
2156 * src/combox.C (peek_event): removed num_bytes as it is declared but
2159 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2160 modified calls to Combox::select() to remove warnings about type
2163 * src/insets/insetbutton.C (width): explicit cast to remove warning
2164 about type conversion.
2166 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2169 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2170 sel_pos_end, refering to cursor position are changed to
2171 LyXParagraph::size_type.
2173 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2174 consistent with LyXCursor::pos().
2175 (inset_pos): changed to LyXParagraph::size_type for same reason.
2177 * src/insets/insettext.C (resizeLyXText): changed some temporary
2178 variables refing to cursor position to LyXParagraph::size_type.
2180 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2182 * src/frontends/kde/<various>: The Great Renaming,
2185 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2187 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2189 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2191 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2192 0 when there are no arguments.
2194 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2196 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2197 to segfaults when pressing Ok in InsetBibtex dialog.
2199 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2201 * forms/layout_forms.fd:
2202 * src/layout_forms.C (create_form_form_character): small change to use
2203 labelframe rather than engraved frame + text
2205 * src/lyx_gui.C (create_forms): initialise choice_language with some
2206 arbitrary value to prevent segfault when dialog is shown.
2208 2000-10-16 Baruch Even <baruch.even@writeme.com>
2210 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2211 is no resulting file. This pertains only to LaTeX output.
2213 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2215 * src/text.C (Backspace): Make sure that the row of the cursor is
2218 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2221 * src/lyx_gui.C (init): Prevent a crash when only one font from
2222 menu/popup fonts is not found.
2224 * lib/lyxrc.example: Add an example for binding a key for language
2227 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2229 * src/converter.C (GetReachable): Changed the returned type to
2231 (IsReachable): New method
2233 * src/MenuBackend.C (expand): Handle formats that appear more
2236 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2238 * src/frontends/support/Makefile.am
2239 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2242 * lib/CREDITS: add Garst Reese.
2244 * src/support/snprintf.h: add extern "C" {} around the definitions.
2246 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2248 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2251 * src/frontends/xforms/FormDocument.C:
2252 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2253 compile without "conversion to integral type of smaller size"
2256 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2258 * src/text.C (GetColumnNearX): Fixed disabled code.
2260 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2262 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2265 * src/support/snprintf.[ch]: new files
2267 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2269 * src/frontends/kde/formprintdialog.C: add
2270 file browser for selecting postscript output
2272 * src/frontends/kde/formprintdialogdata.C:
2273 * src/frontends/kde/formprintdialogdata.h: re-generate
2276 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2278 * src/frontends/gnome/Makefile.am:
2279 * src/frontends/kde/Makefile.am: FormCommand.C
2280 disappeared from xforms
2282 * src/frontends/kde/FormCitation.C:
2283 * src/frontends/kde/FormIndex.C: read-only
2286 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2288 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2291 * src/bufferlist.C: add using directive.
2293 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2295 * src/support/lyxfunctional.h: version of class_fun for void
2296 returns added, const versions of back_inseter_fun and compare_fun
2299 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2301 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2303 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2305 * ChangeLog: cleanup.
2307 * lib/CREDITS: update to add all the contributors we've forgotten.
2308 I have obviously missed some, so tell me whether there were
2311 2000-10-13 Marko Vendelin <markov@ioc.ee>
2313 * src/frontends/gnome/FormCitation.C
2314 * src/frontends/gnome/FormCitation.h
2315 * src/frontends/gnome/FormError.C
2316 * src/frontends/gnome/FormIndex.C
2317 * src/frontends/gnome/FormRef.C
2318 * src/frontends/gnome/FormRef.h
2319 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2321 * src/frontends/gnome/FormCitation.C
2322 * src/frontends/gnome/FormCopyright.C
2323 * src/frontends/gnome/FormError.C
2324 * src/frontends/gnome/FormIndex.C
2325 * src/frontends/gnome/FormRef.C
2326 * src/frontends/gnome/FormToc.C
2327 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2330 * src/frontends/gnome/Menubar_pimpl.C
2331 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2334 2000-10-11 Baruch Even <baruch.even@writeme.com>
2337 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2338 to convey its real action.
2340 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2341 clear the minibuffer and prepare to enter a command.
2343 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2344 the rename from ExecCommand to PrepareForCommand.
2345 * src/lyxfunc.C (Dispatch): ditto.
2347 2000-10-11 Baruch Even <baruch.even@writeme.com>
2349 * src/buffer.C (writeFile): Added test for errors on writing, this
2350 catches all errors and not only file system full errors as intended.
2352 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2354 * src/lyx_gui.C (create_forms): better fix for crash with
2355 translated interface.
2357 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2359 * src/frontends/kde/Makefile.am:
2360 * src/frontends/kde/FormCopyright.C:
2361 * src/frontends/kde/formcopyrightdialog.C:
2362 * src/frontends/kde/formcopyrightdialog.h:
2363 * src/frontends/kde/formcopyrightdialogdata.C:
2364 * src/frontends/kde/formcopyrightdialogdata.h:
2365 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2366 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2367 copyright to use qtarch
2369 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2371 * src/encoding.C (read): Fixed bug that caused an error message at
2372 the end of the file.
2374 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2376 * lib/lyxrc.example: Fixed hebrew example.
2378 2000-10-13 Allan Rae <rae@lyx.org>
2380 * src/frontends/xforms/FormPreferences.C (input): reworking the
2382 (build, update, apply): New inputs in various tabfolders
2384 * src/frontends/xforms/FormToc.C: use new button policy.
2385 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2386 dialogs that either can't use any existing policy or where it just
2389 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2392 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2393 added a bool parameter which is ignored.
2395 * src/buffer.C (setReadonly):
2396 * src/BufferView_pimpl.C (buffer):
2397 * src/frontends/kde/FormCopyright.h (update):
2398 * src/frontends/kde/FormCitation.[Ch] (update):
2399 * src/frontends/kde/FormIndex.[Ch] (update):
2400 * src/frontends/kde/FormPrint.[Ch] (update):
2401 * src/frontends/kde/FormRef.[Ch] (update):
2402 * src/frontends/kde/FormToc.[Ch] (update):
2403 * src/frontends/kde/FormUrl.[Ch] (update):
2404 * src/frontends/gnome/FormCopyright.h (update):
2405 * src/frontends/gnome/FormCitation.[Ch] (update):
2406 * src/frontends/gnome/FormError.[Ch] (update):
2407 * src/frontends/gnome/FormIndex.[Ch] (update):
2408 * src/frontends/gnome/FormPrint.[Ch] (update):
2409 * src/frontends/gnome/FormRef.h (update):
2410 * src/frontends/gnome/FormToc.[Ch] (update):
2411 * src/frontends/gnome/FormUrl.[Ch] (update):
2412 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2413 to updateBufferDependent and DialogBase
2415 * src/frontends/xforms/FormCitation.[hC]:
2416 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2417 * src/frontends/xforms/FormError.[Ch]:
2418 * src/frontends/xforms/FormGraphics.[Ch]:
2419 * src/frontends/xforms/FormIndex.[Ch]:
2420 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2421 and fixed readOnly handling.
2422 * src/frontends/xforms/FormPrint.[Ch]:
2423 * src/frontends/xforms/FormRef.[Ch]:
2424 * src/frontends/xforms/FormTabular.[Ch]:
2425 * src/frontends/xforms/FormToc.[Ch]:
2426 * src/frontends/xforms/FormUrl.[Ch]:
2427 * src/frontends/xforms/FormInset.[Ch]:
2428 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2429 form of updateBufferDependent.
2431 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2432 if form()->visible just in case someone does stuff to the form in a
2435 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2436 the buttoncontroller for everything the enum used to be used for.
2437 (update) It would seem we need to force all dialogs to use a bool
2438 parameter or have two update functions. I chose to go with one.
2439 I did try removing update() from here and FormBase and defining the
2440 appropriate update signatures in FormBaseB[DI] but then ran into the
2441 problem of the update() call in FormBase::show(). Whatever I did
2442 to get around that would require another function and that just
2443 got more confusing. Hence the decision to make everyone have an
2444 update(bool). An alternative might have been to override show() in
2445 FormBaseB[DI] and that would allow the different and appropriate
2448 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2449 true == buffer change occurred. I decided against using a default
2450 template parameter since not all compilers support that at present.
2452 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2454 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2455 army knife" by removing functionality.
2456 (clearStore): removed. All such housekeeping on hide()ing the dialog
2457 is to be carried out by overloaded disconnect() methods.
2458 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2459 superceded by Baruch's neat test (FormGraphics) to update an existing
2460 dialog if a new signal is recieved rather than block all new signals
2462 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2463 only to Inset dialogs.
2464 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2465 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2467 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2469 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2470 as a base class to all inset dialogs. Used solely to connect/disconnect
2471 the Inset::hide signal and to define what action to take on receipt of
2472 a UpdateBufferDependent signal.
2473 (FormCommand): now derived from FormInset.
2475 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2478 * src/frontends/xforms/FormCopyright.[Ch]:
2479 * src/frontends/xforms/FormPreferences.[Ch]:
2480 now derived from FormBaseBI.
2482 * src/frontends/xforms/FormDocument.[Ch]:
2483 * src/frontends/xforms/FormParagraph.[Ch]:
2484 * src/frontends/xforms/FormPrint.[Ch]:
2485 now derived from FormBaseBD.
2487 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2489 * src/frontends/xforms/FormCitation.[Ch]:
2490 * src/frontends/xforms/FormError.[Ch]:
2491 * src/frontends/xforms/FormRef.[Ch]:
2492 * src/frontends/xforms/FormToc.[Ch]:
2493 (clearStore): reworked as disconnect().
2495 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2498 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2500 * src/converter.C (runLaTeX): constify buffer argument
2503 * src/frontends/support/Makefile.am (INCLUDES): fix.
2505 * src/buffer.h: add std:: qualifier
2506 * src/insets/figinset.C (addpidwait): ditto
2507 * src/MenuBackend.C: ditto
2508 * src/buffer.C: ditto
2509 * src/bufferlist.C: ditto
2510 * src/layout.C: ditto
2511 * src/lyxfunc.C: ditto
2513 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2515 * src/lyxtext.h (bidi_level): change return type to
2516 LyXParagraph::size_type.
2518 * src/lyxparagraph.h: change size_type to
2519 TextContainer::difference_type. This should really be
2520 TextContainer::size_type, but we need currently to support signed
2523 2000-10-11 Marko Vendelin <markov@ioc.ee>
2524 * src/frontends/gnome/FormError.h
2525 * src/frontends/gnome/FormRef.C
2526 * src/frontends/gnome/FormRef.h
2527 * src/frontends/gnome/FormError.C
2528 * src/frontends/gnome/Makefile.am
2529 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2530 to Gnome frontend. Both dialogs use "action" area.
2532 2000-10-12 Baruch Even <baruch.even@writeme.com>
2534 * src/graphics/GraphicsCacheItem_pimpl.C:
2535 * src/graphics/Renderer.C:
2536 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2539 2000-10-12 Juergen Vigna <jug@sad.it>
2541 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2542 visible when selecting).
2544 * development/Code_rules/Rules: fixed some typos.
2546 2000-10-09 Baruch Even <baruch.even@writeme.com>
2548 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2549 compiling on egcs 1.1.2 possible.
2551 * src/filedlg.C (comp_direntry::operator() ): ditto.
2553 2000-08-31 Baruch Even <baruch.even@writeme.com>
2555 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2558 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2559 transient it now only gets freed when the object is destructed.
2561 2000-08-24 Baruch Even <baruch.even@writeme.com>
2563 * src/frontends/FormGraphics.h:
2564 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2567 2000-08-20 Baruch Even <baruch.even@writeme.com>
2569 * src/insets/insetgraphics.C:
2570 (draw): Added messages to the drawn rectangle to report status.
2571 (updateInset): Disabled the use of the inline graphics,
2574 2000-08-17 Baruch Even <baruch.even@writeme.com>
2576 * src/frontends/support: Directory added for the support of GUII LyX.
2578 * src/frontends/support/LyXImage.h:
2579 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2582 * src/frontends/support/LyXImage_X.h:
2583 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2584 version of LyXImage, this uses the Xlib Pixmap.
2586 * src/PainterBase.h:
2587 * src/PainterBase.C:
2589 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2590 replacement to Pixmap.
2592 * src/insets/insetgraphics.h:
2593 * src/insets/insetgraphics.C:
2594 * src/graphics/GraphicsCacheItem.h:
2595 * src/graphics/GraphicsCacheItem.C:
2596 * src/graphics/GraphicsCacheItem_pimpl.h:
2597 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2600 * src/graphics/GraphicsCacheItem.h:
2601 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2602 another copy of the object.
2604 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2605 of cacheHandle, this fixed a bug that sent LyX crashing.
2607 * src/graphics/XPM_Renderer.h:
2608 * src/graphics/XPM_Renderer.C:
2609 * src/graphics/EPS_Renderer.h:
2610 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2612 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2614 * src/lyxfunc.C (processKeySym): only handle the
2615 lockinginset/inset stuff if we have a buffer and text loaded...
2617 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2619 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2621 * src/support/lyxfunctional.h: add operator= that takes a reference
2623 * src/lyxserver.C (mkfifo): make first arg const
2625 * src/layout.h: renamed name(...) to setName(...) to work around
2628 * src/buffer.C (setFileName): had to change name of function to
2629 work around bugs in egcs. (renamed from fileName)
2631 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2633 * src/support/translator.h: move helper template classes to
2634 lyxfunctional.h, include "support/lyxfunctional.h"
2636 * src/support/lyxmanip.h: add delaration of fmt
2638 * src/support/lyxfunctional.h: new file
2639 (class_fun_t): new template class
2640 (class_fun): helper template function
2641 (back_insert_fun_iterator): new template class
2642 (back_inserter_fun): helper template function
2643 (compare_memfun_t): new template class
2644 (compare_memfun): helper template function
2645 (equal_1st_in_pair): moved here from translator
2646 (equal_2nd_in_pair): moved here from translator
2648 * src/support/fmt.C: new file
2649 (fmt): new func, can be used for a printf substitute when still
2650 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2652 * src/support/StrPool.C: add some comments
2654 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2657 * src/insets/figinset.C (addpidwait): use std::copy with
2658 ostream_iterator to fill the pidwaitlist
2660 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2662 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2665 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2668 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2670 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2671 (class_update): ditto
2672 (BulletPanel): ditto
2673 (CheckChoiceClass): move initialization of tc and tct
2675 * src/tabular.C: remove current_view
2676 (OldFormatRead): similar to right below [istream::ignore]
2678 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2679 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2680 unused [istream::ignore]
2682 * src/lyxfunc.C: include "support/lyxfunctional.h"
2683 (getInsetByCode): use std::find_if and compare_memfun
2685 * src/lyxfont.C (stateText): remove c_str()
2687 * src/lyx_main.C (setDebuggingLevel): make static
2688 (commandLineHelp): make static
2690 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2691 Screen* together with fl_get_display() and fl_screen
2693 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2694 togheter with fl_get_display() and fl_screen
2695 (create_forms): remove c_str()
2697 * src/layout.C: include "support/lyxfunctional.h"
2698 (hasLayout): use std::find_if and compare_memfun
2699 (GetLayout): use std::find_if and comapre_memfun
2700 (delete_layout): use std::remove_if and compare_memfun
2701 (NumberOfClass): use std:.find_if and compare_memfun
2703 * src/gettext.h: change for the new functions
2705 * src/gettext.C: new file, make _(char const * str) and _(string
2706 const & str) real functions.
2708 * src/font.C (width): rewrite slightly to avoid one extra variable
2710 * src/debug.C: initialize Debug::ANY here
2712 * src/commandtags.h: update number comments
2714 * src/combox.h (get): make const func
2716 (getline): make const
2718 * src/combox.C (input_cb): handle case where fl_get_input can
2721 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2722 "support/lyxfunctional.h", remove current_view variable.
2723 (resize): use std::for_each with std::mem_fun
2724 (getFileNames): use std::copy with back_inserter_fun
2725 (getBuffer): change arg type to unsigned int
2726 (emergencyWriteAll): call emergencyWrite with std::for_each and
2728 (emergencyWrite): new method, the for loop in emergencyWriteAll
2730 (exists): use std::find_if with compare_memfun
2731 (getBuffer): use std::find_if and compare_memfun
2733 * src/buffer.h: add typedefs for iterator_category, value_type
2734 difference_type, pointer and reference for inset_iterator
2735 add postfix ++ for inset_iterator
2736 make inset_iterator::getPos() const
2738 * src/buffer.C: added support/lyxmanip.h
2739 (readFile): use lyxerr << fmt instead of printf
2740 (makeLaTeXFile): use std::copy to write out encodings
2742 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2744 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2745 free and the char * temp.
2746 (hasMenu): use std::find_if and compare_memfun
2749 * src/Makefile.am (lyx_SOURCES): added gettext.C
2751 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2752 string::insert small change to avoid temporary
2754 * src/LColor.C (getGUIName): remove c_str()
2756 * several files: change all occurrences of fl_display to
2759 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2760 that -pedantic is not used for gcc 2.97 (cvs gcc)
2762 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2764 2000-10-11 Allan Rae <rae@lyx.org>
2766 * src/frontends/xforms/FormPreferences.C (input): template path must be
2767 a readable directory. It doesn't need to be writeable.
2768 (build, delete, update, apply): New inputs in the various tabfolders
2770 * src/frontends/xforms/forms/form_preferences.fd:
2771 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2772 several new entries to existing folders. Shuffled some existing stuff
2775 * src/frontends/xforms/forms/form_print.fd:
2776 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2777 Should probably rework PrinterParams as well. Note that the switch to
2778 collated is effectively the same as !unsorted so changing PrinterParams
2779 will require a lot of fiddly changes to reverse the existing logic.
2781 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2783 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2785 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2787 2000-10-10 Allan Rae <rae@lyx.org>
2790 * src/lyxfunc.C (Dispatch):
2792 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2795 * src/lyxrc.C (output): Only write the differences between system lyxrc
2796 and the users settings.
2799 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2801 I'll rewrite this later, after 1.1.6 probably, to keep a single
2802 LyXRC but two instances of a LyXRCStruct.
2804 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2806 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2808 * src/tabular.h: add a few std:: qualifiers.
2810 * src/encoding.C: add using directive.
2811 * src/language.C: ditto.
2813 * src/insets/insetquotes.C (Validate): use languages->lang()
2814 instead of only language.
2816 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2818 * lib/languages: New file.
2820 * lib/encodings: New file.
2822 * src/language.C (Languages): New class.
2823 (read): New method. Reads the languages from the 'languages' file.
2825 * src/encoding.C (Encodings): New class.
2826 (read): New method. Reads the encodings from the 'encodings' file.
2828 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2831 * src/bufferparams.h and a lot of files: Deleted the member language,
2832 and renamed language_info to language
2834 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2835 * src/lyxfont.C (latexWriteStartChanges): ditto.
2836 * src/paragraph.C (validate,TeXOnePar): ditto.
2838 * src/lyxfont.C (update): Restored deleted code.
2840 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2842 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2844 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2846 * src/insets/figinset.[Ch]:
2847 * src/insets/insetinclude.[Ch]:
2848 * src/insets/insetinclude.[Ch]:
2849 * src/insets/insetparent.[Ch]:
2850 * src/insets/insetref.[Ch]:
2851 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2853 * src/insets/*.[Ch]:
2854 * src/mathed/formula.[Ch]:
2855 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2857 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2858 * src/lyx_cb.C (FigureApplyCB):
2859 * src/lyxfunc.C (getStatus, Dispatch):
2860 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2863 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2865 * src/converter.[Ch] (Formats::View):
2866 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2868 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2869 *current_view->buffer(). This will change later, but this patch is way
2872 2000-10-09 Juergen Vigna <jug@sad.it>
2874 * src/text.C (GetRow): small fix.
2876 * src/BufferView_pimpl.C (cursorPrevious):
2877 (cursorNext): added LyXText parameter to function.
2879 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2880 keypress depending on cursor position.
2882 2000-10-06 Juergen Vigna <jug@sad.it>
2884 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2885 (copySelection): redone this function and also copy ascii representa-
2888 * src/tabular.C (Ascii):
2892 (print_n_chars): new functions to realize the ascii export of tabulars.
2894 2000-10-05 Juergen Vigna <jug@sad.it>
2896 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2897 if we don't have a buffer.
2899 2000-10-10 Allan Rae <rae@lyx.org>
2901 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2902 with closing dialog. It seems that nested tabfolders require hiding
2903 of inner tabfolders before hiding the dialog itself. Actually all I
2904 did was hide the active outer folder.
2906 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2907 unless there really is a buffer. hideBufferDependent is called
2910 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2911 POTFILES.in stays in $(srcdir).
2913 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2915 * lib/lyxrc.example: Few changes.
2917 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2919 * src/BufferView_pimpl.C (buffer): only need one the
2920 updateBufferDependent signal to be emitted once! Moved to the end of
2921 the method to allow bv_->text to be updated first.
2923 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2924 and hSignal_ with Dialogs * and BufferDependency variables.
2925 New Buffer * parent_, initialised when the dialog is launched. Used to
2926 check whether to update() or hide() dialog in the new, private
2927 updateOrHide() method that is connected to the updateBufferDependent
2928 signal. Daughter classes dictate what to do using the
2929 ChangedBufferAction enum, passed to the c-tor.
2931 * src/frontends/xforms/FormCitation.C:
2932 * src/frontends/xforms/FormCommand.C:
2933 * src/frontends/xforms/FormCopyright.C:
2934 * src/frontends/xforms/FormDocument.C:
2935 * src/frontends/xforms/FormError.C:
2936 * src/frontends/xforms/FormIndex.C:
2937 * src/frontends/xforms/FormPreferences.C:
2938 * src/frontends/xforms/FormPrint.C:
2939 * src/frontends/xforms/FormRef.C:
2940 * src/frontends/xforms/FormToc.C:
2941 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2944 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2945 ChangedBufferAction enum.
2947 * src/frontends/xforms/FormParagraph.[Ch]
2948 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2951 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2953 * lib/bind/cua.bind: fix a bit.
2954 * lib/bind/emacs.bind: ditto.
2956 * lib/bind/menus.bind: remove real menu entries from there.
2958 * src/spellchecker.C: make sure we only include strings.h when
2961 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2963 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2964 function. It enlarges the maximum number of pup when needed.
2965 (add_toc2): Open a new menu if maximum number of items per menu has
2968 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2970 * src/frontends/kde/FormPrint.C: fix error reporting
2972 * src/frontends/xforms/FormDocument.C: fix compiler
2975 * lib/.cvsignore: add Literate.nw
2977 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2980 * bufferview_funcs.[Ch]
2983 * text2.C: Add support for numbers in RTL text.
2985 2000-10-06 Allan Rae <rae@lyx.org>
2987 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2988 to be gettext.m4 friendly again. ext_l10n.h is now
2989 generated into $top_srcdir instead of $top_builddir
2990 so that lyx.pot will be built correctly -- without
2991 duplicate parsing of ext_l10n.h.
2993 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2995 * src/frontends/kde/FormCitation.C: make the dialog
2996 behave more sensibly
2998 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3000 * config/kde.m4: fix consecutive ./configure runs,
3001 look for qtarch, fix library order
3003 * src/frontends/kde/Makefile.am: tidy up,
3004 add Print dialog, add .dlg dependencies
3006 * src/frontends/kde/FormPrint.C:
3007 * src/frontends/kde/FormPrint.h:
3008 * src/frontends/kde/formprintdialog.C:
3009 * src/frontends/kde/formprintdialog.h:
3010 * src/frontends/kde/formprintdialogdata.C:
3011 * src/frontends/kde/formprintdialogdata.h:
3012 * src/frontends/kde/dlg/formprintdialog.dlg: add
3015 * src/frontends/kde/dlg/README: Added explanatory readme
3017 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3018 script to double-check qtarch's output
3020 * src/frontends/kde/formindexdialog.C:
3021 * src/frontends/kde/formindexdialogdata.C:
3022 * src/frontends/kde/formindexdialogdata.h:
3023 * src/frontends/kde/dlg/formindexdialog.dlg: update
3024 for qtarch, minor fixes
3026 2000-10-05 Allan Rae <rae@lyx.org>
3028 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3029 dialogs when switching buffers update them instead. It's up to each
3030 dialog to decide if it should still be visible or not.
3031 update() should return a bool to control visiblity within show().
3032 Or perhaps better to set a member variable and use that to control
3035 * lib/build-listerrors: create an empty "listerrors" file just to stop
3036 make trying to regenerate it all the time if you don't have noweb
3039 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3041 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3042 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3043 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3044 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3045 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3047 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3049 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3051 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3052 deleting buffer. Closes all buffer-dependent dialogs.
3054 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3056 * src/frontends/xforms/FormCitation.[Ch]:
3057 * src/frontends/xforms/FormPreferences.[Ch]:
3058 * src/frontends/xforms/FormPrint.[Ch]:
3059 * src/frontends/xforms/FormRef.[Ch]:
3060 * src/frontends/xforms/FormUrl.[Ch]: ditto
3062 * src/frontends/xforms/FormDocument.[Ch]:
3063 * src/frontends/xforms/forms/form_document.C.patch:
3064 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3065 pass through a single input() function.
3067 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3069 * lib/build-listerrors: return status as OK
3071 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3073 * lib/lyxrc.example: Updated to new export code
3075 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3077 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3080 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3083 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3084 LyX-Code is defined.
3085 * lib/layouts/amsbook.layout: ditto.
3087 * boost/Makefile.am: fix typo.
3089 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3091 (add_lastfiles): removed.
3092 (add_documents): removed.
3093 (add_formats): removed.
3095 * src/frontends/Menubar.C: remove useless "using" directive.
3097 * src/MenuBackend.h: add a new MenuItem constructor.
3099 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3102 2000-10-04 Allan Rae <rae@lyx.org>
3104 * lib/Makefile.am (listerrors):
3105 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3106 I haven't got notangle installed so Kayvan please test. The output
3107 should end up in $builddir. This also allows people who don't have
3108 noweb installed to complete the make process without error.
3110 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3111 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3112 by JMarc's picky compiler.
3114 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3117 * src/insets/insettabular.C (setPos): change for loop to not use
3118 sequencing operator. Please check this Jürgen.
3120 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3122 * src/insets/insetcite.C (getScreenLabel): ditto
3123 * src/support/filetools.C (QuoteName): ditto
3124 (ChangeExtension): ditto
3126 * src/BufferView_pimpl.C (scrollCB): make heigt int
3128 * src/BufferView2.C (insertInset): comment out unused arg
3130 * boost/Makefile.am (EXTRADIST): new variable
3132 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3134 * src/exporter.C (IsExportable): Fixed
3136 * lib/configure.m4: Small fix
3138 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3140 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3141 * src/insets/insetbib.C (bibitemWidest): ditto.
3142 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3144 2000-10-03 Juergen Vigna <jug@sad.it>
3146 * src/BufferView2.C (theLockingInset): removed const because of
3147 Agnus's compile problems.
3149 * src/insets/insettext.C (LocalDispatch): set the language of the
3150 surronding paragraph on inserting the first character.
3152 * various files: changed use of BufferView::the_locking_inset.
3154 * src/BufferView2.C (theLockingInset):
3155 (theLockingInset): new functions.
3157 * src/BufferView.h: removed the_locking_inset.
3159 * src/lyxtext.h: added the_locking_inset
3161 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3163 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3165 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3167 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3168 * src/mathed/math_cursor.C (IsAlpha): ditto.
3169 * src/mathed/math_inset.C (strnew): ditto.
3170 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3171 (IMetrics): cxp set but never used; removed.
3172 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3173 that the variable in question has been removed also!
3176 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3177 using the Buffer * passed to Latex(), using the BufferView * passed to
3178 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3180 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3181 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3183 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3184 * src/buffer.C (readInset): used new InsetBibtex c-tor
3185 * (getBibkeyList): used new InsetBibtex::getKeys
3187 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3190 * lib/build-listerrors
3192 * src/exporter.C: Add literate programming support to the export code
3195 * src/lyx_cb.C: Remove old literate code.
3197 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3200 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3201 * src/converter.C (View, Convert): Use QuoteName.
3203 * src/insets/figinset.C (Preview): Use Formats::View.
3205 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3207 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3209 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3210 the top of the function, because compaq cxx complains that the
3211 "goto exit_with_message" when the function is disabled bypasses
3213 (MenuNew): try a better fix for the generation of new file names.
3214 This time, I used AddName() instead of AddPath(), hoping Juergen
3217 2000-10-03 Allan Rae <rae@lyx.org>
3219 * src/frontends/xforms/forms/form_preferences.fd:
3220 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3221 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3222 "Look and Feel"->"General" but will need to be split up further into
3223 general output and general input tabs. Current plan is for four outer
3224 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3225 stuff; "Inputs" for input and import configuration; "Outputs" for
3226 output and export configuration; and one more whatever is left over
3227 called "General". The leftovers at present look like being which
3228 viewers to use, spellchecker, language support and might be better
3229 named "Support". I've put "Paths" in "Inputs" for the moment as this
3230 seems reasonable for now at least.
3231 One problem remains: X error kills LyX when you close Preferences.
3233 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3235 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3236 qualifier from form()
3237 * src/frontends/xforms/FormCitation.[Ch]:
3238 * src/frontends/xforms/FormCopyright.[Ch]:
3239 * src/frontends/xforms/FormDocument.[Ch]:
3240 * src/frontends/xforms/FormError.[Ch]:
3241 * src/frontends/xforms/FormIndex.[Ch]:
3242 * src/frontends/xforms/FormPreferences.[Ch]:
3243 * src/frontends/xforms/FormPrint.[Ch]:
3244 * src/frontends/xforms/FormRef.[Ch]:
3245 * src/frontends/xforms/FormToc.[Ch]:
3246 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3248 * src/frontends/xforms/FormCitation.[Ch]:
3249 * src/frontends/xforms/FormIndex.[Ch]:
3250 * src/frontends/xforms/FormRef.[Ch]:
3251 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3252 with Allan's naming policy
3254 * src/frontends/xforms/FormCitation.C: some static casts to remove
3257 2000-10-02 Juergen Vigna <jug@sad.it>
3259 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3260 now you can type or do stuff inside the table-cell also when in dummy
3261 position, fixed visible cursor.
3263 * src/insets/insettext.C (Edit): fixing cursor-view position.
3265 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3266 be used for equal functions in lyxfunc and insettext.
3268 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3270 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3272 * src/frontends/gnome/FormCitation.h:
3273 * src/frontends/gnome/FormCopyright.h:
3274 * src/frontends/gnome/FormIndex.h:
3275 * src/frontends/gnome/FormPrint.h:
3276 * src/frontends/gnome/FormToc.h:
3277 * src/frontends/gnome/FormUrl.h:
3278 * src/frontends/kde/FormCitation.h:
3279 * src/frontends/kde/FormCopyright.h:
3280 * src/frontends/kde/FormIndex.h:
3281 * src/frontends/kde/FormRef.h:
3282 * src/frontends/kde/FormToc.h:
3283 * src/frontends/kde/FormUrl.h: fix remaining users of
3286 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3288 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3289 from depth argument.
3290 (DocBookHandleCaption): ditto.
3291 (DocBookHandleFootnote): ditto.
3292 (SimpleDocBookOnePar): ditto.
3294 * src/frontends/xforms/FormDocument.h (form): remove extra
3295 FormDocument:: qualifier.
3297 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3299 * sigc++/handle.h: ditto.
3301 * src/lyx_gui_misc.C: add "using" directive.
3303 * src/cheaders/cstddef: new file, needed by the boost library (for
3306 2000-10-02 Juergen Vigna <jug@sad.it>
3308 * src/insets/insettext.C (SetFont): better support.
3310 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3312 * src/screen.C (DrawOneRow): some uint refixes!
3314 2000-10-02 Allan Rae <rae@lyx.org>
3316 * boost/.cvsignore: ignore Makefile as well
3318 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3319 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3321 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3322 Left this one out by accident.
3324 * src/frontends/xforms/FormBase.h (restore): default to calling
3325 update() since that will restore the original/currently-applied values.
3326 Any input() triggered error messages will require the derived classes
3327 to redefine restore().
3329 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3330 avoid a segfault. combo_doc_class is the main concern.
3332 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3334 * Simplify build-listerrors in view of GUI-less export ability!
3336 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3338 * src/lyx_main.C (easyParse): Disable gui when exporting
3340 * src/insets/figinset.C:
3343 * src/lyx_gui_misc.C
3344 * src/tabular.C: Changes to allow no-gui.
3346 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3348 * src/support/utility.hpp: removed file
3349 * src/support/block.h: removed file
3351 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3354 * src/mathed/formula.C: add support/lyxlib.h
3355 * src/mathed/formulamacro.C: ditto
3357 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3358 * src/lyxparagraph.h: ditto
3360 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3361 * src/frontends/Makefile.am (INCLUDES): ditto
3362 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3363 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3364 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3365 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3366 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3367 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3369 * src/BufferView.h: use boost/utility.hpp
3370 * src/LColor.h: ditto
3371 * src/LaTeX.h: ditto
3372 * src/LyXAction.h: ditto
3373 * src/LyXView.h: ditto
3374 * src/bufferlist.h: ditto
3375 * src/lastfiles.h: ditto
3376 * src/layout.h: ditto
3377 * src/lyx_gui.h: ditto
3378 * src/lyx_main.h: ditto
3379 * src/lyxlex.h: ditto
3380 * src/lyxrc.h: ditto
3381 * src/frontends/ButtonPolicies.h: ditto
3382 * src/frontends/Dialogs.h: ditto
3383 * src/frontends/xforms/FormBase.h: ditto
3384 * src/frontends/xforms/FormGraphics.h: ditto
3385 * src/frontends/xforms/FormParagraph.h: ditto
3386 * src/frontends/xforms/FormTabular.h: ditto
3387 * src/graphics/GraphicsCache.h: ditto
3388 * src/graphics/Renderer.h: ditto
3389 * src/insets/ExternalTemplate.h: ditto
3390 * src/insets/insetcommand.h: ditto
3391 * src/support/path.h: ditto
3393 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3394 and introduce clause for 2.97.
3396 * boost/libs/README: new file
3398 * boost/boost/utility.hpp: new file
3400 * boost/boost/config.hpp: new file
3402 * boost/boost/array.hpp: new file
3404 * boost/Makefile.am: new file
3406 * boost/.cvsignore: new file
3408 * configure.in (AC_OUTPUT): add boost/Makefile
3410 * Makefile.am (SUBDIRS): add boost
3412 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3414 * src/support/lstrings.C (suffixIs): Fixed.
