1 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
4 It creates a lot of interesting problems.
6 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
9 the menu exists in the current menubar before opening it.
11 * src/MenuBackend.C (hasSubmenu): new method.
13 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
14 action value by offsetting actions by a large constant (so that
15 bogs choice result will be less than this constant).
17 * lib/bind/fi_menus.bind: more cleanup to menus.
18 * lib/bind/sciword.bind: ditto.
19 * lib/bind/xemacs.bind: ditto.
20 * lib/bind/emacs.bind: ditto.
21 * lib/bind/pt_menus.bind: ditto.
22 * lib/bind/hu_menus.bind: ditto.
24 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
26 * INSTALL: update PROBLEMS section.
28 * src/lyxlookup.h: remove condition on xforms version, since we
29 should not include it if not appropriate.
31 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
33 * src/LColor.C: "latex text" -> "latex inset" (from
36 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
38 * src/frontends/kde/FormTabularCreate.C:
39 * src/frontends/kde/citationdlg.C:
40 * src/frontends/kde/copyrightdlg.C:
41 * src/frontends/kde/paradlg.C:
42 * src/frontends/kde/paraextradlg.C:
43 * src/frontends/kde/parageneraldlg.C:
44 * src/frontends/kde/printdlg.C:
45 * src/frontends/kde/refdlg.C:
46 * src/frontends/kde/tabcreatedlg.C:
47 * src/frontends/kde/tocdlg.C:
48 * src/frontends/kde/urldlg.C: add necessary headers
51 * src/frontends/kde/dlg/emptytable.C:
52 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
53 default parameters (from Angus Leeming)
55 * src/frontends/kde/dlg/moc/.cvsignore:
56 * src/frontends/kde/dlg/.cvsignore:
57 * src/frontends/kde/moc/.cvsignore: fix the library name
60 * src/frontends/kde/paradlg.C:
61 * src/frontends/kde/parageneraldlg.C:
62 * src/frontends/kde/dlg/para.dlg:
63 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
65 * src/frontends/kde/dlg/README: clarified qtarch version
67 * src/frontends/kde/dlg/Makefile.am: removed the
68 dlg rules as they created spontaneous rebuilds
69 (not a good idea as it requires qtarch)
71 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
73 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
74 fixlevel along with xforms version.
76 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
77 xforms version is strictly less than 0.89.5.
78 * src/lyx_gui.C (LyXGUI): ditto.
79 * src/LyXView.C (show): ditto.
81 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
83 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
84 movement in inset in RTL text.
85 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
86 (workAreaButtonRelease): Do not open a float when there is a selection.
88 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
90 * src/spellchecker.C (RunSpellChecker): Open all floats before
93 * src/text.C (InsertChar): Consider "," as a part of a number
94 (for LTR numbers in RTL text code).
95 (IsBoundary): Fixed (and simplified).
96 (InsertChar): Recalculate cursor boundary.
99 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
101 * src/spellchecker.C: fix figures with pspell enabled
103 * src/insets/figinset.C: workaround for gs hang xforms bug
105 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
107 * lib/bind/??_menus.bind: comment out the entries corresponding to
108 real menus. They should be eventually removed, but I'll let the
109 language maintainers do that.
111 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
113 * src/frontends/kde/parageneraldlg.C:
114 * src/frontends/kde/parageneraldlg.h: don't use
115 a derived class for SpaceAbove/Below
117 * src/frontends/kde/dlg/README: add some info
119 * src/frontends/kde/dlg/*: update data files, update
122 * src/frontends/kde/dlg/moc/Makefile.am: add
125 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
127 * configure.in: add new KDE Makefiles
128 * src/vspace.h: return GlueLength not a normal one
129 * src/support/lstrings.h:
130 * src/support/lstrings.C: add isStrUnsignedInt(),
133 * src/frontends/kde/*: big reorganisation, update
134 FormParagraph, add FormTabCreate
136 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
138 * lib/ui/default.ui: small grammatical change.
140 * src/frontends/xforms/xform_macros.h: removed.
142 * src/frontends/xforms/FormBase.C:
143 * src/frontends/xforms/FormPreferences.C:
144 * src/frontends/xforms/Makefile.am: changes associated with removing
145 xform_macros.h. Should make Lars' debugging a little easier.
147 * src/frontends/xforms/FormPreferences.C:
148 * src/frontends/xforms/FormPreferences.h:
149 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
150 longer use X11 color name database. HSV and RGB dials/sliders.
151 Please let this be the end of this!
153 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
155 * Several files: Allow compilation when the compiler doesn't
158 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
161 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
162 command line options.
164 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
166 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
167 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
170 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
172 * src/frontends/xforms/FormRef.C (updateBrowser):
173 * src/frontends/xforms/forms/form_ref.fd: try clicking on
174 different insets with the sort key active. Now apply this patch!
176 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
178 * src/frontends/xforms/FormPrint.C: set to valid()
179 when we update from the passed parameters.
181 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
183 * src/LColor.C (getFromGUIName): internationalise the comparison.
185 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
186 FormPreferences choice.
188 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
191 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
193 * src/lyxrc.C: more detail for the printer program config
196 * src/LColor.C: ert->latex text. LColor needs a big revamp
197 but will have to wait till after 1.1.6
199 * src/buffer.C: bring up a dialog if we load a document
200 with an un-installed text class, rather than just complain
203 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
205 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
206 the browser form for a combox in a tabbed folder. Bug fix courtesy of
207 Steve Lamont <spl@ncmir.ucsd.edu>.
209 * src/frontends/xforms/FormDocument.C (build):
210 * src/frontends/xforms/FormPreferences.C (Language::build):
211 pass tabfolders to Combox::add() in order to use this work around.
213 * src/frontends/xforms/FormCitation.C (connect): remove max size
215 (update): sort list of bibliography keys.
217 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
219 No max size limitation. Same popup for new and existing insets. Fixes
220 bugs reported by Rob Lahaye.
222 * src/frontends/xforms/FormCitation.C (c-tor):
223 * src/frontends/xforms/FormCopyright.C (c-tor):
224 * src/frontends/xforms/FormError.C (c-tor):
225 * src/frontends/xforms/FormGraphics.C (c-tor):
226 * src/frontends/xforms/FormIndex.C (c-tor):
227 * src/frontends/xforms/FormRef.C (c-tor):
228 * src/frontends/xforms/FormToc.C (c-tor):
229 * src/frontends/xforms/FormUrl.C (c-tor):
230 use correct policy for ButtonController.
232 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
234 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
237 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
239 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
240 Some resizing changes.
242 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
244 * configure.in: fix typo
246 * lib/languages: add ukraninian and change no to no_NO
248 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
250 * src/bufferview_funcs.C (FontSize): use setLyXSize
252 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
254 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
255 to check for systems where mkstemp() is available but not declared
256 in headers. The new autoconf macro lyx_CHECK_DECL can be used
257 to check for declarations in headers.
259 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
261 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
263 * forms/makefile: added bibforms.fd, include_form.fd.
264 Removed lyx_sendfax.fd.
266 * src/LaTeXLog.C (ShowLatexLog):
267 * src/LyXAction.C (init):
268 * src/bufferparams.C (readLanguage): altered messages as suggested by
271 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
274 * src/credits.C: made fd_form_credits non-static, so that it can be
275 redrawn should the xforms colors be re-mapped.
276 * src/spellchecker.C ditto fd_form_spell_options.
278 * src/filedlg.[Ch] (redraw):
279 * src/intl.[Ch] (redraw):
280 * src/lyxfr0.[Ch] (redraw):
281 * src/insets/figinset.[Ch] (redraw):
282 * src/insets/insetexternal.[Ch] (redraw):
283 new methods, connected to Dialogs::redrawGUI.
285 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
286 to be connected to Dialogs::redrawGUI.
288 * src/frontends/xforms/FormCitation.C (build):
289 * src/frontends/xforms/FormCopyright.C (build):
290 * src/frontends/xforms/FormError.C (build):
291 * src/frontends/xforms/FormGraphics.C (build):
292 * src/frontends/xforms/FormIndex.C (build):
293 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
294 * src/frontends/xforms/FormToc.C (build):
295 * src/frontends/xforms/FormUrl.C (build):
296 use the ButtonController correctly.
298 * src/frontends/xforms/FormCopyright.C (build):
299 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
300 the .fd file and into build().
302 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
304 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
306 * src/frontends/xforms/forms/form_citation.fd:
307 * src/frontends/xforms/forms/form_copyright.fd:
308 * src/frontends/xforms/forms/form_error.fd:
309 * src/frontends/xforms/forms/form_graphics.fd:
310 * src/frontends/xforms/forms/form_index.fd:
311 * src/frontends/xforms/forms/form_toc.fd:
312 * src/frontends/xforms/forms/form_url.fd:
313 renamed some of the objects. Named others explicitly for the first time.
314 Added Restore and Apply buttons where appropriate.
316 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
319 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
321 * src/version.h: try the pre2 again
323 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
325 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
327 * src/frontends/kde/FormParagraph.C: added using directive.
329 * src/frontends/kde/paradlg.C: added config.h and using directive.
331 * src/frontends/kde/paradlg.h: added std::qualifier.
333 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
335 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
337 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
339 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
341 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
343 * src/version.h: set back to 1.1.6cvs
345 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
347 * src/version.h: set to 1.1.6pre2
349 2000-11-20 Marko Vendelin <markov@ioc.ee>
351 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
353 * src/frontends/gnome/Makefile.am: updated list of XForms object files
355 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
357 * src/LColor.C (init):
358 * src/lyxrc.C (getDescription): changed some comments as suggested by
361 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
362 disconnect the redrawGUI signal in best-practice fashion.
364 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
365 long_opts_tab to reflect the change in name of this tabfolder, as
366 suggested by John Levon.
367 (connect, disconnect): new methods. Don't do much at present other than
368 ensuring that we can't resize the dialog. This just makes xforms go
370 (lots of methods in Colors): made void rather than bool. The idea is
371 to have an isOk() function that keeps track of whether any input is
372 genuinely invalid and should therefore block Save, Apply.
373 Easier to manipulate the counters rapidly.
374 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
375 compiler will like this code. Much cleaner way of doing things.
377 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
379 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
380 rather than simple counters, following suggestion by John Levon.
382 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
383 than engraved frame + text.
385 * src/frontends/xforms/forms/makefile: removed spurious command.
387 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
389 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
391 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
394 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
396 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
397 see what Lars has changed and what is just white space!
398 Now used X directly to ascertain the RGB color associated with the
400 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
402 Added some sort capability.
403 The X11 color name database input is only displayed if the database
404 isn't found in the standard place.
405 Got rid of struct compare_converter; it wasn't used.
406 Probably some other stuff that I've forgotten.
408 * src/frontends/xforms/FormPreferences.h: changed the names of some
409 methods in the Colors struct. Added a couple of structs to help sort
410 colors by name and by RGBColor.
412 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
413 functions into a new class RWInfo.
415 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
416 The dialog is now almost navigable using the keyboard. Unfortunately,
417 the cursor has to be inside a browser for it to be activated. There is
418 no visual feedback for the key shortcuts to the arrow keys (use
419 Alt-appropriate arrow key, Alt-x).
421 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
424 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
425 xform_helpers.[Ch]. See above.
427 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
431 * src/screen.C (setCursorColor): new method. Sets the color of the
433 (ShowManualCursor): call it.
434 Constify some local variables.
436 * src/LColor.[Ch] (LColor): add entry for cursor
437 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
440 2000-11-19 Juergen Vigna <jug@sad.it>
442 * src/insets/insettabular.C (draw): fixed text border redraw problem.
443 (calculate_dimensions_of_cells): try to boost up when inserting chars.
445 2000-11-15 Rob Lahaye <lahaye@postech.edu>
447 * lib/ui/default.ui: OptItem used for Fax entry
449 2000-11-17 Matej Cepl <cepl@bigfoot.com>
451 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
453 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
455 * src/vspace.C (nextToken): fix so it can handle length phrases like
456 "10mm+-20mm", "40inplus16mmminus10cm" etc.
458 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
460 * src/frontends/xforms/FormPreferences.C: constify several variables
461 (BrowserLyX): rewrite to not need the choice variable
462 (Modify): rewrite to not need the choide variable
463 (compare_converter): make operator const
465 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
466 correct the writing of \set_color
467 (getDescription): return a const string
469 * src/kbsequence.[Ch] (addkey): remove dead code
471 * src/Painter.C (text): remove some commented code
473 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
475 * src/ColorHandler.[Ch]: removed some header files from .h file.
476 Included LColor.h in .C file.
478 * src/LColor.[Ch]: made class copyable so that I could create a
479 system_lcolor instance.
481 * src/Painter.h: removed LColor.h.
483 * src/lyx_gui.C (create_forms): used AddName.
485 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
486 of user preferences/lyxrc file.
488 * src/lyxrc.C (output): output changes to lcolor.
490 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
492 Moved class xformColor to files xform_helpers.[Ch]. These files,
493 Color.[Ch], could now be moved into src if they would be useful to
496 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
497 Also moved FormPreferences::browseFile here as it can be used by any
498 xform dialog with a "Browse" button. FormGraphics is a perfect example.
500 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
501 ReadableFile): changed the FormPreferences methods a little and moved
502 them here as they'll be useful elsewhere also.
504 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
505 Removed some header files and used forward declarations instead.
507 Removed some methods as they'll be useful elsewhere (see above).
509 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
510 Can also now modify the LyX LColors. However, for reasons that I don't
511 yet understand, it appears that we can use
512 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
513 present. The problem appears to lie in ColorHandler, because I can
514 change the color using LColor.SetColor(). Similarly, when reading in a
515 preferences file with some set_color instances, I'll get a warning
516 like: Color sea green is undefined or may not be redefined
517 Bad lyxrc set_color for sea green
519 Once the buffer is loaded, however, I can happily change to this color.
521 Finally, it appears that I have to set the color of "inset frame"
522 explicitly, or it oscillates from "black" to "indian red" with each
525 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
527 * ANNOUNCE: corrected a spelling mistake.
529 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
532 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
534 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
536 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
539 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
540 match the requirements from the standard better. This is required
541 to work with gnu libstdc++-v3
543 * src/frontends/xforms/FormPreferences.C: add explict pair
544 arguments to browse calls. include support/lyxmanip.h remvoe
545 extern fmt. whitespace changes. reorder variables in
546 FormPreferences.h, to match initalizaton order.
548 * several files: constify more local variables.
550 * src/buffer.C: remove some commented functions.
552 * src/DepTable.C (remove_files_with_extension): temporary
553 work around for gcc 2.97
554 * src/filedlg.C (find): ditto
555 * src/Variables.C (set): ditto
556 * src/LyXAction.C (searchActionArg): ditto
557 (retrieveActionArg): ditto
559 * configure.in: check for mktemp too
561 * UPGRADING: prepare for 1.1.6
563 * Makefile.am (lgbtags): add backup tags for when etags are
564 different than usual.
566 * ANNOUNCE: prepare for 1.1.6
568 * src/support/tempname.C (make_tempfile): new function, wrapper
569 around mkstemp and mktemp. Only mkstemp has been tested.
572 2000-11-14 Rob Lahaye <lahaye@postech.edu>
574 * default.ui: capitalized some menu items to improve shortcuts.
576 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
578 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
580 * src/frontends/xforms/Dialogs.C: add "using" directive.
582 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
584 * src/filedlg.C (Select): highlight suggested file in browser, if
587 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
588 each tab folder is encapsulated in its own class.
589 The Language keymaps are now chosen using a text input and a
590 browser button, rather than a Combox.
591 All the browser buttons are now functional, although LyXFileDlg
592 still needs to be modified to make it straighhtforward to return a
593 directory if that is what is desired.
595 * src/frontends/xforms/forms/form_preferences.fd: use text input
596 and browse button to input the Language keymaps. Add a few
597 callbacks for the browse buttons.
599 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
601 * src/support/tempname.C (tempName): small changes to make it
602 safer. remove the '.' before XXXXXX
604 * src/support/filetools.C (TmpFileName): remove func
607 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
608 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
609 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
610 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
612 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
615 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
618 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
619 for bp (this fixes a reproducible hard crash)
621 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
624 * src/frontends/xforms/FormBase.h: make bp_ private
625 (FormBaseBI): remove default for bp
628 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
631 * src/frontends/xforms/Color.C (RGBColor): made several vars
632 const, changed initialization of j to allow it to be const
635 * several files: added const to local variables.
637 * src/lyx_cb.C: removed several function prototypes and moved them
641 (UpdateLayoutPreamble):
643 (MenuInsertLabel): add BufferView as arguemnt
644 (LayoutsCB): make tmp const
646 * src/layout_forms.h: regenerated
648 * src/debug.C: add Debug::FILES
649 (showLevel) (showTags): translate the desc
651 * src/debug.h: add FILES as debug target
653 * src/bufferlist.C: use current_view as an interim measure becuase
654 of added arguments to MenuWrite and MenuWriteAs
656 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
658 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
660 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
661 libstdc++ is compiled with.
663 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
665 * lib/layouts/docbook-book.layout
666 * lib/layouts/docbook.layout
667 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
668 those paragraphs are expresse as SGML comments <!-- -->.
670 * src/LaTeXFeatures.h
671 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
672 parameter, this allows to express all the include files as relative
673 paths to the master buffer. The verbatim insert works as the other
676 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
678 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
680 (MakeDocBookFile): top_element is always written. Some clean up, as
681 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
683 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
684 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
685 a reference is written instead of the name.
686 (Validate): use the relative path for the filename.
688 * src/insets/insetlabel.C (DocBook): write end tag, for XML
691 * src/support/filetools.h
692 * src/support/filetools.C (IsSGMLFilename): added.
695 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
697 * development/OS2/quick_fix.patch:
699 * README.OS2: quick update to the OS/2 port.
701 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
703 * src/converter.C: add "using" directive.
705 * src/frontends/xforms/FormPreferences.C: add "using" directive.
706 (compare_converter): add "int" as return type.
708 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
711 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
713 * src/lyx_gui.C (create_forms): map the xform colours, should a
714 mapping exist. Ie, call XformColor::read().
716 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
717 and struct HSV as HSVColor.
718 (XformColor::read, XformColor::write) : new methods that
719 input/output any changes to the cform GUI colors.
721 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
724 * src/frontends/xforms/FormPreferences.C Lots of little changes
725 associated with the changed name of the RGB and HSV structs. Can
726 now save changes to xforms GUI to file. Commented out
727 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
728 used currently anyway.
730 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
732 * src/converter.C: A lot of changes:
733 - It is no longer possible to choose between two or more ways to
734 export to some format (the new code uses only the shortest path).
735 However, it is still possible to choose between pdflatex/ps2pdf
736 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
737 - Added several methods that makes the FormPreferences code simpler.
738 - Changed the tokens $$FName and $$OutName to $$i and $$o.
740 * src/exporter.C (Export): lyxrc.use_pdf is set before
741 makeLaTeXFile is called. This works but not very nice.
743 * src/frontends/xforms/FormPreferences.C: The formats/converters
744 tabs are now fully functional.
746 * src/buffer.C (getTocList): Add numbers to the captions.
748 * lib/lyxrc.example: Removed fax section
750 * src/support/rename.C (rename): Delete the old file if lyx::copy
753 2000-11-13 Rob Lahaye <lahaye@postech.edu>
755 * lib/ui/default.ui: minor polishing.
757 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
759 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
762 * lib/Makefile.am (DOCINST): do not install everything in the
763 documentation directory.
765 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
767 * src/bufferlist.C (newFile): set the filename to the constructed
770 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
771 constructed "newfileXX.lyx" name to the dialog
773 * src/frontends/DialogBase.h: make update() non-abstract so
774 KDE doesn't need to implement two update methods for every form
776 * src/frontends/kde/Makefile.am: add missing xforms objects
779 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
781 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
783 * src/frontends/xforms/Color.[Ch]: new files, defining the color
784 structs RGB and HSV. May not be the best place for these files.
785 Perhaps move them into src ?
787 * src/frontends/xforms/Makefile.am: added new files.
789 * src/frontends/xforms/forms/form_preferences.fd:
790 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
791 replaced all instances of "colour" with "color"!
793 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
796 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
797 tab. Can now alter the colors of the xform's GUI on the fly. With
798 the aid of a single static Signal (see below), can "Apply" these
799 changes to all currently open dialogs. (Well, to all of the NEW
800 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
801 subsequently opened dialogs will, of course, also have the new
802 color scheme. Cannot yet save (or load) the choices to file, so
803 they are lost when exiting LyX.
805 * src/frontends/Dialogs.h:
806 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
807 Used to trigger a redraw of any dialogs connected to it because,
808 for example, the GUI colours have been re-mapped.
810 * src/frontends/xforms/FormBase.[Ch]:
811 * src/frontends/xforms/FormDocument.[Ch]:
812 * src/frontends/xforms/FormParagraph.[Ch]:
813 * src/frontends/xforms/FormPreferences.[Ch]:
814 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
815 method, to be connected to Dialogs::redrawGUI. Method must be
816 virtual, because dialogs with tabbed folders need to redraw the
817 forms of each tab folder.
819 * src/LyXView.C (d-tor):
820 * src/frontends/xforms/FormBase.C (d-tor): connected
821 Dialogs::redrawGUI signal to redraw().
823 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
824 removed Assert, because it is identical to that in FormBase.
826 2000-11-10 Rob Lahaye <lahaye@postech.edu>
828 * lib/ui/default.ui: minor polishing.
830 2000-11-10 Juergen Vigna <jug@sad.it>
832 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
833 (deleteLyXText): ditto
835 * src/insets/insettabular.C (InsetButtonPress): don't clear the
836 selection on mouse-button-3.
838 * src/insets/insettabular.h: new function clearSelection(), use this
839 functions inside insettabular.C.
841 * src/insets/insettabular.C (TabularFeatures): clear the selection
842 on remove_row/column.
844 * src/insets/inset.C (scroll): fixed some scroll stuff.
846 * src/insets/insettabular.C (draw): fixed another minor draw problem.
848 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
850 * lib/CREDITS: add Yves Bastide
852 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
854 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
855 check whether C library functions are in the global namespace.
857 * configure.in: calls it.
859 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
862 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
864 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
865 iterators to prevent crash.
867 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
869 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
871 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
872 shortcut for xforms CB to the preemptive or post-handler function.
874 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
875 removed the HIDDEN_TIMER as it's no longer used.
876 Various other small changes.
878 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
879 preemptive handler to obtain feedback, rather than the post-handler.
880 (ColoursLoadBrowser): find "black" and "white" based on RGB values
882 Formats tab is now complete. Converters tab is nearly so.
884 2000-11-09 Juergen Vigna <jug@sad.it>
886 * src/insets/insettext.C (~InsetText):
889 (SetParagraphData): set cache.second to 0 after deleting it!
890 (getLyXText): check if cache.second is not 0 if finding it.
892 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
894 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
895 lyxlex to parse the rgb.txt file.
898 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
899 replace the default '#' comment character.
901 * src/support/tempname.C: add "using" directive
902 * src/frontends/ButtonPolicies.C: ditto.
904 * src/support/filetools.C (DirList): add an explicit cast to avoid
905 a compile error (probably not the right fix)
907 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
909 * src/support/filetools.C (DirList): implement using system functions
911 * src/support/tempname.C: new file
913 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
915 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
917 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
920 * src/frontends/xforms/ButtonController.C: new file
922 * src/os2_defines.h: remove getcwd define
924 * src/lyxvc.C: include support/lyxlib.h
925 (showLog): use lyx::tempName
927 * src/lyx_cb.C: comment out includes that we don't need
928 (AutoSave): use lyx::tempName
930 * src/filedlg.C: include support/lyxlib.h
931 (Reread): use lyx::getcwd
933 * src/converter.C: include support/filetools.h
934 (add_options): change to static inline, make tail const
935 (Add): make old_viewer const
936 (GetAllFormats): make it a const method, use const_iterator
937 (enable): make static inline
938 (SplitFormat): make using_format const
940 * src/LaTeX.C (run): use lyx::getcwd
942 * configure.in: check for mkstemp as well
944 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
946 * src/converter.[Ch] (GetAllCommands): new method.
948 * src/support/filetools.[Ch] (DirList): new method.
950 * src/frontends/xforms/FormPreferences.C: started (just!) adding
951 functionality to the converters tab.
952 The formats tab is now nearly complete.
953 The kbmap choices in Languages tab now display the contents of
954 system_lyxdir/kbd/*.kmap in readable form.
956 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
957 Moved some variables into the class.
959 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
960 inactive tab folder to FL_COL1. Haven't yet worked out how to change
961 colour of active folder to lighter grey instead. Any takers?
962 (form_colours): added an "Apply" button.
963 (form_converters): added a "Flags" input field.
964 (form_formats): added a "Shortcut" input field. Note that we can't use
965 names such as "input_shortcut" as this buggers up the sed script stuff.
967 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
975 * src/lyx_sendfax_main.C:
978 * src/spellchecker.C:
979 * src/insets/figinset.C:
980 * src/insets/insetbib.C:
981 * src/insets/insetexternal.C:
982 * src/insets/insetinclude.C:
983 * src/insets/insetinfo.C:
984 * src/mathed/math_panel.C:
985 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
986 all "daughter" dialogs now have identical "feel".
988 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
990 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
991 used (and was only used in one place prior to this patch. Incorrectly!)
993 * src/frontends/xforms/FormDocument.C: changed some instances of
994 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
995 sense. Also added fl_set_input_return() for class_->input_doc_extra and
996 for options_->input_float_placement. This fixes a bug reported by
999 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1000 functionality into d-tor.
1002 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1003 input of numerals also.
1005 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1006 fl_set_form_atclose(). Can now close dialog from window manager,
1007 fixing a bug reported by Rob Lahaye.
1009 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1011 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1012 are no longer dark. Haven't yet worked out how to lighten the colour of
1013 the active tabfolder. Any ideas anybody?
1014 Adjusted Colours tab a little.
1015 Added Shortcut field to converters tab. Note that we can't create an
1016 fdesign label like "input_shortcut" as this buggers up the sed-script
1019 * src/frontends/xforms/FormPreferences.[Ch]:
1020 (feedback): fixed crash due to to ob=0.
1021 (LanguagesXXX): the kbmap choices now contain the files
1022 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1023 be replaced by an input with a file browse button, but since the browse
1024 buttons don'y yet work, this'll do for the moment.
1025 (FormatsXXX): think that this is now nearly fully functional.
1026 Some points/questions though:
1027 1. Does "Apply" remove formats if no longer present?
1028 2. I think that the browser should list the GUI names rather than the
1030 3. Must ensure that we can't delete Formats used by an existing
1033 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1034 if this is the best way to do this.
1036 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1038 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1040 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1041 for variable assignment.
1043 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1045 * src/lib/ui/default.ui: added sub/superscripts to menu as
1046 Insert->Special characters and cleaned-up the file a bit
1048 2000-11-07 Allan Rae <rae@lyx.org>
1050 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1051 ob isn't 0 before using it. See comments in function.
1053 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1055 * src/frontends/xforms/form_*.C: regenerated
1057 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1059 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1061 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1062 compiling with gcc-2.96
1064 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1066 * src/support/lyxstring.C: add a couple "using" directives.
1068 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1069 a .c_str() here too for good measure.
1070 * src/Spacing.C (set): ditto.
1071 * src/lyxfunc.C (Dispatch): ditto.
1073 * src/insets/insettabular.C (copySelection): change .str() to
1074 .str().c_str() to fix problems with lyxstring.
1075 * src/support/filetools.C (GetFileContents): ditto.
1076 * src/buffer.C (asciiParagraph): ditto.
1077 * src/paragraph.C (String): ditto.
1079 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1080 * lib/bind/sciword.bind: ditto.
1082 * src/LyXAction.C (init): remove "symbol-insert" function, which
1083 shared LFUN_INSERT_MATH with "math-insert".
1085 * lib/configure.m4: == is not a valid operator for command test.
1087 * src/lyxrc.C: add using directive.
1089 * src/converter.h: add std:: qualifier.
1091 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1093 * src/converter.[Ch] and other files: Change the Format class to a
1094 real class, and create two instances: formats and system_format.
1096 * src/lyxrc.C (output): Output the difference between formats and
1099 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1100 (buildFormats): Insert formats into browser.
1101 (inputFormats): Made the browser and add button functional.
1102 (applyFormats): Update formats from format_vec.
1104 * src/converter.C: Changed all (*it). to it->
1105 (Format::dummy): New method.
1106 (Format::importer): New format flag.
1107 (Formats::GetAllFormats): New method.
1108 (Formats::Add): Delete format from the map if prettyname is empty.
1109 (Converter::Convert): Print an error message if moving the file fails.
1110 (Converter::GetReachableTo): New method
1112 * src/MenuBackend.[Ch]: Add support for importformats tag.
1114 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1116 * lib/configure.m4: Add word->tex and ps->fax converters.
1118 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1119 Return fax to file menu.
1123 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1125 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1128 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1131 * src/lyxfunc.C (processKeyEvent): removed
1133 * src/bufferlist.C (emergencyWrite): removed the out commented
1134 emergency write code.
1136 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1138 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1140 * many files: change formatting to be a bit more uniform for
1141 if,while,for,switch statements, remove some parantesis not needed.
1144 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1146 * config/kde.m4: make config more robust when KDEDIR is set
1148 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1150 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1151 not returned a pixmap for "math-insert".
1153 * src/LyXAction.C (init): sort the entries a bit.
1155 2000-11-03 Juergen Vigna <jug@sad.it>
1157 * src/insets/insettabular.h: added fixed number to update codes so
1158 that update is only in one direction.
1160 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1163 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1164 before call to edit because of redraw.
1166 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1168 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1170 * lib/ui/default.ui: Populate "edit_float" menu
1172 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1174 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1175 "floats-operate". The name is ugly (and the func also), but this
1176 is just a band-aid until we switch to new insets.
1178 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1180 * lib/ui/default.ui: update again the menu layout (fix some
1183 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1185 * src/MenuBackend.h (fulllabel): new method.
1187 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1188 the menu shortcuts of a menu are unique and whether they
1189 correspond to a letter of the label.
1190 (expand): call checkShortcuts when debugging.
1192 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1194 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1196 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1198 * lib/examples/*.lyx : '\language default' => '\language english'
1200 * lib/examples/it_splash.lyx : except where it should be italian
1202 * lib/templates/*.lyx : the same
1204 * doc/*.lyx* : the same
1206 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1208 * lib/bind/menus.bind: remove the Layout menu entries, which I
1209 somehow forgot earlier.
1211 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1213 * lib/ui/old-default.ui: keep the old one here for reference (to
1216 * lib/ui/default.ui: update the menu layout
1218 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1220 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1221 Can now Apply to different insets without closing the dialog.
1223 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1224 Can't actually DO anything with them yet, but I'd like a little
1227 * src/frontends/xforms/input_validators.[ch]
1228 (fl_lowercase_filter): new.
1230 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1232 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1233 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1235 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1237 2000-11-02 Juergen Vigna <jug@sad.it>
1239 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1240 on char insertion as it has already be updated by bv->updateInset().
1242 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1243 if an inset inside was updated.
1245 * lib/configure.cmd: commented out fax-search code
1247 2000-11-01 Yves Bastide <stid@acm.org>
1249 * src/tabular.C (OldFormatRead): set tabular language to the
1252 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1254 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1255 class names with non-letter characters (from Yves Bastide).
1257 * lib/ui/default.ui: change Item to OptItem in import menu.
1258 Comment out fax stuff.
1260 * lib/configure.m4: comment out fax-related stuff.
1262 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1264 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1265 useful xforms helper functions. At present contains only formatted().
1266 Input a string and it returns it with line breaks so that in fits
1269 * src/frontends/xforms/Makefile.am: add new files.
1271 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1272 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1275 * src/frontends/xforms/FormPreferences.[Ch]:
1276 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1277 but lots of little clean ups. Removed enum State. Make use of
1278 formatted(). Constify lots of methods. Perhaps best of all: removed
1279 requirement for that horrible reinterpret_cast from pointer to long in
1282 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1284 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1285 conditionalize build on xforms < 0.89
1287 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1289 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1291 * src/LyXAction.C (init): comment out fax
1293 * src/lyxrc.h: comment out the fax enums
1294 comment out the fax variables
1296 * src/commandtags.h: comment out LFUN_FAX
1298 * src/lyxrc.C: disable fax variables.
1299 (read): disable parsing of fax variables
1300 (output): disable writing of fax variables
1301 (getFeedback): now description for fax variables
1303 * src/lyxfunc.C: comment out MenuFax
1304 (Dispatch): disable LFUN_FAX
1306 * src/lyx_cb.C (MenuFax): comment out
1308 * src/WorkArea.C: add <cctype>
1309 (work_area_handler): better key handling, should be ok now.
1310 for accented chars + etc
1312 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1313 lyx_sendfax.h and lyx_sendfax_man.C
1315 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1316 (show): don't call InitLyXLookup when using xforms 0.89
1318 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1320 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1322 * src/support/filetools.C (GetFileContents): close to dummy change
1324 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1326 * src/trans.C (AddDeadkey): workaround stupid compilers.
1328 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1331 of two-sided document.
1333 2000-10-31 Juergen Vigna <jug@sad.it>
1335 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1337 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1338 xposition to the Edit call.
1340 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1342 * src/trans.C (AddDeadkey): cast explicitly to char.
1344 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1346 * src/tabular.C (AsciiBottomHLine): simplify?
1347 (AsciiTopHLine): simplify?
1348 (print_n_chars): simplify
1349 (DocBook): remove most of the << endl; we should flush the stream
1350 as seldom as possible.
1352 (TeXBottomHLine): ditto
1353 (TeXTopHLine): ditto
1355 (write_attribute): try a templified version.
1356 (set_row_column_number_info): lesson scope of variables
1358 * src/support/lstrings.h (tostr): new specialization of tostr
1360 * src/trans.C (AddDeadkey): slightly cleaner fix.
1362 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1364 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1365 '%%' in Toc menu labels.
1368 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1369 font_norm is iso10646-1.
1371 * src/font.C (ascent): Fixed for 16bit fonts
1372 (descent,lbearing,rbearing): ditto
1374 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1376 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1377 (getFeedback): new static method.
1379 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1380 Now use combox rather than choice to display languages.
1381 Feedback is now output using a new timer callback mechanism, identical
1382 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1384 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1386 * src/minibuffer.C: fix for older compilers
1388 2000-10-30 Juergen Vigna <jug@sad.it>
1390 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1391 has to be Left of the inset otherwise LyXText won't find it!
1393 * src/BufferView2.C (open_new_inset): delete the inset if it can
1396 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1398 * lyx.man: fix typo.
1400 2000-10-29 Marko Vendelin <markov@ioc.ee>
1401 * src/frontends/gnome/FormCitation.C
1402 * src/frontends/gnome/FormCitation.h
1403 * src/frontends/gnome/FormCopyright.C
1404 * src/frontends/gnome/FormCopyright.h
1405 * src/frontends/gnome/FormError.C
1406 * src/frontends/gnome/FormError.h
1407 * src/frontends/gnome/FormIndex.C
1408 * src/frontends/gnome/FormIndex.h
1409 * src/frontends/gnome/FormPrint.C
1410 * src/frontends/gnome/FormPrint.h
1411 * src/frontends/gnome/FormRef.C
1412 * src/frontends/gnome/FormRef.h
1413 * src/frontends/gnome/FormToc.C
1414 * src/frontends/gnome/FormToc.h
1415 * src/frontends/gnome/FormUrl.C
1416 * src/frontends/gnome/FormUrl.h
1417 * src/frontends/gnome/Menubar_pimpl.C
1418 * src/frontends/gnome/mainapp.C
1419 * src/frontends/gnome/mainapp.h
1420 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1421 changing update() to updateSlot() where appropriate
1423 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1425 * src/frontends/xforms/FormPreferences.[Ch]:
1426 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1429 2000-10-28 Juergen Vigna <jug@sad.it>
1431 * src/insets/insettabular.C (draw): fixed drawing bug.
1433 * src/insets/insettext.C (clear):
1435 (SetParagraphData): clearing the TEXT buffers when deleting the
1436 paragraphs used by it.
1438 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1440 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1442 2000-10-27 Juergen Vigna <jug@sad.it>
1444 * src/tabular.C (~LyXTabular): removed not needed anymore.
1446 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1449 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1451 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1454 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1457 * src/frontends/xforms/FormPreferences.[Ch]:
1458 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1459 Reorganised as modules based on tabs. Much easier to follow the
1460 flow and to add new tabs. Added warning and feedback messages.
1463 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1465 * src/tabular.h (DocBook): add std:: qualifier.
1467 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1469 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1470 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1473 * insettabular.C (DocBook): uses the tabular methods to export
1476 * src/insets/insettext.h
1477 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1479 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1481 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1484 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1485 moved misplaced AllowInput two lines up.
1487 * src/buffer.C (readFile): compare float with float, not with int
1489 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1491 * src/minibuffer.C: add "using SigC::slot" statement.
1493 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1495 * src/frontends/xforms/forms/README: updated section about make.
1497 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1498 Tidied some forms up, made two of form_tabular's tabs more
1499 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1500 fixed translation problem with "Column".
1502 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1504 * src/minibuffer.h: use Timeout instead of the xforms timer
1506 (setTimer) rewrite for the Timeout, change to unsigned arg
1507 (set): change to unsigned timer arg
1510 * src/minibuffer.C (TimerCB): removed func
1511 (C_MiniBuffer_TimerCB): removed func
1512 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1513 (peek_event): use a switch statement
1514 (add): don't use fl_add_timer.
1515 (Set): rewrite to use the Timeout
1518 * src/Timeout.[Ch] (setType): return a Timeout &
1519 (setTimeout): ditto, change to unsigned arg for timeout
1521 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1523 * src/mathed/formula.C (mathed_string_width): Use string instead
1524 of a constant size char array.
1526 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1528 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1529 the two recently added operator<< for SMInput and State.
1531 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1533 (OkCancelPolicy): ditto
1534 (OkCancelReadOnlyPolicy): ditto
1535 (NoRepeatedApplyReadOnlyPolicy): ditto
1536 (OkApplyCancelReadOnlyPolicy): ditto
1537 (OkApplyCancelPolicy): ditto
1538 (NoRepeatedApplyPolicy): ditto
1540 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1542 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1543 add the usual std:: qualifiers.
1545 2000-10-25 Juergen Vigna <jug@sad.it>
1547 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1549 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1551 * src/support/filetools.C (MakeRelPath): change some types to
1554 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1555 ButtonPolicy::SMInput and ButtonPolicy::State.
1557 * src/FontLoader.C (reset): small cleanup
1558 (unload): small cleanup
1560 * src/FontInfo.C (getFontname): initialize error to 10000.0
1562 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1564 * src/frontends/xforms/FormPreferences.[Ch]:
1565 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1566 TeX encoding and default paper size sections.
1568 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1570 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1573 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1574 make the message_ empty.
1575 (FormError): don't initialize message_ in initializer list.
1577 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1579 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1581 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1583 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1585 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1587 * src/frontends/kde/*data.[Ch]: _("") is not
1590 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1592 * src/buffer.C: removed redundant using directive.
1594 * src/frontends/DialogBase.h: revert to original definition of
1597 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1598 stuff into two classes, one for each dialog, requires a new
1599 element in the dialogs vector, FormTabularCreate.
1601 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1604 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1605 method. Continues Allan's idea, but means that derived classes
1606 don't need to worry about "update or hide?".
1608 * src/frontends/xforms/FormError.C (showInset): add connection
1611 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1612 one for each dialog. FormTabular now contains main tabular dialog
1615 * src/frontends/xforms/FormTabularCreate.[Ch]:
1616 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1619 * src/frontends/xforms/FormGraphics.[Ch]:
1620 * src/frontends/xforms/forms/form_graphics.fd
1621 * src/frontends/xforms/FormTabular.[Ch]:
1622 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1623 classes of FormInset.
1625 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1626 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1628 * src/frontends/xforms/Makefile.am:
1629 * src/frontends/xforms/forms/makefile: added new files.
