1 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
3 * lib/layouts/docbook-book.layout
4 * lib/layouts/docbook.layout
5 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
6 those paragraphs are expresse as SGML comments <!-- -->.
9 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
10 parameter, this allows to express all the include files as relative
11 paths to the master buffer. The verbatim insert works as the other
14 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
16 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
18 (MakeDocBookFile): top_element is always written. Some clean up, as
19 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
21 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
22 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
23 a reference is written instead of the name.
24 (Validate): use the relative path for the filename.
26 * src/insets/insetlabel.C (DocBook): write end tag, for XML
29 * src/support/filetools.h
30 * src/support/filetools.C (IsSGMLFilename): added.
33 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
35 * development/OS2/quick_fix.patch:
37 * README.OS2: quick update to the OS/2 port.
39 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
41 * src/converter.C: add "using" directive.
43 * src/frontends/xforms/FormPreferences.C: add "using" directive.
44 (compare_converter): add "int" as return type.
46 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
49 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
51 * src/lyx_gui.C (create_forms): map the xform colours, should a
52 mapping exist. Ie, call XformColor::read().
54 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
55 and struct HSV as HSVColor.
56 (XformColor::read, XformColor::write) : new methods that
57 input/output any changes to the cform GUI colors.
59 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
62 * src/frontends/xforms/FormPreferences.C Lots of little changes
63 associated with the changed name of the RGB and HSV structs. Can
64 now save changes to xforms GUI to file. Commented out
65 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
66 used currently anyway.
68 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
70 * src/converter.C: A lot of changes:
71 - It is no longer possible to choose between two or more ways to
72 export to some format (the new code uses only the shortest path).
73 However, it is still possible to choose between pdflatex/ps2pdf
74 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
75 - Added several methods that makes the FormPreferences code simpler.
76 - Changed the tokens $$FName and $$OutName to $$i and $$o.
78 * src/exporter.C (Export): lyxrc.use_pdf is set before
79 makeLaTeXFile is called. This works but not very nice.
81 * src/frontends/xforms/FormPreferences.C: The formats/converters
82 tabs are now fully functional.
84 * src/buffer.C (getTocList): Add numbers to the captions.
86 * lib/lyxrc.example: Removed fax section
88 * src/support/rename.C (rename): Delete the old file if lyx::copy
91 2000-11-13 Rob Lahaye <lahaye@postech.edu>
93 * lib/ui/default.ui: minor polishing.
95 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
97 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
100 * lib/Makefile.am (DOCINST): do not install everything in the
101 documentation directory.
103 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
105 * src/bufferlist.C (newFile): set the filename to the constructed
108 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
109 constructed "newfileXX.lyx" name to the dialog
111 * src/frontends/DialogBase.h: make update() non-abstract so
112 KDE doesn't need to implement two update methods for every form
114 * src/frontends/kde/Makefile.am: add missing xforms objects
117 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
119 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
121 * src/frontends/xforms/Color.[Ch]: new files, defining the color
122 structs RGB and HSV. May not be the best place for these files.
123 Perhaps move them into src ?
125 * src/frontends/xforms/Makefile.am: added new files.
127 * src/frontends/xforms/forms/form_preferences.fd:
128 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
129 replaced all instances of "colour" with "color"!
131 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
134 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
135 tab. Can now alter the colors of the xform's GUI on the fly. With
136 the aid of a single static Signal (see below), can "Apply" these
137 changes to all currently open dialogs. (Well, to all of the NEW
138 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
139 subsequently opened dialogs will, of course, also have the new
140 color scheme. Cannot yet save (or load) the choices to file, so
141 they are lost when exiting LyX.
143 * src/frontends/Dialogs.h:
144 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
145 Used to trigger a redraw of any dialogs connected to it because,
146 for example, the GUI colours have been re-mapped.
148 * src/frontends/xforms/FormBase.[Ch]:
149 * src/frontends/xforms/FormDocument.[Ch]:
150 * src/frontends/xforms/FormParagraph.[Ch]:
151 * src/frontends/xforms/FormPreferences.[Ch]:
152 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
153 method, to be connected to Dialogs::redrawGUI. Method must be
154 virtual, because dialogs with tabbed folders need to redraw the
155 forms of each tab folder.
157 * src/LyXView.C (d-tor):
158 * src/frontends/xforms/FormBase.C (d-tor): connected
159 Dialogs::redrawGUI signal to redraw().
161 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
162 removed Assert, because it is identical to that in FormBase.
164 2000-11-10 Rob Lahaye <lahaye@postech.edu>
166 * lib/ui/default.ui: minor polishing.
168 2000-11-10 Juergen Vigna <jug@sad.it>
170 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
171 (deleteLyXText): ditto
173 * src/insets/insettabular.C (InsetButtonPress): don't clear the
174 selection on mouse-button-3.