3416 2000-10-01 Allan Rae <rae@lyx.org>
3418 * src/PrinterParams.h: moved things around to avoid the "can't
3419 inline call" warning.
3421 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3422 into doc++ documentation.
3424 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3426 * src/frontends/xforms/FormRef.C: make use of button controller
3427 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3428 cleaned up button controller usage.
3429 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3430 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3431 use the button controller
3433 * src/frontends/xforms/forms/*.fd: and associated generated files
3434 updated to reflect changes to FormBase. Some other FormXxxx files
3435 also got minor updates to reflect changes to FormBase.
3437 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3438 (hide): made virtual.
3439 (input): return a bool. true == valid input
3440 (RestoreCB, restore): new
3441 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3442 Changes to allow derived dialogs to use a ButtonController and
3443 make sense when doing so: OK button calls ok() and so on.
3445 * src/frontends/xforms/ButtonController.h (class ButtonController):
3446 Switch from template implementation to taking Policy parameter.
3447 Allows FormBase to provide a ButtonController for any dialog.
3449 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3450 Probably should rename connect and disconnect.
3451 (apply): use the radio button groups
3452 (form): needed by FormBase
3453 (build): setup the radio button groups
3455 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3457 * several files: type changes to reduce the number of warnings and
3458 to unify type hangling a bit. Still much to do.
3460 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3462 * lib/images/*: rename a bunch of icons to match Dekel converter
3465 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3468 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3470 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3472 * sigc++/handle.h: ditto for class Handle.
3474 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3476 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3478 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3480 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3481 removal of the "default" language.
3483 * src/combox.h (getline): Check that sel > 0
3485 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3487 * lib/examples/docbook_example.lyx
3488 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3490 * lib/layouts/docbook-book.layout: new docbook book layout.
3492 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3494 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3496 * src/insets/figinset.C (DocBook):fixed small typo.
3498 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3500 * src/insets/insetinclude.h: string include_label doesn't need to be
3503 2000-09-29 Allan Rae <rae@lyx.org>
3505 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3506 Allow derived type to control connection and disconnection from signals
3507 of its choice if desired.
3509 2000-09-28 Juergen Vigna <jug@sad.it>
3511 * src/insets/insettabular.C (update): fixed cursor setting when
3512 the_locking_inset changed.
3513 (draw): made this a bit cleaner.
3514 (InsetButtonPress): fixed!
3516 * various files: added LyXText Parameter to fitCursor call.
3518 * src/BufferView.C (fitCursor): added LyXText parameter.
3520 * src/insets/insettabular.C (draw): small draw fix.
3522 * src/tabular.C: right setting of left/right celllines.
3524 * src/tabular.[Ch]: fixed various types in funcions and structures.
3525 * src/insets/insettabular.C: ditto
3526 * src/frontends/xforms/FormTabular.C: ditto
3528 2000-09-28 Allan Rae <rae@lyx.org>
3530 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3531 that the #ifdef's had been applied to part of what should have been
3532 a complete condition. It's possible there are other tests that
3533 were specific to tables that are also wrong now that InsetTabular is
3534 being used. Now we need to fix the output of '\n' after a table in a
3535 float for the same reason as the original condition:
3536 "don't insert this if we would be adding it before or after a table
3537 in a float. This little trick is needed in order to allow use of
3538 tables in \subfigures or \subtables."
3539 Juergen can you check this?
3541 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3543 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3544 output to the ostream.
3546 * several files: fixed types based on warnings from cxx
3548 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3550 * src/frontends/kde/Makefile.am: fix rule for
3551 formindexdialogdata_moc.C
3553 * src/.cvsignore: add ext_l10n.h to ignore
3555 * acconfig.h: stop messing with __STRICT_ANSI__
3556 * config/gnome.m4: remove option to set -ansi
3557 * config/kde.m4: remove option to set -ansi
3558 * config/lyxinclude.m4: don't set -ansi
3560 2000-09-27 Juergen Vigna <jug@sad.it>
3562 * various files: remove "default" language check.
3564 * src/insets/insetquotes.C: removed use of current_view.
3566 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3567 the one should have red ears by now!
3569 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3570 in more then one paragraph. Fixed cursor-movement/selection.
3572 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3573 paragraphs inside a text inset.
3575 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3576 text-inset if this owner is an inset.
3578 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3580 * src/Bullet.h: changed type of font, character and size to int
3582 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3584 * src/insets/inseturl.[Ch]:
3585 * src/insets/insetref.[Ch]:
3586 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3588 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3590 * src/buffer.C (readFile): block-if statement rearranged to minimise
3591 bloat. Patch does not reverse Jean-Marc's change ;-)
3593 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3594 Class rewritten to store pointers to hide/update signals directly,
3595 rather than Dialogs *. Also defined an enum to ease use. All xforms
3596 forms can now be derived from this class.
3598 * src/frontends/xforms/FormCommand.[Ch]
3599 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3601 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3604 * src/frontends/xforms/forms/form_citation.fd
3605 * src/frontends/xforms/forms/form_copyright.fd
3606 * src/frontends/xforms/forms/form_error.fd
3607 * src/frontends/xforms/forms/form_index.fd
3608 * src/frontends/xforms/forms/form_ref.fd
3609 * src/frontends/xforms/forms/form_toc.fd
3610 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3612 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3614 * src/insets/insetfoot.C: removed redundent using directive.
3616 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3618 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3619 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3621 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3622 created in the constructors in different groups. Then set() just
3623 have to show the groups as needed. This fixes the redraw problems
3624 (and is how the old menu code worked).
3626 * src/support/lyxlib.h: declare the methods as static when we do
3627 not have namespaces.
3629 2000-09-26 Juergen Vigna <jug@sad.it>
3631 * src/buffer.C (asciiParagraph): new function.
3632 (writeFileAscii): new function with parameter ostream.
3633 (writeFileAscii): use now asciiParagraph.
3635 * various inset files: added the linelen parameter to the Ascii-func.
3637 * src/tabular.C (Write): fixed error in writing file introduced by
3638 the last changes from Lars.
3640 * lib/bind/menus.bind: removed not supported functions.
3642 * src/insets/insettext.C (Ascii): implemented this function.
3644 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3646 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3647 (Write): use of the write_attribute functions.
3649 * src/bufferlist.C (close): fixed reasking question!
3651 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3653 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3654 new files use the everwhere possible.
3657 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3658 src/log_form.C src/lyx.C:
3661 * src/buffer.C (runLaTeX): remove func
3663 * src/PaperLayout.C: removed file
3664 * src/ParagraphExtra.C: likewise
3665 * src/bullet_forms.C: likewise
3666 * src/bullet_forms.h: likewise
3667 * src/bullet_forms_cb.C: likewise
3669 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3670 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3673 * several files: remove all traces of the old fd_form_paragraph,
3674 and functions belonging to that.
3676 * several files: remove all traces of the old fd_form_document,
3677 and functions belonging to that.
3679 * several files: constify local variables were possible.
3681 * several files: remove all code that was dead when NEW_EXPORT was
3684 * several files: removed string::c_str in as many places as
3687 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3688 (e): be a bit more outspoken when patching
3689 (updatesrc): only move files if changed.
3691 * forms/layout_forms.h.patch: regenerated
3693 * forms/layout_forms.fd: remove form_document and form_paragraph
3694 and form_quotes and form_paper and form_table_options and
3695 form_paragraph_extra
3697 * forms/form1.fd: remove form_table
3699 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3700 the fdui->... rewrite. Update some comments to xforms 0.88
3702 * forms/bullet_forms.C.patch: removed file
3703 * forms/bullet_forms.fd: likewise
3704 * forms/bullet_forms.h.patch: likewise
3706 * development/Code_rules/Rules: added a section on switch
3707 statements. Updated some comment to xforms 0.88.
3709 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3711 * src/buffer.C (readFile): make sure that the whole version number
3712 is read after \lyxformat (even when it contains a comma)
3714 * lib/ui/default.ui: change shortcut of math menu to M-a.
3716 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3718 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3721 * src/LyXView.C (updateWindowTitle): show the full files name in
3722 window title, limited to 30 characters.
3724 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3725 When a number of characters has been given, we should not assume
3726 that the string is 0-terminated.
3728 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3729 calls (fixes some memory leaks)
3731 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3732 trans member on exit.
3734 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3736 * src/converter.C (GetReachable): fix typo.
3738 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3739 understand ',' instead of '.'.
3740 (GetInteger): rewrite to use strToInt().
3742 2000-09-26 Juergen Vigna <jug@sad.it>
3744 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3745 better visibility and error-message on wrong VSpace input.
3747 * src/language.C (initL): added english again.
3749 2000-09-25 Juergen Vigna <jug@sad.it>
3751 * src/frontends/kde/Dialogs.C (Dialogs):
3752 * src/frontends/gnome/Dialogs.C (Dialogs):
3753 * src/frontends/kde/Makefile.am:
3754 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3756 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3758 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3760 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3762 * src/frontends/xforms/FormParagraph.C:
3763 * src/frontends/xforms/FormParagraph.h:
3764 * src/frontends/xforms/form_paragraph.C:
3765 * src/frontends/xforms/form_paragraph.h:
3766 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3769 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3771 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3772 Paragraph-Data after use.
3774 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3775 non breakable paragraphs.
3777 2000-09-25 Garst R. Reese <reese@isn.net>
3779 * src/language.C (initL): added missing language_country codes.
3781 2000-09-25 Juergen Vigna <jug@sad.it>
3783 * src/insets/insettext.C (InsetText):
3784 (deleteLyXText): remove the not released LyXText structure!
3786 2000-09-24 Marko Vendelin <markov@ioc.ee>
3788 * src/frontends/gnome/mainapp.C
3789 * src/frontends/gnome/mainapp.h: added support for keyboard
3792 * src/frontends/gnome/FormCitation.C
3793 * src/frontends/gnome/FormCitation.h
3794 * src/frontends/gnome/Makefile.am
3795 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3796 FormCitation to use "action area" in mainapp window
3798 * src/frontends/gnome/Menubar_pimpl.C
3799 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3802 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3804 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3805 width/descent/ascent values if name is empty.
3806 (mathed_string_height): Use std::max.
3808 2000-09-25 Allan Rae <rae@lyx.org>
3810 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3811 segfault. This will be completely redesigned soon.
3813 * sigc++: updated libsigc++. Fixes struct timespec bug.
3815 * development/tools/makeLyXsigc.sh: .cvsignore addition
3817 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3819 * several files: removed almost all traces of the old table
3822 * src/TableLayout.C: removed file
3824 2000-09-22 Juergen Vigna <jug@sad.it>
3826 * src/frontends/kde/Dialogs.C: added credits forms.
3828 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3830 * src/frontends/gnome/Dialogs.C: added some forms.
3832 * src/spellchecker.C (init_spell_checker): set language in pspell code
3833 (RunSpellChecker): some modifications for setting language string.
3835 * src/language.[Ch]: added language_country code.
3837 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3839 * src/frontends/Dialogs.h: added new signal showError.
3840 Rearranged existing signals in some sort of alphabetical order.
3842 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3843 FormError.[Ch], form_error.[Ch]
3844 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3845 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3847 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3848 dialogs. I think that this can be used as the base to all these
3851 * src/frontends/xforms/FormError.[Ch]
3852 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3853 implementation of InsetError dialog.
3855 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3857 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3858 * src/frontends/kde/Makefile.am: ditto
3860 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3862 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3863 macrobf. This fixes a bug of invisible text.
3865 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3867 * lib/doc/LaTeXConfig.lyx.in: updated.
3869 * src/language.C (initL): remove language "francais" and change a
3870 bit the names of the two other french variations.
3872 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3873 string that may not be 0-terminated.
3875 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3877 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3879 2000-09-20 Marko Vendelin <markov@ioc.ee>
3881 * src/frontends/gnome/FormCitation.C
3882 * src/frontends/gnome/FormIndex.C
3883 * src/frontends/gnome/FormToc.C
3884 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3885 the variable initialization to shut up the warnings
3887 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3889 * src/table.[Ch]: deleted files
3891 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3894 2000-09-18 Juergen Vigna <jug@sad.it>
3896 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3897 problems with selection. Inserted new LFUN_PASTESELECTION.
3898 (InsetButtonPress): inserted handling of middle mouse-button paste.
3900 * src/spellchecker.C: changed word to word.c_str().
3902 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3904 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3905 included in the ``make dist'' tarball.
3907 2000-09-15 Juergen Vigna <jug@sad.it>
3909 * src/CutAndPaste.C (cutSelection): small fix return the right
3910 end position after cut inside one paragraph only.
3912 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3913 we are locked as otherwise we don't have a valid cursor position!
3915 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3917 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3919 * src/frontends/kde/FormRef.C: added using directive.
3920 * src/frontends/kde/FormToc.C: ditto
3922 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3924 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3926 2000-09-19 Marko Vendelin <markov@ioc.ee>
3928 * src/frontends/gnome/Menubar_pimpl.C
3929 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3930 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3932 * src/frontends/gnome/mainapp.C
3933 * src/frontends/gnome/mainapp.h: support for menu update used
3936 * src/frontends/gnome/mainapp.C
3937 * src/frontends/gnome/mainapp.h: support for "action" area in the
3938 main window. This area is used by small simple dialogs, such as
3941 * src/frontends/gnome/FormIndex.C
3942 * src/frontends/gnome/FormIndex.h
3943 * src/frontends/gnome/FormUrl.C
3944 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3947 * src/frontends/gnome/FormCitation.C
3948 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3949 action area. Only "Insert new citation" is implemented.
3951 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3953 * src/buffer.C (Dispatch): fix call to Dispatch
3954 * src/insets/insetref.C (Edit): likewise
3955 * src/insets/insetparent.C (Edit): likewise
3956 * src/insets/insetinclude.C (include_cb): likewise
3957 * src/frontends/xforms/FormUrl.C (apply): likewise
3958 * src/frontends/xforms/FormToc.C (apply): likewise
3959 * src/frontends/xforms/FormRef.C (apply): likewise
3960 * src/frontends/xforms/FormIndex.C (apply): likewise
3961 * src/frontends/xforms/FormCitation.C (apply): likewise
3962 * src/lyxserver.C (callback): likewise
3963 * src/lyxfunc.C (processKeySym): likewise
3964 (Dispatch): likewise
3965 (Dispatch): likewise
3966 * src/lyx_cb.C (LayoutsCB): likewise
3968 * Makefile.am (sourcedoc): small change
3970 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3972 * src/main.C (main): Don't make an empty GUIRunTime object. all
3973 methods are static. constify a bit remove unneded using + headers.
3975 * src/tabular.C: some more const to local vars move some loop vars
3977 * src/spellchecker.C: added some c_str after some word for pspell
3979 * src/frontends/GUIRunTime.h: add new static method setDefaults
3980 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3981 * src/frontends/kde/GUIRunTime.C (setDefaults):
3982 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3984 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3985 with strnew in arg, use correct emptystring when calling SetName.
3987 * several files: remove all commented code with relation to
3988 HAVE_SSTREAM beeing false. We now only support stringstream and
3991 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3993 * src/lyxfunc.C: construct correctly the automatic new file
3996 * src/text2.C (IsStringInText): change type of variable i to shut
3999 * src/support/sstream.h: do not use namespaces if the compiler
4000 does not support them.
4002 2000-09-15 Marko Vendelin <markov@ioc.ee>
4003 * src/frontends/gnome/FormCitation.C
4004 * src/frontends/gnome/FormCitation.h
4005 * src/frontends/gnome/diainsertcitation_interface.c
4006 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4007 regexp support to FormCitation [Gnome].
4009 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4012 * configure.in: remove unused KDE/GTKGUI define
4014 * src/frontends/kde/FormRef.C
4015 * src/frontends/kde/FormRef.h
4016 * src/frontends/kde/formrefdialog.C
4017 * src/frontends/kde/formrefdialog.h: double click will
4018 go to reference, now it is possible to change a cross-ref
4021 * src/frontends/kde/FormToc.C
4022 * src/frontends/kde/FormToc.h
4023 * src/frontends/kde/formtocdialog.C
4024 * src/frontends/kde/formtocdialog.h: add a depth
4027 * src/frontends/kde/Makefile.am: add QtLyXView.h
4030 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4032 * src/frontends/kde/FormCitation.h: added some using directives.
4034 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4036 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4039 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4042 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4044 * src/buffer.C (pop_tag): revert for the second time a change by
4045 Lars, who seems to really hate having non-local loop variables :)
4047 * src/Lsstream.h: add "using" statements.
4049 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4050 * src/buffer.C (writeFile): ditto
4052 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4054 * src/buffer.C (writeFile): try to fix the locale modified format
4055 number to always be as we want it.
4057 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4058 in XForms 0.89. C-space is now working again.
4060 * src/Lsstream.h src/support/sstream.h: new files.
4062 * also commented out all cases where strstream were used.
4064 * src/Bullet.h (c_str): remove method.
4066 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4068 * a lot of files: get rid of "char const *" and "char *" is as
4069 many places as possible. We only want to use them in interaction
4070 with system of other libraries, not inside lyx.
4072 * a lot of files: return const object is not of pod type. This
4073 helps ensure that temporary objects is not modified. And fits well
4074 with "programming by contract".
4076 * configure.in: check for the locale header too
4078 * Makefile.am (sourcedoc): new tag for generation of doc++
4081 2000-09-14 Juergen Vigna <jug@sad.it>
4083 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4084 callback to check which combo called it and do the right action.
4086 * src/combox.C (combo_cb): added combo * to the callbacks.
4087 (Hide): moved call of callback after Ungrab of the pointer.
4089 * src/intl.h: removed LCombo2 function.
4091 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4092 function as this can now be handled in one function.
4094 * src/combox.h: added Combox * to callback prototype.
4096 * src/frontends/xforms/Toolbar_pimpl.C:
4097 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4099 2000-09-14 Garst Reese <reese@isn.net>
4101 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4102 moved usepackage{xxx}'s to beginning of file. Changed left margin
4103 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4104 underlining from title. Thanks to John Culleton for useful suggestions.
4106 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4108 * src/lyxlex_pimpl.C (setFile): change error message to debug
4111 2000-09-13 Juergen Vigna <jug@sad.it>
4113 * src/frontends/xforms/FormDocument.C: implemented choice_class
4114 as combox and give callback to combo_language so OK/Apply is activated
4117 * src/bufferlist.C (newFile): small fix so already named files
4118 (via an open call) are not requested to be named again on the
4121 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4123 * src/frontends/kde/Makefile.am
4124 * src/frontends/kde/FormRef.C
4125 * src/frontends/kde/FormRef.h
4126 * src/frontends/kde/formrefdialog.C
4127 * src/frontends/kde/formrefdialog.h: implement
4130 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4132 * src/frontends/kde/formtocdialog.C
4133 * src/frontends/kde/formtocdialog.h
4134 * src/frontends/kde/FormToc.C
4135 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4137 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4139 * src/frontends/kde/FormCitation.C: fix thinko
4140 where we didn't always display the reference text
4143 * src/frontends/kde/formurldialog.C
4144 * src/frontends/kde/formurldialog.h
4145 * src/frontends/kde/FormUrl.C
4146 * src/frontends/kde/FormUrl.h: minor cleanups
4148 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4150 * src/frontends/kde/Makefile.am
4151 * src/frontends/kde/FormToc.C
4152 * src/frontends/kde/FormToc.h
4153 * src/frontends/kde/FormCitation.C
4154 * src/frontends/kde/FormCitation.h
4155 * src/frontends/kde/FormIndex.C
4156 * src/frontends/kde/FormIndex.h
4157 * src/frontends/kde/formtocdialog.C
4158 * src/frontends/kde/formtocdialog.h
4159 * src/frontends/kde/formcitationdialog.C
4160 * src/frontends/kde/formcitationdialog.h
4161 * src/frontends/kde/formindexdialog.C
4162 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4164 2000-09-12 Juergen Vigna <jug@sad.it>
4166 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4169 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4171 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4174 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4176 * src/converter.C (Add, Convert): Added support for converter flags:
4177 needaux, resultdir, resultfile.
4178 (Convert): Added new parameter view_file.
4179 (dvips_options): Fixed letter paper option.
4181 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4182 (Export, GetExportableFormats, GetViewableFormats): Added support
4185 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4187 (easyParse): Fixed to work with new export code.
4189 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4192 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4194 * lib/bind/*.bind: Replaced
4195 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4196 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4198 2000-09-11 Juergen Vigna <jug@sad.it>
4200 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4202 * src/main.C (main): now GUII defines global guiruntime!
4204 * src/frontends/gnome/GUIRunTime.C (initApplication):
4205 * src/frontends/kde/GUIRunTime.C (initApplication):
4206 * src/frontends/xforms/GUIRunTime.C (initApplication):
4207 * src/frontends/GUIRunTime.h: added new function initApplication.
4209 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4211 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4213 2000-09-08 Juergen Vigna <jug@sad.it>
4215 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4216 we have already "Reset".
4218 * src/language.C (initL): inserted "default" language and made this
4219 THE default language (and not american!)
4221 * src/paragraph.C: inserted handling of "default" language!
4223 * src/lyxfont.C: ditto
4227 * src/paragraph.C: output the \\par only if we have a following
4228 paragraph otherwise it's not needed.
4230 2000-09-05 Juergen Vigna <jug@sad.it>
4232 * config/pspell.m4: added entry to lyx-flags
4234 * src/spellchecker.C: modified version from Kevin for using pspell
4236 2000-09-01 Marko Vendelin <markov@ioc.ee>
4237 * src/frontends/gnome/Makefile.am
4238 * src/frontends/gnome/FormCitation.C
4239 * src/frontends/gnome/FormCitation.h
4240 * src/frontends/gnome/diainsertcitation_callbacks.c
4241 * src/frontends/gnome/diainsertcitation_callbacks.h
4242 * src/frontends/gnome/diainsertcitation_interface.c
4243 * src/frontends/gnome/diainsertcitation_interface.h
4244 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4245 dialog for Gnome frontend
4247 * src/main.C: Gnome libraries require keeping application name
4248 and its version as strings
4250 * src/frontends/gnome/mainapp.C: Change the name of the main window
4251 from GnomeLyX to PACKAGE
4253 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4255 * src/frontends/Liason.C: add "using: declaration.
4257 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4259 * src/mathed/math_macro.C (Metrics): Set the size of the template
4261 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4263 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4265 * src/converter.C (add_options): New function.
4266 (SetViewer): Change $$FName into '$$FName'.
4267 (View): Add options when running xdvi
4268 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4269 (Convert): The 3rd parameter is now the desired filename. Converts
4270 calls to lyx::rename if necessary.
4271 Add options when running dvips.
4272 (dvi_papersize,dvips_options): New methods.
4274 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4276 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4277 using a call to Converter::dvips_options.
4278 Fixed to work with nex export code.
4280 * src/support/copy.C
4281 * src/support/rename.C: New files
4283 * src/support/syscall.h
4284 * src/support/syscall.C: Added Starttype SystemDontWait.
4286 * lib/ui/default.ui: Changed to work with new export code
4288 * lib/configure.m4: Changed to work with new export code
4290 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4292 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4294 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4295 so that code compiles with DEC cxx.
4297 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4298 to work correctly! Also now supports the additional elements
4301 2000-09-01 Allan Rae <rae@lyx.org>
4303 * src/frontends/ButtonPolicies.C: renamed all the references to
4304 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4306 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4307 since it's a const not a type.
4309 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4311 2000-08-31 Juergen Vigna <jug@sad.it>
4313 * src/insets/figinset.C: Various changes to look if the filename has
4314 an extension and if not add it for inline previewing.
4316 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4318 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4319 make buttonStatus and isReadOnly be const methods. (also reflect
4320 this in derived classes.)
4322 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4323 (nextState): change to be static inline, pass the StateMachine as
4325 (PreferencesPolicy): remove casts
4326 (OkCancelPolicy): remvoe casts
4327 (OkCancelReadOnlyPolicy): remove casts
4328 (NoRepeatedApplyReadOnlyPolicy): remove casts
4329 (OkApplyCancelReadOnlyPolicy): remove casts
4330 (OkApplyCancelPolicy): remove casts
4331 (NoRepeatedApplyPolicy): remove casts
4333 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4335 * src/converter.C: added some using directives
4337 * src/frontends/ButtonPolicies.C: changes to overcome
4338 "need lvalue" error with DEC c++
4340 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4341 to WMHideCB for DEC c++
4343 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4345 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4346 to BulletBMTableCB for DEC c++
4348 2000-08-31 Allan Rae <rae@lyx.org>
4350 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4351 character dialog separately from old document dialogs combo_language.
4354 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4356 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4357 Removed LFUN_REF_CREATE.
4359 * src/MenuBackend.C: Added new tags: toc and references
4361 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4362 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4364 (add_toc, add_references): New methods.
4365 (create_submenu): Handle correctly the case when there is a
4366 seperator after optional menu items.
4368 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4369 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4370 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4372 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4374 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4376 * src/converter.[Ch]: New file for converting between different
4379 * src/export.[Ch]: New file for exporting a LyX file to different
4382 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4383 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4384 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4385 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4386 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4387 RunDocBook, MenuExport.
4389 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4390 Exporter::Preview methods if NEW_EXPORT is defined.
4392 * src/buffer.C (Dispatch): Use Exporter::Export.
4394 * src/lyxrc.C: Added new tags: \converter and \viewer.
4397 * src/LyXAction.C: Define new lyx-function: buffer-update.
4398 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4399 when NEW_EXPORT is defined.
4401 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4403 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4405 * lib/ui/default.ui: Added submenus "view" and "update" to the
4408 * src/filetools.C (GetExtension): New function.
4410 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4412 2000-08-29 Allan Rae <rae@lyx.org>
4414 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4416 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4417 (EnableDocumentLayout): removed
4418 (DisableDocumentLayout): removed
4419 (build): make use of ButtonController's read-only handling to
4420 de/activate various objects. Replaces both of the above functions.
4422 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4423 (readOnly): was read_only
4424 (refresh): fixed dumb mistakes with read_only_ handling
4426 * src/frontends/xforms/forms/form_document.fd:
4427 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4428 tabbed dialogs so the tabs look more like tabs and so its easier to
4429 work out which is the current tab.
4431 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4432 segfault with form_table
4434 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4436 2000-08-28 Juergen Vigna <jug@sad.it>
4438 * acconfig.h: added USE_PSPELL.
4440 * src/config.h.in: added USE_PSPELL.
4442 * autogen.sh: added pspell.m4
4444 * config/pspell.m4: new file.
4446 * src/spellchecker.C: implemented support for pspell libary.
4448 2000-08-25 Juergen Vigna <jug@sad.it>
4450 * src/LyXAction.C (init): renamed LFUN_TABLE to
4451 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4453 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4455 * src/lyxscreen.h: add force_clear variable and fuction to force
4456 a clear area when redrawing in LyXText.
4458 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4460 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4462 * some whitespace and comment changes.
4464 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4466 * src/buffer.C: up te LYX_FORMAT to 2.17
4468 2000-08-23 Juergen Vigna <jug@sad.it>
4470 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4473 * src/insets/insettabular.C (pasteSelection): delete the insets
4474 LyXText as it is not valid anymore.
4475 (copySelection): new function.
4476 (pasteSelection): new function.
4477 (cutSelection): new function.
4478 (LocalDispatch): implemented cut/copy/paste of cell selections.
4480 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4481 don't have a LyXText.
4483 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4485 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4488 2000-08-22 Juergen Vigna <jug@sad.it>
4490 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4491 ifdef form_table out if NEW_TABULAR.
4493 2000-08-21 Juergen Vigna <jug@sad.it>
4495 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4496 (draw): fixed draw position so that the cursor is positioned in the
4498 (InsetMotionNotify): hide/show cursor so the position is updated.
4499 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4500 using cellstart() function where it should be used.
4502 * src/insets/insettext.C (draw): ditto.
4504 * src/tabular.C: fixed initialization of some missing variables and
4505 made BoxType into an enum.
4507 2000-08-22 Marko Vendelin <markov@ioc.ee>
4508 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4509 stock menu item using action numerical value, not its string
4513 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4515 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4516 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4518 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4520 * src/frontends/xforms/GUIRunTime.C: new file
4522 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4523 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4525 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4527 * src/frontends/kde/GUIRunTime.C: new file
4529 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4530 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4532 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4534 * src/frontends/gnome/GUIRunTime.C: new file
4536 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4539 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4540 small change to documetentation.
4542 * src/frontends/GUIRunTime.C: removed file
4544 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4546 * src/lyxparagraph.h: enable NEW_TABULAR as default
4548 * src/lyxfunc.C (processKeySym): remove some commented code
4550 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4551 NEW_TABULAR around the fd_form_table_options.
4553 * src/lyx_gui.C (runTime): call the static member function as
4554 GUIRunTime::runTime().
4556 2000-08-21 Allan Rae <rae@lyx.org>
4558 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4561 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4563 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4565 2000-08-21 Allan Rae <rae@lyx.org>
4567 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4568 keep Garst happy ;-)
4569 * src/frontends/xforms/FormPreferences.C (build): use setOK
4570 * src/frontends/xforms/FormDocument.C (build): use setOK
4571 (FormDocument): use the appropriate policy.
4573 2000-08-21 Allan Rae <rae@lyx.org>
4575 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4576 automatic [de]activation of arbitrary objects when in a read-only state.
4578 * src/frontends/ButtonPolicies.h: More documentation
4579 (isReadOnly): added to support the above.
4581 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4583 2000-08-18 Juergen Vigna <jug@sad.it>
4585 * src/insets/insettabular.C (getStatus): changed to return func_status.
4587 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4588 display toggle menu entries if they are.
4590 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4591 new document layout now.
4593 * src/lyxfunc.C: ditto
4595 * src/lyx_gui_misc.C: ditto
4597 * src/lyx_gui.C: ditto
4599 * lib/ui/default.ui: removed paper and quotes layout as they are now
4600 all in the document layout tabbed folder.
4602 * src/frontends/xforms/forms/form_document.fd: added Restore
4603 button and callbacks for all inputs for Allan's ButtonPolicy.
4605 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4606 (CheckChoiceClass): added missing params setting on class change.
4607 (UpdateLayoutDocument): added for updating the layout on params.
4608 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4609 (FormDocument): Implemented Allan's ButtonPolicy with the
4612 2000-08-17 Allan Rae <rae@lyx.org>
4614 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4615 so we can at least see the credits again.
4617 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4618 controller calls for the appropriate callbacks. Note that since Ok
4619 calls apply followed by cancel, and apply isn't a valid input for the
4620 APPLIED state, the bc_ calls have to be made in the static callback not
4621 within each of the real callbacks.
4623 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4624 (setOk): renamed from setOkay()
4626 2000-08-17 Juergen Vigna <jug@sad.it>
4628 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4629 in the implementation part.
4630 (composeUIInfo): don't show optional menu-items.
4632 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4634 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4636 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4637 text-state when in a text-inset.
4639 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4641 2000-08-17 Marko Vendelin <markov@ioc.ee>
4642 * src/frontends/gnome/FormIndex.C
4643 * src/frontends/gnome/FormIndex.h
4644 * src/frontends/gnome/FormToc.C
4645 * src/frontends/gnome/FormToc.h
4646 * src/frontends/gnome/dialogs
4647 * src/frontends/gnome/diatoc_callbacks.c
4648 * src/frontends/gnome/diatoc_callbacks.h
4649 * src/frontends/gnome/diainsertindex_callbacks.h
4650 * src/frontends/gnome/diainsertindex_callbacks.c
4651 * src/frontends/gnome/diainsertindex_interface.c
4652 * src/frontends/gnome/diainsertindex_interface.h
4653 * src/frontends/gnome/diatoc_interface.h
4654 * src/frontends/gnome/diatoc_interface.c
4655 * src/frontends/gnome/Makefile.am: Table of Contents and
4656 Insert Index dialogs implementation for Gnome frontend
4658 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4660 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4662 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4665 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4667 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4668 destructor. Don't definde if you don't need it
4669 (processEvents): made static, non-blocking events processing for
4671 (runTime): static method. event loop for xforms
4672 * similar as above for kde and gnome.
4674 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4675 new Pimpl is correct
4676 (runTime): new method calss the real frontends runtime func.
4678 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4680 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4682 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4684 2000-08-16 Juergen Vigna <jug@sad.it>
4686 * src/lyx_gui.C (runTime): added GUII RunTime support.
4688 * src/frontends/Makefile.am:
4689 * src/frontends/GUIRunTime.[Ch]:
4690 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4691 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4692 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4694 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4696 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4697 as this is already set in ${FRONTEND_INCLUDE} if needed.
4699 * configure.in (CPPFLAGS): setting the include dir for the frontend
4700 directory and don't set FRONTEND=xforms for now as this is executed
4703 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4705 * src/frontends/kde/Makefile.am:
4706 * src/frontends/kde/FormUrl.C:
4707 * src/frontends/kde/FormUrl.h:
4708 * src/frontends/kde/formurldialog.h:
4709 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4711 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4713 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4715 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4717 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4720 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4722 * src/WorkArea.C (work_area_handler): more work to get te
4723 FL_KEYBOARD to work with xforms 0.88 too, please test.
4725 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4727 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4729 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4732 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4734 * src/Timeout.h: remove Qt::emit hack.
4736 * several files: changes to allo doc++ compilation
4738 * src/lyxfunc.C (processKeySym): new method
4739 (processKeyEvent): comment out if FL_REVISION < 89
4741 * src/WorkArea.C: change some debugging levels.
4742 (WorkArea): set wantkey to FL_KEY_ALL
4743 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4744 clearer code and the use of compose with XForms 0.89. Change to
4745 use signals instead of calling methods in bufferview directly.
4747 * src/Painter.C: change some debugging levels.
4749 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4752 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4753 (workAreaKeyPress): new method
4755 2000-08-14 Juergen Vigna <jug@sad.it>
4757 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4759 * config/kde.m4: addes some features
4761 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4762 include missing xforms dialogs.
4764 * src/Timeout.h: a hack to be able to compile with qt/kde.
4766 * sigc++/.cvsignore: added acinclude.m4
4768 * lib/.cvsignore: added listerros
4770 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4771 xforms tree as objects are needed for other frontends.
4773 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4774 linking with not yet implemented xforms objects.
4776 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4778 2000-08-14 Baruch Even <baruch.even@writeme.com>
4780 * src/frontends/xforms/FormGraphics.h:
4781 * src/frontends/xforms/FormGraphics.C:
4782 * src/frontends/xforms/RadioButtonGroup.h:
4783 * src/frontends/xforms/RadioButtonGroup.C:
4784 * src/insets/insetgraphics.h:
4785 * src/insets/insetgraphics.C:
4786 * src/insets/insetgraphicsParams.h:
4787 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4788 instead of spaces, and various other indentation issues to make the
4789 sources more consistent.
