1 2000-09-05 Juergen Vigna <jug@sad.it>
3 * config/pspell.m4: added entry to lyx-flags
5 * src/spellchecker.C: modified version from Kevin for using pspell
7 2000-09-01 Marko Vendelin <markov@ioc.ee>
8 * src/frontends/gnome/Makefile.am
9 * src/frontends/gnome/FormCitation.C
10 * src/frontends/gnome/FormCitation.h
11 * src/frontends/gnome/diainsertcitation_callbacks.c
12 * src/frontends/gnome/diainsertcitation_callbacks.h
13 * src/frontends/gnome/diainsertcitation_interface.c
14 * src/frontends/gnome/diainsertcitation_interface.h
15 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
16 dialog for Gnome frontend
18 * src/main.C: Gnome libraries require keeping application name
19 and its version as strings
21 * src/frontends/gnome/mainapp.C: Change the name of the main window
22 from GnomeLyX to PACKAGE
24 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
26 * src/frontends/Liason.C: add "using: declaration.
28 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
30 * src/mathed/math_macro.C (Metrics): Set the size of the template
32 * src/mathed/formulamacro.C (Latex): Fixed the returned value
34 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
36 * src/converter.C (add_options): New function.
37 (SetViewer): Change $$FName into '$$FName'.
38 (View): Add options when running xdvi
39 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
40 (Convert): The 3rd parameter is now the desired filename. Converts
41 calls to lyx::rename if necessary.
42 Add options when running dvips.
43 (dvi_papersize,dvips_options): New methods.
45 * src/exporter.C (Export): Use getLatexName() instead of fileName().
47 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
48 using a call to Converter::dvips_options.
49 Fixed to work with nex export code.
52 * src/support/rename.C: New files
54 * src/support/syscall.h
55 * src/support/syscall.C: Added Starttype SystemDontWait.
57 * lib/ui/default.ui: Changed to work with new export code
59 * lib/configure.m4: Changed to work with new export code
61 * src/encoding.C: Changed latex name for iso8859_7 encoding.
63 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
65 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
66 so that code compiles with DEC cxx.
68 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
69 to work correctly! Also now supports the additional elements
72 2000-09-01 Allan Rae <rae@lyx.org>
74 * src/frontends/ButtonPolicies.C: renamed all the references to
75 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
77 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
78 since it's a const not a type.
80 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
82 2000-08-31 Juergen Vigna <jug@sad.it>
84 * src/insets/figinset.C: Various changes to look if the filename has
85 an extension and if not add it for inline previewing.
87 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
90 make buttonStatus and isReadOnly be const methods. (also reflect
91 this in derived classes.)
93 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
94 (nextState): change to be static inline, pass the StateMachine as
96 (PreferencesPolicy): remove casts
97 (OkCancelPolicy): remvoe casts
98 (OkCancelReadOnlyPolicy): remove casts
99 (NoRepeatedApplyReadOnlyPolicy): remove casts
100 (OkApplyCancelReadOnlyPolicy): remove casts
101 (OkApplyCancelPolicy): remove casts
102 (NoRepeatedApplyPolicy): remove casts
104 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
106 * src/converter.C: added some using directives
108 * src/frontends/ButtonPolicies.C: changes to overcome
109 "need lvalue" error with DEC c++
111 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
112 to WMHideCB for DEC c++
114 * src/frontends/xforms/Menubar_pimpl.C: added using directive
116 * src/frontends/xforms/forms/form_document.C.patch: use C callback
117 to BulletBMTableCB for DEC c++
119 2000-08-31 Allan Rae <rae@lyx.org>
121 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
122 character dialog separately from old document dialogs combo_language.
125 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
127 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
128 Removed LFUN_REF_CREATE.
130 * src/MenuBackend.C: Added new tags: toc and references
132 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
133 (add_lastfiles, add_documents, add_formats): Removed the unused smn
135 (add_toc, add_references): New methods.
136 (create_submenu): Handle correctly the case when there is a
137 seperator after optional menu items.
139 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
140 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
141 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
143 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
145 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
147 * src/converter.[Ch]: New file for converting between different
150 * src/export.[Ch]: New file for exporting a LyX file to different
153 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
154 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
155 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
156 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
157 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
158 RunDocBook, MenuExport.
160 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
161 Exporter::Preview methods if NEW_EXPORT is defined.
163 * src/buffer.C (Dispatch): Use Exporter::Export.
165 * src/lyxrc.C: Added new tags: \converter and \viewer.
168 * src/LyXAction.C: Define new lyx-function: buffer-update.
169 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
170 when NEW_EXPORT is defined.
172 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
174 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
176 * lib/ui/default.ui: Added submenus "view" and "update" to the
179 * src/filetools.C (GetExtension): New function.
181 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
183 2000-08-29 Allan Rae <rae@lyx.org>
185 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
187 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
188 (EnableDocumentLayout): removed
189 (DisableDocumentLayout): removed
190 (build): make use of ButtonController's read-only handling to
191 de/activate various objects. Replaces both of the above functions.
193 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
194 (readOnly): was read_only
195 (refresh): fixed dumb mistakes with read_only_ handling
197 * src/frontends/xforms/forms/form_document.fd:
198 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
199 tabbed dialogs so the tabs look more like tabs and so its easier to
200 work out which is the current tab.
202 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
203 segfault with form_table
205 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
207 2000-08-28 Juergen Vigna <jug@sad.it>
209 * acconfig.h: added USE_PSPELL.
211 * src/config.h.in: added USE_PSPELL.
213 * autogen.sh: added pspell.m4
215 * config/pspell.m4: new file.
217 * src/spellchecker.C: implemented support for pspell libary.
219 2000-08-25 Juergen Vigna <jug@sad.it>
221 * src/LyXAction.C (init): renamed LFUN_TABLE to
222 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
224 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
226 * src/lyxscreen.h: add force_clear variable and fuction to force
227 a clear area when redrawing in LyXText.
229 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
231 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
233 * some whitespace and comment changes.
235 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
237 * src/buffer.C: up te LYX_FORMAT to 2.17
239 2000-08-23 Juergen Vigna <jug@sad.it>
241 * src/BufferView_pimpl.C (tripleClick): disable this when in a
244 * src/insets/insettabular.C (pasteSelection): delete the insets
245 LyXText as it is not valid anymore.
246 (copySelection): new function.
247 (pasteSelection): new function.
248 (cutSelection): new function.
249 (LocalDispatch): implemented cut/copy/paste of cell selections.
251 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
252 don't have a LyXText.
254 * src/LyXAction.C (init): a NEW_TABULAR define too much.
256 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
259 2000-08-22 Juergen Vigna <jug@sad.it>
261 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
262 ifdef form_table out if NEW_TABULAR.
264 2000-08-21 Juergen Vigna <jug@sad.it>
266 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
267 (draw): fixed draw position so that the cursor is positioned in the
269 (InsetMotionNotify): hide/show cursor so the position is updated.
270 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
271 using cellstart() function where it should be used.
273 * src/insets/insettext.C (draw): ditto.
275 * src/tabular.C: fixed initialization of some missing variables and
276 made BoxType into an enum.
278 2000-08-22 Marko Vendelin <markov@ioc.ee>
279 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
280 stock menu item using action numerical value, not its string
284 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
286 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
287 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
289 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
291 * src/frontends/xforms/GUIRunTime.C: new file
293 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
294 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
296 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
298 * src/frontends/kde/GUIRunTime.C: new file
300 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
301 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
303 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
305 * src/frontends/gnome/GUIRunTime.C: new file
307 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
310 * src/frontends/GUIRunTime.h: removed constructor and destructor,
311 small change to documetentation.
313 * src/frontends/GUIRunTime.C: removed file
315 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
317 * src/lyxparagraph.h: enable NEW_TABULAR as default
319 * src/lyxfunc.C (processKeySym): remove some commented code
321 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
322 NEW_TABULAR around the fd_form_table_options.
324 * src/lyx_gui.C (runTime): call the static member function as
325 GUIRunTime::runTime().
327 2000-08-21 Allan Rae <rae@lyx.org>
329 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
332 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
334 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
336 2000-08-21 Allan Rae <rae@lyx.org>
338 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
340 * src/frontends/xforms/FormPreferences.C (build): use setOK
341 * src/frontends/xforms/FormDocument.C (build): use setOK
342 (FormDocument): use the appropriate policy.
344 2000-08-21 Allan Rae <rae@lyx.org>
346 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
347 automatic [de]activation of arbitrary objects when in a read-only state.
349 * src/frontends/ButtonPolicies.h: More documentation
350 (isReadOnly): added to support the above.
352 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
354 2000-08-18 Juergen Vigna <jug@sad.it>
356 * src/insets/insettabular.C (getStatus): changed to return func_status.
358 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
359 display toggle menu entries if they are.
361 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
362 new document layout now.
364 * src/lyxfunc.C: ditto
366 * src/lyx_gui_misc.C: ditto
368 * src/lyx_gui.C: ditto
370 * lib/ui/default.ui: removed paper and quotes layout as they are now
371 all in the document layout tabbed folder.
373 * src/frontends/xforms/forms/form_document.fd: added Restore
374 button and callbacks for all inputs for Allan's ButtonPolicy.
376 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
377 (CheckChoiceClass): added missing params setting on class change.
378 (UpdateLayoutDocument): added for updating the layout on params.
379 (build): forgot to RETURN_ALWAYS input_doc_spacing.
380 (FormDocument): Implemented Allan's ButtonPolicy with the
383 2000-08-17 Allan Rae <rae@lyx.org>
385 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
386 so we can at least see the credits again.
388 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
389 controller calls for the appropriate callbacks. Note that since Ok
390 calls apply followed by cancel, and apply isn't a valid input for the
391 APPLIED state, the bc_ calls have to be made in the static callback not
392 within each of the real callbacks.
394 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
395 (setOk): renamed from setOkay()
397 2000-08-17 Juergen Vigna <jug@sad.it>
399 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
400 in the implementation part.
401 (composeUIInfo): don't show optional menu-items.
403 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
405 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
407 * src/bufferview_funcs.C (CurrentState): fixed to show also the
408 text-state when in a text-inset.
410 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
412 2000-08-17 Marko Vendelin <markov@ioc.ee>
413 * src/frontends/gnome/FormIndex.C
414 * src/frontends/gnome/FormIndex.h
415 * src/frontends/gnome/FormToc.C
416 * src/frontends/gnome/FormToc.h
417 * src/frontends/gnome/dialogs
418 * src/frontends/gnome/diatoc_callbacks.c
419 * src/frontends/gnome/diatoc_callbacks.h
420 * src/frontends/gnome/diainsertindex_callbacks.h
421 * src/frontends/gnome/diainsertindex_callbacks.c
422 * src/frontends/gnome/diainsertindex_interface.c
423 * src/frontends/gnome/diainsertindex_interface.h
424 * src/frontends/gnome/diatoc_interface.h
425 * src/frontends/gnome/diatoc_interface.c
426 * src/frontends/gnome/Makefile.am: Table of Contents and
427 Insert Index dialogs implementation for Gnome frontend
429 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
431 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
433 * src/frontends/gnome/diainserturl_interface.c: make the dialog
436 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
438 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
439 destructor. Don't definde if you don't need it
440 (processEvents): made static, non-blocking events processing for
442 (runTime): static method. event loop for xforms
443 * similar as above for kde and gnome.
445 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
447 (runTime): new method calss the real frontends runtime func.
449 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
451 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
453 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
455 2000-08-16 Juergen Vigna <jug@sad.it>
457 * src/lyx_gui.C (runTime): added GUII RunTime support.
459 * src/frontends/Makefile.am:
460 * src/frontends/GUIRunTime.[Ch]:
461 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
462 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
463 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
465 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
467 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
468 as this is already set in ${FRONTEND_INCLUDE} if needed.
470 * configure.in (CPPFLAGS): setting the include dir for the frontend
471 directory and don't set FRONTEND=xforms for now as this is executed
474 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
476 * src/frontends/kde/Makefile.am:
477 * src/frontends/kde/FormUrl.C:
478 * src/frontends/kde/FormUrl.h:
479 * src/frontends/kde/formurldialog.h:
480 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
482 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
484 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
486 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
488 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
491 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
493 * src/WorkArea.C (work_area_handler): more work to get te
494 FL_KEYBOARD to work with xforms 0.88 too, please test.
496 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
498 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
500 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
503 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
505 * src/Timeout.h: remove Qt::emit hack.
507 * several files: changes to allo doc++ compilation
509 * src/lyxfunc.C (processKeySym): new method
510 (processKeyEvent): comment out if FL_REVISION < 89
512 * src/WorkArea.C: change some debugging levels.
513 (WorkArea): set wantkey to FL_KEY_ALL
514 (work_area_handler): enable the FL_KEYBOARD clause, this enables
515 clearer code and the use of compose with XForms 0.89. Change to
516 use signals instead of calling methods in bufferview directly.
518 * src/Painter.C: change some debugging levels.
520 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
523 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
524 (workAreaKeyPress): new method
526 2000-08-14 Juergen Vigna <jug@sad.it>
528 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
530 * config/kde.m4: addes some features
532 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
533 include missing xforms dialogs.
535 * src/Timeout.h: a hack to be able to compile with qt/kde.
537 * sigc++/.cvsignore: added acinclude.m4
539 * lib/.cvsignore: added listerros
541 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
542 xforms tree as objects are needed for other frontends.
544 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
545 linking with not yet implemented xforms objects.
547 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
549 2000-08-14 Baruch Even <baruch.even@writeme.com>
551 * src/frontends/xforms/FormGraphics.h:
552 * src/frontends/xforms/FormGraphics.C:
553 * src/frontends/xforms/RadioButtonGroup.h:
554 * src/frontends/xforms/RadioButtonGroup.C:
555 * src/insets/insetgraphics.h:
556 * src/insets/insetgraphics.C:
557 * src/insets/insetgraphicsParams.h:
558 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
559 instead of spaces, and various other indentation issues to make the
560 sources more consistent.
562 2000-08-14 Marko Vendelin <markov@ioc.ee>
564 * src/frontends/gnome/dialogs/diaprint.glade
565 * src/frontends/gnome/FormPrint.C
566 * src/frontends/gnome/FormPrint.h
567 * src/frontends/gnome/diaprint_callbacks.c
568 * src/frontends/gnome/diaprint_callbacks.h
569 * src/frontends/gnome/diaprint_interface.c
570 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
573 * src/frontends/gnome/dialogs/diainserturl.glade
574 * src/frontends/gnome/FormUrl.C
575 * src/frontends/gnome/FormUrl.h
576 * src/frontends/gnome/diainserturl_callbacks.c
577 * src/frontends/gnome/diainserturl_callbacks.h
578 * src/frontends/gnome/diainserturl_interface.c
579 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
582 * src/frontends/gnome/Dialogs.C
583 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
584 all other dialogs. Copy all unimplemented dialogs from Xforms
587 * src/frontends/gnome/support.c
588 * src/frontends/gnome/support.h: support files generated by Glade
592 * config/gnome.m4: Gnome configuration scripts
594 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
595 configure --help message
597 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
598 only if there are no events pendling in Gnome/Gtk. This enhances
599 the performance of menus.
602 2000-08-14 Allan Rae <rae@lyx.org>
604 * lib/Makefile.am: listerrors cleaning
606 * lib/listerrors: removed -- generated file
607 * acinclude.m4: ditto
608 * sigc++/acinclude.m4: ditto
610 * src/frontends/xforms/forms/form_citation.fd:
611 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
614 * src/frontends/xforms/forms/makefile: I renamed the `install` target
615 `updatesrc` and now we have a `test` target that does what `updatesrc`
616 used to do. I didn't like having an install target that wasn't related
619 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
620 on all except FormGraphics. This may yet happen. Followed by a major
621 cleanup including using FL_TRANSIENT for most of the dialogs. More
622 changes to come when the ButtonController below is introduced.
624 * src/frontends/xforms/ButtonController.h: New file for managing up to
625 four buttons on a dialog according to an externally defined policy.
626 * src/frontends/xforms/Makefile.am: added above
628 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
629 Apply and Cancel/Close buttons and everything in between and beyond.
630 * src/frontends/Makefile.am: added above.
632 * src/frontends/xforms/forms/form_preferences.fd:
633 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
634 and removed variable 'status' as a result. Fixed the set_minsize thing.
635 Use the new screen-font-update after checking screen fonts were changed
636 Added a "Restore" button to restore the original lyxrc values while
637 editing. This restores everything not just the last input changed.
638 That's still a tricky one. As is the "LyX: this shouldn't happen..."
640 * src/LyXAction.C: screen-font-update added for updating buffers after
641 screen font settings have been changed.
642 * src/commandtags.h: ditto
643 * src/lyxfunc.C: ditto
645 * forms/lyx.fd: removed screen fonts dialog.
646 * src/lyx_gui.C: ditto
647 * src/menus.[Ch]: ditto
648 * src/lyx.[Ch]: ditto
649 * src/lyx_cb.C: ditto + code from here moved to make
650 screen-font-update. And people wonder why progress on GUII is
651 slow. Look at how scattered this stuff was! It takes forever
654 * forms/fdfix.sh: Fixup the spacing after commas.
655 * forms/makefile: Remove date from generated files. Fewer clashes now.
656 * forms/bullet_forms.C.patch: included someones handwritten changes
658 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
659 once I've discovered why LyXRC was made noncopyable.
660 * src/lyx_main.C: ditto
662 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
664 * src/frontends/xforms/forms/fdfix.sh:
665 * src/frontends/xforms/forms/fdfixh.sed:
666 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
667 * src/frontends/xforms/Form*.[hC]:
668 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
669 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
670 provide a destructor for the struct FD_form_xxxx. Another version of
671 the set_[max|min]size workaround and a few other cleanups. Actually,
672 Angus' patch from 20000809.
674 2000-08-13 Baruch Even <baruch.even@writeme.com>
676 * src/insets/insetgraphics.C (Clone): Added several fields that needed
679 2000-08-11 Juergen Vigna <jug@sad.it>
681 * src/insets/insetgraphics.C (InsetGraphics): changing init
682 order because of warnings.
684 * src/frontends/xforms/forms/makefile: adding patching .C with
687 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
688 from .C.patch to .c.patch
690 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
691 order because of warning.
693 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
695 * src/frontends/Liason.C (setMinibuffer): new helper function
697 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
699 * src/lyxfunc.C (Dispatch): calling new Document-Layout
701 * lib/ui/default.ui: commented out PaperLayout entry
703 * src/frontends/xforms/form_document.[Ch]: new added files
705 * src/frontends/xforms/FormDocument.[Ch]: ditto
707 * src/frontends/xforms/forms/form_document.fd: ditto
709 * src/frontends/xforms/forms/form_document.C.patch: ditto
711 2000-08-10 Juergen Vigna <jug@sad.it>
713 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
714 (InsetGraphics): initialized cacheHandle to 0.
715 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
717 2000-08-10 Baruch Even <baruch.even@writeme.com>
719 * src/graphics/GraphicsCache.h:
720 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
721 correctly as a cache.
723 * src/graphics/GraphicsCacheItem.h:
724 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
727 * src/graphics/GraphicsCacheItem_pimpl.h:
728 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
731 * src/insets/insetgraphics.h:
732 * src/insets/insetgraphics.C: Changed from using a signal notification
733 to polling when image is not loaded.
735 2000-08-10 Allan Rae <rae@lyx.org>
737 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
738 that there are two functions that have to been taken out of line by
739 hand and aren't taken care of in the script. (Just a reminder note)
741 * sigc++/macros/*.h.m4: Updated as above.
743 2000-08-09 Juergen Vigna <jug@sad.it>
745 * src/insets/insettext.C (draw): small fix for clearing rectangle.
747 * src/insets/insettabular.C: make drawing of single cell smarter.
749 2000-08-09 Marko Vendelin <markov@ioc.ee>
750 * src/frontends/gnome/Menubar_pimpl.C
751 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
752 implementation: new files
754 * src/frontends/gnome/mainapp.C
755 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
758 * src/main.C: create Gnome main window
760 * src/frontends/xforms/Menubar_pimpl.h
761 * src/frontends/Menubar.C
762 * src/frontends/Menubar.h: added method Menubar::update that calls
763 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
765 * src/LyXView.C: calls Menubar::update to update the state
768 * src/frontends/gnome/Makefile.am: added new files
770 * src/frontends/Makefile.am: added frontend compiler options
772 2000-08-08 Juergen Vigna <jug@sad.it>
774 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
776 * src/bufferlist.C (close):
777 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
778 documents if exiting without saving.
780 * src/buffer.C (save): use removeAutosaveFile()
782 * src/support/filetools.C (removeAutosaveFile): new function.
784 * src/lyx_cb.C (MenuWrite): returns a bool now.
785 (MenuWriteAs): check if file could really be saved and revert to the
787 (MenuWriteAs): removing old autosavefile if existant.
789 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
790 before Goto toggle declaration, because of compiler warning.
792 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
794 * src/lyxfunc.C (MenuNew): small fix.
796 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
798 * src/bufferlist.C (newFile):
799 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
801 * src/lyxrc.C: added new_ask_filename tag
803 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
805 * src/lyx.fd: removed code pertaining to form_ref
806 * src/lyx.[Ch]: ditto
807 * src/lyx_cb.C: ditto
808 * src/lyx_gui.C: ditto
809 * src/lyx_gui_misc.C: ditto
811 * src/BufferView_pimpl.C (restorePosition): update buffer only
814 * src/commandtags.h (LFUN_REFTOGGLE): removed
815 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
816 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
817 (LFUN_REFBACK): renamed LFUN_REF_BACK
819 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
821 * src/lyxfunc.C (Dispatch): ditto.
822 InsertRef dialog is now GUI-independent.
824 * src/texrow.C: added using std::endl;
826 * src/insets/insetref.[Ch]: strip out large amounts of code.
827 The inset is now a container and this functionality is now
828 managed by a new FormRef dialog
830 * src/frontends/Dialogs.h (showRef, createRef): new signals
832 * src/frontends/xforms/FormIndex.[Ch],
833 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
834 when setting dialog's min/max size
835 * src/frontends/xforms/FormIndex.[Ch]: ditto
837 * src/frontends/xforms/FormRef.[Ch],
838 src/frontends/xforms/forms/form_ref.fd: new xforms
839 implementation of an InsetRef dialog
841 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
844 * src/graphics/XPM_Renderer.C (isImageFormatOK):
845 ios::nocreate is not part of the standard. Removed.
847 2000-08-07 Baruch Even <baruch.even@writeme.com>
849 * src/graphics/Renderer.h:
850 * src/graphics/Renderer.C: Added base class for rendering of different
851 image formats into Pixmaps.
853 * src/graphics/XPM_Renderer.h:
854 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
855 in a different class.
857 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
858 easily add support for other formats.
860 * src/insets/figinset.C: plugged a leak of an X resource.
862 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
864 * src/CutAndPaste.[Ch]: make all metods static.
866 * development/Code_rules/Rules: more work, added section on
867 Exceptions, and a References section.
869 * a lot of header files: work to make doc++ able to generate the
870 source documentation, some workarounds of doc++ problems. Doc++ is
871 now able to generate the documentation.
873 2000-08-07 Juergen Vigna <jug@sad.it>
875 * src/insets/insettabular.C (recomputeTextInsets): removed function
877 * src/tabular.C (SetWidthOfMulticolCell):
879 (calculate_width_of_column_NMC): fixed return value so that it really
880 only returns true if the column-width has changed (there where
881 problems with muliticolumn-cells in this column).
883 2000-08-04 Juergen Vigna <jug@sad.it>
885 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
886 also on the scrollstatus of the inset.
887 (workAreaMotionNotify): ditto.
889 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
891 2000-08-01 Juergen Vigna <jug@sad.it>
893 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
896 * src/LyXAction.C (init):
897 * src/insets/inset.C (LocalDispatch): added support for
900 * src/insets/inset.C (scroll): new functions.
902 * src/insets/insettext.C (removeNewlines): new function.
903 (SetAutoBreakRows): removes forced newlines in the text of the
904 paragraph if autoBreakRows is set to false.
906 * src/tabular.C (Latex): generates a parbox around the cell contents
909 * src/frontends/xforms/FormTabular.C (local_update): removed
910 the radio_useparbox button.
912 * src/tabular.C (UseParbox): new function
914 2000-08-06 Baruch Even <baruch.even@writeme.com>
916 * src/graphics/GraphicsCache.h:
917 * src/graphics/GraphicsCache.C:
918 * src/graphics/GraphicsCacheItem.h:
919 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
922 * src/insets/insetgraphics.h:
923 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
924 drawing of the inline image.
926 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
927 into the wrong position.
929 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
932 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
934 * src/support/translator.h: move all typedefs to public section
936 * src/support/filetools.C (MakeLatexName): return string const
939 (FileOpenSearch): ditto
941 (LibFileSearch): ditto
942 (i18nLibFileSearch): ditto
945 (CreateTmpDir): ditto
946 (CreateBufferTmpDir): ditto
947 (CreateLyXTmpDir): ditto
952 (OnlyFilename): ditto
954 (NormalizePath): ditto
956 (GetFileContents): ditto
957 (ReplaceEnvironmentPath): ditto
960 (ChangeExtension): ditto
961 (MakeDisplayPath): ditto
962 (do_popen): return cmdret const
963 (findtexfile): return string const
965 * src/support/DebugStream.h: add some /// to please doc++
967 * src/frontends/DialogBase.h (endif): add some /// to please doc++
969 * src/texrow.C (same_rownumber): functor to use with find_if
970 (getIdFromRow): rewritten to use find_if and to not update the
971 positions. return true if row is found
972 (increasePos): new method, use to update positions
974 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
976 * src/lyxlex_pimpl.C (verifyTable): new method
979 (GetString): return string const
980 (pushTable): rewrite to use std::stack
982 (setFile): better check
985 * src/lyxlex.h: make LyXLex noncopyable
987 * src/lyxlex.C (text): return char const * const
988 (GetString): return string const
989 (getLongString): return string const
991 * src/lyx_gui_misc.C (askForText): return pair<...> const
993 * src/lastfiles.[Ch] (operator): return string const
995 * src/buffer.C (parseSingleLyXformat2Token): pass string to
996 istringstream not char const *.
997 move token.end() out of loop.
998 (readFile): move initializaton of token
1000 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1001 getIdFromRow is successful.
1003 * lib/bind/emacs.bind: don't include menus bind
1005 * development/Code_rules/Rules: the beginnings of making this
1006 better and covering more of the unwritten rules that we have.
1008 * development/Code_rules/Recommendations: a couple of wording
1011 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1013 * src/support/strerror.c: remove C++ comment.
1015 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1017 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1018 LFUN_INDEX_INSERT_LAST
1020 * src/texrow.C (getIdFromRow): changed from const_iterator to
1021 iterator, allowing code to compile with DEC cxx
1023 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1024 stores part of the class, as suggested by Allan. Will allow
1026 (apply): test to apply uses InsetCommandParams operator!=
1028 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1029 (apply): test to apply uses InsetCommandParams operator!=
1031 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1032 stores part of the class.
1033 (update): removed limits on min/max size.
1035 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1036 (apply): test to apply uses InsetCommandParams operator!=
1038 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1039 (Read, Write, scanCommand, getCommand): moved functionality
1040 into InsetCommandParams.
1042 (getScreenLabel): made pure virtual
1043 new InsetCommandParams operators== and !=
1045 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1046 c-tors based on InsetCommandParams. Removed others.