1631 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1632 variable. added Signal0 hide signal, in keeping with other GUI-I
1635 * src/support/lstrings.h: removed redundant std:: qualifier as
1636 it's already declared in Lsstream.h.
1638 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1640 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1644 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1646 * src/tabular.C (Ascii): minimize scope of cell.
1648 * src/BufferView2.C (nextWord): return string() instead of 0;
1650 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1652 * src/converter.h: add a std:: qualifier
1654 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1656 * src/importer.[Ch]: New files. Used for importing files into LyX.
1658 * src/lyxfunc.C (doImport): Use the new Importer class.
1660 * src/converter.h: Add shortcut member to the Format class.
1661 Used for holding the menu shortcut.
1663 * src/converter.C and other files: Made a distinction between
1664 format name and format extension. New formats can be defined using
1665 the \format lyxrc tag.
1666 Added two new converter flags: latex and disable.
1668 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1670 * src/support/lyxlib.h: unify namespace/struct implementation.
1671 Remove extra declarations.
1673 * src/support/chdir.C (chdir): remove version taking char const *
1675 * src/support/rename.C: ditto.
1676 * src/support/lyxsum.C: ditto.
1678 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1680 * src/frontends/xforms/FormBase.[Ch]:
1681 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1682 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1683 work only for the next call to fl_show_form(). The correct place to set
1684 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1685 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1686 from FormBase have the minimum size set; no more stupid crashes with
1689 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1691 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1693 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1695 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1697 * src/support/lyxlib.h: changed second argument of mkdir to
1698 unsigned long int (unsigned int would probably have been enough,
1699 but...). Removed <sys/types.h> header.
1700 * src/support/mkdir.C (mkdir): ditto.
1704 2000-10-19 Juergen Vigna <jug@sad.it>
1706 * src/lyxfunc.C (MenuNew): small fix (form John)
1708 * src/screen.C (Update): removed unneeded code.
1710 * src/tabular.C (Ascii): refixed int != uint bug!
1712 * src/support/lyxlib.h: added sys/types.h include for now permits
1713 compiling, but I don't like this!
1715 2000-10-18 Juergen Vigna <jug@sad.it>
1717 * src/text2.C (ClearSelection): if we clear the selection we need
1718 more refresh so set the status apropriately
1720 * src/insets/insettext.C (draw): hopefully finally fixed draw
1723 2000-10-12 Juergen Vigna <jug@sad.it>
1725 * src/insets/insettext.C (draw): another small fix and make a block
1726 so that variables are localized.
1728 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1730 * src/support/lstrings.C (lowercase, uppercase):
1731 use explicit casts to remove compiler warnings.
1733 * src/support/LRegex.C (Impl):
1734 * src/support/StrPool.C (add):
1735 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1736 (AddPath, MakeDisplayPath):
1737 * src/support/lstrings.C (prefixIs, subst):
1738 use correct type to remove compiler warnings.
1740 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1742 * src/support/lyxlib.h:
1743 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1744 portability and to remove compiler warning with DEC cxx.
1746 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1748 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1750 * src/minibuffer.C (peek_event): retun 1 when there has been a
1751 mouseclick in the minibuffer.
1755 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1757 * src/frontends/xforms/FormParagraph.C: more space above/below
1760 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1762 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1763 a char only if real_current_font was changed.
1765 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1767 * NEWS: update somewhat for 1.1.6
1769 * lib/ui/default.ui: clean up.
1771 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1773 * lib/CREDITS: clean up
1775 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1777 * src/combox.[Ch] (select): changed argument back to int
1778 * src/combox.C (peek_event): removed num_bytes as it is declared but
1781 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1782 modified calls to Combox::select() to remove warnings about type
1785 * src/insets/insetbutton.C (width): explicit cast to remove warning
1786 about type conversion.
1788 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1791 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1792 sel_pos_end, refering to cursor position are changed to
1793 LyXParagraph::size_type.
1795 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1796 consistent with LyXCursor::pos().
1797 (inset_pos): changed to LyXParagraph::size_type for same reason.
1799 * src/insets/insettext.C (resizeLyXText): changed some temporary
1800 variables refing to cursor position to LyXParagraph::size_type.
1802 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1804 * src/frontends/kde/<various>: The Great Renaming,
1807 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1809 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1811 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1813 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1814 0 when there are no arguments.
1816 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1818 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1819 to segfaults when pressing Ok in InsetBibtex dialog.
1821 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1823 * forms/layout_forms.fd:
1824 * src/layout_forms.C (create_form_form_character): small change to use
1825 labelframe rather than engraved frame + text
1827 * src/lyx_gui.C (create_forms): initialise choice_language with some
1828 arbitrary value to prevent segfault when dialog is shown.
1830 2000-10-16 Baruch Even <baruch.even@writeme.com>
1832 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1833 is no resulting file. This pertains only to LaTeX output.
1835 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1837 * src/text.C (Backspace): Make sure that the row of the cursor is
1840 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1843 * src/lyx_gui.C (init): Prevent a crash when only one font from
1844 menu/popup fonts is not found.
1846 * lib/lyxrc.example: Add an example for binding a key for language
1849 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1851 * src/converter.C (GetReachable): Changed the returned type to
1853 (IsReachable): New method
1855 * src/MenuBackend.C (expand): Handle formats that appear more
1858 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1860 * src/frontends/support/Makefile.am
1861 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1864 * lib/CREDITS: add Garst Reese.
1866 * src/support/snprintf.h: add extern "C" {} around the definitions.
1868 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1870 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1873 * src/frontends/xforms/FormDocument.C:
1874 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1875 compile without "conversion to integral type of smaller size"
1878 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1880 * src/text.C (GetColumnNearX): Fixed disabled code.
1882 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1884 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1887 * src/support/snprintf.[ch]: new files
1889 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1891 * src/frontends/kde/formprintdialog.C: add
1892 file browser for selecting postscript output
1894 * src/frontends/kde/formprintdialogdata.C:
1895 * src/frontends/kde/formprintdialogdata.h: re-generate
1898 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1900 * src/frontends/gnome/Makefile.am:
1901 * src/frontends/kde/Makefile.am: FormCommand.C
1902 disappeared from xforms
1904 * src/frontends/kde/FormCitation.C:
1905 * src/frontends/kde/FormIndex.C: read-only
1908 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1910 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1913 * src/bufferlist.C: add using directive.
1915 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1917 * src/support/lyxfunctional.h: version of class_fun for void
1918 returns added, const versions of back_inseter_fun and compare_fun
1921 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1923 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1925 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1927 * ChangeLog: cleanup.
1929 * lib/CREDITS: update to add all the contributors we've forgotten.
1930 I have obviously missed some, so tell me whether there were
1933 2000-10-13 Marko Vendelin <markov@ioc.ee>
1935 * src/frontends/gnome/FormCitation.C
1936 * src/frontends/gnome/FormCitation.h
1937 * src/frontends/gnome/FormError.C
1938 * src/frontends/gnome/FormIndex.C
1939 * src/frontends/gnome/FormRef.C
1940 * src/frontends/gnome/FormRef.h
1941 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1943 * src/frontends/gnome/FormCitation.C
1944 * src/frontends/gnome/FormCopyright.C
1945 * src/frontends/gnome/FormError.C
1946 * src/frontends/gnome/FormIndex.C
1947 * src/frontends/gnome/FormRef.C
1948 * src/frontends/gnome/FormToc.C
1949 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1952 * src/frontends/gnome/Menubar_pimpl.C
1953 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1956 2000-10-11 Baruch Even <baruch.even@writeme.com>
1959 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1960 to convey its real action.
1962 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1963 clear the minibuffer and prepare to enter a command.
1965 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1966 the rename from ExecCommand to PrepareForCommand.
1967 * src/lyxfunc.C (Dispatch): ditto.
1969 2000-10-11 Baruch Even <baruch.even@writeme.com>
1971 * src/buffer.C (writeFile): Added test for errors on writing, this
1972 catches all errors and not only file system full errors as intended.
1974 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1976 * src/lyx_gui.C (create_forms): better fix for crash with
1977 translated interface.
1979 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1981 * src/frontends/kde/Makefile.am:
1982 * src/frontends/kde/FormCopyright.C:
1983 * src/frontends/kde/formcopyrightdialog.C:
1984 * src/frontends/kde/formcopyrightdialog.h:
1985 * src/frontends/kde/formcopyrightdialogdata.C:
1986 * src/frontends/kde/formcopyrightdialogdata.h:
1987 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1988 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1989 copyright to use qtarch
1991 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1993 * src/encoding.C (read): Fixed bug that caused an error message at
1994 the end of the file.
1996 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1998 * lib/lyxrc.example: Fixed hebrew example.
2000 2000-10-13 Allan Rae <rae@lyx.org>
2002 * src/frontends/xforms/FormPreferences.C (input): reworking the
2004 (build, update, apply): New inputs in various tabfolders
2006 * src/frontends/xforms/FormToc.C: use new button policy.
2007 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2008 dialogs that either can't use any existing policy or where it just
2011 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2014 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2015 added a bool parameter which is ignored.
2017 * src/buffer.C (setReadonly):
2018 * src/BufferView_pimpl.C (buffer):
2019 * src/frontends/kde/FormCopyright.h (update):
2020 * src/frontends/kde/FormCitation.[Ch] (update):
2021 * src/frontends/kde/FormIndex.[Ch] (update):
2022 * src/frontends/kde/FormPrint.[Ch] (update):
2023 * src/frontends/kde/FormRef.[Ch] (update):
2024 * src/frontends/kde/FormToc.[Ch] (update):
2025 * src/frontends/kde/FormUrl.[Ch] (update):
2026 * src/frontends/gnome/FormCopyright.h (update):
2027 * src/frontends/gnome/FormCitation.[Ch] (update):
2028 * src/frontends/gnome/FormError.[Ch] (update):
2029 * src/frontends/gnome/FormIndex.[Ch] (update):
2030 * src/frontends/gnome/FormPrint.[Ch] (update):
2031 * src/frontends/gnome/FormRef.h (update):
2032 * src/frontends/gnome/FormToc.[Ch] (update):
2033 * src/frontends/gnome/FormUrl.[Ch] (update):
2034 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2035 to updateBufferDependent and DialogBase
2037 * src/frontends/xforms/FormCitation.[hC]:
2038 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2039 * src/frontends/xforms/FormError.[Ch]:
2040 * src/frontends/xforms/FormGraphics.[Ch]:
2041 * src/frontends/xforms/FormIndex.[Ch]:
2042 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2043 and fixed readOnly handling.
2044 * src/frontends/xforms/FormPrint.[Ch]:
2045 * src/frontends/xforms/FormRef.[Ch]:
2046 * src/frontends/xforms/FormTabular.[Ch]:
2047 * src/frontends/xforms/FormToc.[Ch]:
2048 * src/frontends/xforms/FormUrl.[Ch]:
2049 * src/frontends/xforms/FormInset.[Ch]:
2050 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2051 form of updateBufferDependent.
2053 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2054 if form()->visible just in case someone does stuff to the form in a
2057 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2058 the buttoncontroller for everything the enum used to be used for.
2059 (update) It would seem we need to force all dialogs to use a bool
2060 parameter or have two update functions. I chose to go with one.
2061 I did try removing update() from here and FormBase and defining the
2062 appropriate update signatures in FormBaseB[DI] but then ran into the
2063 problem of the update() call in FormBase::show(). Whatever I did
2064 to get around that would require another function and that just
2065 got more confusing. Hence the decision to make everyone have an
2066 update(bool). An alternative might have been to override show() in
2067 FormBaseB[DI] and that would allow the different and appropriate
2070 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2071 true == buffer change occurred. I decided against using a default
2072 template parameter since not all compilers support that at present.
2074 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2076 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2077 army knife" by removing functionality.
2078 (clearStore): removed. All such housekeeping on hide()ing the dialog
2079 is to be carried out by overloaded disconnect() methods.
2080 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2081 superceded by Baruch's neat test (FormGraphics) to update an existing
2082 dialog if a new signal is recieved rather than block all new signals
2084 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2085 only to Inset dialogs.
2086 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2087 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2089 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2091 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2092 as a base class to all inset dialogs. Used solely to connect/disconnect
2093 the Inset::hide signal and to define what action to take on receipt of
2094 a UpdateBufferDependent signal.
2095 (FormCommand): now derived from FormInset.
2097 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2100 * src/frontends/xforms/FormCopyright.[Ch]:
2101 * src/frontends/xforms/FormPreferences.[Ch]:
2102 now derived from FormBaseBI.
2104 * src/frontends/xforms/FormDocument.[Ch]:
2105 * src/frontends/xforms/FormParagraph.[Ch]:
2106 * src/frontends/xforms/FormPrint.[Ch]:
2107 now derived from FormBaseBD.
2109 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2111 * src/frontends/xforms/FormCitation.[Ch]:
2112 * src/frontends/xforms/FormError.[Ch]:
2113 * src/frontends/xforms/FormRef.[Ch]:
2114 * src/frontends/xforms/FormToc.[Ch]:
2115 (clearStore): reworked as disconnect().
2117 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2120 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2122 * src/converter.C (runLaTeX): constify buffer argument
2125 * src/frontends/support/Makefile.am (INCLUDES): fix.
2127 * src/buffer.h: add std:: qualifier
2128 * src/insets/figinset.C (addpidwait): ditto
2129 * src/MenuBackend.C: ditto
2130 * src/buffer.C: ditto
2131 * src/bufferlist.C: ditto
2132 * src/layout.C: ditto
2133 * src/lyxfunc.C: ditto
2135 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2137 * src/lyxtext.h (bidi_level): change return type to
2138 LyXParagraph::size_type.
2140 * src/lyxparagraph.h: change size_type to
2141 TextContainer::difference_type. This should really be
2142 TextContainer::size_type, but we need currently to support signed
2145 2000-10-11 Marko Vendelin <markov@ioc.ee>
2146 * src/frontends/gnome/FormError.h
2147 * src/frontends/gnome/FormRef.C
2148 * src/frontends/gnome/FormRef.h
2149 * src/frontends/gnome/FormError.C
2150 * src/frontends/gnome/Makefile.am
2151 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2152 to Gnome frontend. Both dialogs use "action" area.
2154 2000-10-12 Baruch Even <baruch.even@writeme.com>
2156 * src/graphics/GraphicsCacheItem_pimpl.C:
2157 * src/graphics/Renderer.C:
2158 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2161 2000-10-12 Juergen Vigna <jug@sad.it>
2163 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2164 visible when selecting).
2166 * development/Code_rules/Rules: fixed some typos.
2168 2000-10-09 Baruch Even <baruch.even@writeme.com>
2170 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2171 compiling on egcs 1.1.2 possible.
2173 * src/filedlg.C (comp_direntry::operator() ): ditto.
2175 2000-08-31 Baruch Even <baruch.even@writeme.com>
2177 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2180 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2181 transient it now only gets freed when the object is destructed.
2183 2000-08-24 Baruch Even <baruch.even@writeme.com>
2185 * src/frontends/FormGraphics.h:
2186 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2189 2000-08-20 Baruch Even <baruch.even@writeme.com>
2191 * src/insets/insetgraphics.C:
2192 (draw): Added messages to the drawn rectangle to report status.
2193 (updateInset): Disabled the use of the inline graphics,
2196 2000-08-17 Baruch Even <baruch.even@writeme.com>
2198 * src/frontends/support: Directory added for the support of GUII LyX.
2200 * src/frontends/support/LyXImage.h:
2201 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2204 * src/frontends/support/LyXImage_X.h:
2205 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2206 version of LyXImage, this uses the Xlib Pixmap.
2208 * src/PainterBase.h:
2209 * src/PainterBase.C:
2211 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2212 replacement to Pixmap.
2214 * src/insets/insetgraphics.h:
2215 * src/insets/insetgraphics.C:
2216 * src/graphics/GraphicsCacheItem.h:
2217 * src/graphics/GraphicsCacheItem.C:
2218 * src/graphics/GraphicsCacheItem_pimpl.h:
2219 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2222 * src/graphics/GraphicsCacheItem.h:
2223 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2224 another copy of the object.
2226 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2227 of cacheHandle, this fixed a bug that sent LyX crashing.
2229 * src/graphics/XPM_Renderer.h:
2230 * src/graphics/XPM_Renderer.C:
2231 * src/graphics/EPS_Renderer.h:
2232 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2234 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2236 * src/lyxfunc.C (processKeySym): only handle the
2237 lockinginset/inset stuff if we have a buffer and text loaded...
2239 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2241 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2243 * src/support/lyxfunctional.h: add operator= that takes a reference
2245 * src/lyxserver.C (mkfifo): make first arg const
2247 * src/layout.h: renamed name(...) to setName(...) to work around
2250 * src/buffer.C (setFileName): had to change name of function to
2251 work around bugs in egcs. (renamed from fileName)
2253 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2255 * src/support/translator.h: move helper template classes to
2256 lyxfunctional.h, include "support/lyxfunctional.h"
2258 * src/support/lyxmanip.h: add delaration of fmt
2260 * src/support/lyxfunctional.h: new file
2261 (class_fun_t): new template class
2262 (class_fun): helper template function
2263 (back_insert_fun_iterator): new template class
2264 (back_inserter_fun): helper template function
2265 (compare_memfun_t): new template class
2266 (compare_memfun): helper template function
2267 (equal_1st_in_pair): moved here from translator
2268 (equal_2nd_in_pair): moved here from translator
2270 * src/support/fmt.C: new file
2271 (fmt): new func, can be used for a printf substitute when still
2272 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2274 * src/support/StrPool.C: add some comments
2276 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2279 * src/insets/figinset.C (addpidwait): use std::copy with
2280 ostream_iterator to fill the pidwaitlist
2282 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2284 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2287 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2290 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2292 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2293 (class_update): ditto
2294 (BulletPanel): ditto
2295 (CheckChoiceClass): move initialization of tc and tct
2297 * src/tabular.C: remove current_view
2298 (OldFormatRead): similar to right below [istream::ignore]
2300 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2301 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2302 unused [istream::ignore]
2304 * src/lyxfunc.C: include "support/lyxfunctional.h"
2305 (getInsetByCode): use std::find_if and compare_memfun
2307 * src/lyxfont.C (stateText): remove c_str()
2309 * src/lyx_main.C (setDebuggingLevel): make static
2310 (commandLineHelp): make static
2312 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2313 Screen* together with fl_get_display() and fl_screen
2315 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2316 togheter with fl_get_display() and fl_screen
2317 (create_forms): remove c_str()
2319 * src/layout.C: include "support/lyxfunctional.h"
2320 (hasLayout): use std::find_if and compare_memfun
2321 (GetLayout): use std::find_if and comapre_memfun
2322 (delete_layout): use std::remove_if and compare_memfun
2323 (NumberOfClass): use std:.find_if and compare_memfun
2325 * src/gettext.h: change for the new functions
2327 * src/gettext.C: new file, make _(char const * str) and _(string
2328 const & str) real functions.
2330 * src/font.C (width): rewrite slightly to avoid one extra variable
2332 * src/debug.C: initialize Debug::ANY here
2334 * src/commandtags.h: update number comments
2336 * src/combox.h (get): make const func
2338 (getline): make const
2340 * src/combox.C (input_cb): handle case where fl_get_input can
2343 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2344 "support/lyxfunctional.h", remove current_view variable.
2345 (resize): use std::for_each with std::mem_fun
2346 (getFileNames): use std::copy with back_inserter_fun
2347 (getBuffer): change arg type to unsigned int
2348 (emergencyWriteAll): call emergencyWrite with std::for_each and
2350 (emergencyWrite): new method, the for loop in emergencyWriteAll
2352 (exists): use std::find_if with compare_memfun
2353 (getBuffer): use std::find_if and compare_memfun
2355 * src/buffer.h: add typedefs for iterator_category, value_type
2356 difference_type, pointer and reference for inset_iterator
2357 add postfix ++ for inset_iterator
2358 make inset_iterator::getPos() const
2360 * src/buffer.C: added support/lyxmanip.h
2361 (readFile): use lyxerr << fmt instead of printf
2362 (makeLaTeXFile): use std::copy to write out encodings
2364 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2366 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2367 free and the char * temp.
2368 (hasMenu): use std::find_if and compare_memfun
2371 * src/Makefile.am (lyx_SOURCES): added gettext.C
2373 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2374 string::insert small change to avoid temporary
2376 * src/LColor.C (getGUIName): remove c_str()
2378 * several files: change all occurrences of fl_display to
2381 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2382 that -pedantic is not used for gcc 2.97 (cvs gcc)
2384 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2386 2000-10-11 Allan Rae <rae@lyx.org>
2388 * src/frontends/xforms/FormPreferences.C (input): template path must be
2389 a readable directory. It doesn't need to be writeable.
2390 (build, delete, update, apply): New inputs in the various tabfolders
2392 * src/frontends/xforms/forms/form_preferences.fd:
2393 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2394 several new entries to existing folders. Shuffled some existing stuff
2397 * src/frontends/xforms/forms/form_print.fd:
2398 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2399 Should probably rework PrinterParams as well. Note that the switch to
2400 collated is effectively the same as !unsorted so changing PrinterParams
2401 will require a lot of fiddly changes to reverse the existing logic.
2403 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2405 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2407 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2409 2000-10-10 Allan Rae <rae@lyx.org>
2412 * src/lyxfunc.C (Dispatch):
2414 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2417 * src/lyxrc.C (output): Only write the differences between system lyxrc
2418 and the users settings.
2421 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2423 I'll rewrite this later, after 1.1.6 probably, to keep a single
2424 LyXRC but two instances of a LyXRCStruct.
2426 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2428 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2430 * src/tabular.h: add a few std:: qualifiers.
2432 * src/encoding.C: add using directive.
2433 * src/language.C: ditto.
2435 * src/insets/insetquotes.C (Validate): use languages->lang()
2436 instead of only language.
2438 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2440 * lib/languages: New file.
2442 * lib/encodings: New file.
2444 * src/language.C (Languages): New class.
2445 (read): New method. Reads the languages from the 'languages' file.
2447 * src/encoding.C (Encodings): New class.
2448 (read): New method. Reads the encodings from the 'encodings' file.
2450 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2453 * src/bufferparams.h and a lot of files: Deleted the member language,
2454 and renamed language_info to language
2456 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2457 * src/lyxfont.C (latexWriteStartChanges): ditto.
2458 * src/paragraph.C (validate,TeXOnePar): ditto.
2460 * src/lyxfont.C (update): Restored deleted code.
2462 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2464 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2466 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2468 * src/insets/figinset.[Ch]:
2469 * src/insets/insetinclude.[Ch]:
2470 * src/insets/insetinclude.[Ch]:
2471 * src/insets/insetparent.[Ch]:
2472 * src/insets/insetref.[Ch]:
2473 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2475 * src/insets/*.[Ch]:
2476 * src/mathed/formula.[Ch]:
2477 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2479 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2480 * src/lyx_cb.C (FigureApplyCB):
2481 * src/lyxfunc.C (getStatus, Dispatch):
2482 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2485 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2487 * src/converter.[Ch] (Formats::View):
2488 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2490 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2491 *current_view->buffer(). This will change later, but this patch is way
2494 2000-10-09 Juergen Vigna <jug@sad.it>
2496 * src/text.C (GetRow): small fix.
2498 * src/BufferView_pimpl.C (cursorPrevious):
2499 (cursorNext): added LyXText parameter to function.
2501 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2502 keypress depending on cursor position.
2504 2000-10-06 Juergen Vigna <jug@sad.it>
2506 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2507 (copySelection): redone this function and also copy ascii representa-
2510 * src/tabular.C (Ascii):
2514 (print_n_chars): new functions to realize the ascii export of tabulars.
2516 2000-10-05 Juergen Vigna <jug@sad.it>
2518 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2519 if we don't have a buffer.
2521 2000-10-10 Allan Rae <rae@lyx.org>
2523 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2524 with closing dialog. It seems that nested tabfolders require hiding
2525 of inner tabfolders before hiding the dialog itself. Actually all I
2526 did was hide the active outer folder.
2528 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2529 unless there really is a buffer. hideBufferDependent is called
2532 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2533 POTFILES.in stays in $(srcdir).
2535 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2537 * lib/lyxrc.example: Few changes.
2539 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2541 * src/BufferView_pimpl.C (buffer): only need one the
2542 updateBufferDependent signal to be emitted once! Moved to the end of
2543 the method to allow bv_->text to be updated first.
2545 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2546 and hSignal_ with Dialogs * and BufferDependency variables.
2547 New Buffer * parent_, initialised when the dialog is launched. Used to
2548 check whether to update() or hide() dialog in the new, private
2549 updateOrHide() method that is connected to the updateBufferDependent
2550 signal. Daughter classes dictate what to do using the
2551 ChangedBufferAction enum, passed to the c-tor.
2553 * src/frontends/xforms/FormCitation.C:
2554 * src/frontends/xforms/FormCommand.C:
2555 * src/frontends/xforms/FormCopyright.C:
2556 * src/frontends/xforms/FormDocument.C:
2557 * src/frontends/xforms/FormError.C:
2558 * src/frontends/xforms/FormIndex.C:
2559 * src/frontends/xforms/FormPreferences.C:
2560 * src/frontends/xforms/FormPrint.C:
2561 * src/frontends/xforms/FormRef.C:
2562 * src/frontends/xforms/FormToc.C:
2563 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2566 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2567 ChangedBufferAction enum.
2569 * src/frontends/xforms/FormParagraph.[Ch]
2570 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2573 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * lib/bind/cua.bind: fix a bit.
2576 * lib/bind/emacs.bind: ditto.
2578 * lib/bind/menus.bind: remove real menu entries from there.
2580 * src/spellchecker.C: make sure we only include strings.h when
2583 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2585 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2586 function. It enlarges the maximum number of pup when needed.
2587 (add_toc2): Open a new menu if maximum number of items per menu has
2590 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2592 * src/frontends/kde/FormPrint.C: fix error reporting
2594 * src/frontends/xforms/FormDocument.C: fix compiler
2597 * lib/.cvsignore: add Literate.nw
2599 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2602 * bufferview_funcs.[Ch]
2605 * text2.C: Add support for numbers in RTL text.
2607 2000-10-06 Allan Rae <rae@lyx.org>
2609 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2610 to be gettext.m4 friendly again. ext_l10n.h is now
2611 generated into $top_srcdir instead of $top_builddir
2612 so that lyx.pot will be built correctly -- without
2613 duplicate parsing of ext_l10n.h.
2615 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2617 * src/frontends/kde/FormCitation.C: make the dialog
2618 behave more sensibly
2620 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2622 * config/kde.m4: fix consecutive ./configure runs,
2623 look for qtarch, fix library order
2625 * src/frontends/kde/Makefile.am: tidy up,
2626 add Print dialog, add .dlg dependencies
2628 * src/frontends/kde/FormPrint.C:
2629 * src/frontends/kde/FormPrint.h:
2630 * src/frontends/kde/formprintdialog.C:
2631 * src/frontends/kde/formprintdialog.h:
2632 * src/frontends/kde/formprintdialogdata.C:
2633 * src/frontends/kde/formprintdialogdata.h:
2634 * src/frontends/kde/dlg/formprintdialog.dlg: add
2637 * src/frontends/kde/dlg/README: Added explanatory readme
2639 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2640 script to double-check qtarch's output
2642 * src/frontends/kde/formindexdialog.C:
2643 * src/frontends/kde/formindexdialogdata.C:
2644 * src/frontends/kde/formindexdialogdata.h:
2645 * src/frontends/kde/dlg/formindexdialog.dlg: update
2646 for qtarch, minor fixes
2648 2000-10-05 Allan Rae <rae@lyx.org>
2650 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2651 dialogs when switching buffers update them instead. It's up to each
2652 dialog to decide if it should still be visible or not.
2653 update() should return a bool to control visiblity within show().
2654 Or perhaps better to set a member variable and use that to control
2657 * lib/build-listerrors: create an empty "listerrors" file just to stop
2658 make trying to regenerate it all the time if you don't have noweb
2661 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2663 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2664 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2665 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2666 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2667 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2669 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2671 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2673 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2674 deleting buffer. Closes all buffer-dependent dialogs.
2676 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2678 * src/frontends/xforms/FormCitation.[Ch]:
2679 * src/frontends/xforms/FormPreferences.[Ch]:
2680 * src/frontends/xforms/FormPrint.[Ch]:
2681 * src/frontends/xforms/FormRef.[Ch]:
2682 * src/frontends/xforms/FormUrl.[Ch]: ditto
2684 * src/frontends/xforms/FormDocument.[Ch]:
2685 * src/frontends/xforms/forms/form_document.C.patch:
2686 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2687 pass through a single input() function.
2689 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2691 * lib/build-listerrors: return status as OK
2693 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2695 * lib/lyxrc.example: Updated to new export code
2697 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2699 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2702 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2705 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2706 LyX-Code is defined.
2707 * lib/layouts/amsbook.layout: ditto.
2709 * boost/Makefile.am: fix typo.
2711 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2713 (add_lastfiles): removed.
2714 (add_documents): removed.
2715 (add_formats): removed.
2717 * src/frontends/Menubar.C: remove useless "using" directive.
2719 * src/MenuBackend.h: add a new MenuItem constructor.
2721 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2724 2000-10-04 Allan Rae <rae@lyx.org>
2726 * lib/Makefile.am (listerrors):
2727 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2728 I haven't got notangle installed so Kayvan please test. The output
2729 should end up in $builddir. This also allows people who don't have
2730 noweb installed to complete the make process without error.
2732 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2733 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2734 by JMarc's picky compiler.
2736 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * src/insets/insettabular.C (setPos): change for loop to not use
2740 sequencing operator. Please check this Jürgen.
2742 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2744 * src/insets/insetcite.C (getScreenLabel): ditto
2745 * src/support/filetools.C (QuoteName): ditto
2746 (ChangeExtension): ditto
2748 * src/BufferView_pimpl.C (scrollCB): make heigt int
2750 * src/BufferView2.C (insertInset): comment out unused arg
2752 * boost/Makefile.am (EXTRADIST): new variable
2754 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2756 * src/exporter.C (IsExportable): Fixed
2758 * lib/configure.m4: Small fix
2760 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2762 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2763 * src/insets/insetbib.C (bibitemWidest): ditto.
2764 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2766 2000-10-03 Juergen Vigna <jug@sad.it>
2768 * src/BufferView2.C (theLockingInset): removed const because of
2769 Agnus's compile problems.
2771 * src/insets/insettext.C (LocalDispatch): set the language of the
2772 surronding paragraph on inserting the first character.
2774 * various files: changed use of BufferView::the_locking_inset.
2776 * src/BufferView2.C (theLockingInset):
2777 (theLockingInset): new functions.
2779 * src/BufferView.h: removed the_locking_inset.
2781 * src/lyxtext.h: added the_locking_inset
2783 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2785 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2787 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2789 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2790 * src/mathed/math_cursor.C (IsAlpha): ditto.
2791 * src/mathed/math_inset.C (strnew): ditto.
2792 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2793 (IMetrics): cxp set but never used; removed.
2794 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2795 that the variable in question has been removed also!
2798 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2799 using the Buffer * passed to Latex(), using the BufferView * passed to
2800 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2802 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2803 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2805 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2806 * src/buffer.C (readInset): used new InsetBibtex c-tor
2807 * (getBibkeyList): used new InsetBibtex::getKeys
2809 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2812 * lib/build-listerrors
2814 * src/exporter.C: Add literate programming support to the export code
2817 * src/lyx_cb.C: Remove old literate code.
2819 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2822 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2823 * src/converter.C (View, Convert): Use QuoteName.
2825 * src/insets/figinset.C (Preview): Use Formats::View.
2827 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2829 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2831 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2832 the top of the function, because compaq cxx complains that the
2833 "goto exit_with_message" when the function is disabled bypasses
2835 (MenuNew): try a better fix for the generation of new file names.
2836 This time, I used AddName() instead of AddPath(), hoping Juergen
2839 2000-10-03 Allan Rae <rae@lyx.org>
2841 * src/frontends/xforms/forms/form_preferences.fd:
2842 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2843 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2844 "Look and Feel"->"General" but will need to be split up further into
2845 general output and general input tabs. Current plan is for four outer
2846 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2847 stuff; "Inputs" for input and import configuration; "Outputs" for
2848 output and export configuration; and one more whatever is left over
2849 called "General". The leftovers at present look like being which
2850 viewers to use, spellchecker, language support and might be better
2851 named "Support". I've put "Paths" in "Inputs" for the moment as this
2852 seems reasonable for now at least.
2853 One problem remains: X error kills LyX when you close Preferences.
2855 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2857 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2858 qualifier from form()
2859 * src/frontends/xforms/FormCitation.[Ch]:
2860 * src/frontends/xforms/FormCopyright.[Ch]:
2861 * src/frontends/xforms/FormDocument.[Ch]:
2862 * src/frontends/xforms/FormError.[Ch]:
2863 * src/frontends/xforms/FormIndex.[Ch]:
2864 * src/frontends/xforms/FormPreferences.[Ch]:
2865 * src/frontends/xforms/FormPrint.[Ch]:
2866 * src/frontends/xforms/FormRef.[Ch]:
2867 * src/frontends/xforms/FormToc.[Ch]:
2868 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2870 * src/frontends/xforms/FormCitation.[Ch]:
2871 * src/frontends/xforms/FormIndex.[Ch]:
2872 * src/frontends/xforms/FormRef.[Ch]:
2873 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2874 with Allan's naming policy
2876 * src/frontends/xforms/FormCitation.C: some static casts to remove
2879 2000-10-02 Juergen Vigna <jug@sad.it>
2881 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2882 now you can type or do stuff inside the table-cell also when in dummy
2883 position, fixed visible cursor.
2885 * src/insets/insettext.C (Edit): fixing cursor-view position.
2887 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2888 be used for equal functions in lyxfunc and insettext.
2890 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2892 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2894 * src/frontends/gnome/FormCitation.h:
2895 * src/frontends/gnome/FormCopyright.h:
2896 * src/frontends/gnome/FormIndex.h:
2897 * src/frontends/gnome/FormPrint.h:
2898 * src/frontends/gnome/FormToc.h:
2899 * src/frontends/gnome/FormUrl.h:
2900 * src/frontends/kde/FormCitation.h:
2901 * src/frontends/kde/FormCopyright.h:
2902 * src/frontends/kde/FormIndex.h:
2903 * src/frontends/kde/FormRef.h:
2904 * src/frontends/kde/FormToc.h:
2905 * src/frontends/kde/FormUrl.h: fix remaining users of
2908 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2910 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2911 from depth argument.
2912 (DocBookHandleCaption): ditto.
2913 (DocBookHandleFootnote): ditto.
2914 (SimpleDocBookOnePar): ditto.
2916 * src/frontends/xforms/FormDocument.h (form): remove extra
2917 FormDocument:: qualifier.
2919 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2921 * sigc++/handle.h: ditto.
2923 * src/lyx_gui_misc.C: add "using" directive.
2925 * src/cheaders/cstddef: new file, needed by the boost library (for
2928 2000-10-02 Juergen Vigna <jug@sad.it>
2930 * src/insets/insettext.C (SetFont): better support.
2932 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2934 * src/screen.C (DrawOneRow): some uint refixes!
2936 2000-10-02 Allan Rae <rae@lyx.org>
2938 * boost/.cvsignore: ignore Makefile as well
2940 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2941 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2943 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2944 Left this one out by accident.
2946 * src/frontends/xforms/FormBase.h (restore): default to calling
2947 update() since that will restore the original/currently-applied values.
2948 Any input() triggered error messages will require the derived classes
2949 to redefine restore().
2951 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2952 avoid a segfault. combo_doc_class is the main concern.
2954 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2956 * Simplify build-listerrors in view of GUI-less export ability!
2958 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2960 * src/lyx_main.C (easyParse): Disable gui when exporting
2962 * src/insets/figinset.C:
2965 * src/lyx_gui_misc.C
2966 * src/tabular.C: Changes to allow no-gui.
2968 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2970 * src/support/utility.hpp: removed file
2971 * src/support/block.h: removed file
2973 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2976 * src/mathed/formula.C: add support/lyxlib.h
2977 * src/mathed/formulamacro.C: ditto
2979 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2980 * src/lyxparagraph.h: ditto
2982 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2983 * src/frontends/Makefile.am (INCLUDES): ditto
2984 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2985 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2986 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2987 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2988 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2989 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2991 * src/BufferView.h: use boost/utility.hpp
2992 * src/LColor.h: ditto
2993 * src/LaTeX.h: ditto
2994 * src/LyXAction.h: ditto
2995 * src/LyXView.h: ditto
2996 * src/bufferlist.h: ditto
2997 * src/lastfiles.h: ditto
2998 * src/layout.h: ditto
2999 * src/lyx_gui.h: ditto
3000 * src/lyx_main.h: ditto
3001 * src/lyxlex.h: ditto
3002 * src/lyxrc.h: ditto
3003 * src/frontends/ButtonPolicies.h: ditto
3004 * src/frontends/Dialogs.h: ditto
3005 * src/frontends/xforms/FormBase.h: ditto
3006 * src/frontends/xforms/FormGraphics.h: ditto
3007 * src/frontends/xforms/FormParagraph.h: ditto
3008 * src/frontends/xforms/FormTabular.h: ditto
3009 * src/graphics/GraphicsCache.h: ditto
3010 * src/graphics/Renderer.h: ditto
3011 * src/insets/ExternalTemplate.h: ditto
3012 * src/insets/insetcommand.h: ditto
3013 * src/support/path.h: ditto
3015 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3016 and introduce clause for 2.97.
3018 * boost/libs/README: new file
3020 * boost/boost/utility.hpp: new file
3022 * boost/boost/config.hpp: new file
3024 * boost/boost/array.hpp: new file
3026 * boost/Makefile.am: new file
3028 * boost/.cvsignore: new file
3030 * configure.in (AC_OUTPUT): add boost/Makefile
3032 * Makefile.am (SUBDIRS): add boost
3034 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3036 * src/support/lstrings.C (suffixIs): Fixed.
3038 2000-10-01 Allan Rae <rae@lyx.org>
3040 * src/PrinterParams.h: moved things around to avoid the "can't
3041 inline call" warning.
3043 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3044 into doc++ documentation.
3046 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3048 * src/frontends/xforms/FormRef.C: make use of button controller
3049 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3050 cleaned up button controller usage.
3051 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3052 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3053 use the button controller
3055 * src/frontends/xforms/forms/*.fd: and associated generated files
3056 updated to reflect changes to FormBase. Some other FormXxxx files
3057 also got minor updates to reflect changes to FormBase.
3059 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3060 (hide): made virtual.
3061 (input): return a bool. true == valid input
3062 (RestoreCB, restore): new
3063 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3064 Changes to allow derived dialogs to use a ButtonController and
3065 make sense when doing so: OK button calls ok() and so on.
3067 * src/frontends/xforms/ButtonController.h (class ButtonController):
3068 Switch from template implementation to taking Policy parameter.
3069 Allows FormBase to provide a ButtonController for any dialog.
3071 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3072 Probably should rename connect and disconnect.
3073 (apply): use the radio button groups
3074 (form): needed by FormBase
3075 (build): setup the radio button groups
3077 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3079 * several files: type changes to reduce the number of warnings and
3080 to unify type hangling a bit. Still much to do.
3082 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3084 * lib/images/*: rename a bunch of icons to match Dekel converter
3087 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3090 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3092 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3094 * sigc++/handle.h: ditto for class Handle.
3096 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3098 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3100 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3102 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3103 removal of the "default" language.
3105 * src/combox.h (getline): Check that sel > 0
3107 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3109 * lib/examples/docbook_example.lyx
3110 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3112 * lib/layouts/docbook-book.layout: new docbook book layout.
3114 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3116 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3118 * src/insets/figinset.C (DocBook):fixed small typo.
3120 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3122 * src/insets/insetinclude.h: string include_label doesn't need to be
3125 2000-09-29 Allan Rae <rae@lyx.org>
3127 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3128 Allow derived type to control connection and disconnection from signals
3129 of its choice if desired.
