1 2000-09-29 Allan Rae <rae@lyx.org>
3 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
4 Allow derived type to control connection and disconnection from signals
5 of its choice if desired.
7 2000-09-28 Juergen Vigna <jug@sad.it>
9 * src/insets/insettabular.C (update): fixed cursor setting when
10 the_locking_inset changed.
11 (draw): made this a bit cleaner.
12 (InsetButtonPress): fixed!
14 * various files: added LyXText Parameter to fitCursor call.
16 * src/BufferView.C (fitCursor): added LyXText parameter.
18 * src/insets/insettabular.C (draw): small draw fix.
20 * src/tabular.C: right setting of left/right celllines.
22 * src/tabular.[Ch]: fixed various types in funcions and structures.
23 * src/insets/insettabular.C: ditto
24 * src/frontends/xforms/FormTabular.C: ditto
26 2000-09-28 Allan Rae <rae@lyx.org>
28 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
29 that the #ifdef's had been applied to part of what should have been
30 a complete condition. It's possible there are other tests that
31 were specific to tables that are also wrong now that InsetTabular is
32 being used. Now we need to fix the output of '\n' after a table in a
33 float for the same reason as the original condition:
34 "don't insert this if we would be adding it before or after a table
35 in a float. This little trick is needed in order to allow use of
36 tables in \subfigures or \subtables."
37 Juergen can you check this?
39 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
41 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
42 outputed to the ostream.
44 * several files: fixed types based on warnings from cxx
46 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
48 * src/frontends/kde/Makefile.am: fix rule for
49 formindexdialogdata_moc.C
51 * src/.cvsignore: add ext_l10n.h to ignore
53 * acconfig.h: stop messing with __STRICT_ANSI__
54 * config/gnome.m4: remove option to set -ansi
55 * config/kde.m4: remove option to set -ansi
56 * config/lyxinclude.m4: don't set -ansi
58 2000-09-27 Juergen Vigna <jug@sad.it>
60 * various files: remove "default" language check.
62 * src/insets/insetquotes.C: removed use of current_view.
64 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
65 the one should have red ears by now!
67 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
68 in more then one paragraph. Fixed cursor-movement/selection.
70 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
71 paragraphs inside a text inset.
73 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
74 text-inset if this owner is an inset.
76 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
78 * src/Bullet.h: changed type of font, character and size to int
80 * src/buffer.C (asciiParagraph): remove actcell and fname1.
82 * src/insets/inseturl.[Ch]:
83 * src/insets/insetref.[Ch]:
84 * src/insets/insetlabel.[Ch]: add linelen to Ascii
86 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
88 * src/buffer.C (readFile): block-if statement rearranged to minimise
89 bloat. Patch does not reverse Jean-Marc's change ;-)
91 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
92 Class rewritten to store pointers to hide/update signals directly,
93 rather than Dialogs *. Also defined an enum to ease use. All xforms
94 forms can now be derived from this class.
96 * src/frontends/xforms/FormCommand.[Ch]
97 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
99 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
102 * src/frontends/xforms/forms/form_citation.fd
103 * src/frontends/xforms/forms/form_copyright.fd
104 * src/frontends/xforms/forms/form_error.fd
105 * src/frontends/xforms/forms/form_index.fd
106 * src/frontends/xforms/forms/form_ref.fd
107 * src/frontends/xforms/forms/form_toc.fd
108 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
110 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
112 * src/insets/insetfoot.C: removed redundent using directive.
114 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
116 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
117 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
119 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
120 created in the constructors in different groups. Then set() just
121 have to show the groups as needed. This fixes the redraw problems
122 (and is how the old menu code worked).
124 * src/support/lyxlib.h: declare the methods as static when we do
127 2000-09-26 Juergen Vigna <jug@sad.it>
129 * src/buffer.C (asciiParagraph): new function.
130 (writeFileAscii): new function with parameter ostream.
131 (writeFileAscii): use now asciiParagraph.
133 * various inset files: added the linelen parameter to the Ascii-func.
135 * src/tabular.C (Write): fixed error in writing file introduced by
136 the last changes from Lars.
138 * lib/bind/menus.bind: removed not supported functions.
140 * src/insets/insettext.C (Ascii): implemented this function.
142 * src/insets/lyxinset.h (Ascii): added linelen parameter.
144 * src/tabular.C (write_attribute[int,string,bool]): new functions.
145 (Write): use of the write_attribute functions.
147 * src/bufferlist.C (close): fixed reasking question!
149 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
151 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
152 new files use the everwhere possible.
155 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
156 src/log_form.C src/lyx.C:
159 * src/buffer.C (runLaTeX): remove func
161 * src/PaperLayout.C: removed file
162 * src/ParagraphExtra.C: likewise
163 * src/bullet_forms.C: likewise
164 * src/bullet_forms.h: likewise
165 * src/bullet_forms_cb.C: likewise
167 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
168 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
171 * several files: remove all traces of the old fd_form_paragraph,
172 and functions belonging to that.
174 * several files: remove all traces of the old fd_form_document,
175 and functions belonging to that.
177 * several files: constify local variables were possible.
179 * several files: remove all code that was dead when NEW_EXPORT was
182 * several files: removed string::c_str in as many places as
185 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
186 (e): be a bit more outspoken when patching
187 (updatesrc): only move files if changed.
189 * forms/layout_forms.h.patch: regenerated
191 * forms/layout_forms.fd: remove form_document and form_paragraph
192 and form_quotes and form_paper and form_table_options and
195 * forms/form1.fd: remove form_table
197 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
198 the fdui->... rewrite. Update some comments to xforms 0.88
200 * forms/bullet_forms.C.patch: removed file
201 * forms/bullet_forms.fd: likewise
202 * forms/bullet_forms.h.patch: likewise
204 * development/Code_rules/Rules: added a section on switch
205 statements. Updated some comment to xforms 0.88.
207 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
209 * src/buffer.C (readFile): make sure that the whole version number
210 is read after \lyxformat (even when it contains a comma)
212 * lib/ui/default.ui: change shortcut of math menu to M-a.
214 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
216 * src/vspace.C (nextToken): use isStrDbl() to check for proper
219 * src/LyXView.C (updateWindowTitle): show the full files name in
220 window title, limited to 30 characters.
222 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
223 When a number of characters has been given, we should not assume
224 that the string is 0-terminated.
226 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
227 calls (fixes some memory leaks)
229 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
230 trans member on exit.
232 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
234 * src/converter.C (GetReachable): fix typo.
236 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
237 understand ',' instead of '.'.
238 (GetInteger): rewrite to use strToInt().
240 2000-09-26 Juergen Vigna <jug@sad.it>
242 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
243 better visibility and error-message on wrong VSpace input.
245 * src/language.C (initL): added english again.
247 2000-09-25 Juergen Vigna <jug@sad.it>
249 * src/frontends/kde/Dialogs.C (Dialogs):
250 * src/frontends/gnome/Dialogs.C (Dialogs):
251 * src/frontends/kde/Makefile.am:
252 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
254 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
256 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
258 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
260 * src/frontends/xforms/FormParagraph.C:
261 * src/frontends/xforms/FormParagraph.h:
262 * src/frontends/xforms/form_paragraph.C:
263 * src/frontends/xforms/form_paragraph.h:
264 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
267 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
269 * src/tabular.C (OldFormatRead): forgot to delete the temporary
270 Paragraph-Data after use.
272 * src/insets/insettext.C (LocalDispatch): don't set the layout on
273 non breakable paragraphs.
275 2000-09-25 Garst R. Reese <reese@isn.net>
277 * src/language.C (initL): added missing language_country codes.
279 2000-09-25 Juergen Vigna <jug@sad.it>
281 * src/insets/insettext.C (InsetText):
282 (deleteLyXText): remove the not released LyXText structure!
284 2000-09-24 Marko Vendelin <markov@ioc.ee>
286 * src/frontends/gnome/mainapp.C
287 * src/frontends/gnome/mainapp.h: added support for keyboard
290 * src/frontends/gnome/FormCitation.C
291 * src/frontends/gnome/FormCitation.h
292 * src/frontends/gnome/Makefile.am
293 * src/frontends/gnome/pixbutton.h: completed the rewrite of
294 FormCitation to use "action area" in mainapp window
296 * src/frontends/gnome/Menubar_pimpl.C
297 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
300 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
302 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
303 width/descent/ascent values if name is empty.
304 (mathed_string_height): Use std::max.
306 2000-09-25 Allan Rae <rae@lyx.org>
308 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
309 segfault. This will be completely redesigned soon.
311 * sigc++: updated libsigc++. Fixes struct timespec bug.
313 * development/tools/makeLyXsigc.sh: .cvsignore addition
315 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
317 * several files: removed almost all traces of the old table
320 * src/TableLayout.C: removed file
322 2000-09-22 Juergen Vigna <jug@sad.it>
324 * src/frontends/kde/Dialogs.C: added credits forms.
326 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
328 * src/frontends/gnome/Dialogs.C: added some forms.
330 * src/spellchecker.C (init_spell_checker): set language in pspell code
331 (RunSpellChecker): some modifications for setting language string.
333 * src/language.[Ch]: added language_country code.
335 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
337 * src/frontends/Dialogs.h: added new signal showError.
338 Rearranged existing signals in some sort of alphabetical order.
340 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
341 FormError.[Ch], form_error.[Ch]
342 * src/frontends/xforms/forms/makefile: added new file form_error.fd
343 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
345 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
346 dialogs. I think that this can be used as the base to all these
349 * src/frontends/xforms/FormError.[Ch]
350 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
351 implementation of InsetError dialog.
353 * src/insets/inseterror.[Ch]: rendered GUI-independent.
355 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
356 * src/frontends/kde/Makefile.am: ditto
358 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
360 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
361 macrobf. This fixes a bug of invisible text.
363 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
365 * lib/doc/LaTeXConfig.lyx.in: updated.
367 * src/language.C (initL): remove language "francais" and change a
368 bit the names of the two other french variations.
370 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
371 string that may not be 0-terminated.
373 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
375 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
377 2000-09-20 Marko Vendelin <markov@ioc.ee>
379 * src/frontends/gnome/FormCitation.C
380 * src/frontends/gnome/FormIndex.C
381 * src/frontends/gnome/FormToc.C
382 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
383 the variable initialization to shut up the warnings
385 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
387 * src/table.[Ch]: deleted files
389 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
392 2000-09-18 Juergen Vigna <jug@sad.it>
394 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
395 problems with selection. Inserted new LFUN_PASTESELECTION.
396 (InsetButtonPress): inserted handling of middle mouse-button paste.
398 * src/spellchecker.C: changed word to word.c_str().
400 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
402 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
403 included in the ``make dist'' tarball.
405 2000-09-15 Juergen Vigna <jug@sad.it>
407 * src/CutAndPaste.C (cutSelection): small fix return the right
408 end position after cut inside one paragraph only.
410 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
411 we are locked as otherwise we don't have a valid cursor position!
413 * src/insets/figinset.C (draw): small bugfix but why is this needed???
415 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
417 * src/frontends/kde/FormRef.C: added using directive.
418 * src/frontends/kde/FormToc.C: ditto
420 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
422 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
424 2000-09-19 Marko Vendelin <markov@ioc.ee>
426 * src/frontends/gnome/Menubar_pimpl.C
427 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
428 Toc, ViewFormats, UpdateFormats, and ExportFormats.
430 * src/frontends/gnome/mainapp.C
431 * src/frontends/gnome/mainapp.h: support for menu update used
434 * src/frontends/gnome/mainapp.C
435 * src/frontends/gnome/mainapp.h: support for "action" area in the
436 main window. This area is used by small simple dialogs, such as
439 * src/frontends/gnome/FormIndex.C
440 * src/frontends/gnome/FormIndex.h
441 * src/frontends/gnome/FormUrl.C
442 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
445 * src/frontends/gnome/FormCitation.C
446 * src/frontends/gnome/FormCitation.h: rewrite to use main window
447 action area. Only "Insert new citation" is implemented.
449 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
451 * src/buffer.C (Dispatch): fix call to Dispatch
452 * src/insets/insetref.C (Edit): likewise
453 * src/insets/insetparent.C (Edit): likewise
454 * src/insets/insetinclude.C (include_cb): likewise
455 * src/frontends/xforms/FormUrl.C (apply): likewise
456 * src/frontends/xforms/FormToc.C (apply): likewise
457 * src/frontends/xforms/FormRef.C (apply): likewise
458 * src/frontends/xforms/FormIndex.C (apply): likewise
459 * src/frontends/xforms/FormCitation.C (apply): likewise
460 * src/lyxserver.C (callback): likewise
461 * src/lyxfunc.C (processKeySym): likewise
464 * src/lyx_cb.C (LayoutsCB): likewise
466 * Makefile.am (sourcedoc): small change
468 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
470 * src/main.C (main): Don't make an empty GUIRunTime object. all
471 methods are static. constify a bit remove unneded using + headers.
473 * src/tabular.C: some more const to local vars move some loop vars
475 * src/spellchecker.C: added some c_str after some word for pspell
477 * src/frontends/GUIRunTime.h: add new static method setDefaults
478 * src/frontends/xforms/GUIRunTime.C (setDefaults):
479 * src/frontends/kde/GUIRunTime.C (setDefaults):
480 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
482 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
483 with strnew in arg, use correct emptystring when calling SetName.
485 * several files: remove all commented code with relation to
486 HAVE_SSTREAM beeing false. We now only support stringstream and
489 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
491 * src/lyxfunc.C: construct correctly the automatic new file
494 * src/text2.C (IsStringInText): change type of variable i to shut
497 * src/support/sstream.h: do not use namespaces if the compiler
498 does not support them.
500 2000-09-15 Marko Vendelin <markov@ioc.ee>
501 * src/frontends/gnome/FormCitation.C
502 * src/frontends/gnome/FormCitation.h
503 * src/frontends/gnome/diainsertcitation_interface.c
504 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
505 regexp support to FormCitation [Gnome].
507 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
510 * configure.in: remove unused KDE/GTKGUI define
512 * src/frontends/kde/FormRef.C
513 * src/frontends/kde/FormRef.h
514 * src/frontends/kde/formrefdialog.C
515 * src/frontends/kde/formrefdialog.h: double click will
516 go to reference, now it is possible to change a cross-ref
519 * src/frontends/kde/FormToc.C
520 * src/frontends/kde/FormToc.h
521 * src/frontends/kde/formtocdialog.C
522 * src/frontends/kde/formtocdialog.h: add a depth
525 * src/frontends/kde/Makefile.am: add QtLyXView.h
528 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
530 * src/frontends/kde/FormCitation.h: added some using directives.
532 * src/frontends/kde/FormToc.h: corrected definition of doTree.
534 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
537 * src/mathed/math_defs.h: redefine SetAlign to use string rather
540 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
542 * src/buffer.C (pop_tag): revert for the second time a change by
543 Lars, who seems to really hate having non-local loop variables :)
545 * src/Lsstream.h: add "using" statements.
547 * src/support/copy.C (copy): add a bunch of std:: qualifiers
548 * src/buffer.C (writeFile): ditto
550 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
552 * src/buffer.C (writeFile): try to fix the locale modified format
553 number to always be as we want it.
555 * src/WorkArea.C (work_area_handler): try to workaround the bugs
556 in XForms 0.89. C-space is now working again.
558 * src/Lsstream.h src/support/sstream.h: new files.
560 * also commented out all cases where strstream were used.
562 * src/Bullet.h (c_str): remove method.
564 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
566 * a lot of files: get rid of "char const *" and "char *" is as
567 many places as possible. We only want to use them in interaction
568 with system of other libraries, not inside lyx.
570 * a lot of files: return const object is not of pod type. This
571 helps ensure that temporary objects is not modified. And fits well
572 with "programming by contract".
574 * configure.in: check for the locale header too
576 * Makefile.am (sourcedoc): new tag for generation of doc++
579 2000-09-14 Juergen Vigna <jug@sad.it>
581 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
582 callback to check which combo called it and do the right action.
584 * src/combox.C (combo_cb): added combo * to the callbacks.
585 (Hide): moved call of callback after Ungrab of the pointer.
587 * src/intl.h: removed LCombo2 function.
589 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
590 function as this can now be handled in one function.
592 * src/combox.h: added Combox * to callback prototype.
594 * src/frontends/xforms/Toolbar_pimpl.C:
595 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
597 2000-09-14 Garst Reese <reese@isn.net>
599 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
600 moved usepackage{xxx}'s to beginning of file. Changed left margin
601 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
602 underlining from title. Thanks to John Culleton for useful suggestions.
604 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
606 * src/lyxlex_pimpl.C (setFile): change error message to debug
609 2000-09-13 Juergen Vigna <jug@sad.it>
611 * src/frontends/xforms/FormDocument.C: implemented choice_class
612 as combox and give callback to combo_language so OK/Apply is activated
615 * src/bufferlist.C (newFile): small fix so already named files
616 (via an open call) are not requested to be named again on the
619 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
621 * src/frontends/kde/Makefile.am
622 * src/frontends/kde/FormRef.C
623 * src/frontends/kde/FormRef.h
624 * src/frontends/kde/formrefdialog.C
625 * src/frontends/kde/formrefdialog.h: implement
628 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
630 * src/frontends/kde/formtocdialog.C
631 * src/frontends/kde/formtocdialog.h
632 * src/frontends/kde/FormToc.C
633 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
635 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
637 * src/frontends/kde/FormCitation.C: fix thinko
638 where we didn't always display the reference text
641 * src/frontends/kde/formurldialog.C
642 * src/frontends/kde/formurldialog.h
643 * src/frontends/kde/FormUrl.C
644 * src/frontends/kde/FormUrl.h: minor cleanups
646 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
648 * src/frontends/kde/Makefile.am
649 * src/frontends/kde/FormToc.C
650 * src/frontends/kde/FormToc.h
651 * src/frontends/kde/FormCitation.C
652 * src/frontends/kde/FormCitation.h
653 * src/frontends/kde/FormIndex.C
654 * src/frontends/kde/FormIndex.h
655 * src/frontends/kde/formtocdialog.C
656 * src/frontends/kde/formtocdialog.h
657 * src/frontends/kde/formcitationdialog.C
658 * src/frontends/kde/formcitationdialog.h
659 * src/frontends/kde/formindexdialog.C
660 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
662 2000-09-12 Juergen Vigna <jug@sad.it>
664 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
667 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
669 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
672 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
674 * src/converter.C (Add, Convert): Added support for converter flags:
675 needaux, resultdir, resultfile.
676 (Convert): Added new parameter view_file.
677 (dvips_options): Fixed letter paper option.
679 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
680 (Export, GetExportableFormats, GetViewableFormats): Added support
683 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
685 (easyParse): Fixed to work with new export code.
687 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
690 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
692 * lib/bind/*.bind: Replaced
693 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
694 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
696 2000-09-11 Juergen Vigna <jug@sad.it>
698 * src/lyx_gui.C (runTime): uses global guiruntime variable.
700 * src/main.C (main): now GUII defines global guiruntime!
702 * src/frontends/gnome/GUIRunTime.C (initApplication):
703 * src/frontends/kde/GUIRunTime.C (initApplication):
704 * src/frontends/xforms/GUIRunTime.C (initApplication):
705 * src/frontends/GUIRunTime.h: added new function initApplication.
707 * src/spellchecker.C (sc_accept_word): change to add_to_session.
709 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
711 2000-09-08 Juergen Vigna <jug@sad.it>
713 * src/lyx_gui.C (create_forms): don't display the "default" entry as
714 we have already "Reset".
716 * src/language.C (initL): inserted "default" language and made this
717 THE default language (and not american!)
719 * src/paragraph.C: inserted handling of "default" language!
721 * src/lyxfont.C: ditto
725 * src/paragraph.C: output the \\par only if we have a following
726 paragraph otherwise it's not needed.
728 2000-09-05 Juergen Vigna <jug@sad.it>
730 * config/pspell.m4: added entry to lyx-flags
732 * src/spellchecker.C: modified version from Kevin for using pspell
734 2000-09-01 Marko Vendelin <markov@ioc.ee>
735 * src/frontends/gnome/Makefile.am
736 * src/frontends/gnome/FormCitation.C
737 * src/frontends/gnome/FormCitation.h
738 * src/frontends/gnome/diainsertcitation_callbacks.c
739 * src/frontends/gnome/diainsertcitation_callbacks.h
740 * src/frontends/gnome/diainsertcitation_interface.c
741 * src/frontends/gnome/diainsertcitation_interface.h
742 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
743 dialog for Gnome frontend
745 * src/main.C: Gnome libraries require keeping application name
746 and its version as strings
748 * src/frontends/gnome/mainapp.C: Change the name of the main window
749 from GnomeLyX to PACKAGE
751 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
753 * src/frontends/Liason.C: add "using: declaration.
755 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
757 * src/mathed/math_macro.C (Metrics): Set the size of the template
759 * src/mathed/formulamacro.C (Latex): Fixed the returned value
761 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
763 * src/converter.C (add_options): New function.
764 (SetViewer): Change $$FName into '$$FName'.
765 (View): Add options when running xdvi
766 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
767 (Convert): The 3rd parameter is now the desired filename. Converts
768 calls to lyx::rename if necessary.
769 Add options when running dvips.
770 (dvi_papersize,dvips_options): New methods.
772 * src/exporter.C (Export): Use getLatexName() instead of fileName().
774 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
775 using a call to Converter::dvips_options.
776 Fixed to work with nex export code.
779 * src/support/rename.C: New files
781 * src/support/syscall.h
782 * src/support/syscall.C: Added Starttype SystemDontWait.
784 * lib/ui/default.ui: Changed to work with new export code
786 * lib/configure.m4: Changed to work with new export code
788 * src/encoding.C: Changed latex name for iso8859_7 encoding.
790 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
792 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
793 so that code compiles with DEC cxx.
795 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
796 to work correctly! Also now supports the additional elements
799 2000-09-01 Allan Rae <rae@lyx.org>
801 * src/frontends/ButtonPolicies.C: renamed all the references to
802 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
804 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
805 since it's a const not a type.
807 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
809 2000-08-31 Juergen Vigna <jug@sad.it>
811 * src/insets/figinset.C: Various changes to look if the filename has
812 an extension and if not add it for inline previewing.
814 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
816 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
817 make buttonStatus and isReadOnly be const methods. (also reflect
818 this in derived classes.)
820 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
821 (nextState): change to be static inline, pass the StateMachine as
823 (PreferencesPolicy): remove casts
824 (OkCancelPolicy): remvoe casts
825 (OkCancelReadOnlyPolicy): remove casts
826 (NoRepeatedApplyReadOnlyPolicy): remove casts
827 (OkApplyCancelReadOnlyPolicy): remove casts
828 (OkApplyCancelPolicy): remove casts
829 (NoRepeatedApplyPolicy): remove casts
831 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
833 * src/converter.C: added some using directives
835 * src/frontends/ButtonPolicies.C: changes to overcome
836 "need lvalue" error with DEC c++
838 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
839 to WMHideCB for DEC c++
841 * src/frontends/xforms/Menubar_pimpl.C: added using directive
843 * src/frontends/xforms/forms/form_document.C.patch: use C callback
844 to BulletBMTableCB for DEC c++
846 2000-08-31 Allan Rae <rae@lyx.org>
848 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
849 character dialog separately from old document dialogs combo_language.
852 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
854 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
855 Removed LFUN_REF_CREATE.
857 * src/MenuBackend.C: Added new tags: toc and references
859 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
860 (add_lastfiles, add_documents, add_formats): Removed the unused smn
862 (add_toc, add_references): New methods.
863 (create_submenu): Handle correctly the case when there is a
864 seperator after optional menu items.
866 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
867 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
868 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
870 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
872 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
874 * src/converter.[Ch]: New file for converting between different
877 * src/export.[Ch]: New file for exporting a LyX file to different
880 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
881 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
882 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
883 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
884 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
885 RunDocBook, MenuExport.
887 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
888 Exporter::Preview methods if NEW_EXPORT is defined.
890 * src/buffer.C (Dispatch): Use Exporter::Export.
892 * src/lyxrc.C: Added new tags: \converter and \viewer.
895 * src/LyXAction.C: Define new lyx-function: buffer-update.
896 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
897 when NEW_EXPORT is defined.
899 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
901 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
903 * lib/ui/default.ui: Added submenus "view" and "update" to the
906 * src/filetools.C (GetExtension): New function.
908 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
910 2000-08-29 Allan Rae <rae@lyx.org>
912 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
914 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
915 (EnableDocumentLayout): removed
916 (DisableDocumentLayout): removed
917 (build): make use of ButtonController's read-only handling to
918 de/activate various objects. Replaces both of the above functions.
920 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
921 (readOnly): was read_only
922 (refresh): fixed dumb mistakes with read_only_ handling
924 * src/frontends/xforms/forms/form_document.fd:
925 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
926 tabbed dialogs so the tabs look more like tabs and so its easier to
927 work out which is the current tab.
929 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
930 segfault with form_table
932 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
934 2000-08-28 Juergen Vigna <jug@sad.it>
936 * acconfig.h: added USE_PSPELL.
938 * src/config.h.in: added USE_PSPELL.
940 * autogen.sh: added pspell.m4
942 * config/pspell.m4: new file.
944 * src/spellchecker.C: implemented support for pspell libary.
946 2000-08-25 Juergen Vigna <jug@sad.it>
948 * src/LyXAction.C (init): renamed LFUN_TABLE to
949 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
951 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
953 * src/lyxscreen.h: add force_clear variable and fuction to force
954 a clear area when redrawing in LyXText.
956 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
958 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
960 * some whitespace and comment changes.
962 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
964 * src/buffer.C: up te LYX_FORMAT to 2.17
966 2000-08-23 Juergen Vigna <jug@sad.it>
968 * src/BufferView_pimpl.C (tripleClick): disable this when in a
971 * src/insets/insettabular.C (pasteSelection): delete the insets
972 LyXText as it is not valid anymore.
973 (copySelection): new function.
974 (pasteSelection): new function.
975 (cutSelection): new function.
976 (LocalDispatch): implemented cut/copy/paste of cell selections.
978 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
979 don't have a LyXText.
981 * src/LyXAction.C (init): a NEW_TABULAR define too much.
983 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
986 2000-08-22 Juergen Vigna <jug@sad.it>
988 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
989 ifdef form_table out if NEW_TABULAR.
991 2000-08-21 Juergen Vigna <jug@sad.it>
993 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
994 (draw): fixed draw position so that the cursor is positioned in the
996 (InsetMotionNotify): hide/show cursor so the position is updated.
997 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
998 using cellstart() function where it should be used.
1000 * src/insets/insettext.C (draw): ditto.
1002 * src/tabular.C: fixed initialization of some missing variables and
1003 made BoxType into an enum.
1005 2000-08-22 Marko Vendelin <markov@ioc.ee>
1006 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1007 stock menu item using action numerical value, not its string
1011 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1013 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1014 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1016 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1018 * src/frontends/xforms/GUIRunTime.C: new file
1020 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1021 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1023 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1025 * src/frontends/kde/GUIRunTime.C: new file
1027 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1028 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1030 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1032 * src/frontends/gnome/GUIRunTime.C: new file
1034 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1037 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1038 small change to documetentation.
1040 * src/frontends/GUIRunTime.C: removed file
1042 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1044 * src/lyxparagraph.h: enable NEW_TABULAR as default
1046 * src/lyxfunc.C (processKeySym): remove some commented code
1048 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1049 NEW_TABULAR around the fd_form_table_options.
1051 * src/lyx_gui.C (runTime): call the static member function as
1052 GUIRunTime::runTime().
1054 2000-08-21 Allan Rae <rae@lyx.org>
1056 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1059 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1061 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1063 2000-08-21 Allan Rae <rae@lyx.org>
1065 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1066 keep Garst happy ;-)
1067 * src/frontends/xforms/FormPreferences.C (build): use setOK
1068 * src/frontends/xforms/FormDocument.C (build): use setOK
1069 (FormDocument): use the appropriate policy.
1071 2000-08-21 Allan Rae <rae@lyx.org>
1073 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1074 automatic [de]activation of arbitrary objects when in a read-only state.
1076 * src/frontends/ButtonPolicies.h: More documentation
1077 (isReadOnly): added to support the above.
1079 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1081 2000-08-18 Juergen Vigna <jug@sad.it>
1083 * src/insets/insettabular.C (getStatus): changed to return func_status.
1085 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1086 display toggle menu entries if they are.
1088 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1089 new document layout now.
1091 * src/lyxfunc.C: ditto
1093 * src/lyx_gui_misc.C: ditto
1095 * src/lyx_gui.C: ditto
1097 * lib/ui/default.ui: removed paper and quotes layout as they are now
1098 all in the document layout tabbed folder.
1100 * src/frontends/xforms/forms/form_document.fd: added Restore
1101 button and callbacks for all inputs for Allan's ButtonPolicy.
1103 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1104 (CheckChoiceClass): added missing params setting on class change.
1105 (UpdateLayoutDocument): added for updating the layout on params.
1106 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1107 (FormDocument): Implemented Allan's ButtonPolicy with the
1110 2000-08-17 Allan Rae <rae@lyx.org>
1112 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1113 so we can at least see the credits again.
1115 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1116 controller calls for the appropriate callbacks. Note that since Ok
1117 calls apply followed by cancel, and apply isn't a valid input for the
1118 APPLIED state, the bc_ calls have to be made in the static callback not
1119 within each of the real callbacks.
1121 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1122 (setOk): renamed from setOkay()
1124 2000-08-17 Juergen Vigna <jug@sad.it>
1126 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1127 in the implementation part.
1128 (composeUIInfo): don't show optional menu-items.
1130 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1132 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1134 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1135 text-state when in a text-inset.
