1 2000-09-11 Juergen Vigna <jug@sad.it>
3 * src/lyx_gui.C (runTime): uses global guiruntime variable.
5 * src/main.C (main): now GUII defines global guiruntime!
7 * src/frontends/gnome/GUIRunTime.C (initApplication):
8 * src/frontends/kde/GUIRunTime.C (initApplication):
9 * src/frontends/xforms/GUIRunTime.C (initApplication):
10 * src/frontends/GUIRunTime.h: added new function initApplication.
12 * src/spellchecker.C (sc_accept_word): change to add_to_session.
14 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
16 2000-09-08 Juergen Vigna <jug@sad.it>
18 * src/lyx_gui.C (create_forms): don't display the "default" entry as
19 we have already "Reset".
21 * src/language.C (initL): inserted "default" language and made this
22 THE default language (and not american!)
24 * src/paragraph.C: inserted handling of "default" language!
26 * src/lyxfont.C: ditto
30 * src/paragraph.C: output the \\par only if we have a following
31 paragraph otherwise it's not needed.
33 2000-09-05 Juergen Vigna <jug@sad.it>
35 * config/pspell.m4: added entry to lyx-flags
37 * src/spellchecker.C: modified version from Kevin for using pspell
39 2000-09-01 Marko Vendelin <markov@ioc.ee>
40 * src/frontends/gnome/Makefile.am
41 * src/frontends/gnome/FormCitation.C
42 * src/frontends/gnome/FormCitation.h
43 * src/frontends/gnome/diainsertcitation_callbacks.c
44 * src/frontends/gnome/diainsertcitation_callbacks.h
45 * src/frontends/gnome/diainsertcitation_interface.c
46 * src/frontends/gnome/diainsertcitation_interface.h
47 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
48 dialog for Gnome frontend
50 * src/main.C: Gnome libraries require keeping application name
51 and its version as strings
53 * src/frontends/gnome/mainapp.C: Change the name of the main window
54 from GnomeLyX to PACKAGE
56 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
58 * src/frontends/Liason.C: add "using: declaration.
60 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
62 * src/mathed/math_macro.C (Metrics): Set the size of the template
64 * src/mathed/formulamacro.C (Latex): Fixed the returned value
66 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
68 * src/converter.C (add_options): New function.
69 (SetViewer): Change $$FName into '$$FName'.
70 (View): Add options when running xdvi
71 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
72 (Convert): The 3rd parameter is now the desired filename. Converts
73 calls to lyx::rename if necessary.
74 Add options when running dvips.
75 (dvi_papersize,dvips_options): New methods.
77 * src/exporter.C (Export): Use getLatexName() instead of fileName().
79 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
80 using a call to Converter::dvips_options.
81 Fixed to work with nex export code.
84 * src/support/rename.C: New files
86 * src/support/syscall.h
87 * src/support/syscall.C: Added Starttype SystemDontWait.
89 * lib/ui/default.ui: Changed to work with new export code
91 * lib/configure.m4: Changed to work with new export code
93 * src/encoding.C: Changed latex name for iso8859_7 encoding.
95 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
97 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
98 so that code compiles with DEC cxx.
100 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
101 to work correctly! Also now supports the additional elements
104 2000-09-01 Allan Rae <rae@lyx.org>
106 * src/frontends/ButtonPolicies.C: renamed all the references to
107 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
109 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
110 since it's a const not a type.
112 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
114 2000-08-31 Juergen Vigna <jug@sad.it>
116 * src/insets/figinset.C: Various changes to look if the filename has
117 an extension and if not add it for inline previewing.
119 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
121 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
122 make buttonStatus and isReadOnly be const methods. (also reflect
123 this in derived classes.)
125 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
126 (nextState): change to be static inline, pass the StateMachine as
128 (PreferencesPolicy): remove casts
129 (OkCancelPolicy): remvoe casts
130 (OkCancelReadOnlyPolicy): remove casts
131 (NoRepeatedApplyReadOnlyPolicy): remove casts
132 (OkApplyCancelReadOnlyPolicy): remove casts
133 (OkApplyCancelPolicy): remove casts
134 (NoRepeatedApplyPolicy): remove casts
136 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
138 * src/converter.C: added some using directives
140 * src/frontends/ButtonPolicies.C: changes to overcome
141 "need lvalue" error with DEC c++
143 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
144 to WMHideCB for DEC c++
146 * src/frontends/xforms/Menubar_pimpl.C: added using directive
148 * src/frontends/xforms/forms/form_document.C.patch: use C callback
149 to BulletBMTableCB for DEC c++
151 2000-08-31 Allan Rae <rae@lyx.org>
153 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
154 character dialog separately from old document dialogs combo_language.
157 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
159 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
160 Removed LFUN_REF_CREATE.
162 * src/MenuBackend.C: Added new tags: toc and references
164 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
165 (add_lastfiles, add_documents, add_formats): Removed the unused smn
167 (add_toc, add_references): New methods.
168 (create_submenu): Handle correctly the case when there is a
169 seperator after optional menu items.
171 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
172 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
173 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
175 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
177 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
179 * src/converter.[Ch]: New file for converting between different
182 * src/export.[Ch]: New file for exporting a LyX file to different
185 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
186 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
187 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
188 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
189 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
190 RunDocBook, MenuExport.
192 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
193 Exporter::Preview methods if NEW_EXPORT is defined.
195 * src/buffer.C (Dispatch): Use Exporter::Export.
197 * src/lyxrc.C: Added new tags: \converter and \viewer.
200 * src/LyXAction.C: Define new lyx-function: buffer-update.
201 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
202 when NEW_EXPORT is defined.
204 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
206 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
208 * lib/ui/default.ui: Added submenus "view" and "update" to the
211 * src/filetools.C (GetExtension): New function.
213 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
215 2000-08-29 Allan Rae <rae@lyx.org>
217 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
219 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
220 (EnableDocumentLayout): removed
221 (DisableDocumentLayout): removed
222 (build): make use of ButtonController's read-only handling to
223 de/activate various objects. Replaces both of the above functions.
225 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
226 (readOnly): was read_only
227 (refresh): fixed dumb mistakes with read_only_ handling
229 * src/frontends/xforms/forms/form_document.fd:
230 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
231 tabbed dialogs so the tabs look more like tabs and so its easier to
232 work out which is the current tab.
234 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
235 segfault with form_table
237 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
239 2000-08-28 Juergen Vigna <jug@sad.it>
241 * acconfig.h: added USE_PSPELL.
243 * src/config.h.in: added USE_PSPELL.
245 * autogen.sh: added pspell.m4
247 * config/pspell.m4: new file.
249 * src/spellchecker.C: implemented support for pspell libary.
251 2000-08-25 Juergen Vigna <jug@sad.it>
253 * src/LyXAction.C (init): renamed LFUN_TABLE to
254 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
256 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
258 * src/lyxscreen.h: add force_clear variable and fuction to force
259 a clear area when redrawing in LyXText.
261 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
263 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
265 * some whitespace and comment changes.
267 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
269 * src/buffer.C: up te LYX_FORMAT to 2.17
271 2000-08-23 Juergen Vigna <jug@sad.it>
273 * src/BufferView_pimpl.C (tripleClick): disable this when in a
276 * src/insets/insettabular.C (pasteSelection): delete the insets
277 LyXText as it is not valid anymore.
278 (copySelection): new function.
279 (pasteSelection): new function.
280 (cutSelection): new function.
281 (LocalDispatch): implemented cut/copy/paste of cell selections.
283 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
284 don't have a LyXText.
286 * src/LyXAction.C (init): a NEW_TABULAR define too much.
288 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
291 2000-08-22 Juergen Vigna <jug@sad.it>
293 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
294 ifdef form_table out if NEW_TABULAR.
296 2000-08-21 Juergen Vigna <jug@sad.it>
298 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
299 (draw): fixed draw position so that the cursor is positioned in the
301 (InsetMotionNotify): hide/show cursor so the position is updated.
302 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
303 using cellstart() function where it should be used.
305 * src/insets/insettext.C (draw): ditto.
307 * src/tabular.C: fixed initialization of some missing variables and
308 made BoxType into an enum.
310 2000-08-22 Marko Vendelin <markov@ioc.ee>
311 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
312 stock menu item using action numerical value, not its string
316 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
318 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
319 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
321 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
323 * src/frontends/xforms/GUIRunTime.C: new file
325 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
326 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
328 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
330 * src/frontends/kde/GUIRunTime.C: new file
332 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
333 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
335 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
337 * src/frontends/gnome/GUIRunTime.C: new file
339 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
342 * src/frontends/GUIRunTime.h: removed constructor and destructor,
343 small change to documetentation.
345 * src/frontends/GUIRunTime.C: removed file
347 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
349 * src/lyxparagraph.h: enable NEW_TABULAR as default
351 * src/lyxfunc.C (processKeySym): remove some commented code
353 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
354 NEW_TABULAR around the fd_form_table_options.
356 * src/lyx_gui.C (runTime): call the static member function as
357 GUIRunTime::runTime().
359 2000-08-21 Allan Rae <rae@lyx.org>
361 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
364 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
366 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
368 2000-08-21 Allan Rae <rae@lyx.org>
370 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
372 * src/frontends/xforms/FormPreferences.C (build): use setOK
373 * src/frontends/xforms/FormDocument.C (build): use setOK
374 (FormDocument): use the appropriate policy.
376 2000-08-21 Allan Rae <rae@lyx.org>
378 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
379 automatic [de]activation of arbitrary objects when in a read-only state.
381 * src/frontends/ButtonPolicies.h: More documentation
382 (isReadOnly): added to support the above.
384 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
386 2000-08-18 Juergen Vigna <jug@sad.it>
388 * src/insets/insettabular.C (getStatus): changed to return func_status.
390 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
391 display toggle menu entries if they are.
393 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
394 new document layout now.
396 * src/lyxfunc.C: ditto
398 * src/lyx_gui_misc.C: ditto
400 * src/lyx_gui.C: ditto
402 * lib/ui/default.ui: removed paper and quotes layout as they are now
403 all in the document layout tabbed folder.
405 * src/frontends/xforms/forms/form_document.fd: added Restore
406 button and callbacks for all inputs for Allan's ButtonPolicy.
408 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
409 (CheckChoiceClass): added missing params setting on class change.
410 (UpdateLayoutDocument): added for updating the layout on params.
411 (build): forgot to RETURN_ALWAYS input_doc_spacing.
412 (FormDocument): Implemented Allan's ButtonPolicy with the
415 2000-08-17 Allan Rae <rae@lyx.org>
417 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
418 so we can at least see the credits again.
420 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
421 controller calls for the appropriate callbacks. Note that since Ok
422 calls apply followed by cancel, and apply isn't a valid input for the
423 APPLIED state, the bc_ calls have to be made in the static callback not
424 within each of the real callbacks.
426 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
427 (setOk): renamed from setOkay()
429 2000-08-17 Juergen Vigna <jug@sad.it>
431 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
432 in the implementation part.
433 (composeUIInfo): don't show optional menu-items.
435 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
437 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
439 * src/bufferview_funcs.C (CurrentState): fixed to show also the
440 text-state when in a text-inset.
442 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
444 2000-08-17 Marko Vendelin <markov@ioc.ee>
445 * src/frontends/gnome/FormIndex.C
446 * src/frontends/gnome/FormIndex.h
447 * src/frontends/gnome/FormToc.C
448 * src/frontends/gnome/FormToc.h
449 * src/frontends/gnome/dialogs
450 * src/frontends/gnome/diatoc_callbacks.c
451 * src/frontends/gnome/diatoc_callbacks.h
452 * src/frontends/gnome/diainsertindex_callbacks.h
453 * src/frontends/gnome/diainsertindex_callbacks.c
454 * src/frontends/gnome/diainsertindex_interface.c
455 * src/frontends/gnome/diainsertindex_interface.h
456 * src/frontends/gnome/diatoc_interface.h
457 * src/frontends/gnome/diatoc_interface.c
458 * src/frontends/gnome/Makefile.am: Table of Contents and
459 Insert Index dialogs implementation for Gnome frontend
461 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
463 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
465 * src/frontends/gnome/diainserturl_interface.c: make the dialog
468 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
470 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
471 destructor. Don't definde if you don't need it
472 (processEvents): made static, non-blocking events processing for
474 (runTime): static method. event loop for xforms
475 * similar as above for kde and gnome.
477 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
479 (runTime): new method calss the real frontends runtime func.
481 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
483 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
485 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
487 2000-08-16 Juergen Vigna <jug@sad.it>
489 * src/lyx_gui.C (runTime): added GUII RunTime support.
491 * src/frontends/Makefile.am:
492 * src/frontends/GUIRunTime.[Ch]:
493 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
494 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
495 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
497 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
499 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
500 as this is already set in ${FRONTEND_INCLUDE} if needed.
502 * configure.in (CPPFLAGS): setting the include dir for the frontend
503 directory and don't set FRONTEND=xforms for now as this is executed
506 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
508 * src/frontends/kde/Makefile.am:
509 * src/frontends/kde/FormUrl.C:
510 * src/frontends/kde/FormUrl.h:
511 * src/frontends/kde/formurldialog.h:
512 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
514 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
516 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
518 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
520 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
523 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
525 * src/WorkArea.C (work_area_handler): more work to get te
526 FL_KEYBOARD to work with xforms 0.88 too, please test.
528 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
530 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
532 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
535 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
537 * src/Timeout.h: remove Qt::emit hack.
539 * several files: changes to allo doc++ compilation
541 * src/lyxfunc.C (processKeySym): new method
542 (processKeyEvent): comment out if FL_REVISION < 89
544 * src/WorkArea.C: change some debugging levels.
545 (WorkArea): set wantkey to FL_KEY_ALL
546 (work_area_handler): enable the FL_KEYBOARD clause, this enables
547 clearer code and the use of compose with XForms 0.89. Change to
548 use signals instead of calling methods in bufferview directly.
550 * src/Painter.C: change some debugging levels.
552 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
555 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
556 (workAreaKeyPress): new method
558 2000-08-14 Juergen Vigna <jug@sad.it>
560 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
562 * config/kde.m4: addes some features
564 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
565 include missing xforms dialogs.
567 * src/Timeout.h: a hack to be able to compile with qt/kde.
569 * sigc++/.cvsignore: added acinclude.m4
571 * lib/.cvsignore: added listerros
573 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
574 xforms tree as objects are needed for other frontends.
576 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
577 linking with not yet implemented xforms objects.
579 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
581 2000-08-14 Baruch Even <baruch.even@writeme.com>
583 * src/frontends/xforms/FormGraphics.h:
584 * src/frontends/xforms/FormGraphics.C:
585 * src/frontends/xforms/RadioButtonGroup.h:
586 * src/frontends/xforms/RadioButtonGroup.C:
587 * src/insets/insetgraphics.h:
588 * src/insets/insetgraphics.C:
589 * src/insets/insetgraphicsParams.h:
590 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
591 instead of spaces, and various other indentation issues to make the
592 sources more consistent.
594 2000-08-14 Marko Vendelin <markov@ioc.ee>
596 * src/frontends/gnome/dialogs/diaprint.glade
597 * src/frontends/gnome/FormPrint.C
598 * src/frontends/gnome/FormPrint.h
599 * src/frontends/gnome/diaprint_callbacks.c
600 * src/frontends/gnome/diaprint_callbacks.h
601 * src/frontends/gnome/diaprint_interface.c
602 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
605 * src/frontends/gnome/dialogs/diainserturl.glade
606 * src/frontends/gnome/FormUrl.C
607 * src/frontends/gnome/FormUrl.h
608 * src/frontends/gnome/diainserturl_callbacks.c
609 * src/frontends/gnome/diainserturl_callbacks.h
610 * src/frontends/gnome/diainserturl_interface.c
611 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
614 * src/frontends/gnome/Dialogs.C
615 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
616 all other dialogs. Copy all unimplemented dialogs from Xforms
619 * src/frontends/gnome/support.c
620 * src/frontends/gnome/support.h: support files generated by Glade
624 * config/gnome.m4: Gnome configuration scripts
626 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
627 configure --help message
629 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
630 only if there are no events pendling in Gnome/Gtk. This enhances
631 the performance of menus.
634 2000-08-14 Allan Rae <rae@lyx.org>
636 * lib/Makefile.am: listerrors cleaning
638 * lib/listerrors: removed -- generated file
639 * acinclude.m4: ditto
640 * sigc++/acinclude.m4: ditto
642 * src/frontends/xforms/forms/form_citation.fd:
643 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
646 * src/frontends/xforms/forms/makefile: I renamed the `install` target
647 `updatesrc` and now we have a `test` target that does what `updatesrc`
648 used to do. I didn't like having an install target that wasn't related
651 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
652 on all except FormGraphics. This may yet happen. Followed by a major
653 cleanup including using FL_TRANSIENT for most of the dialogs. More
654 changes to come when the ButtonController below is introduced.
656 * src/frontends/xforms/ButtonController.h: New file for managing up to
657 four buttons on a dialog according to an externally defined policy.
658 * src/frontends/xforms/Makefile.am: added above
660 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
661 Apply and Cancel/Close buttons and everything in between and beyond.
662 * src/frontends/Makefile.am: added above.
664 * src/frontends/xforms/forms/form_preferences.fd:
665 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
666 and removed variable 'status' as a result. Fixed the set_minsize thing.
667 Use the new screen-font-update after checking screen fonts were changed
668 Added a "Restore" button to restore the original lyxrc values while
669 editing. This restores everything not just the last input changed.
670 That's still a tricky one. As is the "LyX: this shouldn't happen..."
672 * src/LyXAction.C: screen-font-update added for updating buffers after
673 screen font settings have been changed.
674 * src/commandtags.h: ditto
675 * src/lyxfunc.C: ditto
677 * forms/lyx.fd: removed screen fonts dialog.
678 * src/lyx_gui.C: ditto
679 * src/menus.[Ch]: ditto
680 * src/lyx.[Ch]: ditto
681 * src/lyx_cb.C: ditto + code from here moved to make
682 screen-font-update. And people wonder why progress on GUII is
683 slow. Look at how scattered this stuff was! It takes forever
686 * forms/fdfix.sh: Fixup the spacing after commas.
687 * forms/makefile: Remove date from generated files. Fewer clashes now.
688 * forms/bullet_forms.C.patch: included someones handwritten changes
690 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
691 once I've discovered why LyXRC was made noncopyable.
692 * src/lyx_main.C: ditto
694 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
696 * src/frontends/xforms/forms/fdfix.sh:
697 * src/frontends/xforms/forms/fdfixh.sed:
698 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
699 * src/frontends/xforms/Form*.[hC]:
700 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
701 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
702 provide a destructor for the struct FD_form_xxxx. Another version of
703 the set_[max|min]size workaround and a few other cleanups. Actually,
704 Angus' patch from 20000809.
706 2000-08-13 Baruch Even <baruch.even@writeme.com>
708 * src/insets/insetgraphics.C (Clone): Added several fields that needed
711 2000-08-11 Juergen Vigna <jug@sad.it>
713 * src/insets/insetgraphics.C (InsetGraphics): changing init
714 order because of warnings.
716 * src/frontends/xforms/forms/makefile: adding patching .C with
719 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
720 from .C.patch to .c.patch
722 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
723 order because of warning.
725 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
727 * src/frontends/Liason.C (setMinibuffer): new helper function
729 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
731 * src/lyxfunc.C (Dispatch): calling new Document-Layout
733 * lib/ui/default.ui: commented out PaperLayout entry
735 * src/frontends/xforms/form_document.[Ch]: new added files
737 * src/frontends/xforms/FormDocument.[Ch]: ditto
739 * src/frontends/xforms/forms/form_document.fd: ditto
741 * src/frontends/xforms/forms/form_document.C.patch: ditto
743 2000-08-10 Juergen Vigna <jug@sad.it>
745 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
746 (InsetGraphics): initialized cacheHandle to 0.
747 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
749 2000-08-10 Baruch Even <baruch.even@writeme.com>
751 * src/graphics/GraphicsCache.h:
752 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
753 correctly as a cache.
755 * src/graphics/GraphicsCacheItem.h:
756 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
759 * src/graphics/GraphicsCacheItem_pimpl.h:
760 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
763 * src/insets/insetgraphics.h:
764 * src/insets/insetgraphics.C: Changed from using a signal notification
765 to polling when image is not loaded.
767 2000-08-10 Allan Rae <rae@lyx.org>
769 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
770 that there are two functions that have to been taken out of line by
771 hand and aren't taken care of in the script. (Just a reminder note)
773 * sigc++/macros/*.h.m4: Updated as above.
775 2000-08-09 Juergen Vigna <jug@sad.it>
777 * src/insets/insettext.C (draw): small fix for clearing rectangle.
779 * src/insets/insettabular.C: make drawing of single cell smarter.
781 2000-08-09 Marko Vendelin <markov@ioc.ee>
782 * src/frontends/gnome/Menubar_pimpl.C
783 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
784 implementation: new files
786 * src/frontends/gnome/mainapp.C
787 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
790 * src/main.C: create Gnome main window
792 * src/frontends/xforms/Menubar_pimpl.h
793 * src/frontends/Menubar.C
794 * src/frontends/Menubar.h: added method Menubar::update that calls
795 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
797 * src/LyXView.C: calls Menubar::update to update the state
800 * src/frontends/gnome/Makefile.am: added new files
802 * src/frontends/Makefile.am: added frontend compiler options
804 2000-08-08 Juergen Vigna <jug@sad.it>
806 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
808 * src/bufferlist.C (close):
809 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
810 documents if exiting without saving.
812 * src/buffer.C (save): use removeAutosaveFile()
814 * src/support/filetools.C (removeAutosaveFile): new function.
816 * src/lyx_cb.C (MenuWrite): returns a bool now.
817 (MenuWriteAs): check if file could really be saved and revert to the
819 (MenuWriteAs): removing old autosavefile if existant.
821 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
822 before Goto toggle declaration, because of compiler warning.
824 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
826 * src/lyxfunc.C (MenuNew): small fix.
828 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
830 * src/bufferlist.C (newFile):
831 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
833 * src/lyxrc.C: added new_ask_filename tag
835 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
837 * src/lyx.fd: removed code pertaining to form_ref
838 * src/lyx.[Ch]: ditto
839 * src/lyx_cb.C: ditto
840 * src/lyx_gui.C: ditto
841 * src/lyx_gui_misc.C: ditto
843 * src/BufferView_pimpl.C (restorePosition): update buffer only
846 * src/commandtags.h (LFUN_REFTOGGLE): removed
847 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
848 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
849 (LFUN_REFBACK): renamed LFUN_REF_BACK
851 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
853 * src/lyxfunc.C (Dispatch): ditto.
854 InsertRef dialog is now GUI-independent.
856 * src/texrow.C: added using std::endl;
858 * src/insets/insetref.[Ch]: strip out large amounts of code.
859 The inset is now a container and this functionality is now
860 managed by a new FormRef dialog
862 * src/frontends/Dialogs.h (showRef, createRef): new signals
864 * src/frontends/xforms/FormIndex.[Ch],
865 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
866 when setting dialog's min/max size
867 * src/frontends/xforms/FormIndex.[Ch]: ditto
869 * src/frontends/xforms/FormRef.[Ch],
870 src/frontends/xforms/forms/form_ref.fd: new xforms
871 implementation of an InsetRef dialog
873 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
876 * src/graphics/XPM_Renderer.C (isImageFormatOK):
877 ios::nocreate is not part of the standard. Removed.
879 2000-08-07 Baruch Even <baruch.even@writeme.com>
881 * src/graphics/Renderer.h:
882 * src/graphics/Renderer.C: Added base class for rendering of different
883 image formats into Pixmaps.
885 * src/graphics/XPM_Renderer.h:
886 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
887 in a different class.
889 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
890 easily add support for other formats.
892 * src/insets/figinset.C: plugged a leak of an X resource.
894 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
896 * src/CutAndPaste.[Ch]: make all metods static.
898 * development/Code_rules/Rules: more work, added section on
899 Exceptions, and a References section.
901 * a lot of header files: work to make doc++ able to generate the
902 source documentation, some workarounds of doc++ problems. Doc++ is
903 now able to generate the documentation.
905 2000-08-07 Juergen Vigna <jug@sad.it>
907 * src/insets/insettabular.C (recomputeTextInsets): removed function
909 * src/tabular.C (SetWidthOfMulticolCell):
911 (calculate_width_of_column_NMC): fixed return value so that it really
912 only returns true if the column-width has changed (there where
913 problems with muliticolumn-cells in this column).
915 2000-08-04 Juergen Vigna <jug@sad.it>
917 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
918 also on the scrollstatus of the inset.
919 (workAreaMotionNotify): ditto.
921 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
923 2000-08-01 Juergen Vigna <jug@sad.it>
925 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
928 * src/LyXAction.C (init):
929 * src/insets/inset.C (LocalDispatch): added support for
932 * src/insets/inset.C (scroll): new functions.
934 * src/insets/insettext.C (removeNewlines): new function.
935 (SetAutoBreakRows): removes forced newlines in the text of the
936 paragraph if autoBreakRows is set to false.
938 * src/tabular.C (Latex): generates a parbox around the cell contents
941 * src/frontends/xforms/FormTabular.C (local_update): removed
942 the radio_useparbox button.
944 * src/tabular.C (UseParbox): new function
946 2000-08-06 Baruch Even <baruch.even@writeme.com>
948 * src/graphics/GraphicsCache.h:
949 * src/graphics/GraphicsCache.C:
950 * src/graphics/GraphicsCacheItem.h:
951 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
954 * src/insets/insetgraphics.h:
955 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
956 drawing of the inline image.
958 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
959 into the wrong position.
961 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
964 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
966 * src/support/translator.h: move all typedefs to public section
968 * src/support/filetools.C (MakeLatexName): return string const
971 (FileOpenSearch): ditto
973 (LibFileSearch): ditto
974 (i18nLibFileSearch): ditto
977 (CreateTmpDir): ditto
978 (CreateBufferTmpDir): ditto
979 (CreateLyXTmpDir): ditto
984 (OnlyFilename): ditto
986 (NormalizePath): ditto
988 (GetFileContents): ditto
989 (ReplaceEnvironmentPath): ditto
992 (ChangeExtension): ditto
993 (MakeDisplayPath): ditto
994 (do_popen): return cmdret const
995 (findtexfile): return string const
997 * src/support/DebugStream.h: add some /// to please doc++
999 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1001 * src/texrow.C (same_rownumber): functor to use with find_if
1002 (getIdFromRow): rewritten to use find_if and to not update the
1003 positions. return true if row is found
1004 (increasePos): new method, use to update positions
1006 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1008 * src/lyxlex_pimpl.C (verifyTable): new method
1011 (GetString): return string const
1012 (pushTable): rewrite to use std::stack
1014 (setFile): better check
1017 * src/lyxlex.h: make LyXLex noncopyable
1019 * src/lyxlex.C (text): return char const * const
1020 (GetString): return string const
1021 (getLongString): return string const
1023 * src/lyx_gui_misc.C (askForText): return pair<...> const
1025 * src/lastfiles.[Ch] (operator): return string const
1027 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1028 istringstream not char const *.
1029 move token.end() out of loop.
1030 (readFile): move initializaton of token
1032 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1033 getIdFromRow is successful.
1035 * lib/bind/emacs.bind: don't include menus bind
1037 * development/Code_rules/Rules: the beginnings of making this
1038 better and covering more of the unwritten rules that we have.
1040 * development/Code_rules/Recommendations: a couple of wording
1043 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1045 * src/support/strerror.c: remove C++ comment.