3131 2000-09-28 Juergen Vigna <jug@sad.it>
3133 * src/insets/insettabular.C (update): fixed cursor setting when
3134 the_locking_inset changed.
3135 (draw): made this a bit cleaner.
3136 (InsetButtonPress): fixed!
3138 * various files: added LyXText Parameter to fitCursor call.
3140 * src/BufferView.C (fitCursor): added LyXText parameter.
3142 * src/insets/insettabular.C (draw): small draw fix.
3144 * src/tabular.C: right setting of left/right celllines.
3146 * src/tabular.[Ch]: fixed various types in funcions and structures.
3147 * src/insets/insettabular.C: ditto
3148 * src/frontends/xforms/FormTabular.C: ditto
3150 2000-09-28 Allan Rae <rae@lyx.org>
3152 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3153 that the #ifdef's had been applied to part of what should have been
3154 a complete condition. It's possible there are other tests that
3155 were specific to tables that are also wrong now that InsetTabular is
3156 being used. Now we need to fix the output of '\n' after a table in a
3157 float for the same reason as the original condition:
3158 "don't insert this if we would be adding it before or after a table
3159 in a float. This little trick is needed in order to allow use of
3160 tables in \subfigures or \subtables."
3161 Juergen can you check this?
3163 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3165 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3166 output to the ostream.
3168 * several files: fixed types based on warnings from cxx
3170 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3172 * src/frontends/kde/Makefile.am: fix rule for
3173 formindexdialogdata_moc.C
3175 * src/.cvsignore: add ext_l10n.h to ignore
3177 * acconfig.h: stop messing with __STRICT_ANSI__
3178 * config/gnome.m4: remove option to set -ansi
3179 * config/kde.m4: remove option to set -ansi
3180 * config/lyxinclude.m4: don't set -ansi
3182 2000-09-27 Juergen Vigna <jug@sad.it>
3184 * various files: remove "default" language check.
3186 * src/insets/insetquotes.C: removed use of current_view.
3188 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3189 the one should have red ears by now!
3191 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3192 in more then one paragraph. Fixed cursor-movement/selection.
3194 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3195 paragraphs inside a text inset.
3197 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3198 text-inset if this owner is an inset.
3200 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3202 * src/Bullet.h: changed type of font, character and size to int
3204 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3206 * src/insets/inseturl.[Ch]:
3207 * src/insets/insetref.[Ch]:
3208 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3210 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3212 * src/buffer.C (readFile): block-if statement rearranged to minimise
3213 bloat. Patch does not reverse Jean-Marc's change ;-)
3215 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3216 Class rewritten to store pointers to hide/update signals directly,
3217 rather than Dialogs *. Also defined an enum to ease use. All xforms
3218 forms can now be derived from this class.
3220 * src/frontends/xforms/FormCommand.[Ch]
3221 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3223 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3226 * src/frontends/xforms/forms/form_citation.fd
3227 * src/frontends/xforms/forms/form_copyright.fd
3228 * src/frontends/xforms/forms/form_error.fd
3229 * src/frontends/xforms/forms/form_index.fd
3230 * src/frontends/xforms/forms/form_ref.fd
3231 * src/frontends/xforms/forms/form_toc.fd
3232 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3234 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3236 * src/insets/insetfoot.C: removed redundent using directive.
3238 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3240 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3241 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3243 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3244 created in the constructors in different groups. Then set() just
3245 have to show the groups as needed. This fixes the redraw problems
3246 (and is how the old menu code worked).
3248 * src/support/lyxlib.h: declare the methods as static when we do
3249 not have namespaces.
3251 2000-09-26 Juergen Vigna <jug@sad.it>
3253 * src/buffer.C (asciiParagraph): new function.
3254 (writeFileAscii): new function with parameter ostream.
3255 (writeFileAscii): use now asciiParagraph.
3257 * various inset files: added the linelen parameter to the Ascii-func.
3259 * src/tabular.C (Write): fixed error in writing file introduced by
3260 the last changes from Lars.
3262 * lib/bind/menus.bind: removed not supported functions.
3264 * src/insets/insettext.C (Ascii): implemented this function.
3266 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3268 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3269 (Write): use of the write_attribute functions.
3271 * src/bufferlist.C (close): fixed reasking question!
3273 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3275 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3276 new files use the everwhere possible.
3279 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3280 src/log_form.C src/lyx.C:
3283 * src/buffer.C (runLaTeX): remove func
3285 * src/PaperLayout.C: removed file
3286 * src/ParagraphExtra.C: likewise
3287 * src/bullet_forms.C: likewise
3288 * src/bullet_forms.h: likewise
3289 * src/bullet_forms_cb.C: likewise
3291 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3292 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3295 * several files: remove all traces of the old fd_form_paragraph,
3296 and functions belonging to that.
3298 * several files: remove all traces of the old fd_form_document,
3299 and functions belonging to that.
3301 * several files: constify local variables were possible.
3303 * several files: remove all code that was dead when NEW_EXPORT was
3306 * several files: removed string::c_str in as many places as
3309 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3310 (e): be a bit more outspoken when patching
3311 (updatesrc): only move files if changed.
3313 * forms/layout_forms.h.patch: regenerated
3315 * forms/layout_forms.fd: remove form_document and form_paragraph
3316 and form_quotes and form_paper and form_table_options and
3317 form_paragraph_extra
3319 * forms/form1.fd: remove form_table
3321 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3322 the fdui->... rewrite. Update some comments to xforms 0.88
3324 * forms/bullet_forms.C.patch: removed file
3325 * forms/bullet_forms.fd: likewise
3326 * forms/bullet_forms.h.patch: likewise
3328 * development/Code_rules/Rules: added a section on switch
3329 statements. Updated some comment to xforms 0.88.
3331 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3333 * src/buffer.C (readFile): make sure that the whole version number
3334 is read after \lyxformat (even when it contains a comma)
3336 * lib/ui/default.ui: change shortcut of math menu to M-a.
3338 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3340 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3343 * src/LyXView.C (updateWindowTitle): show the full files name in
3344 window title, limited to 30 characters.
3346 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3347 When a number of characters has been given, we should not assume
3348 that the string is 0-terminated.
3350 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3351 calls (fixes some memory leaks)
3353 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3354 trans member on exit.
3356 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3358 * src/converter.C (GetReachable): fix typo.
3360 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3361 understand ',' instead of '.'.
3362 (GetInteger): rewrite to use strToInt().
3364 2000-09-26 Juergen Vigna <jug@sad.it>
3366 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3367 better visibility and error-message on wrong VSpace input.
3369 * src/language.C (initL): added english again.
3371 2000-09-25 Juergen Vigna <jug@sad.it>
3373 * src/frontends/kde/Dialogs.C (Dialogs):
3374 * src/frontends/gnome/Dialogs.C (Dialogs):
3375 * src/frontends/kde/Makefile.am:
3376 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3378 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3380 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3382 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3384 * src/frontends/xforms/FormParagraph.C:
3385 * src/frontends/xforms/FormParagraph.h:
3386 * src/frontends/xforms/form_paragraph.C:
3387 * src/frontends/xforms/form_paragraph.h:
3388 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3391 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3393 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3394 Paragraph-Data after use.
3396 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3397 non breakable paragraphs.
3399 2000-09-25 Garst R. Reese <reese@isn.net>
3401 * src/language.C (initL): added missing language_country codes.
3403 2000-09-25 Juergen Vigna <jug@sad.it>
3405 * src/insets/insettext.C (InsetText):
3406 (deleteLyXText): remove the not released LyXText structure!
3408 2000-09-24 Marko Vendelin <markov@ioc.ee>
3410 * src/frontends/gnome/mainapp.C
3411 * src/frontends/gnome/mainapp.h: added support for keyboard
3414 * src/frontends/gnome/FormCitation.C
3415 * src/frontends/gnome/FormCitation.h
3416 * src/frontends/gnome/Makefile.am
3417 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3418 FormCitation to use "action area" in mainapp window
3420 * src/frontends/gnome/Menubar_pimpl.C
3421 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3424 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3426 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3427 width/descent/ascent values if name is empty.
3428 (mathed_string_height): Use std::max.
3430 2000-09-25 Allan Rae <rae@lyx.org>
3432 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3433 segfault. This will be completely redesigned soon.
3435 * sigc++: updated libsigc++. Fixes struct timespec bug.
3437 * development/tools/makeLyXsigc.sh: .cvsignore addition
3439 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3441 * several files: removed almost all traces of the old table
3444 * src/TableLayout.C: removed file
3446 2000-09-22 Juergen Vigna <jug@sad.it>
3448 * src/frontends/kde/Dialogs.C: added credits forms.
3450 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3452 * src/frontends/gnome/Dialogs.C: added some forms.
3454 * src/spellchecker.C (init_spell_checker): set language in pspell code
3455 (RunSpellChecker): some modifications for setting language string.
3457 * src/language.[Ch]: added language_country code.
3459 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3461 * src/frontends/Dialogs.h: added new signal showError.
3462 Rearranged existing signals in some sort of alphabetical order.
3464 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3465 FormError.[Ch], form_error.[Ch]
3466 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3467 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3469 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3470 dialogs. I think that this can be used as the base to all these
3473 * src/frontends/xforms/FormError.[Ch]
3474 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3475 implementation of InsetError dialog.
3477 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3479 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3480 * src/frontends/kde/Makefile.am: ditto
3482 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3484 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3485 macrobf. This fixes a bug of invisible text.
3487 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3489 * lib/doc/LaTeXConfig.lyx.in: updated.
3491 * src/language.C (initL): remove language "francais" and change a
3492 bit the names of the two other french variations.
3494 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3495 string that may not be 0-terminated.
3497 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3499 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3501 2000-09-20 Marko Vendelin <markov@ioc.ee>
3503 * src/frontends/gnome/FormCitation.C
3504 * src/frontends/gnome/FormIndex.C
3505 * src/frontends/gnome/FormToc.C
3506 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3507 the variable initialization to shut up the warnings
3509 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3511 * src/table.[Ch]: deleted files
3513 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3516 2000-09-18 Juergen Vigna <jug@sad.it>
3518 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3519 problems with selection. Inserted new LFUN_PASTESELECTION.
3520 (InsetButtonPress): inserted handling of middle mouse-button paste.
3522 * src/spellchecker.C: changed word to word.c_str().
3524 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3526 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3527 included in the ``make dist'' tarball.
3529 2000-09-15 Juergen Vigna <jug@sad.it>
3531 * src/CutAndPaste.C (cutSelection): small fix return the right
3532 end position after cut inside one paragraph only.
3534 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3535 we are locked as otherwise we don't have a valid cursor position!
3537 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3539 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3541 * src/frontends/kde/FormRef.C: added using directive.
3542 * src/frontends/kde/FormToc.C: ditto
3544 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3546 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3548 2000-09-19 Marko Vendelin <markov@ioc.ee>
3550 * src/frontends/gnome/Menubar_pimpl.C
3551 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3552 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3554 * src/frontends/gnome/mainapp.C
3555 * src/frontends/gnome/mainapp.h: support for menu update used
3558 * src/frontends/gnome/mainapp.C
3559 * src/frontends/gnome/mainapp.h: support for "action" area in the
3560 main window. This area is used by small simple dialogs, such as
3563 * src/frontends/gnome/FormIndex.C
3564 * src/frontends/gnome/FormIndex.h
3565 * src/frontends/gnome/FormUrl.C
3566 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3569 * src/frontends/gnome/FormCitation.C
3570 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3571 action area. Only "Insert new citation" is implemented.
3573 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3575 * src/buffer.C (Dispatch): fix call to Dispatch
3576 * src/insets/insetref.C (Edit): likewise
3577 * src/insets/insetparent.C (Edit): likewise
3578 * src/insets/insetinclude.C (include_cb): likewise
3579 * src/frontends/xforms/FormUrl.C (apply): likewise
3580 * src/frontends/xforms/FormToc.C (apply): likewise
3581 * src/frontends/xforms/FormRef.C (apply): likewise
3582 * src/frontends/xforms/FormIndex.C (apply): likewise
3583 * src/frontends/xforms/FormCitation.C (apply): likewise
3584 * src/lyxserver.C (callback): likewise
3585 * src/lyxfunc.C (processKeySym): likewise
3586 (Dispatch): likewise
3587 (Dispatch): likewise
3588 * src/lyx_cb.C (LayoutsCB): likewise
3590 * Makefile.am (sourcedoc): small change
3592 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3594 * src/main.C (main): Don't make an empty GUIRunTime object. all
3595 methods are static. constify a bit remove unneded using + headers.
3597 * src/tabular.C: some more const to local vars move some loop vars
3599 * src/spellchecker.C: added some c_str after some word for pspell
3601 * src/frontends/GUIRunTime.h: add new static method setDefaults
3602 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3603 * src/frontends/kde/GUIRunTime.C (setDefaults):
3604 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3606 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3607 with strnew in arg, use correct emptystring when calling SetName.
3609 * several files: remove all commented code with relation to
3610 HAVE_SSTREAM beeing false. We now only support stringstream and
3613 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3615 * src/lyxfunc.C: construct correctly the automatic new file
3618 * src/text2.C (IsStringInText): change type of variable i to shut
3621 * src/support/sstream.h: do not use namespaces if the compiler
3622 does not support them.
3624 2000-09-15 Marko Vendelin <markov@ioc.ee>
3625 * src/frontends/gnome/FormCitation.C
3626 * src/frontends/gnome/FormCitation.h
3627 * src/frontends/gnome/diainsertcitation_interface.c
3628 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3629 regexp support to FormCitation [Gnome].
3631 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3634 * configure.in: remove unused KDE/GTKGUI define
3636 * src/frontends/kde/FormRef.C
3637 * src/frontends/kde/FormRef.h
3638 * src/frontends/kde/formrefdialog.C
3639 * src/frontends/kde/formrefdialog.h: double click will
3640 go to reference, now it is possible to change a cross-ref
3643 * src/frontends/kde/FormToc.C
3644 * src/frontends/kde/FormToc.h
3645 * src/frontends/kde/formtocdialog.C
3646 * src/frontends/kde/formtocdialog.h: add a depth
3649 * src/frontends/kde/Makefile.am: add QtLyXView.h
3652 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3654 * src/frontends/kde/FormCitation.h: added some using directives.
3656 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3658 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3661 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3664 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3666 * src/buffer.C (pop_tag): revert for the second time a change by
3667 Lars, who seems to really hate having non-local loop variables :)
3669 * src/Lsstream.h: add "using" statements.
3671 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3672 * src/buffer.C (writeFile): ditto
3674 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3676 * src/buffer.C (writeFile): try to fix the locale modified format
3677 number to always be as we want it.
3679 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3680 in XForms 0.89. C-space is now working again.
3682 * src/Lsstream.h src/support/sstream.h: new files.
3684 * also commented out all cases where strstream were used.
3686 * src/Bullet.h (c_str): remove method.
3688 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3690 * a lot of files: get rid of "char const *" and "char *" is as
3691 many places as possible. We only want to use them in interaction
3692 with system of other libraries, not inside lyx.
3694 * a lot of files: return const object is not of pod type. This
3695 helps ensure that temporary objects is not modified. And fits well
3696 with "programming by contract".
3698 * configure.in: check for the locale header too
3700 * Makefile.am (sourcedoc): new tag for generation of doc++
3703 2000-09-14 Juergen Vigna <jug@sad.it>
3705 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3706 callback to check which combo called it and do the right action.
3708 * src/combox.C (combo_cb): added combo * to the callbacks.
3709 (Hide): moved call of callback after Ungrab of the pointer.
3711 * src/intl.h: removed LCombo2 function.
3713 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3714 function as this can now be handled in one function.
3716 * src/combox.h: added Combox * to callback prototype.
3718 * src/frontends/xforms/Toolbar_pimpl.C:
3719 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3721 2000-09-14 Garst Reese <reese@isn.net>
3723 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3724 moved usepackage{xxx}'s to beginning of file. Changed left margin
3725 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3726 underlining from title. Thanks to John Culleton for useful suggestions.
3728 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3730 * src/lyxlex_pimpl.C (setFile): change error message to debug
3733 2000-09-13 Juergen Vigna <jug@sad.it>
3735 * src/frontends/xforms/FormDocument.C: implemented choice_class
3736 as combox and give callback to combo_language so OK/Apply is activated
3739 * src/bufferlist.C (newFile): small fix so already named files
3740 (via an open call) are not requested to be named again on the
3743 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3745 * src/frontends/kde/Makefile.am
3746 * src/frontends/kde/FormRef.C
3747 * src/frontends/kde/FormRef.h
3748 * src/frontends/kde/formrefdialog.C
3749 * src/frontends/kde/formrefdialog.h: implement
3752 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3754 * src/frontends/kde/formtocdialog.C
3755 * src/frontends/kde/formtocdialog.h
3756 * src/frontends/kde/FormToc.C
3757 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3759 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3761 * src/frontends/kde/FormCitation.C: fix thinko
3762 where we didn't always display the reference text
3765 * src/frontends/kde/formurldialog.C
3766 * src/frontends/kde/formurldialog.h
3767 * src/frontends/kde/FormUrl.C
3768 * src/frontends/kde/FormUrl.h: minor cleanups
3770 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3772 * src/frontends/kde/Makefile.am
3773 * src/frontends/kde/FormToc.C
3774 * src/frontends/kde/FormToc.h
3775 * src/frontends/kde/FormCitation.C
3776 * src/frontends/kde/FormCitation.h
3777 * src/frontends/kde/FormIndex.C
3778 * src/frontends/kde/FormIndex.h
3779 * src/frontends/kde/formtocdialog.C
3780 * src/frontends/kde/formtocdialog.h
3781 * src/frontends/kde/formcitationdialog.C
3782 * src/frontends/kde/formcitationdialog.h
3783 * src/frontends/kde/formindexdialog.C
3784 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3786 2000-09-12 Juergen Vigna <jug@sad.it>
3788 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3791 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3793 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3796 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3798 * src/converter.C (Add, Convert): Added support for converter flags:
3799 needaux, resultdir, resultfile.
3800 (Convert): Added new parameter view_file.
3801 (dvips_options): Fixed letter paper option.
3803 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3804 (Export, GetExportableFormats, GetViewableFormats): Added support
3807 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3809 (easyParse): Fixed to work with new export code.
3811 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3814 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3816 * lib/bind/*.bind: Replaced
3817 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3818 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3820 2000-09-11 Juergen Vigna <jug@sad.it>
3822 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3824 * src/main.C (main): now GUII defines global guiruntime!
3826 * src/frontends/gnome/GUIRunTime.C (initApplication):
3827 * src/frontends/kde/GUIRunTime.C (initApplication):
3828 * src/frontends/xforms/GUIRunTime.C (initApplication):
3829 * src/frontends/GUIRunTime.h: added new function initApplication.
3831 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3833 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3835 2000-09-08 Juergen Vigna <jug@sad.it>
3837 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3838 we have already "Reset".
3840 * src/language.C (initL): inserted "default" language and made this
3841 THE default language (and not american!)
3843 * src/paragraph.C: inserted handling of "default" language!
3845 * src/lyxfont.C: ditto
3849 * src/paragraph.C: output the \\par only if we have a following
3850 paragraph otherwise it's not needed.
3852 2000-09-05 Juergen Vigna <jug@sad.it>
3854 * config/pspell.m4: added entry to lyx-flags
3856 * src/spellchecker.C: modified version from Kevin for using pspell
3858 2000-09-01 Marko Vendelin <markov@ioc.ee>
3859 * src/frontends/gnome/Makefile.am
3860 * src/frontends/gnome/FormCitation.C
3861 * src/frontends/gnome/FormCitation.h
3862 * src/frontends/gnome/diainsertcitation_callbacks.c
3863 * src/frontends/gnome/diainsertcitation_callbacks.h
3864 * src/frontends/gnome/diainsertcitation_interface.c
3865 * src/frontends/gnome/diainsertcitation_interface.h
3866 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3867 dialog for Gnome frontend
3869 * src/main.C: Gnome libraries require keeping application name
3870 and its version as strings
3872 * src/frontends/gnome/mainapp.C: Change the name of the main window
3873 from GnomeLyX to PACKAGE
3875 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * src/frontends/Liason.C: add "using: declaration.
3879 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3881 * src/mathed/math_macro.C (Metrics): Set the size of the template
3883 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3885 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3887 * src/converter.C (add_options): New function.
3888 (SetViewer): Change $$FName into '$$FName'.
3889 (View): Add options when running xdvi
3890 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3891 (Convert): The 3rd parameter is now the desired filename. Converts
3892 calls to lyx::rename if necessary.
3893 Add options when running dvips.
3894 (dvi_papersize,dvips_options): New methods.
3896 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3898 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3899 using a call to Converter::dvips_options.
3900 Fixed to work with nex export code.
3902 * src/support/copy.C
3903 * src/support/rename.C: New files
3905 * src/support/syscall.h
3906 * src/support/syscall.C: Added Starttype SystemDontWait.
3908 * lib/ui/default.ui: Changed to work with new export code
3910 * lib/configure.m4: Changed to work with new export code
3912 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3914 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3916 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3917 so that code compiles with DEC cxx.
3919 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3920 to work correctly! Also now supports the additional elements
3923 2000-09-01 Allan Rae <rae@lyx.org>
3925 * src/frontends/ButtonPolicies.C: renamed all the references to
3926 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3928 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3929 since it's a const not a type.
3931 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3933 2000-08-31 Juergen Vigna <jug@sad.it>
3935 * src/insets/figinset.C: Various changes to look if the filename has
3936 an extension and if not add it for inline previewing.
3938 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3940 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3941 make buttonStatus and isReadOnly be const methods. (also reflect
3942 this in derived classes.)
3944 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3945 (nextState): change to be static inline, pass the StateMachine as
3947 (PreferencesPolicy): remove casts
3948 (OkCancelPolicy): remvoe casts
3949 (OkCancelReadOnlyPolicy): remove casts
3950 (NoRepeatedApplyReadOnlyPolicy): remove casts
3951 (OkApplyCancelReadOnlyPolicy): remove casts
3952 (OkApplyCancelPolicy): remove casts
3953 (NoRepeatedApplyPolicy): remove casts
3955 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3957 * src/converter.C: added some using directives
3959 * src/frontends/ButtonPolicies.C: changes to overcome
3960 "need lvalue" error with DEC c++
3962 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3963 to WMHideCB for DEC c++
3965 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3967 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3968 to BulletBMTableCB for DEC c++
3970 2000-08-31 Allan Rae <rae@lyx.org>
3972 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3973 character dialog separately from old document dialogs combo_language.
3976 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3978 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3979 Removed LFUN_REF_CREATE.
3981 * src/MenuBackend.C: Added new tags: toc and references
3983 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3984 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3986 (add_toc, add_references): New methods.
3987 (create_submenu): Handle correctly the case when there is a
3988 seperator after optional menu items.
3990 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3991 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3992 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3994 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3996 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3998 * src/converter.[Ch]: New file for converting between different
4001 * src/export.[Ch]: New file for exporting a LyX file to different
4004 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4005 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4006 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4007 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4008 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4009 RunDocBook, MenuExport.
4011 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4012 Exporter::Preview methods if NEW_EXPORT is defined.
4014 * src/buffer.C (Dispatch): Use Exporter::Export.
4016 * src/lyxrc.C: Added new tags: \converter and \viewer.
4019 * src/LyXAction.C: Define new lyx-function: buffer-update.
4020 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4021 when NEW_EXPORT is defined.
4023 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4025 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4027 * lib/ui/default.ui: Added submenus "view" and "update" to the
4030 * src/filetools.C (GetExtension): New function.
4032 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4034 2000-08-29 Allan Rae <rae@lyx.org>
4036 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4038 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4039 (EnableDocumentLayout): removed
4040 (DisableDocumentLayout): removed
4041 (build): make use of ButtonController's read-only handling to
4042 de/activate various objects. Replaces both of the above functions.
4044 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4045 (readOnly): was read_only
4046 (refresh): fixed dumb mistakes with read_only_ handling
4048 * src/frontends/xforms/forms/form_document.fd:
4049 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4050 tabbed dialogs so the tabs look more like tabs and so its easier to
4051 work out which is the current tab.
4053 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4054 segfault with form_table
4056 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4058 2000-08-28 Juergen Vigna <jug@sad.it>
4060 * acconfig.h: added USE_PSPELL.
4062 * src/config.h.in: added USE_PSPELL.
4064 * autogen.sh: added pspell.m4
4066 * config/pspell.m4: new file.
4068 * src/spellchecker.C: implemented support for pspell libary.
4070 2000-08-25 Juergen Vigna <jug@sad.it>
4072 * src/LyXAction.C (init): renamed LFUN_TABLE to
4073 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4075 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4077 * src/lyxscreen.h: add force_clear variable and fuction to force
4078 a clear area when redrawing in LyXText.
4080 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4082 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4084 * some whitespace and comment changes.
4086 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4088 * src/buffer.C: up te LYX_FORMAT to 2.17
4090 2000-08-23 Juergen Vigna <jug@sad.it>
4092 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4095 * src/insets/insettabular.C (pasteSelection): delete the insets
4096 LyXText as it is not valid anymore.
4097 (copySelection): new function.
4098 (pasteSelection): new function.
4099 (cutSelection): new function.
4100 (LocalDispatch): implemented cut/copy/paste of cell selections.
4102 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4103 don't have a LyXText.
4105 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4107 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4110 2000-08-22 Juergen Vigna <jug@sad.it>
4112 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4113 ifdef form_table out if NEW_TABULAR.
4115 2000-08-21 Juergen Vigna <jug@sad.it>
4117 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4118 (draw): fixed draw position so that the cursor is positioned in the
4120 (InsetMotionNotify): hide/show cursor so the position is updated.
4121 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4122 using cellstart() function where it should be used.
4124 * src/insets/insettext.C (draw): ditto.
4126 * src/tabular.C: fixed initialization of some missing variables and
4127 made BoxType into an enum.
4129 2000-08-22 Marko Vendelin <markov@ioc.ee>
4130 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4131 stock menu item using action numerical value, not its string
4135 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4137 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4138 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4140 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4142 * src/frontends/xforms/GUIRunTime.C: new file
4144 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4145 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4147 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4149 * src/frontends/kde/GUIRunTime.C: new file
4151 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4152 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4154 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4156 * src/frontends/gnome/GUIRunTime.C: new file
4158 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4161 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4162 small change to documetentation.
4164 * src/frontends/GUIRunTime.C: removed file
4166 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4168 * src/lyxparagraph.h: enable NEW_TABULAR as default
4170 * src/lyxfunc.C (processKeySym): remove some commented code
4172 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4173 NEW_TABULAR around the fd_form_table_options.
4175 * src/lyx_gui.C (runTime): call the static member function as
4176 GUIRunTime::runTime().
4178 2000-08-21 Allan Rae <rae@lyx.org>
4180 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4183 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4185 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4187 2000-08-21 Allan Rae <rae@lyx.org>
4189 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4190 keep Garst happy ;-)
4191 * src/frontends/xforms/FormPreferences.C (build): use setOK
4192 * src/frontends/xforms/FormDocument.C (build): use setOK
4193 (FormDocument): use the appropriate policy.
4195 2000-08-21 Allan Rae <rae@lyx.org>
4197 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4198 automatic [de]activation of arbitrary objects when in a read-only state.
4200 * src/frontends/ButtonPolicies.h: More documentation
4201 (isReadOnly): added to support the above.
4203 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4205 2000-08-18 Juergen Vigna <jug@sad.it>
4207 * src/insets/insettabular.C (getStatus): changed to return func_status.
4209 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4210 display toggle menu entries if they are.
4212 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4213 new document layout now.
4215 * src/lyxfunc.C: ditto
4217 * src/lyx_gui_misc.C: ditto
4219 * src/lyx_gui.C: ditto
4221 * lib/ui/default.ui: removed paper and quotes layout as they are now
4222 all in the document layout tabbed folder.
4224 * src/frontends/xforms/forms/form_document.fd: added Restore
4225 button and callbacks for all inputs for Allan's ButtonPolicy.
4227 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4228 (CheckChoiceClass): added missing params setting on class change.
4229 (UpdateLayoutDocument): added for updating the layout on params.
4230 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4231 (FormDocument): Implemented Allan's ButtonPolicy with the
4234 2000-08-17 Allan Rae <rae@lyx.org>
4236 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4237 so we can at least see the credits again.
4239 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4240 controller calls for the appropriate callbacks. Note that since Ok
4241 calls apply followed by cancel, and apply isn't a valid input for the
4242 APPLIED state, the bc_ calls have to be made in the static callback not
4243 within each of the real callbacks.
4245 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4246 (setOk): renamed from setOkay()
4248 2000-08-17 Juergen Vigna <jug@sad.it>
4250 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4251 in the implementation part.
4252 (composeUIInfo): don't show optional menu-items.
4254 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4256 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4258 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4259 text-state when in a text-inset.
4261 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4263 2000-08-17 Marko Vendelin <markov@ioc.ee>
4264 * src/frontends/gnome/FormIndex.C
4265 * src/frontends/gnome/FormIndex.h
4266 * src/frontends/gnome/FormToc.C
4267 * src/frontends/gnome/FormToc.h
4268 * src/frontends/gnome/dialogs
4269 * src/frontends/gnome/diatoc_callbacks.c
4270 * src/frontends/gnome/diatoc_callbacks.h
4271 * src/frontends/gnome/diainsertindex_callbacks.h
4272 * src/frontends/gnome/diainsertindex_callbacks.c
4273 * src/frontends/gnome/diainsertindex_interface.c
4274 * src/frontends/gnome/diainsertindex_interface.h
4275 * src/frontends/gnome/diatoc_interface.h
4276 * src/frontends/gnome/diatoc_interface.c
4277 * src/frontends/gnome/Makefile.am: Table of Contents and
4278 Insert Index dialogs implementation for Gnome frontend
4280 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4282 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4284 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4287 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4289 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4290 destructor. Don't definde if you don't need it
4291 (processEvents): made static, non-blocking events processing for
4293 (runTime): static method. event loop for xforms
4294 * similar as above for kde and gnome.
4296 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4297 new Pimpl is correct
4298 (runTime): new method calss the real frontends runtime func.
4300 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4302 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4304 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4306 2000-08-16 Juergen Vigna <jug@sad.it>
4308 * src/lyx_gui.C (runTime): added GUII RunTime support.
4310 * src/frontends/Makefile.am:
4311 * src/frontends/GUIRunTime.[Ch]:
4312 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4313 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4314 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4316 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4318 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4319 as this is already set in ${FRONTEND_INCLUDE} if needed.
4321 * configure.in (CPPFLAGS): setting the include dir for the frontend
4322 directory and don't set FRONTEND=xforms for now as this is executed
4325 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4327 * src/frontends/kde/Makefile.am:
4328 * src/frontends/kde/FormUrl.C:
4329 * src/frontends/kde/FormUrl.h:
4330 * src/frontends/kde/formurldialog.h:
4331 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4333 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4335 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4337 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4339 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4342 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4344 * src/WorkArea.C (work_area_handler): more work to get te
4345 FL_KEYBOARD to work with xforms 0.88 too, please test.
4347 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4349 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4351 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4354 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4356 * src/Timeout.h: remove Qt::emit hack.
4358 * several files: changes to allo doc++ compilation
4360 * src/lyxfunc.C (processKeySym): new method
4361 (processKeyEvent): comment out if FL_REVISION < 89
4363 * src/WorkArea.C: change some debugging levels.
4364 (WorkArea): set wantkey to FL_KEY_ALL
4365 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4366 clearer code and the use of compose with XForms 0.89. Change to
4367 use signals instead of calling methods in bufferview directly.
4369 * src/Painter.C: change some debugging levels.
4371 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4374 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4375 (workAreaKeyPress): new method
4377 2000-08-14 Juergen Vigna <jug@sad.it>
4379 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4381 * config/kde.m4: addes some features
4383 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4384 include missing xforms dialogs.
4386 * src/Timeout.h: a hack to be able to compile with qt/kde.
4388 * sigc++/.cvsignore: added acinclude.m4
4390 * lib/.cvsignore: added listerros
4392 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4393 xforms tree as objects are needed for other frontends.
4395 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4396 linking with not yet implemented xforms objects.
4398 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4400 2000-08-14 Baruch Even <baruch.even@writeme.com>
4402 * src/frontends/xforms/FormGraphics.h:
4403 * src/frontends/xforms/FormGraphics.C:
4404 * src/frontends/xforms/RadioButtonGroup.h:
4405 * src/frontends/xforms/RadioButtonGroup.C:
4406 * src/insets/insetgraphics.h:
4407 * src/insets/insetgraphics.C:
4408 * src/insets/insetgraphicsParams.h:
4409 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4410 instead of spaces, and various other indentation issues to make the
4411 sources more consistent.
4413 2000-08-14 Marko Vendelin <markov@ioc.ee>
4415 * src/frontends/gnome/dialogs/diaprint.glade
4416 * src/frontends/gnome/FormPrint.C
4417 * src/frontends/gnome/FormPrint.h
4418 * src/frontends/gnome/diaprint_callbacks.c
4419 * src/frontends/gnome/diaprint_callbacks.h
4420 * src/frontends/gnome/diaprint_interface.c
4421 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4424 * src/frontends/gnome/dialogs/diainserturl.glade
4425 * src/frontends/gnome/FormUrl.C
4426 * src/frontends/gnome/FormUrl.h
4427 * src/frontends/gnome/diainserturl_callbacks.c
4428 * src/frontends/gnome/diainserturl_callbacks.h
4429 * src/frontends/gnome/diainserturl_interface.c
4430 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4431 Gnome implementation
4433 * src/frontends/gnome/Dialogs.C
4434 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4435 all other dialogs. Copy all unimplemented dialogs from Xforms
4438 * src/frontends/gnome/support.c
4439 * src/frontends/gnome/support.h: support files generated by Glade
4443 * config/gnome.m4: Gnome configuration scripts
4445 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4446 configure --help message
4448 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4449 only if there are no events pendling in Gnome/Gtk. This enhances
4450 the performance of menus.
4453 2000-08-14 Allan Rae <rae@lyx.org>
4455 * lib/Makefile.am: listerrors cleaning
4457 * lib/listerrors: removed -- generated file
4458 * acinclude.m4: ditto
4459 * sigc++/acinclude.m4: ditto
4461 * src/frontends/xforms/forms/form_citation.fd:
4462 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4465 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4466 `updatesrc` and now we have a `test` target that does what `updatesrc`
4467 used to do. I didn't like having an install target that wasn't related
4470 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4471 on all except FormGraphics. This may yet happen. Followed by a major
4472 cleanup including using FL_TRANSIENT for most of the dialogs. More
4473 changes to come when the ButtonController below is introduced.
4475 * src/frontends/xforms/ButtonController.h: New file for managing up to
4476 four buttons on a dialog according to an externally defined policy.
4477 * src/frontends/xforms/Makefile.am: added above
4479 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4480 Apply and Cancel/Close buttons and everything in between and beyond.
4481 * src/frontends/Makefile.am: added above.
4483 * src/frontends/xforms/forms/form_preferences.fd:
4484 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4485 and removed variable 'status' as a result. Fixed the set_minsize thing.
4486 Use the new screen-font-update after checking screen fonts were changed
4487 Added a "Restore" button to restore the original lyxrc values while
4488 editing. This restores everything not just the last input changed.
4489 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4491 * src/LyXAction.C: screen-font-update added for updating buffers after
4492 screen font settings have been changed.
4493 * src/commandtags.h: ditto
4494 * src/lyxfunc.C: ditto
4496 * forms/lyx.fd: removed screen fonts dialog.
4497 * src/lyx_gui.C: ditto
4498 * src/menus.[Ch]: ditto
4499 * src/lyx.[Ch]: ditto
4500 * src/lyx_cb.C: ditto + code from here moved to make
4501 screen-font-update. And people wonder why progress on GUII is
4502 slow. Look at how scattered this stuff was! It takes forever
4505 * forms/fdfix.sh: Fixup the spacing after commas.
4506 * forms/makefile: Remove date from generated files. Fewer clashes now.
4507 * forms/bullet_forms.C.patch: included someones handwritten changes
4509 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4510 once I've discovered why LyXRC was made noncopyable.
4511 * src/lyx_main.C: ditto
4513 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4515 * src/frontends/xforms/forms/fdfix.sh:
4516 * src/frontends/xforms/forms/fdfixh.sed:
4517 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4518 * src/frontends/xforms/Form*.[hC]:
4519 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4520 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4521 provide a destructor for the struct FD_form_xxxx. Another version of
4522 the set_[max|min]size workaround and a few other cleanups. Actually,
4523 Angus' patch from 20000809.
4525 2000-08-13 Baruch Even <baruch.even@writeme.com>
4527 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4530 2000-08-11 Juergen Vigna <jug@sad.it>
4532 * src/insets/insetgraphics.C (InsetGraphics): changing init
4533 order because of warnings.
4535 * src/frontends/xforms/forms/makefile: adding patching .C with
4538 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4539 from .C.patch to .c.patch
4541 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4542 order because of warning.
4544 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4546 * src/frontends/Liason.C (setMinibuffer): new helper function
4548 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4550 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4552 * lib/ui/default.ui: commented out PaperLayout entry
4554 * src/frontends/xforms/form_document.[Ch]: new added files
4556 * src/frontends/xforms/FormDocument.[Ch]: ditto
4558 * src/frontends/xforms/forms/form_document.fd: ditto
4560 * src/frontends/xforms/forms/form_document.C.patch: ditto
4562 2000-08-10 Juergen Vigna <jug@sad.it>
4564 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4565 (InsetGraphics): initialized cacheHandle to 0.
4566 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4568 2000-08-10 Baruch Even <baruch.even@writeme.com>
4570 * src/graphics/GraphicsCache.h:
4571 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4572 correctly as a cache.
4574 * src/graphics/GraphicsCacheItem.h:
4575 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4578 * src/graphics/GraphicsCacheItem_pimpl.h:
4579 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4582 * src/insets/insetgraphics.h:
4583 * src/insets/insetgraphics.C: Changed from using a signal notification
4584 to polling when image is not loaded.
4586 2000-08-10 Allan Rae <rae@lyx.org>
4588 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4589 that there are two functions that have to been taken out of line by
4590 hand and aren't taken care of in the script. (Just a reminder note)
4592 * sigc++/macros/*.h.m4: Updated as above.
4594 2000-08-09 Juergen Vigna <jug@sad.it>
4596 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4598 * src/insets/insettabular.C: make drawing of single cell smarter.
4600 2000-08-09 Marko Vendelin <markov@ioc.ee>
4601 * src/frontends/gnome/Menubar_pimpl.C
4602 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4603 implementation: new files
4605 * src/frontends/gnome/mainapp.C
4606 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4609 * src/main.C: create Gnome main window
4611 * src/frontends/xforms/Menubar_pimpl.h
4612 * src/frontends/Menubar.C
4613 * src/frontends/Menubar.h: added method Menubar::update that calls
4614 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4616 * src/LyXView.C: calls Menubar::update to update the state
4619 * src/frontends/gnome/Makefile.am: added new files
4621 * src/frontends/Makefile.am: added frontend compiler options
4623 2000-08-08 Juergen Vigna <jug@sad.it>
4625 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4627 * src/bufferlist.C (close):
4628 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4629 documents if exiting without saving.
4631 * src/buffer.C (save): use removeAutosaveFile()
4633 * src/support/filetools.C (removeAutosaveFile): new function.
4635 * src/lyx_cb.C (MenuWrite): returns a bool now.
4636 (MenuWriteAs): check if file could really be saved and revert to the
4638 (MenuWriteAs): removing old autosavefile if existant.
4640 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4641 before Goto toggle declaration, because of compiler warning.
4643 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4645 * src/lyxfunc.C (MenuNew): small fix.