1137 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1139 2000-08-17 Marko Vendelin <markov@ioc.ee>
1140 * src/frontends/gnome/FormIndex.C
1141 * src/frontends/gnome/FormIndex.h
1142 * src/frontends/gnome/FormToc.C
1143 * src/frontends/gnome/FormToc.h
1144 * src/frontends/gnome/dialogs
1145 * src/frontends/gnome/diatoc_callbacks.c
1146 * src/frontends/gnome/diatoc_callbacks.h
1147 * src/frontends/gnome/diainsertindex_callbacks.h
1148 * src/frontends/gnome/diainsertindex_callbacks.c
1149 * src/frontends/gnome/diainsertindex_interface.c
1150 * src/frontends/gnome/diainsertindex_interface.h
1151 * src/frontends/gnome/diatoc_interface.h
1152 * src/frontends/gnome/diatoc_interface.c
1153 * src/frontends/gnome/Makefile.am: Table of Contents and
1154 Insert Index dialogs implementation for Gnome frontend
1156 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1158 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1160 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1163 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1165 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1166 destructor. Don't definde if you don't need it
1167 (processEvents): made static, non-blocking events processing for
1169 (runTime): static method. event loop for xforms
1170 * similar as above for kde and gnome.
1172 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1173 new Pimpl is correct
1174 (runTime): new method calss the real frontends runtime func.
1176 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1178 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1180 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1182 2000-08-16 Juergen Vigna <jug@sad.it>
1184 * src/lyx_gui.C (runTime): added GUII RunTime support.
1186 * src/frontends/Makefile.am:
1187 * src/frontends/GUIRunTime.[Ch]:
1188 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1189 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1190 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1192 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1194 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1195 as this is already set in ${FRONTEND_INCLUDE} if needed.
1197 * configure.in (CPPFLAGS): setting the include dir for the frontend
1198 directory and don't set FRONTEND=xforms for now as this is executed
1201 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1203 * src/frontends/kde/Makefile.am:
1204 * src/frontends/kde/FormUrl.C:
1205 * src/frontends/kde/FormUrl.h:
1206 * src/frontends/kde/formurldialog.h:
1207 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1209 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1211 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1213 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1215 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1218 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1220 * src/WorkArea.C (work_area_handler): more work to get te
1221 FL_KEYBOARD to work with xforms 0.88 too, please test.
1223 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1225 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1227 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1230 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1232 * src/Timeout.h: remove Qt::emit hack.
1234 * several files: changes to allo doc++ compilation
1236 * src/lyxfunc.C (processKeySym): new method
1237 (processKeyEvent): comment out if FL_REVISION < 89
1239 * src/WorkArea.C: change some debugging levels.
1240 (WorkArea): set wantkey to FL_KEY_ALL
1241 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1242 clearer code and the use of compose with XForms 0.89. Change to
1243 use signals instead of calling methods in bufferview directly.
1245 * src/Painter.C: change some debugging levels.
1247 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1250 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1251 (workAreaKeyPress): new method
1253 2000-08-14 Juergen Vigna <jug@sad.it>
1255 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1257 * config/kde.m4: addes some features
1259 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1260 include missing xforms dialogs.
1262 * src/Timeout.h: a hack to be able to compile with qt/kde.
1264 * sigc++/.cvsignore: added acinclude.m4
1266 * lib/.cvsignore: added listerros
1268 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1269 xforms tree as objects are needed for other frontends.
1271 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1272 linking with not yet implemented xforms objects.
1274 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1276 2000-08-14 Baruch Even <baruch.even@writeme.com>
1278 * src/frontends/xforms/FormGraphics.h:
1279 * src/frontends/xforms/FormGraphics.C:
1280 * src/frontends/xforms/RadioButtonGroup.h:
1281 * src/frontends/xforms/RadioButtonGroup.C:
1282 * src/insets/insetgraphics.h:
1283 * src/insets/insetgraphics.C:
1284 * src/insets/insetgraphicsParams.h:
1285 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1286 instead of spaces, and various other indentation issues to make the
1287 sources more consistent.
1289 2000-08-14 Marko Vendelin <markov@ioc.ee>
1291 * src/frontends/gnome/dialogs/diaprint.glade
1292 * src/frontends/gnome/FormPrint.C
1293 * src/frontends/gnome/FormPrint.h
1294 * src/frontends/gnome/diaprint_callbacks.c
1295 * src/frontends/gnome/diaprint_callbacks.h
1296 * src/frontends/gnome/diaprint_interface.c
1297 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1300 * src/frontends/gnome/dialogs/diainserturl.glade
1301 * src/frontends/gnome/FormUrl.C
1302 * src/frontends/gnome/FormUrl.h
1303 * src/frontends/gnome/diainserturl_callbacks.c
1304 * src/frontends/gnome/diainserturl_callbacks.h
1305 * src/frontends/gnome/diainserturl_interface.c
1306 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1307 Gnome implementation
1309 * src/frontends/gnome/Dialogs.C
1310 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1311 all other dialogs. Copy all unimplemented dialogs from Xforms
1314 * src/frontends/gnome/support.c
1315 * src/frontends/gnome/support.h: support files generated by Glade
1319 * config/gnome.m4: Gnome configuration scripts
1321 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1322 configure --help message
1324 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1325 only if there are no events pendling in Gnome/Gtk. This enhances
1326 the performance of menus.
1329 2000-08-14 Allan Rae <rae@lyx.org>
1331 * lib/Makefile.am: listerrors cleaning
1333 * lib/listerrors: removed -- generated file
1334 * acinclude.m4: ditto
1335 * sigc++/acinclude.m4: ditto
1337 * src/frontends/xforms/forms/form_citation.fd:
1338 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1341 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1342 `updatesrc` and now we have a `test` target that does what `updatesrc`
1343 used to do. I didn't like having an install target that wasn't related
1346 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1347 on all except FormGraphics. This may yet happen. Followed by a major
1348 cleanup including using FL_TRANSIENT for most of the dialogs. More
1349 changes to come when the ButtonController below is introduced.
1351 * src/frontends/xforms/ButtonController.h: New file for managing up to
1352 four buttons on a dialog according to an externally defined policy.
1353 * src/frontends/xforms/Makefile.am: added above
1355 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1356 Apply and Cancel/Close buttons and everything in between and beyond.
1357 * src/frontends/Makefile.am: added above.
1359 * src/frontends/xforms/forms/form_preferences.fd:
1360 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1361 and removed variable 'status' as a result. Fixed the set_minsize thing.
1362 Use the new screen-font-update after checking screen fonts were changed
1363 Added a "Restore" button to restore the original lyxrc values while
1364 editing. This restores everything not just the last input changed.
1365 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1367 * src/LyXAction.C: screen-font-update added for updating buffers after
1368 screen font settings have been changed.
1369 * src/commandtags.h: ditto
1370 * src/lyxfunc.C: ditto
1372 * forms/lyx.fd: removed screen fonts dialog.
1373 * src/lyx_gui.C: ditto
1374 * src/menus.[Ch]: ditto
1375 * src/lyx.[Ch]: ditto
1376 * src/lyx_cb.C: ditto + code from here moved to make
1377 screen-font-update. And people wonder why progress on GUII is
1378 slow. Look at how scattered this stuff was! It takes forever
1381 * forms/fdfix.sh: Fixup the spacing after commas.
1382 * forms/makefile: Remove date from generated files. Fewer clashes now.
1383 * forms/bullet_forms.C.patch: included someones handwritten changes
1385 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1386 once I've discovered why LyXRC was made noncopyable.
1387 * src/lyx_main.C: ditto
1389 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1391 * src/frontends/xforms/forms/fdfix.sh:
1392 * src/frontends/xforms/forms/fdfixh.sed:
1393 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1394 * src/frontends/xforms/Form*.[hC]:
1395 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1396 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1397 provide a destructor for the struct FD_form_xxxx. Another version of
1398 the set_[max|min]size workaround and a few other cleanups. Actually,
1399 Angus' patch from 20000809.
1401 2000-08-13 Baruch Even <baruch.even@writeme.com>
1403 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1406 2000-08-11 Juergen Vigna <jug@sad.it>
1408 * src/insets/insetgraphics.C (InsetGraphics): changing init
1409 order because of warnings.
1411 * src/frontends/xforms/forms/makefile: adding patching .C with
1414 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1415 from .C.patch to .c.patch
1417 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1418 order because of warning.
1420 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1422 * src/frontends/Liason.C (setMinibuffer): new helper function
1424 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1426 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1428 * lib/ui/default.ui: commented out PaperLayout entry
1430 * src/frontends/xforms/form_document.[Ch]: new added files
1432 * src/frontends/xforms/FormDocument.[Ch]: ditto
1434 * src/frontends/xforms/forms/form_document.fd: ditto
1436 * src/frontends/xforms/forms/form_document.C.patch: ditto
1438 2000-08-10 Juergen Vigna <jug@sad.it>
1440 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1441 (InsetGraphics): initialized cacheHandle to 0.
1442 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1444 2000-08-10 Baruch Even <baruch.even@writeme.com>
1446 * src/graphics/GraphicsCache.h:
1447 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1448 correctly as a cache.
1450 * src/graphics/GraphicsCacheItem.h:
1451 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1454 * src/graphics/GraphicsCacheItem_pimpl.h:
1455 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1458 * src/insets/insetgraphics.h:
1459 * src/insets/insetgraphics.C: Changed from using a signal notification
1460 to polling when image is not loaded.
1462 2000-08-10 Allan Rae <rae@lyx.org>
1464 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1465 that there are two functions that have to been taken out of line by
1466 hand and aren't taken care of in the script. (Just a reminder note)
1468 * sigc++/macros/*.h.m4: Updated as above.
1470 2000-08-09 Juergen Vigna <jug@sad.it>
1472 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1474 * src/insets/insettabular.C: make drawing of single cell smarter.
1476 2000-08-09 Marko Vendelin <markov@ioc.ee>
1477 * src/frontends/gnome/Menubar_pimpl.C
1478 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1479 implementation: new files
1481 * src/frontends/gnome/mainapp.C
1482 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1485 * src/main.C: create Gnome main window
1487 * src/frontends/xforms/Menubar_pimpl.h
1488 * src/frontends/Menubar.C
1489 * src/frontends/Menubar.h: added method Menubar::update that calls
1490 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1492 * src/LyXView.C: calls Menubar::update to update the state
1495 * src/frontends/gnome/Makefile.am: added new files
1497 * src/frontends/Makefile.am: added frontend compiler options
1499 2000-08-08 Juergen Vigna <jug@sad.it>
1501 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1503 * src/bufferlist.C (close):
1504 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1505 documents if exiting without saving.
1507 * src/buffer.C (save): use removeAutosaveFile()
1509 * src/support/filetools.C (removeAutosaveFile): new function.
1511 * src/lyx_cb.C (MenuWrite): returns a bool now.
1512 (MenuWriteAs): check if file could really be saved and revert to the
1514 (MenuWriteAs): removing old autosavefile if existant.
1516 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1517 before Goto toggle declaration, because of compiler warning.
1519 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1521 * src/lyxfunc.C (MenuNew): small fix.
1523 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1525 * src/bufferlist.C (newFile):
1526 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1528 * src/lyxrc.C: added new_ask_filename tag
1530 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1532 * src/lyx.fd: removed code pertaining to form_ref
1533 * src/lyx.[Ch]: ditto
1534 * src/lyx_cb.C: ditto
1535 * src/lyx_gui.C: ditto
1536 * src/lyx_gui_misc.C: ditto
1538 * src/BufferView_pimpl.C (restorePosition): update buffer only
1541 * src/commandtags.h (LFUN_REFTOGGLE): removed
1542 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1543 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1544 (LFUN_REFBACK): renamed LFUN_REF_BACK
1546 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1547 * src/menus.C: ditto
1548 * src/lyxfunc.C (Dispatch): ditto.
1549 InsertRef dialog is now GUI-independent.
1551 * src/texrow.C: added using std::endl;
1553 * src/insets/insetref.[Ch]: strip out large amounts of code.
1554 The inset is now a container and this functionality is now
1555 managed by a new FormRef dialog
1557 * src/frontends/Dialogs.h (showRef, createRef): new signals
1559 * src/frontends/xforms/FormIndex.[Ch],
1560 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1561 when setting dialog's min/max size
1562 * src/frontends/xforms/FormIndex.[Ch]: ditto
1564 * src/frontends/xforms/FormRef.[Ch],
1565 src/frontends/xforms/forms/form_ref.fd: new xforms
1566 implementation of an InsetRef dialog
1568 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1571 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1572 ios::nocreate is not part of the standard. Removed.
1574 2000-08-07 Baruch Even <baruch.even@writeme.com>
1576 * src/graphics/Renderer.h:
1577 * src/graphics/Renderer.C: Added base class for rendering of different
1578 image formats into Pixmaps.
1580 * src/graphics/XPM_Renderer.h:
1581 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1582 in a different class.
1584 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1585 easily add support for other formats.
1587 * src/insets/figinset.C: plugged a leak of an X resource.
1589 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1591 * src/CutAndPaste.[Ch]: make all metods static.
1593 * development/Code_rules/Rules: more work, added section on
1594 Exceptions, and a References section.
1596 * a lot of header files: work to make doc++ able to generate the
1597 source documentation, some workarounds of doc++ problems. Doc++ is
1598 now able to generate the documentation.
1600 2000-08-07 Juergen Vigna <jug@sad.it>
1602 * src/insets/insettabular.C (recomputeTextInsets): removed function
1604 * src/tabular.C (SetWidthOfMulticolCell):
1606 (calculate_width_of_column_NMC): fixed return value so that it really
1607 only returns true if the column-width has changed (there where
1608 problems with muliticolumn-cells in this column).
1610 2000-08-04 Juergen Vigna <jug@sad.it>
1612 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1613 also on the scrollstatus of the inset.
1614 (workAreaMotionNotify): ditto.
1616 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1618 2000-08-01 Juergen Vigna <jug@sad.it>
1620 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1622 * src/commandtags.h:
1623 * src/LyXAction.C (init):
1624 * src/insets/inset.C (LocalDispatch): added support for
1627 * src/insets/inset.C (scroll): new functions.
1629 * src/insets/insettext.C (removeNewlines): new function.
1630 (SetAutoBreakRows): removes forced newlines in the text of the
1631 paragraph if autoBreakRows is set to false.
1633 * src/tabular.C (Latex): generates a parbox around the cell contents
1636 * src/frontends/xforms/FormTabular.C (local_update): removed
1637 the radio_useparbox button.
1639 * src/tabular.C (UseParbox): new function
1641 2000-08-06 Baruch Even <baruch.even@writeme.com>
1643 * src/graphics/GraphicsCache.h:
1644 * src/graphics/GraphicsCache.C:
1645 * src/graphics/GraphicsCacheItem.h:
1646 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1649 * src/insets/insetgraphics.h:
1650 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1651 drawing of the inline image.
1653 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1654 into the wrong position.
1656 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1659 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1661 * src/support/translator.h: move all typedefs to public section
1663 * src/support/filetools.C (MakeLatexName): return string const
1665 (TmpFileName): ditto
1666 (FileOpenSearch): ditto
1668 (LibFileSearch): ditto
1669 (i18nLibFileSearch): ditto
1672 (CreateTmpDir): ditto
1673 (CreateBufferTmpDir): ditto
1674 (CreateLyXTmpDir): ditto
1677 (MakeAbsPath): ditto
1679 (OnlyFilename): ditto
1681 (NormalizePath): ditto
1682 (CleanupPath): ditto
1683 (GetFileContents): ditto
1684 (ReplaceEnvironmentPath): ditto
1685 (MakeRelPath): ditto
1687 (ChangeExtension): ditto
1688 (MakeDisplayPath): ditto
1689 (do_popen): return cmdret const
1690 (findtexfile): return string const
1692 * src/support/DebugStream.h: add some /// to please doc++
1694 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1696 * src/texrow.C (same_rownumber): functor to use with find_if
1697 (getIdFromRow): rewritten to use find_if and to not update the
1698 positions. return true if row is found
1699 (increasePos): new method, use to update positions
1701 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1703 * src/lyxlex_pimpl.C (verifyTable): new method
1706 (GetString): return string const
1707 (pushTable): rewrite to use std::stack
1709 (setFile): better check
1712 * src/lyxlex.h: make LyXLex noncopyable
1714 * src/lyxlex.C (text): return char const * const
1715 (GetString): return string const
1716 (getLongString): return string const
1718 * src/lyx_gui_misc.C (askForText): return pair<...> const
1720 * src/lastfiles.[Ch] (operator): return string const
1722 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1723 istringstream not char const *.
1724 move token.end() out of loop.
1725 (readFile): move initializaton of token
1727 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1728 getIdFromRow is successful.
1730 * lib/bind/emacs.bind: don't include menus bind
1732 * development/Code_rules/Rules: the beginnings of making this
1733 better and covering more of the unwritten rules that we have.
1735 * development/Code_rules/Recommendations: a couple of wording
1738 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1740 * src/support/strerror.c: remove C++ comment.
1742 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1744 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1745 LFUN_INDEX_INSERT_LAST
1747 * src/texrow.C (getIdFromRow): changed from const_iterator to
1748 iterator, allowing code to compile with DEC cxx
1750 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1751 stores part of the class, as suggested by Allan. Will allow
1753 (apply): test to apply uses InsetCommandParams operator!=
1755 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1756 (apply): test to apply uses InsetCommandParams operator!=
1758 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1759 stores part of the class.
1760 (update): removed limits on min/max size.
1762 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1763 (apply): test to apply uses InsetCommandParams operator!=
1765 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1766 (Read, Write, scanCommand, getCommand): moved functionality
1767 into InsetCommandParams.
1769 (getScreenLabel): made pure virtual
1770 new InsetCommandParams operators== and !=
1772 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1773 c-tors based on InsetCommandParams. Removed others.
1774 * src/insets/insetinclude.[Ch]: ditto
1775 * src/insets/insetlabel.[Ch]: ditto
1776 * src/insets/insetparent.[Ch]: ditto
1777 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1779 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1780 insets derived from InsetCommand created using similar c-tors
1781 based on InsetCommandParams
1782 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1783 * src/menus.C (ShowRefsMenu): ditto
1784 * src/paragraph.C (Clone): ditto
1785 * src/text2.C (SetCounter): ditto
1786 * src/lyxfunc.C (Dispatch) ditto
1787 Also recreated old InsetIndex behaviour exactly. Can now
1788 index-insert at the start of a paragraph and index-insert-last
1789 without launching the pop-up.
1791 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1793 * lib/lyxrc.example: mark te pdf options as non functional.
1795 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1796 (isStrDbl): move tmpstr.end() out of loop.
1797 (strToDbl): move intialization of tmpstr
1798 (lowercase): return string const and move tmp.end() out of loop.
1799 (uppercase): return string const and move tmp.edn() out of loop.
1800 (prefixIs): add assertion
1805 (containsOnly): ditto
1806 (containsOnly): ditto
1807 (containsOnly): ditto
1808 (countChar): make last arg char not char const
1809 (token): return string const
1810 (subst): return string const, move tmp.end() out of loop.
1811 (subst): return string const, add assertion
1812 (strip): return string const
1813 (frontStrip): return string const, add assertion
1814 (frontStrip): return string const
1819 * src/support/lstrings.C: add inclde "LAssert.h"
1820 (isStrInt): move tmpstr.end() out of loop.
1822 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1823 toollist.end() out of loop.
1824 (deactivate): move toollist.end() out of loop.
1825 (update): move toollist.end() out of loop.
1826 (updateLayoutList): move tc.end() out of loop.
1827 (add): move toollist.end() out of loop.
1829 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1830 md.end() out of loop.
1832 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1834 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1837 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1838 (Erase): move insetlist.end() out of loop.
1840 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1841 ref to const string as first arg. Move initialization of some
1842 variables, whitespace changes.
1844 * src/kbmap.C (defkey): move table.end() out of loop.
1845 (kb_keymap): move table.end() out of loop.
1846 (findbinding): move table.end() out of loop.
1848 * src/MenuBackend.C (hasMenu): move end() out of loop.
1849 (getMenu): move end() out of loop.
1850 (getMenu): move menulist_.end() out of loop.
1852 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1854 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1857 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1858 (getFromLyXName): move infotab.end() out of loop.
1860 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1861 -fvtable-thunks -ffunction-sections -fdata-sections
1863 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1865 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1868 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1870 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1872 * src/frontends/xforms/FormCitation.[Ch],
1873 src/frontends/xforms/FormIndex.[Ch],
1874 src/frontends/xforms/FormToc.[Ch],
1875 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1877 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1879 * src/commandtags.h: renamed, created some flags for citation
1882 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1884 * src/lyxfunc.C (dispatch): use signals to insert index entry
1886 * src/frontends/Dialogs.h: new signal createIndex
1888 * src/frontends/xforms/FormCommand.[Ch],
1889 src/frontends/xforms/FormCitation.[Ch],
1890 src/frontends/xforms/FormToc.[Ch],
1891 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1893 * src/insets/insetindex.[Ch]: GUI-independent
1895 * src/frontends/xforms/FormIndex.[Ch],
1896 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1899 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1901 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1902 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1904 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1906 * src/insets/insetref.C (Latex): rewrite so that there is now
1907 question that a initialization is requested.
1909 * src/insets/insetcommand.h: reenable the hide signal
1911 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1913 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1914 fix handling of shortcuts (many bugs :)
1915 (add_lastfiles): ditto.
1917 * lib/ui/default.ui: fix a few shortcuts.
1919 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1921 * Makefile.am: Fix ``rpmdist'' target to return the exit
1922 status of the ``rpm'' command, instead of the last command in
1923 the chain (the ``rm lyx.xpm'' command, which always returns
1926 2000-08-02 Allan Rae <rae@lyx.org>
1928 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1929 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1930 * src/frontends/xforms/FormToc.C (FormToc): ditto
1932 * src/frontends/xforms/Makefile.am: A few forgotten files
1934 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1935 Signals-not-copyable-problem Lars' started commenting out.
1937 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1939 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1941 * src/insets/insetcommand.h: Signals is not copyable so anoter
1942 scheme for automatic hiding of forms must be used.
1944 * src/frontends/xforms/FormCitation.h: don't inerit from
1945 noncopyable, FormCommand already does that.
1946 * src/frontends/xforms/FormToc.h: ditto
1947 * src/frontends/xforms/FormUrl.h: ditto
1949 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1951 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1953 * src/insets/insetcommand.h (hide): new SigC::Signal0
1954 (d-tor) new virtual destructor emits hide signal
1956 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1957 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1959 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1960 LOF and LOT. Inset is now GUI-independent
1962 * src/insets/insetloa.[Ch]: redundant
1963 * src/insets/insetlof.[Ch]: ditto
1964 * src/insets/insetlot.[Ch]: ditto
1966 * src/frontends/xforms/forms/form_url.fd: tweaked!
1967 * src/frontends/xforms/forms/form_citation.fd: ditto
1969 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1970 dialogs dealing with InsetCommand insets
1972 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1973 FormCommand base class
1974 * src/frontends/xforms/FormUrl.[Ch]: ditto
1976 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1978 * src/frontends/xforms/FormToc.[Ch]: ditto
1980 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1981 passed a generic InsetCommand pointer
1982 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1984 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1985 and modified InsetTOC class
1986 * src/buffer.C: ditto
1988 * forms/lyx.fd: strip out old FD_form_toc code
1989 * src/lyx_gui_misc.C: ditto
1990 * src/lyx_gui.C: ditto
1991 * src/lyx_cb.C: ditto
1992 * src/lyx.[Ch]: ditto
1994 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1996 * src/support/utility.hpp: tr -d '\r'
1998 2000-08-01 Juergen Vigna <jug@sad.it>
2000 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2002 * src/commandtags.h:
2003 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2004 LFUN_TABULAR_FEATURES.
2006 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2007 LFUN_LAYOUT_TABULAR.
2009 * src/insets/insettabular.C (getStatus): implemented helper function.
2011 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2013 2000-07-31 Juergen Vigna <jug@sad.it>
2015 * src/text.C (draw): fixed screen update problem for text-insets.
2017 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2018 something changed probably this has to be added in various other
2021 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2023 2000-07-31 Baruch Even <baruch.even@writeme.com>
2025 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2026 templates to satisfy compaq cxx.
2029 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2031 * src/support/translator.h (equal_1st_in_pair::operator()): take
2032 const ref pair_type as arg.
2033 (equal_2nd_in_pair::operator()): ditto
2034 (Translator::~Translator): remove empty d-tor.
2036 * src/graphics/GraphicsCache.C: move include config.h to top, also
2037 put initialization of GraphicsCache::singleton here.
2038 (~GraphicsCache): move here
2039 (addFile): take const ref as arg
2042 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2044 * src/BufferView2.C (insertLyXFile): change te with/without header
2047 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2049 * src/frontends/xforms/FormGraphics.C (apply): add some
2050 static_cast. Not very nice, but required by compaq cxx.
2052 * src/frontends/xforms/RadioButtonGroup.h: include header
2053 <utility> instead of <pair.h>
2055 * src/insets/insetgraphicsParams.C: add using directive.
2056 (readResize): change return type to void.
2057 (readOrigin): ditto.
2059 * src/lyxfunc.C (getStatus): add missing break for build-program
2060 function; add test for Literate for export functions.
2062 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2063 entries in Options menu.
2065 2000-07-31 Baruch Even <baruch.even@writeme.com>
2067 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2068 protect against auto-allocation; release icon when needed.
2070 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2072 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2073 on usual typewriter.
2075 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2076 earlier czech.kmap), useful only for programming.
2078 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2080 * src/frontends/xforms/FormCitation.h: fix conditioning around
2083 2000-07-31 Juergen Vigna <jug@sad.it>
2085 * src/frontends/xforms/FormTabular.C (local_update): changed
2086 radio_linebreaks to radio_useparbox and added radio_useminipage.
2088 * src/tabular.C: made support for using minipages/parboxes.
2090 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2092 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2094 (descent): so the cursor is in the middle.
2095 (width): bit smaller box.
2097 * src/insets/insetgraphics.h: added display() function.
2099 2000-07-31 Baruch Even <baruch.even@writeme.com>
2101 * src/frontends/Dialogs.h: Added showGraphics signals.
2103 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2104 xforms form definition of the graphics dialog.
2106 * src/frontends/xforms/FormGraphics.h:
2107 * src/frontends/xforms/FormGraphics.C: Added files, the
2108 GUIndependent code of InsetGraphics
2110 * src/insets/insetgraphics.h:
2111 * src/insets/insetgraphics.C: Major writing to make it work.
2113 * src/insets/insetgraphicsParams.h:
2114 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2115 struct between InsetGraphics and GUI.
2117 * src/LaTeXFeatures.h:
2118 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2119 support for graphicx package.
2121 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2122 for the graphics inset.
2124 * src/support/translator.h: Added file, used in
2125 InsetGraphicsParams. this is a template to translate between two
2128 * src/frontends/xforms/RadioButtonGroup.h:
2129 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2130 way to easily control a radio button group.
2132 2000-07-28 Juergen Vigna <jug@sad.it>
2134 * src/insets/insettabular.C (LocalDispatch):
2135 (TabularFeatures): added support for lyx-functions of tabular features.
2136 (cellstart): refixed this function after someone wrongly changed it.
2138 * src/commandtags.h:
2139 * src/LyXAction.C (init): added support for tabular-features
2141 2000-07-28 Allan Rae <rae@lyx.org>
2143 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2144 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2145 triggers the callback for input checking. As a result we sometimes get
2146 "LyX: This shouldn't happen..." printed to cerr.
2147 (input): Started using status variable since I only free() on
2148 destruction. Some input checking for paths and font sizes.
2150 * src/frontends/xforms/FormPreferences.h: Use status to control
2151 activation of Ok and Apply
2153 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2154 callback. Also resized to stop segfaults with 0.88. The problem is
2155 that xforms-0.88 requires the folder to be wide enough to fit all the
2156 tabs. If it isn't it causes all sorts of problems.
2158 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2160 * src/frontends/xforms/forms/README: Reflect reality.
2162 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2163 * src/frontends/xforms/forms/makefile: ditto.
2165 * src/commandtags.h: Get access to new Preferences dialog
2166 * src/LyXAction.C: ditto
2167 * src/lyxfunc.C: ditto
2168 * lib/ui/default.ui: ditto
2170 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2172 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2174 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2177 * src/frontends/xforms/form_url.[Ch]: added.
2179 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2181 * src/insets/insetbib.h: fixed bug in previous commit
2183 * src/frontends/xforms/FormUrl.h: ditto
2185 * src/frontends/xforms/FormPrint.h: ditto
2187 * src/frontends/xforms/FormPreferences.h: ditto
2189 * src/frontends/xforms/FormCopyright.h: ditto
2191 * src/frontends/xforms/FormCitation.C: ditto
2193 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2194 private copyconstructor and private default contructor
2196 * src/support/Makefile.am: add utility.hpp
2198 * src/support/utility.hpp: new file from boost
2200 * src/insets/insetbib.h: set owner in clone
2202 * src/frontends/xforms/FormCitation.C: added missing include
2205 * src/insets/form_url.[Ch]: removed
2207 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2209 * development/lyx.spec.in
2210 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2211 file/directory re-organization.
2213 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2215 * src/insets/insetcommand.[Ch]: moved the string data and
2216 associated manipulation methods into a new stand-alone class
2217 InsetCommandParams. This class has two additional methods
2218 getAsString() and setFromString() allowing the contents to be
2219 moved around as a single string.
2220 (addContents) method removed.
2221 (setContents) method no longer virtual.
2223 * src/buffer.C (readInset): made use of new InsetCitation,
2224 InsetUrl constructors based on InsetCommandParams.
2226 * src/commandtags.h: add LFUN_INSERT_URL
2228 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2229 independent InsetUrl and use InsetCommandParams to extract
2230 string info and create new Insets.
2232 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2234 * src/frontends/xforms/FormCitation.C (apply): uses
2237 * src/frontends/xforms/form_url.C
2238 * src/frontends/xforms/form_url.h
2239 * src/frontends/xforms/FormUrl.h
2240 * src/frontends/xforms/FormUrl.C
2241 * src/frontends/xforms/forms/form_url.fd: new files
2243 * src/insets/insetcite.[Ch]: removed unused constructors.
2245 * src/insets/insetinclude.[Ch]: no longer store filename
2247 * src/insets/inseturl.[Ch]: GUI-independent.
2249 2000-07-26 Juergen Vigna <jug@sad.it>
2250 * renamed frontend from gtk to gnome as it is that what is realized
2251 and did the necessary changes in the files.