176 * src/insets/insettabular.h: new function clearSelection(), use this
177 functions inside insettabular.C.
179 * src/insets/insettabular.C (TabularFeatures): clear the selection
180 on remove_row/column.
182 * src/insets/inset.C (scroll): fixed some scroll stuff.
184 * src/insets/insettabular.C (draw): fixed another minor draw problem.
186 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
188 * lib/CREDITS: add Yves Bastide
190 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
192 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
193 check whether C library functions are in the global namespace.
195 * configure.in: calls it.
197 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
200 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
202 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
203 iterators to prevent crash.
205 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
207 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
209 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
210 shortcut for xforms CB to the preemptive or post-handler function.
212 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
213 removed the HIDDEN_TIMER as it's no longer used.
214 Various other small changes.
216 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
217 preemptive handler to obtain feedback, rather than the post-handler.
218 (ColoursLoadBrowser): find "black" and "white" based on RGB values
220 Formats tab is now complete. Converters tab is nearly so.
222 2000-11-09 Juergen Vigna <jug@sad.it>
224 * src/insets/insettext.C (~InsetText):
227 (SetParagraphData): set cache.second to 0 after deleting it!
228 (getLyXText): check if cache.second is not 0 if finding it.
230 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
232 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
233 lyxlex to parse the rgb.txt file.
236 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
237 replace the default '#' comment character.
239 * src/support/tempname.C: add "using" directive
240 * src/frontends/ButtonPolicies.C: ditto.
242 * src/support/filetools.C (DirList): add an explicit cast to avoid
243 a compile error (probably not the right fix)
245 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
247 * src/support/filetools.C (DirList): implement using system functions
249 * src/support/tempname.C: new file
251 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
253 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
255 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
258 * src/frontends/xforms/ButtonController.C: new file
260 * src/os2_defines.h: remove getcwd define
262 * src/lyxvc.C: include support/lyxlib.h
263 (showLog): use lyx::tempName
265 * src/lyx_cb.C: comment out includes that we don't need
266 (AutoSave): use lyx::tempName
268 * src/filedlg.C: include support/lyxlib.h
269 (Reread): use lyx::getcwd
271 * src/converter.C: include support/filetools.h
272 (add_options): change to static inline, make tail const
273 (Add): make old_viewer const
274 (GetAllFormats): make it a const method, use const_iterator
275 (enable): make static inline
276 (SplitFormat): make using_format const
278 * src/LaTeX.C (run): use lyx::getcwd
280 * configure.in: check for mkstemp as well
282 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
284 * src/converter.[Ch] (GetAllCommands): new method.
286 * src/support/filetools.[Ch] (DirList): new method.
288 * src/frontends/xforms/FormPreferences.C: started (just!) adding
289 functionality to the converters tab.
290 The formats tab is now nearly complete.
291 The kbmap choices in Languages tab now display the contents of
292 system_lyxdir/kbd/*.kmap in readable form.
294 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
295 Moved some variables into the class.
297 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
298 inactive tab folder to FL_COL1. Haven't yet worked out how to change
299 colour of active folder to lighter grey instead. Any takers?
300 (form_colours): added an "Apply" button.
301 (form_converters): added a "Flags" input field.
302 (form_formats): added a "Shortcut" input field. Note that we can't use
303 names such as "input_shortcut" as this buggers up the sed script stuff.
305 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
313 * src/lyx_sendfax_main.C:
316 * src/spellchecker.C:
317 * src/insets/figinset.C:
318 * src/insets/insetbib.C:
319 * src/insets/insetexternal.C:
320 * src/insets/insetinclude.C:
321 * src/insets/insetinfo.C:
322 * src/mathed/math_panel.C:
323 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
324 all "daughter" dialogs now have identical "feel".
326 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
328 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
329 used (and was only used in one place prior to this patch. Incorrectly!)
331 * src/frontends/xforms/FormDocument.C: changed some instances of
332 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
333 sense. Also added fl_set_input_return() for class_->input_doc_extra and
334 for options_->input_float_placement. This fixes a bug reported by
337 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
338 functionality into d-tor.
340 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
341 input of numerals also.
343 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
344 fl_set_form_atclose(). Can now close dialog from window manager,
345 fixing a bug reported by Rob Lahaye.
347 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
349 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
350 are no longer dark. Haven't yet worked out how to lighten the colour of
351 the active tabfolder. Any ideas anybody?
352 Adjusted Colours tab a little.
353 Added Shortcut field to converters tab. Note that we can't create an
354 fdesign label like "input_shortcut" as this buggers up the sed-script
357 * src/frontends/xforms/FormPreferences.[Ch]:
358 (feedback): fixed crash due to to ob=0.
359 (LanguagesXXX): the kbmap choices now contain the files
360 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
361 be replaced by an input with a file browse button, but since the browse
362 buttons don'y yet work, this'll do for the moment.