1047 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1049 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1050 LFUN_INDEX_INSERT_LAST
1052 * src/texrow.C (getIdFromRow): changed from const_iterator to
1053 iterator, allowing code to compile with DEC cxx
1055 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1056 stores part of the class, as suggested by Allan. Will allow
1058 (apply): test to apply uses InsetCommandParams operator!=
1060 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1061 (apply): test to apply uses InsetCommandParams operator!=
1063 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1064 stores part of the class.
1065 (update): removed limits on min/max size.
1067 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1068 (apply): test to apply uses InsetCommandParams operator!=
1070 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1071 (Read, Write, scanCommand, getCommand): moved functionality
1072 into InsetCommandParams.
1074 (getScreenLabel): made pure virtual
1075 new InsetCommandParams operators== and !=
1077 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1078 c-tors based on InsetCommandParams. Removed others.
1079 * src/insets/insetinclude.[Ch]: ditto
1080 * src/insets/insetlabel.[Ch]: ditto
1081 * src/insets/insetparent.[Ch]: ditto
1082 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1084 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1085 insets derived from InsetCommand created using similar c-tors
1086 based on InsetCommandParams
1087 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1088 * src/menus.C (ShowRefsMenu): ditto
1089 * src/paragraph.C (Clone): ditto
1090 * src/text2.C (SetCounter): ditto
1091 * src/lyxfunc.C (Dispatch) ditto
1092 Also recreated old InsetIndex behaviour exactly. Can now
1093 index-insert at the start of a paragraph and index-insert-last
1094 without launching the pop-up.
1096 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1098 * lib/lyxrc.example: mark te pdf options as non functional.
1100 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1101 (isStrDbl): move tmpstr.end() out of loop.
1102 (strToDbl): move intialization of tmpstr
1103 (lowercase): return string const and move tmp.end() out of loop.
1104 (uppercase): return string const and move tmp.edn() out of loop.
1105 (prefixIs): add assertion
1110 (containsOnly): ditto
1111 (containsOnly): ditto
1112 (containsOnly): ditto
1113 (countChar): make last arg char not char const
1114 (token): return string const
1115 (subst): return string const, move tmp.end() out of loop.
1116 (subst): return string const, add assertion
1117 (strip): return string const
1118 (frontStrip): return string const, add assertion
1119 (frontStrip): return string const
1124 * src/support/lstrings.C: add inclde "LAssert.h"
1125 (isStrInt): move tmpstr.end() out of loop.
1127 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1128 toollist.end() out of loop.
1129 (deactivate): move toollist.end() out of loop.
1130 (update): move toollist.end() out of loop.
1131 (updateLayoutList): move tc.end() out of loop.
1132 (add): move toollist.end() out of loop.
1134 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1135 md.end() out of loop.
1137 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1139 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1142 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1143 (Erase): move insetlist.end() out of loop.
1145 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1146 ref to const string as first arg. Move initialization of some
1147 variables, whitespace changes.
1149 * src/kbmap.C (defkey): move table.end() out of loop.
1150 (kb_keymap): move table.end() out of loop.
1151 (findbinding): move table.end() out of loop.
1153 * src/MenuBackend.C (hasMenu): move end() out of loop.
1154 (getMenu): move end() out of loop.
1155 (getMenu): move menulist_.end() out of loop.
1157 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1159 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1162 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1163 (getFromLyXName): move infotab.end() out of loop.
1165 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1166 -fvtable-thunks -ffunction-sections -fdata-sections
1168 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1170 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1173 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1175 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1177 * src/frontends/xforms/FormCitation.[Ch],
1178 src/frontends/xforms/FormIndex.[Ch],
1179 src/frontends/xforms/FormToc.[Ch],
1180 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1182 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1184 * src/commandtags.h: renamed, created some flags for citation
1187 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1189 * src/lyxfunc.C (dispatch): use signals to insert index entry
1191 * src/frontends/Dialogs.h: new signal createIndex
1193 * src/frontends/xforms/FormCommand.[Ch],
1194 src/frontends/xforms/FormCitation.[Ch],
1195 src/frontends/xforms/FormToc.[Ch],
1196 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1198 * src/insets/insetindex.[Ch]: GUI-independent
1200 * src/frontends/xforms/FormIndex.[Ch],
1201 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1204 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1206 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1207 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1209 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1211 * src/insets/insetref.C (Latex): rewrite so that there is now
1212 question that a initialization is requested.
1214 * src/insets/insetcommand.h: reenable the hide signal
1216 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1218 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1219 fix handling of shortcuts (many bugs :)
1220 (add_lastfiles): ditto.
1222 * lib/ui/default.ui: fix a few shortcuts.
1224 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1226 * Makefile.am: Fix ``rpmdist'' target to return the exit
1227 status of the ``rpm'' command, instead of the last command in
1228 the chain (the ``rm lyx.xpm'' command, which always returns
1231 2000-08-02 Allan Rae <rae@lyx.org>
1233 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1234 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1235 * src/frontends/xforms/FormToc.C (FormToc): ditto
1237 * src/frontends/xforms/Makefile.am: A few forgotten files
1239 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1240 Signals-not-copyable-problem Lars' started commenting out.
1242 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1244 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1246 * src/insets/insetcommand.h: Signals is not copyable so anoter
1247 scheme for automatic hiding of forms must be used.
1249 * src/frontends/xforms/FormCitation.h: don't inerit from
1250 noncopyable, FormCommand already does that.
1251 * src/frontends/xforms/FormToc.h: ditto
1252 * src/frontends/xforms/FormUrl.h: ditto
1254 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1256 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1258 * src/insets/insetcommand.h (hide): new SigC::Signal0
1259 (d-tor) new virtual destructor emits hide signal
1261 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1262 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1264 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1265 LOF and LOT. Inset is now GUI-independent
1267 * src/insets/insetloa.[Ch]: redundant
1268 * src/insets/insetlof.[Ch]: ditto
1269 * src/insets/insetlot.[Ch]: ditto
1271 * src/frontends/xforms/forms/form_url.fd: tweaked!
1272 * src/frontends/xforms/forms/form_citation.fd: ditto
1274 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1275 dialogs dealing with InsetCommand insets
1277 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1278 FormCommand base class
1279 * src/frontends/xforms/FormUrl.[Ch]: ditto
1281 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1283 * src/frontends/xforms/FormToc.[Ch]: ditto
1285 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1286 passed a generic InsetCommand pointer
1287 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1289 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1290 and modified InsetTOC class
1291 * src/buffer.C: ditto
1293 * forms/lyx.fd: strip out old FD_form_toc code
1294 * src/lyx_gui_misc.C: ditto
1295 * src/lyx_gui.C: ditto
1296 * src/lyx_cb.C: ditto
1297 * src/lyx.[Ch]: ditto
1299 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1301 * src/support/utility.hpp: tr -d '\r'
1303 2000-08-01 Juergen Vigna <jug@sad.it>
1305 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1307 * src/commandtags.h:
1308 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1309 LFUN_TABULAR_FEATURES.
1311 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1312 LFUN_LAYOUT_TABULAR.
1314 * src/insets/insettabular.C (getStatus): implemented helper function.
1316 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1318 2000-07-31 Juergen Vigna <jug@sad.it>
1320 * src/text.C (draw): fixed screen update problem for text-insets.
1322 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1323 something changed probably this has to be added in various other
1326 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1328 2000-07-31 Baruch Even <baruch.even@writeme.com>
1330 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1331 templates to satisfy compaq cxx.
1334 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1336 * src/support/translator.h (equal_1st_in_pair::operator()): take
1337 const ref pair_type as arg.
1338 (equal_2nd_in_pair::operator()): ditto
1339 (Translator::~Translator): remove empty d-tor.
1341 * src/graphics/GraphicsCache.C: move include config.h to top, also
1342 put initialization of GraphicsCache::singleton here.
1343 (~GraphicsCache): move here
1344 (addFile): take const ref as arg
1347 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1349 * src/BufferView2.C (insertLyXFile): change te with/without header
1352 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1354 * src/frontends/xforms/FormGraphics.C (apply): add some
1355 static_cast. Not very nice, but required by compaq cxx.
1357 * src/frontends/xforms/RadioButtonGroup.h: include header
1358 <utility> instead of <pair.h>
1360 * src/insets/insetgraphicsParams.C: add using directive.
1361 (readResize): change return type to void.
1362 (readOrigin): ditto.
1364 * src/lyxfunc.C (getStatus): add missing break for build-program
1365 function; add test for Literate for export functions.
1367 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1368 entries in Options menu.
1370 2000-07-31 Baruch Even <baruch.even@writeme.com>
1372 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1373 protect against auto-allocation; release icon when needed.
1375 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1377 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1378 on usual typewriter.
1380 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1381 earlier czech.kmap), useful only for programming.
1383 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1385 * src/frontends/xforms/FormCitation.h: fix conditioning around
1388 2000-07-31 Juergen Vigna <jug@sad.it>
1390 * src/frontends/xforms/FormTabular.C (local_update): changed
1391 radio_linebreaks to radio_useparbox and added radio_useminipage.
1393 * src/tabular.C: made support for using minipages/parboxes.
1395 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1397 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1399 (descent): so the cursor is in the middle.
1400 (width): bit smaller box.
1402 * src/insets/insetgraphics.h: added display() function.
1404 2000-07-31 Baruch Even <baruch.even@writeme.com>
1406 * src/frontends/Dialogs.h: Added showGraphics signals.
1408 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1409 xforms form definition of the graphics dialog.
1411 * src/frontends/xforms/FormGraphics.h:
1412 * src/frontends/xforms/FormGraphics.C: Added files, the
1413 GUIndependent code of InsetGraphics
1415 * src/insets/insetgraphics.h:
1416 * src/insets/insetgraphics.C: Major writing to make it work.
1418 * src/insets/insetgraphicsParams.h:
1419 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1420 struct between InsetGraphics and GUI.
1422 * src/LaTeXFeatures.h:
1423 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1424 support for graphicx package.
1426 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1427 for the graphics inset.
1429 * src/support/translator.h: Added file, used in
1430 InsetGraphicsParams. this is a template to translate between two
1433 * src/frontends/xforms/RadioButtonGroup.h:
1434 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1435 way to easily control a radio button group.
1437 2000-07-28 Juergen Vigna <jug@sad.it>
1439 * src/insets/insettabular.C (LocalDispatch):
1440 (TabularFeatures): added support for lyx-functions of tabular features.
1441 (cellstart): refixed this function after someone wrongly changed it.
1443 * src/commandtags.h:
1444 * src/LyXAction.C (init): added support for tabular-features
1446 2000-07-28 Allan Rae <rae@lyx.org>
1448 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1449 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1450 triggers the callback for input checking. As a result we sometimes get
1451 "LyX: This shouldn't happen..." printed to cerr.
1452 (input): Started using status variable since I only free() on
1453 destruction. Some input checking for paths and font sizes.
1455 * src/frontends/xforms/FormPreferences.h: Use status to control
1456 activation of Ok and Apply
1458 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1459 callback. Also resized to stop segfaults with 0.88. The problem is
1460 that xforms-0.88 requires the folder to be wide enough to fit all the
1461 tabs. If it isn't it causes all sorts of problems.
1463 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1465 * src/frontends/xforms/forms/README: Reflect reality.
1467 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1468 * src/frontends/xforms/forms/makefile: ditto.
1470 * src/commandtags.h: Get access to new Preferences dialog
1471 * src/LyXAction.C: ditto
1472 * src/lyxfunc.C: ditto
1473 * lib/ui/default.ui: ditto
1475 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1477 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1479 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1482 * src/frontends/xforms/form_url.[Ch]: added.
1484 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1486 * src/insets/insetbib.h: fixed bug in previous commit
1488 * src/frontends/xforms/FormUrl.h: ditto
1490 * src/frontends/xforms/FormPrint.h: ditto
1492 * src/frontends/xforms/FormPreferences.h: ditto
1494 * src/frontends/xforms/FormCopyright.h: ditto
1496 * src/frontends/xforms/FormCitation.C: ditto
1498 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1499 private copyconstructor and private default contructor
1501 * src/support/Makefile.am: add utility.hpp
1503 * src/support/utility.hpp: new file from boost
1505 * src/insets/insetbib.h: set owner in clone
1507 * src/frontends/xforms/FormCitation.C: added missing include
1510 * src/insets/form_url.[Ch]: removed
1512 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1514 * development/lyx.spec.in
1515 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1516 file/directory re-organization.
1518 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1520 * src/insets/insetcommand.[Ch]: moved the string data and
1521 associated manipulation methods into a new stand-alone class
1522 InsetCommandParams. This class has two additional methods
1523 getAsString() and setFromString() allowing the contents to be
1524 moved around as a single string.
1525 (addContents) method removed.
1526 (setContents) method no longer virtual.
1528 * src/buffer.C (readInset): made use of new InsetCitation,
1529 InsetUrl constructors based on InsetCommandParams.
1531 * src/commandtags.h: add LFUN_INSERT_URL
1533 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1534 independent InsetUrl and use InsetCommandParams to extract
1535 string info and create new Insets.
1537 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1539 * src/frontends/xforms/FormCitation.C (apply): uses
1542 * src/frontends/xforms/form_url.C
1543 * src/frontends/xforms/form_url.h
1544 * src/frontends/xforms/FormUrl.h
1545 * src/frontends/xforms/FormUrl.C
1546 * src/frontends/xforms/forms/form_url.fd: new files
1548 * src/insets/insetcite.[Ch]: removed unused constructors.
1550 * src/insets/insetinclude.[Ch]: no longer store filename
1552 * src/insets/inseturl.[Ch]: GUI-independent.
1554 2000-07-26 Juergen Vigna <jug@sad.it>
1555 * renamed frontend from gtk to gnome as it is that what is realized
1556 and did the necessary changes in the files.
1558 2000-07-26 Marko Vendelin <markov@ioc.ee>
1560 * configure.in: cleaning up gnome configuration scripts
1562 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1564 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1565 shortcuts syndrom by redrawing them explicitely (a better solution
1566 would be appreciated).
1568 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1570 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1573 * src/lyx_cb.C (MenuExport): change html export to do the right
1574 thing depending of the document type (instead of having
1575 html-linuxdoc and html-docbook).
1576 * src/lyxfunc.C (getStatus): update for html
1577 * lib/ui/default.ui: simplify due to the above change.
1578 * src/menus.C (ShowFileMenu): update too (in case we need it).
1580 * src/MenuBackend.C (read): if a menu is defined twice, add the
1581 new entries to the exiting one.
1583 2000-07-26 Juergen Vigna <jug@sad.it>
1585 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1587 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1588 and return a bool if it did actual save the file.
1589 (AutoSave): don't autosave a unnamed doc.
1591 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1592 check if this is an UNNAMED new file and react to it.
1593 (newFile): set buffer to unnamed and change to not mark a new
1594 buffer dirty if I didn't do anything with it.
1596 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1598 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1600 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1601 friend as per Angus's patch posted to lyx-devel.
1603 * src/ext_l10n.h: updated
1605 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1606 gettext on the style string right before inserting them into the
1609 * autogen.sh: add code to extract style strings form layout files,
1610 not good enough yet.
1612 * src/frontends/gtk/.cvsignore: add MAKEFILE
1614 * src/MenuBackend.C (read): run the label strings through gettext
1615 before storing them in the containers.
1617 * src/ext_l10n.h: new file
1619 * autogen.sh : generate the ext_l10n.h file here
1621 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1623 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1626 * lib/ui/default.ui: fix a couple of typos.
1628 * config/gnome/gtk.m4: added (and added to the list of files in
1631 * src/insets/insetinclude.C (unique_id): fix when we are using
1632 lyxstring instead of basic_string<>.
1633 * src/insets/insettext.C (LocalDispatch): ditto.
1634 * src/support/filetools.C: ditto.
1636 * lib/configure.m4: create the ui/ directory if necessary.
1638 * src/LyXView.[Ch] (updateToolbar): new method.
1640 * src/BufferView_pimpl.C (buffer): update the toolbar when
1641 opening/closing buffer.
1643 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1645 * src/LyXAction.C (getActionName): enhance to return also the name
1646 and options of pseudo-actions.
1647 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1649 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1650 as an example of what is possible). Used in File->Build too (more
1651 useful) and in the import/export menus (to mimick the complicated
1652 handling of linuxdoc and friends). Try to update all the entries.
1654 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1657 * src/MenuBackend.C (read): Parse the new OptItem tag.
1659 * src/MenuBackend.h: Add a new optional_ data member (used if the
1660 entry should be omitted when the lyxfunc is disabled).
1662 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1663 function, used as a shortcut.
1664 (create_submenu): align correctly the shortcuts on the widest
1667 * src/MenuBackend.h: MenuItem.label() only returns the label of
1668 the menu without shortcut; new method shortcut().
1670 2000-07-14 Marko Vendelin <markov@ioc.ee>
1672 * src/frontends/gtk/Dialogs.C:
1673 * src/frontends/gtk/FormCopyright.C:
1674 * src/frontends/gtk/FormCopyright.h:
1675 * src/frontends/gtk/Makefile.am: added these source-files for the
1676 Gtk/Gnome support of the Copyright-Dialog.
1678 * src/main.C: added Gnome::Main initialization if using
1679 Gtk/Gnome frontend-GUI.
1681 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1683 * config/gnome/aclocal-include.m4
1684 * config/gnome/compiler-flags.m4
1685 * config/gnome/curses.m4
1686 * config/gnome/gnome--.m4
1687 * config/gnome/gnome-bonobo-check.m4
1688 * config/gnome/gnome-common.m4
1689 * config/gnome/gnome-fileutils.m4
1690 * config/gnome/gnome-ghttp-check.m4
1691 * config/gnome/gnome-gnorba-check.m4
1692 * config/gnome/gnome-guile-checks.m4
1693 * config/gnome/gnome-libgtop-check.m4
1694 * config/gnome/gnome-objc-checks.m4
1695 * config/gnome/gnome-orbit-check.m4
1696 * config/gnome/gnome-print-check.m4
1697 * config/gnome/gnome-pthread-check.m4
1698 * config/gnome/gnome-support.m4
1699 * config/gnome/gnome-undelfs.m4
1700 * config/gnome/gnome-vfs.m4
1701 * config/gnome/gnome-x-checks.m4
1702 * config/gnome/gnome-xml-check.m4
1703 * config/gnome/gnome.m4
1704 * config/gnome/gperf-check.m4
1705 * config/gnome/gtk--.m4
1706 * config/gnome/linger.m4
1707 * config/gnome/need-declaration.m4: added configuration scripts
1708 for Gtk/Gnome frontend-GUI
1710 * configure.in: added support for the --with-frontend=gtk option
1712 * autogen.sh: added config/gnome/* to list of config-files
1714 * acconfig.h: added define for GTKGUI-support
1716 * config/lyxinclude.m4: added --with-frontend[=value] option value
1717 for Gtk/Gnome frontend-GUI support.
1719 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1721 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1725 * src/paragraph.C (GetChar): remove non-const version
1727 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1728 (search_kw): use it.
1730 * src/lyx_main.C (init): if "preferences" exist, read that instead
1732 (ReadRcFile): return bool if the file could be read ok.
1733 (ReadUIFile): add a check to see if lex file is set ok.
1735 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1736 bastring can be used instead of lyxstring (still uses the old code
1737 if std::string is good enough or if lyxstring is used.)
1739 * src/encoding.C: make the arrays static, move ininle functions
1741 * src/encoding.h: from here.
1743 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1744 (parseSingleLyXformat2Token): move inset parsing to separate method
1745 (readInset): new private method
1747 * src/Variables.h: remove virtual from get().
1749 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1750 access to NEW_INSETS and NEW_TABULAR
1752 * src/MenuBackend.h: remove superfluous forward declaration of
1753 MenuItem. Add documentations tags "///", remove empty MenuItem
1754 destructor, remove private default contructor.
1756 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1758 (read): more string mlabel and mname to where they are used
1759 (read): remove unused variables mlabel and mname
1760 (defaults): unconditional clear, make menusetup take advantage of
1761 add returning Menu &.
1763 * src/LyXView.h: define NEW_MENUBAR as default
1765 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1766 to NEW_INSETS and NEW_TABULAR.
1767 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1768 defined. Change some of the "xxxx-inset-insert" functions names to
1771 * several files: more enahncements to NEW_INSETS and the resulting
1774 * lib/lyxrc.example (\date_insert_format): move to misc section
1776 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1777 bastring and use AC_CACHE_CHECK.
1778 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1779 the system have the newest methods. uses AC_CACHE_CHECK
1780 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1781 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1782 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1784 * configure.in: add LYX_CXX_GOOD_STD_STRING
1786 * acinclude.m4: recreated
1788 2000-07-24 Amir Karger
1790 * README: add Hebrew, Arabic kmaps
1793 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1795 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1798 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1800 * Lot of files: add pragma interface/implementation.
1802 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1804 * lib/ui/default.ui: new file (ans new directory). Contains the
1805 default menu and toolbar.
1807 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1808 global space. Toolbars are now read (as menus) in ui files.
1810 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1812 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1813 is disabled because the document is read-only. We want to have the
1814 toggle state of the function anyway.
1815 (getStatus): add code for LFUN_VC* functions (mimicking what is
1816 done in old-style menus)
1818 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1819 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1821 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1822 * src/BufferView_pimpl.C: ditto.
1823 * src/lyxfunc.C: ditto.
1825 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1826 default). This replaces old-style menus by new ones.
1828 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1829 MenuItem. Contain the data structure of a menu.
1831 * src/insets/insettext.C: use LyXView::setLayout instead of
1832 accessing directly the toolbar combox.
1833 * src/lyxfunc.C (Dispatch): ditto.
1835 * src/LyXView.C (setLayout): new method, which just calls
1836 Toolbar::setLayout().
1837 (updateLayoutChoice): move part of this method in Toolbar.
1839 * src/toolbar.[Ch]: removed.
1841 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1842 implementation the toolbar.
1844 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1845 the toolbar. It might make sense to merge it with ToolbarDefaults
1847 (setLayout): new function.
1848 (updateLayoutList): ditto.
1849 (openLayoutList): ditto.
1851 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1852 xforms implementation of the toolbar.
1853 (get_toolbar_func): comment out, since I do not
1854 know what it is good for.
1856 * src/ToolbarDefaults.h: Add the ItemType enum.
1858 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1859 for a list of allocated C strings. Used in Menubar xforms
1860 implementation to avoid memory leaks.
1862 * src/support/lstrings.[Ch] (uppercase): new version taking and
1866 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1867 * lib/bind/emacs.bind: ditto.
1869 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1871 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1872 forward decl of LyXView.
1874 * src/toolbar.C (toolbarItem): moved from toolbar.h
1875 (toolbarItem::clean): ditto
1876 (toolbarItem::~toolbarItem): ditto
1877 (toolbarItem::operator): ditto
1879 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1881 * src/paragraph.h: control the NEW_TABULAR define from here
1883 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1884 USE_TABULAR_INSETS to NEW_TABULAR
1886 * src/ToolbarDefaults.C: add include "lyxlex.h"
1888 * files using the old table/tabular: use NEW_TABULAR to control
1889 compilation of old tabular stuff.
1891 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1894 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1895 planemet in reading of old style floats, fix the \end_deeper
1896 problem when reading old style floats.
1898 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1900 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1902 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1904 * lib/bind/sciword.bind: updated.
1906 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1908 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1909 layout write problem
1911 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1913 * src/Makefile.am (INCLUDES): remove image directory from include
1916 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1917 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1919 * src/LyXView.C (create_form_form_main): read the application icon
1922 * lib/images/*.xpm: change the icons to use transparent color for
1925 * src/toolbar.C (update): change the color of the button when it
1928 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1930 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1931 setting explicitely the minibuffer.
1932 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1934 * src/LyXView.C (showState): new function. Shows font information
1935 in minibuffer and update toolbar state.
1936 (LyXView): call Toolbar::update after creating the
1939 * src/toolbar.C: change toollist to be a vector instead of a
1941 (BubbleTimerCB): get help string directly from the callback
1942 argument of the corresponding icon (which is the action)
1943 (set): remove unnecessary ugliness.
1944 (update): new function. update the icons (depressed, disabled)
1945 depending of the status of the corresponding action.
1947 * src/toolbar.h: remove help in toolbarItem
1949 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1951 * src/Painter.C (text): Added code for using symbol glyphs from
1952 iso10646 fonts. Currently diabled.
1954 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1957 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1958 magyar,turkish and usorbian.
1960 * src/paragraph.C (isMultiLingual): Made more efficient.
1962 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1965 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1966 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1967 Also changed the prototype to "bool math_insert_greek(char)".
1969 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1971 * lots of files: apply the NEW_INSETS on all code that will not be
1972 needed when we move to use the new insets. Enable the define in
1973 lyxparagrah.h to try it.
1975 * src/insets/insettabular.C (cellstart): change to be a static
1977 (InsetTabular): initialize buffer in the initializer list.
1979 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1981 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1982 form_print.h out of the header file. Replaced with forward
1983 declarations of the relevant struct.
1985 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1988 * src/commandtags.h: do not include "debug.h" which does not
1989 belong there. #include it in some other places because of this
1992 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1994 * src/insets/insetcaption.C: add a couple "using" directives.
1996 * src/toolbar.C (add): get the help text directly from lyxaction.
1998 (setPixmap): new function. Loads from disk and sets a pixmap on a
1999 botton; the name of the pixmap file is derived from the command
2002 * src/toolbar.h: remove members isBitmap and pixmap from
2005 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2006 * lib/images/: move many files from images/banner.xpm.
2008 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2010 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2011 * src/toolbar.C: ditto.
2012 * configure.in: ditto.
2013 * INSTALL: document.
2015 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2016 the spellchecker popup is closed from the WM.
2018 2000-07-19 Juergen Vigna <jug@sad.it>
2020 * src/insets/insetfloat.C (Write): small fix because we use the
2021 insetname for the type now!
2023 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2025 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2028 * src/frontends/Dialogs.h: removed hideCitation signal
2030 * src/insets/insetcite.h: added hide signal
2032 * src/insets/insetcite.C (~InsetCitation): emits new signal
2033 (getScreenLabel): "intelligent" label should now fit on the screen!
2035 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2037 * src/frontends/xforms/FormCitation.C (showInset): connects
2038 hide() to the inset's hide signal
2039 (show): modified to use fl_set_object_position rather than
2040 fl_set_object_geometry wherever possible
2042 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2044 * src/insets/lyxinset.h: add caption code
2046 * src/insets/insetfloat.C (type): new method
2048 * src/insets/insetcaption.C (Write): new method
2050 (LyxCode): new method
2052 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2053 to get it right together with using the FloatList.
2055 * src/commandtags.h: add LFUN_INSET_CAPTION
2056 * src/lyxfunc.C (Dispatch): handle it
2058 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2061 * src/Variables.[Ch]: make expand take a const reference, remove
2062 the destructor, some whitespace changes.
2064 * src/LyXAction.C (init): add caption-inset-insert
2066 * src/FloatList.C (FloatList): update the default floats a bit.
2068 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2070 * src/Variables.[Ch]: new files. Intended to be used for language
2071 specific strings (like \chaptername) and filename substitution in
2074 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2076 * lib/kbd/american.kmap: update
2078 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2080 * src/bufferparams.[Ch]: remove member allowAccents.
2082 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2084 * src/LaTeXLog.C: use the log_form.h header.
2085 * src/lyx_gui.C: ditto.
2086 * src/lyx_gui_misc.C: ditto.
2087 * src/lyxvc.h: ditto.
2089 * forms/log_form.fd: new file, created from latexoptions.fd. I
2090 kept the log popup and nuked the options form.
2092 * src/{la,}texoptions.[Ch]: removed.
2093 * src/lyx_cb.C (LaTeXOptions): ditto
2095 * src/lyx_gui.C (create_forms): do not handle the
2096 fd_latex_options form.