2253 2000-07-26 Marko Vendelin <markov@ioc.ee>
2255 * configure.in: cleaning up gnome configuration scripts
2257 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2259 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2260 shortcuts syndrom by redrawing them explicitely (a better solution
2261 would be appreciated).
2263 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2265 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2268 * src/lyx_cb.C (MenuExport): change html export to do the right
2269 thing depending of the document type (instead of having
2270 html-linuxdoc and html-docbook).
2271 * src/lyxfunc.C (getStatus): update for html
2272 * lib/ui/default.ui: simplify due to the above change.
2273 * src/menus.C (ShowFileMenu): update too (in case we need it).
2275 * src/MenuBackend.C (read): if a menu is defined twice, add the
2276 new entries to the exiting one.
2278 2000-07-26 Juergen Vigna <jug@sad.it>
2280 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2282 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2283 and return a bool if it did actual save the file.
2284 (AutoSave): don't autosave a unnamed doc.
2286 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2287 check if this is an UNNAMED new file and react to it.
2288 (newFile): set buffer to unnamed and change to not mark a new
2289 buffer dirty if I didn't do anything with it.
2291 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2293 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2295 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2296 friend as per Angus's patch posted to lyx-devel.
2298 * src/ext_l10n.h: updated
2300 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2301 gettext on the style string right before inserting them into the
2304 * autogen.sh: add code to extract style strings form layout files,
2305 not good enough yet.
2307 * src/frontends/gtk/.cvsignore: add MAKEFILE
2309 * src/MenuBackend.C (read): run the label strings through gettext
2310 before storing them in the containers.
2312 * src/ext_l10n.h: new file
2314 * autogen.sh : generate the ext_l10n.h file here
2316 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2318 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2321 * lib/ui/default.ui: fix a couple of typos.
2323 * config/gnome/gtk.m4: added (and added to the list of files in
2326 * src/insets/insetinclude.C (unique_id): fix when we are using
2327 lyxstring instead of basic_string<>.
2328 * src/insets/insettext.C (LocalDispatch): ditto.
2329 * src/support/filetools.C: ditto.
2331 * lib/configure.m4: create the ui/ directory if necessary.
2333 * src/LyXView.[Ch] (updateToolbar): new method.
2335 * src/BufferView_pimpl.C (buffer): update the toolbar when
2336 opening/closing buffer.
2338 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2340 * src/LyXAction.C (getActionName): enhance to return also the name
2341 and options of pseudo-actions.
2342 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2344 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2345 as an example of what is possible). Used in File->Build too (more
2346 useful) and in the import/export menus (to mimick the complicated
2347 handling of linuxdoc and friends). Try to update all the entries.
2349 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2352 * src/MenuBackend.C (read): Parse the new OptItem tag.
2354 * src/MenuBackend.h: Add a new optional_ data member (used if the
2355 entry should be omitted when the lyxfunc is disabled).
2357 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2358 function, used as a shortcut.
2359 (create_submenu): align correctly the shortcuts on the widest
2362 * src/MenuBackend.h: MenuItem.label() only returns the label of
2363 the menu without shortcut; new method shortcut().
2365 2000-07-14 Marko Vendelin <markov@ioc.ee>
2367 * src/frontends/gtk/Dialogs.C:
2368 * src/frontends/gtk/FormCopyright.C:
2369 * src/frontends/gtk/FormCopyright.h:
2370 * src/frontends/gtk/Makefile.am: added these source-files for the
2371 Gtk/Gnome support of the Copyright-Dialog.
2373 * src/main.C: added Gnome::Main initialization if using
2374 Gtk/Gnome frontend-GUI.
2376 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2378 * config/gnome/aclocal-include.m4
2379 * config/gnome/compiler-flags.m4
2380 * config/gnome/curses.m4
2381 * config/gnome/gnome--.m4
2382 * config/gnome/gnome-bonobo-check.m4
2383 * config/gnome/gnome-common.m4
2384 * config/gnome/gnome-fileutils.m4
2385 * config/gnome/gnome-ghttp-check.m4
2386 * config/gnome/gnome-gnorba-check.m4
2387 * config/gnome/gnome-guile-checks.m4
2388 * config/gnome/gnome-libgtop-check.m4
2389 * config/gnome/gnome-objc-checks.m4
2390 * config/gnome/gnome-orbit-check.m4
2391 * config/gnome/gnome-print-check.m4
2392 * config/gnome/gnome-pthread-check.m4
2393 * config/gnome/gnome-support.m4
2394 * config/gnome/gnome-undelfs.m4
2395 * config/gnome/gnome-vfs.m4
2396 * config/gnome/gnome-x-checks.m4
2397 * config/gnome/gnome-xml-check.m4
2398 * config/gnome/gnome.m4
2399 * config/gnome/gperf-check.m4
2400 * config/gnome/gtk--.m4
2401 * config/gnome/linger.m4
2402 * config/gnome/need-declaration.m4: added configuration scripts
2403 for Gtk/Gnome frontend-GUI
2405 * configure.in: added support for the --with-frontend=gtk option
2407 * autogen.sh: added config/gnome/* to list of config-files
2409 * acconfig.h: added define for GTKGUI-support
2411 * config/lyxinclude.m4: added --with-frontend[=value] option value
2412 for Gtk/Gnome frontend-GUI support.
2414 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2416 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2420 * src/paragraph.C (GetChar): remove non-const version
2422 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2423 (search_kw): use it.
2425 * src/lyx_main.C (init): if "preferences" exist, read that instead
2427 (ReadRcFile): return bool if the file could be read ok.
2428 (ReadUIFile): add a check to see if lex file is set ok.
2430 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2431 bastring can be used instead of lyxstring (still uses the old code
2432 if std::string is good enough or if lyxstring is used.)
2434 * src/encoding.C: make the arrays static, move ininle functions
2436 * src/encoding.h: from here.
2438 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2439 (parseSingleLyXformat2Token): move inset parsing to separate method
2440 (readInset): new private method
2442 * src/Variables.h: remove virtual from get().
2444 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2445 access to NEW_INSETS and NEW_TABULAR
2447 * src/MenuBackend.h: remove superfluous forward declaration of
2448 MenuItem. Add documentations tags "///", remove empty MenuItem
2449 destructor, remove private default contructor.
2451 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2453 (read): more string mlabel and mname to where they are used
2454 (read): remove unused variables mlabel and mname
2455 (defaults): unconditional clear, make menusetup take advantage of
2456 add returning Menu &.
2458 * src/LyXView.h: define NEW_MENUBAR as default
2460 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2461 to NEW_INSETS and NEW_TABULAR.
2462 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2463 defined. Change some of the "xxxx-inset-insert" functions names to
2466 * several files: more enahncements to NEW_INSETS and the resulting
2469 * lib/lyxrc.example (\date_insert_format): move to misc section
2471 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2472 bastring and use AC_CACHE_CHECK.
2473 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2474 the system have the newest methods. uses AC_CACHE_CHECK
2475 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2476 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2477 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2479 * configure.in: add LYX_CXX_GOOD_STD_STRING
2481 * acinclude.m4: recreated
2483 2000-07-24 Amir Karger
2485 * README: add Hebrew, Arabic kmaps
2488 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2490 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2493 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2495 * Lot of files: add pragma interface/implementation.
2497 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2499 * lib/ui/default.ui: new file (ans new directory). Contains the
2500 default menu and toolbar.
2502 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2503 global space. Toolbars are now read (as menus) in ui files.
2505 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2507 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2508 is disabled because the document is read-only. We want to have the
2509 toggle state of the function anyway.
2510 (getStatus): add code for LFUN_VC* functions (mimicking what is
2511 done in old-style menus)
2513 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2514 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2516 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2517 * src/BufferView_pimpl.C: ditto.
2518 * src/lyxfunc.C: ditto.
2520 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2521 default). This replaces old-style menus by new ones.
2523 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2524 MenuItem. Contain the data structure of a menu.
2526 * src/insets/insettext.C: use LyXView::setLayout instead of
2527 accessing directly the toolbar combox.
2528 * src/lyxfunc.C (Dispatch): ditto.
2530 * src/LyXView.C (setLayout): new method, which just calls
2531 Toolbar::setLayout().
2532 (updateLayoutChoice): move part of this method in Toolbar.
2534 * src/toolbar.[Ch]: removed.
2536 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2537 implementation the toolbar.
2539 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2540 the toolbar. It might make sense to merge it with ToolbarDefaults
2542 (setLayout): new function.
2543 (updateLayoutList): ditto.
2544 (openLayoutList): ditto.
2546 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2547 xforms implementation of the toolbar.
2548 (get_toolbar_func): comment out, since I do not
2549 know what it is good for.
2551 * src/ToolbarDefaults.h: Add the ItemType enum.
2553 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2554 for a list of allocated C strings. Used in Menubar xforms
2555 implementation to avoid memory leaks.
2557 * src/support/lstrings.[Ch] (uppercase): new version taking and
2561 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2562 * lib/bind/emacs.bind: ditto.
2564 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2566 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2567 forward decl of LyXView.
2569 * src/toolbar.C (toolbarItem): moved from toolbar.h
2570 (toolbarItem::clean): ditto
2571 (toolbarItem::~toolbarItem): ditto
2572 (toolbarItem::operator): ditto
2574 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2576 * src/paragraph.h: control the NEW_TABULAR define from here
2578 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2579 USE_TABULAR_INSETS to NEW_TABULAR
2581 * src/ToolbarDefaults.C: add include "lyxlex.h"
2583 * files using the old table/tabular: use NEW_TABULAR to control
2584 compilation of old tabular stuff.
2586 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2589 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2590 planemet in reading of old style floats, fix the \end_deeper
2591 problem when reading old style floats.
2593 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2595 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2597 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2599 * lib/bind/sciword.bind: updated.
2601 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2603 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2604 layout write problem
2606 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2608 * src/Makefile.am (INCLUDES): remove image directory from include
2611 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2612 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2614 * src/LyXView.C (create_form_form_main): read the application icon
2617 * lib/images/*.xpm: change the icons to use transparent color for
2620 * src/toolbar.C (update): change the color of the button when it
2623 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2625 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2626 setting explicitely the minibuffer.
2627 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2629 * src/LyXView.C (showState): new function. Shows font information
2630 in minibuffer and update toolbar state.
2631 (LyXView): call Toolbar::update after creating the
2634 * src/toolbar.C: change toollist to be a vector instead of a
2636 (BubbleTimerCB): get help string directly from the callback
2637 argument of the corresponding icon (which is the action)
2638 (set): remove unnecessary ugliness.
2639 (update): new function. update the icons (depressed, disabled)
2640 depending of the status of the corresponding action.
2642 * src/toolbar.h: remove help in toolbarItem
2644 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2646 * src/Painter.C (text): Added code for using symbol glyphs from
2647 iso10646 fonts. Currently diabled.
2649 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2652 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2653 magyar,turkish and usorbian.
2655 * src/paragraph.C (isMultiLingual): Made more efficient.
2657 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2660 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2661 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2662 Also changed the prototype to "bool math_insert_greek(char)".
2664 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2666 * lots of files: apply the NEW_INSETS on all code that will not be
2667 needed when we move to use the new insets. Enable the define in
2668 lyxparagrah.h to try it.
2670 * src/insets/insettabular.C (cellstart): change to be a static
2672 (InsetTabular): initialize buffer in the initializer list.
2674 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2676 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2677 form_print.h out of the header file. Replaced with forward
2678 declarations of the relevant struct.
2680 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2683 * src/commandtags.h: do not include "debug.h" which does not
2684 belong there. #include it in some other places because of this
2687 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2689 * src/insets/insetcaption.C: add a couple "using" directives.
2691 * src/toolbar.C (add): get the help text directly from lyxaction.
2693 (setPixmap): new function. Loads from disk and sets a pixmap on a
2694 botton; the name of the pixmap file is derived from the command
2697 * src/toolbar.h: remove members isBitmap and pixmap from
2700 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2701 * lib/images/: move many files from images/banner.xpm.
2703 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2705 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2706 * src/toolbar.C: ditto.
2707 * configure.in: ditto.
2708 * INSTALL: document.
2710 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2711 the spellchecker popup is closed from the WM.
2713 2000-07-19 Juergen Vigna <jug@sad.it>
2715 * src/insets/insetfloat.C (Write): small fix because we use the
2716 insetname for the type now!
2718 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2720 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2723 * src/frontends/Dialogs.h: removed hideCitation signal
2725 * src/insets/insetcite.h: added hide signal
2727 * src/insets/insetcite.C (~InsetCitation): emits new signal
2728 (getScreenLabel): "intelligent" label should now fit on the screen!
2730 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2732 * src/frontends/xforms/FormCitation.C (showInset): connects
2733 hide() to the inset's hide signal
2734 (show): modified to use fl_set_object_position rather than
2735 fl_set_object_geometry wherever possible
2737 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * src/insets/lyxinset.h: add caption code
2741 * src/insets/insetfloat.C (type): new method
2743 * src/insets/insetcaption.C (Write): new method
2745 (LyxCode): new method
2747 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2748 to get it right together with using the FloatList.
2750 * src/commandtags.h: add LFUN_INSET_CAPTION
2751 * src/lyxfunc.C (Dispatch): handle it
2753 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2756 * src/Variables.[Ch]: make expand take a const reference, remove
2757 the destructor, some whitespace changes.
2759 * src/LyXAction.C (init): add caption-inset-insert
2761 * src/FloatList.C (FloatList): update the default floats a bit.
2763 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2765 * src/Variables.[Ch]: new files. Intended to be used for language
2766 specific strings (like \chaptername) and filename substitution in
2769 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2771 * lib/kbd/american.kmap: update
2773 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2775 * src/bufferparams.[Ch]: remove member allowAccents.
2777 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2779 * src/LaTeXLog.C: use the log_form.h header.
2780 * src/lyx_gui.C: ditto.
2781 * src/lyx_gui_misc.C: ditto.
2782 * src/lyxvc.h: ditto.
2784 * forms/log_form.fd: new file, created from latexoptions.fd. I
2785 kept the log popup and nuked the options form.
2787 * src/{la,}texoptions.[Ch]: removed.
2788 * src/lyx_cb.C (LaTeXOptions): ditto
2790 * src/lyx_gui.C (create_forms): do not handle the
2791 fd_latex_options form.
2793 2000-07-18 Juergen Vigna <jug@sad.it>
2795 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2796 name of the inset so that it can be requested outside (text2.C).
2798 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2801 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2803 * src/mathed/formula.h (ConvertFont): constify
2805 * src/mathed/formula.C (Read): add warning if \end_inset is not
2806 found on expected place.
2808 * src/insets/lyxinset.h (ConvertFont): consify
2810 * src/insets/insetquotes.C (ConvertFont): constify
2811 * src/insets/insetquotes.h: ditto
2813 * src/insets/insetinfo.h: add labelfont
2815 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2816 (ascent): use labelfont
2820 (Write): make .lyx file a bit nicer
2822 * src/insets/insetfloat.C (Write): simplify somewhat...
2823 (Read): add warning if arg is not found
2825 * src/insets/insetcollapsable.C: add using std::max
2826 (Read): move string token and add warning in arg is not found
2827 (draw): use std::max to get the right ty
2828 (getMaxWidth): simplify by using std::max
2830 * src/insets/insetsection.h: new file
2831 * src/insets/insetsection.C: new file
2832 * src/insets/insetcaption.h: new file
2833 * src/insets/insetcaption.C: new file
2835 * src/insets/inset.C (ConvertFont): constify signature
2837 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2838 insetcaption.[Ch] and insetsection.[Ch]
2840 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2841 uses to use LABEL_COUNTER_CHAPTER instead.
2842 * src/text2.C (SetCounter): here
2844 * src/counters.h: new file
2845 * src/counters.C: new file
2846 * src/Sectioning.h: new file
2847 * src/Sectioning.C: new file
2849 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2851 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2853 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2856 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2859 2000-07-17 Juergen Vigna <jug@sad.it>
2861 * src/tabular.C (Validate): check if array-package is needed.
2862 (SetVAlignment): added support for vertical alignment.
2863 (SetLTFoot): better support for longtable header/footers
2864 (Latex): modified to support added features.
2866 * src/LaTeXFeatures.[Ch]: added array-package.
2868 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2870 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2873 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2875 * configure.in: do not forget to put a space after -isystem.
2877 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2879 * lib/kbd/arabic.kmap: a few fixes.
2881 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2883 * some whitespace chagnes to a number of files.
2885 * src/support/DebugStream.h: change to make it easier for
2886 doc++ to parse correctly.
2887 * src/support/lyxstring.h: ditto
2889 * src/mathed/math_utils.C (compara): change to have only one
2891 (MathedLookupBOP): change because of the above.
2893 * src/mathed/math_delim.C (math_deco_compare): change to have only
2895 (search_deco): change becasue of the above.
2897 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2898 instead of manually coded one.
2900 * src/insets/insetquotes.C (Read): read the \end_inset too
2902 * src/insets/insetlatex.h: remove file
2903 * src/insets/insetlatex.C: remove file
2905 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2907 (InsetPrintIndex): remove destructor
2909 * src/insets/insetinclude.h: remove default constructor
2911 * src/insets/insetfloat.C: work to make it work better
2913 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2915 * src/insets/insetcite.h (InsetCitation): remove default constructor
2917 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2919 * src/text.C (GetColumnNearX): comment out some currently unused code.
2921 * src/paragraph.C (writeFile): move some initializations closer to
2923 (CutIntoMinibuffer): small change to use new matchIT operator
2927 (InsertInset): ditto
2930 (InsetIterator): ditto
2931 (Erase): small change to use new matchFT operator
2933 (GetFontSettings): ditto
2934 (HighestFontInRange): ditto
2937 * src/lyxparagraph.h: some chars changed to value_type
2938 (matchIT): because of some stronger checking (perhaps too strong)
2939 in SGI STL, the two operator() unified to one.
2942 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2944 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2945 the last inset read added
2946 (parseSingleLyXformat2Token): some more (future) compability code added
2947 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2948 (parseSingleLyXformat2Token): set last_inset_read
2949 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2950 (parseSingleLyXformat2Token): don't double intializw string next_token
2952 * src/TextCache.C (text_fits::operator()): add const's to the signature
2953 (has_buffer::operator()): ditto
2955 * src/Floating.h: add some comments on the class
2957 * src/FloatList.[Ch] (typeExist): new method
2960 * src/BackStack.h: added default constructor, wanted by Gcc.
2962 2000-07-14 Juergen Vigna <jug@sad.it>
2964 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2966 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2968 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2969 do a redraw when the window is resized!
2970 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2972 * src/insets/insettext.C (resizeLyXText): added function to correctly
2973 being able to resize the LyXWindow.
2975 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2977 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2979 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2980 crashes when closing dialog to a deleted inset.
2982 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2983 method! Now similar to other insets.
2985 2000-07-13 Juergen Vigna <jug@sad.it>
2987 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2989 * lib/examples/Literate.lyx: small patch!
2991 * src/insets/insetbib.C (Read): added this function because of wrong
2992 Write (without [begin|end]_inset).
2994 2000-07-11 Juergen Vigna <jug@sad.it>
2996 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2997 as the insertInset could not be good!
2999 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3000 the bool param should not be last.
3002 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3004 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3005 did submit that to Karl).
3007 * configure.in: use -isystem instead of -I for X headers. This
3008 fixes a problem on solaris with a recent gcc;
3009 put the front-end code after the X detection code;
3010 configure in sigc++ before lib/
3012 * src/lyx_main.C (commandLineHelp): remove -display from command
3015 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3017 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3018 Also put in Makefile rules for building the ``listerrors''
3019 program for parsing errors from literate programs written in LyX.
3021 * lib/build-listerrors: Added small shell script as part of compile
3022 process. This builds a working ``listerrors'' binary if noweb is
3023 installed and either 1) the VNC X server is installed on the machine,
3024 or 2) the user is compiling from within a GUI. The existence of a GUI
3025 is necessary to use the ``lyx --export'' feature for now. This
3026 hack can be removed once ``lyx --export'' no longer requires a GUI to
3029 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3031 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3032 now passed back correctly from gcc and placed "under" error
3033 buttons in a Literate LyX source.
3035 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3037 * src/text.C (GetColumnNearX): Better behavior when a RTL
3038 paragraph is ended by LTR text.
3040 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3043 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3045 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3046 true when clipboard is empty.
3048 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3050 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3051 row of the paragraph.
3052 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3053 to prevent calculation of bidi tables
3055 2000-07-07 Juergen Vigna <jug@sad.it>
3057 * src/screen.C (ToggleSelection): added y_offset and x_offset
3060 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3063 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3065 * src/insets/insettext.C: fixed Layout-Display!
3067 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3069 * configure.in: add check for strings.h header.
3071 * src/spellchecker.C: include <strings.h> in order to have a
3072 definition for bzero().
3074 2000-07-07 Juergen Vigna <jug@sad.it>
3076 * src/insets/insettext.C (draw): set the status of the bv->text to
3077 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3079 * src/screen.C (DrawOneRow):
3080 (DrawFromTo): redraw the actual row if something has changed in it
3083 * src/text.C (draw): call an update of the toplevel-inset if something
3084 has changed inside while drawing.
3086 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3088 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3090 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3091 processing inside class.
3093 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3094 processing inside class.
3096 * src/insets/insetindex.h new struct Holder, consistent with other
3099 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3100 citation dialog from main code and placed it in src/frontends/xforms.
3101 Dialog launched through signals instead of callbacks
3103 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3105 * lyx.man: update the options description.
3107 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3109 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3110 handle neg values, set min width to 590, add doc about -display
3112 2000-07-05 Juergen Vigna <jug@sad.it>
3114 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3115 calls to BufferView *.
3117 * src/insets/insettext.C (checkAndActivateInset): small fix non
3118 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3120 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3121 their \end_inset token!
3123 2000-07-04 edscott <edscott@imp.mx>
3125 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3126 lib/lyxrc.example: added option \wheel_jump
3128 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3130 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3131 remove support for -width,-height,-xpos and -ypos.
3133 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3135 * src/encoding.[Ch]: New files.
3137 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3138 (text): Call to the underline() method only when needed.
3140 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3142 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3143 encoding(s) for the document.
3145 * src/bufferparams.C (BufferParams): Changed default value of
3148 * src/language.C (newLang): Removed.
3149 (items[]): Added encoding information for all defined languages.
3151 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3152 encoding choice button.
3154 * src/lyxrc.h (font_norm_type): New member variable.
3155 (set_font_norm_type): New method.
3157 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3158 paragraphs with different encodings.
3160 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3161 (TransformChar): Changed to work correctly with Arabic points.
3162 (draw): Added support for drawing Arabic points.
3163 (draw): Removed code for drawing underbars (this is done by
3166 * src/support/textutils.h (IsPrintableNonspace): New function.
3168 * src/BufferView_pimpl.h: Added "using SigC::Object".
3169 * src/LyXView.h: ditto.
3171 * src/insets/insetinclude.h (include_label): Changed to mutable.
3173 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3175 * src/mathed/math_iter.h: remove empty destructor
3177 * src/mathed/math_cursor.h: remove empty destructor
3179 * src/insets/lyxinset.h: add THEOREM_CODE
3181 * src/insets/insettheorem.[Ch]: new files
3183 * src/insets/insetminipage.C: (InsertInset): remove
3185 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3187 (InsertInset): remove
3189 * src/insets/insetlist.C: (InsertList): remove
3191 * src/insets/insetfootlike.[Ch]: new files
3193 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3196 (InsertInset): ditto
3198 * src/insets/insetert.C: remove include Painter.h, reindent
3199 (InsertInset): move to header
3201 * src/insets/insetcollapsable.h: remove explicit from default
3202 contructor, remove empty destructor, add InsertInset
3204 * src/insets/insetcollapsable.C (InsertInset): new func
3206 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3208 * src/vspace.h: add explicit to constructor
3210 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3211 \textcompwordmark, please test this.
3213 * src/lyxrc.C: set ascii_linelen to 65 by default
3215 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3217 * src/commandtags.h: add LFUN_INSET_THEOREM
3219 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3220 (makeLinuxDocFile): remove _some_ of the nice logic
3221 (makeDocBookFile): ditto
3223 * src/Painter.[Ch]: (~Painter): removed
3225 * src/LyXAction.C (init): entry for insettheorem added
3227 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3229 (deplog): code to detect files generated by LaTeX, needs testing
3232 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3234 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3236 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3238 * src/LaTeX.C (deplog): Add a check for files that are going to be
3239 created by the first latex run, part of the project to remove the
3242 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3243 contents to the extension list.
3245 2000-07-04 Juergen Vigna <jug@sad.it>
3247 * src/text.C (NextBreakPoint): added support for needFullRow()
3249 * src/insets/lyxinset.h: added needFullRow()
3251 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3254 * src/insets/insettext.C: lots of changes for update!
3256 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3258 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3260 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3262 * src/insets/insetinclude.C (InsetInclude): fixed
3263 initialization of include_label.
3264 (unique_id): now returns a string.
3266 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3268 * src/LaTeXFeatures.h: new member IncludedFiles, for
3269 a map of key, included file name.
3271 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3272 with the included files for inclusion in SGML preamble,
3273 i. e., linuxdoc and docbook.
3276 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3277 nice (is the generated linuxdoc code to be exported?), that
3278 allows to remove column, and only_body that will be true for
3279 slave documents. Insets are allowed inside SGML font type.
3280 New handling of the SGML preamble for included files.
3281 (makeDocBookFile): the same for docbook.
3283 * src/insets/insetinclude.h:
3284 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3286 (DocBook): new export methods.
3288 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3289 and makeDocBookFile.
3291 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3292 formats to export with command line argument -x.
3294 2000-06-29 Juergen Vigna <jug@sad.it>
3296 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3297 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3299 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3300 region could already been cleared by an inset!
3302 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3304 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3307 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3309 (cursorToggle): remove special handling of lyx focus.
3311 2000-06-28 Juergen Vigna <jug@sad.it>
3313 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3316 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3318 * src/insets/insetindex.C (Edit): add a callback when popup is
3321 * src/insets/insettext.C (LocalDispatch):
3322 * src/insets/insetmarginal.h:
3323 * src/insets/insetlist.h:
3324 * src/insets/insetfoot.h:
3325 * src/insets/insetfloat.h:
3326 * src/insets/insetert.h: add a missing std:: qualifier.
3328 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3330 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3333 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3335 * src/insets/insettext.C (Read): remove tmptok unused variable
3336 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3337 (InsertInset): change for new InsetInset code
3339 * src/insets/insettext.h: add TEXT inline method
3341 * src/insets/insettext.C: remove TEXT macro
3343 * src/insets/insetmarginal.C (Write): new method
3344 (Latex): change output slightly
3346 * src/insets/insetfoot.C (Write): new method
3347 (Latex): change output slightly (don't use endl when no need)
3349 * src/insets/insetert.C (Write): new method
3351 * src/insets/insetcollapsable.h: make button_length, button_top_y
3352 and button_bottm_y protected.
3354 * src/insets/insetcollapsable.C (Write): simplify code by using
3355 tostr. Also do not output the float name, the children class
3356 should to that to get control over own arguments
3358 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3359 src/insets/insetminipage.[Ch]:
3362 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3364 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3366 * src/Makefile.am (lyx_SOURCES): add the new files
3368 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3369 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3370 * src/commandtags.h: ditto
3372 * src/LaTeXFeatures.h: add a std::set of used floattypes
3374 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3376 * src/FloatList.[Ch] src/Floating.h: new files
3378 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3380 * src/lyx_cb.C (TableApplyCB): ditto
3382 * src/text2.C: ditto
3383 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3384 (parseSingleLyXformat2Token): ditto + add code for
3385 backwards compability for old float styles + add code for new insets
3387 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3389 (InsertInset(size_type, Inset *, LyXFont)): new method
3390 (InsetChar(size_type, char)): changed to use the other InsetChar
3391 with a LyXFont(ALL_INHERIT).
3392 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3393 insert the META_INSET.
3395 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3397 * sigc++/thread.h (Threads): from here
3399 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3400 definition out of line
3401 * sigc++/scope.h: from here
3403 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3405 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3406 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3408 * Makefile.am (bindist): new target.
3410 * INSTALL: add instructions for doing a binary distribution.
3412 * development/tools/README.bin.example: update a bit.
3414 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3417 * lib/lyxrc.example: new lyxrc tag \set_color.
3419 * src/lyxfunc.C (Dispatch):
3420 * src/commandtags.h:
3421 * src/LyXAction.C: new lyxfunc "set-color".
3423 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3424 and an x11name given as strings.
3426 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3427 cache when a color is changed.
3429 2000-06-26 Juergen Vigna <jug@sad.it>
3431 * src/lyxrow.C (width): added this functions and variable.
3433 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3436 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3438 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3440 * images/undo_bw.xpm: new icon.
3441 * images/redo_bw.xpm: ditto.
3443 * configure.in (INSTALL_SCRIPT): change value to
3444 ${INSTALL} to avoid failures of install-script target.
3445 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3447 * src/BufferView.h: add a magic "friend" declaration to please
3450 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3452 * forms/cite.fd: modified to allow resizing without messing
3455 * src/insetcite.C: Uses code from cite.fd almost without
3457 User can now resize dialog in the x-direction.
3458 Resizing the dialog in the y-direction is prevented, as the
3459 code does this intelligently already.
3461 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3463 * INSTALL: remove obsolete entry in "problems" section.
3465 * lib/examples/sl_*.lyx: update of the slovenian examples.
3467 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3469 2000-06-23 Juergen Vigna <jug@sad.it>
3471 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3473 * src/buffer.C (resize): delete the LyXText of textinsets.
3475 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3477 * src/insets/lyxinset.h: added another parameter 'cleared' to
3478 the draw() function.
3480 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3481 unlocking inset in inset.
3483 2000-06-22 Juergen Vigna <jug@sad.it>
3485 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3486 of insets and moved first to LyXText.
3488 * src/mathed/formulamacro.[Ch]:
3489 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3491 2000-06-21 Juergen Vigna <jug@sad.it>
3493 * src/text.C (GetVisibleRow): look if I should clear the area or not
3494 using Inset::doClearArea() function.
