1 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
4 0 when there are no arguments.
6 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
8 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
9 to segfaults when pressing Ok in InsetBibtex dialog.
11 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
13 * forms/layout_forms.fd:
14 * src/layout_forms.C (create_form_form_character): small change to use
15 labelframe rather than engraved frame + text
17 * src/lyx_gui.C (create_forms): initialise choice_language with some
18 arbitrary value to prevent segfault when dialog is shown.
20 2000-10-16 Baruch Even <baruch.even@writeme.com>
22 * src/converter.C (runLaTeX, scanLog): Added a warning when there
23 is no resulting file. This pertains only to LaTeX output.
25 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
27 * src/text.C (Backspace): Make sure that the row of the cursor is
30 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
33 * src/lyx_gui.C (init): Prevent a crash when only one font from
34 menu/popup fonts is not found.
36 * lib/lyxrc.example: Add an example for binding a key for language
39 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
41 * src/converter.C (GetReachable): Changed the returned type to
43 (IsReachable): New method
45 * src/MenuBackend.C (expand): Handle formats that appear more
48 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
50 * src/frontends/support/Makefile.am
51 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
54 * lib/CREDITS: add Garst Reese.
56 * src/support/snprintf.h: add extern "C" {} around the definitions.
58 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
60 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
63 * src/frontends/xforms/FormDocument.C:
64 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
65 compile without "conversion to integral type of smaller size"
68 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
70 * src/text.C (GetColumnNearX): Fixed disabled code.
72 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
74 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
77 * src/support/snprintf.[ch]: new files
79 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
81 * src/frontends/kde/formprintdialog.C: add
82 file browser for selecting postscript output
84 * src/frontends/kde/formprintdialogdata.C:
85 * src/frontends/kde/formprintdialogdata.h: re-generate
88 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
90 * src/frontends/gnome/Makefile.am:
91 * src/frontends/kde/Makefile.am: FormCommand.C
92 disappeared from xforms
94 * src/frontends/kde/FormCitation.C:
95 * src/frontends/kde/FormIndex.C: read-only
98 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
100 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
103 * src/bufferlist.C: add using directive.
105 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
107 * src/support/lyxfunctional.h: version of class_fun for void
108 returns added, const versions of back_inseter_fun and compare_fun
111 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
113 * src/frontends/xforms/FormInset.C (showInset): fix typo.
115 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
117 * ChangeLog: cleanup.
119 * lib/CREDITS: update to add all the contributors we've forgotten.
120 I have obviously missed some, so tell me whether there were
123 2000-10-13 Marko Vendelin <markov@ioc.ee>
125 * src/frontends/gnome/FormCitation.C
126 * src/frontends/gnome/FormCitation.h
127 * src/frontends/gnome/FormError.C
128 * src/frontends/gnome/FormIndex.C
129 * src/frontends/gnome/FormRef.C
130 * src/frontends/gnome/FormRef.h
131 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
133 * src/frontends/gnome/FormCitation.C
134 * src/frontends/gnome/FormCopyright.C
135 * src/frontends/gnome/FormError.C
136 * src/frontends/gnome/FormIndex.C
137 * src/frontends/gnome/FormRef.C
138 * src/frontends/gnome/FormToc.C
139 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
142 * src/frontends/gnome/Menubar_pimpl.C
143 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
146 2000-10-11 Baruch Even <baruch.even@writeme.com>
149 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
150 to convey its real action.
152 * src/minibuffer.C (peek_event): Added action when mouse clicks to
153 clear the minibuffer and prepare to enter a command.
155 * src/mathed/formula.C (LocalDispatch): Changed to conform with
156 the rename from ExecCommand to PrepareForCommand.
157 * src/lyxfunc.C (Dispatch): ditto.
159 2000-10-11 Baruch Even <baruch.even@writeme.com>
161 * src/buffer.C (writeFile): Added test for errors on writing, this
162 catches all errors and not only file system full errors as intended.
164 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
166 * src/lyx_gui.C (create_forms): better fix for crash with
167 translated interface.
169 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
171 * src/frontends/kde/Makefile.am:
172 * src/frontends/kde/FormCopyright.C:
173 * src/frontends/kde/formcopyrightdialog.C:
174 * src/frontends/kde/formcopyrightdialog.h:
175 * src/frontends/kde/formcopyrightdialogdata.C:
176 * src/frontends/kde/formcopyrightdialogdata.h:
177 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
178 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
179 copyright to use qtarch
181 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
183 * src/encoding.C (read): Fixed bug that caused an error message at
186 * po/Makefile.in.in: Fixed rule for ext_l10n.h
188 * lib/lyxrc.example: Fixed hebrew example.
190 2000-10-13 Allan Rae <rae@lyx.org>
192 * src/frontends/xforms/FormPreferences.C (input): reworking the
194 (build, update, apply): New inputs in various tabfolders
196 * src/frontends/xforms/FormToc.C: use new button policy.
197 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
198 dialogs that either can't use any existing policy or where it just
201 * src/frontends/xforms/FormTabular.h: removed copyright notice that
204 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
205 added a bool parameter which is ignored.
207 * src/buffer.C (setReadonly):
208 * src/BufferView_pimpl.C (buffer):
209 * src/frontends/kde/FormCopyright.h (update):
210 * src/frontends/kde/FormCitation.[Ch] (update):
211 * src/frontends/kde/FormIndex.[Ch] (update):
212 * src/frontends/kde/FormPrint.[Ch] (update):
213 * src/frontends/kde/FormRef.[Ch] (update):
214 * src/frontends/kde/FormToc.[Ch] (update):
215 * src/frontends/kde/FormUrl.[Ch] (update):
216 * src/frontends/gnome/FormCopyright.h (update):
217 * src/frontends/gnome/FormCitation.[Ch] (update):
218 * src/frontends/gnome/FormError.[Ch] (update):
219 * src/frontends/gnome/FormIndex.[Ch] (update):
220 * src/frontends/gnome/FormPrint.[Ch] (update):
221 * src/frontends/gnome/FormRef.h (update):
222 * src/frontends/gnome/FormToc.[Ch] (update):
223 * src/frontends/gnome/FormUrl.[Ch] (update):
224 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
225 to updateBufferDependent and DialogBase
227 * src/frontends/xforms/FormCitation.[hC]:
228 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
229 * src/frontends/xforms/FormError.[Ch]:
230 * src/frontends/xforms/FormGraphics.[Ch]:
231 * src/frontends/xforms/FormIndex.[Ch]:
232 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
233 and fixed readOnly handling.
234 * src/frontends/xforms/FormPrint.[Ch]:
235 * src/frontends/xforms/FormRef.[Ch]:
236 * src/frontends/xforms/FormTabular.[Ch]:
237 * src/frontends/xforms/FormToc.[Ch]:
238 * src/frontends/xforms/FormUrl.[Ch]:
239 * src/frontends/xforms/FormInset.[Ch]:
240 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
241 form of updateBufferDependent.
243 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
244 if form()->visible just in case someone does stuff to the form in a
247 * src/frontends/DialogBase.h (enum): removed enum since we can now use
248 the buttoncontroller for everything the enum used to be used for.
249 (update) It would seem we need to force all dialogs to use a bool
250 parameter or have two update functions. I chose to go with one.
251 I did try removing update() from here and FormBase and defining the
252 appropriate update signatures in FormBaseB[DI] but then ran into the
253 problem of the update() call in FormBase::show(). Whatever I did
254 to get around that would require another function and that just
255 got more confusing. Hence the decision to make everyone have an
256 update(bool). An alternative might have been to override show() in
257 FormBaseB[DI] and that would allow the different and appropriate
260 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
261 true == buffer change occurred. I decided against using a default
262 template parameter since not all compilers support that at present.
264 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
266 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
267 army knife" by removing functionality.
268 (clearStore): removed. All such housekeeping on hide()ing the dialog
269 is to be carried out by overloaded disconnect() methods.
270 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
271 superceded by Baruch's neat test (FormGraphics) to update an existing
272 dialog if a new signal is recieved rather than block all new signals
274 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
275 only to Inset dialogs.
276 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
277 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
279 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
281 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
282 as a base class to all inset dialogs. Used solely to connect/disconnect
283 the Inset::hide signal and to define what action to take on receipt of
284 a UpdateBufferDependent signal.
285 (FormCommand): now derived from FormInset.
287 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
290 * src/frontends/xforms/FormCopyright.[Ch]:
291 * src/frontends/xforms/FormPreferences.[Ch]:
292 now derived from FormBaseBI.
294 * src/frontends/xforms/FormDocument.[Ch]:
295 * src/frontends/xforms/FormParagraph.[Ch]:
296 * src/frontends/xforms/FormPrint.[Ch]:
297 now derived from FormBaseBD.
299 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
301 * src/frontends/xforms/FormCitation.[Ch]:
302 * src/frontends/xforms/FormError.[Ch]:
303 * src/frontends/xforms/FormRef.[Ch]:
304 * src/frontends/xforms/FormToc.[Ch]:
305 (clearStore): reworked as disconnect().
307 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
310 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
312 * src/converter.C (runLaTeX): constify buffer argument
315 * src/frontends/support/Makefile.am (INCLUDES): fix.
317 * src/buffer.h: add std:: qualifier
318 * src/insets/figinset.C (addpidwait): ditto
319 * src/MenuBackend.C: ditto
320 * src/buffer.C: ditto
321 * src/bufferlist.C: ditto
322 * src/layout.C: ditto
323 * src/lyxfunc.C: ditto
325 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
327 * src/lyxtext.h (bidi_level): change return type to
328 LyXParagraph::size_type.
330 * src/lyxparagraph.h: change size_type to
331 TextContainer::difference_type. This should really be
332 TextContainer::size_type, but we need currently to support signed
335 2000-10-11 Marko Vendelin <markov@ioc.ee>
336 * src/frontends/gnome/FormError.h
337 * src/frontends/gnome/FormRef.C
338 * src/frontends/gnome/FormRef.h
339 * src/frontends/gnome/FormError.C
340 * src/frontends/gnome/Makefile.am
341 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
342 to Gnome frontend. Both dialogs use "action" area.
344 2000-10-12 Baruch Even <baruch.even@writeme.com>
346 * src/graphics/GraphicsCacheItem_pimpl.C:
347 * src/graphics/Renderer.C:
348 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
351 2000-10-12 Juergen Vigna <jug@sad.it>
353 * src/insets/insettext.C (draw): fixed drawing bug (specifically
354 visible when selecting).
356 * development/Code_rules/Rules: fixed some typos.
358 2000-10-09 Baruch Even <baruch.even@writeme.com>
360 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
361 compiling on egcs 1.1.2 possible.
363 * src/filedlg.C (comp_direntry::operator() ): ditto.
365 2000-08-31 Baruch Even <baruch.even@writeme.com>
367 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
370 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
371 transient it now only gets freed when the object is destructed.
373 2000-08-24 Baruch Even <baruch.even@writeme.com>
375 * src/frontends/FormGraphics.h:
376 * src/frontends/FormGraphics.C: Changed to use ButtonController and
379 2000-08-20 Baruch Even <baruch.even@writeme.com>
381 * src/insets/insetgraphics.C:
382 (draw): Added messages to the drawn rectangle to report status.
383 (updateInset): Disabled the use of the inline graphics,
386 2000-08-17 Baruch Even <baruch.even@writeme.com>
388 * src/frontends/support: Directory added for the support of GUII LyX.
390 * src/frontends/support/LyXImage.h:
391 * src/frontends/support/LyXImage.C: Base class for GUII holding of
394 * src/frontends/support/LyXImage_X.h:
395 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
396 version of LyXImage, this uses the Xlib Pixmap.
401 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
402 replacement to Pixmap.
404 * src/insets/insetgraphics.h:
405 * src/insets/insetgraphics.C:
406 * src/graphics/GraphicsCacheItem.h:
407 * src/graphics/GraphicsCacheItem.C:
408 * src/graphics/GraphicsCacheItem_pimpl.h:
409 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
412 * src/graphics/GraphicsCacheItem.h:
413 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
414 another copy of the object.
416 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
417 of cacheHandle, this fixed a bug that sent LyX crashing.
419 * src/graphics/XPM_Renderer.h:
420 * src/graphics/XPM_Renderer.C:
421 * src/graphics/EPS_Renderer.h:
422 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
424 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
426 * src/lyxfunc.C (processKeySym): only handle the
427 lockinginset/inset stuff if we have a buffer and text loaded...
429 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
431 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
433 * src/support/lyxfunctional.h: add operator= that takes a reference
435 * src/lyxserver.C (mkfifo): make first arg const
437 * src/layout.h: renamed name(...) to setName(...) to work around
440 * src/buffer.C (setFileName): had to change name of function to
441 work around bugs in egcs. (renamed from fileName)
443 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
445 * src/support/translator.h: move helper template classes to
446 lyxfunctional.h, include "support/lyxfunctional.h"
448 * src/support/lyxmanip.h: add delaration of fmt
450 * src/support/lyxfunctional.h: new file
451 (class_fun_t): new template class
452 (class_fun): helper template function
453 (back_insert_fun_iterator): new template class
454 (back_inserter_fun): helper template function
455 (compare_memfun_t): new template class
456 (compare_memfun): helper template function
457 (equal_1st_in_pair): moved here from translator
458 (equal_2nd_in_pair): moved here from translator
460 * src/support/fmt.C: new file
461 (fmt): new func, can be used for a printf substitute when still
462 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
464 * src/support/StrPool.C: add some comments
466 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
469 * src/insets/figinset.C (addpidwait): use std::copy with
470 ostream_iterator to fill the pidwaitlist
472 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
474 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
477 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
480 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
482 * src/frontends/xforms/FormDocument.C (build): remove c_str()
483 (class_update): ditto
485 (CheckChoiceClass): move initialization of tc and tct
487 * src/tabular.C: remove current_view
488 (OldFormatRead): similar to right below [istream::ignore]
490 * src/lyxlex_pimpl.C (next): add code for faster skipping of
491 chars, unfortunately this is buggy on gcc 2.95.2, so currently
492 unused [istream::ignore]
494 * src/lyxfunc.C: include "support/lyxfunctional.h"
495 (getInsetByCode): use std::find_if and compare_memfun
497 * src/lyxfont.C (stateText): remove c_str()
499 * src/lyx_main.C (setDebuggingLevel): make static
500 (commandLineHelp): make static
502 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
503 Screen* together with fl_get_display() and fl_screen
505 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
506 togheter with fl_get_display() and fl_screen
507 (create_forms): remove c_str()
509 * src/layout.C: include "support/lyxfunctional.h"
510 (hasLayout): use std::find_if and compare_memfun
511 (GetLayout): use std::find_if and comapre_memfun
512 (delete_layout): use std::remove_if and compare_memfun
513 (NumberOfClass): use std:.find_if and compare_memfun
515 * src/gettext.h: change for the new functions
517 * src/gettext.C: new file, make _(char const * str) and _(string
518 const & str) real functions.
520 * src/font.C (width): rewrite slightly to avoid one extra variable
522 * src/debug.C: initialize Debug::ANY here
524 * src/commandtags.h: update number comments
526 * src/combox.h (get): make const func
528 (getline): make const
530 * src/combox.C (input_cb): handle case where fl_get_input can
533 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
534 "support/lyxfunctional.h", remove current_view variable.
535 (resize): use std::for_each with std::mem_fun
536 (getFileNames): use std::copy with back_inserter_fun
537 (getBuffer): change arg type to unsigned int
538 (emergencyWriteAll): call emergencyWrite with std::for_each and
540 (emergencyWrite): new method, the for loop in emergencyWriteAll
542 (exists): use std::find_if with compare_memfun
543 (getBuffer): use std::find_if and compare_memfun
545 * src/buffer.h: add typedefs for iterator_category, value_type
546 difference_type, pointer and reference for inset_iterator
547 add postfix ++ for inset_iterator
548 make inset_iterator::getPos() const
550 * src/buffer.C: added support/lyxmanip.h
551 (readFile): use lyxerr << fmt instead of printf
552 (makeLaTeXFile): use std::copy to write out encodings
554 * src/Painter.C (text): rewrite slightly to avoid extra font variable
556 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
557 free and the char * temp.
558 (hasMenu): use std::find_if and compare_memfun
561 * src/Makefile.am (lyx_SOURCES): added gettext.C
563 * src/LyXAction.C (retrieveActionArg): clear the arg, use
564 string::insert small change to avoid temporary
566 * src/LColor.C (getGUIName): remove c_str()
568 * several files: change all occurrences of fl_display to
571 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
572 that -pedantic is not used for gcc 2.97 (cvs gcc)
574 * boost/Makefile.am: begin slowly to prepare for a real boost lib
576 2000-10-11 Allan Rae <rae@lyx.org>
578 * src/frontends/xforms/FormPreferences.C (input): template path must be
579 a readable directory. It doesn't need to be writeable.
580 (build, delete, update, apply): New inputs in the various tabfolders
582 * src/frontends/xforms/forms/form_preferences.fd:
583 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
584 several new entries to existing folders. Shuffled some existing stuff
587 * src/frontends/xforms/forms/form_print.fd:
588 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
589 Should probably rework PrinterParams as well. Note that the switch to
590 collated is effectively the same as !unsorted so changing PrinterParams
591 will require a lot of fiddly changes to reverse the existing logic.
593 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
595 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
597 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
599 2000-10-10 Allan Rae <rae@lyx.org>
602 * src/lyxfunc.C (Dispatch):
604 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
607 * src/lyxrc.C (output): Only write the differences between system lyxrc
608 and the users settings.
611 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
613 I'll rewrite this later, after 1.1.6 probably, to keep a single
614 LyXRC but two instances of a LyXRCStruct.
616 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
618 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
620 * src/tabular.h: add a few std:: qualifiers.
622 * src/encoding.C: add using directive.
623 * src/language.C: ditto.
625 * src/insets/insetquotes.C (Validate): use languages->lang()
626 instead of only language.
628 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
630 * lib/languages: New file.
632 * lib/encodings: New file.
634 * src/language.C (Languages): New class.
635 (read): New method. Reads the languages from the 'languages' file.
637 * src/encoding.C (Encodings): New class.
638 (read): New method. Reads the encodings from the 'encodings' file.
640 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
643 * src/bufferparams.h and a lot of files: Deleted the member language,
644 and renamed language_info to language
646 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
647 * src/lyxfont.C (latexWriteStartChanges): ditto.
648 * src/paragraph.C (validate,TeXOnePar): ditto.
650 * src/lyxfont.C (update): Restored deleted code.
652 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
654 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
656 * src/BufferView_pimpl.C (buffer): cleaned up a little.
658 * src/insets/figinset.[Ch]:
659 * src/insets/insetinclude.[Ch]:
660 * src/insets/insetinclude.[Ch]:
661 * src/insets/insetparent.[Ch]:
662 * src/insets/insetref.[Ch]:
663 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
666 * src/mathed/formula.[Ch]:
667 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
669 * src/buffer.C (parseSingleLyXformat2Token, readInset):
670 * src/lyx_cb.C (FigureApplyCB):
671 * src/lyxfunc.C (getStatus, Dispatch):
672 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
675 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
677 * src/converter.[Ch] (Formats::View):
678 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
680 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
681 *current_view->buffer(). This will change later, but this patch is way
684 2000-10-09 Juergen Vigna <jug@sad.it>
686 * src/text.C (GetRow): small fix.
688 * src/BufferView_pimpl.C (cursorPrevious):
689 (cursorNext): added LyXText parameter to function.
691 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
692 keypress depending on cursor position.
694 2000-10-06 Juergen Vigna <jug@sad.it>
696 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
697 (copySelection): redone this function and also copy ascii representa-
700 * src/tabular.C (Ascii):
704 (print_n_chars): new functions to realize the ascii export of tabulars.
706 2000-10-05 Juergen Vigna <jug@sad.it>
708 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
709 if we don't have a buffer.
711 2000-10-10 Allan Rae <rae@lyx.org>
713 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
714 with closing dialog. It seems that nested tabfolders require hiding
715 of inner tabfolders before hiding the dialog itself. Actually all I
716 did was hide the active outer folder.
718 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
719 unless there really is a buffer. hideBufferDependent is called
722 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
723 POTFILES.in stays in $(srcdir).
725 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
727 * lib/lyxrc.example: Few changes.
729 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
731 * src/BufferView_pimpl.C (buffer): only need one the
732 updateBufferDependent signal to be emitted once! Moved to the end of
733 the method to allow bv_->text to be updated first.
735 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
736 and hSignal_ with Dialogs * and BufferDependency variables.
737 New Buffer * parent_, initialised when the dialog is launched. Used to
738 check whether to update() or hide() dialog in the new, private
739 updateOrHide() method that is connected to the updateBufferDependent
740 signal. Daughter classes dictate what to do using the
741 ChangedBufferAction enum, passed to the c-tor.
743 * src/frontends/xforms/FormCitation.C:
744 * src/frontends/xforms/FormCommand.C:
745 * src/frontends/xforms/FormCopyright.C:
746 * src/frontends/xforms/FormDocument.C:
747 * src/frontends/xforms/FormError.C:
748 * src/frontends/xforms/FormIndex.C:
749 * src/frontends/xforms/FormPreferences.C:
750 * src/frontends/xforms/FormPrint.C:
751 * src/frontends/xforms/FormRef.C:
752 * src/frontends/xforms/FormToc.C:
753 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
756 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
757 ChangedBufferAction enum.
759 * src/frontends/xforms/FormParagraph.[Ch]
760 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
763 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
765 * lib/bind/cua.bind: fix a bit.
766 * lib/bind/emacs.bind: ditto.
768 * lib/bind/menus.bind: remove real menu entries from there.
770 * src/spellchecker.C: make sure we only include strings.h when
773 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
775 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
776 function. It enlarges the maximum number of pup when needed.
777 (add_toc2): Open a new menu if maximum number of items per menu has
780 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
782 * src/frontends/kde/FormPrint.C: fix error reporting
784 * src/frontends/xforms/FormDocument.C: fix compiler
787 * lib/.cvsignore: add Literate.nw
789 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
792 * bufferview_funcs.[Ch]
795 * text2.C: Add support for numbers in RTL text.
797 2000-10-06 Allan Rae <rae@lyx.org>
799 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
800 to be gettext.m4 friendly again. ext_l10n.h is now
801 generated into $top_srcdir instead of $top_builddir
802 so that lyx.pot will be built correctly -- without
803 duplicate parsing of ext_l10n.h.
805 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
807 * src/frontends/kde/FormCitation.C: make the dialog
810 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
812 * config/kde.m4: fix consecutive ./configure runs,
813 look for qtarch, fix library order
815 * src/frontends/kde/Makefile.am: tidy up,
816 add Print dialog, add .dlg dependencies
818 * src/frontends/kde/FormPrint.C:
819 * src/frontends/kde/FormPrint.h:
820 * src/frontends/kde/formprintdialog.C:
821 * src/frontends/kde/formprintdialog.h:
822 * src/frontends/kde/formprintdialogdata.C:
823 * src/frontends/kde/formprintdialogdata.h:
824 * src/frontends/kde/dlg/formprintdialog.dlg: add
827 * src/frontends/kde/dlg/README: Added explanatory readme
829 * src/frontends/kde/dlg/checkinitorder.pl: small perl
830 script to double-check qtarch's output
832 * src/frontends/kde/formindexdialog.C:
833 * src/frontends/kde/formindexdialogdata.C:
834 * src/frontends/kde/formindexdialogdata.h:
835 * src/frontends/kde/dlg/formindexdialog.dlg: update
836 for qtarch, minor fixes
838 2000-10-05 Allan Rae <rae@lyx.org>
840 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
841 dialogs when switching buffers update them instead. It's up to each
842 dialog to decide if it should still be visible or not.
843 update() should return a bool to control visiblity within show().
844 Or perhaps better to set a member variable and use that to control
847 * lib/build-listerrors: create an empty "listerrors" file just to stop
848 make trying to regenerate it all the time if you don't have noweb
851 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
853 * po/Makefile.in.in (ext_l10n.h): added a rule to build
854 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
855 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
856 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
857 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
859 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
861 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
863 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
864 deleting buffer. Closes all buffer-dependent dialogs.
866 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
868 * src/frontends/xforms/FormCitation.[Ch]:
869 * src/frontends/xforms/FormPreferences.[Ch]:
870 * src/frontends/xforms/FormPrint.[Ch]:
871 * src/frontends/xforms/FormRef.[Ch]:
872 * src/frontends/xforms/FormUrl.[Ch]: ditto
874 * src/frontends/xforms/FormDocument.[Ch]:
875 * src/frontends/xforms/forms/form_document.C.patch:
876 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
877 pass through a single input() function.
879 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
881 * lib/build-listerrors: return status as OK
883 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
885 * lib/lyxrc.example: Updated to new export code
887 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
889 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
892 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
895 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
897 * lib/layouts/amsbook.layout: ditto.
899 * boost/Makefile.am: fix typo.
901 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
903 (add_lastfiles): removed.
904 (add_documents): removed.
905 (add_formats): removed.
907 * src/frontends/Menubar.C: remove useless "using" directive.
909 * src/MenuBackend.h: add a new MenuItem constructor.
911 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
914 2000-10-04 Allan Rae <rae@lyx.org>
916 * lib/Makefile.am (listerrors):
917 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
918 I haven't got notangle installed so Kayvan please test. The output
919 should end up in $builddir. This also allows people who don't have
920 noweb installed to complete the make process without error.
922 * src/frontends/xforms/FormCommand.[Ch] (showInset):
923 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
924 by JMarc's picky compiler.
926 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
929 * src/insets/insettabular.C (setPos): change for loop to not use
930 sequencing operator. Please check this Jürgen.
932 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
934 * src/insets/insetcite.C (getScreenLabel): ditto
935 * src/support/filetools.C (QuoteName): ditto
936 (ChangeExtension): ditto
938 * src/BufferView_pimpl.C (scrollCB): make heigt int
940 * src/BufferView2.C (insertInset): comment out unused arg
942 * boost/Makefile.am (EXTRADIST): new variable
944 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
946 * src/exporter.C (IsExportable): Fixed
948 * lib/configure.m4: Small fix
950 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
952 * src/insets/insetbutton.C (width): Changed to work with no GUI.
953 * src/insets/insetbib.C (bibitemWidest): ditto.
954 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
956 2000-10-03 Juergen Vigna <jug@sad.it>
958 * src/BufferView2.C (theLockingInset): removed const because of
959 Agnus's compile problems.
961 * src/insets/insettext.C (LocalDispatch): set the language of the
962 surronding paragraph on inserting the first character.
964 * various files: changed use of BufferView::the_locking_inset.
966 * src/BufferView2.C (theLockingInset):
967 (theLockingInset): new functions.
969 * src/BufferView.h: removed the_locking_inset.
971 * src/lyxtext.h: added the_locking_inset
973 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
975 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
977 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
979 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
980 * src/mathed/math_cursor.C (IsAlpha): ditto.
981 * src/mathed/math_inset.C (strnew): ditto.
982 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
983 (IMetrics): cxp set but never used; removed.
984 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
985 that the variable in question has been removed also!
988 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
989 using the Buffer * passed to Latex(), using the BufferView * passed to
990 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
992 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
993 Linuxdoc() and DocBook() rather than the stored Buffer * master.
995 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
996 * src/buffer.C (readInset): used new InsetBibtex c-tor
997 * (getBibkeyList): used new InsetBibtex::getKeys
999 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1002 * lib/build-listerrors
1004 * src/exporter.C: Add literate programming support to the export code
1007 * src/lyx_cb.C: Remove old literate code.
1009 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1012 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1013 * src/converter.C (View, Convert): Use QuoteName.
1015 * src/insets/figinset.C (Preview): Use Formats::View.
1017 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1019 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1021 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1022 the top of the function, because compaq cxx complains that the
1023 "goto exit_with_message" when the function is disabled bypasses
1025 (MenuNew): try a better fix for the generation of new file names.
1026 This time, I used AddName() instead of AddPath(), hoping Juergen
1029 2000-10-03 Allan Rae <rae@lyx.org>
1031 * src/frontends/xforms/forms/form_preferences.fd:
1032 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1033 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1034 "Look and Feel"->"General" but will need to be split up further into
1035 general output and general input tabs. Current plan is for four outer
1036 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1037 stuff; "Inputs" for input and import configuration; "Outputs" for
1038 output and export configuration; and one more whatever is left over
1039 called "General". The leftovers at present look like being which
1040 viewers to use, spellchecker, language support and might be better
1041 named "Support". I've put "Paths" in "Inputs" for the moment as this
1042 seems reasonable for now at least.
1043 One problem remains: X error kills LyX when you close Preferences.
1045 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1047 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1048 qualifier from form()
1049 * src/frontends/xforms/FormCitation.[Ch]:
1050 * src/frontends/xforms/FormCopyright.[Ch]:
1051 * src/frontends/xforms/FormDocument.[Ch]:
1052 * src/frontends/xforms/FormError.[Ch]:
1053 * src/frontends/xforms/FormIndex.[Ch]:
1054 * src/frontends/xforms/FormPreferences.[Ch]:
1055 * src/frontends/xforms/FormPrint.[Ch]:
1056 * src/frontends/xforms/FormRef.[Ch]:
1057 * src/frontends/xforms/FormToc.[Ch]:
1058 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1060 * src/frontends/xforms/FormCitation.[Ch]:
1061 * src/frontends/xforms/FormIndex.[Ch]:
1062 * src/frontends/xforms/FormRef.[Ch]:
1063 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1064 with Allan's naming policy
1066 * src/frontends/xforms/FormCitation.C: some static casts to remove
1069 2000-10-02 Juergen Vigna <jug@sad.it>
1071 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1072 now you can type or do stuff inside the table-cell also when in dummy
1073 position, fixed visible cursor.
1075 * src/insets/insettext.C (Edit): fixing cursor-view position.
1077 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1078 be used for equal functions in lyxfunc and insettext.
1080 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1082 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1084 * src/frontends/gnome/FormCitation.h:
1085 * src/frontends/gnome/FormCopyright.h:
1086 * src/frontends/gnome/FormIndex.h:
1087 * src/frontends/gnome/FormPrint.h:
1088 * src/frontends/gnome/FormToc.h:
1089 * src/frontends/gnome/FormUrl.h:
1090 * src/frontends/kde/FormCitation.h:
1091 * src/frontends/kde/FormCopyright.h:
1092 * src/frontends/kde/FormIndex.h:
1093 * src/frontends/kde/FormRef.h:
1094 * src/frontends/kde/FormToc.h:
1095 * src/frontends/kde/FormUrl.h: fix remaining users of
1098 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1100 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1101 from depth argument.
1102 (DocBookHandleCaption): ditto.
1103 (DocBookHandleFootnote): ditto.
1104 (SimpleDocBookOnePar): ditto.
1106 * src/frontends/xforms/FormDocument.h (form): remove extra
1107 FormDocument:: qualifier.
1109 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1111 * sigc++/handle.h: ditto.
1113 * src/lyx_gui_misc.C: add "using" directive.
1115 * src/cheaders/cstddef: new file, needed by the boost library (for
1118 2000-10-02 Juergen Vigna <jug@sad.it>
1120 * src/insets/insettext.C (SetFont): better support.
1122 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1124 * src/screen.C (DrawOneRow): some uint refixes!
1126 2000-10-02 Allan Rae <rae@lyx.org>
1128 * boost/.cvsignore: ignore Makefile as well
1130 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1131 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1133 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1134 Left this one out by accident.
1136 * src/frontends/xforms/FormBase.h (restore): default to calling
1137 update() since that will restore the original/currently-applied values.
1138 Any input() triggered error messages will require the derived classes
1139 to redefine restore().
1141 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1142 avoid a segfault. combo_doc_class is the main concern.
1144 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1146 * Simplify build-listerrors in view of GUI-less export ability!
1148 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1150 * src/lyx_main.C (easyParse): Disable gui when exporting
1152 * src/insets/figinset.C:
1155 * src/lyx_gui_misc.C
1156 * src/tabular.C: Changes to allow no-gui.
1158 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1160 * src/support/utility.hpp: removed file
1161 * src/support/block.h: removed file
1163 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1166 * src/mathed/formula.C: add support/lyxlib.h
1167 * src/mathed/formulamacro.C: ditto
1169 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1170 * src/lyxparagraph.h: ditto
1172 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1173 * src/frontends/Makefile.am (INCLUDES): ditto
1174 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1175 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1176 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1177 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1178 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1179 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1181 * src/BufferView.h: use boost/utility.hpp
1182 * src/LColor.h: ditto
1183 * src/LaTeX.h: ditto
1184 * src/LyXAction.h: ditto
1185 * src/LyXView.h: ditto
1186 * src/bufferlist.h: ditto
1187 * src/lastfiles.h: ditto
1188 * src/layout.h: ditto
1189 * src/lyx_gui.h: ditto
1190 * src/lyx_main.h: ditto
1191 * src/lyxlex.h: ditto
1192 * src/lyxrc.h: ditto
1193 * src/frontends/ButtonPolicies.h: ditto
1194 * src/frontends/Dialogs.h: ditto
1195 * src/frontends/xforms/FormBase.h: ditto
1196 * src/frontends/xforms/FormGraphics.h: ditto
1197 * src/frontends/xforms/FormParagraph.h: ditto
1198 * src/frontends/xforms/FormTabular.h: ditto
1199 * src/graphics/GraphicsCache.h: ditto
1200 * src/graphics/Renderer.h: ditto
1201 * src/insets/ExternalTemplate.h: ditto
1202 * src/insets/insetcommand.h: ditto
1203 * src/support/path.h: ditto
1205 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1206 and introduce clause for 2.97.
1208 * boost/libs/README: new file
1210 * boost/boost/utility.hpp: new file
1212 * boost/boost/config.hpp: new file
1214 * boost/boost/array.hpp: new file
1216 * boost/Makefile.am: new file
1218 * boost/.cvsignore: new file
1220 * configure.in (AC_OUTPUT): add boost/Makefile
1222 * Makefile.am (SUBDIRS): add boost
1224 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1226 * src/support/lstrings.C (suffixIs): Fixed.
1228 2000-10-01 Allan Rae <rae@lyx.org>
1230 * src/PrinterParams.h: moved things around to avoid the "can't
1231 inline call" warning.
1233 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1234 into doc++ documentation.
1236 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1238 * src/frontends/xforms/FormRef.C: make use of button controller
1239 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1240 cleaned up button controller usage.
1241 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1242 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1243 use the button controller
1245 * src/frontends/xforms/forms/*.fd: and associated generated files
1246 updated to reflect changes to FormBase. Some other FormXxxx files
1247 also got minor updates to reflect changes to FormBase.