363 (FormatsXXX): think that this is now nearly fully functional.
364 Some points/questions though:
365 1. Does "Apply" remove formats if no longer present?
366 2. I think that the browser should list the GUI names rather than the
368 3. Must ensure that we can't delete Formats used by an existing
371 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
372 if this is the best way to do this.
374 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
376 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
378 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
379 for variable assignment.
381 2000-11-07 Rob Lahaye <lahaye@postech.edu>
383 * src/lib/ui/default.ui: added sub/superscripts to menu as
384 Insert->Special characters and cleaned-up the file a bit
386 2000-11-07 Allan Rae <rae@lyx.org>
388 * src/frontends/xforms/FormPreferences.C (feedback): make sure
389 ob isn't 0 before using it. See comments in function.
391 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
393 * src/frontends/xforms/form_*.C: regenerated
395 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
397 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
399 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
400 compiling with gcc-2.96
402 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
404 * src/support/lyxstring.C: add a couple "using" directives.
406 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
407 a .c_str() here too for good measure.
408 * src/Spacing.C (set): ditto.
409 * src/lyxfunc.C (Dispatch): ditto.
411 * src/insets/insettabular.C (copySelection): change .str() to
412 .str().c_str() to fix problems with lyxstring.
413 * src/support/filetools.C (GetFileContents): ditto.
414 * src/buffer.C (asciiParagraph): ditto.
415 * src/paragraph.C (String): ditto.
417 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
418 * lib/bind/sciword.bind: ditto.
420 * src/LyXAction.C (init): remove "symbol-insert" function, which
421 shared LFUN_INSERT_MATH with "math-insert".
423 * lib/configure.m4: == is not a valid operator for command test.
425 * src/lyxrc.C: add using directive.
427 * src/converter.h: add std:: qualifier.
429 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
431 * src/converter.[Ch] and other files: Change the Format class to a
432 real class, and create two instances: formats and system_format.
434 * src/lyxrc.C (output): Output the difference between formats and
437 * src/frontends/xforms/FormPreferences.C (input): Simplify.
438 (buildFormats): Insert formats into browser.
439 (inputFormats): Made the browser and add button functional.
440 (applyFormats): Update formats from format_vec.
442 * src/converter.C: Changed all (*it). to it->
443 (Format::dummy): New method.
444 (Format::importer): New format flag.
445 (Formats::GetAllFormats): New method.
446 (Formats::Add): Delete format from the map if prettyname is empty.
447 (Converter::Convert): Print an error message if moving the file fails.
448 (Converter::GetReachableTo): New method
450 * src/MenuBackend.[Ch]: Add support for importformats tag.
452 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
454 * lib/configure.m4: Add word->tex and ps->fax converters.
456 * lib/ui/default.ui: Use ImportFormats on file->import menu.
457 Return fax to file menu.
461 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
463 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
466 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
469 * src/lyxfunc.C (processKeyEvent): removed
471 * src/bufferlist.C (emergencyWrite): removed the out commented
472 emergency write code.
474 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
476 * src/LyXView.[Ch]: remove the outcommented raw_callback code
478 * many files: change formatting to be a bit more uniform for
479 if,while,for,switch statements, remove some parantesis not needed.
482 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
484 * config/kde.m4: make config more robust when KDEDIR is set
486 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
488 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
489 not returned a pixmap for "math-insert".
491 * src/LyXAction.C (init): sort the entries a bit.
493 2000-11-03 Juergen Vigna <jug@sad.it>
495 * src/insets/insettabular.h: added fixed number to update codes so
496 that update is only in one direction.
498 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
501 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
502 before call to edit because of redraw.
504 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
506 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
508 * lib/ui/default.ui: Populate "edit_float" menu
510 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
512 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
513 "floats-operate". The name is ugly (and the func also), but this
514 is just a band-aid until we switch to new insets.
516 2000-11-03 Rob Lahaye <lahaye@postech.edu>
518 * lib/ui/default.ui: update again the menu layout (fix some
521 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
523 * src/MenuBackend.h (fulllabel): new method.
525 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
526 the menu shortcuts of a menu are unique and whether they
527 correspond to a letter of the label.
528 (expand): call checkShortcuts when debugging.
530 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
532 * src/insets/insettext.C (InsetButtonPress): shut off warning.
534 2000-11-02 Lior Silberman <lior@Princeton.EDU>
536 * lib/examples/*.lyx : '\language default' => '\language english'
538 * lib/examples/it_splash.lyx : except where it should be italian
540 * lib/templates/*.lyx : the same
542 * doc/*.lyx* : the same
544 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
546 * lib/bind/menus.bind: remove the Layout menu entries, which I
547 somehow forgot earlier.