4647 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4649 * src/bufferlist.C (newFile):
4650 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4652 * src/lyxrc.C: added new_ask_filename tag
4654 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4656 * src/lyx.fd: removed code pertaining to form_ref
4657 * src/lyx.[Ch]: ditto
4658 * src/lyx_cb.C: ditto
4659 * src/lyx_gui.C: ditto
4660 * src/lyx_gui_misc.C: ditto
4662 * src/BufferView_pimpl.C (restorePosition): update buffer only
4665 * src/commandtags.h (LFUN_REFTOGGLE): removed
4666 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4667 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4668 (LFUN_REFBACK): renamed LFUN_REF_BACK
4670 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4671 * src/menus.C: ditto
4672 * src/lyxfunc.C (Dispatch): ditto.
4673 InsertRef dialog is now GUI-independent.
4675 * src/texrow.C: added using std::endl;
4677 * src/insets/insetref.[Ch]: strip out large amounts of code.
4678 The inset is now a container and this functionality is now
4679 managed by a new FormRef dialog
4681 * src/frontends/Dialogs.h (showRef, createRef): new signals
4683 * src/frontends/xforms/FormIndex.[Ch],
4684 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4685 when setting dialog's min/max size
4686 * src/frontends/xforms/FormIndex.[Ch]: ditto
4688 * src/frontends/xforms/FormRef.[Ch],
4689 src/frontends/xforms/forms/form_ref.fd: new xforms
4690 implementation of an InsetRef dialog
4692 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4695 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4696 ios::nocreate is not part of the standard. Removed.
4698 2000-08-07 Baruch Even <baruch.even@writeme.com>
4700 * src/graphics/Renderer.h:
4701 * src/graphics/Renderer.C: Added base class for rendering of different
4702 image formats into Pixmaps.
4704 * src/graphics/XPM_Renderer.h:
4705 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4706 in a different class.
4708 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4709 easily add support for other formats.
4711 * src/insets/figinset.C: plugged a leak of an X resource.
4713 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4715 * src/CutAndPaste.[Ch]: make all metods static.
4717 * development/Code_rules/Rules: more work, added section on
4718 Exceptions, and a References section.
4720 * a lot of header files: work to make doc++ able to generate the
4721 source documentation, some workarounds of doc++ problems. Doc++ is
4722 now able to generate the documentation.
4724 2000-08-07 Juergen Vigna <jug@sad.it>
4726 * src/insets/insettabular.C (recomputeTextInsets): removed function
4728 * src/tabular.C (SetWidthOfMulticolCell):
4730 (calculate_width_of_column_NMC): fixed return value so that it really
4731 only returns true if the column-width has changed (there where
4732 problems with muliticolumn-cells in this column).
4734 2000-08-04 Juergen Vigna <jug@sad.it>
4736 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4737 also on the scrollstatus of the inset.
4738 (workAreaMotionNotify): ditto.
4740 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4742 2000-08-01 Juergen Vigna <jug@sad.it>
4744 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4746 * src/commandtags.h:
4747 * src/LyXAction.C (init):
4748 * src/insets/inset.C (LocalDispatch): added support for
4751 * src/insets/inset.C (scroll): new functions.
4753 * src/insets/insettext.C (removeNewlines): new function.
4754 (SetAutoBreakRows): removes forced newlines in the text of the
4755 paragraph if autoBreakRows is set to false.
4757 * src/tabular.C (Latex): generates a parbox around the cell contents
4760 * src/frontends/xforms/FormTabular.C (local_update): removed
4761 the radio_useparbox button.
4763 * src/tabular.C (UseParbox): new function
4765 2000-08-06 Baruch Even <baruch.even@writeme.com>
4767 * src/graphics/GraphicsCache.h:
4768 * src/graphics/GraphicsCache.C:
4769 * src/graphics/GraphicsCacheItem.h:
4770 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4773 * src/insets/insetgraphics.h:
4774 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4775 and the drawing of the inline image.
4777 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4778 loaded into the wrong position.
4780 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4783 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4785 * src/support/translator.h: move all typedefs to public section
4787 * src/support/filetools.C (MakeLatexName): return string const
4789 (TmpFileName): ditto
4790 (FileOpenSearch): ditto
4792 (LibFileSearch): ditto
4793 (i18nLibFileSearch): ditto
4796 (CreateTmpDir): ditto
4797 (CreateBufferTmpDir): ditto
4798 (CreateLyXTmpDir): ditto
4801 (MakeAbsPath): ditto
4803 (OnlyFilename): ditto
4805 (NormalizePath): ditto
4806 (CleanupPath): ditto
4807 (GetFileContents): ditto
4808 (ReplaceEnvironmentPath): ditto
4809 (MakeRelPath): ditto
4811 (ChangeExtension): ditto
4812 (MakeDisplayPath): ditto
4813 (do_popen): return cmdret const
4814 (findtexfile): return string const
4816 * src/support/DebugStream.h: add some /// to please doc++
4818 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4820 * src/texrow.C (same_rownumber): functor to use with find_if
4821 (getIdFromRow): rewritten to use find_if and to not update the
4822 positions. return true if row is found
4823 (increasePos): new method, use to update positions
4825 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4827 * src/lyxlex_pimpl.C (verifyTable): new method
4830 (GetString): return string const
4831 (pushTable): rewrite to use std::stack
4833 (setFile): better check
4836 * src/lyxlex.h: make LyXLex noncopyable
4838 * src/lyxlex.C (text): return char const * const
4839 (GetString): return string const
4840 (getLongString): return string const
4842 * src/lyx_gui_misc.C (askForText): return pair<...> const
4844 * src/lastfiles.[Ch] (operator): return string const
4846 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4847 istringstream not char const *.
4848 move token.end() out of loop.
4849 (readFile): move initializaton of token
4851 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4852 getIdFromRow is successful.
4854 * lib/bind/emacs.bind: don't include menus bind
4856 * development/Code_rules/Rules: the beginnings of making this
4857 better and covering more of the unwritten rules that we have.
4859 * development/Code_rules/Recommendations: a couple of wording
4862 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4864 * src/support/strerror.c: remove C++ comment.
4866 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4868 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4869 LFUN_INDEX_INSERT_LAST
4871 * src/texrow.C (getIdFromRow): changed from const_iterator to
4872 iterator, allowing code to compile with DEC cxx
4874 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4875 stores part of the class, as suggested by Allan. Will allow
4877 (apply): test to apply uses InsetCommandParams operator!=
4879 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4880 (apply): test to apply uses InsetCommandParams operator!=
4882 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4883 stores part of the class.
4884 (update): removed limits on min/max size.
4886 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4887 (apply): test to apply uses InsetCommandParams operator!=
4889 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4890 (Read, Write, scanCommand, getCommand): moved functionality
4891 into InsetCommandParams.
4893 (getScreenLabel): made pure virtual
4894 new InsetCommandParams operators== and !=
4896 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4897 c-tors based on InsetCommandParams. Removed others.
4898 * src/insets/insetinclude.[Ch]: ditto
4899 * src/insets/insetlabel.[Ch]: ditto
4900 * src/insets/insetparent.[Ch]: ditto
4901 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4903 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4904 insets derived from InsetCommand created using similar c-tors
4905 based on InsetCommandParams
4906 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4907 * src/menus.C (ShowRefsMenu): ditto
4908 * src/paragraph.C (Clone): ditto
4909 * src/text2.C (SetCounter): ditto
4910 * src/lyxfunc.C (Dispatch) ditto
4911 Also recreated old InsetIndex behaviour exactly. Can now
4912 index-insert at the start of a paragraph and index-insert-last
4913 without launching the pop-up.
4915 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4917 * lib/lyxrc.example: mark te pdf options as non functional.
4919 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4920 (isStrDbl): move tmpstr.end() out of loop.
4921 (strToDbl): move intialization of tmpstr
4922 (lowercase): return string const and move tmp.end() out of loop.
4923 (uppercase): return string const and move tmp.edn() out of loop.
4924 (prefixIs): add assertion
4929 (containsOnly): ditto
4930 (containsOnly): ditto
4931 (containsOnly): ditto
4932 (countChar): make last arg char not char const
4933 (token): return string const
4934 (subst): return string const, move tmp.end() out of loop.
4935 (subst): return string const, add assertion
4936 (strip): return string const
4937 (frontStrip): return string const, add assertion
4938 (frontStrip): return string const
4943 * src/support/lstrings.C: add inclde "LAssert.h"
4944 (isStrInt): move tmpstr.end() out of loop.
4946 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4947 toollist.end() out of loop.
4948 (deactivate): move toollist.end() out of loop.
4949 (update): move toollist.end() out of loop.
4950 (updateLayoutList): move tc.end() out of loop.
4951 (add): move toollist.end() out of loop.
4953 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4954 md.end() out of loop.
4956 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4958 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4961 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4962 (Erase): move insetlist.end() out of loop.
4964 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4965 ref to const string as first arg. Move initialization of some
4966 variables, whitespace changes.
4968 * src/kbmap.C (defkey): move table.end() out of loop.
4969 (kb_keymap): move table.end() out of loop.
4970 (findbinding): move table.end() out of loop.
4972 * src/MenuBackend.C (hasMenu): move end() out of loop.
4973 (getMenu): move end() out of loop.
4974 (getMenu): move menulist_.end() out of loop.
4976 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4978 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4981 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4982 (getFromLyXName): move infotab.end() out of loop.
4984 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4985 -fvtable-thunks -ffunction-sections -fdata-sections
4987 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4989 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4992 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4994 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4996 * src/frontends/xforms/FormCitation.[Ch],
4997 src/frontends/xforms/FormIndex.[Ch],
4998 src/frontends/xforms/FormToc.[Ch],
4999 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5001 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5003 * src/commandtags.h: renamed, created some flags for citation
5006 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5008 * src/lyxfunc.C (dispatch): use signals to insert index entry
5010 * src/frontends/Dialogs.h: new signal createIndex
5012 * src/frontends/xforms/FormCommand.[Ch],
5013 src/frontends/xforms/FormCitation.[Ch],
5014 src/frontends/xforms/FormToc.[Ch],
5015 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5017 * src/insets/insetindex.[Ch]: GUI-independent
5019 * src/frontends/xforms/FormIndex.[Ch],
5020 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5023 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5025 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5026 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5028 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5030 * src/insets/insetref.C (Latex): rewrite so that there is now
5031 question that a initialization is requested.
5033 * src/insets/insetcommand.h: reenable the hide signal
5035 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5037 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5038 fix handling of shortcuts (many bugs :)
5039 (add_lastfiles): ditto.
5041 * lib/ui/default.ui: fix a few shortcuts.
5043 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5045 * Makefile.am: Fix ``rpmdist'' target to return the exit
5046 status of the ``rpm'' command, instead of the last command in
5047 the chain (the ``rm lyx.xpm'' command, which always returns
5050 2000-08-02 Allan Rae <rae@lyx.org>
5052 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5053 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5054 * src/frontends/xforms/FormToc.C (FormToc): ditto
5056 * src/frontends/xforms/Makefile.am: A few forgotten files
5058 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5059 Signals-not-copyable-problem Lars' started commenting out.
5061 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5063 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/insets/insetcommand.h: Signals is not copyable so anoter
5066 scheme for automatic hiding of forms must be used.
5068 * src/frontends/xforms/FormCitation.h: don't inerit from
5069 noncopyable, FormCommand already does that.
5070 * src/frontends/xforms/FormToc.h: ditto
5071 * src/frontends/xforms/FormUrl.h: ditto
5073 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5075 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5077 * src/insets/insetcommand.h (hide): new SigC::Signal0
5078 (d-tor) new virtual destructor emits hide signal
5080 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5081 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5083 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5084 LOF and LOT. Inset is now GUI-independent
5086 * src/insets/insetloa.[Ch]: redundant
5087 * src/insets/insetlof.[Ch]: ditto
5088 * src/insets/insetlot.[Ch]: ditto
5090 * src/frontends/xforms/forms/form_url.fd: tweaked!
5091 * src/frontends/xforms/forms/form_citation.fd: ditto
5093 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5094 dialogs dealing with InsetCommand insets
5096 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5097 FormCommand base class
5098 * src/frontends/xforms/FormUrl.[Ch]: ditto
5100 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5102 * src/frontends/xforms/FormToc.[Ch]: ditto
5104 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5105 passed a generic InsetCommand pointer
5106 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5108 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5109 and modified InsetTOC class
5110 * src/buffer.C: ditto
5112 * forms/lyx.fd: strip out old FD_form_toc code
5113 * src/lyx_gui_misc.C: ditto
5114 * src/lyx_gui.C: ditto
5115 * src/lyx_cb.C: ditto
5116 * src/lyx.[Ch]: ditto
5118 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5120 * src/support/utility.hpp: tr -d '\r'
5122 2000-08-01 Juergen Vigna <jug@sad.it>
5124 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5126 * src/commandtags.h:
5127 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5128 LFUN_TABULAR_FEATURES.
5130 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5131 LFUN_LAYOUT_TABULAR.
5133 * src/insets/insettabular.C (getStatus): implemented helper function.
5135 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5137 2000-07-31 Juergen Vigna <jug@sad.it>
5139 * src/text.C (draw): fixed screen update problem for text-insets.
5141 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5142 something changed probably this has to be added in various other
5145 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5147 2000-07-31 Baruch Even <baruch.even@writeme.com>
5149 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5150 templates to satisfy compaq cxx.
5153 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5155 * src/support/translator.h (equal_1st_in_pair::operator()): take
5156 const ref pair_type as arg.
5157 (equal_2nd_in_pair::operator()): ditto
5158 (Translator::~Translator): remove empty d-tor.
5160 * src/graphics/GraphicsCache.C: move include config.h to top, also
5161 put initialization of GraphicsCache::singleton here.
5162 (~GraphicsCache): move here
5163 (addFile): take const ref as arg
5166 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5168 * src/BufferView2.C (insertLyXFile): change te with/without header
5171 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5173 * src/frontends/xforms/FormGraphics.C (apply): add some
5174 static_cast. Not very nice, but required by compaq cxx.
5176 * src/frontends/xforms/RadioButtonGroup.h: include header
5177 <utility> instead of <pair.h>
5179 * src/insets/insetgraphicsParams.C: add using directive.
5180 (readResize): change return type to void.
5181 (readOrigin): ditto.
5183 * src/lyxfunc.C (getStatus): add missing break for build-program
5184 function; add test for Literate for export functions.
5186 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5187 entries in Options menu.
5189 2000-07-31 Baruch Even <baruch.even@writeme.com>
5191 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5192 protect against auto-allocation; release icon when needed.
5194 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5196 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5197 on usual typewriter.
5199 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5200 earlier czech.kmap), useful only for programming.
5202 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5204 * src/frontends/xforms/FormCitation.h: fix conditioning around
5207 2000-07-31 Juergen Vigna <jug@sad.it>
5209 * src/frontends/xforms/FormTabular.C (local_update): changed
5210 radio_linebreaks to radio_useparbox and added radio_useminipage.
5212 * src/tabular.C: made support for using minipages/parboxes.
5214 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5216 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5218 (descent): so the cursor is in the middle.
5219 (width): bit smaller box.
5221 * src/insets/insetgraphics.h: added display() function.
5223 2000-07-31 Baruch Even <baruch.even@writeme.com>
5225 * src/frontends/Dialogs.h: Added showGraphics signals.
5227 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5228 xforms form definition of the graphics dialog.
5230 * src/frontends/xforms/FormGraphics.h:
5231 * src/frontends/xforms/FormGraphics.C: Added files, the
5232 GUIndependent code of InsetGraphics
5234 * src/insets/insetgraphics.h:
5235 * src/insets/insetgraphics.C: Major writing to make it work.
5237 * src/insets/insetgraphicsParams.h:
5238 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5239 struct between InsetGraphics and GUI.
5241 * src/LaTeXFeatures.h:
5242 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5243 support for graphicx package.
5245 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5246 for the graphics inset.
5248 * src/support/translator.h: Added file, used in
5249 InsetGraphicsParams. this is a template to translate between two
5252 * src/frontends/xforms/RadioButtonGroup.h:
5253 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5254 way to easily control a radio button group.
5256 2000-07-28 Juergen Vigna <jug@sad.it>
5258 * src/insets/insettabular.C (LocalDispatch):
5259 (TabularFeatures): added support for lyx-functions of tabular features.
5260 (cellstart): refixed this function after someone wrongly changed it.
5262 * src/commandtags.h:
5263 * src/LyXAction.C (init): added support for tabular-features
5265 2000-07-28 Allan Rae <rae@lyx.org>
5267 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5268 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5269 triggers the callback for input checking. As a result we sometimes get
5270 "LyX: This shouldn't happen..." printed to cerr.
5271 (input): Started using status variable since I only free() on
5272 destruction. Some input checking for paths and font sizes.
5274 * src/frontends/xforms/FormPreferences.h: Use status to control
5275 activation of Ok and Apply
5277 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5278 callback. Also resized to stop segfaults with 0.88. The problem is
5279 that xforms-0.88 requires the folder to be wide enough to fit all the
5280 tabs. If it isn't it causes all sorts of problems.
5282 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5284 * src/frontends/xforms/forms/README: Reflect reality.
5286 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5287 * src/frontends/xforms/forms/makefile: ditto.
5289 * src/commandtags.h: Get access to new Preferences dialog
5290 * src/LyXAction.C: ditto
5291 * src/lyxfunc.C: ditto
5292 * lib/ui/default.ui: ditto
5294 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5296 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5298 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5301 * src/frontends/xforms/form_url.[Ch]: added.
5303 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5305 * src/insets/insetbib.h: fixed bug in previous commit
5307 * src/frontends/xforms/FormUrl.h: ditto
5309 * src/frontends/xforms/FormPrint.h: ditto
5311 * src/frontends/xforms/FormPreferences.h: ditto
5313 * src/frontends/xforms/FormCopyright.h: ditto
5315 * src/frontends/xforms/FormCitation.C: ditto
5317 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5318 private copyconstructor and private default contructor
5320 * src/support/Makefile.am: add utility.hpp
5322 * src/support/utility.hpp: new file from boost
5324 * src/insets/insetbib.h: set owner in clone
5326 * src/frontends/xforms/FormCitation.C: added missing include
5329 * src/insets/form_url.[Ch]: removed
5331 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5333 * development/lyx.spec.in
5334 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5335 file/directory re-organization.
5337 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5339 * src/insets/insetcommand.[Ch]: moved the string data and
5340 associated manipulation methods into a new stand-alone class
5341 InsetCommandParams. This class has two additional methods
5342 getAsString() and setFromString() allowing the contents to be
5343 moved around as a single string.
5344 (addContents) method removed.
5345 (setContents) method no longer virtual.
5347 * src/buffer.C (readInset): made use of new InsetCitation,
5348 InsetUrl constructors based on InsetCommandParams.
5350 * src/commandtags.h: add LFUN_INSERT_URL
5352 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5353 independent InsetUrl and use InsetCommandParams to extract
5354 string info and create new Insets.
5356 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5358 * src/frontends/xforms/FormCitation.C (apply): uses
5361 * src/frontends/xforms/form_url.C
5362 * src/frontends/xforms/form_url.h
5363 * src/frontends/xforms/FormUrl.h
5364 * src/frontends/xforms/FormUrl.C
5365 * src/frontends/xforms/forms/form_url.fd: new files
5367 * src/insets/insetcite.[Ch]: removed unused constructors.
5369 * src/insets/insetinclude.[Ch]: no longer store filename
5371 * src/insets/inseturl.[Ch]: GUI-independent.
5373 2000-07-26 Juergen Vigna <jug@sad.it>
5374 * renamed frontend from gtk to gnome as it is that what is realized
5375 and did the necessary changes in the files.
5377 2000-07-26 Marko Vendelin <markov@ioc.ee>
5379 * configure.in: cleaning up gnome configuration scripts
5381 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5383 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5384 shortcuts syndrom by redrawing them explicitely (a better solution
5385 would be appreciated).
5387 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5389 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5392 * src/lyx_cb.C (MenuExport): change html export to do the right
5393 thing depending of the document type (instead of having
5394 html-linuxdoc and html-docbook).
5395 * src/lyxfunc.C (getStatus): update for html
5396 * lib/ui/default.ui: simplify due to the above change.
5397 * src/menus.C (ShowFileMenu): update too (in case we need it).
5399 * src/MenuBackend.C (read): if a menu is defined twice, add the
5400 new entries to the exiting one.
5402 2000-07-26 Juergen Vigna <jug@sad.it>
5404 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5406 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5407 and return a bool if it did actual save the file.
5408 (AutoSave): don't autosave a unnamed doc.
5410 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5411 check if this is an UNNAMED new file and react to it.
5412 (newFile): set buffer to unnamed and change to not mark a new
5413 buffer dirty if I didn't do anything with it.
5415 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5417 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5420 friend as per Angus's patch posted to lyx-devel.
5422 * src/ext_l10n.h: updated
5424 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5425 gettext on the style string right before inserting them into the
5428 * autogen.sh: add code to extract style strings form layout files,
5429 not good enough yet.
5431 * src/frontends/gtk/.cvsignore: add MAKEFILE
5433 * src/MenuBackend.C (read): run the label strings through gettext
5434 before storing them in the containers.
5436 * src/ext_l10n.h: new file
5438 * autogen.sh : generate the ext_l10n.h file here
5440 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5442 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5445 * lib/ui/default.ui: fix a couple of typos.
5447 * config/gnome/gtk.m4: added (and added to the list of files in
5450 * src/insets/insetinclude.C (unique_id): fix when we are using
5451 lyxstring instead of basic_string<>.
5452 * src/insets/insettext.C (LocalDispatch): ditto.
5453 * src/support/filetools.C: ditto.
5455 * lib/configure.m4: create the ui/ directory if necessary.
5457 * src/LyXView.[Ch] (updateToolbar): new method.
5459 * src/BufferView_pimpl.C (buffer): update the toolbar when
5460 opening/closing buffer.
5462 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5464 * src/LyXAction.C (getActionName): enhance to return also the name
5465 and options of pseudo-actions.
5466 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5468 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5469 as an example of what is possible). Used in File->Build too (more
5470 useful) and in the import/export menus (to mimick the complicated
5471 handling of linuxdoc and friends). Try to update all the entries.
5473 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5476 * src/MenuBackend.C (read): Parse the new OptItem tag.
5478 * src/MenuBackend.h: Add a new optional_ data member (used if the
5479 entry should be omitted when the lyxfunc is disabled).
5481 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5482 function, used as a shortcut.
5483 (create_submenu): align correctly the shortcuts on the widest
5486 * src/MenuBackend.h: MenuItem.label() only returns the label of
5487 the menu without shortcut; new method shortcut().
5489 2000-07-14 Marko Vendelin <markov@ioc.ee>
5491 * src/frontends/gtk/Dialogs.C:
5492 * src/frontends/gtk/FormCopyright.C:
5493 * src/frontends/gtk/FormCopyright.h:
5494 * src/frontends/gtk/Makefile.am: added these source-files for the
5495 Gtk/Gnome support of the Copyright-Dialog.
5497 * src/main.C: added Gnome::Main initialization if using
5498 Gtk/Gnome frontend-GUI.
5500 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5502 * config/gnome/aclocal-include.m4
5503 * config/gnome/compiler-flags.m4
5504 * config/gnome/curses.m4
5505 * config/gnome/gnome--.m4
5506 * config/gnome/gnome-bonobo-check.m4
5507 * config/gnome/gnome-common.m4
5508 * config/gnome/gnome-fileutils.m4
5509 * config/gnome/gnome-ghttp-check.m4
5510 * config/gnome/gnome-gnorba-check.m4
5511 * config/gnome/gnome-guile-checks.m4
5512 * config/gnome/gnome-libgtop-check.m4
5513 * config/gnome/gnome-objc-checks.m4
5514 * config/gnome/gnome-orbit-check.m4
5515 * config/gnome/gnome-print-check.m4
5516 * config/gnome/gnome-pthread-check.m4
5517 * config/gnome/gnome-support.m4
5518 * config/gnome/gnome-undelfs.m4
5519 * config/gnome/gnome-vfs.m4
5520 * config/gnome/gnome-x-checks.m4
5521 * config/gnome/gnome-xml-check.m4
5522 * config/gnome/gnome.m4
5523 * config/gnome/gperf-check.m4
5524 * config/gnome/gtk--.m4
5525 * config/gnome/linger.m4
5526 * config/gnome/need-declaration.m4: added configuration scripts
5527 for Gtk/Gnome frontend-GUI
5529 * configure.in: added support for the --with-frontend=gtk option
5531 * autogen.sh: added config/gnome/* to list of config-files
5533 * acconfig.h: added define for GTKGUI-support
5535 * config/lyxinclude.m4: added --with-frontend[=value] option value
5536 for Gtk/Gnome frontend-GUI support.
5538 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5540 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5544 * src/paragraph.C (GetChar): remove non-const version
5546 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5547 (search_kw): use it.
5549 * src/lyx_main.C (init): if "preferences" exist, read that instead
5551 (ReadRcFile): return bool if the file could be read ok.
5552 (ReadUIFile): add a check to see if lex file is set ok.
5554 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5555 bastring can be used instead of lyxstring (still uses the old code
5556 if std::string is good enough or if lyxstring is used.)
5558 * src/encoding.C: make the arrays static, move ininle functions
5560 * src/encoding.h: from here.
5562 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5563 (parseSingleLyXformat2Token): move inset parsing to separate method
5564 (readInset): new private method
5566 * src/Variables.h: remove virtual from get().
5568 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5569 access to NEW_INSETS and NEW_TABULAR
5571 * src/MenuBackend.h: remove superfluous forward declaration of
5572 MenuItem. Add documentations tags "///", remove empty MenuItem
5573 destructor, remove private default contructor.
5575 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5577 (read): more string mlabel and mname to where they are used
5578 (read): remove unused variables mlabel and mname
5579 (defaults): unconditional clear, make menusetup take advantage of
5580 add returning Menu &.
5582 * src/LyXView.h: define NEW_MENUBAR as default
5584 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5585 to NEW_INSETS and NEW_TABULAR.
5586 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5587 defined. Change some of the "xxxx-inset-insert" functions names to
5590 * several files: more enahncements to NEW_INSETS and the resulting
5593 * lib/lyxrc.example (\date_insert_format): move to misc section
5595 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5596 bastring and use AC_CACHE_CHECK.
5597 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5598 the system have the newest methods. uses AC_CACHE_CHECK
5599 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5600 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5601 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5603 * configure.in: add LYX_CXX_GOOD_STD_STRING
5605 * acinclude.m4: recreated
5607 2000-07-24 Amir Karger <karger@lyx.org>
5609 * README: add Hebrew, Arabic kmaps
5612 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5614 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5617 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * Lot of files: add pragma interface/implementation.
5621 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5623 * lib/ui/default.ui: new file (ans new directory). Contains the
5624 default menu and toolbar.
5626 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5627 global space. Toolbars are now read (as menus) in ui files.
5629 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5631 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5632 is disabled because the document is read-only. We want to have the
5633 toggle state of the function anyway.
5634 (getStatus): add code for LFUN_VC* functions (mimicking what is
5635 done in old-style menus)
5637 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5638 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5640 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5641 * src/BufferView_pimpl.C: ditto.
5642 * src/lyxfunc.C: ditto.
5644 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5645 default). This replaces old-style menus by new ones.
5647 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5648 MenuItem. Contain the data structure of a menu.
5650 * src/insets/insettext.C: use LyXView::setLayout instead of
5651 accessing directly the toolbar combox.
5652 * src/lyxfunc.C (Dispatch): ditto.
5654 * src/LyXView.C (setLayout): new method, which just calls
5655 Toolbar::setLayout().
5656 (updateLayoutChoice): move part of this method in Toolbar.
5658 * src/toolbar.[Ch]: removed.
5660 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5661 implementation the toolbar.
5663 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5664 the toolbar. It might make sense to merge it with ToolbarDefaults
5666 (setLayout): new function.
5667 (updateLayoutList): ditto.
5668 (openLayoutList): ditto.
5670 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5671 xforms implementation of the toolbar.
5672 (get_toolbar_func): comment out, since I do not
5673 know what it is good for.
5675 * src/ToolbarDefaults.h: Add the ItemType enum.
5677 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5678 for a list of allocated C strings. Used in Menubar xforms
5679 implementation to avoid memory leaks.
5681 * src/support/lstrings.[Ch] (uppercase): new version taking and
5685 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5686 * lib/bind/emacs.bind: ditto.
5688 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5690 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5691 forward decl of LyXView.
5693 * src/toolbar.C (toolbarItem): moved from toolbar.h
5694 (toolbarItem::clean): ditto
5695 (toolbarItem::~toolbarItem): ditto
5696 (toolbarItem::operator): ditto
5698 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5700 * src/paragraph.h: control the NEW_TABULAR define from here
5702 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5703 USE_TABULAR_INSETS to NEW_TABULAR
5705 * src/ToolbarDefaults.C: add include "lyxlex.h"
5707 * files using the old table/tabular: use NEW_TABULAR to control
5708 compilation of old tabular stuff.
5710 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5713 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5714 planemet in reading of old style floats, fix the \end_deeper
5715 problem when reading old style floats.
5717 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5719 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5721 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5723 * lib/bind/sciword.bind: updated.
5725 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5727 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5728 layout write problem
5730 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5732 * src/Makefile.am (INCLUDES): remove image directory from include
5735 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5736 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5738 * src/LyXView.C (create_form_form_main): read the application icon
5741 * lib/images/*.xpm: change the icons to use transparent color for
5744 * src/toolbar.C (update): change the color of the button when it
5747 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5749 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5750 setting explicitely the minibuffer.
5751 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5753 * src/LyXView.C (showState): new function. Shows font information
5754 in minibuffer and update toolbar state.
5755 (LyXView): call Toolbar::update after creating the
5758 * src/toolbar.C: change toollist to be a vector instead of a
5760 (BubbleTimerCB): get help string directly from the callback
5761 argument of the corresponding icon (which is the action)
5762 (set): remove unnecessary ugliness.
5763 (update): new function. update the icons (depressed, disabled)
5764 depending of the status of the corresponding action.
5766 * src/toolbar.h: remove help in toolbarItem
5768 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5770 * src/Painter.C (text): Added code for using symbol glyphs from
5771 iso10646 fonts. Currently diabled.
5773 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5776 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5777 magyar,turkish and usorbian.
5779 * src/paragraph.C (isMultiLingual): Made more efficient.
5781 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5784 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5785 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5786 Also changed the prototype to "bool math_insert_greek(char)".
5788 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5790 * lots of files: apply the NEW_INSETS on all code that will not be
5791 needed when we move to use the new insets. Enable the define in
5792 lyxparagrah.h to try it.
5794 * src/insets/insettabular.C (cellstart): change to be a static
5796 (InsetTabular): initialize buffer in the initializer list.
5798 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5800 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5801 form_print.h out of the header file. Replaced with forward
5802 declarations of the relevant struct.
5804 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5807 * src/commandtags.h: do not include "debug.h" which does not
5808 belong there. #include it in some other places because of this
5811 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5813 * src/insets/insetcaption.C: add a couple "using" directives.
5815 * src/toolbar.C (add): get the help text directly from lyxaction.
5817 (setPixmap): new function. Loads from disk and sets a pixmap on a
5818 botton; the name of the pixmap file is derived from the command
5821 * src/toolbar.h: remove members isBitmap and pixmap from
5824 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5825 * lib/images/: move many files from images/banner.xpm.
5827 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5829 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5830 * src/toolbar.C: ditto.
5831 * configure.in: ditto.
5832 * INSTALL: document.
5834 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5835 the spellchecker popup is closed from the WM.
5837 2000-07-19 Juergen Vigna <jug@sad.it>
5839 * src/insets/insetfloat.C (Write): small fix because we use the
5840 insetname for the type now!
5842 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5844 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5847 * src/frontends/Dialogs.h: removed hideCitation signal
5849 * src/insets/insetcite.h: added hide signal
5851 * src/insets/insetcite.C (~InsetCitation): emits new signal
5852 (getScreenLabel): "intelligent" label should now fit on the screen!
5854 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5856 * src/frontends/xforms/FormCitation.C (showInset): connects
5857 hide() to the inset's hide signal
5858 (show): modified to use fl_set_object_position rather than
5859 fl_set_object_geometry wherever possible
5861 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5863 * src/insets/lyxinset.h: add caption code
5865 * src/insets/insetfloat.C (type): new method
5867 * src/insets/insetcaption.C (Write): new method
5869 (LyxCode): new method
5871 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5872 to get it right together with using the FloatList.
5874 * src/commandtags.h: add LFUN_INSET_CAPTION
5875 * src/lyxfunc.C (Dispatch): handle it
5877 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5880 * src/Variables.[Ch]: make expand take a const reference, remove
5881 the destructor, some whitespace changes.
5883 * src/LyXAction.C (init): add caption-inset-insert
5885 * src/FloatList.C (FloatList): update the default floats a bit.
5887 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5889 * src/Variables.[Ch]: new files. Intended to be used for language
5890 specific strings (like \chaptername) and filename substitution in
5893 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5895 * lib/kbd/american.kmap: update
5897 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5899 * src/bufferparams.[Ch]: remove member allowAccents.
5901 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5903 * src/LaTeXLog.C: use the log_form.h header.
5904 * src/lyx_gui.C: ditto.
5905 * src/lyx_gui_misc.C: ditto.
5906 * src/lyxvc.h: ditto.
5908 * forms/log_form.fd: new file, created from latexoptions.fd. I
5909 kept the log popup and nuked the options form.
5911 * src/{la,}texoptions.[Ch]: removed.
5912 * src/lyx_cb.C (LaTeXOptions): ditto
5914 * src/lyx_gui.C (create_forms): do not handle the
5915 fd_latex_options form.
5917 2000-07-18 Juergen Vigna <jug@sad.it>
5919 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5920 name of the inset so that it can be requested outside (text2.C).
5922 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5925 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5927 * src/mathed/formula.h (ConvertFont): constify
5929 * src/mathed/formula.C (Read): add warning if \end_inset is not
5930 found on expected place.
5932 * src/insets/lyxinset.h (ConvertFont): consify
5934 * src/insets/insetquotes.C (ConvertFont): constify
5935 * src/insets/insetquotes.h: ditto
5937 * src/insets/insetinfo.h: add labelfont
5939 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5940 (ascent): use labelfont
5944 (Write): make .lyx file a bit nicer
5946 * src/insets/insetfloat.C (Write): simplify somewhat...
5947 (Read): add warning if arg is not found
5949 * src/insets/insetcollapsable.C: add using std::max
5950 (Read): move string token and add warning in arg is not found
5951 (draw): use std::max to get the right ty
5952 (getMaxWidth): simplify by using std::max
5954 * src/insets/insetsection.h: new file
5955 * src/insets/insetsection.C: new file
5956 * src/insets/insetcaption.h: new file
5957 * src/insets/insetcaption.C: new file
5959 * src/insets/inset.C (ConvertFont): constify signature
5961 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5962 insetcaption.[Ch] and insetsection.[Ch]
5964 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5965 uses to use LABEL_COUNTER_CHAPTER instead.
5966 * src/text2.C (SetCounter): here
5968 * src/counters.h: new file
5969 * src/counters.C: new file
5970 * src/Sectioning.h: new file
5971 * src/Sectioning.C: new file
5973 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5975 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5977 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5980 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5983 2000-07-17 Juergen Vigna <jug@sad.it>
5985 * src/tabular.C (Validate): check if array-package is needed.
5986 (SetVAlignment): added support for vertical alignment.
5987 (SetLTFoot): better support for longtable header/footers
5988 (Latex): modified to support added features.
5990 * src/LaTeXFeatures.[Ch]: added array-package.
5992 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5994 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5997 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5999 * configure.in: do not forget to put a space after -isystem.
6001 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6003 * lib/kbd/arabic.kmap: a few fixes.
6005 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6007 * some whitespace chagnes to a number of files.
6009 * src/support/DebugStream.h: change to make it easier for
6010 doc++ to parse correctly.
6011 * src/support/lyxstring.h: ditto
6013 * src/mathed/math_utils.C (compara): change to have only one
6015 (MathedLookupBOP): change because of the above.
6017 * src/mathed/math_delim.C (math_deco_compare): change to have only
6019 (search_deco): change becasue of the above.
6021 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6022 instead of manually coded one.
6024 * src/insets/insetquotes.C (Read): read the \end_inset too
6026 * src/insets/insetlatex.h: remove file
6027 * src/insets/insetlatex.C: remove file
6029 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6031 (InsetPrintIndex): remove destructor
6033 * src/insets/insetinclude.h: remove default constructor
6035 * src/insets/insetfloat.C: work to make it work better
6037 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6039 * src/insets/insetcite.h (InsetCitation): remove default constructor
6041 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6043 * src/text.C (GetColumnNearX): comment out some currently unused code.
6045 * src/paragraph.C (writeFile): move some initializations closer to
6047 (CutIntoMinibuffer): small change to use new matchIT operator
6051 (InsertInset): ditto
6054 (InsetIterator): ditto
6055 (Erase): small change to use new matchFT operator
6057 (GetFontSettings): ditto
6058 (HighestFontInRange): ditto
6061 * src/lyxparagraph.h: some chars changed to value_type
6062 (matchIT): because of some stronger checking (perhaps too strong)
6063 in SGI STL, the two operator() unified to one.
6066 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6068 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6069 the last inset read added
6070 (parseSingleLyXformat2Token): some more (future) compability code added
6071 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6072 (parseSingleLyXformat2Token): set last_inset_read
6073 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6074 (parseSingleLyXformat2Token): don't double intializw string next_token
6076 * src/TextCache.C (text_fits::operator()): add const's to the signature
6077 (has_buffer::operator()): ditto
6079 * src/Floating.h: add some comments on the class
6081 * src/FloatList.[Ch] (typeExist): new method
6084 * src/BackStack.h: added default constructor, wanted by Gcc.
6086 2000-07-14 Juergen Vigna <jug@sad.it>
6088 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6090 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6092 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6093 do a redraw when the window is resized!
6094 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6096 * src/insets/insettext.C (resizeLyXText): added function to correctly
6097 being able to resize the LyXWindow.
6099 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6101 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6103 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6104 crashes when closing dialog to a deleted inset.
6106 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6107 method! Now similar to other insets.
6109 2000-07-13 Juergen Vigna <jug@sad.it>
6111 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6113 * lib/examples/Literate.lyx: small patch!
6115 * src/insets/insetbib.C (Read): added this function because of wrong
6116 Write (without [begin|end]_inset).
6118 2000-07-11 Juergen Vigna <jug@sad.it>
6120 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6121 as the insertInset could not be good!
6123 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6124 the bool param should not be last.
6126 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6128 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6129 did submit that to Karl).
6131 * configure.in: use -isystem instead of -I for X headers. This
6132 fixes a problem on solaris with a recent gcc;
6133 put the front-end code after the X detection code;
6134 configure in sigc++ before lib/
6136 * src/lyx_main.C (commandLineHelp): remove -display from command
6139 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6141 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6142 Also put in Makefile rules for building the ``listerrors''
6143 program for parsing errors from literate programs written in LyX.
6145 * lib/build-listerrors: Added small shell script as part of compile
6146 process. This builds a working ``listerrors'' binary if noweb is
6147 installed and either 1) the VNC X server is installed on the machine,
6148 or 2) the user is compiling from within a GUI. The existence of a GUI
6149 is necessary to use the ``lyx --export'' feature for now. This
6150 hack can be removed once ``lyx --export'' no longer requires a GUI to
6153 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6155 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6156 now passed back correctly from gcc and placed "under" error
6157 buttons in a Literate LyX source.
6159 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6161 * src/text.C (GetColumnNearX): Better behavior when a RTL
6162 paragraph is ended by LTR text.
6164 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6167 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6169 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6170 true when clipboard is empty.
6172 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6174 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6175 row of the paragraph.
6176 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6177 to prevent calculation of bidi tables
6179 2000-07-07 Juergen Vigna <jug@sad.it>
6181 * src/screen.C (ToggleSelection): added y_offset and x_offset
6184 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6187 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6189 * src/insets/insettext.C: fixed Layout-Display!
6191 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6193 * configure.in: add check for strings.h header.