1249 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1250 (hide): made virtual.
1251 (input): return a bool. true == valid input
1252 (RestoreCB, restore): new
1253 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1254 Changes to allow derived dialogs to use a ButtonController and
1255 make sense when doing so: OK button calls ok() and so on.
1257 * src/frontends/xforms/ButtonController.h (class ButtonController):
1258 Switch from template implementation to taking Policy parameter.
1259 Allows FormBase to provide a ButtonController for any dialog.
1261 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1262 Probably should rename connect and disconnect.
1263 (apply): use the radio button groups
1264 (form): needed by FormBase
1265 (build): setup the radio button groups
1267 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1269 * several files: type changes to reduce the number of warnings and
1270 to unify type hangling a bit. Still much to do.
1272 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1274 * lib/images/*: rename a bunch of icons to match Dekel converter
1277 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1280 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1282 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1284 * sigc++/handle.h: ditto for class Handle.
1286 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1288 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1290 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1292 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1293 removal of the "default" language.
1295 * src/combox.h (getline): Check that sel > 0
1297 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1299 * lib/examples/docbook_example.lyx
1300 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1302 * lib/layouts/docbook-book.layout: new docbook book layout.
1304 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1306 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1308 * src/insets/figinset.C (DocBook):fixed small typo.
1310 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1312 * src/insets/insetinclude.h: string include_label doesn't need to be
1315 2000-09-29 Allan Rae <rae@lyx.org>
1317 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1318 Allow derived type to control connection and disconnection from signals
1319 of its choice if desired.
1321 2000-09-28 Juergen Vigna <jug@sad.it>
1323 * src/insets/insettabular.C (update): fixed cursor setting when
1324 the_locking_inset changed.
1325 (draw): made this a bit cleaner.
1326 (InsetButtonPress): fixed!
1328 * various files: added LyXText Parameter to fitCursor call.
1330 * src/BufferView.C (fitCursor): added LyXText parameter.
1332 * src/insets/insettabular.C (draw): small draw fix.
1334 * src/tabular.C: right setting of left/right celllines.
1336 * src/tabular.[Ch]: fixed various types in funcions and structures.
1337 * src/insets/insettabular.C: ditto
1338 * src/frontends/xforms/FormTabular.C: ditto
1340 2000-09-28 Allan Rae <rae@lyx.org>
1342 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1343 that the #ifdef's had been applied to part of what should have been
1344 a complete condition. It's possible there are other tests that
1345 were specific to tables that are also wrong now that InsetTabular is
1346 being used. Now we need to fix the output of '\n' after a table in a
1347 float for the same reason as the original condition:
1348 "don't insert this if we would be adding it before or after a table
1349 in a float. This little trick is needed in order to allow use of
1350 tables in \subfigures or \subtables."
1351 Juergen can you check this?
1353 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1355 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1356 outputed to the ostream.
1358 * several files: fixed types based on warnings from cxx
1360 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1362 * src/frontends/kde/Makefile.am: fix rule for
1363 formindexdialogdata_moc.C
1365 * src/.cvsignore: add ext_l10n.h to ignore
1367 * acconfig.h: stop messing with __STRICT_ANSI__
1368 * config/gnome.m4: remove option to set -ansi
1369 * config/kde.m4: remove option to set -ansi
1370 * config/lyxinclude.m4: don't set -ansi
1372 2000-09-27 Juergen Vigna <jug@sad.it>
1374 * various files: remove "default" language check.
1376 * src/insets/insetquotes.C: removed use of current_view.
1378 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1379 the one should have red ears by now!
1381 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1382 in more then one paragraph. Fixed cursor-movement/selection.
1384 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1385 paragraphs inside a text inset.
1387 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1388 text-inset if this owner is an inset.
1390 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1392 * src/Bullet.h: changed type of font, character and size to int
1394 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1396 * src/insets/inseturl.[Ch]:
1397 * src/insets/insetref.[Ch]:
1398 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1400 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1402 * src/buffer.C (readFile): block-if statement rearranged to minimise
1403 bloat. Patch does not reverse Jean-Marc's change ;-)
1405 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1406 Class rewritten to store pointers to hide/update signals directly,
1407 rather than Dialogs *. Also defined an enum to ease use. All xforms
1408 forms can now be derived from this class.
1410 * src/frontends/xforms/FormCommand.[Ch]
1411 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1413 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1416 * src/frontends/xforms/forms/form_citation.fd
1417 * src/frontends/xforms/forms/form_copyright.fd
1418 * src/frontends/xforms/forms/form_error.fd
1419 * src/frontends/xforms/forms/form_index.fd
1420 * src/frontends/xforms/forms/form_ref.fd
1421 * src/frontends/xforms/forms/form_toc.fd
1422 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1424 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1426 * src/insets/insetfoot.C: removed redundent using directive.
1428 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1430 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1431 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1433 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1434 created in the constructors in different groups. Then set() just
1435 have to show the groups as needed. This fixes the redraw problems
1436 (and is how the old menu code worked).
1438 * src/support/lyxlib.h: declare the methods as static when we do
1439 not have namespaces.
1441 2000-09-26 Juergen Vigna <jug@sad.it>
1443 * src/buffer.C (asciiParagraph): new function.
1444 (writeFileAscii): new function with parameter ostream.
1445 (writeFileAscii): use now asciiParagraph.
1447 * various inset files: added the linelen parameter to the Ascii-func.
1449 * src/tabular.C (Write): fixed error in writing file introduced by
1450 the last changes from Lars.
1452 * lib/bind/menus.bind: removed not supported functions.
1454 * src/insets/insettext.C (Ascii): implemented this function.
1456 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1458 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1459 (Write): use of the write_attribute functions.
1461 * src/bufferlist.C (close): fixed reasking question!
1463 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1465 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1466 new files use the everwhere possible.
1469 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1470 src/log_form.C src/lyx.C:
1473 * src/buffer.C (runLaTeX): remove func
1475 * src/PaperLayout.C: removed file
1476 * src/ParagraphExtra.C: likewise
1477 * src/bullet_forms.C: likewise
1478 * src/bullet_forms.h: likewise
1479 * src/bullet_forms_cb.C: likewise
1481 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1482 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1485 * several files: remove all traces of the old fd_form_paragraph,
1486 and functions belonging to that.
1488 * several files: remove all traces of the old fd_form_document,
1489 and functions belonging to that.
1491 * several files: constify local variables were possible.
1493 * several files: remove all code that was dead when NEW_EXPORT was
1496 * several files: removed string::c_str in as many places as
1499 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1500 (e): be a bit more outspoken when patching
1501 (updatesrc): only move files if changed.
1503 * forms/layout_forms.h.patch: regenerated
1505 * forms/layout_forms.fd: remove form_document and form_paragraph
1506 and form_quotes and form_paper and form_table_options and
1507 form_paragraph_extra
1509 * forms/form1.fd: remove form_table
1511 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1512 the fdui->... rewrite. Update some comments to xforms 0.88
1514 * forms/bullet_forms.C.patch: removed file
1515 * forms/bullet_forms.fd: likewise
1516 * forms/bullet_forms.h.patch: likewise
1518 * development/Code_rules/Rules: added a section on switch
1519 statements. Updated some comment to xforms 0.88.
1521 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1523 * src/buffer.C (readFile): make sure that the whole version number
1524 is read after \lyxformat (even when it contains a comma)
1526 * lib/ui/default.ui: change shortcut of math menu to M-a.
1528 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1530 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1533 * src/LyXView.C (updateWindowTitle): show the full files name in
1534 window title, limited to 30 characters.
1536 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1537 When a number of characters has been given, we should not assume
1538 that the string is 0-terminated.
1540 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1541 calls (fixes some memory leaks)
1543 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1544 trans member on exit.
1546 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1548 * src/converter.C (GetReachable): fix typo.
1550 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1551 understand ',' instead of '.'.
1552 (GetInteger): rewrite to use strToInt().
1554 2000-09-26 Juergen Vigna <jug@sad.it>
1556 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1557 better visibility and error-message on wrong VSpace input.
1559 * src/language.C (initL): added english again.
1561 2000-09-25 Juergen Vigna <jug@sad.it>
1563 * src/frontends/kde/Dialogs.C (Dialogs):
1564 * src/frontends/gnome/Dialogs.C (Dialogs):
1565 * src/frontends/kde/Makefile.am:
1566 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1568 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1570 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1572 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1574 * src/frontends/xforms/FormParagraph.C:
1575 * src/frontends/xforms/FormParagraph.h:
1576 * src/frontends/xforms/form_paragraph.C:
1577 * src/frontends/xforms/form_paragraph.h:
1578 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1581 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1583 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1584 Paragraph-Data after use.
1586 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1587 non breakable paragraphs.
1589 2000-09-25 Garst R. Reese <reese@isn.net>
1591 * src/language.C (initL): added missing language_country codes.
1593 2000-09-25 Juergen Vigna <jug@sad.it>
1595 * src/insets/insettext.C (InsetText):
1596 (deleteLyXText): remove the not released LyXText structure!
1598 2000-09-24 Marko Vendelin <markov@ioc.ee>
1600 * src/frontends/gnome/mainapp.C
1601 * src/frontends/gnome/mainapp.h: added support for keyboard
1604 * src/frontends/gnome/FormCitation.C
1605 * src/frontends/gnome/FormCitation.h
1606 * src/frontends/gnome/Makefile.am
1607 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1608 FormCitation to use "action area" in mainapp window
1610 * src/frontends/gnome/Menubar_pimpl.C
1611 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1614 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1616 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1617 width/descent/ascent values if name is empty.
1618 (mathed_string_height): Use std::max.
1620 2000-09-25 Allan Rae <rae@lyx.org>
1622 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1623 segfault. This will be completely redesigned soon.
1625 * sigc++: updated libsigc++. Fixes struct timespec bug.
1627 * development/tools/makeLyXsigc.sh: .cvsignore addition
1629 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1631 * several files: removed almost all traces of the old table
1634 * src/TableLayout.C: removed file
1636 2000-09-22 Juergen Vigna <jug@sad.it>
1638 * src/frontends/kde/Dialogs.C: added credits forms.
1640 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1642 * src/frontends/gnome/Dialogs.C: added some forms.
1644 * src/spellchecker.C (init_spell_checker): set language in pspell code
1645 (RunSpellChecker): some modifications for setting language string.
1647 * src/language.[Ch]: added language_country code.
1649 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1651 * src/frontends/Dialogs.h: added new signal showError.
1652 Rearranged existing signals in some sort of alphabetical order.
1654 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1655 FormError.[Ch], form_error.[Ch]
1656 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1657 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1659 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1660 dialogs. I think that this can be used as the base to all these
1663 * src/frontends/xforms/FormError.[Ch]
1664 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1665 implementation of InsetError dialog.
1667 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1669 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1670 * src/frontends/kde/Makefile.am: ditto
1672 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1674 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1675 macrobf. This fixes a bug of invisible text.
1677 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1679 * lib/doc/LaTeXConfig.lyx.in: updated.
1681 * src/language.C (initL): remove language "francais" and change a
1682 bit the names of the two other french variations.
1684 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1685 string that may not be 0-terminated.
1687 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1689 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1691 2000-09-20 Marko Vendelin <markov@ioc.ee>
1693 * src/frontends/gnome/FormCitation.C
1694 * src/frontends/gnome/FormIndex.C
1695 * src/frontends/gnome/FormToc.C
1696 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1697 the variable initialization to shut up the warnings
1699 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1701 * src/table.[Ch]: deleted files
1703 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1706 2000-09-18 Juergen Vigna <jug@sad.it>
1708 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1709 problems with selection. Inserted new LFUN_PASTESELECTION.
1710 (InsetButtonPress): inserted handling of middle mouse-button paste.
1712 * src/spellchecker.C: changed word to word.c_str().
1714 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1716 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1717 included in the ``make dist'' tarball.
1719 2000-09-15 Juergen Vigna <jug@sad.it>
1721 * src/CutAndPaste.C (cutSelection): small fix return the right
1722 end position after cut inside one paragraph only.
1724 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1725 we are locked as otherwise we don't have a valid cursor position!
1727 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1729 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1731 * src/frontends/kde/FormRef.C: added using directive.
1732 * src/frontends/kde/FormToc.C: ditto
1734 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1736 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1738 2000-09-19 Marko Vendelin <markov@ioc.ee>
1740 * src/frontends/gnome/Menubar_pimpl.C
1741 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1742 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1744 * src/frontends/gnome/mainapp.C
1745 * src/frontends/gnome/mainapp.h: support for menu update used
1748 * src/frontends/gnome/mainapp.C
1749 * src/frontends/gnome/mainapp.h: support for "action" area in the
1750 main window. This area is used by small simple dialogs, such as
1753 * src/frontends/gnome/FormIndex.C
1754 * src/frontends/gnome/FormIndex.h
1755 * src/frontends/gnome/FormUrl.C
1756 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1759 * src/frontends/gnome/FormCitation.C
1760 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1761 action area. Only "Insert new citation" is implemented.
1763 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1765 * src/buffer.C (Dispatch): fix call to Dispatch
1766 * src/insets/insetref.C (Edit): likewise
1767 * src/insets/insetparent.C (Edit): likewise
1768 * src/insets/insetinclude.C (include_cb): likewise
1769 * src/frontends/xforms/FormUrl.C (apply): likewise
1770 * src/frontends/xforms/FormToc.C (apply): likewise
1771 * src/frontends/xforms/FormRef.C (apply): likewise
1772 * src/frontends/xforms/FormIndex.C (apply): likewise
1773 * src/frontends/xforms/FormCitation.C (apply): likewise
1774 * src/lyxserver.C (callback): likewise
1775 * src/lyxfunc.C (processKeySym): likewise
1776 (Dispatch): likewise
1777 (Dispatch): likewise
1778 * src/lyx_cb.C (LayoutsCB): likewise
1780 * Makefile.am (sourcedoc): small change
1782 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1784 * src/main.C (main): Don't make an empty GUIRunTime object. all
1785 methods are static. constify a bit remove unneded using + headers.
1787 * src/tabular.C: some more const to local vars move some loop vars
1789 * src/spellchecker.C: added some c_str after some word for pspell
1791 * src/frontends/GUIRunTime.h: add new static method setDefaults
1792 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1793 * src/frontends/kde/GUIRunTime.C (setDefaults):
1794 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1796 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1797 with strnew in arg, use correct emptystring when calling SetName.
1799 * several files: remove all commented code with relation to
1800 HAVE_SSTREAM beeing false. We now only support stringstream and
1803 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1805 * src/lyxfunc.C: construct correctly the automatic new file
1808 * src/text2.C (IsStringInText): change type of variable i to shut
1811 * src/support/sstream.h: do not use namespaces if the compiler
1812 does not support them.
1814 2000-09-15 Marko Vendelin <markov@ioc.ee>
1815 * src/frontends/gnome/FormCitation.C
1816 * src/frontends/gnome/FormCitation.h
1817 * src/frontends/gnome/diainsertcitation_interface.c
1818 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1819 regexp support to FormCitation [Gnome].
1821 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1824 * configure.in: remove unused KDE/GTKGUI define
1826 * src/frontends/kde/FormRef.C
1827 * src/frontends/kde/FormRef.h
1828 * src/frontends/kde/formrefdialog.C
1829 * src/frontends/kde/formrefdialog.h: double click will
1830 go to reference, now it is possible to change a cross-ref
1833 * src/frontends/kde/FormToc.C
1834 * src/frontends/kde/FormToc.h
1835 * src/frontends/kde/formtocdialog.C
1836 * src/frontends/kde/formtocdialog.h: add a depth
1839 * src/frontends/kde/Makefile.am: add QtLyXView.h
1842 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1844 * src/frontends/kde/FormCitation.h: added some using directives.
1846 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1848 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1851 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1854 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1856 * src/buffer.C (pop_tag): revert for the second time a change by
1857 Lars, who seems to really hate having non-local loop variables :)
1859 * src/Lsstream.h: add "using" statements.
1861 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1862 * src/buffer.C (writeFile): ditto
1864 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1866 * src/buffer.C (writeFile): try to fix the locale modified format
1867 number to always be as we want it.
1869 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1870 in XForms 0.89. C-space is now working again.
1872 * src/Lsstream.h src/support/sstream.h: new files.
1874 * also commented out all cases where strstream were used.
1876 * src/Bullet.h (c_str): remove method.
1878 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1880 * a lot of files: get rid of "char const *" and "char *" is as
1881 many places as possible. We only want to use them in interaction
1882 with system of other libraries, not inside lyx.
1884 * a lot of files: return const object is not of pod type. This
1885 helps ensure that temporary objects is not modified. And fits well
1886 with "programming by contract".
1888 * configure.in: check for the locale header too
1890 * Makefile.am (sourcedoc): new tag for generation of doc++
1893 2000-09-14 Juergen Vigna <jug@sad.it>
1895 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1896 callback to check which combo called it and do the right action.
1898 * src/combox.C (combo_cb): added combo * to the callbacks.
1899 (Hide): moved call of callback after Ungrab of the pointer.
1901 * src/intl.h: removed LCombo2 function.
1903 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1904 function as this can now be handled in one function.
1906 * src/combox.h: added Combox * to callback prototype.
1908 * src/frontends/xforms/Toolbar_pimpl.C:
1909 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1911 2000-09-14 Garst Reese <reese@isn.net>
1913 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1914 moved usepackage{xxx}'s to beginning of file. Changed left margin
1915 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1916 underlining from title. Thanks to John Culleton for useful suggestions.
1918 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1920 * src/lyxlex_pimpl.C (setFile): change error message to debug
1923 2000-09-13 Juergen Vigna <jug@sad.it>
1925 * src/frontends/xforms/FormDocument.C: implemented choice_class
1926 as combox and give callback to combo_language so OK/Apply is activated
1929 * src/bufferlist.C (newFile): small fix so already named files
1930 (via an open call) are not requested to be named again on the
1933 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1935 * src/frontends/kde/Makefile.am
1936 * src/frontends/kde/FormRef.C
1937 * src/frontends/kde/FormRef.h
1938 * src/frontends/kde/formrefdialog.C
1939 * src/frontends/kde/formrefdialog.h: implement
1942 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1944 * src/frontends/kde/formtocdialog.C
1945 * src/frontends/kde/formtocdialog.h
1946 * src/frontends/kde/FormToc.C
1947 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1949 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1951 * src/frontends/kde/FormCitation.C: fix thinko
1952 where we didn't always display the reference text
1955 * src/frontends/kde/formurldialog.C
1956 * src/frontends/kde/formurldialog.h
1957 * src/frontends/kde/FormUrl.C
1958 * src/frontends/kde/FormUrl.h: minor cleanups
1960 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1962 * src/frontends/kde/Makefile.am
1963 * src/frontends/kde/FormToc.C
1964 * src/frontends/kde/FormToc.h
1965 * src/frontends/kde/FormCitation.C
1966 * src/frontends/kde/FormCitation.h
1967 * src/frontends/kde/FormIndex.C
1968 * src/frontends/kde/FormIndex.h
1969 * src/frontends/kde/formtocdialog.C
1970 * src/frontends/kde/formtocdialog.h
1971 * src/frontends/kde/formcitationdialog.C
1972 * src/frontends/kde/formcitationdialog.h
1973 * src/frontends/kde/formindexdialog.C
1974 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1976 2000-09-12 Juergen Vigna <jug@sad.it>
1978 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1981 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1983 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1986 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1988 * src/converter.C (Add, Convert): Added support for converter flags:
1989 needaux, resultdir, resultfile.
1990 (Convert): Added new parameter view_file.
1991 (dvips_options): Fixed letter paper option.
1993 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1994 (Export, GetExportableFormats, GetViewableFormats): Added support
1997 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1999 (easyParse): Fixed to work with new export code.
2001 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2004 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2006 * lib/bind/*.bind: Replaced
2007 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2008 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2010 2000-09-11 Juergen Vigna <jug@sad.it>
2012 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2014 * src/main.C (main): now GUII defines global guiruntime!
2016 * src/frontends/gnome/GUIRunTime.C (initApplication):
2017 * src/frontends/kde/GUIRunTime.C (initApplication):
2018 * src/frontends/xforms/GUIRunTime.C (initApplication):
2019 * src/frontends/GUIRunTime.h: added new function initApplication.
2021 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2023 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2025 2000-09-08 Juergen Vigna <jug@sad.it>
2027 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2028 we have already "Reset".
2030 * src/language.C (initL): inserted "default" language and made this
2031 THE default language (and not american!)
2033 * src/paragraph.C: inserted handling of "default" language!
2035 * src/lyxfont.C: ditto
2039 * src/paragraph.C: output the \\par only if we have a following
2040 paragraph otherwise it's not needed.
2042 2000-09-05 Juergen Vigna <jug@sad.it>
2044 * config/pspell.m4: added entry to lyx-flags
2046 * src/spellchecker.C: modified version from Kevin for using pspell
2048 2000-09-01 Marko Vendelin <markov@ioc.ee>
2049 * src/frontends/gnome/Makefile.am
2050 * src/frontends/gnome/FormCitation.C
2051 * src/frontends/gnome/FormCitation.h
2052 * src/frontends/gnome/diainsertcitation_callbacks.c
2053 * src/frontends/gnome/diainsertcitation_callbacks.h
2054 * src/frontends/gnome/diainsertcitation_interface.c
2055 * src/frontends/gnome/diainsertcitation_interface.h
2056 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2057 dialog for Gnome frontend
2059 * src/main.C: Gnome libraries require keeping application name
2060 and its version as strings
2062 * src/frontends/gnome/mainapp.C: Change the name of the main window
2063 from GnomeLyX to PACKAGE
2065 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2067 * src/frontends/Liason.C: add "using: declaration.
2069 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2071 * src/mathed/math_macro.C (Metrics): Set the size of the template
2073 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2075 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2077 * src/converter.C (add_options): New function.
2078 (SetViewer): Change $$FName into '$$FName'.
2079 (View): Add options when running xdvi
2080 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2081 (Convert): The 3rd parameter is now the desired filename. Converts
2082 calls to lyx::rename if necessary.
2083 Add options when running dvips.
2084 (dvi_papersize,dvips_options): New methods.
2086 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2088 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2089 using a call to Converter::dvips_options.
2090 Fixed to work with nex export code.
2092 * src/support/copy.C
2093 * src/support/rename.C: New files
2095 * src/support/syscall.h
2096 * src/support/syscall.C: Added Starttype SystemDontWait.
2098 * lib/ui/default.ui: Changed to work with new export code
2100 * lib/configure.m4: Changed to work with new export code
2102 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2104 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2106 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2107 so that code compiles with DEC cxx.
2109 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2110 to work correctly! Also now supports the additional elements
2113 2000-09-01 Allan Rae <rae@lyx.org>
2115 * src/frontends/ButtonPolicies.C: renamed all the references to
2116 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2118 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2119 since it's a const not a type.
2121 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2123 2000-08-31 Juergen Vigna <jug@sad.it>
2125 * src/insets/figinset.C: Various changes to look if the filename has
2126 an extension and if not add it for inline previewing.
2128 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2130 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2131 make buttonStatus and isReadOnly be const methods. (also reflect
2132 this in derived classes.)
2134 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2135 (nextState): change to be static inline, pass the StateMachine as
2137 (PreferencesPolicy): remove casts
2138 (OkCancelPolicy): remvoe casts
2139 (OkCancelReadOnlyPolicy): remove casts
2140 (NoRepeatedApplyReadOnlyPolicy): remove casts
2141 (OkApplyCancelReadOnlyPolicy): remove casts
2142 (OkApplyCancelPolicy): remove casts
2143 (NoRepeatedApplyPolicy): remove casts
2145 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2147 * src/converter.C: added some using directives
2149 * src/frontends/ButtonPolicies.C: changes to overcome
2150 "need lvalue" error with DEC c++
2152 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2153 to WMHideCB for DEC c++
2155 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2157 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2158 to BulletBMTableCB for DEC c++
2160 2000-08-31 Allan Rae <rae@lyx.org>
2162 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2163 character dialog separately from old document dialogs combo_language.
2166 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2168 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2169 Removed LFUN_REF_CREATE.
2171 * src/MenuBackend.C: Added new tags: toc and references
2173 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2174 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2176 (add_toc, add_references): New methods.
2177 (create_submenu): Handle correctly the case when there is a
2178 seperator after optional menu items.
2180 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2181 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2182 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2184 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2186 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2188 * src/converter.[Ch]: New file for converting between different
2191 * src/export.[Ch]: New file for exporting a LyX file to different
2194 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2195 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2196 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2197 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2198 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2199 RunDocBook, MenuExport.
2201 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2202 Exporter::Preview methods if NEW_EXPORT is defined.
2204 * src/buffer.C (Dispatch): Use Exporter::Export.
2206 * src/lyxrc.C: Added new tags: \converter and \viewer.
2209 * src/LyXAction.C: Define new lyx-function: buffer-update.
2210 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2211 when NEW_EXPORT is defined.
2213 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2215 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2217 * lib/ui/default.ui: Added submenus "view" and "update" to the
2220 * src/filetools.C (GetExtension): New function.
2222 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2224 2000-08-29 Allan Rae <rae@lyx.org>
2226 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2228 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2229 (EnableDocumentLayout): removed
2230 (DisableDocumentLayout): removed
2231 (build): make use of ButtonController's read-only handling to
2232 de/activate various objects. Replaces both of the above functions.
2234 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2235 (readOnly): was read_only
2236 (refresh): fixed dumb mistakes with read_only_ handling
2238 * src/frontends/xforms/forms/form_document.fd:
2239 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2240 tabbed dialogs so the tabs look more like tabs and so its easier to
2241 work out which is the current tab.
2243 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2244 segfault with form_table
2246 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2248 2000-08-28 Juergen Vigna <jug@sad.it>
2250 * acconfig.h: added USE_PSPELL.
2252 * src/config.h.in: added USE_PSPELL.
2254 * autogen.sh: added pspell.m4
2256 * config/pspell.m4: new file.
2258 * src/spellchecker.C: implemented support for pspell libary.
2260 2000-08-25 Juergen Vigna <jug@sad.it>
2262 * src/LyXAction.C (init): renamed LFUN_TABLE to
2263 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2265 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2267 * src/lyxscreen.h: add force_clear variable and fuction to force
2268 a clear area when redrawing in LyXText.
2270 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2272 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2274 * some whitespace and comment changes.
2276 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2278 * src/buffer.C: up te LYX_FORMAT to 2.17
2280 2000-08-23 Juergen Vigna <jug@sad.it>
2282 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2285 * src/insets/insettabular.C (pasteSelection): delete the insets
2286 LyXText as it is not valid anymore.
2287 (copySelection): new function.
2288 (pasteSelection): new function.
2289 (cutSelection): new function.
2290 (LocalDispatch): implemented cut/copy/paste of cell selections.
2292 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2293 don't have a LyXText.
2295 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2297 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2300 2000-08-22 Juergen Vigna <jug@sad.it>
2302 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2303 ifdef form_table out if NEW_TABULAR.
2305 2000-08-21 Juergen Vigna <jug@sad.it>
2307 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2308 (draw): fixed draw position so that the cursor is positioned in the
2310 (InsetMotionNotify): hide/show cursor so the position is updated.
2311 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2312 using cellstart() function where it should be used.
2314 * src/insets/insettext.C (draw): ditto.
2316 * src/tabular.C: fixed initialization of some missing variables and
2317 made BoxType into an enum.
2319 2000-08-22 Marko Vendelin <markov@ioc.ee>
2320 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2321 stock menu item using action numerical value, not its string
2325 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2327 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2328 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2330 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2332 * src/frontends/xforms/GUIRunTime.C: new file
2334 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2335 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2337 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2339 * src/frontends/kde/GUIRunTime.C: new file
2341 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2342 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2344 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2346 * src/frontends/gnome/GUIRunTime.C: new file
2348 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2351 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2352 small change to documetentation.
2354 * src/frontends/GUIRunTime.C: removed file
2356 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2358 * src/lyxparagraph.h: enable NEW_TABULAR as default
2360 * src/lyxfunc.C (processKeySym): remove some commented code
2362 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2363 NEW_TABULAR around the fd_form_table_options.
2365 * src/lyx_gui.C (runTime): call the static member function as
2366 GUIRunTime::runTime().
2368 2000-08-21 Allan Rae <rae@lyx.org>
2370 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2373 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2375 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2377 2000-08-21 Allan Rae <rae@lyx.org>
2379 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2380 keep Garst happy ;-)
2381 * src/frontends/xforms/FormPreferences.C (build): use setOK
2382 * src/frontends/xforms/FormDocument.C (build): use setOK
2383 (FormDocument): use the appropriate policy.
2385 2000-08-21 Allan Rae <rae@lyx.org>
2387 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2388 automatic [de]activation of arbitrary objects when in a read-only state.
2390 * src/frontends/ButtonPolicies.h: More documentation
2391 (isReadOnly): added to support the above.
2393 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2395 2000-08-18 Juergen Vigna <jug@sad.it>
2397 * src/insets/insettabular.C (getStatus): changed to return func_status.
2399 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2400 display toggle menu entries if they are.
2402 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2403 new document layout now.
2405 * src/lyxfunc.C: ditto
2407 * src/lyx_gui_misc.C: ditto
2409 * src/lyx_gui.C: ditto
2411 * lib/ui/default.ui: removed paper and quotes layout as they are now
2412 all in the document layout tabbed folder.
2414 * src/frontends/xforms/forms/form_document.fd: added Restore
2415 button and callbacks for all inputs for Allan's ButtonPolicy.
2417 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2418 (CheckChoiceClass): added missing params setting on class change.
2419 (UpdateLayoutDocument): added for updating the layout on params.
2420 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2421 (FormDocument): Implemented Allan's ButtonPolicy with the
2424 2000-08-17 Allan Rae <rae@lyx.org>
2426 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2427 so we can at least see the credits again.
2429 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2430 controller calls for the appropriate callbacks. Note that since Ok
2431 calls apply followed by cancel, and apply isn't a valid input for the
2432 APPLIED state, the bc_ calls have to be made in the static callback not
2433 within each of the real callbacks.
2435 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2436 (setOk): renamed from setOkay()
2438 2000-08-17 Juergen Vigna <jug@sad.it>
2440 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2441 in the implementation part.
2442 (composeUIInfo): don't show optional menu-items.
2444 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2446 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2448 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2449 text-state when in a text-inset.
2451 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2453 2000-08-17 Marko Vendelin <markov@ioc.ee>
2454 * src/frontends/gnome/FormIndex.C
2455 * src/frontends/gnome/FormIndex.h
2456 * src/frontends/gnome/FormToc.C
2457 * src/frontends/gnome/FormToc.h
2458 * src/frontends/gnome/dialogs
2459 * src/frontends/gnome/diatoc_callbacks.c
2460 * src/frontends/gnome/diatoc_callbacks.h
2461 * src/frontends/gnome/diainsertindex_callbacks.h
2462 * src/frontends/gnome/diainsertindex_callbacks.c
2463 * src/frontends/gnome/diainsertindex_interface.c
2464 * src/frontends/gnome/diainsertindex_interface.h
2465 * src/frontends/gnome/diatoc_interface.h
2466 * src/frontends/gnome/diatoc_interface.c
2467 * src/frontends/gnome/Makefile.am: Table of Contents and
2468 Insert Index dialogs implementation for Gnome frontend
2470 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2472 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2474 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2477 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2479 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2480 destructor. Don't definde if you don't need it
2481 (processEvents): made static, non-blocking events processing for
2483 (runTime): static method. event loop for xforms
2484 * similar as above for kde and gnome.
2486 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2487 new Pimpl is correct
2488 (runTime): new method calss the real frontends runtime func.
2490 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2492 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2494 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2496 2000-08-16 Juergen Vigna <jug@sad.it>
2498 * src/lyx_gui.C (runTime): added GUII RunTime support.
2500 * src/frontends/Makefile.am:
2501 * src/frontends/GUIRunTime.[Ch]:
2502 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2503 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2504 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2506 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2508 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2509 as this is already set in ${FRONTEND_INCLUDE} if needed.
2511 * configure.in (CPPFLAGS): setting the include dir for the frontend
2512 directory and don't set FRONTEND=xforms for now as this is executed
2515 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2517 * src/frontends/kde/Makefile.am:
2518 * src/frontends/kde/FormUrl.C:
2519 * src/frontends/kde/FormUrl.h:
2520 * src/frontends/kde/formurldialog.h:
2521 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2523 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2525 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2527 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2529 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2532 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2534 * src/WorkArea.C (work_area_handler): more work to get te
2535 FL_KEYBOARD to work with xforms 0.88 too, please test.
2537 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2539 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2541 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2544 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2546 * src/Timeout.h: remove Qt::emit hack.
2548 * several files: changes to allo doc++ compilation
2550 * src/lyxfunc.C (processKeySym): new method
2551 (processKeyEvent): comment out if FL_REVISION < 89
2553 * src/WorkArea.C: change some debugging levels.
2554 (WorkArea): set wantkey to FL_KEY_ALL
2555 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2556 clearer code and the use of compose with XForms 0.89. Change to
2557 use signals instead of calling methods in bufferview directly.
2559 * src/Painter.C: change some debugging levels.
2561 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2564 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2565 (workAreaKeyPress): new method
2567 2000-08-14 Juergen Vigna <jug@sad.it>
2569 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2571 * config/kde.m4: addes some features
2573 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2574 include missing xforms dialogs.
2576 * src/Timeout.h: a hack to be able to compile with qt/kde.
2578 * sigc++/.cvsignore: added acinclude.m4
2580 * lib/.cvsignore: added listerros
2582 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2583 xforms tree as objects are needed for other frontends.
2585 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2586 linking with not yet implemented xforms objects.
2588 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2590 2000-08-14 Baruch Even <baruch.even@writeme.com>
2592 * src/frontends/xforms/FormGraphics.h:
2593 * src/frontends/xforms/FormGraphics.C:
2594 * src/frontends/xforms/RadioButtonGroup.h:
2595 * src/frontends/xforms/RadioButtonGroup.C:
2596 * src/insets/insetgraphics.h:
2597 * src/insets/insetgraphics.C:
2598 * src/insets/insetgraphicsParams.h:
2599 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2600 instead of spaces, and various other indentation issues to make the
2601 sources more consistent.