1047 * src/insets/insetinclude.[Ch]: ditto
1048 * src/insets/insetlabel.[Ch]: ditto
1049 * src/insets/insetparent.[Ch]: ditto
1050 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1052 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1053 insets derived from InsetCommand created using similar c-tors
1054 based on InsetCommandParams
1055 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1056 * src/menus.C (ShowRefsMenu): ditto
1057 * src/paragraph.C (Clone): ditto
1058 * src/text2.C (SetCounter): ditto
1059 * src/lyxfunc.C (Dispatch) ditto
1060 Also recreated old InsetIndex behaviour exactly. Can now
1061 index-insert at the start of a paragraph and index-insert-last
1062 without launching the pop-up.
1064 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1066 * lib/lyxrc.example: mark te pdf options as non functional.
1068 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1069 (isStrDbl): move tmpstr.end() out of loop.
1070 (strToDbl): move intialization of tmpstr
1071 (lowercase): return string const and move tmp.end() out of loop.
1072 (uppercase): return string const and move tmp.edn() out of loop.
1073 (prefixIs): add assertion
1078 (containsOnly): ditto
1079 (containsOnly): ditto
1080 (containsOnly): ditto
1081 (countChar): make last arg char not char const
1082 (token): return string const
1083 (subst): return string const, move tmp.end() out of loop.
1084 (subst): return string const, add assertion
1085 (strip): return string const
1086 (frontStrip): return string const, add assertion
1087 (frontStrip): return string const
1092 * src/support/lstrings.C: add inclde "LAssert.h"
1093 (isStrInt): move tmpstr.end() out of loop.
1095 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1096 toollist.end() out of loop.
1097 (deactivate): move toollist.end() out of loop.
1098 (update): move toollist.end() out of loop.
1099 (updateLayoutList): move tc.end() out of loop.
1100 (add): move toollist.end() out of loop.
1102 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1103 md.end() out of loop.
1105 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1107 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1110 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1111 (Erase): move insetlist.end() out of loop.
1113 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1114 ref to const string as first arg. Move initialization of some
1115 variables, whitespace changes.
1117 * src/kbmap.C (defkey): move table.end() out of loop.
1118 (kb_keymap): move table.end() out of loop.
1119 (findbinding): move table.end() out of loop.
1121 * src/MenuBackend.C (hasMenu): move end() out of loop.
1122 (getMenu): move end() out of loop.
1123 (getMenu): move menulist_.end() out of loop.
1125 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1127 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1130 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1131 (getFromLyXName): move infotab.end() out of loop.
1133 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1134 -fvtable-thunks -ffunction-sections -fdata-sections
1136 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1138 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1141 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1143 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1145 * src/frontends/xforms/FormCitation.[Ch],
1146 src/frontends/xforms/FormIndex.[Ch],
1147 src/frontends/xforms/FormToc.[Ch],
1148 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1150 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1152 * src/commandtags.h: renamed, created some flags for citation
1155 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1157 * src/lyxfunc.C (dispatch): use signals to insert index entry
1159 * src/frontends/Dialogs.h: new signal createIndex
1161 * src/frontends/xforms/FormCommand.[Ch],
1162 src/frontends/xforms/FormCitation.[Ch],
1163 src/frontends/xforms/FormToc.[Ch],
1164 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1166 * src/insets/insetindex.[Ch]: GUI-independent
1168 * src/frontends/xforms/FormIndex.[Ch],
1169 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1172 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1174 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1175 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1177 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1179 * src/insets/insetref.C (Latex): rewrite so that there is now
1180 question that a initialization is requested.
1182 * src/insets/insetcommand.h: reenable the hide signal
1184 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1186 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1187 fix handling of shortcuts (many bugs :)
1188 (add_lastfiles): ditto.
1190 * lib/ui/default.ui: fix a few shortcuts.
1192 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1194 * Makefile.am: Fix ``rpmdist'' target to return the exit
1195 status of the ``rpm'' command, instead of the last command in
1196 the chain (the ``rm lyx.xpm'' command, which always returns
1199 2000-08-02 Allan Rae <rae@lyx.org>
1201 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1202 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1203 * src/frontends/xforms/FormToc.C (FormToc): ditto
1205 * src/frontends/xforms/Makefile.am: A few forgotten files
1207 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1208 Signals-not-copyable-problem Lars' started commenting out.
1210 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1212 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1214 * src/insets/insetcommand.h: Signals is not copyable so anoter
1215 scheme for automatic hiding of forms must be used.
1217 * src/frontends/xforms/FormCitation.h: don't inerit from
1218 noncopyable, FormCommand already does that.
1219 * src/frontends/xforms/FormToc.h: ditto
1220 * src/frontends/xforms/FormUrl.h: ditto
1222 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1224 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1226 * src/insets/insetcommand.h (hide): new SigC::Signal0
1227 (d-tor) new virtual destructor emits hide signal
1229 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1230 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1232 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1233 LOF and LOT. Inset is now GUI-independent
1235 * src/insets/insetloa.[Ch]: redundant
1236 * src/insets/insetlof.[Ch]: ditto
1237 * src/insets/insetlot.[Ch]: ditto
1239 * src/frontends/xforms/forms/form_url.fd: tweaked!
1240 * src/frontends/xforms/forms/form_citation.fd: ditto
1242 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1243 dialogs dealing with InsetCommand insets
1245 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1246 FormCommand base class
1247 * src/frontends/xforms/FormUrl.[Ch]: ditto
1249 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1251 * src/frontends/xforms/FormToc.[Ch]: ditto
1253 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1254 passed a generic InsetCommand pointer
1255 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1257 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1258 and modified InsetTOC class
1259 * src/buffer.C: ditto
1261 * forms/lyx.fd: strip out old FD_form_toc code
1262 * src/lyx_gui_misc.C: ditto
1263 * src/lyx_gui.C: ditto
1264 * src/lyx_cb.C: ditto
1265 * src/lyx.[Ch]: ditto
1267 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1269 * src/support/utility.hpp: tr -d '\r'
1271 2000-08-01 Juergen Vigna <jug@sad.it>
1273 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1275 * src/commandtags.h:
1276 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1277 LFUN_TABULAR_FEATURES.
1279 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1280 LFUN_LAYOUT_TABULAR.
1282 * src/insets/insettabular.C (getStatus): implemented helper function.
1284 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1286 2000-07-31 Juergen Vigna <jug@sad.it>
1288 * src/text.C (draw): fixed screen update problem for text-insets.
1290 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1291 something changed probably this has to be added in various other
1294 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1296 2000-07-31 Baruch Even <baruch.even@writeme.com>
1298 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1299 templates to satisfy compaq cxx.
1302 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1304 * src/support/translator.h (equal_1st_in_pair::operator()): take
1305 const ref pair_type as arg.
1306 (equal_2nd_in_pair::operator()): ditto
1307 (Translator::~Translator): remove empty d-tor.
1309 * src/graphics/GraphicsCache.C: move include config.h to top, also
1310 put initialization of GraphicsCache::singleton here.
1311 (~GraphicsCache): move here
1312 (addFile): take const ref as arg
1315 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1317 * src/BufferView2.C (insertLyXFile): change te with/without header
1320 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1322 * src/frontends/xforms/FormGraphics.C (apply): add some
1323 static_cast. Not very nice, but required by compaq cxx.
1325 * src/frontends/xforms/RadioButtonGroup.h: include header
1326 <utility> instead of <pair.h>
1328 * src/insets/insetgraphicsParams.C: add using directive.
1329 (readResize): change return type to void.
1330 (readOrigin): ditto.
1332 * src/lyxfunc.C (getStatus): add missing break for build-program
1333 function; add test for Literate for export functions.
1335 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1336 entries in Options menu.
1338 2000-07-31 Baruch Even <baruch.even@writeme.com>
1340 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1341 protect against auto-allocation; release icon when needed.
1343 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1345 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1346 on usual typewriter.
1348 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1349 earlier czech.kmap), useful only for programming.
1351 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1353 * src/frontends/xforms/FormCitation.h: fix conditioning around
1356 2000-07-31 Juergen Vigna <jug@sad.it>
1358 * src/frontends/xforms/FormTabular.C (local_update): changed
1359 radio_linebreaks to radio_useparbox and added radio_useminipage.
1361 * src/tabular.C: made support for using minipages/parboxes.
1363 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1365 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1367 (descent): so the cursor is in the middle.
1368 (width): bit smaller box.
1370 * src/insets/insetgraphics.h: added display() function.
1372 2000-07-31 Baruch Even <baruch.even@writeme.com>
1374 * src/frontends/Dialogs.h: Added showGraphics signals.
1376 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1377 xforms form definition of the graphics dialog.
1379 * src/frontends/xforms/FormGraphics.h:
1380 * src/frontends/xforms/FormGraphics.C: Added files, the
1381 GUIndependent code of InsetGraphics
1383 * src/insets/insetgraphics.h:
1384 * src/insets/insetgraphics.C: Major writing to make it work.
1386 * src/insets/insetgraphicsParams.h:
1387 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1388 struct between InsetGraphics and GUI.
1390 * src/LaTeXFeatures.h:
1391 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1392 support for graphicx package.
1394 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1395 for the graphics inset.
1397 * src/support/translator.h: Added file, used in
1398 InsetGraphicsParams. this is a template to translate between two
1401 * src/frontends/xforms/RadioButtonGroup.h:
1402 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1403 way to easily control a radio button group.
1405 2000-07-28 Juergen Vigna <jug@sad.it>
1407 * src/insets/insettabular.C (LocalDispatch):
1408 (TabularFeatures): added support for lyx-functions of tabular features.
1409 (cellstart): refixed this function after someone wrongly changed it.
1411 * src/commandtags.h:
1412 * src/LyXAction.C (init): added support for tabular-features
1414 2000-07-28 Allan Rae <rae@lyx.org>
1416 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1417 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1418 triggers the callback for input checking. As a result we sometimes get
1419 "LyX: This shouldn't happen..." printed to cerr.
1420 (input): Started using status variable since I only free() on
1421 destruction. Some input checking for paths and font sizes.
1423 * src/frontends/xforms/FormPreferences.h: Use status to control
1424 activation of Ok and Apply
1426 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1427 callback. Also resized to stop segfaults with 0.88. The problem is
1428 that xforms-0.88 requires the folder to be wide enough to fit all the
1429 tabs. If it isn't it causes all sorts of problems.
1431 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1433 * src/frontends/xforms/forms/README: Reflect reality.
1435 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1436 * src/frontends/xforms/forms/makefile: ditto.
1438 * src/commandtags.h: Get access to new Preferences dialog
1439 * src/LyXAction.C: ditto
1440 * src/lyxfunc.C: ditto
1441 * lib/ui/default.ui: ditto
1443 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1445 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1447 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1450 * src/frontends/xforms/form_url.[Ch]: added.
1452 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1454 * src/insets/insetbib.h: fixed bug in previous commit
1456 * src/frontends/xforms/FormUrl.h: ditto
1458 * src/frontends/xforms/FormPrint.h: ditto
1460 * src/frontends/xforms/FormPreferences.h: ditto
1462 * src/frontends/xforms/FormCopyright.h: ditto
1464 * src/frontends/xforms/FormCitation.C: ditto
1466 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1467 private copyconstructor and private default contructor
1469 * src/support/Makefile.am: add utility.hpp
1471 * src/support/utility.hpp: new file from boost
1473 * src/insets/insetbib.h: set owner in clone
1475 * src/frontends/xforms/FormCitation.C: added missing include
1478 * src/insets/form_url.[Ch]: removed
1480 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1482 * development/lyx.spec.in
1483 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1484 file/directory re-organization.
1486 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1488 * src/insets/insetcommand.[Ch]: moved the string data and
1489 associated manipulation methods into a new stand-alone class
1490 InsetCommandParams. This class has two additional methods
1491 getAsString() and setFromString() allowing the contents to be
1492 moved around as a single string.
1493 (addContents) method removed.
1494 (setContents) method no longer virtual.
1496 * src/buffer.C (readInset): made use of new InsetCitation,
1497 InsetUrl constructors based on InsetCommandParams.
1499 * src/commandtags.h: add LFUN_INSERT_URL
1501 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1502 independent InsetUrl and use InsetCommandParams to extract
1503 string info and create new Insets.
1505 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1507 * src/frontends/xforms/FormCitation.C (apply): uses
1510 * src/frontends/xforms/form_url.C
1511 * src/frontends/xforms/form_url.h
1512 * src/frontends/xforms/FormUrl.h
1513 * src/frontends/xforms/FormUrl.C
1514 * src/frontends/xforms/forms/form_url.fd: new files
1516 * src/insets/insetcite.[Ch]: removed unused constructors.
1518 * src/insets/insetinclude.[Ch]: no longer store filename
1520 * src/insets/inseturl.[Ch]: GUI-independent.
1522 2000-07-26 Juergen Vigna <jug@sad.it>
1523 * renamed frontend from gtk to gnome as it is that what is realized
1524 and did the necessary changes in the files.
1526 2000-07-26 Marko Vendelin <markov@ioc.ee>
1528 * configure.in: cleaning up gnome configuration scripts
1530 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1532 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1533 shortcuts syndrom by redrawing them explicitely (a better solution
1534 would be appreciated).
1536 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1538 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1541 * src/lyx_cb.C (MenuExport): change html export to do the right
1542 thing depending of the document type (instead of having
1543 html-linuxdoc and html-docbook).
1544 * src/lyxfunc.C (getStatus): update for html
1545 * lib/ui/default.ui: simplify due to the above change.
1546 * src/menus.C (ShowFileMenu): update too (in case we need it).
1548 * src/MenuBackend.C (read): if a menu is defined twice, add the
1549 new entries to the exiting one.
1551 2000-07-26 Juergen Vigna <jug@sad.it>
1553 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1555 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1556 and return a bool if it did actual save the file.
1557 (AutoSave): don't autosave a unnamed doc.
1559 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1560 check if this is an UNNAMED new file and react to it.
1561 (newFile): set buffer to unnamed and change to not mark a new
1562 buffer dirty if I didn't do anything with it.
1564 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1566 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1568 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1569 friend as per Angus's patch posted to lyx-devel.
1571 * src/ext_l10n.h: updated
1573 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1574 gettext on the style string right before inserting them into the
1577 * autogen.sh: add code to extract style strings form layout files,
1578 not good enough yet.
1580 * src/frontends/gtk/.cvsignore: add MAKEFILE
1582 * src/MenuBackend.C (read): run the label strings through gettext
1583 before storing them in the containers.
1585 * src/ext_l10n.h: new file
1587 * autogen.sh : generate the ext_l10n.h file here
1589 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1591 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1594 * lib/ui/default.ui: fix a couple of typos.
1596 * config/gnome/gtk.m4: added (and added to the list of files in
1599 * src/insets/insetinclude.C (unique_id): fix when we are using
1600 lyxstring instead of basic_string<>.
1601 * src/insets/insettext.C (LocalDispatch): ditto.
1602 * src/support/filetools.C: ditto.
1604 * lib/configure.m4: create the ui/ directory if necessary.
1606 * src/LyXView.[Ch] (updateToolbar): new method.
1608 * src/BufferView_pimpl.C (buffer): update the toolbar when
1609 opening/closing buffer.
1611 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1613 * src/LyXAction.C (getActionName): enhance to return also the name
1614 and options of pseudo-actions.
1615 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1617 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1618 as an example of what is possible). Used in File->Build too (more
1619 useful) and in the import/export menus (to mimick the complicated
1620 handling of linuxdoc and friends). Try to update all the entries.
1622 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1625 * src/MenuBackend.C (read): Parse the new OptItem tag.
1627 * src/MenuBackend.h: Add a new optional_ data member (used if the
1628 entry should be omitted when the lyxfunc is disabled).
1630 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1631 function, used as a shortcut.
1632 (create_submenu): align correctly the shortcuts on the widest
1635 * src/MenuBackend.h: MenuItem.label() only returns the label of
1636 the menu without shortcut; new method shortcut().
1638 2000-07-14 Marko Vendelin <markov@ioc.ee>
1640 * src/frontends/gtk/Dialogs.C:
1641 * src/frontends/gtk/FormCopyright.C:
1642 * src/frontends/gtk/FormCopyright.h:
1643 * src/frontends/gtk/Makefile.am: added these source-files for the
1644 Gtk/Gnome support of the Copyright-Dialog.
1646 * src/main.C: added Gnome::Main initialization if using
1647 Gtk/Gnome frontend-GUI.
1649 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1651 * config/gnome/aclocal-include.m4
1652 * config/gnome/compiler-flags.m4
1653 * config/gnome/curses.m4
1654 * config/gnome/gnome--.m4
1655 * config/gnome/gnome-bonobo-check.m4
1656 * config/gnome/gnome-common.m4
1657 * config/gnome/gnome-fileutils.m4
1658 * config/gnome/gnome-ghttp-check.m4
1659 * config/gnome/gnome-gnorba-check.m4
1660 * config/gnome/gnome-guile-checks.m4
1661 * config/gnome/gnome-libgtop-check.m4
1662 * config/gnome/gnome-objc-checks.m4
1663 * config/gnome/gnome-orbit-check.m4
1664 * config/gnome/gnome-print-check.m4
1665 * config/gnome/gnome-pthread-check.m4
1666 * config/gnome/gnome-support.m4
1667 * config/gnome/gnome-undelfs.m4
1668 * config/gnome/gnome-vfs.m4
1669 * config/gnome/gnome-x-checks.m4
1670 * config/gnome/gnome-xml-check.m4
1671 * config/gnome/gnome.m4
1672 * config/gnome/gperf-check.m4
1673 * config/gnome/gtk--.m4
1674 * config/gnome/linger.m4
1675 * config/gnome/need-declaration.m4: added configuration scripts
1676 for Gtk/Gnome frontend-GUI
1678 * configure.in: added support for the --with-frontend=gtk option
1680 * autogen.sh: added config/gnome/* to list of config-files
1682 * acconfig.h: added define for GTKGUI-support
1684 * config/lyxinclude.m4: added --with-frontend[=value] option value
1685 for Gtk/Gnome frontend-GUI support.
1687 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1689 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1693 * src/paragraph.C (GetChar): remove non-const version
1695 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1696 (search_kw): use it.
1698 * src/lyx_main.C (init): if "preferences" exist, read that instead
1700 (ReadRcFile): return bool if the file could be read ok.
1701 (ReadUIFile): add a check to see if lex file is set ok.
1703 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1704 bastring can be used instead of lyxstring (still uses the old code
1705 if std::string is good enough or if lyxstring is used.)
1707 * src/encoding.C: make the arrays static, move ininle functions
1709 * src/encoding.h: from here.
1711 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1712 (parseSingleLyXformat2Token): move inset parsing to separate method
1713 (readInset): new private method
1715 * src/Variables.h: remove virtual from get().
1717 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1718 access to NEW_INSETS and NEW_TABULAR
1720 * src/MenuBackend.h: remove superfluous forward declaration of
1721 MenuItem. Add documentations tags "///", remove empty MenuItem
1722 destructor, remove private default contructor.
1724 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1726 (read): more string mlabel and mname to where they are used
1727 (read): remove unused variables mlabel and mname
1728 (defaults): unconditional clear, make menusetup take advantage of
1729 add returning Menu &.
1731 * src/LyXView.h: define NEW_MENUBAR as default
1733 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1734 to NEW_INSETS and NEW_TABULAR.
1735 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1736 defined. Change some of the "xxxx-inset-insert" functions names to
1739 * several files: more enahncements to NEW_INSETS and the resulting
1742 * lib/lyxrc.example (\date_insert_format): move to misc section
1744 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1745 bastring and use AC_CACHE_CHECK.
1746 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1747 the system have the newest methods. uses AC_CACHE_CHECK
1748 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1749 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1750 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1752 * configure.in: add LYX_CXX_GOOD_STD_STRING
1754 * acinclude.m4: recreated
1756 2000-07-24 Amir Karger
1758 * README: add Hebrew, Arabic kmaps
1761 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1763 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1766 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1768 * Lot of files: add pragma interface/implementation.
1770 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1772 * lib/ui/default.ui: new file (ans new directory). Contains the
1773 default menu and toolbar.
1775 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1776 global space. Toolbars are now read (as menus) in ui files.
1778 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1780 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1781 is disabled because the document is read-only. We want to have the
1782 toggle state of the function anyway.
1783 (getStatus): add code for LFUN_VC* functions (mimicking what is
1784 done in old-style menus)
1786 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1787 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1789 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1790 * src/BufferView_pimpl.C: ditto.
1791 * src/lyxfunc.C: ditto.
1793 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1794 default). This replaces old-style menus by new ones.
1796 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1797 MenuItem. Contain the data structure of a menu.
1799 * src/insets/insettext.C: use LyXView::setLayout instead of
1800 accessing directly the toolbar combox.
1801 * src/lyxfunc.C (Dispatch): ditto.
1803 * src/LyXView.C (setLayout): new method, which just calls
1804 Toolbar::setLayout().
1805 (updateLayoutChoice): move part of this method in Toolbar.
1807 * src/toolbar.[Ch]: removed.
1809 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1810 implementation the toolbar.
1812 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1813 the toolbar. It might make sense to merge it with ToolbarDefaults
1815 (setLayout): new function.
1816 (updateLayoutList): ditto.
1817 (openLayoutList): ditto.
1819 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1820 xforms implementation of the toolbar.
1821 (get_toolbar_func): comment out, since I do not
1822 know what it is good for.
1824 * src/ToolbarDefaults.h: Add the ItemType enum.
1826 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1827 for a list of allocated C strings. Used in Menubar xforms
1828 implementation to avoid memory leaks.
1830 * src/support/lstrings.[Ch] (uppercase): new version taking and
1834 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1835 * lib/bind/emacs.bind: ditto.
1837 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1839 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1840 forward decl of LyXView.
1842 * src/toolbar.C (toolbarItem): moved from toolbar.h
1843 (toolbarItem::clean): ditto
1844 (toolbarItem::~toolbarItem): ditto
1845 (toolbarItem::operator): ditto
1847 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1849 * src/paragraph.h: control the NEW_TABULAR define from here
1851 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1852 USE_TABULAR_INSETS to NEW_TABULAR
1854 * src/ToolbarDefaults.C: add include "lyxlex.h"
1856 * files using the old table/tabular: use NEW_TABULAR to control
1857 compilation of old tabular stuff.
1859 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1862 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1863 planemet in reading of old style floats, fix the \end_deeper
1864 problem when reading old style floats.
1866 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1868 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1870 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1872 * lib/bind/sciword.bind: updated.
1874 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1876 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1877 layout write problem
1879 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1881 * src/Makefile.am (INCLUDES): remove image directory from include
1884 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1885 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1887 * src/LyXView.C (create_form_form_main): read the application icon
1890 * lib/images/*.xpm: change the icons to use transparent color for
1893 * src/toolbar.C (update): change the color of the button when it
1896 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1898 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1899 setting explicitely the minibuffer.
1900 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1902 * src/LyXView.C (showState): new function. Shows font information
1903 in minibuffer and update toolbar state.
1904 (LyXView): call Toolbar::update after creating the
1907 * src/toolbar.C: change toollist to be a vector instead of a
1909 (BubbleTimerCB): get help string directly from the callback
1910 argument of the corresponding icon (which is the action)
1911 (set): remove unnecessary ugliness.
1912 (update): new function. update the icons (depressed, disabled)
1913 depending of the status of the corresponding action.
1915 * src/toolbar.h: remove help in toolbarItem
1917 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1919 * src/Painter.C (text): Added code for using symbol glyphs from
1920 iso10646 fonts. Currently diabled.
1922 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1925 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1926 magyar,turkish and usorbian.
1928 * src/paragraph.C (isMultiLingual): Made more efficient.
1930 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1933 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1934 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1935 Also changed the prototype to "bool math_insert_greek(char)".
1937 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1939 * lots of files: apply the NEW_INSETS on all code that will not be
1940 needed when we move to use the new insets. Enable the define in
1941 lyxparagrah.h to try it.
1943 * src/insets/insettabular.C (cellstart): change to be a static
1945 (InsetTabular): initialize buffer in the initializer list.
1947 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1949 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1950 form_print.h out of the header file. Replaced with forward
1951 declarations of the relevant struct.
1953 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1956 * src/commandtags.h: do not include "debug.h" which does not
1957 belong there. #include it in some other places because of this
1960 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1962 * src/insets/insetcaption.C: add a couple "using" directives.
1964 * src/toolbar.C (add): get the help text directly from lyxaction.
1966 (setPixmap): new function. Loads from disk and sets a pixmap on a
1967 botton; the name of the pixmap file is derived from the command
1970 * src/toolbar.h: remove members isBitmap and pixmap from
1973 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1974 * lib/images/: move many files from images/banner.xpm.
1976 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1978 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1979 * src/toolbar.C: ditto.
1980 * configure.in: ditto.
1981 * INSTALL: document.
1983 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1984 the spellchecker popup is closed from the WM.
1986 2000-07-19 Juergen Vigna <jug@sad.it>
1988 * src/insets/insetfloat.C (Write): small fix because we use the
1989 insetname for the type now!
1991 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1993 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1996 * src/frontends/Dialogs.h: removed hideCitation signal
1998 * src/insets/insetcite.h: added hide signal
2000 * src/insets/insetcite.C (~InsetCitation): emits new signal
2001 (getScreenLabel): "intelligent" label should now fit on the screen!
2003 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2005 * src/frontends/xforms/FormCitation.C (showInset): connects
2006 hide() to the inset's hide signal
2007 (show): modified to use fl_set_object_position rather than
2008 fl_set_object_geometry wherever possible
2010 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2012 * src/insets/lyxinset.h: add caption code
2014 * src/insets/insetfloat.C (type): new method
2016 * src/insets/insetcaption.C (Write): new method
2018 (LyxCode): new method
2020 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2021 to get it right together with using the FloatList.
2023 * src/commandtags.h: add LFUN_INSET_CAPTION
2024 * src/lyxfunc.C (Dispatch): handle it
2026 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2029 * src/Variables.[Ch]: make expand take a const reference, remove
2030 the destructor, some whitespace changes.
2032 * src/LyXAction.C (init): add caption-inset-insert
2034 * src/FloatList.C (FloatList): update the default floats a bit.
2036 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2038 * src/Variables.[Ch]: new files. Intended to be used for language
2039 specific strings (like \chaptername) and filename substitution in
2042 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2044 * lib/kbd/american.kmap: update
2046 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2048 * src/bufferparams.[Ch]: remove member allowAccents.
2050 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2052 * src/LaTeXLog.C: use the log_form.h header.
2053 * src/lyx_gui.C: ditto.
2054 * src/lyx_gui_misc.C: ditto.
2055 * src/lyxvc.h: ditto.
2057 * forms/log_form.fd: new file, created from latexoptions.fd. I
2058 kept the log popup and nuked the options form.
2060 * src/{la,}texoptions.[Ch]: removed.
2061 * src/lyx_cb.C (LaTeXOptions): ditto
2063 * src/lyx_gui.C (create_forms): do not handle the
2064 fd_latex_options form.
2066 2000-07-18 Juergen Vigna <jug@sad.it>
2068 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2069 name of the inset so that it can be requested outside (text2.C).
2071 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2074 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2076 * src/mathed/formula.h (ConvertFont): constify
2078 * src/mathed/formula.C (Read): add warning if \end_inset is not
2079 found on expected place.
2081 * src/insets/lyxinset.h (ConvertFont): consify
2083 * src/insets/insetquotes.C (ConvertFont): constify
2084 * src/insets/insetquotes.h: ditto
2086 * src/insets/insetinfo.h: add labelfont
2088 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2089 (ascent): use labelfont
2093 (Write): make .lyx file a bit nicer
2095 * src/insets/insetfloat.C (Write): simplify somewhat...