2098 2000-07-18 Juergen Vigna <jug@sad.it>
2100 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2101 name of the inset so that it can be requested outside (text2.C).
2103 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2106 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2108 * src/mathed/formula.h (ConvertFont): constify
2110 * src/mathed/formula.C (Read): add warning if \end_inset is not
2111 found on expected place.
2113 * src/insets/lyxinset.h (ConvertFont): consify
2115 * src/insets/insetquotes.C (ConvertFont): constify
2116 * src/insets/insetquotes.h: ditto
2118 * src/insets/insetinfo.h: add labelfont
2120 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2121 (ascent): use labelfont
2125 (Write): make .lyx file a bit nicer
2127 * src/insets/insetfloat.C (Write): simplify somewhat...
2128 (Read): add warning if arg is not found
2130 * src/insets/insetcollapsable.C: add using std::max
2131 (Read): move string token and add warning in arg is not found
2132 (draw): use std::max to get the right ty
2133 (getMaxWidth): simplify by using std::max
2135 * src/insets/insetsection.h: new file
2136 * src/insets/insetsection.C: new file
2137 * src/insets/insetcaption.h: new file
2138 * src/insets/insetcaption.C: new file
2140 * src/insets/inset.C (ConvertFont): constify signature
2142 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2143 insetcaption.[Ch] and insetsection.[Ch]
2145 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2146 uses to use LABEL_COUNTER_CHAPTER instead.
2147 * src/text2.C (SetCounter): here
2149 * src/counters.h: new file
2150 * src/counters.C: new file
2151 * src/Sectioning.h: new file
2152 * src/Sectioning.C: new file
2154 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2156 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2158 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2161 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2164 2000-07-17 Juergen Vigna <jug@sad.it>
2166 * src/tabular.C (Validate): check if array-package is needed.
2167 (SetVAlignment): added support for vertical alignment.
2168 (SetLTFoot): better support for longtable header/footers
2169 (Latex): modified to support added features.
2171 * src/LaTeXFeatures.[Ch]: added array-package.
2173 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2175 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2178 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2180 * configure.in: do not forget to put a space after -isystem.
2182 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2184 * lib/kbd/arabic.kmap: a few fixes.
2186 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2188 * some whitespace chagnes to a number of files.
2190 * src/support/DebugStream.h: change to make it easier for
2191 doc++ to parse correctly.
2192 * src/support/lyxstring.h: ditto
2194 * src/mathed/math_utils.C (compara): change to have only one
2196 (MathedLookupBOP): change because of the above.
2198 * src/mathed/math_delim.C (math_deco_compare): change to have only
2200 (search_deco): change becasue of the above.
2202 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2203 instead of manually coded one.
2205 * src/insets/insetquotes.C (Read): read the \end_inset too
2207 * src/insets/insetlatex.h: remove file
2208 * src/insets/insetlatex.C: remove file
2210 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2212 (InsetPrintIndex): remove destructor
2214 * src/insets/insetinclude.h: remove default constructor
2216 * src/insets/insetfloat.C: work to make it work better
2218 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2220 * src/insets/insetcite.h (InsetCitation): remove default constructor
2222 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2224 * src/text.C (GetColumnNearX): comment out some currently unused code.
2226 * src/paragraph.C (writeFile): move some initializations closer to
2228 (CutIntoMinibuffer): small change to use new matchIT operator
2232 (InsertInset): ditto
2235 (InsetIterator): ditto
2236 (Erase): small change to use new matchFT operator
2238 (GetFontSettings): ditto
2239 (HighestFontInRange): ditto
2242 * src/lyxparagraph.h: some chars changed to value_type
2243 (matchIT): because of some stronger checking (perhaps too strong)
2244 in SGI STL, the two operator() unified to one.
2247 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2249 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2250 the last inset read added
2251 (parseSingleLyXformat2Token): some more (future) compability code added
2252 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2253 (parseSingleLyXformat2Token): set last_inset_read
2254 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2255 (parseSingleLyXformat2Token): don't double intializw string next_token
2257 * src/TextCache.C (text_fits::operator()): add const's to the signature
2258 (has_buffer::operator()): ditto
2260 * src/Floating.h: add some comments on the class
2262 * src/FloatList.[Ch] (typeExist): new method
2265 * src/BackStack.h: added default constructor, wanted by Gcc.
2267 2000-07-14 Juergen Vigna <jug@sad.it>
2269 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2271 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2273 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2274 do a redraw when the window is resized!
2275 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2277 * src/insets/insettext.C (resizeLyXText): added function to correctly
2278 being able to resize the LyXWindow.
2280 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2282 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2284 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2285 crashes when closing dialog to a deleted inset.
2287 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2288 method! Now similar to other insets.
2290 2000-07-13 Juergen Vigna <jug@sad.it>
2292 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2294 * lib/examples/Literate.lyx: small patch!
2296 * src/insets/insetbib.C (Read): added this function because of wrong
2297 Write (without [begin|end]_inset).
2299 2000-07-11 Juergen Vigna <jug@sad.it>
2301 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2302 as the insertInset could not be good!
2304 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2305 the bool param should not be last.
2307 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2309 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2310 did submit that to Karl).
2312 * configure.in: use -isystem instead of -I for X headers. This
2313 fixes a problem on solaris with a recent gcc;
2314 put the front-end code after the X detection code;
2315 configure in sigc++ before lib/
2317 * src/lyx_main.C (commandLineHelp): remove -display from command
2320 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2322 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2323 Also put in Makefile rules for building the ``listerrors''
2324 program for parsing errors from literate programs written in LyX.
2326 * lib/build-listerrors: Added small shell script as part of compile
2327 process. This builds a working ``listerrors'' binary if noweb is
2328 installed and either 1) the VNC X server is installed on the machine,
2329 or 2) the user is compiling from within a GUI. The existence of a GUI
2330 is necessary to use the ``lyx --export'' feature for now. This
2331 hack can be removed once ``lyx --export'' no longer requires a GUI to
2334 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2336 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2337 now passed back correctly from gcc and placed "under" error
2338 buttons in a Literate LyX source.
2340 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2342 * src/text.C (GetColumnNearX): Better behavior when a RTL
2343 paragraph is ended by LTR text.
2345 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2348 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2350 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2351 true when clipboard is empty.
2353 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2355 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2356 row of the paragraph.
2357 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2358 to prevent calculation of bidi tables
2360 2000-07-07 Juergen Vigna <jug@sad.it>
2362 * src/screen.C (ToggleSelection): added y_offset and x_offset
2365 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2368 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2370 * src/insets/insettext.C: fixed Layout-Display!
2372 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2374 * configure.in: add check for strings.h header.
2376 * src/spellchecker.C: include <strings.h> in order to have a
2377 definition for bzero().
2379 2000-07-07 Juergen Vigna <jug@sad.it>
2381 * src/insets/insettext.C (draw): set the status of the bv->text to
2382 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2384 * src/screen.C (DrawOneRow):
2385 (DrawFromTo): redraw the actual row if something has changed in it
2388 * src/text.C (draw): call an update of the toplevel-inset if something
2389 has changed inside while drawing.
2391 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2393 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2395 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2396 processing inside class.
2398 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2399 processing inside class.
2401 * src/insets/insetindex.h new struct Holder, consistent with other
2404 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2405 citation dialog from main code and placed it in src/frontends/xforms.
2406 Dialog launched through signals instead of callbacks
2408 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2410 * lyx.man: update the options description.
2412 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2414 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2415 handle neg values, set min width to 590, add doc about -display
2417 2000-07-05 Juergen Vigna <jug@sad.it>
2419 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2420 calls to BufferView *.
2422 * src/insets/insettext.C (checkAndActivateInset): small fix non
2423 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2425 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2426 their \end_inset token!
2428 2000-07-04 edscott <edscott@imp.mx>
2430 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2431 lib/lyxrc.example: added option \wheel_jump
2433 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2435 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2436 remove support for -width,-height,-xpos and -ypos.
2438 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2440 * src/encoding.[Ch]: New files.
2442 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2443 (text): Call to the underline() method only when needed.
2445 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2447 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2448 encoding(s) for the document.
2450 * src/bufferparams.C (BufferParams): Changed default value of
2453 * src/language.C (newLang): Removed.
2454 (items[]): Added encoding information for all defined languages.
2456 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2457 encoding choice button.
2459 * src/lyxrc.h (font_norm_type): New member variable.
2460 (set_font_norm_type): New method.
2462 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2463 paragraphs with different encodings.
2465 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2466 (TransformChar): Changed to work correctly with Arabic points.
2467 (draw): Added support for drawing Arabic points.
2468 (draw): Removed code for drawing underbars (this is done by
2471 * src/support/textutils.h (IsPrintableNonspace): New function.
2473 * src/BufferView_pimpl.h: Added "using SigC::Object".
2474 * src/LyXView.h: ditto.
2476 * src/insets/insetinclude.h (include_label): Changed to mutable.
2478 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2480 * src/mathed/math_iter.h: remove empty destructor
2482 * src/mathed/math_cursor.h: remove empty destructor
2484 * src/insets/lyxinset.h: add THEOREM_CODE
2486 * src/insets/insettheorem.[Ch]: new files
2488 * src/insets/insetminipage.C: (InsertInset): remove
2490 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2492 (InsertInset): remove
2494 * src/insets/insetlist.C: (InsertList): remove
2496 * src/insets/insetfootlike.[Ch]: new files
2498 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2501 (InsertInset): ditto
2503 * src/insets/insetert.C: remove include Painter.h, reindent
2504 (InsertInset): move to header
2506 * src/insets/insetcollapsable.h: remove explicit from default
2507 contructor, remove empty destructor, add InsertInset
2509 * src/insets/insetcollapsable.C (InsertInset): new func
2511 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2513 * src/vspace.h: add explicit to constructor
2515 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2516 \textcompwordmark, please test this.
2518 * src/lyxrc.C: set ascii_linelen to 65 by default
2520 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2522 * src/commandtags.h: add LFUN_INSET_THEOREM
2524 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2525 (makeLinuxDocFile): remove _some_ of the nice logic
2526 (makeDocBookFile): ditto
2528 * src/Painter.[Ch]: (~Painter): removed
2530 * src/LyXAction.C (init): entry for insettheorem added
2532 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2534 (deplog): code to detect files generated by LaTeX, needs testing
2537 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2539 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2541 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2543 * src/LaTeX.C (deplog): Add a check for files that are going to be
2544 created by the first latex run, part of the project to remove the
2547 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2548 contents to the extension list.
2550 2000-07-04 Juergen Vigna <jug@sad.it>
2552 * src/text.C (NextBreakPoint): added support for needFullRow()
2554 * src/insets/lyxinset.h: added needFullRow()
2556 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2559 * src/insets/insettext.C: lots of changes for update!
2561 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2563 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2565 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2567 * src/insets/insetinclude.C (InsetInclude): fixed
2568 initialization of include_label.
2569 (unique_id): now returns a string.
2571 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2573 * src/LaTeXFeatures.h: new member IncludedFiles, for
2574 a map of key, included file name.
2576 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2577 with the included files for inclusion in SGML preamble,
2578 i. e., linuxdoc and docbook.
2581 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2582 nice (is the generated linuxdoc code to be exported?), that
2583 allows to remove column, and only_body that will be true for
2584 slave documents. Insets are allowed inside SGML font type.
2585 New handling of the SGML preamble for included files.
2586 (makeDocBookFile): the same for docbook.
2588 * src/insets/insetinclude.h:
2589 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2591 (DocBook): new export methods.
2593 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2594 and makeDocBookFile.
2596 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2597 formats to export with command line argument -x.
2599 2000-06-29 Juergen Vigna <jug@sad.it>
2601 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2602 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2604 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2605 region could already been cleared by an inset!
2607 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2609 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2612 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2614 (cursorToggle): remove special handling of lyx focus.
2616 2000-06-28 Juergen Vigna <jug@sad.it>
2618 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2621 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2623 * src/insets/insetindex.C (Edit): add a callback when popup is
2626 * src/insets/insettext.C (LocalDispatch):
2627 * src/insets/insetmarginal.h:
2628 * src/insets/insetlist.h:
2629 * src/insets/insetfoot.h:
2630 * src/insets/insetfloat.h:
2631 * src/insets/insetert.h: add a missing std:: qualifier.
2633 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2635 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2638 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2640 * src/insets/insettext.C (Read): remove tmptok unused variable
2641 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2642 (InsertInset): change for new InsetInset code
2644 * src/insets/insettext.h: add TEXT inline method
2646 * src/insets/insettext.C: remove TEXT macro
2648 * src/insets/insetmarginal.C (Write): new method
2649 (Latex): change output slightly
2651 * src/insets/insetfoot.C (Write): new method
2652 (Latex): change output slightly (don't use endl when no need)
2654 * src/insets/insetert.C (Write): new method
2656 * src/insets/insetcollapsable.h: make button_length, button_top_y
2657 and button_bottm_y protected.
2659 * src/insets/insetcollapsable.C (Write): simplify code by using
2660 tostr. Also do not output the float name, the children class
2661 should to that to get control over own arguments
2663 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2664 src/insets/insetminipage.[Ch]:
2667 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2669 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2671 * src/Makefile.am (lyx_SOURCES): add the new files
2673 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2674 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2675 * src/commandtags.h: ditto
2677 * src/LaTeXFeatures.h: add a std::set of used floattypes
2679 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2681 * src/FloatList.[Ch] src/Floating.h: new files
2683 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2685 * src/lyx_cb.C (TableApplyCB): ditto
2687 * src/text2.C: ditto
2688 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2689 (parseSingleLyXformat2Token): ditto + add code for
2690 backwards compability for old float styles + add code for new insets
2692 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2694 (InsertInset(size_type, Inset *, LyXFont)): new method
2695 (InsetChar(size_type, char)): changed to use the other InsetChar
2696 with a LyXFont(ALL_INHERIT).
2697 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2698 insert the META_INSET.
2700 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2702 * sigc++/thread.h (Threads): from here
2704 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2705 definition out of line
2706 * sigc++/scope.h: from here
2708 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2710 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2711 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2713 * Makefile.am (bindist): new target.
2715 * INSTALL: add instructions for doing a binary distribution.
2717 * development/tools/README.bin.example: update a bit.
2719 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2722 * lib/lyxrc.example: new lyxrc tag \set_color.
2724 * src/lyxfunc.C (Dispatch):
2725 * src/commandtags.h:
2726 * src/LyXAction.C: new lyxfunc "set-color".
2728 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2729 and an x11name given as strings.
2731 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2732 cache when a color is changed.
2734 2000-06-26 Juergen Vigna <jug@sad.it>
2736 * src/lyxrow.C (width): added this functions and variable.
2738 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2741 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2743 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2745 * images/undo_bw.xpm: new icon.
2746 * images/redo_bw.xpm: ditto.
2748 * configure.in (INSTALL_SCRIPT): change value to
2749 ${INSTALL} to avoid failures of install-script target.
2750 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2752 * src/BufferView.h: add a magic "friend" declaration to please
2755 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2757 * forms/cite.fd: modified to allow resizing without messing
2760 * src/insetcite.C: Uses code from cite.fd almost without
2762 User can now resize dialog in the x-direction.
2763 Resizing the dialog in the y-direction is prevented, as the
2764 code does this intelligently already.
2766 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2768 * INSTALL: remove obsolete entry in "problems" section.
2770 * lib/examples/sl_*.lyx: update of the slovenian examples.
2772 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2774 2000-06-23 Juergen Vigna <jug@sad.it>
2776 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2778 * src/buffer.C (resize): delete the LyXText of textinsets.
2780 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2782 * src/insets/lyxinset.h: added another parameter 'cleared' to
2783 the draw() function.
2785 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2786 unlocking inset in inset.
2788 2000-06-22 Juergen Vigna <jug@sad.it>
2790 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2791 of insets and moved first to LyXText.
2793 * src/mathed/formulamacro.[Ch]:
2794 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2796 2000-06-21 Juergen Vigna <jug@sad.it>
2798 * src/text.C (GetVisibleRow): look if I should clear the area or not
2799 using Inset::doClearArea() function.
2801 * src/insets/lyxinset.h: added doClearArea() function and
2802 modified draw(Painter &, ...) to draw(BufferView *, ...)
2804 * src/text2.C (UpdateInset): return bool insted of int
2806 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2808 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2809 combox in the character popup
2811 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2812 BufferParams const & params
2814 2000-06-20 Juergen Vigna <jug@sad.it>
2816 * src/insets/insettext.C (SetParagraphData): set insetowner on
2819 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2821 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2822 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2824 (form_main_): remove
2826 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2827 (create_form_form_main): remove FD_form_main stuff, connect to
2828 autosave_timeout signal
2830 * src/LyXView.[Ch] (getMainForm): remove
2831 (UpdateTimerCB): remove
2832 * src/BufferView_pimpl.h: inherit from SigC::Object
2834 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2835 signal instead of callback
2837 * src/BufferView.[Ch] (cursorToggleCB): remove
2839 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2841 * src/BufferView_pimpl.C: changes because of the one below
2843 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2844 instead of storing a pointer to a LyXText.
2846 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2848 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2850 * src/lyxparagraph.h
2852 * src/paragraph.C: Changed fontlist to a sorted vector.
2854 2000-06-19 Juergen Vigna <jug@sad.it>
2856 * src/BufferView.h: added screen() function.
2858 * src/insets/insettext.C (LocalDispatch): some selection code
2861 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2863 * src/insets/insettext.C (SetParagraphData):
2865 (InsetText): fixes for multiple paragraphs.
2867 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2869 * development/lyx.spec.in: Call configure with ``--without-warnings''
2870 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2871 This should be fine, however, since we generally don't want to be
2872 verbose when making an RPM.
2874 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2876 * lib/scripts/fig2pstex.py: New file
2878 2000-06-16 Juergen Vigna <jug@sad.it>
2880 * src/insets/insettabular.C (UpdateLocal):
2881 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2882 (LocalDispatch): Changed all functions to use LyXText.
2884 2000-06-15 Juergen Vigna <jug@sad.it>
2886 * src/text.C (SetHeightOfRow): call inset::update before requesting
2889 * src/insets/insettext.C (update):
2890 * src/insets/insettabular.C (update): added implementation
2892 * src/insets/lyxinset.h: added update function
2894 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2896 * src/text.C (SelectNextWord): protect against null pointers with
2897 old-style string streams. (fix from Paul Theo Gonciari
2900 * src/cite.[Ch]: remove erroneous files.
2902 * lib/configure.m4: update the list of created directories.
2904 * src/lyxrow.C: include <config.h>
2905 * src/lyxcursor.C: ditto.
2907 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2909 * lib/examples/decimal.lyx: new example file from Mike.
2911 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2912 to find template definitions (from Dekel)
2914 * src/frontends/.cvsignore: add a few things.
2916 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2918 * src/Timeout.C (TimeOut): remove default argument.
2920 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2923 * src/insets/ExternalTemplate.C: add a "using" directive.
2925 * src/lyx_main.h: remove the act_ struct, which seems unused
2928 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2930 * LyX Developers Meeting: All files changed, due to random C++ (by
2931 coincidence) code generator script.
2933 - external inset (cool!)
2934 - initial online editing of preferences
2935 - insettabular breaks insettext(s contents)
2937 - some DocBook fixes
2938 - example files update
2939 - other cool stuff, create a diff and look for yourself.
2941 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2943 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2944 -1 this is a non-line-breaking textinset.
2946 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2947 if there is no width set.
2949 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2951 * Lots of files: Merged the dialogbase branch.
2953 2000-06-09 Allan Rae <rae@lyx.org>
2955 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2956 and the Dispatch methods that used it.
2958 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2959 access to functions formerly kept in Dispatch.
2961 2000-05-19 Allan Rae <rae@lyx.org>
2963 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2964 made to_page and count_copies integers again. from_page remains a
2965 string however because I want to allow entry of a print range like
2966 "1,4,22-25" using this field.
2968 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2969 and printer-params-get. These aren't useful from the minibuffer but
2970 could be used by a script/LyXServer app provided it passes a suitable
2971 auto_mem_buffer. I guess I should take a look at how the LyXServer
2972 works and make it support xtl buffers.
2974 * sigc++/: updated to libsigc++-1.0.1
2976 * src/xtl/: updated to xtl-1.3.pl.11
2978 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2979 those changes done to the files in src/ are actually recreated when
2980 they get regenerated. Please don't ever accept a patch that changes a
2981 dialog unless that patch includes the changes to the corresponding *.fd
2984 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2985 stringOnlyContains, renamed it and generalised it.
2987 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2988 branch. Removed the remaining old form_print code.
2990 2000-04-26 Allan Rae <rae@lyx.org>
2992 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2993 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2995 2000-04-25 Allan Rae <rae@lyx.org>
2997 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2998 against a base of xtl-1.3.pl.4
3000 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3001 filter the Id: entries so they still show the xtl version number
3004 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3005 into the src/xtl code. Patch still pending with José (XTL)
3007 2000-04-24 Allan Rae <rae@lyx.org>
3009 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3010 both more generic and much safer. Use the new template functions.
3011 * src/buffer.[Ch] (Dispatch): ditto.
3013 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3014 and mem buffer more intelligently. Also a little general cleanup.
3017 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3018 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3019 * src/xtl/Makefile.am: ditto.
3020 * src/xtl/.cvsignore: ditto.
3021 * src/Makefile.am: ditto.
3023 * src/PrinterParams.h: Removed the macros member functions. Added a
3024 testInvariant member function. A bit of tidying up and commenting.
3025 Included Angus's idea for fixing operation with egcs-1.1.2.
3027 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3028 cool expansion of XTL's mem_buffer to support automatic memory
3029 management within the buffer itself. Removed the various macros and
3030 replaced them with template functions that use either auto_mem_buffer
3031 or mem_buffer depending on a #define. The mem_buffer support will
3032 disappear as soon as the auto_mem_buffer is confirmed to be good on
3033 other platforms/compilers. That is, it's there so you've got something
3036 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3037 effectively forked XTL. However I expect José will include my code
3038 into the next major release. Also fixed a memory leak.
3039 * src/xtl/text.h: ditto.
3040 * src/xtl/xdr.h: ditto.
3041 * src/xtl/giop.h: ditto.
3043 2000-04-16 Allan Rae <rae@lyx.org>
3045 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3046 by autogen.sh and removed by maintainer-clean anyway.
3047 * .cvsignore, sigc++/.cvsignore: Support the above.
3049 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3051 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3053 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3054 macros, renamed static callback-target member functions to suit new
3055 scheme and made them public.
3056 * src/frontends/xforms/forms/form_print.fd: ditto.
3057 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3059 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3062 * src/xtl/: New directory containing a minimal distribution of XTL.
3063 This is XTL-1.3.pl.4.
3065 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3067 2000-04-15 Allan Rae <rae@lyx.org>
3069 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3071 * sigc++/: Updated to libsigc++-1.0.0
3073 2000-04-14 Allan Rae <rae@lyx.org>
3075 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3076 use the generic ones in future. I'll modify my conversion script.
3078 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3080 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3081 (CloseAllBufferRelatedDialogs): Renamed.
3082 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3084 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3085 of the generic ones. These are the same ones my conversion script
3088 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3089 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3090 * src/buffer.C (Dispatch): ditto
3092 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3093 functions for updating and hiding buffer dependent dialogs.
3094 * src/BufferView.C (buffer): ditto
3095 * src/buffer.C (setReadonly): ditto
3096 * src/lyxfunc.C (CloseBuffer): ditto
3098 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3099 Dialogs.h, and hence all the SigC stuff, into every file that includes
3100 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3102 * src/BufferView2.C: reduce the number of headers included by buffer.h
3104 2000-04-11 Allan Rae <rae@lyx.org>
3106 * src/frontends/xforms/xform_macros.h: A small collection of macros
3107 for building C callbacks.
3109 * src/frontends/xforms/Makefile.am: Added above file.
3111 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3112 scheme again. This time it should work for JMarc. If this is
3113 successful I'll revise my conversion script to automate some of this.
3114 The static member functions in the class also have to be public for
3115 this scheme will work. If the scheme works (it's almost identical to
3116 the way BufferView::cursorToggleCB is handled so it should work) then
3117 FormCopyright and FormPrint will be ready for inclusion into the main
3118 trunk immediately after 1.1.5 is released -- provided we're prepared
3119 for complaints about lame compilers not handling XTL.
3121 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3123 2000-04-07 Allan Rae <rae@lyx.org>
3125 * config/lyxinclude.m4: A bit more tidying up (Angus)
3127 * src/LString.h: JMarc's <string> header fix
3129 * src/PrinterParams.h: Used string for most data to remove some
3130 ugly code in the Print dialog and avoid even uglier code when
3131 appending the ints to a string for output.
3133 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3134 and moved "default:" back to the end of switch statement. Cleaned
3135 up the printing so it uses the right function calls and so the
3136 "print to file" option actually puts the file in the right directory.
3138 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3140 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3141 and Ok+Apply button control into a separate method: input (Angus).
3142 (input) Cleaned it up and improved it to be very thorough now.
3143 (All CB) static_cast used instead of C style cast (Angus). This will
3144 probably change again once we've worked out how to keep gcc-2.8.1 happy
3145 with real C callbacks.
3146 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3147 ignore some of the bool settings and has random numbers instead. Needs
3148 some more investigation. Added other input length checks and checking
3149 of file and printer names.
3151 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3152 would link (Angus). Seems the old code doesn't compile with the pragma
3153 statement either. Separated callback entries from internal methods.
3155 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3157 2000-03-17 Allan Rae <rae@lyx.org>
3159 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3160 need it? Maybe it could go in Dialogs instead? I could make it a
3161 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3162 values to get the bool return value.
3163 (Dispatch): New overloaded method for xtl support.
3165 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3166 extern "C" callback instead of static member functions. Hopefully,
3167 JMarc will be able to compile this. I haven't changed
3168 forms/form_copyright.fd yet. Breaking one of my own rules already.
3170 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3171 because they aren't useful from the minibuffer. Maybe a LyXServer
3172 might want a help message though?
3174 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3176 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3177 xtl which needs both rtti and exceptions.
3179 * src/support/Makefile.am:
3180 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3182 * src/frontends/xforms/input_validators.[ch]: input filters and
3183 validators. These conrol what keys are valid in input boxes.
3184 Use them and write some more. Much better idea than waiting till
3185 after the user has pressed Ok to say that the input fields don't make
3188 * src/frontends/xforms/Makefile.am:
3189 * src/frontends/xforms/forms/form_print.fd:
3190 * src/frontends/xforms/forms/makefile:
3191 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3192 new scheme. Still have to make sure I haven't missed anything from
3193 the current implementation.
3195 * src/Makefile.am, src/PrinterParams.h: New data store.
3197 * other files: Added a couple of copyright notices.
3199 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3201 * src/insets/insetbib.h: move Holder struct in public space.
3203 * src/frontends/include/DialogBase.h: use SigC:: only when
3204 SIGC_CXX_NAMESPACES is defined.
3205 * src/frontends/include/Dialogs.h: ditto.
3207 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3209 * src/frontends/xforms/FormCopyright.[Ch]: do not
3210 mention SigC:: explicitely.
3212 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3214 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3215 deals with testing KDE in main configure.in
3216 * configure.in: ditto.
3218 2000-02-22 Allan Rae <rae@lyx.org>
3220 * Lots of files: Merged from HEAD
3222 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3223 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3225 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3227 * sigc++/: new minidist.
3229 2000-02-14 Allan Rae <rae@lyx.org>
3231 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3233 2000-02-08 Juergen Vigna <jug@sad.it>
3235 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3236 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3238 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3239 for this port and so it is much easier for other people to port
3240 dialogs in a common development environment.
3242 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3243 the QT/KDE implementation.