2603 2000-08-14 Marko Vendelin <markov@ioc.ee>
2605 * src/frontends/gnome/dialogs/diaprint.glade
2606 * src/frontends/gnome/FormPrint.C
2607 * src/frontends/gnome/FormPrint.h
2608 * src/frontends/gnome/diaprint_callbacks.c
2609 * src/frontends/gnome/diaprint_callbacks.h
2610 * src/frontends/gnome/diaprint_interface.c
2611 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2614 * src/frontends/gnome/dialogs/diainserturl.glade
2615 * src/frontends/gnome/FormUrl.C
2616 * src/frontends/gnome/FormUrl.h
2617 * src/frontends/gnome/diainserturl_callbacks.c
2618 * src/frontends/gnome/diainserturl_callbacks.h
2619 * src/frontends/gnome/diainserturl_interface.c
2620 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2621 Gnome implementation
2623 * src/frontends/gnome/Dialogs.C
2624 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2625 all other dialogs. Copy all unimplemented dialogs from Xforms
2628 * src/frontends/gnome/support.c
2629 * src/frontends/gnome/support.h: support files generated by Glade
2633 * config/gnome.m4: Gnome configuration scripts
2635 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2636 configure --help message
2638 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2639 only if there are no events pendling in Gnome/Gtk. This enhances
2640 the performance of menus.
2643 2000-08-14 Allan Rae <rae@lyx.org>
2645 * lib/Makefile.am: listerrors cleaning
2647 * lib/listerrors: removed -- generated file
2648 * acinclude.m4: ditto
2649 * sigc++/acinclude.m4: ditto
2651 * src/frontends/xforms/forms/form_citation.fd:
2652 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2655 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2656 `updatesrc` and now we have a `test` target that does what `updatesrc`
2657 used to do. I didn't like having an install target that wasn't related
2660 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2661 on all except FormGraphics. This may yet happen. Followed by a major
2662 cleanup including using FL_TRANSIENT for most of the dialogs. More
2663 changes to come when the ButtonController below is introduced.
2665 * src/frontends/xforms/ButtonController.h: New file for managing up to
2666 four buttons on a dialog according to an externally defined policy.
2667 * src/frontends/xforms/Makefile.am: added above
2669 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2670 Apply and Cancel/Close buttons and everything in between and beyond.
2671 * src/frontends/Makefile.am: added above.
2673 * src/frontends/xforms/forms/form_preferences.fd:
2674 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2675 and removed variable 'status' as a result. Fixed the set_minsize thing.
2676 Use the new screen-font-update after checking screen fonts were changed
2677 Added a "Restore" button to restore the original lyxrc values while
2678 editing. This restores everything not just the last input changed.
2679 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2681 * src/LyXAction.C: screen-font-update added for updating buffers after
2682 screen font settings have been changed.
2683 * src/commandtags.h: ditto
2684 * src/lyxfunc.C: ditto
2686 * forms/lyx.fd: removed screen fonts dialog.
2687 * src/lyx_gui.C: ditto
2688 * src/menus.[Ch]: ditto
2689 * src/lyx.[Ch]: ditto
2690 * src/lyx_cb.C: ditto + code from here moved to make
2691 screen-font-update. And people wonder why progress on GUII is
2692 slow. Look at how scattered this stuff was! It takes forever
2695 * forms/fdfix.sh: Fixup the spacing after commas.
2696 * forms/makefile: Remove date from generated files. Fewer clashes now.
2697 * forms/bullet_forms.C.patch: included someones handwritten changes
2699 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2700 once I've discovered why LyXRC was made noncopyable.
2701 * src/lyx_main.C: ditto
2703 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2705 * src/frontends/xforms/forms/fdfix.sh:
2706 * src/frontends/xforms/forms/fdfixh.sed:
2707 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2708 * src/frontends/xforms/Form*.[hC]:
2709 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2710 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2711 provide a destructor for the struct FD_form_xxxx. Another version of
2712 the set_[max|min]size workaround and a few other cleanups. Actually,
2713 Angus' patch from 20000809.
2715 2000-08-13 Baruch Even <baruch.even@writeme.com>
2717 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2720 2000-08-11 Juergen Vigna <jug@sad.it>
2722 * src/insets/insetgraphics.C (InsetGraphics): changing init
2723 order because of warnings.
2725 * src/frontends/xforms/forms/makefile: adding patching .C with
2728 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2729 from .C.patch to .c.patch
2731 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2732 order because of warning.
2734 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2736 * src/frontends/Liason.C (setMinibuffer): new helper function
2738 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2740 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2742 * lib/ui/default.ui: commented out PaperLayout entry
2744 * src/frontends/xforms/form_document.[Ch]: new added files
2746 * src/frontends/xforms/FormDocument.[Ch]: ditto
2748 * src/frontends/xforms/forms/form_document.fd: ditto
2750 * src/frontends/xforms/forms/form_document.C.patch: ditto
2752 2000-08-10 Juergen Vigna <jug@sad.it>
2754 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2755 (InsetGraphics): initialized cacheHandle to 0.
2756 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2758 2000-08-10 Baruch Even <baruch.even@writeme.com>
2760 * src/graphics/GraphicsCache.h:
2761 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2762 correctly as a cache.
2764 * src/graphics/GraphicsCacheItem.h:
2765 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2768 * src/graphics/GraphicsCacheItem_pimpl.h:
2769 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2772 * src/insets/insetgraphics.h:
2773 * src/insets/insetgraphics.C: Changed from using a signal notification
2774 to polling when image is not loaded.
2776 2000-08-10 Allan Rae <rae@lyx.org>
2778 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2779 that there are two functions that have to been taken out of line by
2780 hand and aren't taken care of in the script. (Just a reminder note)
2782 * sigc++/macros/*.h.m4: Updated as above.
2784 2000-08-09 Juergen Vigna <jug@sad.it>
2786 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2788 * src/insets/insettabular.C: make drawing of single cell smarter.
2790 2000-08-09 Marko Vendelin <markov@ioc.ee>
2791 * src/frontends/gnome/Menubar_pimpl.C
2792 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2793 implementation: new files
2795 * src/frontends/gnome/mainapp.C
2796 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2799 * src/main.C: create Gnome main window
2801 * src/frontends/xforms/Menubar_pimpl.h
2802 * src/frontends/Menubar.C
2803 * src/frontends/Menubar.h: added method Menubar::update that calls
2804 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2806 * src/LyXView.C: calls Menubar::update to update the state
2809 * src/frontends/gnome/Makefile.am: added new files
2811 * src/frontends/Makefile.am: added frontend compiler options
2813 2000-08-08 Juergen Vigna <jug@sad.it>
2815 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2817 * src/bufferlist.C (close):
2818 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2819 documents if exiting without saving.
2821 * src/buffer.C (save): use removeAutosaveFile()
2823 * src/support/filetools.C (removeAutosaveFile): new function.
2825 * src/lyx_cb.C (MenuWrite): returns a bool now.
2826 (MenuWriteAs): check if file could really be saved and revert to the
2828 (MenuWriteAs): removing old autosavefile if existant.
2830 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2831 before Goto toggle declaration, because of compiler warning.
2833 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2835 * src/lyxfunc.C (MenuNew): small fix.
2837 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2839 * src/bufferlist.C (newFile):
2840 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2842 * src/lyxrc.C: added new_ask_filename tag
2844 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2846 * src/lyx.fd: removed code pertaining to form_ref
2847 * src/lyx.[Ch]: ditto
2848 * src/lyx_cb.C: ditto
2849 * src/lyx_gui.C: ditto
2850 * src/lyx_gui_misc.C: ditto
2852 * src/BufferView_pimpl.C (restorePosition): update buffer only
2855 * src/commandtags.h (LFUN_REFTOGGLE): removed
2856 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2857 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2858 (LFUN_REFBACK): renamed LFUN_REF_BACK
2860 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2861 * src/menus.C: ditto
2862 * src/lyxfunc.C (Dispatch): ditto.
2863 InsertRef dialog is now GUI-independent.
2865 * src/texrow.C: added using std::endl;
2867 * src/insets/insetref.[Ch]: strip out large amounts of code.
2868 The inset is now a container and this functionality is now
2869 managed by a new FormRef dialog
2871 * src/frontends/Dialogs.h (showRef, createRef): new signals
2873 * src/frontends/xforms/FormIndex.[Ch],
2874 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2875 when setting dialog's min/max size
2876 * src/frontends/xforms/FormIndex.[Ch]: ditto
2878 * src/frontends/xforms/FormRef.[Ch],
2879 src/frontends/xforms/forms/form_ref.fd: new xforms
2880 implementation of an InsetRef dialog
2882 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2885 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2886 ios::nocreate is not part of the standard. Removed.
2888 2000-08-07 Baruch Even <baruch.even@writeme.com>
2890 * src/graphics/Renderer.h:
2891 * src/graphics/Renderer.C: Added base class for rendering of different
2892 image formats into Pixmaps.
2894 * src/graphics/XPM_Renderer.h:
2895 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2896 in a different class.
2898 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2899 easily add support for other formats.
2901 * src/insets/figinset.C: plugged a leak of an X resource.
2903 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2905 * src/CutAndPaste.[Ch]: make all metods static.
2907 * development/Code_rules/Rules: more work, added section on
2908 Exceptions, and a References section.
2910 * a lot of header files: work to make doc++ able to generate the
2911 source documentation, some workarounds of doc++ problems. Doc++ is
2912 now able to generate the documentation.
2914 2000-08-07 Juergen Vigna <jug@sad.it>
2916 * src/insets/insettabular.C (recomputeTextInsets): removed function
2918 * src/tabular.C (SetWidthOfMulticolCell):
2920 (calculate_width_of_column_NMC): fixed return value so that it really
2921 only returns true if the column-width has changed (there where
2922 problems with muliticolumn-cells in this column).
2924 2000-08-04 Juergen Vigna <jug@sad.it>
2926 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2927 also on the scrollstatus of the inset.
2928 (workAreaMotionNotify): ditto.
2930 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2932 2000-08-01 Juergen Vigna <jug@sad.it>
2934 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2936 * src/commandtags.h:
2937 * src/LyXAction.C (init):
2938 * src/insets/inset.C (LocalDispatch): added support for
2941 * src/insets/inset.C (scroll): new functions.
2943 * src/insets/insettext.C (removeNewlines): new function.
2944 (SetAutoBreakRows): removes forced newlines in the text of the
2945 paragraph if autoBreakRows is set to false.
2947 * src/tabular.C (Latex): generates a parbox around the cell contents
2950 * src/frontends/xforms/FormTabular.C (local_update): removed
2951 the radio_useparbox button.
2953 * src/tabular.C (UseParbox): new function
2955 2000-08-06 Baruch Even <baruch.even@writeme.com>
2957 * src/graphics/GraphicsCache.h:
2958 * src/graphics/GraphicsCache.C:
2959 * src/graphics/GraphicsCacheItem.h:
2960 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2963 * src/insets/insetgraphics.h:
2964 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
2965 and the drawing of the inline image.
2967 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
2968 loaded into the wrong position.
2970 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2973 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2975 * src/support/translator.h: move all typedefs to public section
2977 * src/support/filetools.C (MakeLatexName): return string const
2979 (TmpFileName): ditto
2980 (FileOpenSearch): ditto
2982 (LibFileSearch): ditto
2983 (i18nLibFileSearch): ditto
2986 (CreateTmpDir): ditto
2987 (CreateBufferTmpDir): ditto
2988 (CreateLyXTmpDir): ditto
2991 (MakeAbsPath): ditto
2993 (OnlyFilename): ditto
2995 (NormalizePath): ditto
2996 (CleanupPath): ditto
2997 (GetFileContents): ditto
2998 (ReplaceEnvironmentPath): ditto
2999 (MakeRelPath): ditto
3001 (ChangeExtension): ditto
3002 (MakeDisplayPath): ditto
3003 (do_popen): return cmdret const
3004 (findtexfile): return string const
3006 * src/support/DebugStream.h: add some /// to please doc++
3008 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3010 * src/texrow.C (same_rownumber): functor to use with find_if
3011 (getIdFromRow): rewritten to use find_if and to not update the
3012 positions. return true if row is found
3013 (increasePos): new method, use to update positions
3015 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3017 * src/lyxlex_pimpl.C (verifyTable): new method
3020 (GetString): return string const
3021 (pushTable): rewrite to use std::stack
3023 (setFile): better check
3026 * src/lyxlex.h: make LyXLex noncopyable
3028 * src/lyxlex.C (text): return char const * const
3029 (GetString): return string const
3030 (getLongString): return string const
3032 * src/lyx_gui_misc.C (askForText): return pair<...> const
3034 * src/lastfiles.[Ch] (operator): return string const
3036 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3037 istringstream not char const *.
3038 move token.end() out of loop.
3039 (readFile): move initializaton of token
3041 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3042 getIdFromRow is successful.
3044 * lib/bind/emacs.bind: don't include menus bind
3046 * development/Code_rules/Rules: the beginnings of making this
3047 better and covering more of the unwritten rules that we have.
3049 * development/Code_rules/Recommendations: a couple of wording
3052 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3054 * src/support/strerror.c: remove C++ comment.
3056 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3058 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3059 LFUN_INDEX_INSERT_LAST
3061 * src/texrow.C (getIdFromRow): changed from const_iterator to
3062 iterator, allowing code to compile with DEC cxx
3064 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3065 stores part of the class, as suggested by Allan. Will allow
3067 (apply): test to apply uses InsetCommandParams operator!=
3069 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3070 (apply): test to apply uses InsetCommandParams operator!=
3072 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3073 stores part of the class.
3074 (update): removed limits on min/max size.
3076 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3077 (apply): test to apply uses InsetCommandParams operator!=
3079 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3080 (Read, Write, scanCommand, getCommand): moved functionality
3081 into InsetCommandParams.
3083 (getScreenLabel): made pure virtual
3084 new InsetCommandParams operators== and !=
3086 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3087 c-tors based on InsetCommandParams. Removed others.
3088 * src/insets/insetinclude.[Ch]: ditto
3089 * src/insets/insetlabel.[Ch]: ditto
3090 * src/insets/insetparent.[Ch]: ditto
3091 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3093 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3094 insets derived from InsetCommand created using similar c-tors
3095 based on InsetCommandParams
3096 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3097 * src/menus.C (ShowRefsMenu): ditto
3098 * src/paragraph.C (Clone): ditto
3099 * src/text2.C (SetCounter): ditto
3100 * src/lyxfunc.C (Dispatch) ditto
3101 Also recreated old InsetIndex behaviour exactly. Can now
3102 index-insert at the start of a paragraph and index-insert-last
3103 without launching the pop-up.
3105 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3107 * lib/lyxrc.example: mark te pdf options as non functional.
3109 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3110 (isStrDbl): move tmpstr.end() out of loop.
3111 (strToDbl): move intialization of tmpstr
3112 (lowercase): return string const and move tmp.end() out of loop.
3113 (uppercase): return string const and move tmp.edn() out of loop.
3114 (prefixIs): add assertion
3119 (containsOnly): ditto
3120 (containsOnly): ditto
3121 (containsOnly): ditto
3122 (countChar): make last arg char not char const
3123 (token): return string const
3124 (subst): return string const, move tmp.end() out of loop.
3125 (subst): return string const, add assertion
3126 (strip): return string const
3127 (frontStrip): return string const, add assertion
3128 (frontStrip): return string const
3133 * src/support/lstrings.C: add inclde "LAssert.h"
3134 (isStrInt): move tmpstr.end() out of loop.
3136 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3137 toollist.end() out of loop.
3138 (deactivate): move toollist.end() out of loop.
3139 (update): move toollist.end() out of loop.
3140 (updateLayoutList): move tc.end() out of loop.
3141 (add): move toollist.end() out of loop.
3143 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3144 md.end() out of loop.
3146 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3148 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3151 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3152 (Erase): move insetlist.end() out of loop.
3154 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3155 ref to const string as first arg. Move initialization of some
3156 variables, whitespace changes.
3158 * src/kbmap.C (defkey): move table.end() out of loop.
3159 (kb_keymap): move table.end() out of loop.
3160 (findbinding): move table.end() out of loop.
3162 * src/MenuBackend.C (hasMenu): move end() out of loop.
3163 (getMenu): move end() out of loop.
3164 (getMenu): move menulist_.end() out of loop.
3166 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3168 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3171 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3172 (getFromLyXName): move infotab.end() out of loop.
3174 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3175 -fvtable-thunks -ffunction-sections -fdata-sections
3177 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3179 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3182 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3184 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3186 * src/frontends/xforms/FormCitation.[Ch],
3187 src/frontends/xforms/FormIndex.[Ch],
3188 src/frontends/xforms/FormToc.[Ch],
3189 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3191 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3193 * src/commandtags.h: renamed, created some flags for citation
3196 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3198 * src/lyxfunc.C (dispatch): use signals to insert index entry
3200 * src/frontends/Dialogs.h: new signal createIndex
3202 * src/frontends/xforms/FormCommand.[Ch],
3203 src/frontends/xforms/FormCitation.[Ch],
3204 src/frontends/xforms/FormToc.[Ch],
3205 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3207 * src/insets/insetindex.[Ch]: GUI-independent
3209 * src/frontends/xforms/FormIndex.[Ch],
3210 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3213 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3215 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3216 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3218 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3220 * src/insets/insetref.C (Latex): rewrite so that there is now
3221 question that a initialization is requested.
3223 * src/insets/insetcommand.h: reenable the hide signal
3225 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3227 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3228 fix handling of shortcuts (many bugs :)
3229 (add_lastfiles): ditto.
3231 * lib/ui/default.ui: fix a few shortcuts.
3233 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3235 * Makefile.am: Fix ``rpmdist'' target to return the exit
3236 status of the ``rpm'' command, instead of the last command in
3237 the chain (the ``rm lyx.xpm'' command, which always returns
3240 2000-08-02 Allan Rae <rae@lyx.org>
3242 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3243 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3244 * src/frontends/xforms/FormToc.C (FormToc): ditto
3246 * src/frontends/xforms/Makefile.am: A few forgotten files
3248 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3249 Signals-not-copyable-problem Lars' started commenting out.
3251 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3253 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3255 * src/insets/insetcommand.h: Signals is not copyable so anoter
3256 scheme for automatic hiding of forms must be used.
3258 * src/frontends/xforms/FormCitation.h: don't inerit from
3259 noncopyable, FormCommand already does that.
3260 * src/frontends/xforms/FormToc.h: ditto
3261 * src/frontends/xforms/FormUrl.h: ditto
3263 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3265 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3267 * src/insets/insetcommand.h (hide): new SigC::Signal0
3268 (d-tor) new virtual destructor emits hide signal
3270 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3271 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3273 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3274 LOF and LOT. Inset is now GUI-independent
3276 * src/insets/insetloa.[Ch]: redundant
3277 * src/insets/insetlof.[Ch]: ditto
3278 * src/insets/insetlot.[Ch]: ditto
3280 * src/frontends/xforms/forms/form_url.fd: tweaked!
3281 * src/frontends/xforms/forms/form_citation.fd: ditto
3283 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3284 dialogs dealing with InsetCommand insets
3286 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3287 FormCommand base class
3288 * src/frontends/xforms/FormUrl.[Ch]: ditto
3290 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3292 * src/frontends/xforms/FormToc.[Ch]: ditto
3294 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3295 passed a generic InsetCommand pointer
3296 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3298 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3299 and modified InsetTOC class
3300 * src/buffer.C: ditto
3302 * forms/lyx.fd: strip out old FD_form_toc code
3303 * src/lyx_gui_misc.C: ditto
3304 * src/lyx_gui.C: ditto
3305 * src/lyx_cb.C: ditto
3306 * src/lyx.[Ch]: ditto
3308 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3310 * src/support/utility.hpp: tr -d '\r'
3312 2000-08-01 Juergen Vigna <jug@sad.it>
3314 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3316 * src/commandtags.h:
3317 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3318 LFUN_TABULAR_FEATURES.
3320 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3321 LFUN_LAYOUT_TABULAR.
3323 * src/insets/insettabular.C (getStatus): implemented helper function.
3325 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3327 2000-07-31 Juergen Vigna <jug@sad.it>
3329 * src/text.C (draw): fixed screen update problem for text-insets.
3331 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3332 something changed probably this has to be added in various other
3335 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3337 2000-07-31 Baruch Even <baruch.even@writeme.com>
3339 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3340 templates to satisfy compaq cxx.
3343 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3345 * src/support/translator.h (equal_1st_in_pair::operator()): take
3346 const ref pair_type as arg.
3347 (equal_2nd_in_pair::operator()): ditto
3348 (Translator::~Translator): remove empty d-tor.
3350 * src/graphics/GraphicsCache.C: move include config.h to top, also
3351 put initialization of GraphicsCache::singleton here.
3352 (~GraphicsCache): move here
3353 (addFile): take const ref as arg
3356 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3358 * src/BufferView2.C (insertLyXFile): change te with/without header
3361 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3363 * src/frontends/xforms/FormGraphics.C (apply): add some
3364 static_cast. Not very nice, but required by compaq cxx.
3366 * src/frontends/xforms/RadioButtonGroup.h: include header
3367 <utility> instead of <pair.h>
3369 * src/insets/insetgraphicsParams.C: add using directive.
3370 (readResize): change return type to void.
3371 (readOrigin): ditto.
3373 * src/lyxfunc.C (getStatus): add missing break for build-program
3374 function; add test for Literate for export functions.
3376 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3377 entries in Options menu.
3379 2000-07-31 Baruch Even <baruch.even@writeme.com>
3381 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3382 protect against auto-allocation; release icon when needed.
3384 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3386 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3387 on usual typewriter.
3389 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3390 earlier czech.kmap), useful only for programming.
3392 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3394 * src/frontends/xforms/FormCitation.h: fix conditioning around
3397 2000-07-31 Juergen Vigna <jug@sad.it>
3399 * src/frontends/xforms/FormTabular.C (local_update): changed
3400 radio_linebreaks to radio_useparbox and added radio_useminipage.
3402 * src/tabular.C: made support for using minipages/parboxes.
3404 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3406 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3408 (descent): so the cursor is in the middle.
3409 (width): bit smaller box.
3411 * src/insets/insetgraphics.h: added display() function.
3413 2000-07-31 Baruch Even <baruch.even@writeme.com>
3415 * src/frontends/Dialogs.h: Added showGraphics signals.
3417 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3418 xforms form definition of the graphics dialog.
3420 * src/frontends/xforms/FormGraphics.h:
3421 * src/frontends/xforms/FormGraphics.C: Added files, the
3422 GUIndependent code of InsetGraphics
3424 * src/insets/insetgraphics.h:
3425 * src/insets/insetgraphics.C: Major writing to make it work.
3427 * src/insets/insetgraphicsParams.h:
3428 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3429 struct between InsetGraphics and GUI.
3431 * src/LaTeXFeatures.h:
3432 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3433 support for graphicx package.
3435 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3436 for the graphics inset.
3438 * src/support/translator.h: Added file, used in
3439 InsetGraphicsParams. this is a template to translate between two
3442 * src/frontends/xforms/RadioButtonGroup.h:
3443 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3444 way to easily control a radio button group.
3446 2000-07-28 Juergen Vigna <jug@sad.it>
3448 * src/insets/insettabular.C (LocalDispatch):
3449 (TabularFeatures): added support for lyx-functions of tabular features.
3450 (cellstart): refixed this function after someone wrongly changed it.
3452 * src/commandtags.h:
3453 * src/LyXAction.C (init): added support for tabular-features
3455 2000-07-28 Allan Rae <rae@lyx.org>
3457 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3458 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3459 triggers the callback for input checking. As a result we sometimes get
3460 "LyX: This shouldn't happen..." printed to cerr.
3461 (input): Started using status variable since I only free() on
3462 destruction. Some input checking for paths and font sizes.
3464 * src/frontends/xforms/FormPreferences.h: Use status to control
3465 activation of Ok and Apply
3467 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3468 callback. Also resized to stop segfaults with 0.88. The problem is
3469 that xforms-0.88 requires the folder to be wide enough to fit all the
3470 tabs. If it isn't it causes all sorts of problems.
3472 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3474 * src/frontends/xforms/forms/README: Reflect reality.
3476 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3477 * src/frontends/xforms/forms/makefile: ditto.
3479 * src/commandtags.h: Get access to new Preferences dialog
3480 * src/LyXAction.C: ditto
3481 * src/lyxfunc.C: ditto
3482 * lib/ui/default.ui: ditto
3484 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3486 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3488 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3491 * src/frontends/xforms/form_url.[Ch]: added.
3493 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3495 * src/insets/insetbib.h: fixed bug in previous commit
3497 * src/frontends/xforms/FormUrl.h: ditto
3499 * src/frontends/xforms/FormPrint.h: ditto
3501 * src/frontends/xforms/FormPreferences.h: ditto
3503 * src/frontends/xforms/FormCopyright.h: ditto
3505 * src/frontends/xforms/FormCitation.C: ditto
3507 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3508 private copyconstructor and private default contructor
3510 * src/support/Makefile.am: add utility.hpp
3512 * src/support/utility.hpp: new file from boost
3514 * src/insets/insetbib.h: set owner in clone
3516 * src/frontends/xforms/FormCitation.C: added missing include
3519 * src/insets/form_url.[Ch]: removed
3521 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3523 * development/lyx.spec.in
3524 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3525 file/directory re-organization.
3527 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3529 * src/insets/insetcommand.[Ch]: moved the string data and
3530 associated manipulation methods into a new stand-alone class
3531 InsetCommandParams. This class has two additional methods
3532 getAsString() and setFromString() allowing the contents to be
3533 moved around as a single string.
3534 (addContents) method removed.
3535 (setContents) method no longer virtual.
3537 * src/buffer.C (readInset): made use of new InsetCitation,
3538 InsetUrl constructors based on InsetCommandParams.
3540 * src/commandtags.h: add LFUN_INSERT_URL
3542 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3543 independent InsetUrl and use InsetCommandParams to extract
3544 string info and create new Insets.
3546 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3548 * src/frontends/xforms/FormCitation.C (apply): uses
3551 * src/frontends/xforms/form_url.C
3552 * src/frontends/xforms/form_url.h
3553 * src/frontends/xforms/FormUrl.h
3554 * src/frontends/xforms/FormUrl.C
3555 * src/frontends/xforms/forms/form_url.fd: new files
3557 * src/insets/insetcite.[Ch]: removed unused constructors.
3559 * src/insets/insetinclude.[Ch]: no longer store filename
3561 * src/insets/inseturl.[Ch]: GUI-independent.
3563 2000-07-26 Juergen Vigna <jug@sad.it>
3564 * renamed frontend from gtk to gnome as it is that what is realized
3565 and did the necessary changes in the files.
3567 2000-07-26 Marko Vendelin <markov@ioc.ee>
3569 * configure.in: cleaning up gnome configuration scripts
3571 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3573 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3574 shortcuts syndrom by redrawing them explicitely (a better solution
3575 would be appreciated).
3577 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3579 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3582 * src/lyx_cb.C (MenuExport): change html export to do the right
3583 thing depending of the document type (instead of having
3584 html-linuxdoc and html-docbook).
3585 * src/lyxfunc.C (getStatus): update for html
3586 * lib/ui/default.ui: simplify due to the above change.
3587 * src/menus.C (ShowFileMenu): update too (in case we need it).
3589 * src/MenuBackend.C (read): if a menu is defined twice, add the
3590 new entries to the exiting one.
3592 2000-07-26 Juergen Vigna <jug@sad.it>
3594 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3596 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3597 and return a bool if it did actual save the file.
3598 (AutoSave): don't autosave a unnamed doc.
3600 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3601 check if this is an UNNAMED new file and react to it.
3602 (newFile): set buffer to unnamed and change to not mark a new
3603 buffer dirty if I didn't do anything with it.
3605 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3607 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3609 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3610 friend as per Angus's patch posted to lyx-devel.
3612 * src/ext_l10n.h: updated
3614 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3615 gettext on the style string right before inserting them into the
3618 * autogen.sh: add code to extract style strings form layout files,
3619 not good enough yet.
3621 * src/frontends/gtk/.cvsignore: add MAKEFILE
3623 * src/MenuBackend.C (read): run the label strings through gettext
3624 before storing them in the containers.
3626 * src/ext_l10n.h: new file
3628 * autogen.sh : generate the ext_l10n.h file here
3630 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3632 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3635 * lib/ui/default.ui: fix a couple of typos.
3637 * config/gnome/gtk.m4: added (and added to the list of files in
3640 * src/insets/insetinclude.C (unique_id): fix when we are using
3641 lyxstring instead of basic_string<>.
3642 * src/insets/insettext.C (LocalDispatch): ditto.
3643 * src/support/filetools.C: ditto.
3645 * lib/configure.m4: create the ui/ directory if necessary.
3647 * src/LyXView.[Ch] (updateToolbar): new method.
3649 * src/BufferView_pimpl.C (buffer): update the toolbar when
3650 opening/closing buffer.
3652 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3654 * src/LyXAction.C (getActionName): enhance to return also the name
3655 and options of pseudo-actions.
3656 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3658 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3659 as an example of what is possible). Used in File->Build too (more
3660 useful) and in the import/export menus (to mimick the complicated
3661 handling of linuxdoc and friends). Try to update all the entries.
3663 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3666 * src/MenuBackend.C (read): Parse the new OptItem tag.
3668 * src/MenuBackend.h: Add a new optional_ data member (used if the
3669 entry should be omitted when the lyxfunc is disabled).
3671 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3672 function, used as a shortcut.
3673 (create_submenu): align correctly the shortcuts on the widest
3676 * src/MenuBackend.h: MenuItem.label() only returns the label of
3677 the menu without shortcut; new method shortcut().
3679 2000-07-14 Marko Vendelin <markov@ioc.ee>
3681 * src/frontends/gtk/Dialogs.C:
3682 * src/frontends/gtk/FormCopyright.C:
3683 * src/frontends/gtk/FormCopyright.h:
3684 * src/frontends/gtk/Makefile.am: added these source-files for the
3685 Gtk/Gnome support of the Copyright-Dialog.
3687 * src/main.C: added Gnome::Main initialization if using
3688 Gtk/Gnome frontend-GUI.
3690 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3692 * config/gnome/aclocal-include.m4
3693 * config/gnome/compiler-flags.m4
3694 * config/gnome/curses.m4
3695 * config/gnome/gnome--.m4
3696 * config/gnome/gnome-bonobo-check.m4
3697 * config/gnome/gnome-common.m4
3698 * config/gnome/gnome-fileutils.m4
3699 * config/gnome/gnome-ghttp-check.m4
3700 * config/gnome/gnome-gnorba-check.m4
3701 * config/gnome/gnome-guile-checks.m4
3702 * config/gnome/gnome-libgtop-check.m4
3703 * config/gnome/gnome-objc-checks.m4
3704 * config/gnome/gnome-orbit-check.m4
3705 * config/gnome/gnome-print-check.m4
3706 * config/gnome/gnome-pthread-check.m4
3707 * config/gnome/gnome-support.m4
3708 * config/gnome/gnome-undelfs.m4
3709 * config/gnome/gnome-vfs.m4
3710 * config/gnome/gnome-x-checks.m4
3711 * config/gnome/gnome-xml-check.m4
3712 * config/gnome/gnome.m4
3713 * config/gnome/gperf-check.m4
3714 * config/gnome/gtk--.m4
3715 * config/gnome/linger.m4
3716 * config/gnome/need-declaration.m4: added configuration scripts
3717 for Gtk/Gnome frontend-GUI
3719 * configure.in: added support for the --with-frontend=gtk option
3721 * autogen.sh: added config/gnome/* to list of config-files
3723 * acconfig.h: added define for GTKGUI-support
3725 * config/lyxinclude.m4: added --with-frontend[=value] option value
3726 for Gtk/Gnome frontend-GUI support.
3728 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3730 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3734 * src/paragraph.C (GetChar): remove non-const version
3736 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3737 (search_kw): use it.
3739 * src/lyx_main.C (init): if "preferences" exist, read that instead
3741 (ReadRcFile): return bool if the file could be read ok.
3742 (ReadUIFile): add a check to see if lex file is set ok.
3744 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3745 bastring can be used instead of lyxstring (still uses the old code
3746 if std::string is good enough or if lyxstring is used.)
3748 * src/encoding.C: make the arrays static, move ininle functions
3750 * src/encoding.h: from here.
3752 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3753 (parseSingleLyXformat2Token): move inset parsing to separate method
3754 (readInset): new private method
3756 * src/Variables.h: remove virtual from get().
3758 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3759 access to NEW_INSETS and NEW_TABULAR
3761 * src/MenuBackend.h: remove superfluous forward declaration of
3762 MenuItem. Add documentations tags "///", remove empty MenuItem
3763 destructor, remove private default contructor.
3765 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3767 (read): more string mlabel and mname to where they are used
3768 (read): remove unused variables mlabel and mname
3769 (defaults): unconditional clear, make menusetup take advantage of
3770 add returning Menu &.
3772 * src/LyXView.h: define NEW_MENUBAR as default
3774 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3775 to NEW_INSETS and NEW_TABULAR.
3776 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3777 defined. Change some of the "xxxx-inset-insert" functions names to
3780 * several files: more enahncements to NEW_INSETS and the resulting
3783 * lib/lyxrc.example (\date_insert_format): move to misc section
3785 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3786 bastring and use AC_CACHE_CHECK.
3787 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3788 the system have the newest methods. uses AC_CACHE_CHECK
3789 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3790 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3791 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3793 * configure.in: add LYX_CXX_GOOD_STD_STRING
3795 * acinclude.m4: recreated
3797 2000-07-24 Amir Karger <karger@lyx.org>
3799 * README: add Hebrew, Arabic kmaps
3802 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3804 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3807 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3809 * Lot of files: add pragma interface/implementation.
3811 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3813 * lib/ui/default.ui: new file (ans new directory). Contains the
3814 default menu and toolbar.
3816 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3817 global space. Toolbars are now read (as menus) in ui files.
3819 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3821 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3822 is disabled because the document is read-only. We want to have the
3823 toggle state of the function anyway.
3824 (getStatus): add code for LFUN_VC* functions (mimicking what is
3825 done in old-style menus)
3827 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3828 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3830 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3831 * src/BufferView_pimpl.C: ditto.
3832 * src/lyxfunc.C: ditto.
3834 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3835 default). This replaces old-style menus by new ones.
3837 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3838 MenuItem. Contain the data structure of a menu.
3840 * src/insets/insettext.C: use LyXView::setLayout instead of
3841 accessing directly the toolbar combox.
3842 * src/lyxfunc.C (Dispatch): ditto.