4791 2000-08-14 Marko Vendelin <markov@ioc.ee>
4793 * src/frontends/gnome/dialogs/diaprint.glade
4794 * src/frontends/gnome/FormPrint.C
4795 * src/frontends/gnome/FormPrint.h
4796 * src/frontends/gnome/diaprint_callbacks.c
4797 * src/frontends/gnome/diaprint_callbacks.h
4798 * src/frontends/gnome/diaprint_interface.c
4799 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4802 * src/frontends/gnome/dialogs/diainserturl.glade
4803 * src/frontends/gnome/FormUrl.C
4804 * src/frontends/gnome/FormUrl.h
4805 * src/frontends/gnome/diainserturl_callbacks.c
4806 * src/frontends/gnome/diainserturl_callbacks.h
4807 * src/frontends/gnome/diainserturl_interface.c
4808 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4809 Gnome implementation
4811 * src/frontends/gnome/Dialogs.C
4812 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4813 all other dialogs. Copy all unimplemented dialogs from Xforms
4816 * src/frontends/gnome/support.c
4817 * src/frontends/gnome/support.h: support files generated by Glade
4821 * config/gnome.m4: Gnome configuration scripts
4823 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4824 configure --help message
4826 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4827 only if there are no events pendling in Gnome/Gtk. This enhances
4828 the performance of menus.
4831 2000-08-14 Allan Rae <rae@lyx.org>
4833 * lib/Makefile.am: listerrors cleaning
4835 * lib/listerrors: removed -- generated file
4836 * acinclude.m4: ditto
4837 * sigc++/acinclude.m4: ditto
4839 * src/frontends/xforms/forms/form_citation.fd:
4840 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4843 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4844 `updatesrc` and now we have a `test` target that does what `updatesrc`
4845 used to do. I didn't like having an install target that wasn't related
4848 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4849 on all except FormGraphics. This may yet happen. Followed by a major
4850 cleanup including using FL_TRANSIENT for most of the dialogs. More
4851 changes to come when the ButtonController below is introduced.
4853 * src/frontends/xforms/ButtonController.h: New file for managing up to
4854 four buttons on a dialog according to an externally defined policy.
4855 * src/frontends/xforms/Makefile.am: added above
4857 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4858 Apply and Cancel/Close buttons and everything in between and beyond.
4859 * src/frontends/Makefile.am: added above.
4861 * src/frontends/xforms/forms/form_preferences.fd:
4862 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4863 and removed variable 'status' as a result. Fixed the set_minsize thing.
4864 Use the new screen-font-update after checking screen fonts were changed
4865 Added a "Restore" button to restore the original lyxrc values while
4866 editing. This restores everything not just the last input changed.
4867 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4869 * src/LyXAction.C: screen-font-update added for updating buffers after
4870 screen font settings have been changed.
4871 * src/commandtags.h: ditto
4872 * src/lyxfunc.C: ditto
4874 * forms/lyx.fd: removed screen fonts dialog.
4875 * src/lyx_gui.C: ditto
4876 * src/menus.[Ch]: ditto
4877 * src/lyx.[Ch]: ditto
4878 * src/lyx_cb.C: ditto + code from here moved to make
4879 screen-font-update. And people wonder why progress on GUII is
4880 slow. Look at how scattered this stuff was! It takes forever
4883 * forms/fdfix.sh: Fixup the spacing after commas.
4884 * forms/makefile: Remove date from generated files. Fewer clashes now.
4885 * forms/bullet_forms.C.patch: included someones handwritten changes
4887 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4888 once I've discovered why LyXRC was made noncopyable.
4889 * src/lyx_main.C: ditto
4891 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4893 * src/frontends/xforms/forms/fdfix.sh:
4894 * src/frontends/xforms/forms/fdfixh.sed:
4895 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4896 * src/frontends/xforms/Form*.[hC]:
4897 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4898 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4899 provide a destructor for the struct FD_form_xxxx. Another version of
4900 the set_[max|min]size workaround and a few other cleanups. Actually,
4901 Angus' patch from 20000809.
4903 2000-08-13 Baruch Even <baruch.even@writeme.com>
4905 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4908 2000-08-11 Juergen Vigna <jug@sad.it>
4910 * src/insets/insetgraphics.C (InsetGraphics): changing init
4911 order because of warnings.
4913 * src/frontends/xforms/forms/makefile: adding patching .C with
4916 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4917 from .C.patch to .c.patch
4919 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4920 order because of warning.
4922 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4924 * src/frontends/Liason.C (setMinibuffer): new helper function
4926 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4928 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4930 * lib/ui/default.ui: commented out PaperLayout entry
4932 * src/frontends/xforms/form_document.[Ch]: new added files
4934 * src/frontends/xforms/FormDocument.[Ch]: ditto
4936 * src/frontends/xforms/forms/form_document.fd: ditto
4938 * src/frontends/xforms/forms/form_document.C.patch: ditto
4940 2000-08-10 Juergen Vigna <jug@sad.it>
4942 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4943 (InsetGraphics): initialized cacheHandle to 0.
4944 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4946 2000-08-10 Baruch Even <baruch.even@writeme.com>
4948 * src/graphics/GraphicsCache.h:
4949 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4950 correctly as a cache.
4952 * src/graphics/GraphicsCacheItem.h:
4953 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4956 * src/graphics/GraphicsCacheItem_pimpl.h:
4957 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4960 * src/insets/insetgraphics.h:
4961 * src/insets/insetgraphics.C: Changed from using a signal notification
4962 to polling when image is not loaded.
4964 2000-08-10 Allan Rae <rae@lyx.org>
4966 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4967 that there are two functions that have to been taken out of line by
4968 hand and aren't taken care of in the script. (Just a reminder note)
4970 * sigc++/macros/*.h.m4: Updated as above.
4972 2000-08-09 Juergen Vigna <jug@sad.it>
4974 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4976 * src/insets/insettabular.C: make drawing of single cell smarter.
4978 2000-08-09 Marko Vendelin <markov@ioc.ee>
4979 * src/frontends/gnome/Menubar_pimpl.C
4980 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4981 implementation: new files
4983 * src/frontends/gnome/mainapp.C
4984 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4987 * src/main.C: create Gnome main window
4989 * src/frontends/xforms/Menubar_pimpl.h
4990 * src/frontends/Menubar.C
4991 * src/frontends/Menubar.h: added method Menubar::update that calls
4992 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4994 * src/LyXView.C: calls Menubar::update to update the state
4997 * src/frontends/gnome/Makefile.am: added new files
4999 * src/frontends/Makefile.am: added frontend compiler options
5001 2000-08-08 Juergen Vigna <jug@sad.it>
5003 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5005 * src/bufferlist.C (close):
5006 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5007 documents if exiting without saving.
5009 * src/buffer.C (save): use removeAutosaveFile()
5011 * src/support/filetools.C (removeAutosaveFile): new function.
5013 * src/lyx_cb.C (MenuWrite): returns a bool now.
5014 (MenuWriteAs): check if file could really be saved and revert to the
5016 (MenuWriteAs): removing old autosavefile if existant.
5018 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5019 before Goto toggle declaration, because of compiler warning.
5021 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5023 * src/lyxfunc.C (MenuNew): small fix.
5025 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5027 * src/bufferlist.C (newFile):
5028 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5030 * src/lyxrc.C: added new_ask_filename tag
5032 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5034 * src/lyx.fd: removed code pertaining to form_ref
5035 * src/lyx.[Ch]: ditto
5036 * src/lyx_cb.C: ditto
5037 * src/lyx_gui.C: ditto
5038 * src/lyx_gui_misc.C: ditto
5040 * src/BufferView_pimpl.C (restorePosition): update buffer only
5043 * src/commandtags.h (LFUN_REFTOGGLE): removed
5044 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5045 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5046 (LFUN_REFBACK): renamed LFUN_REF_BACK
5048 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5049 * src/menus.C: ditto
5050 * src/lyxfunc.C (Dispatch): ditto.
5051 InsertRef dialog is now GUI-independent.
5053 * src/texrow.C: added using std::endl;
5055 * src/insets/insetref.[Ch]: strip out large amounts of code.
5056 The inset is now a container and this functionality is now
5057 managed by a new FormRef dialog
5059 * src/frontends/Dialogs.h (showRef, createRef): new signals
5061 * src/frontends/xforms/FormIndex.[Ch],
5062 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5063 when setting dialog's min/max size
5064 * src/frontends/xforms/FormIndex.[Ch]: ditto
5066 * src/frontends/xforms/FormRef.[Ch],
5067 src/frontends/xforms/forms/form_ref.fd: new xforms
5068 implementation of an InsetRef dialog
5070 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5073 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5074 ios::nocreate is not part of the standard. Removed.
5076 2000-08-07 Baruch Even <baruch.even@writeme.com>
5078 * src/graphics/Renderer.h:
5079 * src/graphics/Renderer.C: Added base class for rendering of different
5080 image formats into Pixmaps.
5082 * src/graphics/XPM_Renderer.h:
5083 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5084 in a different class.
5086 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5087 easily add support for other formats.
5089 * src/insets/figinset.C: plugged a leak of an X resource.
5091 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5093 * src/CutAndPaste.[Ch]: make all metods static.
5095 * development/Code_rules/Rules: more work, added section on
5096 Exceptions, and a References section.
5098 * a lot of header files: work to make doc++ able to generate the
5099 source documentation, some workarounds of doc++ problems. Doc++ is
5100 now able to generate the documentation.
5102 2000-08-07 Juergen Vigna <jug@sad.it>
5104 * src/insets/insettabular.C (recomputeTextInsets): removed function
5106 * src/tabular.C (SetWidthOfMulticolCell):
5108 (calculate_width_of_column_NMC): fixed return value so that it really
5109 only returns true if the column-width has changed (there where
5110 problems with muliticolumn-cells in this column).
5112 2000-08-04 Juergen Vigna <jug@sad.it>
5114 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5115 also on the scrollstatus of the inset.
5116 (workAreaMotionNotify): ditto.
5118 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5120 2000-08-01 Juergen Vigna <jug@sad.it>
5122 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5124 * src/commandtags.h:
5125 * src/LyXAction.C (init):
5126 * src/insets/inset.C (LocalDispatch): added support for
5129 * src/insets/inset.C (scroll): new functions.
5131 * src/insets/insettext.C (removeNewlines): new function.
5132 (SetAutoBreakRows): removes forced newlines in the text of the
5133 paragraph if autoBreakRows is set to false.
5135 * src/tabular.C (Latex): generates a parbox around the cell contents
5138 * src/frontends/xforms/FormTabular.C (local_update): removed
5139 the radio_useparbox button.
5141 * src/tabular.C (UseParbox): new function
5143 2000-08-06 Baruch Even <baruch.even@writeme.com>
5145 * src/graphics/GraphicsCache.h:
5146 * src/graphics/GraphicsCache.C:
5147 * src/graphics/GraphicsCacheItem.h:
5148 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5151 * src/insets/insetgraphics.h:
5152 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5153 and the drawing of the inline image.
5155 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5156 loaded into the wrong position.
5158 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5161 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5163 * src/support/translator.h: move all typedefs to public section
5165 * src/support/filetools.C (MakeLatexName): return string const
5167 (TmpFileName): ditto
5168 (FileOpenSearch): ditto
5170 (LibFileSearch): ditto
5171 (i18nLibFileSearch): ditto
5174 (CreateTmpDir): ditto
5175 (CreateBufferTmpDir): ditto
5176 (CreateLyXTmpDir): ditto
5179 (MakeAbsPath): ditto
5181 (OnlyFilename): ditto
5183 (NormalizePath): ditto
5184 (CleanupPath): ditto
5185 (GetFileContents): ditto
5186 (ReplaceEnvironmentPath): ditto
5187 (MakeRelPath): ditto
5189 (ChangeExtension): ditto
5190 (MakeDisplayPath): ditto
5191 (do_popen): return cmdret const
5192 (findtexfile): return string const
5194 * src/support/DebugStream.h: add some /// to please doc++
5196 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5198 * src/texrow.C (same_rownumber): functor to use with find_if
5199 (getIdFromRow): rewritten to use find_if and to not update the
5200 positions. return true if row is found
5201 (increasePos): new method, use to update positions
5203 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5205 * src/lyxlex_pimpl.C (verifyTable): new method
5208 (GetString): return string const
5209 (pushTable): rewrite to use std::stack
5211 (setFile): better check
5214 * src/lyxlex.h: make LyXLex noncopyable
5216 * src/lyxlex.C (text): return char const * const
5217 (GetString): return string const
5218 (getLongString): return string const
5220 * src/lyx_gui_misc.C (askForText): return pair<...> const
5222 * src/lastfiles.[Ch] (operator): return string const
5224 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5225 istringstream not char const *.
5226 move token.end() out of loop.
5227 (readFile): move initializaton of token
5229 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5230 getIdFromRow is successful.
5232 * lib/bind/emacs.bind: don't include menus bind
5234 * development/Code_rules/Rules: the beginnings of making this
5235 better and covering more of the unwritten rules that we have.
5237 * development/Code_rules/Recommendations: a couple of wording
5240 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5242 * src/support/strerror.c: remove C++ comment.
5244 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5246 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5247 LFUN_INDEX_INSERT_LAST
5249 * src/texrow.C (getIdFromRow): changed from const_iterator to
5250 iterator, allowing code to compile with DEC cxx
5252 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5253 stores part of the class, as suggested by Allan. Will allow
5255 (apply): test to apply uses InsetCommandParams operator!=
5257 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5258 (apply): test to apply uses InsetCommandParams operator!=
5260 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5261 stores part of the class.
5262 (update): removed limits on min/max size.
5264 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5265 (apply): test to apply uses InsetCommandParams operator!=
5267 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5268 (Read, Write, scanCommand, getCommand): moved functionality
5269 into InsetCommandParams.
5271 (getScreenLabel): made pure virtual
5272 new InsetCommandParams operators== and !=
5274 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5275 c-tors based on InsetCommandParams. Removed others.
5276 * src/insets/insetinclude.[Ch]: ditto
5277 * src/insets/insetlabel.[Ch]: ditto
5278 * src/insets/insetparent.[Ch]: ditto
5279 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5281 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5282 insets derived from InsetCommand created using similar c-tors
5283 based on InsetCommandParams
5284 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5285 * src/menus.C (ShowRefsMenu): ditto
5286 * src/paragraph.C (Clone): ditto
5287 * src/text2.C (SetCounter): ditto
5288 * src/lyxfunc.C (Dispatch) ditto
5289 Also recreated old InsetIndex behaviour exactly. Can now
5290 index-insert at the start of a paragraph and index-insert-last
5291 without launching the pop-up.
5293 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * lib/lyxrc.example: mark te pdf options as non functional.
5297 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5298 (isStrDbl): move tmpstr.end() out of loop.
5299 (strToDbl): move intialization of tmpstr
5300 (lowercase): return string const and move tmp.end() out of loop.
5301 (uppercase): return string const and move tmp.edn() out of loop.
5302 (prefixIs): add assertion
5307 (containsOnly): ditto
5308 (containsOnly): ditto
5309 (containsOnly): ditto
5310 (countChar): make last arg char not char const
5311 (token): return string const
5312 (subst): return string const, move tmp.end() out of loop.
5313 (subst): return string const, add assertion
5314 (strip): return string const
5315 (frontStrip): return string const, add assertion
5316 (frontStrip): return string const
5321 * src/support/lstrings.C: add inclde "LAssert.h"
5322 (isStrInt): move tmpstr.end() out of loop.
5324 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5325 toollist.end() out of loop.
5326 (deactivate): move toollist.end() out of loop.
5327 (update): move toollist.end() out of loop.
5328 (updateLayoutList): move tc.end() out of loop.
5329 (add): move toollist.end() out of loop.
5331 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5332 md.end() out of loop.
5334 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5336 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5339 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5340 (Erase): move insetlist.end() out of loop.
5342 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5343 ref to const string as first arg. Move initialization of some
5344 variables, whitespace changes.
5346 * src/kbmap.C (defkey): move table.end() out of loop.
5347 (kb_keymap): move table.end() out of loop.
5348 (findbinding): move table.end() out of loop.
5350 * src/MenuBackend.C (hasMenu): move end() out of loop.
5351 (getMenu): move end() out of loop.
5352 (getMenu): move menulist_.end() out of loop.
5354 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5356 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5359 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5360 (getFromLyXName): move infotab.end() out of loop.
5362 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5363 -fvtable-thunks -ffunction-sections -fdata-sections
5365 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5367 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5370 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5372 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5374 * src/frontends/xforms/FormCitation.[Ch],
5375 src/frontends/xforms/FormIndex.[Ch],
5376 src/frontends/xforms/FormToc.[Ch],
5377 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5379 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5381 * src/commandtags.h: renamed, created some flags for citation
5384 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5386 * src/lyxfunc.C (dispatch): use signals to insert index entry
5388 * src/frontends/Dialogs.h: new signal createIndex
5390 * src/frontends/xforms/FormCommand.[Ch],
5391 src/frontends/xforms/FormCitation.[Ch],
5392 src/frontends/xforms/FormToc.[Ch],
5393 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5395 * src/insets/insetindex.[Ch]: GUI-independent
5397 * src/frontends/xforms/FormIndex.[Ch],
5398 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5401 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5403 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5404 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5406 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5408 * src/insets/insetref.C (Latex): rewrite so that there is now
5409 question that a initialization is requested.
5411 * src/insets/insetcommand.h: reenable the hide signal
5413 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5415 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5416 fix handling of shortcuts (many bugs :)
5417 (add_lastfiles): ditto.
5419 * lib/ui/default.ui: fix a few shortcuts.
5421 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5423 * Makefile.am: Fix ``rpmdist'' target to return the exit
5424 status of the ``rpm'' command, instead of the last command in
5425 the chain (the ``rm lyx.xpm'' command, which always returns
5428 2000-08-02 Allan Rae <rae@lyx.org>
5430 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5431 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5432 * src/frontends/xforms/FormToc.C (FormToc): ditto
5434 * src/frontends/xforms/Makefile.am: A few forgotten files
5436 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5437 Signals-not-copyable-problem Lars' started commenting out.
5439 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5441 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * src/insets/insetcommand.h: Signals is not copyable so anoter
5444 scheme for automatic hiding of forms must be used.
5446 * src/frontends/xforms/FormCitation.h: don't inerit from
5447 noncopyable, FormCommand already does that.
5448 * src/frontends/xforms/FormToc.h: ditto
5449 * src/frontends/xforms/FormUrl.h: ditto
5451 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5453 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5455 * src/insets/insetcommand.h (hide): new SigC::Signal0
5456 (d-tor) new virtual destructor emits hide signal
5458 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5459 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5461 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5462 LOF and LOT. Inset is now GUI-independent
5464 * src/insets/insetloa.[Ch]: redundant
5465 * src/insets/insetlof.[Ch]: ditto
5466 * src/insets/insetlot.[Ch]: ditto
5468 * src/frontends/xforms/forms/form_url.fd: tweaked!
5469 * src/frontends/xforms/forms/form_citation.fd: ditto
5471 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5472 dialogs dealing with InsetCommand insets
5474 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5475 FormCommand base class
5476 * src/frontends/xforms/FormUrl.[Ch]: ditto
5478 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5480 * src/frontends/xforms/FormToc.[Ch]: ditto
5482 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5483 passed a generic InsetCommand pointer
5484 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5486 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5487 and modified InsetTOC class
5488 * src/buffer.C: ditto
5490 * forms/lyx.fd: strip out old FD_form_toc code
5491 * src/lyx_gui_misc.C: ditto
5492 * src/lyx_gui.C: ditto
5493 * src/lyx_cb.C: ditto
5494 * src/lyx.[Ch]: ditto
5496 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5498 * src/support/utility.hpp: tr -d '\r'
5500 2000-08-01 Juergen Vigna <jug@sad.it>
5502 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5504 * src/commandtags.h:
5505 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5506 LFUN_TABULAR_FEATURES.
5508 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5509 LFUN_LAYOUT_TABULAR.
5511 * src/insets/insettabular.C (getStatus): implemented helper function.
5513 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5515 2000-07-31 Juergen Vigna <jug@sad.it>
5517 * src/text.C (draw): fixed screen update problem for text-insets.
5519 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5520 something changed probably this has to be added in various other
5523 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5525 2000-07-31 Baruch Even <baruch.even@writeme.com>
5527 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5528 templates to satisfy compaq cxx.
5531 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5533 * src/support/translator.h (equal_1st_in_pair::operator()): take
5534 const ref pair_type as arg.
5535 (equal_2nd_in_pair::operator()): ditto
5536 (Translator::~Translator): remove empty d-tor.
5538 * src/graphics/GraphicsCache.C: move include config.h to top, also
5539 put initialization of GraphicsCache::singleton here.
5540 (~GraphicsCache): move here
5541 (addFile): take const ref as arg
5544 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5546 * src/BufferView2.C (insertLyXFile): change te with/without header
5549 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/frontends/xforms/FormGraphics.C (apply): add some
5552 static_cast. Not very nice, but required by compaq cxx.
5554 * src/frontends/xforms/RadioButtonGroup.h: include header
5555 <utility> instead of <pair.h>
5557 * src/insets/insetgraphicsParams.C: add using directive.
5558 (readResize): change return type to void.
5559 (readOrigin): ditto.
5561 * src/lyxfunc.C (getStatus): add missing break for build-program
5562 function; add test for Literate for export functions.
5564 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5565 entries in Options menu.
5567 2000-07-31 Baruch Even <baruch.even@writeme.com>
5569 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5570 protect against auto-allocation; release icon when needed.
5572 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5574 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5575 on usual typewriter.
5577 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5578 earlier czech.kmap), useful only for programming.
5580 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5582 * src/frontends/xforms/FormCitation.h: fix conditioning around
5585 2000-07-31 Juergen Vigna <jug@sad.it>
5587 * src/frontends/xforms/FormTabular.C (local_update): changed
5588 radio_linebreaks to radio_useparbox and added radio_useminipage.
5590 * src/tabular.C: made support for using minipages/parboxes.
5592 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5594 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5596 (descent): so the cursor is in the middle.
5597 (width): bit smaller box.
5599 * src/insets/insetgraphics.h: added display() function.
5601 2000-07-31 Baruch Even <baruch.even@writeme.com>
5603 * src/frontends/Dialogs.h: Added showGraphics signals.
5605 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5606 xforms form definition of the graphics dialog.
5608 * src/frontends/xforms/FormGraphics.h:
5609 * src/frontends/xforms/FormGraphics.C: Added files, the
5610 GUIndependent code of InsetGraphics
5612 * src/insets/insetgraphics.h:
5613 * src/insets/insetgraphics.C: Major writing to make it work.
5615 * src/insets/insetgraphicsParams.h:
5616 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5617 struct between InsetGraphics and GUI.
5619 * src/LaTeXFeatures.h:
5620 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5621 support for graphicx package.
5623 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5624 for the graphics inset.
5626 * src/support/translator.h: Added file, used in
5627 InsetGraphicsParams. this is a template to translate between two
5630 * src/frontends/xforms/RadioButtonGroup.h:
5631 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5632 way to easily control a radio button group.
5634 2000-07-28 Juergen Vigna <jug@sad.it>
5636 * src/insets/insettabular.C (LocalDispatch):
5637 (TabularFeatures): added support for lyx-functions of tabular features.
5638 (cellstart): refixed this function after someone wrongly changed it.
5640 * src/commandtags.h:
5641 * src/LyXAction.C (init): added support for tabular-features
5643 2000-07-28 Allan Rae <rae@lyx.org>
5645 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5646 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5647 triggers the callback for input checking. As a result we sometimes get
5648 "LyX: This shouldn't happen..." printed to cerr.
5649 (input): Started using status variable since I only free() on
5650 destruction. Some input checking for paths and font sizes.
5652 * src/frontends/xforms/FormPreferences.h: Use status to control
5653 activation of Ok and Apply
5655 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5656 callback. Also resized to stop segfaults with 0.88. The problem is
5657 that xforms-0.88 requires the folder to be wide enough to fit all the
5658 tabs. If it isn't it causes all sorts of problems.
5660 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5662 * src/frontends/xforms/forms/README: Reflect reality.
5664 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5665 * src/frontends/xforms/forms/makefile: ditto.
5667 * src/commandtags.h: Get access to new Preferences dialog
5668 * src/LyXAction.C: ditto
5669 * src/lyxfunc.C: ditto
5670 * lib/ui/default.ui: ditto
5672 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5674 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5676 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5679 * src/frontends/xforms/form_url.[Ch]: added.
5681 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5683 * src/insets/insetbib.h: fixed bug in previous commit
5685 * src/frontends/xforms/FormUrl.h: ditto
5687 * src/frontends/xforms/FormPrint.h: ditto
5689 * src/frontends/xforms/FormPreferences.h: ditto
5691 * src/frontends/xforms/FormCopyright.h: ditto
5693 * src/frontends/xforms/FormCitation.C: ditto
5695 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5696 private copyconstructor and private default contructor
5698 * src/support/Makefile.am: add utility.hpp
5700 * src/support/utility.hpp: new file from boost
5702 * src/insets/insetbib.h: set owner in clone
5704 * src/frontends/xforms/FormCitation.C: added missing include
5707 * src/insets/form_url.[Ch]: removed
5709 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5711 * development/lyx.spec.in
5712 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5713 file/directory re-organization.
5715 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5717 * src/insets/insetcommand.[Ch]: moved the string data and
5718 associated manipulation methods into a new stand-alone class
5719 InsetCommandParams. This class has two additional methods
5720 getAsString() and setFromString() allowing the contents to be
5721 moved around as a single string.
5722 (addContents) method removed.
5723 (setContents) method no longer virtual.
5725 * src/buffer.C (readInset): made use of new InsetCitation,
5726 InsetUrl constructors based on InsetCommandParams.
5728 * src/commandtags.h: add LFUN_INSERT_URL
5730 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5731 independent InsetUrl and use InsetCommandParams to extract
5732 string info and create new Insets.
5734 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5736 * src/frontends/xforms/FormCitation.C (apply): uses
5739 * src/frontends/xforms/form_url.C
5740 * src/frontends/xforms/form_url.h
5741 * src/frontends/xforms/FormUrl.h
5742 * src/frontends/xforms/FormUrl.C
5743 * src/frontends/xforms/forms/form_url.fd: new files
5745 * src/insets/insetcite.[Ch]: removed unused constructors.
5747 * src/insets/insetinclude.[Ch]: no longer store filename
5749 * src/insets/inseturl.[Ch]: GUI-independent.
5751 2000-07-26 Juergen Vigna <jug@sad.it>
5752 * renamed frontend from gtk to gnome as it is that what is realized
5753 and did the necessary changes in the files.
5755 2000-07-26 Marko Vendelin <markov@ioc.ee>
5757 * configure.in: cleaning up gnome configuration scripts
5759 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5761 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5762 shortcuts syndrom by redrawing them explicitely (a better solution
5763 would be appreciated).
5765 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5767 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5770 * src/lyx_cb.C (MenuExport): change html export to do the right
5771 thing depending of the document type (instead of having
5772 html-linuxdoc and html-docbook).
5773 * src/lyxfunc.C (getStatus): update for html
5774 * lib/ui/default.ui: simplify due to the above change.
5775 * src/menus.C (ShowFileMenu): update too (in case we need it).
5777 * src/MenuBackend.C (read): if a menu is defined twice, add the
5778 new entries to the exiting one.
5780 2000-07-26 Juergen Vigna <jug@sad.it>
5782 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5784 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5785 and return a bool if it did actual save the file.
5786 (AutoSave): don't autosave a unnamed doc.
5788 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5789 check if this is an UNNAMED new file and react to it.
5790 (newFile): set buffer to unnamed and change to not mark a new
5791 buffer dirty if I didn't do anything with it.
5793 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5795 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5797 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5798 friend as per Angus's patch posted to lyx-devel.
5800 * src/ext_l10n.h: updated
5802 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5803 gettext on the style string right before inserting them into the
5806 * autogen.sh: add code to extract style strings form layout files,
5807 not good enough yet.
5809 * src/frontends/gtk/.cvsignore: add MAKEFILE
5811 * src/MenuBackend.C (read): run the label strings through gettext
5812 before storing them in the containers.
5814 * src/ext_l10n.h: new file
5816 * autogen.sh : generate the ext_l10n.h file here
5818 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5820 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5823 * lib/ui/default.ui: fix a couple of typos.
5825 * config/gnome/gtk.m4: added (and added to the list of files in
5828 * src/insets/insetinclude.C (unique_id): fix when we are using
5829 lyxstring instead of basic_string<>.
5830 * src/insets/insettext.C (LocalDispatch): ditto.
5831 * src/support/filetools.C: ditto.
5833 * lib/configure.m4: create the ui/ directory if necessary.
5835 * src/LyXView.[Ch] (updateToolbar): new method.
5837 * src/BufferView_pimpl.C (buffer): update the toolbar when
5838 opening/closing buffer.
5840 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5842 * src/LyXAction.C (getActionName): enhance to return also the name
5843 and options of pseudo-actions.
5844 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5846 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5847 as an example of what is possible). Used in File->Build too (more
5848 useful) and in the import/export menus (to mimick the complicated
5849 handling of linuxdoc and friends). Try to update all the entries.
5851 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5854 * src/MenuBackend.C (read): Parse the new OptItem tag.
5856 * src/MenuBackend.h: Add a new optional_ data member (used if the
5857 entry should be omitted when the lyxfunc is disabled).
5859 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5860 function, used as a shortcut.
5861 (create_submenu): align correctly the shortcuts on the widest
5864 * src/MenuBackend.h: MenuItem.label() only returns the label of
5865 the menu without shortcut; new method shortcut().
5867 2000-07-14 Marko Vendelin <markov@ioc.ee>
5869 * src/frontends/gtk/Dialogs.C:
5870 * src/frontends/gtk/FormCopyright.C:
5871 * src/frontends/gtk/FormCopyright.h:
5872 * src/frontends/gtk/Makefile.am: added these source-files for the
5873 Gtk/Gnome support of the Copyright-Dialog.
5875 * src/main.C: added Gnome::Main initialization if using
5876 Gtk/Gnome frontend-GUI.
5878 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5880 * config/gnome/aclocal-include.m4
5881 * config/gnome/compiler-flags.m4
5882 * config/gnome/curses.m4
5883 * config/gnome/gnome--.m4
5884 * config/gnome/gnome-bonobo-check.m4
5885 * config/gnome/gnome-common.m4
5886 * config/gnome/gnome-fileutils.m4
5887 * config/gnome/gnome-ghttp-check.m4
5888 * config/gnome/gnome-gnorba-check.m4
5889 * config/gnome/gnome-guile-checks.m4
5890 * config/gnome/gnome-libgtop-check.m4
5891 * config/gnome/gnome-objc-checks.m4
5892 * config/gnome/gnome-orbit-check.m4
5893 * config/gnome/gnome-print-check.m4
5894 * config/gnome/gnome-pthread-check.m4
5895 * config/gnome/gnome-support.m4
5896 * config/gnome/gnome-undelfs.m4
5897 * config/gnome/gnome-vfs.m4
5898 * config/gnome/gnome-x-checks.m4
5899 * config/gnome/gnome-xml-check.m4
5900 * config/gnome/gnome.m4
5901 * config/gnome/gperf-check.m4
5902 * config/gnome/gtk--.m4
5903 * config/gnome/linger.m4
5904 * config/gnome/need-declaration.m4: added configuration scripts
5905 for Gtk/Gnome frontend-GUI
5907 * configure.in: added support for the --with-frontend=gtk option
5909 * autogen.sh: added config/gnome/* to list of config-files
5911 * acconfig.h: added define for GTKGUI-support
5913 * config/lyxinclude.m4: added --with-frontend[=value] option value
5914 for Gtk/Gnome frontend-GUI support.
5916 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5918 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5922 * src/paragraph.C (GetChar): remove non-const version
5924 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5925 (search_kw): use it.
5927 * src/lyx_main.C (init): if "preferences" exist, read that instead
5929 (ReadRcFile): return bool if the file could be read ok.
5930 (ReadUIFile): add a check to see if lex file is set ok.
5932 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5933 bastring can be used instead of lyxstring (still uses the old code
5934 if std::string is good enough or if lyxstring is used.)
5936 * src/encoding.C: make the arrays static, move ininle functions
5938 * src/encoding.h: from here.
5940 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5941 (parseSingleLyXformat2Token): move inset parsing to separate method
5942 (readInset): new private method
5944 * src/Variables.h: remove virtual from get().
5946 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5947 access to NEW_INSETS and NEW_TABULAR
5949 * src/MenuBackend.h: remove superfluous forward declaration of
5950 MenuItem. Add documentations tags "///", remove empty MenuItem
5951 destructor, remove private default contructor.
5953 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5955 (read): more string mlabel and mname to where they are used
5956 (read): remove unused variables mlabel and mname
5957 (defaults): unconditional clear, make menusetup take advantage of
5958 add returning Menu &.
5960 * src/LyXView.h: define NEW_MENUBAR as default
5962 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5963 to NEW_INSETS and NEW_TABULAR.
5964 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5965 defined. Change some of the "xxxx-inset-insert" functions names to
5968 * several files: more enahncements to NEW_INSETS and the resulting
5971 * lib/lyxrc.example (\date_insert_format): move to misc section
5973 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5974 bastring and use AC_CACHE_CHECK.
5975 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5976 the system have the newest methods. uses AC_CACHE_CHECK
5977 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5978 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5979 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5981 * configure.in: add LYX_CXX_GOOD_STD_STRING
5983 * acinclude.m4: recreated
5985 2000-07-24 Amir Karger <karger@lyx.org>
5987 * README: add Hebrew, Arabic kmaps
5990 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5992 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5995 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5997 * Lot of files: add pragma interface/implementation.
5999 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6001 * lib/ui/default.ui: new file (ans new directory). Contains the
6002 default menu and toolbar.
6004 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6005 global space. Toolbars are now read (as menus) in ui files.
6007 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6009 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6010 is disabled because the document is read-only. We want to have the
6011 toggle state of the function anyway.
6012 (getStatus): add code for LFUN_VC* functions (mimicking what is
6013 done in old-style menus)
6015 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6016 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6018 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6019 * src/BufferView_pimpl.C: ditto.
6020 * src/lyxfunc.C: ditto.
6022 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6023 default). This replaces old-style menus by new ones.
6025 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6026 MenuItem. Contain the data structure of a menu.
6028 * src/insets/insettext.C: use LyXView::setLayout instead of
6029 accessing directly the toolbar combox.