3245 * src/frontends/kde/Dialogs.C:
3246 * src/frontends/kde/FormCopyright.C:
3247 * src/frontends/kde/FormCopyright.h:
3248 * src/frontends/kde/Makefile.am:
3249 * src/frontends/kde/formcopyrightdialog.C:
3250 * src/frontends/kde/formcopyrightdialog.h:
3251 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3252 for the kde support of the Copyright-Dialog.
3254 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3255 subdir-substitution instead of hardcoded 'xforms' as we now have also
3258 * src/frontends/include/DialogBase.h (Object): just commented the
3259 label after #endif (nasty warning and I don't like warnings ;)
3261 * src/main.C (main): added KApplication initialization if using
3264 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3265 For now only the KDE event-loop is added if frontend==kde.
3267 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3269 * configure.in: added support for the --with-frontend[=value] option
3271 * autogen.sh: added kde.m4 file to list of config-files
3273 * acconfig.h: added define for KDEGUI-support
3275 * config/kde.m4: added configuration functions for KDE-port
3277 * config/lyxinclude.m4: added --with-frontend[=value] option with
3278 support for xforms and KDE.
3280 2000-02-08 Allan Rae <rae@lyx.org>
3282 * all Makefile.am: Fixed up so the make targets dist, distclean,
3283 install and uninstall all work even if builddir != srcdir. Still
3284 have a new sigc++ minidist update to come.
3286 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3288 2000-02-01 Allan Rae <rae@lyx.org>
3290 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3291 Many mods to get builddir != srcdir working.
3293 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3294 for building on NT and so we can do the builddir != srcdir stuff.
3296 2000-01-30 Allan Rae <rae@lyx.org>
3298 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3299 This will stay in "rae" branch. We probably don't really need it in
3300 the main trunk as anyone who wants to help programming it should get
3301 a full library installed also. So they can check both included and
3302 system supplied library compilation.
3304 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3305 Added a 'mini' distribution of libsigc++. If you feel the urge to
3306 change something in these directories - Resist it. If you can't
3307 resist the urge then you should modify the following script and rebuild
3308 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3309 all happen. Still uses a hacked version of libsigc++'s configure.in.
3310 I'm quite happy with the results. I'm not sure the extra work to turn
3311 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3312 worth the trouble and would probably lead to extra maintenance
3314 I haven't tested the following important make targets: install, dist.
3315 Not ready for prime time but very close. Maybe 1.1.5.
3317 * development/tools/makeLyXsigc.sh: A shell script to automatically
3318 generate our mini-dist of libsigc++. It can only be used with a CVS
3319 checkout of libsigc++ not a tarball distribution. It's well commented.
3320 This will end up as part of the libsigc++ distribution so other apps
3321 can easily have an included mini-dist. If someone makes mods to the
3322 sigc++ subpackage without modifying this script to generate those
3323 changes I'll be very upset!
3325 * src/frontends/: Started the gui/system indep structure.
3327 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3328 to access the gui-indep dialogs are in this class. Much improved
3329 design compared to previous revision. Lars, please refrain from
3330 moving this header into src/ like you did with Popups.h last time.
3332 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3334 * src/frontends/xforms/: Started the gui-indep system with a single
3335 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3338 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3339 Here you'll find a very useful makefile and automated fdfix.sh that
3340 makes updating dailogs a no-brainer -- provided you follow the rules
3341 set out in the README. I'm thinking about adding another script to
3342 automatically generate skeleton code for a new dialog given just the
3345 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3346 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3347 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3349 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3351 * src/support/LSubstring.C (operator): simplify
3353 * src/lyxtext.h: removed bparams, use buffer_->params instead
3355 * src/lyxrow.h: make Row a real class, move all variables to
3356 private and use accessors.
3358 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3360 (isRightToLeftPar): ditto
3361 (ChangeLanguage): ditto
3362 (isMultiLingual): ditto
3365 (SimpleTeXOnePar): ditto
3366 (TeXEnvironment): ditto
3367 (GetEndLabel): ditto
3369 (SetOnlyLayout): ditto
3370 (BreakParagraph): ditto
3371 (BreakParagraphConservative): ditto
3372 (GetFontSettings): ditto
3374 (CopyIntoMinibuffer): ditto
3375 (CutIntoMinibuffer): ditto
3376 (PasteParagraph): ditto
3377 (SetPExtraType): ditto
3378 (UnsetPExtraType): ditto
3379 (DocBookContTableRows): ditto
3380 (SimpleDocBookOneTablePar): ditto
3382 (TeXFootnote): ditto
3383 (SimpleTeXOneTablePar): ditto
3384 (TeXContTableRows): ditto
3385 (SimpleTeXSpecialChars): ditto
3388 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3389 to private and use accessors.
3391 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3392 this, we did not use it anymore and has not been for ages. Just a
3393 waste of cpu cycles.
3395 * src/language.h: make Language a real class, move all variables
3396 to private and use accessors.
3398 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3399 (create_view): remove
3400 (update): some changes for new timer
3401 (cursorToggle): use new timer
3402 (beforeChange): change for new timer
3404 * src/BufferView.h (cursorToggleCB): removed last paramter because
3407 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3408 (cursorToggleCB): change because of new timer code
3410 * lib/CREDITS: updated own mailaddress
3412 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3414 * src/support/filetools.C (PutEnv): fix the code in case neither
3415 putenv() nor setenv() have been found.
3417 * INSTALL: mention the install-strip Makefile target.
3419 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3420 read-only documents.
3422 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3424 * lib/reLyX/configure.in (VERSION): avoid using a previously
3425 generated reLyX wrapper to find out $prefix.
3427 * lib/examples/eu_adibide_lyx-atua.lyx:
3428 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3429 translation of the Tutorial (Dooteo)
3431 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3433 * forms/cite.fd: new citation dialog
3435 * src/insetcite.[Ch]: the new citation dialog is moved into
3438 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3441 * src/insets/insetcommand.h: data members made private.
3443 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3445 * LyX 1.1.5 released
3447 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3449 * src/version.h (LYX_RELEASE): to 1.1.5
3451 * src/spellchecker.C (RunSpellChecker): return false if the
3452 spellchecker dies upon creation.
3454 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3456 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3457 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3461 * lib/CREDITS: update entry for Martin Vermeer.
3463 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3465 * src/text.C (draw): Draw foreign language bars at the bottom of
3466 the row instead of at the baseline.
3468 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3470 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3472 * lib/bind/de_menus.bind: updated
3474 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3476 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3478 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3480 * src/menus.C (Limit_string_length): New function
3481 (ShowTocMenu): Limit the number of items/length of items in the
3484 * src/paragraph.C (String): Correct result for a paragraph inside
3487 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3489 * src/bufferlist.C (close): test of buf->getuser() == NULL
3491 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3493 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3494 Do not call to SetCursor when the paragraph is a closed footnote!
3496 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3498 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3501 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3503 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3506 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3507 reference popup, that activates the reference-back action
3509 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3511 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3512 the menus. Also fixed a bug.
3514 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3515 the math panels when switching buffers (unless new buffer is readonly).
3517 * src/BufferView.C (NoSavedPositions)
3518 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3520 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3522 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3523 less of dvi dirty or not.
3525 * src/trans_mgr.[Ch] (insert): change first parameter to string
3528 * src/chset.[Ch] (encodeString): add const to first parameter
3530 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3532 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3536 * src/LaTeX.C (deplog): better searching for dependency files in
3537 the latex log. Uses now regexps.
3539 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3540 instead of the box hack or \hfill.
3542 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3544 * src/lyxfunc.C (doImportHelper): do not create the file before
3545 doing the actual import.
3546 (doImportASCIIasLines): create a new file before doing the insert.
3547 (doImportASCIIasParagraphs): ditto.
3549 * lib/lyxrc.example: remove mention of non-existing commands
3551 * lyx.man: remove mention of color-related switches.
3553 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3555 * src/lyx_gui.C: remove all the color-related ressources, which
3556 are not used anymore.
3558 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3561 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3563 * src/lyxrc.C (read): Add a missing break in the switch
3565 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3567 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3569 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3572 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3574 * src/text.C (draw): draw bars under foreign language words.
3576 * src/LColor.[Ch]: add LColor::language
3578 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3580 * src/lyxcursor.h (boundary): New member variable
3582 * src/text.C (IsBoundary): New methods
3584 * src/text.C: Use the above for currect cursor movement when there
3585 is both RTL & LTR text.
3587 * src/text2.C: ditto
3589 * src/bufferview_funcs.C (ToggleAndShow): ditto
3591 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3593 * src/text.C (DeleteLineForward): set selection to true to avoid
3594 that DeleteEmptyParagraphMechanism does some magic. This is how it
3595 is done in all other functions, and seems reasonable.
3596 (DeleteWordForward): do not jump over non-word stuff, since
3597 CursorRightOneWord() already does it.
3599 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3600 DeleteWordBackward, since they seem safe to me (since selection is
3601 set to "true") DeleteEmptyParagraphMechanism does nothing.
3603 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3605 * src/lyx_main.C (easyParse): simplify the code by factoring the
3606 part that removes parameters from the command line.
3607 (LyX): check wether wrong command line options have been given.
3609 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3611 * src/lyx_main.C : add support for specifying user LyX
3612 directory via command line option -userdir.
3614 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3616 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3617 the number of items per popup.
3618 (Add_to_refs_menu): Ditto.
3620 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3622 * src/lyxparagraph.h: renamed ClearParagraph() to
3623 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3624 textclass as parameter, and do nothing if free_spacing is
3625 true. This fixes part of the line-delete-forward problems.
3627 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3628 (pasteSelection): ditto.
3629 (SwitchLayoutsBetweenClasses): more translatable strings.
3631 * src/text2.C (CutSelection): use StripLeadingSpaces.
3632 (PasteSelection): ditto.
3633 (DeleteEmptyParagraphMechanism): ditto.
3635 2000-05-26 Juergen Vigna <jug@sad.it>
3637 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3638 is not needed in tabular insets.
3640 * src/insets/insettabular.C (TabularFeatures): added missing features.
3642 * src/tabular.C (DeleteColumn):
3644 (AppendRow): implemented this functions
3645 (cellsturct::operator=): clone the inset too;
3647 2000-05-23 Juergen Vigna <jug@sad.it>
3649 * src/insets/insettabular.C (LocalDispatch): better selection support
3650 when having multicolumn-cells.
3652 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3654 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3656 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3658 * src/ColorHandler.C (getGCForeground): put more test into _()
3660 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3663 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3666 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3668 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3669 there are no labels, or when buffer is readonly.
3671 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3672 there are no labels, buffer is SGML, or when buffer is readonly.
3674 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3676 * src/LColor.C (LColor): change a couple of grey40 to grey60
3677 (LColor): rewore initalization to make compiles go some magnitude
3679 (getGUIName): don't use gettext until we need the string.
3681 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3683 * src/Bullet.[Ch]: Fixed a small bug.
3685 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3687 * src/paragraph.C (String): Several fixes/improvements
3689 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3691 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3693 * src/paragraph.C (String): give more correct output.
3695 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3697 * src/lyxfont.C (stateText) Do not output the language if it is
3698 eqaul to the language of the document.
3700 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3701 between two paragraphs with the same language.
3703 * src/paragraph.C (getParLanguage) Return a correct answer for an
3704 empty dummy paragraph.
3706 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3709 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3712 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3713 the menus/popup, if requested fonts are unavailable.
3715 2000-05-22 Juergen Vigna <jug@sad.it>
3717 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3718 movement support (Up/Down/Tab/Shift-Tab).
3719 (LocalDispatch): added also preliminari cursor-selection.
3721 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3723 * src/paragraph.C (PasteParagraph): Hopefully now right!
3725 2000-05-22 Garst R. Reese <reese@isn.net>
3727 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3728 of list, change all references to Environment to Command
3729 * tex/hollywood.cls : rewrite environments as commands, add
3730 \uppercase to interiorshot and exteriorshot to force uppecase.
3731 * tex/broadway.cls : rewrite environments as commands. Tweak
3734 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3736 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3737 size of items: use a constant intead of the hardcoded 40, and more
3738 importantly do not remove the %m and %x tags added at the end.
3739 (Add_to_refs_menu): use vector::size_type instead of
3740 unsigned int as basic types for the variables. _Please_ do not
3741 assume that size_t is equal to unsigned int. On an alpha, this is
3742 unsigned long, which is _not_ the same.
3744 * src/language.C (initL): remove language "hungarian", since it
3745 seems that "magyar" is better.
3747 2000-05-22 Juergen Vigna <jug@sad.it>
3749 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3751 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3754 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3755 next was deleted but not set to 0.
3757 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3759 * src/language.C (initL): change the initialization of languages
3760 so that compiles goes _fast_.
3762 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3765 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3767 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3771 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3773 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3775 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3779 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3782 * src/insets/insetlo*.[Ch]: Made editable
3784 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3786 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3787 the current selection.
3789 * src/BufferView_pimpl.C (stuffClipboard): new method
3791 * src/BufferView.C (stuffClipboard): new method
3793 * src/paragraph.C (String): new method
3795 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3796 LColor::ignore when lyxname is not found.
3798 * src/BufferView.C (pasteSelection): new method
3800 * src/BufferView_pimpl.C (pasteSelection): new method
3802 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3804 * src/WorkArea.C (request_clipboard_cb): new static function
3805 (getClipboard): new method
3806 (putClipboard): new method
3808 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3810 * LyX 1.1.5pre2 released
3812 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3814 * src/vspace.C (operator=): removed
3815 (operator=): removed
3817 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3819 * src/layout.C (NumberOfClass): manually set the type in make_pair
3820 (NumberOfLayout): ditto
3822 * src/language.C: use the Language constructor for ignore_lang
3824 * src/language.h: add constructors to struct Language
3826 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3828 * src/text2.C (SetCursorIntern): comment out #warning
3830 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3832 * src/mathed/math_iter.h: initialize sx and sw to 0
3834 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3836 * forms/lyx.fd: Redesign of form_ref
3838 * src/LaTeXFeatures.[Ch]
3842 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3845 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3846 and Buffer::inset_iterator.
3848 * src/menus.C: Added new menus: TOC and Refs.
3850 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3852 * src/buffer.C (getTocList): New method.
3854 * src/BufferView2.C (ChangeRefs): New method.
3856 * src/buffer.C (getLabelList): New method. It replaces the old
3857 getReferenceList. The return type is vector<string> instead of
3860 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3861 the old getLabel() and GetNumberOfLabels() methods.
3862 * src/insets/insetlabel.C (getLabelList): ditto
3863 * src/mathed/formula.C (getLabelList): ditto
3865 * src/paragraph.C (String): New method.
3867 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3868 Uses the new getTocList() method.
3869 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3870 which automatically updates the contents of the browser.
3871 (RefUpdateCB): Use the new getLabelList method.
3873 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3875 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3877 * src/spellchecker.C: Added using std::reverse;
3879 2000-05-19 Juergen Vigna <jug@sad.it>
3881 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3883 * src/insets/insettext.C (computeTextRows): small fix for display of
3884 1 character after a newline.
3886 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3889 2000-05-18 Juergen Vigna <jug@sad.it>
3891 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3892 when changing width of column.
3894 * src/tabular.C (set_row_column_number_info): setting of
3895 autobreak rows if necessary.
3897 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3899 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3901 * src/vc-backend.*: renamed stat() to status() and vcstat to
3902 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3903 compilation broke. The new name seems more relevant, anyway.
3905 2000-05-17 Juergen Vigna <jug@sad.it>
3907 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3908 which was wrong if the removing caused removing of rows!
3910 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3911 (pushToken): new function.
3913 * src/text2.C (CutSelection): fix problem discovered with purify
3915 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3917 * src/debug.C (showTags): enlarge the first column, now that we
3918 have 6-digits debug codes.
3920 * lib/layouts/hollywood.layout:
3921 * lib/tex/hollywood.cls:
3922 * lib/tex/brodway.cls:
3923 * lib/layouts/brodway.layout: more commands and fewer
3924 environments. Preambles moved in the .cls files. Broadway now has
3925 more options on scene numbering and less whitespace (from Garst)
3927 * src/insets/insetbib.C (getKeys): make sure that we are in the
3928 document directory, in case the bib file is there.
3930 * src/insets/insetbib.C (Latex): revert bogus change.
3932 2000-05-16 Juergen Vigna <jug@sad.it>
3934 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3935 the TabularLayout on cursor move.
3937 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3939 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3942 (draw): fixed cursor position and drawing so that the cursor is
3943 visible when before the tabular-inset.
3945 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3946 when creating from old insettext.
3948 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3950 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3952 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3953 * lib/tex/brodway.cls: ditto
3955 * lib/layouts/brodway.layout: change alignment of parenthical
3958 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3960 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3961 versions 0.88 and 0.89 are supported.
3963 2000-05-15 Juergen Vigna <jug@sad.it>
3965 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3968 * src/insets/insettext.C (computeTextRows): redone completely this
3969 function in a much cleaner way, because of problems when having a
3971 (draw): added a frame border when the inset is locked.
3972 (SetDrawLockedFrame): this sets if we draw the border or not.
3973 (SetFrameColor): this sets the frame color (default=insetframe).
3975 * src/insets/lyxinset.h: added x() and y() functions which return
3976 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3977 function which is needed to see if we have a locking inset of some
3978 type in this inset (needed for now in insettabular).
3980 * src/vspace.C (inPixels): the same function also without a BufferView
3981 parameter as so it is easier to use it in some ocasions.
3983 * src/lyxfunc.C: changed all places where insertInset was used so
3984 that now if it couldn't be inserted it is deleted!
3986 * src/TabularLayout.C:
3987 * src/TableLayout.C: added support for new tabular-inset!
3989 * src/BufferView2.C (insertInset): this now returns a bool if the
3990 inset was really inserted!!!
3992 * src/tabular.C (GetLastCellInRow):
3993 (GetFirstCellInRow): new helper functions.
3994 (Latex): implemented for new tabular class.
3998 (TeXTopHLine): new Latex() helper functions.
4000 2000-05-12 Juergen Vigna <jug@sad.it>
4002 * src/mathed/formulamacro.C (Read):
4003 * src/mathed/formula.C (Read): read also the \end_inset here!
4005 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4007 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4008 crush when saving formulae with unbalanced parenthesis.
4010 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4012 * src/layout.C: Add new keyword "endlabelstring" to layout file
4014 * src/text.C (GetVisibleRow): Draw endlabel string.
4016 * lib/layouts/broadway.layout
4017 * lib/layouts/hollywood.layout: Added endlabel for the
4018 Parenthetical layout.
4020 * lib/layouts/heb-article.layout: Do not use slanted font shape
4021 for Theorem like environments.
4023 * src/buffer.C (makeLaTeXFile): Always add "american" to
4024 the UsedLanguages list if document language is RTL.
4026 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4028 * add addendum to README.OS2 and small patch (from SMiyata)
4030 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4032 * many files: correct the calls to ChangeExtension().
4034 * src/support/filetools.C (ChangeExtension): remove the no_path
4035 argument, which does not belong there. Use OnlyFileName() instead.
4037 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4038 files when LaTeXing a non-nice latex file.
4040 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4041 a chain of "if". Return false when deadkeys are not handled.
4043 * src/lyx_main.C (LyX): adapted the code for default bindings.
4045 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4046 bindings for basic functionality (except deadkeys).
4047 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4049 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4050 several methods: handle override_x_deadkeys.
4052 * src/lyxrc.h: remove the "bindings" map, which did not make much
4053 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4055 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4057 * src/lyxfont.C (stateText): use a saner method to determine
4058 whether the font is "default". Seems to fix the crash with DEC
4061 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4063 2000-05-08 Juergen Vigna <jug@sad.it>
4065 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4066 TabularLayoutMenu with mouse-button-3
4067 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4069 * src/TabularLayout.C: added this file for having a Layout for
4072 2000-05-05 Juergen Vigna <jug@sad.it>
4074 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4075 recalculating inset-widths.
4076 (TabularFeatures): activated this function so that I can change
4077 tabular-features via menu.
4079 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4080 that I can test some functions with the Table menu.
4082 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4084 * src/lyxfont.C (stateText): guard against stupid c++libs.
4086 * src/tabular.C: add using std::vector
4087 some whitespace changes, + removed som autogenerated code.
4089 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4091 2000-05-05 Juergen Vigna <jug@sad.it>
4093 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4094 row, columns and cellstructures.
4096 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4098 * lib/lyxrc.example: remove obsolete entries.
4100 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4101 reading of protected_separator for free_spacing.
4103 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4105 * src/text.C (draw): do not display an exclamation mark in the
4106 margin for margin notes. This is confusing, ugly and
4109 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4110 AMS math' is checked.
4112 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4113 name to see whether including the amsmath package is needed.
4115 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4117 * src/paragraph.C (validate): Compute UsedLanguages correctly
4118 (don't insert the american language if it doesn't appear in the
4121 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4122 The argument of \thanks{} command is considered moving argument
4124 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4127 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4129 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4130 for appendix/minipage/depth. The lines can be now both in the footnote
4131 frame, and outside the frame.
4133 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4136 2000-05-05 Juergen Vigna <jug@sad.it>
4138 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4139 neede only in tabular.[Ch].
4141 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4143 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4145 (Write): write '~' for PROTECTED_SEPARATOR
4147 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4149 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4152 * src/mathed/formula.C (drawStr): rename size to siz.
4154 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4155 possibly fix a bug by not changing the pflags = flags to piflags =
4158 2000-05-05 Juergen Vigna <jug@sad.it>
4160 * src/insets/insetbib.C: moved using directive
4162 * src/ImportNoweb.C: small fix for being able to compile (missing
4165 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4167 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4168 to use clear, since we don't depend on this in the code. Add test
4171 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4173 * (various *.C files): add using std::foo directives to please dec
4176 * replace calls to string::clear() to string::erase() (Angus)
4178 * src/cheaders/cmath: modified to provide std::abs.
4180 2000-05-04 Juergen Vigna <jug@sad.it>
4182 * src/insets/insettext.C: Prepared all for inserting of multiple
4183 paragraphs. Still display stuff to do (alignment and other things),
4184 but I would like to use LyXText to do this when we cleaned out the
4185 table-support stuff.
4187 * src/insets/insettabular.C: Changed lot of stuff and added lots
4188 of functionality still a lot to do.
4190 * src/tabular.C: Various functions changed name and moved to be
4191 const functions. Added new Read and Write functions and changed
4192 lots of things so it works good with tabular-insets (also removed
4193 some stuff which is not needed anymore * hacks *).
4195 * src/lyxcursor.h: added operators == and != which just look if
4196 par and pos are (not) equal.
4198 * src/buffer.C (latexParagraphs): inserted this function to latex
4199 all paragraphs form par to endpar as then I can use this too for
4202 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4203 so that I can call this to from text insets with their own cursor.
4205 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4206 output off all paragraphs (because of the fix below)!
4208 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4209 the very last paragraph (this could be also the last paragraph of an
4212 * src/texrow.h: added rows() call which returns the count-variable.
4214 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4216 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4218 * lib/configure.m4: better autodetection of DocBook tools.
4220 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4222 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4224 * src/lyx_cb.C: add using std::reverse;
4226 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4229 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4230 selected files. Should fix repeated errors from generated files.
4232 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4234 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4236 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4237 the spellchecker popup.
4239 * lib/lyxrc.example: Removed the \number_inset section
4241 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4243 * src/insets/figinset.C (various): Use IsFileReadable() to make
4244 sure that the file actually exist. Relying on ghostscripts errors
4245 is a bad idea since they can lead to X server crashes.
4247 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4249 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4252 * lib/lyxrc.example: smallish typo in description of
4253 \view_dvi_paper_option
4255 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4258 * src/lyxfunc.C: doImportHelper to factor out common code of the
4259 various import methods. New functions doImportASCIIasLines,
4260 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4261 doImportLinuxDoc for the format specific parts.
4264 * buffer.C: Dispatch returns now a bool to indicate success
4267 * lyx_gui.C: Add getLyXView() for member access
4269 * lyx_main.C: Change logic for batch commands: First try
4270 Buffer::Dispatch (possibly without GUI), if that fails, use
4273 * lyx_main.C: Add support for --import command line switch.
4274 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4275 Available Formats: Everything accepted by 'buffer-import <format>'
4277 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4279 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4282 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4283 documents will be reformatted upon reentry.
4285 2000-04-27 Juergen Vigna <jug@sad.it>
4287 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4288 correctly only last pos this was a bug.
4290 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4292 * release of lyx-1.1.5pre1
4294 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4296 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4298 * src/menus.C: revert the change of naming (Figure->Graphic...)
4299 from 2000-04-11. It was incomplete and bad.
4301 * src/LColor.[Ch]: add LColor::depthbar.
4302 * src/text.C (GetVisibleRow): use it.
4304 * README: update the languages list.
4306 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4308 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4311 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4313 * README: remove sections that were just wrong.
4315 * src/text2.C (GetRowNearY): remove currentrow code
4317 * src/text.C (GetRow): remove currentrow code
4319 * src/screen.C (Update): rewritten a bit.
4320 (SmallUpdate): removed func
4322 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4324 (FullRebreak): return bool
4325 (currentrow): remove var
4326 (currentrow_y): ditto
4328 * src/lyxscreen.h (Draw): change arg to unsigned long
4329 (FitCursor): return bool
4330 (FitManualCursor): ditto
4331 (Smallpdate): remove func
4332 (first): change to unsigned long
4333 (DrawOneRow): change second arg to long (from long &)
4334 (screen_refresh_y): remove var
4335 (scree_refresh_row): ditto
4337 * src/lyxrow.h: change baseline to usigned int from unsigned
4338 short, this brings some implicit/unsigned issues out in the open.
4340 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4342 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4343 instead of smallUpdate.
4345 * src/lyxcursor.h: change y to unsigned long
4347 * src/buffer.h: don't call updateScrollbar after fitcursor
4349 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4350 where they are used. Removed "\\direction", this was not present
4351 in 1.1.4 and is already obsolete. Commented out some code that I
4352 believe to never be called.
4353 (runLiterate): don't call updateScrollbar after fitCursor
4355 (buildProgram): ditto
4358 * src/WorkArea.h (workWidth): change return val to unsigned
4361 (redraw): remove the button redraws
4362 (setScrollbarValue): change for scrollbar
4363 (getScrollbarValue): change for scrollbar
4364 (getScrollbarBounds): change for scrollbar
4366 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4367 (C_WorkArea_down_cb): removed func
4368 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4369 (resize): change for scrollbar
4370 (setScrollbar): ditto
4371 (setScrollbarBounds): ditto
4372 (setScrollbarIncrements): ditto
4373 (up_cb): removed func
4374 (down_cb): removed func
4375 (scroll_cb): change for scrollbar
4376 (work_area_handler): ditto
4378 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4379 when FitCursor did something.
4380 (updateScrollbar): some unsigned changes
4381 (downCB): removed func
4382 (scrollUpOnePage): removed func
4383 (scrollDownOnePage): remvoed func
4384 (workAreaMotionNotify): don't call screen->FitCursor but use
4385 fitCursor instead. and bool return val
4386 (workAreaButtonPress): ditto
4387 (workAreaButtonRelease): some unsigned changes
4388 (checkInsetHit): ditto
4389 (workAreaExpose): ditto
4390 (update): parts rewritten, comments about the signed char arg added
4391 (smallUpdate): removed func
4392 (cursorPrevious): call needed updateScrollbar
4395 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4398 * src/BufferView.[Ch] (upCB): removed func
4399 (downCB): removed func
4400 (smallUpdate): removed func
4402 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4404 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4405 currentrow, currentrow_y optimization. This did not help a lot and
4406 if we want to do this kind of optimization we should rather use
4407 cursor.row instead of the currentrow.
4409 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4410 buffer spacing and klyx spacing support.