2096 (Read): add warning if arg is not found
2098 * src/insets/insetcollapsable.C: add using std::max
2099 (Read): move string token and add warning in arg is not found
2100 (draw): use std::max to get the right ty
2101 (getMaxWidth): simplify by using std::max
2103 * src/insets/insetsection.h: new file
2104 * src/insets/insetsection.C: new file
2105 * src/insets/insetcaption.h: new file
2106 * src/insets/insetcaption.C: new file
2108 * src/insets/inset.C (ConvertFont): constify signature
2110 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2111 insetcaption.[Ch] and insetsection.[Ch]
2113 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2114 uses to use LABEL_COUNTER_CHAPTER instead.
2115 * src/text2.C (SetCounter): here
2117 * src/counters.h: new file
2118 * src/counters.C: new file
2119 * src/Sectioning.h: new file
2120 * src/Sectioning.C: new file
2122 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2124 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2126 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2129 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2132 2000-07-17 Juergen Vigna <jug@sad.it>
2134 * src/tabular.C (Validate): check if array-package is needed.
2135 (SetVAlignment): added support for vertical alignment.
2136 (SetLTFoot): better support for longtable header/footers
2137 (Latex): modified to support added features.
2139 * src/LaTeXFeatures.[Ch]: added array-package.
2141 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2143 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2146 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2148 * configure.in: do not forget to put a space after -isystem.
2150 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2152 * lib/kbd/arabic.kmap: a few fixes.
2154 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2156 * some whitespace chagnes to a number of files.
2158 * src/support/DebugStream.h: change to make it easier for
2159 doc++ to parse correctly.
2160 * src/support/lyxstring.h: ditto
2162 * src/mathed/math_utils.C (compara): change to have only one
2164 (MathedLookupBOP): change because of the above.
2166 * src/mathed/math_delim.C (math_deco_compare): change to have only
2168 (search_deco): change becasue of the above.
2170 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2171 instead of manually coded one.
2173 * src/insets/insetquotes.C (Read): read the \end_inset too
2175 * src/insets/insetlatex.h: remove file
2176 * src/insets/insetlatex.C: remove file
2178 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2180 (InsetPrintIndex): remove destructor
2182 * src/insets/insetinclude.h: remove default constructor
2184 * src/insets/insetfloat.C: work to make it work better
2186 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2188 * src/insets/insetcite.h (InsetCitation): remove default constructor
2190 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2192 * src/text.C (GetColumnNearX): comment out some currently unused code.
2194 * src/paragraph.C (writeFile): move some initializations closer to
2196 (CutIntoMinibuffer): small change to use new matchIT operator
2200 (InsertInset): ditto
2203 (InsetIterator): ditto
2204 (Erase): small change to use new matchFT operator
2206 (GetFontSettings): ditto
2207 (HighestFontInRange): ditto
2210 * src/lyxparagraph.h: some chars changed to value_type
2211 (matchIT): because of some stronger checking (perhaps too strong)
2212 in SGI STL, the two operator() unified to one.
2215 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2217 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2218 the last inset read added
2219 (parseSingleLyXformat2Token): some more (future) compability code added
2220 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2221 (parseSingleLyXformat2Token): set last_inset_read
2222 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2223 (parseSingleLyXformat2Token): don't double intializw string next_token
2225 * src/TextCache.C (text_fits::operator()): add const's to the signature
2226 (has_buffer::operator()): ditto
2228 * src/Floating.h: add some comments on the class
2230 * src/FloatList.[Ch] (typeExist): new method
2233 * src/BackStack.h: added default constructor, wanted by Gcc.
2235 2000-07-14 Juergen Vigna <jug@sad.it>
2237 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2239 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2241 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2242 do a redraw when the window is resized!
2243 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2245 * src/insets/insettext.C (resizeLyXText): added function to correctly
2246 being able to resize the LyXWindow.
2248 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2250 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2252 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2253 crashes when closing dialog to a deleted inset.
2255 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2256 method! Now similar to other insets.
2258 2000-07-13 Juergen Vigna <jug@sad.it>
2260 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2262 * lib/examples/Literate.lyx: small patch!
2264 * src/insets/insetbib.C (Read): added this function because of wrong
2265 Write (without [begin|end]_inset).
2267 2000-07-11 Juergen Vigna <jug@sad.it>
2269 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2270 as the insertInset could not be good!
2272 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2273 the bool param should not be last.
2275 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2277 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2278 did submit that to Karl).
2280 * configure.in: use -isystem instead of -I for X headers. This
2281 fixes a problem on solaris with a recent gcc;
2282 put the front-end code after the X detection code;
2283 configure in sigc++ before lib/
2285 * src/lyx_main.C (commandLineHelp): remove -display from command
2288 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2290 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2291 Also put in Makefile rules for building the ``listerrors''
2292 program for parsing errors from literate programs written in LyX.
2294 * lib/build-listerrors: Added small shell script as part of compile
2295 process. This builds a working ``listerrors'' binary if noweb is
2296 installed and either 1) the VNC X server is installed on the machine,
2297 or 2) the user is compiling from within a GUI. The existence of a GUI
2298 is necessary to use the ``lyx --export'' feature for now. This
2299 hack can be removed once ``lyx --export'' no longer requires a GUI to
2302 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2304 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2305 now passed back correctly from gcc and placed "under" error
2306 buttons in a Literate LyX source.
2308 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2310 * src/text.C (GetColumnNearX): Better behavior when a RTL
2311 paragraph is ended by LTR text.
2313 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2316 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2318 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2319 true when clipboard is empty.
2321 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2323 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2324 row of the paragraph.
2325 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2326 to prevent calculation of bidi tables
2328 2000-07-07 Juergen Vigna <jug@sad.it>
2330 * src/screen.C (ToggleSelection): added y_offset and x_offset
2333 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2336 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2338 * src/insets/insettext.C: fixed Layout-Display!
2340 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2342 * configure.in: add check for strings.h header.
2344 * src/spellchecker.C: include <strings.h> in order to have a
2345 definition for bzero().
2347 2000-07-07 Juergen Vigna <jug@sad.it>
2349 * src/insets/insettext.C (draw): set the status of the bv->text to
2350 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2352 * src/screen.C (DrawOneRow):
2353 (DrawFromTo): redraw the actual row if something has changed in it
2356 * src/text.C (draw): call an update of the toplevel-inset if something
2357 has changed inside while drawing.
2359 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2361 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2363 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2364 processing inside class.
2366 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2367 processing inside class.
2369 * src/insets/insetindex.h new struct Holder, consistent with other
2372 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2373 citation dialog from main code and placed it in src/frontends/xforms.
2374 Dialog launched through signals instead of callbacks
2376 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2378 * lyx.man: update the options description.
2380 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2382 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2383 handle neg values, set min width to 590, add doc about -display
2385 2000-07-05 Juergen Vigna <jug@sad.it>
2387 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2388 calls to BufferView *.
2390 * src/insets/insettext.C (checkAndActivateInset): small fix non
2391 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2393 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2394 their \end_inset token!
2396 2000-07-04 edscott <edscott@imp.mx>
2398 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2399 lib/lyxrc.example: added option \wheel_jump
2401 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2403 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2404 remove support for -width,-height,-xpos and -ypos.
2406 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2408 * src/encoding.[Ch]: New files.
2410 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2411 (text): Call to the underline() method only when needed.
2413 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2415 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2416 encoding(s) for the document.
2418 * src/bufferparams.C (BufferParams): Changed default value of
2421 * src/language.C (newLang): Removed.
2422 (items[]): Added encoding information for all defined languages.
2424 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2425 encoding choice button.
2427 * src/lyxrc.h (font_norm_type): New member variable.
2428 (set_font_norm_type): New method.
2430 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2431 paragraphs with different encodings.
2433 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2434 (TransformChar): Changed to work correctly with Arabic points.
2435 (draw): Added support for drawing Arabic points.
2436 (draw): Removed code for drawing underbars (this is done by
2439 * src/support/textutils.h (IsPrintableNonspace): New function.
2441 * src/BufferView_pimpl.h: Added "using SigC::Object".
2442 * src/LyXView.h: ditto.
2444 * src/insets/insetinclude.h (include_label): Changed to mutable.
2446 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2448 * src/mathed/math_iter.h: remove empty destructor
2450 * src/mathed/math_cursor.h: remove empty destructor
2452 * src/insets/lyxinset.h: add THEOREM_CODE
2454 * src/insets/insettheorem.[Ch]: new files
2456 * src/insets/insetminipage.C: (InsertInset): remove
2458 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2460 (InsertInset): remove
2462 * src/insets/insetlist.C: (InsertList): remove
2464 * src/insets/insetfootlike.[Ch]: new files
2466 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2469 (InsertInset): ditto
2471 * src/insets/insetert.C: remove include Painter.h, reindent
2472 (InsertInset): move to header
2474 * src/insets/insetcollapsable.h: remove explicit from default
2475 contructor, remove empty destructor, add InsertInset
2477 * src/insets/insetcollapsable.C (InsertInset): new func
2479 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2481 * src/vspace.h: add explicit to constructor
2483 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2484 \textcompwordmark, please test this.
2486 * src/lyxrc.C: set ascii_linelen to 65 by default
2488 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2490 * src/commandtags.h: add LFUN_INSET_THEOREM
2492 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2493 (makeLinuxDocFile): remove _some_ of the nice logic
2494 (makeDocBookFile): ditto
2496 * src/Painter.[Ch]: (~Painter): removed
2498 * src/LyXAction.C (init): entry for insettheorem added
2500 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2502 (deplog): code to detect files generated by LaTeX, needs testing
2505 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2507 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2509 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2511 * src/LaTeX.C (deplog): Add a check for files that are going to be
2512 created by the first latex run, part of the project to remove the
2515 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2516 contents to the extension list.
2518 2000-07-04 Juergen Vigna <jug@sad.it>
2520 * src/text.C (NextBreakPoint): added support for needFullRow()
2522 * src/insets/lyxinset.h: added needFullRow()
2524 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2527 * src/insets/insettext.C: lots of changes for update!
2529 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2531 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2533 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2535 * src/insets/insetinclude.C (InsetInclude): fixed
2536 initialization of include_label.
2537 (unique_id): now returns a string.
2539 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2541 * src/LaTeXFeatures.h: new member IncludedFiles, for
2542 a map of key, included file name.
2544 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2545 with the included files for inclusion in SGML preamble,
2546 i. e., linuxdoc and docbook.
2549 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2550 nice (is the generated linuxdoc code to be exported?), that
2551 allows to remove column, and only_body that will be true for
2552 slave documents. Insets are allowed inside SGML font type.
2553 New handling of the SGML preamble for included files.
2554 (makeDocBookFile): the same for docbook.
2556 * src/insets/insetinclude.h:
2557 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2559 (DocBook): new export methods.
2561 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2562 and makeDocBookFile.
2564 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2565 formats to export with command line argument -x.
2567 2000-06-29 Juergen Vigna <jug@sad.it>
2569 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2570 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2572 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2573 region could already been cleared by an inset!
2575 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2577 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2580 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2582 (cursorToggle): remove special handling of lyx focus.
2584 2000-06-28 Juergen Vigna <jug@sad.it>
2586 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2589 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2591 * src/insets/insetindex.C (Edit): add a callback when popup is
2594 * src/insets/insettext.C (LocalDispatch):
2595 * src/insets/insetmarginal.h:
2596 * src/insets/insetlist.h:
2597 * src/insets/insetfoot.h:
2598 * src/insets/insetfloat.h:
2599 * src/insets/insetert.h: add a missing std:: qualifier.
2601 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2603 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2606 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2608 * src/insets/insettext.C (Read): remove tmptok unused variable
2609 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2610 (InsertInset): change for new InsetInset code
2612 * src/insets/insettext.h: add TEXT inline method
2614 * src/insets/insettext.C: remove TEXT macro
2616 * src/insets/insetmarginal.C (Write): new method
2617 (Latex): change output slightly
2619 * src/insets/insetfoot.C (Write): new method
2620 (Latex): change output slightly (don't use endl when no need)
2622 * src/insets/insetert.C (Write): new method
2624 * src/insets/insetcollapsable.h: make button_length, button_top_y
2625 and button_bottm_y protected.
2627 * src/insets/insetcollapsable.C (Write): simplify code by using
2628 tostr. Also do not output the float name, the children class
2629 should to that to get control over own arguments
2631 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2632 src/insets/insetminipage.[Ch]:
2635 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2637 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2639 * src/Makefile.am (lyx_SOURCES): add the new files
2641 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2642 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2643 * src/commandtags.h: ditto
2645 * src/LaTeXFeatures.h: add a std::set of used floattypes
2647 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2649 * src/FloatList.[Ch] src/Floating.h: new files
2651 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2653 * src/lyx_cb.C (TableApplyCB): ditto
2655 * src/text2.C: ditto
2656 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2657 (parseSingleLyXformat2Token): ditto + add code for
2658 backwards compability for old float styles + add code for new insets
2660 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2662 (InsertInset(size_type, Inset *, LyXFont)): new method
2663 (InsetChar(size_type, char)): changed to use the other InsetChar
2664 with a LyXFont(ALL_INHERIT).
2665 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2666 insert the META_INSET.
2668 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2670 * sigc++/thread.h (Threads): from here
2672 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2673 definition out of line
2674 * sigc++/scope.h: from here
2676 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2678 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2679 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2681 * Makefile.am (bindist): new target.
2683 * INSTALL: add instructions for doing a binary distribution.
2685 * development/tools/README.bin.example: update a bit.
2687 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2690 * lib/lyxrc.example: new lyxrc tag \set_color.
2692 * src/lyxfunc.C (Dispatch):
2693 * src/commandtags.h:
2694 * src/LyXAction.C: new lyxfunc "set-color".
2696 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2697 and an x11name given as strings.
2699 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2700 cache when a color is changed.
2702 2000-06-26 Juergen Vigna <jug@sad.it>
2704 * src/lyxrow.C (width): added this functions and variable.
2706 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2709 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2711 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2713 * images/undo_bw.xpm: new icon.
2714 * images/redo_bw.xpm: ditto.
2716 * configure.in (INSTALL_SCRIPT): change value to
2717 ${INSTALL} to avoid failures of install-script target.
2718 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2720 * src/BufferView.h: add a magic "friend" declaration to please
2723 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2725 * forms/cite.fd: modified to allow resizing without messing
2728 * src/insetcite.C: Uses code from cite.fd almost without
2730 User can now resize dialog in the x-direction.
2731 Resizing the dialog in the y-direction is prevented, as the
2732 code does this intelligently already.
2734 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2736 * INSTALL: remove obsolete entry in "problems" section.
2738 * lib/examples/sl_*.lyx: update of the slovenian examples.
2740 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2742 2000-06-23 Juergen Vigna <jug@sad.it>
2744 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2746 * src/buffer.C (resize): delete the LyXText of textinsets.
2748 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2750 * src/insets/lyxinset.h: added another parameter 'cleared' to
2751 the draw() function.
2753 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2754 unlocking inset in inset.
2756 2000-06-22 Juergen Vigna <jug@sad.it>
2758 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2759 of insets and moved first to LyXText.
2761 * src/mathed/formulamacro.[Ch]:
2762 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2764 2000-06-21 Juergen Vigna <jug@sad.it>
2766 * src/text.C (GetVisibleRow): look if I should clear the area or not
2767 using Inset::doClearArea() function.
2769 * src/insets/lyxinset.h: added doClearArea() function and
2770 modified draw(Painter &, ...) to draw(BufferView *, ...)
2772 * src/text2.C (UpdateInset): return bool insted of int
2774 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2776 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2777 combox in the character popup
2779 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2780 BufferParams const & params
2782 2000-06-20 Juergen Vigna <jug@sad.it>
2784 * src/insets/insettext.C (SetParagraphData): set insetowner on
2787 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2789 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2790 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2792 (form_main_): remove
2794 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2795 (create_form_form_main): remove FD_form_main stuff, connect to
2796 autosave_timeout signal
2798 * src/LyXView.[Ch] (getMainForm): remove
2799 (UpdateTimerCB): remove
2800 * src/BufferView_pimpl.h: inherit from SigC::Object
2802 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2803 signal instead of callback
2805 * src/BufferView.[Ch] (cursorToggleCB): remove
2807 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2809 * src/BufferView_pimpl.C: changes because of the one below
2811 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2812 instead of storing a pointer to a LyXText.
2814 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2816 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2818 * src/lyxparagraph.h
2820 * src/paragraph.C: Changed fontlist to a sorted vector.
2822 2000-06-19 Juergen Vigna <jug@sad.it>
2824 * src/BufferView.h: added screen() function.
2826 * src/insets/insettext.C (LocalDispatch): some selection code
2829 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2831 * src/insets/insettext.C (SetParagraphData):
2833 (InsetText): fixes for multiple paragraphs.
2835 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2837 * development/lyx.spec.in: Call configure with ``--without-warnings''
2838 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2839 This should be fine, however, since we generally don't want to be
2840 verbose when making an RPM.
2842 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2844 * lib/scripts/fig2pstex.py: New file
2846 2000-06-16 Juergen Vigna <jug@sad.it>
2848 * src/insets/insettabular.C (UpdateLocal):
2849 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2850 (LocalDispatch): Changed all functions to use LyXText.
2852 2000-06-15 Juergen Vigna <jug@sad.it>
2854 * src/text.C (SetHeightOfRow): call inset::update before requesting
2857 * src/insets/insettext.C (update):
2858 * src/insets/insettabular.C (update): added implementation
2860 * src/insets/lyxinset.h: added update function
2862 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2864 * src/text.C (SelectNextWord): protect against null pointers with
2865 old-style string streams. (fix from Paul Theo Gonciari
2868 * src/cite.[Ch]: remove erroneous files.
2870 * lib/configure.m4: update the list of created directories.
2872 * src/lyxrow.C: include <config.h>
2873 * src/lyxcursor.C: ditto.
2875 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2877 * lib/examples/decimal.lyx: new example file from Mike.
2879 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2880 to find template definitions (from Dekel)
2882 * src/frontends/.cvsignore: add a few things.
2884 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2886 * src/Timeout.C (TimeOut): remove default argument.
2888 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2891 * src/insets/ExternalTemplate.C: add a "using" directive.
2893 * src/lyx_main.h: remove the act_ struct, which seems unused
2896 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2898 * LyX Developers Meeting: All files changed, due to random C++ (by
2899 coincidence) code generator script.
2901 - external inset (cool!)
2902 - initial online editing of preferences
2903 - insettabular breaks insettext(s contents)
2905 - some DocBook fixes
2906 - example files update
2907 - other cool stuff, create a diff and look for yourself.
2909 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2911 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2912 -1 this is a non-line-breaking textinset.
2914 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2915 if there is no width set.
2917 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2919 * Lots of files: Merged the dialogbase branch.
2921 2000-06-09 Allan Rae <rae@lyx.org>
2923 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2924 and the Dispatch methods that used it.
2926 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2927 access to functions formerly kept in Dispatch.
2929 2000-05-19 Allan Rae <rae@lyx.org>
2931 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2932 made to_page and count_copies integers again. from_page remains a
2933 string however because I want to allow entry of a print range like
2934 "1,4,22-25" using this field.
2936 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2937 and printer-params-get. These aren't useful from the minibuffer but
2938 could be used by a script/LyXServer app provided it passes a suitable
2939 auto_mem_buffer. I guess I should take a look at how the LyXServer
2940 works and make it support xtl buffers.
2942 * sigc++/: updated to libsigc++-1.0.1
2944 * src/xtl/: updated to xtl-1.3.pl.11
2946 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2947 those changes done to the files in src/ are actually recreated when
2948 they get regenerated. Please don't ever accept a patch that changes a
2949 dialog unless that patch includes the changes to the corresponding *.fd
2952 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2953 stringOnlyContains, renamed it and generalised it.
2955 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2956 branch. Removed the remaining old form_print code.
2958 2000-04-26 Allan Rae <rae@lyx.org>
2960 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2961 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2963 2000-04-25 Allan Rae <rae@lyx.org>
2965 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2966 against a base of xtl-1.3.pl.4
2968 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2969 filter the Id: entries so they still show the xtl version number
2972 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2973 into the src/xtl code. Patch still pending with José (XTL)
2975 2000-04-24 Allan Rae <rae@lyx.org>
2977 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2978 both more generic and much safer. Use the new template functions.
2979 * src/buffer.[Ch] (Dispatch): ditto.
2981 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2982 and mem buffer more intelligently. Also a little general cleanup.
2985 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2986 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2987 * src/xtl/Makefile.am: ditto.
2988 * src/xtl/.cvsignore: ditto.
2989 * src/Makefile.am: ditto.
2991 * src/PrinterParams.h: Removed the macros member functions. Added a
2992 testInvariant member function. A bit of tidying up and commenting.
2993 Included Angus's idea for fixing operation with egcs-1.1.2.
2995 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2996 cool expansion of XTL's mem_buffer to support automatic memory
2997 management within the buffer itself. Removed the various macros and
2998 replaced them with template functions that use either auto_mem_buffer
2999 or mem_buffer depending on a #define. The mem_buffer support will
3000 disappear as soon as the auto_mem_buffer is confirmed to be good on
3001 other platforms/compilers. That is, it's there so you've got something
3004 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3005 effectively forked XTL. However I expect José will include my code
3006 into the next major release. Also fixed a memory leak.
3007 * src/xtl/text.h: ditto.
3008 * src/xtl/xdr.h: ditto.
3009 * src/xtl/giop.h: ditto.
3011 2000-04-16 Allan Rae <rae@lyx.org>
3013 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3014 by autogen.sh and removed by maintainer-clean anyway.
3015 * .cvsignore, sigc++/.cvsignore: Support the above.
3017 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3019 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3021 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3022 macros, renamed static callback-target member functions to suit new
3023 scheme and made them public.
3024 * src/frontends/xforms/forms/form_print.fd: ditto.
3025 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3027 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3030 * src/xtl/: New directory containing a minimal distribution of XTL.
3031 This is XTL-1.3.pl.4.
3033 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3035 2000-04-15 Allan Rae <rae@lyx.org>
3037 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3039 * sigc++/: Updated to libsigc++-1.0.0
3041 2000-04-14 Allan Rae <rae@lyx.org>
3043 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3044 use the generic ones in future. I'll modify my conversion script.
3046 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3048 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3049 (CloseAllBufferRelatedDialogs): Renamed.
3050 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3052 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3053 of the generic ones. These are the same ones my conversion script
3056 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3057 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3058 * src/buffer.C (Dispatch): ditto
3060 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3061 functions for updating and hiding buffer dependent dialogs.
3062 * src/BufferView.C (buffer): ditto
3063 * src/buffer.C (setReadonly): ditto
3064 * src/lyxfunc.C (CloseBuffer): ditto
3066 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3067 Dialogs.h, and hence all the SigC stuff, into every file that includes
3068 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3070 * src/BufferView2.C: reduce the number of headers included by buffer.h
3072 2000-04-11 Allan Rae <rae@lyx.org>
3074 * src/frontends/xforms/xform_macros.h: A small collection of macros
3075 for building C callbacks.
3077 * src/frontends/xforms/Makefile.am: Added above file.
3079 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3080 scheme again. This time it should work for JMarc. If this is
3081 successful I'll revise my conversion script to automate some of this.
3082 The static member functions in the class also have to be public for
3083 this scheme will work. If the scheme works (it's almost identical to
3084 the way BufferView::cursorToggleCB is handled so it should work) then
3085 FormCopyright and FormPrint will be ready for inclusion into the main
3086 trunk immediately after 1.1.5 is released -- provided we're prepared
3087 for complaints about lame compilers not handling XTL.
3089 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3091 2000-04-07 Allan Rae <rae@lyx.org>
3093 * config/lyxinclude.m4: A bit more tidying up (Angus)
3095 * src/LString.h: JMarc's <string> header fix
3097 * src/PrinterParams.h: Used string for most data to remove some
3098 ugly code in the Print dialog and avoid even uglier code when
3099 appending the ints to a string for output.
3101 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3102 and moved "default:" back to the end of switch statement. Cleaned
3103 up the printing so it uses the right function calls and so the
3104 "print to file" option actually puts the file in the right directory.
3106 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3108 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3109 and Ok+Apply button control into a separate method: input (Angus).
3110 (input) Cleaned it up and improved it to be very thorough now.
3111 (All CB) static_cast used instead of C style cast (Angus). This will
3112 probably change again once we've worked out how to keep gcc-2.8.1 happy
3113 with real C callbacks.
3114 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3115 ignore some of the bool settings and has random numbers instead. Needs
3116 some more investigation. Added other input length checks and checking
3117 of file and printer names.
3119 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3120 would link (Angus). Seems the old code doesn't compile with the pragma
3121 statement either. Separated callback entries from internal methods.
3123 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3125 2000-03-17 Allan Rae <rae@lyx.org>
3127 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3128 need it? Maybe it could go in Dialogs instead? I could make it a
3129 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3130 values to get the bool return value.
3131 (Dispatch): New overloaded method for xtl support.
3133 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3134 extern "C" callback instead of static member functions. Hopefully,
3135 JMarc will be able to compile this. I haven't changed
3136 forms/form_copyright.fd yet. Breaking one of my own rules already.
3138 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3139 because they aren't useful from the minibuffer. Maybe a LyXServer
3140 might want a help message though?
3142 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3144 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3145 xtl which needs both rtti and exceptions.
3147 * src/support/Makefile.am:
3148 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3150 * src/frontends/xforms/input_validators.[ch]: input filters and
3151 validators. These conrol what keys are valid in input boxes.
3152 Use them and write some more. Much better idea than waiting till
3153 after the user has pressed Ok to say that the input fields don't make
3156 * src/frontends/xforms/Makefile.am:
3157 * src/frontends/xforms/forms/form_print.fd:
3158 * src/frontends/xforms/forms/makefile:
3159 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3160 new scheme. Still have to make sure I haven't missed anything from
3161 the current implementation.
3163 * src/Makefile.am, src/PrinterParams.h: New data store.
3165 * other files: Added a couple of copyright notices.
3167 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3169 * src/insets/insetbib.h: move Holder struct in public space.
3171 * src/frontends/include/DialogBase.h: use SigC:: only when
3172 SIGC_CXX_NAMESPACES is defined.
3173 * src/frontends/include/Dialogs.h: ditto.
3175 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3177 * src/frontends/xforms/FormCopyright.[Ch]: do not
3178 mention SigC:: explicitely.
3180 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3182 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3183 deals with testing KDE in main configure.in
3184 * configure.in: ditto.
3186 2000-02-22 Allan Rae <rae@lyx.org>
3188 * Lots of files: Merged from HEAD
3190 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3191 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3193 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3195 * sigc++/: new minidist.
3197 2000-02-14 Allan Rae <rae@lyx.org>
3199 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3201 2000-02-08 Juergen Vigna <jug@sad.it>
3203 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3204 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3206 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3207 for this port and so it is much easier for other people to port
3208 dialogs in a common development environment.
3210 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3211 the QT/KDE implementation.
3213 * src/frontends/kde/Dialogs.C:
3214 * src/frontends/kde/FormCopyright.C:
3215 * src/frontends/kde/FormCopyright.h:
3216 * src/frontends/kde/Makefile.am:
3217 * src/frontends/kde/formcopyrightdialog.C:
3218 * src/frontends/kde/formcopyrightdialog.h:
3219 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3220 for the kde support of the Copyright-Dialog.
3222 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3223 subdir-substitution instead of hardcoded 'xforms' as we now have also
3226 * src/frontends/include/DialogBase.h (Object): just commented the
3227 label after #endif (nasty warning and I don't like warnings ;)
3229 * src/main.C (main): added KApplication initialization if using
3232 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3233 For now only the KDE event-loop is added if frontend==kde.