3844 * src/LyXView.C (setLayout): new method, which just calls
3845 Toolbar::setLayout().
3846 (updateLayoutChoice): move part of this method in Toolbar.
3848 * src/toolbar.[Ch]: removed.
3850 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3851 implementation the toolbar.
3853 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3854 the toolbar. It might make sense to merge it with ToolbarDefaults
3856 (setLayout): new function.
3857 (updateLayoutList): ditto.
3858 (openLayoutList): ditto.
3860 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3861 xforms implementation of the toolbar.
3862 (get_toolbar_func): comment out, since I do not
3863 know what it is good for.
3865 * src/ToolbarDefaults.h: Add the ItemType enum.
3867 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3868 for a list of allocated C strings. Used in Menubar xforms
3869 implementation to avoid memory leaks.
3871 * src/support/lstrings.[Ch] (uppercase): new version taking and
3875 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3876 * lib/bind/emacs.bind: ditto.
3878 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3880 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3881 forward decl of LyXView.
3883 * src/toolbar.C (toolbarItem): moved from toolbar.h
3884 (toolbarItem::clean): ditto
3885 (toolbarItem::~toolbarItem): ditto
3886 (toolbarItem::operator): ditto
3888 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3890 * src/paragraph.h: control the NEW_TABULAR define from here
3892 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3893 USE_TABULAR_INSETS to NEW_TABULAR
3895 * src/ToolbarDefaults.C: add include "lyxlex.h"
3897 * files using the old table/tabular: use NEW_TABULAR to control
3898 compilation of old tabular stuff.
3900 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3903 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3904 planemet in reading of old style floats, fix the \end_deeper
3905 problem when reading old style floats.
3907 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3909 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3911 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3913 * lib/bind/sciword.bind: updated.
3915 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3917 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3918 layout write problem
3920 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3922 * src/Makefile.am (INCLUDES): remove image directory from include
3925 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3926 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3928 * src/LyXView.C (create_form_form_main): read the application icon
3931 * lib/images/*.xpm: change the icons to use transparent color for
3934 * src/toolbar.C (update): change the color of the button when it
3937 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3939 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3940 setting explicitely the minibuffer.
3941 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3943 * src/LyXView.C (showState): new function. Shows font information
3944 in minibuffer and update toolbar state.
3945 (LyXView): call Toolbar::update after creating the
3948 * src/toolbar.C: change toollist to be a vector instead of a
3950 (BubbleTimerCB): get help string directly from the callback
3951 argument of the corresponding icon (which is the action)
3952 (set): remove unnecessary ugliness.
3953 (update): new function. update the icons (depressed, disabled)
3954 depending of the status of the corresponding action.
3956 * src/toolbar.h: remove help in toolbarItem
3958 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3960 * src/Painter.C (text): Added code for using symbol glyphs from
3961 iso10646 fonts. Currently diabled.
3963 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3966 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3967 magyar,turkish and usorbian.
3969 * src/paragraph.C (isMultiLingual): Made more efficient.
3971 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3974 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3975 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3976 Also changed the prototype to "bool math_insert_greek(char)".
3978 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * lots of files: apply the NEW_INSETS on all code that will not be
3981 needed when we move to use the new insets. Enable the define in
3982 lyxparagrah.h to try it.
3984 * src/insets/insettabular.C (cellstart): change to be a static
3986 (InsetTabular): initialize buffer in the initializer list.
3988 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3990 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3991 form_print.h out of the header file. Replaced with forward
3992 declarations of the relevant struct.
3994 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3997 * src/commandtags.h: do not include "debug.h" which does not
3998 belong there. #include it in some other places because of this
4001 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4003 * src/insets/insetcaption.C: add a couple "using" directives.
4005 * src/toolbar.C (add): get the help text directly from lyxaction.
4007 (setPixmap): new function. Loads from disk and sets a pixmap on a
4008 botton; the name of the pixmap file is derived from the command
4011 * src/toolbar.h: remove members isBitmap and pixmap from
4014 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4015 * lib/images/: move many files from images/banner.xpm.
4017 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4019 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4020 * src/toolbar.C: ditto.
4021 * configure.in: ditto.
4022 * INSTALL: document.
4024 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4025 the spellchecker popup is closed from the WM.
4027 2000-07-19 Juergen Vigna <jug@sad.it>
4029 * src/insets/insetfloat.C (Write): small fix because we use the
4030 insetname for the type now!
4032 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4034 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4037 * src/frontends/Dialogs.h: removed hideCitation signal
4039 * src/insets/insetcite.h: added hide signal
4041 * src/insets/insetcite.C (~InsetCitation): emits new signal
4042 (getScreenLabel): "intelligent" label should now fit on the screen!
4044 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4046 * src/frontends/xforms/FormCitation.C (showInset): connects
4047 hide() to the inset's hide signal
4048 (show): modified to use fl_set_object_position rather than
4049 fl_set_object_geometry wherever possible
4051 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4053 * src/insets/lyxinset.h: add caption code
4055 * src/insets/insetfloat.C (type): new method
4057 * src/insets/insetcaption.C (Write): new method
4059 (LyxCode): new method
4061 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4062 to get it right together with using the FloatList.
4064 * src/commandtags.h: add LFUN_INSET_CAPTION
4065 * src/lyxfunc.C (Dispatch): handle it
4067 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4070 * src/Variables.[Ch]: make expand take a const reference, remove
4071 the destructor, some whitespace changes.
4073 * src/LyXAction.C (init): add caption-inset-insert
4075 * src/FloatList.C (FloatList): update the default floats a bit.
4077 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4079 * src/Variables.[Ch]: new files. Intended to be used for language
4080 specific strings (like \chaptername) and filename substitution in
4083 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4085 * lib/kbd/american.kmap: update
4087 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4089 * src/bufferparams.[Ch]: remove member allowAccents.
4091 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4093 * src/LaTeXLog.C: use the log_form.h header.
4094 * src/lyx_gui.C: ditto.
4095 * src/lyx_gui_misc.C: ditto.
4096 * src/lyxvc.h: ditto.
4098 * forms/log_form.fd: new file, created from latexoptions.fd. I
4099 kept the log popup and nuked the options form.
4101 * src/{la,}texoptions.[Ch]: removed.
4102 * src/lyx_cb.C (LaTeXOptions): ditto
4104 * src/lyx_gui.C (create_forms): do not handle the
4105 fd_latex_options form.
4107 2000-07-18 Juergen Vigna <jug@sad.it>
4109 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4110 name of the inset so that it can be requested outside (text2.C).
4112 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4115 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4117 * src/mathed/formula.h (ConvertFont): constify
4119 * src/mathed/formula.C (Read): add warning if \end_inset is not
4120 found on expected place.
4122 * src/insets/lyxinset.h (ConvertFont): consify
4124 * src/insets/insetquotes.C (ConvertFont): constify
4125 * src/insets/insetquotes.h: ditto
4127 * src/insets/insetinfo.h: add labelfont
4129 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4130 (ascent): use labelfont
4134 (Write): make .lyx file a bit nicer
4136 * src/insets/insetfloat.C (Write): simplify somewhat...
4137 (Read): add warning if arg is not found
4139 * src/insets/insetcollapsable.C: add using std::max
4140 (Read): move string token and add warning in arg is not found
4141 (draw): use std::max to get the right ty
4142 (getMaxWidth): simplify by using std::max
4144 * src/insets/insetsection.h: new file
4145 * src/insets/insetsection.C: new file
4146 * src/insets/insetcaption.h: new file
4147 * src/insets/insetcaption.C: new file
4149 * src/insets/inset.C (ConvertFont): constify signature
4151 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4152 insetcaption.[Ch] and insetsection.[Ch]
4154 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4155 uses to use LABEL_COUNTER_CHAPTER instead.
4156 * src/text2.C (SetCounter): here
4158 * src/counters.h: new file
4159 * src/counters.C: new file
4160 * src/Sectioning.h: new file
4161 * src/Sectioning.C: new file
4163 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4165 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4167 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4170 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4173 2000-07-17 Juergen Vigna <jug@sad.it>
4175 * src/tabular.C (Validate): check if array-package is needed.
4176 (SetVAlignment): added support for vertical alignment.
4177 (SetLTFoot): better support for longtable header/footers
4178 (Latex): modified to support added features.
4180 * src/LaTeXFeatures.[Ch]: added array-package.
4182 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4184 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4187 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4189 * configure.in: do not forget to put a space after -isystem.
4191 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4193 * lib/kbd/arabic.kmap: a few fixes.
4195 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4197 * some whitespace chagnes to a number of files.
4199 * src/support/DebugStream.h: change to make it easier for
4200 doc++ to parse correctly.
4201 * src/support/lyxstring.h: ditto
4203 * src/mathed/math_utils.C (compara): change to have only one
4205 (MathedLookupBOP): change because of the above.
4207 * src/mathed/math_delim.C (math_deco_compare): change to have only
4209 (search_deco): change becasue of the above.
4211 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4212 instead of manually coded one.
4214 * src/insets/insetquotes.C (Read): read the \end_inset too
4216 * src/insets/insetlatex.h: remove file
4217 * src/insets/insetlatex.C: remove file
4219 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4221 (InsetPrintIndex): remove destructor
4223 * src/insets/insetinclude.h: remove default constructor
4225 * src/insets/insetfloat.C: work to make it work better
4227 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4229 * src/insets/insetcite.h (InsetCitation): remove default constructor
4231 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4233 * src/text.C (GetColumnNearX): comment out some currently unused code.
4235 * src/paragraph.C (writeFile): move some initializations closer to
4237 (CutIntoMinibuffer): small change to use new matchIT operator
4241 (InsertInset): ditto
4244 (InsetIterator): ditto
4245 (Erase): small change to use new matchFT operator
4247 (GetFontSettings): ditto
4248 (HighestFontInRange): ditto
4251 * src/lyxparagraph.h: some chars changed to value_type
4252 (matchIT): because of some stronger checking (perhaps too strong)
4253 in SGI STL, the two operator() unified to one.
4256 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4258 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4259 the last inset read added
4260 (parseSingleLyXformat2Token): some more (future) compability code added
4261 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4262 (parseSingleLyXformat2Token): set last_inset_read
4263 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4264 (parseSingleLyXformat2Token): don't double intializw string next_token
4266 * src/TextCache.C (text_fits::operator()): add const's to the signature
4267 (has_buffer::operator()): ditto
4269 * src/Floating.h: add some comments on the class
4271 * src/FloatList.[Ch] (typeExist): new method
4274 * src/BackStack.h: added default constructor, wanted by Gcc.
4276 2000-07-14 Juergen Vigna <jug@sad.it>
4278 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4280 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4282 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4283 do a redraw when the window is resized!
4284 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4286 * src/insets/insettext.C (resizeLyXText): added function to correctly
4287 being able to resize the LyXWindow.
4289 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4291 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4293 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4294 crashes when closing dialog to a deleted inset.
4296 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4297 method! Now similar to other insets.
4299 2000-07-13 Juergen Vigna <jug@sad.it>
4301 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4303 * lib/examples/Literate.lyx: small patch!
4305 * src/insets/insetbib.C (Read): added this function because of wrong
4306 Write (without [begin|end]_inset).
4308 2000-07-11 Juergen Vigna <jug@sad.it>
4310 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4311 as the insertInset could not be good!
4313 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4314 the bool param should not be last.
4316 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4318 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4319 did submit that to Karl).
4321 * configure.in: use -isystem instead of -I for X headers. This
4322 fixes a problem on solaris with a recent gcc;
4323 put the front-end code after the X detection code;
4324 configure in sigc++ before lib/
4326 * src/lyx_main.C (commandLineHelp): remove -display from command
4329 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4331 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4332 Also put in Makefile rules for building the ``listerrors''
4333 program for parsing errors from literate programs written in LyX.
4335 * lib/build-listerrors: Added small shell script as part of compile
4336 process. This builds a working ``listerrors'' binary if noweb is
4337 installed and either 1) the VNC X server is installed on the machine,
4338 or 2) the user is compiling from within a GUI. The existence of a GUI
4339 is necessary to use the ``lyx --export'' feature for now. This
4340 hack can be removed once ``lyx --export'' no longer requires a GUI to
4343 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4345 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4346 now passed back correctly from gcc and placed "under" error
4347 buttons in a Literate LyX source.
4349 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4351 * src/text.C (GetColumnNearX): Better behavior when a RTL
4352 paragraph is ended by LTR text.
4354 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4357 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4359 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4360 true when clipboard is empty.
4362 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4364 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4365 row of the paragraph.
4366 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4367 to prevent calculation of bidi tables
4369 2000-07-07 Juergen Vigna <jug@sad.it>
4371 * src/screen.C (ToggleSelection): added y_offset and x_offset
4374 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4377 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4379 * src/insets/insettext.C: fixed Layout-Display!
4381 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4383 * configure.in: add check for strings.h header.
4385 * src/spellchecker.C: include <strings.h> in order to have a
4386 definition for bzero().
4388 2000-07-07 Juergen Vigna <jug@sad.it>
4390 * src/insets/insettext.C (draw): set the status of the bv->text to
4391 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4393 * src/screen.C (DrawOneRow):
4394 (DrawFromTo): redraw the actual row if something has changed in it
4397 * src/text.C (draw): call an update of the toplevel-inset if something
4398 has changed inside while drawing.
4400 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4402 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4404 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4405 processing inside class.
4407 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4408 processing inside class.
4410 * src/insets/insetindex.h new struct Holder, consistent with other
4413 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4414 citation dialog from main code and placed it in src/frontends/xforms.
4415 Dialog launched through signals instead of callbacks
4417 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4419 * lyx.man: update the options description.
4421 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4423 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4424 handle neg values, set min width to 590, add doc about -display
4426 2000-07-05 Juergen Vigna <jug@sad.it>
4428 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4429 calls to BufferView *.
4431 * src/insets/insettext.C (checkAndActivateInset): small fix non
4432 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4434 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4435 their \end_inset token!
4437 2000-07-04 edscott <edscott@imp.mx>
4439 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4440 lib/lyxrc.example: added option \wheel_jump
4442 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4444 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4445 remove support for -width,-height,-xpos and -ypos.
4447 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4449 * src/encoding.[Ch]: New files.
4451 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4452 (text): Call to the underline() method only when needed.
4454 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4456 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4457 encoding(s) for the document.
4459 * src/bufferparams.C (BufferParams): Changed default value of
4462 * src/language.C (newLang): Removed.
4463 (items[]): Added encoding information for all defined languages.
4465 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4466 encoding choice button.
4468 * src/lyxrc.h (font_norm_type): New member variable.
4469 (set_font_norm_type): New method.
4471 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4472 paragraphs with different encodings.
4474 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4475 (TransformChar): Changed to work correctly with Arabic points.
4476 (draw): Added support for drawing Arabic points.
4477 (draw): Removed code for drawing underbars (this is done by
4480 * src/support/textutils.h (IsPrintableNonspace): New function.
4482 * src/BufferView_pimpl.h: Added "using SigC::Object".
4483 * src/LyXView.h: ditto.
4485 * src/insets/insetinclude.h (include_label): Changed to mutable.
4487 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4489 * src/mathed/math_iter.h: remove empty destructor
4491 * src/mathed/math_cursor.h: remove empty destructor
4493 * src/insets/lyxinset.h: add THEOREM_CODE
4495 * src/insets/insettheorem.[Ch]: new files
4497 * src/insets/insetminipage.C: (InsertInset): remove
4499 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4501 (InsertInset): remove
4503 * src/insets/insetlist.C: (InsertList): remove
4505 * src/insets/insetfootlike.[Ch]: new files
4507 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4510 (InsertInset): ditto
4512 * src/insets/insetert.C: remove include Painter.h, reindent
4513 (InsertInset): move to header
4515 * src/insets/insetcollapsable.h: remove explicit from default
4516 contructor, remove empty destructor, add InsertInset
4518 * src/insets/insetcollapsable.C (InsertInset): new func
4520 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4522 * src/vspace.h: add explicit to constructor
4524 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4525 \textcompwordmark, please test this.
4527 * src/lyxrc.C: set ascii_linelen to 65 by default
4529 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4531 * src/commandtags.h: add LFUN_INSET_THEOREM
4533 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4534 (makeLinuxDocFile): remove _some_ of the nice logic
4535 (makeDocBookFile): ditto
4537 * src/Painter.[Ch]: (~Painter): removed
4539 * src/LyXAction.C (init): entry for insettheorem added
4541 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4543 (deplog): code to detect files generated by LaTeX, needs testing
4546 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4548 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4550 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/LaTeX.C (deplog): Add a check for files that are going to be
4553 created by the first latex run, part of the project to remove the
4556 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4557 contents to the extension list.
4559 2000-07-04 Juergen Vigna <jug@sad.it>
4561 * src/text.C (NextBreakPoint): added support for needFullRow()
4563 * src/insets/lyxinset.h: added needFullRow()
4565 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4568 * src/insets/insettext.C: lots of changes for update!
4570 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4572 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4574 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4576 * src/insets/insetinclude.C (InsetInclude): fixed
4577 initialization of include_label.
4578 (unique_id): now returns a string.
4580 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4582 * src/LaTeXFeatures.h: new member IncludedFiles, for
4583 a map of key, included file name.
4585 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4586 with the included files for inclusion in SGML preamble,
4587 i. e., linuxdoc and docbook.
4590 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4591 nice (is the generated linuxdoc code to be exported?), that
4592 allows to remove column, and only_body that will be true for
4593 slave documents. Insets are allowed inside SGML font type.
4594 New handling of the SGML preamble for included files.
4595 (makeDocBookFile): the same for docbook.
4597 * src/insets/insetinclude.h:
4598 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4600 (DocBook): new export methods.
4602 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4603 and makeDocBookFile.
4605 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4606 formats to export with command line argument -x.
4608 2000-06-29 Juergen Vigna <jug@sad.it>
4610 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4611 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4613 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4614 region could already been cleared by an inset!
4616 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4618 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4621 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4623 (cursorToggle): remove special handling of lyx focus.
4625 2000-06-28 Juergen Vigna <jug@sad.it>
4627 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4630 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4632 * src/insets/insetindex.C (Edit): add a callback when popup is
4635 * src/insets/insettext.C (LocalDispatch):
4636 * src/insets/insetmarginal.h:
4637 * src/insets/insetlist.h:
4638 * src/insets/insetfoot.h:
4639 * src/insets/insetfloat.h:
4640 * src/insets/insetert.h: add a missing std:: qualifier.
4642 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4644 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4647 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4649 * src/insets/insettext.C (Read): remove tmptok unused variable
4650 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4651 (InsertInset): change for new InsetInset code
4653 * src/insets/insettext.h: add TEXT inline method
4655 * src/insets/insettext.C: remove TEXT macro
4657 * src/insets/insetmarginal.C (Write): new method
4658 (Latex): change output slightly
4660 * src/insets/insetfoot.C (Write): new method
4661 (Latex): change output slightly (don't use endl when no need)
4663 * src/insets/insetert.C (Write): new method
4665 * src/insets/insetcollapsable.h: make button_length, button_top_y
4666 and button_bottm_y protected.
4668 * src/insets/insetcollapsable.C (Write): simplify code by using
4669 tostr. Also do not output the float name, the children class
4670 should to that to get control over own arguments
4672 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4673 src/insets/insetminipage.[Ch]:
4676 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4678 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4680 * src/Makefile.am (lyx_SOURCES): add the new files
4682 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4683 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4684 * src/commandtags.h: ditto
4686 * src/LaTeXFeatures.h: add a std::set of used floattypes
4688 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4690 * src/FloatList.[Ch] src/Floating.h: new files
4692 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4694 * src/lyx_cb.C (TableApplyCB): ditto
4696 * src/text2.C: ditto
4697 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4698 (parseSingleLyXformat2Token): ditto + add code for
4699 backwards compability for old float styles + add code for new insets
4701 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4703 (InsertInset(size_type, Inset *, LyXFont)): new method
4704 (InsetChar(size_type, char)): changed to use the other InsetChar
4705 with a LyXFont(ALL_INHERIT).
4706 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4707 insert the META_INSET.
4709 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4711 * sigc++/thread.h (Threads): from here
4713 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4714 definition out of line
4715 * sigc++/scope.h: from here
4717 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4719 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4720 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4722 * Makefile.am (bindist): new target.
4724 * INSTALL: add instructions for doing a binary distribution.
4726 * development/tools/README.bin.example: update a bit.
4728 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4731 * lib/lyxrc.example: new lyxrc tag \set_color.
4733 * src/lyxfunc.C (Dispatch):
4734 * src/commandtags.h:
4735 * src/LyXAction.C: new lyxfunc "set-color".
4737 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4738 and an x11name given as strings.
4740 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4741 cache when a color is changed.
4743 2000-06-26 Juergen Vigna <jug@sad.it>
4745 * src/lyxrow.C (width): added this functions and variable.
4747 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4750 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4752 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4754 * images/undo_bw.xpm: new icon.
4755 * images/redo_bw.xpm: ditto.
4757 * configure.in (INSTALL_SCRIPT): change value to
4758 ${INSTALL} to avoid failures of install-script target.
4759 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4761 * src/BufferView.h: add a magic "friend" declaration to please
4764 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4766 * forms/cite.fd: modified to allow resizing without messing
4769 * src/insetcite.C: Uses code from cite.fd almost without
4771 User can now resize dialog in the x-direction.
4772 Resizing the dialog in the y-direction is prevented, as the
4773 code does this intelligently already.
4775 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4777 * INSTALL: remove obsolete entry in "problems" section.
4779 * lib/examples/sl_*.lyx: update of the slovenian examples.
4781 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4783 2000-06-23 Juergen Vigna <jug@sad.it>
4785 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4787 * src/buffer.C (resize): delete the LyXText of textinsets.
4789 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4791 * src/insets/lyxinset.h: added another parameter 'cleared' to
4792 the draw() function.
4794 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4795 unlocking inset in inset.
4797 2000-06-22 Juergen Vigna <jug@sad.it>
4799 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4800 of insets and moved first to LyXText.
4802 * src/mathed/formulamacro.[Ch]:
4803 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4805 2000-06-21 Juergen Vigna <jug@sad.it>
4807 * src/text.C (GetVisibleRow): look if I should clear the area or not
4808 using Inset::doClearArea() function.
4810 * src/insets/lyxinset.h: added doClearArea() function and
4811 modified draw(Painter &, ...) to draw(BufferView *, ...)
4813 * src/text2.C (UpdateInset): return bool insted of int
4815 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4817 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4818 combox in the character popup
4820 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4821 BufferParams const & params
4823 2000-06-20 Juergen Vigna <jug@sad.it>
4825 * src/insets/insettext.C (SetParagraphData): set insetowner on
4828 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4830 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4831 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4833 (form_main_): remove
4835 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4836 (create_form_form_main): remove FD_form_main stuff, connect to
4837 autosave_timeout signal
4839 * src/LyXView.[Ch] (getMainForm): remove
4840 (UpdateTimerCB): remove
4841 * src/BufferView_pimpl.h: inherit from SigC::Object
4843 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4844 signal instead of callback
4846 * src/BufferView.[Ch] (cursorToggleCB): remove
4848 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4850 * src/BufferView_pimpl.C: changes because of the one below
4852 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4853 instead of storing a pointer to a LyXText.
4855 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4857 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4859 * src/lyxparagraph.h
4861 * src/paragraph.C: Changed fontlist to a sorted vector.
4863 2000-06-19 Juergen Vigna <jug@sad.it>
4865 * src/BufferView.h: added screen() function.
4867 * src/insets/insettext.C (LocalDispatch): some selection code
4870 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4872 * src/insets/insettext.C (SetParagraphData):
4874 (InsetText): fixes for multiple paragraphs.
4876 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4878 * development/lyx.spec.in: Call configure with ``--without-warnings''
4879 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4880 This should be fine, however, since we generally don't want to be
4881 verbose when making an RPM.
4883 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4885 * lib/scripts/fig2pstex.py: New file
4887 2000-06-16 Juergen Vigna <jug@sad.it>
4889 * src/insets/insettabular.C (UpdateLocal):
4890 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4891 (LocalDispatch): Changed all functions to use LyXText.
4893 2000-06-15 Juergen Vigna <jug@sad.it>
4895 * src/text.C (SetHeightOfRow): call inset::update before requesting
4898 * src/insets/insettext.C (update):
4899 * src/insets/insettabular.C (update): added implementation
4901 * src/insets/lyxinset.h: added update function
4903 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4905 * src/text.C (SelectNextWord): protect against null pointers with
4906 old-style string streams. (fix from Paul Theo Gonciari
4909 * src/cite.[Ch]: remove erroneous files.
4911 * lib/configure.m4: update the list of created directories.
4913 * src/lyxrow.C: include <config.h>
4914 * src/lyxcursor.C: ditto.
4916 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4918 * lib/examples/decimal.lyx: new example file from Mike.
4920 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4921 to find template definitions (from Dekel)
4923 * src/frontends/.cvsignore: add a few things.
4925 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4927 * src/Timeout.C (TimeOut): remove default argument.
4929 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4932 * src/insets/ExternalTemplate.C: add a "using" directive.
4934 * src/lyx_main.h: remove the act_ struct, which seems unused
4937 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4939 * LyX Developers Meeting: All files changed, due to random C++ (by
4940 coincidence) code generator script.
4942 - external inset (cool!)
4943 - initial online editing of preferences
4944 - insettabular breaks insettext(s contents)
4946 - some DocBook fixes
4947 - example files update
4948 - other cool stuff, create a diff and look for yourself.
4950 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4952 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4953 -1 this is a non-line-breaking textinset.
4955 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4956 if there is no width set.
4958 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4960 * Lots of files: Merged the dialogbase branch.
4962 2000-06-09 Allan Rae <rae@lyx.org>
4964 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4965 and the Dispatch methods that used it.
4967 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4968 access to functions formerly kept in Dispatch.
4970 2000-05-19 Allan Rae <rae@lyx.org>
4972 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4973 made to_page and count_copies integers again. from_page remains a
4974 string however because I want to allow entry of a print range like
4975 "1,4,22-25" using this field.
4977 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4978 and printer-params-get. These aren't useful from the minibuffer but
4979 could be used by a script/LyXServer app provided it passes a suitable
4980 auto_mem_buffer. I guess I should take a look at how the LyXServer
4981 works and make it support xtl buffers.
4983 * sigc++/: updated to libsigc++-1.0.1
4985 * src/xtl/: updated to xtl-1.3.pl.11
4987 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4988 those changes done to the files in src/ are actually recreated when
4989 they get regenerated. Please don't ever accept a patch that changes a
4990 dialog unless that patch includes the changes to the corresponding *.fd
4993 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4994 stringOnlyContains, renamed it and generalised it.
4996 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4997 branch. Removed the remaining old form_print code.
4999 2000-04-26 Allan Rae <rae@lyx.org>
5001 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5002 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5004 2000-04-25 Allan Rae <rae@lyx.org>
5006 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5007 against a base of xtl-1.3.pl.4
5009 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5010 filter the Id: entries so they still show the xtl version number
5013 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5014 into the src/xtl code. Patch still pending with José (XTL)
5016 2000-04-24 Allan Rae <rae@lyx.org>
5018 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5019 both more generic and much safer. Use the new template functions.
5020 * src/buffer.[Ch] (Dispatch): ditto.
5022 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5023 and mem buffer more intelligently. Also a little general cleanup.
5026 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5027 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5028 * src/xtl/Makefile.am: ditto.
5029 * src/xtl/.cvsignore: ditto.
5030 * src/Makefile.am: ditto.
5032 * src/PrinterParams.h: Removed the macros member functions. Added a
5033 testInvariant member function. A bit of tidying up and commenting.
5034 Included Angus's idea for fixing operation with egcs-1.1.2.
5036 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5037 cool expansion of XTL's mem_buffer to support automatic memory
5038 management within the buffer itself. Removed the various macros and
5039 replaced them with template functions that use either auto_mem_buffer
5040 or mem_buffer depending on a #define. The mem_buffer support will
5041 disappear as soon as the auto_mem_buffer is confirmed to be good on
5042 other platforms/compilers. That is, it's there so you've got something
5045 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5046 effectively forked XTL. However I expect José will include my code
5047 into the next major release. Also fixed a memory leak.
5048 * src/xtl/text.h: ditto.
5049 * src/xtl/xdr.h: ditto.
5050 * src/xtl/giop.h: ditto.
5052 2000-04-16 Allan Rae <rae@lyx.org>
5054 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5055 by autogen.sh and removed by maintainer-clean anyway.
5056 * .cvsignore, sigc++/.cvsignore: Support the above.
5058 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5060 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5062 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5063 macros, renamed static callback-target member functions to suit new
5064 scheme and made them public.
5065 * src/frontends/xforms/forms/form_print.fd: ditto.
5066 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5068 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5071 * src/xtl/: New directory containing a minimal distribution of XTL.
5072 This is XTL-1.3.pl.4.
5074 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5076 2000-04-15 Allan Rae <rae@lyx.org>
5078 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5080 * sigc++/: Updated to libsigc++-1.0.0
5082 2000-04-14 Allan Rae <rae@lyx.org>
5084 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5085 use the generic ones in future. I'll modify my conversion script.
5087 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5089 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5090 (CloseAllBufferRelatedDialogs): Renamed.
5091 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5093 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5094 of the generic ones. These are the same ones my conversion script
5097 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5098 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5099 * src/buffer.C (Dispatch): ditto
5101 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5102 functions for updating and hiding buffer dependent dialogs.
5103 * src/BufferView.C (buffer): ditto
5104 * src/buffer.C (setReadonly): ditto
5105 * src/lyxfunc.C (CloseBuffer): ditto
5107 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5108 Dialogs.h, and hence all the SigC stuff, into every file that includes
5109 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5111 * src/BufferView2.C: reduce the number of headers included by buffer.h
5113 2000-04-11 Allan Rae <rae@lyx.org>
5115 * src/frontends/xforms/xform_macros.h: A small collection of macros
5116 for building C callbacks.
5118 * src/frontends/xforms/Makefile.am: Added above file.
5120 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5121 scheme again. This time it should work for JMarc. If this is
5122 successful I'll revise my conversion script to automate some of this.
5123 The static member functions in the class also have to be public for
5124 this scheme will work. If the scheme works (it's almost identical to
5125 the way BufferView::cursorToggleCB is handled so it should work) then
5126 FormCopyright and FormPrint will be ready for inclusion into the main
5127 trunk immediately after 1.1.5 is released -- provided we're prepared
5128 for complaints about lame compilers not handling XTL.
5130 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5132 2000-04-07 Allan Rae <rae@lyx.org>
5134 * config/lyxinclude.m4: A bit more tidying up (Angus)
5136 * src/LString.h: JMarc's <string> header fix
5138 * src/PrinterParams.h: Used string for most data to remove some
5139 ugly code in the Print dialog and avoid even uglier code when
5140 appending the ints to a string for output.
5142 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5143 and moved "default:" back to the end of switch statement. Cleaned
5144 up the printing so it uses the right function calls and so the
5145 "print to file" option actually puts the file in the right directory.
5147 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5149 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5150 and Ok+Apply button control into a separate method: input (Angus).
5151 (input) Cleaned it up and improved it to be very thorough now.
5152 (All CB) static_cast used instead of C style cast (Angus). This will
5153 probably change again once we've worked out how to keep gcc-2.8.1 happy
5154 with real C callbacks.
5155 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5156 ignore some of the bool settings and has random numbers instead. Needs
5157 some more investigation. Added other input length checks and checking
5158 of file and printer names.
5160 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5161 would link (Angus). Seems the old code doesn't compile with the pragma
5162 statement either. Separated callback entries from internal methods.
5164 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5166 2000-03-17 Allan Rae <rae@lyx.org>
5168 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5169 need it? Maybe it could go in Dialogs instead? I could make it a
5170 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5171 values to get the bool return value.
5172 (Dispatch): New overloaded method for xtl support.
5174 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5175 extern "C" callback instead of static member functions. Hopefully,
5176 JMarc will be able to compile this. I haven't changed
5177 forms/form_copyright.fd yet. Breaking one of my own rules already.
5179 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5180 because they aren't useful from the minibuffer. Maybe a LyXServer
5181 might want a help message though?
5183 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5185 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5186 xtl which needs both rtti and exceptions.
5188 * src/support/Makefile.am:
5189 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5191 * src/frontends/xforms/input_validators.[ch]: input filters and
5192 validators. These conrol what keys are valid in input boxes.
5193 Use them and write some more. Much better idea than waiting till
5194 after the user has pressed Ok to say that the input fields don't make
5197 * src/frontends/xforms/Makefile.am:
5198 * src/frontends/xforms/forms/form_print.fd:
5199 * src/frontends/xforms/forms/makefile:
5200 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5201 new scheme. Still have to make sure I haven't missed anything from
5202 the current implementation.
5204 * src/Makefile.am, src/PrinterParams.h: New data store.
5206 * other files: Added a couple of copyright notices.
5208 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5210 * src/insets/insetbib.h: move Holder struct in public space.
5212 * src/frontends/include/DialogBase.h: use SigC:: only when
5213 SIGC_CXX_NAMESPACES is defined.
5214 * src/frontends/include/Dialogs.h: ditto.
5216 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5218 * src/frontends/xforms/FormCopyright.[Ch]: do not
5219 mention SigC:: explicitely.
5221 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5223 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5224 deals with testing KDE in main configure.in
5225 * configure.in: ditto.
5227 2000-02-22 Allan Rae <rae@lyx.org>
5229 * Lots of files: Merged from HEAD
5231 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5232 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5234 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5236 * sigc++/: new minidist.
5238 2000-02-14 Allan Rae <rae@lyx.org>
5240 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5242 2000-02-08 Juergen Vigna <jug@sad.it>
5244 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5245 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5247 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5248 for this port and so it is much easier for other people to port
5249 dialogs in a common development environment.
5251 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5252 the QT/KDE implementation.
5254 * src/frontends/kde/Dialogs.C:
5255 * src/frontends/kde/FormCopyright.C:
5256 * src/frontends/kde/FormCopyright.h:
5257 * src/frontends/kde/Makefile.am:
5258 * src/frontends/kde/formcopyrightdialog.C:
5259 * src/frontends/kde/formcopyrightdialog.h:
5260 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5261 for the kde support of the Copyright-Dialog.
5263 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5264 subdir-substitution instead of hardcoded 'xforms' as we now have also
5267 * src/frontends/include/DialogBase.h (Object): just commented the
5268 label after #endif (nasty warning and I don't like warnings ;)
5270 * src/main.C (main): added KApplication initialization if using
5273 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5274 For now only the KDE event-loop is added if frontend==kde.