4412 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4414 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4417 2000-04-26 Juergen Vigna <jug@sad.it>
4419 * src/insets/figinset.C: fixes to Lars sstream changes!
4421 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4423 * A lot of files: Added Ascii(ostream &) methods to all inset
4424 classes. Used when exporting to ASCII.
4426 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4427 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4430 * src/text2.C (ToggleFree): Disabled implicit word selection when
4431 there is a change in the language
4433 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4434 no output was generated for end-of-sentence inset.
4436 * src/insets/lyxinset.h
4439 * src/paragraph.C: Removed the insetnumber code
4441 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4443 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4445 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4446 no_babel and no_epsfig completely from the file.
4447 (parseSingleLyXformat2Token): add handling for per-paragraph
4448 spacing as written by klyx.
4450 * src/insets/figinset.C: applied patch by Andre. Made it work with
4453 2000-04-20 Juergen Vigna <jug@sad.it>
4455 * src/insets/insettext.C (cutSelection):
4456 (copySelection): Fixed with selection from right to left.
4457 (draw): now the rows are not recalculated at every draw.
4458 (computeTextRows): for now reset the inset-owner here (this is
4459 important for an undo or copy where the inset-owner is not set
4462 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4463 motion to the_locking_inset screen->first was forgotten, this was
4464 not important till we got multiline insets.
4466 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4468 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4469 code seems to be alright (it is code changed by Dekel, and the
4470 intent is indeed that all macros should be defined \protect'ed)
4472 * NEWS: a bit of reorganisation of the new user-visible features.
4474 2000-04-19 Juergen Vigna <jug@sad.it>
4476 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4477 position. Set the inset_owner of the used paragraph so that it knows
4478 that it is inside an inset. Fixed cursor handling with mouse and
4479 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4480 and cleanups to make TextInsets work better.
4482 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4483 Changed parameters of various functions and added LockInsetInInset().
4485 * src/insets/insettext.C:
4487 * src/insets/insetcollapsable.h:
4488 * src/insets/insetcollapsable.C:
4489 * src/insets/insetfoot.h:
4490 * src/insets/insetfoot.C:
4491 * src/insets/insetert.h:
4492 * src/insets/insetert.C: cleaned up the code so that it works now
4493 correctly with insettext.
4495 * src/insets/inset.C:
4496 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4497 that insets in insets are supported right.
4500 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4502 * src/paragraph.C: some small fixes
4504 * src/debug.h: inserted INSETS debug info
4506 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4507 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4509 * src/commandtags.h:
4510 * src/LyXAction.C: insert code for InsetTabular.
4512 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4513 not Button1MotionMask.
4514 (workAreaButtonRelease): send always a InsetButtonRelease event to
4516 (checkInsetHit): some setCursor fixes (always with insets).
4518 * src/BufferView2.C (lockInset): returns a bool now and extended for
4519 locking insets inside insets.
4520 (showLockedInsetCursor): it is important to have the cursor always
4521 before the locked inset.
4522 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4524 * src/BufferView.h: made lockInset return a bool.
4526 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4528 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4529 that is used also internally but can be called as public to have back
4530 a cursor pos which is not set internally.
4531 (SetCursorIntern): Changed to use above function.
4533 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4535 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4540 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4541 patches for things that should be in or should be changed.
4543 * src/* [insetfiles]: change "usigned char fragile" to bool
4544 fragile. There was only one point that could that be questioned
4545 and that is commented in formulamacro.C. Grep for "CHECK".
4547 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4548 (DeleteBuffer): take it out of CutAndPaste and make it static.
4550 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4553 output the spacing envir commands. Also the new commands used in
4554 the LaTeX output makes the result better.
4556 * src/Spacing.C (writeEnvirBegin): new method
4557 (writeEnvirEnd): new method
4559 2000-04-18 Juergen Vigna <jug@sad.it>
4561 * src/CutAndPaste.C: made textclass a static member of the class
4562 as otherwise it is not accesed right!!!
4564 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4566 * forms/layout_forms.fd
4567 * src/layout_forms.h
4568 * src/layout_forms.C (create_form_form_character)
4569 * src/lyx_cb.C (UserFreeFont)
4570 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4571 documents (in the layout->character popup).
4573 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4575 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4576 \spell_command was in fact not honored (from Kevin Atkinson).
4578 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4581 * src/lyx_gui.h: make lyxViews private (Angus)
4583 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4585 * src/mathed/math_write.C
4586 (MathMatrixInset::Write) Put \protect before \begin{array} and
4587 \end{array} if fragile
4588 (MathParInset::Write): Put \protect before \\ if fragile
4590 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4592 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4593 initialization if the LyXColorHandler must be done after the
4594 connections to the XServer has been established.
4596 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4597 get the background pixel from the lyxColorhandler so that the
4598 figures are rendered with the correct background color.
4599 (NextToken): removed functions.
4600 (GetPSSizes): use ifs >> string instead of NextToken.
4602 * src/Painter.[Ch]: the color cache moved out of this file.
4604 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4607 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4609 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4610 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4612 * src/BufferView.C (enterView): new func
4613 (leaveView): new func
4615 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4617 (leaveView): new func, undefines xterm cursor when approp.
4619 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4620 (AllowInput): delete the Workarea cursor handling from this func.
4622 * src/Painter.C (underline): draw a slimer underline in most cases.
4624 * src/lyx_main.C (error_handler): use extern "C"
4626 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4628 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4629 sent directly to me.
4631 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4632 to the list by Dekel.
4634 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4637 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4638 methods from lyx_cb.here.
4640 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4643 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4646 instead of using current_view directly.
4648 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4650 * src/LyXAction.C (init): add the paragraph-spacing command.
4652 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4654 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4656 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4657 different from the documents.
4659 * src/text.C (SetHeightOfRow): take paragraph spacing into
4660 account, paragraph spacing takes precedence over buffer spacing
4661 (GetVisibleRow): ditto
4663 * src/paragraph.C (writeFile): output the spacing parameter too.
4664 (validate): set the correct features if spacing is used in the
4666 (Clear): set spacing to default
4667 (MakeSameLayout): spacing too
4668 (HasSameLayout): spacing too
4669 (SetLayout): spacing too
4670 (TeXOnePar): output the spacing commands
4672 * src/lyxparagraph.h: added a spacing variable for use with
4673 per-paragraph spacing.
4675 * src/Spacing.h: add a Default spacing and a method to check if
4676 the current spacing is default. also added an operator==
4678 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4681 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4683 * src/lyxserver.C (callback): fix dispatch of functions
4685 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4686 printf() into lyxerr call.
4688 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4691 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4692 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4693 the "Float" from each of the subitems.
4694 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4696 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4697 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4698 documented the change so that the workaround can be nuked later.
4700 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4703 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4705 * src/buffer.C (getLatexName): ditto
4706 (setReadonly): ditto
4708 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4710 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4711 avoid some uses of current_view. Added also a bufferParams()
4712 method to get at this.
4714 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4716 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4718 * src/lyxparagraph.[Ch]: removed
4719 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4720 with operators used by lower_bound and
4721 upper_bound in InsetTable's
4722 Make struct InsetTable private again. Used matchpos.
4724 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4726 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4727 document, the language of existing text is changed (unless the
4728 document is multi-lingual)
4730 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4732 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4734 * A lot of files: A rewrite of the Right-to-Left support.
4736 2000-04-10 Juergen Vigna <jug@sad.it>
4738 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4739 misplaced cursor when inset in inset is locked.
4741 * src/insets/insettext.C (LocalDispatch): small fix so that a
4742 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4744 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4745 footnote font should be decreased in size twice when displaying.
4747 * src/insets/insettext.C (GetDrawFont): inserted this function as
4748 the drawing-font may differ from the real paragraph font.
4750 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4751 insets (inset in inset!).
4753 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4754 function here because we don't want footnotes inside footnotes.
4756 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4758 (init): now set the inset_owner in paragraph.C
4759 (LocalDispatch): added some resetPos() in the right position
4762 (pasteSelection): changed to use the new CutAndPaste-Class.
4764 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4765 which tells if it is allowed to insert another inset inside this one.
4767 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4768 SwitchLayoutsBetweenClasses.
4770 * src/text2.C (InsertInset): checking of the new paragraph-function
4772 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4773 is not needed anymore here!
4776 (PasteSelection): redone (also with #ifdef) so that now this uses
4777 the CutAndPaste-Class.
4778 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4781 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4782 from/to text/insets.
4784 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4785 so that the paragraph knows if it is inside an (text)-inset.
4786 (InsertFromMinibuffer): changed return-value to bool as now it
4787 may happen that an inset is not inserted in the paragraph.
4788 (InsertInsetAllowed): this checks if it is allowed to insert an
4789 inset in this paragraph.
4791 (BreakParagraphConservative):
4792 (BreakParagraph) : small change for the above change of the return
4793 value of InsertFromMinibuffer.
4795 * src/lyxparagraph.h: added inset_owner and the functions to handle
4796 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4798 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4800 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4801 functions from BufferView to BufferView::Pimpl to ease maintence.
4803 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4804 correctly. Also use SetCursorIntern instead of SetCursor.
4806 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4809 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4811 * src/WorkArea.C (belowMouse): manually implement below mouse.
4813 * src/*: Add "explicit" on several constructors, I added probably
4814 some unneeded ones. A couple of changes to code because of this.
4816 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4817 implementation and private parts from the users of BufferView. Not
4820 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4821 implementation and private parts from the users of LyXLex. Not
4824 * src/BufferView_pimpl.[Ch]: new files
4826 * src/lyxlex_pimpl.[Ch]: new files
4828 * src/LyXView.[Ch]: some inline functions move out-of-line
4830 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4832 * src/lyxparagraph.h: make struct InsetTable public.
4834 * src/support/lyxstring.h: change lyxstring::difference_type to be
4835 ptrdiff_t. Add std:: modifiers to streams.
4837 * src/font.C: include the <cctype> header, for islower() and
4840 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4842 * src/font.[Ch]: new files. Contains the metric functions for
4843 fonts, takes a LyXFont as parameter. Better separation of concepts.
4845 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4846 changes because of this.
4848 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4850 * src/*: compile with -Winline and move functions that don't
4853 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4856 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4858 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4859 (various files changed because of this)
4861 * src/Painter.C (text): fixed the drawing of smallcaps.
4863 * src/lyxfont.[Ch] (drawText): removed unused member func.
4866 * src/*.C: added needed "using" statements and "std::" qualifiers.
4868 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4870 * src/*.h: removed all use of "using" from header files use
4871 qualifier std:: instead.
4873 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4875 * src/text.C (Backspace): some additional cleanups (we already
4876 know whether cursor.pos is 0 or not).
4878 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4879 automake does not provide one).
4881 * src/bmtable.h: replace C++ comments with C comments.
4883 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4885 * src/screen.C (ShowCursor): Change the shape of the cursor if
4886 the current language is not equal to the language of the document.
4887 (If the cursor change its shape unexpectedly, then you've found a bug)
4889 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4892 * src/insets/insetnumber.[Ch]: New files.
4894 * src/LyXAction.C (init)
4895 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4898 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4900 * src/lyxparagraph.h
4901 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4902 (the vector is kept sorted).
4904 * src/text.C (GetVisibleRow): Draw selection correctly when there
4905 is both LTR and RTL text.
4907 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4908 which is much faster.
4910 * src/text.C (GetVisibleRow and other): Do not draw the last space
4911 in a row if the direction of the last letter is not equal to the
4912 direction of the paragraph.
4914 * src/lyxfont.C (latexWriteStartChanges):
4915 Check that font language is not equal to basefont language.
4916 (latexWriteEndChanges): ditto
4918 * src/lyx_cb.C (StyleReset): Don't change the language while using
4919 the font-default command.
4921 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4922 empty paragraph before a footnote.
4924 * src/insets/insetcommand.C (draw): Increase x correctly.
4926 * src/screen.C (ShowCursor): Change cursor shape if
4927 current language != document language.
4929 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4931 2000-03-31 Juergen Vigna <jug@sad.it>
4933 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4934 (Clone): changed mode how the paragraph-data is copied to the
4935 new clone-paragraph.
4937 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4938 GetInset(pos) with no inset anymore there (in inset UNDO)
4940 * src/insets/insetcommand.C (draw): small fix as here x is
4941 incremented not as much as width() returns (2 before, 2 behind = 4)
4943 2000-03-30 Juergen Vigna <jug@sad.it>
4945 * src/insets/insettext.C (InsetText): small fix in initialize
4946 widthOffset (should not be done in the init() function)
4948 2000-03-29 Amir Karger <karger@lyx.org>
4950 * lib/examples/it_ItemizeBullets.lyx: translation by
4953 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4955 2000-03-29 Juergen Vigna <jug@sad.it>
4957 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4959 * src/insets/insetfoot.C (Clone): small change as for the below
4960 new init function in the text-inset
4962 * src/insets/insettext.C (init): new function as I've seen that
4963 clone did not copy the Paragraph-Data!
4964 (LocalDispatch): Added code so that now we have some sort of Undo
4965 functionality (well actually we HAVE Undo ;)
4967 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4969 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4971 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4974 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 * src/main.C: added a runtime check that verifies that the xforms
4977 header used when building LyX and the library used when running
4978 LyX match. Exit with a message if they don't match. This is a
4979 version number check only.
4981 * src/buffer.C (save): Don't allocate memory on the heap for
4982 struct utimbuf times.
4984 * *: some using changes, use iosfwd instead of the real headers.
4986 * src/lyxfont.C use char const * instead of string for the static
4987 strings. Rewrite some functions to use sstream.
4989 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4991 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4994 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4996 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4997 of Geodesy (from Martin Vermeer)
4999 * lib/layouts/svjour.inc: include file for the Springer svjour
5000 class. It can be used to support journals other than JoG.
5002 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5003 Miskiewicz <misiek@pld.org.pl>)
5004 * lib/reLyX/Makefile.am: ditto.
5006 2000-03-27 Juergen Vigna <jug@sad.it>
5008 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5009 also some modifications with operations on selected text.
5011 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5012 problems with clicking on insets (last famous words ;)
5014 * src/insets/insetcommand.C (draw):
5015 (width): Changed to have a bit of space before and after the inset so
5016 that the blinking cursor can be seen (otherwise it was hidden)
5018 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5020 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5021 would not be added to the link list when an installed gettext (not
5022 part of libc) is found.
5024 2000-03-24 Juergen Vigna <jug@sad.it>
5026 * src/insets/insetcollapsable.C (Edit):
5027 * src/mathed/formula.C (InsetButtonRelease):
5028 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5031 * src/BufferView.C (workAreaButtonPress):
5032 (workAreaButtonRelease):
5033 (checkInsetHit): Finally fixed the clicking on insets be handled
5036 * src/insets/insetert.C (Edit): inserted this call so that ERT
5037 insets work always with LaTeX-font
5039 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5041 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5042 caused lyx to startup with no GUI in place, causing in a crash
5043 upon startup when called with arguments.
5045 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5047 * src/FontLoader.C: better initialization of dummyXFontStruct.
5049 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5051 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5052 for linuxdoc and docbook import and export format options.
5054 * lib/lyxrc.example Example of default values for the previous flags.
5056 * src/lyx_cb.C Use those flags instead of the hardwired values for
5057 linuxdoc and docbook export.
5059 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5062 * src/menus.C Added menus entries for the new import/exports formats.
5064 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5066 * src/lyxrc.*: Added support for running without Gui
5069 * src/FontLoader.C: sensible defaults if no fonts are needed
5071 * src/lyx_cb.C: New function ShowMessage (writes either to the
5072 minibuffer or cout in case of no gui
5073 New function AskOverwrite for common stuff
5074 Consequently various changes to call these functions
5076 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5077 wild guess at sensible screen resolution when having no gui
5079 * src/lyxfont.C: no gui, no fonts... set some defaults
5081 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5083 * src/LColor.C: made the command inset background a bit lighter.
5085 2000-03-20 Hartmut Goebel <goebel@noris.net>
5087 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5088 stdstruct.inc. Koma-Script added some title elements which
5089 otherwise have been listed below "bibliography". This split allows
5090 adding title elements to where they belong.
5092 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5093 define the additional tilte elements and then include
5096 * many other layout files: changed to include stdtitle.inc just
5097 before stdstruct.inc.
5099 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5101 * src/buffer.C: (save) Added the option to store all backup files
5102 in a single directory
5104 * src/lyxrc.[Ch]: Added variable \backupdir_path
5106 * lib/lyxrc.example: Added descriptions of recently added variables
5108 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5109 bibtex inset, not closing the bibtex popup when deleting the inset)
5111 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5113 * src/lyx_cb.C: add a couple using directives.
5115 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5116 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5117 import based on the filename.
5119 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5120 file would be imported at start, if the filename where of a sgml file.
5122 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5124 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5126 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5127 * src/lyxfont.h Replaced the member variable bits.direction by the
5128 member variable lang. Made many changes in other files.
5129 This allows having a multi-lingual document
5131 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5132 that change the current language to <l>.
5133 Removed the command "font-rtl"
5135 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5136 format for Hebrew documents)
5138 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5139 When auto_mathmode is "true", pressing a digit key in normal mode
5140 will cause entering into mathmode.
5141 If auto_mathmode is "rtl" then this behavior will be active only
5142 when writing right-to-left text.
5144 * src/text2.C (InsertStringA) The string is inserted using the
5147 * src/paragraph.C (GetEndLabel) Gives a correct result for
5148 footnote paragraphs.
5150 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5152 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5154 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5155 front of PasteParagraph. Never insert a ' '. This should at least
5156 fix some cause for the segfaults that we have been experiencing,
5157 it also fixes backspace behaviour slightly. (Phu!)
5159 * src/support/lstrings.C (compare_no_case): some change to make it
5160 compile with gcc 2.95.2 and stdlibc++-v3
5162 * src/text2.C (MeltFootnoteEnvironment): change type o
5163 first_footnote_par_is_not_empty to bool.
5165 * src/lyxparagraph.h: make text private. Changes in other files
5167 (fitToSize): new function
5168 (setContentsFromPar): new function
5169 (clearContents): new function
5170 (SetChar): new function
5172 * src/paragraph.C (readSimpleWholeFile): deleted.
5174 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5175 the file, just use a simple string instead. Also read the file in
5176 a more maintainable manner.
5178 * src/text2.C (InsertStringA): deleted.
5179 (InsertStringB): deleted.
5181 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5183 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5184 RedoParagraphs from the doublespace handling part, just set status
5185 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5186 done, but perhaps not like this.)
5188 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5190 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5191 character when inserting an inset.
5193 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * src/bufferparams.C (readLanguage): now takes "default" into
5198 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5199 also initialize the toplevel_keymap with the default bindings from
5202 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5204 * all files using lyxrc: have lyxrc as a real variable and not a
5205 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5208 * src/lyxrc.C: remove double call to defaultKeyBindings
5210 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5211 toolbar defauls using lyxlex. Remove enums, structs, functions
5214 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5215 toolbar defaults. Also store default keybindings in a map.
5217 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5218 storing the toolbar defaults without any xforms dependencies.
5220 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5221 applied. Changed to use iterators.
5223 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5225 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5226 systems that don't have LINGUAS set to begin with.
5228 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5230 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5231 the list by Dekel Tsur.
5233 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5235 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5236 * src/insets/form_graphics.C: ditto.
5238 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5240 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5242 * src/bufferparams.C (readLanguage): use the new language map
5244 * src/intl.C (InitKeyMapper): use the new language map
5246 * src/lyx_gui.C (create_forms): use the new language map
5248 * src/language.[Ch]: New files. Used for holding the information
5249 about each language. Now! Use this new language map enhance it and
5250 make it really usable for our needs.
5252 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5254 * screen.C (ShowCursor): Removed duplicate code.
5255 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5256 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5258 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5261 * src/text.C Added TransformChar method. Used for rendering Arabic
5262 text correctly (change the glyphs of the letter according to the
5263 position in the word)
5268 * src/lyxrc.C Added lyxrc command {language_command_begin,
5269 language_command_end,language_command_ltr,language_command_rtl,
5270 language_package} which allows the use of either arabtex or Omega
5273 * src/lyx_gui.C (init)
5275 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5276 to use encoding for menu fonts which is different than the encoding
5279 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5280 do not load the babel package.
5281 To write an English document with Hebrew/Arabic, change the document
5282 language to "english".
5284 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5285 (alphaCounter): changed to return char
5286 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5288 * lib/lyxrc.example Added examples for Hebrew/Arabic
5291 * src/layout.C Added layout command endlabeltype
5293 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5295 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5297 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5299 * src/mathed/math_delim.C (search_deco): return a
5300 math_deco_struct* instead of index.
5302 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5304 * All files with a USE_OSTREAM_ONLY within: removed all code that
5305 was unused when USE_OSTREAM_ONLY is defined.
5307 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5308 of any less. Removed header and using.
5310 * src/text.C (GetVisibleRow): draw the string "Page Break
5311 (top/bottom)" on screen when drawing a pagebreak line.
5313 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5315 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5317 * src/mathed/math_macro.C (draw): do some cast magic.
5320 * src/mathed/math_defs.h: change byte* argument to byte const*.
5322 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5324 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5325 know it is right to return InsetFoot* too, but cxx does not like
5328 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5330 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5332 * src/mathed/math_delim.C: change == to proper assignment.
5334 2000-03-09 Juergen Vigna <jug@sad.it>
5336 * src/insets/insettext.C (setPos): fixed various cursor positioning
5337 problems (via mouse and cursor-keys)
5338 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5339 inset (still a small display problem but it works ;)
5341 * src/insets/insetcollapsable.C (draw): added button_top_y and
5342 button_bottom_y to have correct values for clicking on the inset.
5344 * src/support/lyxalgo.h: commented out 'using std::less'
5346 2000-03-08 Juergen Vigna <jug@sad.it>
5348 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5349 Button-Release event closes as it is alos the Release-Event
5352 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5354 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5356 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5357 can add multiple spaces in Scrap (literate programming) styles...
5358 which, by the way, is how I got hooked on LyX to begin with.
5360 * src/mathed/formula.C (Write): Added dummy variable to an
5361 inset::Latex() call.
5362 (Latex): Add free_spacing boolean to inset::Latex()
5364 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5366 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5367 virtual function to include the free_spacing boolean from
5368 the containing paragraph's style.
5370 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5371 Added free_spacing boolean arg to match inset.h
5373 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5374 Added free_spacing boolean arg to match inset.h
5376 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5377 Added free_spacing boolean and made sure that if in a free_spacing
5378 paragraph, that we output normal space if there is a protected space.
5380 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5381 Added free_spacing boolean arg to match inset.h
5383 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5384 Added free_spacing boolean arg to match inset.h
5386 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5387 Added free_spacing boolean arg to match inset.h
5389 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5390 Added free_spacing boolean arg to match inset.h
5392 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5393 Added free_spacing boolean arg to match inset.h
5395 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5396 free_spacing boolean arg to match inset.h
5398 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5399 Added free_spacing boolean arg to match inset.h
5401 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5402 Added free_spacing boolean arg to match inset.h
5404 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5405 Added free_spacing boolean arg to match inset.h
5407 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5408 Added free_spacing boolean arg to match inset.h
5410 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5411 Added free_spacing boolean arg to match inset.h
5413 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5414 free_spacing boolean arg to match inset.h
5416 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5417 free_spacing boolean arg to match inset.h
5419 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5420 ignore free_spacing paragraphs. The user's spaces are left
5423 * src/text.C (InsertChar): Fixed the free_spacing layout
5424 attribute behavior. Now, if free_spacing is set, you can
5425 add multiple spaces in a paragraph with impunity (and they
5426 get output verbatim).
5427 (SelectSelectedWord): Added dummy argument to inset::Latex()
5430 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5433 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5434 paragraph layouts now only input a simple space instead.
5435 Special character insets don't make any sense in free-spacing
5438 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5439 hard-spaces in the *input* file to simple spaces if the layout
5440 is free-spacing. This converts old files which had to have
5441 hard-spaces in free-spacing layouts where a simple space was
5443 (writeFileAscii): Added free_spacing check to pass to the newly
5444 reworked inset::Latex(...) methods. The inset::Latex() code
5445 ensures that hard-spaces in free-spacing paragraphs get output
5446 as spaces (rather than "~").
5448 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5450 * src/mathed/math_delim.C (draw): draw the empty placeholder
5451 delims with a onoffdash line.
5452 (struct math_deco_compare): struct that holds the "functors" used
5453 for the sort and the binary search in math_deco_table.
5454 (class init_deco_table): class used for initial sort of the
5456 (search_deco): use lower_bound to do a binary search in the
5459 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5461 * src/lyxrc.C: a small secret thingie...
5463 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5464 and to not flush the stream as often as it used to.
5466 * src/support/lyxalgo.h: new file
5467 (sorted): template function used for checking if a sequence is
5468 sorted or not. Two versions with and without user supplied
5469 compare. Uses same compare as std::sort.
5471 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5472 it and give warning on lyxerr.
5474 (struct compare_tags): struct with function operators used for
5475 checking if sorted, sorting and lower_bound.
5476 (search_kw): use lower_bound instead of manually implemented
5479 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5481 * src/insets/insetcollapsable.h: fix Clone() declaration.
5482 * src/insets/insetfoot.h: ditto.
5484 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5486 2000-03-08 Juergen Vigna <jug@sad.it>
5488 * src/insets/lyxinset.h: added owner call which tells us if
5489 this inset is inside another inset. Changed also the return-type
5490 of Editable to an enum so it tells clearer what the return-value is.
5492 * src/insets/insettext.C (computeTextRows): fixed computing of
5493 textinsets which split automatically on more rows.
5495 * src/insets/insetert.[Ch]: changed this to be of BaseType
5498 * src/insets/insetfoot.[Ch]: added footnote inset
5500 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5501 collapsable insets (like footnote, ert, ...)
5503 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5505 * src/lyxdraw.h: remvoe file
5507 * src/lyxdraw.C: remove file
5509 * src/insets/insettext.C: added <algorithm>.
5511 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5513 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5514 (matrix_cb): case MM_OK use string stream
5516 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5519 * src/mathed/math_macro.C (draw): use string stream
5520 (Metrics): use string stream
5522 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5523 directly to the ostream.
5525 * src/vspace.C (asString): use string stream.
5526 (asString): use string stream
5527 (asLatexString): use string stream
5529 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5530 setting Spacing::Other.
5532 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5533 sprintf when creating the stretch vale.
5535 * src/text2.C (alphaCounter): changed to return a string and to
5536 not use a static variable internally. Also fixed a one-off bug.
5537 (SetCounter): changed the drawing of the labels to use string
5538 streams instead of sprintf.
5540 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5541 manipulator to use a scheme that does not require library support.
5542 This is also the way it is done in the new GNU libstdc++. Should
5543 work with DEC cxx now.
5545 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5547 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5548 end. This fixes a bug.
5550 * src/mathed (all files concerned with file writing): apply the
5551 USE_OSTREAM_ONLY changes to mathed too.
5553 * src/support/DebugStream.h: make the constructor explicit.
5555 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5556 count and ostream squashed.
5558 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5560 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5562 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5563 ostringstream uses STL strings, and we might not.
5565 * src/insets/insetspecialchar.C: add using directive.
5566 * src/insets/insettext.C: ditto.
5568 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5570 * lib/layouts/seminar.layout: feeble attempt at a layout for
5571 seminar.cls, far from completet and could really use some looking
5572 at from people used to write layout files.
5574 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5575 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5576 a lot nicer and works nicely with ostreams.
5578 * src/mathed/formula.C (draw): a slightly different solution that
5579 the one posted to the list, but I think this one works too. (font
5580 size wrong in headers.)
5582 * src/insets/insettext.C (computeTextRows): some fiddling on
5583 Jürgens turf, added some comments that he should read.
5585 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5586 used and it gave compiler warnings.