3235 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3237 * configure.in: added support for the --with-frontend[=value] option
3239 * autogen.sh: added kde.m4 file to list of config-files
3241 * acconfig.h: added define for KDEGUI-support
3243 * config/kde.m4: added configuration functions for KDE-port
3245 * config/lyxinclude.m4: added --with-frontend[=value] option with
3246 support for xforms and KDE.
3248 2000-02-08 Allan Rae <rae@lyx.org>
3250 * all Makefile.am: Fixed up so the make targets dist, distclean,
3251 install and uninstall all work even if builddir != srcdir. Still
3252 have a new sigc++ minidist update to come.
3254 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3256 2000-02-01 Allan Rae <rae@lyx.org>
3258 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3259 Many mods to get builddir != srcdir working.
3261 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3262 for building on NT and so we can do the builddir != srcdir stuff.
3264 2000-01-30 Allan Rae <rae@lyx.org>
3266 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3267 This will stay in "rae" branch. We probably don't really need it in
3268 the main trunk as anyone who wants to help programming it should get
3269 a full library installed also. So they can check both included and
3270 system supplied library compilation.
3272 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3273 Added a 'mini' distribution of libsigc++. If you feel the urge to
3274 change something in these directories - Resist it. If you can't
3275 resist the urge then you should modify the following script and rebuild
3276 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3277 all happen. Still uses a hacked version of libsigc++'s configure.in.
3278 I'm quite happy with the results. I'm not sure the extra work to turn
3279 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3280 worth the trouble and would probably lead to extra maintenance
3282 I haven't tested the following important make targets: install, dist.
3283 Not ready for prime time but very close. Maybe 1.1.5.
3285 * development/tools/makeLyXsigc.sh: A shell script to automatically
3286 generate our mini-dist of libsigc++. It can only be used with a CVS
3287 checkout of libsigc++ not a tarball distribution. It's well commented.
3288 This will end up as part of the libsigc++ distribution so other apps
3289 can easily have an included mini-dist. If someone makes mods to the
3290 sigc++ subpackage without modifying this script to generate those
3291 changes I'll be very upset!
3293 * src/frontends/: Started the gui/system indep structure.
3295 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3296 to access the gui-indep dialogs are in this class. Much improved
3297 design compared to previous revision. Lars, please refrain from
3298 moving this header into src/ like you did with Popups.h last time.
3300 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3302 * src/frontends/xforms/: Started the gui-indep system with a single
3303 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3306 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3307 Here you'll find a very useful makefile and automated fdfix.sh that
3308 makes updating dailogs a no-brainer -- provided you follow the rules
3309 set out in the README. I'm thinking about adding another script to
3310 automatically generate skeleton code for a new dialog given just the
3313 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3314 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3315 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3317 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3319 * src/support/LSubstring.C (operator): simplify
3321 * src/lyxtext.h: removed bparams, use buffer_->params instead
3323 * src/lyxrow.h: make Row a real class, move all variables to
3324 private and use accessors.
3326 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3328 (isRightToLeftPar): ditto
3329 (ChangeLanguage): ditto
3330 (isMultiLingual): ditto
3333 (SimpleTeXOnePar): ditto
3334 (TeXEnvironment): ditto
3335 (GetEndLabel): ditto
3337 (SetOnlyLayout): ditto
3338 (BreakParagraph): ditto
3339 (BreakParagraphConservative): ditto
3340 (GetFontSettings): ditto
3342 (CopyIntoMinibuffer): ditto
3343 (CutIntoMinibuffer): ditto
3344 (PasteParagraph): ditto
3345 (SetPExtraType): ditto
3346 (UnsetPExtraType): ditto
3347 (DocBookContTableRows): ditto
3348 (SimpleDocBookOneTablePar): ditto
3350 (TeXFootnote): ditto
3351 (SimpleTeXOneTablePar): ditto
3352 (TeXContTableRows): ditto
3353 (SimpleTeXSpecialChars): ditto
3356 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3357 to private and use accessors.
3359 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3360 this, we did not use it anymore and has not been for ages. Just a
3361 waste of cpu cycles.
3363 * src/language.h: make Language a real class, move all variables
3364 to private and use accessors.
3366 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3367 (create_view): remove
3368 (update): some changes for new timer
3369 (cursorToggle): use new timer
3370 (beforeChange): change for new timer
3372 * src/BufferView.h (cursorToggleCB): removed last paramter because
3375 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3376 (cursorToggleCB): change because of new timer code
3378 * lib/CREDITS: updated own mailaddress
3380 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3382 * src/support/filetools.C (PutEnv): fix the code in case neither
3383 putenv() nor setenv() have been found.
3385 * INSTALL: mention the install-strip Makefile target.
3387 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3388 read-only documents.
3390 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3392 * lib/reLyX/configure.in (VERSION): avoid using a previously
3393 generated reLyX wrapper to find out $prefix.
3395 * lib/examples/eu_adibide_lyx-atua.lyx:
3396 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3397 translation of the Tutorial (Dooteo)
3399 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3401 * forms/cite.fd: new citation dialog
3403 * src/insetcite.[Ch]: the new citation dialog is moved into
3406 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3409 * src/insets/insetcommand.h: data members made private.
3411 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3413 * LyX 1.1.5 released
3415 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3417 * src/version.h (LYX_RELEASE): to 1.1.5
3419 * src/spellchecker.C (RunSpellChecker): return false if the
3420 spellchecker dies upon creation.
3422 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3424 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3425 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3429 * lib/CREDITS: update entry for Martin Vermeer.
3431 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3433 * src/text.C (draw): Draw foreign language bars at the bottom of
3434 the row instead of at the baseline.
3436 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3438 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3440 * lib/bind/de_menus.bind: updated
3442 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3444 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3446 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3448 * src/menus.C (Limit_string_length): New function
3449 (ShowTocMenu): Limit the number of items/length of items in the
3452 * src/paragraph.C (String): Correct result for a paragraph inside
3455 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3457 * src/bufferlist.C (close): test of buf->getuser() == NULL
3459 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3461 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3462 Do not call to SetCursor when the paragraph is a closed footnote!
3464 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3466 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3469 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3471 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3474 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3475 reference popup, that activates the reference-back action
3477 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3479 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3480 the menus. Also fixed a bug.
3482 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3483 the math panels when switching buffers (unless new buffer is readonly).
3485 * src/BufferView.C (NoSavedPositions)
3486 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3488 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3490 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3491 less of dvi dirty or not.
3493 * src/trans_mgr.[Ch] (insert): change first parameter to string
3496 * src/chset.[Ch] (encodeString): add const to first parameter
3498 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3500 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3504 * src/LaTeX.C (deplog): better searching for dependency files in
3505 the latex log. Uses now regexps.
3507 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3508 instead of the box hack or \hfill.
3510 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3512 * src/lyxfunc.C (doImportHelper): do not create the file before
3513 doing the actual import.
3514 (doImportASCIIasLines): create a new file before doing the insert.
3515 (doImportASCIIasParagraphs): ditto.
3517 * lib/lyxrc.example: remove mention of non-existing commands
3519 * lyx.man: remove mention of color-related switches.
3521 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3523 * src/lyx_gui.C: remove all the color-related ressources, which
3524 are not used anymore.
3526 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3529 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3531 * src/lyxrc.C (read): Add a missing break in the switch
3533 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3535 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3537 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3540 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3542 * src/text.C (draw): draw bars under foreign language words.
3544 * src/LColor.[Ch]: add LColor::language
3546 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3548 * src/lyxcursor.h (boundary): New member variable
3550 * src/text.C (IsBoundary): New methods
3552 * src/text.C: Use the above for currect cursor movement when there
3553 is both RTL & LTR text.
3555 * src/text2.C: ditto
3557 * src/bufferview_funcs.C (ToggleAndShow): ditto
3559 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3561 * src/text.C (DeleteLineForward): set selection to true to avoid
3562 that DeleteEmptyParagraphMechanism does some magic. This is how it
3563 is done in all other functions, and seems reasonable.
3564 (DeleteWordForward): do not jump over non-word stuff, since
3565 CursorRightOneWord() already does it.
3567 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3568 DeleteWordBackward, since they seem safe to me (since selection is
3569 set to "true") DeleteEmptyParagraphMechanism does nothing.
3571 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3573 * src/lyx_main.C (easyParse): simplify the code by factoring the
3574 part that removes parameters from the command line.
3575 (LyX): check wether wrong command line options have been given.
3577 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3579 * src/lyx_main.C : add support for specifying user LyX
3580 directory via command line option -userdir.
3582 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3584 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3585 the number of items per popup.
3586 (Add_to_refs_menu): Ditto.
3588 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3590 * src/lyxparagraph.h: renamed ClearParagraph() to
3591 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3592 textclass as parameter, and do nothing if free_spacing is
3593 true. This fixes part of the line-delete-forward problems.
3595 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3596 (pasteSelection): ditto.
3597 (SwitchLayoutsBetweenClasses): more translatable strings.
3599 * src/text2.C (CutSelection): use StripLeadingSpaces.
3600 (PasteSelection): ditto.
3601 (DeleteEmptyParagraphMechanism): ditto.
3603 2000-05-26 Juergen Vigna <jug@sad.it>
3605 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3606 is not needed in tabular insets.
3608 * src/insets/insettabular.C (TabularFeatures): added missing features.
3610 * src/tabular.C (DeleteColumn):
3612 (AppendRow): implemented this functions
3613 (cellsturct::operator=): clone the inset too;
3615 2000-05-23 Juergen Vigna <jug@sad.it>
3617 * src/insets/insettabular.C (LocalDispatch): better selection support
3618 when having multicolumn-cells.
3620 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3622 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3624 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3626 * src/ColorHandler.C (getGCForeground): put more test into _()
3628 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3631 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3634 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3636 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3637 there are no labels, or when buffer is readonly.
3639 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3640 there are no labels, buffer is SGML, or when buffer is readonly.
3642 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3644 * src/LColor.C (LColor): change a couple of grey40 to grey60
3645 (LColor): rewore initalization to make compiles go some magnitude
3647 (getGUIName): don't use gettext until we need the string.
3649 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3651 * src/Bullet.[Ch]: Fixed a small bug.
3653 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3655 * src/paragraph.C (String): Several fixes/improvements
3657 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3659 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3661 * src/paragraph.C (String): give more correct output.
3663 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3665 * src/lyxfont.C (stateText) Do not output the language if it is
3666 eqaul to the language of the document.
3668 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3669 between two paragraphs with the same language.
3671 * src/paragraph.C (getParLanguage) Return a correct answer for an
3672 empty dummy paragraph.
3674 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3677 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3680 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3681 the menus/popup, if requested fonts are unavailable.
3683 2000-05-22 Juergen Vigna <jug@sad.it>
3685 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3686 movement support (Up/Down/Tab/Shift-Tab).
3687 (LocalDispatch): added also preliminari cursor-selection.
3689 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3691 * src/paragraph.C (PasteParagraph): Hopefully now right!
3693 2000-05-22 Garst R. Reese <reese@isn.net>
3695 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3696 of list, change all references to Environment to Command
3697 * tex/hollywood.cls : rewrite environments as commands, add
3698 \uppercase to interiorshot and exteriorshot to force uppecase.
3699 * tex/broadway.cls : rewrite environments as commands. Tweak
3702 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3704 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3705 size of items: use a constant intead of the hardcoded 40, and more
3706 importantly do not remove the %m and %x tags added at the end.
3707 (Add_to_refs_menu): use vector::size_type instead of
3708 unsigned int as basic types for the variables. _Please_ do not
3709 assume that size_t is equal to unsigned int. On an alpha, this is
3710 unsigned long, which is _not_ the same.
3712 * src/language.C (initL): remove language "hungarian", since it
3713 seems that "magyar" is better.
3715 2000-05-22 Juergen Vigna <jug@sad.it>
3717 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3719 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3722 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3723 next was deleted but not set to 0.
3725 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3727 * src/language.C (initL): change the initialization of languages
3728 so that compiles goes _fast_.
3730 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3733 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3735 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3739 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3741 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3743 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3747 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3750 * src/insets/insetlo*.[Ch]: Made editable
3752 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3754 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3755 the current selection.
3757 * src/BufferView_pimpl.C (stuffClipboard): new method
3759 * src/BufferView.C (stuffClipboard): new method
3761 * src/paragraph.C (String): new method
3763 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3764 LColor::ignore when lyxname is not found.
3766 * src/BufferView.C (pasteSelection): new method
3768 * src/BufferView_pimpl.C (pasteSelection): new method
3770 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3772 * src/WorkArea.C (request_clipboard_cb): new static function
3773 (getClipboard): new method
3774 (putClipboard): new method
3776 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3778 * LyX 1.1.5pre2 released
3780 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3782 * src/vspace.C (operator=): removed
3783 (operator=): removed
3785 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3787 * src/layout.C (NumberOfClass): manually set the type in make_pair
3788 (NumberOfLayout): ditto
3790 * src/language.C: use the Language constructor for ignore_lang
3792 * src/language.h: add constructors to struct Language
3794 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3796 * src/text2.C (SetCursorIntern): comment out #warning
3798 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3800 * src/mathed/math_iter.h: initialize sx and sw to 0
3802 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3804 * forms/lyx.fd: Redesign of form_ref
3806 * src/LaTeXFeatures.[Ch]
3810 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3813 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3814 and Buffer::inset_iterator.
3816 * src/menus.C: Added new menus: TOC and Refs.
3818 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3820 * src/buffer.C (getTocList): New method.
3822 * src/BufferView2.C (ChangeRefs): New method.
3824 * src/buffer.C (getLabelList): New method. It replaces the old
3825 getReferenceList. The return type is vector<string> instead of
3828 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3829 the old getLabel() and GetNumberOfLabels() methods.
3830 * src/insets/insetlabel.C (getLabelList): ditto
3831 * src/mathed/formula.C (getLabelList): ditto
3833 * src/paragraph.C (String): New method.
3835 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3836 Uses the new getTocList() method.
3837 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3838 which automatically updates the contents of the browser.
3839 (RefUpdateCB): Use the new getLabelList method.
3841 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3843 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3845 * src/spellchecker.C: Added using std::reverse;
3847 2000-05-19 Juergen Vigna <jug@sad.it>
3849 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3851 * src/insets/insettext.C (computeTextRows): small fix for display of
3852 1 character after a newline.
3854 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3857 2000-05-18 Juergen Vigna <jug@sad.it>
3859 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3860 when changing width of column.
3862 * src/tabular.C (set_row_column_number_info): setting of
3863 autobreak rows if necessary.
3865 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3867 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3869 * src/vc-backend.*: renamed stat() to status() and vcstat to
3870 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3871 compilation broke. The new name seems more relevant, anyway.
3873 2000-05-17 Juergen Vigna <jug@sad.it>
3875 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3876 which was wrong if the removing caused removing of rows!
3878 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3879 (pushToken): new function.
3881 * src/text2.C (CutSelection): fix problem discovered with purify
3883 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3885 * src/debug.C (showTags): enlarge the first column, now that we
3886 have 6-digits debug codes.
3888 * lib/layouts/hollywood.layout:
3889 * lib/tex/hollywood.cls:
3890 * lib/tex/brodway.cls:
3891 * lib/layouts/brodway.layout: more commands and fewer
3892 environments. Preambles moved in the .cls files. Broadway now has
3893 more options on scene numbering and less whitespace (from Garst)
3895 * src/insets/insetbib.C (getKeys): make sure that we are in the
3896 document directory, in case the bib file is there.
3898 * src/insets/insetbib.C (Latex): revert bogus change.
3900 2000-05-16 Juergen Vigna <jug@sad.it>
3902 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3903 the TabularLayout on cursor move.
3905 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3907 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3910 (draw): fixed cursor position and drawing so that the cursor is
3911 visible when before the tabular-inset.
3913 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3914 when creating from old insettext.
3916 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3918 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3920 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3921 * lib/tex/brodway.cls: ditto
3923 * lib/layouts/brodway.layout: change alignment of parenthical
3926 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3928 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3929 versions 0.88 and 0.89 are supported.
3931 2000-05-15 Juergen Vigna <jug@sad.it>
3933 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3936 * src/insets/insettext.C (computeTextRows): redone completely this
3937 function in a much cleaner way, because of problems when having a
3939 (draw): added a frame border when the inset is locked.
3940 (SetDrawLockedFrame): this sets if we draw the border or not.
3941 (SetFrameColor): this sets the frame color (default=insetframe).
3943 * src/insets/lyxinset.h: added x() and y() functions which return
3944 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3945 function which is needed to see if we have a locking inset of some
3946 type in this inset (needed for now in insettabular).
3948 * src/vspace.C (inPixels): the same function also without a BufferView
3949 parameter as so it is easier to use it in some ocasions.
3951 * src/lyxfunc.C: changed all places where insertInset was used so
3952 that now if it couldn't be inserted it is deleted!
3954 * src/TabularLayout.C:
3955 * src/TableLayout.C: added support for new tabular-inset!
3957 * src/BufferView2.C (insertInset): this now returns a bool if the
3958 inset was really inserted!!!
3960 * src/tabular.C (GetLastCellInRow):
3961 (GetFirstCellInRow): new helper functions.
3962 (Latex): implemented for new tabular class.
3966 (TeXTopHLine): new Latex() helper functions.
3968 2000-05-12 Juergen Vigna <jug@sad.it>
3970 * src/mathed/formulamacro.C (Read):
3971 * src/mathed/formula.C (Read): read also the \end_inset here!
3973 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3975 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3976 crush when saving formulae with unbalanced parenthesis.
3978 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3980 * src/layout.C: Add new keyword "endlabelstring" to layout file
3982 * src/text.C (GetVisibleRow): Draw endlabel string.
3984 * lib/layouts/broadway.layout
3985 * lib/layouts/hollywood.layout: Added endlabel for the
3986 Parenthetical layout.
3988 * lib/layouts/heb-article.layout: Do not use slanted font shape
3989 for Theorem like environments.
3991 * src/buffer.C (makeLaTeXFile): Always add "american" to
3992 the UsedLanguages list if document language is RTL.
3994 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3996 * add addendum to README.OS2 and small patch (from SMiyata)
3998 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4000 * many files: correct the calls to ChangeExtension().
4002 * src/support/filetools.C (ChangeExtension): remove the no_path
4003 argument, which does not belong there. Use OnlyFileName() instead.
4005 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4006 files when LaTeXing a non-nice latex file.
4008 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4009 a chain of "if". Return false when deadkeys are not handled.
4011 * src/lyx_main.C (LyX): adapted the code for default bindings.
4013 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4014 bindings for basic functionality (except deadkeys).
4015 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4017 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4018 several methods: handle override_x_deadkeys.
4020 * src/lyxrc.h: remove the "bindings" map, which did not make much
4021 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4023 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4025 * src/lyxfont.C (stateText): use a saner method to determine
4026 whether the font is "default". Seems to fix the crash with DEC
4029 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4031 2000-05-08 Juergen Vigna <jug@sad.it>
4033 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4034 TabularLayoutMenu with mouse-button-3
4035 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4037 * src/TabularLayout.C: added this file for having a Layout for
4040 2000-05-05 Juergen Vigna <jug@sad.it>
4042 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4043 recalculating inset-widths.
4044 (TabularFeatures): activated this function so that I can change
4045 tabular-features via menu.
4047 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4048 that I can test some functions with the Table menu.
4050 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4052 * src/lyxfont.C (stateText): guard against stupid c++libs.
4054 * src/tabular.C: add using std::vector
4055 some whitespace changes, + removed som autogenerated code.
4057 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4059 2000-05-05 Juergen Vigna <jug@sad.it>
4061 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4062 row, columns and cellstructures.
4064 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4066 * lib/lyxrc.example: remove obsolete entries.
4068 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4069 reading of protected_separator for free_spacing.
4071 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4073 * src/text.C (draw): do not display an exclamation mark in the
4074 margin for margin notes. This is confusing, ugly and
4077 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4078 AMS math' is checked.
4080 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4081 name to see whether including the amsmath package is needed.
4083 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4085 * src/paragraph.C (validate): Compute UsedLanguages correctly
4086 (don't insert the american language if it doesn't appear in the
4089 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4090 The argument of \thanks{} command is considered moving argument
4092 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4095 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4097 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4098 for appendix/minipage/depth. The lines can be now both in the footnote
4099 frame, and outside the frame.
4101 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4104 2000-05-05 Juergen Vigna <jug@sad.it>
4106 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4107 neede only in tabular.[Ch].
4109 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4111 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4113 (Write): write '~' for PROTECTED_SEPARATOR
4115 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4117 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4120 * src/mathed/formula.C (drawStr): rename size to siz.
4122 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4123 possibly fix a bug by not changing the pflags = flags to piflags =
4126 2000-05-05 Juergen Vigna <jug@sad.it>
4128 * src/insets/insetbib.C: moved using directive
4130 * src/ImportNoweb.C: small fix for being able to compile (missing
4133 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4135 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4136 to use clear, since we don't depend on this in the code. Add test
4139 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4141 * (various *.C files): add using std::foo directives to please dec
4144 * replace calls to string::clear() to string::erase() (Angus)
4146 * src/cheaders/cmath: modified to provide std::abs.
4148 2000-05-04 Juergen Vigna <jug@sad.it>
4150 * src/insets/insettext.C: Prepared all for inserting of multiple
4151 paragraphs. Still display stuff to do (alignment and other things),
4152 but I would like to use LyXText to do this when we cleaned out the
4153 table-support stuff.
4155 * src/insets/insettabular.C: Changed lot of stuff and added lots
4156 of functionality still a lot to do.
4158 * src/tabular.C: Various functions changed name and moved to be
4159 const functions. Added new Read and Write functions and changed
4160 lots of things so it works good with tabular-insets (also removed
4161 some stuff which is not needed anymore * hacks *).
4163 * src/lyxcursor.h: added operators == and != which just look if
4164 par and pos are (not) equal.
4166 * src/buffer.C (latexParagraphs): inserted this function to latex
4167 all paragraphs form par to endpar as then I can use this too for
4170 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4171 so that I can call this to from text insets with their own cursor.
4173 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4174 output off all paragraphs (because of the fix below)!
4176 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4177 the very last paragraph (this could be also the last paragraph of an
4180 * src/texrow.h: added rows() call which returns the count-variable.
4182 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4184 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4186 * lib/configure.m4: better autodetection of DocBook tools.
4188 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4190 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4192 * src/lyx_cb.C: add using std::reverse;
4194 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4197 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4198 selected files. Should fix repeated errors from generated files.
4200 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4202 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4204 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4205 the spellchecker popup.
4207 * lib/lyxrc.example: Removed the \number_inset section
4209 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4211 * src/insets/figinset.C (various): Use IsFileReadable() to make
4212 sure that the file actually exist. Relying on ghostscripts errors
4213 is a bad idea since they can lead to X server crashes.
4215 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4217 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4220 * lib/lyxrc.example: smallish typo in description of
4221 \view_dvi_paper_option
4223 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4226 * src/lyxfunc.C: doImportHelper to factor out common code of the
4227 various import methods. New functions doImportASCIIasLines,
4228 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4229 doImportLinuxDoc for the format specific parts.
4232 * buffer.C: Dispatch returns now a bool to indicate success
4235 * lyx_gui.C: Add getLyXView() for member access
4237 * lyx_main.C: Change logic for batch commands: First try
4238 Buffer::Dispatch (possibly without GUI), if that fails, use
4241 * lyx_main.C: Add support for --import command line switch.
4242 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4243 Available Formats: Everything accepted by 'buffer-import <format>'
4245 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4247 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4250 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4251 documents will be reformatted upon reentry.
4253 2000-04-27 Juergen Vigna <jug@sad.it>
4255 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4256 correctly only last pos this was a bug.
4258 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4260 * release of lyx-1.1.5pre1
4262 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4264 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4266 * src/menus.C: revert the change of naming (Figure->Graphic...)
4267 from 2000-04-11. It was incomplete and bad.
4269 * src/LColor.[Ch]: add LColor::depthbar.
4270 * src/text.C (GetVisibleRow): use it.
4272 * README: update the languages list.
4274 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4276 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4279 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4281 * README: remove sections that were just wrong.
4283 * src/text2.C (GetRowNearY): remove currentrow code
4285 * src/text.C (GetRow): remove currentrow code
4287 * src/screen.C (Update): rewritten a bit.
4288 (SmallUpdate): removed func
4290 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4292 (FullRebreak): return bool
4293 (currentrow): remove var
4294 (currentrow_y): ditto
4296 * src/lyxscreen.h (Draw): change arg to unsigned long
4297 (FitCursor): return bool
4298 (FitManualCursor): ditto
4299 (Smallpdate): remove func
4300 (first): change to unsigned long
4301 (DrawOneRow): change second arg to long (from long &)
4302 (screen_refresh_y): remove var
4303 (scree_refresh_row): ditto
4305 * src/lyxrow.h: change baseline to usigned int from unsigned
4306 short, this brings some implicit/unsigned issues out in the open.
4308 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4310 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4311 instead of smallUpdate.
4313 * src/lyxcursor.h: change y to unsigned long
4315 * src/buffer.h: don't call updateScrollbar after fitcursor
4317 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4318 where they are used. Removed "\\direction", this was not present
4319 in 1.1.4 and is already obsolete. Commented out some code that I
4320 believe to never be called.
4321 (runLiterate): don't call updateScrollbar after fitCursor
4323 (buildProgram): ditto
4326 * src/WorkArea.h (workWidth): change return val to unsigned
4329 (redraw): remove the button redraws
4330 (setScrollbarValue): change for scrollbar
4331 (getScrollbarValue): change for scrollbar
4332 (getScrollbarBounds): change for scrollbar
4334 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4335 (C_WorkArea_down_cb): removed func
4336 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4337 (resize): change for scrollbar
4338 (setScrollbar): ditto
4339 (setScrollbarBounds): ditto
4340 (setScrollbarIncrements): ditto
4341 (up_cb): removed func
4342 (down_cb): removed func
4343 (scroll_cb): change for scrollbar
4344 (work_area_handler): ditto
4346 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4347 when FitCursor did something.
4348 (updateScrollbar): some unsigned changes
4349 (downCB): removed func
4350 (scrollUpOnePage): removed func
4351 (scrollDownOnePage): remvoed func
4352 (workAreaMotionNotify): don't call screen->FitCursor but use
4353 fitCursor instead. and bool return val
4354 (workAreaButtonPress): ditto
4355 (workAreaButtonRelease): some unsigned changes
4356 (checkInsetHit): ditto
4357 (workAreaExpose): ditto
4358 (update): parts rewritten, comments about the signed char arg added
4359 (smallUpdate): removed func
4360 (cursorPrevious): call needed updateScrollbar
4363 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4366 * src/BufferView.[Ch] (upCB): removed func
4367 (downCB): removed func
4368 (smallUpdate): removed func
4370 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4372 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4373 currentrow, currentrow_y optimization. This did not help a lot and
4374 if we want to do this kind of optimization we should rather use
4375 cursor.row instead of the currentrow.
4377 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4378 buffer spacing and klyx spacing support.
4380 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4382 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4385 2000-04-26 Juergen Vigna <jug@sad.it>
4387 * src/insets/figinset.C: fixes to Lars sstream changes!
4389 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4391 * A lot of files: Added Ascii(ostream &) methods to all inset
4392 classes. Used when exporting to ASCII.
4394 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4395 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4398 * src/text2.C (ToggleFree): Disabled implicit word selection when
4399 there is a change in the language
4401 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4402 no output was generated for end-of-sentence inset.