3496 * src/insets/lyxinset.h: added doClearArea() function and
3497 modified draw(Painter &, ...) to draw(BufferView *, ...)
3499 * src/text2.C (UpdateInset): return bool insted of int
3501 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3503 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3504 combox in the character popup
3506 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3507 BufferParams const & params
3509 2000-06-20 Juergen Vigna <jug@sad.it>
3511 * src/insets/insettext.C (SetParagraphData): set insetowner on
3514 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3516 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3517 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3519 (form_main_): remove
3521 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3522 (create_form_form_main): remove FD_form_main stuff, connect to
3523 autosave_timeout signal
3525 * src/LyXView.[Ch] (getMainForm): remove
3526 (UpdateTimerCB): remove
3527 * src/BufferView_pimpl.h: inherit from SigC::Object
3529 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3530 signal instead of callback
3532 * src/BufferView.[Ch] (cursorToggleCB): remove
3534 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3536 * src/BufferView_pimpl.C: changes because of the one below
3538 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3539 instead of storing a pointer to a LyXText.
3541 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3543 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3545 * src/lyxparagraph.h
3547 * src/paragraph.C: Changed fontlist to a sorted vector.
3549 2000-06-19 Juergen Vigna <jug@sad.it>
3551 * src/BufferView.h: added screen() function.
3553 * src/insets/insettext.C (LocalDispatch): some selection code
3556 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3558 * src/insets/insettext.C (SetParagraphData):
3560 (InsetText): fixes for multiple paragraphs.
3562 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3564 * development/lyx.spec.in: Call configure with ``--without-warnings''
3565 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3566 This should be fine, however, since we generally don't want to be
3567 verbose when making an RPM.
3569 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3571 * lib/scripts/fig2pstex.py: New file
3573 2000-06-16 Juergen Vigna <jug@sad.it>
3575 * src/insets/insettabular.C (UpdateLocal):
3576 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3577 (LocalDispatch): Changed all functions to use LyXText.
3579 2000-06-15 Juergen Vigna <jug@sad.it>
3581 * src/text.C (SetHeightOfRow): call inset::update before requesting
3584 * src/insets/insettext.C (update):
3585 * src/insets/insettabular.C (update): added implementation
3587 * src/insets/lyxinset.h: added update function
3589 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3591 * src/text.C (SelectNextWord): protect against null pointers with
3592 old-style string streams. (fix from Paul Theo Gonciari
3595 * src/cite.[Ch]: remove erroneous files.
3597 * lib/configure.m4: update the list of created directories.
3599 * src/lyxrow.C: include <config.h>
3600 * src/lyxcursor.C: ditto.
3602 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3604 * lib/examples/decimal.lyx: new example file from Mike.
3606 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3607 to find template definitions (from Dekel)
3609 * src/frontends/.cvsignore: add a few things.
3611 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3613 * src/Timeout.C (TimeOut): remove default argument.
3615 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3618 * src/insets/ExternalTemplate.C: add a "using" directive.
3620 * src/lyx_main.h: remove the act_ struct, which seems unused
3623 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3625 * LyX Developers Meeting: All files changed, due to random C++ (by
3626 coincidence) code generator script.
3628 - external inset (cool!)
3629 - initial online editing of preferences
3630 - insettabular breaks insettext(s contents)
3632 - some DocBook fixes
3633 - example files update
3634 - other cool stuff, create a diff and look for yourself.
3636 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3638 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3639 -1 this is a non-line-breaking textinset.
3641 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3642 if there is no width set.
3644 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3646 * Lots of files: Merged the dialogbase branch.
3648 2000-06-09 Allan Rae <rae@lyx.org>
3650 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3651 and the Dispatch methods that used it.
3653 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3654 access to functions formerly kept in Dispatch.
3656 2000-05-19 Allan Rae <rae@lyx.org>
3658 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3659 made to_page and count_copies integers again. from_page remains a
3660 string however because I want to allow entry of a print range like
3661 "1,4,22-25" using this field.
3663 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3664 and printer-params-get. These aren't useful from the minibuffer but
3665 could be used by a script/LyXServer app provided it passes a suitable
3666 auto_mem_buffer. I guess I should take a look at how the LyXServer
3667 works and make it support xtl buffers.
3669 * sigc++/: updated to libsigc++-1.0.1
3671 * src/xtl/: updated to xtl-1.3.pl.11
3673 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3674 those changes done to the files in src/ are actually recreated when
3675 they get regenerated. Please don't ever accept a patch that changes a
3676 dialog unless that patch includes the changes to the corresponding *.fd
3679 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3680 stringOnlyContains, renamed it and generalised it.
3682 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3683 branch. Removed the remaining old form_print code.
3685 2000-04-26 Allan Rae <rae@lyx.org>
3687 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3688 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3690 2000-04-25 Allan Rae <rae@lyx.org>
3692 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3693 against a base of xtl-1.3.pl.4
3695 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3696 filter the Id: entries so they still show the xtl version number
3699 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3700 into the src/xtl code. Patch still pending with José (XTL)
3702 2000-04-24 Allan Rae <rae@lyx.org>
3704 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3705 both more generic and much safer. Use the new template functions.
3706 * src/buffer.[Ch] (Dispatch): ditto.
3708 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3709 and mem buffer more intelligently. Also a little general cleanup.
3712 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3713 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3714 * src/xtl/Makefile.am: ditto.
3715 * src/xtl/.cvsignore: ditto.
3716 * src/Makefile.am: ditto.
3718 * src/PrinterParams.h: Removed the macros member functions. Added a
3719 testInvariant member function. A bit of tidying up and commenting.
3720 Included Angus's idea for fixing operation with egcs-1.1.2.
3722 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3723 cool expansion of XTL's mem_buffer to support automatic memory
3724 management within the buffer itself. Removed the various macros and
3725 replaced them with template functions that use either auto_mem_buffer
3726 or mem_buffer depending on a #define. The mem_buffer support will
3727 disappear as soon as the auto_mem_buffer is confirmed to be good on
3728 other platforms/compilers. That is, it's there so you've got something
3731 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3732 effectively forked XTL. However I expect José will include my code
3733 into the next major release. Also fixed a memory leak.
3734 * src/xtl/text.h: ditto.
3735 * src/xtl/xdr.h: ditto.
3736 * src/xtl/giop.h: ditto.
3738 2000-04-16 Allan Rae <rae@lyx.org>
3740 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3741 by autogen.sh and removed by maintainer-clean anyway.
3742 * .cvsignore, sigc++/.cvsignore: Support the above.
3744 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3746 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3748 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3749 macros, renamed static callback-target member functions to suit new
3750 scheme and made them public.
3751 * src/frontends/xforms/forms/form_print.fd: ditto.
3752 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3754 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3757 * src/xtl/: New directory containing a minimal distribution of XTL.
3758 This is XTL-1.3.pl.4.
3760 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3762 2000-04-15 Allan Rae <rae@lyx.org>
3764 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3766 * sigc++/: Updated to libsigc++-1.0.0
3768 2000-04-14 Allan Rae <rae@lyx.org>
3770 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3771 use the generic ones in future. I'll modify my conversion script.
3773 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3775 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3776 (CloseAllBufferRelatedDialogs): Renamed.
3777 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3779 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3780 of the generic ones. These are the same ones my conversion script
3783 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3784 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3785 * src/buffer.C (Dispatch): ditto
3787 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3788 functions for updating and hiding buffer dependent dialogs.
3789 * src/BufferView.C (buffer): ditto
3790 * src/buffer.C (setReadonly): ditto
3791 * src/lyxfunc.C (CloseBuffer): ditto
3793 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3794 Dialogs.h, and hence all the SigC stuff, into every file that includes
3795 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3797 * src/BufferView2.C: reduce the number of headers included by buffer.h
3799 2000-04-11 Allan Rae <rae@lyx.org>
3801 * src/frontends/xforms/xform_macros.h: A small collection of macros
3802 for building C callbacks.
3804 * src/frontends/xforms/Makefile.am: Added above file.
3806 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3807 scheme again. This time it should work for JMarc. If this is
3808 successful I'll revise my conversion script to automate some of this.
3809 The static member functions in the class also have to be public for
3810 this scheme will work. If the scheme works (it's almost identical to
3811 the way BufferView::cursorToggleCB is handled so it should work) then
3812 FormCopyright and FormPrint will be ready for inclusion into the main
3813 trunk immediately after 1.1.5 is released -- provided we're prepared
3814 for complaints about lame compilers not handling XTL.
3816 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3818 2000-04-07 Allan Rae <rae@lyx.org>
3820 * config/lyxinclude.m4: A bit more tidying up (Angus)
3822 * src/LString.h: JMarc's <string> header fix
3824 * src/PrinterParams.h: Used string for most data to remove some
3825 ugly code in the Print dialog and avoid even uglier code when
3826 appending the ints to a string for output.
3828 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3829 and moved "default:" back to the end of switch statement. Cleaned
3830 up the printing so it uses the right function calls and so the
3831 "print to file" option actually puts the file in the right directory.
3833 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3835 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3836 and Ok+Apply button control into a separate method: input (Angus).
3837 (input) Cleaned it up and improved it to be very thorough now.
3838 (All CB) static_cast used instead of C style cast (Angus). This will
3839 probably change again once we've worked out how to keep gcc-2.8.1 happy
3840 with real C callbacks.
3841 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3842 ignore some of the bool settings and has random numbers instead. Needs
3843 some more investigation. Added other input length checks and checking
3844 of file and printer names.
3846 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3847 would link (Angus). Seems the old code doesn't compile with the pragma
3848 statement either. Separated callback entries from internal methods.
3850 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3852 2000-03-17 Allan Rae <rae@lyx.org>
3854 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3855 need it? Maybe it could go in Dialogs instead? I could make it a
3856 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3857 values to get the bool return value.
3858 (Dispatch): New overloaded method for xtl support.
3860 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3861 extern "C" callback instead of static member functions. Hopefully,
3862 JMarc will be able to compile this. I haven't changed
3863 forms/form_copyright.fd yet. Breaking one of my own rules already.
3865 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3866 because they aren't useful from the minibuffer. Maybe a LyXServer
3867 might want a help message though?
3869 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3871 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3872 xtl which needs both rtti and exceptions.
3874 * src/support/Makefile.am:
3875 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3877 * src/frontends/xforms/input_validators.[ch]: input filters and
3878 validators. These conrol what keys are valid in input boxes.
3879 Use them and write some more. Much better idea than waiting till
3880 after the user has pressed Ok to say that the input fields don't make
3883 * src/frontends/xforms/Makefile.am:
3884 * src/frontends/xforms/forms/form_print.fd:
3885 * src/frontends/xforms/forms/makefile:
3886 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3887 new scheme. Still have to make sure I haven't missed anything from
3888 the current implementation.
3890 * src/Makefile.am, src/PrinterParams.h: New data store.
3892 * other files: Added a couple of copyright notices.
3894 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3896 * src/insets/insetbib.h: move Holder struct in public space.
3898 * src/frontends/include/DialogBase.h: use SigC:: only when
3899 SIGC_CXX_NAMESPACES is defined.
3900 * src/frontends/include/Dialogs.h: ditto.
3902 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3904 * src/frontends/xforms/FormCopyright.[Ch]: do not
3905 mention SigC:: explicitely.
3907 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3909 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3910 deals with testing KDE in main configure.in
3911 * configure.in: ditto.
3913 2000-02-22 Allan Rae <rae@lyx.org>
3915 * Lots of files: Merged from HEAD
3917 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3918 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3920 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3922 * sigc++/: new minidist.
3924 2000-02-14 Allan Rae <rae@lyx.org>
3926 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3928 2000-02-08 Juergen Vigna <jug@sad.it>
3930 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3931 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3933 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3934 for this port and so it is much easier for other people to port
3935 dialogs in a common development environment.
3937 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3938 the QT/KDE implementation.
3940 * src/frontends/kde/Dialogs.C:
3941 * src/frontends/kde/FormCopyright.C:
3942 * src/frontends/kde/FormCopyright.h:
3943 * src/frontends/kde/Makefile.am:
3944 * src/frontends/kde/formcopyrightdialog.C:
3945 * src/frontends/kde/formcopyrightdialog.h:
3946 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3947 for the kde support of the Copyright-Dialog.
3949 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3950 subdir-substitution instead of hardcoded 'xforms' as we now have also
3953 * src/frontends/include/DialogBase.h (Object): just commented the
3954 label after #endif (nasty warning and I don't like warnings ;)
3956 * src/main.C (main): added KApplication initialization if using
3959 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3960 For now only the KDE event-loop is added if frontend==kde.
3962 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3964 * configure.in: added support for the --with-frontend[=value] option
3966 * autogen.sh: added kde.m4 file to list of config-files
3968 * acconfig.h: added define for KDEGUI-support
3970 * config/kde.m4: added configuration functions for KDE-port
3972 * config/lyxinclude.m4: added --with-frontend[=value] option with
3973 support for xforms and KDE.
3975 2000-02-08 Allan Rae <rae@lyx.org>
3977 * all Makefile.am: Fixed up so the make targets dist, distclean,
3978 install and uninstall all work even if builddir != srcdir. Still
3979 have a new sigc++ minidist update to come.
3981 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3983 2000-02-01 Allan Rae <rae@lyx.org>
3985 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3986 Many mods to get builddir != srcdir working.
3988 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3989 for building on NT and so we can do the builddir != srcdir stuff.
3991 2000-01-30 Allan Rae <rae@lyx.org>
3993 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3994 This will stay in "rae" branch. We probably don't really need it in
3995 the main trunk as anyone who wants to help programming it should get
3996 a full library installed also. So they can check both included and
3997 system supplied library compilation.
3999 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4000 Added a 'mini' distribution of libsigc++. If you feel the urge to
4001 change something in these directories - Resist it. If you can't
4002 resist the urge then you should modify the following script and rebuild
4003 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4004 all happen. Still uses a hacked version of libsigc++'s configure.in.
4005 I'm quite happy with the results. I'm not sure the extra work to turn
4006 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4007 worth the trouble and would probably lead to extra maintenance
4009 I haven't tested the following important make targets: install, dist.
4010 Not ready for prime time but very close. Maybe 1.1.5.
4012 * development/tools/makeLyXsigc.sh: A shell script to automatically
4013 generate our mini-dist of libsigc++. It can only be used with a CVS
4014 checkout of libsigc++ not a tarball distribution. It's well commented.
4015 This will end up as part of the libsigc++ distribution so other apps
4016 can easily have an included mini-dist. If someone makes mods to the
4017 sigc++ subpackage without modifying this script to generate those
4018 changes I'll be very upset!
4020 * src/frontends/: Started the gui/system indep structure.
4022 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4023 to access the gui-indep dialogs are in this class. Much improved
4024 design compared to previous revision. Lars, please refrain from
4025 moving this header into src/ like you did with Popups.h last time.
4027 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4029 * src/frontends/xforms/: Started the gui-indep system with a single
4030 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4033 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4034 Here you'll find a very useful makefile and automated fdfix.sh that
4035 makes updating dailogs a no-brainer -- provided you follow the rules
4036 set out in the README. I'm thinking about adding another script to
4037 automatically generate skeleton code for a new dialog given just the
4040 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4041 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4042 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4044 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4046 * src/support/LSubstring.C (operator): simplify
4048 * src/lyxtext.h: removed bparams, use buffer_->params instead
4050 * src/lyxrow.h: make Row a real class, move all variables to
4051 private and use accessors.
4053 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4055 (isRightToLeftPar): ditto
4056 (ChangeLanguage): ditto
4057 (isMultiLingual): ditto
4060 (SimpleTeXOnePar): ditto
4061 (TeXEnvironment): ditto
4062 (GetEndLabel): ditto
4064 (SetOnlyLayout): ditto
4065 (BreakParagraph): ditto
4066 (BreakParagraphConservative): ditto
4067 (GetFontSettings): ditto
4069 (CopyIntoMinibuffer): ditto
4070 (CutIntoMinibuffer): ditto
4071 (PasteParagraph): ditto
4072 (SetPExtraType): ditto
4073 (UnsetPExtraType): ditto
4074 (DocBookContTableRows): ditto
4075 (SimpleDocBookOneTablePar): ditto
4077 (TeXFootnote): ditto
4078 (SimpleTeXOneTablePar): ditto
4079 (TeXContTableRows): ditto
4080 (SimpleTeXSpecialChars): ditto
4083 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4084 to private and use accessors.
4086 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4087 this, we did not use it anymore and has not been for ages. Just a
4088 waste of cpu cycles.
4090 * src/language.h: make Language a real class, move all variables
4091 to private and use accessors.
4093 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4094 (create_view): remove
4095 (update): some changes for new timer
4096 (cursorToggle): use new timer
4097 (beforeChange): change for new timer
4099 * src/BufferView.h (cursorToggleCB): removed last paramter because
4102 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4103 (cursorToggleCB): change because of new timer code
4105 * lib/CREDITS: updated own mailaddress
4107 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4109 * src/support/filetools.C (PutEnv): fix the code in case neither
4110 putenv() nor setenv() have been found.
4112 * INSTALL: mention the install-strip Makefile target.
4114 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4115 read-only documents.
4117 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4119 * lib/reLyX/configure.in (VERSION): avoid using a previously
4120 generated reLyX wrapper to find out $prefix.
4122 * lib/examples/eu_adibide_lyx-atua.lyx:
4123 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4124 translation of the Tutorial (Dooteo)
4126 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4128 * forms/cite.fd: new citation dialog
4130 * src/insetcite.[Ch]: the new citation dialog is moved into
4133 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4136 * src/insets/insetcommand.h: data members made private.
4138 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4140 * LyX 1.1.5 released
4142 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4144 * src/version.h (LYX_RELEASE): to 1.1.5
4146 * src/spellchecker.C (RunSpellChecker): return false if the
4147 spellchecker dies upon creation.
4149 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4151 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4152 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4156 * lib/CREDITS: update entry for Martin Vermeer.
4158 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4160 * src/text.C (draw): Draw foreign language bars at the bottom of
4161 the row instead of at the baseline.
4163 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4165 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4167 * lib/bind/de_menus.bind: updated
4169 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4171 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4173 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4175 * src/menus.C (Limit_string_length): New function
4176 (ShowTocMenu): Limit the number of items/length of items in the
4179 * src/paragraph.C (String): Correct result for a paragraph inside
4182 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4184 * src/bufferlist.C (close): test of buf->getuser() == NULL
4186 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4188 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4189 Do not call to SetCursor when the paragraph is a closed footnote!
4191 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4193 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4196 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4198 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4201 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4202 reference popup, that activates the reference-back action
4204 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4206 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4207 the menus. Also fixed a bug.
4209 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4210 the math panels when switching buffers (unless new buffer is readonly).
4212 * src/BufferView.C (NoSavedPositions)
4213 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4215 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4217 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4218 less of dvi dirty or not.
4220 * src/trans_mgr.[Ch] (insert): change first parameter to string
4223 * src/chset.[Ch] (encodeString): add const to first parameter
4225 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4227 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4231 * src/LaTeX.C (deplog): better searching for dependency files in
4232 the latex log. Uses now regexps.
4234 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4235 instead of the box hack or \hfill.
4237 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4239 * src/lyxfunc.C (doImportHelper): do not create the file before
4240 doing the actual import.
4241 (doImportASCIIasLines): create a new file before doing the insert.
4242 (doImportASCIIasParagraphs): ditto.
4244 * lib/lyxrc.example: remove mention of non-existing commands
4246 * lyx.man: remove mention of color-related switches.
4248 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4250 * src/lyx_gui.C: remove all the color-related ressources, which
4251 are not used anymore.
4253 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4256 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4258 * src/lyxrc.C (read): Add a missing break in the switch
4260 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4262 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4264 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4267 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4269 * src/text.C (draw): draw bars under foreign language words.
4271 * src/LColor.[Ch]: add LColor::language
4273 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4275 * src/lyxcursor.h (boundary): New member variable
4277 * src/text.C (IsBoundary): New methods
4279 * src/text.C: Use the above for currect cursor movement when there
4280 is both RTL & LTR text.
4282 * src/text2.C: ditto
4284 * src/bufferview_funcs.C (ToggleAndShow): ditto
4286 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4288 * src/text.C (DeleteLineForward): set selection to true to avoid
4289 that DeleteEmptyParagraphMechanism does some magic. This is how it
4290 is done in all other functions, and seems reasonable.
4291 (DeleteWordForward): do not jump over non-word stuff, since
4292 CursorRightOneWord() already does it.
4294 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4295 DeleteWordBackward, since they seem safe to me (since selection is
4296 set to "true") DeleteEmptyParagraphMechanism does nothing.
4298 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4300 * src/lyx_main.C (easyParse): simplify the code by factoring the
4301 part that removes parameters from the command line.
4302 (LyX): check wether wrong command line options have been given.
4304 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4306 * src/lyx_main.C : add support for specifying user LyX
4307 directory via command line option -userdir.
4309 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4311 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4312 the number of items per popup.
4313 (Add_to_refs_menu): Ditto.
4315 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4317 * src/lyxparagraph.h: renamed ClearParagraph() to
4318 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4319 textclass as parameter, and do nothing if free_spacing is
4320 true. This fixes part of the line-delete-forward problems.
4322 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4323 (pasteSelection): ditto.
4324 (SwitchLayoutsBetweenClasses): more translatable strings.
4326 * src/text2.C (CutSelection): use StripLeadingSpaces.
4327 (PasteSelection): ditto.
4328 (DeleteEmptyParagraphMechanism): ditto.
4330 2000-05-26 Juergen Vigna <jug@sad.it>
4332 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4333 is not needed in tabular insets.
4335 * src/insets/insettabular.C (TabularFeatures): added missing features.
4337 * src/tabular.C (DeleteColumn):
4339 (AppendRow): implemented this functions
4340 (cellsturct::operator=): clone the inset too;
4342 2000-05-23 Juergen Vigna <jug@sad.it>
4344 * src/insets/insettabular.C (LocalDispatch): better selection support
4345 when having multicolumn-cells.
4347 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4349 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4351 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4353 * src/ColorHandler.C (getGCForeground): put more test into _()
4355 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4358 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4361 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4363 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4364 there are no labels, or when buffer is readonly.
4366 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4367 there are no labels, buffer is SGML, or when buffer is readonly.
4369 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4371 * src/LColor.C (LColor): change a couple of grey40 to grey60
4372 (LColor): rewore initalization to make compiles go some magnitude
4374 (getGUIName): don't use gettext until we need the string.
4376 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4378 * src/Bullet.[Ch]: Fixed a small bug.
4380 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4382 * src/paragraph.C (String): Several fixes/improvements
4384 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4386 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4388 * src/paragraph.C (String): give more correct output.
4390 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4392 * src/lyxfont.C (stateText) Do not output the language if it is
4393 eqaul to the language of the document.
4395 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4396 between two paragraphs with the same language.
4398 * src/paragraph.C (getParLanguage) Return a correct answer for an
4399 empty dummy paragraph.
4401 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4404 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4407 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4408 the menus/popup, if requested fonts are unavailable.
4410 2000-05-22 Juergen Vigna <jug@sad.it>
4412 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4413 movement support (Up/Down/Tab/Shift-Tab).
4414 (LocalDispatch): added also preliminari cursor-selection.
4416 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4418 * src/paragraph.C (PasteParagraph): Hopefully now right!
4420 2000-05-22 Garst R. Reese <reese@isn.net>
4422 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4423 of list, change all references to Environment to Command
4424 * tex/hollywood.cls : rewrite environments as commands, add
4425 \uppercase to interiorshot and exteriorshot to force uppecase.
4426 * tex/broadway.cls : rewrite environments as commands. Tweak
4429 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4431 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4432 size of items: use a constant intead of the hardcoded 40, and more
4433 importantly do not remove the %m and %x tags added at the end.
4434 (Add_to_refs_menu): use vector::size_type instead of
4435 unsigned int as basic types for the variables. _Please_ do not
4436 assume that size_t is equal to unsigned int. On an alpha, this is
4437 unsigned long, which is _not_ the same.
4439 * src/language.C (initL): remove language "hungarian", since it
4440 seems that "magyar" is better.
4442 2000-05-22 Juergen Vigna <jug@sad.it>
4444 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4446 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4449 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4450 next was deleted but not set to 0.
4452 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4454 * src/language.C (initL): change the initialization of languages
4455 so that compiles goes _fast_.
4457 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4460 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4462 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4466 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4470 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4474 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4477 * src/insets/insetlo*.[Ch]: Made editable
4479 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4481 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4482 the current selection.
4484 * src/BufferView_pimpl.C (stuffClipboard): new method
4486 * src/BufferView.C (stuffClipboard): new method
4488 * src/paragraph.C (String): new method
4490 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4491 LColor::ignore when lyxname is not found.
4493 * src/BufferView.C (pasteSelection): new method
4495 * src/BufferView_pimpl.C (pasteSelection): new method
4497 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4499 * src/WorkArea.C (request_clipboard_cb): new static function
4500 (getClipboard): new method
4501 (putClipboard): new method
4503 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4505 * LyX 1.1.5pre2 released
4507 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 * src/vspace.C (operator=): removed
4510 (operator=): removed
4512 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4514 * src/layout.C (NumberOfClass): manually set the type in make_pair
4515 (NumberOfLayout): ditto
4517 * src/language.C: use the Language constructor for ignore_lang
4519 * src/language.h: add constructors to struct Language
4521 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4523 * src/text2.C (SetCursorIntern): comment out #warning
4525 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4527 * src/mathed/math_iter.h: initialize sx and sw to 0
4529 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4531 * forms/lyx.fd: Redesign of form_ref
4533 * src/LaTeXFeatures.[Ch]
4537 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4540 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4541 and Buffer::inset_iterator.
4543 * src/menus.C: Added new menus: TOC and Refs.
4545 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4547 * src/buffer.C (getTocList): New method.
4549 * src/BufferView2.C (ChangeRefs): New method.
4551 * src/buffer.C (getLabelList): New method. It replaces the old
4552 getReferenceList. The return type is vector<string> instead of
4555 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4556 the old getLabel() and GetNumberOfLabels() methods.
4557 * src/insets/insetlabel.C (getLabelList): ditto
4558 * src/mathed/formula.C (getLabelList): ditto
4560 * src/paragraph.C (String): New method.
4562 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4563 Uses the new getTocList() method.
4564 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4565 which automatically updates the contents of the browser.
4566 (RefUpdateCB): Use the new getLabelList method.
4568 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4570 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4572 * src/spellchecker.C: Added using std::reverse;
4574 2000-05-19 Juergen Vigna <jug@sad.it>
4576 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4578 * src/insets/insettext.C (computeTextRows): small fix for display of
4579 1 character after a newline.
4581 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4584 2000-05-18 Juergen Vigna <jug@sad.it>
4586 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4587 when changing width of column.
4589 * src/tabular.C (set_row_column_number_info): setting of
4590 autobreak rows if necessary.
4592 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4594 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4596 * src/vc-backend.*: renamed stat() to status() and vcstat to
4597 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4598 compilation broke. The new name seems more relevant, anyway.
4600 2000-05-17 Juergen Vigna <jug@sad.it>
4602 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4603 which was wrong if the removing caused removing of rows!
4605 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4606 (pushToken): new function.
4608 * src/text2.C (CutSelection): fix problem discovered with purify
4610 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4612 * src/debug.C (showTags): enlarge the first column, now that we
4613 have 6-digits debug codes.
4615 * lib/layouts/hollywood.layout:
4616 * lib/tex/hollywood.cls:
4617 * lib/tex/brodway.cls:
4618 * lib/layouts/brodway.layout: more commands and fewer
4619 environments. Preambles moved in the .cls files. Broadway now has
4620 more options on scene numbering and less whitespace (from Garst)
4622 * src/insets/insetbib.C (getKeys): make sure that we are in the
4623 document directory, in case the bib file is there.
4625 * src/insets/insetbib.C (Latex): revert bogus change.
4627 2000-05-16 Juergen Vigna <jug@sad.it>
4629 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4630 the TabularLayout on cursor move.
4632 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4634 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4637 (draw): fixed cursor position and drawing so that the cursor is
4638 visible when before the tabular-inset.
4640 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4641 when creating from old insettext.
4643 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4645 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4647 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4648 * lib/tex/brodway.cls: ditto
4650 * lib/layouts/brodway.layout: change alignment of parenthical
4653 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4655 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4656 versions 0.88 and 0.89 are supported.
4658 2000-05-15 Juergen Vigna <jug@sad.it>
4660 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4663 * src/insets/insettext.C (computeTextRows): redone completely this
4664 function in a much cleaner way, because of problems when having a
4666 (draw): added a frame border when the inset is locked.
4667 (SetDrawLockedFrame): this sets if we draw the border or not.
4668 (SetFrameColor): this sets the frame color (default=insetframe).
4670 * src/insets/lyxinset.h: added x() and y() functions which return
4671 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4672 function which is needed to see if we have a locking inset of some
4673 type in this inset (needed for now in insettabular).
4675 * src/vspace.C (inPixels): the same function also without a BufferView
4676 parameter as so it is easier to use it in some ocasions.
4678 * src/lyxfunc.C: changed all places where insertInset was used so
4679 that now if it couldn't be inserted it is deleted!
4681 * src/TabularLayout.C:
4682 * src/TableLayout.C: added support for new tabular-inset!
4684 * src/BufferView2.C (insertInset): this now returns a bool if the
4685 inset was really inserted!!!
4687 * src/tabular.C (GetLastCellInRow):
4688 (GetFirstCellInRow): new helper functions.
4689 (Latex): implemented for new tabular class.
4693 (TeXTopHLine): new Latex() helper functions.
4695 2000-05-12 Juergen Vigna <jug@sad.it>
4697 * src/mathed/formulamacro.C (Read):
4698 * src/mathed/formula.C (Read): read also the \end_inset here!
4700 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4702 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4703 crush when saving formulae with unbalanced parenthesis.
4705 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4707 * src/layout.C: Add new keyword "endlabelstring" to layout file
4709 * src/text.C (GetVisibleRow): Draw endlabel string.