5587 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5590 * src/lyx_gui.C (create_forms): do the right thing when
5591 show_banner is true/false.
5593 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5594 show_banner is false.
5596 * most file writing files: Now use iostreams to do almost all of
5597 the writing. Also instead of passing string &, we now use
5598 stringstreams. mathed output is still not adapted to iostreams.
5599 This change can be turned off by commenting out all the occurences
5600 of the "#define USE_OSTREAM_ONLY 1" lines.
5602 * src/WorkArea.C (createPixmap): don't output debug messages.
5603 (WorkArea): don't output debug messages.
5605 * lib/lyxrc.example: added a comment about the new variable
5608 * development/Code_rules/Rules: Added some more commente about how
5609 to build class interfaces and on how better encapsulation can be
5612 2000-03-03 Juergen Vigna <jug@sad.it>
5614 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5615 automatically with the width of the LyX-Window
5617 * src/insets/insettext.C (computeTextRows): fixed update bug in
5618 displaying text-insets (scrollvalues where not initialized!)
5620 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5622 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5623 id in the check of the result from lower_bound is not enough since
5624 lower_bound can return last too, and then res->id will not be a
5627 * all insets and some code that use them: I have conditionalized
5628 removed the Latex(string & out, ...) this means that only the
5629 Latex(ostream &, ...) will be used. This is a work in progress to
5630 move towards using streams for all output of files.
5632 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5635 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5638 routine (this fixes bug where greek letters were surrounded by too
5641 * src/support/filetools.C (findtexfile): change a bit the search
5642 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5643 no longer passed to kpsewhich, we may have to change that later.
5645 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5646 warning options to avoid problems with X header files (from Angus
5648 * acinclude.m4: regenerated.
5650 2000-03-02 Juergen Vigna <jug@sad.it>
5652 * src/insets/insettext.C (WriteParagraphData): Using the
5653 par->writeFile() function for writing paragraph-data.
5654 (Read): Using buffer->parseSingleLyXformat2Token()-function
5655 for parsing paragraph data!
5657 * src/buffer.C (readLyXformat2): removed all parse data and using
5658 the new parseSingleLyXformat2Token()-function.
5659 (parseSingleLyXformat2Token): added this function to parse (read)
5660 lyx-file-format (this is called also from text-insets now!)
5662 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5664 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5667 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5668 directly instead of going through a func. One very bad thing: a
5669 static LyXFindReplace, but I don't know where to place it.
5671 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5672 string instead of char[]. Also changed to static.
5673 (GetSelectionOrWordAtCursor): changed to static inline
5674 (SetSelectionOverLenChars): ditto.
5676 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5677 current_view and global variables. both classes has changed names
5678 and LyXFindReplace is not inherited from SearchForm.
5680 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5681 fl_form_search form.
5683 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5685 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5687 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5688 bound (from Kayvan).
5690 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5692 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5694 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5696 * some things that I should comment but the local pub says head to
5699 * comment out all code that belongs to the Roff code for Ascii
5700 export of tables. (this is unused)
5702 * src/LyXView.C: use correct type for global variable
5703 current_layout. (LyXTextClass::size_type)
5705 * some code to get the new insetgraphics closer to working I'd be
5706 grateful for any help.
5708 * src/BufferView2.C (insertInset): use the return type of
5709 NumberOfLayout properly. (also changes in other files)
5711 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5712 this as a test. I want to know what breaks because of this.
5714 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5716 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5718 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5719 to use a \makebox in the label, this allows proper justification
5720 with out using protected spaces or multiple hfills. Now it is
5721 "label" for left justified, "\hfill label\hfill" for center, and
5722 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5723 should be changed accordingly.
5725 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5727 * src/lyxtext.h: change SetLayout() to take a
5728 LyXTextClass::size_type instead of a char (when there is more than
5729 127 layouts in a class); also change type of copylayouttype.
5730 * src/text2.C (SetLayout): ditto.
5731 * src/LyXView.C (updateLayoutChoice): ditto.
5733 * src/LaTeX.C (scanLogFile): errors where the line number was not
5734 given just after the '!'-line were ignored (from Dekel Tsur).
5736 * lib/lyxrc.example: fix description of \date_insert_format
5738 * lib/layouts/llncs.layout: new layout, contributed by Martin
5741 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5743 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5744 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5745 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5746 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5747 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5748 paragraph.C, text.C, text2.C)
5750 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5752 * src/insets/insettext.C (LocalDispatch): remove extra break
5755 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5756 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5758 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5759 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5761 * src/insets/insetbib.h: move InsetBibkey::Holder and
5762 InsetCitation::Holder in public space.
5764 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5766 * src/insets/insettext.h: small change to get the new files from
5767 Juergen to compile (use "string", not "class string").
5769 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5770 const & as parameter to LocalDispatch, use LyXFont const & as
5771 paramter to some other func. This also had impacto on lyxinsets.h
5772 and the two mathed insets.
5774 2000-02-24 Juergen Vigna <jug@sad.it>
5777 * src/commandtags.h:
5779 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5783 * src/BufferView2.C: added/updated code for various inset-functions
5785 * src/insets/insetert.[Ch]: added implementation of InsetERT
5787 * src/insets/insettext.[Ch]: added implementation of InsetText
5789 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5790 (draw): added preliminary code for inset scrolling not finshed yet
5792 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5793 as it is in lyxfunc.C now
5795 * src/insets/lyxinset.h: Added functions for text-insets
5797 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5799 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5800 BufferView and reimplement the list as a queue put inside its own
5803 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5805 * several files: use the new interface to the "updateinsetlist"
5807 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5809 (work_area_handler): call BufferView::trippleClick on trippleclick.
5811 * src/BufferView.C (doubleClick): new function, selects word on
5813 (trippleClick): new function, selects line on trippleclick.
5815 2000-02-22 Allan Rae <rae@lyx.org>
5817 * lib/bind/xemacs.bind: buffer-previous not supported
5819 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5821 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5824 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5826 * src/bufferlist.C: get rid of current_view from this file
5828 * src/spellchecker.C: get rid of current_view from this file
5830 * src/vspace.C: get rid of current_view from this file
5831 (inPixels): added BufferView parameter for this func
5832 (asLatexCommand): added a BufferParams for this func
5834 * src/text.C src/text2.C: get rid of current_view from these
5837 * src/lyxfont.C (getFontDirection): move this function here from
5840 * src/bufferparams.C (getDocumentDirection): move this function
5843 * src/paragraph.C (getParDirection): move this function here from
5845 (getLetterDirection): ditto
5847 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5849 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5850 resize due to wrong pixmap beeing used. Also took the opurtunity
5851 to make the LyXScreen stateless on regard to WorkArea and some
5852 general cleanup in the same files.
5854 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5856 * src/Makefile.am: add missing direction.h
5858 * src/PainterBase.h: made the width functions const.
5860 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5863 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5865 * src/insets/insetlatexaccent.C (draw): make the accents draw
5866 better, at present this will only work well with iso8859-1.
5868 * several files: remove the old drawing code, now we use the new
5871 * several files: remove support for mono_video, reverse_video and
5874 2000-02-17 Juergen Vigna <jug@sad.it>
5876 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5877 int ** as we have to return the pointer, otherwise we have only
5878 NULL pointers in the returning function.
5880 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5882 * src/LaTeX.C (operator()): quote file name when running latex.
5884 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5886 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5887 (bubble tip), this removes our special handling of this.
5889 * Remove all code that is unused now that we have the new
5890 workarea. (Code that are not active when NEW_WA is defined.)
5892 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5894 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5896 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5897 nonexisting layout; correctly redirect obsoleted layouts.
5899 * lib/lyxrc.example: document \view_dvi_paper_option
5901 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5904 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5905 (PreviewDVI): handle the view_dvi_paper_option variable.
5906 [Both from Roland Krause]
5908 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5910 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5911 char const *, int, LyXFont)
5912 (text(int, int, string, LyXFont)): ditto
5914 * src/text.C (InsertCharInTable): attempt to fix the double-space
5915 feature in tables too.
5916 (BackspaceInTable): ditto.
5917 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5919 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5921 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5923 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5924 newly found text in textcache to this.
5925 (buffer): set the owner of the text put into the textcache to 0
5927 * src/insets/figinset.C (draw): fixed the drawing of figures with
5930 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5931 drawing of mathframe, hfills, protected space, table lines. I have
5932 now no outstanding drawing problems with the new Painter code.
5934 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5936 * src/PainterBase.C (ellipse, circle): do not specify the default
5939 * src/LColor.h: add using directive.
5941 * src/Painter.[Ch]: change return type of methods from Painter& to
5942 PainterBase&. Add a using directive.
5944 * src/WorkArea.C: wrap xforms callbacks in C functions
5947 * lib/layouts/foils.layout: font fix and simplifications from Carl
5950 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5952 * a lot of files: The Painter, LColor and WorkArea from the old
5953 devel branch has been ported to lyx-devel. Some new files and a
5954 lot of #ifdeffed code. The new workarea is enabled by default, but
5955 if you want to test the new Painter and LColor you have to compile
5956 with USE_PAINTER defined (do this in config.h f.ex.) There are
5957 still some rought edges, and I'd like some help to clear those
5958 out. It looks stable (loads and displays the Userguide very well).
5961 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5963 * src/buffer.C (pop_tag): revert to the previous implementation
5964 (use a global variable for both loops).
5966 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5968 * src/lyxrc.C (LyXRC): change slightly default date format.
5970 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5971 there is an English text with a footnote that starts with a Hebrew
5972 paragraph, or vice versa.
5973 (TeXFootnote): ditto.
5975 * src/text.C (LeftMargin): allow for negative values for
5976 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5979 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5980 for input encoding (cyrillic)
5982 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5984 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5987 * src/toolbar.C (set): ditto
5988 * src/insets/insetbib.C (create_form_citation_form): ditto
5990 * lib/CREDITS: added Dekel Tsur.
5992 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5993 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5994 hebrew supports files from Dekel Tsur.
5996 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5997 <tzafrir@technion.ac.il>
5999 * src/lyxrc.C: put \date_insert_format at the right place.
6001 * src/buffer.C (makeLaTeXFile): fix the handling of
6002 BufferParams::sides when writing out latex files.
6004 * src/BufferView2.C: add a "using" directive.
6006 * src/support/lyxsum.C (sum): when we use lyxstring,
6007 ostringstream::str needs an additional .c_str().
6009 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6011 * src/support/filetools.C (ChangeExtension): patch from Etienne
6014 * src/TextCache.C (show): remove const_cast and make second
6015 parameter non-const LyXText *.
6017 * src/TextCache.h: use non const LyXText in show.
6019 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6022 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6024 * src/support/lyxsum.C: rework to be more flexible.
6026 * several places: don't check if a pointer is 0 if you are going
6029 * src/text.C: remove some dead code.
6031 * src/insets/figinset.C: remove some dead code
6033 * src/buffer.C: move the BufferView funcs to BufferView2.C
6034 remove all support for insetlatexdel
6035 remove support for oldpapersize stuff
6036 made some member funcs const
6038 * src/kbmap.C: use a std::list to store the bindings in.
6040 * src/BufferView2.C: new file
6042 * src/kbsequence.[Ch]: new files
6044 * src/LyXAction.C + others: remove all trace of buffer-previous
6046 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6047 only have one copy in the binary of this table.
6049 * hebrew patch: moved some functions from LyXText to more
6050 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6052 * several files: remove support for XForms older than 0.88
6054 remove some #if 0 #endif code
6056 * src/TextCache.[Ch]: new file. Holds the textcache.
6058 * src/BufferView.C: changes to use the new TextCache interface.
6059 (waitForX): remove the now unused code.
6061 * src/BackStack.h: remove some commented code
6063 * lib/bind/emacs.bind: remove binding for buffer-previous
6065 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6067 * applied the hebrew patch.
6069 * src/lyxrow.h: make sure that all Row variables are initialized.
6071 * src/text2.C (TextHandleUndo): comment out a delete, this might
6072 introduce a memory leak, but should also help us to not try to
6073 read freed memory. We need to look at this one.
6075 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6076 (LyXParagraph): initalize footnotekind.
6078 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6079 forgot this when applying the patch. Please heed the warnings.
6081 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6082 (aka. reformat problem)
6084 * src/bufferlist.C (exists): made const, and use const_iterator
6085 (isLoaded): new func.
6086 (release): use std::find to find the correct buffer.
6088 * src/bufferlist.h: made getState a const func.
6089 made empty a const func.
6090 made exists a const func.
6093 2000-02-01 Juergen Vigna <jug@sad.it>
6095 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6097 * po/it.po: updated a bit the italian po file and also changed the
6098 'file nuovo' for newfile to 'filenuovo' without a space, this did
6101 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6102 for the new insert_date command.
6104 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6105 from jdblair, to insert a date into the current text conforming to
6106 a strftime format (for now only considering the locale-set and not
6107 the document-language).
6109 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6111 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6112 Bounds Read error seen by purify. The problem was that islower is
6113 a macros which takes an unsigned char and uses it as an index for
6114 in array of characters properties (and is thus subject to the
6118 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6119 correctly the paper sides radio buttons.
6120 (UpdateDocumentButtons): ditto.
6122 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6124 * src/kbmap.C (getsym + others): change to return unsigned int,
6125 returning a long can give problems on 64 bit systems. (I assume
6126 that int is 32bit on 64bit systems)
6128 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6130 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6131 LyXLookupString to be zero-terminated. Really fixes problems seen
6134 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6137 write a (char*)0 to the lyxerr stream.
6139 * src/lastfiles.C: move algorithm before the using statemets.
6141 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6144 complains otherwise).
6145 * src/table.C: ditto
6147 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6150 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6151 that I removed earlier... It is really needed.
6153 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6155 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6157 * INSTALL: update xforms home page URL.
6159 * lib/configure.m4: fix a bug with unreadable layout files.
6161 * src/table.C (calculate_width_of_column): add "using std::max"
6164 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6166 * several files: marked several lines with "DEL LINE", this is
6167 lines that can be deleted without changing anything.
6168 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6169 checks this anyway */
6172 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6174 * src/DepTable.C (update): add a "+" at the end when the checksum
6175 is different. (debugging string only)
6177 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6178 the next inset to not be displayed. This should also fix the list
6179 of labels in the "Insert Crossreference" dialog.
6181 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6184 when regex was not found.
6186 * src/support/lstrings.C (lowercase): use handcoded transform always.
6189 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6190 old_cursor.par->prev could be 0.
6192 * several files: changed post inc/dec to pre inc/dec
6194 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6195 write the lastfiles to file.
6197 * src/BufferView.C (buffer): only show TextCache info when debugging
6199 (resizeCurrentBuffer): ditto
6200 (workAreaExpose): ditto
6202 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6204 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6206 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6207 a bit better by removing the special case for \i and \j.
6209 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/lyx_main.C (easyParse): remove test for bad comand line
6212 options, since this broke all xforms-related parsing.
6214 * src/kbmap.C (getsym): set return type to unsigned long, as
6215 declared in header. On an alpha, long is _not_ the same as int.
6217 * src/support/LOstream.h: add a "using std::flush;"
6219 * src/insets/figinset.C: ditto.
6221 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * src/bufferlist.C (write): use blinding fast file copy instead of
6224 "a char at a time", now we are doing it the C++ way.
6226 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6227 std::list<int> instead.
6228 (addpidwait): reflect move to std::list<int>
6229 (sigchldchecker): ditto
6231 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6234 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6235 that obviously was wrong...
6237 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6238 c, this avoids warnings with purify and islower.
6240 * src/insets/figinset.C: rename struct queue to struct
6241 queue_element and rewrite to use a std::queue. gsqueue is now a
6242 std::queue<queue_element>
6243 (runqueue): reflect move to std::queue
6246 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6247 we would get "1" "0" instead of "true" "false. Also make the tostr
6250 2000-01-21 Juergen Vigna <jug@sad.it>
6252 * src/buffer.C (writeFileAscii): Disabled code for special groff
6253 handling of tabulars till I fix this in table.C
6255 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6257 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6259 * src/support/lyxlib.h: ditto.
6261 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6264 and 'j' look better. This might fix the "macron" bug that has been
6267 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6268 functions as one template function. Delete the old versions.
6270 * src/support/lyxsum.C: move using std::ifstream inside
6273 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6276 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6278 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6280 * src/insets/figinset.C (InitFigures): use new instead of malloc
6281 to allocate memory for figures and bitmaps.
6282 (DoneFigures): use delete[] instead of free to deallocate memory
6283 for figures and bitmaps.
6284 (runqueue): use new to allocate
6285 (getfigdata): use new/delete[] instead of malloc/free
6286 (RegisterFigure): ditto
6288 * some files: moved some declarations closer to first use, small
6289 whitespace changes use preincrement instead of postincrement where
6290 it does not make a difference.
6292 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6293 step on the way to use stl::containers for key maps.
6295 * src/bufferlist.h: add a typedef for const_iterator and const
6296 versions of begin and end.
6298 * src/bufferlist.[Ch]: change name of member variable _state to
6299 state_. (avoid reserved names)
6301 (getFileNames): returns the filenames of the buffers in a vector.
6303 * configure.in (ALL_LINGUAS): added ro
6305 * src/support/putenv.C: new file
6307 * src/support/mkdir.C: new file
6309 2000-01-20 Allan Rae <rae@lyx.org>
6311 * lib/layouts/IEEEtran.layout: Added several theorem environments
6313 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6314 couple of minor additions.
6316 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6317 (except for those in footnotes of course)
6319 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6321 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6323 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6324 std::sort and std::lower_bound instead of qsort and handwritten
6326 (struct compara): struct that holds the functors used by std::sort
6327 and std::lower_bound in MathedLookupBOP.
6329 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6331 * src/support/LAssert.h: do not do partial specialization. We do
6334 * src/support/lyxlib.h: note that lyx::getUserName() and
6335 lyx::date() are not in use right now. Should these be suppressed?
6337 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6338 (makeLinuxDocFile): do not put date and user name in linuxdoc
6341 * src/support/lyxlib.h (kill): change first argument to long int,
6342 since that's what solaris uses.
6344 * src/support/kill.C (kill): fix declaration to match prototype.
6346 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6347 actually check whether namespaces are supported. This is not what
6350 * src/support/lyxsum.C: add a using directive.
6352 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6354 * src/support/kill.C: if we have namespace support we don't have
6355 to include lyxlib.h.
6357 * src/support/lyxlib.h: use namespace lyx if supported.
6359 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6361 * src/support/date.C: new file
6363 * src/support/chdir.C: new file
6365 * src/support/getUserName.C: new file
6367 * src/support/getcwd.C: new file
6369 * src/support/abort.C: new file
6371 * src/support/kill.C: new file
6373 * src/support/lyxlib.h: moved all the functions in this file
6374 insede struct lyx. Added also kill and abort to this struct. This
6375 is a way to avoid the "kill is not defined in <csignal>", we make
6376 C++ wrappers for functions that are not ANSI C or ANSI C++.
6378 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6379 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6380 lyx it has been renamed to sum.
6382 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6384 * src/text.C: add using directives for std::min and std::max.
6386 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * src/texrow.C (getIdFromRow): actually return something useful in
6389 id and pos. Hopefully fixes the bug with positionning of errorbox
6392 * src/lyx_main.C (easyParse): output an error and exit if an
6393 incorrect command line option has been given.
6395 * src/spellchecker.C (ispell_check_word): document a memory leak.
6397 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6398 where a "struct utimbuf" is allocated with "new" and deleted with
6401 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6403 * src/text2.C (CutSelection): don't delete double spaces.
6404 (PasteSelection): ditto
6405 (CopySelection): ditto
6407 * src/text.C (Backspace): don't delete double spaces.
6409 * src/lyxlex.C (next): fix a bug that were only present with
6410 conformant std::istream::get to read comment lines, use
6411 std::istream::getline instead. This seems to fix the problem.
6413 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6415 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6416 allowed to insert space before space" editing problem. Please read
6417 commends at the beginning of the function. Comments about usage
6420 * src/text.C (InsertChar): fix for the "not allowed to insert
6421 space before space" editing problem.
6423 * src/text2.C (DeleteEmptyParagraphMechanism): when
6424 IsEmptyTableRow can only return false this last "else if" will
6425 always be a no-op. Commented out.
6427 * src/text.C (RedoParagraph): As far as I can understand tmp
6428 cursor is not really needed.
6430 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6431 present it could only return false anyway.
6432 (several functions): Did something not so smart...added a const
6433 specifier on a lot of methods.
6435 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6436 and add a tmp->text.resize. The LyXParagraph constructor does the
6438 (BreakParagraphConservative): ditto
6440 * src/support/path.h (Path): add a define so that the wrong usage
6441 "Path("/tmp") will be flagged as a compilation error:
6442 "`unnamed_Path' undeclared (first use this function)"
6444 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6446 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6447 which was bogus for several reasons.
6449 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6453 * autogen.sh: do not use "type -path" (what's that anyway?).
6455 * src/support/filetools.C (findtexfile): remove extraneous space
6456 which caused a kpsewhich warning (at least with kpathsea version
6459 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6463 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6465 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6467 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6469 * src/paragraph.C (BreakParagraph): do not reserve space on text
6470 if we don't need to (otherwise, if pos_end < pos, we end up
6471 reserving huge amounts of memory due to bad unsigned karma).
6472 (BreakParagraphConservative): ditto, although I have not seen
6473 evidence the bug can happen here.
6475 * src/lyxparagraph.h: add a using std::list.
6477 2000-01-11 Juergen Vigna <jug@sad.it>
6479 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6482 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6484 * src/vc-backend.C (doVCCommand): change to be static and take one
6485 more parameter: the path to chdir too be fore executing the command.
6486 (retrive): new function equiv to "co -r"
6488 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6489 file_not_found_hook is true.
6491 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6493 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6494 if a file is readwrite,readonly...anything else.
6496 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6498 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6499 (CreatePostscript): name change from MenuRunDVIPS (or something)
6500 (PreviewPostscript): name change from MenuPreviewPS
6501 (PreviewDVI): name change from MenuPreviewDVI
6503 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6504 \view_pdf_command., \pdf_to_ps_command
6506 * lib/configure.m4: added search for PDF viewer, and search for
6507 PDF to PS converter.
6508 (lyxrc.defaults output): add \pdflatex_command,
6509 \view_pdf_command and \pdf_to_ps_command.
6511 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6513 * src/bufferlist.C (write): we don't use blocksize for anything so
6516 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6518 * src/support/block.h: disable operator T* (), since it causes
6519 problems with both compilers I tried. See comments in the file.
6521 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6524 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6525 variable LYX_DIR_10x to LYX_DIR_11x.
6527 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6529 * INSTALL: document --with-lyxname.
6532 * configure.in: new configure flag --with-lyxname which allows to
6533 choose the name under which lyx is installed. Default is "lyx", of
6534 course. It used to be possible to do this with --program-suffix,
6535 but the later has in fact a different meaning for autoconf.
6537 * src/support/lstrings.h (lstrchr): reformat a bit.
6539 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6540 * src/mathed/math_defs.h: ditto.
6542 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6545 true, decides if we create a backup file or not when saving. New
6546 tag and variable \pdf_mode, defaults to false. New tag and
6547 variable \pdflatex_command, defaults to pdflatex. New tag and
6548 variable \view_pdf_command, defaults to xpdf. New tag and variable
6549 \pdf_to_ps_command, defaults to pdf2ps.
6551 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6553 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6554 does not have a BufferView.
6555 (unlockInset): ditto + don't access the_locking_inset if the
6556 buffer does not have a BufferView.
6558 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6559 certain circumstances so that we don't continue a keyboard
6560 operation long after the key was released. Try f.ex. to load a
6561 large document, press PageDown for some seconds and then release
6562 it. Before this change the document would contine to scroll for
6563 some time, with this change it stops imidiatly.
6565 * src/support/block.h: don't allocate more space than needed. As
6566 long as we don't try to write to the arr[x] in a array_type arr[x]
6567 it is perfectly ok. (if you write to it you might segfault).
6568 added operator value_type*() so that is possible to pass the array
6569 to functions expecting a C-pointer.
6571 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6574 * intl/*: updated to gettext 0.10.35, tried to add our own
6575 required modifications. Please verify.
6577 * po/*: updated to gettext 0.10.35, tried to add our own required
6578 modifications. Please verify.
6580 * src/support/lstrings.C (tostr): go at fixing the problem with
6581 cxx and stringstream. When stringstream is used return
6582 oss.str().c_str() so that problems with lyxstring and basic_string
6583 are avoided. Note that the best solution would be for cxx to use
6584 basic_string all the way, but it is not conformant yet. (it seems)
6586 * src/lyx_cb.C + other files: moved several global functions to
6587 class BufferView, some have been moved to BufferView.[Ch] others
6588 are still located in lyx_cb.C. Code changes because of this. (part
6589 of "get rid of current_view project".)
6591 * src/buffer.C + other files: moved several Buffer functions to
6592 class BufferView, the functions are still present in buffer.C.
6593 Code changes because of this.
6595 * config/lcmessage.m4: updated to most recent. used when creating
6598 * config/progtest.m4: updated to most recent. used when creating
6601 * config/gettext.m4: updated to most recent. applied patch for
6604 * config/gettext.m4.patch: new file that shows what changes we
6605 have done to the local copy of gettext.m4.
6607 * config/libtool.m4: new file, used in creation of acinclude.m4
6609 * config/lyxinclude.m4: new file, this is the lyx created m4
6610 macros, used in making acinclude.m4.
6612 * autogen.sh: GNU m4 discovered as a separate task not as part of
6613 the lib/configure creation.
6614 Generate acinlucde from files in config. Actually cat
6615 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6616 easier to upgrade .m4 files that really are external.
6618 * src/Spacing.h: moved using std::istringstream to right after
6619 <sstream>. This should fix the problem seen with some compilers.
6621 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6623 * src/lyx_cb.C: began some work to remove the dependency a lot of
6624 functions have on BufferView::text, even if not really needed.
6625 (GetCurrentTextClass): removed this func, it only hid the
6628 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6629 forgot this in last commit.
6631 * src/Bullet.C (bulletEntry): use static char const *[] for the
6632 tables, becuase of this the return arg had to change to string.
6634 (~Bullet): removed unneeded destructor
6636 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6637 (insetSleep): moved from Buffer
6638 (insetWakeup): moved from Buffer
6639 (insetUnlock): moved from Buffer
6641 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6642 from Buffer to BufferView.
6644 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6646 * config/ltmain.sh: updated to version 1.3.4 of libtool
6648 * config/ltconfig: updated to version 1.3.4 of libtool
6650 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6653 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6654 Did I get that right?
6656 * src/lyxlex.h: add a "using" directive or two.
6657 * src/Spacing.h: ditto.
6658 * src/insets/figinset.C: ditto.
6659 * src/support/filetools.C: ditto.
6660 * src/support/lstrings.C: ditto.
6661 * src/BufferView.C: ditto.
6662 * src/bufferlist.C: ditto.
6663 * src/lyx_cb.C: ditto.
6664 * src/lyxlex.C: ditto.
6666 * NEWS: add some changes for 1.1.4.
6668 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6670 * src/BufferView.C: first go at a TextCache to speed up switching
6673 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6675 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6676 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6677 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6678 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6681 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6682 members of the struct are correctly initialized to 0 (detected by
6684 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6685 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6687 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6688 pidwait, since it was allocated with "new". This was potentially
6689 very bad. Thanks to Michael Schmitt for running purify for us.
6692 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6694 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6696 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6698 1999-12-30 Allan Rae <rae@lyx.org>
6700 * lib/templates/IEEEtran.lyx: minor change
6702 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6703 src/mathed/formula.C (LocalDispatch): askForText changes
6705 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6706 know when a user has cancelled input. Fixes annoying problems with
6707 inserting labels and version control.