5276 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5278 * configure.in: added support for the --with-frontend[=value] option
5280 * autogen.sh: added kde.m4 file to list of config-files
5282 * acconfig.h: added define for KDEGUI-support
5284 * config/kde.m4: added configuration functions for KDE-port
5286 * config/lyxinclude.m4: added --with-frontend[=value] option with
5287 support for xforms and KDE.
5289 2000-02-08 Allan Rae <rae@lyx.org>
5291 * all Makefile.am: Fixed up so the make targets dist, distclean,
5292 install and uninstall all work even if builddir != srcdir. Still
5293 have a new sigc++ minidist update to come.
5295 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5297 2000-02-01 Allan Rae <rae@lyx.org>
5299 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5300 Many mods to get builddir != srcdir working.
5302 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5303 for building on NT and so we can do the builddir != srcdir stuff.
5305 2000-01-30 Allan Rae <rae@lyx.org>
5307 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5308 This will stay in "rae" branch. We probably don't really need it in
5309 the main trunk as anyone who wants to help programming it should get
5310 a full library installed also. So they can check both included and
5311 system supplied library compilation.
5313 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5314 Added a 'mini' distribution of libsigc++. If you feel the urge to
5315 change something in these directories - Resist it. If you can't
5316 resist the urge then you should modify the following script and rebuild
5317 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5318 all happen. Still uses a hacked version of libsigc++'s configure.in.
5319 I'm quite happy with the results. I'm not sure the extra work to turn
5320 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5321 worth the trouble and would probably lead to extra maintenance
5323 I haven't tested the following important make targets: install, dist.
5324 Not ready for prime time but very close. Maybe 1.1.5.
5326 * development/tools/makeLyXsigc.sh: A shell script to automatically
5327 generate our mini-dist of libsigc++. It can only be used with a CVS
5328 checkout of libsigc++ not a tarball distribution. It's well commented.
5329 This will end up as part of the libsigc++ distribution so other apps
5330 can easily have an included mini-dist. If someone makes mods to the
5331 sigc++ subpackage without modifying this script to generate those
5332 changes I'll be very upset!
5334 * src/frontends/: Started the gui/system indep structure.
5336 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5337 to access the gui-indep dialogs are in this class. Much improved
5338 design compared to previous revision. Lars, please refrain from
5339 moving this header into src/ like you did with Popups.h last time.
5341 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5343 * src/frontends/xforms/: Started the gui-indep system with a single
5344 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5347 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5348 Here you'll find a very useful makefile and automated fdfix.sh that
5349 makes updating dailogs a no-brainer -- provided you follow the rules
5350 set out in the README. I'm thinking about adding another script to
5351 automatically generate skeleton code for a new dialog given just the
5354 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5355 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5356 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5358 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5360 * src/support/LSubstring.C (operator): simplify
5362 * src/lyxtext.h: removed bparams, use buffer_->params instead
5364 * src/lyxrow.h: make Row a real class, move all variables to
5365 private and use accessors.
5367 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5369 (isRightToLeftPar): ditto
5370 (ChangeLanguage): ditto
5371 (isMultiLingual): ditto
5374 (SimpleTeXOnePar): ditto
5375 (TeXEnvironment): ditto
5376 (GetEndLabel): ditto
5378 (SetOnlyLayout): ditto
5379 (BreakParagraph): ditto
5380 (BreakParagraphConservative): ditto
5381 (GetFontSettings): ditto
5383 (CopyIntoMinibuffer): ditto
5384 (CutIntoMinibuffer): ditto
5385 (PasteParagraph): ditto
5386 (SetPExtraType): ditto
5387 (UnsetPExtraType): ditto
5388 (DocBookContTableRows): ditto
5389 (SimpleDocBookOneTablePar): ditto
5391 (TeXFootnote): ditto
5392 (SimpleTeXOneTablePar): ditto
5393 (TeXContTableRows): ditto
5394 (SimpleTeXSpecialChars): ditto
5397 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5398 to private and use accessors.
5400 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5401 this, we did not use it anymore and has not been for ages. Just a
5402 waste of cpu cycles.
5404 * src/language.h: make Language a real class, move all variables
5405 to private and use accessors.
5407 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5408 (create_view): remove
5409 (update): some changes for new timer
5410 (cursorToggle): use new timer
5411 (beforeChange): change for new timer
5413 * src/BufferView.h (cursorToggleCB): removed last paramter because
5416 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5417 (cursorToggleCB): change because of new timer code
5419 * lib/CREDITS: updated own mailaddress
5421 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5423 * src/support/filetools.C (PutEnv): fix the code in case neither
5424 putenv() nor setenv() have been found.
5426 * INSTALL: mention the install-strip Makefile target.
5428 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5429 read-only documents.
5431 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5433 * lib/reLyX/configure.in (VERSION): avoid using a previously
5434 generated reLyX wrapper to find out $prefix.
5436 * lib/examples/eu_adibide_lyx-atua.lyx:
5437 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5438 translation of the Tutorial (Dooteo)
5440 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5442 * forms/cite.fd: new citation dialog
5444 * src/insetcite.[Ch]: the new citation dialog is moved into
5447 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5450 * src/insets/insetcommand.h: data members made private.
5452 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5454 * LyX 1.1.5 released
5456 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5458 * src/version.h (LYX_RELEASE): to 1.1.5
5460 * src/spellchecker.C (RunSpellChecker): return false if the
5461 spellchecker dies upon creation.
5463 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5465 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5466 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5470 * lib/CREDITS: update entry for Martin Vermeer.
5472 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5474 * src/text.C (draw): Draw foreign language bars at the bottom of
5475 the row instead of at the baseline.
5477 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5479 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5481 * lib/bind/de_menus.bind: updated
5483 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5485 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5487 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5489 * src/menus.C (Limit_string_length): New function
5490 (ShowTocMenu): Limit the number of items/length of items in the
5493 * src/paragraph.C (String): Correct result for a paragraph inside
5496 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5498 * src/bufferlist.C (close): test of buf->getuser() == NULL
5500 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5502 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5503 Do not call to SetCursor when the paragraph is a closed footnote!
5505 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5507 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5510 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5512 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5515 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5516 reference popup, that activates the reference-back action
5518 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5520 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5521 the menus. Also fixed a bug.
5523 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5524 the math panels when switching buffers (unless new buffer is readonly).
5526 * src/BufferView.C (NoSavedPositions)
5527 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5529 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5531 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5532 less of dvi dirty or not.
5534 * src/trans_mgr.[Ch] (insert): change first parameter to string
5537 * src/chset.[Ch] (encodeString): add const to first parameter
5539 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5541 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5545 * src/LaTeX.C (deplog): better searching for dependency files in
5546 the latex log. Uses now regexps.
5548 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5549 instead of the box hack or \hfill.
5551 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5553 * src/lyxfunc.C (doImportHelper): do not create the file before
5554 doing the actual import.
5555 (doImportASCIIasLines): create a new file before doing the insert.
5556 (doImportASCIIasParagraphs): ditto.
5558 * lib/lyxrc.example: remove mention of non-existing commands
5560 * lyx.man: remove mention of color-related switches.
5562 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5564 * src/lyx_gui.C: remove all the color-related ressources, which
5565 are not used anymore.
5567 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5570 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5572 * src/lyxrc.C (read): Add a missing break in the switch
5574 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5576 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5578 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5581 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5583 * src/text.C (draw): draw bars under foreign language words.
5585 * src/LColor.[Ch]: add LColor::language
5587 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5589 * src/lyxcursor.h (boundary): New member variable
5591 * src/text.C (IsBoundary): New methods
5593 * src/text.C: Use the above for currect cursor movement when there
5594 is both RTL & LTR text.
5596 * src/text2.C: ditto
5598 * src/bufferview_funcs.C (ToggleAndShow): ditto
5600 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5602 * src/text.C (DeleteLineForward): set selection to true to avoid
5603 that DeleteEmptyParagraphMechanism does some magic. This is how it
5604 is done in all other functions, and seems reasonable.
5605 (DeleteWordForward): do not jump over non-word stuff, since
5606 CursorRightOneWord() already does it.
5608 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5609 DeleteWordBackward, since they seem safe to me (since selection is
5610 set to "true") DeleteEmptyParagraphMechanism does nothing.
5612 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5614 * src/lyx_main.C (easyParse): simplify the code by factoring the
5615 part that removes parameters from the command line.
5616 (LyX): check wether wrong command line options have been given.
5618 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5620 * src/lyx_main.C : add support for specifying user LyX
5621 directory via command line option -userdir.
5623 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5625 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5626 the number of items per popup.
5627 (Add_to_refs_menu): Ditto.
5629 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5631 * src/lyxparagraph.h: renamed ClearParagraph() to
5632 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5633 textclass as parameter, and do nothing if free_spacing is
5634 true. This fixes part of the line-delete-forward problems.
5636 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5637 (pasteSelection): ditto.
5638 (SwitchLayoutsBetweenClasses): more translatable strings.
5640 * src/text2.C (CutSelection): use StripLeadingSpaces.
5641 (PasteSelection): ditto.
5642 (DeleteEmptyParagraphMechanism): ditto.
5644 2000-05-26 Juergen Vigna <jug@sad.it>
5646 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5647 is not needed in tabular insets.
5649 * src/insets/insettabular.C (TabularFeatures): added missing features.
5651 * src/tabular.C (DeleteColumn):
5653 (AppendRow): implemented this functions
5654 (cellsturct::operator=): clone the inset too;
5656 2000-05-23 Juergen Vigna <jug@sad.it>
5658 * src/insets/insettabular.C (LocalDispatch): better selection support
5659 when having multicolumn-cells.
5661 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5663 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5665 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5667 * src/ColorHandler.C (getGCForeground): put more test into _()
5669 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5672 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5675 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5677 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5678 there are no labels, or when buffer is readonly.
5680 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5681 there are no labels, buffer is SGML, or when buffer is readonly.
5683 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5685 * src/LColor.C (LColor): change a couple of grey40 to grey60
5686 (LColor): rewore initalization to make compiles go some magnitude
5688 (getGUIName): don't use gettext until we need the string.
5690 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5692 * src/Bullet.[Ch]: Fixed a small bug.
5694 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5696 * src/paragraph.C (String): Several fixes/improvements
5698 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5700 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5702 * src/paragraph.C (String): give more correct output.
5704 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5706 * src/lyxfont.C (stateText) Do not output the language if it is
5707 eqaul to the language of the document.
5709 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5710 between two paragraphs with the same language.
5712 * src/paragraph.C (getParLanguage) Return a correct answer for an
5713 empty dummy paragraph.
5715 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5718 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5721 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5722 the menus/popup, if requested fonts are unavailable.
5724 2000-05-22 Juergen Vigna <jug@sad.it>
5726 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5727 movement support (Up/Down/Tab/Shift-Tab).
5728 (LocalDispatch): added also preliminari cursor-selection.
5730 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5732 * src/paragraph.C (PasteParagraph): Hopefully now right!
5734 2000-05-22 Garst R. Reese <reese@isn.net>
5736 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5737 of list, change all references to Environment to Command
5738 * tex/hollywood.cls : rewrite environments as commands, add
5739 \uppercase to interiorshot and exteriorshot to force uppecase.
5740 * tex/broadway.cls : rewrite environments as commands. Tweak
5743 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5745 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5746 size of items: use a constant intead of the hardcoded 40, and more
5747 importantly do not remove the %m and %x tags added at the end.
5748 (Add_to_refs_menu): use vector::size_type instead of
5749 unsigned int as basic types for the variables. _Please_ do not
5750 assume that size_t is equal to unsigned int. On an alpha, this is
5751 unsigned long, which is _not_ the same.
5753 * src/language.C (initL): remove language "hungarian", since it
5754 seems that "magyar" is better.
5756 2000-05-22 Juergen Vigna <jug@sad.it>
5758 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5760 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5763 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5764 next was deleted but not set to 0.
5766 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/language.C (initL): change the initialization of languages
5769 so that compiles goes _fast_.
5771 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5774 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5776 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5780 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5782 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5784 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5788 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5791 * src/insets/insetlo*.[Ch]: Made editable
5793 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5795 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5796 the current selection.
5798 * src/BufferView_pimpl.C (stuffClipboard): new method
5800 * src/BufferView.C (stuffClipboard): new method
5802 * src/paragraph.C (String): new method
5804 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5805 LColor::ignore when lyxname is not found.
5807 * src/BufferView.C (pasteSelection): new method
5809 * src/BufferView_pimpl.C (pasteSelection): new method
5811 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5813 * src/WorkArea.C (request_clipboard_cb): new static function
5814 (getClipboard): new method
5815 (putClipboard): new method
5817 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5819 * LyX 1.1.5pre2 released
5821 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5823 * src/vspace.C (operator=): removed
5824 (operator=): removed
5826 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5828 * src/layout.C (NumberOfClass): manually set the type in make_pair
5829 (NumberOfLayout): ditto
5831 * src/language.C: use the Language constructor for ignore_lang
5833 * src/language.h: add constructors to struct Language
5835 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5837 * src/text2.C (SetCursorIntern): comment out #warning
5839 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5841 * src/mathed/math_iter.h: initialize sx and sw to 0
5843 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5845 * forms/lyx.fd: Redesign of form_ref
5847 * src/LaTeXFeatures.[Ch]
5851 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5854 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5855 and Buffer::inset_iterator.
5857 * src/menus.C: Added new menus: TOC and Refs.
5859 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5861 * src/buffer.C (getTocList): New method.
5863 * src/BufferView2.C (ChangeRefs): New method.
5865 * src/buffer.C (getLabelList): New method. It replaces the old
5866 getReferenceList. The return type is vector<string> instead of
5869 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5870 the old getLabel() and GetNumberOfLabels() methods.
5871 * src/insets/insetlabel.C (getLabelList): ditto
5872 * src/mathed/formula.C (getLabelList): ditto
5874 * src/paragraph.C (String): New method.
5876 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5877 Uses the new getTocList() method.
5878 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5879 which automatically updates the contents of the browser.
5880 (RefUpdateCB): Use the new getLabelList method.
5882 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5884 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5886 * src/spellchecker.C: Added using std::reverse;
5888 2000-05-19 Juergen Vigna <jug@sad.it>
5890 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5892 * src/insets/insettext.C (computeTextRows): small fix for display of
5893 1 character after a newline.
5895 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5898 2000-05-18 Juergen Vigna <jug@sad.it>
5900 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5901 when changing width of column.
5903 * src/tabular.C (set_row_column_number_info): setting of
5904 autobreak rows if necessary.
5906 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5908 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5910 * src/vc-backend.*: renamed stat() to status() and vcstat to
5911 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5912 compilation broke. The new name seems more relevant, anyway.
5914 2000-05-17 Juergen Vigna <jug@sad.it>
5916 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5917 which was wrong if the removing caused removing of rows!
5919 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5920 (pushToken): new function.
5922 * src/text2.C (CutSelection): fix problem discovered with purify
5924 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5926 * src/debug.C (showTags): enlarge the first column, now that we
5927 have 6-digits debug codes.
5929 * lib/layouts/hollywood.layout:
5930 * lib/tex/hollywood.cls:
5931 * lib/tex/brodway.cls:
5932 * lib/layouts/brodway.layout: more commands and fewer
5933 environments. Preambles moved in the .cls files. Broadway now has
5934 more options on scene numbering and less whitespace (from Garst)
5936 * src/insets/insetbib.C (getKeys): make sure that we are in the
5937 document directory, in case the bib file is there.
5939 * src/insets/insetbib.C (Latex): revert bogus change.
5941 2000-05-16 Juergen Vigna <jug@sad.it>
5943 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5944 the TabularLayout on cursor move.
5946 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5948 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5951 (draw): fixed cursor position and drawing so that the cursor is
5952 visible when before the tabular-inset.
5954 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5955 when creating from old insettext.
5957 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5959 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5961 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5962 * lib/tex/brodway.cls: ditto
5964 * lib/layouts/brodway.layout: change alignment of parenthical
5967 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5969 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5970 versions 0.88 and 0.89 are supported.
5972 2000-05-15 Juergen Vigna <jug@sad.it>
5974 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5977 * src/insets/insettext.C (computeTextRows): redone completely this
5978 function in a much cleaner way, because of problems when having a
5980 (draw): added a frame border when the inset is locked.
5981 (SetDrawLockedFrame): this sets if we draw the border or not.
5982 (SetFrameColor): this sets the frame color (default=insetframe).
5984 * src/insets/lyxinset.h: added x() and y() functions which return
5985 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5986 function which is needed to see if we have a locking inset of some
5987 type in this inset (needed for now in insettabular).
5989 * src/vspace.C (inPixels): the same function also without a BufferView
5990 parameter as so it is easier to use it in some ocasions.
5992 * src/lyxfunc.C: changed all places where insertInset was used so
5993 that now if it couldn't be inserted it is deleted!
5995 * src/TabularLayout.C:
5996 * src/TableLayout.C: added support for new tabular-inset!
5998 * src/BufferView2.C (insertInset): this now returns a bool if the
5999 inset was really inserted!!!
6001 * src/tabular.C (GetLastCellInRow):
6002 (GetFirstCellInRow): new helper functions.
6003 (Latex): implemented for new tabular class.
6007 (TeXTopHLine): new Latex() helper functions.
6009 2000-05-12 Juergen Vigna <jug@sad.it>
6011 * src/mathed/formulamacro.C (Read):
6012 * src/mathed/formula.C (Read): read also the \end_inset here!
6014 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6016 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6017 crush when saving formulae with unbalanced parenthesis.
6019 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6021 * src/layout.C: Add new keyword "endlabelstring" to layout file
6023 * src/text.C (GetVisibleRow): Draw endlabel string.
6025 * lib/layouts/broadway.layout
6026 * lib/layouts/hollywood.layout: Added endlabel for the
6027 Parenthetical layout.
6029 * lib/layouts/heb-article.layout: Do not use slanted font shape
6030 for Theorem like environments.
6032 * src/buffer.C (makeLaTeXFile): Always add "american" to
6033 the UsedLanguages list if document language is RTL.
6035 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6037 * add addendum to README.OS2 and small patch (from SMiyata)
6039 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6041 * many files: correct the calls to ChangeExtension().
6043 * src/support/filetools.C (ChangeExtension): remove the no_path
6044 argument, which does not belong there. Use OnlyFileName() instead.
6046 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6047 files when LaTeXing a non-nice latex file.
6049 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6050 a chain of "if". Return false when deadkeys are not handled.
6052 * src/lyx_main.C (LyX): adapted the code for default bindings.
6054 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6055 bindings for basic functionality (except deadkeys).
6056 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6058 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6059 several methods: handle override_x_deadkeys.
6061 * src/lyxrc.h: remove the "bindings" map, which did not make much
6062 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6064 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6066 * src/lyxfont.C (stateText): use a saner method to determine
6067 whether the font is "default". Seems to fix the crash with DEC
6070 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6072 2000-05-08 Juergen Vigna <jug@sad.it>
6074 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6075 TabularLayoutMenu with mouse-button-3
6076 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6078 * src/TabularLayout.C: added this file for having a Layout for
6081 2000-05-05 Juergen Vigna <jug@sad.it>
6083 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6084 recalculating inset-widths.
6085 (TabularFeatures): activated this function so that I can change
6086 tabular-features via menu.
6088 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6089 that I can test some functions with the Table menu.
6091 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6093 * src/lyxfont.C (stateText): guard against stupid c++libs.
6095 * src/tabular.C: add using std::vector
6096 some whitespace changes, + removed som autogenerated code.
6098 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6100 2000-05-05 Juergen Vigna <jug@sad.it>
6102 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6103 row, columns and cellstructures.
6105 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6107 * lib/lyxrc.example: remove obsolete entries.
6109 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6110 reading of protected_separator for free_spacing.
6112 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6114 * src/text.C (draw): do not display an exclamation mark in the
6115 margin for margin notes. This is confusing, ugly and
6118 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6119 AMS math' is checked.
6121 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6122 name to see whether including the amsmath package is needed.
6124 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6126 * src/paragraph.C (validate): Compute UsedLanguages correctly
6127 (don't insert the american language if it doesn't appear in the
6130 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6131 The argument of \thanks{} command is considered moving argument
6133 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6136 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6138 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6139 for appendix/minipage/depth. The lines can be now both in the footnote
6140 frame, and outside the frame.
6142 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6145 2000-05-05 Juergen Vigna <jug@sad.it>
6147 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6148 neede only in tabular.[Ch].
6150 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6152 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6154 (Write): write '~' for PROTECTED_SEPARATOR
6156 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6158 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6161 * src/mathed/formula.C (drawStr): rename size to siz.
6163 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6164 possibly fix a bug by not changing the pflags = flags to piflags =
6167 2000-05-05 Juergen Vigna <jug@sad.it>
6169 * src/insets/insetbib.C: moved using directive
6171 * src/ImportNoweb.C: small fix for being able to compile (missing
6174 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6176 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6177 to use clear, since we don't depend on this in the code. Add test
6180 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6182 * (various *.C files): add using std::foo directives to please dec
6185 * replace calls to string::clear() to string::erase() (Angus)
6187 * src/cheaders/cmath: modified to provide std::abs.
6189 2000-05-04 Juergen Vigna <jug@sad.it>
6191 * src/insets/insettext.C: Prepared all for inserting of multiple
6192 paragraphs. Still display stuff to do (alignment and other things),
6193 but I would like to use LyXText to do this when we cleaned out the
6194 table-support stuff.
6196 * src/insets/insettabular.C: Changed lot of stuff and added lots
6197 of functionality still a lot to do.
6199 * src/tabular.C: Various functions changed name and moved to be
6200 const functions. Added new Read and Write functions and changed
6201 lots of things so it works good with tabular-insets (also removed
6202 some stuff which is not needed anymore * hacks *).
6204 * src/lyxcursor.h: added operators == and != which just look if
6205 par and pos are (not) equal.
6207 * src/buffer.C (latexParagraphs): inserted this function to latex
6208 all paragraphs form par to endpar as then I can use this too for
6211 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6212 so that I can call this to from text insets with their own cursor.
6214 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6215 output off all paragraphs (because of the fix below)!
6217 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6218 the very last paragraph (this could be also the last paragraph of an
6221 * src/texrow.h: added rows() call which returns the count-variable.
6223 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6225 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6227 * lib/configure.m4: better autodetection of DocBook tools.
6229 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6231 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6233 * src/lyx_cb.C: add using std::reverse;
6235 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6238 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6239 selected files. Should fix repeated errors from generated files.
6241 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6243 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6245 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6246 the spellchecker popup.
6248 * lib/lyxrc.example: Removed the \number_inset section
6250 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6252 * src/insets/figinset.C (various): Use IsFileReadable() to make
6253 sure that the file actually exist. Relying on ghostscripts errors
6254 is a bad idea since they can lead to X server crashes.
6256 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6258 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6261 * lib/lyxrc.example: smallish typo in description of
6262 \view_dvi_paper_option
6264 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6267 * src/lyxfunc.C: doImportHelper to factor out common code of the
6268 various import methods. New functions doImportASCIIasLines,
6269 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6270 doImportLinuxDoc for the format specific parts.
6273 * buffer.C: Dispatch returns now a bool to indicate success
6276 * lyx_gui.C: Add getLyXView() for member access
6278 * lyx_main.C: Change logic for batch commands: First try
6279 Buffer::Dispatch (possibly without GUI), if that fails, use
6282 * lyx_main.C: Add support for --import command line switch.
6283 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6284 Available Formats: Everything accepted by 'buffer-import <format>'
6286 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6288 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6291 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6292 documents will be reformatted upon reentry.
6294 2000-04-27 Juergen Vigna <jug@sad.it>
6296 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6297 correctly only last pos this was a bug.
6299 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6301 * release of lyx-1.1.5pre1
6303 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6305 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6307 * src/menus.C: revert the change of naming (Figure->Graphic...)
6308 from 2000-04-11. It was incomplete and bad.
6310 * src/LColor.[Ch]: add LColor::depthbar.
6311 * src/text.C (GetVisibleRow): use it.
6313 * README: update the languages list.
6315 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6317 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6320 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6322 * README: remove sections that were just wrong.
6324 * src/text2.C (GetRowNearY): remove currentrow code
6326 * src/text.C (GetRow): remove currentrow code
6328 * src/screen.C (Update): rewritten a bit.
6329 (SmallUpdate): removed func
6331 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6333 (FullRebreak): return bool
6334 (currentrow): remove var
6335 (currentrow_y): ditto
6337 * src/lyxscreen.h (Draw): change arg to unsigned long
6338 (FitCursor): return bool
6339 (FitManualCursor): ditto
6340 (Smallpdate): remove func
6341 (first): change to unsigned long
6342 (DrawOneRow): change second arg to long (from long &)
6343 (screen_refresh_y): remove var
6344 (scree_refresh_row): ditto
6346 * src/lyxrow.h: change baseline to usigned int from unsigned
6347 short, this brings some implicit/unsigned issues out in the open.
6349 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6351 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6352 instead of smallUpdate.
6354 * src/lyxcursor.h: change y to unsigned long
6356 * src/buffer.h: don't call updateScrollbar after fitcursor
6358 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6359 where they are used. Removed "\\direction", this was not present
6360 in 1.1.4 and is already obsolete. Commented out some code that I
6361 believe to never be called.
6362 (runLiterate): don't call updateScrollbar after fitCursor
6364 (buildProgram): ditto
6367 * src/WorkArea.h (workWidth): change return val to unsigned
6370 (redraw): remove the button redraws
6371 (setScrollbarValue): change for scrollbar
6372 (getScrollbarValue): change for scrollbar
6373 (getScrollbarBounds): change for scrollbar
6375 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6376 (C_WorkArea_down_cb): removed func
6377 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6378 (resize): change for scrollbar
6379 (setScrollbar): ditto
6380 (setScrollbarBounds): ditto
6381 (setScrollbarIncrements): ditto
6382 (up_cb): removed func
6383 (down_cb): removed func
6384 (scroll_cb): change for scrollbar
6385 (work_area_handler): ditto
6387 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6388 when FitCursor did something.
6389 (updateScrollbar): some unsigned changes
6390 (downCB): removed func
6391 (scrollUpOnePage): removed func
6392 (scrollDownOnePage): remvoed func
6393 (workAreaMotionNotify): don't call screen->FitCursor but use
6394 fitCursor instead. and bool return val
6395 (workAreaButtonPress): ditto
6396 (workAreaButtonRelease): some unsigned changes
6397 (checkInsetHit): ditto
6398 (workAreaExpose): ditto
6399 (update): parts rewritten, comments about the signed char arg added
6400 (smallUpdate): removed func
6401 (cursorPrevious): call needed updateScrollbar
6404 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6407 * src/BufferView.[Ch] (upCB): removed func
6408 (downCB): removed func
6409 (smallUpdate): removed func
6411 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6413 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6414 currentrow, currentrow_y optimization. This did not help a lot and
6415 if we want to do this kind of optimization we should rather use
6416 cursor.row instead of the currentrow.
6418 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6419 buffer spacing and klyx spacing support.
6421 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6423 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6426 2000-04-26 Juergen Vigna <jug@sad.it>
6428 * src/insets/figinset.C: fixes to Lars sstream changes!
6430 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6432 * A lot of files: Added Ascii(ostream &) methods to all inset
6433 classes. Used when exporting to ASCII.
6435 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6436 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6439 * src/text2.C (ToggleFree): Disabled implicit word selection when
6440 there is a change in the language
6442 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6443 no output was generated for end-of-sentence inset.
6445 * src/insets/lyxinset.h
6448 * src/paragraph.C: Removed the insetnumber code
6450 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6452 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6454 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6455 no_babel and no_epsfig completely from the file.
6456 (parseSingleLyXformat2Token): add handling for per-paragraph
6457 spacing as written by klyx.
6459 * src/insets/figinset.C: applied patch by Andre. Made it work with
6462 2000-04-20 Juergen Vigna <jug@sad.it>
6464 * src/insets/insettext.C (cutSelection):
6465 (copySelection): Fixed with selection from right to left.
6466 (draw): now the rows are not recalculated at every draw.
6467 (computeTextRows): for now reset the inset-owner here (this is
6468 important for an undo or copy where the inset-owner is not set
6471 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6472 motion to the_locking_inset screen->first was forgotten, this was
6473 not important till we got multiline insets.
6475 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6477 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6478 code seems to be alright (it is code changed by Dekel, and the
6479 intent is indeed that all macros should be defined \protect'ed)
6481 * NEWS: a bit of reorganisation of the new user-visible features.
6483 2000-04-19 Juergen Vigna <jug@sad.it>
6485 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6486 position. Set the inset_owner of the used paragraph so that it knows
6487 that it is inside an inset. Fixed cursor handling with mouse and
6488 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6489 and cleanups to make TextInsets work better.
6491 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6492 Changed parameters of various functions and added LockInsetInInset().
6494 * src/insets/insettext.C:
6496 * src/insets/insetcollapsable.h:
6497 * src/insets/insetcollapsable.C:
6498 * src/insets/insetfoot.h:
6499 * src/insets/insetfoot.C:
6500 * src/insets/insetert.h:
6501 * src/insets/insetert.C: cleaned up the code so that it works now
6502 correctly with insettext.
6504 * src/insets/inset.C:
6505 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6506 that insets in insets are supported right.
6509 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6511 * src/paragraph.C: some small fixes
6513 * src/debug.h: inserted INSETS debug info
6515 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6516 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6518 * src/commandtags.h:
6519 * src/LyXAction.C: insert code for InsetTabular.
6521 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6522 not Button1MotionMask.
6523 (workAreaButtonRelease): send always a InsetButtonRelease event to
6525 (checkInsetHit): some setCursor fixes (always with insets).
6527 * src/BufferView2.C (lockInset): returns a bool now and extended for
6528 locking insets inside insets.
6529 (showLockedInsetCursor): it is important to have the cursor always
6530 before the locked inset.
6531 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6533 * src/BufferView.h: made lockInset return a bool.
6535 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6537 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6538 that is used also internally but can be called as public to have back
6539 a cursor pos which is not set internally.
6540 (SetCursorIntern): Changed to use above function.
6542 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6544 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6549 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6550 patches for things that should be in or should be changed.
6552 * src/* [insetfiles]: change "usigned char fragile" to bool
6553 fragile. There was only one point that could that be questioned
6554 and that is commented in formulamacro.C. Grep for "CHECK".
6556 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6557 (DeleteBuffer): take it out of CutAndPaste and make it static.
6559 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6561 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6562 output the spacing envir commands. Also the new commands used in
6563 the LaTeX output makes the result better.
6565 * src/Spacing.C (writeEnvirBegin): new method
6566 (writeEnvirEnd): new method
6568 2000-04-18 Juergen Vigna <jug@sad.it>
6570 * src/CutAndPaste.C: made textclass a static member of the class
6571 as otherwise it is not accesed right!!!
6573 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6575 * forms/layout_forms.fd
6576 * src/layout_forms.h
6577 * src/layout_forms.C (create_form_form_character)
6578 * src/lyx_cb.C (UserFreeFont)
6579 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6580 documents (in the layout->character popup).
6582 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6584 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6585 \spell_command was in fact not honored (from Kevin Atkinson).
6587 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6590 * src/lyx_gui.h: make lyxViews private (Angus)
6592 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6594 * src/mathed/math_write.C
6595 (MathMatrixInset::Write) Put \protect before \begin{array} and
6596 \end{array} if fragile
6597 (MathParInset::Write): Put \protect before \\ if fragile
6599 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6602 initialization if the LyXColorHandler must be done after the
6603 connections to the XServer has been established.
6605 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6606 get the background pixel from the lyxColorhandler so that the
6607 figures are rendered with the correct background color.
6608 (NextToken): removed functions.
6609 (GetPSSizes): use ifs >> string instead of NextToken.
6611 * src/Painter.[Ch]: the color cache moved out of this file.
6613 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6616 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6618 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6619 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6621 * src/BufferView.C (enterView): new func
6622 (leaveView): new func
6624 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6626 (leaveView): new func, undefines xterm cursor when approp.
6628 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6629 (AllowInput): delete the Workarea cursor handling from this func.
6631 * src/Painter.C (underline): draw a slimer underline in most cases.
6633 * src/lyx_main.C (error_handler): use extern "C"
6635 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6637 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6638 sent directly to me.
6640 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6641 to the list by Dekel.
6643 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6646 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6647 methods from lyx_cb.here.
6649 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6652 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6654 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6655 instead of using current_view directly.
6657 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6659 * src/LyXAction.C (init): add the paragraph-spacing command.
6661 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6663 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6665 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6666 different from the documents.
6668 * src/text.C (SetHeightOfRow): take paragraph spacing into
6669 account, paragraph spacing takes precedence over buffer spacing
6670 (GetVisibleRow): ditto
6672 * src/paragraph.C (writeFile): output the spacing parameter too.
6673 (validate): set the correct features if spacing is used in the
6675 (Clear): set spacing to default
6676 (MakeSameLayout): spacing too
6677 (HasSameLayout): spacing too
6678 (SetLayout): spacing too
6679 (TeXOnePar): output the spacing commands
6681 * src/lyxparagraph.h: added a spacing variable for use with
6682 per-paragraph spacing.
6684 * src/Spacing.h: add a Default spacing and a method to check if
6685 the current spacing is default. also added an operator==
6687 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6690 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6692 * src/lyxserver.C (callback): fix dispatch of functions
6694 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6695 printf() into lyxerr call.
6697 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6700 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6701 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6702 the "Float" from each of the subitems.
6703 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6705 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6706 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6707 documented the change so that the workaround can be nuked later.
6709 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6712 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6714 * src/buffer.C (getLatexName): ditto
6715 (setReadonly): ditto
6717 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6719 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6720 avoid some uses of current_view. Added also a bufferParams()
6721 method to get at this.
6723 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6725 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6727 * src/lyxparagraph.[Ch]: removed
6728 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6729 with operators used by lower_bound and
6730 upper_bound in InsetTable's
6731 Make struct InsetTable private again. Used matchpos.
6733 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6735 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6736 document, the language of existing text is changed (unless the
6737 document is multi-lingual)
6739 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6741 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6743 * A lot of files: A rewrite of the Right-to-Left support.
6745 2000-04-10 Juergen Vigna <jug@sad.it>
6747 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6748 misplaced cursor when inset in inset is locked.
6750 * src/insets/insettext.C (LocalDispatch): small fix so that a
6751 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6753 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6754 footnote font should be decreased in size twice when displaying.
6756 * src/insets/insettext.C (GetDrawFont): inserted this function as
6757 the drawing-font may differ from the real paragraph font.