4404 * src/insets/lyxinset.h
4407 * src/paragraph.C: Removed the insetnumber code
4409 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4411 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4413 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4414 no_babel and no_epsfig completely from the file.
4415 (parseSingleLyXformat2Token): add handling for per-paragraph
4416 spacing as written by klyx.
4418 * src/insets/figinset.C: applied patch by Andre. Made it work with
4421 2000-04-20 Juergen Vigna <jug@sad.it>
4423 * src/insets/insettext.C (cutSelection):
4424 (copySelection): Fixed with selection from right to left.
4425 (draw): now the rows are not recalculated at every draw.
4426 (computeTextRows): for now reset the inset-owner here (this is
4427 important for an undo or copy where the inset-owner is not set
4430 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4431 motion to the_locking_inset screen->first was forgotten, this was
4432 not important till we got multiline insets.
4434 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4436 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4437 code seems to be alright (it is code changed by Dekel, and the
4438 intent is indeed that all macros should be defined \protect'ed)
4440 * NEWS: a bit of reorganisation of the new user-visible features.
4442 2000-04-19 Juergen Vigna <jug@sad.it>
4444 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4445 position. Set the inset_owner of the used paragraph so that it knows
4446 that it is inside an inset. Fixed cursor handling with mouse and
4447 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4448 and cleanups to make TextInsets work better.
4450 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4451 Changed parameters of various functions and added LockInsetInInset().
4453 * src/insets/insettext.C:
4455 * src/insets/insetcollapsable.h:
4456 * src/insets/insetcollapsable.C:
4457 * src/insets/insetfoot.h:
4458 * src/insets/insetfoot.C:
4459 * src/insets/insetert.h:
4460 * src/insets/insetert.C: cleaned up the code so that it works now
4461 correctly with insettext.
4463 * src/insets/inset.C:
4464 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4465 that insets in insets are supported right.
4468 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4470 * src/paragraph.C: some small fixes
4472 * src/debug.h: inserted INSETS debug info
4474 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4475 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4477 * src/commandtags.h:
4478 * src/LyXAction.C: insert code for InsetTabular.
4480 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4481 not Button1MotionMask.
4482 (workAreaButtonRelease): send always a InsetButtonRelease event to
4484 (checkInsetHit): some setCursor fixes (always with insets).
4486 * src/BufferView2.C (lockInset): returns a bool now and extended for
4487 locking insets inside insets.
4488 (showLockedInsetCursor): it is important to have the cursor always
4489 before the locked inset.
4490 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4492 * src/BufferView.h: made lockInset return a bool.
4494 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4496 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4497 that is used also internally but can be called as public to have back
4498 a cursor pos which is not set internally.
4499 (SetCursorIntern): Changed to use above function.
4501 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4503 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4508 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4509 patches for things that should be in or should be changed.
4511 * src/* [insetfiles]: change "usigned char fragile" to bool
4512 fragile. There was only one point that could that be questioned
4513 and that is commented in formulamacro.C. Grep for "CHECK".
4515 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4516 (DeleteBuffer): take it out of CutAndPaste and make it static.
4518 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4520 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4521 output the spacing envir commands. Also the new commands used in
4522 the LaTeX output makes the result better.
4524 * src/Spacing.C (writeEnvirBegin): new method
4525 (writeEnvirEnd): new method
4527 2000-04-18 Juergen Vigna <jug@sad.it>
4529 * src/CutAndPaste.C: made textclass a static member of the class
4530 as otherwise it is not accesed right!!!
4532 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4534 * forms/layout_forms.fd
4535 * src/layout_forms.h
4536 * src/layout_forms.C (create_form_form_character)
4537 * src/lyx_cb.C (UserFreeFont)
4538 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4539 documents (in the layout->character popup).
4541 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4543 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4544 \spell_command was in fact not honored (from Kevin Atkinson).
4546 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4549 * src/lyx_gui.h: make lyxViews private (Angus)
4551 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4553 * src/mathed/math_write.C
4554 (MathMatrixInset::Write) Put \protect before \begin{array} and
4555 \end{array} if fragile
4556 (MathParInset::Write): Put \protect before \\ if fragile
4558 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4560 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4561 initialization if the LyXColorHandler must be done after the
4562 connections to the XServer has been established.
4564 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4565 get the background pixel from the lyxColorhandler so that the
4566 figures are rendered with the correct background color.
4567 (NextToken): removed functions.
4568 (GetPSSizes): use ifs >> string instead of NextToken.
4570 * src/Painter.[Ch]: the color cache moved out of this file.
4572 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4575 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4577 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4578 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4580 * src/BufferView.C (enterView): new func
4581 (leaveView): new func
4583 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4585 (leaveView): new func, undefines xterm cursor when approp.
4587 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4588 (AllowInput): delete the Workarea cursor handling from this func.
4590 * src/Painter.C (underline): draw a slimer underline in most cases.
4592 * src/lyx_main.C (error_handler): use extern "C"
4594 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4596 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4597 sent directly to me.
4599 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4600 to the list by Dekel.
4602 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4605 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4606 methods from lyx_cb.here.
4608 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4611 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4613 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4614 instead of using current_view directly.
4616 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4618 * src/LyXAction.C (init): add the paragraph-spacing command.
4620 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4622 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4624 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4625 different from the documents.
4627 * src/text.C (SetHeightOfRow): take paragraph spacing into
4628 account, paragraph spacing takes precedence over buffer spacing
4629 (GetVisibleRow): ditto
4631 * src/paragraph.C (writeFile): output the spacing parameter too.
4632 (validate): set the correct features if spacing is used in the
4634 (Clear): set spacing to default
4635 (MakeSameLayout): spacing too
4636 (HasSameLayout): spacing too
4637 (SetLayout): spacing too
4638 (TeXOnePar): output the spacing commands
4640 * src/lyxparagraph.h: added a spacing variable for use with
4641 per-paragraph spacing.
4643 * src/Spacing.h: add a Default spacing and a method to check if
4644 the current spacing is default. also added an operator==
4646 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4649 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4651 * src/lyxserver.C (callback): fix dispatch of functions
4653 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4654 printf() into lyxerr call.
4656 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4659 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4660 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4661 the "Float" from each of the subitems.
4662 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4664 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4665 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4666 documented the change so that the workaround can be nuked later.
4668 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4671 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4673 * src/buffer.C (getLatexName): ditto
4674 (setReadonly): ditto
4676 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4678 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4679 avoid some uses of current_view. Added also a bufferParams()
4680 method to get at this.
4682 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4684 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4686 * src/lyxparagraph.[Ch]: removed
4687 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4688 with operators used by lower_bound and
4689 upper_bound in InsetTable's
4690 Make struct InsetTable private again. Used matchpos.
4692 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4694 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4695 document, the language of existing text is changed (unless the
4696 document is multi-lingual)
4698 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4700 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4702 * A lot of files: A rewrite of the Right-to-Left support.
4704 2000-04-10 Juergen Vigna <jug@sad.it>
4706 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4707 misplaced cursor when inset in inset is locked.
4709 * src/insets/insettext.C (LocalDispatch): small fix so that a
4710 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4712 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4713 footnote font should be decreased in size twice when displaying.
4715 * src/insets/insettext.C (GetDrawFont): inserted this function as
4716 the drawing-font may differ from the real paragraph font.
4718 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4719 insets (inset in inset!).
4721 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4722 function here because we don't want footnotes inside footnotes.
4724 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4726 (init): now set the inset_owner in paragraph.C
4727 (LocalDispatch): added some resetPos() in the right position
4730 (pasteSelection): changed to use the new CutAndPaste-Class.
4732 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4733 which tells if it is allowed to insert another inset inside this one.
4735 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4736 SwitchLayoutsBetweenClasses.
4738 * src/text2.C (InsertInset): checking of the new paragraph-function
4740 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4741 is not needed anymore here!
4744 (PasteSelection): redone (also with #ifdef) so that now this uses
4745 the CutAndPaste-Class.
4746 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4749 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4750 from/to text/insets.
4752 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4753 so that the paragraph knows if it is inside an (text)-inset.
4754 (InsertFromMinibuffer): changed return-value to bool as now it
4755 may happen that an inset is not inserted in the paragraph.
4756 (InsertInsetAllowed): this checks if it is allowed to insert an
4757 inset in this paragraph.
4759 (BreakParagraphConservative):
4760 (BreakParagraph) : small change for the above change of the return
4761 value of InsertFromMinibuffer.
4763 * src/lyxparagraph.h: added inset_owner and the functions to handle
4764 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4766 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4768 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4769 functions from BufferView to BufferView::Pimpl to ease maintence.
4771 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4772 correctly. Also use SetCursorIntern instead of SetCursor.
4774 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4777 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4779 * src/WorkArea.C (belowMouse): manually implement below mouse.
4781 * src/*: Add "explicit" on several constructors, I added probably
4782 some unneeded ones. A couple of changes to code because of this.
4784 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4785 implementation and private parts from the users of BufferView. Not
4788 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4789 implementation and private parts from the users of LyXLex. Not
4792 * src/BufferView_pimpl.[Ch]: new files
4794 * src/lyxlex_pimpl.[Ch]: new files
4796 * src/LyXView.[Ch]: some inline functions move out-of-line
4798 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4800 * src/lyxparagraph.h: make struct InsetTable public.
4802 * src/support/lyxstring.h: change lyxstring::difference_type to be
4803 ptrdiff_t. Add std:: modifiers to streams.
4805 * src/font.C: include the <cctype> header, for islower() and
4808 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4810 * src/font.[Ch]: new files. Contains the metric functions for
4811 fonts, takes a LyXFont as parameter. Better separation of concepts.
4813 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4814 changes because of this.
4816 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4818 * src/*: compile with -Winline and move functions that don't
4821 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4824 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4826 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4827 (various files changed because of this)
4829 * src/Painter.C (text): fixed the drawing of smallcaps.
4831 * src/lyxfont.[Ch] (drawText): removed unused member func.
4834 * src/*.C: added needed "using" statements and "std::" qualifiers.
4836 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4838 * src/*.h: removed all use of "using" from header files use
4839 qualifier std:: instead.
4841 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4843 * src/text.C (Backspace): some additional cleanups (we already
4844 know whether cursor.pos is 0 or not).
4846 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4847 automake does not provide one).
4849 * src/bmtable.h: replace C++ comments with C comments.
4851 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4853 * src/screen.C (ShowCursor): Change the shape of the cursor if
4854 the current language is not equal to the language of the document.
4855 (If the cursor change its shape unexpectedly, then you've found a bug)
4857 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4860 * src/insets/insetnumber.[Ch]: New files.
4862 * src/LyXAction.C (init)
4863 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4866 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4868 * src/lyxparagraph.h
4869 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4870 (the vector is kept sorted).
4872 * src/text.C (GetVisibleRow): Draw selection correctly when there
4873 is both LTR and RTL text.
4875 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4876 which is much faster.
4878 * src/text.C (GetVisibleRow and other): Do not draw the last space
4879 in a row if the direction of the last letter is not equal to the
4880 direction of the paragraph.
4882 * src/lyxfont.C (latexWriteStartChanges):
4883 Check that font language is not equal to basefont language.
4884 (latexWriteEndChanges): ditto
4886 * src/lyx_cb.C (StyleReset): Don't change the language while using
4887 the font-default command.
4889 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4890 empty paragraph before a footnote.
4892 * src/insets/insetcommand.C (draw): Increase x correctly.
4894 * src/screen.C (ShowCursor): Change cursor shape if
4895 current language != document language.
4897 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4899 2000-03-31 Juergen Vigna <jug@sad.it>
4901 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4902 (Clone): changed mode how the paragraph-data is copied to the
4903 new clone-paragraph.
4905 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4906 GetInset(pos) with no inset anymore there (in inset UNDO)
4908 * src/insets/insetcommand.C (draw): small fix as here x is
4909 incremented not as much as width() returns (2 before, 2 behind = 4)
4911 2000-03-30 Juergen Vigna <jug@sad.it>
4913 * src/insets/insettext.C (InsetText): small fix in initialize
4914 widthOffset (should not be done in the init() function)
4916 2000-03-29 Amir Karger <karger@lyx.org>
4918 * lib/examples/it_ItemizeBullets.lyx: translation by
4921 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4923 2000-03-29 Juergen Vigna <jug@sad.it>
4925 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4927 * src/insets/insetfoot.C (Clone): small change as for the below
4928 new init function in the text-inset
4930 * src/insets/insettext.C (init): new function as I've seen that
4931 clone did not copy the Paragraph-Data!
4932 (LocalDispatch): Added code so that now we have some sort of Undo
4933 functionality (well actually we HAVE Undo ;)
4935 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4937 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4939 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4942 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4944 * src/main.C: added a runtime check that verifies that the xforms
4945 header used when building LyX and the library used when running
4946 LyX match. Exit with a message if they don't match. This is a
4947 version number check only.
4949 * src/buffer.C (save): Don't allocate memory on the heap for
4950 struct utimbuf times.
4952 * *: some using changes, use iosfwd instead of the real headers.
4954 * src/lyxfont.C use char const * instead of string for the static
4955 strings. Rewrite some functions to use sstream.
4957 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4959 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4962 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4964 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4965 of Geodesy (from Martin Vermeer)
4967 * lib/layouts/svjour.inc: include file for the Springer svjour
4968 class. It can be used to support journals other than JoG.
4970 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4971 Miskiewicz <misiek@pld.org.pl>)
4972 * lib/reLyX/Makefile.am: ditto.
4974 2000-03-27 Juergen Vigna <jug@sad.it>
4976 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4977 also some modifications with operations on selected text.
4979 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4980 problems with clicking on insets (last famous words ;)
4982 * src/insets/insetcommand.C (draw):
4983 (width): Changed to have a bit of space before and after the inset so
4984 that the blinking cursor can be seen (otherwise it was hidden)
4986 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4988 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4989 would not be added to the link list when an installed gettext (not
4990 part of libc) is found.
4992 2000-03-24 Juergen Vigna <jug@sad.it>
4994 * src/insets/insetcollapsable.C (Edit):
4995 * src/mathed/formula.C (InsetButtonRelease):
4996 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4999 * src/BufferView.C (workAreaButtonPress):
5000 (workAreaButtonRelease):
5001 (checkInsetHit): Finally fixed the clicking on insets be handled
5004 * src/insets/insetert.C (Edit): inserted this call so that ERT
5005 insets work always with LaTeX-font
5007 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5009 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5010 caused lyx to startup with no GUI in place, causing in a crash
5011 upon startup when called with arguments.
5013 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5015 * src/FontLoader.C: better initialization of dummyXFontStruct.
5017 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5019 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5020 for linuxdoc and docbook import and export format options.
5022 * lib/lyxrc.example Example of default values for the previous flags.
5024 * src/lyx_cb.C Use those flags instead of the hardwired values for
5025 linuxdoc and docbook export.
5027 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5030 * src/menus.C Added menus entries for the new import/exports formats.
5032 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5034 * src/lyxrc.*: Added support for running without Gui
5037 * src/FontLoader.C: sensible defaults if no fonts are needed
5039 * src/lyx_cb.C: New function ShowMessage (writes either to the
5040 minibuffer or cout in case of no gui
5041 New function AskOverwrite for common stuff
5042 Consequently various changes to call these functions
5044 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5045 wild guess at sensible screen resolution when having no gui
5047 * src/lyxfont.C: no gui, no fonts... set some defaults
5049 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5051 * src/LColor.C: made the command inset background a bit lighter.
5053 2000-03-20 Hartmut Goebel <goebel@noris.net>
5055 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5056 stdstruct.inc. Koma-Script added some title elements which
5057 otherwise have been listed below "bibliography". This split allows
5058 adding title elements to where they belong.
5060 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5061 define the additional tilte elements and then include
5064 * many other layout files: changed to include stdtitle.inc just
5065 before stdstruct.inc.
5067 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5069 * src/buffer.C: (save) Added the option to store all backup files
5070 in a single directory
5072 * src/lyxrc.[Ch]: Added variable \backupdir_path
5074 * lib/lyxrc.example: Added descriptions of recently added variables
5076 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5077 bibtex inset, not closing the bibtex popup when deleting the inset)
5079 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5081 * src/lyx_cb.C: add a couple using directives.
5083 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5084 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5085 import based on the filename.
5087 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5088 file would be imported at start, if the filename where of a sgml file.
5090 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5092 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5094 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5095 * src/lyxfont.h Replaced the member variable bits.direction by the
5096 member variable lang. Made many changes in other files.
5097 This allows having a multi-lingual document
5099 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5100 that change the current language to <l>.
5101 Removed the command "font-rtl"
5103 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5104 format for Hebrew documents)
5106 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5107 When auto_mathmode is "true", pressing a digit key in normal mode
5108 will cause entering into mathmode.
5109 If auto_mathmode is "rtl" then this behavior will be active only
5110 when writing right-to-left text.
5112 * src/text2.C (InsertStringA) The string is inserted using the
5115 * src/paragraph.C (GetEndLabel) Gives a correct result for
5116 footnote paragraphs.
5118 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5120 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5122 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5123 front of PasteParagraph. Never insert a ' '. This should at least
5124 fix some cause for the segfaults that we have been experiencing,
5125 it also fixes backspace behaviour slightly. (Phu!)
5127 * src/support/lstrings.C (compare_no_case): some change to make it
5128 compile with gcc 2.95.2 and stdlibc++-v3
5130 * src/text2.C (MeltFootnoteEnvironment): change type o
5131 first_footnote_par_is_not_empty to bool.
5133 * src/lyxparagraph.h: make text private. Changes in other files
5135 (fitToSize): new function
5136 (setContentsFromPar): new function
5137 (clearContents): new function
5138 (SetChar): new function
5140 * src/paragraph.C (readSimpleWholeFile): deleted.
5142 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5143 the file, just use a simple string instead. Also read the file in
5144 a more maintainable manner.
5146 * src/text2.C (InsertStringA): deleted.
5147 (InsertStringB): deleted.
5149 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5151 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5152 RedoParagraphs from the doublespace handling part, just set status
5153 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5154 done, but perhaps not like this.)
5156 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5158 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5159 character when inserting an inset.
5161 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5163 * src/bufferparams.C (readLanguage): now takes "default" into
5166 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5167 also initialize the toplevel_keymap with the default bindings from
5170 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5172 * all files using lyxrc: have lyxrc as a real variable and not a
5173 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5176 * src/lyxrc.C: remove double call to defaultKeyBindings
5178 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5179 toolbar defauls using lyxlex. Remove enums, structs, functions
5182 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5183 toolbar defaults. Also store default keybindings in a map.
5185 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5186 storing the toolbar defaults without any xforms dependencies.
5188 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5189 applied. Changed to use iterators.
5191 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5193 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5194 systems that don't have LINGUAS set to begin with.
5196 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5198 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5199 the list by Dekel Tsur.
5201 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5203 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5204 * src/insets/form_graphics.C: ditto.
5206 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5208 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5210 * src/bufferparams.C (readLanguage): use the new language map
5212 * src/intl.C (InitKeyMapper): use the new language map
5214 * src/lyx_gui.C (create_forms): use the new language map
5216 * src/language.[Ch]: New files. Used for holding the information
5217 about each language. Now! Use this new language map enhance it and
5218 make it really usable for our needs.
5220 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5222 * screen.C (ShowCursor): Removed duplicate code.
5223 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5224 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5226 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5229 * src/text.C Added TransformChar method. Used for rendering Arabic
5230 text correctly (change the glyphs of the letter according to the
5231 position in the word)
5236 * src/lyxrc.C Added lyxrc command {language_command_begin,
5237 language_command_end,language_command_ltr,language_command_rtl,
5238 language_package} which allows the use of either arabtex or Omega
5241 * src/lyx_gui.C (init)
5243 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5244 to use encoding for menu fonts which is different than the encoding
5247 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5248 do not load the babel package.
5249 To write an English document with Hebrew/Arabic, change the document
5250 language to "english".
5252 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5253 (alphaCounter): changed to return char
5254 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5256 * lib/lyxrc.example Added examples for Hebrew/Arabic
5259 * src/layout.C Added layout command endlabeltype
5261 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5263 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5265 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5267 * src/mathed/math_delim.C (search_deco): return a
5268 math_deco_struct* instead of index.
5270 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5272 * All files with a USE_OSTREAM_ONLY within: removed all code that
5273 was unused when USE_OSTREAM_ONLY is defined.
5275 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5276 of any less. Removed header and using.
5278 * src/text.C (GetVisibleRow): draw the string "Page Break
5279 (top/bottom)" on screen when drawing a pagebreak line.
5281 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5283 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5285 * src/mathed/math_macro.C (draw): do some cast magic.
5288 * src/mathed/math_defs.h: change byte* argument to byte const*.
5290 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5292 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5293 know it is right to return InsetFoot* too, but cxx does not like
5296 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5298 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5300 * src/mathed/math_delim.C: change == to proper assignment.
5302 2000-03-09 Juergen Vigna <jug@sad.it>
5304 * src/insets/insettext.C (setPos): fixed various cursor positioning
5305 problems (via mouse and cursor-keys)
5306 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5307 inset (still a small display problem but it works ;)
5309 * src/insets/insetcollapsable.C (draw): added button_top_y and
5310 button_bottom_y to have correct values for clicking on the inset.
5312 * src/support/lyxalgo.h: commented out 'using std::less'
5314 2000-03-08 Juergen Vigna <jug@sad.it>
5316 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5317 Button-Release event closes as it is alos the Release-Event
5320 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5322 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5324 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5325 can add multiple spaces in Scrap (literate programming) styles...
5326 which, by the way, is how I got hooked on LyX to begin with.
5328 * src/mathed/formula.C (Write): Added dummy variable to an
5329 inset::Latex() call.
5330 (Latex): Add free_spacing boolean to inset::Latex()
5332 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5334 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5335 virtual function to include the free_spacing boolean from
5336 the containing paragraph's style.
5338 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5339 Added free_spacing boolean arg to match inset.h
5341 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5342 Added free_spacing boolean arg to match inset.h
5344 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5345 Added free_spacing boolean and made sure that if in a free_spacing
5346 paragraph, that we output normal space if there is a protected space.
5348 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5349 Added free_spacing boolean arg to match inset.h
5351 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5352 Added free_spacing boolean arg to match inset.h
5354 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5355 Added free_spacing boolean arg to match inset.h
5357 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5358 Added free_spacing boolean arg to match inset.h
5360 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5361 Added free_spacing boolean arg to match inset.h
5363 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5364 free_spacing boolean arg to match inset.h
5366 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5367 Added free_spacing boolean arg to match inset.h
5369 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5370 Added free_spacing boolean arg to match inset.h
5372 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5373 Added free_spacing boolean arg to match inset.h
5375 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5376 Added free_spacing boolean arg to match inset.h
5378 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5379 Added free_spacing boolean arg to match inset.h
5381 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5382 free_spacing boolean arg to match inset.h
5384 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5385 free_spacing boolean arg to match inset.h
5387 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5388 ignore free_spacing paragraphs. The user's spaces are left
5391 * src/text.C (InsertChar): Fixed the free_spacing layout
5392 attribute behavior. Now, if free_spacing is set, you can
5393 add multiple spaces in a paragraph with impunity (and they
5394 get output verbatim).
5395 (SelectSelectedWord): Added dummy argument to inset::Latex()
5398 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5401 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5402 paragraph layouts now only input a simple space instead.
5403 Special character insets don't make any sense in free-spacing
5406 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5407 hard-spaces in the *input* file to simple spaces if the layout
5408 is free-spacing. This converts old files which had to have
5409 hard-spaces in free-spacing layouts where a simple space was
5411 (writeFileAscii): Added free_spacing check to pass to the newly
5412 reworked inset::Latex(...) methods. The inset::Latex() code
5413 ensures that hard-spaces in free-spacing paragraphs get output
5414 as spaces (rather than "~").
5416 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5418 * src/mathed/math_delim.C (draw): draw the empty placeholder
5419 delims with a onoffdash line.
5420 (struct math_deco_compare): struct that holds the "functors" used
5421 for the sort and the binary search in math_deco_table.
5422 (class init_deco_table): class used for initial sort of the
5424 (search_deco): use lower_bound to do a binary search in the
5427 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5429 * src/lyxrc.C: a small secret thingie...
5431 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5432 and to not flush the stream as often as it used to.
5434 * src/support/lyxalgo.h: new file
5435 (sorted): template function used for checking if a sequence is
5436 sorted or not. Two versions with and without user supplied
5437 compare. Uses same compare as std::sort.
5439 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5440 it and give warning on lyxerr.
5442 (struct compare_tags): struct with function operators used for
5443 checking if sorted, sorting and lower_bound.
5444 (search_kw): use lower_bound instead of manually implemented
5447 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5449 * src/insets/insetcollapsable.h: fix Clone() declaration.
5450 * src/insets/insetfoot.h: ditto.
5452 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5454 2000-03-08 Juergen Vigna <jug@sad.it>
5456 * src/insets/lyxinset.h: added owner call which tells us if
5457 this inset is inside another inset. Changed also the return-type
5458 of Editable to an enum so it tells clearer what the return-value is.
5460 * src/insets/insettext.C (computeTextRows): fixed computing of
5461 textinsets which split automatically on more rows.
5463 * src/insets/insetert.[Ch]: changed this to be of BaseType
5466 * src/insets/insetfoot.[Ch]: added footnote inset
5468 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5469 collapsable insets (like footnote, ert, ...)
5471 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5473 * src/lyxdraw.h: remvoe file
5475 * src/lyxdraw.C: remove file
5477 * src/insets/insettext.C: added <algorithm>.
5479 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5481 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5482 (matrix_cb): case MM_OK use string stream
5484 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5487 * src/mathed/math_macro.C (draw): use string stream
5488 (Metrics): use string stream
5490 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5491 directly to the ostream.
5493 * src/vspace.C (asString): use string stream.
5494 (asString): use string stream
5495 (asLatexString): use string stream
5497 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5498 setting Spacing::Other.
5500 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5501 sprintf when creating the stretch vale.
5503 * src/text2.C (alphaCounter): changed to return a string and to
5504 not use a static variable internally. Also fixed a one-off bug.
5505 (SetCounter): changed the drawing of the labels to use string
5506 streams instead of sprintf.
5508 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5509 manipulator to use a scheme that does not require library support.
5510 This is also the way it is done in the new GNU libstdc++. Should
5511 work with DEC cxx now.
5513 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5515 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5516 end. This fixes a bug.
5518 * src/mathed (all files concerned with file writing): apply the
5519 USE_OSTREAM_ONLY changes to mathed too.
5521 * src/support/DebugStream.h: make the constructor explicit.
5523 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5524 count and ostream squashed.
5526 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5528 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5530 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5531 ostringstream uses STL strings, and we might not.
5533 * src/insets/insetspecialchar.C: add using directive.
5534 * src/insets/insettext.C: ditto.
5536 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * lib/layouts/seminar.layout: feeble attempt at a layout for
5539 seminar.cls, far from completet and could really use some looking
5540 at from people used to write layout files.
5542 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5543 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5544 a lot nicer and works nicely with ostreams.
5546 * src/mathed/formula.C (draw): a slightly different solution that
5547 the one posted to the list, but I think this one works too. (font
5548 size wrong in headers.)
5550 * src/insets/insettext.C (computeTextRows): some fiddling on
5551 Jürgens turf, added some comments that he should read.
5553 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5554 used and it gave compiler warnings.
5555 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5558 * src/lyx_gui.C (create_forms): do the right thing when
5559 show_banner is true/false.
5561 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5562 show_banner is false.
5564 * most file writing files: Now use iostreams to do almost all of
5565 the writing. Also instead of passing string &, we now use
5566 stringstreams. mathed output is still not adapted to iostreams.