6030 * src/lyxfunc.C (Dispatch): ditto.
6032 * src/LyXView.C (setLayout): new method, which just calls
6033 Toolbar::setLayout().
6034 (updateLayoutChoice): move part of this method in Toolbar.
6036 * src/toolbar.[Ch]: removed.
6038 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6039 implementation the toolbar.
6041 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6042 the toolbar. It might make sense to merge it with ToolbarDefaults
6044 (setLayout): new function.
6045 (updateLayoutList): ditto.
6046 (openLayoutList): ditto.
6048 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6049 xforms implementation of the toolbar.
6050 (get_toolbar_func): comment out, since I do not
6051 know what it is good for.
6053 * src/ToolbarDefaults.h: Add the ItemType enum.
6055 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6056 for a list of allocated C strings. Used in Menubar xforms
6057 implementation to avoid memory leaks.
6059 * src/support/lstrings.[Ch] (uppercase): new version taking and
6063 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6064 * lib/bind/emacs.bind: ditto.
6066 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6068 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6069 forward decl of LyXView.
6071 * src/toolbar.C (toolbarItem): moved from toolbar.h
6072 (toolbarItem::clean): ditto
6073 (toolbarItem::~toolbarItem): ditto
6074 (toolbarItem::operator): ditto
6076 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6078 * src/paragraph.h: control the NEW_TABULAR define from here
6080 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6081 USE_TABULAR_INSETS to NEW_TABULAR
6083 * src/ToolbarDefaults.C: add include "lyxlex.h"
6085 * files using the old table/tabular: use NEW_TABULAR to control
6086 compilation of old tabular stuff.
6088 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6091 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6092 planemet in reading of old style floats, fix the \end_deeper
6093 problem when reading old style floats.
6095 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6097 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6099 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6101 * lib/bind/sciword.bind: updated.
6103 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6105 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6106 layout write problem
6108 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6110 * src/Makefile.am (INCLUDES): remove image directory from include
6113 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6114 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6116 * src/LyXView.C (create_form_form_main): read the application icon
6119 * lib/images/*.xpm: change the icons to use transparent color for
6122 * src/toolbar.C (update): change the color of the button when it
6125 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6127 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6128 setting explicitely the minibuffer.
6129 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6131 * src/LyXView.C (showState): new function. Shows font information
6132 in minibuffer and update toolbar state.
6133 (LyXView): call Toolbar::update after creating the
6136 * src/toolbar.C: change toollist to be a vector instead of a
6138 (BubbleTimerCB): get help string directly from the callback
6139 argument of the corresponding icon (which is the action)
6140 (set): remove unnecessary ugliness.
6141 (update): new function. update the icons (depressed, disabled)
6142 depending of the status of the corresponding action.
6144 * src/toolbar.h: remove help in toolbarItem
6146 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6148 * src/Painter.C (text): Added code for using symbol glyphs from
6149 iso10646 fonts. Currently diabled.
6151 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6154 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6155 magyar,turkish and usorbian.
6157 * src/paragraph.C (isMultiLingual): Made more efficient.
6159 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6162 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6163 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6164 Also changed the prototype to "bool math_insert_greek(char)".
6166 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6168 * lots of files: apply the NEW_INSETS on all code that will not be
6169 needed when we move to use the new insets. Enable the define in
6170 lyxparagrah.h to try it.
6172 * src/insets/insettabular.C (cellstart): change to be a static
6174 (InsetTabular): initialize buffer in the initializer list.
6176 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6178 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6179 form_print.h out of the header file. Replaced with forward
6180 declarations of the relevant struct.
6182 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6185 * src/commandtags.h: do not include "debug.h" which does not
6186 belong there. #include it in some other places because of this
6189 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * src/insets/insetcaption.C: add a couple "using" directives.
6193 * src/toolbar.C (add): get the help text directly from lyxaction.
6195 (setPixmap): new function. Loads from disk and sets a pixmap on a
6196 botton; the name of the pixmap file is derived from the command
6199 * src/toolbar.h: remove members isBitmap and pixmap from
6202 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6203 * lib/images/: move many files from images/banner.xpm.
6205 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6207 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6208 * src/toolbar.C: ditto.
6209 * configure.in: ditto.
6210 * INSTALL: document.
6212 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6213 the spellchecker popup is closed from the WM.
6215 2000-07-19 Juergen Vigna <jug@sad.it>
6217 * src/insets/insetfloat.C (Write): small fix because we use the
6218 insetname for the type now!
6220 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6222 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6225 * src/frontends/Dialogs.h: removed hideCitation signal
6227 * src/insets/insetcite.h: added hide signal
6229 * src/insets/insetcite.C (~InsetCitation): emits new signal
6230 (getScreenLabel): "intelligent" label should now fit on the screen!
6232 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6234 * src/frontends/xforms/FormCitation.C (showInset): connects
6235 hide() to the inset's hide signal
6236 (show): modified to use fl_set_object_position rather than
6237 fl_set_object_geometry wherever possible
6239 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6241 * src/insets/lyxinset.h: add caption code
6243 * src/insets/insetfloat.C (type): new method
6245 * src/insets/insetcaption.C (Write): new method
6247 (LyxCode): new method
6249 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6250 to get it right together with using the FloatList.
6252 * src/commandtags.h: add LFUN_INSET_CAPTION
6253 * src/lyxfunc.C (Dispatch): handle it
6255 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6258 * src/Variables.[Ch]: make expand take a const reference, remove
6259 the destructor, some whitespace changes.
6261 * src/LyXAction.C (init): add caption-inset-insert
6263 * src/FloatList.C (FloatList): update the default floats a bit.
6265 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6267 * src/Variables.[Ch]: new files. Intended to be used for language
6268 specific strings (like \chaptername) and filename substitution in
6271 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6273 * lib/kbd/american.kmap: update
6275 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6277 * src/bufferparams.[Ch]: remove member allowAccents.
6279 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6281 * src/LaTeXLog.C: use the log_form.h header.
6282 * src/lyx_gui.C: ditto.
6283 * src/lyx_gui_misc.C: ditto.
6284 * src/lyxvc.h: ditto.
6286 * forms/log_form.fd: new file, created from latexoptions.fd. I
6287 kept the log popup and nuked the options form.
6289 * src/{la,}texoptions.[Ch]: removed.
6290 * src/lyx_cb.C (LaTeXOptions): ditto
6292 * src/lyx_gui.C (create_forms): do not handle the
6293 fd_latex_options form.
6295 2000-07-18 Juergen Vigna <jug@sad.it>
6297 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6298 name of the inset so that it can be requested outside (text2.C).
6300 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6303 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6305 * src/mathed/formula.h (ConvertFont): constify
6307 * src/mathed/formula.C (Read): add warning if \end_inset is not
6308 found on expected place.
6310 * src/insets/lyxinset.h (ConvertFont): consify
6312 * src/insets/insetquotes.C (ConvertFont): constify
6313 * src/insets/insetquotes.h: ditto
6315 * src/insets/insetinfo.h: add labelfont
6317 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6318 (ascent): use labelfont
6322 (Write): make .lyx file a bit nicer
6324 * src/insets/insetfloat.C (Write): simplify somewhat...
6325 (Read): add warning if arg is not found
6327 * src/insets/insetcollapsable.C: add using std::max
6328 (Read): move string token and add warning in arg is not found
6329 (draw): use std::max to get the right ty
6330 (getMaxWidth): simplify by using std::max
6332 * src/insets/insetsection.h: new file
6333 * src/insets/insetsection.C: new file
6334 * src/insets/insetcaption.h: new file
6335 * src/insets/insetcaption.C: new file
6337 * src/insets/inset.C (ConvertFont): constify signature
6339 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6340 insetcaption.[Ch] and insetsection.[Ch]
6342 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6343 uses to use LABEL_COUNTER_CHAPTER instead.
6344 * src/text2.C (SetCounter): here
6346 * src/counters.h: new file
6347 * src/counters.C: new file
6348 * src/Sectioning.h: new file
6349 * src/Sectioning.C: new file
6351 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6353 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6355 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6358 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6361 2000-07-17 Juergen Vigna <jug@sad.it>
6363 * src/tabular.C (Validate): check if array-package is needed.
6364 (SetVAlignment): added support for vertical alignment.
6365 (SetLTFoot): better support for longtable header/footers
6366 (Latex): modified to support added features.
6368 * src/LaTeXFeatures.[Ch]: added array-package.
6370 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6372 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6375 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6377 * configure.in: do not forget to put a space after -isystem.
6379 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6381 * lib/kbd/arabic.kmap: a few fixes.
6383 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6385 * some whitespace chagnes to a number of files.
6387 * src/support/DebugStream.h: change to make it easier for
6388 doc++ to parse correctly.
6389 * src/support/lyxstring.h: ditto
6391 * src/mathed/math_utils.C (compara): change to have only one
6393 (MathedLookupBOP): change because of the above.
6395 * src/mathed/math_delim.C (math_deco_compare): change to have only
6397 (search_deco): change becasue of the above.
6399 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6400 instead of manually coded one.
6402 * src/insets/insetquotes.C (Read): read the \end_inset too
6404 * src/insets/insetlatex.h: remove file
6405 * src/insets/insetlatex.C: remove file
6407 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6409 (InsetPrintIndex): remove destructor
6411 * src/insets/insetinclude.h: remove default constructor
6413 * src/insets/insetfloat.C: work to make it work better
6415 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6417 * src/insets/insetcite.h (InsetCitation): remove default constructor
6419 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6421 * src/text.C (GetColumnNearX): comment out some currently unused code.
6423 * src/paragraph.C (writeFile): move some initializations closer to
6425 (CutIntoMinibuffer): small change to use new matchIT operator
6429 (InsertInset): ditto
6432 (InsetIterator): ditto
6433 (Erase): small change to use new matchFT operator
6435 (GetFontSettings): ditto
6436 (HighestFontInRange): ditto
6439 * src/lyxparagraph.h: some chars changed to value_type
6440 (matchIT): because of some stronger checking (perhaps too strong)
6441 in SGI STL, the two operator() unified to one.
6444 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6446 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6447 the last inset read added
6448 (parseSingleLyXformat2Token): some more (future) compability code added
6449 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6450 (parseSingleLyXformat2Token): set last_inset_read
6451 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6452 (parseSingleLyXformat2Token): don't double intializw string next_token
6454 * src/TextCache.C (text_fits::operator()): add const's to the signature
6455 (has_buffer::operator()): ditto
6457 * src/Floating.h: add some comments on the class
6459 * src/FloatList.[Ch] (typeExist): new method
6462 * src/BackStack.h: added default constructor, wanted by Gcc.
6464 2000-07-14 Juergen Vigna <jug@sad.it>
6466 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6468 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6470 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6471 do a redraw when the window is resized!
6472 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6474 * src/insets/insettext.C (resizeLyXText): added function to correctly
6475 being able to resize the LyXWindow.
6477 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6479 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6481 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6482 crashes when closing dialog to a deleted inset.
6484 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6485 method! Now similar to other insets.
6487 2000-07-13 Juergen Vigna <jug@sad.it>
6489 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6491 * lib/examples/Literate.lyx: small patch!
6493 * src/insets/insetbib.C (Read): added this function because of wrong
6494 Write (without [begin|end]_inset).
6496 2000-07-11 Juergen Vigna <jug@sad.it>
6498 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6499 as the insertInset could not be good!
6501 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6502 the bool param should not be last.
6504 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6506 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6507 did submit that to Karl).
6509 * configure.in: use -isystem instead of -I for X headers. This
6510 fixes a problem on solaris with a recent gcc;
6511 put the front-end code after the X detection code;
6512 configure in sigc++ before lib/
6514 * src/lyx_main.C (commandLineHelp): remove -display from command
6517 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6519 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6520 Also put in Makefile rules for building the ``listerrors''
6521 program for parsing errors from literate programs written in LyX.
6523 * lib/build-listerrors: Added small shell script as part of compile
6524 process. This builds a working ``listerrors'' binary if noweb is
6525 installed and either 1) the VNC X server is installed on the machine,
6526 or 2) the user is compiling from within a GUI. The existence of a GUI
6527 is necessary to use the ``lyx --export'' feature for now. This
6528 hack can be removed once ``lyx --export'' no longer requires a GUI to
6531 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6533 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6534 now passed back correctly from gcc and placed "under" error
6535 buttons in a Literate LyX source.
6537 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6539 * src/text.C (GetColumnNearX): Better behavior when a RTL
6540 paragraph is ended by LTR text.
6542 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6545 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6547 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6548 true when clipboard is empty.
6550 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6552 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6553 row of the paragraph.
6554 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6555 to prevent calculation of bidi tables
6557 2000-07-07 Juergen Vigna <jug@sad.it>
6559 * src/screen.C (ToggleSelection): added y_offset and x_offset
6562 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6565 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6567 * src/insets/insettext.C: fixed Layout-Display!
6569 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6571 * configure.in: add check for strings.h header.
6573 * src/spellchecker.C: include <strings.h> in order to have a
6574 definition for bzero().
6576 2000-07-07 Juergen Vigna <jug@sad.it>
6578 * src/insets/insettext.C (draw): set the status of the bv->text to
6579 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6581 * src/screen.C (DrawOneRow):
6582 (DrawFromTo): redraw the actual row if something has changed in it
6585 * src/text.C (draw): call an update of the toplevel-inset if something
6586 has changed inside while drawing.
6588 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6590 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6592 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6593 processing inside class.
6595 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6596 processing inside class.
6598 * src/insets/insetindex.h new struct Holder, consistent with other
6601 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6602 citation dialog from main code and placed it in src/frontends/xforms.
6603 Dialog launched through signals instead of callbacks
6605 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6607 * lyx.man: update the options description.
6609 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6611 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6612 handle neg values, set min width to 590, add doc about -display
6614 2000-07-05 Juergen Vigna <jug@sad.it>
6616 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6617 calls to BufferView *.
6619 * src/insets/insettext.C (checkAndActivateInset): small fix non
6620 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6622 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6623 their \end_inset token!
6625 2000-07-04 edscott <edscott@imp.mx>
6627 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6628 lib/lyxrc.example: added option \wheel_jump
6630 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6632 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6633 remove support for -width,-height,-xpos and -ypos.
6635 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6637 * src/encoding.[Ch]: New files.
6639 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6640 (text): Call to the underline() method only when needed.
6642 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6644 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6645 encoding(s) for the document.
6647 * src/bufferparams.C (BufferParams): Changed default value of
6650 * src/language.C (newLang): Removed.
6651 (items[]): Added encoding information for all defined languages.
6653 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6654 encoding choice button.
6656 * src/lyxrc.h (font_norm_type): New member variable.
6657 (set_font_norm_type): New method.
6659 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6660 paragraphs with different encodings.
6662 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6663 (TransformChar): Changed to work correctly with Arabic points.
6664 (draw): Added support for drawing Arabic points.
6665 (draw): Removed code for drawing underbars (this is done by
6668 * src/support/textutils.h (IsPrintableNonspace): New function.
6670 * src/BufferView_pimpl.h: Added "using SigC::Object".
6671 * src/LyXView.h: ditto.
6673 * src/insets/insetinclude.h (include_label): Changed to mutable.
6675 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6677 * src/mathed/math_iter.h: remove empty destructor
6679 * src/mathed/math_cursor.h: remove empty destructor
6681 * src/insets/lyxinset.h: add THEOREM_CODE
6683 * src/insets/insettheorem.[Ch]: new files
6685 * src/insets/insetminipage.C: (InsertInset): remove
6687 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6689 (InsertInset): remove
6691 * src/insets/insetlist.C: (InsertList): remove
6693 * src/insets/insetfootlike.[Ch]: new files
6695 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6698 (InsertInset): ditto
6700 * src/insets/insetert.C: remove include Painter.h, reindent
6701 (InsertInset): move to header
6703 * src/insets/insetcollapsable.h: remove explicit from default
6704 contructor, remove empty destructor, add InsertInset
6706 * src/insets/insetcollapsable.C (InsertInset): new func
6708 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6710 * src/vspace.h: add explicit to constructor
6712 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6713 \textcompwordmark, please test this.
6715 * src/lyxrc.C: set ascii_linelen to 65 by default
6717 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6719 * src/commandtags.h: add LFUN_INSET_THEOREM
6721 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6722 (makeLinuxDocFile): remove _some_ of the nice logic
6723 (makeDocBookFile): ditto
6725 * src/Painter.[Ch]: (~Painter): removed
6727 * src/LyXAction.C (init): entry for insettheorem added
6729 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6731 (deplog): code to detect files generated by LaTeX, needs testing
6734 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6736 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6738 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6740 * src/LaTeX.C (deplog): Add a check for files that are going to be
6741 created by the first latex run, part of the project to remove the
6744 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6745 contents to the extension list.
6747 2000-07-04 Juergen Vigna <jug@sad.it>
6749 * src/text.C (NextBreakPoint): added support for needFullRow()
6751 * src/insets/lyxinset.h: added needFullRow()
6753 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6756 * src/insets/insettext.C: lots of changes for update!
6758 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6760 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6762 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6764 * src/insets/insetinclude.C (InsetInclude): fixed
6765 initialization of include_label.
6766 (unique_id): now returns a string.
6768 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6770 * src/LaTeXFeatures.h: new member IncludedFiles, for
6771 a map of key, included file name.
6773 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6774 with the included files for inclusion in SGML preamble,
6775 i. e., linuxdoc and docbook.
6778 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6779 nice (is the generated linuxdoc code to be exported?), that
6780 allows to remove column, and only_body that will be true for
6781 slave documents. Insets are allowed inside SGML font type.
6782 New handling of the SGML preamble for included files.
6783 (makeDocBookFile): the same for docbook.
6785 * src/insets/insetinclude.h:
6786 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6788 (DocBook): new export methods.
6790 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6791 and makeDocBookFile.
6793 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6794 formats to export with command line argument -x.
6796 2000-06-29 Juergen Vigna <jug@sad.it>
6798 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6799 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6801 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6802 region could already been cleared by an inset!
6804 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6806 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6809 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6811 (cursorToggle): remove special handling of lyx focus.
6813 2000-06-28 Juergen Vigna <jug@sad.it>
6815 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6818 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6820 * src/insets/insetindex.C (Edit): add a callback when popup is
6823 * src/insets/insettext.C (LocalDispatch):
6824 * src/insets/insetmarginal.h:
6825 * src/insets/insetlist.h:
6826 * src/insets/insetfoot.h:
6827 * src/insets/insetfloat.h:
6828 * src/insets/insetert.h: add a missing std:: qualifier.
6830 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6832 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6835 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6837 * src/insets/insettext.C (Read): remove tmptok unused variable
6838 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6839 (InsertInset): change for new InsetInset code
6841 * src/insets/insettext.h: add TEXT inline method
6843 * src/insets/insettext.C: remove TEXT macro
6845 * src/insets/insetmarginal.C (Write): new method
6846 (Latex): change output slightly
6848 * src/insets/insetfoot.C (Write): new method
6849 (Latex): change output slightly (don't use endl when no need)
6851 * src/insets/insetert.C (Write): new method
6853 * src/insets/insetcollapsable.h: make button_length, button_top_y
6854 and button_bottm_y protected.
6856 * src/insets/insetcollapsable.C (Write): simplify code by using
6857 tostr. Also do not output the float name, the children class
6858 should to that to get control over own arguments
6860 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6861 src/insets/insetminipage.[Ch]:
6864 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6866 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6868 * src/Makefile.am (lyx_SOURCES): add the new files
6870 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6871 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6872 * src/commandtags.h: ditto
6874 * src/LaTeXFeatures.h: add a std::set of used floattypes
6876 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6878 * src/FloatList.[Ch] src/Floating.h: new files
6880 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6882 * src/lyx_cb.C (TableApplyCB): ditto
6884 * src/text2.C: ditto
6885 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6886 (parseSingleLyXformat2Token): ditto + add code for
6887 backwards compability for old float styles + add code for new insets
6889 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6891 (InsertInset(size_type, Inset *, LyXFont)): new method
6892 (InsetChar(size_type, char)): changed to use the other InsetChar
6893 with a LyXFont(ALL_INHERIT).
6894 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6895 insert the META_INSET.
6897 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6899 * sigc++/thread.h (Threads): from here
6901 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6902 definition out of line
6903 * sigc++/scope.h: from here
6905 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6907 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6908 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6910 * Makefile.am (bindist): new target.
6912 * INSTALL: add instructions for doing a binary distribution.
6914 * development/tools/README.bin.example: update a bit.
6916 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6919 * lib/lyxrc.example: new lyxrc tag \set_color.
6921 * src/lyxfunc.C (Dispatch):
6922 * src/commandtags.h:
6923 * src/LyXAction.C: new lyxfunc "set-color".
6925 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6926 and an x11name given as strings.
6928 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6929 cache when a color is changed.
6931 2000-06-26 Juergen Vigna <jug@sad.it>
6933 * src/lyxrow.C (width): added this functions and variable.
6935 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6938 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6940 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6942 * images/undo_bw.xpm: new icon.
6943 * images/redo_bw.xpm: ditto.
6945 * configure.in (INSTALL_SCRIPT): change value to
6946 ${INSTALL} to avoid failures of install-script target.
6947 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6949 * src/BufferView.h: add a magic "friend" declaration to please
6952 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6954 * forms/cite.fd: modified to allow resizing without messing
6957 * src/insetcite.C: Uses code from cite.fd almost without
6959 User can now resize dialog in the x-direction.
6960 Resizing the dialog in the y-direction is prevented, as the
6961 code does this intelligently already.
6963 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6965 * INSTALL: remove obsolete entry in "problems" section.
6967 * lib/examples/sl_*.lyx: update of the slovenian examples.
6969 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6971 2000-06-23 Juergen Vigna <jug@sad.it>
6973 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6975 * src/buffer.C (resize): delete the LyXText of textinsets.
6977 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6979 * src/insets/lyxinset.h: added another parameter 'cleared' to
6980 the draw() function.
6982 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6983 unlocking inset in inset.
6985 2000-06-22 Juergen Vigna <jug@sad.it>
6987 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6988 of insets and moved first to LyXText.
6990 * src/mathed/formulamacro.[Ch]:
6991 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6993 2000-06-21 Juergen Vigna <jug@sad.it>
6995 * src/text.C (GetVisibleRow): look if I should clear the area or not
6996 using Inset::doClearArea() function.
6998 * src/insets/lyxinset.h: added doClearArea() function and
6999 modified draw(Painter &, ...) to draw(BufferView *, ...)
7001 * src/text2.C (UpdateInset): return bool insted of int
7003 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7005 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7006 combox in the character popup
7008 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7009 BufferParams const & params
7011 2000-06-20 Juergen Vigna <jug@sad.it>
7013 * src/insets/insettext.C (SetParagraphData): set insetowner on
7016 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7018 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7019 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7021 (form_main_): remove
7023 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7024 (create_form_form_main): remove FD_form_main stuff, connect to
7025 autosave_timeout signal
7027 * src/LyXView.[Ch] (getMainForm): remove
7028 (UpdateTimerCB): remove
7029 * src/BufferView_pimpl.h: inherit from SigC::Object
7031 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7032 signal instead of callback
7034 * src/BufferView.[Ch] (cursorToggleCB): remove
7036 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7038 * src/BufferView_pimpl.C: changes because of the one below
7040 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7041 instead of storing a pointer to a LyXText.
7043 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7045 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7047 * src/lyxparagraph.h
7049 * src/paragraph.C: Changed fontlist to a sorted vector.
7051 2000-06-19 Juergen Vigna <jug@sad.it>
7053 * src/BufferView.h: added screen() function.
7055 * src/insets/insettext.C (LocalDispatch): some selection code
7058 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7060 * src/insets/insettext.C (SetParagraphData):
7062 (InsetText): fixes for multiple paragraphs.
7064 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7066 * development/lyx.spec.in: Call configure with ``--without-warnings''
7067 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7068 This should be fine, however, since we generally don't want to be
7069 verbose when making an RPM.
7071 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7073 * lib/scripts/fig2pstex.py: New file
7075 2000-06-16 Juergen Vigna <jug@sad.it>
7077 * src/insets/insettabular.C (UpdateLocal):
7078 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7079 (LocalDispatch): Changed all functions to use LyXText.
7081 2000-06-15 Juergen Vigna <jug@sad.it>
7083 * src/text.C (SetHeightOfRow): call inset::update before requesting
7086 * src/insets/insettext.C (update):
7087 * src/insets/insettabular.C (update): added implementation
7089 * src/insets/lyxinset.h: added update function
7091 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7093 * src/text.C (SelectNextWord): protect against null pointers with
7094 old-style string streams. (fix from Paul Theo Gonciari
7097 * src/cite.[Ch]: remove erroneous files.
7099 * lib/configure.m4: update the list of created directories.
7101 * src/lyxrow.C: include <config.h>
7102 * src/lyxcursor.C: ditto.
7104 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * lib/examples/decimal.lyx: new example file from Mike.
7108 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7109 to find template definitions (from Dekel)
7111 * src/frontends/.cvsignore: add a few things.
7113 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7115 * src/Timeout.C (TimeOut): remove default argument.
7117 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7120 * src/insets/ExternalTemplate.C: add a "using" directive.
7122 * src/lyx_main.h: remove the act_ struct, which seems unused
7125 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7127 * LyX Developers Meeting: All files changed, due to random C++ (by
7128 coincidence) code generator script.
7130 - external inset (cool!)
7131 - initial online editing of preferences
7132 - insettabular breaks insettext(s contents)
7134 - some DocBook fixes
7135 - example files update
7136 - other cool stuff, create a diff and look for yourself.
7138 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7140 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7141 -1 this is a non-line-breaking textinset.
7143 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7144 if there is no width set.
7146 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7148 * Lots of files: Merged the dialogbase branch.
7150 2000-06-09 Allan Rae <rae@lyx.org>
7152 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7153 and the Dispatch methods that used it.
7155 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7156 access to functions formerly kept in Dispatch.
7158 2000-05-19 Allan Rae <rae@lyx.org>
7160 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7161 made to_page and count_copies integers again. from_page remains a
7162 string however because I want to allow entry of a print range like
7163 "1,4,22-25" using this field.
7165 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7166 and printer-params-get. These aren't useful from the minibuffer but
7167 could be used by a script/LyXServer app provided it passes a suitable
7168 auto_mem_buffer. I guess I should take a look at how the LyXServer
7169 works and make it support xtl buffers.
7171 * sigc++/: updated to libsigc++-1.0.1
7173 * src/xtl/: updated to xtl-1.3.pl.11
7175 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7176 those changes done to the files in src/ are actually recreated when
7177 they get regenerated. Please don't ever accept a patch that changes a
7178 dialog unless that patch includes the changes to the corresponding *.fd
7181 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7182 stringOnlyContains, renamed it and generalised it.
7184 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7185 branch. Removed the remaining old form_print code.
7187 2000-04-26 Allan Rae <rae@lyx.org>
7189 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7190 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7192 2000-04-25 Allan Rae <rae@lyx.org>
7194 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7195 against a base of xtl-1.3.pl.4
7197 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7198 filter the Id: entries so they still show the xtl version number
7201 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7202 into the src/xtl code. Patch still pending with José (XTL)
7204 2000-04-24 Allan Rae <rae@lyx.org>
7206 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7207 both more generic and much safer. Use the new template functions.
7208 * src/buffer.[Ch] (Dispatch): ditto.
7210 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7211 and mem buffer more intelligently. Also a little general cleanup.
7214 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7215 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7216 * src/xtl/Makefile.am: ditto.
7217 * src/xtl/.cvsignore: ditto.
7218 * src/Makefile.am: ditto.
7220 * src/PrinterParams.h: Removed the macros member functions. Added a
7221 testInvariant member function. A bit of tidying up and commenting.
7222 Included Angus's idea for fixing operation with egcs-1.1.2.
7224 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7225 cool expansion of XTL's mem_buffer to support automatic memory
7226 management within the buffer itself. Removed the various macros and
7227 replaced them with template functions that use either auto_mem_buffer
7228 or mem_buffer depending on a #define. The mem_buffer support will
7229 disappear as soon as the auto_mem_buffer is confirmed to be good on
7230 other platforms/compilers. That is, it's there so you've got something
7233 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7234 effectively forked XTL. However I expect José will include my code
7235 into the next major release. Also fixed a memory leak.
7236 * src/xtl/text.h: ditto.
7237 * src/xtl/xdr.h: ditto.
7238 * src/xtl/giop.h: ditto.
7240 2000-04-16 Allan Rae <rae@lyx.org>
7242 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7243 by autogen.sh and removed by maintainer-clean anyway.
7244 * .cvsignore, sigc++/.cvsignore: Support the above.
7246 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7248 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7250 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7251 macros, renamed static callback-target member functions to suit new
7252 scheme and made them public.
7253 * src/frontends/xforms/forms/form_print.fd: ditto.
7254 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7256 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7259 * src/xtl/: New directory containing a minimal distribution of XTL.
7260 This is XTL-1.3.pl.4.
7262 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7264 2000-04-15 Allan Rae <rae@lyx.org>
7266 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7268 * sigc++/: Updated to libsigc++-1.0.0
7270 2000-04-14 Allan Rae <rae@lyx.org>
7272 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7273 use the generic ones in future. I'll modify my conversion script.
7275 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7277 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7278 (CloseAllBufferRelatedDialogs): Renamed.
7279 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7281 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7282 of the generic ones. These are the same ones my conversion script
7285 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7286 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7287 * src/buffer.C (Dispatch): ditto
7289 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7290 functions for updating and hiding buffer dependent dialogs.
7291 * src/BufferView.C (buffer): ditto
7292 * src/buffer.C (setReadonly): ditto
7293 * src/lyxfunc.C (CloseBuffer): ditto
7295 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7296 Dialogs.h, and hence all the SigC stuff, into every file that includes
7297 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7299 * src/BufferView2.C: reduce the number of headers included by buffer.h
7301 2000-04-11 Allan Rae <rae@lyx.org>
7303 * src/frontends/xforms/xform_macros.h: A small collection of macros
7304 for building C callbacks.
7306 * src/frontends/xforms/Makefile.am: Added above file.
7308 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7309 scheme again. This time it should work for JMarc. If this is
7310 successful I'll revise my conversion script to automate some of this.
7311 The static member functions in the class also have to be public for
7312 this scheme will work. If the scheme works (it's almost identical to
7313 the way BufferView::cursorToggleCB is handled so it should work) then
7314 FormCopyright and FormPrint will be ready for inclusion into the main
7315 trunk immediately after 1.1.5 is released -- provided we're prepared
7316 for complaints about lame compilers not handling XTL.
7318 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7320 2000-04-07 Allan Rae <rae@lyx.org>
7322 * config/lyxinclude.m4: A bit more tidying up (Angus)
7324 * src/LString.h: JMarc's <string> header fix
7326 * src/PrinterParams.h: Used string for most data to remove some
7327 ugly code in the Print dialog and avoid even uglier code when
7328 appending the ints to a string for output.
7330 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7331 and moved "default:" back to the end of switch statement. Cleaned
7332 up the printing so it uses the right function calls and so the
7333 "print to file" option actually puts the file in the right directory.
7335 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7337 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7338 and Ok+Apply button control into a separate method: input (Angus).
7339 (input) Cleaned it up and improved it to be very thorough now.
7340 (All CB) static_cast used instead of C style cast (Angus). This will
7341 probably change again once we've worked out how to keep gcc-2.8.1 happy
7342 with real C callbacks.
7343 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7344 ignore some of the bool settings and has random numbers instead. Needs
7345 some more investigation. Added other input length checks and checking
7346 of file and printer names.
7348 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7349 would link (Angus). Seems the old code doesn't compile with the pragma
7350 statement either. Separated callback entries from internal methods.
7352 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7354 2000-03-17 Allan Rae <rae@lyx.org>
7356 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7357 need it? Maybe it could go in Dialogs instead? I could make it a
7358 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7359 values to get the bool return value.
7360 (Dispatch): New overloaded method for xtl support.
7362 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7363 extern "C" callback instead of static member functions. Hopefully,
7364 JMarc will be able to compile this. I haven't changed
7365 forms/form_copyright.fd yet. Breaking one of my own rules already.
7367 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7368 because they aren't useful from the minibuffer. Maybe a LyXServer
7369 might want a help message though?
7371 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7373 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7374 xtl which needs both rtti and exceptions.
7376 * src/support/Makefile.am:
7377 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7379 * src/frontends/xforms/input_validators.[ch]: input filters and
7380 validators. These conrol what keys are valid in input boxes.
7381 Use them and write some more. Much better idea than waiting till
7382 after the user has pressed Ok to say that the input fields don't make
7385 * src/frontends/xforms/Makefile.am:
7386 * src/frontends/xforms/forms/form_print.fd:
7387 * src/frontends/xforms/forms/makefile:
7388 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7389 new scheme. Still have to make sure I haven't missed anything from
7390 the current implementation.
7392 * src/Makefile.am, src/PrinterParams.h: New data store.
7394 * other files: Added a couple of copyright notices.
7396 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7398 * src/insets/insetbib.h: move Holder struct in public space.
7400 * src/frontends/include/DialogBase.h: use SigC:: only when
7401 SIGC_CXX_NAMESPACES is defined.
7402 * src/frontends/include/Dialogs.h: ditto.
7404 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7406 * src/frontends/xforms/FormCopyright.[Ch]: do not
7407 mention SigC:: explicitely.
7409 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7411 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7412 deals with testing KDE in main configure.in
7413 * configure.in: ditto.
7415 2000-02-22 Allan Rae <rae@lyx.org>
7417 * Lots of files: Merged from HEAD
7419 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7420 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7422 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7424 * sigc++/: new minidist.
7426 2000-02-14 Allan Rae <rae@lyx.org>
7428 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7430 2000-02-08 Juergen Vigna <jug@sad.it>
7432 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7433 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7435 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7436 for this port and so it is much easier for other people to port
7437 dialogs in a common development environment.
7439 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7440 the QT/KDE implementation.
7442 * src/frontends/kde/Dialogs.C:
7443 * src/frontends/kde/FormCopyright.C:
7444 * src/frontends/kde/FormCopyright.h:
7445 * src/frontends/kde/Makefile.am:
7446 * src/frontends/kde/formcopyrightdialog.C:
7447 * src/frontends/kde/formcopyrightdialog.h:
7448 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7449 for the kde support of the Copyright-Dialog.
7451 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7452 subdir-substitution instead of hardcoded 'xforms' as we now have also
7455 * src/frontends/include/DialogBase.h (Object): just commented the
7456 label after #endif (nasty warning and I don't like warnings ;)
7458 * src/main.C (main): added KApplication initialization if using
7461 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7462 For now only the KDE event-loop is added if frontend==kde.