6759 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6760 insets (inset in inset!).
6762 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6763 function here because we don't want footnotes inside footnotes.
6765 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6767 (init): now set the inset_owner in paragraph.C
6768 (LocalDispatch): added some resetPos() in the right position
6771 (pasteSelection): changed to use the new CutAndPaste-Class.
6773 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6774 which tells if it is allowed to insert another inset inside this one.
6776 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6777 SwitchLayoutsBetweenClasses.
6779 * src/text2.C (InsertInset): checking of the new paragraph-function
6781 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6782 is not needed anymore here!
6785 (PasteSelection): redone (also with #ifdef) so that now this uses
6786 the CutAndPaste-Class.
6787 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6790 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6791 from/to text/insets.
6793 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6794 so that the paragraph knows if it is inside an (text)-inset.
6795 (InsertFromMinibuffer): changed return-value to bool as now it
6796 may happen that an inset is not inserted in the paragraph.
6797 (InsertInsetAllowed): this checks if it is allowed to insert an
6798 inset in this paragraph.
6800 (BreakParagraphConservative):
6801 (BreakParagraph) : small change for the above change of the return
6802 value of InsertFromMinibuffer.
6804 * src/lyxparagraph.h: added inset_owner and the functions to handle
6805 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6807 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6809 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6810 functions from BufferView to BufferView::Pimpl to ease maintence.
6812 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6813 correctly. Also use SetCursorIntern instead of SetCursor.
6815 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6818 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6820 * src/WorkArea.C (belowMouse): manually implement below mouse.
6822 * src/*: Add "explicit" on several constructors, I added probably
6823 some unneeded ones. A couple of changes to code because of this.
6825 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6826 implementation and private parts from the users of BufferView. Not
6829 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6830 implementation and private parts from the users of LyXLex. Not
6833 * src/BufferView_pimpl.[Ch]: new files
6835 * src/lyxlex_pimpl.[Ch]: new files
6837 * src/LyXView.[Ch]: some inline functions move out-of-line
6839 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6841 * src/lyxparagraph.h: make struct InsetTable public.
6843 * src/support/lyxstring.h: change lyxstring::difference_type to be
6844 ptrdiff_t. Add std:: modifiers to streams.
6846 * src/font.C: include the <cctype> header, for islower() and
6849 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6851 * src/font.[Ch]: new files. Contains the metric functions for
6852 fonts, takes a LyXFont as parameter. Better separation of concepts.
6854 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6855 changes because of this.
6857 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6859 * src/*: compile with -Winline and move functions that don't
6862 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6865 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6868 (various files changed because of this)
6870 * src/Painter.C (text): fixed the drawing of smallcaps.
6872 * src/lyxfont.[Ch] (drawText): removed unused member func.
6875 * src/*.C: added needed "using" statements and "std::" qualifiers.
6877 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6879 * src/*.h: removed all use of "using" from header files use
6880 qualifier std:: instead.
6882 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6884 * src/text.C (Backspace): some additional cleanups (we already
6885 know whether cursor.pos is 0 or not).
6887 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6888 automake does not provide one).
6890 * src/bmtable.h: replace C++ comments with C comments.
6892 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6894 * src/screen.C (ShowCursor): Change the shape of the cursor if
6895 the current language is not equal to the language of the document.
6896 (If the cursor change its shape unexpectedly, then you've found a bug)
6898 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6901 * src/insets/insetnumber.[Ch]: New files.
6903 * src/LyXAction.C (init)
6904 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6907 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6909 * src/lyxparagraph.h
6910 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6911 (the vector is kept sorted).
6913 * src/text.C (GetVisibleRow): Draw selection correctly when there
6914 is both LTR and RTL text.
6916 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6917 which is much faster.
6919 * src/text.C (GetVisibleRow and other): Do not draw the last space
6920 in a row if the direction of the last letter is not equal to the
6921 direction of the paragraph.
6923 * src/lyxfont.C (latexWriteStartChanges):
6924 Check that font language is not equal to basefont language.
6925 (latexWriteEndChanges): ditto
6927 * src/lyx_cb.C (StyleReset): Don't change the language while using
6928 the font-default command.
6930 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6931 empty paragraph before a footnote.
6933 * src/insets/insetcommand.C (draw): Increase x correctly.
6935 * src/screen.C (ShowCursor): Change cursor shape if
6936 current language != document language.
6938 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6940 2000-03-31 Juergen Vigna <jug@sad.it>
6942 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6943 (Clone): changed mode how the paragraph-data is copied to the
6944 new clone-paragraph.
6946 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6947 GetInset(pos) with no inset anymore there (in inset UNDO)
6949 * src/insets/insetcommand.C (draw): small fix as here x is
6950 incremented not as much as width() returns (2 before, 2 behind = 4)
6952 2000-03-30 Juergen Vigna <jug@sad.it>
6954 * src/insets/insettext.C (InsetText): small fix in initialize
6955 widthOffset (should not be done in the init() function)
6957 2000-03-29 Amir Karger <karger@lyx.org>
6959 * lib/examples/it_ItemizeBullets.lyx: translation by
6962 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6964 2000-03-29 Juergen Vigna <jug@sad.it>
6966 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6968 * src/insets/insetfoot.C (Clone): small change as for the below
6969 new init function in the text-inset
6971 * src/insets/insettext.C (init): new function as I've seen that
6972 clone did not copy the Paragraph-Data!
6973 (LocalDispatch): Added code so that now we have some sort of Undo
6974 functionality (well actually we HAVE Undo ;)
6976 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6978 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6980 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6983 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6985 * src/main.C: added a runtime check that verifies that the xforms
6986 header used when building LyX and the library used when running
6987 LyX match. Exit with a message if they don't match. This is a
6988 version number check only.
6990 * src/buffer.C (save): Don't allocate memory on the heap for
6991 struct utimbuf times.
6993 * *: some using changes, use iosfwd instead of the real headers.
6995 * src/lyxfont.C use char const * instead of string for the static
6996 strings. Rewrite some functions to use sstream.
6998 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7000 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7003 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7005 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7006 of Geodesy (from Martin Vermeer)
7008 * lib/layouts/svjour.inc: include file for the Springer svjour
7009 class. It can be used to support journals other than JoG.
7011 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7012 Miskiewicz <misiek@pld.org.pl>)
7013 * lib/reLyX/Makefile.am: ditto.
7015 2000-03-27 Juergen Vigna <jug@sad.it>
7017 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7018 also some modifications with operations on selected text.
7020 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7021 problems with clicking on insets (last famous words ;)
7023 * src/insets/insetcommand.C (draw):
7024 (width): Changed to have a bit of space before and after the inset so
7025 that the blinking cursor can be seen (otherwise it was hidden)
7027 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7029 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7030 would not be added to the link list when an installed gettext (not
7031 part of libc) is found.
7033 2000-03-24 Juergen Vigna <jug@sad.it>
7035 * src/insets/insetcollapsable.C (Edit):
7036 * src/mathed/formula.C (InsetButtonRelease):
7037 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7040 * src/BufferView.C (workAreaButtonPress):
7041 (workAreaButtonRelease):
7042 (checkInsetHit): Finally fixed the clicking on insets be handled
7045 * src/insets/insetert.C (Edit): inserted this call so that ERT
7046 insets work always with LaTeX-font
7048 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7050 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7051 caused lyx to startup with no GUI in place, causing in a crash
7052 upon startup when called with arguments.
7054 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7056 * src/FontLoader.C: better initialization of dummyXFontStruct.
7058 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7060 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7061 for linuxdoc and docbook import and export format options.
7063 * lib/lyxrc.example Example of default values for the previous flags.
7065 * src/lyx_cb.C Use those flags instead of the hardwired values for
7066 linuxdoc and docbook export.
7068 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7071 * src/menus.C Added menus entries for the new import/exports formats.
7073 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7075 * src/lyxrc.*: Added support for running without Gui
7078 * src/FontLoader.C: sensible defaults if no fonts are needed
7080 * src/lyx_cb.C: New function ShowMessage (writes either to the
7081 minibuffer or cout in case of no gui
7082 New function AskOverwrite for common stuff
7083 Consequently various changes to call these functions
7085 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7086 wild guess at sensible screen resolution when having no gui
7088 * src/lyxfont.C: no gui, no fonts... set some defaults
7090 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7092 * src/LColor.C: made the command inset background a bit lighter.
7094 2000-03-20 Hartmut Goebel <goebel@noris.net>
7096 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7097 stdstruct.inc. Koma-Script added some title elements which
7098 otherwise have been listed below "bibliography". This split allows
7099 adding title elements to where they belong.
7101 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7102 define the additional title elements and then include
7105 * many other layout files: changed to include stdtitle.inc just
7106 before stdstruct.inc.
7108 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7110 * src/buffer.C: (save) Added the option to store all backup files
7111 in a single directory
7113 * src/lyxrc.[Ch]: Added variable \backupdir_path
7115 * lib/lyxrc.example: Added descriptions of recently added variables
7117 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7118 bibtex inset, not closing the bibtex popup when deleting the inset)
7120 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7122 * src/lyx_cb.C: add a couple using directives.
7124 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7125 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7126 import based on the filename.
7128 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7129 file would be imported at start, if the filename where of a sgml file.
7131 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7133 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7135 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7136 * src/lyxfont.h Replaced the member variable bits.direction by the
7137 member variable lang. Made many changes in other files.
7138 This allows having a multi-lingual document
7140 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7141 that change the current language to <l>.
7142 Removed the command "font-rtl"
7144 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7145 format for Hebrew documents)
7147 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7148 When auto_mathmode is "true", pressing a digit key in normal mode
7149 will cause entering into mathmode.
7150 If auto_mathmode is "rtl" then this behavior will be active only
7151 when writing right-to-left text.
7153 * src/text2.C (InsertStringA) The string is inserted using the
7156 * src/paragraph.C (GetEndLabel) Gives a correct result for
7157 footnote paragraphs.
7159 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7161 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7163 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7164 front of PasteParagraph. Never insert a ' '. This should at least
7165 fix some cause for the segfaults that we have been experiencing,
7166 it also fixes backspace behaviour slightly. (Phu!)
7168 * src/support/lstrings.C (compare_no_case): some change to make it
7169 compile with gcc 2.95.2 and stdlibc++-v3
7171 * src/text2.C (MeltFootnoteEnvironment): change type o
7172 first_footnote_par_is_not_empty to bool.
7174 * src/lyxparagraph.h: make text private. Changes in other files
7176 (fitToSize): new function
7177 (setContentsFromPar): new function
7178 (clearContents): new function
7179 (SetChar): new function
7181 * src/paragraph.C (readSimpleWholeFile): deleted.
7183 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7184 the file, just use a simple string instead. Also read the file in
7185 a more maintainable manner.
7187 * src/text2.C (InsertStringA): deleted.
7188 (InsertStringB): deleted.
7190 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7192 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7193 RedoParagraphs from the doublespace handling part, just set status
7194 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7195 done, but perhaps not like this.)
7197 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7199 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7200 character when inserting an inset.
7202 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/bufferparams.C (readLanguage): now takes "default" into
7207 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7208 also initialize the toplevel_keymap with the default bindings from
7211 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7213 * all files using lyxrc: have lyxrc as a real variable and not a
7214 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7217 * src/lyxrc.C: remove double call to defaultKeyBindings
7219 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7220 toolbar defauls using lyxlex. Remove enums, structs, functions
7223 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7224 toolbar defaults. Also store default keybindings in a map.
7226 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7227 storing the toolbar defaults without any xforms dependencies.
7229 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7230 applied. Changed to use iterators.
7232 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7234 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7235 systems that don't have LINGUAS set to begin with.
7237 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7239 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7240 the list by Dekel Tsur.
7242 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7244 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7245 * src/insets/form_graphics.C: ditto.
7247 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7249 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7251 * src/bufferparams.C (readLanguage): use the new language map
7253 * src/intl.C (InitKeyMapper): use the new language map
7255 * src/lyx_gui.C (create_forms): use the new language map
7257 * src/language.[Ch]: New files. Used for holding the information
7258 about each language. Now! Use this new language map enhance it and
7259 make it really usable for our needs.
7261 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7263 * screen.C (ShowCursor): Removed duplicate code.
7264 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7265 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7267 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7270 * src/text.C Added TransformChar method. Used for rendering Arabic
7271 text correctly (change the glyphs of the letter according to the
7272 position in the word)
7277 * src/lyxrc.C Added lyxrc command {language_command_begin,
7278 language_command_end,language_command_ltr,language_command_rtl,
7279 language_package} which allows the use of either arabtex or Omega
7282 * src/lyx_gui.C (init)
7284 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7285 to use encoding for menu fonts which is different than the encoding
7288 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7289 do not load the babel package.
7290 To write an English document with Hebrew/Arabic, change the document
7291 language to "english".
7293 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7294 (alphaCounter): changed to return char
7295 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7297 * lib/lyxrc.example Added examples for Hebrew/Arabic
7300 * src/layout.C Added layout command endlabeltype
7302 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7304 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7306 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/mathed/math_delim.C (search_deco): return a
7309 math_deco_struct* instead of index.
7311 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7313 * All files with a USE_OSTREAM_ONLY within: removed all code that
7314 was unused when USE_OSTREAM_ONLY is defined.
7316 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7317 of any less. Removed header and using.
7319 * src/text.C (GetVisibleRow): draw the string "Page Break
7320 (top/bottom)" on screen when drawing a pagebreak line.
7322 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7324 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7326 * src/mathed/math_macro.C (draw): do some cast magic.
7329 * src/mathed/math_defs.h: change byte* argument to byte const*.
7331 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7333 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7334 know it is right to return InsetFoot* too, but cxx does not like
7337 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7339 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7341 * src/mathed/math_delim.C: change == to proper assignment.
7343 2000-03-09 Juergen Vigna <jug@sad.it>
7345 * src/insets/insettext.C (setPos): fixed various cursor positioning
7346 problems (via mouse and cursor-keys)
7347 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7348 inset (still a small display problem but it works ;)
7350 * src/insets/insetcollapsable.C (draw): added button_top_y and
7351 button_bottom_y to have correct values for clicking on the inset.
7353 * src/support/lyxalgo.h: commented out 'using std::less'
7355 2000-03-08 Juergen Vigna <jug@sad.it>
7357 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7358 Button-Release event closes as it is alos the Release-Event
7361 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7363 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7365 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7366 can add multiple spaces in Scrap (literate programming) styles...
7367 which, by the way, is how I got hooked on LyX to begin with.
7369 * src/mathed/formula.C (Write): Added dummy variable to an
7370 inset::Latex() call.
7371 (Latex): Add free_spacing boolean to inset::Latex()
7373 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7375 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7376 virtual function to include the free_spacing boolean from
7377 the containing paragraph's style.
7379 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7380 Added free_spacing boolean arg to match inset.h
7382 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7383 Added free_spacing boolean arg to match inset.h
7385 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7386 Added free_spacing boolean and made sure that if in a free_spacing
7387 paragraph, that we output normal space if there is a protected space.
7389 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7390 Added free_spacing boolean arg to match inset.h
7392 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7393 Added free_spacing boolean arg to match inset.h
7395 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7396 Added free_spacing boolean arg to match inset.h
7398 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7399 Added free_spacing boolean arg to match inset.h
7401 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7402 Added free_spacing boolean arg to match inset.h
7404 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7405 free_spacing boolean arg to match inset.h
7407 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7408 Added free_spacing boolean arg to match inset.h
7410 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7411 Added free_spacing boolean arg to match inset.h
7413 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7414 Added free_spacing boolean arg to match inset.h
7416 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7417 Added free_spacing boolean arg to match inset.h
7419 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7420 Added free_spacing boolean arg to match inset.h
7422 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7423 free_spacing boolean arg to match inset.h
7425 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7426 free_spacing boolean arg to match inset.h
7428 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7429 ignore free_spacing paragraphs. The user's spaces are left
7432 * src/text.C (InsertChar): Fixed the free_spacing layout
7433 attribute behavior. Now, if free_spacing is set, you can
7434 add multiple spaces in a paragraph with impunity (and they
7435 get output verbatim).
7436 (SelectSelectedWord): Added dummy argument to inset::Latex()
7439 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7442 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7443 paragraph layouts now only input a simple space instead.
7444 Special character insets don't make any sense in free-spacing
7447 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7448 hard-spaces in the *input* file to simple spaces if the layout
7449 is free-spacing. This converts old files which had to have
7450 hard-spaces in free-spacing layouts where a simple space was
7452 (writeFileAscii): Added free_spacing check to pass to the newly
7453 reworked inset::Latex(...) methods. The inset::Latex() code
7454 ensures that hard-spaces in free-spacing paragraphs get output
7455 as spaces (rather than "~").
7457 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7459 * src/mathed/math_delim.C (draw): draw the empty placeholder
7460 delims with a onoffdash line.
7461 (struct math_deco_compare): struct that holds the "functors" used
7462 for the sort and the binary search in math_deco_table.
7463 (class init_deco_table): class used for initial sort of the
7465 (search_deco): use lower_bound to do a binary search in the
7468 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/lyxrc.C: a small secret thingie...
7472 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7473 and to not flush the stream as often as it used to.
7475 * src/support/lyxalgo.h: new file
7476 (sorted): template function used for checking if a sequence is
7477 sorted or not. Two versions with and without user supplied
7478 compare. Uses same compare as std::sort.
7480 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7481 it and give warning on lyxerr.
7483 (struct compare_tags): struct with function operators used for
7484 checking if sorted, sorting and lower_bound.
7485 (search_kw): use lower_bound instead of manually implemented
7488 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7490 * src/insets/insetcollapsable.h: fix Clone() declaration.
7491 * src/insets/insetfoot.h: ditto.
7493 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7495 2000-03-08 Juergen Vigna <jug@sad.it>
7497 * src/insets/lyxinset.h: added owner call which tells us if
7498 this inset is inside another inset. Changed also the return-type
7499 of Editable to an enum so it tells clearer what the return-value is.
7501 * src/insets/insettext.C (computeTextRows): fixed computing of
7502 textinsets which split automatically on more rows.
7504 * src/insets/insetert.[Ch]: changed this to be of BaseType
7507 * src/insets/insetfoot.[Ch]: added footnote inset
7509 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7510 collapsable insets (like footnote, ert, ...)
7512 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7514 * src/lyxdraw.h: remvoe file
7516 * src/lyxdraw.C: remove file
7518 * src/insets/insettext.C: added <algorithm>.
7520 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7522 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7523 (matrix_cb): case MM_OK use string stream
7525 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7528 * src/mathed/math_macro.C (draw): use string stream
7529 (Metrics): use string stream
7531 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7532 directly to the ostream.
7534 * src/vspace.C (asString): use string stream.
7535 (asString): use string stream
7536 (asLatexString): use string stream
7538 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7539 setting Spacing::Other.
7541 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7542 sprintf when creating the stretch vale.
7544 * src/text2.C (alphaCounter): changed to return a string and to
7545 not use a static variable internally. Also fixed a one-off bug.
7546 (SetCounter): changed the drawing of the labels to use string
7547 streams instead of sprintf.
7549 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7550 manipulator to use a scheme that does not require library support.
7551 This is also the way it is done in the new GNU libstdc++. Should
7552 work with DEC cxx now.
7554 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7556 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7557 end. This fixes a bug.
7559 * src/mathed (all files concerned with file writing): apply the
7560 USE_OSTREAM_ONLY changes to mathed too.
7562 * src/support/DebugStream.h: make the constructor explicit.
7564 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7565 count and ostream squashed.
7567 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7569 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7571 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7572 ostringstream uses STL strings, and we might not.
7574 * src/insets/insetspecialchar.C: add using directive.
7575 * src/insets/insettext.C: ditto.
7577 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7579 * lib/layouts/seminar.layout: feeble attempt at a layout for
7580 seminar.cls, far from completet and could really use some looking
7581 at from people used to write layout files.
7583 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7584 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7585 a lot nicer and works nicely with ostreams.
7587 * src/mathed/formula.C (draw): a slightly different solution that
7588 the one posted to the list, but I think this one works too. (font
7589 size wrong in headers.)
7591 * src/insets/insettext.C (computeTextRows): some fiddling on
7592 Jürgens turf, added some comments that he should read.
7594 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7595 used and it gave compiler warnings.
7596 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7599 * src/lyx_gui.C (create_forms): do the right thing when
7600 show_banner is true/false.
7602 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7603 show_banner is false.
7605 * most file writing files: Now use iostreams to do almost all of
7606 the writing. Also instead of passing string &, we now use
7607 stringstreams. mathed output is still not adapted to iostreams.
7608 This change can be turned off by commenting out all the occurences
7609 of the "#define USE_OSTREAM_ONLY 1" lines.
7611 * src/WorkArea.C (createPixmap): don't output debug messages.
7612 (WorkArea): don't output debug messages.
7614 * lib/lyxrc.example: added a comment about the new variable
7617 * development/Code_rules/Rules: Added some more commente about how
7618 to build class interfaces and on how better encapsulation can be
7621 2000-03-03 Juergen Vigna <jug@sad.it>
7623 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7624 automatically with the width of the LyX-Window
7626 * src/insets/insettext.C (computeTextRows): fixed update bug in
7627 displaying text-insets (scrollvalues where not initialized!)
7629 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7631 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7632 id in the check of the result from lower_bound is not enough since
7633 lower_bound can return last too, and then res->id will not be a
7636 * all insets and some code that use them: I have conditionalized
7637 removed the Latex(string & out, ...) this means that only the
7638 Latex(ostream &, ...) will be used. This is a work in progress to
7639 move towards using streams for all output of files.
7641 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7644 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7646 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7647 routine (this fixes bug where greek letters were surrounded by too
7650 * src/support/filetools.C (findtexfile): change a bit the search
7651 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7652 no longer passed to kpsewhich, we may have to change that later.
7654 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7655 warning options to avoid problems with X header files (from Angus
7657 * acinclude.m4: regenerated.
7659 2000-03-02 Juergen Vigna <jug@sad.it>
7661 * src/insets/insettext.C (WriteParagraphData): Using the
7662 par->writeFile() function for writing paragraph-data.
7663 (Read): Using buffer->parseSingleLyXformat2Token()-function
7664 for parsing paragraph data!
7666 * src/buffer.C (readLyXformat2): removed all parse data and using
7667 the new parseSingleLyXformat2Token()-function.
7668 (parseSingleLyXformat2Token): added this function to parse (read)
7669 lyx-file-format (this is called also from text-insets now!)
7671 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7673 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7676 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7677 directly instead of going through a func. One very bad thing: a
7678 static LyXFindReplace, but I don't know where to place it.
7680 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7681 string instead of char[]. Also changed to static.
7682 (GetSelectionOrWordAtCursor): changed to static inline
7683 (SetSelectionOverLenChars): ditto.
7685 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7686 current_view and global variables. both classes has changed names
7687 and LyXFindReplace is not inherited from SearchForm.
7689 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7690 fl_form_search form.
7692 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7694 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7696 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7697 bound (from Kayvan).
7699 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7701 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7703 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7705 * some things that I should comment but the local pub says head to
7708 * comment out all code that belongs to the Roff code for Ascii
7709 export of tables. (this is unused)
7711 * src/LyXView.C: use correct type for global variable
7712 current_layout. (LyXTextClass::size_type)
7714 * some code to get the new insetgraphics closer to working I'd be
7715 grateful for any help.
7717 * src/BufferView2.C (insertInset): use the return type of
7718 NumberOfLayout properly. (also changes in other files)
7720 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7721 this as a test. I want to know what breaks because of this.
7723 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7725 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7727 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7728 to use a \makebox in the label, this allows proper justification
7729 with out using protected spaces or multiple hfills. Now it is
7730 "label" for left justified, "\hfill label\hfill" for center, and
7731 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7732 should be changed accordingly.
7734 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7736 * src/lyxtext.h: change SetLayout() to take a
7737 LyXTextClass::size_type instead of a char (when there is more than
7738 127 layouts in a class); also change type of copylayouttype.
7739 * src/text2.C (SetLayout): ditto.
7740 * src/LyXView.C (updateLayoutChoice): ditto.
7742 * src/LaTeX.C (scanLogFile): errors where the line number was not
7743 given just after the '!'-line were ignored (from Dekel Tsur).
7745 * lib/lyxrc.example: fix description of \date_insert_format
7747 * lib/layouts/llncs.layout: new layout, contributed by Martin
7750 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7752 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7753 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7754 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7755 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7756 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7757 paragraph.C, text.C, text2.C)
7759 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7761 * src/insets/insettext.C (LocalDispatch): remove extra break
7764 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7765 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7767 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7768 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7770 * src/insets/insetbib.h: move InsetBibkey::Holder and
7771 InsetCitation::Holder in public space.
7773 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7775 * src/insets/insettext.h: small change to get the new files from
7776 Juergen to compile (use "string", not "class string").
7778 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7779 const & as parameter to LocalDispatch, use LyXFont const & as
7780 paramter to some other func. This also had impacto on lyxinsets.h
7781 and the two mathed insets.
7783 2000-02-24 Juergen Vigna <jug@sad.it>
7786 * src/commandtags.h:
7788 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7792 * src/BufferView2.C: added/updated code for various inset-functions
7794 * src/insets/insetert.[Ch]: added implementation of InsetERT
7796 * src/insets/insettext.[Ch]: added implementation of InsetText
7798 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7799 (draw): added preliminary code for inset scrolling not finshed yet
7801 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7802 as it is in lyxfunc.C now
7804 * src/insets/lyxinset.h: Added functions for text-insets
7806 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7808 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7809 BufferView and reimplement the list as a queue put inside its own
7812 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7814 * several files: use the new interface to the "updateinsetlist"
7816 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7818 (work_area_handler): call BufferView::trippleClick on trippleclick.
7820 * src/BufferView.C (doubleClick): new function, selects word on
7822 (trippleClick): new function, selects line on trippleclick.
7824 2000-02-22 Allan Rae <rae@lyx.org>
7826 * lib/bind/xemacs.bind: buffer-previous not supported
7828 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7830 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7833 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7835 * src/bufferlist.C: get rid of current_view from this file
7837 * src/spellchecker.C: get rid of current_view from this file
7839 * src/vspace.C: get rid of current_view from this file
7840 (inPixels): added BufferView parameter for this func
7841 (asLatexCommand): added a BufferParams for this func
7843 * src/text.C src/text2.C: get rid of current_view from these
7846 * src/lyxfont.C (getFontDirection): move this function here from
7849 * src/bufferparams.C (getDocumentDirection): move this function
7852 * src/paragraph.C (getParDirection): move this function here from
7854 (getLetterDirection): ditto
7856 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7858 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7859 resize due to wrong pixmap beeing used. Also took the opurtunity
7860 to make the LyXScreen stateless on regard to WorkArea and some
7861 general cleanup in the same files.
7863 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7865 * src/Makefile.am: add missing direction.h
7867 * src/PainterBase.h: made the width functions const.
7869 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7872 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7874 * src/insets/insetlatexaccent.C (draw): make the accents draw
7875 better, at present this will only work well with iso8859-1.
7877 * several files: remove the old drawing code, now we use the new
7880 * several files: remove support for mono_video, reverse_video and
7883 2000-02-17 Juergen Vigna <jug@sad.it>
7885 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7886 int ** as we have to return the pointer, otherwise we have only
7887 NULL pointers in the returning function.
7889 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7891 * src/LaTeX.C (operator()): quote file name when running latex.
7893 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7895 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7896 (bubble tip), this removes our special handling of this.
7898 * Remove all code that is unused now that we have the new
7899 workarea. (Code that are not active when NEW_WA is defined.)
7901 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7903 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7905 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7906 nonexisting layout; correctly redirect obsoleted layouts.
7908 * lib/lyxrc.example: document \view_dvi_paper_option
7910 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7913 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7914 (PreviewDVI): handle the view_dvi_paper_option variable.
7915 [Both from Roland Krause]
7917 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7919 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7920 char const *, int, LyXFont)
7921 (text(int, int, string, LyXFont)): ditto
7923 * src/text.C (InsertCharInTable): attempt to fix the double-space
7924 feature in tables too.
7925 (BackspaceInTable): ditto.
7926 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7928 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7930 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7932 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7933 newly found text in textcache to this.
7934 (buffer): set the owner of the text put into the textcache to 0
7936 * src/insets/figinset.C (draw): fixed the drawing of figures with
7939 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7940 drawing of mathframe, hfills, protected space, table lines. I have
7941 now no outstanding drawing problems with the new Painter code.
7943 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7945 * src/PainterBase.C (ellipse, circle): do not specify the default
7948 * src/LColor.h: add using directive.
7950 * src/Painter.[Ch]: change return type of methods from Painter& to
7951 PainterBase&. Add a using directive.
7953 * src/WorkArea.C: wrap xforms callbacks in C functions
7956 * lib/layouts/foils.layout: font fix and simplifications from Carl
7959 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7961 * a lot of files: The Painter, LColor and WorkArea from the old
7962 devel branch has been ported to lyx-devel. Some new files and a
7963 lot of #ifdeffed code. The new workarea is enabled by default, but
7964 if you want to test the new Painter and LColor you have to compile
7965 with USE_PAINTER defined (do this in config.h f.ex.) There are
7966 still some rought edges, and I'd like some help to clear those
7967 out. It looks stable (loads and displays the Userguide very well).
7970 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7972 * src/buffer.C (pop_tag): revert to the previous implementation
7973 (use a global variable for both loops).
7975 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7977 * src/lyxrc.C (LyXRC): change slightly default date format.
7979 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7980 there is an English text with a footnote that starts with a Hebrew
7981 paragraph, or vice versa.
7982 (TeXFootnote): ditto.
7984 * src/text.C (LeftMargin): allow for negative values for
7985 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7988 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7989 for input encoding (cyrillic)
7991 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7993 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7996 * src/toolbar.C (set): ditto
7997 * src/insets/insetbib.C (create_form_citation_form): ditto
7999 * lib/CREDITS: added Dekel Tsur.
8001 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8002 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8003 hebrew supports files from Dekel Tsur.
8005 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8006 <tzafrir@technion.ac.il>
8008 * src/lyxrc.C: put \date_insert_format at the right place.
8010 * src/buffer.C (makeLaTeXFile): fix the handling of
8011 BufferParams::sides when writing out latex files.
8013 * src/BufferView2.C: add a "using" directive.
8015 * src/support/lyxsum.C (sum): when we use lyxstring,
8016 ostringstream::str needs an additional .c_str().
8018 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8020 * src/support/filetools.C (ChangeExtension): patch from Etienne
8023 * src/TextCache.C (show): remove const_cast and make second
8024 parameter non-const LyXText *.
8026 * src/TextCache.h: use non const LyXText in show.
8028 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8031 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8033 * src/support/lyxsum.C: rework to be more flexible.
8035 * several places: don't check if a pointer is 0 if you are going
8038 * src/text.C: remove some dead code.
8040 * src/insets/figinset.C: remove some dead code
8042 * src/buffer.C: move the BufferView funcs to BufferView2.C
8043 remove all support for insetlatexdel
8044 remove support for oldpapersize stuff
8045 made some member funcs const
8047 * src/kbmap.C: use a std::list to store the bindings in.
8049 * src/BufferView2.C: new file
8051 * src/kbsequence.[Ch]: new files
8053 * src/LyXAction.C + others: remove all trace of buffer-previous
8055 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8056 only have one copy in the binary of this table.
8058 * hebrew patch: moved some functions from LyXText to more
8059 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8061 * several files: remove support for XForms older than 0.88
8063 remove some #if 0 #endif code
8065 * src/TextCache.[Ch]: new file. Holds the textcache.
8067 * src/BufferView.C: changes to use the new TextCache interface.
8068 (waitForX): remove the now unused code.
8070 * src/BackStack.h: remove some commented code
8072 * lib/bind/emacs.bind: remove binding for buffer-previous
8074 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8076 * applied the hebrew patch.
8078 * src/lyxrow.h: make sure that all Row variables are initialized.
8080 * src/text2.C (TextHandleUndo): comment out a delete, this might
8081 introduce a memory leak, but should also help us to not try to
8082 read freed memory. We need to look at this one.
8084 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8085 (LyXParagraph): initalize footnotekind.
8087 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8088 forgot this when applying the patch. Please heed the warnings.
8090 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8091 (aka. reformat problem)
8093 * src/bufferlist.C (exists): made const, and use const_iterator
8094 (isLoaded): new func.
8095 (release): use std::find to find the correct buffer.
8097 * src/bufferlist.h: made getState a const func.
8098 made empty a const func.
8099 made exists a const func.
8102 2000-02-01 Juergen Vigna <jug@sad.it>
8104 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8106 * po/it.po: updated a bit the italian po file and also changed the
8107 'file nuovo' for newfile to 'filenuovo' without a space, this did
8110 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8111 for the new insert_date command.
8113 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8114 from jdblair, to insert a date into the current text conforming to
8115 a strftime format (for now only considering the locale-set and not
8116 the document-language).
8118 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8120 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8121 Bounds Read error seen by purify. The problem was that islower is
8122 a macros which takes an unsigned char and uses it as an index for
8123 in array of characters properties (and is thus subject to the
8127 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8128 correctly the paper sides radio buttons.
8129 (UpdateDocumentButtons): ditto.
8131 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8133 * src/kbmap.C (getsym + others): change to return unsigned int,
8134 returning a long can give problems on 64 bit systems. (I assume
8135 that int is 32bit on 64bit systems)
8137 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8139 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8140 LyXLookupString to be zero-terminated. Really fixes problems seen
8143 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8146 write a (char*)0 to the lyxerr stream.
8148 * src/lastfiles.C: move algorithm before the using statemets.
8150 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8152 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8153 complains otherwise).
8154 * src/table.C: ditto
8156 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8159 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8160 that I removed earlier... It is really needed.
8162 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8164 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8166 * INSTALL: update xforms home page URL.
8168 * lib/configure.m4: fix a bug with unreadable layout files.
8170 * src/table.C (calculate_width_of_column): add "using std::max"
8173 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8175 * several files: marked several lines with "DEL LINE", this is
8176 lines that can be deleted without changing anything.
8177 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8178 checks this anyway */
8181 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8183 * src/DepTable.C (update): add a "+" at the end when the checksum
8184 is different. (debugging string only)
8186 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8187 the next inset to not be displayed. This should also fix the list
8188 of labels in the "Insert Crossreference" dialog.
8190 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8192 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8193 when regex was not found.
8195 * src/support/lstrings.C (lowercase): use handcoded transform always.