4711 * lib/layouts/broadway.layout
4712 * lib/layouts/hollywood.layout: Added endlabel for the
4713 Parenthetical layout.
4715 * lib/layouts/heb-article.layout: Do not use slanted font shape
4716 for Theorem like environments.
4718 * src/buffer.C (makeLaTeXFile): Always add "american" to
4719 the UsedLanguages list if document language is RTL.
4721 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4723 * add addendum to README.OS2 and small patch (from SMiyata)
4725 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4727 * many files: correct the calls to ChangeExtension().
4729 * src/support/filetools.C (ChangeExtension): remove the no_path
4730 argument, which does not belong there. Use OnlyFileName() instead.
4732 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4733 files when LaTeXing a non-nice latex file.
4735 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4736 a chain of "if". Return false when deadkeys are not handled.
4738 * src/lyx_main.C (LyX): adapted the code for default bindings.
4740 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4741 bindings for basic functionality (except deadkeys).
4742 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4744 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4745 several methods: handle override_x_deadkeys.
4747 * src/lyxrc.h: remove the "bindings" map, which did not make much
4748 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4750 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4752 * src/lyxfont.C (stateText): use a saner method to determine
4753 whether the font is "default". Seems to fix the crash with DEC
4756 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4758 2000-05-08 Juergen Vigna <jug@sad.it>
4760 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4761 TabularLayoutMenu with mouse-button-3
4762 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4764 * src/TabularLayout.C: added this file for having a Layout for
4767 2000-05-05 Juergen Vigna <jug@sad.it>
4769 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4770 recalculating inset-widths.
4771 (TabularFeatures): activated this function so that I can change
4772 tabular-features via menu.
4774 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4775 that I can test some functions with the Table menu.
4777 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4779 * src/lyxfont.C (stateText): guard against stupid c++libs.
4781 * src/tabular.C: add using std::vector
4782 some whitespace changes, + removed som autogenerated code.
4784 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4786 2000-05-05 Juergen Vigna <jug@sad.it>
4788 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4789 row, columns and cellstructures.
4791 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4793 * lib/lyxrc.example: remove obsolete entries.
4795 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4796 reading of protected_separator for free_spacing.
4798 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4800 * src/text.C (draw): do not display an exclamation mark in the
4801 margin for margin notes. This is confusing, ugly and
4804 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4805 AMS math' is checked.
4807 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4808 name to see whether including the amsmath package is needed.
4810 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4812 * src/paragraph.C (validate): Compute UsedLanguages correctly
4813 (don't insert the american language if it doesn't appear in the
4816 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4817 The argument of \thanks{} command is considered moving argument
4819 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4822 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4824 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4825 for appendix/minipage/depth. The lines can be now both in the footnote
4826 frame, and outside the frame.
4828 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4831 2000-05-05 Juergen Vigna <jug@sad.it>
4833 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4834 neede only in tabular.[Ch].
4836 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4838 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4840 (Write): write '~' for PROTECTED_SEPARATOR
4842 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4844 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4847 * src/mathed/formula.C (drawStr): rename size to siz.
4849 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4850 possibly fix a bug by not changing the pflags = flags to piflags =
4853 2000-05-05 Juergen Vigna <jug@sad.it>
4855 * src/insets/insetbib.C: moved using directive
4857 * src/ImportNoweb.C: small fix for being able to compile (missing
4860 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4862 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4863 to use clear, since we don't depend on this in the code. Add test
4866 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4868 * (various *.C files): add using std::foo directives to please dec
4871 * replace calls to string::clear() to string::erase() (Angus)
4873 * src/cheaders/cmath: modified to provide std::abs.
4875 2000-05-04 Juergen Vigna <jug@sad.it>
4877 * src/insets/insettext.C: Prepared all for inserting of multiple
4878 paragraphs. Still display stuff to do (alignment and other things),
4879 but I would like to use LyXText to do this when we cleaned out the
4880 table-support stuff.
4882 * src/insets/insettabular.C: Changed lot of stuff and added lots
4883 of functionality still a lot to do.
4885 * src/tabular.C: Various functions changed name and moved to be
4886 const functions. Added new Read and Write functions and changed
4887 lots of things so it works good with tabular-insets (also removed
4888 some stuff which is not needed anymore * hacks *).
4890 * src/lyxcursor.h: added operators == and != which just look if
4891 par and pos are (not) equal.
4893 * src/buffer.C (latexParagraphs): inserted this function to latex
4894 all paragraphs form par to endpar as then I can use this too for
4897 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4898 so that I can call this to from text insets with their own cursor.
4900 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4901 output off all paragraphs (because of the fix below)!
4903 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4904 the very last paragraph (this could be also the last paragraph of an
4907 * src/texrow.h: added rows() call which returns the count-variable.
4909 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4911 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4913 * lib/configure.m4: better autodetection of DocBook tools.
4915 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4917 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4919 * src/lyx_cb.C: add using std::reverse;
4921 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4924 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4925 selected files. Should fix repeated errors from generated files.
4927 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4929 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4931 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4932 the spellchecker popup.
4934 * lib/lyxrc.example: Removed the \number_inset section
4936 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4938 * src/insets/figinset.C (various): Use IsFileReadable() to make
4939 sure that the file actually exist. Relying on ghostscripts errors
4940 is a bad idea since they can lead to X server crashes.
4942 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4944 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4947 * lib/lyxrc.example: smallish typo in description of
4948 \view_dvi_paper_option
4950 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4953 * src/lyxfunc.C: doImportHelper to factor out common code of the
4954 various import methods. New functions doImportASCIIasLines,
4955 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4956 doImportLinuxDoc for the format specific parts.
4959 * buffer.C: Dispatch returns now a bool to indicate success
4962 * lyx_gui.C: Add getLyXView() for member access
4964 * lyx_main.C: Change logic for batch commands: First try
4965 Buffer::Dispatch (possibly without GUI), if that fails, use
4968 * lyx_main.C: Add support for --import command line switch.
4969 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4970 Available Formats: Everything accepted by 'buffer-import <format>'
4972 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4974 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4977 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4978 documents will be reformatted upon reentry.
4980 2000-04-27 Juergen Vigna <jug@sad.it>
4982 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4983 correctly only last pos this was a bug.
4985 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4987 * release of lyx-1.1.5pre1
4989 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4991 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4993 * src/menus.C: revert the change of naming (Figure->Graphic...)
4994 from 2000-04-11. It was incomplete and bad.
4996 * src/LColor.[Ch]: add LColor::depthbar.
4997 * src/text.C (GetVisibleRow): use it.
4999 * README: update the languages list.
5001 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5003 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5006 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5008 * README: remove sections that were just wrong.
5010 * src/text2.C (GetRowNearY): remove currentrow code
5012 * src/text.C (GetRow): remove currentrow code
5014 * src/screen.C (Update): rewritten a bit.
5015 (SmallUpdate): removed func
5017 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5019 (FullRebreak): return bool
5020 (currentrow): remove var
5021 (currentrow_y): ditto
5023 * src/lyxscreen.h (Draw): change arg to unsigned long
5024 (FitCursor): return bool
5025 (FitManualCursor): ditto
5026 (Smallpdate): remove func
5027 (first): change to unsigned long
5028 (DrawOneRow): change second arg to long (from long &)
5029 (screen_refresh_y): remove var
5030 (scree_refresh_row): ditto
5032 * src/lyxrow.h: change baseline to usigned int from unsigned
5033 short, this brings some implicit/unsigned issues out in the open.
5035 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5037 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5038 instead of smallUpdate.
5040 * src/lyxcursor.h: change y to unsigned long
5042 * src/buffer.h: don't call updateScrollbar after fitcursor
5044 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5045 where they are used. Removed "\\direction", this was not present
5046 in 1.1.4 and is already obsolete. Commented out some code that I
5047 believe to never be called.
5048 (runLiterate): don't call updateScrollbar after fitCursor
5050 (buildProgram): ditto
5053 * src/WorkArea.h (workWidth): change return val to unsigned
5056 (redraw): remove the button redraws
5057 (setScrollbarValue): change for scrollbar
5058 (getScrollbarValue): change for scrollbar
5059 (getScrollbarBounds): change for scrollbar
5061 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5062 (C_WorkArea_down_cb): removed func
5063 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5064 (resize): change for scrollbar
5065 (setScrollbar): ditto
5066 (setScrollbarBounds): ditto
5067 (setScrollbarIncrements): ditto
5068 (up_cb): removed func
5069 (down_cb): removed func
5070 (scroll_cb): change for scrollbar
5071 (work_area_handler): ditto
5073 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5074 when FitCursor did something.
5075 (updateScrollbar): some unsigned changes
5076 (downCB): removed func
5077 (scrollUpOnePage): removed func
5078 (scrollDownOnePage): remvoed func
5079 (workAreaMotionNotify): don't call screen->FitCursor but use
5080 fitCursor instead. and bool return val
5081 (workAreaButtonPress): ditto
5082 (workAreaButtonRelease): some unsigned changes
5083 (checkInsetHit): ditto
5084 (workAreaExpose): ditto
5085 (update): parts rewritten, comments about the signed char arg added
5086 (smallUpdate): removed func
5087 (cursorPrevious): call needed updateScrollbar
5090 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5093 * src/BufferView.[Ch] (upCB): removed func
5094 (downCB): removed func
5095 (smallUpdate): removed func
5097 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5099 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5100 currentrow, currentrow_y optimization. This did not help a lot and
5101 if we want to do this kind of optimization we should rather use
5102 cursor.row instead of the currentrow.
5104 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5105 buffer spacing and klyx spacing support.
5107 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5109 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5112 2000-04-26 Juergen Vigna <jug@sad.it>
5114 * src/insets/figinset.C: fixes to Lars sstream changes!
5116 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5118 * A lot of files: Added Ascii(ostream &) methods to all inset
5119 classes. Used when exporting to ASCII.
5121 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5122 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5125 * src/text2.C (ToggleFree): Disabled implicit word selection when
5126 there is a change in the language
5128 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5129 no output was generated for end-of-sentence inset.
5131 * src/insets/lyxinset.h
5134 * src/paragraph.C: Removed the insetnumber code
5136 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5138 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5140 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5141 no_babel and no_epsfig completely from the file.
5142 (parseSingleLyXformat2Token): add handling for per-paragraph
5143 spacing as written by klyx.
5145 * src/insets/figinset.C: applied patch by Andre. Made it work with
5148 2000-04-20 Juergen Vigna <jug@sad.it>
5150 * src/insets/insettext.C (cutSelection):
5151 (copySelection): Fixed with selection from right to left.
5152 (draw): now the rows are not recalculated at every draw.
5153 (computeTextRows): for now reset the inset-owner here (this is
5154 important for an undo or copy where the inset-owner is not set
5157 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5158 motion to the_locking_inset screen->first was forgotten, this was
5159 not important till we got multiline insets.
5161 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5163 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5164 code seems to be alright (it is code changed by Dekel, and the
5165 intent is indeed that all macros should be defined \protect'ed)
5167 * NEWS: a bit of reorganisation of the new user-visible features.
5169 2000-04-19 Juergen Vigna <jug@sad.it>
5171 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5172 position. Set the inset_owner of the used paragraph so that it knows
5173 that it is inside an inset. Fixed cursor handling with mouse and
5174 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5175 and cleanups to make TextInsets work better.
5177 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5178 Changed parameters of various functions and added LockInsetInInset().
5180 * src/insets/insettext.C:
5182 * src/insets/insetcollapsable.h:
5183 * src/insets/insetcollapsable.C:
5184 * src/insets/insetfoot.h:
5185 * src/insets/insetfoot.C:
5186 * src/insets/insetert.h:
5187 * src/insets/insetert.C: cleaned up the code so that it works now
5188 correctly with insettext.
5190 * src/insets/inset.C:
5191 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5192 that insets in insets are supported right.
5195 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5197 * src/paragraph.C: some small fixes
5199 * src/debug.h: inserted INSETS debug info
5201 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5202 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5204 * src/commandtags.h:
5205 * src/LyXAction.C: insert code for InsetTabular.
5207 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5208 not Button1MotionMask.
5209 (workAreaButtonRelease): send always a InsetButtonRelease event to
5211 (checkInsetHit): some setCursor fixes (always with insets).
5213 * src/BufferView2.C (lockInset): returns a bool now and extended for
5214 locking insets inside insets.
5215 (showLockedInsetCursor): it is important to have the cursor always
5216 before the locked inset.
5217 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5219 * src/BufferView.h: made lockInset return a bool.
5221 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5223 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5224 that is used also internally but can be called as public to have back
5225 a cursor pos which is not set internally.
5226 (SetCursorIntern): Changed to use above function.
5228 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5230 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5235 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5236 patches for things that should be in or should be changed.
5238 * src/* [insetfiles]: change "usigned char fragile" to bool
5239 fragile. There was only one point that could that be questioned
5240 and that is commented in formulamacro.C. Grep for "CHECK".
5242 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5243 (DeleteBuffer): take it out of CutAndPaste and make it static.
5245 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5247 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5248 output the spacing envir commands. Also the new commands used in
5249 the LaTeX output makes the result better.
5251 * src/Spacing.C (writeEnvirBegin): new method
5252 (writeEnvirEnd): new method
5254 2000-04-18 Juergen Vigna <jug@sad.it>
5256 * src/CutAndPaste.C: made textclass a static member of the class
5257 as otherwise it is not accesed right!!!
5259 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5261 * forms/layout_forms.fd
5262 * src/layout_forms.h
5263 * src/layout_forms.C (create_form_form_character)
5264 * src/lyx_cb.C (UserFreeFont)
5265 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5266 documents (in the layout->character popup).
5268 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5270 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5271 \spell_command was in fact not honored (from Kevin Atkinson).
5273 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5276 * src/lyx_gui.h: make lyxViews private (Angus)
5278 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5280 * src/mathed/math_write.C
5281 (MathMatrixInset::Write) Put \protect before \begin{array} and
5282 \end{array} if fragile
5283 (MathParInset::Write): Put \protect before \\ if fragile
5285 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5287 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5288 initialization if the LyXColorHandler must be done after the
5289 connections to the XServer has been established.
5291 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5292 get the background pixel from the lyxColorhandler so that the
5293 figures are rendered with the correct background color.
5294 (NextToken): removed functions.
5295 (GetPSSizes): use ifs >> string instead of NextToken.
5297 * src/Painter.[Ch]: the color cache moved out of this file.
5299 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5302 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5304 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5305 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5307 * src/BufferView.C (enterView): new func
5308 (leaveView): new func
5310 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5312 (leaveView): new func, undefines xterm cursor when approp.
5314 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5315 (AllowInput): delete the Workarea cursor handling from this func.
5317 * src/Painter.C (underline): draw a slimer underline in most cases.
5319 * src/lyx_main.C (error_handler): use extern "C"
5321 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5323 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5324 sent directly to me.
5326 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5327 to the list by Dekel.
5329 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5332 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5333 methods from lyx_cb.here.
5335 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5338 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5340 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5341 instead of using current_view directly.
5343 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5345 * src/LyXAction.C (init): add the paragraph-spacing command.
5347 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5349 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5351 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5352 different from the documents.
5354 * src/text.C (SetHeightOfRow): take paragraph spacing into
5355 account, paragraph spacing takes precedence over buffer spacing
5356 (GetVisibleRow): ditto
5358 * src/paragraph.C (writeFile): output the spacing parameter too.
5359 (validate): set the correct features if spacing is used in the
5361 (Clear): set spacing to default
5362 (MakeSameLayout): spacing too
5363 (HasSameLayout): spacing too
5364 (SetLayout): spacing too
5365 (TeXOnePar): output the spacing commands
5367 * src/lyxparagraph.h: added a spacing variable for use with
5368 per-paragraph spacing.
5370 * src/Spacing.h: add a Default spacing and a method to check if
5371 the current spacing is default. also added an operator==
5373 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5376 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5378 * src/lyxserver.C (callback): fix dispatch of functions
5380 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5381 printf() into lyxerr call.
5383 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5386 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5387 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5388 the "Float" from each of the subitems.
5389 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5391 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5392 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5393 documented the change so that the workaround can be nuked later.
5395 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5398 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5400 * src/buffer.C (getLatexName): ditto
5401 (setReadonly): ditto
5403 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5405 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5406 avoid some uses of current_view. Added also a bufferParams()
5407 method to get at this.
5409 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5411 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5413 * src/lyxparagraph.[Ch]: removed
5414 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5415 with operators used by lower_bound and
5416 upper_bound in InsetTable's
5417 Make struct InsetTable private again. Used matchpos.
5419 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5421 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5422 document, the language of existing text is changed (unless the
5423 document is multi-lingual)
5425 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5427 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5429 * A lot of files: A rewrite of the Right-to-Left support.
5431 2000-04-10 Juergen Vigna <jug@sad.it>
5433 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5434 misplaced cursor when inset in inset is locked.
5436 * src/insets/insettext.C (LocalDispatch): small fix so that a
5437 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5439 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5440 footnote font should be decreased in size twice when displaying.
5442 * src/insets/insettext.C (GetDrawFont): inserted this function as
5443 the drawing-font may differ from the real paragraph font.
5445 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5446 insets (inset in inset!).
5448 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5449 function here because we don't want footnotes inside footnotes.
5451 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5453 (init): now set the inset_owner in paragraph.C
5454 (LocalDispatch): added some resetPos() in the right position
5457 (pasteSelection): changed to use the new CutAndPaste-Class.
5459 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5460 which tells if it is allowed to insert another inset inside this one.
5462 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5463 SwitchLayoutsBetweenClasses.
5465 * src/text2.C (InsertInset): checking of the new paragraph-function
5467 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5468 is not needed anymore here!
5471 (PasteSelection): redone (also with #ifdef) so that now this uses
5472 the CutAndPaste-Class.
5473 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5476 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5477 from/to text/insets.
5479 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5480 so that the paragraph knows if it is inside an (text)-inset.
5481 (InsertFromMinibuffer): changed return-value to bool as now it
5482 may happen that an inset is not inserted in the paragraph.
5483 (InsertInsetAllowed): this checks if it is allowed to insert an
5484 inset in this paragraph.
5486 (BreakParagraphConservative):
5487 (BreakParagraph) : small change for the above change of the return
5488 value of InsertFromMinibuffer.
5490 * src/lyxparagraph.h: added inset_owner and the functions to handle
5491 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5493 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5495 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5496 functions from BufferView to BufferView::Pimpl to ease maintence.
5498 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5499 correctly. Also use SetCursorIntern instead of SetCursor.
5501 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5504 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5506 * src/WorkArea.C (belowMouse): manually implement below mouse.
5508 * src/*: Add "explicit" on several constructors, I added probably
5509 some unneeded ones. A couple of changes to code because of this.
5511 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5512 implementation and private parts from the users of BufferView. Not
5515 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5516 implementation and private parts from the users of LyXLex. Not
5519 * src/BufferView_pimpl.[Ch]: new files
5521 * src/lyxlex_pimpl.[Ch]: new files
5523 * src/LyXView.[Ch]: some inline functions move out-of-line
5525 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5527 * src/lyxparagraph.h: make struct InsetTable public.
5529 * src/support/lyxstring.h: change lyxstring::difference_type to be
5530 ptrdiff_t. Add std:: modifiers to streams.
5532 * src/font.C: include the <cctype> header, for islower() and
5535 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5537 * src/font.[Ch]: new files. Contains the metric functions for
5538 fonts, takes a LyXFont as parameter. Better separation of concepts.
5540 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5541 changes because of this.
5543 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5545 * src/*: compile with -Winline and move functions that don't
5548 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5551 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5553 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5554 (various files changed because of this)
5556 * src/Painter.C (text): fixed the drawing of smallcaps.
5558 * src/lyxfont.[Ch] (drawText): removed unused member func.
5561 * src/*.C: added needed "using" statements and "std::" qualifiers.
5563 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5565 * src/*.h: removed all use of "using" from header files use
5566 qualifier std:: instead.
5568 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5570 * src/text.C (Backspace): some additional cleanups (we already
5571 know whether cursor.pos is 0 or not).
5573 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5574 automake does not provide one).
5576 * src/bmtable.h: replace C++ comments with C comments.
5578 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5580 * src/screen.C (ShowCursor): Change the shape of the cursor if
5581 the current language is not equal to the language of the document.
5582 (If the cursor change its shape unexpectedly, then you've found a bug)
5584 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5587 * src/insets/insetnumber.[Ch]: New files.
5589 * src/LyXAction.C (init)
5590 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5593 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5595 * src/lyxparagraph.h
5596 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5597 (the vector is kept sorted).
5599 * src/text.C (GetVisibleRow): Draw selection correctly when there
5600 is both LTR and RTL text.
5602 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5603 which is much faster.
5605 * src/text.C (GetVisibleRow and other): Do not draw the last space
5606 in a row if the direction of the last letter is not equal to the
5607 direction of the paragraph.
5609 * src/lyxfont.C (latexWriteStartChanges):
5610 Check that font language is not equal to basefont language.
5611 (latexWriteEndChanges): ditto
5613 * src/lyx_cb.C (StyleReset): Don't change the language while using
5614 the font-default command.
5616 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5617 empty paragraph before a footnote.
5619 * src/insets/insetcommand.C (draw): Increase x correctly.
5621 * src/screen.C (ShowCursor): Change cursor shape if
5622 current language != document language.
5624 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5626 2000-03-31 Juergen Vigna <jug@sad.it>
5628 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5629 (Clone): changed mode how the paragraph-data is copied to the
5630 new clone-paragraph.
5632 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5633 GetInset(pos) with no inset anymore there (in inset UNDO)
5635 * src/insets/insetcommand.C (draw): small fix as here x is
5636 incremented not as much as width() returns (2 before, 2 behind = 4)
5638 2000-03-30 Juergen Vigna <jug@sad.it>
5640 * src/insets/insettext.C (InsetText): small fix in initialize
5641 widthOffset (should not be done in the init() function)
5643 2000-03-29 Amir Karger <karger@lyx.org>
5645 * lib/examples/it_ItemizeBullets.lyx: translation by
5648 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5650 2000-03-29 Juergen Vigna <jug@sad.it>
5652 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5654 * src/insets/insetfoot.C (Clone): small change as for the below
5655 new init function in the text-inset
5657 * src/insets/insettext.C (init): new function as I've seen that
5658 clone did not copy the Paragraph-Data!
5659 (LocalDispatch): Added code so that now we have some sort of Undo
5660 functionality (well actually we HAVE Undo ;)
5662 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5664 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5666 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5669 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5671 * src/main.C: added a runtime check that verifies that the xforms
5672 header used when building LyX and the library used when running
5673 LyX match. Exit with a message if they don't match. This is a
5674 version number check only.
5676 * src/buffer.C (save): Don't allocate memory on the heap for
5677 struct utimbuf times.
5679 * *: some using changes, use iosfwd instead of the real headers.
5681 * src/lyxfont.C use char const * instead of string for the static
5682 strings. Rewrite some functions to use sstream.
5684 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5686 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5689 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5691 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5692 of Geodesy (from Martin Vermeer)
5694 * lib/layouts/svjour.inc: include file for the Springer svjour
5695 class. It can be used to support journals other than JoG.
5697 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5698 Miskiewicz <misiek@pld.org.pl>)
5699 * lib/reLyX/Makefile.am: ditto.
5701 2000-03-27 Juergen Vigna <jug@sad.it>
5703 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5704 also some modifications with operations on selected text.
5706 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5707 problems with clicking on insets (last famous words ;)
5709 * src/insets/insetcommand.C (draw):
5710 (width): Changed to have a bit of space before and after the inset so
5711 that the blinking cursor can be seen (otherwise it was hidden)
5713 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5715 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5716 would not be added to the link list when an installed gettext (not
5717 part of libc) is found.
5719 2000-03-24 Juergen Vigna <jug@sad.it>
5721 * src/insets/insetcollapsable.C (Edit):
5722 * src/mathed/formula.C (InsetButtonRelease):
5723 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5726 * src/BufferView.C (workAreaButtonPress):
5727 (workAreaButtonRelease):
5728 (checkInsetHit): Finally fixed the clicking on insets be handled
5731 * src/insets/insetert.C (Edit): inserted this call so that ERT
5732 insets work always with LaTeX-font
5734 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5736 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5737 caused lyx to startup with no GUI in place, causing in a crash
5738 upon startup when called with arguments.
5740 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5742 * src/FontLoader.C: better initialization of dummyXFontStruct.
5744 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5746 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5747 for linuxdoc and docbook import and export format options.
5749 * lib/lyxrc.example Example of default values for the previous flags.
5751 * src/lyx_cb.C Use those flags instead of the hardwired values for
5752 linuxdoc and docbook export.
5754 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5757 * src/menus.C Added menus entries for the new import/exports formats.
5759 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5761 * src/lyxrc.*: Added support for running without Gui
5764 * src/FontLoader.C: sensible defaults if no fonts are needed
5766 * src/lyx_cb.C: New function ShowMessage (writes either to the
5767 minibuffer or cout in case of no gui
5768 New function AskOverwrite for common stuff
5769 Consequently various changes to call these functions
5771 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5772 wild guess at sensible screen resolution when having no gui
5774 * src/lyxfont.C: no gui, no fonts... set some defaults
5776 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5778 * src/LColor.C: made the command inset background a bit lighter.
5780 2000-03-20 Hartmut Goebel <goebel@noris.net>
5782 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5783 stdstruct.inc. Koma-Script added some title elements which
5784 otherwise have been listed below "bibliography". This split allows
5785 adding title elements to where they belong.
5787 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5788 define the additional tilte elements and then include
5791 * many other layout files: changed to include stdtitle.inc just
5792 before stdstruct.inc.
5794 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5796 * src/buffer.C: (save) Added the option to store all backup files
5797 in a single directory
5799 * src/lyxrc.[Ch]: Added variable \backupdir_path
5801 * lib/lyxrc.example: Added descriptions of recently added variables
5803 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5804 bibtex inset, not closing the bibtex popup when deleting the inset)
5806 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * src/lyx_cb.C: add a couple using directives.
5810 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5811 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5812 import based on the filename.
5814 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5815 file would be imported at start, if the filename where of a sgml file.
5817 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5819 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5821 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5822 * src/lyxfont.h Replaced the member variable bits.direction by the
5823 member variable lang. Made many changes in other files.
5824 This allows having a multi-lingual document
5826 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5827 that change the current language to <l>.
5828 Removed the command "font-rtl"
5830 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5831 format for Hebrew documents)
5833 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5834 When auto_mathmode is "true", pressing a digit key in normal mode
5835 will cause entering into mathmode.
5836 If auto_mathmode is "rtl" then this behavior will be active only
5837 when writing right-to-left text.
5839 * src/text2.C (InsertStringA) The string is inserted using the
5842 * src/paragraph.C (GetEndLabel) Gives a correct result for
5843 footnote paragraphs.
5845 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5847 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5849 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5850 front of PasteParagraph. Never insert a ' '. This should at least
5851 fix some cause for the segfaults that we have been experiencing,
5852 it also fixes backspace behaviour slightly. (Phu!)
5854 * src/support/lstrings.C (compare_no_case): some change to make it
5855 compile with gcc 2.95.2 and stdlibc++-v3
5857 * src/text2.C (MeltFootnoteEnvironment): change type o
5858 first_footnote_par_is_not_empty to bool.
5860 * src/lyxparagraph.h: make text private. Changes in other files
5862 (fitToSize): new function
5863 (setContentsFromPar): new function
5864 (clearContents): new function
5865 (SetChar): new function
5867 * src/paragraph.C (readSimpleWholeFile): deleted.
5869 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5870 the file, just use a simple string instead. Also read the file in
5871 a more maintainable manner.
5873 * src/text2.C (InsertStringA): deleted.
5874 (InsertStringB): deleted.
5876 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5878 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5879 RedoParagraphs from the doublespace handling part, just set status
5880 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5881 done, but perhaps not like this.)
5883 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5885 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5886 character when inserting an inset.
5888 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5890 * src/bufferparams.C (readLanguage): now takes "default" into
5893 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5894 also initialize the toplevel_keymap with the default bindings from
5897 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5899 * all files using lyxrc: have lyxrc as a real variable and not a
5900 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5903 * src/lyxrc.C: remove double call to defaultKeyBindings
5905 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5906 toolbar defauls using lyxlex. Remove enums, structs, functions
5909 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5910 toolbar defaults. Also store default keybindings in a map.
5912 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5913 storing the toolbar defaults without any xforms dependencies.
5915 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5916 applied. Changed to use iterators.
5918 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5920 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5921 systems that don't have LINGUAS set to begin with.
5923 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5925 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5926 the list by Dekel Tsur.
5928 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5930 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5931 * src/insets/form_graphics.C: ditto.
5933 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5935 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5937 * src/bufferparams.C (readLanguage): use the new language map
5939 * src/intl.C (InitKeyMapper): use the new language map
5941 * src/lyx_gui.C (create_forms): use the new language map
5943 * src/language.[Ch]: New files. Used for holding the information
5944 about each language. Now! Use this new language map enhance it and
5945 make it really usable for our needs.
5947 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5949 * screen.C (ShowCursor): Removed duplicate code.
5950 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5951 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5953 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5956 * src/text.C Added TransformChar method. Used for rendering Arabic
5957 text correctly (change the glyphs of the letter according to the
5958 position in the word)
5963 * src/lyxrc.C Added lyxrc command {language_command_begin,
5964 language_command_end,language_command_ltr,language_command_rtl,
5965 language_package} which allows the use of either arabtex or Omega
5968 * src/lyx_gui.C (init)
5970 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5971 to use encoding for menu fonts which is different than the encoding
5974 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5975 do not load the babel package.
5976 To write an English document with Hebrew/Arabic, change the document
5977 language to "english".
5979 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5980 (alphaCounter): changed to return char
5981 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5983 * lib/lyxrc.example Added examples for Hebrew/Arabic
5986 * src/layout.C Added layout command endlabeltype
5988 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5990 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5992 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5994 * src/mathed/math_delim.C (search_deco): return a
5995 math_deco_struct* instead of index.