7464 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7466 * configure.in: added support for the --with-frontend[=value] option
7468 * autogen.sh: added kde.m4 file to list of config-files
7470 * acconfig.h: added define for KDEGUI-support
7472 * config/kde.m4: added configuration functions for KDE-port
7474 * config/lyxinclude.m4: added --with-frontend[=value] option with
7475 support for xforms and KDE.
7477 2000-02-08 Allan Rae <rae@lyx.org>
7479 * all Makefile.am: Fixed up so the make targets dist, distclean,
7480 install and uninstall all work even if builddir != srcdir. Still
7481 have a new sigc++ minidist update to come.
7483 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7485 2000-02-01 Allan Rae <rae@lyx.org>
7487 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7488 Many mods to get builddir != srcdir working.
7490 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7491 for building on NT and so we can do the builddir != srcdir stuff.
7493 2000-01-30 Allan Rae <rae@lyx.org>
7495 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7496 This will stay in "rae" branch. We probably don't really need it in
7497 the main trunk as anyone who wants to help programming it should get
7498 a full library installed also. So they can check both included and
7499 system supplied library compilation.
7501 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7502 Added a 'mini' distribution of libsigc++. If you feel the urge to
7503 change something in these directories - Resist it. If you can't
7504 resist the urge then you should modify the following script and rebuild
7505 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7506 all happen. Still uses a hacked version of libsigc++'s configure.in.
7507 I'm quite happy with the results. I'm not sure the extra work to turn
7508 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7509 worth the trouble and would probably lead to extra maintenance
7511 I haven't tested the following important make targets: install, dist.
7512 Not ready for prime time but very close. Maybe 1.1.5.
7514 * development/tools/makeLyXsigc.sh: A shell script to automatically
7515 generate our mini-dist of libsigc++. It can only be used with a CVS
7516 checkout of libsigc++ not a tarball distribution. It's well commented.
7517 This will end up as part of the libsigc++ distribution so other apps
7518 can easily have an included mini-dist. If someone makes mods to the
7519 sigc++ subpackage without modifying this script to generate those
7520 changes I'll be very upset!
7522 * src/frontends/: Started the gui/system indep structure.
7524 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7525 to access the gui-indep dialogs are in this class. Much improved
7526 design compared to previous revision. Lars, please refrain from
7527 moving this header into src/ like you did with Popups.h last time.
7529 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7531 * src/frontends/xforms/: Started the gui-indep system with a single
7532 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7535 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7536 Here you'll find a very useful makefile and automated fdfix.sh that
7537 makes updating dailogs a no-brainer -- provided you follow the rules
7538 set out in the README. I'm thinking about adding another script to
7539 automatically generate skeleton code for a new dialog given just the
7542 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7543 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7544 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7546 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7548 * src/support/LSubstring.C (operator): simplify
7550 * src/lyxtext.h: removed bparams, use buffer_->params instead
7552 * src/lyxrow.h: make Row a real class, move all variables to
7553 private and use accessors.
7555 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7557 (isRightToLeftPar): ditto
7558 (ChangeLanguage): ditto
7559 (isMultiLingual): ditto
7562 (SimpleTeXOnePar): ditto
7563 (TeXEnvironment): ditto
7564 (GetEndLabel): ditto
7566 (SetOnlyLayout): ditto
7567 (BreakParagraph): ditto
7568 (BreakParagraphConservative): ditto
7569 (GetFontSettings): ditto
7571 (CopyIntoMinibuffer): ditto
7572 (CutIntoMinibuffer): ditto
7573 (PasteParagraph): ditto
7574 (SetPExtraType): ditto
7575 (UnsetPExtraType): ditto
7576 (DocBookContTableRows): ditto
7577 (SimpleDocBookOneTablePar): ditto
7579 (TeXFootnote): ditto
7580 (SimpleTeXOneTablePar): ditto
7581 (TeXContTableRows): ditto
7582 (SimpleTeXSpecialChars): ditto
7585 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7586 to private and use accessors.
7588 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7589 this, we did not use it anymore and has not been for ages. Just a
7590 waste of cpu cycles.
7592 * src/language.h: make Language a real class, move all variables
7593 to private and use accessors.
7595 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7596 (create_view): remove
7597 (update): some changes for new timer
7598 (cursorToggle): use new timer
7599 (beforeChange): change for new timer
7601 * src/BufferView.h (cursorToggleCB): removed last paramter because
7604 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7605 (cursorToggleCB): change because of new timer code
7607 * lib/CREDITS: updated own mailaddress
7609 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7611 * src/support/filetools.C (PutEnv): fix the code in case neither
7612 putenv() nor setenv() have been found.
7614 * INSTALL: mention the install-strip Makefile target.
7616 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7617 read-only documents.
7619 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7621 * lib/reLyX/configure.in (VERSION): avoid using a previously
7622 generated reLyX wrapper to find out $prefix.
7624 * lib/examples/eu_adibide_lyx-atua.lyx:
7625 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7626 translation of the Tutorial (Dooteo)
7628 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7630 * forms/cite.fd: new citation dialog
7632 * src/insetcite.[Ch]: the new citation dialog is moved into
7635 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7638 * src/insets/insetcommand.h: data members made private.
7640 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * LyX 1.1.5 released
7644 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7646 * src/version.h (LYX_RELEASE): to 1.1.5
7648 * src/spellchecker.C (RunSpellChecker): return false if the
7649 spellchecker dies upon creation.
7651 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7653 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7654 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7658 * lib/CREDITS: update entry for Martin Vermeer.
7660 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7662 * src/text.C (draw): Draw foreign language bars at the bottom of
7663 the row instead of at the baseline.
7665 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7667 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7669 * lib/bind/de_menus.bind: updated
7671 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7673 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7675 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7677 * src/menus.C (Limit_string_length): New function
7678 (ShowTocMenu): Limit the number of items/length of items in the
7681 * src/paragraph.C (String): Correct result for a paragraph inside
7684 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7686 * src/bufferlist.C (close): test of buf->getuser() == NULL
7688 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7690 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7691 Do not call to SetCursor when the paragraph is a closed footnote!
7693 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7695 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7698 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7700 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7703 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7704 reference popup, that activates the reference-back action
7706 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7708 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7709 the menus. Also fixed a bug.
7711 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7712 the math panels when switching buffers (unless new buffer is readonly).
7714 * src/BufferView.C (NoSavedPositions)
7715 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7717 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7719 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7720 less of dvi dirty or not.
7722 * src/trans_mgr.[Ch] (insert): change first parameter to string
7725 * src/chset.[Ch] (encodeString): add const to first parameter
7727 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7729 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7733 * src/LaTeX.C (deplog): better searching for dependency files in
7734 the latex log. Uses now regexps.
7736 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7737 instead of the box hack or \hfill.
7739 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7741 * src/lyxfunc.C (doImportHelper): do not create the file before
7742 doing the actual import.
7743 (doImportASCIIasLines): create a new file before doing the insert.
7744 (doImportASCIIasParagraphs): ditto.
7746 * lib/lyxrc.example: remove mention of non-existing commands
7748 * lyx.man: remove mention of color-related switches.
7750 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7752 * src/lyx_gui.C: remove all the color-related ressources, which
7753 are not used anymore.
7755 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7758 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7760 * src/lyxrc.C (read): Add a missing break in the switch
7762 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7764 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7766 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7769 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7771 * src/text.C (draw): draw bars under foreign language words.
7773 * src/LColor.[Ch]: add LColor::language
7775 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7777 * src/lyxcursor.h (boundary): New member variable
7779 * src/text.C (IsBoundary): New methods
7781 * src/text.C: Use the above for currect cursor movement when there
7782 is both RTL & LTR text.
7784 * src/text2.C: ditto
7786 * src/bufferview_funcs.C (ToggleAndShow): ditto
7788 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7790 * src/text.C (DeleteLineForward): set selection to true to avoid
7791 that DeleteEmptyParagraphMechanism does some magic. This is how it
7792 is done in all other functions, and seems reasonable.
7793 (DeleteWordForward): do not jump over non-word stuff, since
7794 CursorRightOneWord() already does it.
7796 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7797 DeleteWordBackward, since they seem safe to me (since selection is
7798 set to "true") DeleteEmptyParagraphMechanism does nothing.
7800 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7802 * src/lyx_main.C (easyParse): simplify the code by factoring the
7803 part that removes parameters from the command line.
7804 (LyX): check wether wrong command line options have been given.
7806 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7808 * src/lyx_main.C : add support for specifying user LyX
7809 directory via command line option -userdir.
7811 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7813 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7814 the number of items per popup.
7815 (Add_to_refs_menu): Ditto.
7817 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7819 * src/lyxparagraph.h: renamed ClearParagraph() to
7820 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7821 textclass as parameter, and do nothing if free_spacing is
7822 true. This fixes part of the line-delete-forward problems.
7824 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7825 (pasteSelection): ditto.
7826 (SwitchLayoutsBetweenClasses): more translatable strings.
7828 * src/text2.C (CutSelection): use StripLeadingSpaces.
7829 (PasteSelection): ditto.
7830 (DeleteEmptyParagraphMechanism): ditto.
7832 2000-05-26 Juergen Vigna <jug@sad.it>
7834 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7835 is not needed in tabular insets.
7837 * src/insets/insettabular.C (TabularFeatures): added missing features.
7839 * src/tabular.C (DeleteColumn):
7841 (AppendRow): implemented this functions
7842 (cellsturct::operator=): clone the inset too;
7844 2000-05-23 Juergen Vigna <jug@sad.it>
7846 * src/insets/insettabular.C (LocalDispatch): better selection support
7847 when having multicolumn-cells.
7849 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7851 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7853 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7855 * src/ColorHandler.C (getGCForeground): put more test into _()
7857 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7860 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7863 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7865 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7866 there are no labels, or when buffer is readonly.
7868 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7869 there are no labels, buffer is SGML, or when buffer is readonly.
7871 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7873 * src/LColor.C (LColor): change a couple of grey40 to grey60
7874 (LColor): rewore initalization to make compiles go some magnitude
7876 (getGUIName): don't use gettext until we need the string.
7878 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7880 * src/Bullet.[Ch]: Fixed a small bug.
7882 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7884 * src/paragraph.C (String): Several fixes/improvements
7886 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7888 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7890 * src/paragraph.C (String): give more correct output.
7892 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7894 * src/lyxfont.C (stateText) Do not output the language if it is
7895 eqaul to the language of the document.
7897 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7898 between two paragraphs with the same language.
7900 * src/paragraph.C (getParLanguage) Return a correct answer for an
7901 empty dummy paragraph.
7903 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7906 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7909 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7910 the menus/popup, if requested fonts are unavailable.
7912 2000-05-22 Juergen Vigna <jug@sad.it>
7914 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7915 movement support (Up/Down/Tab/Shift-Tab).
7916 (LocalDispatch): added also preliminari cursor-selection.
7918 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7920 * src/paragraph.C (PasteParagraph): Hopefully now right!
7922 2000-05-22 Garst R. Reese <reese@isn.net>
7924 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7925 of list, change all references to Environment to Command
7926 * tex/hollywood.cls : rewrite environments as commands, add
7927 \uppercase to interiorshot and exteriorshot to force uppecase.
7928 * tex/broadway.cls : rewrite environments as commands. Tweak
7931 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7933 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7934 size of items: use a constant intead of the hardcoded 40, and more
7935 importantly do not remove the %m and %x tags added at the end.
7936 (Add_to_refs_menu): use vector::size_type instead of
7937 unsigned int as basic types for the variables. _Please_ do not
7938 assume that size_t is equal to unsigned int. On an alpha, this is
7939 unsigned long, which is _not_ the same.
7941 * src/language.C (initL): remove language "hungarian", since it
7942 seems that "magyar" is better.
7944 2000-05-22 Juergen Vigna <jug@sad.it>
7946 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7948 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7951 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7952 next was deleted but not set to 0.
7954 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7956 * src/language.C (initL): change the initialization of languages
7957 so that compiles goes _fast_.
7959 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7962 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7964 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7968 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7970 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7972 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7976 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7979 * src/insets/insetlo*.[Ch]: Made editable
7981 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7983 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7984 the current selection.
7986 * src/BufferView_pimpl.C (stuffClipboard): new method
7988 * src/BufferView.C (stuffClipboard): new method
7990 * src/paragraph.C (String): new method
7992 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7993 LColor::ignore when lyxname is not found.
7995 * src/BufferView.C (pasteSelection): new method
7997 * src/BufferView_pimpl.C (pasteSelection): new method
7999 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8001 * src/WorkArea.C (request_clipboard_cb): new static function
8002 (getClipboard): new method
8003 (putClipboard): new method
8005 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8007 * LyX 1.1.5pre2 released
8009 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8011 * src/vspace.C (operator=): removed
8012 (operator=): removed
8014 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8016 * src/layout.C (NumberOfClass): manually set the type in make_pair
8017 (NumberOfLayout): ditto
8019 * src/language.C: use the Language constructor for ignore_lang
8021 * src/language.h: add constructors to struct Language
8023 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8025 * src/text2.C (SetCursorIntern): comment out #warning
8027 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8029 * src/mathed/math_iter.h: initialize sx and sw to 0
8031 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8033 * forms/lyx.fd: Redesign of form_ref
8035 * src/LaTeXFeatures.[Ch]
8039 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8042 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8043 and Buffer::inset_iterator.
8045 * src/menus.C: Added new menus: TOC and Refs.
8047 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8049 * src/buffer.C (getTocList): New method.
8051 * src/BufferView2.C (ChangeRefs): New method.
8053 * src/buffer.C (getLabelList): New method. It replaces the old
8054 getReferenceList. The return type is vector<string> instead of
8057 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8058 the old getLabel() and GetNumberOfLabels() methods.
8059 * src/insets/insetlabel.C (getLabelList): ditto
8060 * src/mathed/formula.C (getLabelList): ditto
8062 * src/paragraph.C (String): New method.
8064 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8065 Uses the new getTocList() method.
8066 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8067 which automatically updates the contents of the browser.
8068 (RefUpdateCB): Use the new getLabelList method.
8070 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8072 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8074 * src/spellchecker.C: Added using std::reverse;
8076 2000-05-19 Juergen Vigna <jug@sad.it>
8078 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8080 * src/insets/insettext.C (computeTextRows): small fix for display of
8081 1 character after a newline.
8083 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8086 2000-05-18 Juergen Vigna <jug@sad.it>
8088 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8089 when changing width of column.
8091 * src/tabular.C (set_row_column_number_info): setting of
8092 autobreak rows if necessary.
8094 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8096 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8098 * src/vc-backend.*: renamed stat() to status() and vcstat to
8099 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8100 compilation broke. The new name seems more relevant, anyway.
8102 2000-05-17 Juergen Vigna <jug@sad.it>
8104 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8105 which was wrong if the removing caused removing of rows!
8107 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8108 (pushToken): new function.
8110 * src/text2.C (CutSelection): fix problem discovered with purify
8112 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8114 * src/debug.C (showTags): enlarge the first column, now that we
8115 have 6-digits debug codes.
8117 * lib/layouts/hollywood.layout:
8118 * lib/tex/hollywood.cls:
8119 * lib/tex/brodway.cls:
8120 * lib/layouts/brodway.layout: more commands and fewer
8121 environments. Preambles moved in the .cls files. Broadway now has
8122 more options on scene numbering and less whitespace (from Garst)
8124 * src/insets/insetbib.C (getKeys): make sure that we are in the
8125 document directory, in case the bib file is there.
8127 * src/insets/insetbib.C (Latex): revert bogus change.
8129 2000-05-16 Juergen Vigna <jug@sad.it>
8131 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8132 the TabularLayout on cursor move.
8134 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8136 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8139 (draw): fixed cursor position and drawing so that the cursor is
8140 visible when before the tabular-inset.
8142 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8143 when creating from old insettext.
8145 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8147 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8149 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8150 * lib/tex/brodway.cls: ditto
8152 * lib/layouts/brodway.layout: change alignment of parenthical
8155 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8157 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8158 versions 0.88 and 0.89 are supported.
8160 2000-05-15 Juergen Vigna <jug@sad.it>
8162 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8165 * src/insets/insettext.C (computeTextRows): redone completely this
8166 function in a much cleaner way, because of problems when having a
8168 (draw): added a frame border when the inset is locked.
8169 (SetDrawLockedFrame): this sets if we draw the border or not.
8170 (SetFrameColor): this sets the frame color (default=insetframe).
8172 * src/insets/lyxinset.h: added x() and y() functions which return
8173 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8174 function which is needed to see if we have a locking inset of some
8175 type in this inset (needed for now in insettabular).
8177 * src/vspace.C (inPixels): the same function also without a BufferView
8178 parameter as so it is easier to use it in some ocasions.
8180 * src/lyxfunc.C: changed all places where insertInset was used so
8181 that now if it couldn't be inserted it is deleted!
8183 * src/TabularLayout.C:
8184 * src/TableLayout.C: added support for new tabular-inset!
8186 * src/BufferView2.C (insertInset): this now returns a bool if the
8187 inset was really inserted!!!
8189 * src/tabular.C (GetLastCellInRow):
8190 (GetFirstCellInRow): new helper functions.
8191 (Latex): implemented for new tabular class.
8195 (TeXTopHLine): new Latex() helper functions.
8197 2000-05-12 Juergen Vigna <jug@sad.it>
8199 * src/mathed/formulamacro.C (Read):
8200 * src/mathed/formula.C (Read): read also the \end_inset here!
8202 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8204 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8205 crush when saving formulae with unbalanced parenthesis.
8207 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8209 * src/layout.C: Add new keyword "endlabelstring" to layout file
8211 * src/text.C (GetVisibleRow): Draw endlabel string.
8213 * lib/layouts/broadway.layout
8214 * lib/layouts/hollywood.layout: Added endlabel for the
8215 Parenthetical layout.
8217 * lib/layouts/heb-article.layout: Do not use slanted font shape
8218 for Theorem like environments.
8220 * src/buffer.C (makeLaTeXFile): Always add "american" to
8221 the UsedLanguages list if document language is RTL.
8223 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * add addendum to README.OS2 and small patch (from SMiyata)
8227 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8229 * many files: correct the calls to ChangeExtension().
8231 * src/support/filetools.C (ChangeExtension): remove the no_path
8232 argument, which does not belong there. Use OnlyFileName() instead.
8234 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8235 files when LaTeXing a non-nice latex file.
8237 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8238 a chain of "if". Return false when deadkeys are not handled.
8240 * src/lyx_main.C (LyX): adapted the code for default bindings.
8242 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8243 bindings for basic functionality (except deadkeys).
8244 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8246 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8247 several methods: handle override_x_deadkeys.
8249 * src/lyxrc.h: remove the "bindings" map, which did not make much
8250 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8252 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8254 * src/lyxfont.C (stateText): use a saner method to determine
8255 whether the font is "default". Seems to fix the crash with DEC
8258 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8260 2000-05-08 Juergen Vigna <jug@sad.it>
8262 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8263 TabularLayoutMenu with mouse-button-3
8264 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8266 * src/TabularLayout.C: added this file for having a Layout for
8269 2000-05-05 Juergen Vigna <jug@sad.it>
8271 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8272 recalculating inset-widths.
8273 (TabularFeatures): activated this function so that I can change
8274 tabular-features via menu.
8276 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8277 that I can test some functions with the Table menu.
8279 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8281 * src/lyxfont.C (stateText): guard against stupid c++libs.
8283 * src/tabular.C: add using std::vector
8284 some whitespace changes, + removed som autogenerated code.
8286 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8288 2000-05-05 Juergen Vigna <jug@sad.it>
8290 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8291 row, columns and cellstructures.
8293 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8295 * lib/lyxrc.example: remove obsolete entries.
8297 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8298 reading of protected_separator for free_spacing.
8300 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8302 * src/text.C (draw): do not display an exclamation mark in the
8303 margin for margin notes. This is confusing, ugly and
8306 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8307 AMS math' is checked.
8309 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8310 name to see whether including the amsmath package is needed.
8312 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8314 * src/paragraph.C (validate): Compute UsedLanguages correctly
8315 (don't insert the american language if it doesn't appear in the
8318 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8319 The argument of \thanks{} command is considered moving argument
8321 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8324 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8326 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8327 for appendix/minipage/depth. The lines can be now both in the footnote
8328 frame, and outside the frame.
8330 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8333 2000-05-05 Juergen Vigna <jug@sad.it>
8335 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8336 neede only in tabular.[Ch].
8338 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8340 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8342 (Write): write '~' for PROTECTED_SEPARATOR
8344 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8349 * src/mathed/formula.C (drawStr): rename size to siz.
8351 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8352 possibly fix a bug by not changing the pflags = flags to piflags =
8355 2000-05-05 Juergen Vigna <jug@sad.it>
8357 * src/insets/insetbib.C: moved using directive
8359 * src/ImportNoweb.C: small fix for being able to compile (missing
8362 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8364 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8365 to use clear, since we don't depend on this in the code. Add test
8368 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8370 * (various *.C files): add using std::foo directives to please dec
8373 * replace calls to string::clear() to string::erase() (Angus)
8375 * src/cheaders/cmath: modified to provide std::abs.
8377 2000-05-04 Juergen Vigna <jug@sad.it>
8379 * src/insets/insettext.C: Prepared all for inserting of multiple
8380 paragraphs. Still display stuff to do (alignment and other things),
8381 but I would like to use LyXText to do this when we cleaned out the
8382 table-support stuff.
8384 * src/insets/insettabular.C: Changed lot of stuff and added lots
8385 of functionality still a lot to do.
8387 * src/tabular.C: Various functions changed name and moved to be
8388 const functions. Added new Read and Write functions and changed
8389 lots of things so it works good with tabular-insets (also removed
8390 some stuff which is not needed anymore * hacks *).
8392 * src/lyxcursor.h: added operators == and != which just look if
8393 par and pos are (not) equal.
8395 * src/buffer.C (latexParagraphs): inserted this function to latex
8396 all paragraphs form par to endpar as then I can use this too for
8399 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8400 so that I can call this to from text insets with their own cursor.
8402 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8403 output off all paragraphs (because of the fix below)!
8405 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8406 the very last paragraph (this could be also the last paragraph of an
8409 * src/texrow.h: added rows() call which returns the count-variable.
8411 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8413 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8415 * lib/configure.m4: better autodetection of DocBook tools.
8417 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8419 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8421 * src/lyx_cb.C: add using std::reverse;
8423 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8426 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8427 selected files. Should fix repeated errors from generated files.
8429 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8431 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8433 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8434 the spellchecker popup.
8436 * lib/lyxrc.example: Removed the \number_inset section
8438 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8440 * src/insets/figinset.C (various): Use IsFileReadable() to make
8441 sure that the file actually exist. Relying on ghostscripts errors
8442 is a bad idea since they can lead to X server crashes.
8444 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8446 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8449 * lib/lyxrc.example: smallish typo in description of
8450 \view_dvi_paper_option
8452 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8455 * src/lyxfunc.C: doImportHelper to factor out common code of the
8456 various import methods. New functions doImportASCIIasLines,
8457 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8458 doImportLinuxDoc for the format specific parts.
8461 * buffer.C: Dispatch returns now a bool to indicate success
8464 * lyx_gui.C: Add getLyXView() for member access
8466 * lyx_main.C: Change logic for batch commands: First try
8467 Buffer::Dispatch (possibly without GUI), if that fails, use
8470 * lyx_main.C: Add support for --import command line switch.
8471 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8472 Available Formats: Everything accepted by 'buffer-import <format>'
8474 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8476 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8479 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8480 documents will be reformatted upon reentry.
8482 2000-04-27 Juergen Vigna <jug@sad.it>
8484 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8485 correctly only last pos this was a bug.
8487 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8489 * release of lyx-1.1.5pre1
8491 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8493 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8495 * src/menus.C: revert the change of naming (Figure->Graphic...)
8496 from 2000-04-11. It was incomplete and bad.
8498 * src/LColor.[Ch]: add LColor::depthbar.
8499 * src/text.C (GetVisibleRow): use it.
8501 * README: update the languages list.
8503 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8505 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8508 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8510 * README: remove sections that were just wrong.
8512 * src/text2.C (GetRowNearY): remove currentrow code
8514 * src/text.C (GetRow): remove currentrow code
8516 * src/screen.C (Update): rewritten a bit.
8517 (SmallUpdate): removed func
8519 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8521 (FullRebreak): return bool
8522 (currentrow): remove var
8523 (currentrow_y): ditto
8525 * src/lyxscreen.h (Draw): change arg to unsigned long
8526 (FitCursor): return bool
8527 (FitManualCursor): ditto
8528 (Smallpdate): remove func
8529 (first): change to unsigned long
8530 (DrawOneRow): change second arg to long (from long &)
8531 (screen_refresh_y): remove var
8532 (scree_refresh_row): ditto
8534 * src/lyxrow.h: change baseline to usigned int from unsigned
8535 short, this brings some implicit/unsigned issues out in the open.
8537 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8539 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8540 instead of smallUpdate.
8542 * src/lyxcursor.h: change y to unsigned long
8544 * src/buffer.h: don't call updateScrollbar after fitcursor
8546 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8547 where they are used. Removed "\\direction", this was not present
8548 in 1.1.4 and is already obsolete. Commented out some code that I
8549 believe to never be called.
8550 (runLiterate): don't call updateScrollbar after fitCursor
8552 (buildProgram): ditto
8555 * src/WorkArea.h (workWidth): change return val to unsigned
8558 (redraw): remove the button redraws
8559 (setScrollbarValue): change for scrollbar
8560 (getScrollbarValue): change for scrollbar
8561 (getScrollbarBounds): change for scrollbar
8563 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8564 (C_WorkArea_down_cb): removed func
8565 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8566 (resize): change for scrollbar
8567 (setScrollbar): ditto
8568 (setScrollbarBounds): ditto
8569 (setScrollbarIncrements): ditto
8570 (up_cb): removed func
8571 (down_cb): removed func
8572 (scroll_cb): change for scrollbar
8573 (work_area_handler): ditto
8575 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8576 when FitCursor did something.
8577 (updateScrollbar): some unsigned changes
8578 (downCB): removed func
8579 (scrollUpOnePage): removed func
8580 (scrollDownOnePage): remvoed func
8581 (workAreaMotionNotify): don't call screen->FitCursor but use
8582 fitCursor instead. and bool return val
8583 (workAreaButtonPress): ditto
8584 (workAreaButtonRelease): some unsigned changes
8585 (checkInsetHit): ditto
8586 (workAreaExpose): ditto
8587 (update): parts rewritten, comments about the signed char arg added
8588 (smallUpdate): removed func
8589 (cursorPrevious): call needed updateScrollbar
8592 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8595 * src/BufferView.[Ch] (upCB): removed func
8596 (downCB): removed func
8597 (smallUpdate): removed func
8599 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8601 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8602 currentrow, currentrow_y optimization. This did not help a lot and
8603 if we want to do this kind of optimization we should rather use
8604 cursor.row instead of the currentrow.
8606 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8607 buffer spacing and klyx spacing support.
8609 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8611 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8614 2000-04-26 Juergen Vigna <jug@sad.it>
8616 * src/insets/figinset.C: fixes to Lars sstream changes!
8618 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8620 * A lot of files: Added Ascii(ostream &) methods to all inset
8621 classes. Used when exporting to ASCII.
8623 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8624 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8627 * src/text2.C (ToggleFree): Disabled implicit word selection when
8628 there is a change in the language
8630 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8631 no output was generated for end-of-sentence inset.
8633 * src/insets/lyxinset.h
8636 * src/paragraph.C: Removed the insetnumber code
8638 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8640 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8642 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8643 no_babel and no_epsfig completely from the file.
8644 (parseSingleLyXformat2Token): add handling for per-paragraph
8645 spacing as written by klyx.
8647 * src/insets/figinset.C: applied patch by Andre. Made it work with
8650 2000-04-20 Juergen Vigna <jug@sad.it>
8652 * src/insets/insettext.C (cutSelection):
8653 (copySelection): Fixed with selection from right to left.
8654 (draw): now the rows are not recalculated at every draw.
8655 (computeTextRows): for now reset the inset-owner here (this is
8656 important for an undo or copy where the inset-owner is not set
8659 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8660 motion to the_locking_inset screen->first was forgotten, this was
8661 not important till we got multiline insets.
8663 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8665 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8666 code seems to be alright (it is code changed by Dekel, and the
8667 intent is indeed that all macros should be defined \protect'ed)
8669 * NEWS: a bit of reorganisation of the new user-visible features.
8671 2000-04-19 Juergen Vigna <jug@sad.it>
8673 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8674 position. Set the inset_owner of the used paragraph so that it knows
8675 that it is inside an inset. Fixed cursor handling with mouse and
8676 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8677 and cleanups to make TextInsets work better.
8679 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8680 Changed parameters of various functions and added LockInsetInInset().
8682 * src/insets/insettext.C:
8684 * src/insets/insetcollapsable.h:
8685 * src/insets/insetcollapsable.C:
8686 * src/insets/insetfoot.h:
8687 * src/insets/insetfoot.C:
8688 * src/insets/insetert.h:
8689 * src/insets/insetert.C: cleaned up the code so that it works now
8690 correctly with insettext.
8692 * src/insets/inset.C:
8693 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8694 that insets in insets are supported right.
8697 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8699 * src/paragraph.C: some small fixes
8701 * src/debug.h: inserted INSETS debug info
8703 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8704 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8706 * src/commandtags.h:
8707 * src/LyXAction.C: insert code for InsetTabular.
8709 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8710 not Button1MotionMask.
8711 (workAreaButtonRelease): send always a InsetButtonRelease event to
8713 (checkInsetHit): some setCursor fixes (always with insets).
8715 * src/BufferView2.C (lockInset): returns a bool now and extended for
8716 locking insets inside insets.
8717 (showLockedInsetCursor): it is important to have the cursor always
8718 before the locked inset.
8719 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8721 * src/BufferView.h: made lockInset return a bool.
8723 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8725 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8726 that is used also internally but can be called as public to have back
8727 a cursor pos which is not set internally.
8728 (SetCursorIntern): Changed to use above function.
8730 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8732 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8737 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8738 patches for things that should be in or should be changed.
8740 * src/* [insetfiles]: change "usigned char fragile" to bool
8741 fragile. There was only one point that could that be questioned
8742 and that is commented in formulamacro.C. Grep for "CHECK".
8744 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8745 (DeleteBuffer): take it out of CutAndPaste and make it static.
8747 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8750 output the spacing envir commands. Also the new commands used in
8751 the LaTeX output makes the result better.
8753 * src/Spacing.C (writeEnvirBegin): new method
8754 (writeEnvirEnd): new method
8756 2000-04-18 Juergen Vigna <jug@sad.it>
8758 * src/CutAndPaste.C: made textclass a static member of the class
8759 as otherwise it is not accesed right!!!
8761 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8763 * forms/layout_forms.fd
8764 * src/layout_forms.h
8765 * src/layout_forms.C (create_form_form_character)
8766 * src/lyx_cb.C (UserFreeFont)
8767 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8768 documents (in the layout->character popup).
8770 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8772 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8773 \spell_command was in fact not honored (from Kevin Atkinson).
8775 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8778 * src/lyx_gui.h: make lyxViews private (Angus)
8780 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8782 * src/mathed/math_write.C
8783 (MathMatrixInset::Write) Put \protect before \begin{array} and
8784 \end{array} if fragile
8785 (MathParInset::Write): Put \protect before \\ if fragile
8787 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8789 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8790 initialization if the LyXColorHandler must be done after the
8791 connections to the XServer has been established.
8793 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8794 get the background pixel from the lyxColorhandler so that the
8795 figures are rendered with the correct background color.
8796 (NextToken): removed functions.
8797 (GetPSSizes): use ifs >> string instead of NextToken.
8799 * src/Painter.[Ch]: the color cache moved out of this file.
8801 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8804 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8806 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8807 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8809 * src/BufferView.C (enterView): new func
8810 (leaveView): new func
8812 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8814 (leaveView): new func, undefines xterm cursor when approp.
8816 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8817 (AllowInput): delete the Workarea cursor handling from this func.
8819 * src/Painter.C (underline): draw a slimer underline in most cases.
8821 * src/lyx_main.C (error_handler): use extern "C"
8823 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8825 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8826 sent directly to me.
8828 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8829 to the list by Dekel.
8831 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8834 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8835 methods from lyx_cb.here.
8837 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8840 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8842 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8843 instead of using current_view directly.
8845 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8847 * src/LyXAction.C (init): add the paragraph-spacing command.
8849 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8851 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8853 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8854 different from the documents.
8856 * src/text.C (SetHeightOfRow): take paragraph spacing into
8857 account, paragraph spacing takes precedence over buffer spacing
8858 (GetVisibleRow): ditto
8860 * src/paragraph.C (writeFile): output the spacing parameter too.
8861 (validate): set the correct features if spacing is used in the
8863 (Clear): set spacing to default
8864 (MakeSameLayout): spacing too
8865 (HasSameLayout): spacing too
8866 (SetLayout): spacing too
8867 (TeXOnePar): output the spacing commands
8869 * src/lyxparagraph.h: added a spacing variable for use with
8870 per-paragraph spacing.
8872 * src/Spacing.h: add a Default spacing and a method to check if
8873 the current spacing is default. also added an operator==
8875 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8878 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * src/lyxserver.C (callback): fix dispatch of functions
8882 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8883 printf() into lyxerr call.
8885 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8888 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8889 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8890 the "Float" from each of the subitems.
8891 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8893 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8894 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8895 documented the change so that the workaround can be nuked later.
8897 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8900 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8902 * src/buffer.C (getLatexName): ditto
8903 (setReadonly): ditto
8905 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8907 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8908 avoid some uses of current_view. Added also a bufferParams()
8909 method to get at this.
8911 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8913 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8915 * src/lyxparagraph.[Ch]: removed
8916 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8917 with operators used by lower_bound and
8918 upper_bound in InsetTable's
8919 Make struct InsetTable private again. Used matchpos.
8921 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8923 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8924 document, the language of existing text is changed (unless the
8925 document is multi-lingual)
8927 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8929 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8931 * A lot of files: A rewrite of the Right-to-Left support.
8933 2000-04-10 Juergen Vigna <jug@sad.it>
8935 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8936 misplaced cursor when inset in inset is locked.
8938 * src/insets/insettext.C (LocalDispatch): small fix so that a
8939 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8941 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8942 footnote font should be decreased in size twice when displaying.
8944 * src/insets/insettext.C (GetDrawFont): inserted this function as
8945 the drawing-font may differ from the real paragraph font.