5567 This change can be turned off by commenting out all the occurences
5568 of the "#define USE_OSTREAM_ONLY 1" lines.
5570 * src/WorkArea.C (createPixmap): don't output debug messages.
5571 (WorkArea): don't output debug messages.
5573 * lib/lyxrc.example: added a comment about the new variable
5576 * development/Code_rules/Rules: Added some more commente about how
5577 to build class interfaces and on how better encapsulation can be
5580 2000-03-03 Juergen Vigna <jug@sad.it>
5582 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5583 automatically with the width of the LyX-Window
5585 * src/insets/insettext.C (computeTextRows): fixed update bug in
5586 displaying text-insets (scrollvalues where not initialized!)
5588 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5590 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5591 id in the check of the result from lower_bound is not enough since
5592 lower_bound can return last too, and then res->id will not be a
5595 * all insets and some code that use them: I have conditionalized
5596 removed the Latex(string & out, ...) this means that only the
5597 Latex(ostream &, ...) will be used. This is a work in progress to
5598 move towards using streams for all output of files.
5600 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5603 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5605 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5606 routine (this fixes bug where greek letters were surrounded by too
5609 * src/support/filetools.C (findtexfile): change a bit the search
5610 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5611 no longer passed to kpsewhich, we may have to change that later.
5613 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5614 warning options to avoid problems with X header files (from Angus
5616 * acinclude.m4: regenerated.
5618 2000-03-02 Juergen Vigna <jug@sad.it>
5620 * src/insets/insettext.C (WriteParagraphData): Using the
5621 par->writeFile() function for writing paragraph-data.
5622 (Read): Using buffer->parseSingleLyXformat2Token()-function
5623 for parsing paragraph data!
5625 * src/buffer.C (readLyXformat2): removed all parse data and using
5626 the new parseSingleLyXformat2Token()-function.
5627 (parseSingleLyXformat2Token): added this function to parse (read)
5628 lyx-file-format (this is called also from text-insets now!)
5630 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5632 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5635 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5636 directly instead of going through a func. One very bad thing: a
5637 static LyXFindReplace, but I don't know where to place it.
5639 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5640 string instead of char[]. Also changed to static.
5641 (GetSelectionOrWordAtCursor): changed to static inline
5642 (SetSelectionOverLenChars): ditto.
5644 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5645 current_view and global variables. both classes has changed names
5646 and LyXFindReplace is not inherited from SearchForm.
5648 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5649 fl_form_search form.
5651 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5653 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5655 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5656 bound (from Kayvan).
5658 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5660 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5662 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5664 * some things that I should comment but the local pub says head to
5667 * comment out all code that belongs to the Roff code for Ascii
5668 export of tables. (this is unused)
5670 * src/LyXView.C: use correct type for global variable
5671 current_layout. (LyXTextClass::size_type)
5673 * some code to get the new insetgraphics closer to working I'd be
5674 grateful for any help.
5676 * src/BufferView2.C (insertInset): use the return type of
5677 NumberOfLayout properly. (also changes in other files)
5679 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5680 this as a test. I want to know what breaks because of this.
5682 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5684 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5686 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5687 to use a \makebox in the label, this allows proper justification
5688 with out using protected spaces or multiple hfills. Now it is
5689 "label" for left justified, "\hfill label\hfill" for center, and
5690 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5691 should be changed accordingly.
5693 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5695 * src/lyxtext.h: change SetLayout() to take a
5696 LyXTextClass::size_type instead of a char (when there is more than
5697 127 layouts in a class); also change type of copylayouttype.
5698 * src/text2.C (SetLayout): ditto.
5699 * src/LyXView.C (updateLayoutChoice): ditto.
5701 * src/LaTeX.C (scanLogFile): errors where the line number was not
5702 given just after the '!'-line were ignored (from Dekel Tsur).
5704 * lib/lyxrc.example: fix description of \date_insert_format
5706 * lib/layouts/llncs.layout: new layout, contributed by Martin
5709 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5711 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5712 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5713 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5714 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5715 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5716 paragraph.C, text.C, text2.C)
5718 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5720 * src/insets/insettext.C (LocalDispatch): remove extra break
5723 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5724 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5726 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5727 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5729 * src/insets/insetbib.h: move InsetBibkey::Holder and
5730 InsetCitation::Holder in public space.
5732 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/insets/insettext.h: small change to get the new files from
5735 Juergen to compile (use "string", not "class string").
5737 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5738 const & as parameter to LocalDispatch, use LyXFont const & as
5739 paramter to some other func. This also had impacto on lyxinsets.h
5740 and the two mathed insets.
5742 2000-02-24 Juergen Vigna <jug@sad.it>
5745 * src/commandtags.h:
5747 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5751 * src/BufferView2.C: added/updated code for various inset-functions
5753 * src/insets/insetert.[Ch]: added implementation of InsetERT
5755 * src/insets/insettext.[Ch]: added implementation of InsetText
5757 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5758 (draw): added preliminary code for inset scrolling not finshed yet
5760 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5761 as it is in lyxfunc.C now
5763 * src/insets/lyxinset.h: Added functions for text-insets
5765 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5767 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5768 BufferView and reimplement the list as a queue put inside its own
5771 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5773 * several files: use the new interface to the "updateinsetlist"
5775 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5777 (work_area_handler): call BufferView::trippleClick on trippleclick.
5779 * src/BufferView.C (doubleClick): new function, selects word on
5781 (trippleClick): new function, selects line on trippleclick.
5783 2000-02-22 Allan Rae <rae@lyx.org>
5785 * lib/bind/xemacs.bind: buffer-previous not supported
5787 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5789 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5792 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5794 * src/bufferlist.C: get rid of current_view from this file
5796 * src/spellchecker.C: get rid of current_view from this file
5798 * src/vspace.C: get rid of current_view from this file
5799 (inPixels): added BufferView parameter for this func
5800 (asLatexCommand): added a BufferParams for this func
5802 * src/text.C src/text2.C: get rid of current_view from these
5805 * src/lyxfont.C (getFontDirection): move this function here from
5808 * src/bufferparams.C (getDocumentDirection): move this function
5811 * src/paragraph.C (getParDirection): move this function here from
5813 (getLetterDirection): ditto
5815 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5817 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5818 resize due to wrong pixmap beeing used. Also took the opurtunity
5819 to make the LyXScreen stateless on regard to WorkArea and some
5820 general cleanup in the same files.
5822 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5824 * src/Makefile.am: add missing direction.h
5826 * src/PainterBase.h: made the width functions const.
5828 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5831 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5833 * src/insets/insetlatexaccent.C (draw): make the accents draw
5834 better, at present this will only work well with iso8859-1.
5836 * several files: remove the old drawing code, now we use the new
5839 * several files: remove support for mono_video, reverse_video and
5842 2000-02-17 Juergen Vigna <jug@sad.it>
5844 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5845 int ** as we have to return the pointer, otherwise we have only
5846 NULL pointers in the returning function.
5848 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5850 * src/LaTeX.C (operator()): quote file name when running latex.
5852 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5854 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5855 (bubble tip), this removes our special handling of this.
5857 * Remove all code that is unused now that we have the new
5858 workarea. (Code that are not active when NEW_WA is defined.)
5860 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5862 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5864 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5865 nonexisting layout; correctly redirect obsoleted layouts.
5867 * lib/lyxrc.example: document \view_dvi_paper_option
5869 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5872 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5873 (PreviewDVI): handle the view_dvi_paper_option variable.
5874 [Both from Roland Krause]
5876 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5878 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5879 char const *, int, LyXFont)
5880 (text(int, int, string, LyXFont)): ditto
5882 * src/text.C (InsertCharInTable): attempt to fix the double-space
5883 feature in tables too.
5884 (BackspaceInTable): ditto.
5885 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5887 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5889 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5891 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5892 newly found text in textcache to this.
5893 (buffer): set the owner of the text put into the textcache to 0
5895 * src/insets/figinset.C (draw): fixed the drawing of figures with
5898 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5899 drawing of mathframe, hfills, protected space, table lines. I have
5900 now no outstanding drawing problems with the new Painter code.
5902 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5904 * src/PainterBase.C (ellipse, circle): do not specify the default
5907 * src/LColor.h: add using directive.
5909 * src/Painter.[Ch]: change return type of methods from Painter& to
5910 PainterBase&. Add a using directive.
5912 * src/WorkArea.C: wrap xforms callbacks in C functions
5915 * lib/layouts/foils.layout: font fix and simplifications from Carl
5918 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5920 * a lot of files: The Painter, LColor and WorkArea from the old
5921 devel branch has been ported to lyx-devel. Some new files and a
5922 lot of #ifdeffed code. The new workarea is enabled by default, but
5923 if you want to test the new Painter and LColor you have to compile
5924 with USE_PAINTER defined (do this in config.h f.ex.) There are
5925 still some rought edges, and I'd like some help to clear those
5926 out. It looks stable (loads and displays the Userguide very well).
5929 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5931 * src/buffer.C (pop_tag): revert to the previous implementation
5932 (use a global variable for both loops).
5934 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5936 * src/lyxrc.C (LyXRC): change slightly default date format.
5938 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5939 there is an English text with a footnote that starts with a Hebrew
5940 paragraph, or vice versa.
5941 (TeXFootnote): ditto.
5943 * src/text.C (LeftMargin): allow for negative values for
5944 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5947 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5948 for input encoding (cyrillic)
5950 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5952 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5955 * src/toolbar.C (set): ditto
5956 * src/insets/insetbib.C (create_form_citation_form): ditto
5958 * lib/CREDITS: added Dekel Tsur.
5960 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5961 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5962 hebrew supports files from Dekel Tsur.
5964 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5965 <tzafrir@technion.ac.il>
5967 * src/lyxrc.C: put \date_insert_format at the right place.
5969 * src/buffer.C (makeLaTeXFile): fix the handling of
5970 BufferParams::sides when writing out latex files.
5972 * src/BufferView2.C: add a "using" directive.
5974 * src/support/lyxsum.C (sum): when we use lyxstring,
5975 ostringstream::str needs an additional .c_str().
5977 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5979 * src/support/filetools.C (ChangeExtension): patch from Etienne
5982 * src/TextCache.C (show): remove const_cast and make second
5983 parameter non-const LyXText *.
5985 * src/TextCache.h: use non const LyXText in show.
5987 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5990 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5992 * src/support/lyxsum.C: rework to be more flexible.
5994 * several places: don't check if a pointer is 0 if you are going
5997 * src/text.C: remove some dead code.
5999 * src/insets/figinset.C: remove some dead code
6001 * src/buffer.C: move the BufferView funcs to BufferView2.C
6002 remove all support for insetlatexdel
6003 remove support for oldpapersize stuff
6004 made some member funcs const
6006 * src/kbmap.C: use a std::list to store the bindings in.
6008 * src/BufferView2.C: new file
6010 * src/kbsequence.[Ch]: new files
6012 * src/LyXAction.C + others: remove all trace of buffer-previous
6014 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6015 only have one copy in the binary of this table.
6017 * hebrew patch: moved some functions from LyXText to more
6018 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6020 * several files: remove support for XForms older than 0.88
6022 remove some #if 0 #endif code
6024 * src/TextCache.[Ch]: new file. Holds the textcache.
6026 * src/BufferView.C: changes to use the new TextCache interface.
6027 (waitForX): remove the now unused code.
6029 * src/BackStack.h: remove some commented code
6031 * lib/bind/emacs.bind: remove binding for buffer-previous
6033 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6035 * applied the hebrew patch.
6037 * src/lyxrow.h: make sure that all Row variables are initialized.
6039 * src/text2.C (TextHandleUndo): comment out a delete, this might
6040 introduce a memory leak, but should also help us to not try to
6041 read freed memory. We need to look at this one.
6043 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6044 (LyXParagraph): initalize footnotekind.
6046 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6047 forgot this when applying the patch. Please heed the warnings.
6049 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6050 (aka. reformat problem)
6052 * src/bufferlist.C (exists): made const, and use const_iterator
6053 (isLoaded): new func.
6054 (release): use std::find to find the correct buffer.
6056 * src/bufferlist.h: made getState a const func.
6057 made empty a const func.
6058 made exists a const func.
6061 2000-02-01 Juergen Vigna <jug@sad.it>
6063 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6065 * po/it.po: updated a bit the italian po file and also changed the
6066 'file nuovo' for newfile to 'filenuovo' without a space, this did
6069 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6070 for the new insert_date command.
6072 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6073 from jdblair, to insert a date into the current text conforming to
6074 a strftime format (for now only considering the locale-set and not
6075 the document-language).
6077 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6079 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6080 Bounds Read error seen by purify. The problem was that islower is
6081 a macros which takes an unsigned char and uses it as an index for
6082 in array of characters properties (and is thus subject to the
6086 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6087 correctly the paper sides radio buttons.
6088 (UpdateDocumentButtons): ditto.
6090 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6092 * src/kbmap.C (getsym + others): change to return unsigned int,
6093 returning a long can give problems on 64 bit systems. (I assume
6094 that int is 32bit on 64bit systems)
6096 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6098 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6099 LyXLookupString to be zero-terminated. Really fixes problems seen
6102 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6105 write a (char*)0 to the lyxerr stream.
6107 * src/lastfiles.C: move algorithm before the using statemets.
6109 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6111 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6112 complains otherwise).
6113 * src/table.C: ditto
6115 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6118 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6119 that I removed earlier... It is really needed.
6121 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6123 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6125 * INSTALL: update xforms home page URL.
6127 * lib/configure.m4: fix a bug with unreadable layout files.
6129 * src/table.C (calculate_width_of_column): add "using std::max"
6132 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6134 * several files: marked several lines with "DEL LINE", this is
6135 lines that can be deleted without changing anything.
6136 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6137 checks this anyway */
6140 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6142 * src/DepTable.C (update): add a "+" at the end when the checksum
6143 is different. (debugging string only)
6145 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6146 the next inset to not be displayed. This should also fix the list
6147 of labels in the "Insert Crossreference" dialog.
6149 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6151 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6152 when regex was not found.
6154 * src/support/lstrings.C (lowercase): use handcoded transform always.
6157 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6158 old_cursor.par->prev could be 0.
6160 * several files: changed post inc/dec to pre inc/dec
6162 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6163 write the lastfiles to file.
6165 * src/BufferView.C (buffer): only show TextCache info when debugging
6167 (resizeCurrentBuffer): ditto
6168 (workAreaExpose): ditto
6170 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6172 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6174 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6175 a bit better by removing the special case for \i and \j.
6177 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6179 * src/lyx_main.C (easyParse): remove test for bad comand line
6180 options, since this broke all xforms-related parsing.
6182 * src/kbmap.C (getsym): set return type to unsigned long, as
6183 declared in header. On an alpha, long is _not_ the same as int.
6185 * src/support/LOstream.h: add a "using std::flush;"
6187 * src/insets/figinset.C: ditto.
6189 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6191 * src/bufferlist.C (write): use blinding fast file copy instead of
6192 "a char at a time", now we are doing it the C++ way.
6194 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6195 std::list<int> instead.
6196 (addpidwait): reflect move to std::list<int>
6197 (sigchldchecker): ditto
6199 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6202 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6203 that obviously was wrong...
6205 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6206 c, this avoids warnings with purify and islower.
6208 * src/insets/figinset.C: rename struct queue to struct
6209 queue_element and rewrite to use a std::queue. gsqueue is now a
6210 std::queue<queue_element>
6211 (runqueue): reflect move to std::queue
6214 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6215 we would get "1" "0" instead of "true" "false. Also make the tostr
6218 2000-01-21 Juergen Vigna <jug@sad.it>
6220 * src/buffer.C (writeFileAscii): Disabled code for special groff
6221 handling of tabulars till I fix this in table.C
6223 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6225 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6227 * src/support/lyxlib.h: ditto.
6229 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6231 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6232 and 'j' look better. This might fix the "macron" bug that has been
6235 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6236 functions as one template function. Delete the old versions.
6238 * src/support/lyxsum.C: move using std::ifstream inside
6241 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6244 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6246 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6248 * src/insets/figinset.C (InitFigures): use new instead of malloc
6249 to allocate memory for figures and bitmaps.
6250 (DoneFigures): use delete[] instead of free to deallocate memory
6251 for figures and bitmaps.
6252 (runqueue): use new to allocate
6253 (getfigdata): use new/delete[] instead of malloc/free
6254 (RegisterFigure): ditto
6256 * some files: moved some declarations closer to first use, small
6257 whitespace changes use preincrement instead of postincrement where
6258 it does not make a difference.
6260 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6261 step on the way to use stl::containers for key maps.
6263 * src/bufferlist.h: add a typedef for const_iterator and const
6264 versions of begin and end.
6266 * src/bufferlist.[Ch]: change name of member variable _state to
6267 state_. (avoid reserved names)
6269 (getFileNames): returns the filenames of the buffers in a vector.
6271 * configure.in (ALL_LINGUAS): added ro
6273 * src/support/putenv.C: new file
6275 * src/support/mkdir.C: new file
6277 2000-01-20 Allan Rae <rae@lyx.org>
6279 * lib/layouts/IEEEtran.layout: Added several theorem environments
6281 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6282 couple of minor additions.
6284 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6285 (except for those in footnotes of course)
6287 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6289 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6291 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6292 std::sort and std::lower_bound instead of qsort and handwritten
6294 (struct compara): struct that holds the functors used by std::sort
6295 and std::lower_bound in MathedLookupBOP.
6297 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6299 * src/support/LAssert.h: do not do partial specialization. We do
6302 * src/support/lyxlib.h: note that lyx::getUserName() and
6303 lyx::date() are not in use right now. Should these be suppressed?
6305 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6306 (makeLinuxDocFile): do not put date and user name in linuxdoc
6309 * src/support/lyxlib.h (kill): change first argument to long int,
6310 since that's what solaris uses.
6312 * src/support/kill.C (kill): fix declaration to match prototype.
6314 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6315 actually check whether namespaces are supported. This is not what
6318 * src/support/lyxsum.C: add a using directive.
6320 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6322 * src/support/kill.C: if we have namespace support we don't have
6323 to include lyxlib.h.
6325 * src/support/lyxlib.h: use namespace lyx if supported.
6327 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6329 * src/support/date.C: new file
6331 * src/support/chdir.C: new file
6333 * src/support/getUserName.C: new file
6335 * src/support/getcwd.C: new file
6337 * src/support/abort.C: new file
6339 * src/support/kill.C: new file
6341 * src/support/lyxlib.h: moved all the functions in this file
6342 insede struct lyx. Added also kill and abort to this struct. This
6343 is a way to avoid the "kill is not defined in <csignal>", we make
6344 C++ wrappers for functions that are not ANSI C or ANSI C++.
6346 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6347 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6348 lyx it has been renamed to sum.
6350 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6352 * src/text.C: add using directives for std::min and std::max.
6354 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6356 * src/texrow.C (getIdFromRow): actually return something useful in
6357 id and pos. Hopefully fixes the bug with positionning of errorbox
6360 * src/lyx_main.C (easyParse): output an error and exit if an
6361 incorrect command line option has been given.
6363 * src/spellchecker.C (ispell_check_word): document a memory leak.
6365 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6366 where a "struct utimbuf" is allocated with "new" and deleted with
6369 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6371 * src/text2.C (CutSelection): don't delete double spaces.
6372 (PasteSelection): ditto
6373 (CopySelection): ditto
6375 * src/text.C (Backspace): don't delete double spaces.
6377 * src/lyxlex.C (next): fix a bug that were only present with
6378 conformant std::istream::get to read comment lines, use
6379 std::istream::getline instead. This seems to fix the problem.
6381 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6383 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6384 allowed to insert space before space" editing problem. Please read
6385 commends at the beginning of the function. Comments about usage
6388 * src/text.C (InsertChar): fix for the "not allowed to insert
6389 space before space" editing problem.
6391 * src/text2.C (DeleteEmptyParagraphMechanism): when
6392 IsEmptyTableRow can only return false this last "else if" will
6393 always be a no-op. Commented out.
6395 * src/text.C (RedoParagraph): As far as I can understand tmp
6396 cursor is not really needed.
6398 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6399 present it could only return false anyway.
6400 (several functions): Did something not so smart...added a const
6401 specifier on a lot of methods.
6403 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6404 and add a tmp->text.resize. The LyXParagraph constructor does the
6406 (BreakParagraphConservative): ditto
6408 * src/support/path.h (Path): add a define so that the wrong usage
6409 "Path("/tmp") will be flagged as a compilation error:
6410 "`unnamed_Path' undeclared (first use this function)"
6412 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6414 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6415 which was bogus for several reasons.
6417 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6421 * autogen.sh: do not use "type -path" (what's that anyway?).
6423 * src/support/filetools.C (findtexfile): remove extraneous space
6424 which caused a kpsewhich warning (at least with kpathsea version
6427 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6429 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6431 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6433 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6435 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6437 * src/paragraph.C (BreakParagraph): do not reserve space on text
6438 if we don't need to (otherwise, if pos_end < pos, we end up
6439 reserving huge amounts of memory due to bad unsigned karma).
6440 (BreakParagraphConservative): ditto, although I have not seen
6441 evidence the bug can happen here.
6443 * src/lyxparagraph.h: add a using std::list.
6445 2000-01-11 Juergen Vigna <jug@sad.it>
6447 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6450 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6452 * src/vc-backend.C (doVCCommand): change to be static and take one
6453 more parameter: the path to chdir too be fore executing the command.
6454 (retrive): new function equiv to "co -r"
6456 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6457 file_not_found_hook is true.
6459 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6461 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6462 if a file is readwrite,readonly...anything else.
6464 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6466 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6467 (CreatePostscript): name change from MenuRunDVIPS (or something)
6468 (PreviewPostscript): name change from MenuPreviewPS
6469 (PreviewDVI): name change from MenuPreviewDVI
6471 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6472 \view_pdf_command., \pdf_to_ps_command
6474 * lib/configure.m4: added search for PDF viewer, and search for
6475 PDF to PS converter.
6476 (lyxrc.defaults output): add \pdflatex_command,
6477 \view_pdf_command and \pdf_to_ps_command.
6479 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6481 * src/bufferlist.C (write): we don't use blocksize for anything so
6484 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6486 * src/support/block.h: disable operator T* (), since it causes
6487 problems with both compilers I tried. See comments in the file.
6489 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6492 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6493 variable LYX_DIR_10x to LYX_DIR_11x.
6495 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6497 * INSTALL: document --with-lyxname.
6500 * configure.in: new configure flag --with-lyxname which allows to
6501 choose the name under which lyx is installed. Default is "lyx", of
6502 course. It used to be possible to do this with --program-suffix,
6503 but the later has in fact a different meaning for autoconf.
6505 * src/support/lstrings.h (lstrchr): reformat a bit.
6507 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6508 * src/mathed/math_defs.h: ditto.
6510 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6512 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6513 true, decides if we create a backup file or not when saving. New
6514 tag and variable \pdf_mode, defaults to false. New tag and
6515 variable \pdflatex_command, defaults to pdflatex. New tag and
6516 variable \view_pdf_command, defaults to xpdf. New tag and variable
6517 \pdf_to_ps_command, defaults to pdf2ps.
6519 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6521 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6522 does not have a BufferView.
6523 (unlockInset): ditto + don't access the_locking_inset if the
6524 buffer does not have a BufferView.
6526 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6527 certain circumstances so that we don't continue a keyboard
6528 operation long after the key was released. Try f.ex. to load a
6529 large document, press PageDown for some seconds and then release
6530 it. Before this change the document would contine to scroll for
6531 some time, with this change it stops imidiatly.
6533 * src/support/block.h: don't allocate more space than needed. As
6534 long as we don't try to write to the arr[x] in a array_type arr[x]
6535 it is perfectly ok. (if you write to it you might segfault).
6536 added operator value_type*() so that is possible to pass the array
6537 to functions expecting a C-pointer.
6539 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6542 * intl/*: updated to gettext 0.10.35, tried to add our own
6543 required modifications. Please verify.
6545 * po/*: updated to gettext 0.10.35, tried to add our own required
6546 modifications. Please verify.
6548 * src/support/lstrings.C (tostr): go at fixing the problem with
6549 cxx and stringstream. When stringstream is used return
6550 oss.str().c_str() so that problems with lyxstring and basic_string
6551 are avoided. Note that the best solution would be for cxx to use
6552 basic_string all the way, but it is not conformant yet. (it seems)
6554 * src/lyx_cb.C + other files: moved several global functions to
6555 class BufferView, some have been moved to BufferView.[Ch] others
6556 are still located in lyx_cb.C. Code changes because of this. (part
6557 of "get rid of current_view project".)
6559 * src/buffer.C + other files: moved several Buffer functions to
6560 class BufferView, the functions are still present in buffer.C.
6561 Code changes because of this.
6563 * config/lcmessage.m4: updated to most recent. used when creating
6566 * config/progtest.m4: updated to most recent. used when creating
6569 * config/gettext.m4: updated to most recent. applied patch for
6572 * config/gettext.m4.patch: new file that shows what changes we
6573 have done to the local copy of gettext.m4.
6575 * config/libtool.m4: new file, used in creation of acinclude.m4
6577 * config/lyxinclude.m4: new file, this is the lyx created m4
6578 macros, used in making acinclude.m4.
6580 * autogen.sh: GNU m4 discovered as a separate task not as part of
6581 the lib/configure creation.
6582 Generate acinlucde from files in config. Actually cat
6583 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6584 easier to upgrade .m4 files that really are external.
6586 * src/Spacing.h: moved using std::istringstream to right after
6587 <sstream>. This should fix the problem seen with some compilers.
6589 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6591 * src/lyx_cb.C: began some work to remove the dependency a lot of
6592 functions have on BufferView::text, even if not really needed.
6593 (GetCurrentTextClass): removed this func, it only hid the
6596 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6597 forgot this in last commit.
6599 * src/Bullet.C (bulletEntry): use static char const *[] for the
6600 tables, becuase of this the return arg had to change to string.
6602 (~Bullet): removed unneeded destructor
6604 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6605 (insetSleep): moved from Buffer
6606 (insetWakeup): moved from Buffer
6607 (insetUnlock): moved from Buffer
6609 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6610 from Buffer to BufferView.
6612 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6614 * config/ltmain.sh: updated to version 1.3.4 of libtool
6616 * config/ltconfig: updated to version 1.3.4 of libtool
6618 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6621 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6622 Did I get that right?
6624 * src/lyxlex.h: add a "using" directive or two.
6625 * src/Spacing.h: ditto.
6626 * src/insets/figinset.C: ditto.
6627 * src/support/filetools.C: ditto.
6628 * src/support/lstrings.C: ditto.
6629 * src/BufferView.C: ditto.
6630 * src/bufferlist.C: ditto.
6631 * src/lyx_cb.C: ditto.
6632 * src/lyxlex.C: ditto.
6634 * NEWS: add some changes for 1.1.4.
6636 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6638 * src/BufferView.C: first go at a TextCache to speed up switching
6641 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6643 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6644 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6645 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6646 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6649 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6650 members of the struct are correctly initialized to 0 (detected by
6652 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6653 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6655 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6656 pidwait, since it was allocated with "new". This was potentially
6657 very bad. Thanks to Michael Schmitt for running purify for us.
6660 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6662 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6664 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6666 1999-12-30 Allan Rae <rae@lyx.org>
6668 * lib/templates/IEEEtran.lyx: minor change
6670 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6671 src/mathed/formula.C (LocalDispatch): askForText changes
6673 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6674 know when a user has cancelled input. Fixes annoying problems with
6675 inserting labels and version control.