6195 * src/spellchecker.C: include <strings.h> in order to have a
6196 definition for bzero().
6198 2000-07-07 Juergen Vigna <jug@sad.it>
6200 * src/insets/insettext.C (draw): set the status of the bv->text to
6201 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6203 * src/screen.C (DrawOneRow):
6204 (DrawFromTo): redraw the actual row if something has changed in it
6207 * src/text.C (draw): call an update of the toplevel-inset if something
6208 has changed inside while drawing.
6210 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6212 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6214 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6215 processing inside class.
6217 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6218 processing inside class.
6220 * src/insets/insetindex.h new struct Holder, consistent with other
6223 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6224 citation dialog from main code and placed it in src/frontends/xforms.
6225 Dialog launched through signals instead of callbacks
6227 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6229 * lyx.man: update the options description.
6231 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6233 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6234 handle neg values, set min width to 590, add doc about -display
6236 2000-07-05 Juergen Vigna <jug@sad.it>
6238 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6239 calls to BufferView *.
6241 * src/insets/insettext.C (checkAndActivateInset): small fix non
6242 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6244 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6245 their \end_inset token!
6247 2000-07-04 edscott <edscott@imp.mx>
6249 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6250 lib/lyxrc.example: added option \wheel_jump
6252 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6254 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6255 remove support for -width,-height,-xpos and -ypos.
6257 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6259 * src/encoding.[Ch]: New files.
6261 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6262 (text): Call to the underline() method only when needed.
6264 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6266 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6267 encoding(s) for the document.
6269 * src/bufferparams.C (BufferParams): Changed default value of
6272 * src/language.C (newLang): Removed.
6273 (items[]): Added encoding information for all defined languages.
6275 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6276 encoding choice button.
6278 * src/lyxrc.h (font_norm_type): New member variable.
6279 (set_font_norm_type): New method.
6281 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6282 paragraphs with different encodings.
6284 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6285 (TransformChar): Changed to work correctly with Arabic points.
6286 (draw): Added support for drawing Arabic points.
6287 (draw): Removed code for drawing underbars (this is done by
6290 * src/support/textutils.h (IsPrintableNonspace): New function.
6292 * src/BufferView_pimpl.h: Added "using SigC::Object".
6293 * src/LyXView.h: ditto.
6295 * src/insets/insetinclude.h (include_label): Changed to mutable.
6297 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6299 * src/mathed/math_iter.h: remove empty destructor
6301 * src/mathed/math_cursor.h: remove empty destructor
6303 * src/insets/lyxinset.h: add THEOREM_CODE
6305 * src/insets/insettheorem.[Ch]: new files
6307 * src/insets/insetminipage.C: (InsertInset): remove
6309 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6311 (InsertInset): remove
6313 * src/insets/insetlist.C: (InsertList): remove
6315 * src/insets/insetfootlike.[Ch]: new files
6317 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6320 (InsertInset): ditto
6322 * src/insets/insetert.C: remove include Painter.h, reindent
6323 (InsertInset): move to header
6325 * src/insets/insetcollapsable.h: remove explicit from default
6326 contructor, remove empty destructor, add InsertInset
6328 * src/insets/insetcollapsable.C (InsertInset): new func
6330 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6332 * src/vspace.h: add explicit to constructor
6334 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6335 \textcompwordmark, please test this.
6337 * src/lyxrc.C: set ascii_linelen to 65 by default
6339 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6341 * src/commandtags.h: add LFUN_INSET_THEOREM
6343 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6344 (makeLinuxDocFile): remove _some_ of the nice logic
6345 (makeDocBookFile): ditto
6347 * src/Painter.[Ch]: (~Painter): removed
6349 * src/LyXAction.C (init): entry for insettheorem added
6351 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6353 (deplog): code to detect files generated by LaTeX, needs testing
6356 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6358 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6360 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6362 * src/LaTeX.C (deplog): Add a check for files that are going to be
6363 created by the first latex run, part of the project to remove the
6366 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6367 contents to the extension list.
6369 2000-07-04 Juergen Vigna <jug@sad.it>
6371 * src/text.C (NextBreakPoint): added support for needFullRow()
6373 * src/insets/lyxinset.h: added needFullRow()
6375 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6378 * src/insets/insettext.C: lots of changes for update!
6380 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6382 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6384 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6386 * src/insets/insetinclude.C (InsetInclude): fixed
6387 initialization of include_label.
6388 (unique_id): now returns a string.
6390 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6392 * src/LaTeXFeatures.h: new member IncludedFiles, for
6393 a map of key, included file name.
6395 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6396 with the included files for inclusion in SGML preamble,
6397 i. e., linuxdoc and docbook.
6400 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6401 nice (is the generated linuxdoc code to be exported?), that
6402 allows to remove column, and only_body that will be true for
6403 slave documents. Insets are allowed inside SGML font type.
6404 New handling of the SGML preamble for included files.
6405 (makeDocBookFile): the same for docbook.
6407 * src/insets/insetinclude.h:
6408 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6410 (DocBook): new export methods.
6412 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6413 and makeDocBookFile.
6415 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6416 formats to export with command line argument -x.
6418 2000-06-29 Juergen Vigna <jug@sad.it>
6420 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6421 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6423 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6424 region could already been cleared by an inset!
6426 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6428 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6431 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6433 (cursorToggle): remove special handling of lyx focus.
6435 2000-06-28 Juergen Vigna <jug@sad.it>
6437 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6440 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6442 * src/insets/insetindex.C (Edit): add a callback when popup is
6445 * src/insets/insettext.C (LocalDispatch):
6446 * src/insets/insetmarginal.h:
6447 * src/insets/insetlist.h:
6448 * src/insets/insetfoot.h:
6449 * src/insets/insetfloat.h:
6450 * src/insets/insetert.h: add a missing std:: qualifier.
6452 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6454 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6457 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6459 * src/insets/insettext.C (Read): remove tmptok unused variable
6460 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6461 (InsertInset): change for new InsetInset code
6463 * src/insets/insettext.h: add TEXT inline method
6465 * src/insets/insettext.C: remove TEXT macro
6467 * src/insets/insetmarginal.C (Write): new method
6468 (Latex): change output slightly
6470 * src/insets/insetfoot.C (Write): new method
6471 (Latex): change output slightly (don't use endl when no need)
6473 * src/insets/insetert.C (Write): new method
6475 * src/insets/insetcollapsable.h: make button_length, button_top_y
6476 and button_bottm_y protected.
6478 * src/insets/insetcollapsable.C (Write): simplify code by using
6479 tostr. Also do not output the float name, the children class
6480 should to that to get control over own arguments
6482 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6483 src/insets/insetminipage.[Ch]:
6486 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6488 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6490 * src/Makefile.am (lyx_SOURCES): add the new files
6492 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6493 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6494 * src/commandtags.h: ditto
6496 * src/LaTeXFeatures.h: add a std::set of used floattypes
6498 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6500 * src/FloatList.[Ch] src/Floating.h: new files
6502 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6504 * src/lyx_cb.C (TableApplyCB): ditto
6506 * src/text2.C: ditto
6507 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6508 (parseSingleLyXformat2Token): ditto + add code for
6509 backwards compability for old float styles + add code for new insets
6511 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6513 (InsertInset(size_type, Inset *, LyXFont)): new method
6514 (InsetChar(size_type, char)): changed to use the other InsetChar
6515 with a LyXFont(ALL_INHERIT).
6516 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6517 insert the META_INSET.
6519 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6521 * sigc++/thread.h (Threads): from here
6523 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6524 definition out of line
6525 * sigc++/scope.h: from here
6527 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6529 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6530 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6532 * Makefile.am (bindist): new target.
6534 * INSTALL: add instructions for doing a binary distribution.
6536 * development/tools/README.bin.example: update a bit.
6538 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6541 * lib/lyxrc.example: new lyxrc tag \set_color.
6543 * src/lyxfunc.C (Dispatch):
6544 * src/commandtags.h:
6545 * src/LyXAction.C: new lyxfunc "set-color".
6547 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6548 and an x11name given as strings.
6550 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6551 cache when a color is changed.
6553 2000-06-26 Juergen Vigna <jug@sad.it>
6555 * src/lyxrow.C (width): added this functions and variable.
6557 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6560 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6562 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * images/undo_bw.xpm: new icon.
6565 * images/redo_bw.xpm: ditto.
6567 * configure.in (INSTALL_SCRIPT): change value to
6568 ${INSTALL} to avoid failures of install-script target.
6569 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6571 * src/BufferView.h: add a magic "friend" declaration to please
6574 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6576 * forms/cite.fd: modified to allow resizing without messing
6579 * src/insetcite.C: Uses code from cite.fd almost without
6581 User can now resize dialog in the x-direction.
6582 Resizing the dialog in the y-direction is prevented, as the
6583 code does this intelligently already.
6585 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6587 * INSTALL: remove obsolete entry in "problems" section.
6589 * lib/examples/sl_*.lyx: update of the slovenian examples.
6591 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6593 2000-06-23 Juergen Vigna <jug@sad.it>
6595 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6597 * src/buffer.C (resize): delete the LyXText of textinsets.
6599 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6601 * src/insets/lyxinset.h: added another parameter 'cleared' to
6602 the draw() function.
6604 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6605 unlocking inset in inset.
6607 2000-06-22 Juergen Vigna <jug@sad.it>
6609 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6610 of insets and moved first to LyXText.
6612 * src/mathed/formulamacro.[Ch]:
6613 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6615 2000-06-21 Juergen Vigna <jug@sad.it>
6617 * src/text.C (GetVisibleRow): look if I should clear the area or not
6618 using Inset::doClearArea() function.
6620 * src/insets/lyxinset.h: added doClearArea() function and
6621 modified draw(Painter &, ...) to draw(BufferView *, ...)
6623 * src/text2.C (UpdateInset): return bool insted of int
6625 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6627 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6628 combox in the character popup
6630 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6631 BufferParams const & params
6633 2000-06-20 Juergen Vigna <jug@sad.it>
6635 * src/insets/insettext.C (SetParagraphData): set insetowner on
6638 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6640 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6641 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6643 (form_main_): remove
6645 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6646 (create_form_form_main): remove FD_form_main stuff, connect to
6647 autosave_timeout signal
6649 * src/LyXView.[Ch] (getMainForm): remove
6650 (UpdateTimerCB): remove
6651 * src/BufferView_pimpl.h: inherit from SigC::Object
6653 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6654 signal instead of callback
6656 * src/BufferView.[Ch] (cursorToggleCB): remove
6658 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6660 * src/BufferView_pimpl.C: changes because of the one below
6662 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6663 instead of storing a pointer to a LyXText.
6665 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6667 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6669 * src/lyxparagraph.h
6671 * src/paragraph.C: Changed fontlist to a sorted vector.
6673 2000-06-19 Juergen Vigna <jug@sad.it>
6675 * src/BufferView.h: added screen() function.
6677 * src/insets/insettext.C (LocalDispatch): some selection code
6680 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6682 * src/insets/insettext.C (SetParagraphData):
6684 (InsetText): fixes for multiple paragraphs.
6686 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6688 * development/lyx.spec.in: Call configure with ``--without-warnings''
6689 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6690 This should be fine, however, since we generally don't want to be
6691 verbose when making an RPM.
6693 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6695 * lib/scripts/fig2pstex.py: New file
6697 2000-06-16 Juergen Vigna <jug@sad.it>
6699 * src/insets/insettabular.C (UpdateLocal):
6700 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6701 (LocalDispatch): Changed all functions to use LyXText.
6703 2000-06-15 Juergen Vigna <jug@sad.it>
6705 * src/text.C (SetHeightOfRow): call inset::update before requesting
6708 * src/insets/insettext.C (update):
6709 * src/insets/insettabular.C (update): added implementation
6711 * src/insets/lyxinset.h: added update function
6713 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6715 * src/text.C (SelectNextWord): protect against null pointers with
6716 old-style string streams. (fix from Paul Theo Gonciari
6719 * src/cite.[Ch]: remove erroneous files.
6721 * lib/configure.m4: update the list of created directories.
6723 * src/lyxrow.C: include <config.h>
6724 * src/lyxcursor.C: ditto.
6726 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6728 * lib/examples/decimal.lyx: new example file from Mike.
6730 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6731 to find template definitions (from Dekel)
6733 * src/frontends/.cvsignore: add a few things.
6735 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6737 * src/Timeout.C (TimeOut): remove default argument.
6739 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6742 * src/insets/ExternalTemplate.C: add a "using" directive.
6744 * src/lyx_main.h: remove the act_ struct, which seems unused
6747 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * LyX Developers Meeting: All files changed, due to random C++ (by
6750 coincidence) code generator script.
6752 - external inset (cool!)
6753 - initial online editing of preferences
6754 - insettabular breaks insettext(s contents)
6756 - some DocBook fixes
6757 - example files update
6758 - other cool stuff, create a diff and look for yourself.
6760 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6762 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6763 -1 this is a non-line-breaking textinset.
6765 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6766 if there is no width set.
6768 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6770 * Lots of files: Merged the dialogbase branch.
6772 2000-06-09 Allan Rae <rae@lyx.org>
6774 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6775 and the Dispatch methods that used it.
6777 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6778 access to functions formerly kept in Dispatch.
6780 2000-05-19 Allan Rae <rae@lyx.org>
6782 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6783 made to_page and count_copies integers again. from_page remains a
6784 string however because I want to allow entry of a print range like
6785 "1,4,22-25" using this field.
6787 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6788 and printer-params-get. These aren't useful from the minibuffer but
6789 could be used by a script/LyXServer app provided it passes a suitable
6790 auto_mem_buffer. I guess I should take a look at how the LyXServer
6791 works and make it support xtl buffers.
6793 * sigc++/: updated to libsigc++-1.0.1
6795 * src/xtl/: updated to xtl-1.3.pl.11
6797 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6798 those changes done to the files in src/ are actually recreated when
6799 they get regenerated. Please don't ever accept a patch that changes a
6800 dialog unless that patch includes the changes to the corresponding *.fd
6803 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6804 stringOnlyContains, renamed it and generalised it.
6806 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6807 branch. Removed the remaining old form_print code.
6809 2000-04-26 Allan Rae <rae@lyx.org>
6811 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6812 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6814 2000-04-25 Allan Rae <rae@lyx.org>
6816 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6817 against a base of xtl-1.3.pl.4
6819 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6820 filter the Id: entries so they still show the xtl version number
6823 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6824 into the src/xtl code. Patch still pending with José (XTL)
6826 2000-04-24 Allan Rae <rae@lyx.org>
6828 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6829 both more generic and much safer. Use the new template functions.
6830 * src/buffer.[Ch] (Dispatch): ditto.
6832 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6833 and mem buffer more intelligently. Also a little general cleanup.
6836 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6837 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6838 * src/xtl/Makefile.am: ditto.
6839 * src/xtl/.cvsignore: ditto.
6840 * src/Makefile.am: ditto.
6842 * src/PrinterParams.h: Removed the macros member functions. Added a
6843 testInvariant member function. A bit of tidying up and commenting.
6844 Included Angus's idea for fixing operation with egcs-1.1.2.
6846 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6847 cool expansion of XTL's mem_buffer to support automatic memory
6848 management within the buffer itself. Removed the various macros and
6849 replaced them with template functions that use either auto_mem_buffer
6850 or mem_buffer depending on a #define. The mem_buffer support will
6851 disappear as soon as the auto_mem_buffer is confirmed to be good on
6852 other platforms/compilers. That is, it's there so you've got something
6855 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6856 effectively forked XTL. However I expect José will include my code
6857 into the next major release. Also fixed a memory leak.
6858 * src/xtl/text.h: ditto.
6859 * src/xtl/xdr.h: ditto.
6860 * src/xtl/giop.h: ditto.
6862 2000-04-16 Allan Rae <rae@lyx.org>
6864 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6865 by autogen.sh and removed by maintainer-clean anyway.
6866 * .cvsignore, sigc++/.cvsignore: Support the above.
6868 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6870 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6872 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6873 macros, renamed static callback-target member functions to suit new
6874 scheme and made them public.
6875 * src/frontends/xforms/forms/form_print.fd: ditto.
6876 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6878 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6881 * src/xtl/: New directory containing a minimal distribution of XTL.
6882 This is XTL-1.3.pl.4.
6884 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6886 2000-04-15 Allan Rae <rae@lyx.org>
6888 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6890 * sigc++/: Updated to libsigc++-1.0.0
6892 2000-04-14 Allan Rae <rae@lyx.org>
6894 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6895 use the generic ones in future. I'll modify my conversion script.
6897 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6899 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6900 (CloseAllBufferRelatedDialogs): Renamed.
6901 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6903 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6904 of the generic ones. These are the same ones my conversion script
6907 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6908 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6909 * src/buffer.C (Dispatch): ditto
6911 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6912 functions for updating and hiding buffer dependent dialogs.
6913 * src/BufferView.C (buffer): ditto
6914 * src/buffer.C (setReadonly): ditto
6915 * src/lyxfunc.C (CloseBuffer): ditto
6917 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6918 Dialogs.h, and hence all the SigC stuff, into every file that includes
6919 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6921 * src/BufferView2.C: reduce the number of headers included by buffer.h
6923 2000-04-11 Allan Rae <rae@lyx.org>
6925 * src/frontends/xforms/xform_macros.h: A small collection of macros
6926 for building C callbacks.
6928 * src/frontends/xforms/Makefile.am: Added above file.
6930 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6931 scheme again. This time it should work for JMarc. If this is
6932 successful I'll revise my conversion script to automate some of this.
6933 The static member functions in the class also have to be public for
6934 this scheme will work. If the scheme works (it's almost identical to
6935 the way BufferView::cursorToggleCB is handled so it should work) then
6936 FormCopyright and FormPrint will be ready for inclusion into the main
6937 trunk immediately after 1.1.5 is released -- provided we're prepared
6938 for complaints about lame compilers not handling XTL.
6940 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6942 2000-04-07 Allan Rae <rae@lyx.org>
6944 * config/lyxinclude.m4: A bit more tidying up (Angus)
6946 * src/LString.h: JMarc's <string> header fix
6948 * src/PrinterParams.h: Used string for most data to remove some
6949 ugly code in the Print dialog and avoid even uglier code when
6950 appending the ints to a string for output.
6952 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6953 and moved "default:" back to the end of switch statement. Cleaned
6954 up the printing so it uses the right function calls and so the
6955 "print to file" option actually puts the file in the right directory.
6957 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6959 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6960 and Ok+Apply button control into a separate method: input (Angus).
6961 (input) Cleaned it up and improved it to be very thorough now.
6962 (All CB) static_cast used instead of C style cast (Angus). This will
6963 probably change again once we've worked out how to keep gcc-2.8.1 happy
6964 with real C callbacks.
6965 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6966 ignore some of the bool settings and has random numbers instead. Needs
6967 some more investigation. Added other input length checks and checking
6968 of file and printer names.
6970 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6971 would link (Angus). Seems the old code doesn't compile with the pragma
6972 statement either. Separated callback entries from internal methods.
6974 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6976 2000-03-17 Allan Rae <rae@lyx.org>
6978 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6979 need it? Maybe it could go in Dialogs instead? I could make it a
6980 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6981 values to get the bool return value.
6982 (Dispatch): New overloaded method for xtl support.
6984 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6985 extern "C" callback instead of static member functions. Hopefully,
6986 JMarc will be able to compile this. I haven't changed
6987 forms/form_copyright.fd yet. Breaking one of my own rules already.
6989 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6990 because they aren't useful from the minibuffer. Maybe a LyXServer
6991 might want a help message though?
6993 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6995 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6996 xtl which needs both rtti and exceptions.
6998 * src/support/Makefile.am:
6999 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7001 * src/frontends/xforms/input_validators.[ch]: input filters and
7002 validators. These conrol what keys are valid in input boxes.
7003 Use them and write some more. Much better idea than waiting till
7004 after the user has pressed Ok to say that the input fields don't make
7007 * src/frontends/xforms/Makefile.am:
7008 * src/frontends/xforms/forms/form_print.fd:
7009 * src/frontends/xforms/forms/makefile:
7010 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7011 new scheme. Still have to make sure I haven't missed anything from
7012 the current implementation.
7014 * src/Makefile.am, src/PrinterParams.h: New data store.
7016 * other files: Added a couple of copyright notices.
7018 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7020 * src/insets/insetbib.h: move Holder struct in public space.
7022 * src/frontends/include/DialogBase.h: use SigC:: only when
7023 SIGC_CXX_NAMESPACES is defined.
7024 * src/frontends/include/Dialogs.h: ditto.
7026 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7028 * src/frontends/xforms/FormCopyright.[Ch]: do not
7029 mention SigC:: explicitely.
7031 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7033 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7034 deals with testing KDE in main configure.in
7035 * configure.in: ditto.
7037 2000-02-22 Allan Rae <rae@lyx.org>
7039 * Lots of files: Merged from HEAD
7041 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7042 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7044 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7046 * sigc++/: new minidist.
7048 2000-02-14 Allan Rae <rae@lyx.org>
7050 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7052 2000-02-08 Juergen Vigna <jug@sad.it>
7054 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7055 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7057 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7058 for this port and so it is much easier for other people to port
7059 dialogs in a common development environment.
7061 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7062 the QT/KDE implementation.
7064 * src/frontends/kde/Dialogs.C:
7065 * src/frontends/kde/FormCopyright.C:
7066 * src/frontends/kde/FormCopyright.h:
7067 * src/frontends/kde/Makefile.am:
7068 * src/frontends/kde/formcopyrightdialog.C:
7069 * src/frontends/kde/formcopyrightdialog.h:
7070 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7071 for the kde support of the Copyright-Dialog.
7073 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7074 subdir-substitution instead of hardcoded 'xforms' as we now have also
7077 * src/frontends/include/DialogBase.h (Object): just commented the
7078 label after #endif (nasty warning and I don't like warnings ;)
7080 * src/main.C (main): added KApplication initialization if using
7083 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7084 For now only the KDE event-loop is added if frontend==kde.
7086 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7088 * configure.in: added support for the --with-frontend[=value] option
7090 * autogen.sh: added kde.m4 file to list of config-files
7092 * acconfig.h: added define for KDEGUI-support
7094 * config/kde.m4: added configuration functions for KDE-port
7096 * config/lyxinclude.m4: added --with-frontend[=value] option with
7097 support for xforms and KDE.
7099 2000-02-08 Allan Rae <rae@lyx.org>
7101 * all Makefile.am: Fixed up so the make targets dist, distclean,
7102 install and uninstall all work even if builddir != srcdir. Still
7103 have a new sigc++ minidist update to come.
7105 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7107 2000-02-01 Allan Rae <rae@lyx.org>
7109 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7110 Many mods to get builddir != srcdir working.
7112 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7113 for building on NT and so we can do the builddir != srcdir stuff.
7115 2000-01-30 Allan Rae <rae@lyx.org>
7117 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7118 This will stay in "rae" branch. We probably don't really need it in
7119 the main trunk as anyone who wants to help programming it should get
7120 a full library installed also. So they can check both included and
7121 system supplied library compilation.
7123 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7124 Added a 'mini' distribution of libsigc++. If you feel the urge to
7125 change something in these directories - Resist it. If you can't
7126 resist the urge then you should modify the following script and rebuild
7127 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7128 all happen. Still uses a hacked version of libsigc++'s configure.in.
7129 I'm quite happy with the results. I'm not sure the extra work to turn
7130 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7131 worth the trouble and would probably lead to extra maintenance
7133 I haven't tested the following important make targets: install, dist.
7134 Not ready for prime time but very close. Maybe 1.1.5.
7136 * development/tools/makeLyXsigc.sh: A shell script to automatically
7137 generate our mini-dist of libsigc++. It can only be used with a CVS
7138 checkout of libsigc++ not a tarball distribution. It's well commented.
7139 This will end up as part of the libsigc++ distribution so other apps
7140 can easily have an included mini-dist. If someone makes mods to the
7141 sigc++ subpackage without modifying this script to generate those
7142 changes I'll be very upset!
7144 * src/frontends/: Started the gui/system indep structure.
7146 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7147 to access the gui-indep dialogs are in this class. Much improved
7148 design compared to previous revision. Lars, please refrain from
7149 moving this header into src/ like you did with Popups.h last time.
7151 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7153 * src/frontends/xforms/: Started the gui-indep system with a single
7154 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7157 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7158 Here you'll find a very useful makefile and automated fdfix.sh that
7159 makes updating dailogs a no-brainer -- provided you follow the rules
7160 set out in the README. I'm thinking about adding another script to
7161 automatically generate skeleton code for a new dialog given just the
7164 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7165 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7166 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7168 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7170 * src/support/LSubstring.C (operator): simplify
7172 * src/lyxtext.h: removed bparams, use buffer_->params instead
7174 * src/lyxrow.h: make Row a real class, move all variables to
7175 private and use accessors.
7177 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7179 (isRightToLeftPar): ditto
7180 (ChangeLanguage): ditto
7181 (isMultiLingual): ditto
7184 (SimpleTeXOnePar): ditto
7185 (TeXEnvironment): ditto
7186 (GetEndLabel): ditto
7188 (SetOnlyLayout): ditto
7189 (BreakParagraph): ditto
7190 (BreakParagraphConservative): ditto
7191 (GetFontSettings): ditto
7193 (CopyIntoMinibuffer): ditto
7194 (CutIntoMinibuffer): ditto
7195 (PasteParagraph): ditto
7196 (SetPExtraType): ditto
7197 (UnsetPExtraType): ditto
7198 (DocBookContTableRows): ditto
7199 (SimpleDocBookOneTablePar): ditto
7201 (TeXFootnote): ditto
7202 (SimpleTeXOneTablePar): ditto
7203 (TeXContTableRows): ditto
7204 (SimpleTeXSpecialChars): ditto
7207 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7208 to private and use accessors.
7210 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7211 this, we did not use it anymore and has not been for ages. Just a
7212 waste of cpu cycles.
7214 * src/language.h: make Language a real class, move all variables
7215 to private and use accessors.
7217 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7218 (create_view): remove
7219 (update): some changes for new timer
7220 (cursorToggle): use new timer
7221 (beforeChange): change for new timer
7223 * src/BufferView.h (cursorToggleCB): removed last paramter because
7226 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7227 (cursorToggleCB): change because of new timer code
7229 * lib/CREDITS: updated own mailaddress
7231 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7233 * src/support/filetools.C (PutEnv): fix the code in case neither
7234 putenv() nor setenv() have been found.
7236 * INSTALL: mention the install-strip Makefile target.
7238 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7239 read-only documents.
7241 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * lib/reLyX/configure.in (VERSION): avoid using a previously
7244 generated reLyX wrapper to find out $prefix.
7246 * lib/examples/eu_adibide_lyx-atua.lyx:
7247 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7248 translation of the Tutorial (Dooteo)
7250 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7252 * forms/cite.fd: new citation dialog
7254 * src/insetcite.[Ch]: the new citation dialog is moved into
7257 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7260 * src/insets/insetcommand.h: data members made private.
7262 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7264 * LyX 1.1.5 released
7266 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7268 * src/version.h (LYX_RELEASE): to 1.1.5
7270 * src/spellchecker.C (RunSpellChecker): return false if the
7271 spellchecker dies upon creation.
7273 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7275 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7276 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7280 * lib/CREDITS: update entry for Martin Vermeer.
7282 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7284 * src/text.C (draw): Draw foreign language bars at the bottom of
7285 the row instead of at the baseline.
7287 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7289 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7291 * lib/bind/de_menus.bind: updated
7293 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7295 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7297 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7299 * src/menus.C (Limit_string_length): New function
7300 (ShowTocMenu): Limit the number of items/length of items in the
7303 * src/paragraph.C (String): Correct result for a paragraph inside
7306 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/bufferlist.C (close): test of buf->getuser() == NULL
7310 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7312 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7313 Do not call to SetCursor when the paragraph is a closed footnote!
7315 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7317 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7320 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7322 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7325 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7326 reference popup, that activates the reference-back action
7328 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7330 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7331 the menus. Also fixed a bug.
7333 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7334 the math panels when switching buffers (unless new buffer is readonly).
7336 * src/BufferView.C (NoSavedPositions)
7337 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7339 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7341 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7342 less of dvi dirty or not.
7344 * src/trans_mgr.[Ch] (insert): change first parameter to string
7347 * src/chset.[Ch] (encodeString): add const to first parameter
7349 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7351 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7355 * src/LaTeX.C (deplog): better searching for dependency files in
7356 the latex log. Uses now regexps.
7358 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7359 instead of the box hack or \hfill.
7361 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7363 * src/lyxfunc.C (doImportHelper): do not create the file before
7364 doing the actual import.
7365 (doImportASCIIasLines): create a new file before doing the insert.
7366 (doImportASCIIasParagraphs): ditto.
7368 * lib/lyxrc.example: remove mention of non-existing commands
7370 * lyx.man: remove mention of color-related switches.
7372 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7374 * src/lyx_gui.C: remove all the color-related ressources, which
7375 are not used anymore.
7377 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7380 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7382 * src/lyxrc.C (read): Add a missing break in the switch
7384 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7386 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7388 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7391 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7393 * src/text.C (draw): draw bars under foreign language words.
7395 * src/LColor.[Ch]: add LColor::language
7397 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7399 * src/lyxcursor.h (boundary): New member variable
7401 * src/text.C (IsBoundary): New methods
7403 * src/text.C: Use the above for currect cursor movement when there
7404 is both RTL & LTR text.
7406 * src/text2.C: ditto
7408 * src/bufferview_funcs.C (ToggleAndShow): ditto
7410 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7412 * src/text.C (DeleteLineForward): set selection to true to avoid
7413 that DeleteEmptyParagraphMechanism does some magic. This is how it
7414 is done in all other functions, and seems reasonable.
7415 (DeleteWordForward): do not jump over non-word stuff, since
7416 CursorRightOneWord() already does it.
7418 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7419 DeleteWordBackward, since they seem safe to me (since selection is
7420 set to "true") DeleteEmptyParagraphMechanism does nothing.
7422 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7424 * src/lyx_main.C (easyParse): simplify the code by factoring the
7425 part that removes parameters from the command line.
7426 (LyX): check wether wrong command line options have been given.
7428 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7430 * src/lyx_main.C : add support for specifying user LyX
7431 directory via command line option -userdir.
7433 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7435 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7436 the number of items per popup.
7437 (Add_to_refs_menu): Ditto.
7439 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7441 * src/lyxparagraph.h: renamed ClearParagraph() to
7442 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7443 textclass as parameter, and do nothing if free_spacing is
7444 true. This fixes part of the line-delete-forward problems.
7446 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7447 (pasteSelection): ditto.
7448 (SwitchLayoutsBetweenClasses): more translatable strings.
7450 * src/text2.C (CutSelection): use StripLeadingSpaces.
7451 (PasteSelection): ditto.
7452 (DeleteEmptyParagraphMechanism): ditto.
7454 2000-05-26 Juergen Vigna <jug@sad.it>
7456 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7457 is not needed in tabular insets.
7459 * src/insets/insettabular.C (TabularFeatures): added missing features.
7461 * src/tabular.C (DeleteColumn):
7463 (AppendRow): implemented this functions
7464 (cellsturct::operator=): clone the inset too;
7466 2000-05-23 Juergen Vigna <jug@sad.it>
7468 * src/insets/insettabular.C (LocalDispatch): better selection support
7469 when having multicolumn-cells.
7471 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7473 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7475 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7477 * src/ColorHandler.C (getGCForeground): put more test into _()
7479 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7482 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7485 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7487 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7488 there are no labels, or when buffer is readonly.
7490 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7491 there are no labels, buffer is SGML, or when buffer is readonly.
7493 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7495 * src/LColor.C (LColor): change a couple of grey40 to grey60
7496 (LColor): rewore initalization to make compiles go some magnitude
7498 (getGUIName): don't use gettext until we need the string.
7500 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7502 * src/Bullet.[Ch]: Fixed a small bug.
7504 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7506 * src/paragraph.C (String): Several fixes/improvements
7508 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7510 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7512 * src/paragraph.C (String): give more correct output.
7514 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7516 * src/lyxfont.C (stateText) Do not output the language if it is
7517 eqaul to the language of the document.
7519 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7520 between two paragraphs with the same language.
7522 * src/paragraph.C (getParLanguage) Return a correct answer for an
7523 empty dummy paragraph.
7525 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7528 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7531 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7532 the menus/popup, if requested fonts are unavailable.
7534 2000-05-22 Juergen Vigna <jug@sad.it>
7536 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7537 movement support (Up/Down/Tab/Shift-Tab).
7538 (LocalDispatch): added also preliminari cursor-selection.
7540 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7542 * src/paragraph.C (PasteParagraph): Hopefully now right!
7544 2000-05-22 Garst R. Reese <reese@isn.net>
7546 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7547 of list, change all references to Environment to Command
7548 * tex/hollywood.cls : rewrite environments as commands, add
7549 \uppercase to interiorshot and exteriorshot to force uppecase.
7550 * tex/broadway.cls : rewrite environments as commands. Tweak
7553 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7555 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7556 size of items: use a constant intead of the hardcoded 40, and more
7557 importantly do not remove the %m and %x tags added at the end.
7558 (Add_to_refs_menu): use vector::size_type instead of
7559 unsigned int as basic types for the variables. _Please_ do not
7560 assume that size_t is equal to unsigned int. On an alpha, this is
7561 unsigned long, which is _not_ the same.
7563 * src/language.C (initL): remove language "hungarian", since it
7564 seems that "magyar" is better.
7566 2000-05-22 Juergen Vigna <jug@sad.it>
7568 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7570 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7573 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7574 next was deleted but not set to 0.
7576 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7578 * src/language.C (initL): change the initialization of languages
7579 so that compiles goes _fast_.
7581 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7584 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7586 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7590 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7592 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7594 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7598 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7601 * src/insets/insetlo*.[Ch]: Made editable
7603 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7605 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7606 the current selection.
7608 * src/BufferView_pimpl.C (stuffClipboard): new method
7610 * src/BufferView.C (stuffClipboard): new method
7612 * src/paragraph.C (String): new method
7614 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7615 LColor::ignore when lyxname is not found.
7617 * src/BufferView.C (pasteSelection): new method
7619 * src/BufferView_pimpl.C (pasteSelection): new method
7621 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7623 * src/WorkArea.C (request_clipboard_cb): new static function
7624 (getClipboard): new method
7625 (putClipboard): new method
7627 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7629 * LyX 1.1.5pre2 released
7631 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7633 * src/vspace.C (operator=): removed
7634 (operator=): removed
7636 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7638 * src/layout.C (NumberOfClass): manually set the type in make_pair
7639 (NumberOfLayout): ditto
7641 * src/language.C: use the Language constructor for ignore_lang
7643 * src/language.h: add constructors to struct Language
7645 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7647 * src/text2.C (SetCursorIntern): comment out #warning
7649 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7651 * src/mathed/math_iter.h: initialize sx and sw to 0
7653 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7655 * forms/lyx.fd: Redesign of form_ref
7657 * src/LaTeXFeatures.[Ch]
7661 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7664 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7665 and Buffer::inset_iterator.
7667 * src/menus.C: Added new menus: TOC and Refs.
7669 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7671 * src/buffer.C (getTocList): New method.
7673 * src/BufferView2.C (ChangeRefs): New method.
7675 * src/buffer.C (getLabelList): New method. It replaces the old
7676 getReferenceList. The return type is vector<string> instead of
7679 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7680 the old getLabel() and GetNumberOfLabels() methods.
7681 * src/insets/insetlabel.C (getLabelList): ditto
7682 * src/mathed/formula.C (getLabelList): ditto
7684 * src/paragraph.C (String): New method.
7686 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7687 Uses the new getTocList() method.
7688 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7689 which automatically updates the contents of the browser.
7690 (RefUpdateCB): Use the new getLabelList method.
7692 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7694 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7696 * src/spellchecker.C: Added using std::reverse;
7698 2000-05-19 Juergen Vigna <jug@sad.it>
7700 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7702 * src/insets/insettext.C (computeTextRows): small fix for display of
7703 1 character after a newline.
7705 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7708 2000-05-18 Juergen Vigna <jug@sad.it>
7710 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7711 when changing width of column.
7713 * src/tabular.C (set_row_column_number_info): setting of
7714 autobreak rows if necessary.
7716 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7718 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7720 * src/vc-backend.*: renamed stat() to status() and vcstat to
7721 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7722 compilation broke. The new name seems more relevant, anyway.
7724 2000-05-17 Juergen Vigna <jug@sad.it>
7726 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7727 which was wrong if the removing caused removing of rows!
7729 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7730 (pushToken): new function.
7732 * src/text2.C (CutSelection): fix problem discovered with purify
7734 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7736 * src/debug.C (showTags): enlarge the first column, now that we
7737 have 6-digits debug codes.
7739 * lib/layouts/hollywood.layout:
7740 * lib/tex/hollywood.cls:
7741 * lib/tex/brodway.cls:
7742 * lib/layouts/brodway.layout: more commands and fewer
7743 environments. Preambles moved in the .cls files. Broadway now has
7744 more options on scene numbering and less whitespace (from Garst)
7746 * src/insets/insetbib.C (getKeys): make sure that we are in the
7747 document directory, in case the bib file is there.
7749 * src/insets/insetbib.C (Latex): revert bogus change.
7751 2000-05-16 Juergen Vigna <jug@sad.it>
7753 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7754 the TabularLayout on cursor move.
7756 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7758 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7761 (draw): fixed cursor position and drawing so that the cursor is
7762 visible when before the tabular-inset.
7764 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7765 when creating from old insettext.
7767 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7769 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7771 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7772 * lib/tex/brodway.cls: ditto
7774 * lib/layouts/brodway.layout: change alignment of parenthical
7777 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7779 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7780 versions 0.88 and 0.89 are supported.
7782 2000-05-15 Juergen Vigna <jug@sad.it>
7784 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7787 * src/insets/insettext.C (computeTextRows): redone completely this
7788 function in a much cleaner way, because of problems when having a
7790 (draw): added a frame border when the inset is locked.
7791 (SetDrawLockedFrame): this sets if we draw the border or not.
7792 (SetFrameColor): this sets the frame color (default=insetframe).
7794 * src/insets/lyxinset.h: added x() and y() functions which return
7795 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7796 function which is needed to see if we have a locking inset of some
7797 type in this inset (needed for now in insettabular).
7799 * src/vspace.C (inPixels): the same function also without a BufferView
7800 parameter as so it is easier to use it in some ocasions.
7802 * src/lyxfunc.C: changed all places where insertInset was used so
7803 that now if it couldn't be inserted it is deleted!
7805 * src/TabularLayout.C:
7806 * src/TableLayout.C: added support for new tabular-inset!
7808 * src/BufferView2.C (insertInset): this now returns a bool if the
7809 inset was really inserted!!!
7811 * src/tabular.C (GetLastCellInRow):
7812 (GetFirstCellInRow): new helper functions.
7813 (Latex): implemented for new tabular class.
7817 (TeXTopHLine): new Latex() helper functions.
7819 2000-05-12 Juergen Vigna <jug@sad.it>
7821 * src/mathed/formulamacro.C (Read):
7822 * src/mathed/formula.C (Read): read also the \end_inset here!
7824 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7826 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7827 crush when saving formulae with unbalanced parenthesis.
7829 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7831 * src/layout.C: Add new keyword "endlabelstring" to layout file
7833 * src/text.C (GetVisibleRow): Draw endlabel string.
7835 * lib/layouts/broadway.layout
7836 * lib/layouts/hollywood.layout: Added endlabel for the
7837 Parenthetical layout.
7839 * lib/layouts/heb-article.layout: Do not use slanted font shape
7840 for Theorem like environments.
7842 * src/buffer.C (makeLaTeXFile): Always add "american" to
7843 the UsedLanguages list if document language is RTL.
7845 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7847 * add addendum to README.OS2 and small patch (from SMiyata)
7849 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7851 * many files: correct the calls to ChangeExtension().
7853 * src/support/filetools.C (ChangeExtension): remove the no_path
7854 argument, which does not belong there. Use OnlyFileName() instead.