8947 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8948 insets (inset in inset!).
8950 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8951 function here because we don't want footnotes inside footnotes.
8953 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8955 (init): now set the inset_owner in paragraph.C
8956 (LocalDispatch): added some resetPos() in the right position
8959 (pasteSelection): changed to use the new CutAndPaste-Class.
8961 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8962 which tells if it is allowed to insert another inset inside this one.
8964 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8965 SwitchLayoutsBetweenClasses.
8967 * src/text2.C (InsertInset): checking of the new paragraph-function
8969 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8970 is not needed anymore here!
8973 (PasteSelection): redone (also with #ifdef) so that now this uses
8974 the CutAndPaste-Class.
8975 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8978 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8979 from/to text/insets.
8981 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8982 so that the paragraph knows if it is inside an (text)-inset.
8983 (InsertFromMinibuffer): changed return-value to bool as now it
8984 may happen that an inset is not inserted in the paragraph.
8985 (InsertInsetAllowed): this checks if it is allowed to insert an
8986 inset in this paragraph.
8988 (BreakParagraphConservative):
8989 (BreakParagraph) : small change for the above change of the return
8990 value of InsertFromMinibuffer.
8992 * src/lyxparagraph.h: added inset_owner and the functions to handle
8993 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8995 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8997 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8998 functions from BufferView to BufferView::Pimpl to ease maintence.
9000 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9001 correctly. Also use SetCursorIntern instead of SetCursor.
9003 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9006 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9008 * src/WorkArea.C (belowMouse): manually implement below mouse.
9010 * src/*: Add "explicit" on several constructors, I added probably
9011 some unneeded ones. A couple of changes to code because of this.
9013 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9014 implementation and private parts from the users of BufferView. Not
9017 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9018 implementation and private parts from the users of LyXLex. Not
9021 * src/BufferView_pimpl.[Ch]: new files
9023 * src/lyxlex_pimpl.[Ch]: new files
9025 * src/LyXView.[Ch]: some inline functions move out-of-line
9027 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9029 * src/lyxparagraph.h: make struct InsetTable public.
9031 * src/support/lyxstring.h: change lyxstring::difference_type to be
9032 ptrdiff_t. Add std:: modifiers to streams.
9034 * src/font.C: include the <cctype> header, for islower() and
9037 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9039 * src/font.[Ch]: new files. Contains the metric functions for
9040 fonts, takes a LyXFont as parameter. Better separation of concepts.
9042 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9043 changes because of this.
9045 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9047 * src/*: compile with -Winline and move functions that don't
9050 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9053 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9055 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9056 (various files changed because of this)
9058 * src/Painter.C (text): fixed the drawing of smallcaps.
9060 * src/lyxfont.[Ch] (drawText): removed unused member func.
9063 * src/*.C: added needed "using" statements and "std::" qualifiers.
9065 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9067 * src/*.h: removed all use of "using" from header files use
9068 qualifier std:: instead.
9070 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9072 * src/text.C (Backspace): some additional cleanups (we already
9073 know whether cursor.pos is 0 or not).
9075 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9076 automake does not provide one).
9078 * src/bmtable.h: replace C++ comments with C comments.
9080 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9082 * src/screen.C (ShowCursor): Change the shape of the cursor if
9083 the current language is not equal to the language of the document.
9084 (If the cursor change its shape unexpectedly, then you've found a bug)
9086 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9089 * src/insets/insetnumber.[Ch]: New files.
9091 * src/LyXAction.C (init)
9092 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9095 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9097 * src/lyxparagraph.h
9098 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9099 (the vector is kept sorted).
9101 * src/text.C (GetVisibleRow): Draw selection correctly when there
9102 is both LTR and RTL text.
9104 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9105 which is much faster.
9107 * src/text.C (GetVisibleRow and other): Do not draw the last space
9108 in a row if the direction of the last letter is not equal to the
9109 direction of the paragraph.
9111 * src/lyxfont.C (latexWriteStartChanges):
9112 Check that font language is not equal to basefont language.
9113 (latexWriteEndChanges): ditto
9115 * src/lyx_cb.C (StyleReset): Don't change the language while using
9116 the font-default command.
9118 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9119 empty paragraph before a footnote.
9121 * src/insets/insetcommand.C (draw): Increase x correctly.
9123 * src/screen.C (ShowCursor): Change cursor shape if
9124 current language != document language.
9126 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9128 2000-03-31 Juergen Vigna <jug@sad.it>
9130 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9131 (Clone): changed mode how the paragraph-data is copied to the
9132 new clone-paragraph.
9134 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9135 GetInset(pos) with no inset anymore there (in inset UNDO)
9137 * src/insets/insetcommand.C (draw): small fix as here x is
9138 incremented not as much as width() returns (2 before, 2 behind = 4)
9140 2000-03-30 Juergen Vigna <jug@sad.it>
9142 * src/insets/insettext.C (InsetText): small fix in initialize
9143 widthOffset (should not be done in the init() function)
9145 2000-03-29 Amir Karger <karger@lyx.org>
9147 * lib/examples/it_ItemizeBullets.lyx: translation by
9150 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9152 2000-03-29 Juergen Vigna <jug@sad.it>
9154 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9156 * src/insets/insetfoot.C (Clone): small change as for the below
9157 new init function in the text-inset
9159 * src/insets/insettext.C (init): new function as I've seen that
9160 clone did not copy the Paragraph-Data!
9161 (LocalDispatch): Added code so that now we have some sort of Undo
9162 functionality (well actually we HAVE Undo ;)
9164 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9166 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9168 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9171 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9173 * src/main.C: added a runtime check that verifies that the xforms
9174 header used when building LyX and the library used when running
9175 LyX match. Exit with a message if they don't match. This is a
9176 version number check only.
9178 * src/buffer.C (save): Don't allocate memory on the heap for
9179 struct utimbuf times.
9181 * *: some using changes, use iosfwd instead of the real headers.
9183 * src/lyxfont.C use char const * instead of string for the static
9184 strings. Rewrite some functions to use sstream.
9186 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9188 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9191 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9193 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9194 of Geodesy (from Martin Vermeer)
9196 * lib/layouts/svjour.inc: include file for the Springer svjour
9197 class. It can be used to support journals other than JoG.
9199 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9200 Miskiewicz <misiek@pld.org.pl>)
9201 * lib/reLyX/Makefile.am: ditto.
9203 2000-03-27 Juergen Vigna <jug@sad.it>
9205 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9206 also some modifications with operations on selected text.
9208 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9209 problems with clicking on insets (last famous words ;)
9211 * src/insets/insetcommand.C (draw):
9212 (width): Changed to have a bit of space before and after the inset so
9213 that the blinking cursor can be seen (otherwise it was hidden)
9215 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9217 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9218 would not be added to the link list when an installed gettext (not
9219 part of libc) is found.
9221 2000-03-24 Juergen Vigna <jug@sad.it>
9223 * src/insets/insetcollapsable.C (Edit):
9224 * src/mathed/formula.C (InsetButtonRelease):
9225 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9228 * src/BufferView.C (workAreaButtonPress):
9229 (workAreaButtonRelease):
9230 (checkInsetHit): Finally fixed the clicking on insets be handled
9233 * src/insets/insetert.C (Edit): inserted this call so that ERT
9234 insets work always with LaTeX-font
9236 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9238 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9239 caused lyx to startup with no GUI in place, causing in a crash
9240 upon startup when called with arguments.
9242 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9244 * src/FontLoader.C: better initialization of dummyXFontStruct.
9246 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9248 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9249 for linuxdoc and docbook import and export format options.
9251 * lib/lyxrc.example Example of default values for the previous flags.
9253 * src/lyx_cb.C Use those flags instead of the hardwired values for
9254 linuxdoc and docbook export.
9256 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9259 * src/menus.C Added menus entries for the new import/exports formats.
9261 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9263 * src/lyxrc.*: Added support for running without Gui
9266 * src/FontLoader.C: sensible defaults if no fonts are needed
9268 * src/lyx_cb.C: New function ShowMessage (writes either to the
9269 minibuffer or cout in case of no gui
9270 New function AskOverwrite for common stuff
9271 Consequently various changes to call these functions
9273 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9274 wild guess at sensible screen resolution when having no gui
9276 * src/lyxfont.C: no gui, no fonts... set some defaults
9278 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9280 * src/LColor.C: made the command inset background a bit lighter.
9282 2000-03-20 Hartmut Goebel <goebel@noris.net>
9284 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9285 stdstruct.inc. Koma-Script added some title elements which
9286 otherwise have been listed below "bibliography". This split allows
9287 adding title elements to where they belong.
9289 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9290 define the additional title elements and then include
9293 * many other layout files: changed to include stdtitle.inc just
9294 before stdstruct.inc.
9296 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9298 * src/buffer.C: (save) Added the option to store all backup files
9299 in a single directory
9301 * src/lyxrc.[Ch]: Added variable \backupdir_path
9303 * lib/lyxrc.example: Added descriptions of recently added variables
9305 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9306 bibtex inset, not closing the bibtex popup when deleting the inset)
9308 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9310 * src/lyx_cb.C: add a couple using directives.
9312 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9313 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9314 import based on the filename.
9316 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9317 file would be imported at start, if the filename where of a sgml file.
9319 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9321 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9323 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9324 * src/lyxfont.h Replaced the member variable bits.direction by the
9325 member variable lang. Made many changes in other files.
9326 This allows having a multi-lingual document
9328 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9329 that change the current language to <l>.
9330 Removed the command "font-rtl"
9332 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9333 format for Hebrew documents)
9335 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9336 When auto_mathmode is "true", pressing a digit key in normal mode
9337 will cause entering into mathmode.
9338 If auto_mathmode is "rtl" then this behavior will be active only
9339 when writing right-to-left text.
9341 * src/text2.C (InsertStringA) The string is inserted using the
9344 * src/paragraph.C (GetEndLabel) Gives a correct result for
9345 footnote paragraphs.
9347 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9349 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9351 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9352 front of PasteParagraph. Never insert a ' '. This should at least
9353 fix some cause for the segfaults that we have been experiencing,
9354 it also fixes backspace behaviour slightly. (Phu!)
9356 * src/support/lstrings.C (compare_no_case): some change to make it
9357 compile with gcc 2.95.2 and stdlibc++-v3
9359 * src/text2.C (MeltFootnoteEnvironment): change type o
9360 first_footnote_par_is_not_empty to bool.
9362 * src/lyxparagraph.h: make text private. Changes in other files
9364 (fitToSize): new function
9365 (setContentsFromPar): new function
9366 (clearContents): new function
9367 (SetChar): new function
9369 * src/paragraph.C (readSimpleWholeFile): deleted.
9371 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9372 the file, just use a simple string instead. Also read the file in
9373 a more maintainable manner.
9375 * src/text2.C (InsertStringA): deleted.
9376 (InsertStringB): deleted.
9378 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9381 RedoParagraphs from the doublespace handling part, just set status
9382 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9383 done, but perhaps not like this.)
9385 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9387 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9388 character when inserting an inset.
9390 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9392 * src/bufferparams.C (readLanguage): now takes "default" into
9395 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9396 also initialize the toplevel_keymap with the default bindings from
9399 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9401 * all files using lyxrc: have lyxrc as a real variable and not a
9402 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9405 * src/lyxrc.C: remove double call to defaultKeyBindings
9407 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9408 toolbar defauls using lyxlex. Remove enums, structs, functions
9411 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9412 toolbar defaults. Also store default keybindings in a map.
9414 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9415 storing the toolbar defaults without any xforms dependencies.
9417 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9418 applied. Changed to use iterators.
9420 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9422 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9423 systems that don't have LINGUAS set to begin with.
9425 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9428 the list by Dekel Tsur.
9430 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9432 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9433 * src/insets/form_graphics.C: ditto.
9435 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9437 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * src/bufferparams.C (readLanguage): use the new language map
9441 * src/intl.C (InitKeyMapper): use the new language map
9443 * src/lyx_gui.C (create_forms): use the new language map
9445 * src/language.[Ch]: New files. Used for holding the information
9446 about each language. Now! Use this new language map enhance it and
9447 make it really usable for our needs.
9449 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9451 * screen.C (ShowCursor): Removed duplicate code.
9452 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9453 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9455 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9458 * src/text.C Added TransformChar method. Used for rendering Arabic
9459 text correctly (change the glyphs of the letter according to the
9460 position in the word)
9465 * src/lyxrc.C Added lyxrc command {language_command_begin,
9466 language_command_end,language_command_ltr,language_command_rtl,
9467 language_package} which allows the use of either arabtex or Omega
9470 * src/lyx_gui.C (init)
9472 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9473 to use encoding for menu fonts which is different than the encoding
9476 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9477 do not load the babel package.
9478 To write an English document with Hebrew/Arabic, change the document
9479 language to "english".
9481 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9482 (alphaCounter): changed to return char
9483 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9485 * lib/lyxrc.example Added examples for Hebrew/Arabic
9488 * src/layout.C Added layout command endlabeltype
9490 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9492 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9494 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9496 * src/mathed/math_delim.C (search_deco): return a
9497 math_deco_struct* instead of index.
9499 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9501 * All files with a USE_OSTREAM_ONLY within: removed all code that
9502 was unused when USE_OSTREAM_ONLY is defined.
9504 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9505 of any less. Removed header and using.
9507 * src/text.C (GetVisibleRow): draw the string "Page Break
9508 (top/bottom)" on screen when drawing a pagebreak line.
9510 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9512 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9514 * src/mathed/math_macro.C (draw): do some cast magic.
9517 * src/mathed/math_defs.h: change byte* argument to byte const*.
9519 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9521 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9522 know it is right to return InsetFoot* too, but cxx does not like
9525 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9527 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9529 * src/mathed/math_delim.C: change == to proper assignment.
9531 2000-03-09 Juergen Vigna <jug@sad.it>
9533 * src/insets/insettext.C (setPos): fixed various cursor positioning
9534 problems (via mouse and cursor-keys)
9535 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9536 inset (still a small display problem but it works ;)
9538 * src/insets/insetcollapsable.C (draw): added button_top_y and
9539 button_bottom_y to have correct values for clicking on the inset.
9541 * src/support/lyxalgo.h: commented out 'using std::less'
9543 2000-03-08 Juergen Vigna <jug@sad.it>
9545 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9546 Button-Release event closes as it is alos the Release-Event
9549 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9551 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9553 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9554 can add multiple spaces in Scrap (literate programming) styles...
9555 which, by the way, is how I got hooked on LyX to begin with.
9557 * src/mathed/formula.C (Write): Added dummy variable to an
9558 inset::Latex() call.
9559 (Latex): Add free_spacing boolean to inset::Latex()
9561 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9563 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9564 virtual function to include the free_spacing boolean from
9565 the containing paragraph's style.
9567 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9568 Added free_spacing boolean arg to match inset.h
9570 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9571 Added free_spacing boolean arg to match inset.h
9573 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9574 Added free_spacing boolean and made sure that if in a free_spacing
9575 paragraph, that we output normal space if there is a protected space.
9577 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9578 Added free_spacing boolean arg to match inset.h
9580 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9581 Added free_spacing boolean arg to match inset.h
9583 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9584 Added free_spacing boolean arg to match inset.h
9586 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9587 Added free_spacing boolean arg to match inset.h
9589 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9590 Added free_spacing boolean arg to match inset.h
9592 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9593 free_spacing boolean arg to match inset.h
9595 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9596 Added free_spacing boolean arg to match inset.h
9598 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9599 Added free_spacing boolean arg to match inset.h
9601 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9602 Added free_spacing boolean arg to match inset.h
9604 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9605 Added free_spacing boolean arg to match inset.h
9607 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9608 Added free_spacing boolean arg to match inset.h
9610 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9611 free_spacing boolean arg to match inset.h
9613 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9614 free_spacing boolean arg to match inset.h
9616 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9617 ignore free_spacing paragraphs. The user's spaces are left
9620 * src/text.C (InsertChar): Fixed the free_spacing layout
9621 attribute behavior. Now, if free_spacing is set, you can
9622 add multiple spaces in a paragraph with impunity (and they
9623 get output verbatim).
9624 (SelectSelectedWord): Added dummy argument to inset::Latex()
9627 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9630 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9631 paragraph layouts now only input a simple space instead.
9632 Special character insets don't make any sense in free-spacing
9635 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9636 hard-spaces in the *input* file to simple spaces if the layout
9637 is free-spacing. This converts old files which had to have
9638 hard-spaces in free-spacing layouts where a simple space was
9640 (writeFileAscii): Added free_spacing check to pass to the newly
9641 reworked inset::Latex(...) methods. The inset::Latex() code
9642 ensures that hard-spaces in free-spacing paragraphs get output
9643 as spaces (rather than "~").
9645 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9647 * src/mathed/math_delim.C (draw): draw the empty placeholder
9648 delims with a onoffdash line.
9649 (struct math_deco_compare): struct that holds the "functors" used
9650 for the sort and the binary search in math_deco_table.
9651 (class init_deco_table): class used for initial sort of the
9653 (search_deco): use lower_bound to do a binary search in the
9656 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9658 * src/lyxrc.C: a small secret thingie...
9660 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9661 and to not flush the stream as often as it used to.
9663 * src/support/lyxalgo.h: new file
9664 (sorted): template function used for checking if a sequence is
9665 sorted or not. Two versions with and without user supplied
9666 compare. Uses same compare as std::sort.
9668 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9669 it and give warning on lyxerr.
9671 (struct compare_tags): struct with function operators used for
9672 checking if sorted, sorting and lower_bound.
9673 (search_kw): use lower_bound instead of manually implemented
9676 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9678 * src/insets/insetcollapsable.h: fix Clone() declaration.
9679 * src/insets/insetfoot.h: ditto.
9681 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9683 2000-03-08 Juergen Vigna <jug@sad.it>
9685 * src/insets/lyxinset.h: added owner call which tells us if
9686 this inset is inside another inset. Changed also the return-type
9687 of Editable to an enum so it tells clearer what the return-value is.
9689 * src/insets/insettext.C (computeTextRows): fixed computing of
9690 textinsets which split automatically on more rows.
9692 * src/insets/insetert.[Ch]: changed this to be of BaseType
9695 * src/insets/insetfoot.[Ch]: added footnote inset
9697 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9698 collapsable insets (like footnote, ert, ...)
9700 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9702 * src/lyxdraw.h: remvoe file
9704 * src/lyxdraw.C: remove file
9706 * src/insets/insettext.C: added <algorithm>.
9708 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9710 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9711 (matrix_cb): case MM_OK use string stream
9713 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9716 * src/mathed/math_macro.C (draw): use string stream
9717 (Metrics): use string stream
9719 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9720 directly to the ostream.
9722 * src/vspace.C (asString): use string stream.
9723 (asString): use string stream
9724 (asLatexString): use string stream
9726 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9727 setting Spacing::Other.
9729 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9730 sprintf when creating the stretch vale.
9732 * src/text2.C (alphaCounter): changed to return a string and to
9733 not use a static variable internally. Also fixed a one-off bug.
9734 (SetCounter): changed the drawing of the labels to use string
9735 streams instead of sprintf.
9737 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9738 manipulator to use a scheme that does not require library support.
9739 This is also the way it is done in the new GNU libstdc++. Should
9740 work with DEC cxx now.
9742 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9744 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9745 end. This fixes a bug.
9747 * src/mathed (all files concerned with file writing): apply the
9748 USE_OSTREAM_ONLY changes to mathed too.
9750 * src/support/DebugStream.h: make the constructor explicit.
9752 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9753 count and ostream squashed.
9755 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9757 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9759 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9760 ostringstream uses STL strings, and we might not.
9762 * src/insets/insetspecialchar.C: add using directive.
9763 * src/insets/insettext.C: ditto.
9765 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9767 * lib/layouts/seminar.layout: feeble attempt at a layout for
9768 seminar.cls, far from completet and could really use some looking
9769 at from people used to write layout files.
9771 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9772 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9773 a lot nicer and works nicely with ostreams.
9775 * src/mathed/formula.C (draw): a slightly different solution that
9776 the one posted to the list, but I think this one works too. (font
9777 size wrong in headers.)
9779 * src/insets/insettext.C (computeTextRows): some fiddling on
9780 Jürgens turf, added some comments that he should read.
9782 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9783 used and it gave compiler warnings.
9784 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9787 * src/lyx_gui.C (create_forms): do the right thing when
9788 show_banner is true/false.
9790 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9791 show_banner is false.
9793 * most file writing files: Now use iostreams to do almost all of
9794 the writing. Also instead of passing string &, we now use
9795 stringstreams. mathed output is still not adapted to iostreams.
9796 This change can be turned off by commenting out all the occurences
9797 of the "#define USE_OSTREAM_ONLY 1" lines.
9799 * src/WorkArea.C (createPixmap): don't output debug messages.
9800 (WorkArea): don't output debug messages.
9802 * lib/lyxrc.example: added a comment about the new variable
9805 * development/Code_rules/Rules: Added some more commente about how
9806 to build class interfaces and on how better encapsulation can be
9809 2000-03-03 Juergen Vigna <jug@sad.it>
9811 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9812 automatically with the width of the LyX-Window
9814 * src/insets/insettext.C (computeTextRows): fixed update bug in
9815 displaying text-insets (scrollvalues where not initialized!)
9817 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9819 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9820 id in the check of the result from lower_bound is not enough since
9821 lower_bound can return last too, and then res->id will not be a
9824 * all insets and some code that use them: I have conditionalized
9825 removed the Latex(string & out, ...) this means that only the
9826 Latex(ostream &, ...) will be used. This is a work in progress to
9827 move towards using streams for all output of files.
9829 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9832 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9834 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9835 routine (this fixes bug where greek letters were surrounded by too
9838 * src/support/filetools.C (findtexfile): change a bit the search
9839 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9840 no longer passed to kpsewhich, we may have to change that later.
9842 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9843 warning options to avoid problems with X header files (from Angus
9845 * acinclude.m4: regenerated.
9847 2000-03-02 Juergen Vigna <jug@sad.it>
9849 * src/insets/insettext.C (WriteParagraphData): Using the
9850 par->writeFile() function for writing paragraph-data.
9851 (Read): Using buffer->parseSingleLyXformat2Token()-function
9852 for parsing paragraph data!
9854 * src/buffer.C (readLyXformat2): removed all parse data and using
9855 the new parseSingleLyXformat2Token()-function.
9856 (parseSingleLyXformat2Token): added this function to parse (read)
9857 lyx-file-format (this is called also from text-insets now!)
9859 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9861 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9864 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9865 directly instead of going through a func. One very bad thing: a
9866 static LyXFindReplace, but I don't know where to place it.
9868 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9869 string instead of char[]. Also changed to static.
9870 (GetSelectionOrWordAtCursor): changed to static inline
9871 (SetSelectionOverLenChars): ditto.
9873 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9874 current_view and global variables. both classes has changed names
9875 and LyXFindReplace is not inherited from SearchForm.
9877 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9878 fl_form_search form.
9880 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9882 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9884 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9885 bound (from Kayvan).
9887 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9889 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9891 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9893 * some things that I should comment but the local pub says head to
9896 * comment out all code that belongs to the Roff code for Ascii
9897 export of tables. (this is unused)
9899 * src/LyXView.C: use correct type for global variable
9900 current_layout. (LyXTextClass::size_type)
9902 * some code to get the new insetgraphics closer to working I'd be
9903 grateful for any help.
9905 * src/BufferView2.C (insertInset): use the return type of
9906 NumberOfLayout properly. (also changes in other files)
9908 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9909 this as a test. I want to know what breaks because of this.
9911 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9913 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9915 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9916 to use a \makebox in the label, this allows proper justification
9917 with out using protected spaces or multiple hfills. Now it is
9918 "label" for left justified, "\hfill label\hfill" for center, and
9919 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9920 should be changed accordingly.
9922 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9924 * src/lyxtext.h: change SetLayout() to take a
9925 LyXTextClass::size_type instead of a char (when there is more than
9926 127 layouts in a class); also change type of copylayouttype.
9927 * src/text2.C (SetLayout): ditto.
9928 * src/LyXView.C (updateLayoutChoice): ditto.
9930 * src/LaTeX.C (scanLogFile): errors where the line number was not
9931 given just after the '!'-line were ignored (from Dekel Tsur).
9933 * lib/lyxrc.example: fix description of \date_insert_format
9935 * lib/layouts/llncs.layout: new layout, contributed by Martin
9938 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9940 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9941 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9942 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9943 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9944 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9945 paragraph.C, text.C, text2.C)
9947 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9949 * src/insets/insettext.C (LocalDispatch): remove extra break
9952 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9953 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9955 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9956 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9958 * src/insets/insetbib.h: move InsetBibkey::Holder and
9959 InsetCitation::Holder in public space.
9961 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9963 * src/insets/insettext.h: small change to get the new files from
9964 Juergen to compile (use "string", not "class string").
9966 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9967 const & as parameter to LocalDispatch, use LyXFont const & as
9968 paramter to some other func. This also had impacto on lyxinsets.h
9969 and the two mathed insets.
9971 2000-02-24 Juergen Vigna <jug@sad.it>
9974 * src/commandtags.h:
9976 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9980 * src/BufferView2.C: added/updated code for various inset-functions
9982 * src/insets/insetert.[Ch]: added implementation of InsetERT
9984 * src/insets/insettext.[Ch]: added implementation of InsetText
9986 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9987 (draw): added preliminary code for inset scrolling not finshed yet
9989 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9990 as it is in lyxfunc.C now
9992 * src/insets/lyxinset.h: Added functions for text-insets
9994 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9996 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9997 BufferView and reimplement the list as a queue put inside its own
10000 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10002 * several files: use the new interface to the "updateinsetlist"
10004 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10006 (work_area_handler): call BufferView::trippleClick on trippleclick.
10008 * src/BufferView.C (doubleClick): new function, selects word on
10010 (trippleClick): new function, selects line on trippleclick.
10012 2000-02-22 Allan Rae <rae@lyx.org>
10014 * lib/bind/xemacs.bind: buffer-previous not supported
10016 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10018 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10021 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10023 * src/bufferlist.C: get rid of current_view from this file
10025 * src/spellchecker.C: get rid of current_view from this file
10027 * src/vspace.C: get rid of current_view from this file
10028 (inPixels): added BufferView parameter for this func
10029 (asLatexCommand): added a BufferParams for this func
10031 * src/text.C src/text2.C: get rid of current_view from these
10034 * src/lyxfont.C (getFontDirection): move this function here from
10037 * src/bufferparams.C (getDocumentDirection): move this function
10040 * src/paragraph.C (getParDirection): move this function here from
10042 (getLetterDirection): ditto
10044 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10046 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10047 resize due to wrong pixmap beeing used. Also took the opurtunity
10048 to make the LyXScreen stateless on regard to WorkArea and some
10049 general cleanup in the same files.
10051 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10053 * src/Makefile.am: add missing direction.h
10055 * src/PainterBase.h: made the width functions const.
10057 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10060 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10062 * src/insets/insetlatexaccent.C (draw): make the accents draw
10063 better, at present this will only work well with iso8859-1.
10065 * several files: remove the old drawing code, now we use the new
10068 * several files: remove support for mono_video, reverse_video and
10071 2000-02-17 Juergen Vigna <jug@sad.it>
10073 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10074 int ** as we have to return the pointer, otherwise we have only
10075 NULL pointers in the returning function.
10077 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10079 * src/LaTeX.C (operator()): quote file name when running latex.
10081 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10083 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10084 (bubble tip), this removes our special handling of this.
10086 * Remove all code that is unused now that we have the new
10087 workarea. (Code that are not active when NEW_WA is defined.)
10089 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10091 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10093 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10094 nonexisting layout; correctly redirect obsoleted layouts.
10096 * lib/lyxrc.example: document \view_dvi_paper_option
10098 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10101 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10102 (PreviewDVI): handle the view_dvi_paper_option variable.
10103 [Both from Roland Krause]
10105 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10107 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10108 char const *, int, LyXFont)
10109 (text(int, int, string, LyXFont)): ditto
10111 * src/text.C (InsertCharInTable): attempt to fix the double-space
10112 feature in tables too.
10113 (BackspaceInTable): ditto.
10114 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10116 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10118 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10120 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10121 newly found text in textcache to this.
10122 (buffer): set the owner of the text put into the textcache to 0
10124 * src/insets/figinset.C (draw): fixed the drawing of figures with
10127 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10128 drawing of mathframe, hfills, protected space, table lines. I have
10129 now no outstanding drawing problems with the new Painter code.
10131 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10133 * src/PainterBase.C (ellipse, circle): do not specify the default
10136 * src/LColor.h: add using directive.
10138 * src/Painter.[Ch]: change return type of methods from Painter& to
10139 PainterBase&. Add a using directive.
10141 * src/WorkArea.C: wrap xforms callbacks in C functions
10144 * lib/layouts/foils.layout: font fix and simplifications from Carl
10147 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * a lot of files: The Painter, LColor and WorkArea from the old
10150 devel branch has been ported to lyx-devel. Some new files and a
10151 lot of #ifdeffed code. The new workarea is enabled by default, but
10152 if you want to test the new Painter and LColor you have to compile
10153 with USE_PAINTER defined (do this in config.h f.ex.) There are
10154 still some rought edges, and I'd like some help to clear those
10155 out. It looks stable (loads and displays the Userguide very well).
10158 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10160 * src/buffer.C (pop_tag): revert to the previous implementation
10161 (use a global variable for both loops).
10163 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10165 * src/lyxrc.C (LyXRC): change slightly default date format.
10167 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10168 there is an English text with a footnote that starts with a Hebrew
10169 paragraph, or vice versa.
10170 (TeXFootnote): ditto.
10172 * src/text.C (LeftMargin): allow for negative values for
10173 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10176 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10177 for input encoding (cyrillic)
10179 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10181 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10184 * src/toolbar.C (set): ditto
10185 * src/insets/insetbib.C (create_form_citation_form): ditto
10187 * lib/CREDITS: added Dekel Tsur.
10189 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10190 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10191 hebrew supports files from Dekel Tsur.
10193 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10194 <tzafrir@technion.ac.il>
10196 * src/lyxrc.C: put \date_insert_format at the right place.
10198 * src/buffer.C (makeLaTeXFile): fix the handling of
10199 BufferParams::sides when writing out latex files.
10201 * src/BufferView2.C: add a "using" directive.
10203 * src/support/lyxsum.C (sum): when we use lyxstring,
10204 ostringstream::str needs an additional .c_str().
10206 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10208 * src/support/filetools.C (ChangeExtension): patch from Etienne
10211 * src/TextCache.C (show): remove const_cast and make second
10212 parameter non-const LyXText *.
10214 * src/TextCache.h: use non const LyXText in show.
10216 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10219 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10221 * src/support/lyxsum.C: rework to be more flexible.
10223 * several places: don't check if a pointer is 0 if you are going
10226 * src/text.C: remove some dead code.
10228 * src/insets/figinset.C: remove some dead code
10230 * src/buffer.C: move the BufferView funcs to BufferView2.C
10231 remove all support for insetlatexdel
10232 remove support for oldpapersize stuff
10233 made some member funcs const
10235 * src/kbmap.C: use a std::list to store the bindings in.
10237 * src/BufferView2.C: new file
10239 * src/kbsequence.[Ch]: new files
10241 * src/LyXAction.C + others: remove all trace of buffer-previous
10243 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10244 only have one copy in the binary of this table.
10246 * hebrew patch: moved some functions from LyXText to more
10247 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10249 * several files: remove support for XForms older than 0.88
10250 whitespace changes.
10251 remove some #if 0 #endif code
10253 * src/TextCache.[Ch]: new file. Holds the textcache.
10255 * src/BufferView.C: changes to use the new TextCache interface.
10256 (waitForX): remove the now unused code.
10258 * src/BackStack.h: remove some commented code
10260 * lib/bind/emacs.bind: remove binding for buffer-previous
10262 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10264 * applied the hebrew patch.
10266 * src/lyxrow.h: make sure that all Row variables are initialized.
10268 * src/text2.C (TextHandleUndo): comment out a delete, this might
10269 introduce a memory leak, but should also help us to not try to
10270 read freed memory. We need to look at this one.
10272 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10273 (LyXParagraph): initalize footnotekind.
10275 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10276 forgot this when applying the patch. Please heed the warnings.
10278 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10279 (aka. reformat problem)
10281 * src/bufferlist.C (exists): made const, and use const_iterator
10282 (isLoaded): new func.
10283 (release): use std::find to find the correct buffer.
10285 * src/bufferlist.h: made getState a const func.
10286 made empty a const func.
10287 made exists a const func.
10290 2000-02-01 Juergen Vigna <jug@sad.it>
10292 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10294 * po/it.po: updated a bit the italian po file and also changed the
10295 'file nuovo' for newfile to 'filenuovo' without a space, this did
10298 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10299 for the new insert_date command.
10301 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10302 from jdblair, to insert a date into the current text conforming to
10303 a strftime format (for now only considering the locale-set and not
10304 the document-language).
10306 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10308 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10309 Bounds Read error seen by purify. The problem was that islower is
10310 a macros which takes an unsigned char and uses it as an index for
10311 in array of characters properties (and is thus subject to the
10315 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10316 correctly the paper sides radio buttons.
10317 (UpdateDocumentButtons): ditto.
10319 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10321 * src/kbmap.C (getsym + others): change to return unsigned int,
10322 returning a long can give problems on 64 bit systems. (I assume
10323 that int is 32bit on 64bit systems)
10325 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10327 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10328 LyXLookupString to be zero-terminated. Really fixes problems seen
10329 by purify, I think.
10331 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10334 write a (char*)0 to the lyxerr stream.
10336 * src/lastfiles.C: move algorithm before the using statemets.
10338 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10340 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10341 complains otherwise).
10342 * src/table.C: ditto
10344 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10347 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10348 that I removed earlier... It is really needed.
10350 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10352 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10354 * INSTALL: update xforms home page URL.
10356 * lib/configure.m4: fix a bug with unreadable layout files.
10358 * src/table.C (calculate_width_of_column): add "using std::max"
10361 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10363 * several files: marked several lines with "DEL LINE", this is
10364 lines that can be deleted without changing anything.
10365 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10366 checks this anyway */
10369 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10371 * src/DepTable.C (update): add a "+" at the end when the checksum
10372 is different. (debugging string only)
10374 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10375 the next inset to not be displayed. This should also fix the list
10376 of labels in the "Insert Crossreference" dialog.
10378 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10380 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10381 when regex was not found.
10383 * src/support/lstrings.C (lowercase): use handcoded transform always.
10386 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10387 old_cursor.par->prev could be 0.
10389 * several files: changed post inc/dec to pre inc/dec
10391 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10392 write the lastfiles to file.