5997 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5999 * All files with a USE_OSTREAM_ONLY within: removed all code that
6000 was unused when USE_OSTREAM_ONLY is defined.
6002 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6003 of any less. Removed header and using.
6005 * src/text.C (GetVisibleRow): draw the string "Page Break
6006 (top/bottom)" on screen when drawing a pagebreak line.
6008 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6010 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6012 * src/mathed/math_macro.C (draw): do some cast magic.
6015 * src/mathed/math_defs.h: change byte* argument to byte const*.
6017 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6019 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6020 know it is right to return InsetFoot* too, but cxx does not like
6023 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6025 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6027 * src/mathed/math_delim.C: change == to proper assignment.
6029 2000-03-09 Juergen Vigna <jug@sad.it>
6031 * src/insets/insettext.C (setPos): fixed various cursor positioning
6032 problems (via mouse and cursor-keys)
6033 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6034 inset (still a small display problem but it works ;)
6036 * src/insets/insetcollapsable.C (draw): added button_top_y and
6037 button_bottom_y to have correct values for clicking on the inset.
6039 * src/support/lyxalgo.h: commented out 'using std::less'
6041 2000-03-08 Juergen Vigna <jug@sad.it>
6043 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6044 Button-Release event closes as it is alos the Release-Event
6047 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6049 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6051 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6052 can add multiple spaces in Scrap (literate programming) styles...
6053 which, by the way, is how I got hooked on LyX to begin with.
6055 * src/mathed/formula.C (Write): Added dummy variable to an
6056 inset::Latex() call.
6057 (Latex): Add free_spacing boolean to inset::Latex()
6059 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6061 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6062 virtual function to include the free_spacing boolean from
6063 the containing paragraph's style.
6065 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6066 Added free_spacing boolean arg to match inset.h
6068 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6069 Added free_spacing boolean arg to match inset.h
6071 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6072 Added free_spacing boolean and made sure that if in a free_spacing
6073 paragraph, that we output normal space if there is a protected space.
6075 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6076 Added free_spacing boolean arg to match inset.h
6078 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6079 Added free_spacing boolean arg to match inset.h
6081 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6082 Added free_spacing boolean arg to match inset.h
6084 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6085 Added free_spacing boolean arg to match inset.h
6087 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6088 Added free_spacing boolean arg to match inset.h
6090 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6091 free_spacing boolean arg to match inset.h
6093 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6094 Added free_spacing boolean arg to match inset.h
6096 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6097 Added free_spacing boolean arg to match inset.h
6099 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6100 Added free_spacing boolean arg to match inset.h
6102 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6103 Added free_spacing boolean arg to match inset.h
6105 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6106 Added free_spacing boolean arg to match inset.h
6108 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6109 free_spacing boolean arg to match inset.h
6111 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6112 free_spacing boolean arg to match inset.h
6114 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6115 ignore free_spacing paragraphs. The user's spaces are left
6118 * src/text.C (InsertChar): Fixed the free_spacing layout
6119 attribute behavior. Now, if free_spacing is set, you can
6120 add multiple spaces in a paragraph with impunity (and they
6121 get output verbatim).
6122 (SelectSelectedWord): Added dummy argument to inset::Latex()
6125 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6128 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6129 paragraph layouts now only input a simple space instead.
6130 Special character insets don't make any sense in free-spacing
6133 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6134 hard-spaces in the *input* file to simple spaces if the layout
6135 is free-spacing. This converts old files which had to have
6136 hard-spaces in free-spacing layouts where a simple space was
6138 (writeFileAscii): Added free_spacing check to pass to the newly
6139 reworked inset::Latex(...) methods. The inset::Latex() code
6140 ensures that hard-spaces in free-spacing paragraphs get output
6141 as spaces (rather than "~").
6143 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/mathed/math_delim.C (draw): draw the empty placeholder
6146 delims with a onoffdash line.
6147 (struct math_deco_compare): struct that holds the "functors" used
6148 for the sort and the binary search in math_deco_table.
6149 (class init_deco_table): class used for initial sort of the
6151 (search_deco): use lower_bound to do a binary search in the
6154 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6156 * src/lyxrc.C: a small secret thingie...
6158 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6159 and to not flush the stream as often as it used to.
6161 * src/support/lyxalgo.h: new file
6162 (sorted): template function used for checking if a sequence is
6163 sorted or not. Two versions with and without user supplied
6164 compare. Uses same compare as std::sort.
6166 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6167 it and give warning on lyxerr.
6169 (struct compare_tags): struct with function operators used for
6170 checking if sorted, sorting and lower_bound.
6171 (search_kw): use lower_bound instead of manually implemented
6174 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6176 * src/insets/insetcollapsable.h: fix Clone() declaration.
6177 * src/insets/insetfoot.h: ditto.
6179 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6181 2000-03-08 Juergen Vigna <jug@sad.it>
6183 * src/insets/lyxinset.h: added owner call which tells us if
6184 this inset is inside another inset. Changed also the return-type
6185 of Editable to an enum so it tells clearer what the return-value is.
6187 * src/insets/insettext.C (computeTextRows): fixed computing of
6188 textinsets which split automatically on more rows.
6190 * src/insets/insetert.[Ch]: changed this to be of BaseType
6193 * src/insets/insetfoot.[Ch]: added footnote inset
6195 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6196 collapsable insets (like footnote, ert, ...)
6198 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6200 * src/lyxdraw.h: remvoe file
6202 * src/lyxdraw.C: remove file
6204 * src/insets/insettext.C: added <algorithm>.
6206 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6208 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6209 (matrix_cb): case MM_OK use string stream
6211 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6214 * src/mathed/math_macro.C (draw): use string stream
6215 (Metrics): use string stream
6217 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6218 directly to the ostream.
6220 * src/vspace.C (asString): use string stream.
6221 (asString): use string stream
6222 (asLatexString): use string stream
6224 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6225 setting Spacing::Other.
6227 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6228 sprintf when creating the stretch vale.
6230 * src/text2.C (alphaCounter): changed to return a string and to
6231 not use a static variable internally. Also fixed a one-off bug.
6232 (SetCounter): changed the drawing of the labels to use string
6233 streams instead of sprintf.
6235 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6236 manipulator to use a scheme that does not require library support.
6237 This is also the way it is done in the new GNU libstdc++. Should
6238 work with DEC cxx now.
6240 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6242 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6243 end. This fixes a bug.
6245 * src/mathed (all files concerned with file writing): apply the
6246 USE_OSTREAM_ONLY changes to mathed too.
6248 * src/support/DebugStream.h: make the constructor explicit.
6250 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6251 count and ostream squashed.
6253 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6255 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6257 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6258 ostringstream uses STL strings, and we might not.
6260 * src/insets/insetspecialchar.C: add using directive.
6261 * src/insets/insettext.C: ditto.
6263 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6265 * lib/layouts/seminar.layout: feeble attempt at a layout for
6266 seminar.cls, far from completet and could really use some looking
6267 at from people used to write layout files.
6269 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6270 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6271 a lot nicer and works nicely with ostreams.
6273 * src/mathed/formula.C (draw): a slightly different solution that
6274 the one posted to the list, but I think this one works too. (font
6275 size wrong in headers.)
6277 * src/insets/insettext.C (computeTextRows): some fiddling on
6278 Jürgens turf, added some comments that he should read.
6280 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6281 used and it gave compiler warnings.
6282 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6285 * src/lyx_gui.C (create_forms): do the right thing when
6286 show_banner is true/false.
6288 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6289 show_banner is false.
6291 * most file writing files: Now use iostreams to do almost all of
6292 the writing. Also instead of passing string &, we now use
6293 stringstreams. mathed output is still not adapted to iostreams.
6294 This change can be turned off by commenting out all the occurences
6295 of the "#define USE_OSTREAM_ONLY 1" lines.
6297 * src/WorkArea.C (createPixmap): don't output debug messages.
6298 (WorkArea): don't output debug messages.
6300 * lib/lyxrc.example: added a comment about the new variable
6303 * development/Code_rules/Rules: Added some more commente about how
6304 to build class interfaces and on how better encapsulation can be
6307 2000-03-03 Juergen Vigna <jug@sad.it>
6309 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6310 automatically with the width of the LyX-Window
6312 * src/insets/insettext.C (computeTextRows): fixed update bug in
6313 displaying text-insets (scrollvalues where not initialized!)
6315 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6317 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6318 id in the check of the result from lower_bound is not enough since
6319 lower_bound can return last too, and then res->id will not be a
6322 * all insets and some code that use them: I have conditionalized
6323 removed the Latex(string & out, ...) this means that only the
6324 Latex(ostream &, ...) will be used. This is a work in progress to
6325 move towards using streams for all output of files.
6327 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6330 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6332 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6333 routine (this fixes bug where greek letters were surrounded by too
6336 * src/support/filetools.C (findtexfile): change a bit the search
6337 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6338 no longer passed to kpsewhich, we may have to change that later.
6340 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6341 warning options to avoid problems with X header files (from Angus
6343 * acinclude.m4: regenerated.
6345 2000-03-02 Juergen Vigna <jug@sad.it>
6347 * src/insets/insettext.C (WriteParagraphData): Using the
6348 par->writeFile() function for writing paragraph-data.
6349 (Read): Using buffer->parseSingleLyXformat2Token()-function
6350 for parsing paragraph data!
6352 * src/buffer.C (readLyXformat2): removed all parse data and using
6353 the new parseSingleLyXformat2Token()-function.
6354 (parseSingleLyXformat2Token): added this function to parse (read)
6355 lyx-file-format (this is called also from text-insets now!)
6357 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6359 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6362 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6363 directly instead of going through a func. One very bad thing: a
6364 static LyXFindReplace, but I don't know where to place it.
6366 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6367 string instead of char[]. Also changed to static.
6368 (GetSelectionOrWordAtCursor): changed to static inline
6369 (SetSelectionOverLenChars): ditto.
6371 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6372 current_view and global variables. both classes has changed names
6373 and LyXFindReplace is not inherited from SearchForm.
6375 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6376 fl_form_search form.
6378 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6380 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6382 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6383 bound (from Kayvan).
6385 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6387 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6389 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6391 * some things that I should comment but the local pub says head to
6394 * comment out all code that belongs to the Roff code for Ascii
6395 export of tables. (this is unused)
6397 * src/LyXView.C: use correct type for global variable
6398 current_layout. (LyXTextClass::size_type)
6400 * some code to get the new insetgraphics closer to working I'd be
6401 grateful for any help.
6403 * src/BufferView2.C (insertInset): use the return type of
6404 NumberOfLayout properly. (also changes in other files)
6406 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6407 this as a test. I want to know what breaks because of this.
6409 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6411 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6413 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6414 to use a \makebox in the label, this allows proper justification
6415 with out using protected spaces or multiple hfills. Now it is
6416 "label" for left justified, "\hfill label\hfill" for center, and
6417 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6418 should be changed accordingly.
6420 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6422 * src/lyxtext.h: change SetLayout() to take a
6423 LyXTextClass::size_type instead of a char (when there is more than
6424 127 layouts in a class); also change type of copylayouttype.
6425 * src/text2.C (SetLayout): ditto.
6426 * src/LyXView.C (updateLayoutChoice): ditto.
6428 * src/LaTeX.C (scanLogFile): errors where the line number was not
6429 given just after the '!'-line were ignored (from Dekel Tsur).
6431 * lib/lyxrc.example: fix description of \date_insert_format
6433 * lib/layouts/llncs.layout: new layout, contributed by Martin
6436 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6438 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6439 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6440 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6441 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6442 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6443 paragraph.C, text.C, text2.C)
6445 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6447 * src/insets/insettext.C (LocalDispatch): remove extra break
6450 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6451 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6453 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6454 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6456 * src/insets/insetbib.h: move InsetBibkey::Holder and
6457 InsetCitation::Holder in public space.
6459 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * src/insets/insettext.h: small change to get the new files from
6462 Juergen to compile (use "string", not "class string").
6464 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6465 const & as parameter to LocalDispatch, use LyXFont const & as
6466 paramter to some other func. This also had impacto on lyxinsets.h
6467 and the two mathed insets.
6469 2000-02-24 Juergen Vigna <jug@sad.it>
6472 * src/commandtags.h:
6474 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6478 * src/BufferView2.C: added/updated code for various inset-functions
6480 * src/insets/insetert.[Ch]: added implementation of InsetERT
6482 * src/insets/insettext.[Ch]: added implementation of InsetText
6484 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6485 (draw): added preliminary code for inset scrolling not finshed yet
6487 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6488 as it is in lyxfunc.C now
6490 * src/insets/lyxinset.h: Added functions for text-insets
6492 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6494 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6495 BufferView and reimplement the list as a queue put inside its own
6498 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6500 * several files: use the new interface to the "updateinsetlist"
6502 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6504 (work_area_handler): call BufferView::trippleClick on trippleclick.
6506 * src/BufferView.C (doubleClick): new function, selects word on
6508 (trippleClick): new function, selects line on trippleclick.
6510 2000-02-22 Allan Rae <rae@lyx.org>
6512 * lib/bind/xemacs.bind: buffer-previous not supported
6514 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6516 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6519 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6521 * src/bufferlist.C: get rid of current_view from this file
6523 * src/spellchecker.C: get rid of current_view from this file
6525 * src/vspace.C: get rid of current_view from this file
6526 (inPixels): added BufferView parameter for this func
6527 (asLatexCommand): added a BufferParams for this func
6529 * src/text.C src/text2.C: get rid of current_view from these
6532 * src/lyxfont.C (getFontDirection): move this function here from
6535 * src/bufferparams.C (getDocumentDirection): move this function
6538 * src/paragraph.C (getParDirection): move this function here from
6540 (getLetterDirection): ditto
6542 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6545 resize due to wrong pixmap beeing used. Also took the opurtunity
6546 to make the LyXScreen stateless on regard to WorkArea and some
6547 general cleanup in the same files.
6549 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6551 * src/Makefile.am: add missing direction.h
6553 * src/PainterBase.h: made the width functions const.
6555 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6558 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6560 * src/insets/insetlatexaccent.C (draw): make the accents draw
6561 better, at present this will only work well with iso8859-1.
6563 * several files: remove the old drawing code, now we use the new
6566 * several files: remove support for mono_video, reverse_video and
6569 2000-02-17 Juergen Vigna <jug@sad.it>
6571 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6572 int ** as we have to return the pointer, otherwise we have only
6573 NULL pointers in the returning function.
6575 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6577 * src/LaTeX.C (operator()): quote file name when running latex.
6579 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6581 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6582 (bubble tip), this removes our special handling of this.
6584 * Remove all code that is unused now that we have the new
6585 workarea. (Code that are not active when NEW_WA is defined.)
6587 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6589 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6591 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6592 nonexisting layout; correctly redirect obsoleted layouts.
6594 * lib/lyxrc.example: document \view_dvi_paper_option
6596 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6599 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6600 (PreviewDVI): handle the view_dvi_paper_option variable.
6601 [Both from Roland Krause]
6603 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6605 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6606 char const *, int, LyXFont)
6607 (text(int, int, string, LyXFont)): ditto
6609 * src/text.C (InsertCharInTable): attempt to fix the double-space
6610 feature in tables too.
6611 (BackspaceInTable): ditto.
6612 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6614 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6616 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6618 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6619 newly found text in textcache to this.
6620 (buffer): set the owner of the text put into the textcache to 0
6622 * src/insets/figinset.C (draw): fixed the drawing of figures with
6625 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6626 drawing of mathframe, hfills, protected space, table lines. I have
6627 now no outstanding drawing problems with the new Painter code.
6629 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6631 * src/PainterBase.C (ellipse, circle): do not specify the default
6634 * src/LColor.h: add using directive.
6636 * src/Painter.[Ch]: change return type of methods from Painter& to
6637 PainterBase&. Add a using directive.
6639 * src/WorkArea.C: wrap xforms callbacks in C functions
6642 * lib/layouts/foils.layout: font fix and simplifications from Carl
6645 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6647 * a lot of files: The Painter, LColor and WorkArea from the old
6648 devel branch has been ported to lyx-devel. Some new files and a
6649 lot of #ifdeffed code. The new workarea is enabled by default, but
6650 if you want to test the new Painter and LColor you have to compile
6651 with USE_PAINTER defined (do this in config.h f.ex.) There are
6652 still some rought edges, and I'd like some help to clear those
6653 out. It looks stable (loads and displays the Userguide very well).
6656 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6658 * src/buffer.C (pop_tag): revert to the previous implementation
6659 (use a global variable for both loops).
6661 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6663 * src/lyxrc.C (LyXRC): change slightly default date format.
6665 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6666 there is an English text with a footnote that starts with a Hebrew
6667 paragraph, or vice versa.
6668 (TeXFootnote): ditto.
6670 * src/text.C (LeftMargin): allow for negative values for
6671 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6674 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6675 for input encoding (cyrillic)
6677 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6679 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6682 * src/toolbar.C (set): ditto
6683 * src/insets/insetbib.C (create_form_citation_form): ditto
6685 * lib/CREDITS: added Dekel Tsur.
6687 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6688 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6689 hebrew supports files from Dekel Tsur.
6691 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6692 <tzafrir@technion.ac.il>
6694 * src/lyxrc.C: put \date_insert_format at the right place.
6696 * src/buffer.C (makeLaTeXFile): fix the handling of
6697 BufferParams::sides when writing out latex files.
6699 * src/BufferView2.C: add a "using" directive.
6701 * src/support/lyxsum.C (sum): when we use lyxstring,
6702 ostringstream::str needs an additional .c_str().
6704 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6706 * src/support/filetools.C (ChangeExtension): patch from Etienne
6709 * src/TextCache.C (show): remove const_cast and make second
6710 parameter non-const LyXText *.
6712 * src/TextCache.h: use non const LyXText in show.
6714 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6717 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6719 * src/support/lyxsum.C: rework to be more flexible.
6721 * several places: don't check if a pointer is 0 if you are going
6724 * src/text.C: remove some dead code.
6726 * src/insets/figinset.C: remove some dead code
6728 * src/buffer.C: move the BufferView funcs to BufferView2.C
6729 remove all support for insetlatexdel
6730 remove support for oldpapersize stuff
6731 made some member funcs const
6733 * src/kbmap.C: use a std::list to store the bindings in.
6735 * src/BufferView2.C: new file
6737 * src/kbsequence.[Ch]: new files
6739 * src/LyXAction.C + others: remove all trace of buffer-previous
6741 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6742 only have one copy in the binary of this table.
6744 * hebrew patch: moved some functions from LyXText to more
6745 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6747 * several files: remove support for XForms older than 0.88
6749 remove some #if 0 #endif code
6751 * src/TextCache.[Ch]: new file. Holds the textcache.
6753 * src/BufferView.C: changes to use the new TextCache interface.
6754 (waitForX): remove the now unused code.
6756 * src/BackStack.h: remove some commented code
6758 * lib/bind/emacs.bind: remove binding for buffer-previous
6760 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6762 * applied the hebrew patch.
6764 * src/lyxrow.h: make sure that all Row variables are initialized.
6766 * src/text2.C (TextHandleUndo): comment out a delete, this might
6767 introduce a memory leak, but should also help us to not try to
6768 read freed memory. We need to look at this one.
6770 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6771 (LyXParagraph): initalize footnotekind.
6773 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6774 forgot this when applying the patch. Please heed the warnings.
6776 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6777 (aka. reformat problem)
6779 * src/bufferlist.C (exists): made const, and use const_iterator
6780 (isLoaded): new func.
6781 (release): use std::find to find the correct buffer.
6783 * src/bufferlist.h: made getState a const func.
6784 made empty a const func.
6785 made exists a const func.
6788 2000-02-01 Juergen Vigna <jug@sad.it>
6790 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6792 * po/it.po: updated a bit the italian po file and also changed the
6793 'file nuovo' for newfile to 'filenuovo' without a space, this did
6796 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6797 for the new insert_date command.
6799 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6800 from jdblair, to insert a date into the current text conforming to
6801 a strftime format (for now only considering the locale-set and not
6802 the document-language).
6804 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6806 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6807 Bounds Read error seen by purify. The problem was that islower is
6808 a macros which takes an unsigned char and uses it as an index for
6809 in array of characters properties (and is thus subject to the
6813 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6814 correctly the paper sides radio buttons.
6815 (UpdateDocumentButtons): ditto.
6817 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6819 * src/kbmap.C (getsym + others): change to return unsigned int,
6820 returning a long can give problems on 64 bit systems. (I assume
6821 that int is 32bit on 64bit systems)
6823 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6825 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6826 LyXLookupString to be zero-terminated. Really fixes problems seen
6829 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6831 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6832 write a (char*)0 to the lyxerr stream.
6834 * src/lastfiles.C: move algorithm before the using statemets.
6836 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6838 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6839 complains otherwise).
6840 * src/table.C: ditto
6842 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6845 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6846 that I removed earlier... It is really needed.
6848 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6850 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6852 * INSTALL: update xforms home page URL.
6854 * lib/configure.m4: fix a bug with unreadable layout files.
6856 * src/table.C (calculate_width_of_column): add "using std::max"
6859 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6861 * several files: marked several lines with "DEL LINE", this is
6862 lines that can be deleted without changing anything.
6863 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6864 checks this anyway */
6867 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6869 * src/DepTable.C (update): add a "+" at the end when the checksum
6870 is different. (debugging string only)
6872 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6873 the next inset to not be displayed. This should also fix the list
6874 of labels in the "Insert Crossreference" dialog.
6876 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6878 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6879 when regex was not found.
6881 * src/support/lstrings.C (lowercase): use handcoded transform always.
6884 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6885 old_cursor.par->prev could be 0.
6887 * several files: changed post inc/dec to pre inc/dec
6889 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6890 write the lastfiles to file.
6892 * src/BufferView.C (buffer): only show TextCache info when debugging
6894 (resizeCurrentBuffer): ditto
6895 (workAreaExpose): ditto
6897 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6899 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6901 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6902 a bit better by removing the special case for \i and \j.
6904 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6906 * src/lyx_main.C (easyParse): remove test for bad comand line
6907 options, since this broke all xforms-related parsing.
6909 * src/kbmap.C (getsym): set return type to unsigned long, as
6910 declared in header. On an alpha, long is _not_ the same as int.
6912 * src/support/LOstream.h: add a "using std::flush;"
6914 * src/insets/figinset.C: ditto.
6916 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6918 * src/bufferlist.C (write): use blinding fast file copy instead of
6919 "a char at a time", now we are doing it the C++ way.
6921 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6922 std::list<int> instead.
6923 (addpidwait): reflect move to std::list<int>
6924 (sigchldchecker): ditto
6926 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6929 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6930 that obviously was wrong...
6932 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6933 c, this avoids warnings with purify and islower.
6935 * src/insets/figinset.C: rename struct queue to struct
6936 queue_element and rewrite to use a std::queue. gsqueue is now a
6937 std::queue<queue_element>
6938 (runqueue): reflect move to std::queue
6941 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6942 we would get "1" "0" instead of "true" "false. Also make the tostr
6945 2000-01-21 Juergen Vigna <jug@sad.it>
6947 * src/buffer.C (writeFileAscii): Disabled code for special groff
6948 handling of tabulars till I fix this in table.C
6950 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6952 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6954 * src/support/lyxlib.h: ditto.
6956 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6958 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6959 and 'j' look better. This might fix the "macron" bug that has been
6962 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6963 functions as one template function. Delete the old versions.
6965 * src/support/lyxsum.C: move using std::ifstream inside
6968 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6971 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6973 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6975 * src/insets/figinset.C (InitFigures): use new instead of malloc
6976 to allocate memory for figures and bitmaps.
6977 (DoneFigures): use delete[] instead of free to deallocate memory
6978 for figures and bitmaps.
6979 (runqueue): use new to allocate
6980 (getfigdata): use new/delete[] instead of malloc/free
6981 (RegisterFigure): ditto
6983 * some files: moved some declarations closer to first use, small
6984 whitespace changes use preincrement instead of postincrement where
6985 it does not make a difference.
6987 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6988 step on the way to use stl::containers for key maps.
6990 * src/bufferlist.h: add a typedef for const_iterator and const
6991 versions of begin and end.
6993 * src/bufferlist.[Ch]: change name of member variable _state to
6994 state_. (avoid reserved names)
6996 (getFileNames): returns the filenames of the buffers in a vector.
6998 * configure.in (ALL_LINGUAS): added ro
7000 * src/support/putenv.C: new file
7002 * src/support/mkdir.C: new file
7004 2000-01-20 Allan Rae <rae@lyx.org>
7006 * lib/layouts/IEEEtran.layout: Added several theorem environments
7008 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7009 couple of minor additions.
7011 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7012 (except for those in footnotes of course)
7014 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7018 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7019 std::sort and std::lower_bound instead of qsort and handwritten
7021 (struct compara): struct that holds the functors used by std::sort
7022 and std::lower_bound in MathedLookupBOP.
7024 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7026 * src/support/LAssert.h: do not do partial specialization. We do
7029 * src/support/lyxlib.h: note that lyx::getUserName() and
7030 lyx::date() are not in use right now. Should these be suppressed?
7032 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7033 (makeLinuxDocFile): do not put date and user name in linuxdoc
7036 * src/support/lyxlib.h (kill): change first argument to long int,
7037 since that's what solaris uses.
7039 * src/support/kill.C (kill): fix declaration to match prototype.
7041 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7042 actually check whether namespaces are supported. This is not what
7045 * src/support/lyxsum.C: add a using directive.
7047 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7049 * src/support/kill.C: if we have namespace support we don't have
7050 to include lyxlib.h.
7052 * src/support/lyxlib.h: use namespace lyx if supported.
7054 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/support/date.C: new file
7058 * src/support/chdir.C: new file
7060 * src/support/getUserName.C: new file
7062 * src/support/getcwd.C: new file
7064 * src/support/abort.C: new file
7066 * src/support/kill.C: new file
7068 * src/support/lyxlib.h: moved all the functions in this file
7069 insede struct lyx. Added also kill and abort to this struct. This
7070 is a way to avoid the "kill is not defined in <csignal>", we make
7071 C++ wrappers for functions that are not ANSI C or ANSI C++.
7073 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7074 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7075 lyx it has been renamed to sum.
7077 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7079 * src/text.C: add using directives for std::min and std::max.
7081 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7083 * src/texrow.C (getIdFromRow): actually return something useful in
7084 id and pos. Hopefully fixes the bug with positionning of errorbox
7087 * src/lyx_main.C (easyParse): output an error and exit if an
7088 incorrect command line option has been given.
7090 * src/spellchecker.C (ispell_check_word): document a memory leak.
7092 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7093 where a "struct utimbuf" is allocated with "new" and deleted with
7096 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7098 * src/text2.C (CutSelection): don't delete double spaces.
7099 (PasteSelection): ditto
7100 (CopySelection): ditto
7102 * src/text.C (Backspace): don't delete double spaces.
7104 * src/lyxlex.C (next): fix a bug that were only present with
7105 conformant std::istream::get to read comment lines, use
7106 std::istream::getline instead. This seems to fix the problem.
7108 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7110 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7111 allowed to insert space before space" editing problem. Please read
7112 commends at the beginning of the function. Comments about usage
7115 * src/text.C (InsertChar): fix for the "not allowed to insert
7116 space before space" editing problem.
7118 * src/text2.C (DeleteEmptyParagraphMechanism): when
7119 IsEmptyTableRow can only return false this last "else if" will
7120 always be a no-op. Commented out.
7122 * src/text.C (RedoParagraph): As far as I can understand tmp
7123 cursor is not really needed.
7125 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7126 present it could only return false anyway.
7127 (several functions): Did something not so smart...added a const
7128 specifier on a lot of methods.
7130 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7131 and add a tmp->text.resize. The LyXParagraph constructor does the
7133 (BreakParagraphConservative): ditto
7135 * src/support/path.h (Path): add a define so that the wrong usage
7136 "Path("/tmp") will be flagged as a compilation error:
7137 "`unnamed_Path' undeclared (first use this function)"
7139 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7141 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7142 which was bogus for several reasons.
7144 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7148 * autogen.sh: do not use "type -path" (what's that anyway?).
7150 * src/support/filetools.C (findtexfile): remove extraneous space
7151 which caused a kpsewhich warning (at least with kpathsea version
7154 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7156 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7158 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7160 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7162 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7164 * src/paragraph.C (BreakParagraph): do not reserve space on text
7165 if we don't need to (otherwise, if pos_end < pos, we end up
7166 reserving huge amounts of memory due to bad unsigned karma).
7167 (BreakParagraphConservative): ditto, although I have not seen
7168 evidence the bug can happen here.
7170 * src/lyxparagraph.h: add a using std::list.
7172 2000-01-11 Juergen Vigna <jug@sad.it>
7174 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7177 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7179 * src/vc-backend.C (doVCCommand): change to be static and take one
7180 more parameter: the path to chdir too be fore executing the command.
7181 (retrive): new function equiv to "co -r"
7183 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7184 file_not_found_hook is true.
7186 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7188 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7189 if a file is readwrite,readonly...anything else.
7191 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7193 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7194 (CreatePostscript): name change from MenuRunDVIPS (or something)
7195 (PreviewPostscript): name change from MenuPreviewPS
7196 (PreviewDVI): name change from MenuPreviewDVI
7198 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7199 \view_pdf_command., \pdf_to_ps_command
7201 * lib/configure.m4: added search for PDF viewer, and search for
7202 PDF to PS converter.
7203 (lyxrc.defaults output): add \pdflatex_command,
7204 \view_pdf_command and \pdf_to_ps_command.
7206 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7208 * src/bufferlist.C (write): we don't use blocksize for anything so
7211 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7213 * src/support/block.h: disable operator T* (), since it causes
7214 problems with both compilers I tried. See comments in the file.
7216 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7219 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7220 variable LYX_DIR_10x to LYX_DIR_11x.
7222 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7224 * INSTALL: document --with-lyxname.
7227 * configure.in: new configure flag --with-lyxname which allows to
7228 choose the name under which lyx is installed. Default is "lyx", of
7229 course. It used to be possible to do this with --program-suffix,
7230 but the later has in fact a different meaning for autoconf.