7856 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7857 files when LaTeXing a non-nice latex file.
7859 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7860 a chain of "if". Return false when deadkeys are not handled.
7862 * src/lyx_main.C (LyX): adapted the code for default bindings.
7864 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7865 bindings for basic functionality (except deadkeys).
7866 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7868 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7869 several methods: handle override_x_deadkeys.
7871 * src/lyxrc.h: remove the "bindings" map, which did not make much
7872 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7874 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7876 * src/lyxfont.C (stateText): use a saner method to determine
7877 whether the font is "default". Seems to fix the crash with DEC
7880 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7882 2000-05-08 Juergen Vigna <jug@sad.it>
7884 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7885 TabularLayoutMenu with mouse-button-3
7886 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7888 * src/TabularLayout.C: added this file for having a Layout for
7891 2000-05-05 Juergen Vigna <jug@sad.it>
7893 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7894 recalculating inset-widths.
7895 (TabularFeatures): activated this function so that I can change
7896 tabular-features via menu.
7898 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7899 that I can test some functions with the Table menu.
7901 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7903 * src/lyxfont.C (stateText): guard against stupid c++libs.
7905 * src/tabular.C: add using std::vector
7906 some whitespace changes, + removed som autogenerated code.
7908 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7910 2000-05-05 Juergen Vigna <jug@sad.it>
7912 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7913 row, columns and cellstructures.
7915 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7917 * lib/lyxrc.example: remove obsolete entries.
7919 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7920 reading of protected_separator for free_spacing.
7922 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7924 * src/text.C (draw): do not display an exclamation mark in the
7925 margin for margin notes. This is confusing, ugly and
7928 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7929 AMS math' is checked.
7931 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7932 name to see whether including the amsmath package is needed.
7934 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7936 * src/paragraph.C (validate): Compute UsedLanguages correctly
7937 (don't insert the american language if it doesn't appear in the
7940 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7941 The argument of \thanks{} command is considered moving argument
7943 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7946 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7948 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7949 for appendix/minipage/depth. The lines can be now both in the footnote
7950 frame, and outside the frame.
7952 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7955 2000-05-05 Juergen Vigna <jug@sad.it>
7957 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7958 neede only in tabular.[Ch].
7960 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7964 (Write): write '~' for PROTECTED_SEPARATOR
7966 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7968 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7971 * src/mathed/formula.C (drawStr): rename size to siz.
7973 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7974 possibly fix a bug by not changing the pflags = flags to piflags =
7977 2000-05-05 Juergen Vigna <jug@sad.it>
7979 * src/insets/insetbib.C: moved using directive
7981 * src/ImportNoweb.C: small fix for being able to compile (missing
7984 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7986 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7987 to use clear, since we don't depend on this in the code. Add test
7990 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7992 * (various *.C files): add using std::foo directives to please dec
7995 * replace calls to string::clear() to string::erase() (Angus)
7997 * src/cheaders/cmath: modified to provide std::abs.
7999 2000-05-04 Juergen Vigna <jug@sad.it>
8001 * src/insets/insettext.C: Prepared all for inserting of multiple
8002 paragraphs. Still display stuff to do (alignment and other things),
8003 but I would like to use LyXText to do this when we cleaned out the
8004 table-support stuff.
8006 * src/insets/insettabular.C: Changed lot of stuff and added lots
8007 of functionality still a lot to do.
8009 * src/tabular.C: Various functions changed name and moved to be
8010 const functions. Added new Read and Write functions and changed
8011 lots of things so it works good with tabular-insets (also removed
8012 some stuff which is not needed anymore * hacks *).
8014 * src/lyxcursor.h: added operators == and != which just look if
8015 par and pos are (not) equal.
8017 * src/buffer.C (latexParagraphs): inserted this function to latex
8018 all paragraphs form par to endpar as then I can use this too for
8021 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8022 so that I can call this to from text insets with their own cursor.
8024 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8025 output off all paragraphs (because of the fix below)!
8027 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8028 the very last paragraph (this could be also the last paragraph of an
8031 * src/texrow.h: added rows() call which returns the count-variable.
8033 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8035 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8037 * lib/configure.m4: better autodetection of DocBook tools.
8039 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8043 * src/lyx_cb.C: add using std::reverse;
8045 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8048 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8049 selected files. Should fix repeated errors from generated files.
8051 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8053 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8055 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8056 the spellchecker popup.
8058 * lib/lyxrc.example: Removed the \number_inset section
8060 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8062 * src/insets/figinset.C (various): Use IsFileReadable() to make
8063 sure that the file actually exist. Relying on ghostscripts errors
8064 is a bad idea since they can lead to X server crashes.
8066 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8068 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8071 * lib/lyxrc.example: smallish typo in description of
8072 \view_dvi_paper_option
8074 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8077 * src/lyxfunc.C: doImportHelper to factor out common code of the
8078 various import methods. New functions doImportASCIIasLines,
8079 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8080 doImportLinuxDoc for the format specific parts.
8083 * buffer.C: Dispatch returns now a bool to indicate success
8086 * lyx_gui.C: Add getLyXView() for member access
8088 * lyx_main.C: Change logic for batch commands: First try
8089 Buffer::Dispatch (possibly without GUI), if that fails, use
8092 * lyx_main.C: Add support for --import command line switch.
8093 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8094 Available Formats: Everything accepted by 'buffer-import <format>'
8096 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8098 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8101 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8102 documents will be reformatted upon reentry.
8104 2000-04-27 Juergen Vigna <jug@sad.it>
8106 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8107 correctly only last pos this was a bug.
8109 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8111 * release of lyx-1.1.5pre1
8113 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8117 * src/menus.C: revert the change of naming (Figure->Graphic...)
8118 from 2000-04-11. It was incomplete and bad.
8120 * src/LColor.[Ch]: add LColor::depthbar.
8121 * src/text.C (GetVisibleRow): use it.
8123 * README: update the languages list.
8125 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8127 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8130 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * README: remove sections that were just wrong.
8134 * src/text2.C (GetRowNearY): remove currentrow code
8136 * src/text.C (GetRow): remove currentrow code
8138 * src/screen.C (Update): rewritten a bit.
8139 (SmallUpdate): removed func
8141 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8143 (FullRebreak): return bool
8144 (currentrow): remove var
8145 (currentrow_y): ditto
8147 * src/lyxscreen.h (Draw): change arg to unsigned long
8148 (FitCursor): return bool
8149 (FitManualCursor): ditto
8150 (Smallpdate): remove func
8151 (first): change to unsigned long
8152 (DrawOneRow): change second arg to long (from long &)
8153 (screen_refresh_y): remove var
8154 (scree_refresh_row): ditto
8156 * src/lyxrow.h: change baseline to usigned int from unsigned
8157 short, this brings some implicit/unsigned issues out in the open.
8159 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8161 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8162 instead of smallUpdate.
8164 * src/lyxcursor.h: change y to unsigned long
8166 * src/buffer.h: don't call updateScrollbar after fitcursor
8168 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8169 where they are used. Removed "\\direction", this was not present
8170 in 1.1.4 and is already obsolete. Commented out some code that I
8171 believe to never be called.
8172 (runLiterate): don't call updateScrollbar after fitCursor
8174 (buildProgram): ditto
8177 * src/WorkArea.h (workWidth): change return val to unsigned
8180 (redraw): remove the button redraws
8181 (setScrollbarValue): change for scrollbar
8182 (getScrollbarValue): change for scrollbar
8183 (getScrollbarBounds): change for scrollbar
8185 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8186 (C_WorkArea_down_cb): removed func
8187 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8188 (resize): change for scrollbar
8189 (setScrollbar): ditto
8190 (setScrollbarBounds): ditto
8191 (setScrollbarIncrements): ditto
8192 (up_cb): removed func
8193 (down_cb): removed func
8194 (scroll_cb): change for scrollbar
8195 (work_area_handler): ditto
8197 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8198 when FitCursor did something.
8199 (updateScrollbar): some unsigned changes
8200 (downCB): removed func
8201 (scrollUpOnePage): removed func
8202 (scrollDownOnePage): remvoed func
8203 (workAreaMotionNotify): don't call screen->FitCursor but use
8204 fitCursor instead. and bool return val
8205 (workAreaButtonPress): ditto
8206 (workAreaButtonRelease): some unsigned changes
8207 (checkInsetHit): ditto
8208 (workAreaExpose): ditto
8209 (update): parts rewritten, comments about the signed char arg added
8210 (smallUpdate): removed func
8211 (cursorPrevious): call needed updateScrollbar
8214 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8217 * src/BufferView.[Ch] (upCB): removed func
8218 (downCB): removed func
8219 (smallUpdate): removed func
8221 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8223 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8224 currentrow, currentrow_y optimization. This did not help a lot and
8225 if we want to do this kind of optimization we should rather use
8226 cursor.row instead of the currentrow.
8228 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8229 buffer spacing and klyx spacing support.
8231 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8233 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8236 2000-04-26 Juergen Vigna <jug@sad.it>
8238 * src/insets/figinset.C: fixes to Lars sstream changes!
8240 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8242 * A lot of files: Added Ascii(ostream &) methods to all inset
8243 classes. Used when exporting to ASCII.
8245 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8246 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8249 * src/text2.C (ToggleFree): Disabled implicit word selection when
8250 there is a change in the language
8252 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8253 no output was generated for end-of-sentence inset.
8255 * src/insets/lyxinset.h
8258 * src/paragraph.C: Removed the insetnumber code
8260 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8262 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8264 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8265 no_babel and no_epsfig completely from the file.
8266 (parseSingleLyXformat2Token): add handling for per-paragraph
8267 spacing as written by klyx.
8269 * src/insets/figinset.C: applied patch by Andre. Made it work with
8272 2000-04-20 Juergen Vigna <jug@sad.it>
8274 * src/insets/insettext.C (cutSelection):
8275 (copySelection): Fixed with selection from right to left.
8276 (draw): now the rows are not recalculated at every draw.
8277 (computeTextRows): for now reset the inset-owner here (this is
8278 important for an undo or copy where the inset-owner is not set
8281 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8282 motion to the_locking_inset screen->first was forgotten, this was
8283 not important till we got multiline insets.
8285 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8287 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8288 code seems to be alright (it is code changed by Dekel, and the
8289 intent is indeed that all macros should be defined \protect'ed)
8291 * NEWS: a bit of reorganisation of the new user-visible features.
8293 2000-04-19 Juergen Vigna <jug@sad.it>
8295 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8296 position. Set the inset_owner of the used paragraph so that it knows
8297 that it is inside an inset. Fixed cursor handling with mouse and
8298 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8299 and cleanups to make TextInsets work better.
8301 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8302 Changed parameters of various functions and added LockInsetInInset().
8304 * src/insets/insettext.C:
8306 * src/insets/insetcollapsable.h:
8307 * src/insets/insetcollapsable.C:
8308 * src/insets/insetfoot.h:
8309 * src/insets/insetfoot.C:
8310 * src/insets/insetert.h:
8311 * src/insets/insetert.C: cleaned up the code so that it works now
8312 correctly with insettext.
8314 * src/insets/inset.C:
8315 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8316 that insets in insets are supported right.
8319 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8321 * src/paragraph.C: some small fixes
8323 * src/debug.h: inserted INSETS debug info
8325 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8326 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8328 * src/commandtags.h:
8329 * src/LyXAction.C: insert code for InsetTabular.
8331 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8332 not Button1MotionMask.
8333 (workAreaButtonRelease): send always a InsetButtonRelease event to
8335 (checkInsetHit): some setCursor fixes (always with insets).
8337 * src/BufferView2.C (lockInset): returns a bool now and extended for
8338 locking insets inside insets.
8339 (showLockedInsetCursor): it is important to have the cursor always
8340 before the locked inset.
8341 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8343 * src/BufferView.h: made lockInset return a bool.
8345 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8347 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8348 that is used also internally but can be called as public to have back
8349 a cursor pos which is not set internally.
8350 (SetCursorIntern): Changed to use above function.
8352 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8354 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8359 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8360 patches for things that should be in or should be changed.
8362 * src/* [insetfiles]: change "usigned char fragile" to bool
8363 fragile. There was only one point that could that be questioned
8364 and that is commented in formulamacro.C. Grep for "CHECK".
8366 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8367 (DeleteBuffer): take it out of CutAndPaste and make it static.
8369 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8371 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8372 output the spacing envir commands. Also the new commands used in
8373 the LaTeX output makes the result better.
8375 * src/Spacing.C (writeEnvirBegin): new method
8376 (writeEnvirEnd): new method
8378 2000-04-18 Juergen Vigna <jug@sad.it>
8380 * src/CutAndPaste.C: made textclass a static member of the class
8381 as otherwise it is not accesed right!!!
8383 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8385 * forms/layout_forms.fd
8386 * src/layout_forms.h
8387 * src/layout_forms.C (create_form_form_character)
8388 * src/lyx_cb.C (UserFreeFont)
8389 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8390 documents (in the layout->character popup).
8392 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8394 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8395 \spell_command was in fact not honored (from Kevin Atkinson).
8397 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8400 * src/lyx_gui.h: make lyxViews private (Angus)
8402 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8404 * src/mathed/math_write.C
8405 (MathMatrixInset::Write) Put \protect before \begin{array} and
8406 \end{array} if fragile
8407 (MathParInset::Write): Put \protect before \\ if fragile
8409 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8411 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8412 initialization if the LyXColorHandler must be done after the
8413 connections to the XServer has been established.
8415 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8416 get the background pixel from the lyxColorhandler so that the
8417 figures are rendered with the correct background color.
8418 (NextToken): removed functions.
8419 (GetPSSizes): use ifs >> string instead of NextToken.
8421 * src/Painter.[Ch]: the color cache moved out of this file.
8423 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8426 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8428 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8429 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8431 * src/BufferView.C (enterView): new func
8432 (leaveView): new func
8434 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8436 (leaveView): new func, undefines xterm cursor when approp.
8438 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8439 (AllowInput): delete the Workarea cursor handling from this func.
8441 * src/Painter.C (underline): draw a slimer underline in most cases.
8443 * src/lyx_main.C (error_handler): use extern "C"
8445 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8448 sent directly to me.
8450 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8451 to the list by Dekel.
8453 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8456 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8457 methods from lyx_cb.here.
8459 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8462 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8464 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8465 instead of using current_view directly.
8467 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8469 * src/LyXAction.C (init): add the paragraph-spacing command.
8471 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8473 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8475 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8476 different from the documents.
8478 * src/text.C (SetHeightOfRow): take paragraph spacing into
8479 account, paragraph spacing takes precedence over buffer spacing
8480 (GetVisibleRow): ditto
8482 * src/paragraph.C (writeFile): output the spacing parameter too.
8483 (validate): set the correct features if spacing is used in the
8485 (Clear): set spacing to default
8486 (MakeSameLayout): spacing too
8487 (HasSameLayout): spacing too
8488 (SetLayout): spacing too
8489 (TeXOnePar): output the spacing commands
8491 * src/lyxparagraph.h: added a spacing variable for use with
8492 per-paragraph spacing.
8494 * src/Spacing.h: add a Default spacing and a method to check if
8495 the current spacing is default. also added an operator==
8497 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8500 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8502 * src/lyxserver.C (callback): fix dispatch of functions
8504 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8505 printf() into lyxerr call.
8507 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8510 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8511 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8512 the "Float" from each of the subitems.
8513 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8515 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8516 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8517 documented the change so that the workaround can be nuked later.
8519 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8522 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8524 * src/buffer.C (getLatexName): ditto
8525 (setReadonly): ditto
8527 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8529 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8530 avoid some uses of current_view. Added also a bufferParams()
8531 method to get at this.
8533 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8535 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * src/lyxparagraph.[Ch]: removed
8538 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8539 with operators used by lower_bound and
8540 upper_bound in InsetTable's
8541 Make struct InsetTable private again. Used matchpos.
8543 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8545 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8546 document, the language of existing text is changed (unless the
8547 document is multi-lingual)
8549 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8551 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8553 * A lot of files: A rewrite of the Right-to-Left support.
8555 2000-04-10 Juergen Vigna <jug@sad.it>
8557 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8558 misplaced cursor when inset in inset is locked.
8560 * src/insets/insettext.C (LocalDispatch): small fix so that a
8561 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8563 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8564 footnote font should be decreased in size twice when displaying.
8566 * src/insets/insettext.C (GetDrawFont): inserted this function as
8567 the drawing-font may differ from the real paragraph font.
8569 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8570 insets (inset in inset!).
8572 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8573 function here because we don't want footnotes inside footnotes.
8575 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8577 (init): now set the inset_owner in paragraph.C
8578 (LocalDispatch): added some resetPos() in the right position
8581 (pasteSelection): changed to use the new CutAndPaste-Class.
8583 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8584 which tells if it is allowed to insert another inset inside this one.
8586 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8587 SwitchLayoutsBetweenClasses.
8589 * src/text2.C (InsertInset): checking of the new paragraph-function
8591 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8592 is not needed anymore here!
8595 (PasteSelection): redone (also with #ifdef) so that now this uses
8596 the CutAndPaste-Class.
8597 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8600 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8601 from/to text/insets.
8603 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8604 so that the paragraph knows if it is inside an (text)-inset.
8605 (InsertFromMinibuffer): changed return-value to bool as now it
8606 may happen that an inset is not inserted in the paragraph.
8607 (InsertInsetAllowed): this checks if it is allowed to insert an
8608 inset in this paragraph.
8610 (BreakParagraphConservative):
8611 (BreakParagraph) : small change for the above change of the return
8612 value of InsertFromMinibuffer.
8614 * src/lyxparagraph.h: added inset_owner and the functions to handle
8615 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8617 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8619 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8620 functions from BufferView to BufferView::Pimpl to ease maintence.
8622 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8623 correctly. Also use SetCursorIntern instead of SetCursor.
8625 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8628 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8630 * src/WorkArea.C (belowMouse): manually implement below mouse.
8632 * src/*: Add "explicit" on several constructors, I added probably
8633 some unneeded ones. A couple of changes to code because of this.
8635 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8636 implementation and private parts from the users of BufferView. Not
8639 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8640 implementation and private parts from the users of LyXLex. Not
8643 * src/BufferView_pimpl.[Ch]: new files
8645 * src/lyxlex_pimpl.[Ch]: new files
8647 * src/LyXView.[Ch]: some inline functions move out-of-line
8649 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8651 * src/lyxparagraph.h: make struct InsetTable public.
8653 * src/support/lyxstring.h: change lyxstring::difference_type to be
8654 ptrdiff_t. Add std:: modifiers to streams.
8656 * src/font.C: include the <cctype> header, for islower() and
8659 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8661 * src/font.[Ch]: new files. Contains the metric functions for
8662 fonts, takes a LyXFont as parameter. Better separation of concepts.
8664 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8665 changes because of this.
8667 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8669 * src/*: compile with -Winline and move functions that don't
8672 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8675 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8677 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8678 (various files changed because of this)
8680 * src/Painter.C (text): fixed the drawing of smallcaps.
8682 * src/lyxfont.[Ch] (drawText): removed unused member func.
8685 * src/*.C: added needed "using" statements and "std::" qualifiers.
8687 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8689 * src/*.h: removed all use of "using" from header files use
8690 qualifier std:: instead.
8692 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8694 * src/text.C (Backspace): some additional cleanups (we already
8695 know whether cursor.pos is 0 or not).
8697 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8698 automake does not provide one).
8700 * src/bmtable.h: replace C++ comments with C comments.
8702 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8704 * src/screen.C (ShowCursor): Change the shape of the cursor if
8705 the current language is not equal to the language of the document.
8706 (If the cursor change its shape unexpectedly, then you've found a bug)
8708 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8711 * src/insets/insetnumber.[Ch]: New files.
8713 * src/LyXAction.C (init)
8714 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8717 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8719 * src/lyxparagraph.h
8720 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8721 (the vector is kept sorted).
8723 * src/text.C (GetVisibleRow): Draw selection correctly when there
8724 is both LTR and RTL text.
8726 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8727 which is much faster.
8729 * src/text.C (GetVisibleRow and other): Do not draw the last space
8730 in a row if the direction of the last letter is not equal to the
8731 direction of the paragraph.
8733 * src/lyxfont.C (latexWriteStartChanges):
8734 Check that font language is not equal to basefont language.
8735 (latexWriteEndChanges): ditto
8737 * src/lyx_cb.C (StyleReset): Don't change the language while using
8738 the font-default command.
8740 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8741 empty paragraph before a footnote.
8743 * src/insets/insetcommand.C (draw): Increase x correctly.
8745 * src/screen.C (ShowCursor): Change cursor shape if
8746 current language != document language.
8748 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8750 2000-03-31 Juergen Vigna <jug@sad.it>
8752 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8753 (Clone): changed mode how the paragraph-data is copied to the
8754 new clone-paragraph.
8756 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8757 GetInset(pos) with no inset anymore there (in inset UNDO)
8759 * src/insets/insetcommand.C (draw): small fix as here x is
8760 incremented not as much as width() returns (2 before, 2 behind = 4)
8762 2000-03-30 Juergen Vigna <jug@sad.it>
8764 * src/insets/insettext.C (InsetText): small fix in initialize
8765 widthOffset (should not be done in the init() function)
8767 2000-03-29 Amir Karger <karger@lyx.org>
8769 * lib/examples/it_ItemizeBullets.lyx: translation by
8772 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8774 2000-03-29 Juergen Vigna <jug@sad.it>
8776 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8778 * src/insets/insetfoot.C (Clone): small change as for the below
8779 new init function in the text-inset
8781 * src/insets/insettext.C (init): new function as I've seen that
8782 clone did not copy the Paragraph-Data!
8783 (LocalDispatch): Added code so that now we have some sort of Undo
8784 functionality (well actually we HAVE Undo ;)
8786 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8788 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8790 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8793 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * src/main.C: added a runtime check that verifies that the xforms
8796 header used when building LyX and the library used when running
8797 LyX match. Exit with a message if they don't match. This is a
8798 version number check only.
8800 * src/buffer.C (save): Don't allocate memory on the heap for
8801 struct utimbuf times.
8803 * *: some using changes, use iosfwd instead of the real headers.
8805 * src/lyxfont.C use char const * instead of string for the static
8806 strings. Rewrite some functions to use sstream.
8808 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8810 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8813 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8815 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8816 of Geodesy (from Martin Vermeer)
8818 * lib/layouts/svjour.inc: include file for the Springer svjour
8819 class. It can be used to support journals other than JoG.
8821 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8822 Miskiewicz <misiek@pld.org.pl>)
8823 * lib/reLyX/Makefile.am: ditto.
8825 2000-03-27 Juergen Vigna <jug@sad.it>
8827 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8828 also some modifications with operations on selected text.
8830 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8831 problems with clicking on insets (last famous words ;)
8833 * src/insets/insetcommand.C (draw):
8834 (width): Changed to have a bit of space before and after the inset so
8835 that the blinking cursor can be seen (otherwise it was hidden)
8837 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8839 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8840 would not be added to the link list when an installed gettext (not
8841 part of libc) is found.
8843 2000-03-24 Juergen Vigna <jug@sad.it>
8845 * src/insets/insetcollapsable.C (Edit):
8846 * src/mathed/formula.C (InsetButtonRelease):
8847 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8850 * src/BufferView.C (workAreaButtonPress):
8851 (workAreaButtonRelease):
8852 (checkInsetHit): Finally fixed the clicking on insets be handled
8855 * src/insets/insetert.C (Edit): inserted this call so that ERT
8856 insets work always with LaTeX-font
8858 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8860 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8861 caused lyx to startup with no GUI in place, causing in a crash
8862 upon startup when called with arguments.
8864 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8866 * src/FontLoader.C: better initialization of dummyXFontStruct.
8868 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8870 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8871 for linuxdoc and docbook import and export format options.
8873 * lib/lyxrc.example Example of default values for the previous flags.
8875 * src/lyx_cb.C Use those flags instead of the hardwired values for
8876 linuxdoc and docbook export.
8878 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8881 * src/menus.C Added menus entries for the new import/exports formats.
8883 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8885 * src/lyxrc.*: Added support for running without Gui
8888 * src/FontLoader.C: sensible defaults if no fonts are needed
8890 * src/lyx_cb.C: New function ShowMessage (writes either to the
8891 minibuffer or cout in case of no gui
8892 New function AskOverwrite for common stuff
8893 Consequently various changes to call these functions
8895 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8896 wild guess at sensible screen resolution when having no gui
8898 * src/lyxfont.C: no gui, no fonts... set some defaults
8900 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8902 * src/LColor.C: made the command inset background a bit lighter.
8904 2000-03-20 Hartmut Goebel <goebel@noris.net>
8906 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8907 stdstruct.inc. Koma-Script added some title elements which
8908 otherwise have been listed below "bibliography". This split allows
8909 adding title elements to where they belong.
8911 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8912 define the additional title elements and then include
8915 * many other layout files: changed to include stdtitle.inc just
8916 before stdstruct.inc.
8918 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8920 * src/buffer.C: (save) Added the option to store all backup files
8921 in a single directory
8923 * src/lyxrc.[Ch]: Added variable \backupdir_path
8925 * lib/lyxrc.example: Added descriptions of recently added variables
8927 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8928 bibtex inset, not closing the bibtex popup when deleting the inset)
8930 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8932 * src/lyx_cb.C: add a couple using directives.
8934 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8935 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8936 import based on the filename.
8938 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8939 file would be imported at start, if the filename where of a sgml file.
8941 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8943 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8945 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8946 * src/lyxfont.h Replaced the member variable bits.direction by the
8947 member variable lang. Made many changes in other files.
8948 This allows having a multi-lingual document
8950 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8951 that change the current language to <l>.
8952 Removed the command "font-rtl"
8954 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8955 format for Hebrew documents)
8957 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8958 When auto_mathmode is "true", pressing a digit key in normal mode
8959 will cause entering into mathmode.
8960 If auto_mathmode is "rtl" then this behavior will be active only
8961 when writing right-to-left text.
8963 * src/text2.C (InsertStringA) The string is inserted using the
8966 * src/paragraph.C (GetEndLabel) Gives a correct result for
8967 footnote paragraphs.
8969 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8971 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8973 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8974 front of PasteParagraph. Never insert a ' '. This should at least
8975 fix some cause for the segfaults that we have been experiencing,
8976 it also fixes backspace behaviour slightly. (Phu!)
8978 * src/support/lstrings.C (compare_no_case): some change to make it
8979 compile with gcc 2.95.2 and stdlibc++-v3
8981 * src/text2.C (MeltFootnoteEnvironment): change type o
8982 first_footnote_par_is_not_empty to bool.
8984 * src/lyxparagraph.h: make text private. Changes in other files
8986 (fitToSize): new function
8987 (setContentsFromPar): new function
8988 (clearContents): new function
8989 (SetChar): new function
8991 * src/paragraph.C (readSimpleWholeFile): deleted.
8993 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8994 the file, just use a simple string instead. Also read the file in
8995 a more maintainable manner.
8997 * src/text2.C (InsertStringA): deleted.
8998 (InsertStringB): deleted.
9000 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9002 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9003 RedoParagraphs from the doublespace handling part, just set status
9004 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9005 done, but perhaps not like this.)
9007 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9009 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9010 character when inserting an inset.
9012 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/bufferparams.C (readLanguage): now takes "default" into
9017 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9018 also initialize the toplevel_keymap with the default bindings from
9021 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9023 * all files using lyxrc: have lyxrc as a real variable and not a
9024 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9027 * src/lyxrc.C: remove double call to defaultKeyBindings
9029 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9030 toolbar defauls using lyxlex. Remove enums, structs, functions
9033 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9034 toolbar defaults. Also store default keybindings in a map.
9036 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9037 storing the toolbar defaults without any xforms dependencies.
9039 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9040 applied. Changed to use iterators.
9042 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9044 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9045 systems that don't have LINGUAS set to begin with.
9047 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9050 the list by Dekel Tsur.
9052 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9054 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9055 * src/insets/form_graphics.C: ditto.
9057 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9059 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9061 * src/bufferparams.C (readLanguage): use the new language map
9063 * src/intl.C (InitKeyMapper): use the new language map
9065 * src/lyx_gui.C (create_forms): use the new language map
9067 * src/language.[Ch]: New files. Used for holding the information
9068 about each language. Now! Use this new language map enhance it and
9069 make it really usable for our needs.
9071 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9073 * screen.C (ShowCursor): Removed duplicate code.
9074 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9075 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9077 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9080 * src/text.C Added TransformChar method. Used for rendering Arabic
9081 text correctly (change the glyphs of the letter according to the
9082 position in the word)
9087 * src/lyxrc.C Added lyxrc command {language_command_begin,
9088 language_command_end,language_command_ltr,language_command_rtl,
9089 language_package} which allows the use of either arabtex or Omega
9092 * src/lyx_gui.C (init)
9094 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9095 to use encoding for menu fonts which is different than the encoding
9098 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9099 do not load the babel package.
9100 To write an English document with Hebrew/Arabic, change the document
9101 language to "english".
9103 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9104 (alphaCounter): changed to return char
9105 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9107 * lib/lyxrc.example Added examples for Hebrew/Arabic
9110 * src/layout.C Added layout command endlabeltype
9112 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9114 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9116 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9118 * src/mathed/math_delim.C (search_deco): return a
9119 math_deco_struct* instead of index.
9121 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9123 * All files with a USE_OSTREAM_ONLY within: removed all code that
9124 was unused when USE_OSTREAM_ONLY is defined.
9126 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9127 of any less. Removed header and using.
9129 * src/text.C (GetVisibleRow): draw the string "Page Break
9130 (top/bottom)" on screen when drawing a pagebreak line.
9132 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9134 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9136 * src/mathed/math_macro.C (draw): do some cast magic.
9139 * src/mathed/math_defs.h: change byte* argument to byte const*.
9141 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9143 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9144 know it is right to return InsetFoot* too, but cxx does not like
9147 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9149 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9151 * src/mathed/math_delim.C: change == to proper assignment.
9153 2000-03-09 Juergen Vigna <jug@sad.it>
9155 * src/insets/insettext.C (setPos): fixed various cursor positioning
9156 problems (via mouse and cursor-keys)
9157 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9158 inset (still a small display problem but it works ;)
9160 * src/insets/insetcollapsable.C (draw): added button_top_y and
9161 button_bottom_y to have correct values for clicking on the inset.
9163 * src/support/lyxalgo.h: commented out 'using std::less'
9165 2000-03-08 Juergen Vigna <jug@sad.it>
9167 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9168 Button-Release event closes as it is alos the Release-Event
9171 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9173 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9175 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9176 can add multiple spaces in Scrap (literate programming) styles...
9177 which, by the way, is how I got hooked on LyX to begin with.
9179 * src/mathed/formula.C (Write): Added dummy variable to an
9180 inset::Latex() call.
9181 (Latex): Add free_spacing boolean to inset::Latex()
9183 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9185 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9186 virtual function to include the free_spacing boolean from
9187 the containing paragraph's style.
9189 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9190 Added free_spacing boolean arg to match inset.h
9192 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9193 Added free_spacing boolean arg to match inset.h
9195 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9196 Added free_spacing boolean and made sure that if in a free_spacing
9197 paragraph, that we output normal space if there is a protected space.
9199 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9200 Added free_spacing boolean arg to match inset.h
9202 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9203 Added free_spacing boolean arg to match inset.h
9205 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9206 Added free_spacing boolean arg to match inset.h
9208 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9209 Added free_spacing boolean arg to match inset.h
9211 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9212 Added free_spacing boolean arg to match inset.h
9214 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9215 free_spacing boolean arg to match inset.h
9217 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9218 Added free_spacing boolean arg to match inset.h
9220 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9221 Added free_spacing boolean arg to match inset.h
9223 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9224 Added free_spacing boolean arg to match inset.h
9226 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9227 Added free_spacing boolean arg to match inset.h
9229 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9230 Added free_spacing boolean arg to match inset.h
9232 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9233 free_spacing boolean arg to match inset.h
9235 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9236 free_spacing boolean arg to match inset.h
9238 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9239 ignore free_spacing paragraphs. The user's spaces are left
9242 * src/text.C (InsertChar): Fixed the free_spacing layout
9243 attribute behavior. Now, if free_spacing is set, you can
9244 add multiple spaces in a paragraph with impunity (and they
9245 get output verbatim).
9246 (SelectSelectedWord): Added dummy argument to inset::Latex()
9249 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9252 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9253 paragraph layouts now only input a simple space instead.
9254 Special character insets don't make any sense in free-spacing
9257 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9258 hard-spaces in the *input* file to simple spaces if the layout
9259 is free-spacing. This converts old files which had to have
9260 hard-spaces in free-spacing layouts where a simple space was
9262 (writeFileAscii): Added free_spacing check to pass to the newly
9263 reworked inset::Latex(...) methods. The inset::Latex() code
9264 ensures that hard-spaces in free-spacing paragraphs get output
9265 as spaces (rather than "~").
9267 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9269 * src/mathed/math_delim.C (draw): draw the empty placeholder
9270 delims with a onoffdash line.
9271 (struct math_deco_compare): struct that holds the "functors" used
9272 for the sort and the binary search in math_deco_table.
9273 (class init_deco_table): class used for initial sort of the
9275 (search_deco): use lower_bound to do a binary search in the
9278 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9280 * src/lyxrc.C: a small secret thingie...
9282 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9283 and to not flush the stream as often as it used to.
9285 * src/support/lyxalgo.h: new file
9286 (sorted): template function used for checking if a sequence is
9287 sorted or not. Two versions with and without user supplied
9288 compare. Uses same compare as std::sort.
9290 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9291 it and give warning on lyxerr.
9293 (struct compare_tags): struct with function operators used for
9294 checking if sorted, sorting and lower_bound.
9295 (search_kw): use lower_bound instead of manually implemented
9298 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9300 * src/insets/insetcollapsable.h: fix Clone() declaration.
9301 * src/insets/insetfoot.h: ditto.
9303 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9305 2000-03-08 Juergen Vigna <jug@sad.it>
9307 * src/insets/lyxinset.h: added owner call which tells us if
9308 this inset is inside another inset. Changed also the return-type
9309 of Editable to an enum so it tells clearer what the return-value is.
9311 * src/insets/insettext.C (computeTextRows): fixed computing of
9312 textinsets which split automatically on more rows.
9314 * src/insets/insetert.[Ch]: changed this to be of BaseType
9317 * src/insets/insetfoot.[Ch]: added footnote inset
9319 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9320 collapsable insets (like footnote, ert, ...)
9322 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9324 * src/lyxdraw.h: remvoe file
9326 * src/lyxdraw.C: remove file
9328 * src/insets/insettext.C: added <algorithm>.
9330 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9332 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9333 (matrix_cb): case MM_OK use string stream
9335 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9338 * src/mathed/math_macro.C (draw): use string stream
9339 (Metrics): use string stream
9341 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9342 directly to the ostream.
9344 * src/vspace.C (asString): use string stream.
9345 (asString): use string stream
9346 (asLatexString): use string stream
9348 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9349 setting Spacing::Other.
9351 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9352 sprintf when creating the stretch vale.
9354 * src/text2.C (alphaCounter): changed to return a string and to
9355 not use a static variable internally. Also fixed a one-off bug.
9356 (SetCounter): changed the drawing of the labels to use string
9357 streams instead of sprintf.
9359 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9360 manipulator to use a scheme that does not require library support.
9361 This is also the way it is done in the new GNU libstdc++. Should
9362 work with DEC cxx now.
9364 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9366 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9367 end. This fixes a bug.
9369 * src/mathed (all files concerned with file writing): apply the
9370 USE_OSTREAM_ONLY changes to mathed too.
9372 * src/support/DebugStream.h: make the constructor explicit.
9374 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9375 count and ostream squashed.
9377 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9379 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9381 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9382 ostringstream uses STL strings, and we might not.
9384 * src/insets/insetspecialchar.C: add using directive.
9385 * src/insets/insettext.C: ditto.
9387 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9389 * lib/layouts/seminar.layout: feeble attempt at a layout for
9390 seminar.cls, far from completet and could really use some looking
9391 at from people used to write layout files.
9393 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9394 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9395 a lot nicer and works nicely with ostreams.
9397 * src/mathed/formula.C (draw): a slightly different solution that
9398 the one posted to the list, but I think this one works too. (font
9399 size wrong in headers.)
9401 * src/insets/insettext.C (computeTextRows): some fiddling on
9402 Jürgens turf, added some comments that he should read.
9404 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9405 used and it gave compiler warnings.
9406 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9409 * src/lyx_gui.C (create_forms): do the right thing when
9410 show_banner is true/false.
9412 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9413 show_banner is false.
9415 * most file writing files: Now use iostreams to do almost all of
9416 the writing. Also instead of passing string &, we now use
9417 stringstreams. mathed output is still not adapted to iostreams.
9418 This change can be turned off by commenting out all the occurences
9419 of the "#define USE_OSTREAM_ONLY 1" lines.
9421 * src/WorkArea.C (createPixmap): don't output debug messages.
9422 (WorkArea): don't output debug messages.
9424 * lib/lyxrc.example: added a comment about the new variable
9427 * development/Code_rules/Rules: Added some more commente about how
9428 to build class interfaces and on how better encapsulation can be
9431 2000-03-03 Juergen Vigna <jug@sad.it>
9433 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9434 automatically with the width of the LyX-Window
9436 * src/insets/insettext.C (computeTextRows): fixed update bug in
9437 displaying text-insets (scrollvalues where not initialized!)
9439 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9441 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9442 id in the check of the result from lower_bound is not enough since
9443 lower_bound can return last too, and then res->id will not be a
9446 * all insets and some code that use them: I have conditionalized
9447 removed the Latex(string & out, ...) this means that only the
9448 Latex(ostream &, ...) will be used. This is a work in progress to
9449 move towards using streams for all output of files.
9451 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9454 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9456 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9457 routine (this fixes bug where greek letters were surrounded by too
9460 * src/support/filetools.C (findtexfile): change a bit the search
9461 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9462 no longer passed to kpsewhich, we may have to change that later.
9464 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9465 warning options to avoid problems with X header files (from Angus
9467 * acinclude.m4: regenerated.
9469 2000-03-02 Juergen Vigna <jug@sad.it>
9471 * src/insets/insettext.C (WriteParagraphData): Using the
9472 par->writeFile() function for writing paragraph-data.
9473 (Read): Using buffer->parseSingleLyXformat2Token()-function
9474 for parsing paragraph data!
9476 * src/buffer.C (readLyXformat2): removed all parse data and using
9477 the new parseSingleLyXformat2Token()-function.
9478 (parseSingleLyXformat2Token): added this function to parse (read)
9479 lyx-file-format (this is called also from text-insets now!)
9481 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9483 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9486 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9487 directly instead of going through a func. One very bad thing: a
9488 static LyXFindReplace, but I don't know where to place it.
9490 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9491 string instead of char[]. Also changed to static.
9492 (GetSelectionOrWordAtCursor): changed to static inline
9493 (SetSelectionOverLenChars): ditto.
9495 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9496 current_view and global variables. both classes has changed names
9497 and LyXFindReplace is not inherited from SearchForm.
9499 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9500 fl_form_search form.
9502 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9504 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9506 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9507 bound (from Kayvan).
9509 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9511 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9513 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9515 * some things that I should comment but the local pub says head to
9518 * comment out all code that belongs to the Roff code for Ascii
9519 export of tables. (this is unused)
9521 * src/LyXView.C: use correct type for global variable
9522 current_layout. (LyXTextClass::size_type)
9524 * some code to get the new insetgraphics closer to working I'd be
9525 grateful for any help.
9527 * src/BufferView2.C (insertInset): use the return type of
9528 NumberOfLayout properly. (also changes in other files)
9530 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9531 this as a test. I want to know what breaks because of this.
9533 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9535 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9537 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9538 to use a \makebox in the label, this allows proper justification
9539 with out using protected spaces or multiple hfills. Now it is
9540 "label" for left justified, "\hfill label\hfill" for center, and
9541 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9542 should be changed accordingly.