6709 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6711 * src/support/lstrings.C (tostr): rewritten to use strstream and
6714 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6716 * src/support/filetools.C (IsFileWriteable): use fstream to check
6717 (IsDirWriteable): use fileinfo to check
6719 * src/support/filetools.h (FilePtr): whole class deleted
6721 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6723 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6725 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6727 * src/bufferlist.C (write): use ifstream and ofstream instead of
6730 * src/Spacing.h: use istrstream instead of sscanf
6732 * src/mathed/math_defs.h: change first arg to istream from FILE*
6734 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6736 * src/mathed/math_parser.C: have yyis to be an istream
6737 (LexGetArg): use istream (yyis)
6739 (mathed_parse): ditto
6740 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6742 * src/mathed/formula.C (Read): rewritten to use istream
6744 * src/mathed/formulamacro.C (Read): rewritten to use istream
6746 * src/lyxlex.h (~LyXLex): deleted desturctor
6747 (getStream): new function, returns an istream
6748 (getFile): deleted funtion
6749 (IsOK): return is.good();
6751 * src/lyxlex.C (LyXLex): delete file and owns_file
6752 (setFile): open an filebuf and assign that to a istream instead of
6754 (setStream): new function, takes an istream as arg.
6755 (setFile): deleted function
6756 (EatLine): rewritten us use istream instead of FILE*
6760 * src/table.C (LyXTable): use istream instead of FILE*
6761 (Read): rewritten to take an istream instead of FILE*
6763 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6765 * src/buffer.C (Dispatch): remove an extraneous break statement.
6767 * src/support/filetools.C (QuoteName): change to do simple
6768 'quoting'. More work is necessary. Also changed to do nothing
6769 under emx (needs fix too).
6770 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6772 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6773 config.h.in to the AC_DEFINE_UNQUOTED() call.
6774 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6775 needs char * as argument (because Solaris 7 declares it like
6778 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6779 remove definition of BZERO.
6781 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6783 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6784 defined, "lyxregex.h" if not.
6786 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6788 (REGEX): new variable that is set to regex.c lyxregex.h when
6789 AM_CONDITIONAL USE_REGEX is set.
6790 (libsupport_la_SOURCES): add $(REGEX)
6792 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6795 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6798 * configure.in: add call to LYX_REGEX
6800 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6801 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6803 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6805 * lib/bind/fi_menus.bind: new file, from
6806 pauli.virtanen@saunalahti.fi.
6808 * src/buffer.C (getBibkeyList): pass the parameter delim to
6809 InsetInclude::getKeys and InsetBibtex::getKeys.
6811 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6812 is passed to Buffer::getBibkeyList
6814 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6815 instead of the hardcoded comma.
6817 * src/insets/insetbib.C (getKeys): make sure that there are not
6818 leading blanks in bibtex keys. Normal latex does not care, but
6819 harvard.sty seems to dislike blanks at the beginning of citation
6820 keys. In particular, the retturn value of the function is
6822 * INSTALL: make it clear that libstdc++ is needed and that gcc
6823 2.7.x probably does not work.
6825 * src/support/filetools.C (findtexfile): make debug message go to
6827 * src/insets/insetbib.C (getKeys): ditto
6829 * src/debug.C (showTags): make sure that the output is correctly
6832 * configure.in: add a comment for TWO_COLOR_ICON define.
6834 * acconfig.h: remove all the entries that already defined in
6835 configure.in or acinclude.m4.
6837 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6838 to avoid user name, date and copyright.
6840 1999-12-21 Juergen Vigna <jug@sad.it>
6842 * src/table.C (Read): Now read bogus row format informations
6843 if the format is < 5 so that afterwards the table can
6844 be read by lyx but without any format-info. Fixed the
6845 crash we experienced when not doing this.
6847 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6849 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6850 (RedoDrawingOfParagraph): ditto
6851 (RedoParagraphs): ditto
6852 (RemoveTableRow): ditto
6854 * src/text.C (Fill): rename arg paperwidth -> paper_width
6856 * src/buffer.C (insertLyXFile): rename var filename -> fname
6857 (writeFile): rename arg filename -> fname
6858 (writeFileAscii): ditto
6859 (makeLaTeXFile): ditto
6860 (makeLinuxDocFile): ditto
6861 (makeDocBookFile): ditto
6863 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6866 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6868 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6871 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6872 compiled by a C compiler not C++.
6874 * src/layout.h (LyXTextClass): added typedef for const_iterator
6875 (LyXTextClassList): added typedef for const_iterator + member
6876 functions begin and end.
6878 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6879 iterators to fill the choice_class.
6880 (updateLayoutChoice): rewritten to use iterators to fill the
6881 layoutlist in the toolbar.
6883 * src/BufferView.h (BufferView::work_area_width): removed unused
6886 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6888 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6889 (sgmlCloseTag): ditto
6891 * src/support/lstrings.h: return type of countChar changed to
6894 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6895 what version of this func to use. Also made to return unsigned int.
6897 * configure.in: call LYX_STD_COUNT
6899 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6900 conforming std::count.
6902 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6904 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6905 and a subscript would give bad display (patch from Dekel Tsur
6906 <dekel@math.tau.ac.il>).
6908 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6910 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6913 * src/chset.h: add a few 'using' directives
6915 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6916 triggered when no buffer is active
6918 * src/layout.C: removed `break' after `return' in switch(), since
6921 * src/lyx_main.C (init): make sure LyX can be ran in place even
6922 when libtool has done its magic with shared libraries. Fix the
6923 test for the case when the system directory has not been found.
6925 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6926 name for the latex file.
6927 (MenuMakeHTML): ditto
6929 * src/buffer.h: add an optional boolean argument, which is passed
6932 1999-12-20 Allan Rae <rae@lyx.org>
6934 * lib/templates/IEEEtran.lyx: small correction and update.
6936 * configure.in: Attempted to use LYX_PATH_HEADER
6938 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6940 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6941 input from JMarc. Now use preprocessor to find the header.
6942 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6943 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6944 LYX_STL_STRING_FWD. See comments in file.
6946 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6948 * The global MiniBuffer * minibuffer variable is dead.
6950 * The global FD_form_main * fd_form_main variable is dead.
6952 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6954 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6956 * src/table.h: add the LOstream.h header
6957 * src/debug.h: ditto
6959 * src/LyXAction.h: change the explaination of the ReadOnly
6960 attribute: is indicates that the function _can_ be used.
6962 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6965 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6967 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6973 * src/paragraph.C (GetWord): assert on pos>=0
6976 * src/support/lyxstring.C: condition the use of an invariant on
6978 * src/support/lyxstring.h: ditto
6980 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6981 Use LAssert.h instead of plain assert().
6983 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6985 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6986 * src/support/filetools.C: ditto
6988 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6991 * INSTALL: document the new configure flags
6993 * configure.in: suppress --with-debug; add --enable-assertions
6995 * acinclude.m4: various changes in alignment of help strings.
6997 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6999 * src/kbmap.C: commented out the use of the hash map in kb_map,
7000 beginning of movement to a stl::container.
7002 * several files: removed code that was not in effect when
7003 MOVE_TEXT was defined.
7005 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7006 for escaping should not be used. We can discuss if the string
7007 should be enclosed in f.ex. [] instead of "".
7009 * src/trans_mgr.C (insert): use the new returned value from
7010 encodeString to get deadkeys and keymaps done correctly.
7012 * src/chset.C (encodeString): changed to return a pair, to tell
7013 what to use if we know the string.
7015 * src/lyxscreen.h (fillArc): new function.
7017 * src/FontInfo.C (resize): rewritten to use more std::string like
7018 structore, especially string::replace.
7020 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7023 * configure.in (chmod +x some scripts): remove config/gcc-hack
7025 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7027 * src/buffer.C (writeFile): change once again the top comment in a
7028 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7029 instead of an hardcoded version number.
7030 (makeDocBookFile): ditto
7032 * src/version.h: add new define LYX_DOCVERSION
7034 * po/de.po: update from Pit Sütterlin
7035 * lib/bind/de_menus.bind: ditto.
7037 * src/lyxfunc.C (Dispatch): call MenuExport()
7038 * src/buffer.C (Dispatch): ditto
7040 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7041 LyXFunc::Dispatch().
7042 (MenuExport): new function, moved from
7043 LyXFunc::Dispatch().
7045 * src/trans_mgr.C (insert): small cleanup
7046 * src/chset.C (loadFile): ditto
7048 * lib/kbd/iso8859-1.cdef: add missing backslashes
7050 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7052 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7053 help with placing the manually drawn accents better.
7055 (Draw): x2 and hg changed to float to minimize rounding errors and
7056 help place the accents better.
7058 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7059 unsigned short to char is just wrong...cast the char to unsigned
7060 char instead so that the two values can compare sanely. This
7061 should also make the display of insetlatexaccents better and
7062 perhaps also some other insets.
7064 (lbearing): new function
7067 1999-12-15 Allan Rae <rae@lyx.org>
7069 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7070 header that provides a wrapper around the very annoying SGI STL header
7073 * src/support/lyxstring.C, src/LString.h:
7074 removed old SGI-STL-compatability attempts.
7076 * configure.in: Use LYX_STL_STRING_FWD.
7078 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7079 stl_string_fwd.h is around and try to determine it's location.
7080 Major improvement over previous SGI STL 3.2 compatability.
7081 Three small problems remain with this function due to my zero
7082 knowledge of autoconf. JMarc and lgb see the comments in the code.
7084 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7086 * src/broken_const.h, config/hack-gcc, config/README: removed
7088 * configure.in: remove --with-gcc-hack option; do not call
7091 * INSTALL: remove documentation of --with-broken-const and
7094 * acconfig.h: remove all trace of BROKEN_CONST define
7096 * src/buffer.C (makeDocBookFile): update version number in output
7098 (SimpleDocBookOnePar): fix an assert when trying to a character
7099 access beyond string length
7102 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7104 * po/de.po: fix the Export menu
7106 * lyx.man: update the description of -dbg
7108 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7109 (commandLineHelp): updated
7110 (easyParse): show list of available debug levels if -dbg is passed
7113 * src/Makefile.am: add debug.C
7115 * src/debug.h: moved some code to debug.C
7117 * src/debug.C: new file. Contains code to set and show debug
7120 * src/layout.C: remove 'break' after 'continue' in switch
7121 statements, since these cannot be reached.
7123 1999-12-13 Allan Rae <rae@lyx.org>
7125 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7126 (in_word_set): hash() -> math_hash()
7128 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7130 * acconfig.h: Added a test for whether we are using exceptions in the
7131 current compilation run. If so USING_EXCEPTIONS is defined.
7133 * config.in: Check for existance of stl_string_fwd.h
7134 * src/LString.h: If compiling --with-included-string and SGI's
7135 STL version 3.2 is present (see above test) we need to block their
7136 forward declaration of string and supply a __get_c_string().
7137 However, it turns out this is only necessary if compiling with
7138 exceptions enabled so I've a bit more to add yet.
7140 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7141 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7142 src/support/LRegex.h, src/undo.h:
7143 Shuffle the order of the included files a little to ensure that
7144 LString.h gets included before anything that includes stl_string_fwd.h
7146 * src/support/lyxstring.C: We need to #include LString.h instead of
7147 lyxstring.h to get the necessary definition of __get_c_string.
7148 (__get_c_string): New function. This is defined static just like SGI's
7149 although why they need to do this I'm not sure. Perhaps it should be
7150 in lstrings.C instead.
7152 * lib/templates/IEEEtran.lyx: New template file.
7154 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7156 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7157 * intl/Makefile.in (MKINSTALLDIRS): ditto
7159 * src/LyXAction.C (init): changed to hold the LFUN data in a
7160 automatic array in stead of in callso to newFunc, this speeds up
7161 compilation a lot. Also all the memory used by the array is
7162 returned when the init is completed.
7164 * a lot of files: compiled with -Wold-style-cast, changed most of
7165 the reported offenders to C++ style casts. Did not change the
7166 offenders in C files.
7168 * src/trans.h (Match): change argument type to unsigned int.
7170 * src/support/DebugStream.C: fix some types on the streambufs so
7171 that it works on a conforming implementation.
7173 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7175 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7177 * src/support/lyxstring.C: remove the inline added earlier since
7178 they cause a bunch of unsatisfied symbols when linking with dec
7179 cxx. Cxx likes to have the body of inlines at the place where they
7182 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7183 accessing negative bounds in array. This fixes the crash when
7184 inserting accented characters.
7185 * src/trans.h (Match): ditto
7187 * src/buffer.C (Dispatch): since this is a void, it should not try
7188 to return anything...
7190 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7192 * src/buffer.h: removed the two friends from Buffer. Some changes
7193 because of this. Buffer::getFileName and Buffer::setFileName
7194 renamed to Buffer::fileName() and Buffer::fileName(...).
7196 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7198 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7199 and Buffer::update(short) to BufferView. This move is currently
7200 controlled by a define MOVE_TEXT, this will be removed when all
7201 shows to be ok. This move paves the way for better separation
7202 between buffer contents and buffer view. One side effect is that
7203 the BufferView needs a rebreak when swiching buffers, if we want
7204 to avoid this we can add a cache that holds pointers to LyXText's
7205 that is not currently in use.
7207 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7210 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7212 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7214 * lyx_main.C: new command line option -x (or --execute) and
7215 -e (or --export). Now direct conversion from .lyx to .tex
7216 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7217 Unfortunately, X is still needed and the GUI pops up during the
7220 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7222 * src/Spacing.C: add a using directive to bring stream stuff into
7224 * src/paragraph.C: ditto
7225 * src/buffer.C: ditto
7227 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7228 from Lars' announcement).
7230 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7231 example files from Tino Meinen.
7233 1999-12-06 Allan Rae <rae@lyx.org>
7235 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7237 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7239 * src/support/lyxstring.C: added a lot of inline for no good
7242 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7243 latexWriteEndChanges, they were not used.
7245 * src/layout.h (operator<<): output operator for PageSides
7247 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7249 * some example files: loaded in LyX 1.0.4 and saved again to update
7250 certain constructs (table format)
7252 * a lot of files: did the change to use fstream/iostream for all
7253 writing of files. Done with a close look at Andre Poenitz's patch.
7255 * some files: whitespace changes.
7257 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7259 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7260 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7261 architecture, we provide our own. It is used unconditionnally, but
7262 I do not think this is a performance problem. Thanks to Angus
7263 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7264 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7266 (GetInset): use my_memcpy.
7270 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7271 it is easier to understand, but it uses less TeX-only constructs now.
7273 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7274 elements contain spaces
7276 * lib/configure: regenerated
7278 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7279 elements contain spaces; display the list of programs that are
7282 * autogen.sh: make sure lib/configure is executable
7284 * lib/examples/*: rename the tutorial examples to begin with the
7285 two-letters language code.
7287 * src/lyxfunc.C (getStatus): do not query current font if no
7290 * src/lyx_cb.C (RunScript): use QuoteName
7291 (MenuRunDvips): ditto
7292 (PrintApplyCB): ditto
7294 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7295 around argument, so that it works well with the current shell.
7296 Does not work properly with OS/2 shells currently.
7298 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7299 * src/LyXSendto.C (SendtoApplyCB): ditto
7300 * src/lyxfunc.C (Dispatch): ditto
7301 * src/buffer.C (runLaTeX): ditto
7302 (runLiterate): ditto
7303 (buildProgram): ditto
7305 * src/lyx_cb.C (RunScript): ditto
7306 (MenuMakeLaTeX): ditto
7308 * src/buffer.h (getLatexName): new method
7310 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7312 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7314 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7315 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7316 (create_math_panel): ditto
7318 * src/lyxfunc.C (getStatus): re-activate the code which gets
7319 current font and cursor; add test for export to html.
7321 * src/lyxrc.C (read): remove unreachable break statements; add a
7324 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7326 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7328 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7329 introduced by faulty regex.
7330 * src/buffer.C: ditto
7331 * src/lastfiles.C: ditto
7332 * src/paragraph.C: ditto
7333 * src/table.C: ditto
7334 * src/vspace.C: ditto
7335 * src/insets/figinset.C: ditto
7336 Note: most of these is absolutely harmless, except the one in
7337 src/mathed formula.C.
7339 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7341 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7342 operation, yielding correct results for the reLyX command.
7344 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7346 * src/support/filetools.C (ExpandPath): removed an over eager
7348 (ReplaceEnvironmentPath): ditto
7350 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7351 shows that we are doing something fishy in our code...
7355 * src/lyxrc.C (read): use a double switch trick to get more help
7356 from the compiler. (the same trick is used in layout.C)
7357 (write): new function. opens a ofstream and pass that to output
7358 (output): new function, takes a ostream and writes the lyxrc
7359 elemts to it. uses a dummy switch to make sure no elements are
7362 * src/lyxlex.h: added a struct pushpophelper for use in functions
7363 with more than one exit point.
7365 * src/lyxlex.[Ch] (GetInteger): made it const
7369 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7371 * src/layout.[hC] : LayoutTags splitted into several enums, new
7372 methods created, better error handling cleaner use of lyxlex. Read
7375 * src/bmtable.[Ch]: change some member prototypes because of the
7376 image const changes.
7378 * commandtags.h, src/LyXAction.C (init): new function:
7379 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7380 This file is not read automatically but you can add \input
7381 preferences to your lyxrc if you want to. We need to discuss how
7384 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7385 in .aux, also remove .bib and .bst files from dependencies when
7388 * src/BufferView.C, src/LyXView.C: add const_cast several places
7389 because of changes to images.
7391 * lib/images/*: same change as for images/*
7393 * lib/lyxrc.example: Default for accept_compound is false not no.
7395 * images/*: changed to be const, however I have som misgivings
7396 about this change so it might be changed back.
7398 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7400 * lib/configure, po/POTFILES.in: regenerated
7402 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7404 * config/lib_configure.m4: removed
7406 * lib/configure.m4: new file (was config/lib_configure.m4)
7408 * configure.in: do not test for rtti, since we do not use it.
7410 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7412 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7413 doubling of allocated space scheme. This makes it faster for large
7414 strings end to use less memory for small strings. xtra rememoved.
7416 * src/insets/figinset.C (waitalarm): commented out.
7417 (GhostscriptMsg): use static_cast
7418 (GhostscriptMsg): use new instead of malloc to allocate memory for
7419 cmap. also delete the memory after use.
7421 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7423 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7424 for changes in bibtex database or style.
7425 (runBibTeX): remove all .bib and .bst files from dep before we
7427 (run): use scanAuc in when dep file already exist.
7429 * src/DepTable.C (remove_files_with_extension): new method
7432 * src/DepTable.[Ch]: made many of the methods const.
7434 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7436 * src/bufferparams.C: make sure that the default textclass is
7437 "article". It used to be the first one by description order, but
7438 now the first one is "docbook".
7440 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7441 string; call Debug::value.
7442 (easyParse): pass complete argument to setDebuggingLevel().
7444 * src/debug.h (value): fix the code that parses debug levels.
7446 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7449 * src/LyXAction.C: use Debug::ACTION as debug channel.
7451 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7453 * NEWS: updated for the future 1.1.3 release.
7455 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7456 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7457 it should. This is of course a controversial change (since many
7458 people will find that their lyx workscreen is suddenly full of
7459 red), but done for the sake of correctness.
7461 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7462 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7464 * src/insets/inseterror.h, src/insets/inseturl.h,
7465 src/insets/insetinfo.h, src/insets/figinset.h,
7466 src/mathed/formulamacro.h, src/mathed/math_macro.h
7467 (EditMessage): add a missing const and add _() to make sure that
7470 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7471 src/insets/insetbib.C, src/support/filetools.C: add `using'
7474 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7475 doing 'Insert index of last word' at the beginning of a paragraph.
7477 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7479 * several files: white-space changes.
7481 * src/mathed/formula.C: removed IsAlpha and IsDigit
7483 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7484 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7487 * src/insets/figinset.C (GetPSSizes): don't break when
7488 "EndComments" is seen. But break when a boundingbox is read.
7490 * all classes inherited from Inset: return value of Clone
7491 changed back to Inset *.
7493 * all classes inherited form MathInset: return value of Clone
7494 changed back to MathedInset *.
7496 * src/insets/figinset.C (runqueue): use a ofstream to output the
7497 gs/ps file. Might need some setpresicion or setw. However I can
7498 see no problem with the current code.
7499 (runqueue): use sleep instead of the alarm/signal code. I just
7500 can't see the difference.
7502 * src/paragraph.C (LyXParagraph): reserve space in the new
7503 paragraph and resize the inserted paragraph to just fit.
7505 * src/lyxfunc.h (operator|=): added operator for func_status.
7507 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7508 check for readable file.
7510 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7511 check for readable file.
7512 (MenuMakeLinuxDoc): ditto
7513 (MenuMakeDocBook): ditto
7514 (MenuMakeAscii): ditto
7515 (InsertAsciiFile): split the test for openable and readable
7517 * src/bmtable.C (draw_bitmaptable): use
7518 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7520 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7521 findtexfile from LaTeX to filetools.
7523 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7524 instead of FilePtr. Needs to be verified by a literate user.
7526 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7528 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7529 (EditMessage): likewise.
7531 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7532 respectively as \textasciitilde and \textasciicircum.
7534 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7536 * src/support/lyxstring.h: made the methods that take iterators
7539 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7540 (regexMatch): made is use the real regex class.
7542 * src/support/Makefile.am: changed to use libtool
7544 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7546 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7548 (MathIsInset ++): changed several macros to be inline functions
7551 * src/mathed/Makefile.am: changed to use libtool
7553 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7555 * src/insets/inset* : Clone changed to const and return type is
7556 the true insettype not just Inset*.
7558 * src/insets/Makefile.am: changed to use libtool
7560 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7562 * src/undo.[Ch] : added empty() and changed some of the method
7565 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7567 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7568 setID use block<> for the bullets array, added const several places.
7570 * src/lyxfunc.C (getStatus): new function
7572 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7573 LyXAction, added const to several funtions.
7575 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7576 a std::map, and to store the dir items in a vector.
7578 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7581 * src/LyXView.[Ch] + other files : changed currentView to view.
7583 * src/LyXAction.[Ch] : ported from the old devel branch.
7585 * src/.cvsignore: added .libs and a.out
7587 * configure.in : changes to use libtool.
7589 * acinclude.m4 : inserted libtool.m4
7591 * .cvsignore: added libtool
7593 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7595 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7596 file name in insets and mathed directories (otherwise the
7597 dependency is not taken in account under cygwin).
7599 * src/text2.C (InsertString[AB]): make sure that we do not try to
7600 read characters past the string length.
7602 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7604 * lib/doc/LaTeXConfig.lyx.in,
7605 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7607 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7608 file saying who created them and when this heppened; this is
7609 useless and annoys tools like cvs.
7611 * lib/layouts/g-brief-{en,de}.layout,
7612 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7613 from Thomas Hartkens <thomas@hartkens.de>.
7615 * src/{insets,mathed}/Makefile.am: do not declare an empty
7616 LDFLAGS, so that it can be set at configure time (useful on Irix
7619 * lib/reLyX/configure.in: make sure that the prefix is set
7620 correctly in LYX_DIR.
7622 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7624 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7625 be used by 'command-sequence' this allows to bind a key to a
7626 sequence of LyX-commands
7627 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7629 * src/LyXAction.C: add "command-sequence"
7631 * src/LyXFunction.C: handling of "command-sequence"
7633 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7634 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7636 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7638 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7640 * src/buffer.C (writeFile): Do not output a comment giving user
7641 and date at the beginning of a .lyx file. This is useless and
7642 annoys cvs anyway; update version number to 1.1.
7644 * src/Makefile.am (LYX_DIR): add this definition, so that a
7645 default path is hardcoded in LyX.
7647 * configure.in: Use LYX_GNU_GETTEXT.
7649 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7650 AM_GNU_GETTEXT with a bug fixed.
7652 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7654 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7656 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7657 which is used to point to LyX data is now LYX_DIR_11x.
7659 * lyx.man: convert to a unix text file; small updates.
7661 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7663 * src/support/LSubstring.[Ch]: made the second arg of most of the
7664 constructors be a const reference.
7666 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7669 * src/support/lyxstring.[Ch] (swap): added missing member function
7670 and specialization of swap(str, str);
7672 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7674 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7675 trace of the old one.
7677 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7678 put the member definitions in undo.C.
7680 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7681 NEW_TEXT and have now only code that was included when this was
7684 * src/intl.C (LCombo): use static_cast
7686 (DispatchCallback): ditto
7688 * src/definitions.h: removed whole file
7690 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7692 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7693 parsing and stores in a std:map. a regex defines the file format.
7694 removed unneeded members.
7696 * src/bufferparams.h: added several enums from definitions.h here.
7697 Removed unsused destructor. Changed some types to use proper enum
7698 types. use block to have the temp_bullets and user_defined_bullets
7699 and to make the whole class assignable.
7701 * src/bufferparams.C (Copy): removed this functions, use a default
7704 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7707 * src/buffer.C (readLyXformat2): commend out all that have with
7708 oldpapersize to do. also comment out all that hve to do with
7709 insetlatex and insetlatexdel.
7710 (setOldPaperStuff): commented out
7712 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7714 * src/LyXAction.C: remove use of inset-latex-insert
7716 * src/mathed/math_panel.C (button_cb): use static_cast
7718 * src/insets/Makefile.am (insets_o_SOURCES): removed
7721 * src/support/lyxstring.C (helper): use the unsigned long
7722 specifier, UL, instead of a static_cast.
7724 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7726 * src/support/block.h: new file. to be used as a c-style array in
7727 classes, so that the class can be assignable.
7729 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7731 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7732 NULL, make sure to return an empty string (it is not possible to
7733 set a string to NULL).
7735 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7737 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7739 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7741 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7742 link line, so that Irix users (for example) can set it explicitely to
7745 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7746 it can be overidden at make time (static or dynamic link, for
7749 * src/vc-backend.C, src/LaTeXFeatures.h,
7750 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7751 statements to bring templates to global namespace.
7753 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7755 * src/support/lyxstring.C (operator[] const): make it standard
7758 * src/minibuffer.C (Init): changed to reflect that more
7759 information is given from the lyxvc and need not be provided here.
7761 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7763 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7765 * src/LyXView.C (UpdateTimerCB): use static_cast
7766 (KeyPressMask_raw_callback): ditto
7768 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7769 buffer_, a lot of changes because of this. currentBuffer() ->
7770 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7771 also changes to other files because of this.
7773 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7775 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7776 have no support for RCS and partial support for CVS, will be
7779 * src/insets/ several files: changes because of function name
7780 changes in Bufferview and LyXView.
7782 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7784 * src/support/LSubstring.[Ch]: new files. These implement a
7785 Substring that can be very convenient to use. i.e. is this
7787 string a = "Mary had a little sheep";
7788 Substring(a, "sheep") = "lamb";
7789 a is now "Mary has a little lamb".
7791 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7792 out patterns and subpatterns of strings. It is used by LSubstring
7793 and also by vc-backend.C
7795 * src/support/lyxstring.C: went over all the assertions used and
7796 tried to correct the wrong ones and flag which of them is required
7797 by the standard. some bugs found because of this. Also removed a
7798 couple of assertions.
7800 * src/support/Makefile.am (libsupport_a_SOURCES): added
7801 LSubstring.[Ch] and LRegex.[Ch]
7803 * src/support/FileInfo.h: have struct stat buf as an object and
7804 not a pointer to one, some changes because of this.
7806 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7807 information in layout when adding the layouts preamble to the
7810 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7813 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7814 because of bug in OS/2.
7816 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7818 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7819 \verbatim@font instead of \ttfamily, so that it can be redefined.