7232 * src/support/lstrings.h (lstrchr): reformat a bit.
7234 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7235 * src/mathed/math_defs.h: ditto.
7237 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7239 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7240 true, decides if we create a backup file or not when saving. New
7241 tag and variable \pdf_mode, defaults to false. New tag and
7242 variable \pdflatex_command, defaults to pdflatex. New tag and
7243 variable \view_pdf_command, defaults to xpdf. New tag and variable
7244 \pdf_to_ps_command, defaults to pdf2ps.
7246 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7248 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7249 does not have a BufferView.
7250 (unlockInset): ditto + don't access the_locking_inset if the
7251 buffer does not have a BufferView.
7253 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7254 certain circumstances so that we don't continue a keyboard
7255 operation long after the key was released. Try f.ex. to load a
7256 large document, press PageDown for some seconds and then release
7257 it. Before this change the document would contine to scroll for
7258 some time, with this change it stops imidiatly.
7260 * src/support/block.h: don't allocate more space than needed. As
7261 long as we don't try to write to the arr[x] in a array_type arr[x]
7262 it is perfectly ok. (if you write to it you might segfault).
7263 added operator value_type*() so that is possible to pass the array
7264 to functions expecting a C-pointer.
7266 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7269 * intl/*: updated to gettext 0.10.35, tried to add our own
7270 required modifications. Please verify.
7272 * po/*: updated to gettext 0.10.35, tried to add our own required
7273 modifications. Please verify.
7275 * src/support/lstrings.C (tostr): go at fixing the problem with
7276 cxx and stringstream. When stringstream is used return
7277 oss.str().c_str() so that problems with lyxstring and basic_string
7278 are avoided. Note that the best solution would be for cxx to use
7279 basic_string all the way, but it is not conformant yet. (it seems)
7281 * src/lyx_cb.C + other files: moved several global functions to
7282 class BufferView, some have been moved to BufferView.[Ch] others
7283 are still located in lyx_cb.C. Code changes because of this. (part
7284 of "get rid of current_view project".)
7286 * src/buffer.C + other files: moved several Buffer functions to
7287 class BufferView, the functions are still present in buffer.C.
7288 Code changes because of this.
7290 * config/lcmessage.m4: updated to most recent. used when creating
7293 * config/progtest.m4: updated to most recent. used when creating
7296 * config/gettext.m4: updated to most recent. applied patch for
7299 * config/gettext.m4.patch: new file that shows what changes we
7300 have done to the local copy of gettext.m4.
7302 * config/libtool.m4: new file, used in creation of acinclude.m4
7304 * config/lyxinclude.m4: new file, this is the lyx created m4
7305 macros, used in making acinclude.m4.
7307 * autogen.sh: GNU m4 discovered as a separate task not as part of
7308 the lib/configure creation.
7309 Generate acinlucde from files in config. Actually cat
7310 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7311 easier to upgrade .m4 files that really are external.
7313 * src/Spacing.h: moved using std::istringstream to right after
7314 <sstream>. This should fix the problem seen with some compilers.
7316 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7318 * src/lyx_cb.C: began some work to remove the dependency a lot of
7319 functions have on BufferView::text, even if not really needed.
7320 (GetCurrentTextClass): removed this func, it only hid the
7323 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7324 forgot this in last commit.
7326 * src/Bullet.C (bulletEntry): use static char const *[] for the
7327 tables, becuase of this the return arg had to change to string.
7329 (~Bullet): removed unneeded destructor
7331 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7332 (insetSleep): moved from Buffer
7333 (insetWakeup): moved from Buffer
7334 (insetUnlock): moved from Buffer
7336 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7337 from Buffer to BufferView.
7339 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7341 * config/ltmain.sh: updated to version 1.3.4 of libtool
7343 * config/ltconfig: updated to version 1.3.4 of libtool
7345 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7348 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7349 Did I get that right?
7351 * src/lyxlex.h: add a "using" directive or two.
7352 * src/Spacing.h: ditto.
7353 * src/insets/figinset.C: ditto.
7354 * src/support/filetools.C: ditto.
7355 * src/support/lstrings.C: ditto.
7356 * src/BufferView.C: ditto.
7357 * src/bufferlist.C: ditto.
7358 * src/lyx_cb.C: ditto.
7359 * src/lyxlex.C: ditto.
7361 * NEWS: add some changes for 1.1.4.
7363 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7365 * src/BufferView.C: first go at a TextCache to speed up switching
7368 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7370 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7371 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7372 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7373 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7376 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7377 members of the struct are correctly initialized to 0 (detected by
7379 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7380 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7382 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7383 pidwait, since it was allocated with "new". This was potentially
7384 very bad. Thanks to Michael Schmitt for running purify for us.
7387 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7389 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7391 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7393 1999-12-30 Allan Rae <rae@lyx.org>
7395 * lib/templates/IEEEtran.lyx: minor change
7397 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7398 src/mathed/formula.C (LocalDispatch): askForText changes
7400 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7401 know when a user has cancelled input. Fixes annoying problems with
7402 inserting labels and version control.
7404 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7406 * src/support/lstrings.C (tostr): rewritten to use strstream and
7409 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7411 * src/support/filetools.C (IsFileWriteable): use fstream to check
7412 (IsDirWriteable): use fileinfo to check
7414 * src/support/filetools.h (FilePtr): whole class deleted
7416 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7418 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7420 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7422 * src/bufferlist.C (write): use ifstream and ofstream instead of
7425 * src/Spacing.h: use istrstream instead of sscanf
7427 * src/mathed/math_defs.h: change first arg to istream from FILE*
7429 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7431 * src/mathed/math_parser.C: have yyis to be an istream
7432 (LexGetArg): use istream (yyis)
7434 (mathed_parse): ditto
7435 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7437 * src/mathed/formula.C (Read): rewritten to use istream
7439 * src/mathed/formulamacro.C (Read): rewritten to use istream
7441 * src/lyxlex.h (~LyXLex): deleted desturctor
7442 (getStream): new function, returns an istream
7443 (getFile): deleted funtion
7444 (IsOK): return is.good();
7446 * src/lyxlex.C (LyXLex): delete file and owns_file
7447 (setFile): open an filebuf and assign that to a istream instead of
7449 (setStream): new function, takes an istream as arg.
7450 (setFile): deleted function
7451 (EatLine): rewritten us use istream instead of FILE*
7455 * src/table.C (LyXTable): use istream instead of FILE*
7456 (Read): rewritten to take an istream instead of FILE*
7458 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7460 * src/buffer.C (Dispatch): remove an extraneous break statement.
7462 * src/support/filetools.C (QuoteName): change to do simple
7463 'quoting'. More work is necessary. Also changed to do nothing
7464 under emx (needs fix too).
7465 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7467 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7468 config.h.in to the AC_DEFINE_UNQUOTED() call.
7469 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7470 needs char * as argument (because Solaris 7 declares it like
7473 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7474 remove definition of BZERO.
7476 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7478 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7479 defined, "lyxregex.h" if not.
7481 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7483 (REGEX): new variable that is set to regex.c lyxregex.h when
7484 AM_CONDITIONAL USE_REGEX is set.
7485 (libsupport_la_SOURCES): add $(REGEX)
7487 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7490 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7493 * configure.in: add call to LYX_REGEX
7495 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7496 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7498 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7500 * lib/bind/fi_menus.bind: new file, from
7501 pauli.virtanen@saunalahti.fi.
7503 * src/buffer.C (getBibkeyList): pass the parameter delim to
7504 InsetInclude::getKeys and InsetBibtex::getKeys.
7506 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7507 is passed to Buffer::getBibkeyList
7509 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7510 instead of the hardcoded comma.
7512 * src/insets/insetbib.C (getKeys): make sure that there are not
7513 leading blanks in bibtex keys. Normal latex does not care, but
7514 harvard.sty seems to dislike blanks at the beginning of citation
7515 keys. In particular, the retturn value of the function is
7517 * INSTALL: make it clear that libstdc++ is needed and that gcc
7518 2.7.x probably does not work.
7520 * src/support/filetools.C (findtexfile): make debug message go to
7522 * src/insets/insetbib.C (getKeys): ditto
7524 * src/debug.C (showTags): make sure that the output is correctly
7527 * configure.in: add a comment for TWO_COLOR_ICON define.
7529 * acconfig.h: remove all the entries that already defined in
7530 configure.in or acinclude.m4.
7532 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7533 to avoid user name, date and copyright.
7535 1999-12-21 Juergen Vigna <jug@sad.it>
7537 * src/table.C (Read): Now read bogus row format informations
7538 if the format is < 5 so that afterwards the table can
7539 be read by lyx but without any format-info. Fixed the
7540 crash we experienced when not doing this.
7542 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7544 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7545 (RedoDrawingOfParagraph): ditto
7546 (RedoParagraphs): ditto
7547 (RemoveTableRow): ditto
7549 * src/text.C (Fill): rename arg paperwidth -> paper_width
7551 * src/buffer.C (insertLyXFile): rename var filename -> fname
7552 (writeFile): rename arg filename -> fname
7553 (writeFileAscii): ditto
7554 (makeLaTeXFile): ditto
7555 (makeLinuxDocFile): ditto
7556 (makeDocBookFile): ditto
7558 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7561 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7563 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7566 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7567 compiled by a C compiler not C++.
7569 * src/layout.h (LyXTextClass): added typedef for const_iterator
7570 (LyXTextClassList): added typedef for const_iterator + member
7571 functions begin and end.
7573 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7574 iterators to fill the choice_class.
7575 (updateLayoutChoice): rewritten to use iterators to fill the
7576 layoutlist in the toolbar.
7578 * src/BufferView.h (BufferView::work_area_width): removed unused
7581 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7583 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7584 (sgmlCloseTag): ditto
7586 * src/support/lstrings.h: return type of countChar changed to
7589 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7590 what version of this func to use. Also made to return unsigned int.
7592 * configure.in: call LYX_STD_COUNT
7594 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7595 conforming std::count.
7597 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7599 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7600 and a subscript would give bad display (patch from Dekel Tsur
7601 <dekel@math.tau.ac.il>).
7603 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7605 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7608 * src/chset.h: add a few 'using' directives
7610 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7611 triggered when no buffer is active
7613 * src/layout.C: removed `break' after `return' in switch(), since
7616 * src/lyx_main.C (init): make sure LyX can be ran in place even
7617 when libtool has done its magic with shared libraries. Fix the
7618 test for the case when the system directory has not been found.
7620 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7621 name for the latex file.
7622 (MenuMakeHTML): ditto
7624 * src/buffer.h: add an optional boolean argument, which is passed
7627 1999-12-20 Allan Rae <rae@lyx.org>
7629 * lib/templates/IEEEtran.lyx: small correction and update.
7631 * configure.in: Attempted to use LYX_PATH_HEADER
7633 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7635 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7636 input from JMarc. Now use preprocessor to find the header.
7637 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7638 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7639 LYX_STL_STRING_FWD. See comments in file.
7641 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7643 * The global MiniBuffer * minibuffer variable is dead.
7645 * The global FD_form_main * fd_form_main variable is dead.
7647 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7649 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7651 * src/table.h: add the LOstream.h header
7652 * src/debug.h: ditto
7654 * src/LyXAction.h: change the explaination of the ReadOnly
7655 attribute: is indicates that the function _can_ be used.
7657 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7660 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7662 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7668 * src/paragraph.C (GetWord): assert on pos>=0
7671 * src/support/lyxstring.C: condition the use of an invariant on
7673 * src/support/lyxstring.h: ditto
7675 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7676 Use LAssert.h instead of plain assert().
7678 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7680 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7681 * src/support/filetools.C: ditto
7683 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7686 * INSTALL: document the new configure flags
7688 * configure.in: suppress --with-debug; add --enable-assertions
7690 * acinclude.m4: various changes in alignment of help strings.
7692 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7694 * src/kbmap.C: commented out the use of the hash map in kb_map,
7695 beginning of movement to a stl::container.
7697 * several files: removed code that was not in effect when
7698 MOVE_TEXT was defined.
7700 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7701 for escaping should not be used. We can discuss if the string
7702 should be enclosed in f.ex. [] instead of "".
7704 * src/trans_mgr.C (insert): use the new returned value from
7705 encodeString to get deadkeys and keymaps done correctly.
7707 * src/chset.C (encodeString): changed to return a pair, to tell
7708 what to use if we know the string.
7710 * src/lyxscreen.h (fillArc): new function.
7712 * src/FontInfo.C (resize): rewritten to use more std::string like
7713 structore, especially string::replace.
7715 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7718 * configure.in (chmod +x some scripts): remove config/gcc-hack
7720 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7722 * src/buffer.C (writeFile): change once again the top comment in a
7723 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7724 instead of an hardcoded version number.
7725 (makeDocBookFile): ditto
7727 * src/version.h: add new define LYX_DOCVERSION
7729 * po/de.po: update from Pit Sütterlin
7730 * lib/bind/de_menus.bind: ditto.
7732 * src/lyxfunc.C (Dispatch): call MenuExport()
7733 * src/buffer.C (Dispatch): ditto
7735 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7736 LyXFunc::Dispatch().
7737 (MenuExport): new function, moved from
7738 LyXFunc::Dispatch().
7740 * src/trans_mgr.C (insert): small cleanup
7741 * src/chset.C (loadFile): ditto
7743 * lib/kbd/iso8859-1.cdef: add missing backslashes
7745 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7747 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7748 help with placing the manually drawn accents better.
7750 (Draw): x2 and hg changed to float to minimize rounding errors and
7751 help place the accents better.
7753 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7754 unsigned short to char is just wrong...cast the char to unsigned
7755 char instead so that the two values can compare sanely. This
7756 should also make the display of insetlatexaccents better and
7757 perhaps also some other insets.
7759 (lbearing): new function
7762 1999-12-15 Allan Rae <rae@lyx.org>
7764 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7765 header that provides a wrapper around the very annoying SGI STL header
7768 * src/support/lyxstring.C, src/LString.h:
7769 removed old SGI-STL-compatability attempts.
7771 * configure.in: Use LYX_STL_STRING_FWD.
7773 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7774 stl_string_fwd.h is around and try to determine it's location.
7775 Major improvement over previous SGI STL 3.2 compatability.
7776 Three small problems remain with this function due to my zero
7777 knowledge of autoconf. JMarc and lgb see the comments in the code.
7779 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7781 * src/broken_const.h, config/hack-gcc, config/README: removed
7783 * configure.in: remove --with-gcc-hack option; do not call
7786 * INSTALL: remove documentation of --with-broken-const and
7789 * acconfig.h: remove all trace of BROKEN_CONST define
7791 * src/buffer.C (makeDocBookFile): update version number in output
7793 (SimpleDocBookOnePar): fix an assert when trying to a character
7794 access beyond string length
7797 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7799 * po/de.po: fix the Export menu
7801 * lyx.man: update the description of -dbg
7803 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7804 (commandLineHelp): updated
7805 (easyParse): show list of available debug levels if -dbg is passed
7808 * src/Makefile.am: add debug.C
7810 * src/debug.h: moved some code to debug.C
7812 * src/debug.C: new file. Contains code to set and show debug
7815 * src/layout.C: remove 'break' after 'continue' in switch
7816 statements, since these cannot be reached.
7818 1999-12-13 Allan Rae <rae@lyx.org>
7820 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7821 (in_word_set): hash() -> math_hash()
7823 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7825 * acconfig.h: Added a test for whether we are using exceptions in the
7826 current compilation run. If so USING_EXCEPTIONS is defined.
7828 * config.in: Check for existance of stl_string_fwd.h
7829 * src/LString.h: If compiling --with-included-string and SGI's
7830 STL version 3.2 is present (see above test) we need to block their
7831 forward declaration of string and supply a __get_c_string().
7832 However, it turns out this is only necessary if compiling with
7833 exceptions enabled so I've a bit more to add yet.
7835 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7836 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7837 src/support/LRegex.h, src/undo.h:
7838 Shuffle the order of the included files a little to ensure that
7839 LString.h gets included before anything that includes stl_string_fwd.h
7841 * src/support/lyxstring.C: We need to #include LString.h instead of
7842 lyxstring.h to get the necessary definition of __get_c_string.
7843 (__get_c_string): New function. This is defined static just like SGI's
7844 although why they need to do this I'm not sure. Perhaps it should be
7845 in lstrings.C instead.
7847 * lib/templates/IEEEtran.lyx: New template file.
7849 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7851 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7852 * intl/Makefile.in (MKINSTALLDIRS): ditto
7854 * src/LyXAction.C (init): changed to hold the LFUN data in a
7855 automatic array in stead of in callso to newFunc, this speeds up
7856 compilation a lot. Also all the memory used by the array is
7857 returned when the init is completed.
7859 * a lot of files: compiled with -Wold-style-cast, changed most of
7860 the reported offenders to C++ style casts. Did not change the
7861 offenders in C files.
7863 * src/trans.h (Match): change argument type to unsigned int.
7865 * src/support/DebugStream.C: fix some types on the streambufs so
7866 that it works on a conforming implementation.
7868 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7870 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7872 * src/support/lyxstring.C: remove the inline added earlier since
7873 they cause a bunch of unsatisfied symbols when linking with dec
7874 cxx. Cxx likes to have the body of inlines at the place where they
7877 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7878 accessing negative bounds in array. This fixes the crash when
7879 inserting accented characters.
7880 * src/trans.h (Match): ditto
7882 * src/buffer.C (Dispatch): since this is a void, it should not try
7883 to return anything...
7885 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7887 * src/buffer.h: removed the two friends from Buffer. Some changes
7888 because of this. Buffer::getFileName and Buffer::setFileName
7889 renamed to Buffer::fileName() and Buffer::fileName(...).
7891 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7893 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7894 and Buffer::update(short) to BufferView. This move is currently
7895 controlled by a define MOVE_TEXT, this will be removed when all
7896 shows to be ok. This move paves the way for better separation
7897 between buffer contents and buffer view. One side effect is that
7898 the BufferView needs a rebreak when swiching buffers, if we want
7899 to avoid this we can add a cache that holds pointers to LyXText's
7900 that is not currently in use.
7902 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7905 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7907 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7909 * lyx_main.C: new command line option -x (or --execute) and
7910 -e (or --export). Now direct conversion from .lyx to .tex
7911 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7912 Unfortunately, X is still needed and the GUI pops up during the
7915 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7917 * src/Spacing.C: add a using directive to bring stream stuff into
7919 * src/paragraph.C: ditto
7920 * src/buffer.C: ditto
7922 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7923 from Lars' announcement).
7925 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7926 example files from Tino Meinen.
7928 1999-12-06 Allan Rae <rae@lyx.org>
7930 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7932 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7934 * src/support/lyxstring.C: added a lot of inline for no good
7937 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7938 latexWriteEndChanges, they were not used.
7940 * src/layout.h (operator<<): output operator for PageSides
7942 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7944 * some example files: loaded in LyX 1.0.4 and saved again to update
7945 certain constructs (table format)
7947 * a lot of files: did the change to use fstream/iostream for all
7948 writing of files. Done with a close look at Andre Poenitz's patch.
7950 * some files: whitespace changes.
7952 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7954 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7955 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7956 architecture, we provide our own. It is used unconditionnally, but
7957 I do not think this is a performance problem. Thanks to Angus
7958 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7959 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7961 (GetInset): use my_memcpy.
7965 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7966 it is easier to understand, but it uses less TeX-only constructs now.
7968 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7969 elements contain spaces
7971 * lib/configure: regenerated
7973 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7974 elements contain spaces; display the list of programs that are
7977 * autogen.sh: make sure lib/configure is executable
7979 * lib/examples/*: rename the tutorial examples to begin with the
7980 two-letters language code.
7982 * src/lyxfunc.C (getStatus): do not query current font if no
7985 * src/lyx_cb.C (RunScript): use QuoteName
7986 (MenuRunDvips): ditto
7987 (PrintApplyCB): ditto
7989 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7990 around argument, so that it works well with the current shell.
7991 Does not work properly with OS/2 shells currently.
7993 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7994 * src/LyXSendto.C (SendtoApplyCB): ditto
7995 * src/lyxfunc.C (Dispatch): ditto
7996 * src/buffer.C (runLaTeX): ditto
7997 (runLiterate): ditto
7998 (buildProgram): ditto
8000 * src/lyx_cb.C (RunScript): ditto
8001 (MenuMakeLaTeX): ditto
8003 * src/buffer.h (getLatexName): new method
8005 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8007 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8009 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8010 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8011 (create_math_panel): ditto
8013 * src/lyxfunc.C (getStatus): re-activate the code which gets
8014 current font and cursor; add test for export to html.
8016 * src/lyxrc.C (read): remove unreachable break statements; add a
8019 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8021 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8023 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8024 introduced by faulty regex.
8025 * src/buffer.C: ditto
8026 * src/lastfiles.C: ditto
8027 * src/paragraph.C: ditto
8028 * src/table.C: ditto
8029 * src/vspace.C: ditto
8030 * src/insets/figinset.C: ditto
8031 Note: most of these is absolutely harmless, except the one in
8032 src/mathed formula.C.
8034 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8036 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8037 operation, yielding correct results for the reLyX command.
8039 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * src/support/filetools.C (ExpandPath): removed an over eager
8043 (ReplaceEnvironmentPath): ditto
8045 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8046 shows that we are doing something fishy in our code...
8050 * src/lyxrc.C (read): use a double switch trick to get more help
8051 from the compiler. (the same trick is used in layout.C)
8052 (write): new function. opens a ofstream and pass that to output
8053 (output): new function, takes a ostream and writes the lyxrc
8054 elemts to it. uses a dummy switch to make sure no elements are
8057 * src/lyxlex.h: added a struct pushpophelper for use in functions
8058 with more than one exit point.
8060 * src/lyxlex.[Ch] (GetInteger): made it const
8064 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8066 * src/layout.[hC] : LayoutTags splitted into several enums, new
8067 methods created, better error handling cleaner use of lyxlex. Read
8070 * src/bmtable.[Ch]: change some member prototypes because of the
8071 image const changes.
8073 * commandtags.h, src/LyXAction.C (init): new function:
8074 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8075 This file is not read automatically but you can add \input
8076 preferences to your lyxrc if you want to. We need to discuss how
8079 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8080 in .aux, also remove .bib and .bst files from dependencies when
8083 * src/BufferView.C, src/LyXView.C: add const_cast several places
8084 because of changes to images.
8086 * lib/images/*: same change as for images/*
8088 * lib/lyxrc.example: Default for accept_compound is false not no.
8090 * images/*: changed to be const, however I have som misgivings
8091 about this change so it might be changed back.
8093 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8095 * lib/configure, po/POTFILES.in: regenerated
8097 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8099 * config/lib_configure.m4: removed
8101 * lib/configure.m4: new file (was config/lib_configure.m4)
8103 * configure.in: do not test for rtti, since we do not use it.
8105 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8107 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8108 doubling of allocated space scheme. This makes it faster for large
8109 strings end to use less memory for small strings. xtra rememoved.
8111 * src/insets/figinset.C (waitalarm): commented out.
8112 (GhostscriptMsg): use static_cast
8113 (GhostscriptMsg): use new instead of malloc to allocate memory for
8114 cmap. also delete the memory after use.
8116 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8118 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8119 for changes in bibtex database or style.
8120 (runBibTeX): remove all .bib and .bst files from dep before we
8122 (run): use scanAuc in when dep file already exist.
8124 * src/DepTable.C (remove_files_with_extension): new method
8127 * src/DepTable.[Ch]: made many of the methods const.
8129 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8131 * src/bufferparams.C: make sure that the default textclass is
8132 "article". It used to be the first one by description order, but
8133 now the first one is "docbook".
8135 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8136 string; call Debug::value.
8137 (easyParse): pass complete argument to setDebuggingLevel().
8139 * src/debug.h (value): fix the code that parses debug levels.
8141 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8144 * src/LyXAction.C: use Debug::ACTION as debug channel.
8146 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8148 * NEWS: updated for the future 1.1.3 release.
8150 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8151 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8152 it should. This is of course a controversial change (since many
8153 people will find that their lyx workscreen is suddenly full of
8154 red), but done for the sake of correctness.
8156 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8157 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8159 * src/insets/inseterror.h, src/insets/inseturl.h,
8160 src/insets/insetinfo.h, src/insets/figinset.h,
8161 src/mathed/formulamacro.h, src/mathed/math_macro.h
8162 (EditMessage): add a missing const and add _() to make sure that
8165 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8166 src/insets/insetbib.C, src/support/filetools.C: add `using'
8169 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8170 doing 'Insert index of last word' at the beginning of a paragraph.
8172 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8174 * several files: white-space changes.
8176 * src/mathed/formula.C: removed IsAlpha and IsDigit
8178 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8179 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8182 * src/insets/figinset.C (GetPSSizes): don't break when
8183 "EndComments" is seen. But break when a boundingbox is read.
8185 * all classes inherited from Inset: return value of Clone
8186 changed back to Inset *.
8188 * all classes inherited form MathInset: return value of Clone
8189 changed back to MathedInset *.
8191 * src/insets/figinset.C (runqueue): use a ofstream to output the
8192 gs/ps file. Might need some setpresicion or setw. However I can
8193 see no problem with the current code.
8194 (runqueue): use sleep instead of the alarm/signal code. I just
8195 can't see the difference.
8197 * src/paragraph.C (LyXParagraph): reserve space in the new
8198 paragraph and resize the inserted paragraph to just fit.
8200 * src/lyxfunc.h (operator|=): added operator for func_status.
8202 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8203 check for readable file.
8205 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8206 check for readable file.
8207 (MenuMakeLinuxDoc): ditto
8208 (MenuMakeDocBook): ditto
8209 (MenuMakeAscii): ditto
8210 (InsertAsciiFile): split the test for openable and readable
8212 * src/bmtable.C (draw_bitmaptable): use
8213 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8215 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8216 findtexfile from LaTeX to filetools.
8218 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8219 instead of FilePtr. Needs to be verified by a literate user.
8221 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8223 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8224 (EditMessage): likewise.
8226 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8227 respectively as \textasciitilde and \textasciicircum.
8229 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8231 * src/support/lyxstring.h: made the methods that take iterators
8234 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8235 (regexMatch): made is use the real regex class.
8237 * src/support/Makefile.am: changed to use libtool
8239 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8241 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8243 (MathIsInset ++): changed several macros to be inline functions
8246 * src/mathed/Makefile.am: changed to use libtool
8248 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8250 * src/insets/inset* : Clone changed to const and return type is
8251 the true insettype not just Inset*.
8253 * src/insets/Makefile.am: changed to use libtool
8255 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8257 * src/undo.[Ch] : added empty() and changed some of the method
8260 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8262 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8263 setID use block<> for the bullets array, added const several places.
8265 * src/lyxfunc.C (getStatus): new function
8267 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8268 LyXAction, added const to several funtions.
8270 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8271 a std::map, and to store the dir items in a vector.
8273 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8276 * src/LyXView.[Ch] + other files : changed currentView to view.
8278 * src/LyXAction.[Ch] : ported from the old devel branch.
8280 * src/.cvsignore: added .libs and a.out
8282 * configure.in : changes to use libtool.
8284 * acinclude.m4 : inserted libtool.m4
8286 * .cvsignore: added libtool
8288 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8291 file name in insets and mathed directories (otherwise the
8292 dependency is not taken in account under cygwin).
8294 * src/text2.C (InsertString[AB]): make sure that we do not try to
8295 read characters past the string length.
8297 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8299 * lib/doc/LaTeXConfig.lyx.in,
8300 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8302 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8303 file saying who created them and when this heppened; this is
8304 useless and annoys tools like cvs.
8306 * lib/layouts/g-brief-{en,de}.layout,
8307 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8308 from Thomas Hartkens <thomas@hartkens.de>.
8310 * src/{insets,mathed}/Makefile.am: do not declare an empty
8311 LDFLAGS, so that it can be set at configure time (useful on Irix
8314 * lib/reLyX/configure.in: make sure that the prefix is set
8315 correctly in LYX_DIR.
8317 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8319 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8320 be used by 'command-sequence' this allows to bind a key to a
8321 sequence of LyX-commands
8322 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8324 * src/LyXAction.C: add "command-sequence"
8326 * src/LyXFunction.C: handling of "command-sequence"
8328 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8329 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8331 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8333 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8335 * src/buffer.C (writeFile): Do not output a comment giving user
8336 and date at the beginning of a .lyx file. This is useless and
8337 annoys cvs anyway; update version number to 1.1.
8339 * src/Makefile.am (LYX_DIR): add this definition, so that a
8340 default path is hardcoded in LyX.
8342 * configure.in: Use LYX_GNU_GETTEXT.
8344 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8345 AM_GNU_GETTEXT with a bug fixed.
8347 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8349 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8351 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8352 which is used to point to LyX data is now LYX_DIR_11x.
8354 * lyx.man: convert to a unix text file; small updates.
8356 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8358 * src/support/LSubstring.[Ch]: made the second arg of most of the
8359 constructors be a const reference.
8361 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8364 * src/support/lyxstring.[Ch] (swap): added missing member function
8365 and specialization of swap(str, str);
8367 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8369 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8370 trace of the old one.
8372 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8373 put the member definitions in undo.C.
8375 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8376 NEW_TEXT and have now only code that was included when this was
8379 * src/intl.C (LCombo): use static_cast
8381 (DispatchCallback): ditto
8383 * src/definitions.h: removed whole file
8385 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8387 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8388 parsing and stores in a std:map. a regex defines the file format.
8389 removed unneeded members.
8391 * src/bufferparams.h: added several enums from definitions.h here.
8392 Removed unsused destructor. Changed some types to use proper enum
8393 types. use block to have the temp_bullets and user_defined_bullets
8394 and to make the whole class assignable.
8396 * src/bufferparams.C (Copy): removed this functions, use a default
8399 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8402 * src/buffer.C (readLyXformat2): commend out all that have with
8403 oldpapersize to do. also comment out all that hve to do with
8404 insetlatex and insetlatexdel.