10394 * src/BufferView.C (buffer): only show TextCache info when debugging
10396 (resizeCurrentBuffer): ditto
10397 (workAreaExpose): ditto
10399 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10401 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10403 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10404 a bit better by removing the special case for \i and \j.
10406 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10408 * src/lyx_main.C (easyParse): remove test for bad comand line
10409 options, since this broke all xforms-related parsing.
10411 * src/kbmap.C (getsym): set return type to unsigned long, as
10412 declared in header. On an alpha, long is _not_ the same as int.
10414 * src/support/LOstream.h: add a "using std::flush;"
10416 * src/insets/figinset.C: ditto.
10418 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10420 * src/bufferlist.C (write): use blinding fast file copy instead of
10421 "a char at a time", now we are doing it the C++ way.
10423 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10424 std::list<int> instead.
10425 (addpidwait): reflect move to std::list<int>
10426 (sigchldchecker): ditto
10428 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10431 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10432 that obviously was wrong...
10434 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10435 c, this avoids warnings with purify and islower.
10437 * src/insets/figinset.C: rename struct queue to struct
10438 queue_element and rewrite to use a std::queue. gsqueue is now a
10439 std::queue<queue_element>
10440 (runqueue): reflect move to std::queue
10443 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10444 we would get "1" "0" instead of "true" "false. Also make the tostr
10447 2000-01-21 Juergen Vigna <jug@sad.it>
10449 * src/buffer.C (writeFileAscii): Disabled code for special groff
10450 handling of tabulars till I fix this in table.C
10452 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10454 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10456 * src/support/lyxlib.h: ditto.
10458 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10460 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10461 and 'j' look better. This might fix the "macron" bug that has been
10464 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10465 functions as one template function. Delete the old versions.
10467 * src/support/lyxsum.C: move using std::ifstream inside
10470 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10473 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10475 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10477 * src/insets/figinset.C (InitFigures): use new instead of malloc
10478 to allocate memory for figures and bitmaps.
10479 (DoneFigures): use delete[] instead of free to deallocate memory
10480 for figures and bitmaps.
10481 (runqueue): use new to allocate
10482 (getfigdata): use new/delete[] instead of malloc/free
10483 (RegisterFigure): ditto
10485 * some files: moved some declarations closer to first use, small
10486 whitespace changes use preincrement instead of postincrement where
10487 it does not make a difference.
10489 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10490 step on the way to use stl::containers for key maps.
10492 * src/bufferlist.h: add a typedef for const_iterator and const
10493 versions of begin and end.
10495 * src/bufferlist.[Ch]: change name of member variable _state to
10496 state_. (avoid reserved names)
10498 (getFileNames): returns the filenames of the buffers in a vector.
10500 * configure.in (ALL_LINGUAS): added ro
10502 * src/support/putenv.C: new file
10504 * src/support/mkdir.C: new file
10506 2000-01-20 Allan Rae <rae@lyx.org>
10508 * lib/layouts/IEEEtran.layout: Added several theorem environments
10510 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10511 couple of minor additions.
10513 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10514 (except for those in footnotes of course)
10516 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10518 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10520 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10521 std::sort and std::lower_bound instead of qsort and handwritten
10523 (struct compara): struct that holds the functors used by std::sort
10524 and std::lower_bound in MathedLookupBOP.
10526 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10528 * src/support/LAssert.h: do not do partial specialization. We do
10529 not really need it.
10531 * src/support/lyxlib.h: note that lyx::getUserName() and
10532 lyx::date() are not in use right now. Should these be suppressed?
10534 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10535 (makeLinuxDocFile): do not put date and user name in linuxdoc
10538 * src/support/lyxlib.h (kill): change first argument to long int,
10539 since that's what solaris uses.
10541 * src/support/kill.C (kill): fix declaration to match prototype.
10543 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10544 actually check whether namespaces are supported. This is not what
10547 * src/support/lyxsum.C: add a using directive.
10549 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10551 * src/support/kill.C: if we have namespace support we don't have
10552 to include lyxlib.h.
10554 * src/support/lyxlib.h: use namespace lyx if supported.
10556 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10558 * src/support/date.C: new file
10560 * src/support/chdir.C: new file
10562 * src/support/getUserName.C: new file
10564 * src/support/getcwd.C: new file
10566 * src/support/abort.C: new file
10568 * src/support/kill.C: new file
10570 * src/support/lyxlib.h: moved all the functions in this file
10571 insede struct lyx. Added also kill and abort to this struct. This
10572 is a way to avoid the "kill is not defined in <csignal>", we make
10573 C++ wrappers for functions that are not ANSI C or ANSI C++.
10575 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10576 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10577 lyx it has been renamed to sum.
10579 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10581 * src/text.C: add using directives for std::min and std::max.
10583 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10585 * src/texrow.C (getIdFromRow): actually return something useful in
10586 id and pos. Hopefully fixes the bug with positionning of errorbox
10589 * src/lyx_main.C (easyParse): output an error and exit if an
10590 incorrect command line option has been given.
10592 * src/spellchecker.C (ispell_check_word): document a memory leak.
10594 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10595 where a "struct utimbuf" is allocated with "new" and deleted with
10598 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10600 * src/text2.C (CutSelection): don't delete double spaces.
10601 (PasteSelection): ditto
10602 (CopySelection): ditto
10604 * src/text.C (Backspace): don't delete double spaces.
10606 * src/lyxlex.C (next): fix a bug that were only present with
10607 conformant std::istream::get to read comment lines, use
10608 std::istream::getline instead. This seems to fix the problem.
10610 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10612 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10613 allowed to insert space before space" editing problem. Please read
10614 commends at the beginning of the function. Comments about usage
10617 * src/text.C (InsertChar): fix for the "not allowed to insert
10618 space before space" editing problem.
10620 * src/text2.C (DeleteEmptyParagraphMechanism): when
10621 IsEmptyTableRow can only return false this last "else if" will
10622 always be a no-op. Commented out.
10624 * src/text.C (RedoParagraph): As far as I can understand tmp
10625 cursor is not really needed.
10627 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10628 present it could only return false anyway.
10629 (several functions): Did something not so smart...added a const
10630 specifier on a lot of methods.
10632 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10633 and add a tmp->text.resize. The LyXParagraph constructor does the
10635 (BreakParagraphConservative): ditto
10637 * src/support/path.h (Path): add a define so that the wrong usage
10638 "Path("/tmp") will be flagged as a compilation error:
10639 "`unnamed_Path' undeclared (first use this function)"
10641 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10643 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10644 which was bogus for several reasons.
10646 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10648 (runBibTeX): ditto.
10650 * autogen.sh: do not use "type -path" (what's that anyway?).
10652 * src/support/filetools.C (findtexfile): remove extraneous space
10653 which caused a kpsewhich warning (at least with kpathsea version
10656 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10658 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10660 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10662 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10664 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10666 * src/paragraph.C (BreakParagraph): do not reserve space on text
10667 if we don't need to (otherwise, if pos_end < pos, we end up
10668 reserving huge amounts of memory due to bad unsigned karma).
10669 (BreakParagraphConservative): ditto, although I have not seen
10670 evidence the bug can happen here.
10672 * src/lyxparagraph.h: add a using std::list.
10674 2000-01-11 Juergen Vigna <jug@sad.it>
10676 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10677 could not be found.
10679 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10681 * src/vc-backend.C (doVCCommand): change to be static and take one
10682 more parameter: the path to chdir too be fore executing the command.
10683 (retrive): new function equiv to "co -r"
10685 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10686 file_not_found_hook is true.
10688 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10690 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10691 if a file is readwrite,readonly...anything else.
10693 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10695 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10696 (CreatePostscript): name change from MenuRunDVIPS (or something)
10697 (PreviewPostscript): name change from MenuPreviewPS
10698 (PreviewDVI): name change from MenuPreviewDVI
10700 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10701 \view_pdf_command., \pdf_to_ps_command
10703 * lib/configure.m4: added search for PDF viewer, and search for
10704 PDF to PS converter.
10705 (lyxrc.defaults output): add \pdflatex_command,
10706 \view_pdf_command and \pdf_to_ps_command.
10708 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10710 * src/bufferlist.C (write): we don't use blocksize for anything so
10713 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10715 * src/support/block.h: disable operator T* (), since it causes
10716 problems with both compilers I tried. See comments in the file.
10718 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10721 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10722 variable LYX_DIR_10x to LYX_DIR_11x.
10724 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10726 * INSTALL: document --with-lyxname.
10729 * configure.in: new configure flag --with-lyxname which allows to
10730 choose the name under which lyx is installed. Default is "lyx", of
10731 course. It used to be possible to do this with --program-suffix,
10732 but the later has in fact a different meaning for autoconf.
10734 * src/support/lstrings.h (lstrchr): reformat a bit.
10736 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10737 * src/mathed/math_defs.h: ditto.
10739 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10741 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10742 true, decides if we create a backup file or not when saving. New
10743 tag and variable \pdf_mode, defaults to false. New tag and
10744 variable \pdflatex_command, defaults to pdflatex. New tag and
10745 variable \view_pdf_command, defaults to xpdf. New tag and variable
10746 \pdf_to_ps_command, defaults to pdf2ps.
10748 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10750 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10751 does not have a BufferView.
10752 (unlockInset): ditto + don't access the_locking_inset if the
10753 buffer does not have a BufferView.
10755 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10756 certain circumstances so that we don't continue a keyboard
10757 operation long after the key was released. Try f.ex. to load a
10758 large document, press PageDown for some seconds and then release
10759 it. Before this change the document would contine to scroll for
10760 some time, with this change it stops imidiatly.
10762 * src/support/block.h: don't allocate more space than needed. As
10763 long as we don't try to write to the arr[x] in a array_type arr[x]
10764 it is perfectly ok. (if you write to it you might segfault).
10765 added operator value_type*() so that is possible to pass the array
10766 to functions expecting a C-pointer.
10768 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10771 * intl/*: updated to gettext 0.10.35, tried to add our own
10772 required modifications. Please verify.
10774 * po/*: updated to gettext 0.10.35, tried to add our own required
10775 modifications. Please verify.
10777 * src/support/lstrings.C (tostr): go at fixing the problem with
10778 cxx and stringstream. When stringstream is used return
10779 oss.str().c_str() so that problems with lyxstring and basic_string
10780 are avoided. Note that the best solution would be for cxx to use
10781 basic_string all the way, but it is not conformant yet. (it seems)
10783 * src/lyx_cb.C + other files: moved several global functions to
10784 class BufferView, some have been moved to BufferView.[Ch] others
10785 are still located in lyx_cb.C. Code changes because of this. (part
10786 of "get rid of current_view project".)
10788 * src/buffer.C + other files: moved several Buffer functions to
10789 class BufferView, the functions are still present in buffer.C.
10790 Code changes because of this.
10792 * config/lcmessage.m4: updated to most recent. used when creating
10795 * config/progtest.m4: updated to most recent. used when creating
10798 * config/gettext.m4: updated to most recent. applied patch for
10801 * config/gettext.m4.patch: new file that shows what changes we
10802 have done to the local copy of gettext.m4.
10804 * config/libtool.m4: new file, used in creation of acinclude.m4
10806 * config/lyxinclude.m4: new file, this is the lyx created m4
10807 macros, used in making acinclude.m4.
10809 * autogen.sh: GNU m4 discovered as a separate task not as part of
10810 the lib/configure creation.
10811 Generate acinlucde from files in config. Actually cat
10812 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10813 easier to upgrade .m4 files that really are external.
10815 * src/Spacing.h: moved using std::istringstream to right after
10816 <sstream>. This should fix the problem seen with some compilers.
10818 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10820 * src/lyx_cb.C: began some work to remove the dependency a lot of
10821 functions have on BufferView::text, even if not really needed.
10822 (GetCurrentTextClass): removed this func, it only hid the
10825 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10826 forgot this in last commit.
10828 * src/Bullet.C (bulletEntry): use static char const *[] for the
10829 tables, becuase of this the return arg had to change to string.
10830 (bulletSize): ditto
10831 (~Bullet): removed unneeded destructor
10833 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10834 (insetSleep): moved from Buffer
10835 (insetWakeup): moved from Buffer
10836 (insetUnlock): moved from Buffer
10838 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10839 from Buffer to BufferView.
10841 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10843 * config/ltmain.sh: updated to version 1.3.4 of libtool
10845 * config/ltconfig: updated to version 1.3.4 of libtool
10847 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10850 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10851 Did I get that right?
10853 * src/lyxlex.h: add a "using" directive or two.
10854 * src/Spacing.h: ditto.
10855 * src/insets/figinset.C: ditto.
10856 * src/support/filetools.C: ditto.
10857 * src/support/lstrings.C: ditto.
10858 * src/BufferView.C: ditto.
10859 * src/bufferlist.C: ditto.
10860 * src/lyx_cb.C: ditto.
10861 * src/lyxlex.C: ditto.
10863 * NEWS: add some changes for 1.1.4.
10865 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10867 * src/BufferView.C: first go at a TextCache to speed up switching
10870 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10872 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10873 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10874 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10875 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10878 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10879 members of the struct are correctly initialized to 0 (detected by
10881 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10882 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10884 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10885 pidwait, since it was allocated with "new". This was potentially
10886 very bad. Thanks to Michael Schmitt for running purify for us.
10889 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10891 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10893 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10895 1999-12-30 Allan Rae <rae@lyx.org>
10897 * lib/templates/IEEEtran.lyx: minor change
10899 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10900 src/mathed/formula.C (LocalDispatch): askForText changes
10902 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10903 know when a user has cancelled input. Fixes annoying problems with
10904 inserting labels and version control.
10906 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10908 * src/support/lstrings.C (tostr): rewritten to use strstream and
10911 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10913 * src/support/filetools.C (IsFileWriteable): use fstream to check
10914 (IsDirWriteable): use fileinfo to check
10916 * src/support/filetools.h (FilePtr): whole class deleted
10918 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10920 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10922 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10924 * src/bufferlist.C (write): use ifstream and ofstream instead of
10927 * src/Spacing.h: use istrstream instead of sscanf
10929 * src/mathed/math_defs.h: change first arg to istream from FILE*
10931 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10933 * src/mathed/math_parser.C: have yyis to be an istream
10934 (LexGetArg): use istream (yyis)
10936 (mathed_parse): ditto
10937 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10939 * src/mathed/formula.C (Read): rewritten to use istream
10941 * src/mathed/formulamacro.C (Read): rewritten to use istream
10943 * src/lyxlex.h (~LyXLex): deleted desturctor
10944 (getStream): new function, returns an istream
10945 (getFile): deleted funtion
10946 (IsOK): return is.good();
10948 * src/lyxlex.C (LyXLex): delete file and owns_file
10949 (setFile): open an filebuf and assign that to a istream instead of
10951 (setStream): new function, takes an istream as arg.
10952 (setFile): deleted function
10953 (EatLine): rewritten us use istream instead of FILE*
10957 * src/table.C (LyXTable): use istream instead of FILE*
10958 (Read): rewritten to take an istream instead of FILE*
10960 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10962 * src/buffer.C (Dispatch): remove an extraneous break statement.
10964 * src/support/filetools.C (QuoteName): change to do simple
10965 'quoting'. More work is necessary. Also changed to do nothing
10966 under emx (needs fix too).
10967 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10969 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10970 config.h.in to the AC_DEFINE_UNQUOTED() call.
10971 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10972 needs char * as argument (because Solaris 7 declares it like
10975 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10976 remove definition of BZERO.
10978 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10980 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10981 defined, "lyxregex.h" if not.
10983 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10985 (REGEX): new variable that is set to regex.c lyxregex.h when
10986 AM_CONDITIONAL USE_REGEX is set.
10987 (libsupport_la_SOURCES): add $(REGEX)
10989 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10992 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10995 * configure.in: add call to LYX_REGEX
10997 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10998 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11000 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11002 * lib/bind/fi_menus.bind: new file, from
11003 pauli.virtanen@saunalahti.fi.
11005 * src/buffer.C (getBibkeyList): pass the parameter delim to
11006 InsetInclude::getKeys and InsetBibtex::getKeys.
11008 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11009 is passed to Buffer::getBibkeyList
11011 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11012 instead of the hardcoded comma.
11014 * src/insets/insetbib.C (getKeys): make sure that there are not
11015 leading blanks in bibtex keys. Normal latex does not care, but
11016 harvard.sty seems to dislike blanks at the beginning of citation
11017 keys. In particular, the retturn value of the function is
11019 * INSTALL: make it clear that libstdc++ is needed and that gcc
11020 2.7.x probably does not work.
11022 * src/support/filetools.C (findtexfile): make debug message go to
11024 * src/insets/insetbib.C (getKeys): ditto
11026 * src/debug.C (showTags): make sure that the output is correctly
11029 * configure.in: add a comment for TWO_COLOR_ICON define.
11031 * acconfig.h: remove all the entries that already defined in
11032 configure.in or acinclude.m4.
11034 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11035 to avoid user name, date and copyright.
11037 1999-12-21 Juergen Vigna <jug@sad.it>
11039 * src/table.C (Read): Now read bogus row format informations
11040 if the format is < 5 so that afterwards the table can
11041 be read by lyx but without any format-info. Fixed the
11042 crash we experienced when not doing this.
11044 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11046 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11047 (RedoDrawingOfParagraph): ditto
11048 (RedoParagraphs): ditto
11049 (RemoveTableRow): ditto
11051 * src/text.C (Fill): rename arg paperwidth -> paper_width
11053 * src/buffer.C (insertLyXFile): rename var filename -> fname
11054 (writeFile): rename arg filename -> fname
11055 (writeFileAscii): ditto
11056 (makeLaTeXFile): ditto
11057 (makeLinuxDocFile): ditto
11058 (makeDocBookFile): ditto
11060 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11063 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11065 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11068 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11069 compiled by a C compiler not C++.
11071 * src/layout.h (LyXTextClass): added typedef for const_iterator
11072 (LyXTextClassList): added typedef for const_iterator + member
11073 functions begin and end.
11075 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11076 iterators to fill the choice_class.
11077 (updateLayoutChoice): rewritten to use iterators to fill the
11078 layoutlist in the toolbar.
11080 * src/BufferView.h (BufferView::work_area_width): removed unused
11083 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11085 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11086 (sgmlCloseTag): ditto
11088 * src/support/lstrings.h: return type of countChar changed to
11091 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11092 what version of this func to use. Also made to return unsigned int.
11094 * configure.in: call LYX_STD_COUNT
11096 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11097 conforming std::count.
11099 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11101 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11102 and a subscript would give bad display (patch from Dekel Tsur
11103 <dekel@math.tau.ac.il>).
11105 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11107 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11110 * src/chset.h: add a few 'using' directives
11112 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11113 triggered when no buffer is active
11115 * src/layout.C: removed `break' after `return' in switch(), since
11118 * src/lyx_main.C (init): make sure LyX can be ran in place even
11119 when libtool has done its magic with shared libraries. Fix the
11120 test for the case when the system directory has not been found.
11122 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11123 name for the latex file.
11124 (MenuMakeHTML): ditto
11126 * src/buffer.h: add an optional boolean argument, which is passed
11127 to ChangeExtension.
11129 1999-12-20 Allan Rae <rae@lyx.org>
11131 * lib/templates/IEEEtran.lyx: small correction and update.
11133 * configure.in: Attempted to use LYX_PATH_HEADER
11135 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11137 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11138 input from JMarc. Now use preprocessor to find the header.
11139 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11140 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11141 LYX_STL_STRING_FWD. See comments in file.
11143 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11145 * The global MiniBuffer * minibuffer variable is dead.
11147 * The global FD_form_main * fd_form_main variable is dead.
11149 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11151 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11153 * src/table.h: add the LOstream.h header
11154 * src/debug.h: ditto
11156 * src/LyXAction.h: change the explaination of the ReadOnly
11157 attribute: is indicates that the function _can_ be used.
11159 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11162 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11164 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11170 * src/paragraph.C (GetWord): assert on pos>=0
11173 * src/support/lyxstring.C: condition the use of an invariant on
11175 * src/support/lyxstring.h: ditto
11177 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11178 Use LAssert.h instead of plain assert().
11180 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11182 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11183 * src/support/filetools.C: ditto
11185 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11188 * INSTALL: document the new configure flags
11190 * configure.in: suppress --with-debug; add --enable-assertions
11192 * acinclude.m4: various changes in alignment of help strings.
11194 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11196 * src/kbmap.C: commented out the use of the hash map in kb_map,
11197 beginning of movement to a stl::container.
11199 * several files: removed code that was not in effect when
11200 MOVE_TEXT was defined.
11202 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11203 for escaping should not be used. We can discuss if the string
11204 should be enclosed in f.ex. [] instead of "".
11206 * src/trans_mgr.C (insert): use the new returned value from
11207 encodeString to get deadkeys and keymaps done correctly.
11209 * src/chset.C (encodeString): changed to return a pair, to tell
11210 what to use if we know the string.
11212 * src/lyxscreen.h (fillArc): new function.
11214 * src/FontInfo.C (resize): rewritten to use more std::string like
11215 structore, especially string::replace.
11217 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11220 * configure.in (chmod +x some scripts): remove config/gcc-hack
11222 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11224 * src/buffer.C (writeFile): change once again the top comment in a
11225 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11226 instead of an hardcoded version number.
11227 (makeDocBookFile): ditto
11229 * src/version.h: add new define LYX_DOCVERSION
11231 * po/de.po: update from Pit Sütterlin
11232 * lib/bind/de_menus.bind: ditto.
11234 * src/lyxfunc.C (Dispatch): call MenuExport()
11235 * src/buffer.C (Dispatch): ditto
11237 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11238 LyXFunc::Dispatch().
11239 (MenuExport): new function, moved from
11240 LyXFunc::Dispatch().
11242 * src/trans_mgr.C (insert): small cleanup
11243 * src/chset.C (loadFile): ditto
11245 * lib/kbd/iso8859-1.cdef: add missing backslashes
11247 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11249 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11250 help with placing the manually drawn accents better.
11252 (Draw): x2 and hg changed to float to minimize rounding errors and
11253 help place the accents better.
11255 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11256 unsigned short to char is just wrong...cast the char to unsigned
11257 char instead so that the two values can compare sanely. This
11258 should also make the display of insetlatexaccents better and
11259 perhaps also some other insets.
11261 (lbearing): new function
11264 1999-12-15 Allan Rae <rae@lyx.org>
11266 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11267 header that provides a wrapper around the very annoying SGI STL header
11270 * src/support/lyxstring.C, src/LString.h:
11271 removed old SGI-STL-compatability attempts.
11273 * configure.in: Use LYX_STL_STRING_FWD.
11275 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11276 stl_string_fwd.h is around and try to determine it's location.
11277 Major improvement over previous SGI STL 3.2 compatability.
11278 Three small problems remain with this function due to my zero
11279 knowledge of autoconf. JMarc and lgb see the comments in the code.
11281 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11283 * src/broken_const.h, config/hack-gcc, config/README: removed
11285 * configure.in: remove --with-gcc-hack option; do not call
11288 * INSTALL: remove documentation of --with-broken-const and
11291 * acconfig.h: remove all trace of BROKEN_CONST define
11293 * src/buffer.C (makeDocBookFile): update version number in output
11295 (SimpleDocBookOnePar): fix an assert when trying to a character
11296 access beyond string length
11299 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11301 * po/de.po: fix the Export menu
11303 * lyx.man: update the description of -dbg
11305 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11306 (commandLineHelp): updated
11307 (easyParse): show list of available debug levels if -dbg is passed
11310 * src/Makefile.am: add debug.C
11312 * src/debug.h: moved some code to debug.C
11314 * src/debug.C: new file. Contains code to set and show debug
11317 * src/layout.C: remove 'break' after 'continue' in switch
11318 statements, since these cannot be reached.
11320 1999-12-13 Allan Rae <rae@lyx.org>
11322 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11323 (in_word_set): hash() -> math_hash()
11325 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11327 * acconfig.h: Added a test for whether we are using exceptions in the
11328 current compilation run. If so USING_EXCEPTIONS is defined.
11330 * config.in: Check for existance of stl_string_fwd.h
11331 * src/LString.h: If compiling --with-included-string and SGI's
11332 STL version 3.2 is present (see above test) we need to block their
11333 forward declaration of string and supply a __get_c_string().
11334 However, it turns out this is only necessary if compiling with
11335 exceptions enabled so I've a bit more to add yet.
11337 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11338 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11339 src/support/LRegex.h, src/undo.h:
11340 Shuffle the order of the included files a little to ensure that
11341 LString.h gets included before anything that includes stl_string_fwd.h
11343 * src/support/lyxstring.C: We need to #include LString.h instead of
11344 lyxstring.h to get the necessary definition of __get_c_string.
11345 (__get_c_string): New function. This is defined static just like SGI's
11346 although why they need to do this I'm not sure. Perhaps it should be
11347 in lstrings.C instead.
11349 * lib/templates/IEEEtran.lyx: New template file.
11351 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11353 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11354 * intl/Makefile.in (MKINSTALLDIRS): ditto
11356 * src/LyXAction.C (init): changed to hold the LFUN data in a
11357 automatic array in stead of in callso to newFunc, this speeds up
11358 compilation a lot. Also all the memory used by the array is
11359 returned when the init is completed.
11361 * a lot of files: compiled with -Wold-style-cast, changed most of
11362 the reported offenders to C++ style casts. Did not change the
11363 offenders in C files.
11365 * src/trans.h (Match): change argument type to unsigned int.
11367 * src/support/DebugStream.C: fix some types on the streambufs so
11368 that it works on a conforming implementation.
11370 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11372 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11374 * src/support/lyxstring.C: remove the inline added earlier since
11375 they cause a bunch of unsatisfied symbols when linking with dec
11376 cxx. Cxx likes to have the body of inlines at the place where they
11379 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11380 accessing negative bounds in array. This fixes the crash when
11381 inserting accented characters.
11382 * src/trans.h (Match): ditto
11384 * src/buffer.C (Dispatch): since this is a void, it should not try
11385 to return anything...
11387 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11389 * src/buffer.h: removed the two friends from Buffer. Some changes
11390 because of this. Buffer::getFileName and Buffer::setFileName
11391 renamed to Buffer::fileName() and Buffer::fileName(...).
11393 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11395 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11396 and Buffer::update(short) to BufferView. This move is currently
11397 controlled by a define MOVE_TEXT, this will be removed when all
11398 shows to be ok. This move paves the way for better separation
11399 between buffer contents and buffer view. One side effect is that
11400 the BufferView needs a rebreak when swiching buffers, if we want
11401 to avoid this we can add a cache that holds pointers to LyXText's
11402 that is not currently in use.
11404 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11407 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11409 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11411 * lyx_main.C: new command line option -x (or --execute) and
11412 -e (or --export). Now direct conversion from .lyx to .tex
11413 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11414 Unfortunately, X is still needed and the GUI pops up during the
11417 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11419 * src/Spacing.C: add a using directive to bring stream stuff into
11421 * src/paragraph.C: ditto
11422 * src/buffer.C: ditto
11424 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11425 from Lars' announcement).
11427 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11428 example files from Tino Meinen.
11430 1999-12-06 Allan Rae <rae@lyx.org>
11432 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11434 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11436 * src/support/lyxstring.C: added a lot of inline for no good
11439 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11440 latexWriteEndChanges, they were not used.
11442 * src/layout.h (operator<<): output operator for PageSides
11444 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11446 * some example files: loaded in LyX 1.0.4 and saved again to update
11447 certain constructs (table format)
11449 * a lot of files: did the change to use fstream/iostream for all
11450 writing of files. Done with a close look at Andre Poenitz's patch.
11452 * some files: whitespace changes.
11454 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11456 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11457 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11458 architecture, we provide our own. It is used unconditionnally, but
11459 I do not think this is a performance problem. Thanks to Angus
11460 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11461 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11463 (GetInset): use my_memcpy.
11467 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11468 it is easier to understand, but it uses less TeX-only constructs now.
11470 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11471 elements contain spaces
11473 * lib/configure: regenerated
11475 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11476 elements contain spaces; display the list of programs that are
11479 * autogen.sh: make sure lib/configure is executable
11481 * lib/examples/*: rename the tutorial examples to begin with the
11482 two-letters language code.
11484 * src/lyxfunc.C (getStatus): do not query current font if no
11487 * src/lyx_cb.C (RunScript): use QuoteName
11488 (MenuRunDvips): ditto
11489 (PrintApplyCB): ditto
11491 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11492 around argument, so that it works well with the current shell.
11493 Does not work properly with OS/2 shells currently.
11495 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11496 * src/LyXSendto.C (SendtoApplyCB): ditto
11497 * src/lyxfunc.C (Dispatch): ditto
11498 * src/buffer.C (runLaTeX): ditto
11499 (runLiterate): ditto
11500 (buildProgram): ditto
11502 * src/lyx_cb.C (RunScript): ditto
11503 (MenuMakeLaTeX): ditto
11505 * src/buffer.h (getLatexName): new method
11507 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11509 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11511 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11512 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11513 (create_math_panel): ditto
11515 * src/lyxfunc.C (getStatus): re-activate the code which gets
11516 current font and cursor; add test for export to html.
11518 * src/lyxrc.C (read): remove unreachable break statements; add a
11521 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11523 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11525 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11526 introduced by faulty regex.
11527 * src/buffer.C: ditto
11528 * src/lastfiles.C: ditto
11529 * src/paragraph.C: ditto
11530 * src/table.C: ditto
11531 * src/vspace.C: ditto
11532 * src/insets/figinset.C: ditto
11533 Note: most of these is absolutely harmless, except the one in
11534 src/mathed formula.C.
11536 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11538 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11539 operation, yielding correct results for the reLyX command.
11541 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11543 * src/support/filetools.C (ExpandPath): removed an over eager
11545 (ReplaceEnvironmentPath): ditto
11547 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11548 shows that we are doing something fishy in our code...
11549 (BubblePost): ditto
11552 * src/lyxrc.C (read): use a double switch trick to get more help
11553 from the compiler. (the same trick is used in layout.C)
11554 (write): new function. opens a ofstream and pass that to output
11555 (output): new function, takes a ostream and writes the lyxrc
11556 elemts to it. uses a dummy switch to make sure no elements are
11559 * src/lyxlex.h: added a struct pushpophelper for use in functions
11560 with more than one exit point.
11562 * src/lyxlex.[Ch] (GetInteger): made it const
11566 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11568 * src/layout.[hC] : LayoutTags splitted into several enums, new
11569 methods created, better error handling cleaner use of lyxlex. Read
11572 * src/bmtable.[Ch]: change some member prototypes because of the
11573 image const changes.
11575 * commandtags.h, src/LyXAction.C (init): new function:
11576 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11577 This file is not read automatically but you can add \input
11578 preferences to your lyxrc if you want to. We need to discuss how
11581 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11582 in .aux, also remove .bib and .bst files from dependencies when
11585 * src/BufferView.C, src/LyXView.C: add const_cast several places
11586 because of changes to images.
11588 * lib/images/*: same change as for images/*
11590 * lib/lyxrc.example: Default for accept_compound is false not no.
11592 * images/*: changed to be const, however I have som misgivings
11593 about this change so it might be changed back.
11595 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11597 * lib/configure, po/POTFILES.in: regenerated
11599 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11601 * config/lib_configure.m4: removed
11603 * lib/configure.m4: new file (was config/lib_configure.m4)
11605 * configure.in: do not test for rtti, since we do not use it.
11607 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11609 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11610 doubling of allocated space scheme. This makes it faster for large
11611 strings end to use less memory for small strings. xtra rememoved.
11613 * src/insets/figinset.C (waitalarm): commented out.
11614 (GhostscriptMsg): use static_cast
11615 (GhostscriptMsg): use new instead of malloc to allocate memory for
11616 cmap. also delete the memory after use.
11618 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11620 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11621 for changes in bibtex database or style.
11622 (runBibTeX): remove all .bib and .bst files from dep before we
11624 (run): use scanAuc in when dep file already exist.
11626 * src/DepTable.C (remove_files_with_extension): new method
11627 (exist): new method
11629 * src/DepTable.[Ch]: made many of the methods const.
11631 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11633 * src/bufferparams.C: make sure that the default textclass is
11634 "article". It used to be the first one by description order, but
11635 now the first one is "docbook".
11637 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11638 string; call Debug::value.
11639 (easyParse): pass complete argument to setDebuggingLevel().
11641 * src/debug.h (value): fix the code that parses debug levels.
11643 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11646 * src/LyXAction.C: use Debug::ACTION as debug channel.
11648 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11650 * NEWS: updated for the future 1.1.3 release.
11652 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11653 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11654 it should. This is of course a controversial change (since many
11655 people will find that their lyx workscreen is suddenly full of
11656 red), but done for the sake of correctness.
11658 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11659 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11661 * src/insets/inseterror.h, src/insets/inseturl.h,
11662 src/insets/insetinfo.h, src/insets/figinset.h,
11663 src/mathed/formulamacro.h, src/mathed/math_macro.h
11664 (EditMessage): add a missing const and add _() to make sure that
11665 translation happens
11667 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11668 src/insets/insetbib.C, src/support/filetools.C: add `using'
11669 directives for cxx.
11671 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11672 doing 'Insert index of last word' at the beginning of a paragraph.
11674 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11676 * several files: white-space changes.
11678 * src/mathed/formula.C: removed IsAlpha and IsDigit
11680 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11681 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11684 * src/insets/figinset.C (GetPSSizes): don't break when
11685 "EndComments" is seen. But break when a boundingbox is read.
11687 * all classes inherited from Inset: return value of Clone
11688 changed back to Inset *.
11690 * all classes inherited form MathInset: return value of Clone
11691 changed back to MathedInset *.
11693 * src/insets/figinset.C (runqueue): use a ofstream to output the
11694 gs/ps file. Might need some setpresicion or setw. However I can
11695 see no problem with the current code.
11696 (runqueue): use sleep instead of the alarm/signal code. I just
11697 can't see the difference.
11699 * src/paragraph.C (LyXParagraph): reserve space in the new
11700 paragraph and resize the inserted paragraph to just fit.
11702 * src/lyxfunc.h (operator|=): added operator for func_status.
11704 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11705 check for readable file.
11707 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11708 check for readable file.
11709 (MenuMakeLinuxDoc): ditto
11710 (MenuMakeDocBook): ditto
11711 (MenuMakeAscii): ditto
11712 (InsertAsciiFile): split the test for openable and readable
11714 * src/bmtable.C (draw_bitmaptable): use
11715 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11717 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11718 findtexfile from LaTeX to filetools.
11720 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11721 instead of FilePtr. Needs to be verified by a literate user.