7821 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7822 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7823 src/layout.h, src/text2.C: add 'using' directive to bring the
7824 STL templates we need from the std:: namespace to the global one.
7825 Needed by DEC cxx in strict ansi mode.
7827 * src/support/LIstream.h,src/support/LOstream.h,
7828 src/support/lyxstring.h,src/table.h,
7829 src/lyxlookup.h: do not include <config.h> in header
7830 files. This should be done in the .C files only.
7832 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7836 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7838 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7839 from Kayvan to fix the tth invokation.
7841 * development/lyx.spec.in: updates from Kayvan to reflect the
7842 changes of file names.
7844 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7846 * src/text2.C (InsertStringB): use std::copy
7847 (InsertStringA): use std::copy
7849 * src/bufferlist.C: use a vector to store the buffers in. This is
7850 an internal change and should not affect any other thing.
7852 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7855 * src/text.C (Fill): fix potential bug, one off bug.
7857 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7859 * src/Makefile.am (lyx_main.o): add more files it depends on.
7861 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7863 * src/support/lyxstring.C: use size_t for the reference count,
7864 size, reserved memory and xtra.
7865 (internal_compare): new private member function. Now the compare
7866 functions should work for std::strings that have embedded '\0'
7868 (compare): all compare functions rewritten to use
7871 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7873 * src/support/lyxstring.C (compare): pass c_str()
7874 (compare): pass c_str
7875 (compare): pass c_str
7877 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7879 * src/support/DebugStream.C: <config.h> was not included correctly.
7881 * lib/configure: forgot to re-generate it :( I'll make this file
7882 auto generated soon.
7884 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7886 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7889 * src/support/lyxstring.C: some changes from length() to rep->sz.
7890 avoids a function call.
7892 * src/support/filetools.C (SpaceLess): yet another version of the
7893 algorithm...now per Jean-Marc's suggestions.
7895 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7897 * src/layout.C (less_textclass_desc): functor for use in sorting
7899 (LyXTextClass::Read): sort the textclasses after reading.
7901 * src/support/filetools.C (SpaceLess): new version of the
7902 SpaceLess functions. What problems does this one give? Please
7905 * images/banner_bw.xbm: made the arrays unsigned char *
7907 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7909 * src/support/lyxstring.C (find): remove bogus assertion in the
7910 two versions of find where this has not been done yet.
7912 * src/support/lyxlib.h: add missing int return type to
7915 * src/menus.C (ShowFileMenu): disable exporting to html if no
7916 html export command is present.
7918 * config/lib_configure.m4: add a test for an HTML converter. The
7919 programs checked for are, in this order: tth, latex2html and
7922 * lib/configure: generated from config/lib_configure.m4.
7924 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7925 html converter. The parameters are now passed through $$FName and
7926 $$OutName, instead of standard input/output.
7928 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7930 * lib/lyxrc.example: update description of \html_command.
7931 add "quotes" around \screen_font_xxx font setting examples to help
7932 people who use fonts with spaces in their names.
7934 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7936 * Distribution files: updates for v1.1.2
7938 * src/support/lyxstring.C (find): remove bogus assert and return
7939 npos for the same condition.
7941 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7943 * added patch for OS/2 from SMiyata.
7945 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7947 * src/text2.C (CutSelection): make space_wrapped a bool
7948 (CutSelection): dont declare int i until we have to.
7949 (alphaCounter): return a char const *.
7951 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7953 * src/support/syscall.C (Systemcalls::kill):
7954 src/support/filetools.C (PutEnv, PutEnvPath):
7955 src/lyx_cb.C (addNewlineAndDepth):
7956 src/FontInfo.C (FontInfo::resize): condition some #warning
7957 directives with WITH_WARNINGS.
7960 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/layout.[Ch] + several files: access to class variables
7963 limited and made accessor functions instead a lot of code changed
7964 becuase of this. Also instead of returning pointers often a const
7965 reference is returned instead.
7967 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7969 * src/Makefile.am (dist-hook): added used to remove the CVS from
7970 cheaders upon creating a dist
7971 (EXTRA_DIST): added cheaders
7973 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7974 a character not as a small integer.
7976 * src/support/lyxstring.C (find): removed Assert and added i >=
7977 rep->sz to the first if.
7979 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7981 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7982 src/LyXView.C src/buffer.C src/bufferparams.C
7983 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7984 src/text2.C src/insets/insetinclude.C:
7985 lyxlayout renamed to textclasslist.
7987 * src/layout.C: some lyxerr changes.
7989 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7990 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7991 (LyXLayoutList): removed all traces of this class.
7992 (LyXTextClass::Read): rewrote LT_STYLE
7993 (LyXTextClass::hasLayout): new function
7994 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7995 both const and nonconst version.
7996 (LyXTextClass::delete_layout): new function.
7997 (LyXTextClassList::Style): bug fix. do the right thing if layout
7999 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8000 (LyXTextClassList::NameOfLayout): ditto
8001 (LyXTextClassList::Load): ditto
8003 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8005 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8007 * src/LyXAction.C (LookupFunc): added a workaround for sun
8008 compiler, on the other hand...we don't know if the current code
8009 compiles on sun at all...
8011 * src/support/filetools.C (CleanupPath): subst fix
8013 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8016 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8017 complained about this one?
8019 * src/insets/insetinclude.C (Latex): subst fix
8021 * src/insets/insetbib.C (getKeys): subst fix
8023 * src/LyXSendto.C (SendtoApplyCB): subst fix
8025 * src/lyx_main.C (init): subst fix
8027 * src/layout.C (Read): subst fix
8029 * src/lyx_sendfax_main.C (button_send): subst fix
8031 * src/buffer.C (RoffAsciiTable): subst fix
8033 * src/lyx_cb.C (MenuFax): subst fix
8034 (PrintApplyCB): subst fix
8036 1999-10-26 Juergen Vigna <jug@sad.it>
8038 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8040 (Read): Cleaned up this code so now we read only format vestion >= 5
8042 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8044 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8045 come nobody has complained about this one?
8047 * src/insets/insetinclude.C (Latex): subst fix
8049 * src/insets/insetbib.C (getKeys): subst fix
8051 * src/lyx_main.C (init): subst fix
8053 * src/layout.C (Read): subst fix
8055 * src/buffer.C (RoffAsciiTable): subst fix
8057 * src/lyx_cb.C (MenuFax): subst fix.
8059 * src/layout.[hC] + some other files: rewrote to use
8060 std::container to store textclasses and layouts in.
8061 Simplified, removed a lot of code. Make all classes
8062 assignable. Further simplifications and review of type
8063 use still to be one.
8065 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8066 lastfiles to create the lastfiles partr of the menu.
8068 * src/lastfiles.[Ch]: rewritten to use deque to store the
8069 lastfiles in. Uses fstream for reading and writing. Simplifies
8072 * src/support/syscall.C: remove explicit cast.
8074 * src/BufferView.C (CursorToggleCB): removed code snippets that
8076 use explicat C++ style casts instead of C style casts. also use
8077 u_vdata instea of passing pointers in longs.
8079 * src/PaperLayout.C: removed code snippets that were commented out.
8081 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8083 * src/lyx_main.C: removed code snippets that wer commented out.
8085 * src/paragraph.C: removed code snippets that were commented out.
8087 * src/lyxvc.C (logClose): use static_cast
8089 (viewLog): remove explicit cast to void*
8090 (showLog): removed old commented code
8092 * src/menus.C: use static_cast instead of C style casts. use
8093 u_vdata instead of u_ldata. remove explicit cast to (long) for
8094 pointers. Removed old code that was commented out.
8096 * src/insets/inset.C: removed old commented func
8098 * src/insets/insetref.C (InsetRef): removed old code that had been
8099 commented out for a long time.
8101 (escape): removed C style cast
8103 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8105 * src/insets/insetlatex.C (Draw): removed old commented code
8106 (Read): rewritten to use string
8108 * src/insets/insetlabel.C (escape): removed C style cast
8110 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8112 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8115 * src/insets/insetinclude.h: removed a couple of stupid bools
8117 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8118 (Clone): remove C style cast
8119 (getKeys): changed list to lst because of std::list
8121 * src/insets/inseterror.C (Draw): removed som old commented code.
8123 * src/insets/insetcommand.C (Draw): removed some old commented code.
8125 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8126 commented out forever.
8127 (bibitem_cb): use static_cast instead of C style cast
8128 use of vdata changed to u_vdata.
8130 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8132 (CloseUrlCB): use static_cast instead of C style cast.
8133 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8135 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8136 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8137 (CloseInfoCB): static_cast from ob->u_vdata instead.
8138 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8141 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8142 (C_InsetError_CloseErrorCB): forward the ob parameter
8143 (CloseErrorCB): static_cast from ob->u_vdata instead.
8145 * src/vspace.h: include LString.h since we use string in this class.
8147 * src/vspace.C (lyx_advance): changed name from advance because of
8148 nameclash with stl. And since we cannot use namespaces yet...I
8149 used a lyx_ prefix instead. Expect this to change when we begin
8152 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8154 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8155 and removed now defunct constructor and deconstructor.
8157 * src/BufferView.h: have backstack as a object not as a pointer.
8158 removed initialization from constructor. added include for BackStack
8160 * development/lyx.spec.in (%build): add CFLAGS also.
8162 * src/screen.C (drawFrame): removed another warning.
8164 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8166 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8167 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8168 README and ANNOUNCE a bit for the next release. More work is
8171 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8172 unbreakable if we are in freespacing mode (LyX-Code), but not in
8175 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * src/BackStack.h: fixed initialization order in constructor
8179 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8181 * acinclude.m4 (VERSION): new rules for when a version is
8182 development, added also a variable for prerelease.
8183 (warnings): we set with_warnings=yes for prereleases
8184 (lyx_opt): prereleases compile with same optimization as development
8185 (CXXFLAGS): only use pedantic if we are a development version
8187 * src/BufferView.C (restorePosition): don't do anything if the
8190 * src/BackStack.h: added member empty, use this to test if there
8191 is anything to pop...
8193 1999-10-25 Juergen Vigna <jug@sad.it>
8196 * forms/layout_forms.fd +
8197 * forms/latexoptions.fd +
8198 * lyx.fd: changed for various form resize issues
8200 * src/mathed/math_panel.C +
8201 * src/insets/inseterror.C +
8202 * src/insets/insetinfo.C +
8203 * src/insets/inseturl.C +
8204 * src/insets/inseturl.h +
8207 * src/PaperLayout.C +
8208 * src/ParagraphExtra.C +
8209 * src/TableLayout.C +
8211 * src/layout_forms.C +
8218 * src/menus.C: fixed various resize issues. So now forms can be
8219 resized savely or not be resized at all.
8221 * forms/form_url.fd +
8222 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8225 * src/insets/Makefile.am: added files form_url.[Ch]
8227 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8229 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8230 (and presumably 6.2).
8232 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8233 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8234 remaining static member callbacks.
8236 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8239 * src/support/lyxstring.h: declare struct Srep as friend of
8240 lyxstring, since DEC cxx complains otherwise.
8242 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8244 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8246 * src/LaTeX.C (run): made run_bibtex also depend on files with
8248 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8249 are put into the dependency file.
8251 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8252 the code has shown itself to work
8253 (create_ispell_pipe): removed another warning, added a comment
8256 * src/minibuffer.C (ExecutingCB): removed code that has been
8257 commented out a long time
8259 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8260 out code + a warning.
8262 * src/support/lyxstring.h: comment out the three private
8263 operators, when compiling with string ansi conforming compilers
8266 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8268 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8269 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8272 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8275 * src/mathed/math_panel.C (create_math_panel): remove explicit
8278 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8281 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8282 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8283 to XCreatePixmapFromBitmapData
8284 (fl_set_bmtable_data): change the last argument to be unsigned
8286 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8287 and bh to be unsigned int, remove explicit casts in call to
8288 XReadBitmapFileData.
8290 * images/arrows.xbm: made the arrays unsigned char *
8291 * images/varsz.xbm: ditto
8292 * images/misc.xbm: ditto
8293 * images/greek.xbm: ditto
8294 * images/dots.xbm: ditto
8295 * images/brel.xbm: ditto
8296 * images/bop.xbm: ditto
8298 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8300 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8301 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8302 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8304 (LYX_CXX_CHEADERS): added <clocale> to the test.
8306 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8308 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8310 * src/support/lyxstring.C (append): fixed something that must be a
8311 bug, rep->assign was used instead of rep->append.
8313 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8316 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8317 lyx insert double chars. Fix spotted by Kayvan.
8319 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8321 * Fixed the tth support. I messed up with the Emacs patch apply feature
8322 and omitted the changes in lyxrc.C.
8324 1999-10-22 Juergen Vigna <jug@sad.it>
8326 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8328 * src/lyx_cb.C (MenuInsertRef) +
8329 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8330 the form cannot be resized under it limits (fixes a segfault)
8332 * src/lyx.C (create_form_form_ref) +
8333 * forms/lyx.fd: Changed Gravity on name input field so that it is
8336 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8338 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8339 <ostream> and <istream>.
8341 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8342 whether <fstream> provides the latest standard features, or if we
8343 have an oldstyle library (like in egcs).
8344 (LYX_CXX_STL_STRING): fix the test.
8346 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8347 code on MODERN_STL_STREAM.
8349 * src/support/lyxstring.h: use L{I,O}stream.h.
8351 * src/support/L{I,O}stream.h: new files, designed to setup
8352 correctly streams for our use
8353 - includes the right header depending on STL capabilities
8354 - puts std::ostream and std::endl (for LOStream.h) or
8355 std::istream (LIStream.h) in toplevel namespace.
8357 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8359 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8360 was a bib file that had been changed we ensure that bibtex is run.
8361 (runBibTeX): enhanced to extract the names of the bib files and
8362 getting their absolute path and enter them into the dep file.
8363 (findtexfile): static func that is used to look for tex-files,
8364 checks for absolute patchs and tries also with kpsewhich.
8365 Alternative ways of finding the correct files are wanted. Will
8367 (do_popen): function that runs a command using popen and returns
8368 the whole output of that command in a string. Should be moved to
8371 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8372 file with extension ext has changed.
8374 * src/insets/figinset.C: added ifdef guards around the fl_free
8375 code that jug commented out. Now it is commented out when
8376 compiling with XForms == 0.89.
8378 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8379 to lyxstring.C, and only keep a forward declaration in
8380 lyxstring.h. Simplifies the header file a bit and should help a
8381 bit on compile time too. Also changes to Srep will not mandate a
8382 recompile of code just using string.
8383 (~lyxstring): definition moved here since it uses srep.
8384 (size): definition moved here since it uses srep.
8386 * src/support/lyxstring.h: removed a couple of "inline" that should
8389 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8391 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8394 1999-10-21 Juergen Vigna <jug@sad.it>
8396 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8397 set to left if I just remove the width entry (or it is empty).
8399 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8400 paragraph when having dummy paragraphs.
8402 1999-10-20 Juergen Vigna <jug@sad.it>
8404 * src/insets/figinset.C: just commented some fl_free_form calls
8405 and added warnings so that this calls should be activated later
8406 again. This avoids for now a segfault, but we have a memory leak!
8408 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8409 'const char * argument' to 'string argument', this should
8410 fix some Asserts() in lyxstring.C.
8412 * src/lyxfunc.h: Removed the function argAsString(const char *)
8413 as it is not used anymore.
8415 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8417 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8420 * src/Literate.h: some funcs moved from public to private to make
8421 interface clearer. Unneeded args removed.
8423 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8425 (scanBuildLogFile): ditto
8427 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8428 normal TeX Error. Still room for improvement.
8430 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8432 * src/buffer.C (insertErrors): changes to make the error
8433 desctription show properly.
8435 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8438 * src/support/lyxstring.C (helper): changed to use
8439 sizeof(object->rep->ref).
8440 (operator>>): changed to use a pointer instead.
8442 * src/support/lyxstring.h: changed const reference & to value_type
8443 const & lets see if that helps.
8445 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * Makefile.am (rpmdist): fixed to have non static package and
8450 * src/support/lyxstring.C: removed the compilation guards
8452 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8455 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8456 conditional compile of lyxstring.Ch
8458 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8459 stupid check, but it is a lot better than the bastring hack.
8460 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8462 * several files: changed string::erase into string::clear. Not
8465 * src/chset.C (encodeString): use a char temporary instead
8467 * src/table.C (TexEndOfCell): added tostr around
8468 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8469 (TexEndOfCell): ditto
8470 (TexEndOfCell): ditto
8471 (TexEndOfCell): ditto
8472 (DocBookEndOfCell): ditto
8473 (DocBookEndOfCell): ditto
8474 (DocBookEndOfCell): ditto
8475 (DocBookEndOfCell): ditto
8477 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8479 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8481 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8482 (MenuBuildProg): added tostr around ret
8483 (MenuRunChktex): added tostr around ret
8484 (DocumentApplyCB): added tostr around ret
8486 * src/chset.C (encodeString): added tostr around t->ic
8488 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8489 (makeLaTeXFile): added tostr around tocdepth
8490 (makeLaTeXFile): added tostr around ftcound - 1
8492 * src/insets/insetbib.C (setCounter): added tostr around counter.
8494 * src/support/lyxstring.h: added an operator+=(int) to catch more
8497 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8498 (lyxstring): We DON'T allow NULL pointers.
8500 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8502 * src/mathed/math_macro.C (MathMacroArgument::Write,
8503 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8504 when writing them out.
8506 * src/LString.C: remove, since it is not used anymore.
8508 * src/support/lyxstring.C: condition the content to
8509 USE_INCLUDED_STRING macro.
8511 * src/mathed/math_symbols.C, src/support/lstrings.C,
8512 src/support/lyxstring.C: add `using' directive to specify what
8513 we need in <algorithm>. I do not think that we need to
8514 conditionalize this, but any thought is appreciated.
8516 * many files: change all callback functions to "C" linkage
8517 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8518 strict_ansi. Those who were static are now global.
8519 The case of callbacks which are static class members is
8520 trickier, since we have to make C wrappers around them (see
8521 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8522 did not finish this yet, since it defeats the purpose of
8523 encapsulation, and I am not sure what the best route is.
8525 1999-10-19 Juergen Vigna <jug@sad.it>
8527 * src/support/lyxstring.C (lyxstring): we permit to have a null
8528 pointer as assignment value and just don't assign it.
8530 * src/vspace.C (nextToken): corrected this function substituting
8531 find_first(_not)_of with find_last_of.
8533 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8534 (TableOptCloseCB) (TableSpeCloseCB):
8535 inserted fl_set_focus call for problem with fl_hide_form() in
8538 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8540 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8543 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8545 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8546 LyXLex::next() and not eatline() to get its argument.
8548 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8550 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8551 instead, use fstreams for io of the depfile, removed unneeded
8552 functions and variables.
8554 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8555 vector instead, removed all functions and variables that is not in
8558 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8560 * src/buffer.C (insertErrors): use new interface to TeXError
8562 * Makefile.am (rpmdist): added a rpmdist target
8564 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8565 per Kayvan's instructions.
8567 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8569 * src/Makefile.am: add a definition for localedir, so that locales
8570 are found after installation (Kayvan)
8572 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8574 * development/.cvsignore: new file.
8576 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8578 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8579 C++ compiler provides wrappers for C headers and use our alternate
8582 * configure.in: use LYX_CXX_CHEADERS.
8584 * src/cheader/: new directory, populated with cname headers from
8585 libstdc++-2.8.1. They are a bit old, but probably good enough for
8586 what we want (support compilers who lack them).
8588 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8589 from includes. It turns out is was stupid.
8591 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8593 * lib/Makefile.am (install-data-local): forgot a ';'
8594 (install-data-local): forgot a '\'
8595 (libinstalldirs): needed after all. reintroduced.
8597 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8599 * configure.in (AC_OUTPUT): added lyx.spec
8601 * development/lyx.spec: removed file
8603 * development/lyx.spec.in: new file
8605 * po/*.po: merged with lyx.pot becuase of make distcheck
8607 * lib/Makefile.am (dist-hook): added dist-hook so that
8608 documentation files will be included when doing a make
8609 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8610 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8612 more: tried to make install do the right thing, exclude CVS dirs
8615 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8616 Path would fit in more nicely.
8618 * all files that used to use pathstack: uses now Path instead.
8619 This change was a lot easier than expected.
8621 * src/support/path.h: new file
8623 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8625 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8627 * src/support/lyxstring.C (getline): Default arg was given for
8630 * Configure.cmd: removed file
8632 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8634 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8635 streams classes and types, add the proper 'using' statements when
8636 MODERN_STL is defined.
8638 * src/debug.h: move the << operator definition after the inclusion
8641 * src/support/filetools.C: include "LAssert.h", which is needed
8644 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8647 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8648 include "debug.h" to define a proper ostream.
8650 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8652 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8653 method to the SystemCall class which can kill a process, but it's
8654 not fully implemented yet.
8656 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8658 * src/support/FileInfo.h: Better documentation
8660 * src/lyxfunc.C: Added support for buffer-export html
8662 * src/menus.C: Added Export->As HTML...
8664 * lib/bind/*.bind: Added short-cut for buffer-export html
8666 * src/lyxrc.*: Added support for new \tth_command
8668 * lib/lyxrc.example: Added stuff for new \tth_command
8670 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8672 * lib/Makefile.am (IMAGES): removed images/README
8673 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8674 installes in correct place. Check permisions is installed
8677 * src/LaTeX.C: some no-op changes moved declaration of some
8680 * src/LaTeX.h (LATEX_H): changed include guard name
8682 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8684 * lib/reLyX/Makefile.am: install noweb2lyx.
8686 * lib/Makefile.am: install configure.
8688 * lib/reLyX/configure.in: declare a config aux dir; set package
8689 name to lyx (not sure what the best solution is); generate noweb2lyx.
8691 * lib/layouts/egs.layout: fix the bibliography layout.
8693 1999-10-08 Jürgen Vigna <jug@sad.it>
8695 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8696 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8697 it returned without continuing to search the path.
8699 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8701 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8702 also fixes a bug. It is not allowed to do tricks with std::strings
8703 like: string a("hei"); &a[e]; this will not give what you
8704 think... Any reason for the complexity in this func?
8706 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8708 * Updated README and INSTALL a bit, mostly to check that my
8709 CVS rights are correctly set up.
8711 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8713 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8714 does not allow '\0' chars but lyxstring and std::string does.
8716 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8718 * autogen.sh (AUTOCONF): let the autogen script create the
8719 POTFILES.in file too. POTFILES.in should perhaps now not be
8720 included in the cvs module.
8722 * some more files changed to use C++ includes instead of C ones.
8724 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8726 (Reread): added tostr to nlink. buggy output otherwise.
8727 (Reread): added a string() around szMode when assigning to Buffer,
8728 without this I got a log of garbled info strings.
8730 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8733 * I have added several ostream & operator<<(ostream &, some_type)
8734 functions. This has been done to avoid casting and warnings when
8735 outputting enums to lyxerr. This as thus eliminated a lot of
8736 explicit casts and has made the code clearer. Among the enums
8737 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8738 mathed enums, some font enum the Debug::type enum.
8740 * src/support/lyxstring.h (clear): missing method. equivalent of
8743 * all files that contained "stderr": rewrote constructs that used
8744 stderr to use lyxerr instead. (except bmtable)
8746 * src/support/DebugStream.h (level): and the passed t with
8747 Debug::ANY to avoid spurious bits set.
8749 * src/debug.h (Debug::type value): made it accept strings of the
8752 * configure.in (Check for programs): Added a check for kpsewhich,
8753 the latex generation will use this later to better the dicovery of
8756 * src/BufferView.C (create_view): we don't need to cast this to
8757 (void*) that is done automatically.
8758 (WorkAreaButtonPress): removed some dead code.
8760 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8762 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8763 is not overwritten when translated (David Sua'rez de Lis).
8765 * lib/CREDITS: Added David Sua'rez de Lis
8767 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8769 * src/bufferparams.C (BufferParams): default input encoding is now
8772 * acinclude.m4 (cross_compiling): comment out macro
8773 LYX_GXX_STRENGTH_REDUCE.
8775 * acconfig.h: make sure that const is not defined (to empty) when
8776 we are compiling C++. Remove commented out code using SIZEOF_xx
8779 * configure.in : move the test for const and inline as late as
8780 possible so that these C tests do not interefere with C++ ones.
8781 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8782 has not been proven.
8784 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8786 * src/table.C (getDocBookAlign): remove bad default value for
8789 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8791 (ShowFileMenu2): ditto.
8793 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8796 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8798 * Most files: finished the change from the old error code to use
8799 DebugStream for all lyxerr debugging. Only minor changes remain
8800 (e.g. the setting of debug levels using strings instead of number)
8802 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8804 * src/layout.C (Add): Changed to use compare_no_case instead of
8807 * src/FontInfo.C: changed loop variable type too string::size_type.
8809 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8811 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8812 set ETAGS_ARGS to --c++
8814 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8816 * src/table.C (DocBookEndOfCell): commented out two unused variables
8818 * src/paragraph.C: commented out four unused variables.
8820 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8821 insed a if clause with type string::size_type.
8823 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8826 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8828 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8829 variable, also changed loop to go from 0 to lenght + 1, instead of
8830 -1 to length. This should be correct.
8832 * src/LaTeX.C (scanError): use string::size_type as loop variable
8835 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8836 (l.896) since y_tmp and row was not used anyway.
8838 * src/insets/insetref.C (escape): use string::size_type as loop
8841 * src/insets/insetquotes.C (Width): use string::size_type as loop
8843 (Draw): use string::size_type as loop variable type.
8845 * src/insets/insetlatexaccent.C (checkContents): use
8846 string::size_type as loop variable type.
8848 * src/insets/insetlabel.C (escape): use string::size_type as loop
8851 * src/insets/insetinfo.C: added an extern for current_view.
8853 * src/insets/insetcommand.C (scanCommand): use string::size_type
8854 as loop variable type.
8856 * most files: removed the RCS tags. With them we had to recompile
8857 a lot of files after a simple cvs commit. Also we have never used
8858 them for anything meaningful.
8860 * most files: tags-query-replace NULL 0. As adviced several plases
8861 we now use "0" instead of "NULL" in our code.
8863 * src/support/filetools.C (SpaceLess): use string::size_type as
8866 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8868 * src/paragraph.C: fixed up some more string stuff.
8870 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8872 * src/support/filetools.h: make modestr a std::string.
8874 * src/filetools.C (GetEnv): made ch really const.
8876 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8877 made code that used these use max/min from <algorithm> instead.
8879 * changed several c library include files to their equivalent c++
8880 library include files. All is not changed yet.
8882 * created a support subdir in src, put lyxstring and lstrings
8883 there + the extra files atexit, fileblock, strerror. Created
8884 Makefile.am. edited configure.in and src/Makefile.am to use this
8885 new subdir. More files moved to support.
8887 * imported som of the functions from repository lyx, filetools
8889 * ran tags-query-replace on LString -> string, corrected the bogus
8890 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8891 is still some errors in there. This is errors where too much or
8892 too litle get deleted from strings (string::erase, string::substr,
8893 string::replace), there can also be some off by one errors, or
8894 just plain wrong use of functions from lstrings. Viewing of quotes
8897 * LyX is now running fairly well with string, but there are
8898 certainly some bugs yet (see above) also string is quite different
8899 from LString among others in that it does not allow null pointers
8900 passed in and will abort if it gets any.
8902 * Added the revtex4 files I forgot when setting up the repository.
8904 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8906 * All over: Tried to clean everything up so that only the files
8907 that we really need are included in the cvs repository.
8908 * Switched to use automake.
8909 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8910 * Install has not been checked.
8912 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8914 * po/pt.po: Three errors:
8915 l.533 and l.538 format specification error
8916 l. 402 duplicate entry, I just deleted it.