8198 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8199 old_cursor.par->prev could be 0.
8201 * several files: changed post inc/dec to pre inc/dec
8203 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8204 write the lastfiles to file.
8206 * src/BufferView.C (buffer): only show TextCache info when debugging
8208 (resizeCurrentBuffer): ditto
8209 (workAreaExpose): ditto
8211 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8213 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8215 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8216 a bit better by removing the special case for \i and \j.
8218 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8220 * src/lyx_main.C (easyParse): remove test for bad comand line
8221 options, since this broke all xforms-related parsing.
8223 * src/kbmap.C (getsym): set return type to unsigned long, as
8224 declared in header. On an alpha, long is _not_ the same as int.
8226 * src/support/LOstream.h: add a "using std::flush;"
8228 * src/insets/figinset.C: ditto.
8230 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8232 * src/bufferlist.C (write): use blinding fast file copy instead of
8233 "a char at a time", now we are doing it the C++ way.
8235 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8236 std::list<int> instead.
8237 (addpidwait): reflect move to std::list<int>
8238 (sigchldchecker): ditto
8240 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8243 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8244 that obviously was wrong...
8246 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8247 c, this avoids warnings with purify and islower.
8249 * src/insets/figinset.C: rename struct queue to struct
8250 queue_element and rewrite to use a std::queue. gsqueue is now a
8251 std::queue<queue_element>
8252 (runqueue): reflect move to std::queue
8255 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8256 we would get "1" "0" instead of "true" "false. Also make the tostr
8259 2000-01-21 Juergen Vigna <jug@sad.it>
8261 * src/buffer.C (writeFileAscii): Disabled code for special groff
8262 handling of tabulars till I fix this in table.C
8264 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8266 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8268 * src/support/lyxlib.h: ditto.
8270 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8272 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8273 and 'j' look better. This might fix the "macron" bug that has been
8276 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8277 functions as one template function. Delete the old versions.
8279 * src/support/lyxsum.C: move using std::ifstream inside
8282 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8285 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8287 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8289 * src/insets/figinset.C (InitFigures): use new instead of malloc
8290 to allocate memory for figures and bitmaps.
8291 (DoneFigures): use delete[] instead of free to deallocate memory
8292 for figures and bitmaps.
8293 (runqueue): use new to allocate
8294 (getfigdata): use new/delete[] instead of malloc/free
8295 (RegisterFigure): ditto
8297 * some files: moved some declarations closer to first use, small
8298 whitespace changes use preincrement instead of postincrement where
8299 it does not make a difference.
8301 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8302 step on the way to use stl::containers for key maps.
8304 * src/bufferlist.h: add a typedef for const_iterator and const
8305 versions of begin and end.
8307 * src/bufferlist.[Ch]: change name of member variable _state to
8308 state_. (avoid reserved names)
8310 (getFileNames): returns the filenames of the buffers in a vector.
8312 * configure.in (ALL_LINGUAS): added ro
8314 * src/support/putenv.C: new file
8316 * src/support/mkdir.C: new file
8318 2000-01-20 Allan Rae <rae@lyx.org>
8320 * lib/layouts/IEEEtran.layout: Added several theorem environments
8322 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8323 couple of minor additions.
8325 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8326 (except for those in footnotes of course)
8328 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8330 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8332 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8333 std::sort and std::lower_bound instead of qsort and handwritten
8335 (struct compara): struct that holds the functors used by std::sort
8336 and std::lower_bound in MathedLookupBOP.
8338 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8340 * src/support/LAssert.h: do not do partial specialization. We do
8343 * src/support/lyxlib.h: note that lyx::getUserName() and
8344 lyx::date() are not in use right now. Should these be suppressed?
8346 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8347 (makeLinuxDocFile): do not put date and user name in linuxdoc
8350 * src/support/lyxlib.h (kill): change first argument to long int,
8351 since that's what solaris uses.
8353 * src/support/kill.C (kill): fix declaration to match prototype.
8355 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8356 actually check whether namespaces are supported. This is not what
8359 * src/support/lyxsum.C: add a using directive.
8361 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8363 * src/support/kill.C: if we have namespace support we don't have
8364 to include lyxlib.h.
8366 * src/support/lyxlib.h: use namespace lyx if supported.
8368 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8370 * src/support/date.C: new file
8372 * src/support/chdir.C: new file
8374 * src/support/getUserName.C: new file
8376 * src/support/getcwd.C: new file
8378 * src/support/abort.C: new file
8380 * src/support/kill.C: new file
8382 * src/support/lyxlib.h: moved all the functions in this file
8383 insede struct lyx. Added also kill and abort to this struct. This
8384 is a way to avoid the "kill is not defined in <csignal>", we make
8385 C++ wrappers for functions that are not ANSI C or ANSI C++.
8387 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8388 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8389 lyx it has been renamed to sum.
8391 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8393 * src/text.C: add using directives for std::min and std::max.
8395 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8397 * src/texrow.C (getIdFromRow): actually return something useful in
8398 id and pos. Hopefully fixes the bug with positionning of errorbox
8401 * src/lyx_main.C (easyParse): output an error and exit if an
8402 incorrect command line option has been given.
8404 * src/spellchecker.C (ispell_check_word): document a memory leak.
8406 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8407 where a "struct utimbuf" is allocated with "new" and deleted with
8410 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8412 * src/text2.C (CutSelection): don't delete double spaces.
8413 (PasteSelection): ditto
8414 (CopySelection): ditto
8416 * src/text.C (Backspace): don't delete double spaces.
8418 * src/lyxlex.C (next): fix a bug that were only present with
8419 conformant std::istream::get to read comment lines, use
8420 std::istream::getline instead. This seems to fix the problem.
8422 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8424 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8425 allowed to insert space before space" editing problem. Please read
8426 commends at the beginning of the function. Comments about usage
8429 * src/text.C (InsertChar): fix for the "not allowed to insert
8430 space before space" editing problem.
8432 * src/text2.C (DeleteEmptyParagraphMechanism): when
8433 IsEmptyTableRow can only return false this last "else if" will
8434 always be a no-op. Commented out.
8436 * src/text.C (RedoParagraph): As far as I can understand tmp
8437 cursor is not really needed.
8439 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8440 present it could only return false anyway.
8441 (several functions): Did something not so smart...added a const
8442 specifier on a lot of methods.
8444 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8445 and add a tmp->text.resize. The LyXParagraph constructor does the
8447 (BreakParagraphConservative): ditto
8449 * src/support/path.h (Path): add a define so that the wrong usage
8450 "Path("/tmp") will be flagged as a compilation error:
8451 "`unnamed_Path' undeclared (first use this function)"
8453 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8455 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8456 which was bogus for several reasons.
8458 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8462 * autogen.sh: do not use "type -path" (what's that anyway?).
8464 * src/support/filetools.C (findtexfile): remove extraneous space
8465 which caused a kpsewhich warning (at least with kpathsea version
8468 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8470 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8472 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8474 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8476 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8478 * src/paragraph.C (BreakParagraph): do not reserve space on text
8479 if we don't need to (otherwise, if pos_end < pos, we end up
8480 reserving huge amounts of memory due to bad unsigned karma).
8481 (BreakParagraphConservative): ditto, although I have not seen
8482 evidence the bug can happen here.
8484 * src/lyxparagraph.h: add a using std::list.
8486 2000-01-11 Juergen Vigna <jug@sad.it>
8488 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8491 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8493 * src/vc-backend.C (doVCCommand): change to be static and take one
8494 more parameter: the path to chdir too be fore executing the command.
8495 (retrive): new function equiv to "co -r"
8497 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8498 file_not_found_hook is true.
8500 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8502 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8503 if a file is readwrite,readonly...anything else.
8505 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8507 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8508 (CreatePostscript): name change from MenuRunDVIPS (or something)
8509 (PreviewPostscript): name change from MenuPreviewPS
8510 (PreviewDVI): name change from MenuPreviewDVI
8512 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8513 \view_pdf_command., \pdf_to_ps_command
8515 * lib/configure.m4: added search for PDF viewer, and search for
8516 PDF to PS converter.
8517 (lyxrc.defaults output): add \pdflatex_command,
8518 \view_pdf_command and \pdf_to_ps_command.
8520 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8522 * src/bufferlist.C (write): we don't use blocksize for anything so
8525 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8527 * src/support/block.h: disable operator T* (), since it causes
8528 problems with both compilers I tried. See comments in the file.
8530 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8533 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8534 variable LYX_DIR_10x to LYX_DIR_11x.
8536 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8538 * INSTALL: document --with-lyxname.
8541 * configure.in: new configure flag --with-lyxname which allows to
8542 choose the name under which lyx is installed. Default is "lyx", of
8543 course. It used to be possible to do this with --program-suffix,
8544 but the later has in fact a different meaning for autoconf.
8546 * src/support/lstrings.h (lstrchr): reformat a bit.
8548 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8549 * src/mathed/math_defs.h: ditto.
8551 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8554 true, decides if we create a backup file or not when saving. New
8555 tag and variable \pdf_mode, defaults to false. New tag and
8556 variable \pdflatex_command, defaults to pdflatex. New tag and
8557 variable \view_pdf_command, defaults to xpdf. New tag and variable
8558 \pdf_to_ps_command, defaults to pdf2ps.
8560 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8562 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8563 does not have a BufferView.
8564 (unlockInset): ditto + don't access the_locking_inset if the
8565 buffer does not have a BufferView.
8567 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8568 certain circumstances so that we don't continue a keyboard
8569 operation long after the key was released. Try f.ex. to load a
8570 large document, press PageDown for some seconds and then release
8571 it. Before this change the document would contine to scroll for
8572 some time, with this change it stops imidiatly.
8574 * src/support/block.h: don't allocate more space than needed. As
8575 long as we don't try to write to the arr[x] in a array_type arr[x]
8576 it is perfectly ok. (if you write to it you might segfault).
8577 added operator value_type*() so that is possible to pass the array
8578 to functions expecting a C-pointer.
8580 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8583 * intl/*: updated to gettext 0.10.35, tried to add our own
8584 required modifications. Please verify.
8586 * po/*: updated to gettext 0.10.35, tried to add our own required
8587 modifications. Please verify.
8589 * src/support/lstrings.C (tostr): go at fixing the problem with
8590 cxx and stringstream. When stringstream is used return
8591 oss.str().c_str() so that problems with lyxstring and basic_string
8592 are avoided. Note that the best solution would be for cxx to use
8593 basic_string all the way, but it is not conformant yet. (it seems)
8595 * src/lyx_cb.C + other files: moved several global functions to
8596 class BufferView, some have been moved to BufferView.[Ch] others
8597 are still located in lyx_cb.C. Code changes because of this. (part
8598 of "get rid of current_view project".)
8600 * src/buffer.C + other files: moved several Buffer functions to
8601 class BufferView, the functions are still present in buffer.C.
8602 Code changes because of this.
8604 * config/lcmessage.m4: updated to most recent. used when creating
8607 * config/progtest.m4: updated to most recent. used when creating
8610 * config/gettext.m4: updated to most recent. applied patch for
8613 * config/gettext.m4.patch: new file that shows what changes we
8614 have done to the local copy of gettext.m4.
8616 * config/libtool.m4: new file, used in creation of acinclude.m4
8618 * config/lyxinclude.m4: new file, this is the lyx created m4
8619 macros, used in making acinclude.m4.
8621 * autogen.sh: GNU m4 discovered as a separate task not as part of
8622 the lib/configure creation.
8623 Generate acinlucde from files in config. Actually cat
8624 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8625 easier to upgrade .m4 files that really are external.
8627 * src/Spacing.h: moved using std::istringstream to right after
8628 <sstream>. This should fix the problem seen with some compilers.
8630 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8632 * src/lyx_cb.C: began some work to remove the dependency a lot of
8633 functions have on BufferView::text, even if not really needed.
8634 (GetCurrentTextClass): removed this func, it only hid the
8637 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8638 forgot this in last commit.
8640 * src/Bullet.C (bulletEntry): use static char const *[] for the
8641 tables, becuase of this the return arg had to change to string.
8643 (~Bullet): removed unneeded destructor
8645 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8646 (insetSleep): moved from Buffer
8647 (insetWakeup): moved from Buffer
8648 (insetUnlock): moved from Buffer
8650 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8651 from Buffer to BufferView.
8653 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8655 * config/ltmain.sh: updated to version 1.3.4 of libtool
8657 * config/ltconfig: updated to version 1.3.4 of libtool
8659 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8662 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8663 Did I get that right?
8665 * src/lyxlex.h: add a "using" directive or two.
8666 * src/Spacing.h: ditto.
8667 * src/insets/figinset.C: ditto.
8668 * src/support/filetools.C: ditto.
8669 * src/support/lstrings.C: ditto.
8670 * src/BufferView.C: ditto.
8671 * src/bufferlist.C: ditto.
8672 * src/lyx_cb.C: ditto.
8673 * src/lyxlex.C: ditto.
8675 * NEWS: add some changes for 1.1.4.
8677 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8679 * src/BufferView.C: first go at a TextCache to speed up switching
8682 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8684 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8685 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8686 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8687 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8690 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8691 members of the struct are correctly initialized to 0 (detected by
8693 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8694 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8696 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8697 pidwait, since it was allocated with "new". This was potentially
8698 very bad. Thanks to Michael Schmitt for running purify for us.
8701 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8703 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8705 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8707 1999-12-30 Allan Rae <rae@lyx.org>
8709 * lib/templates/IEEEtran.lyx: minor change
8711 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8712 src/mathed/formula.C (LocalDispatch): askForText changes
8714 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8715 know when a user has cancelled input. Fixes annoying problems with
8716 inserting labels and version control.
8718 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8720 * src/support/lstrings.C (tostr): rewritten to use strstream and
8723 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8725 * src/support/filetools.C (IsFileWriteable): use fstream to check
8726 (IsDirWriteable): use fileinfo to check
8728 * src/support/filetools.h (FilePtr): whole class deleted
8730 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8732 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8734 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8736 * src/bufferlist.C (write): use ifstream and ofstream instead of
8739 * src/Spacing.h: use istrstream instead of sscanf
8741 * src/mathed/math_defs.h: change first arg to istream from FILE*
8743 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8745 * src/mathed/math_parser.C: have yyis to be an istream
8746 (LexGetArg): use istream (yyis)
8748 (mathed_parse): ditto
8749 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8751 * src/mathed/formula.C (Read): rewritten to use istream
8753 * src/mathed/formulamacro.C (Read): rewritten to use istream
8755 * src/lyxlex.h (~LyXLex): deleted desturctor
8756 (getStream): new function, returns an istream
8757 (getFile): deleted funtion
8758 (IsOK): return is.good();
8760 * src/lyxlex.C (LyXLex): delete file and owns_file
8761 (setFile): open an filebuf and assign that to a istream instead of
8763 (setStream): new function, takes an istream as arg.
8764 (setFile): deleted function
8765 (EatLine): rewritten us use istream instead of FILE*
8769 * src/table.C (LyXTable): use istream instead of FILE*
8770 (Read): rewritten to take an istream instead of FILE*
8772 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8774 * src/buffer.C (Dispatch): remove an extraneous break statement.
8776 * src/support/filetools.C (QuoteName): change to do simple
8777 'quoting'. More work is necessary. Also changed to do nothing
8778 under emx (needs fix too).
8779 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8781 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8782 config.h.in to the AC_DEFINE_UNQUOTED() call.
8783 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8784 needs char * as argument (because Solaris 7 declares it like
8787 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8788 remove definition of BZERO.
8790 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8792 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8793 defined, "lyxregex.h" if not.
8795 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8797 (REGEX): new variable that is set to regex.c lyxregex.h when
8798 AM_CONDITIONAL USE_REGEX is set.
8799 (libsupport_la_SOURCES): add $(REGEX)
8801 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8804 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8807 * configure.in: add call to LYX_REGEX
8809 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8810 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8812 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8814 * lib/bind/fi_menus.bind: new file, from
8815 pauli.virtanen@saunalahti.fi.
8817 * src/buffer.C (getBibkeyList): pass the parameter delim to
8818 InsetInclude::getKeys and InsetBibtex::getKeys.
8820 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8821 is passed to Buffer::getBibkeyList
8823 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8824 instead of the hardcoded comma.
8826 * src/insets/insetbib.C (getKeys): make sure that there are not
8827 leading blanks in bibtex keys. Normal latex does not care, but
8828 harvard.sty seems to dislike blanks at the beginning of citation
8829 keys. In particular, the retturn value of the function is
8831 * INSTALL: make it clear that libstdc++ is needed and that gcc
8832 2.7.x probably does not work.
8834 * src/support/filetools.C (findtexfile): make debug message go to
8836 * src/insets/insetbib.C (getKeys): ditto
8838 * src/debug.C (showTags): make sure that the output is correctly
8841 * configure.in: add a comment for TWO_COLOR_ICON define.
8843 * acconfig.h: remove all the entries that already defined in
8844 configure.in or acinclude.m4.
8846 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8847 to avoid user name, date and copyright.
8849 1999-12-21 Juergen Vigna <jug@sad.it>
8851 * src/table.C (Read): Now read bogus row format informations
8852 if the format is < 5 so that afterwards the table can
8853 be read by lyx but without any format-info. Fixed the
8854 crash we experienced when not doing this.
8856 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8858 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8859 (RedoDrawingOfParagraph): ditto
8860 (RedoParagraphs): ditto
8861 (RemoveTableRow): ditto
8863 * src/text.C (Fill): rename arg paperwidth -> paper_width
8865 * src/buffer.C (insertLyXFile): rename var filename -> fname
8866 (writeFile): rename arg filename -> fname
8867 (writeFileAscii): ditto
8868 (makeLaTeXFile): ditto
8869 (makeLinuxDocFile): ditto
8870 (makeDocBookFile): ditto
8872 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8875 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8877 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8880 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8881 compiled by a C compiler not C++.
8883 * src/layout.h (LyXTextClass): added typedef for const_iterator
8884 (LyXTextClassList): added typedef for const_iterator + member
8885 functions begin and end.
8887 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8888 iterators to fill the choice_class.
8889 (updateLayoutChoice): rewritten to use iterators to fill the
8890 layoutlist in the toolbar.
8892 * src/BufferView.h (BufferView::work_area_width): removed unused
8895 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8897 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8898 (sgmlCloseTag): ditto
8900 * src/support/lstrings.h: return type of countChar changed to
8903 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8904 what version of this func to use. Also made to return unsigned int.
8906 * configure.in: call LYX_STD_COUNT
8908 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8909 conforming std::count.
8911 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8913 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8914 and a subscript would give bad display (patch from Dekel Tsur
8915 <dekel@math.tau.ac.il>).
8917 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8919 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8922 * src/chset.h: add a few 'using' directives
8924 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8925 triggered when no buffer is active
8927 * src/layout.C: removed `break' after `return' in switch(), since
8930 * src/lyx_main.C (init): make sure LyX can be ran in place even
8931 when libtool has done its magic with shared libraries. Fix the
8932 test for the case when the system directory has not been found.
8934 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8935 name for the latex file.
8936 (MenuMakeHTML): ditto
8938 * src/buffer.h: add an optional boolean argument, which is passed
8941 1999-12-20 Allan Rae <rae@lyx.org>
8943 * lib/templates/IEEEtran.lyx: small correction and update.
8945 * configure.in: Attempted to use LYX_PATH_HEADER
8947 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8949 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8950 input from JMarc. Now use preprocessor to find the header.
8951 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8952 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8953 LYX_STL_STRING_FWD. See comments in file.
8955 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8957 * The global MiniBuffer * minibuffer variable is dead.
8959 * The global FD_form_main * fd_form_main variable is dead.
8961 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8963 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8965 * src/table.h: add the LOstream.h header
8966 * src/debug.h: ditto
8968 * src/LyXAction.h: change the explaination of the ReadOnly
8969 attribute: is indicates that the function _can_ be used.
8971 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8974 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8976 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8982 * src/paragraph.C (GetWord): assert on pos>=0
8985 * src/support/lyxstring.C: condition the use of an invariant on
8987 * src/support/lyxstring.h: ditto
8989 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8990 Use LAssert.h instead of plain assert().
8992 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8994 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8995 * src/support/filetools.C: ditto
8997 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9000 * INSTALL: document the new configure flags
9002 * configure.in: suppress --with-debug; add --enable-assertions
9004 * acinclude.m4: various changes in alignment of help strings.
9006 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9008 * src/kbmap.C: commented out the use of the hash map in kb_map,
9009 beginning of movement to a stl::container.
9011 * several files: removed code that was not in effect when
9012 MOVE_TEXT was defined.
9014 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9015 for escaping should not be used. We can discuss if the string
9016 should be enclosed in f.ex. [] instead of "".
9018 * src/trans_mgr.C (insert): use the new returned value from
9019 encodeString to get deadkeys and keymaps done correctly.
9021 * src/chset.C (encodeString): changed to return a pair, to tell
9022 what to use if we know the string.
9024 * src/lyxscreen.h (fillArc): new function.
9026 * src/FontInfo.C (resize): rewritten to use more std::string like
9027 structore, especially string::replace.
9029 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9032 * configure.in (chmod +x some scripts): remove config/gcc-hack
9034 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9036 * src/buffer.C (writeFile): change once again the top comment in a
9037 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9038 instead of an hardcoded version number.
9039 (makeDocBookFile): ditto
9041 * src/version.h: add new define LYX_DOCVERSION
9043 * po/de.po: update from Pit Sütterlin
9044 * lib/bind/de_menus.bind: ditto.
9046 * src/lyxfunc.C (Dispatch): call MenuExport()
9047 * src/buffer.C (Dispatch): ditto
9049 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9050 LyXFunc::Dispatch().
9051 (MenuExport): new function, moved from
9052 LyXFunc::Dispatch().
9054 * src/trans_mgr.C (insert): small cleanup
9055 * src/chset.C (loadFile): ditto
9057 * lib/kbd/iso8859-1.cdef: add missing backslashes
9059 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9061 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9062 help with placing the manually drawn accents better.
9064 (Draw): x2 and hg changed to float to minimize rounding errors and
9065 help place the accents better.
9067 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9068 unsigned short to char is just wrong...cast the char to unsigned
9069 char instead so that the two values can compare sanely. This
9070 should also make the display of insetlatexaccents better and
9071 perhaps also some other insets.
9073 (lbearing): new function
9076 1999-12-15 Allan Rae <rae@lyx.org>
9078 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9079 header that provides a wrapper around the very annoying SGI STL header
9082 * src/support/lyxstring.C, src/LString.h:
9083 removed old SGI-STL-compatability attempts.
9085 * configure.in: Use LYX_STL_STRING_FWD.
9087 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9088 stl_string_fwd.h is around and try to determine it's location.
9089 Major improvement over previous SGI STL 3.2 compatability.
9090 Three small problems remain with this function due to my zero
9091 knowledge of autoconf. JMarc and lgb see the comments in the code.
9093 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9095 * src/broken_const.h, config/hack-gcc, config/README: removed
9097 * configure.in: remove --with-gcc-hack option; do not call
9100 * INSTALL: remove documentation of --with-broken-const and
9103 * acconfig.h: remove all trace of BROKEN_CONST define
9105 * src/buffer.C (makeDocBookFile): update version number in output
9107 (SimpleDocBookOnePar): fix an assert when trying to a character
9108 access beyond string length
9111 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9113 * po/de.po: fix the Export menu
9115 * lyx.man: update the description of -dbg
9117 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9118 (commandLineHelp): updated
9119 (easyParse): show list of available debug levels if -dbg is passed
9122 * src/Makefile.am: add debug.C
9124 * src/debug.h: moved some code to debug.C
9126 * src/debug.C: new file. Contains code to set and show debug
9129 * src/layout.C: remove 'break' after 'continue' in switch
9130 statements, since these cannot be reached.
9132 1999-12-13 Allan Rae <rae@lyx.org>
9134 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9135 (in_word_set): hash() -> math_hash()
9137 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9139 * acconfig.h: Added a test for whether we are using exceptions in the
9140 current compilation run. If so USING_EXCEPTIONS is defined.
9142 * config.in: Check for existance of stl_string_fwd.h
9143 * src/LString.h: If compiling --with-included-string and SGI's
9144 STL version 3.2 is present (see above test) we need to block their
9145 forward declaration of string and supply a __get_c_string().
9146 However, it turns out this is only necessary if compiling with
9147 exceptions enabled so I've a bit more to add yet.
9149 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9150 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9151 src/support/LRegex.h, src/undo.h:
9152 Shuffle the order of the included files a little to ensure that
9153 LString.h gets included before anything that includes stl_string_fwd.h
9155 * src/support/lyxstring.C: We need to #include LString.h instead of
9156 lyxstring.h to get the necessary definition of __get_c_string.
9157 (__get_c_string): New function. This is defined static just like SGI's
9158 although why they need to do this I'm not sure. Perhaps it should be
9159 in lstrings.C instead.
9161 * lib/templates/IEEEtran.lyx: New template file.
9163 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9166 * intl/Makefile.in (MKINSTALLDIRS): ditto
9168 * src/LyXAction.C (init): changed to hold the LFUN data in a
9169 automatic array in stead of in callso to newFunc, this speeds up
9170 compilation a lot. Also all the memory used by the array is
9171 returned when the init is completed.
9173 * a lot of files: compiled with -Wold-style-cast, changed most of
9174 the reported offenders to C++ style casts. Did not change the
9175 offenders in C files.
9177 * src/trans.h (Match): change argument type to unsigned int.
9179 * src/support/DebugStream.C: fix some types on the streambufs so
9180 that it works on a conforming implementation.
9182 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9186 * src/support/lyxstring.C: remove the inline added earlier since
9187 they cause a bunch of unsatisfied symbols when linking with dec
9188 cxx. Cxx likes to have the body of inlines at the place where they
9191 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9192 accessing negative bounds in array. This fixes the crash when
9193 inserting accented characters.
9194 * src/trans.h (Match): ditto
9196 * src/buffer.C (Dispatch): since this is a void, it should not try
9197 to return anything...
9199 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9201 * src/buffer.h: removed the two friends from Buffer. Some changes
9202 because of this. Buffer::getFileName and Buffer::setFileName
9203 renamed to Buffer::fileName() and Buffer::fileName(...).
9205 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9207 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9208 and Buffer::update(short) to BufferView. This move is currently
9209 controlled by a define MOVE_TEXT, this will be removed when all
9210 shows to be ok. This move paves the way for better separation
9211 between buffer contents and buffer view. One side effect is that
9212 the BufferView needs a rebreak when swiching buffers, if we want
9213 to avoid this we can add a cache that holds pointers to LyXText's
9214 that is not currently in use.
9216 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9219 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9221 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9223 * lyx_main.C: new command line option -x (or --execute) and
9224 -e (or --export). Now direct conversion from .lyx to .tex
9225 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9226 Unfortunately, X is still needed and the GUI pops up during the
9229 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9231 * src/Spacing.C: add a using directive to bring stream stuff into
9233 * src/paragraph.C: ditto
9234 * src/buffer.C: ditto
9236 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9237 from Lars' announcement).
9239 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9240 example files from Tino Meinen.
9242 1999-12-06 Allan Rae <rae@lyx.org>
9244 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9246 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9248 * src/support/lyxstring.C: added a lot of inline for no good
9251 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9252 latexWriteEndChanges, they were not used.
9254 * src/layout.h (operator<<): output operator for PageSides
9256 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9258 * some example files: loaded in LyX 1.0.4 and saved again to update
9259 certain constructs (table format)
9261 * a lot of files: did the change to use fstream/iostream for all
9262 writing of files. Done with a close look at Andre Poenitz's patch.
9264 * some files: whitespace changes.
9266 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9268 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9269 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9270 architecture, we provide our own. It is used unconditionnally, but
9271 I do not think this is a performance problem. Thanks to Angus
9272 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9273 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9275 (GetInset): use my_memcpy.
9279 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9280 it is easier to understand, but it uses less TeX-only constructs now.
9282 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9283 elements contain spaces
9285 * lib/configure: regenerated
9287 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9288 elements contain spaces; display the list of programs that are
9291 * autogen.sh: make sure lib/configure is executable
9293 * lib/examples/*: rename the tutorial examples to begin with the
9294 two-letters language code.
9296 * src/lyxfunc.C (getStatus): do not query current font if no
9299 * src/lyx_cb.C (RunScript): use QuoteName
9300 (MenuRunDvips): ditto
9301 (PrintApplyCB): ditto
9303 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9304 around argument, so that it works well with the current shell.
9305 Does not work properly with OS/2 shells currently.
9307 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9308 * src/LyXSendto.C (SendtoApplyCB): ditto
9309 * src/lyxfunc.C (Dispatch): ditto
9310 * src/buffer.C (runLaTeX): ditto
9311 (runLiterate): ditto
9312 (buildProgram): ditto
9314 * src/lyx_cb.C (RunScript): ditto
9315 (MenuMakeLaTeX): ditto
9317 * src/buffer.h (getLatexName): new method
9319 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9321 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9323 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9324 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9325 (create_math_panel): ditto
9327 * src/lyxfunc.C (getStatus): re-activate the code which gets
9328 current font and cursor; add test for export to html.
9330 * src/lyxrc.C (read): remove unreachable break statements; add a
9333 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9335 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9337 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9338 introduced by faulty regex.
9339 * src/buffer.C: ditto
9340 * src/lastfiles.C: ditto
9341 * src/paragraph.C: ditto
9342 * src/table.C: ditto
9343 * src/vspace.C: ditto
9344 * src/insets/figinset.C: ditto
9345 Note: most of these is absolutely harmless, except the one in
9346 src/mathed formula.C.
9348 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9350 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9351 operation, yielding correct results for the reLyX command.
9353 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9355 * src/support/filetools.C (ExpandPath): removed an over eager
9357 (ReplaceEnvironmentPath): ditto
9359 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9360 shows that we are doing something fishy in our code...
9364 * src/lyxrc.C (read): use a double switch trick to get more help
9365 from the compiler. (the same trick is used in layout.C)
9366 (write): new function. opens a ofstream and pass that to output
9367 (output): new function, takes a ostream and writes the lyxrc
9368 elemts to it. uses a dummy switch to make sure no elements are
9371 * src/lyxlex.h: added a struct pushpophelper for use in functions
9372 with more than one exit point.
9374 * src/lyxlex.[Ch] (GetInteger): made it const
9378 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9380 * src/layout.[hC] : LayoutTags splitted into several enums, new
9381 methods created, better error handling cleaner use of lyxlex. Read
9384 * src/bmtable.[Ch]: change some member prototypes because of the
9385 image const changes.
9387 * commandtags.h, src/LyXAction.C (init): new function:
9388 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9389 This file is not read automatically but you can add \input
9390 preferences to your lyxrc if you want to. We need to discuss how
9393 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9394 in .aux, also remove .bib and .bst files from dependencies when
9397 * src/BufferView.C, src/LyXView.C: add const_cast several places
9398 because of changes to images.
9400 * lib/images/*: same change as for images/*
9402 * lib/lyxrc.example: Default for accept_compound is false not no.
9404 * images/*: changed to be const, however I have som misgivings
9405 about this change so it might be changed back.
9407 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9409 * lib/configure, po/POTFILES.in: regenerated
9411 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9413 * config/lib_configure.m4: removed
9415 * lib/configure.m4: new file (was config/lib_configure.m4)
9417 * configure.in: do not test for rtti, since we do not use it.
9419 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9421 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9422 doubling of allocated space scheme. This makes it faster for large
9423 strings end to use less memory for small strings. xtra rememoved.
9425 * src/insets/figinset.C (waitalarm): commented out.
9426 (GhostscriptMsg): use static_cast
9427 (GhostscriptMsg): use new instead of malloc to allocate memory for
9428 cmap. also delete the memory after use.
9430 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9432 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9433 for changes in bibtex database or style.
9434 (runBibTeX): remove all .bib and .bst files from dep before we
9436 (run): use scanAuc in when dep file already exist.
9438 * src/DepTable.C (remove_files_with_extension): new method
9441 * src/DepTable.[Ch]: made many of the methods const.
9443 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9445 * src/bufferparams.C: make sure that the default textclass is
9446 "article". It used to be the first one by description order, but
9447 now the first one is "docbook".
9449 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9450 string; call Debug::value.
9451 (easyParse): pass complete argument to setDebuggingLevel().
9453 * src/debug.h (value): fix the code that parses debug levels.
9455 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9458 * src/LyXAction.C: use Debug::ACTION as debug channel.
9460 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9462 * NEWS: updated for the future 1.1.3 release.
9464 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9465 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9466 it should. This is of course a controversial change (since many
9467 people will find that their lyx workscreen is suddenly full of
9468 red), but done for the sake of correctness.
9470 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9471 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9473 * src/insets/inseterror.h, src/insets/inseturl.h,
9474 src/insets/insetinfo.h, src/insets/figinset.h,
9475 src/mathed/formulamacro.h, src/mathed/math_macro.h
9476 (EditMessage): add a missing const and add _() to make sure that
9479 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9480 src/insets/insetbib.C, src/support/filetools.C: add `using'
9483 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9484 doing 'Insert index of last word' at the beginning of a paragraph.
9486 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9488 * several files: white-space changes.
9490 * src/mathed/formula.C: removed IsAlpha and IsDigit
9492 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9493 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9496 * src/insets/figinset.C (GetPSSizes): don't break when
9497 "EndComments" is seen. But break when a boundingbox is read.
9499 * all classes inherited from Inset: return value of Clone
9500 changed back to Inset *.
9502 * all classes inherited form MathInset: return value of Clone
9503 changed back to MathedInset *.
9505 * src/insets/figinset.C (runqueue): use a ofstream to output the
9506 gs/ps file. Might need some setpresicion or setw. However I can
9507 see no problem with the current code.
9508 (runqueue): use sleep instead of the alarm/signal code. I just
9509 can't see the difference.
9511 * src/paragraph.C (LyXParagraph): reserve space in the new
9512 paragraph and resize the inserted paragraph to just fit.
9514 * src/lyxfunc.h (operator|=): added operator for func_status.
9516 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9517 check for readable file.
9519 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9520 check for readable file.
9521 (MenuMakeLinuxDoc): ditto
9522 (MenuMakeDocBook): ditto
9523 (MenuMakeAscii): ditto
9524 (InsertAsciiFile): split the test for openable and readable
9526 * src/bmtable.C (draw_bitmaptable): use
9527 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9529 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9530 findtexfile from LaTeX to filetools.
9532 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9533 instead of FilePtr. Needs to be verified by a literate user.
9535 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9537 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9538 (EditMessage): likewise.