11723 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11725 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11726 (EditMessage): likewise.
11728 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11729 respectively as \textasciitilde and \textasciicircum.
11731 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11733 * src/support/lyxstring.h: made the methods that take iterators
11734 use const_iterator.
11736 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11737 (regexMatch): made is use the real regex class.
11739 * src/support/Makefile.am: changed to use libtool
11741 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11743 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11745 (MathIsInset ++): changed several macros to be inline functions
11748 * src/mathed/Makefile.am: changed to use libtool
11750 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11752 * src/insets/inset* : Clone changed to const and return type is
11753 the true insettype not just Inset*.
11755 * src/insets/Makefile.am: changed to use libtool
11757 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11759 * src/undo.[Ch] : added empty() and changed some of the method
11762 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11764 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11765 setID use block<> for the bullets array, added const several places.
11767 * src/lyxfunc.C (getStatus): new function
11769 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11770 LyXAction, added const to several funtions.
11772 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11773 a std::map, and to store the dir items in a vector.
11775 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11778 * src/LyXView.[Ch] + other files : changed currentView to view.
11780 * src/LyXAction.[Ch] : ported from the old devel branch.
11782 * src/.cvsignore: added .libs and a.out
11784 * configure.in : changes to use libtool.
11786 * acinclude.m4 : inserted libtool.m4
11788 * .cvsignore: added libtool
11790 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11792 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11793 file name in insets and mathed directories (otherwise the
11794 dependency is not taken in account under cygwin).
11796 * src/text2.C (InsertString[AB]): make sure that we do not try to
11797 read characters past the string length.
11799 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11801 * lib/doc/LaTeXConfig.lyx.in,
11802 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11804 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11805 file saying who created them and when this heppened; this is
11806 useless and annoys tools like cvs.
11808 * lib/layouts/g-brief-{en,de}.layout,
11809 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11810 from Thomas Hartkens <thomas@hartkens.de>.
11812 * src/{insets,mathed}/Makefile.am: do not declare an empty
11813 LDFLAGS, so that it can be set at configure time (useful on Irix
11816 * lib/reLyX/configure.in: make sure that the prefix is set
11817 correctly in LYX_DIR.
11819 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11821 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11822 be used by 'command-sequence' this allows to bind a key to a
11823 sequence of LyX-commands
11824 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11826 * src/LyXAction.C: add "command-sequence"
11828 * src/LyXFunction.C: handling of "command-sequence"
11830 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11831 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11833 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11835 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11837 * src/buffer.C (writeFile): Do not output a comment giving user
11838 and date at the beginning of a .lyx file. This is useless and
11839 annoys cvs anyway; update version number to 1.1.
11841 * src/Makefile.am (LYX_DIR): add this definition, so that a
11842 default path is hardcoded in LyX.
11844 * configure.in: Use LYX_GNU_GETTEXT.
11846 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11847 AM_GNU_GETTEXT with a bug fixed.
11849 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11851 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11853 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11854 which is used to point to LyX data is now LYX_DIR_11x.
11856 * lyx.man: convert to a unix text file; small updates.
11858 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11860 * src/support/LSubstring.[Ch]: made the second arg of most of the
11861 constructors be a const reference.
11863 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11866 * src/support/lyxstring.[Ch] (swap): added missing member function
11867 and specialization of swap(str, str);
11869 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11871 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11872 trace of the old one.
11874 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11875 put the member definitions in undo.C.
11877 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11878 NEW_TEXT and have now only code that was included when this was
11881 * src/intl.C (LCombo): use static_cast
11883 (DispatchCallback): ditto
11885 * src/definitions.h: removed whole file
11887 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11889 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11890 parsing and stores in a std:map. a regex defines the file format.
11891 removed unneeded members.
11893 * src/bufferparams.h: added several enums from definitions.h here.
11894 Removed unsused destructor. Changed some types to use proper enum
11895 types. use block to have the temp_bullets and user_defined_bullets
11896 and to make the whole class assignable.
11898 * src/bufferparams.C (Copy): removed this functions, use a default
11899 assignment instead.
11901 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11904 * src/buffer.C (readLyXformat2): commend out all that have with
11905 oldpapersize to do. also comment out all that hve to do with
11906 insetlatex and insetlatexdel.
11907 (setOldPaperStuff): commented out
11909 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11911 * src/LyXAction.C: remove use of inset-latex-insert
11913 * src/mathed/math_panel.C (button_cb): use static_cast
11915 * src/insets/Makefile.am (insets_o_SOURCES): removed
11918 * src/support/lyxstring.C (helper): use the unsigned long
11919 specifier, UL, instead of a static_cast.
11921 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11923 * src/support/block.h: new file. to be used as a c-style array in
11924 classes, so that the class can be assignable.
11926 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11928 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11929 NULL, make sure to return an empty string (it is not possible to
11930 set a string to NULL).
11932 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11934 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11936 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11938 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11939 link line, so that Irix users (for example) can set it explicitely to
11942 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11943 it can be overidden at make time (static or dynamic link, for
11946 * src/vc-backend.C, src/LaTeXFeatures.h,
11947 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11948 statements to bring templates to global namespace.
11950 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11952 * src/support/lyxstring.C (operator[] const): make it standard
11955 * src/minibuffer.C (Init): changed to reflect that more
11956 information is given from the lyxvc and need not be provided here.
11958 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11960 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11962 * src/LyXView.C (UpdateTimerCB): use static_cast
11963 (KeyPressMask_raw_callback): ditto
11965 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11966 buffer_, a lot of changes because of this. currentBuffer() ->
11967 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11968 also changes to other files because of this.
11970 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11972 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11973 have no support for RCS and partial support for CVS, will be
11976 * src/insets/ several files: changes because of function name
11977 changes in Bufferview and LyXView.
11979 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11981 * src/support/LSubstring.[Ch]: new files. These implement a
11982 Substring that can be very convenient to use. i.e. is this
11984 string a = "Mary had a little sheep";
11985 Substring(a, "sheep") = "lamb";
11986 a is now "Mary has a little lamb".
11988 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11989 out patterns and subpatterns of strings. It is used by LSubstring
11990 and also by vc-backend.C
11992 * src/support/lyxstring.C: went over all the assertions used and
11993 tried to correct the wrong ones and flag which of them is required
11994 by the standard. some bugs found because of this. Also removed a
11995 couple of assertions.
11997 * src/support/Makefile.am (libsupport_a_SOURCES): added
11998 LSubstring.[Ch] and LRegex.[Ch]
12000 * src/support/FileInfo.h: have struct stat buf as an object and
12001 not a pointer to one, some changes because of this.
12003 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12004 information in layout when adding the layouts preamble to the
12005 textclass preamble.
12007 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12010 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12011 because of bug in OS/2.
12013 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12015 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12016 \verbatim@font instead of \ttfamily, so that it can be redefined.
12018 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12019 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12020 src/layout.h, src/text2.C: add 'using' directive to bring the
12021 STL templates we need from the std:: namespace to the global one.
12022 Needed by DEC cxx in strict ansi mode.
12024 * src/support/LIstream.h,src/support/LOstream.h,
12025 src/support/lyxstring.h,src/table.h,
12026 src/lyxlookup.h: do not include <config.h> in header
12027 files. This should be done in the .C files only.
12029 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12033 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12035 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12036 from Kayvan to fix the tth invokation.
12038 * development/lyx.spec.in: updates from Kayvan to reflect the
12039 changes of file names.
12041 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12043 * src/text2.C (InsertStringB): use std::copy
12044 (InsertStringA): use std::copy
12046 * src/bufferlist.C: use a vector to store the buffers in. This is
12047 an internal change and should not affect any other thing.
12049 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12052 * src/text.C (Fill): fix potential bug, one off bug.
12054 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12056 * src/Makefile.am (lyx_main.o): add more files it depends on.
12058 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12060 * src/support/lyxstring.C: use size_t for the reference count,
12061 size, reserved memory and xtra.
12062 (internal_compare): new private member function. Now the compare
12063 functions should work for std::strings that have embedded '\0'
12065 (compare): all compare functions rewritten to use
12068 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12070 * src/support/lyxstring.C (compare): pass c_str()
12071 (compare): pass c_str
12072 (compare): pass c_str
12074 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12076 * src/support/DebugStream.C: <config.h> was not included correctly.
12078 * lib/configure: forgot to re-generate it :( I'll make this file
12079 auto generated soon.
12081 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12083 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12086 * src/support/lyxstring.C: some changes from length() to rep->sz.
12087 avoids a function call.
12089 * src/support/filetools.C (SpaceLess): yet another version of the
12090 algorithm...now per Jean-Marc's suggestions.
12092 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12094 * src/layout.C (less_textclass_desc): functor for use in sorting
12096 (LyXTextClass::Read): sort the textclasses after reading.
12098 * src/support/filetools.C (SpaceLess): new version of the
12099 SpaceLess functions. What problems does this one give? Please
12102 * images/banner_bw.xbm: made the arrays unsigned char *
12104 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12106 * src/support/lyxstring.C (find): remove bogus assertion in the
12107 two versions of find where this has not been done yet.
12109 * src/support/lyxlib.h: add missing int return type to
12112 * src/menus.C (ShowFileMenu): disable exporting to html if no
12113 html export command is present.
12115 * config/lib_configure.m4: add a test for an HTML converter. The
12116 programs checked for are, in this order: tth, latex2html and
12119 * lib/configure: generated from config/lib_configure.m4.
12121 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12122 html converter. The parameters are now passed through $$FName and
12123 $$OutName, instead of standard input/output.
12125 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12127 * lib/lyxrc.example: update description of \html_command.
12128 add "quotes" around \screen_font_xxx font setting examples to help
12129 people who use fonts with spaces in their names.
12131 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12133 * Distribution files: updates for v1.1.2
12135 * src/support/lyxstring.C (find): remove bogus assert and return
12136 npos for the same condition.
12138 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12140 * added patch for OS/2 from SMiyata.
12142 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12144 * src/text2.C (CutSelection): make space_wrapped a bool
12145 (CutSelection): dont declare int i until we have to.
12146 (alphaCounter): return a char const *.
12148 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12150 * src/support/syscall.C (Systemcalls::kill):
12151 src/support/filetools.C (PutEnv, PutEnvPath):
12152 src/lyx_cb.C (addNewlineAndDepth):
12153 src/FontInfo.C (FontInfo::resize): condition some #warning
12154 directives with WITH_WARNINGS.
12157 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12159 * src/layout.[Ch] + several files: access to class variables
12160 limited and made accessor functions instead a lot of code changed
12161 becuase of this. Also instead of returning pointers often a const
12162 reference is returned instead.
12164 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12166 * src/Makefile.am (dist-hook): added used to remove the CVS from
12167 cheaders upon creating a dist
12168 (EXTRA_DIST): added cheaders
12170 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12171 a character not as a small integer.
12173 * src/support/lyxstring.C (find): removed Assert and added i >=
12174 rep->sz to the first if.
12176 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12178 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12179 src/LyXView.C src/buffer.C src/bufferparams.C
12180 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12181 src/text2.C src/insets/insetinclude.C:
12182 lyxlayout renamed to textclasslist.
12184 * src/layout.C: some lyxerr changes.
12186 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12187 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12188 (LyXLayoutList): removed all traces of this class.
12189 (LyXTextClass::Read): rewrote LT_STYLE
12190 (LyXTextClass::hasLayout): new function
12191 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12192 both const and nonconst version.
12193 (LyXTextClass::delete_layout): new function.
12194 (LyXTextClassList::Style): bug fix. do the right thing if layout
12196 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12197 (LyXTextClassList::NameOfLayout): ditto
12198 (LyXTextClassList::Load): ditto
12200 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12202 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12204 * src/LyXAction.C (LookupFunc): added a workaround for sun
12205 compiler, on the other hand...we don't know if the current code
12206 compiles on sun at all...
12208 * src/support/filetools.C (CleanupPath): subst fix
12210 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12213 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12214 complained about this one?
12216 * src/insets/insetinclude.C (Latex): subst fix
12218 * src/insets/insetbib.C (getKeys): subst fix
12220 * src/LyXSendto.C (SendtoApplyCB): subst fix
12222 * src/lyx_main.C (init): subst fix
12224 * src/layout.C (Read): subst fix
12226 * src/lyx_sendfax_main.C (button_send): subst fix
12228 * src/buffer.C (RoffAsciiTable): subst fix
12230 * src/lyx_cb.C (MenuFax): subst fix
12231 (PrintApplyCB): subst fix
12233 1999-10-26 Juergen Vigna <jug@sad.it>
12235 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12237 (Read): Cleaned up this code so now we read only format vestion >= 5
12239 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12241 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12242 come nobody has complained about this one?
12244 * src/insets/insetinclude.C (Latex): subst fix
12246 * src/insets/insetbib.C (getKeys): subst fix
12248 * src/lyx_main.C (init): subst fix
12250 * src/layout.C (Read): subst fix
12252 * src/buffer.C (RoffAsciiTable): subst fix
12254 * src/lyx_cb.C (MenuFax): subst fix.
12256 * src/layout.[hC] + some other files: rewrote to use
12257 std::container to store textclasses and layouts in.
12258 Simplified, removed a lot of code. Make all classes
12259 assignable. Further simplifications and review of type
12260 use still to be one.
12262 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12263 lastfiles to create the lastfiles partr of the menu.
12265 * src/lastfiles.[Ch]: rewritten to use deque to store the
12266 lastfiles in. Uses fstream for reading and writing. Simplifies
12269 * src/support/syscall.C: remove explicit cast.
12271 * src/BufferView.C (CursorToggleCB): removed code snippets that
12272 were commented out.
12273 use explicat C++ style casts instead of C style casts. also use
12274 u_vdata instea of passing pointers in longs.
12276 * src/PaperLayout.C: removed code snippets that were commented out.
12278 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12280 * src/lyx_main.C: removed code snippets that wer commented out.
12282 * src/paragraph.C: removed code snippets that were commented out.
12284 * src/lyxvc.C (logClose): use static_cast
12286 (viewLog): remove explicit cast to void*
12287 (showLog): removed old commented code
12289 * src/menus.C: use static_cast instead of C style casts. use
12290 u_vdata instead of u_ldata. remove explicit cast to (long) for
12291 pointers. Removed old code that was commented out.
12293 * src/insets/inset.C: removed old commented func
12295 * src/insets/insetref.C (InsetRef): removed old code that had been
12296 commented out for a long time.
12298 (escape): removed C style cast
12300 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12302 * src/insets/insetlatex.C (Draw): removed old commented code
12303 (Read): rewritten to use string
12305 * src/insets/insetlabel.C (escape): removed C style cast
12307 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12309 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12310 old commented code.
12312 * src/insets/insetinclude.h: removed a couple of stupid bools
12314 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12315 (Clone): remove C style cast
12316 (getKeys): changed list to lst because of std::list
12318 * src/insets/inseterror.C (Draw): removed som old commented code.
12320 * src/insets/insetcommand.C (Draw): removed some old commented code.
12322 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12323 commented out forever.
12324 (bibitem_cb): use static_cast instead of C style cast
12325 use of vdata changed to u_vdata.
12327 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12329 (CloseUrlCB): use static_cast instead of C style cast.
12330 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12332 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12333 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12334 (CloseInfoCB): static_cast from ob->u_vdata instead.
12335 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12338 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12339 (C_InsetError_CloseErrorCB): forward the ob parameter
12340 (CloseErrorCB): static_cast from ob->u_vdata instead.
12342 * src/vspace.h: include LString.h since we use string in this class.
12344 * src/vspace.C (lyx_advance): changed name from advance because of
12345 nameclash with stl. And since we cannot use namespaces yet...I
12346 used a lyx_ prefix instead. Expect this to change when we begin
12349 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12351 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12352 and removed now defunct constructor and deconstructor.
12354 * src/BufferView.h: have backstack as a object not as a pointer.
12355 removed initialization from constructor. added include for BackStack
12357 * development/lyx.spec.in (%build): add CFLAGS also.
12359 * src/screen.C (drawFrame): removed another warning.
12361 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12363 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12364 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12365 README and ANNOUNCE a bit for the next release. More work is
12368 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12369 unbreakable if we are in freespacing mode (LyX-Code), but not in
12372 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12374 * src/BackStack.h: fixed initialization order in constructor
12376 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12378 * acinclude.m4 (VERSION): new rules for when a version is
12379 development, added also a variable for prerelease.
12380 (warnings): we set with_warnings=yes for prereleases
12381 (lyx_opt): prereleases compile with same optimization as development
12382 (CXXFLAGS): only use pedantic if we are a development version
12384 * src/BufferView.C (restorePosition): don't do anything if the
12385 backstack is empty.
12387 * src/BackStack.h: added member empty, use this to test if there
12388 is anything to pop...
12390 1999-10-25 Juergen Vigna <jug@sad.it>
12393 * forms/layout_forms.fd +
12394 * forms/latexoptions.fd +
12395 * lyx.fd: changed for various form resize issues
12397 * src/mathed/math_panel.C +
12398 * src/insets/inseterror.C +
12399 * src/insets/insetinfo.C +
12400 * src/insets/inseturl.C +
12401 * src/insets/inseturl.h +
12403 * src/LyXSendto.C +
12404 * src/PaperLayout.C +
12405 * src/ParagraphExtra.C +
12406 * src/TableLayout.C +
12408 * src/layout_forms.C +
12415 * src/menus.C: fixed various resize issues. So now forms can be
12416 resized savely or not be resized at all.
12418 * forms/form_url.fd +
12419 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12422 * src/insets/Makefile.am: added files form_url.[Ch]
12424 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12426 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12427 (and presumably 6.2).
12429 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12430 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12431 remaining static member callbacks.
12433 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12436 * src/support/lyxstring.h: declare struct Srep as friend of
12437 lyxstring, since DEC cxx complains otherwise.
12439 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12441 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12443 * src/LaTeX.C (run): made run_bibtex also depend on files with
12445 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12446 are put into the dependency file.
12448 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12449 the code has shown itself to work
12450 (create_ispell_pipe): removed another warning, added a comment
12453 * src/minibuffer.C (ExecutingCB): removed code that has been
12454 commented out a long time
12456 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12457 out code + a warning.
12459 * src/support/lyxstring.h: comment out the three private
12460 operators, when compiling with string ansi conforming compilers
12461 they make problems.
12463 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12465 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12466 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12469 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12472 * src/mathed/math_panel.C (create_math_panel): remove explicit
12475 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12478 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12479 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12480 to XCreatePixmapFromBitmapData
12481 (fl_set_bmtable_data): change the last argument to be unsigned
12483 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12484 and bh to be unsigned int, remove explicit casts in call to
12485 XReadBitmapFileData.
12487 * images/arrows.xbm: made the arrays unsigned char *
12488 * images/varsz.xbm: ditto
12489 * images/misc.xbm: ditto
12490 * images/greek.xbm: ditto
12491 * images/dots.xbm: ditto
12492 * images/brel.xbm: ditto
12493 * images/bop.xbm: ditto
12495 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12497 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12498 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12499 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12501 (LYX_CXX_CHEADERS): added <clocale> to the test.
12503 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12505 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12507 * src/support/lyxstring.C (append): fixed something that must be a
12508 bug, rep->assign was used instead of rep->append.
12510 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12513 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12514 lyx insert double chars. Fix spotted by Kayvan.
12516 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12518 * Fixed the tth support. I messed up with the Emacs patch apply feature
12519 and omitted the changes in lyxrc.C.
12521 1999-10-22 Juergen Vigna <jug@sad.it>
12523 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12525 * src/lyx_cb.C (MenuInsertRef) +
12526 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12527 the form cannot be resized under it limits (fixes a segfault)
12529 * src/lyx.C (create_form_form_ref) +
12530 * forms/lyx.fd: Changed Gravity on name input field so that it is
12533 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12535 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12536 <ostream> and <istream>.
12538 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12539 whether <fstream> provides the latest standard features, or if we
12540 have an oldstyle library (like in egcs).
12541 (LYX_CXX_STL_STRING): fix the test.
12543 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12544 code on MODERN_STL_STREAM.
12546 * src/support/lyxstring.h: use L{I,O}stream.h.
12548 * src/support/L{I,O}stream.h: new files, designed to setup
12549 correctly streams for our use
12550 - includes the right header depending on STL capabilities
12551 - puts std::ostream and std::endl (for LOStream.h) or
12552 std::istream (LIStream.h) in toplevel namespace.
12554 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12556 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12557 was a bib file that had been changed we ensure that bibtex is run.
12558 (runBibTeX): enhanced to extract the names of the bib files and
12559 getting their absolute path and enter them into the dep file.
12560 (findtexfile): static func that is used to look for tex-files,
12561 checks for absolute patchs and tries also with kpsewhich.
12562 Alternative ways of finding the correct files are wanted. Will
12564 (do_popen): function that runs a command using popen and returns
12565 the whole output of that command in a string. Should be moved to
12568 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12569 file with extension ext has changed.
12571 * src/insets/figinset.C: added ifdef guards around the fl_free
12572 code that jug commented out. Now it is commented out when
12573 compiling with XForms == 0.89.
12575 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12576 to lyxstring.C, and only keep a forward declaration in
12577 lyxstring.h. Simplifies the header file a bit and should help a
12578 bit on compile time too. Also changes to Srep will not mandate a
12579 recompile of code just using string.
12580 (~lyxstring): definition moved here since it uses srep.
12581 (size): definition moved here since it uses srep.
12583 * src/support/lyxstring.h: removed a couple of "inline" that should
12586 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12588 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12591 1999-10-21 Juergen Vigna <jug@sad.it>
12593 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12594 set to left if I just remove the width entry (or it is empty).
12596 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12597 paragraph when having dummy paragraphs.
12599 1999-10-20 Juergen Vigna <jug@sad.it>
12601 * src/insets/figinset.C: just commented some fl_free_form calls
12602 and added warnings so that this calls should be activated later
12603 again. This avoids for now a segfault, but we have a memory leak!
12605 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12606 'const char * argument' to 'string argument', this should
12607 fix some Asserts() in lyxstring.C.
12609 * src/lyxfunc.h: Removed the function argAsString(const char *)
12610 as it is not used anymore.
12612 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12614 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12617 * src/Literate.h: some funcs moved from public to private to make
12618 interface clearer. Unneeded args removed.
12620 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12622 (scanBuildLogFile): ditto
12624 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12625 normal TeX Error. Still room for improvement.
12627 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12629 * src/buffer.C (insertErrors): changes to make the error
12630 desctription show properly.
12632 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12635 * src/support/lyxstring.C (helper): changed to use
12636 sizeof(object->rep->ref).
12637 (operator>>): changed to use a pointer instead.
12639 * src/support/lyxstring.h: changed const reference & to value_type
12640 const & lets see if that helps.
12642 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12644 * Makefile.am (rpmdist): fixed to have non static package and
12647 * src/support/lyxstring.C: removed the compilation guards
12649 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12652 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12653 conditional compile of lyxstring.Ch
12655 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12656 stupid check, but it is a lot better than the bastring hack.
12657 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12659 * several files: changed string::erase into string::clear. Not
12662 * src/chset.C (encodeString): use a char temporary instead
12664 * src/table.C (TexEndOfCell): added tostr around
12665 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12666 (TexEndOfCell): ditto
12667 (TexEndOfCell): ditto
12668 (TexEndOfCell): ditto
12669 (DocBookEndOfCell): ditto
12670 (DocBookEndOfCell): ditto
12671 (DocBookEndOfCell): ditto
12672 (DocBookEndOfCell): ditto
12674 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12676 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12678 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12679 (MenuBuildProg): added tostr around ret
12680 (MenuRunChktex): added tostr around ret
12681 (DocumentApplyCB): added tostr around ret
12683 * src/chset.C (encodeString): added tostr around t->ic
12685 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12686 (makeLaTeXFile): added tostr around tocdepth
12687 (makeLaTeXFile): added tostr around ftcound - 1
12689 * src/insets/insetbib.C (setCounter): added tostr around counter.
12691 * src/support/lyxstring.h: added an operator+=(int) to catch more
12694 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12695 (lyxstring): We DON'T allow NULL pointers.
12697 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12699 * src/mathed/math_macro.C (MathMacroArgument::Write,
12700 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12701 when writing them out.
12703 * src/LString.C: remove, since it is not used anymore.
12705 * src/support/lyxstring.C: condition the content to
12706 USE_INCLUDED_STRING macro.
12708 * src/mathed/math_symbols.C, src/support/lstrings.C,
12709 src/support/lyxstring.C: add `using' directive to specify what
12710 we need in <algorithm>. I do not think that we need to
12711 conditionalize this, but any thought is appreciated.
12713 * many files: change all callback functions to "C" linkage
12714 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12715 strict_ansi. Those who were static are now global.
12716 The case of callbacks which are static class members is
12717 trickier, since we have to make C wrappers around them (see
12718 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12719 did not finish this yet, since it defeats the purpose of
12720 encapsulation, and I am not sure what the best route is.
12722 1999-10-19 Juergen Vigna <jug@sad.it>
12724 * src/support/lyxstring.C (lyxstring): we permit to have a null
12725 pointer as assignment value and just don't assign it.
12727 * src/vspace.C (nextToken): corrected this function substituting
12728 find_first(_not)_of with find_last_of.
12730 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12731 (TableOptCloseCB) (TableSpeCloseCB):
12732 inserted fl_set_focus call for problem with fl_hide_form() in
12735 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12737 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12740 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12742 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12743 LyXLex::next() and not eatline() to get its argument.
12745 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12747 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12748 instead, use fstreams for io of the depfile, removed unneeded
12749 functions and variables.
12751 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12752 vector instead, removed all functions and variables that is not in
12755 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12757 * src/buffer.C (insertErrors): use new interface to TeXError
12759 * Makefile.am (rpmdist): added a rpmdist target
12761 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12762 per Kayvan's instructions.
12764 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12766 * src/Makefile.am: add a definition for localedir, so that locales
12767 are found after installation (Kayvan)
12769 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12771 * development/.cvsignore: new file.
12773 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12775 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12776 C++ compiler provides wrappers for C headers and use our alternate
12779 * configure.in: use LYX_CXX_CHEADERS.
12781 * src/cheader/: new directory, populated with cname headers from
12782 libstdc++-2.8.1. They are a bit old, but probably good enough for
12783 what we want (support compilers who lack them).
12785 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12786 from includes. It turns out is was stupid.
12788 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12790 * lib/Makefile.am (install-data-local): forgot a ';'
12791 (install-data-local): forgot a '\'
12792 (libinstalldirs): needed after all. reintroduced.
12794 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12796 * configure.in (AC_OUTPUT): added lyx.spec
12798 * development/lyx.spec: removed file
12800 * development/lyx.spec.in: new file
12802 * po/*.po: merged with lyx.pot becuase of make distcheck
12804 * lib/Makefile.am (dist-hook): added dist-hook so that
12805 documentation files will be included when doing a make
12806 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12807 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12809 more: tried to make install do the right thing, exclude CVS dirs
12812 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12813 Path would fit in more nicely.
12815 * all files that used to use pathstack: uses now Path instead.
12816 This change was a lot easier than expected.
12818 * src/support/path.h: new file
12820 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12822 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12824 * src/support/lyxstring.C (getline): Default arg was given for
12827 * Configure.cmd: removed file
12829 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12831 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12832 streams classes and types, add the proper 'using' statements when
12833 MODERN_STL is defined.
12835 * src/debug.h: move the << operator definition after the inclusion
12838 * src/support/filetools.C: include "LAssert.h", which is needed
12841 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12844 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12845 include "debug.h" to define a proper ostream.
12847 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12849 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12850 method to the SystemCall class which can kill a process, but it's
12851 not fully implemented yet.
12853 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12855 * src/support/FileInfo.h: Better documentation
12857 * src/lyxfunc.C: Added support for buffer-export html
12859 * src/menus.C: Added Export->As HTML...
12861 * lib/bind/*.bind: Added short-cut for buffer-export html
12863 * src/lyxrc.*: Added support for new \tth_command
12865 * lib/lyxrc.example: Added stuff for new \tth_command
12867 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12869 * lib/Makefile.am (IMAGES): removed images/README
12870 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12871 installes in correct place. Check permisions is installed
12874 * src/LaTeX.C: some no-op changes moved declaration of some
12877 * src/LaTeX.h (LATEX_H): changed include guard name
12879 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12881 * lib/reLyX/Makefile.am: install noweb2lyx.
12883 * lib/Makefile.am: install configure.
12885 * lib/reLyX/configure.in: declare a config aux dir; set package
12886 name to lyx (not sure what the best solution is); generate noweb2lyx.
12888 * lib/layouts/egs.layout: fix the bibliography layout.
12890 1999-10-08 Jürgen Vigna <jug@sad.it>
12892 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12893 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12894 it returned without continuing to search the path.
12896 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12898 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12899 also fixes a bug. It is not allowed to do tricks with std::strings
12900 like: string a("hei"); &a[e]; this will not give what you
12901 think... Any reason for the complexity in this func?
12903 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12905 * Updated README and INSTALL a bit, mostly to check that my
12906 CVS rights are correctly set up.
12908 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12910 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12911 does not allow '\0' chars but lyxstring and std::string does.
12913 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12915 * autogen.sh (AUTOCONF): let the autogen script create the
12916 POTFILES.in file too. POTFILES.in should perhaps now not be
12917 included in the cvs module.
12919 * some more files changed to use C++ includes instead of C ones.
12921 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12923 (Reread): added tostr to nlink. buggy output otherwise.
12924 (Reread): added a string() around szMode when assigning to Buffer,
12925 without this I got a log of garbled info strings.
12927 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12930 * I have added several ostream & operator<<(ostream &, some_type)
12931 functions. This has been done to avoid casting and warnings when
12932 outputting enums to lyxerr. This as thus eliminated a lot of
12933 explicit casts and has made the code clearer. Among the enums
12934 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12935 mathed enums, some font enum the Debug::type enum.
12937 * src/support/lyxstring.h (clear): missing method. equivalent of
12940 * all files that contained "stderr": rewrote constructs that used
12941 stderr to use lyxerr instead. (except bmtable)
12943 * src/support/DebugStream.h (level): and the passed t with
12944 Debug::ANY to avoid spurious bits set.
12946 * src/debug.h (Debug::type value): made it accept strings of the
12947 type INFO,INIT,KEY.
12949 * configure.in (Check for programs): Added a check for kpsewhich,
12950 the latex generation will use this later to better the dicovery of
12953 * src/BufferView.C (create_view): we don't need to cast this to
12954 (void*) that is done automatically.
12955 (WorkAreaButtonPress): removed some dead code.
12957 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12959 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12960 is not overwritten when translated (David Sua'rez de Lis).
12962 * lib/CREDITS: Added David Sua'rez de Lis
12964 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12966 * src/bufferparams.C (BufferParams): default input encoding is now
12969 * acinclude.m4 (cross_compiling): comment out macro
12970 LYX_GXX_STRENGTH_REDUCE.
12972 * acconfig.h: make sure that const is not defined (to empty) when
12973 we are compiling C++. Remove commented out code using SIZEOF_xx
12976 * configure.in : move the test for const and inline as late as
12977 possible so that these C tests do not interefere with C++ ones.
12978 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12979 has not been proven.
12981 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12983 * src/table.C (getDocBookAlign): remove bad default value for
12984 isColumn parameter.
12986 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12988 (ShowFileMenu2): ditto.
12990 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12991 of files to ignore.
12993 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12995 * Most files: finished the change from the old error code to use
12996 DebugStream for all lyxerr debugging. Only minor changes remain
12997 (e.g. the setting of debug levels using strings instead of number)
12999 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13001 * src/layout.C (Add): Changed to use compare_no_case instead of
13004 * src/FontInfo.C: changed loop variable type too string::size_type.
13006 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13008 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13009 set ETAGS_ARGS to --c++
13011 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13013 * src/table.C (DocBookEndOfCell): commented out two unused variables
13015 * src/paragraph.C: commented out four unused variables.
13017 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13018 insed a if clause with type string::size_type.
13020 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13023 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13025 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13026 variable, also changed loop to go from 0 to lenght + 1, instead of
13027 -1 to length. This should be correct.
13029 * src/LaTeX.C (scanError): use string::size_type as loop variable
13032 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13033 (l.896) since y_tmp and row was not used anyway.
13035 * src/insets/insetref.C (escape): use string::size_type as loop
13038 * src/insets/insetquotes.C (Width): use string::size_type as loop
13040 (Draw): use string::size_type as loop variable type.
13042 * src/insets/insetlatexaccent.C (checkContents): use
13043 string::size_type as loop variable type.
13045 * src/insets/insetlabel.C (escape): use string::size_type as loop
13048 * src/insets/insetinfo.C: added an extern for current_view.
13050 * src/insets/insetcommand.C (scanCommand): use string::size_type
13051 as loop variable type.
13053 * most files: removed the RCS tags. With them we had to recompile
13054 a lot of files after a simple cvs commit. Also we have never used
13055 them for anything meaningful.
13057 * most files: tags-query-replace NULL 0. As adviced several plases
13058 we now use "0" instead of "NULL" in our code.
13060 * src/support/filetools.C (SpaceLess): use string::size_type as
13061 loop variable type.
13063 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13065 * src/paragraph.C: fixed up some more string stuff.
13067 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13069 * src/support/filetools.h: make modestr a std::string.
13071 * src/filetools.C (GetEnv): made ch really const.
13073 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13074 made code that used these use max/min from <algorithm> instead.
13076 * changed several c library include files to their equivalent c++
13077 library include files. All is not changed yet.
13079 * created a support subdir in src, put lyxstring and lstrings
13080 there + the extra files atexit, fileblock, strerror. Created
13081 Makefile.am. edited configure.in and src/Makefile.am to use this
13082 new subdir. More files moved to support.
13084 * imported som of the functions from repository lyx, filetools
13086 * ran tags-query-replace on LString -> string, corrected the bogus
13087 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13088 is still some errors in there. This is errors where too much or
13089 too litle get deleted from strings (string::erase, string::substr,
13090 string::replace), there can also be some off by one errors, or
13091 just plain wrong use of functions from lstrings. Viewing of quotes
13094 * LyX is now running fairly well with string, but there are
13095 certainly some bugs yet (see above) also string is quite different
13096 from LString among others in that it does not allow null pointers
13097 passed in and will abort if it gets any.
13099 * Added the revtex4 files I forgot when setting up the repository.
13101 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13103 * All over: Tried to clean everything up so that only the files
13104 that we really need are included in the cvs repository.
13105 * Switched to use automake.
13106 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13107 * Install has not been checked.
13109 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13111 * po/pt.po: Three errors:
13112 l.533 and l.538 format specification error
13113 l. 402 duplicate entry, I just deleted it.