9544 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9546 * src/lyxtext.h: change SetLayout() to take a
9547 LyXTextClass::size_type instead of a char (when there is more than
9548 127 layouts in a class); also change type of copylayouttype.
9549 * src/text2.C (SetLayout): ditto.
9550 * src/LyXView.C (updateLayoutChoice): ditto.
9552 * src/LaTeX.C (scanLogFile): errors where the line number was not
9553 given just after the '!'-line were ignored (from Dekel Tsur).
9555 * lib/lyxrc.example: fix description of \date_insert_format
9557 * lib/layouts/llncs.layout: new layout, contributed by Martin
9560 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9562 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9563 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9564 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9565 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9566 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9567 paragraph.C, text.C, text2.C)
9569 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9571 * src/insets/insettext.C (LocalDispatch): remove extra break
9574 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9575 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9577 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9578 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9580 * src/insets/insetbib.h: move InsetBibkey::Holder and
9581 InsetCitation::Holder in public space.
9583 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9585 * src/insets/insettext.h: small change to get the new files from
9586 Juergen to compile (use "string", not "class string").
9588 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9589 const & as parameter to LocalDispatch, use LyXFont const & as
9590 paramter to some other func. This also had impacto on lyxinsets.h
9591 and the two mathed insets.
9593 2000-02-24 Juergen Vigna <jug@sad.it>
9596 * src/commandtags.h:
9598 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9602 * src/BufferView2.C: added/updated code for various inset-functions
9604 * src/insets/insetert.[Ch]: added implementation of InsetERT
9606 * src/insets/insettext.[Ch]: added implementation of InsetText
9608 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9609 (draw): added preliminary code for inset scrolling not finshed yet
9611 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9612 as it is in lyxfunc.C now
9614 * src/insets/lyxinset.h: Added functions for text-insets
9616 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9618 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9619 BufferView and reimplement the list as a queue put inside its own
9622 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9624 * several files: use the new interface to the "updateinsetlist"
9626 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9628 (work_area_handler): call BufferView::trippleClick on trippleclick.
9630 * src/BufferView.C (doubleClick): new function, selects word on
9632 (trippleClick): new function, selects line on trippleclick.
9634 2000-02-22 Allan Rae <rae@lyx.org>
9636 * lib/bind/xemacs.bind: buffer-previous not supported
9638 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9640 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9643 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9645 * src/bufferlist.C: get rid of current_view from this file
9647 * src/spellchecker.C: get rid of current_view from this file
9649 * src/vspace.C: get rid of current_view from this file
9650 (inPixels): added BufferView parameter for this func
9651 (asLatexCommand): added a BufferParams for this func
9653 * src/text.C src/text2.C: get rid of current_view from these
9656 * src/lyxfont.C (getFontDirection): move this function here from
9659 * src/bufferparams.C (getDocumentDirection): move this function
9662 * src/paragraph.C (getParDirection): move this function here from
9664 (getLetterDirection): ditto
9666 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9668 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9669 resize due to wrong pixmap beeing used. Also took the opurtunity
9670 to make the LyXScreen stateless on regard to WorkArea and some
9671 general cleanup in the same files.
9673 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9675 * src/Makefile.am: add missing direction.h
9677 * src/PainterBase.h: made the width functions const.
9679 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9682 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9684 * src/insets/insetlatexaccent.C (draw): make the accents draw
9685 better, at present this will only work well with iso8859-1.
9687 * several files: remove the old drawing code, now we use the new
9690 * several files: remove support for mono_video, reverse_video and
9693 2000-02-17 Juergen Vigna <jug@sad.it>
9695 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9696 int ** as we have to return the pointer, otherwise we have only
9697 NULL pointers in the returning function.
9699 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9701 * src/LaTeX.C (operator()): quote file name when running latex.
9703 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9705 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9706 (bubble tip), this removes our special handling of this.
9708 * Remove all code that is unused now that we have the new
9709 workarea. (Code that are not active when NEW_WA is defined.)
9711 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9713 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9715 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9716 nonexisting layout; correctly redirect obsoleted layouts.
9718 * lib/lyxrc.example: document \view_dvi_paper_option
9720 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9723 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9724 (PreviewDVI): handle the view_dvi_paper_option variable.
9725 [Both from Roland Krause]
9727 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9729 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9730 char const *, int, LyXFont)
9731 (text(int, int, string, LyXFont)): ditto
9733 * src/text.C (InsertCharInTable): attempt to fix the double-space
9734 feature in tables too.
9735 (BackspaceInTable): ditto.
9736 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9738 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9740 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9742 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9743 newly found text in textcache to this.
9744 (buffer): set the owner of the text put into the textcache to 0
9746 * src/insets/figinset.C (draw): fixed the drawing of figures with
9749 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9750 drawing of mathframe, hfills, protected space, table lines. I have
9751 now no outstanding drawing problems with the new Painter code.
9753 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9755 * src/PainterBase.C (ellipse, circle): do not specify the default
9758 * src/LColor.h: add using directive.
9760 * src/Painter.[Ch]: change return type of methods from Painter& to
9761 PainterBase&. Add a using directive.
9763 * src/WorkArea.C: wrap xforms callbacks in C functions
9766 * lib/layouts/foils.layout: font fix and simplifications from Carl
9769 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9771 * a lot of files: The Painter, LColor and WorkArea from the old
9772 devel branch has been ported to lyx-devel. Some new files and a
9773 lot of #ifdeffed code. The new workarea is enabled by default, but
9774 if you want to test the new Painter and LColor you have to compile
9775 with USE_PAINTER defined (do this in config.h f.ex.) There are
9776 still some rought edges, and I'd like some help to clear those
9777 out. It looks stable (loads and displays the Userguide very well).
9780 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9782 * src/buffer.C (pop_tag): revert to the previous implementation
9783 (use a global variable for both loops).
9785 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9787 * src/lyxrc.C (LyXRC): change slightly default date format.
9789 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9790 there is an English text with a footnote that starts with a Hebrew
9791 paragraph, or vice versa.
9792 (TeXFootnote): ditto.
9794 * src/text.C (LeftMargin): allow for negative values for
9795 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9798 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9799 for input encoding (cyrillic)
9801 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9803 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9806 * src/toolbar.C (set): ditto
9807 * src/insets/insetbib.C (create_form_citation_form): ditto
9809 * lib/CREDITS: added Dekel Tsur.
9811 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9812 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9813 hebrew supports files from Dekel Tsur.
9815 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9816 <tzafrir@technion.ac.il>
9818 * src/lyxrc.C: put \date_insert_format at the right place.
9820 * src/buffer.C (makeLaTeXFile): fix the handling of
9821 BufferParams::sides when writing out latex files.
9823 * src/BufferView2.C: add a "using" directive.
9825 * src/support/lyxsum.C (sum): when we use lyxstring,
9826 ostringstream::str needs an additional .c_str().
9828 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9830 * src/support/filetools.C (ChangeExtension): patch from Etienne
9833 * src/TextCache.C (show): remove const_cast and make second
9834 parameter non-const LyXText *.
9836 * src/TextCache.h: use non const LyXText in show.
9838 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9841 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9843 * src/support/lyxsum.C: rework to be more flexible.
9845 * several places: don't check if a pointer is 0 if you are going
9848 * src/text.C: remove some dead code.
9850 * src/insets/figinset.C: remove some dead code
9852 * src/buffer.C: move the BufferView funcs to BufferView2.C
9853 remove all support for insetlatexdel
9854 remove support for oldpapersize stuff
9855 made some member funcs const
9857 * src/kbmap.C: use a std::list to store the bindings in.
9859 * src/BufferView2.C: new file
9861 * src/kbsequence.[Ch]: new files
9863 * src/LyXAction.C + others: remove all trace of buffer-previous
9865 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9866 only have one copy in the binary of this table.
9868 * hebrew patch: moved some functions from LyXText to more
9869 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9871 * several files: remove support for XForms older than 0.88
9873 remove some #if 0 #endif code
9875 * src/TextCache.[Ch]: new file. Holds the textcache.
9877 * src/BufferView.C: changes to use the new TextCache interface.
9878 (waitForX): remove the now unused code.
9880 * src/BackStack.h: remove some commented code
9882 * lib/bind/emacs.bind: remove binding for buffer-previous
9884 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9886 * applied the hebrew patch.
9888 * src/lyxrow.h: make sure that all Row variables are initialized.
9890 * src/text2.C (TextHandleUndo): comment out a delete, this might
9891 introduce a memory leak, but should also help us to not try to
9892 read freed memory. We need to look at this one.
9894 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9895 (LyXParagraph): initalize footnotekind.
9897 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9898 forgot this when applying the patch. Please heed the warnings.
9900 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9901 (aka. reformat problem)
9903 * src/bufferlist.C (exists): made const, and use const_iterator
9904 (isLoaded): new func.
9905 (release): use std::find to find the correct buffer.
9907 * src/bufferlist.h: made getState a const func.
9908 made empty a const func.
9909 made exists a const func.
9912 2000-02-01 Juergen Vigna <jug@sad.it>
9914 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9916 * po/it.po: updated a bit the italian po file and also changed the
9917 'file nuovo' for newfile to 'filenuovo' without a space, this did
9920 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9921 for the new insert_date command.
9923 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9924 from jdblair, to insert a date into the current text conforming to
9925 a strftime format (for now only considering the locale-set and not
9926 the document-language).
9928 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9930 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9931 Bounds Read error seen by purify. The problem was that islower is
9932 a macros which takes an unsigned char and uses it as an index for
9933 in array of characters properties (and is thus subject to the
9937 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9938 correctly the paper sides radio buttons.
9939 (UpdateDocumentButtons): ditto.
9941 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9943 * src/kbmap.C (getsym + others): change to return unsigned int,
9944 returning a long can give problems on 64 bit systems. (I assume
9945 that int is 32bit on 64bit systems)
9947 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9949 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9950 LyXLookupString to be zero-terminated. Really fixes problems seen
9953 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9955 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9956 write a (char*)0 to the lyxerr stream.
9958 * src/lastfiles.C: move algorithm before the using statemets.
9960 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9962 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9963 complains otherwise).
9964 * src/table.C: ditto
9966 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9969 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9970 that I removed earlier... It is really needed.
9972 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9974 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9976 * INSTALL: update xforms home page URL.
9978 * lib/configure.m4: fix a bug with unreadable layout files.
9980 * src/table.C (calculate_width_of_column): add "using std::max"
9983 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9985 * several files: marked several lines with "DEL LINE", this is
9986 lines that can be deleted without changing anything.
9987 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9988 checks this anyway */
9991 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9993 * src/DepTable.C (update): add a "+" at the end when the checksum
9994 is different. (debugging string only)
9996 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9997 the next inset to not be displayed. This should also fix the list
9998 of labels in the "Insert Crossreference" dialog.
10000 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10002 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10003 when regex was not found.
10005 * src/support/lstrings.C (lowercase): use handcoded transform always.
10008 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10009 old_cursor.par->prev could be 0.
10011 * several files: changed post inc/dec to pre inc/dec
10013 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10014 write the lastfiles to file.
10016 * src/BufferView.C (buffer): only show TextCache info when debugging
10018 (resizeCurrentBuffer): ditto
10019 (workAreaExpose): ditto
10021 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10023 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10025 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10026 a bit better by removing the special case for \i and \j.
10028 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10030 * src/lyx_main.C (easyParse): remove test for bad comand line
10031 options, since this broke all xforms-related parsing.
10033 * src/kbmap.C (getsym): set return type to unsigned long, as
10034 declared in header. On an alpha, long is _not_ the same as int.
10036 * src/support/LOstream.h: add a "using std::flush;"
10038 * src/insets/figinset.C: ditto.
10040 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10042 * src/bufferlist.C (write): use blinding fast file copy instead of
10043 "a char at a time", now we are doing it the C++ way.
10045 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10046 std::list<int> instead.
10047 (addpidwait): reflect move to std::list<int>
10048 (sigchldchecker): ditto
10050 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10053 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10054 that obviously was wrong...
10056 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10057 c, this avoids warnings with purify and islower.
10059 * src/insets/figinset.C: rename struct queue to struct
10060 queue_element and rewrite to use a std::queue. gsqueue is now a
10061 std::queue<queue_element>
10062 (runqueue): reflect move to std::queue
10065 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10066 we would get "1" "0" instead of "true" "false. Also make the tostr
10069 2000-01-21 Juergen Vigna <jug@sad.it>
10071 * src/buffer.C (writeFileAscii): Disabled code for special groff
10072 handling of tabulars till I fix this in table.C
10074 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10076 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10078 * src/support/lyxlib.h: ditto.
10080 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10082 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10083 and 'j' look better. This might fix the "macron" bug that has been
10086 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10087 functions as one template function. Delete the old versions.
10089 * src/support/lyxsum.C: move using std::ifstream inside
10092 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10095 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10097 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10099 * src/insets/figinset.C (InitFigures): use new instead of malloc
10100 to allocate memory for figures and bitmaps.
10101 (DoneFigures): use delete[] instead of free to deallocate memory
10102 for figures and bitmaps.
10103 (runqueue): use new to allocate
10104 (getfigdata): use new/delete[] instead of malloc/free
10105 (RegisterFigure): ditto
10107 * some files: moved some declarations closer to first use, small
10108 whitespace changes use preincrement instead of postincrement where
10109 it does not make a difference.
10111 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10112 step on the way to use stl::containers for key maps.
10114 * src/bufferlist.h: add a typedef for const_iterator and const
10115 versions of begin and end.
10117 * src/bufferlist.[Ch]: change name of member variable _state to
10118 state_. (avoid reserved names)
10120 (getFileNames): returns the filenames of the buffers in a vector.
10122 * configure.in (ALL_LINGUAS): added ro
10124 * src/support/putenv.C: new file
10126 * src/support/mkdir.C: new file
10128 2000-01-20 Allan Rae <rae@lyx.org>
10130 * lib/layouts/IEEEtran.layout: Added several theorem environments
10132 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10133 couple of minor additions.
10135 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10136 (except for those in footnotes of course)
10138 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10140 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10142 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10143 std::sort and std::lower_bound instead of qsort and handwritten
10145 (struct compara): struct that holds the functors used by std::sort
10146 and std::lower_bound in MathedLookupBOP.
10148 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10150 * src/support/LAssert.h: do not do partial specialization. We do
10151 not really need it.
10153 * src/support/lyxlib.h: note that lyx::getUserName() and
10154 lyx::date() are not in use right now. Should these be suppressed?
10156 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10157 (makeLinuxDocFile): do not put date and user name in linuxdoc
10160 * src/support/lyxlib.h (kill): change first argument to long int,
10161 since that's what solaris uses.
10163 * src/support/kill.C (kill): fix declaration to match prototype.
10165 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10166 actually check whether namespaces are supported. This is not what
10169 * src/support/lyxsum.C: add a using directive.
10171 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10173 * src/support/kill.C: if we have namespace support we don't have
10174 to include lyxlib.h.
10176 * src/support/lyxlib.h: use namespace lyx if supported.
10178 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10180 * src/support/date.C: new file
10182 * src/support/chdir.C: new file
10184 * src/support/getUserName.C: new file
10186 * src/support/getcwd.C: new file
10188 * src/support/abort.C: new file
10190 * src/support/kill.C: new file
10192 * src/support/lyxlib.h: moved all the functions in this file
10193 insede struct lyx. Added also kill and abort to this struct. This
10194 is a way to avoid the "kill is not defined in <csignal>", we make
10195 C++ wrappers for functions that are not ANSI C or ANSI C++.
10197 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10198 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10199 lyx it has been renamed to sum.
10201 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10203 * src/text.C: add using directives for std::min and std::max.
10205 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10207 * src/texrow.C (getIdFromRow): actually return something useful in
10208 id and pos. Hopefully fixes the bug with positionning of errorbox
10211 * src/lyx_main.C (easyParse): output an error and exit if an
10212 incorrect command line option has been given.
10214 * src/spellchecker.C (ispell_check_word): document a memory leak.
10216 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10217 where a "struct utimbuf" is allocated with "new" and deleted with
10220 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10222 * src/text2.C (CutSelection): don't delete double spaces.
10223 (PasteSelection): ditto
10224 (CopySelection): ditto
10226 * src/text.C (Backspace): don't delete double spaces.
10228 * src/lyxlex.C (next): fix a bug that were only present with
10229 conformant std::istream::get to read comment lines, use
10230 std::istream::getline instead. This seems to fix the problem.
10232 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10234 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10235 allowed to insert space before space" editing problem. Please read
10236 commends at the beginning of the function. Comments about usage
10239 * src/text.C (InsertChar): fix for the "not allowed to insert
10240 space before space" editing problem.
10242 * src/text2.C (DeleteEmptyParagraphMechanism): when
10243 IsEmptyTableRow can only return false this last "else if" will
10244 always be a no-op. Commented out.
10246 * src/text.C (RedoParagraph): As far as I can understand tmp
10247 cursor is not really needed.
10249 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10250 present it could only return false anyway.
10251 (several functions): Did something not so smart...added a const
10252 specifier on a lot of methods.
10254 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10255 and add a tmp->text.resize. The LyXParagraph constructor does the
10257 (BreakParagraphConservative): ditto
10259 * src/support/path.h (Path): add a define so that the wrong usage
10260 "Path("/tmp") will be flagged as a compilation error:
10261 "`unnamed_Path' undeclared (first use this function)"
10263 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10265 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10266 which was bogus for several reasons.
10268 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10270 (runBibTeX): ditto.
10272 * autogen.sh: do not use "type -path" (what's that anyway?).
10274 * src/support/filetools.C (findtexfile): remove extraneous space
10275 which caused a kpsewhich warning (at least with kpathsea version
10278 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10280 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10282 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10284 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10286 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10288 * src/paragraph.C (BreakParagraph): do not reserve space on text
10289 if we don't need to (otherwise, if pos_end < pos, we end up
10290 reserving huge amounts of memory due to bad unsigned karma).
10291 (BreakParagraphConservative): ditto, although I have not seen
10292 evidence the bug can happen here.
10294 * src/lyxparagraph.h: add a using std::list.
10296 2000-01-11 Juergen Vigna <jug@sad.it>
10298 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10299 could not be found.
10301 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10303 * src/vc-backend.C (doVCCommand): change to be static and take one
10304 more parameter: the path to chdir too be fore executing the command.
10305 (retrive): new function equiv to "co -r"
10307 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10308 file_not_found_hook is true.
10310 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10312 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10313 if a file is readwrite,readonly...anything else.
10315 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10317 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10318 (CreatePostscript): name change from MenuRunDVIPS (or something)
10319 (PreviewPostscript): name change from MenuPreviewPS
10320 (PreviewDVI): name change from MenuPreviewDVI
10322 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10323 \view_pdf_command., \pdf_to_ps_command
10325 * lib/configure.m4: added search for PDF viewer, and search for
10326 PDF to PS converter.
10327 (lyxrc.defaults output): add \pdflatex_command,
10328 \view_pdf_command and \pdf_to_ps_command.
10330 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10332 * src/bufferlist.C (write): we don't use blocksize for anything so
10335 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10337 * src/support/block.h: disable operator T* (), since it causes
10338 problems with both compilers I tried. See comments in the file.
10340 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10343 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10344 variable LYX_DIR_10x to LYX_DIR_11x.
10346 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10348 * INSTALL: document --with-lyxname.
10351 * configure.in: new configure flag --with-lyxname which allows to
10352 choose the name under which lyx is installed. Default is "lyx", of
10353 course. It used to be possible to do this with --program-suffix,
10354 but the later has in fact a different meaning for autoconf.
10356 * src/support/lstrings.h (lstrchr): reformat a bit.
10358 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10359 * src/mathed/math_defs.h: ditto.
10361 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10363 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10364 true, decides if we create a backup file or not when saving. New
10365 tag and variable \pdf_mode, defaults to false. New tag and
10366 variable \pdflatex_command, defaults to pdflatex. New tag and
10367 variable \view_pdf_command, defaults to xpdf. New tag and variable
10368 \pdf_to_ps_command, defaults to pdf2ps.
10370 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10373 does not have a BufferView.
10374 (unlockInset): ditto + don't access the_locking_inset if the
10375 buffer does not have a BufferView.
10377 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10378 certain circumstances so that we don't continue a keyboard
10379 operation long after the key was released. Try f.ex. to load a
10380 large document, press PageDown for some seconds and then release
10381 it. Before this change the document would contine to scroll for
10382 some time, with this change it stops imidiatly.
10384 * src/support/block.h: don't allocate more space than needed. As
10385 long as we don't try to write to the arr[x] in a array_type arr[x]
10386 it is perfectly ok. (if you write to it you might segfault).
10387 added operator value_type*() so that is possible to pass the array
10388 to functions expecting a C-pointer.
10390 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10393 * intl/*: updated to gettext 0.10.35, tried to add our own
10394 required modifications. Please verify.
10396 * po/*: updated to gettext 0.10.35, tried to add our own required
10397 modifications. Please verify.
10399 * src/support/lstrings.C (tostr): go at fixing the problem with
10400 cxx and stringstream. When stringstream is used return
10401 oss.str().c_str() so that problems with lyxstring and basic_string
10402 are avoided. Note that the best solution would be for cxx to use
10403 basic_string all the way, but it is not conformant yet. (it seems)
10405 * src/lyx_cb.C + other files: moved several global functions to
10406 class BufferView, some have been moved to BufferView.[Ch] others
10407 are still located in lyx_cb.C. Code changes because of this. (part
10408 of "get rid of current_view project".)
10410 * src/buffer.C + other files: moved several Buffer functions to
10411 class BufferView, the functions are still present in buffer.C.
10412 Code changes because of this.
10414 * config/lcmessage.m4: updated to most recent. used when creating
10417 * config/progtest.m4: updated to most recent. used when creating
10420 * config/gettext.m4: updated to most recent. applied patch for
10423 * config/gettext.m4.patch: new file that shows what changes we
10424 have done to the local copy of gettext.m4.
10426 * config/libtool.m4: new file, used in creation of acinclude.m4
10428 * config/lyxinclude.m4: new file, this is the lyx created m4
10429 macros, used in making acinclude.m4.
10431 * autogen.sh: GNU m4 discovered as a separate task not as part of
10432 the lib/configure creation.
10433 Generate acinlucde from files in config. Actually cat
10434 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10435 easier to upgrade .m4 files that really are external.
10437 * src/Spacing.h: moved using std::istringstream to right after
10438 <sstream>. This should fix the problem seen with some compilers.
10440 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10442 * src/lyx_cb.C: began some work to remove the dependency a lot of
10443 functions have on BufferView::text, even if not really needed.
10444 (GetCurrentTextClass): removed this func, it only hid the
10447 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10448 forgot this in last commit.
10450 * src/Bullet.C (bulletEntry): use static char const *[] for the
10451 tables, becuase of this the return arg had to change to string.
10452 (bulletSize): ditto
10453 (~Bullet): removed unneeded destructor
10455 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10456 (insetSleep): moved from Buffer
10457 (insetWakeup): moved from Buffer
10458 (insetUnlock): moved from Buffer
10460 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10461 from Buffer to BufferView.
10463 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10465 * config/ltmain.sh: updated to version 1.3.4 of libtool
10467 * config/ltconfig: updated to version 1.3.4 of libtool
10469 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10472 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10473 Did I get that right?
10475 * src/lyxlex.h: add a "using" directive or two.
10476 * src/Spacing.h: ditto.
10477 * src/insets/figinset.C: ditto.
10478 * src/support/filetools.C: ditto.
10479 * src/support/lstrings.C: ditto.
10480 * src/BufferView.C: ditto.
10481 * src/bufferlist.C: ditto.
10482 * src/lyx_cb.C: ditto.
10483 * src/lyxlex.C: ditto.
10485 * NEWS: add some changes for 1.1.4.
10487 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10489 * src/BufferView.C: first go at a TextCache to speed up switching
10492 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10494 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10495 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10496 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10497 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10500 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10501 members of the struct are correctly initialized to 0 (detected by
10503 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10504 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10506 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10507 pidwait, since it was allocated with "new". This was potentially
10508 very bad. Thanks to Michael Schmitt for running purify for us.
10511 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10513 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10515 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10517 1999-12-30 Allan Rae <rae@lyx.org>
10519 * lib/templates/IEEEtran.lyx: minor change
10521 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10522 src/mathed/formula.C (LocalDispatch): askForText changes
10524 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10525 know when a user has cancelled input. Fixes annoying problems with
10526 inserting labels and version control.
10528 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10530 * src/support/lstrings.C (tostr): rewritten to use strstream and
10533 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10535 * src/support/filetools.C (IsFileWriteable): use fstream to check
10536 (IsDirWriteable): use fileinfo to check
10538 * src/support/filetools.h (FilePtr): whole class deleted
10540 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10542 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10544 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10546 * src/bufferlist.C (write): use ifstream and ofstream instead of
10549 * src/Spacing.h: use istrstream instead of sscanf
10551 * src/mathed/math_defs.h: change first arg to istream from FILE*
10553 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10555 * src/mathed/math_parser.C: have yyis to be an istream
10556 (LexGetArg): use istream (yyis)
10558 (mathed_parse): ditto
10559 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10561 * src/mathed/formula.C (Read): rewritten to use istream
10563 * src/mathed/formulamacro.C (Read): rewritten to use istream
10565 * src/lyxlex.h (~LyXLex): deleted desturctor
10566 (getStream): new function, returns an istream
10567 (getFile): deleted funtion
10568 (IsOK): return is.good();
10570 * src/lyxlex.C (LyXLex): delete file and owns_file
10571 (setFile): open an filebuf and assign that to a istream instead of
10573 (setStream): new function, takes an istream as arg.
10574 (setFile): deleted function
10575 (EatLine): rewritten us use istream instead of FILE*
10579 * src/table.C (LyXTable): use istream instead of FILE*
10580 (Read): rewritten to take an istream instead of FILE*
10582 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10584 * src/buffer.C (Dispatch): remove an extraneous break statement.
10586 * src/support/filetools.C (QuoteName): change to do simple
10587 'quoting'. More work is necessary. Also changed to do nothing
10588 under emx (needs fix too).
10589 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10591 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10592 config.h.in to the AC_DEFINE_UNQUOTED() call.
10593 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10594 needs char * as argument (because Solaris 7 declares it like
10597 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10598 remove definition of BZERO.
10600 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10602 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10603 defined, "lyxregex.h" if not.
10605 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10607 (REGEX): new variable that is set to regex.c lyxregex.h when
10608 AM_CONDITIONAL USE_REGEX is set.
10609 (libsupport_la_SOURCES): add $(REGEX)
10611 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10614 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10617 * configure.in: add call to LYX_REGEX
10619 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10620 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10622 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10624 * lib/bind/fi_menus.bind: new file, from
10625 pauli.virtanen@saunalahti.fi.
10627 * src/buffer.C (getBibkeyList): pass the parameter delim to
10628 InsetInclude::getKeys and InsetBibtex::getKeys.
10630 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10631 is passed to Buffer::getBibkeyList
10633 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10634 instead of the hardcoded comma.
10636 * src/insets/insetbib.C (getKeys): make sure that there are not
10637 leading blanks in bibtex keys. Normal latex does not care, but
10638 harvard.sty seems to dislike blanks at the beginning of citation
10639 keys. In particular, the retturn value of the function is
10641 * INSTALL: make it clear that libstdc++ is needed and that gcc
10642 2.7.x probably does not work.
10644 * src/support/filetools.C (findtexfile): make debug message go to
10646 * src/insets/insetbib.C (getKeys): ditto
10648 * src/debug.C (showTags): make sure that the output is correctly
10651 * configure.in: add a comment for TWO_COLOR_ICON define.
10653 * acconfig.h: remove all the entries that already defined in
10654 configure.in or acinclude.m4.
10656 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10657 to avoid user name, date and copyright.
10659 1999-12-21 Juergen Vigna <jug@sad.it>
10661 * src/table.C (Read): Now read bogus row format informations
10662 if the format is < 5 so that afterwards the table can
10663 be read by lyx but without any format-info. Fixed the
10664 crash we experienced when not doing this.
10666 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10668 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10669 (RedoDrawingOfParagraph): ditto
10670 (RedoParagraphs): ditto
10671 (RemoveTableRow): ditto
10673 * src/text.C (Fill): rename arg paperwidth -> paper_width
10675 * src/buffer.C (insertLyXFile): rename var filename -> fname
10676 (writeFile): rename arg filename -> fname
10677 (writeFileAscii): ditto
10678 (makeLaTeXFile): ditto
10679 (makeLinuxDocFile): ditto
10680 (makeDocBookFile): ditto
10682 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10685 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10687 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10690 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10691 compiled by a C compiler not C++.
10693 * src/layout.h (LyXTextClass): added typedef for const_iterator
10694 (LyXTextClassList): added typedef for const_iterator + member
10695 functions begin and end.
10697 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10698 iterators to fill the choice_class.
10699 (updateLayoutChoice): rewritten to use iterators to fill the
10700 layoutlist in the toolbar.
10702 * src/BufferView.h (BufferView::work_area_width): removed unused
10705 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10707 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10708 (sgmlCloseTag): ditto
10710 * src/support/lstrings.h: return type of countChar changed to
10713 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10714 what version of this func to use. Also made to return unsigned int.
10716 * configure.in: call LYX_STD_COUNT
10718 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10719 conforming std::count.
10721 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10723 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10724 and a subscript would give bad display (patch from Dekel Tsur
10725 <dekel@math.tau.ac.il>).
10727 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10729 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10732 * src/chset.h: add a few 'using' directives
10734 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10735 triggered when no buffer is active
10737 * src/layout.C: removed `break' after `return' in switch(), since
10740 * src/lyx_main.C (init): make sure LyX can be ran in place even
10741 when libtool has done its magic with shared libraries. Fix the
10742 test for the case when the system directory has not been found.
10744 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10745 name for the latex file.
10746 (MenuMakeHTML): ditto
10748 * src/buffer.h: add an optional boolean argument, which is passed
10749 to ChangeExtension.
10751 1999-12-20 Allan Rae <rae@lyx.org>
10753 * lib/templates/IEEEtran.lyx: small correction and update.
10755 * configure.in: Attempted to use LYX_PATH_HEADER
10757 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10759 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10760 input from JMarc. Now use preprocessor to find the header.
10761 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10762 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10763 LYX_STL_STRING_FWD. See comments in file.
10765 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10767 * The global MiniBuffer * minibuffer variable is dead.
10769 * The global FD_form_main * fd_form_main variable is dead.
10771 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10773 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10775 * src/table.h: add the LOstream.h header
10776 * src/debug.h: ditto
10778 * src/LyXAction.h: change the explaination of the ReadOnly
10779 attribute: is indicates that the function _can_ be used.
10781 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10784 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10786 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10792 * src/paragraph.C (GetWord): assert on pos>=0
10795 * src/support/lyxstring.C: condition the use of an invariant on
10797 * src/support/lyxstring.h: ditto
10799 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10800 Use LAssert.h instead of plain assert().
10802 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10804 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10805 * src/support/filetools.C: ditto
10807 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10810 * INSTALL: document the new configure flags
10812 * configure.in: suppress --with-debug; add --enable-assertions
10814 * acinclude.m4: various changes in alignment of help strings.
10816 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10818 * src/kbmap.C: commented out the use of the hash map in kb_map,
10819 beginning of movement to a stl::container.
10821 * several files: removed code that was not in effect when
10822 MOVE_TEXT was defined.
10824 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10825 for escaping should not be used. We can discuss if the string
10826 should be enclosed in f.ex. [] instead of "".
10828 * src/trans_mgr.C (insert): use the new returned value from
10829 encodeString to get deadkeys and keymaps done correctly.
10831 * src/chset.C (encodeString): changed to return a pair, to tell
10832 what to use if we know the string.
10834 * src/lyxscreen.h (fillArc): new function.
10836 * src/FontInfo.C (resize): rewritten to use more std::string like
10837 structore, especially string::replace.
10839 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10842 * configure.in (chmod +x some scripts): remove config/gcc-hack
10844 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10846 * src/buffer.C (writeFile): change once again the top comment in a
10847 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10848 instead of an hardcoded version number.
10849 (makeDocBookFile): ditto
10851 * src/version.h: add new define LYX_DOCVERSION
10853 * po/de.po: update from Pit Sütterlin
10854 * lib/bind/de_menus.bind: ditto.
10856 * src/lyxfunc.C (Dispatch): call MenuExport()
10857 * src/buffer.C (Dispatch): ditto
10859 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10860 LyXFunc::Dispatch().
10861 (MenuExport): new function, moved from
10862 LyXFunc::Dispatch().
10864 * src/trans_mgr.C (insert): small cleanup
10865 * src/chset.C (loadFile): ditto
10867 * lib/kbd/iso8859-1.cdef: add missing backslashes
10869 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10871 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10872 help with placing the manually drawn accents better.
10874 (Draw): x2 and hg changed to float to minimize rounding errors and
10875 help place the accents better.
10877 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10878 unsigned short to char is just wrong...cast the char to unsigned
10879 char instead so that the two values can compare sanely. This
10880 should also make the display of insetlatexaccents better and
10881 perhaps also some other insets.
10883 (lbearing): new function
10886 1999-12-15 Allan Rae <rae@lyx.org>
10888 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10889 header that provides a wrapper around the very annoying SGI STL header
10892 * src/support/lyxstring.C, src/LString.h:
10893 removed old SGI-STL-compatability attempts.
10895 * configure.in: Use LYX_STL_STRING_FWD.
10897 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10898 stl_string_fwd.h is around and try to determine it's location.
10899 Major improvement over previous SGI STL 3.2 compatability.
10900 Three small problems remain with this function due to my zero
10901 knowledge of autoconf. JMarc and lgb see the comments in the code.
10903 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10905 * src/broken_const.h, config/hack-gcc, config/README: removed
10907 * configure.in: remove --with-gcc-hack option; do not call
10910 * INSTALL: remove documentation of --with-broken-const and
10913 * acconfig.h: remove all trace of BROKEN_CONST define
10915 * src/buffer.C (makeDocBookFile): update version number in output
10917 (SimpleDocBookOnePar): fix an assert when trying to a character
10918 access beyond string length
10921 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10923 * po/de.po: fix the Export menu
10925 * lyx.man: update the description of -dbg
10927 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10928 (commandLineHelp): updated
10929 (easyParse): show list of available debug levels if -dbg is passed
10932 * src/Makefile.am: add debug.C
10934 * src/debug.h: moved some code to debug.C
10936 * src/debug.C: new file. Contains code to set and show debug
10939 * src/layout.C: remove 'break' after 'continue' in switch
10940 statements, since these cannot be reached.
10942 1999-12-13 Allan Rae <rae@lyx.org>
10944 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10945 (in_word_set): hash() -> math_hash()
10947 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10949 * acconfig.h: Added a test for whether we are using exceptions in the
10950 current compilation run. If so USING_EXCEPTIONS is defined.
10952 * config.in: Check for existance of stl_string_fwd.h
10953 * src/LString.h: If compiling --with-included-string and SGI's
10954 STL version 3.2 is present (see above test) we need to block their
10955 forward declaration of string and supply a __get_c_string().
10956 However, it turns out this is only necessary if compiling with
10957 exceptions enabled so I've a bit more to add yet.
10959 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10960 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10961 src/support/LRegex.h, src/undo.h:
10962 Shuffle the order of the included files a little to ensure that
10963 LString.h gets included before anything that includes stl_string_fwd.h
10965 * src/support/lyxstring.C: We need to #include LString.h instead of
10966 lyxstring.h to get the necessary definition of __get_c_string.
10967 (__get_c_string): New function. This is defined static just like SGI's
10968 although why they need to do this I'm not sure. Perhaps it should be
10969 in lstrings.C instead.
10971 * lib/templates/IEEEtran.lyx: New template file.
10973 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10975 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10976 * intl/Makefile.in (MKINSTALLDIRS): ditto
10978 * src/LyXAction.C (init): changed to hold the LFUN data in a
10979 automatic array in stead of in callso to newFunc, this speeds up
10980 compilation a lot. Also all the memory used by the array is
10981 returned when the init is completed.
10983 * a lot of files: compiled with -Wold-style-cast, changed most of
10984 the reported offenders to C++ style casts. Did not change the
10985 offenders in C files.
10987 * src/trans.h (Match): change argument type to unsigned int.
10989 * src/support/DebugStream.C: fix some types on the streambufs so
10990 that it works on a conforming implementation.
10992 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10994 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10996 * src/support/lyxstring.C: remove the inline added earlier since
10997 they cause a bunch of unsatisfied symbols when linking with dec
10998 cxx. Cxx likes to have the body of inlines at the place where they
11001 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11002 accessing negative bounds in array. This fixes the crash when
11003 inserting accented characters.
11004 * src/trans.h (Match): ditto
11006 * src/buffer.C (Dispatch): since this is a void, it should not try
11007 to return anything...
11009 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11011 * src/buffer.h: removed the two friends from Buffer. Some changes
11012 because of this. Buffer::getFileName and Buffer::setFileName
11013 renamed to Buffer::fileName() and Buffer::fileName(...).
11015 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11017 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11018 and Buffer::update(short) to BufferView. This move is currently
11019 controlled by a define MOVE_TEXT, this will be removed when all
11020 shows to be ok. This move paves the way for better separation
11021 between buffer contents and buffer view. One side effect is that
11022 the BufferView needs a rebreak when swiching buffers, if we want
11023 to avoid this we can add a cache that holds pointers to LyXText's
11024 that is not currently in use.
11026 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11029 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11031 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11033 * lyx_main.C: new command line option -x (or --execute) and
11034 -e (or --export). Now direct conversion from .lyx to .tex
11035 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11036 Unfortunately, X is still needed and the GUI pops up during the
11039 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11041 * src/Spacing.C: add a using directive to bring stream stuff into
11043 * src/paragraph.C: ditto
11044 * src/buffer.C: ditto
11046 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11047 from Lars' announcement).
11049 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11050 example files from Tino Meinen.
11052 1999-12-06 Allan Rae <rae@lyx.org>
11054 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11056 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11058 * src/support/lyxstring.C: added a lot of inline for no good
11061 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11062 latexWriteEndChanges, they were not used.
11064 * src/layout.h (operator<<): output operator for PageSides
11066 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11068 * some example files: loaded in LyX 1.0.4 and saved again to update
11069 certain constructs (table format)
11071 * a lot of files: did the change to use fstream/iostream for all
11072 writing of files. Done with a close look at Andre Poenitz's patch.
11074 * some files: whitespace changes.
11076 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11078 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11079 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11080 architecture, we provide our own. It is used unconditionnally, but
11081 I do not think this is a performance problem. Thanks to Angus
11082 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11083 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11085 (GetInset): use my_memcpy.
11089 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11090 it is easier to understand, but it uses less TeX-only constructs now.
11092 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11093 elements contain spaces
11095 * lib/configure: regenerated
11097 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11098 elements contain spaces; display the list of programs that are
11101 * autogen.sh: make sure lib/configure is executable
11103 * lib/examples/*: rename the tutorial examples to begin with the
11104 two-letters language code.
11106 * src/lyxfunc.C (getStatus): do not query current font if no
11109 * src/lyx_cb.C (RunScript): use QuoteName
11110 (MenuRunDvips): ditto
11111 (PrintApplyCB): ditto
11113 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11114 around argument, so that it works well with the current shell.
11115 Does not work properly with OS/2 shells currently.
11117 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11118 * src/LyXSendto.C (SendtoApplyCB): ditto
11119 * src/lyxfunc.C (Dispatch): ditto
11120 * src/buffer.C (runLaTeX): ditto
11121 (runLiterate): ditto
11122 (buildProgram): ditto
11124 * src/lyx_cb.C (RunScript): ditto
11125 (MenuMakeLaTeX): ditto
11127 * src/buffer.h (getLatexName): new method
11129 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11131 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11133 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11134 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11135 (create_math_panel): ditto
11137 * src/lyxfunc.C (getStatus): re-activate the code which gets
11138 current font and cursor; add test for export to html.
11140 * src/lyxrc.C (read): remove unreachable break statements; add a
11143 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11145 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11147 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11148 introduced by faulty regex.