6677 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6679 * src/support/lstrings.C (tostr): rewritten to use strstream and
6682 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6684 * src/support/filetools.C (IsFileWriteable): use fstream to check
6685 (IsDirWriteable): use fileinfo to check
6687 * src/support/filetools.h (FilePtr): whole class deleted
6689 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6691 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6693 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6695 * src/bufferlist.C (write): use ifstream and ofstream instead of
6698 * src/Spacing.h: use istrstream instead of sscanf
6700 * src/mathed/math_defs.h: change first arg to istream from FILE*
6702 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6704 * src/mathed/math_parser.C: have yyis to be an istream
6705 (LexGetArg): use istream (yyis)
6707 (mathed_parse): ditto
6708 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6710 * src/mathed/formula.C (Read): rewritten to use istream
6712 * src/mathed/formulamacro.C (Read): rewritten to use istream
6714 * src/lyxlex.h (~LyXLex): deleted desturctor
6715 (getStream): new function, returns an istream
6716 (getFile): deleted funtion
6717 (IsOK): return is.good();
6719 * src/lyxlex.C (LyXLex): delete file and owns_file
6720 (setFile): open an filebuf and assign that to a istream instead of
6722 (setStream): new function, takes an istream as arg.
6723 (setFile): deleted function
6724 (EatLine): rewritten us use istream instead of FILE*
6728 * src/table.C (LyXTable): use istream instead of FILE*
6729 (Read): rewritten to take an istream instead of FILE*
6731 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6733 * src/buffer.C (Dispatch): remove an extraneous break statement.
6735 * src/support/filetools.C (QuoteName): change to do simple
6736 'quoting'. More work is necessary. Also changed to do nothing
6737 under emx (needs fix too).
6738 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6740 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6741 config.h.in to the AC_DEFINE_UNQUOTED() call.
6742 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6743 needs char * as argument (because Solaris 7 declares it like
6746 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6747 remove definition of BZERO.
6749 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6752 defined, "lyxregex.h" if not.
6754 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6756 (REGEX): new variable that is set to regex.c lyxregex.h when
6757 AM_CONDITIONAL USE_REGEX is set.
6758 (libsupport_la_SOURCES): add $(REGEX)
6760 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6763 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6766 * configure.in: add call to LYX_REGEX
6768 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6769 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6771 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6773 * lib/bind/fi_menus.bind: new file, from
6774 pauli.virtanen@saunalahti.fi.
6776 * src/buffer.C (getBibkeyList): pass the parameter delim to
6777 InsetInclude::getKeys and InsetBibtex::getKeys.
6779 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6780 is passed to Buffer::getBibkeyList
6782 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6783 instead of the hardcoded comma.
6785 * src/insets/insetbib.C (getKeys): make sure that there are not
6786 leading blanks in bibtex keys. Normal latex does not care, but
6787 harvard.sty seems to dislike blanks at the beginning of citation
6788 keys. In particular, the retturn value of the function is
6790 * INSTALL: make it clear that libstdc++ is needed and that gcc
6791 2.7.x probably does not work.
6793 * src/support/filetools.C (findtexfile): make debug message go to
6795 * src/insets/insetbib.C (getKeys): ditto
6797 * src/debug.C (showTags): make sure that the output is correctly
6800 * configure.in: add a comment for TWO_COLOR_ICON define.
6802 * acconfig.h: remove all the entries that already defined in
6803 configure.in or acinclude.m4.
6805 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6806 to avoid user name, date and copyright.
6808 1999-12-21 Juergen Vigna <jug@sad.it>
6810 * src/table.C (Read): Now read bogus row format informations
6811 if the format is < 5 so that afterwards the table can
6812 be read by lyx but without any format-info. Fixed the
6813 crash we experienced when not doing this.
6815 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6817 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6818 (RedoDrawingOfParagraph): ditto
6819 (RedoParagraphs): ditto
6820 (RemoveTableRow): ditto
6822 * src/text.C (Fill): rename arg paperwidth -> paper_width
6824 * src/buffer.C (insertLyXFile): rename var filename -> fname
6825 (writeFile): rename arg filename -> fname
6826 (writeFileAscii): ditto
6827 (makeLaTeXFile): ditto
6828 (makeLinuxDocFile): ditto
6829 (makeDocBookFile): ditto
6831 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6834 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6836 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6839 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6840 compiled by a C compiler not C++.
6842 * src/layout.h (LyXTextClass): added typedef for const_iterator
6843 (LyXTextClassList): added typedef for const_iterator + member
6844 functions begin and end.
6846 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6847 iterators to fill the choice_class.
6848 (updateLayoutChoice): rewritten to use iterators to fill the
6849 layoutlist in the toolbar.
6851 * src/BufferView.h (BufferView::work_area_width): removed unused
6854 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6856 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6857 (sgmlCloseTag): ditto
6859 * src/support/lstrings.h: return type of countChar changed to
6862 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6863 what version of this func to use. Also made to return unsigned int.
6865 * configure.in: call LYX_STD_COUNT
6867 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6868 conforming std::count.
6870 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6872 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6873 and a subscript would give bad display (patch from Dekel Tsur
6874 <dekel@math.tau.ac.il>).
6876 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6878 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6881 * src/chset.h: add a few 'using' directives
6883 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6884 triggered when no buffer is active
6886 * src/layout.C: removed `break' after `return' in switch(), since
6889 * src/lyx_main.C (init): make sure LyX can be ran in place even
6890 when libtool has done its magic with shared libraries. Fix the
6891 test for the case when the system directory has not been found.
6893 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6894 name for the latex file.
6895 (MenuMakeHTML): ditto
6897 * src/buffer.h: add an optional boolean argument, which is passed
6900 1999-12-20 Allan Rae <rae@lyx.org>
6902 * lib/templates/IEEEtran.lyx: small correction and update.
6904 * configure.in: Attempted to use LYX_PATH_HEADER
6906 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6908 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6909 input from JMarc. Now use preprocessor to find the header.
6910 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6911 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6912 LYX_STL_STRING_FWD. See comments in file.
6914 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6916 * The global MiniBuffer * minibuffer variable is dead.
6918 * The global FD_form_main * fd_form_main variable is dead.
6920 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6922 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6924 * src/table.h: add the LOstream.h header
6925 * src/debug.h: ditto
6927 * src/LyXAction.h: change the explaination of the ReadOnly
6928 attribute: is indicates that the function _can_ be used.
6930 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6933 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6941 * src/paragraph.C (GetWord): assert on pos>=0
6944 * src/support/lyxstring.C: condition the use of an invariant on
6946 * src/support/lyxstring.h: ditto
6948 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6949 Use LAssert.h instead of plain assert().
6951 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6953 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6954 * src/support/filetools.C: ditto
6956 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6959 * INSTALL: document the new configure flags
6961 * configure.in: suppress --with-debug; add --enable-assertions
6963 * acinclude.m4: various changes in alignment of help strings.
6965 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6967 * src/kbmap.C: commented out the use of the hash map in kb_map,
6968 beginning of movement to a stl::container.
6970 * several files: removed code that was not in effect when
6971 MOVE_TEXT was defined.
6973 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6974 for escaping should not be used. We can discuss if the string
6975 should be enclosed in f.ex. [] instead of "".
6977 * src/trans_mgr.C (insert): use the new returned value from
6978 encodeString to get deadkeys and keymaps done correctly.
6980 * src/chset.C (encodeString): changed to return a pair, to tell
6981 what to use if we know the string.
6983 * src/lyxscreen.h (fillArc): new function.
6985 * src/FontInfo.C (resize): rewritten to use more std::string like
6986 structore, especially string::replace.
6988 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6991 * configure.in (chmod +x some scripts): remove config/gcc-hack
6993 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6995 * src/buffer.C (writeFile): change once again the top comment in a
6996 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6997 instead of an hardcoded version number.
6998 (makeDocBookFile): ditto
7000 * src/version.h: add new define LYX_DOCVERSION
7002 * po/de.po: update from Pit Sütterlin
7003 * lib/bind/de_menus.bind: ditto.
7005 * src/lyxfunc.C (Dispatch): call MenuExport()
7006 * src/buffer.C (Dispatch): ditto
7008 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7009 LyXFunc::Dispatch().
7010 (MenuExport): new function, moved from
7011 LyXFunc::Dispatch().
7013 * src/trans_mgr.C (insert): small cleanup
7014 * src/chset.C (loadFile): ditto
7016 * lib/kbd/iso8859-1.cdef: add missing backslashes
7018 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7020 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7021 help with placing the manually drawn accents better.
7023 (Draw): x2 and hg changed to float to minimize rounding errors and
7024 help place the accents better.
7026 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7027 unsigned short to char is just wrong...cast the char to unsigned
7028 char instead so that the two values can compare sanely. This
7029 should also make the display of insetlatexaccents better and
7030 perhaps also some other insets.
7032 (lbearing): new function
7035 1999-12-15 Allan Rae <rae@lyx.org>
7037 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7038 header that provides a wrapper around the very annoying SGI STL header
7041 * src/support/lyxstring.C, src/LString.h:
7042 removed old SGI-STL-compatability attempts.
7044 * configure.in: Use LYX_STL_STRING_FWD.
7046 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7047 stl_string_fwd.h is around and try to determine it's location.
7048 Major improvement over previous SGI STL 3.2 compatability.
7049 Three small problems remain with this function due to my zero
7050 knowledge of autoconf. JMarc and lgb see the comments in the code.
7052 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7054 * src/broken_const.h, config/hack-gcc, config/README: removed
7056 * configure.in: remove --with-gcc-hack option; do not call
7059 * INSTALL: remove documentation of --with-broken-const and
7062 * acconfig.h: remove all trace of BROKEN_CONST define
7064 * src/buffer.C (makeDocBookFile): update version number in output
7066 (SimpleDocBookOnePar): fix an assert when trying to a character
7067 access beyond string length
7070 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7072 * po/de.po: fix the Export menu
7074 * lyx.man: update the description of -dbg
7076 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7077 (commandLineHelp): updated
7078 (easyParse): show list of available debug levels if -dbg is passed
7081 * src/Makefile.am: add debug.C
7083 * src/debug.h: moved some code to debug.C
7085 * src/debug.C: new file. Contains code to set and show debug
7088 * src/layout.C: remove 'break' after 'continue' in switch
7089 statements, since these cannot be reached.
7091 1999-12-13 Allan Rae <rae@lyx.org>
7093 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7094 (in_word_set): hash() -> math_hash()
7096 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7098 * acconfig.h: Added a test for whether we are using exceptions in the
7099 current compilation run. If so USING_EXCEPTIONS is defined.
7101 * config.in: Check for existance of stl_string_fwd.h
7102 * src/LString.h: If compiling --with-included-string and SGI's
7103 STL version 3.2 is present (see above test) we need to block their
7104 forward declaration of string and supply a __get_c_string().
7105 However, it turns out this is only necessary if compiling with
7106 exceptions enabled so I've a bit more to add yet.
7108 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7109 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7110 src/support/LRegex.h, src/undo.h:
7111 Shuffle the order of the included files a little to ensure that
7112 LString.h gets included before anything that includes stl_string_fwd.h
7114 * src/support/lyxstring.C: We need to #include LString.h instead of
7115 lyxstring.h to get the necessary definition of __get_c_string.
7116 (__get_c_string): New function. This is defined static just like SGI's
7117 although why they need to do this I'm not sure. Perhaps it should be
7118 in lstrings.C instead.
7120 * lib/templates/IEEEtran.lyx: New template file.
7122 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7124 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7125 * intl/Makefile.in (MKINSTALLDIRS): ditto
7127 * src/LyXAction.C (init): changed to hold the LFUN data in a
7128 automatic array in stead of in callso to newFunc, this speeds up
7129 compilation a lot. Also all the memory used by the array is
7130 returned when the init is completed.
7132 * a lot of files: compiled with -Wold-style-cast, changed most of
7133 the reported offenders to C++ style casts. Did not change the
7134 offenders in C files.
7136 * src/trans.h (Match): change argument type to unsigned int.
7138 * src/support/DebugStream.C: fix some types on the streambufs so
7139 that it works on a conforming implementation.
7141 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7143 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7145 * src/support/lyxstring.C: remove the inline added earlier since
7146 they cause a bunch of unsatisfied symbols when linking with dec
7147 cxx. Cxx likes to have the body of inlines at the place where they
7150 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7151 accessing negative bounds in array. This fixes the crash when
7152 inserting accented characters.
7153 * src/trans.h (Match): ditto
7155 * src/buffer.C (Dispatch): since this is a void, it should not try
7156 to return anything...
7158 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7160 * src/buffer.h: removed the two friends from Buffer. Some changes
7161 because of this. Buffer::getFileName and Buffer::setFileName
7162 renamed to Buffer::fileName() and Buffer::fileName(...).
7164 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7166 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7167 and Buffer::update(short) to BufferView. This move is currently
7168 controlled by a define MOVE_TEXT, this will be removed when all
7169 shows to be ok. This move paves the way for better separation
7170 between buffer contents and buffer view. One side effect is that
7171 the BufferView needs a rebreak when swiching buffers, if we want
7172 to avoid this we can add a cache that holds pointers to LyXText's
7173 that is not currently in use.
7175 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7178 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7180 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7182 * lyx_main.C: new command line option -x (or --execute) and
7183 -e (or --export). Now direct conversion from .lyx to .tex
7184 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7185 Unfortunately, X is still needed and the GUI pops up during the
7188 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7190 * src/Spacing.C: add a using directive to bring stream stuff into
7192 * src/paragraph.C: ditto
7193 * src/buffer.C: ditto
7195 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7196 from Lars' announcement).
7198 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7199 example files from Tino Meinen.
7201 1999-12-06 Allan Rae <rae@lyx.org>
7203 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7205 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7207 * src/support/lyxstring.C: added a lot of inline for no good
7210 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7211 latexWriteEndChanges, they were not used.
7213 * src/layout.h (operator<<): output operator for PageSides
7215 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7217 * some example files: loaded in LyX 1.0.4 and saved again to update
7218 certain constructs (table format)
7220 * a lot of files: did the change to use fstream/iostream for all
7221 writing of files. Done with a close look at Andre Poenitz's patch.
7223 * some files: whitespace changes.
7225 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7227 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7228 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7229 architecture, we provide our own. It is used unconditionnally, but
7230 I do not think this is a performance problem. Thanks to Angus
7231 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7232 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7234 (GetInset): use my_memcpy.
7238 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7239 it is easier to understand, but it uses less TeX-only constructs now.
7241 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7242 elements contain spaces
7244 * lib/configure: regenerated
7246 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7247 elements contain spaces; display the list of programs that are
7250 * autogen.sh: make sure lib/configure is executable
7252 * lib/examples/*: rename the tutorial examples to begin with the
7253 two-letters language code.
7255 * src/lyxfunc.C (getStatus): do not query current font if no
7258 * src/lyx_cb.C (RunScript): use QuoteName
7259 (MenuRunDvips): ditto
7260 (PrintApplyCB): ditto
7262 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7263 around argument, so that it works well with the current shell.
7264 Does not work properly with OS/2 shells currently.
7266 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7267 * src/LyXSendto.C (SendtoApplyCB): ditto
7268 * src/lyxfunc.C (Dispatch): ditto
7269 * src/buffer.C (runLaTeX): ditto
7270 (runLiterate): ditto
7271 (buildProgram): ditto
7273 * src/lyx_cb.C (RunScript): ditto
7274 (MenuMakeLaTeX): ditto
7276 * src/buffer.h (getLatexName): new method
7278 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7280 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7282 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7283 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7284 (create_math_panel): ditto
7286 * src/lyxfunc.C (getStatus): re-activate the code which gets
7287 current font and cursor; add test for export to html.
7289 * src/lyxrc.C (read): remove unreachable break statements; add a
7292 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7294 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7296 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7297 introduced by faulty regex.
7298 * src/buffer.C: ditto
7299 * src/lastfiles.C: ditto
7300 * src/paragraph.C: ditto
7301 * src/table.C: ditto
7302 * src/vspace.C: ditto
7303 * src/insets/figinset.C: ditto
7304 Note: most of these is absolutely harmless, except the one in
7305 src/mathed formula.C.
7307 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7309 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7310 operation, yielding correct results for the reLyX command.
7312 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7314 * src/support/filetools.C (ExpandPath): removed an over eager
7316 (ReplaceEnvironmentPath): ditto
7318 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7319 shows that we are doing something fishy in our code...
7323 * src/lyxrc.C (read): use a double switch trick to get more help
7324 from the compiler. (the same trick is used in layout.C)
7325 (write): new function. opens a ofstream and pass that to output
7326 (output): new function, takes a ostream and writes the lyxrc
7327 elemts to it. uses a dummy switch to make sure no elements are
7330 * src/lyxlex.h: added a struct pushpophelper for use in functions
7331 with more than one exit point.
7333 * src/lyxlex.[Ch] (GetInteger): made it const
7337 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7339 * src/layout.[hC] : LayoutTags splitted into several enums, new
7340 methods created, better error handling cleaner use of lyxlex. Read
7343 * src/bmtable.[Ch]: change some member prototypes because of the
7344 image const changes.
7346 * commandtags.h, src/LyXAction.C (init): new function:
7347 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7348 This file is not read automatically but you can add \input
7349 preferences to your lyxrc if you want to. We need to discuss how
7352 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7353 in .aux, also remove .bib and .bst files from dependencies when
7356 * src/BufferView.C, src/LyXView.C: add const_cast several places
7357 because of changes to images.
7359 * lib/images/*: same change as for images/*
7361 * lib/lyxrc.example: Default for accept_compound is false not no.
7363 * images/*: changed to be const, however I have som misgivings
7364 about this change so it might be changed back.
7366 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7368 * lib/configure, po/POTFILES.in: regenerated
7370 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7372 * config/lib_configure.m4: removed
7374 * lib/configure.m4: new file (was config/lib_configure.m4)
7376 * configure.in: do not test for rtti, since we do not use it.
7378 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7380 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7381 doubling of allocated space scheme. This makes it faster for large
7382 strings end to use less memory for small strings. xtra rememoved.
7384 * src/insets/figinset.C (waitalarm): commented out.
7385 (GhostscriptMsg): use static_cast
7386 (GhostscriptMsg): use new instead of malloc to allocate memory for
7387 cmap. also delete the memory after use.
7389 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7391 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7392 for changes in bibtex database or style.
7393 (runBibTeX): remove all .bib and .bst files from dep before we
7395 (run): use scanAuc in when dep file already exist.
7397 * src/DepTable.C (remove_files_with_extension): new method
7400 * src/DepTable.[Ch]: made many of the methods const.
7402 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7404 * src/bufferparams.C: make sure that the default textclass is
7405 "article". It used to be the first one by description order, but
7406 now the first one is "docbook".
7408 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7409 string; call Debug::value.
7410 (easyParse): pass complete argument to setDebuggingLevel().
7412 * src/debug.h (value): fix the code that parses debug levels.
7414 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7417 * src/LyXAction.C: use Debug::ACTION as debug channel.
7419 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7421 * NEWS: updated for the future 1.1.3 release.
7423 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7424 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7425 it should. This is of course a controversial change (since many
7426 people will find that their lyx workscreen is suddenly full of
7427 red), but done for the sake of correctness.
7429 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7430 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7432 * src/insets/inseterror.h, src/insets/inseturl.h,
7433 src/insets/insetinfo.h, src/insets/figinset.h,
7434 src/mathed/formulamacro.h, src/mathed/math_macro.h
7435 (EditMessage): add a missing const and add _() to make sure that
7438 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7439 src/insets/insetbib.C, src/support/filetools.C: add `using'
7442 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7443 doing 'Insert index of last word' at the beginning of a paragraph.
7445 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7447 * several files: white-space changes.
7449 * src/mathed/formula.C: removed IsAlpha and IsDigit
7451 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7452 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7455 * src/insets/figinset.C (GetPSSizes): don't break when
7456 "EndComments" is seen. But break when a boundingbox is read.
7458 * all classes inherited from Inset: return value of Clone
7459 changed back to Inset *.
7461 * all classes inherited form MathInset: return value of Clone
7462 changed back to MathedInset *.
7464 * src/insets/figinset.C (runqueue): use a ofstream to output the
7465 gs/ps file. Might need some setpresicion or setw. However I can
7466 see no problem with the current code.
7467 (runqueue): use sleep instead of the alarm/signal code. I just
7468 can't see the difference.
7470 * src/paragraph.C (LyXParagraph): reserve space in the new
7471 paragraph and resize the inserted paragraph to just fit.
7473 * src/lyxfunc.h (operator|=): added operator for func_status.
7475 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7476 check for readable file.
7478 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7479 check for readable file.
7480 (MenuMakeLinuxDoc): ditto
7481 (MenuMakeDocBook): ditto
7482 (MenuMakeAscii): ditto
7483 (InsertAsciiFile): split the test for openable and readable
7485 * src/bmtable.C (draw_bitmaptable): use
7486 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7488 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7489 findtexfile from LaTeX to filetools.
7491 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7492 instead of FilePtr. Needs to be verified by a literate user.
7494 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7496 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7497 (EditMessage): likewise.
7499 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7500 respectively as \textasciitilde and \textasciicircum.
7502 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7504 * src/support/lyxstring.h: made the methods that take iterators
7507 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7508 (regexMatch): made is use the real regex class.
7510 * src/support/Makefile.am: changed to use libtool
7512 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7514 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7516 (MathIsInset ++): changed several macros to be inline functions
7519 * src/mathed/Makefile.am: changed to use libtool
7521 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7523 * src/insets/inset* : Clone changed to const and return type is
7524 the true insettype not just Inset*.
7526 * src/insets/Makefile.am: changed to use libtool
7528 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7530 * src/undo.[Ch] : added empty() and changed some of the method
7533 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7535 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7536 setID use block<> for the bullets array, added const several places.
7538 * src/lyxfunc.C (getStatus): new function
7540 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7541 LyXAction, added const to several funtions.
7543 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7544 a std::map, and to store the dir items in a vector.
7546 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7549 * src/LyXView.[Ch] + other files : changed currentView to view.
7551 * src/LyXAction.[Ch] : ported from the old devel branch.
7553 * src/.cvsignore: added .libs and a.out
7555 * configure.in : changes to use libtool.
7557 * acinclude.m4 : inserted libtool.m4
7559 * .cvsignore: added libtool
7561 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7563 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7564 file name in insets and mathed directories (otherwise the
7565 dependency is not taken in account under cygwin).
7567 * src/text2.C (InsertString[AB]): make sure that we do not try to
7568 read characters past the string length.
7570 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7572 * lib/doc/LaTeXConfig.lyx.in,
7573 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7575 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7576 file saying who created them and when this heppened; this is
7577 useless and annoys tools like cvs.
7579 * lib/layouts/g-brief-{en,de}.layout,
7580 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7581 from Thomas Hartkens <thomas@hartkens.de>.
7583 * src/{insets,mathed}/Makefile.am: do not declare an empty
7584 LDFLAGS, so that it can be set at configure time (useful on Irix
7587 * lib/reLyX/configure.in: make sure that the prefix is set
7588 correctly in LYX_DIR.
7590 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7592 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7593 be used by 'command-sequence' this allows to bind a key to a
7594 sequence of LyX-commands
7595 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7597 * src/LyXAction.C: add "command-sequence"
7599 * src/LyXFunction.C: handling of "command-sequence"
7601 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7602 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7604 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7606 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7608 * src/buffer.C (writeFile): Do not output a comment giving user
7609 and date at the beginning of a .lyx file. This is useless and
7610 annoys cvs anyway; update version number to 1.1.
7612 * src/Makefile.am (LYX_DIR): add this definition, so that a
7613 default path is hardcoded in LyX.
7615 * configure.in: Use LYX_GNU_GETTEXT.
7617 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7618 AM_GNU_GETTEXT with a bug fixed.
7620 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7622 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7624 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7625 which is used to point to LyX data is now LYX_DIR_11x.
7627 * lyx.man: convert to a unix text file; small updates.
7629 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7631 * src/support/LSubstring.[Ch]: made the second arg of most of the
7632 constructors be a const reference.
7634 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7637 * src/support/lyxstring.[Ch] (swap): added missing member function
7638 and specialization of swap(str, str);
7640 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7642 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7643 trace of the old one.
7645 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7646 put the member definitions in undo.C.
7648 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7649 NEW_TEXT and have now only code that was included when this was
7652 * src/intl.C (LCombo): use static_cast
7654 (DispatchCallback): ditto
7656 * src/definitions.h: removed whole file
7658 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7660 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7661 parsing and stores in a std:map. a regex defines the file format.
7662 removed unneeded members.
7664 * src/bufferparams.h: added several enums from definitions.h here.
7665 Removed unsused destructor. Changed some types to use proper enum
7666 types. use block to have the temp_bullets and user_defined_bullets
7667 and to make the whole class assignable.
7669 * src/bufferparams.C (Copy): removed this functions, use a default
7672 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7675 * src/buffer.C (readLyXformat2): commend out all that have with
7676 oldpapersize to do. also comment out all that hve to do with
7677 insetlatex and insetlatexdel.
7678 (setOldPaperStuff): commented out
7680 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7682 * src/LyXAction.C: remove use of inset-latex-insert
7684 * src/mathed/math_panel.C (button_cb): use static_cast
7686 * src/insets/Makefile.am (insets_o_SOURCES): removed
7689 * src/support/lyxstring.C (helper): use the unsigned long
7690 specifier, UL, instead of a static_cast.
7692 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7694 * src/support/block.h: new file. to be used as a c-style array in
7695 classes, so that the class can be assignable.
7697 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7699 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7700 NULL, make sure to return an empty string (it is not possible to
7701 set a string to NULL).
7703 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7705 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7707 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7709 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7710 link line, so that Irix users (for example) can set it explicitely to
7713 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7714 it can be overidden at make time (static or dynamic link, for
7717 * src/vc-backend.C, src/LaTeXFeatures.h,
7718 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7719 statements to bring templates to global namespace.
7721 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/support/lyxstring.C (operator[] const): make it standard
7726 * src/minibuffer.C (Init): changed to reflect that more
7727 information is given from the lyxvc and need not be provided here.
7729 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7731 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7733 * src/LyXView.C (UpdateTimerCB): use static_cast
7734 (KeyPressMask_raw_callback): ditto
7736 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7737 buffer_, a lot of changes because of this. currentBuffer() ->
7738 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7739 also changes to other files because of this.
7741 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7743 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7744 have no support for RCS and partial support for CVS, will be
7747 * src/insets/ several files: changes because of function name
7748 changes in Bufferview and LyXView.
7750 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7752 * src/support/LSubstring.[Ch]: new files. These implement a
7753 Substring that can be very convenient to use. i.e. is this
7755 string a = "Mary had a little sheep";
7756 Substring(a, "sheep") = "lamb";
7757 a is now "Mary has a little lamb".
7759 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7760 out patterns and subpatterns of strings. It is used by LSubstring
7761 and also by vc-backend.C
7763 * src/support/lyxstring.C: went over all the assertions used and
7764 tried to correct the wrong ones and flag which of them is required
7765 by the standard. some bugs found because of this. Also removed a
7766 couple of assertions.
7768 * src/support/Makefile.am (libsupport_a_SOURCES): added
7769 LSubstring.[Ch] and LRegex.[Ch]
7771 * src/support/FileInfo.h: have struct stat buf as an object and
7772 not a pointer to one, some changes because of this.
7774 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7775 information in layout when adding the layouts preamble to the
7778 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7781 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7782 because of bug in OS/2.
7784 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7786 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7787 \verbatim@font instead of \ttfamily, so that it can be redefined.