8405 (setOldPaperStuff): commented out
8407 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8409 * src/LyXAction.C: remove use of inset-latex-insert
8411 * src/mathed/math_panel.C (button_cb): use static_cast
8413 * src/insets/Makefile.am (insets_o_SOURCES): removed
8416 * src/support/lyxstring.C (helper): use the unsigned long
8417 specifier, UL, instead of a static_cast.
8419 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8421 * src/support/block.h: new file. to be used as a c-style array in
8422 classes, so that the class can be assignable.
8424 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8426 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8427 NULL, make sure to return an empty string (it is not possible to
8428 set a string to NULL).
8430 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8432 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8434 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8436 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8437 link line, so that Irix users (for example) can set it explicitely to
8440 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8441 it can be overidden at make time (static or dynamic link, for
8444 * src/vc-backend.C, src/LaTeXFeatures.h,
8445 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8446 statements to bring templates to global namespace.
8448 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8450 * src/support/lyxstring.C (operator[] const): make it standard
8453 * src/minibuffer.C (Init): changed to reflect that more
8454 information is given from the lyxvc and need not be provided here.
8456 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8458 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8460 * src/LyXView.C (UpdateTimerCB): use static_cast
8461 (KeyPressMask_raw_callback): ditto
8463 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8464 buffer_, a lot of changes because of this. currentBuffer() ->
8465 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8466 also changes to other files because of this.
8468 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8470 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8471 have no support for RCS and partial support for CVS, will be
8474 * src/insets/ several files: changes because of function name
8475 changes in Bufferview and LyXView.
8477 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8479 * src/support/LSubstring.[Ch]: new files. These implement a
8480 Substring that can be very convenient to use. i.e. is this
8482 string a = "Mary had a little sheep";
8483 Substring(a, "sheep") = "lamb";
8484 a is now "Mary has a little lamb".
8486 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8487 out patterns and subpatterns of strings. It is used by LSubstring
8488 and also by vc-backend.C
8490 * src/support/lyxstring.C: went over all the assertions used and
8491 tried to correct the wrong ones and flag which of them is required
8492 by the standard. some bugs found because of this. Also removed a
8493 couple of assertions.
8495 * src/support/Makefile.am (libsupport_a_SOURCES): added
8496 LSubstring.[Ch] and LRegex.[Ch]
8498 * src/support/FileInfo.h: have struct stat buf as an object and
8499 not a pointer to one, some changes because of this.
8501 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8502 information in layout when adding the layouts preamble to the
8505 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8508 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8509 because of bug in OS/2.
8511 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8513 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8514 \verbatim@font instead of \ttfamily, so that it can be redefined.
8516 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8517 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8518 src/layout.h, src/text2.C: add 'using' directive to bring the
8519 STL templates we need from the std:: namespace to the global one.
8520 Needed by DEC cxx in strict ansi mode.
8522 * src/support/LIstream.h,src/support/LOstream.h,
8523 src/support/lyxstring.h,src/table.h,
8524 src/lyxlookup.h: do not include <config.h> in header
8525 files. This should be done in the .C files only.
8527 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8531 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8533 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8534 from Kayvan to fix the tth invokation.
8536 * development/lyx.spec.in: updates from Kayvan to reflect the
8537 changes of file names.
8539 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8541 * src/text2.C (InsertStringB): use std::copy
8542 (InsertStringA): use std::copy
8544 * src/bufferlist.C: use a vector to store the buffers in. This is
8545 an internal change and should not affect any other thing.
8547 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8550 * src/text.C (Fill): fix potential bug, one off bug.
8552 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/Makefile.am (lyx_main.o): add more files it depends on.
8556 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8558 * src/support/lyxstring.C: use size_t for the reference count,
8559 size, reserved memory and xtra.
8560 (internal_compare): new private member function. Now the compare
8561 functions should work for std::strings that have embedded '\0'
8563 (compare): all compare functions rewritten to use
8566 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8568 * src/support/lyxstring.C (compare): pass c_str()
8569 (compare): pass c_str
8570 (compare): pass c_str
8572 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8574 * src/support/DebugStream.C: <config.h> was not included correctly.
8576 * lib/configure: forgot to re-generate it :( I'll make this file
8577 auto generated soon.
8579 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8581 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8584 * src/support/lyxstring.C: some changes from length() to rep->sz.
8585 avoids a function call.
8587 * src/support/filetools.C (SpaceLess): yet another version of the
8588 algorithm...now per Jean-Marc's suggestions.
8590 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8592 * src/layout.C (less_textclass_desc): functor for use in sorting
8594 (LyXTextClass::Read): sort the textclasses after reading.
8596 * src/support/filetools.C (SpaceLess): new version of the
8597 SpaceLess functions. What problems does this one give? Please
8600 * images/banner_bw.xbm: made the arrays unsigned char *
8602 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8604 * src/support/lyxstring.C (find): remove bogus assertion in the
8605 two versions of find where this has not been done yet.
8607 * src/support/lyxlib.h: add missing int return type to
8610 * src/menus.C (ShowFileMenu): disable exporting to html if no
8611 html export command is present.
8613 * config/lib_configure.m4: add a test for an HTML converter. The
8614 programs checked for are, in this order: tth, latex2html and
8617 * lib/configure: generated from config/lib_configure.m4.
8619 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8620 html converter. The parameters are now passed through $$FName and
8621 $$OutName, instead of standard input/output.
8623 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8625 * lib/lyxrc.example: update description of \html_command.
8626 add "quotes" around \screen_font_xxx font setting examples to help
8627 people who use fonts with spaces in their names.
8629 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8631 * Distribution files: updates for v1.1.2
8633 * src/support/lyxstring.C (find): remove bogus assert and return
8634 npos for the same condition.
8636 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8638 * added patch for OS/2 from SMiyata.
8640 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8642 * src/text2.C (CutSelection): make space_wrapped a bool
8643 (CutSelection): dont declare int i until we have to.
8644 (alphaCounter): return a char const *.
8646 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8648 * src/support/syscall.C (Systemcalls::kill):
8649 src/support/filetools.C (PutEnv, PutEnvPath):
8650 src/lyx_cb.C (addNewlineAndDepth):
8651 src/FontInfo.C (FontInfo::resize): condition some #warning
8652 directives with WITH_WARNINGS.
8655 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8657 * src/layout.[Ch] + several files: access to class variables
8658 limited and made accessor functions instead a lot of code changed
8659 becuase of this. Also instead of returning pointers often a const
8660 reference is returned instead.
8662 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8664 * src/Makefile.am (dist-hook): added used to remove the CVS from
8665 cheaders upon creating a dist
8666 (EXTRA_DIST): added cheaders
8668 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8669 a character not as a small integer.
8671 * src/support/lyxstring.C (find): removed Assert and added i >=
8672 rep->sz to the first if.
8674 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8677 src/LyXView.C src/buffer.C src/bufferparams.C
8678 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8679 src/text2.C src/insets/insetinclude.C:
8680 lyxlayout renamed to textclasslist.
8682 * src/layout.C: some lyxerr changes.
8684 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8685 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8686 (LyXLayoutList): removed all traces of this class.
8687 (LyXTextClass::Read): rewrote LT_STYLE
8688 (LyXTextClass::hasLayout): new function
8689 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8690 both const and nonconst version.
8691 (LyXTextClass::delete_layout): new function.
8692 (LyXTextClassList::Style): bug fix. do the right thing if layout
8694 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8695 (LyXTextClassList::NameOfLayout): ditto
8696 (LyXTextClassList::Load): ditto
8698 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8700 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8702 * src/LyXAction.C (LookupFunc): added a workaround for sun
8703 compiler, on the other hand...we don't know if the current code
8704 compiles on sun at all...
8706 * src/support/filetools.C (CleanupPath): subst fix
8708 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8711 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8712 complained about this one?
8714 * src/insets/insetinclude.C (Latex): subst fix
8716 * src/insets/insetbib.C (getKeys): subst fix
8718 * src/LyXSendto.C (SendtoApplyCB): subst fix
8720 * src/lyx_main.C (init): subst fix
8722 * src/layout.C (Read): subst fix
8724 * src/lyx_sendfax_main.C (button_send): subst fix
8726 * src/buffer.C (RoffAsciiTable): subst fix
8728 * src/lyx_cb.C (MenuFax): subst fix
8729 (PrintApplyCB): subst fix
8731 1999-10-26 Juergen Vigna <jug@sad.it>
8733 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8735 (Read): Cleaned up this code so now we read only format vestion >= 5
8737 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8739 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8740 come nobody has complained about this one?
8742 * src/insets/insetinclude.C (Latex): subst fix
8744 * src/insets/insetbib.C (getKeys): subst fix
8746 * src/lyx_main.C (init): subst fix
8748 * src/layout.C (Read): subst fix
8750 * src/buffer.C (RoffAsciiTable): subst fix
8752 * src/lyx_cb.C (MenuFax): subst fix.
8754 * src/layout.[hC] + some other files: rewrote to use
8755 std::container to store textclasses and layouts in.
8756 Simplified, removed a lot of code. Make all classes
8757 assignable. Further simplifications and review of type
8758 use still to be one.
8760 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8761 lastfiles to create the lastfiles partr of the menu.
8763 * src/lastfiles.[Ch]: rewritten to use deque to store the
8764 lastfiles in. Uses fstream for reading and writing. Simplifies
8767 * src/support/syscall.C: remove explicit cast.
8769 * src/BufferView.C (CursorToggleCB): removed code snippets that
8771 use explicat C++ style casts instead of C style casts. also use
8772 u_vdata instea of passing pointers in longs.
8774 * src/PaperLayout.C: removed code snippets that were commented out.
8776 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8778 * src/lyx_main.C: removed code snippets that wer commented out.
8780 * src/paragraph.C: removed code snippets that were commented out.
8782 * src/lyxvc.C (logClose): use static_cast
8784 (viewLog): remove explicit cast to void*
8785 (showLog): removed old commented code
8787 * src/menus.C: use static_cast instead of C style casts. use
8788 u_vdata instead of u_ldata. remove explicit cast to (long) for
8789 pointers. Removed old code that was commented out.
8791 * src/insets/inset.C: removed old commented func
8793 * src/insets/insetref.C (InsetRef): removed old code that had been
8794 commented out for a long time.
8796 (escape): removed C style cast
8798 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8800 * src/insets/insetlatex.C (Draw): removed old commented code
8801 (Read): rewritten to use string
8803 * src/insets/insetlabel.C (escape): removed C style cast
8805 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8807 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8810 * src/insets/insetinclude.h: removed a couple of stupid bools
8812 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8813 (Clone): remove C style cast
8814 (getKeys): changed list to lst because of std::list
8816 * src/insets/inseterror.C (Draw): removed som old commented code.
8818 * src/insets/insetcommand.C (Draw): removed some old commented code.
8820 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8821 commented out forever.
8822 (bibitem_cb): use static_cast instead of C style cast
8823 use of vdata changed to u_vdata.
8825 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8827 (CloseUrlCB): use static_cast instead of C style cast.
8828 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8830 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8831 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8832 (CloseInfoCB): static_cast from ob->u_vdata instead.
8833 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8836 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8837 (C_InsetError_CloseErrorCB): forward the ob parameter
8838 (CloseErrorCB): static_cast from ob->u_vdata instead.
8840 * src/vspace.h: include LString.h since we use string in this class.
8842 * src/vspace.C (lyx_advance): changed name from advance because of
8843 nameclash with stl. And since we cannot use namespaces yet...I
8844 used a lyx_ prefix instead. Expect this to change when we begin
8847 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8849 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8850 and removed now defunct constructor and deconstructor.
8852 * src/BufferView.h: have backstack as a object not as a pointer.
8853 removed initialization from constructor. added include for BackStack
8855 * development/lyx.spec.in (%build): add CFLAGS also.
8857 * src/screen.C (drawFrame): removed another warning.
8859 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8861 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8862 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8863 README and ANNOUNCE a bit for the next release. More work is
8866 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8867 unbreakable if we are in freespacing mode (LyX-Code), but not in
8870 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8872 * src/BackStack.h: fixed initialization order in constructor
8874 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8876 * acinclude.m4 (VERSION): new rules for when a version is
8877 development, added also a variable for prerelease.
8878 (warnings): we set with_warnings=yes for prereleases
8879 (lyx_opt): prereleases compile with same optimization as development
8880 (CXXFLAGS): only use pedantic if we are a development version
8882 * src/BufferView.C (restorePosition): don't do anything if the
8885 * src/BackStack.h: added member empty, use this to test if there
8886 is anything to pop...
8888 1999-10-25 Juergen Vigna <jug@sad.it>
8891 * forms/layout_forms.fd +
8892 * forms/latexoptions.fd +
8893 * lyx.fd: changed for various form resize issues
8895 * src/mathed/math_panel.C +
8896 * src/insets/inseterror.C +
8897 * src/insets/insetinfo.C +
8898 * src/insets/inseturl.C +
8899 * src/insets/inseturl.h +
8902 * src/PaperLayout.C +
8903 * src/ParagraphExtra.C +
8904 * src/TableLayout.C +
8906 * src/layout_forms.C +
8913 * src/menus.C: fixed various resize issues. So now forms can be
8914 resized savely or not be resized at all.
8916 * forms/form_url.fd +
8917 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8920 * src/insets/Makefile.am: added files form_url.[Ch]
8922 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8924 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8925 (and presumably 6.2).
8927 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8928 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8929 remaining static member callbacks.
8931 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8934 * src/support/lyxstring.h: declare struct Srep as friend of
8935 lyxstring, since DEC cxx complains otherwise.
8937 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8939 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8941 * src/LaTeX.C (run): made run_bibtex also depend on files with
8943 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8944 are put into the dependency file.
8946 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8947 the code has shown itself to work
8948 (create_ispell_pipe): removed another warning, added a comment
8951 * src/minibuffer.C (ExecutingCB): removed code that has been
8952 commented out a long time
8954 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8955 out code + a warning.
8957 * src/support/lyxstring.h: comment out the three private
8958 operators, when compiling with string ansi conforming compilers
8961 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8963 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8964 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8967 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8970 * src/mathed/math_panel.C (create_math_panel): remove explicit
8973 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8976 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8977 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8978 to XCreatePixmapFromBitmapData
8979 (fl_set_bmtable_data): change the last argument to be unsigned
8981 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8982 and bh to be unsigned int, remove explicit casts in call to
8983 XReadBitmapFileData.
8985 * images/arrows.xbm: made the arrays unsigned char *
8986 * images/varsz.xbm: ditto
8987 * images/misc.xbm: ditto
8988 * images/greek.xbm: ditto
8989 * images/dots.xbm: ditto
8990 * images/brel.xbm: ditto
8991 * images/bop.xbm: ditto
8993 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8995 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8996 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8997 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8999 (LYX_CXX_CHEADERS): added <clocale> to the test.
9001 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9003 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9005 * src/support/lyxstring.C (append): fixed something that must be a
9006 bug, rep->assign was used instead of rep->append.
9008 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9011 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9012 lyx insert double chars. Fix spotted by Kayvan.
9014 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9016 * Fixed the tth support. I messed up with the Emacs patch apply feature
9017 and omitted the changes in lyxrc.C.
9019 1999-10-22 Juergen Vigna <jug@sad.it>
9021 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9023 * src/lyx_cb.C (MenuInsertRef) +
9024 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9025 the form cannot be resized under it limits (fixes a segfault)
9027 * src/lyx.C (create_form_form_ref) +
9028 * forms/lyx.fd: Changed Gravity on name input field so that it is
9031 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9033 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9034 <ostream> and <istream>.
9036 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9037 whether <fstream> provides the latest standard features, or if we
9038 have an oldstyle library (like in egcs).
9039 (LYX_CXX_STL_STRING): fix the test.
9041 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9042 code on MODERN_STL_STREAM.
9044 * src/support/lyxstring.h: use L{I,O}stream.h.
9046 * src/support/L{I,O}stream.h: new files, designed to setup
9047 correctly streams for our use
9048 - includes the right header depending on STL capabilities
9049 - puts std::ostream and std::endl (for LOStream.h) or
9050 std::istream (LIStream.h) in toplevel namespace.
9052 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9054 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9055 was a bib file that had been changed we ensure that bibtex is run.
9056 (runBibTeX): enhanced to extract the names of the bib files and
9057 getting their absolute path and enter them into the dep file.
9058 (findtexfile): static func that is used to look for tex-files,
9059 checks for absolute patchs and tries also with kpsewhich.
9060 Alternative ways of finding the correct files are wanted. Will
9062 (do_popen): function that runs a command using popen and returns
9063 the whole output of that command in a string. Should be moved to
9066 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9067 file with extension ext has changed.
9069 * src/insets/figinset.C: added ifdef guards around the fl_free
9070 code that jug commented out. Now it is commented out when
9071 compiling with XForms == 0.89.
9073 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9074 to lyxstring.C, and only keep a forward declaration in
9075 lyxstring.h. Simplifies the header file a bit and should help a
9076 bit on compile time too. Also changes to Srep will not mandate a
9077 recompile of code just using string.
9078 (~lyxstring): definition moved here since it uses srep.
9079 (size): definition moved here since it uses srep.
9081 * src/support/lyxstring.h: removed a couple of "inline" that should
9084 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9086 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9089 1999-10-21 Juergen Vigna <jug@sad.it>
9091 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9092 set to left if I just remove the width entry (or it is empty).
9094 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9095 paragraph when having dummy paragraphs.
9097 1999-10-20 Juergen Vigna <jug@sad.it>
9099 * src/insets/figinset.C: just commented some fl_free_form calls
9100 and added warnings so that this calls should be activated later
9101 again. This avoids for now a segfault, but we have a memory leak!
9103 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9104 'const char * argument' to 'string argument', this should
9105 fix some Asserts() in lyxstring.C.
9107 * src/lyxfunc.h: Removed the function argAsString(const char *)
9108 as it is not used anymore.
9110 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9112 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9115 * src/Literate.h: some funcs moved from public to private to make
9116 interface clearer. Unneeded args removed.
9118 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9120 (scanBuildLogFile): ditto
9122 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9123 normal TeX Error. Still room for improvement.
9125 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9127 * src/buffer.C (insertErrors): changes to make the error
9128 desctription show properly.
9130 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9133 * src/support/lyxstring.C (helper): changed to use
9134 sizeof(object->rep->ref).
9135 (operator>>): changed to use a pointer instead.
9137 * src/support/lyxstring.h: changed const reference & to value_type
9138 const & lets see if that helps.
9140 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9142 * Makefile.am (rpmdist): fixed to have non static package and
9145 * src/support/lyxstring.C: removed the compilation guards
9147 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9150 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9151 conditional compile of lyxstring.Ch
9153 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9154 stupid check, but it is a lot better than the bastring hack.
9155 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9157 * several files: changed string::erase into string::clear. Not
9160 * src/chset.C (encodeString): use a char temporary instead
9162 * src/table.C (TexEndOfCell): added tostr around
9163 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9164 (TexEndOfCell): ditto
9165 (TexEndOfCell): ditto
9166 (TexEndOfCell): ditto
9167 (DocBookEndOfCell): ditto
9168 (DocBookEndOfCell): ditto
9169 (DocBookEndOfCell): ditto
9170 (DocBookEndOfCell): ditto
9172 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9174 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9176 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9177 (MenuBuildProg): added tostr around ret
9178 (MenuRunChktex): added tostr around ret
9179 (DocumentApplyCB): added tostr around ret
9181 * src/chset.C (encodeString): added tostr around t->ic
9183 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9184 (makeLaTeXFile): added tostr around tocdepth
9185 (makeLaTeXFile): added tostr around ftcound - 1
9187 * src/insets/insetbib.C (setCounter): added tostr around counter.
9189 * src/support/lyxstring.h: added an operator+=(int) to catch more
9192 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9193 (lyxstring): We DON'T allow NULL pointers.
9195 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9197 * src/mathed/math_macro.C (MathMacroArgument::Write,
9198 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9199 when writing them out.
9201 * src/LString.C: remove, since it is not used anymore.
9203 * src/support/lyxstring.C: condition the content to
9204 USE_INCLUDED_STRING macro.
9206 * src/mathed/math_symbols.C, src/support/lstrings.C,
9207 src/support/lyxstring.C: add `using' directive to specify what
9208 we need in <algorithm>. I do not think that we need to
9209 conditionalize this, but any thought is appreciated.
9211 * many files: change all callback functions to "C" linkage
9212 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9213 strict_ansi. Those who were static are now global.
9214 The case of callbacks which are static class members is
9215 trickier, since we have to make C wrappers around them (see
9216 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9217 did not finish this yet, since it defeats the purpose of
9218 encapsulation, and I am not sure what the best route is.
9220 1999-10-19 Juergen Vigna <jug@sad.it>
9222 * src/support/lyxstring.C (lyxstring): we permit to have a null
9223 pointer as assignment value and just don't assign it.
9225 * src/vspace.C (nextToken): corrected this function substituting
9226 find_first(_not)_of with find_last_of.
9228 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9229 (TableOptCloseCB) (TableSpeCloseCB):
9230 inserted fl_set_focus call for problem with fl_hide_form() in
9233 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9235 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9238 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9240 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9241 LyXLex::next() and not eatline() to get its argument.
9243 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9245 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9246 instead, use fstreams for io of the depfile, removed unneeded
9247 functions and variables.
9249 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9250 vector instead, removed all functions and variables that is not in
9253 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9255 * src/buffer.C (insertErrors): use new interface to TeXError
9257 * Makefile.am (rpmdist): added a rpmdist target
9259 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9260 per Kayvan's instructions.
9262 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9264 * src/Makefile.am: add a definition for localedir, so that locales
9265 are found after installation (Kayvan)
9267 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9269 * development/.cvsignore: new file.
9271 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9273 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9274 C++ compiler provides wrappers for C headers and use our alternate
9277 * configure.in: use LYX_CXX_CHEADERS.
9279 * src/cheader/: new directory, populated with cname headers from
9280 libstdc++-2.8.1. They are a bit old, but probably good enough for
9281 what we want (support compilers who lack them).
9283 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9284 from includes. It turns out is was stupid.
9286 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9288 * lib/Makefile.am (install-data-local): forgot a ';'
9289 (install-data-local): forgot a '\'
9290 (libinstalldirs): needed after all. reintroduced.
9292 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9294 * configure.in (AC_OUTPUT): added lyx.spec
9296 * development/lyx.spec: removed file
9298 * development/lyx.spec.in: new file
9300 * po/*.po: merged with lyx.pot becuase of make distcheck
9302 * lib/Makefile.am (dist-hook): added dist-hook so that
9303 documentation files will be included when doing a make
9304 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9305 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9307 more: tried to make install do the right thing, exclude CVS dirs
9310 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9311 Path would fit in more nicely.
9313 * all files that used to use pathstack: uses now Path instead.
9314 This change was a lot easier than expected.
9316 * src/support/path.h: new file
9318 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9320 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9322 * src/support/lyxstring.C (getline): Default arg was given for
9325 * Configure.cmd: removed file
9327 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9329 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9330 streams classes and types, add the proper 'using' statements when
9331 MODERN_STL is defined.
9333 * src/debug.h: move the << operator definition after the inclusion
9336 * src/support/filetools.C: include "LAssert.h", which is needed
9339 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9342 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9343 include "debug.h" to define a proper ostream.
9345 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9347 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9348 method to the SystemCall class which can kill a process, but it's
9349 not fully implemented yet.
9351 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9353 * src/support/FileInfo.h: Better documentation
9355 * src/lyxfunc.C: Added support for buffer-export html
9357 * src/menus.C: Added Export->As HTML...
9359 * lib/bind/*.bind: Added short-cut for buffer-export html
9361 * src/lyxrc.*: Added support for new \tth_command
9363 * lib/lyxrc.example: Added stuff for new \tth_command
9365 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9367 * lib/Makefile.am (IMAGES): removed images/README
9368 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9369 installes in correct place. Check permisions is installed
9372 * src/LaTeX.C: some no-op changes moved declaration of some
9375 * src/LaTeX.h (LATEX_H): changed include guard name
9377 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9379 * lib/reLyX/Makefile.am: install noweb2lyx.
9381 * lib/Makefile.am: install configure.
9383 * lib/reLyX/configure.in: declare a config aux dir; set package
9384 name to lyx (not sure what the best solution is); generate noweb2lyx.
9386 * lib/layouts/egs.layout: fix the bibliography layout.
9388 1999-10-08 Jürgen Vigna <jug@sad.it>
9390 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9391 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9392 it returned without continuing to search the path.
9394 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9396 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9397 also fixes a bug. It is not allowed to do tricks with std::strings
9398 like: string a("hei"); &a[e]; this will not give what you
9399 think... Any reason for the complexity in this func?
9401 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9403 * Updated README and INSTALL a bit, mostly to check that my
9404 CVS rights are correctly set up.
9406 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9408 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9409 does not allow '\0' chars but lyxstring and std::string does.
9411 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9413 * autogen.sh (AUTOCONF): let the autogen script create the
9414 POTFILES.in file too. POTFILES.in should perhaps now not be
9415 included in the cvs module.
9417 * some more files changed to use C++ includes instead of C ones.
9419 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9421 (Reread): added tostr to nlink. buggy output otherwise.
9422 (Reread): added a string() around szMode when assigning to Buffer,
9423 without this I got a log of garbled info strings.
9425 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9428 * I have added several ostream & operator<<(ostream &, some_type)
9429 functions. This has been done to avoid casting and warnings when
9430 outputting enums to lyxerr. This as thus eliminated a lot of
9431 explicit casts and has made the code clearer. Among the enums
9432 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9433 mathed enums, some font enum the Debug::type enum.
9435 * src/support/lyxstring.h (clear): missing method. equivalent of
9438 * all files that contained "stderr": rewrote constructs that used
9439 stderr to use lyxerr instead. (except bmtable)
9441 * src/support/DebugStream.h (level): and the passed t with
9442 Debug::ANY to avoid spurious bits set.
9444 * src/debug.h (Debug::type value): made it accept strings of the
9447 * configure.in (Check for programs): Added a check for kpsewhich,
9448 the latex generation will use this later to better the dicovery of
9451 * src/BufferView.C (create_view): we don't need to cast this to
9452 (void*) that is done automatically.
9453 (WorkAreaButtonPress): removed some dead code.
9455 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9457 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9458 is not overwritten when translated (David Sua'rez de Lis).
9460 * lib/CREDITS: Added David Sua'rez de Lis
9462 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9464 * src/bufferparams.C (BufferParams): default input encoding is now
9467 * acinclude.m4 (cross_compiling): comment out macro
9468 LYX_GXX_STRENGTH_REDUCE.
9470 * acconfig.h: make sure that const is not defined (to empty) when
9471 we are compiling C++. Remove commented out code using SIZEOF_xx
9474 * configure.in : move the test for const and inline as late as
9475 possible so that these C tests do not interefere with C++ ones.
9476 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9477 has not been proven.
9479 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9481 * src/table.C (getDocBookAlign): remove bad default value for
9484 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9486 (ShowFileMenu2): ditto.
9488 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9491 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9493 * Most files: finished the change from the old error code to use
9494 DebugStream for all lyxerr debugging. Only minor changes remain
9495 (e.g. the setting of debug levels using strings instead of number)
9497 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * src/layout.C (Add): Changed to use compare_no_case instead of
9502 * src/FontInfo.C: changed loop variable type too string::size_type.
9504 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9506 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9507 set ETAGS_ARGS to --c++
9509 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * src/table.C (DocBookEndOfCell): commented out two unused variables
9513 * src/paragraph.C: commented out four unused variables.
9515 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9516 insed a if clause with type string::size_type.
9518 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9521 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9523 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9524 variable, also changed loop to go from 0 to lenght + 1, instead of
9525 -1 to length. This should be correct.
9527 * src/LaTeX.C (scanError): use string::size_type as loop variable
9530 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9531 (l.896) since y_tmp and row was not used anyway.
9533 * src/insets/insetref.C (escape): use string::size_type as loop
9536 * src/insets/insetquotes.C (Width): use string::size_type as loop
9538 (Draw): use string::size_type as loop variable type.
9540 * src/insets/insetlatexaccent.C (checkContents): use
9541 string::size_type as loop variable type.
9543 * src/insets/insetlabel.C (escape): use string::size_type as loop
9546 * src/insets/insetinfo.C: added an extern for current_view.
9548 * src/insets/insetcommand.C (scanCommand): use string::size_type
9549 as loop variable type.
9551 * most files: removed the RCS tags. With them we had to recompile
9552 a lot of files after a simple cvs commit. Also we have never used
9553 them for anything meaningful.
9555 * most files: tags-query-replace NULL 0. As adviced several plases
9556 we now use "0" instead of "NULL" in our code.
9558 * src/support/filetools.C (SpaceLess): use string::size_type as
9561 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9563 * src/paragraph.C: fixed up some more string stuff.
9565 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9567 * src/support/filetools.h: make modestr a std::string.
9569 * src/filetools.C (GetEnv): made ch really const.
9571 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9572 made code that used these use max/min from <algorithm> instead.
9574 * changed several c library include files to their equivalent c++
9575 library include files. All is not changed yet.
9577 * created a support subdir in src, put lyxstring and lstrings
9578 there + the extra files atexit, fileblock, strerror. Created
9579 Makefile.am. edited configure.in and src/Makefile.am to use this
9580 new subdir. More files moved to support.
9582 * imported som of the functions from repository lyx, filetools
9584 * ran tags-query-replace on LString -> string, corrected the bogus
9585 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9586 is still some errors in there. This is errors where too much or
9587 too litle get deleted from strings (string::erase, string::substr,
9588 string::replace), there can also be some off by one errors, or
9589 just plain wrong use of functions from lstrings. Viewing of quotes
9592 * LyX is now running fairly well with string, but there are
9593 certainly some bugs yet (see above) also string is quite different
9594 from LString among others in that it does not allow null pointers
9595 passed in and will abort if it gets any.
9597 * Added the revtex4 files I forgot when setting up the repository.
9599 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9601 * All over: Tried to clean everything up so that only the files
9602 that we really need are included in the cvs repository.
9603 * Switched to use automake.
9604 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9605 * Install has not been checked.
9607 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9609 * po/pt.po: Three errors:
9610 l.533 and l.538 format specification error
9611 l. 402 duplicate entry, I just deleted it.