11149 * src/buffer.C: ditto
11150 * src/lastfiles.C: ditto
11151 * src/paragraph.C: ditto
11152 * src/table.C: ditto
11153 * src/vspace.C: ditto
11154 * src/insets/figinset.C: ditto
11155 Note: most of these is absolutely harmless, except the one in
11156 src/mathed formula.C.
11158 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11160 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11161 operation, yielding correct results for the reLyX command.
11163 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11165 * src/support/filetools.C (ExpandPath): removed an over eager
11167 (ReplaceEnvironmentPath): ditto
11169 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11170 shows that we are doing something fishy in our code...
11171 (BubblePost): ditto
11174 * src/lyxrc.C (read): use a double switch trick to get more help
11175 from the compiler. (the same trick is used in layout.C)
11176 (write): new function. opens a ofstream and pass that to output
11177 (output): new function, takes a ostream and writes the lyxrc
11178 elemts to it. uses a dummy switch to make sure no elements are
11181 * src/lyxlex.h: added a struct pushpophelper for use in functions
11182 with more than one exit point.
11184 * src/lyxlex.[Ch] (GetInteger): made it const
11188 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11190 * src/layout.[hC] : LayoutTags splitted into several enums, new
11191 methods created, better error handling cleaner use of lyxlex. Read
11194 * src/bmtable.[Ch]: change some member prototypes because of the
11195 image const changes.
11197 * commandtags.h, src/LyXAction.C (init): new function:
11198 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11199 This file is not read automatically but you can add \input
11200 preferences to your lyxrc if you want to. We need to discuss how
11203 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11204 in .aux, also remove .bib and .bst files from dependencies when
11207 * src/BufferView.C, src/LyXView.C: add const_cast several places
11208 because of changes to images.
11210 * lib/images/*: same change as for images/*
11212 * lib/lyxrc.example: Default for accept_compound is false not no.
11214 * images/*: changed to be const, however I have som misgivings
11215 about this change so it might be changed back.
11217 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11219 * lib/configure, po/POTFILES.in: regenerated
11221 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11223 * config/lib_configure.m4: removed
11225 * lib/configure.m4: new file (was config/lib_configure.m4)
11227 * configure.in: do not test for rtti, since we do not use it.
11229 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11231 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11232 doubling of allocated space scheme. This makes it faster for large
11233 strings end to use less memory for small strings. xtra rememoved.
11235 * src/insets/figinset.C (waitalarm): commented out.
11236 (GhostscriptMsg): use static_cast
11237 (GhostscriptMsg): use new instead of malloc to allocate memory for
11238 cmap. also delete the memory after use.
11240 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11242 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11243 for changes in bibtex database or style.
11244 (runBibTeX): remove all .bib and .bst files from dep before we
11246 (run): use scanAuc in when dep file already exist.
11248 * src/DepTable.C (remove_files_with_extension): new method
11249 (exist): new method
11251 * src/DepTable.[Ch]: made many of the methods const.
11253 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11255 * src/bufferparams.C: make sure that the default textclass is
11256 "article". It used to be the first one by description order, but
11257 now the first one is "docbook".
11259 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11260 string; call Debug::value.
11261 (easyParse): pass complete argument to setDebuggingLevel().
11263 * src/debug.h (value): fix the code that parses debug levels.
11265 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11268 * src/LyXAction.C: use Debug::ACTION as debug channel.
11270 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11272 * NEWS: updated for the future 1.1.3 release.
11274 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11275 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11276 it should. This is of course a controversial change (since many
11277 people will find that their lyx workscreen is suddenly full of
11278 red), but done for the sake of correctness.
11280 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11281 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11283 * src/insets/inseterror.h, src/insets/inseturl.h,
11284 src/insets/insetinfo.h, src/insets/figinset.h,
11285 src/mathed/formulamacro.h, src/mathed/math_macro.h
11286 (EditMessage): add a missing const and add _() to make sure that
11287 translation happens
11289 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11290 src/insets/insetbib.C, src/support/filetools.C: add `using'
11291 directives for cxx.
11293 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11294 doing 'Insert index of last word' at the beginning of a paragraph.
11296 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11298 * several files: white-space changes.
11300 * src/mathed/formula.C: removed IsAlpha and IsDigit
11302 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11303 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11306 * src/insets/figinset.C (GetPSSizes): don't break when
11307 "EndComments" is seen. But break when a boundingbox is read.
11309 * all classes inherited from Inset: return value of Clone
11310 changed back to Inset *.
11312 * all classes inherited form MathInset: return value of Clone
11313 changed back to MathedInset *.
11315 * src/insets/figinset.C (runqueue): use a ofstream to output the
11316 gs/ps file. Might need some setpresicion or setw. However I can
11317 see no problem with the current code.
11318 (runqueue): use sleep instead of the alarm/signal code. I just
11319 can't see the difference.
11321 * src/paragraph.C (LyXParagraph): reserve space in the new
11322 paragraph and resize the inserted paragraph to just fit.
11324 * src/lyxfunc.h (operator|=): added operator for func_status.
11326 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11327 check for readable file.
11329 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11330 check for readable file.
11331 (MenuMakeLinuxDoc): ditto
11332 (MenuMakeDocBook): ditto
11333 (MenuMakeAscii): ditto
11334 (InsertAsciiFile): split the test for openable and readable
11336 * src/bmtable.C (draw_bitmaptable): use
11337 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11339 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11340 findtexfile from LaTeX to filetools.
11342 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11343 instead of FilePtr. Needs to be verified by a literate user.
11345 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11347 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11348 (EditMessage): likewise.
11350 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11351 respectively as \textasciitilde and \textasciicircum.
11353 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11355 * src/support/lyxstring.h: made the methods that take iterators
11356 use const_iterator.
11358 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11359 (regexMatch): made is use the real regex class.
11361 * src/support/Makefile.am: changed to use libtool
11363 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11365 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11367 (MathIsInset ++): changed several macros to be inline functions
11370 * src/mathed/Makefile.am: changed to use libtool
11372 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11374 * src/insets/inset* : Clone changed to const and return type is
11375 the true insettype not just Inset*.
11377 * src/insets/Makefile.am: changed to use libtool
11379 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11381 * src/undo.[Ch] : added empty() and changed some of the method
11384 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11386 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11387 setID use block<> for the bullets array, added const several places.
11389 * src/lyxfunc.C (getStatus): new function
11391 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11392 LyXAction, added const to several funtions.
11394 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11395 a std::map, and to store the dir items in a vector.
11397 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11400 * src/LyXView.[Ch] + other files : changed currentView to view.
11402 * src/LyXAction.[Ch] : ported from the old devel branch.
11404 * src/.cvsignore: added .libs and a.out
11406 * configure.in : changes to use libtool.
11408 * acinclude.m4 : inserted libtool.m4
11410 * .cvsignore: added libtool
11412 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11414 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11415 file name in insets and mathed directories (otherwise the
11416 dependency is not taken in account under cygwin).
11418 * src/text2.C (InsertString[AB]): make sure that we do not try to
11419 read characters past the string length.
11421 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11423 * lib/doc/LaTeXConfig.lyx.in,
11424 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11426 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11427 file saying who created them and when this heppened; this is
11428 useless and annoys tools like cvs.
11430 * lib/layouts/g-brief-{en,de}.layout,
11431 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11432 from Thomas Hartkens <thomas@hartkens.de>.
11434 * src/{insets,mathed}/Makefile.am: do not declare an empty
11435 LDFLAGS, so that it can be set at configure time (useful on Irix
11438 * lib/reLyX/configure.in: make sure that the prefix is set
11439 correctly in LYX_DIR.
11441 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11443 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11444 be used by 'command-sequence' this allows to bind a key to a
11445 sequence of LyX-commands
11446 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11448 * src/LyXAction.C: add "command-sequence"
11450 * src/LyXFunction.C: handling of "command-sequence"
11452 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11453 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11455 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11457 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11459 * src/buffer.C (writeFile): Do not output a comment giving user
11460 and date at the beginning of a .lyx file. This is useless and
11461 annoys cvs anyway; update version number to 1.1.
11463 * src/Makefile.am (LYX_DIR): add this definition, so that a
11464 default path is hardcoded in LyX.
11466 * configure.in: Use LYX_GNU_GETTEXT.
11468 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11469 AM_GNU_GETTEXT with a bug fixed.
11471 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11473 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11475 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11476 which is used to point to LyX data is now LYX_DIR_11x.
11478 * lyx.man: convert to a unix text file; small updates.
11480 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11482 * src/support/LSubstring.[Ch]: made the second arg of most of the
11483 constructors be a const reference.
11485 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11488 * src/support/lyxstring.[Ch] (swap): added missing member function
11489 and specialization of swap(str, str);
11491 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11493 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11494 trace of the old one.
11496 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11497 put the member definitions in undo.C.
11499 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11500 NEW_TEXT and have now only code that was included when this was
11503 * src/intl.C (LCombo): use static_cast
11505 (DispatchCallback): ditto
11507 * src/definitions.h: removed whole file
11509 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11511 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11512 parsing and stores in a std:map. a regex defines the file format.
11513 removed unneeded members.
11515 * src/bufferparams.h: added several enums from definitions.h here.
11516 Removed unsused destructor. Changed some types to use proper enum
11517 types. use block to have the temp_bullets and user_defined_bullets
11518 and to make the whole class assignable.
11520 * src/bufferparams.C (Copy): removed this functions, use a default
11521 assignment instead.
11523 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11526 * src/buffer.C (readLyXformat2): commend out all that have with
11527 oldpapersize to do. also comment out all that hve to do with
11528 insetlatex and insetlatexdel.
11529 (setOldPaperStuff): commented out
11531 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11533 * src/LyXAction.C: remove use of inset-latex-insert
11535 * src/mathed/math_panel.C (button_cb): use static_cast
11537 * src/insets/Makefile.am (insets_o_SOURCES): removed
11540 * src/support/lyxstring.C (helper): use the unsigned long
11541 specifier, UL, instead of a static_cast.
11543 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11545 * src/support/block.h: new file. to be used as a c-style array in
11546 classes, so that the class can be assignable.
11548 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11550 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11551 NULL, make sure to return an empty string (it is not possible to
11552 set a string to NULL).
11554 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11556 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11558 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11560 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11561 link line, so that Irix users (for example) can set it explicitely to
11564 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11565 it can be overidden at make time (static or dynamic link, for
11568 * src/vc-backend.C, src/LaTeXFeatures.h,
11569 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11570 statements to bring templates to global namespace.
11572 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11574 * src/support/lyxstring.C (operator[] const): make it standard
11577 * src/minibuffer.C (Init): changed to reflect that more
11578 information is given from the lyxvc and need not be provided here.
11580 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11582 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11584 * src/LyXView.C (UpdateTimerCB): use static_cast
11585 (KeyPressMask_raw_callback): ditto
11587 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11588 buffer_, a lot of changes because of this. currentBuffer() ->
11589 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11590 also changes to other files because of this.
11592 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11594 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11595 have no support for RCS and partial support for CVS, will be
11598 * src/insets/ several files: changes because of function name
11599 changes in Bufferview and LyXView.
11601 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11603 * src/support/LSubstring.[Ch]: new files. These implement a
11604 Substring that can be very convenient to use. i.e. is this
11606 string a = "Mary had a little sheep";
11607 Substring(a, "sheep") = "lamb";
11608 a is now "Mary has a little lamb".
11610 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11611 out patterns and subpatterns of strings. It is used by LSubstring
11612 and also by vc-backend.C
11614 * src/support/lyxstring.C: went over all the assertions used and
11615 tried to correct the wrong ones and flag which of them is required
11616 by the standard. some bugs found because of this. Also removed a
11617 couple of assertions.
11619 * src/support/Makefile.am (libsupport_a_SOURCES): added
11620 LSubstring.[Ch] and LRegex.[Ch]
11622 * src/support/FileInfo.h: have struct stat buf as an object and
11623 not a pointer to one, some changes because of this.
11625 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11626 information in layout when adding the layouts preamble to the
11627 textclass preamble.
11629 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11632 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11633 because of bug in OS/2.
11635 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11637 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11638 \verbatim@font instead of \ttfamily, so that it can be redefined.
11640 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11641 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11642 src/layout.h, src/text2.C: add 'using' directive to bring the
11643 STL templates we need from the std:: namespace to the global one.
11644 Needed by DEC cxx in strict ansi mode.
11646 * src/support/LIstream.h,src/support/LOstream.h,
11647 src/support/lyxstring.h,src/table.h,
11648 src/lyxlookup.h: do not include <config.h> in header
11649 files. This should be done in the .C files only.
11651 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11655 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11657 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11658 from Kayvan to fix the tth invokation.
11660 * development/lyx.spec.in: updates from Kayvan to reflect the
11661 changes of file names.
11663 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11665 * src/text2.C (InsertStringB): use std::copy
11666 (InsertStringA): use std::copy
11668 * src/bufferlist.C: use a vector to store the buffers in. This is
11669 an internal change and should not affect any other thing.
11671 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11674 * src/text.C (Fill): fix potential bug, one off bug.
11676 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11678 * src/Makefile.am (lyx_main.o): add more files it depends on.
11680 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11682 * src/support/lyxstring.C: use size_t for the reference count,
11683 size, reserved memory and xtra.
11684 (internal_compare): new private member function. Now the compare
11685 functions should work for std::strings that have embedded '\0'
11687 (compare): all compare functions rewritten to use
11690 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11692 * src/support/lyxstring.C (compare): pass c_str()
11693 (compare): pass c_str
11694 (compare): pass c_str
11696 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11698 * src/support/DebugStream.C: <config.h> was not included correctly.
11700 * lib/configure: forgot to re-generate it :( I'll make this file
11701 auto generated soon.
11703 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11705 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11708 * src/support/lyxstring.C: some changes from length() to rep->sz.
11709 avoids a function call.
11711 * src/support/filetools.C (SpaceLess): yet another version of the
11712 algorithm...now per Jean-Marc's suggestions.
11714 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11716 * src/layout.C (less_textclass_desc): functor for use in sorting
11718 (LyXTextClass::Read): sort the textclasses after reading.
11720 * src/support/filetools.C (SpaceLess): new version of the
11721 SpaceLess functions. What problems does this one give? Please
11724 * images/banner_bw.xbm: made the arrays unsigned char *
11726 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11728 * src/support/lyxstring.C (find): remove bogus assertion in the
11729 two versions of find where this has not been done yet.
11731 * src/support/lyxlib.h: add missing int return type to
11734 * src/menus.C (ShowFileMenu): disable exporting to html if no
11735 html export command is present.
11737 * config/lib_configure.m4: add a test for an HTML converter. The
11738 programs checked for are, in this order: tth, latex2html and
11741 * lib/configure: generated from config/lib_configure.m4.
11743 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11744 html converter. The parameters are now passed through $$FName and
11745 $$OutName, instead of standard input/output.
11747 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11749 * lib/lyxrc.example: update description of \html_command.
11750 add "quotes" around \screen_font_xxx font setting examples to help
11751 people who use fonts with spaces in their names.
11753 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11755 * Distribution files: updates for v1.1.2
11757 * src/support/lyxstring.C (find): remove bogus assert and return
11758 npos for the same condition.
11760 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11762 * added patch for OS/2 from SMiyata.
11764 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11766 * src/text2.C (CutSelection): make space_wrapped a bool
11767 (CutSelection): dont declare int i until we have to.
11768 (alphaCounter): return a char const *.
11770 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11772 * src/support/syscall.C (Systemcalls::kill):
11773 src/support/filetools.C (PutEnv, PutEnvPath):
11774 src/lyx_cb.C (addNewlineAndDepth):
11775 src/FontInfo.C (FontInfo::resize): condition some #warning
11776 directives with WITH_WARNINGS.
11779 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11781 * src/layout.[Ch] + several files: access to class variables
11782 limited and made accessor functions instead a lot of code changed
11783 becuase of this. Also instead of returning pointers often a const
11784 reference is returned instead.
11786 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11788 * src/Makefile.am (dist-hook): added used to remove the CVS from
11789 cheaders upon creating a dist
11790 (EXTRA_DIST): added cheaders
11792 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11793 a character not as a small integer.
11795 * src/support/lyxstring.C (find): removed Assert and added i >=
11796 rep->sz to the first if.
11798 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11800 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11801 src/LyXView.C src/buffer.C src/bufferparams.C
11802 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11803 src/text2.C src/insets/insetinclude.C:
11804 lyxlayout renamed to textclasslist.
11806 * src/layout.C: some lyxerr changes.
11808 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11809 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11810 (LyXLayoutList): removed all traces of this class.
11811 (LyXTextClass::Read): rewrote LT_STYLE
11812 (LyXTextClass::hasLayout): new function
11813 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11814 both const and nonconst version.
11815 (LyXTextClass::delete_layout): new function.
11816 (LyXTextClassList::Style): bug fix. do the right thing if layout
11818 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11819 (LyXTextClassList::NameOfLayout): ditto
11820 (LyXTextClassList::Load): ditto
11822 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11824 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11826 * src/LyXAction.C (LookupFunc): added a workaround for sun
11827 compiler, on the other hand...we don't know if the current code
11828 compiles on sun at all...
11830 * src/support/filetools.C (CleanupPath): subst fix
11832 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11835 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11836 complained about this one?
11838 * src/insets/insetinclude.C (Latex): subst fix
11840 * src/insets/insetbib.C (getKeys): subst fix
11842 * src/LyXSendto.C (SendtoApplyCB): subst fix
11844 * src/lyx_main.C (init): subst fix
11846 * src/layout.C (Read): subst fix
11848 * src/lyx_sendfax_main.C (button_send): subst fix
11850 * src/buffer.C (RoffAsciiTable): subst fix
11852 * src/lyx_cb.C (MenuFax): subst fix
11853 (PrintApplyCB): subst fix
11855 1999-10-26 Juergen Vigna <jug@sad.it>
11857 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11859 (Read): Cleaned up this code so now we read only format vestion >= 5
11861 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11863 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11864 come nobody has complained about this one?
11866 * src/insets/insetinclude.C (Latex): subst fix
11868 * src/insets/insetbib.C (getKeys): subst fix
11870 * src/lyx_main.C (init): subst fix
11872 * src/layout.C (Read): subst fix
11874 * src/buffer.C (RoffAsciiTable): subst fix
11876 * src/lyx_cb.C (MenuFax): subst fix.
11878 * src/layout.[hC] + some other files: rewrote to use
11879 std::container to store textclasses and layouts in.
11880 Simplified, removed a lot of code. Make all classes
11881 assignable. Further simplifications and review of type
11882 use still to be one.
11884 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11885 lastfiles to create the lastfiles partr of the menu.
11887 * src/lastfiles.[Ch]: rewritten to use deque to store the
11888 lastfiles in. Uses fstream for reading and writing. Simplifies
11891 * src/support/syscall.C: remove explicit cast.
11893 * src/BufferView.C (CursorToggleCB): removed code snippets that
11894 were commented out.
11895 use explicat C++ style casts instead of C style casts. also use
11896 u_vdata instea of passing pointers in longs.
11898 * src/PaperLayout.C: removed code snippets that were commented out.
11900 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11902 * src/lyx_main.C: removed code snippets that wer commented out.
11904 * src/paragraph.C: removed code snippets that were commented out.
11906 * src/lyxvc.C (logClose): use static_cast
11908 (viewLog): remove explicit cast to void*
11909 (showLog): removed old commented code
11911 * src/menus.C: use static_cast instead of C style casts. use
11912 u_vdata instead of u_ldata. remove explicit cast to (long) for
11913 pointers. Removed old code that was commented out.
11915 * src/insets/inset.C: removed old commented func
11917 * src/insets/insetref.C (InsetRef): removed old code that had been
11918 commented out for a long time.
11920 (escape): removed C style cast
11922 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11924 * src/insets/insetlatex.C (Draw): removed old commented code
11925 (Read): rewritten to use string
11927 * src/insets/insetlabel.C (escape): removed C style cast
11929 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11931 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11932 old commented code.
11934 * src/insets/insetinclude.h: removed a couple of stupid bools
11936 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11937 (Clone): remove C style cast
11938 (getKeys): changed list to lst because of std::list
11940 * src/insets/inseterror.C (Draw): removed som old commented code.
11942 * src/insets/insetcommand.C (Draw): removed some old commented code.
11944 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11945 commented out forever.
11946 (bibitem_cb): use static_cast instead of C style cast
11947 use of vdata changed to u_vdata.
11949 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11951 (CloseUrlCB): use static_cast instead of C style cast.
11952 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11954 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11955 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11956 (CloseInfoCB): static_cast from ob->u_vdata instead.
11957 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11960 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11961 (C_InsetError_CloseErrorCB): forward the ob parameter
11962 (CloseErrorCB): static_cast from ob->u_vdata instead.
11964 * src/vspace.h: include LString.h since we use string in this class.
11966 * src/vspace.C (lyx_advance): changed name from advance because of
11967 nameclash with stl. And since we cannot use namespaces yet...I
11968 used a lyx_ prefix instead. Expect this to change when we begin
11971 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11973 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11974 and removed now defunct constructor and deconstructor.
11976 * src/BufferView.h: have backstack as a object not as a pointer.
11977 removed initialization from constructor. added include for BackStack
11979 * development/lyx.spec.in (%build): add CFLAGS also.
11981 * src/screen.C (drawFrame): removed another warning.
11983 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11985 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11986 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11987 README and ANNOUNCE a bit for the next release. More work is
11990 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11991 unbreakable if we are in freespacing mode (LyX-Code), but not in
11994 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11996 * src/BackStack.h: fixed initialization order in constructor
11998 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12000 * acinclude.m4 (VERSION): new rules for when a version is
12001 development, added also a variable for prerelease.
12002 (warnings): we set with_warnings=yes for prereleases
12003 (lyx_opt): prereleases compile with same optimization as development
12004 (CXXFLAGS): only use pedantic if we are a development version
12006 * src/BufferView.C (restorePosition): don't do anything if the
12007 backstack is empty.
12009 * src/BackStack.h: added member empty, use this to test if there
12010 is anything to pop...
12012 1999-10-25 Juergen Vigna <jug@sad.it>
12015 * forms/layout_forms.fd +
12016 * forms/latexoptions.fd +
12017 * lyx.fd: changed for various form resize issues
12019 * src/mathed/math_panel.C +
12020 * src/insets/inseterror.C +
12021 * src/insets/insetinfo.C +
12022 * src/insets/inseturl.C +
12023 * src/insets/inseturl.h +
12025 * src/LyXSendto.C +
12026 * src/PaperLayout.C +
12027 * src/ParagraphExtra.C +
12028 * src/TableLayout.C +
12030 * src/layout_forms.C +
12037 * src/menus.C: fixed various resize issues. So now forms can be
12038 resized savely or not be resized at all.
12040 * forms/form_url.fd +
12041 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12044 * src/insets/Makefile.am: added files form_url.[Ch]
12046 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12048 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12049 (and presumably 6.2).
12051 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12052 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12053 remaining static member callbacks.
12055 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12058 * src/support/lyxstring.h: declare struct Srep as friend of
12059 lyxstring, since DEC cxx complains otherwise.
12061 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12063 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12065 * src/LaTeX.C (run): made run_bibtex also depend on files with
12067 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12068 are put into the dependency file.
12070 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12071 the code has shown itself to work
12072 (create_ispell_pipe): removed another warning, added a comment
12075 * src/minibuffer.C (ExecutingCB): removed code that has been
12076 commented out a long time
12078 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12079 out code + a warning.
12081 * src/support/lyxstring.h: comment out the three private
12082 operators, when compiling with string ansi conforming compilers
12083 they make problems.
12085 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12087 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12088 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12091 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12094 * src/mathed/math_panel.C (create_math_panel): remove explicit
12097 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12100 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12101 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12102 to XCreatePixmapFromBitmapData
12103 (fl_set_bmtable_data): change the last argument to be unsigned
12105 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12106 and bh to be unsigned int, remove explicit casts in call to
12107 XReadBitmapFileData.
12109 * images/arrows.xbm: made the arrays unsigned char *
12110 * images/varsz.xbm: ditto
12111 * images/misc.xbm: ditto
12112 * images/greek.xbm: ditto
12113 * images/dots.xbm: ditto
12114 * images/brel.xbm: ditto
12115 * images/bop.xbm: ditto
12117 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12119 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12120 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12121 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12123 (LYX_CXX_CHEADERS): added <clocale> to the test.
12125 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12127 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12129 * src/support/lyxstring.C (append): fixed something that must be a
12130 bug, rep->assign was used instead of rep->append.
12132 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12135 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12136 lyx insert double chars. Fix spotted by Kayvan.
12138 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12140 * Fixed the tth support. I messed up with the Emacs patch apply feature
12141 and omitted the changes in lyxrc.C.
12143 1999-10-22 Juergen Vigna <jug@sad.it>
12145 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12147 * src/lyx_cb.C (MenuInsertRef) +
12148 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12149 the form cannot be resized under it limits (fixes a segfault)
12151 * src/lyx.C (create_form_form_ref) +
12152 * forms/lyx.fd: Changed Gravity on name input field so that it is
12155 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12157 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12158 <ostream> and <istream>.
12160 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12161 whether <fstream> provides the latest standard features, or if we
12162 have an oldstyle library (like in egcs).
12163 (LYX_CXX_STL_STRING): fix the test.
12165 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12166 code on MODERN_STL_STREAM.
12168 * src/support/lyxstring.h: use L{I,O}stream.h.
12170 * src/support/L{I,O}stream.h: new files, designed to setup
12171 correctly streams for our use
12172 - includes the right header depending on STL capabilities
12173 - puts std::ostream and std::endl (for LOStream.h) or
12174 std::istream (LIStream.h) in toplevel namespace.
12176 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12178 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12179 was a bib file that had been changed we ensure that bibtex is run.
12180 (runBibTeX): enhanced to extract the names of the bib files and
12181 getting their absolute path and enter them into the dep file.
12182 (findtexfile): static func that is used to look for tex-files,
12183 checks for absolute patchs and tries also with kpsewhich.
12184 Alternative ways of finding the correct files are wanted. Will
12186 (do_popen): function that runs a command using popen and returns
12187 the whole output of that command in a string. Should be moved to
12190 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12191 file with extension ext has changed.
12193 * src/insets/figinset.C: added ifdef guards around the fl_free
12194 code that jug commented out. Now it is commented out when
12195 compiling with XForms == 0.89.
12197 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12198 to lyxstring.C, and only keep a forward declaration in
12199 lyxstring.h. Simplifies the header file a bit and should help a
12200 bit on compile time too. Also changes to Srep will not mandate a
12201 recompile of code just using string.
12202 (~lyxstring): definition moved here since it uses srep.
12203 (size): definition moved here since it uses srep.
12205 * src/support/lyxstring.h: removed a couple of "inline" that should
12208 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12210 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12213 1999-10-21 Juergen Vigna <jug@sad.it>
12215 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12216 set to left if I just remove the width entry (or it is empty).
12218 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12219 paragraph when having dummy paragraphs.
12221 1999-10-20 Juergen Vigna <jug@sad.it>
12223 * src/insets/figinset.C: just commented some fl_free_form calls
12224 and added warnings so that this calls should be activated later
12225 again. This avoids for now a segfault, but we have a memory leak!
12227 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12228 'const char * argument' to 'string argument', this should
12229 fix some Asserts() in lyxstring.C.
12231 * src/lyxfunc.h: Removed the function argAsString(const char *)
12232 as it is not used anymore.
12234 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12236 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12239 * src/Literate.h: some funcs moved from public to private to make
12240 interface clearer. Unneeded args removed.
12242 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12244 (scanBuildLogFile): ditto
12246 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12247 normal TeX Error. Still room for improvement.
12249 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12251 * src/buffer.C (insertErrors): changes to make the error
12252 desctription show properly.
12254 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12257 * src/support/lyxstring.C (helper): changed to use
12258 sizeof(object->rep->ref).
12259 (operator>>): changed to use a pointer instead.
12261 * src/support/lyxstring.h: changed const reference & to value_type
12262 const & lets see if that helps.
12264 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12266 * Makefile.am (rpmdist): fixed to have non static package and
12269 * src/support/lyxstring.C: removed the compilation guards
12271 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12274 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12275 conditional compile of lyxstring.Ch
12277 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12278 stupid check, but it is a lot better than the bastring hack.
12279 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12281 * several files: changed string::erase into string::clear. Not
12284 * src/chset.C (encodeString): use a char temporary instead
12286 * src/table.C (TexEndOfCell): added tostr around
12287 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12288 (TexEndOfCell): ditto
12289 (TexEndOfCell): ditto
12290 (TexEndOfCell): ditto
12291 (DocBookEndOfCell): ditto
12292 (DocBookEndOfCell): ditto
12293 (DocBookEndOfCell): ditto
12294 (DocBookEndOfCell): ditto
12296 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12298 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12300 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12301 (MenuBuildProg): added tostr around ret
12302 (MenuRunChktex): added tostr around ret
12303 (DocumentApplyCB): added tostr around ret
12305 * src/chset.C (encodeString): added tostr around t->ic
12307 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12308 (makeLaTeXFile): added tostr around tocdepth
12309 (makeLaTeXFile): added tostr around ftcound - 1
12311 * src/insets/insetbib.C (setCounter): added tostr around counter.
12313 * src/support/lyxstring.h: added an operator+=(int) to catch more
12316 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12317 (lyxstring): We DON'T allow NULL pointers.
12319 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12321 * src/mathed/math_macro.C (MathMacroArgument::Write,
12322 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12323 when writing them out.
12325 * src/LString.C: remove, since it is not used anymore.
12327 * src/support/lyxstring.C: condition the content to
12328 USE_INCLUDED_STRING macro.
12330 * src/mathed/math_symbols.C, src/support/lstrings.C,
12331 src/support/lyxstring.C: add `using' directive to specify what
12332 we need in <algorithm>. I do not think that we need to
12333 conditionalize this, but any thought is appreciated.
12335 * many files: change all callback functions to "C" linkage
12336 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12337 strict_ansi. Those who were static are now global.
12338 The case of callbacks which are static class members is
12339 trickier, since we have to make C wrappers around them (see
12340 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12341 did not finish this yet, since it defeats the purpose of
12342 encapsulation, and I am not sure what the best route is.
12344 1999-10-19 Juergen Vigna <jug@sad.it>
12346 * src/support/lyxstring.C (lyxstring): we permit to have a null
12347 pointer as assignment value and just don't assign it.
12349 * src/vspace.C (nextToken): corrected this function substituting
12350 find_first(_not)_of with find_last_of.
12352 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12353 (TableOptCloseCB) (TableSpeCloseCB):
12354 inserted fl_set_focus call for problem with fl_hide_form() in
12357 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12359 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12362 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12364 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12365 LyXLex::next() and not eatline() to get its argument.
12367 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12369 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12370 instead, use fstreams for io of the depfile, removed unneeded
12371 functions and variables.
12373 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12374 vector instead, removed all functions and variables that is not in
12377 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12379 * src/buffer.C (insertErrors): use new interface to TeXError
12381 * Makefile.am (rpmdist): added a rpmdist target
12383 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12384 per Kayvan's instructions.
12386 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12388 * src/Makefile.am: add a definition for localedir, so that locales
12389 are found after installation (Kayvan)
12391 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12393 * development/.cvsignore: new file.
12395 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12397 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12398 C++ compiler provides wrappers for C headers and use our alternate
12401 * configure.in: use LYX_CXX_CHEADERS.
12403 * src/cheader/: new directory, populated with cname headers from
12404 libstdc++-2.8.1. They are a bit old, but probably good enough for
12405 what we want (support compilers who lack them).
12407 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12408 from includes. It turns out is was stupid.
12410 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12412 * lib/Makefile.am (install-data-local): forgot a ';'
12413 (install-data-local): forgot a '\'
12414 (libinstalldirs): needed after all. reintroduced.
12416 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12418 * configure.in (AC_OUTPUT): added lyx.spec
12420 * development/lyx.spec: removed file
12422 * development/lyx.spec.in: new file
12424 * po/*.po: merged with lyx.pot becuase of make distcheck
12426 * lib/Makefile.am (dist-hook): added dist-hook so that
12427 documentation files will be included when doing a make
12428 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12429 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12431 more: tried to make install do the right thing, exclude CVS dirs
12434 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12435 Path would fit in more nicely.
12437 * all files that used to use pathstack: uses now Path instead.
12438 This change was a lot easier than expected.
12440 * src/support/path.h: new file
12442 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12444 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12446 * src/support/lyxstring.C (getline): Default arg was given for
12449 * Configure.cmd: removed file
12451 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12453 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12454 streams classes and types, add the proper 'using' statements when
12455 MODERN_STL is defined.
12457 * src/debug.h: move the << operator definition after the inclusion
12460 * src/support/filetools.C: include "LAssert.h", which is needed
12463 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12466 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12467 include "debug.h" to define a proper ostream.
12469 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12471 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12472 method to the SystemCall class which can kill a process, but it's
12473 not fully implemented yet.
12475 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12477 * src/support/FileInfo.h: Better documentation
12479 * src/lyxfunc.C: Added support for buffer-export html
12481 * src/menus.C: Added Export->As HTML...
12483 * lib/bind/*.bind: Added short-cut for buffer-export html
12485 * src/lyxrc.*: Added support for new \tth_command
12487 * lib/lyxrc.example: Added stuff for new \tth_command
12489 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12491 * lib/Makefile.am (IMAGES): removed images/README
12492 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12493 installes in correct place. Check permisions is installed
12496 * src/LaTeX.C: some no-op changes moved declaration of some
12499 * src/LaTeX.h (LATEX_H): changed include guard name
12501 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12503 * lib/reLyX/Makefile.am: install noweb2lyx.
12505 * lib/Makefile.am: install configure.
12507 * lib/reLyX/configure.in: declare a config aux dir; set package
12508 name to lyx (not sure what the best solution is); generate noweb2lyx.
12510 * lib/layouts/egs.layout: fix the bibliography layout.
12512 1999-10-08 Jürgen Vigna <jug@sad.it>
12514 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12515 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12516 it returned without continuing to search the path.
12518 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12520 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12521 also fixes a bug. It is not allowed to do tricks with std::strings
12522 like: string a("hei"); &a[e]; this will not give what you
12523 think... Any reason for the complexity in this func?
12525 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12527 * Updated README and INSTALL a bit, mostly to check that my
12528 CVS rights are correctly set up.
12530 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12532 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12533 does not allow '\0' chars but lyxstring and std::string does.
12535 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12537 * autogen.sh (AUTOCONF): let the autogen script create the
12538 POTFILES.in file too. POTFILES.in should perhaps now not be
12539 included in the cvs module.
12541 * some more files changed to use C++ includes instead of C ones.
12543 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12545 (Reread): added tostr to nlink. buggy output otherwise.
12546 (Reread): added a string() around szMode when assigning to Buffer,
12547 without this I got a log of garbled info strings.
12549 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12552 * I have added several ostream & operator<<(ostream &, some_type)
12553 functions. This has been done to avoid casting and warnings when
12554 outputting enums to lyxerr. This as thus eliminated a lot of
12555 explicit casts and has made the code clearer. Among the enums
12556 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12557 mathed enums, some font enum the Debug::type enum.
12559 * src/support/lyxstring.h (clear): missing method. equivalent of
12562 * all files that contained "stderr": rewrote constructs that used
12563 stderr to use lyxerr instead. (except bmtable)
12565 * src/support/DebugStream.h (level): and the passed t with
12566 Debug::ANY to avoid spurious bits set.
12568 * src/debug.h (Debug::type value): made it accept strings of the
12569 type INFO,INIT,KEY.
12571 * configure.in (Check for programs): Added a check for kpsewhich,
12572 the latex generation will use this later to better the dicovery of
12575 * src/BufferView.C (create_view): we don't need to cast this to
12576 (void*) that is done automatically.
12577 (WorkAreaButtonPress): removed some dead code.
12579 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12581 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12582 is not overwritten when translated (David Sua'rez de Lis).
12584 * lib/CREDITS: Added David Sua'rez de Lis
12586 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12588 * src/bufferparams.C (BufferParams): default input encoding is now
12591 * acinclude.m4 (cross_compiling): comment out macro
12592 LYX_GXX_STRENGTH_REDUCE.
12594 * acconfig.h: make sure that const is not defined (to empty) when
12595 we are compiling C++. Remove commented out code using SIZEOF_xx
12598 * configure.in : move the test for const and inline as late as
12599 possible so that these C tests do not interefere with C++ ones.
12600 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12601 has not been proven.
12603 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12605 * src/table.C (getDocBookAlign): remove bad default value for
12606 isColumn parameter.
12608 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12610 (ShowFileMenu2): ditto.
12612 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12613 of files to ignore.
12615 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12617 * Most files: finished the change from the old error code to use
12618 DebugStream for all lyxerr debugging. Only minor changes remain
12619 (e.g. the setting of debug levels using strings instead of number)
12621 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12623 * src/layout.C (Add): Changed to use compare_no_case instead of
12626 * src/FontInfo.C: changed loop variable type too string::size_type.
12628 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12630 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12631 set ETAGS_ARGS to --c++
12633 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12635 * src/table.C (DocBookEndOfCell): commented out two unused variables
12637 * src/paragraph.C: commented out four unused variables.
12639 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12640 insed a if clause with type string::size_type.
12642 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12645 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12647 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12648 variable, also changed loop to go from 0 to lenght + 1, instead of
12649 -1 to length. This should be correct.
12651 * src/LaTeX.C (scanError): use string::size_type as loop variable
12654 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12655 (l.896) since y_tmp and row was not used anyway.
12657 * src/insets/insetref.C (escape): use string::size_type as loop
12660 * src/insets/insetquotes.C (Width): use string::size_type as loop
12662 (Draw): use string::size_type as loop variable type.
12664 * src/insets/insetlatexaccent.C (checkContents): use
12665 string::size_type as loop variable type.
12667 * src/insets/insetlabel.C (escape): use string::size_type as loop
12670 * src/insets/insetinfo.C: added an extern for current_view.
12672 * src/insets/insetcommand.C (scanCommand): use string::size_type
12673 as loop variable type.
12675 * most files: removed the RCS tags. With them we had to recompile
12676 a lot of files after a simple cvs commit. Also we have never used
12677 them for anything meaningful.
12679 * most files: tags-query-replace NULL 0. As adviced several plases
12680 we now use "0" instead of "NULL" in our code.
12682 * src/support/filetools.C (SpaceLess): use string::size_type as
12683 loop variable type.
12685 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12687 * src/paragraph.C: fixed up some more string stuff.
12689 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12691 * src/support/filetools.h: make modestr a std::string.
12693 * src/filetools.C (GetEnv): made ch really const.
12695 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12696 made code that used these use max/min from <algorithm> instead.
12698 * changed several c library include files to their equivalent c++
12699 library include files. All is not changed yet.
12701 * created a support subdir in src, put lyxstring and lstrings
12702 there + the extra files atexit, fileblock, strerror. Created
12703 Makefile.am. edited configure.in and src/Makefile.am to use this
12704 new subdir. More files moved to support.
12706 * imported som of the functions from repository lyx, filetools
12708 * ran tags-query-replace on LString -> string, corrected the bogus
12709 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12710 is still some errors in there. This is errors where too much or
12711 too litle get deleted from strings (string::erase, string::substr,
12712 string::replace), there can also be some off by one errors, or
12713 just plain wrong use of functions from lstrings. Viewing of quotes
12716 * LyX is now running fairly well with string, but there are
12717 certainly some bugs yet (see above) also string is quite different
12718 from LString among others in that it does not allow null pointers
12719 passed in and will abort if it gets any.
12721 * Added the revtex4 files I forgot when setting up the repository.
12723 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12725 * All over: Tried to clean everything up so that only the files
12726 that we really need are included in the cvs repository.
12727 * Switched to use automake.
12728 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12729 * Install has not been checked.
12731 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12733 * po/pt.po: Three errors:
12734 l.533 and l.538 format specification error
12735 l. 402 duplicate entry, I just deleted it.