7789 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7790 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7791 src/layout.h, src/text2.C: add 'using' directive to bring the
7792 STL templates we need from the std:: namespace to the global one.
7793 Needed by DEC cxx in strict ansi mode.
7795 * src/support/LIstream.h,src/support/LOstream.h,
7796 src/support/lyxstring.h,src/table.h,
7797 src/lyxlookup.h: do not include <config.h> in header
7798 files. This should be done in the .C files only.
7800 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7804 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7806 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7807 from Kayvan to fix the tth invokation.
7809 * development/lyx.spec.in: updates from Kayvan to reflect the
7810 changes of file names.
7812 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7814 * src/text2.C (InsertStringB): use std::copy
7815 (InsertStringA): use std::copy
7817 * src/bufferlist.C: use a vector to store the buffers in. This is
7818 an internal change and should not affect any other thing.
7820 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7823 * src/text.C (Fill): fix potential bug, one off bug.
7825 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7827 * src/Makefile.am (lyx_main.o): add more files it depends on.
7829 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7831 * src/support/lyxstring.C: use size_t for the reference count,
7832 size, reserved memory and xtra.
7833 (internal_compare): new private member function. Now the compare
7834 functions should work for std::strings that have embedded '\0'
7836 (compare): all compare functions rewritten to use
7839 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/support/lyxstring.C (compare): pass c_str()
7842 (compare): pass c_str
7843 (compare): pass c_str
7845 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7847 * src/support/DebugStream.C: <config.h> was not included correctly.
7849 * lib/configure: forgot to re-generate it :( I'll make this file
7850 auto generated soon.
7852 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7854 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7857 * src/support/lyxstring.C: some changes from length() to rep->sz.
7858 avoids a function call.
7860 * src/support/filetools.C (SpaceLess): yet another version of the
7861 algorithm...now per Jean-Marc's suggestions.
7863 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7865 * src/layout.C (less_textclass_desc): functor for use in sorting
7867 (LyXTextClass::Read): sort the textclasses after reading.
7869 * src/support/filetools.C (SpaceLess): new version of the
7870 SpaceLess functions. What problems does this one give? Please
7873 * images/banner_bw.xbm: made the arrays unsigned char *
7875 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7877 * src/support/lyxstring.C (find): remove bogus assertion in the
7878 two versions of find where this has not been done yet.
7880 * src/support/lyxlib.h: add missing int return type to
7883 * src/menus.C (ShowFileMenu): disable exporting to html if no
7884 html export command is present.
7886 * config/lib_configure.m4: add a test for an HTML converter. The
7887 programs checked for are, in this order: tth, latex2html and
7890 * lib/configure: generated from config/lib_configure.m4.
7892 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7893 html converter. The parameters are now passed through $$FName and
7894 $$OutName, instead of standard input/output.
7896 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7898 * lib/lyxrc.example: update description of \html_command.
7899 add "quotes" around \screen_font_xxx font setting examples to help
7900 people who use fonts with spaces in their names.
7902 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7904 * Distribution files: updates for v1.1.2
7906 * src/support/lyxstring.C (find): remove bogus assert and return
7907 npos for the same condition.
7909 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7911 * added patch for OS/2 from SMiyata.
7913 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7915 * src/text2.C (CutSelection): make space_wrapped a bool
7916 (CutSelection): dont declare int i until we have to.
7917 (alphaCounter): return a char const *.
7919 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7921 * src/support/syscall.C (Systemcalls::kill):
7922 src/support/filetools.C (PutEnv, PutEnvPath):
7923 src/lyx_cb.C (addNewlineAndDepth):
7924 src/FontInfo.C (FontInfo::resize): condition some #warning
7925 directives with WITH_WARNINGS.
7928 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7930 * src/layout.[Ch] + several files: access to class variables
7931 limited and made accessor functions instead a lot of code changed
7932 becuase of this. Also instead of returning pointers often a const
7933 reference is returned instead.
7935 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7937 * src/Makefile.am (dist-hook): added used to remove the CVS from
7938 cheaders upon creating a dist
7939 (EXTRA_DIST): added cheaders
7941 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7942 a character not as a small integer.
7944 * src/support/lyxstring.C (find): removed Assert and added i >=
7945 rep->sz to the first if.
7947 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7949 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7950 src/LyXView.C src/buffer.C src/bufferparams.C
7951 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7952 src/text2.C src/insets/insetinclude.C:
7953 lyxlayout renamed to textclasslist.
7955 * src/layout.C: some lyxerr changes.
7957 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7958 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7959 (LyXLayoutList): removed all traces of this class.
7960 (LyXTextClass::Read): rewrote LT_STYLE
7961 (LyXTextClass::hasLayout): new function
7962 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7963 both const and nonconst version.
7964 (LyXTextClass::delete_layout): new function.
7965 (LyXTextClassList::Style): bug fix. do the right thing if layout
7967 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7968 (LyXTextClassList::NameOfLayout): ditto
7969 (LyXTextClassList::Load): ditto
7971 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7973 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7975 * src/LyXAction.C (LookupFunc): added a workaround for sun
7976 compiler, on the other hand...we don't know if the current code
7977 compiles on sun at all...
7979 * src/support/filetools.C (CleanupPath): subst fix
7981 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7984 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7985 complained about this one?
7987 * src/insets/insetinclude.C (Latex): subst fix
7989 * src/insets/insetbib.C (getKeys): subst fix
7991 * src/LyXSendto.C (SendtoApplyCB): subst fix
7993 * src/lyx_main.C (init): subst fix
7995 * src/layout.C (Read): subst fix
7997 * src/lyx_sendfax_main.C (button_send): subst fix
7999 * src/buffer.C (RoffAsciiTable): subst fix
8001 * src/lyx_cb.C (MenuFax): subst fix
8002 (PrintApplyCB): subst fix
8004 1999-10-26 Juergen Vigna <jug@sad.it>
8006 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8008 (Read): Cleaned up this code so now we read only format vestion >= 5
8010 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8012 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8013 come nobody has complained about this one?
8015 * src/insets/insetinclude.C (Latex): subst fix
8017 * src/insets/insetbib.C (getKeys): subst fix
8019 * src/lyx_main.C (init): subst fix
8021 * src/layout.C (Read): subst fix
8023 * src/buffer.C (RoffAsciiTable): subst fix
8025 * src/lyx_cb.C (MenuFax): subst fix.
8027 * src/layout.[hC] + some other files: rewrote to use
8028 std::container to store textclasses and layouts in.
8029 Simplified, removed a lot of code. Make all classes
8030 assignable. Further simplifications and review of type
8031 use still to be one.
8033 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8034 lastfiles to create the lastfiles partr of the menu.
8036 * src/lastfiles.[Ch]: rewritten to use deque to store the
8037 lastfiles in. Uses fstream for reading and writing. Simplifies
8040 * src/support/syscall.C: remove explicit cast.
8042 * src/BufferView.C (CursorToggleCB): removed code snippets that
8044 use explicat C++ style casts instead of C style casts. also use
8045 u_vdata instea of passing pointers in longs.
8047 * src/PaperLayout.C: removed code snippets that were commented out.
8049 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8051 * src/lyx_main.C: removed code snippets that wer commented out.
8053 * src/paragraph.C: removed code snippets that were commented out.
8055 * src/lyxvc.C (logClose): use static_cast
8057 (viewLog): remove explicit cast to void*
8058 (showLog): removed old commented code
8060 * src/menus.C: use static_cast instead of C style casts. use
8061 u_vdata instead of u_ldata. remove explicit cast to (long) for
8062 pointers. Removed old code that was commented out.
8064 * src/insets/inset.C: removed old commented func
8066 * src/insets/insetref.C (InsetRef): removed old code that had been
8067 commented out for a long time.
8069 (escape): removed C style cast
8071 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8073 * src/insets/insetlatex.C (Draw): removed old commented code
8074 (Read): rewritten to use string
8076 * src/insets/insetlabel.C (escape): removed C style cast
8078 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8080 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8083 * src/insets/insetinclude.h: removed a couple of stupid bools
8085 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8086 (Clone): remove C style cast
8087 (getKeys): changed list to lst because of std::list
8089 * src/insets/inseterror.C (Draw): removed som old commented code.
8091 * src/insets/insetcommand.C (Draw): removed some old commented code.
8093 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8094 commented out forever.
8095 (bibitem_cb): use static_cast instead of C style cast
8096 use of vdata changed to u_vdata.
8098 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8100 (CloseUrlCB): use static_cast instead of C style cast.
8101 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8103 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8104 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8105 (CloseInfoCB): static_cast from ob->u_vdata instead.
8106 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8109 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8110 (C_InsetError_CloseErrorCB): forward the ob parameter
8111 (CloseErrorCB): static_cast from ob->u_vdata instead.
8113 * src/vspace.h: include LString.h since we use string in this class.
8115 * src/vspace.C (lyx_advance): changed name from advance because of
8116 nameclash with stl. And since we cannot use namespaces yet...I
8117 used a lyx_ prefix instead. Expect this to change when we begin
8120 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8122 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8123 and removed now defunct constructor and deconstructor.
8125 * src/BufferView.h: have backstack as a object not as a pointer.
8126 removed initialization from constructor. added include for BackStack
8128 * development/lyx.spec.in (%build): add CFLAGS also.
8130 * src/screen.C (drawFrame): removed another warning.
8132 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8134 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8135 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8136 README and ANNOUNCE a bit for the next release. More work is
8139 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8140 unbreakable if we are in freespacing mode (LyX-Code), but not in
8143 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/BackStack.h: fixed initialization order in constructor
8147 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8149 * acinclude.m4 (VERSION): new rules for when a version is
8150 development, added also a variable for prerelease.
8151 (warnings): we set with_warnings=yes for prereleases
8152 (lyx_opt): prereleases compile with same optimization as development
8153 (CXXFLAGS): only use pedantic if we are a development version
8155 * src/BufferView.C (restorePosition): don't do anything if the
8158 * src/BackStack.h: added member empty, use this to test if there
8159 is anything to pop...
8161 1999-10-25 Juergen Vigna <jug@sad.it>
8164 * forms/layout_forms.fd +
8165 * forms/latexoptions.fd +
8166 * lyx.fd: changed for various form resize issues
8168 * src/mathed/math_panel.C +
8169 * src/insets/inseterror.C +
8170 * src/insets/insetinfo.C +
8171 * src/insets/inseturl.C +
8172 * src/insets/inseturl.h +
8175 * src/PaperLayout.C +
8176 * src/ParagraphExtra.C +
8177 * src/TableLayout.C +
8179 * src/layout_forms.C +
8186 * src/menus.C: fixed various resize issues. So now forms can be
8187 resized savely or not be resized at all.
8189 * forms/form_url.fd +
8190 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8193 * src/insets/Makefile.am: added files form_url.[Ch]
8195 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8197 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8198 (and presumably 6.2).
8200 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8201 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8202 remaining static member callbacks.
8204 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8207 * src/support/lyxstring.h: declare struct Srep as friend of
8208 lyxstring, since DEC cxx complains otherwise.
8210 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8212 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8214 * src/LaTeX.C (run): made run_bibtex also depend on files with
8216 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8217 are put into the dependency file.
8219 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8220 the code has shown itself to work
8221 (create_ispell_pipe): removed another warning, added a comment
8224 * src/minibuffer.C (ExecutingCB): removed code that has been
8225 commented out a long time
8227 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8228 out code + a warning.
8230 * src/support/lyxstring.h: comment out the three private
8231 operators, when compiling with string ansi conforming compilers
8234 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8236 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8237 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8240 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8243 * src/mathed/math_panel.C (create_math_panel): remove explicit
8246 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8249 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8250 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8251 to XCreatePixmapFromBitmapData
8252 (fl_set_bmtable_data): change the last argument to be unsigned
8254 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8255 and bh to be unsigned int, remove explicit casts in call to
8256 XReadBitmapFileData.
8258 * images/arrows.xbm: made the arrays unsigned char *
8259 * images/varsz.xbm: ditto
8260 * images/misc.xbm: ditto
8261 * images/greek.xbm: ditto
8262 * images/dots.xbm: ditto
8263 * images/brel.xbm: ditto
8264 * images/bop.xbm: ditto
8266 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8268 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8269 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8270 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8272 (LYX_CXX_CHEADERS): added <clocale> to the test.
8274 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8276 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8278 * src/support/lyxstring.C (append): fixed something that must be a
8279 bug, rep->assign was used instead of rep->append.
8281 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8284 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8285 lyx insert double chars. Fix spotted by Kayvan.
8287 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8289 * Fixed the tth support. I messed up with the Emacs patch apply feature
8290 and omitted the changes in lyxrc.C.
8292 1999-10-22 Juergen Vigna <jug@sad.it>
8294 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8296 * src/lyx_cb.C (MenuInsertRef) +
8297 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8298 the form cannot be resized under it limits (fixes a segfault)
8300 * src/lyx.C (create_form_form_ref) +
8301 * forms/lyx.fd: Changed Gravity on name input field so that it is
8304 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8306 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8307 <ostream> and <istream>.
8309 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8310 whether <fstream> provides the latest standard features, or if we
8311 have an oldstyle library (like in egcs).
8312 (LYX_CXX_STL_STRING): fix the test.
8314 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8315 code on MODERN_STL_STREAM.
8317 * src/support/lyxstring.h: use L{I,O}stream.h.
8319 * src/support/L{I,O}stream.h: new files, designed to setup
8320 correctly streams for our use
8321 - includes the right header depending on STL capabilities
8322 - puts std::ostream and std::endl (for LOStream.h) or
8323 std::istream (LIStream.h) in toplevel namespace.
8325 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8327 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8328 was a bib file that had been changed we ensure that bibtex is run.
8329 (runBibTeX): enhanced to extract the names of the bib files and
8330 getting their absolute path and enter them into the dep file.
8331 (findtexfile): static func that is used to look for tex-files,
8332 checks for absolute patchs and tries also with kpsewhich.
8333 Alternative ways of finding the correct files are wanted. Will
8335 (do_popen): function that runs a command using popen and returns
8336 the whole output of that command in a string. Should be moved to
8339 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8340 file with extension ext has changed.
8342 * src/insets/figinset.C: added ifdef guards around the fl_free
8343 code that jug commented out. Now it is commented out when
8344 compiling with XForms == 0.89.
8346 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8347 to lyxstring.C, and only keep a forward declaration in
8348 lyxstring.h. Simplifies the header file a bit and should help a
8349 bit on compile time too. Also changes to Srep will not mandate a
8350 recompile of code just using string.
8351 (~lyxstring): definition moved here since it uses srep.
8352 (size): definition moved here since it uses srep.
8354 * src/support/lyxstring.h: removed a couple of "inline" that should
8357 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8359 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8362 1999-10-21 Juergen Vigna <jug@sad.it>
8364 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8365 set to left if I just remove the width entry (or it is empty).
8367 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8368 paragraph when having dummy paragraphs.
8370 1999-10-20 Juergen Vigna <jug@sad.it>
8372 * src/insets/figinset.C: just commented some fl_free_form calls
8373 and added warnings so that this calls should be activated later
8374 again. This avoids for now a segfault, but we have a memory leak!
8376 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8377 'const char * argument' to 'string argument', this should
8378 fix some Asserts() in lyxstring.C.
8380 * src/lyxfunc.h: Removed the function argAsString(const char *)
8381 as it is not used anymore.
8383 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8385 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8388 * src/Literate.h: some funcs moved from public to private to make
8389 interface clearer. Unneeded args removed.
8391 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8393 (scanBuildLogFile): ditto
8395 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8396 normal TeX Error. Still room for improvement.
8398 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8400 * src/buffer.C (insertErrors): changes to make the error
8401 desctription show properly.
8403 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8406 * src/support/lyxstring.C (helper): changed to use
8407 sizeof(object->rep->ref).
8408 (operator>>): changed to use a pointer instead.
8410 * src/support/lyxstring.h: changed const reference & to value_type
8411 const & lets see if that helps.
8413 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8415 * Makefile.am (rpmdist): fixed to have non static package and
8418 * src/support/lyxstring.C: removed the compilation guards
8420 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8423 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8424 conditional compile of lyxstring.Ch
8426 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8427 stupid check, but it is a lot better than the bastring hack.
8428 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8430 * several files: changed string::erase into string::clear. Not
8433 * src/chset.C (encodeString): use a char temporary instead
8435 * src/table.C (TexEndOfCell): added tostr around
8436 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8437 (TexEndOfCell): ditto
8438 (TexEndOfCell): ditto
8439 (TexEndOfCell): ditto
8440 (DocBookEndOfCell): ditto
8441 (DocBookEndOfCell): ditto
8442 (DocBookEndOfCell): ditto
8443 (DocBookEndOfCell): ditto
8445 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8447 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8449 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8450 (MenuBuildProg): added tostr around ret
8451 (MenuRunChktex): added tostr around ret
8452 (DocumentApplyCB): added tostr around ret
8454 * src/chset.C (encodeString): added tostr around t->ic
8456 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8457 (makeLaTeXFile): added tostr around tocdepth
8458 (makeLaTeXFile): added tostr around ftcound - 1
8460 * src/insets/insetbib.C (setCounter): added tostr around counter.
8462 * src/support/lyxstring.h: added an operator+=(int) to catch more
8465 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8466 (lyxstring): We DON'T allow NULL pointers.
8468 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8470 * src/mathed/math_macro.C (MathMacroArgument::Write,
8471 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8472 when writing them out.
8474 * src/LString.C: remove, since it is not used anymore.
8476 * src/support/lyxstring.C: condition the content to
8477 USE_INCLUDED_STRING macro.
8479 * src/mathed/math_symbols.C, src/support/lstrings.C,
8480 src/support/lyxstring.C: add `using' directive to specify what
8481 we need in <algorithm>. I do not think that we need to
8482 conditionalize this, but any thought is appreciated.
8484 * many files: change all callback functions to "C" linkage
8485 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8486 strict_ansi. Those who were static are now global.
8487 The case of callbacks which are static class members is
8488 trickier, since we have to make C wrappers around them (see
8489 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8490 did not finish this yet, since it defeats the purpose of
8491 encapsulation, and I am not sure what the best route is.
8493 1999-10-19 Juergen Vigna <jug@sad.it>
8495 * src/support/lyxstring.C (lyxstring): we permit to have a null
8496 pointer as assignment value and just don't assign it.
8498 * src/vspace.C (nextToken): corrected this function substituting
8499 find_first(_not)_of with find_last_of.
8501 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8502 (TableOptCloseCB) (TableSpeCloseCB):
8503 inserted fl_set_focus call for problem with fl_hide_form() in
8506 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8508 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8511 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8513 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8514 LyXLex::next() and not eatline() to get its argument.
8516 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8519 instead, use fstreams for io of the depfile, removed unneeded
8520 functions and variables.
8522 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8523 vector instead, removed all functions and variables that is not in
8526 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * src/buffer.C (insertErrors): use new interface to TeXError
8530 * Makefile.am (rpmdist): added a rpmdist target
8532 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8533 per Kayvan's instructions.
8535 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8537 * src/Makefile.am: add a definition for localedir, so that locales
8538 are found after installation (Kayvan)
8540 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8542 * development/.cvsignore: new file.
8544 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8546 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8547 C++ compiler provides wrappers for C headers and use our alternate
8550 * configure.in: use LYX_CXX_CHEADERS.
8552 * src/cheader/: new directory, populated with cname headers from
8553 libstdc++-2.8.1. They are a bit old, but probably good enough for
8554 what we want (support compilers who lack them).
8556 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8557 from includes. It turns out is was stupid.
8559 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * lib/Makefile.am (install-data-local): forgot a ';'
8562 (install-data-local): forgot a '\'
8563 (libinstalldirs): needed after all. reintroduced.
8565 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * configure.in (AC_OUTPUT): added lyx.spec
8569 * development/lyx.spec: removed file
8571 * development/lyx.spec.in: new file
8573 * po/*.po: merged with lyx.pot becuase of make distcheck
8575 * lib/Makefile.am (dist-hook): added dist-hook so that
8576 documentation files will be included when doing a make
8577 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8578 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8580 more: tried to make install do the right thing, exclude CVS dirs
8583 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8584 Path would fit in more nicely.
8586 * all files that used to use pathstack: uses now Path instead.
8587 This change was a lot easier than expected.
8589 * src/support/path.h: new file
8591 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8593 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8595 * src/support/lyxstring.C (getline): Default arg was given for
8598 * Configure.cmd: removed file
8600 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8602 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8603 streams classes and types, add the proper 'using' statements when
8604 MODERN_STL is defined.
8606 * src/debug.h: move the << operator definition after the inclusion
8609 * src/support/filetools.C: include "LAssert.h", which is needed
8612 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8615 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8616 include "debug.h" to define a proper ostream.
8618 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8620 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8621 method to the SystemCall class which can kill a process, but it's
8622 not fully implemented yet.
8624 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8626 * src/support/FileInfo.h: Better documentation
8628 * src/lyxfunc.C: Added support for buffer-export html
8630 * src/menus.C: Added Export->As HTML...
8632 * lib/bind/*.bind: Added short-cut for buffer-export html
8634 * src/lyxrc.*: Added support for new \tth_command
8636 * lib/lyxrc.example: Added stuff for new \tth_command
8638 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8640 * lib/Makefile.am (IMAGES): removed images/README
8641 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8642 installes in correct place. Check permisions is installed
8645 * src/LaTeX.C: some no-op changes moved declaration of some
8648 * src/LaTeX.h (LATEX_H): changed include guard name
8650 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8652 * lib/reLyX/Makefile.am: install noweb2lyx.
8654 * lib/Makefile.am: install configure.
8656 * lib/reLyX/configure.in: declare a config aux dir; set package
8657 name to lyx (not sure what the best solution is); generate noweb2lyx.
8659 * lib/layouts/egs.layout: fix the bibliography layout.
8661 1999-10-08 Jürgen Vigna <jug@sad.it>
8663 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8664 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8665 it returned without continuing to search the path.
8667 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8670 also fixes a bug. It is not allowed to do tricks with std::strings
8671 like: string a("hei"); &a[e]; this will not give what you
8672 think... Any reason for the complexity in this func?
8674 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8676 * Updated README and INSTALL a bit, mostly to check that my
8677 CVS rights are correctly set up.
8679 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8681 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8682 does not allow '\0' chars but lyxstring and std::string does.
8684 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * autogen.sh (AUTOCONF): let the autogen script create the
8687 POTFILES.in file too. POTFILES.in should perhaps now not be
8688 included in the cvs module.
8690 * some more files changed to use C++ includes instead of C ones.
8692 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8694 (Reread): added tostr to nlink. buggy output otherwise.
8695 (Reread): added a string() around szMode when assigning to Buffer,
8696 without this I got a log of garbled info strings.
8698 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8701 * I have added several ostream & operator<<(ostream &, some_type)
8702 functions. This has been done to avoid casting and warnings when
8703 outputting enums to lyxerr. This as thus eliminated a lot of
8704 explicit casts and has made the code clearer. Among the enums
8705 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8706 mathed enums, some font enum the Debug::type enum.
8708 * src/support/lyxstring.h (clear): missing method. equivalent of
8711 * all files that contained "stderr": rewrote constructs that used
8712 stderr to use lyxerr instead. (except bmtable)
8714 * src/support/DebugStream.h (level): and the passed t with
8715 Debug::ANY to avoid spurious bits set.
8717 * src/debug.h (Debug::type value): made it accept strings of the
8720 * configure.in (Check for programs): Added a check for kpsewhich,
8721 the latex generation will use this later to better the dicovery of
8724 * src/BufferView.C (create_view): we don't need to cast this to
8725 (void*) that is done automatically.
8726 (WorkAreaButtonPress): removed some dead code.
8728 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8730 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8731 is not overwritten when translated (David Sua'rez de Lis).
8733 * lib/CREDITS: Added David Sua'rez de Lis
8735 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8737 * src/bufferparams.C (BufferParams): default input encoding is now
8740 * acinclude.m4 (cross_compiling): comment out macro
8741 LYX_GXX_STRENGTH_REDUCE.
8743 * acconfig.h: make sure that const is not defined (to empty) when
8744 we are compiling C++. Remove commented out code using SIZEOF_xx
8747 * configure.in : move the test for const and inline as late as
8748 possible so that these C tests do not interefere with C++ ones.
8749 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8750 has not been proven.
8752 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8754 * src/table.C (getDocBookAlign): remove bad default value for
8757 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8759 (ShowFileMenu2): ditto.
8761 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8764 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8766 * Most files: finished the change from the old error code to use
8767 DebugStream for all lyxerr debugging. Only minor changes remain
8768 (e.g. the setting of debug levels using strings instead of number)
8770 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8772 * src/layout.C (Add): Changed to use compare_no_case instead of
8775 * src/FontInfo.C: changed loop variable type too string::size_type.
8777 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8779 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8780 set ETAGS_ARGS to --c++
8782 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8784 * src/table.C (DocBookEndOfCell): commented out two unused variables
8786 * src/paragraph.C: commented out four unused variables.
8788 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8789 insed a if clause with type string::size_type.
8791 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8794 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8796 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8797 variable, also changed loop to go from 0 to lenght + 1, instead of
8798 -1 to length. This should be correct.
8800 * src/LaTeX.C (scanError): use string::size_type as loop variable
8803 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8804 (l.896) since y_tmp and row was not used anyway.
8806 * src/insets/insetref.C (escape): use string::size_type as loop
8809 * src/insets/insetquotes.C (Width): use string::size_type as loop
8811 (Draw): use string::size_type as loop variable type.
8813 * src/insets/insetlatexaccent.C (checkContents): use
8814 string::size_type as loop variable type.
8816 * src/insets/insetlabel.C (escape): use string::size_type as loop
8819 * src/insets/insetinfo.C: added an extern for current_view.
8821 * src/insets/insetcommand.C (scanCommand): use string::size_type
8822 as loop variable type.
8824 * most files: removed the RCS tags. With them we had to recompile
8825 a lot of files after a simple cvs commit. Also we have never used
8826 them for anything meaningful.
8828 * most files: tags-query-replace NULL 0. As adviced several plases
8829 we now use "0" instead of "NULL" in our code.
8831 * src/support/filetools.C (SpaceLess): use string::size_type as
8834 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8836 * src/paragraph.C: fixed up some more string stuff.
8838 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8840 * src/support/filetools.h: make modestr a std::string.
8842 * src/filetools.C (GetEnv): made ch really const.
8844 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8845 made code that used these use max/min from <algorithm> instead.
8847 * changed several c library include files to their equivalent c++
8848 library include files. All is not changed yet.
8850 * created a support subdir in src, put lyxstring and lstrings
8851 there + the extra files atexit, fileblock, strerror. Created
8852 Makefile.am. edited configure.in and src/Makefile.am to use this
8853 new subdir. More files moved to support.
8855 * imported som of the functions from repository lyx, filetools
8857 * ran tags-query-replace on LString -> string, corrected the bogus
8858 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8859 is still some errors in there. This is errors where too much or
8860 too litle get deleted from strings (string::erase, string::substr,
8861 string::replace), there can also be some off by one errors, or
8862 just plain wrong use of functions from lstrings. Viewing of quotes
8865 * LyX is now running fairly well with string, but there are
8866 certainly some bugs yet (see above) also string is quite different
8867 from LString among others in that it does not allow null pointers
8868 passed in and will abort if it gets any.
8870 * Added the revtex4 files I forgot when setting up the repository.
8872 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8874 * All over: Tried to clean everything up so that only the files
8875 that we really need are included in the cvs repository.
8876 * Switched to use automake.
8877 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8878 * Install has not been checked.
8880 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8882 * po/pt.po: Three errors:
8883 l.533 and l.538 format specification error
8884 l. 402 duplicate entry, I just deleted it.