9540 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9541 respectively as \textasciitilde and \textasciicircum.
9543 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9545 * src/support/lyxstring.h: made the methods that take iterators
9548 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9549 (regexMatch): made is use the real regex class.
9551 * src/support/Makefile.am: changed to use libtool
9553 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9555 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9557 (MathIsInset ++): changed several macros to be inline functions
9560 * src/mathed/Makefile.am: changed to use libtool
9562 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9564 * src/insets/inset* : Clone changed to const and return type is
9565 the true insettype not just Inset*.
9567 * src/insets/Makefile.am: changed to use libtool
9569 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9571 * src/undo.[Ch] : added empty() and changed some of the method
9574 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9576 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9577 setID use block<> for the bullets array, added const several places.
9579 * src/lyxfunc.C (getStatus): new function
9581 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9582 LyXAction, added const to several funtions.
9584 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9585 a std::map, and to store the dir items in a vector.
9587 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9590 * src/LyXView.[Ch] + other files : changed currentView to view.
9592 * src/LyXAction.[Ch] : ported from the old devel branch.
9594 * src/.cvsignore: added .libs and a.out
9596 * configure.in : changes to use libtool.
9598 * acinclude.m4 : inserted libtool.m4
9600 * .cvsignore: added libtool
9602 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9604 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9605 file name in insets and mathed directories (otherwise the
9606 dependency is not taken in account under cygwin).
9608 * src/text2.C (InsertString[AB]): make sure that we do not try to
9609 read characters past the string length.
9611 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9613 * lib/doc/LaTeXConfig.lyx.in,
9614 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9616 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9617 file saying who created them and when this heppened; this is
9618 useless and annoys tools like cvs.
9620 * lib/layouts/g-brief-{en,de}.layout,
9621 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9622 from Thomas Hartkens <thomas@hartkens.de>.
9624 * src/{insets,mathed}/Makefile.am: do not declare an empty
9625 LDFLAGS, so that it can be set at configure time (useful on Irix
9628 * lib/reLyX/configure.in: make sure that the prefix is set
9629 correctly in LYX_DIR.
9631 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9633 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9634 be used by 'command-sequence' this allows to bind a key to a
9635 sequence of LyX-commands
9636 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9638 * src/LyXAction.C: add "command-sequence"
9640 * src/LyXFunction.C: handling of "command-sequence"
9642 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9643 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9645 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9647 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9649 * src/buffer.C (writeFile): Do not output a comment giving user
9650 and date at the beginning of a .lyx file. This is useless and
9651 annoys cvs anyway; update version number to 1.1.
9653 * src/Makefile.am (LYX_DIR): add this definition, so that a
9654 default path is hardcoded in LyX.
9656 * configure.in: Use LYX_GNU_GETTEXT.
9658 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9659 AM_GNU_GETTEXT with a bug fixed.
9661 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9663 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9665 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9666 which is used to point to LyX data is now LYX_DIR_11x.
9668 * lyx.man: convert to a unix text file; small updates.
9670 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9672 * src/support/LSubstring.[Ch]: made the second arg of most of the
9673 constructors be a const reference.
9675 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9678 * src/support/lyxstring.[Ch] (swap): added missing member function
9679 and specialization of swap(str, str);
9681 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9683 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9684 trace of the old one.
9686 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9687 put the member definitions in undo.C.
9689 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9690 NEW_TEXT and have now only code that was included when this was
9693 * src/intl.C (LCombo): use static_cast
9695 (DispatchCallback): ditto
9697 * src/definitions.h: removed whole file
9699 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9701 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9702 parsing and stores in a std:map. a regex defines the file format.
9703 removed unneeded members.
9705 * src/bufferparams.h: added several enums from definitions.h here.
9706 Removed unsused destructor. Changed some types to use proper enum
9707 types. use block to have the temp_bullets and user_defined_bullets
9708 and to make the whole class assignable.
9710 * src/bufferparams.C (Copy): removed this functions, use a default
9713 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9716 * src/buffer.C (readLyXformat2): commend out all that have with
9717 oldpapersize to do. also comment out all that hve to do with
9718 insetlatex and insetlatexdel.
9719 (setOldPaperStuff): commented out
9721 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9723 * src/LyXAction.C: remove use of inset-latex-insert
9725 * src/mathed/math_panel.C (button_cb): use static_cast
9727 * src/insets/Makefile.am (insets_o_SOURCES): removed
9730 * src/support/lyxstring.C (helper): use the unsigned long
9731 specifier, UL, instead of a static_cast.
9733 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9735 * src/support/block.h: new file. to be used as a c-style array in
9736 classes, so that the class can be assignable.
9738 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9740 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9741 NULL, make sure to return an empty string (it is not possible to
9742 set a string to NULL).
9744 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9746 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9748 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9750 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9751 link line, so that Irix users (for example) can set it explicitely to
9754 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9755 it can be overidden at make time (static or dynamic link, for
9758 * src/vc-backend.C, src/LaTeXFeatures.h,
9759 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9760 statements to bring templates to global namespace.
9762 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9764 * src/support/lyxstring.C (operator[] const): make it standard
9767 * src/minibuffer.C (Init): changed to reflect that more
9768 information is given from the lyxvc and need not be provided here.
9770 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9772 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9774 * src/LyXView.C (UpdateTimerCB): use static_cast
9775 (KeyPressMask_raw_callback): ditto
9777 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9778 buffer_, a lot of changes because of this. currentBuffer() ->
9779 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9780 also changes to other files because of this.
9782 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9784 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9785 have no support for RCS and partial support for CVS, will be
9788 * src/insets/ several files: changes because of function name
9789 changes in Bufferview and LyXView.
9791 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9793 * src/support/LSubstring.[Ch]: new files. These implement a
9794 Substring that can be very convenient to use. i.e. is this
9796 string a = "Mary had a little sheep";
9797 Substring(a, "sheep") = "lamb";
9798 a is now "Mary has a little lamb".
9800 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9801 out patterns and subpatterns of strings. It is used by LSubstring
9802 and also by vc-backend.C
9804 * src/support/lyxstring.C: went over all the assertions used and
9805 tried to correct the wrong ones and flag which of them is required
9806 by the standard. some bugs found because of this. Also removed a
9807 couple of assertions.
9809 * src/support/Makefile.am (libsupport_a_SOURCES): added
9810 LSubstring.[Ch] and LRegex.[Ch]
9812 * src/support/FileInfo.h: have struct stat buf as an object and
9813 not a pointer to one, some changes because of this.
9815 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9816 information in layout when adding the layouts preamble to the
9819 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9822 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9823 because of bug in OS/2.
9825 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9827 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9828 \verbatim@font instead of \ttfamily, so that it can be redefined.
9830 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9831 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9832 src/layout.h, src/text2.C: add 'using' directive to bring the
9833 STL templates we need from the std:: namespace to the global one.
9834 Needed by DEC cxx in strict ansi mode.
9836 * src/support/LIstream.h,src/support/LOstream.h,
9837 src/support/lyxstring.h,src/table.h,
9838 src/lyxlookup.h: do not include <config.h> in header
9839 files. This should be done in the .C files only.
9841 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9845 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9847 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9848 from Kayvan to fix the tth invokation.
9850 * development/lyx.spec.in: updates from Kayvan to reflect the
9851 changes of file names.
9853 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9855 * src/text2.C (InsertStringB): use std::copy
9856 (InsertStringA): use std::copy
9858 * src/bufferlist.C: use a vector to store the buffers in. This is
9859 an internal change and should not affect any other thing.
9861 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9864 * src/text.C (Fill): fix potential bug, one off bug.
9866 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9868 * src/Makefile.am (lyx_main.o): add more files it depends on.
9870 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9872 * src/support/lyxstring.C: use size_t for the reference count,
9873 size, reserved memory and xtra.
9874 (internal_compare): new private member function. Now the compare
9875 functions should work for std::strings that have embedded '\0'
9877 (compare): all compare functions rewritten to use
9880 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9882 * src/support/lyxstring.C (compare): pass c_str()
9883 (compare): pass c_str
9884 (compare): pass c_str
9886 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9888 * src/support/DebugStream.C: <config.h> was not included correctly.
9890 * lib/configure: forgot to re-generate it :( I'll make this file
9891 auto generated soon.
9893 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9895 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9898 * src/support/lyxstring.C: some changes from length() to rep->sz.
9899 avoids a function call.
9901 * src/support/filetools.C (SpaceLess): yet another version of the
9902 algorithm...now per Jean-Marc's suggestions.
9904 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9906 * src/layout.C (less_textclass_desc): functor for use in sorting
9908 (LyXTextClass::Read): sort the textclasses after reading.
9910 * src/support/filetools.C (SpaceLess): new version of the
9911 SpaceLess functions. What problems does this one give? Please
9914 * images/banner_bw.xbm: made the arrays unsigned char *
9916 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9918 * src/support/lyxstring.C (find): remove bogus assertion in the
9919 two versions of find where this has not been done yet.
9921 * src/support/lyxlib.h: add missing int return type to
9924 * src/menus.C (ShowFileMenu): disable exporting to html if no
9925 html export command is present.
9927 * config/lib_configure.m4: add a test for an HTML converter. The
9928 programs checked for are, in this order: tth, latex2html and
9931 * lib/configure: generated from config/lib_configure.m4.
9933 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9934 html converter. The parameters are now passed through $$FName and
9935 $$OutName, instead of standard input/output.
9937 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9939 * lib/lyxrc.example: update description of \html_command.
9940 add "quotes" around \screen_font_xxx font setting examples to help
9941 people who use fonts with spaces in their names.
9943 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9945 * Distribution files: updates for v1.1.2
9947 * src/support/lyxstring.C (find): remove bogus assert and return
9948 npos for the same condition.
9950 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9952 * added patch for OS/2 from SMiyata.
9954 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9956 * src/text2.C (CutSelection): make space_wrapped a bool
9957 (CutSelection): dont declare int i until we have to.
9958 (alphaCounter): return a char const *.
9960 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9962 * src/support/syscall.C (Systemcalls::kill):
9963 src/support/filetools.C (PutEnv, PutEnvPath):
9964 src/lyx_cb.C (addNewlineAndDepth):
9965 src/FontInfo.C (FontInfo::resize): condition some #warning
9966 directives with WITH_WARNINGS.
9969 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9971 * src/layout.[Ch] + several files: access to class variables
9972 limited and made accessor functions instead a lot of code changed
9973 becuase of this. Also instead of returning pointers often a const
9974 reference is returned instead.
9976 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9978 * src/Makefile.am (dist-hook): added used to remove the CVS from
9979 cheaders upon creating a dist
9980 (EXTRA_DIST): added cheaders
9982 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9983 a character not as a small integer.
9985 * src/support/lyxstring.C (find): removed Assert and added i >=
9986 rep->sz to the first if.
9988 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9990 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9991 src/LyXView.C src/buffer.C src/bufferparams.C
9992 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9993 src/text2.C src/insets/insetinclude.C:
9994 lyxlayout renamed to textclasslist.
9996 * src/layout.C: some lyxerr changes.
9998 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9999 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10000 (LyXLayoutList): removed all traces of this class.
10001 (LyXTextClass::Read): rewrote LT_STYLE
10002 (LyXTextClass::hasLayout): new function
10003 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10004 both const and nonconst version.
10005 (LyXTextClass::delete_layout): new function.
10006 (LyXTextClassList::Style): bug fix. do the right thing if layout
10008 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10009 (LyXTextClassList::NameOfLayout): ditto
10010 (LyXTextClassList::Load): ditto
10012 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10014 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10016 * src/LyXAction.C (LookupFunc): added a workaround for sun
10017 compiler, on the other hand...we don't know if the current code
10018 compiles on sun at all...
10020 * src/support/filetools.C (CleanupPath): subst fix
10022 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10025 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10026 complained about this one?
10028 * src/insets/insetinclude.C (Latex): subst fix
10030 * src/insets/insetbib.C (getKeys): subst fix
10032 * src/LyXSendto.C (SendtoApplyCB): subst fix
10034 * src/lyx_main.C (init): subst fix
10036 * src/layout.C (Read): subst fix
10038 * src/lyx_sendfax_main.C (button_send): subst fix
10040 * src/buffer.C (RoffAsciiTable): subst fix
10042 * src/lyx_cb.C (MenuFax): subst fix
10043 (PrintApplyCB): subst fix
10045 1999-10-26 Juergen Vigna <jug@sad.it>
10047 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10049 (Read): Cleaned up this code so now we read only format vestion >= 5
10051 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10053 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10054 come nobody has complained about this one?
10056 * src/insets/insetinclude.C (Latex): subst fix
10058 * src/insets/insetbib.C (getKeys): subst fix
10060 * src/lyx_main.C (init): subst fix
10062 * src/layout.C (Read): subst fix
10064 * src/buffer.C (RoffAsciiTable): subst fix
10066 * src/lyx_cb.C (MenuFax): subst fix.
10068 * src/layout.[hC] + some other files: rewrote to use
10069 std::container to store textclasses and layouts in.
10070 Simplified, removed a lot of code. Make all classes
10071 assignable. Further simplifications and review of type
10072 use still to be one.
10074 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10075 lastfiles to create the lastfiles partr of the menu.
10077 * src/lastfiles.[Ch]: rewritten to use deque to store the
10078 lastfiles in. Uses fstream for reading and writing. Simplifies
10081 * src/support/syscall.C: remove explicit cast.
10083 * src/BufferView.C (CursorToggleCB): removed code snippets that
10084 were commented out.
10085 use explicat C++ style casts instead of C style casts. also use
10086 u_vdata instea of passing pointers in longs.
10088 * src/PaperLayout.C: removed code snippets that were commented out.
10090 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10092 * src/lyx_main.C: removed code snippets that wer commented out.
10094 * src/paragraph.C: removed code snippets that were commented out.
10096 * src/lyxvc.C (logClose): use static_cast
10098 (viewLog): remove explicit cast to void*
10099 (showLog): removed old commented code
10101 * src/menus.C: use static_cast instead of C style casts. use
10102 u_vdata instead of u_ldata. remove explicit cast to (long) for
10103 pointers. Removed old code that was commented out.
10105 * src/insets/inset.C: removed old commented func
10107 * src/insets/insetref.C (InsetRef): removed old code that had been
10108 commented out for a long time.
10110 (escape): removed C style cast
10112 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10114 * src/insets/insetlatex.C (Draw): removed old commented code
10115 (Read): rewritten to use string
10117 * src/insets/insetlabel.C (escape): removed C style cast
10119 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10121 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10122 old commented code.
10124 * src/insets/insetinclude.h: removed a couple of stupid bools
10126 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10127 (Clone): remove C style cast
10128 (getKeys): changed list to lst because of std::list
10130 * src/insets/inseterror.C (Draw): removed som old commented code.
10132 * src/insets/insetcommand.C (Draw): removed some old commented code.
10134 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10135 commented out forever.
10136 (bibitem_cb): use static_cast instead of C style cast
10137 use of vdata changed to u_vdata.
10139 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10141 (CloseUrlCB): use static_cast instead of C style cast.
10142 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10144 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10145 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10146 (CloseInfoCB): static_cast from ob->u_vdata instead.
10147 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10150 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10151 (C_InsetError_CloseErrorCB): forward the ob parameter
10152 (CloseErrorCB): static_cast from ob->u_vdata instead.
10154 * src/vspace.h: include LString.h since we use string in this class.
10156 * src/vspace.C (lyx_advance): changed name from advance because of
10157 nameclash with stl. And since we cannot use namespaces yet...I
10158 used a lyx_ prefix instead. Expect this to change when we begin
10161 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10163 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10164 and removed now defunct constructor and deconstructor.
10166 * src/BufferView.h: have backstack as a object not as a pointer.
10167 removed initialization from constructor. added include for BackStack
10169 * development/lyx.spec.in (%build): add CFLAGS also.
10171 * src/screen.C (drawFrame): removed another warning.
10173 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10175 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10176 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10177 README and ANNOUNCE a bit for the next release. More work is
10180 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10181 unbreakable if we are in freespacing mode (LyX-Code), but not in
10184 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10186 * src/BackStack.h: fixed initialization order in constructor
10188 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10190 * acinclude.m4 (VERSION): new rules for when a version is
10191 development, added also a variable for prerelease.
10192 (warnings): we set with_warnings=yes for prereleases
10193 (lyx_opt): prereleases compile with same optimization as development
10194 (CXXFLAGS): only use pedantic if we are a development version
10196 * src/BufferView.C (restorePosition): don't do anything if the
10197 backstack is empty.
10199 * src/BackStack.h: added member empty, use this to test if there
10200 is anything to pop...
10202 1999-10-25 Juergen Vigna <jug@sad.it>
10205 * forms/layout_forms.fd +
10206 * forms/latexoptions.fd +
10207 * lyx.fd: changed for various form resize issues
10209 * src/mathed/math_panel.C +
10210 * src/insets/inseterror.C +
10211 * src/insets/insetinfo.C +
10212 * src/insets/inseturl.C +
10213 * src/insets/inseturl.h +
10215 * src/LyXSendto.C +
10216 * src/PaperLayout.C +
10217 * src/ParagraphExtra.C +
10218 * src/TableLayout.C +
10220 * src/layout_forms.C +
10227 * src/menus.C: fixed various resize issues. So now forms can be
10228 resized savely or not be resized at all.
10230 * forms/form_url.fd +
10231 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10234 * src/insets/Makefile.am: added files form_url.[Ch]
10236 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10238 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10239 (and presumably 6.2).
10241 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10242 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10243 remaining static member callbacks.
10245 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10248 * src/support/lyxstring.h: declare struct Srep as friend of
10249 lyxstring, since DEC cxx complains otherwise.
10251 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10253 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10255 * src/LaTeX.C (run): made run_bibtex also depend on files with
10257 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10258 are put into the dependency file.
10260 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10261 the code has shown itself to work
10262 (create_ispell_pipe): removed another warning, added a comment
10265 * src/minibuffer.C (ExecutingCB): removed code that has been
10266 commented out a long time
10268 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10269 out code + a warning.
10271 * src/support/lyxstring.h: comment out the three private
10272 operators, when compiling with string ansi conforming compilers
10273 they make problems.
10275 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10277 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10278 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10281 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10284 * src/mathed/math_panel.C (create_math_panel): remove explicit
10287 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10290 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10291 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10292 to XCreatePixmapFromBitmapData
10293 (fl_set_bmtable_data): change the last argument to be unsigned
10295 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10296 and bh to be unsigned int, remove explicit casts in call to
10297 XReadBitmapFileData.
10299 * images/arrows.xbm: made the arrays unsigned char *
10300 * images/varsz.xbm: ditto
10301 * images/misc.xbm: ditto
10302 * images/greek.xbm: ditto
10303 * images/dots.xbm: ditto
10304 * images/brel.xbm: ditto
10305 * images/bop.xbm: ditto
10307 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10309 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10310 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10311 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10313 (LYX_CXX_CHEADERS): added <clocale> to the test.
10315 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10317 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10319 * src/support/lyxstring.C (append): fixed something that must be a
10320 bug, rep->assign was used instead of rep->append.
10322 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10325 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10326 lyx insert double chars. Fix spotted by Kayvan.
10328 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10330 * Fixed the tth support. I messed up with the Emacs patch apply feature
10331 and omitted the changes in lyxrc.C.
10333 1999-10-22 Juergen Vigna <jug@sad.it>
10335 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10337 * src/lyx_cb.C (MenuInsertRef) +
10338 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10339 the form cannot be resized under it limits (fixes a segfault)
10341 * src/lyx.C (create_form_form_ref) +
10342 * forms/lyx.fd: Changed Gravity on name input field so that it is
10345 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10347 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10348 <ostream> and <istream>.
10350 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10351 whether <fstream> provides the latest standard features, or if we
10352 have an oldstyle library (like in egcs).
10353 (LYX_CXX_STL_STRING): fix the test.
10355 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10356 code on MODERN_STL_STREAM.
10358 * src/support/lyxstring.h: use L{I,O}stream.h.
10360 * src/support/L{I,O}stream.h: new files, designed to setup
10361 correctly streams for our use
10362 - includes the right header depending on STL capabilities
10363 - puts std::ostream and std::endl (for LOStream.h) or
10364 std::istream (LIStream.h) in toplevel namespace.
10366 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10368 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10369 was a bib file that had been changed we ensure that bibtex is run.
10370 (runBibTeX): enhanced to extract the names of the bib files and
10371 getting their absolute path and enter them into the dep file.
10372 (findtexfile): static func that is used to look for tex-files,
10373 checks for absolute patchs and tries also with kpsewhich.
10374 Alternative ways of finding the correct files are wanted. Will
10376 (do_popen): function that runs a command using popen and returns
10377 the whole output of that command in a string. Should be moved to
10380 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10381 file with extension ext has changed.
10383 * src/insets/figinset.C: added ifdef guards around the fl_free
10384 code that jug commented out. Now it is commented out when
10385 compiling with XForms == 0.89.
10387 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10388 to lyxstring.C, and only keep a forward declaration in
10389 lyxstring.h. Simplifies the header file a bit and should help a
10390 bit on compile time too. Also changes to Srep will not mandate a
10391 recompile of code just using string.
10392 (~lyxstring): definition moved here since it uses srep.
10393 (size): definition moved here since it uses srep.
10395 * src/support/lyxstring.h: removed a couple of "inline" that should
10398 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10400 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10403 1999-10-21 Juergen Vigna <jug@sad.it>
10405 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10406 set to left if I just remove the width entry (or it is empty).
10408 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10409 paragraph when having dummy paragraphs.
10411 1999-10-20 Juergen Vigna <jug@sad.it>
10413 * src/insets/figinset.C: just commented some fl_free_form calls
10414 and added warnings so that this calls should be activated later
10415 again. This avoids for now a segfault, but we have a memory leak!
10417 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10418 'const char * argument' to 'string argument', this should
10419 fix some Asserts() in lyxstring.C.
10421 * src/lyxfunc.h: Removed the function argAsString(const char *)
10422 as it is not used anymore.
10424 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10426 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10429 * src/Literate.h: some funcs moved from public to private to make
10430 interface clearer. Unneeded args removed.
10432 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10434 (scanBuildLogFile): ditto
10436 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10437 normal TeX Error. Still room for improvement.
10439 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10441 * src/buffer.C (insertErrors): changes to make the error
10442 desctription show properly.
10444 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10447 * src/support/lyxstring.C (helper): changed to use
10448 sizeof(object->rep->ref).
10449 (operator>>): changed to use a pointer instead.
10451 * src/support/lyxstring.h: changed const reference & to value_type
10452 const & lets see if that helps.
10454 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10456 * Makefile.am (rpmdist): fixed to have non static package and
10459 * src/support/lyxstring.C: removed the compilation guards
10461 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10464 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10465 conditional compile of lyxstring.Ch
10467 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10468 stupid check, but it is a lot better than the bastring hack.
10469 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10471 * several files: changed string::erase into string::clear. Not
10474 * src/chset.C (encodeString): use a char temporary instead
10476 * src/table.C (TexEndOfCell): added tostr around
10477 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10478 (TexEndOfCell): ditto
10479 (TexEndOfCell): ditto
10480 (TexEndOfCell): ditto
10481 (DocBookEndOfCell): ditto
10482 (DocBookEndOfCell): ditto
10483 (DocBookEndOfCell): ditto
10484 (DocBookEndOfCell): ditto
10486 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10488 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10490 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10491 (MenuBuildProg): added tostr around ret
10492 (MenuRunChktex): added tostr around ret
10493 (DocumentApplyCB): added tostr around ret
10495 * src/chset.C (encodeString): added tostr around t->ic
10497 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10498 (makeLaTeXFile): added tostr around tocdepth
10499 (makeLaTeXFile): added tostr around ftcound - 1
10501 * src/insets/insetbib.C (setCounter): added tostr around counter.
10503 * src/support/lyxstring.h: added an operator+=(int) to catch more
10506 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10507 (lyxstring): We DON'T allow NULL pointers.
10509 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10511 * src/mathed/math_macro.C (MathMacroArgument::Write,
10512 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10513 when writing them out.
10515 * src/LString.C: remove, since it is not used anymore.
10517 * src/support/lyxstring.C: condition the content to
10518 USE_INCLUDED_STRING macro.
10520 * src/mathed/math_symbols.C, src/support/lstrings.C,
10521 src/support/lyxstring.C: add `using' directive to specify what
10522 we need in <algorithm>. I do not think that we need to
10523 conditionalize this, but any thought is appreciated.
10525 * many files: change all callback functions to "C" linkage
10526 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10527 strict_ansi. Those who were static are now global.
10528 The case of callbacks which are static class members is
10529 trickier, since we have to make C wrappers around them (see
10530 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10531 did not finish this yet, since it defeats the purpose of
10532 encapsulation, and I am not sure what the best route is.
10534 1999-10-19 Juergen Vigna <jug@sad.it>
10536 * src/support/lyxstring.C (lyxstring): we permit to have a null
10537 pointer as assignment value and just don't assign it.
10539 * src/vspace.C (nextToken): corrected this function substituting
10540 find_first(_not)_of with find_last_of.
10542 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10543 (TableOptCloseCB) (TableSpeCloseCB):
10544 inserted fl_set_focus call for problem with fl_hide_form() in
10547 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10549 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10552 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10554 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10555 LyXLex::next() and not eatline() to get its argument.
10557 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10559 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10560 instead, use fstreams for io of the depfile, removed unneeded
10561 functions and variables.
10563 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10564 vector instead, removed all functions and variables that is not in
10567 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10569 * src/buffer.C (insertErrors): use new interface to TeXError
10571 * Makefile.am (rpmdist): added a rpmdist target
10573 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10574 per Kayvan's instructions.
10576 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10578 * src/Makefile.am: add a definition for localedir, so that locales
10579 are found after installation (Kayvan)
10581 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10583 * development/.cvsignore: new file.
10585 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10587 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10588 C++ compiler provides wrappers for C headers and use our alternate
10591 * configure.in: use LYX_CXX_CHEADERS.
10593 * src/cheader/: new directory, populated with cname headers from
10594 libstdc++-2.8.1. They are a bit old, but probably good enough for
10595 what we want (support compilers who lack them).
10597 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10598 from includes. It turns out is was stupid.
10600 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10602 * lib/Makefile.am (install-data-local): forgot a ';'
10603 (install-data-local): forgot a '\'
10604 (libinstalldirs): needed after all. reintroduced.
10606 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10608 * configure.in (AC_OUTPUT): added lyx.spec
10610 * development/lyx.spec: removed file
10612 * development/lyx.spec.in: new file
10614 * po/*.po: merged with lyx.pot becuase of make distcheck
10616 * lib/Makefile.am (dist-hook): added dist-hook so that
10617 documentation files will be included when doing a make
10618 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10619 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10621 more: tried to make install do the right thing, exclude CVS dirs
10624 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10625 Path would fit in more nicely.
10627 * all files that used to use pathstack: uses now Path instead.
10628 This change was a lot easier than expected.
10630 * src/support/path.h: new file
10632 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10634 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10636 * src/support/lyxstring.C (getline): Default arg was given for
10639 * Configure.cmd: removed file
10641 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10643 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10644 streams classes and types, add the proper 'using' statements when
10645 MODERN_STL is defined.
10647 * src/debug.h: move the << operator definition after the inclusion
10650 * src/support/filetools.C: include "LAssert.h", which is needed
10653 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10656 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10657 include "debug.h" to define a proper ostream.
10659 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10661 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10662 method to the SystemCall class which can kill a process, but it's
10663 not fully implemented yet.
10665 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10667 * src/support/FileInfo.h: Better documentation
10669 * src/lyxfunc.C: Added support for buffer-export html
10671 * src/menus.C: Added Export->As HTML...
10673 * lib/bind/*.bind: Added short-cut for buffer-export html
10675 * src/lyxrc.*: Added support for new \tth_command
10677 * lib/lyxrc.example: Added stuff for new \tth_command
10679 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10681 * lib/Makefile.am (IMAGES): removed images/README
10682 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10683 installes in correct place. Check permisions is installed
10686 * src/LaTeX.C: some no-op changes moved declaration of some
10689 * src/LaTeX.h (LATEX_H): changed include guard name
10691 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * lib/reLyX/Makefile.am: install noweb2lyx.
10695 * lib/Makefile.am: install configure.
10697 * lib/reLyX/configure.in: declare a config aux dir; set package
10698 name to lyx (not sure what the best solution is); generate noweb2lyx.
10700 * lib/layouts/egs.layout: fix the bibliography layout.
10702 1999-10-08 Jürgen Vigna <jug@sad.it>
10704 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10705 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10706 it returned without continuing to search the path.
10708 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10710 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10711 also fixes a bug. It is not allowed to do tricks with std::strings
10712 like: string a("hei"); &a[e]; this will not give what you
10713 think... Any reason for the complexity in this func?
10715 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10717 * Updated README and INSTALL a bit, mostly to check that my
10718 CVS rights are correctly set up.
10720 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10722 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10723 does not allow '\0' chars but lyxstring and std::string does.
10725 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10727 * autogen.sh (AUTOCONF): let the autogen script create the
10728 POTFILES.in file too. POTFILES.in should perhaps now not be
10729 included in the cvs module.
10731 * some more files changed to use C++ includes instead of C ones.
10733 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10735 (Reread): added tostr to nlink. buggy output otherwise.
10736 (Reread): added a string() around szMode when assigning to Buffer,
10737 without this I got a log of garbled info strings.
10739 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10742 * I have added several ostream & operator<<(ostream &, some_type)
10743 functions. This has been done to avoid casting and warnings when
10744 outputting enums to lyxerr. This as thus eliminated a lot of
10745 explicit casts and has made the code clearer. Among the enums
10746 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10747 mathed enums, some font enum the Debug::type enum.
10749 * src/support/lyxstring.h (clear): missing method. equivalent of
10752 * all files that contained "stderr": rewrote constructs that used
10753 stderr to use lyxerr instead. (except bmtable)
10755 * src/support/DebugStream.h (level): and the passed t with
10756 Debug::ANY to avoid spurious bits set.
10758 * src/debug.h (Debug::type value): made it accept strings of the
10759 type INFO,INIT,KEY.
10761 * configure.in (Check for programs): Added a check for kpsewhich,
10762 the latex generation will use this later to better the dicovery of
10765 * src/BufferView.C (create_view): we don't need to cast this to
10766 (void*) that is done automatically.
10767 (WorkAreaButtonPress): removed some dead code.
10769 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10771 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10772 is not overwritten when translated (David Sua'rez de Lis).
10774 * lib/CREDITS: Added David Sua'rez de Lis
10776 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10778 * src/bufferparams.C (BufferParams): default input encoding is now
10781 * acinclude.m4 (cross_compiling): comment out macro
10782 LYX_GXX_STRENGTH_REDUCE.
10784 * acconfig.h: make sure that const is not defined (to empty) when
10785 we are compiling C++. Remove commented out code using SIZEOF_xx
10788 * configure.in : move the test for const and inline as late as
10789 possible so that these C tests do not interefere with C++ ones.
10790 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10791 has not been proven.
10793 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10795 * src/table.C (getDocBookAlign): remove bad default value for
10796 isColumn parameter.
10798 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10800 (ShowFileMenu2): ditto.
10802 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10803 of files to ignore.
10805 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10807 * Most files: finished the change from the old error code to use
10808 DebugStream for all lyxerr debugging. Only minor changes remain
10809 (e.g. the setting of debug levels using strings instead of number)
10811 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10813 * src/layout.C (Add): Changed to use compare_no_case instead of
10816 * src/FontInfo.C: changed loop variable type too string::size_type.
10818 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10820 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10821 set ETAGS_ARGS to --c++
10823 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10825 * src/table.C (DocBookEndOfCell): commented out two unused variables
10827 * src/paragraph.C: commented out four unused variables.
10829 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10830 insed a if clause with type string::size_type.
10832 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10835 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10837 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10838 variable, also changed loop to go from 0 to lenght + 1, instead of
10839 -1 to length. This should be correct.
10841 * src/LaTeX.C (scanError): use string::size_type as loop variable
10844 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10845 (l.896) since y_tmp and row was not used anyway.
10847 * src/insets/insetref.C (escape): use string::size_type as loop
10850 * src/insets/insetquotes.C (Width): use string::size_type as loop
10852 (Draw): use string::size_type as loop variable type.
10854 * src/insets/insetlatexaccent.C (checkContents): use
10855 string::size_type as loop variable type.
10857 * src/insets/insetlabel.C (escape): use string::size_type as loop
10860 * src/insets/insetinfo.C: added an extern for current_view.
10862 * src/insets/insetcommand.C (scanCommand): use string::size_type
10863 as loop variable type.
10865 * most files: removed the RCS tags. With them we had to recompile
10866 a lot of files after a simple cvs commit. Also we have never used
10867 them for anything meaningful.
10869 * most files: tags-query-replace NULL 0. As adviced several plases
10870 we now use "0" instead of "NULL" in our code.
10872 * src/support/filetools.C (SpaceLess): use string::size_type as
10873 loop variable type.
10875 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10877 * src/paragraph.C: fixed up some more string stuff.
10879 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10881 * src/support/filetools.h: make modestr a std::string.
10883 * src/filetools.C (GetEnv): made ch really const.
10885 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10886 made code that used these use max/min from <algorithm> instead.
10888 * changed several c library include files to their equivalent c++
10889 library include files. All is not changed yet.
10891 * created a support subdir in src, put lyxstring and lstrings
10892 there + the extra files atexit, fileblock, strerror. Created
10893 Makefile.am. edited configure.in and src/Makefile.am to use this
10894 new subdir. More files moved to support.
10896 * imported som of the functions from repository lyx, filetools
10898 * ran tags-query-replace on LString -> string, corrected the bogus
10899 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10900 is still some errors in there. This is errors where too much or
10901 too litle get deleted from strings (string::erase, string::substr,
10902 string::replace), there can also be some off by one errors, or
10903 just plain wrong use of functions from lstrings. Viewing of quotes
10906 * LyX is now running fairly well with string, but there are
10907 certainly some bugs yet (see above) also string is quite different
10908 from LString among others in that it does not allow null pointers
10909 passed in and will abort if it gets any.
10911 * Added the revtex4 files I forgot when setting up the repository.
10913 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10915 * All over: Tried to clean everything up so that only the files
10916 that we really need are included in the cvs repository.
10917 * Switched to use automake.
10918 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10919 * Install has not been checked.
10921 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10923 * po/pt.po: Three errors:
10924 l.533 and l.538 format specification error
10925 l. 402 duplicate entry, I just deleted it.