549 2000-11-03 Rob Lahaye <lahaye@postech.edu>
551 * lib/ui/old-default.ui: keep the old one here for reference (to
554 * lib/ui/default.ui: update the menu layout
556 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
558 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
559 Can now Apply to different insets without closing the dialog.
561 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
562 Can't actually DO anything with them yet, but I'd like a little
565 * src/frontends/xforms/input_validators.[ch]
566 (fl_lowercase_filter): new.
568 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
570 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
571 of MATH_CODE. This fixes a bug with math-macros in RTL text.
573 * src/text.C (PrepareToPrint): Show math-macros block aligned.
575 2000-11-02 Juergen Vigna <jug@sad.it>
577 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
578 on char insertion as it has already be updated by bv->updateInset().
580 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
581 if an inset inside was updated.
583 * lib/configure.cmd: commented out fax-search code
585 2000-11-01 Yves Bastide <stid@acm.org>
587 * src/tabular.C (OldFormatRead): set tabular language to the
590 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
592 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
593 class names with non-letter characters (from Yves Bastide).
595 * lib/ui/default.ui: change Item to OptItem in import menu.
596 Comment out fax stuff.
598 * lib/configure.m4: comment out fax-related stuff.
600 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
602 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
603 useful xforms helper functions. At present contains only formatted().
604 Input a string and it returns it with line breaks so that in fits
607 * src/frontends/xforms/Makefile.am: add new files.
609 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
610 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
613 * src/frontends/xforms/FormPreferences.[Ch]:
614 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
615 but lots of little clean ups. Removed enum State. Make use of
616 formatted(). Constify lots of methods. Perhaps best of all: removed
617 requirement for that horrible reinterpret_cast from pointer to long in
620 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
622 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
623 conditionalize build on xforms < 0.89
625 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
627 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
629 * src/LyXAction.C (init): comment out fax
631 * src/lyxrc.h: comment out the fax enums
632 comment out the fax variables
634 * src/commandtags.h: comment out LFUN_FAX
636 * src/lyxrc.C: disable fax variables.
637 (read): disable parsing of fax variables
638 (output): disable writing of fax variables
639 (getFeedback): now description for fax variables
641 * src/lyxfunc.C: comment out MenuFax
642 (Dispatch): disable LFUN_FAX
644 * src/lyx_cb.C (MenuFax): comment out
646 * src/WorkArea.C: add <cctype>
647 (work_area_handler): better key handling, should be ok now.
648 for accented chars + etc
650 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
651 lyx_sendfax.h and lyx_sendfax_man.C
653 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
654 (show): don't call InitLyXLookup when using xforms 0.89
656 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
658 * src/trans.C (AddDeadkey): better fix, the other one could crash...
660 * src/support/filetools.C (GetFileContents): close to dummy change
662 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
664 * src/trans.C (AddDeadkey): workaround stupid compilers.
666 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
668 * src/frontends/xforms/FormDocument.C (class_update): fix setting
669 of two-sided document.
671 2000-10-31 Juergen Vigna <jug@sad.it>
673 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
675 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
676 xposition to the Edit call.
678 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
680 * src/trans.C (AddDeadkey): cast explicitly to char.
682 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
684 * src/tabular.C (AsciiBottomHLine): simplify?
685 (AsciiTopHLine): simplify?
686 (print_n_chars): simplify
687 (DocBook): remove most of the << endl; we should flush the stream
688 as seldom as possible.
690 (TeXBottomHLine): ditto
693 (write_attribute): try a templified version.
694 (set_row_column_number_info): lesson scope of variables
696 * src/support/lstrings.h (tostr): new specialization of tostr
698 * src/trans.C (AddDeadkey): slightly cleaner fix.
700 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
702 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
703 '%%' in Toc menu labels.
706 * src/insets/insetlatexaccent.C (draw): Correct rendering when
707 font_norm is iso10646-1.
709 * src/font.C (ascent): Fixed for 16bit fonts
710 (descent,lbearing,rbearing): ditto
712 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
714 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
715 (getFeedback): new static method.
717 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
718 Now use combox rather than choice to display languages.
719 Feedback is now output using a new timer callback mechanism, identical
720 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
722 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
724 * src/minibuffer.C: fix for older compilers
726 2000-10-30 Juergen Vigna <jug@sad.it>
728 * src/insets/insettext.C (InsertInset): fixed this as the cursor
729 has to be Left of the inset otherwise LyXText won't find it!
731 * src/BufferView2.C (open_new_inset): delete the inset if it can
734 2000-10-30 Rob Lahaye <lahaye@postech.edu>
738 2000-10-29 Marko Vendelin <markov@ioc.ee>
739 * src/frontends/gnome/FormCitation.C
740 * src/frontends/gnome/FormCitation.h
741 * src/frontends/gnome/FormCopyright.C
742 * src/frontends/gnome/FormCopyright.h
743 * src/frontends/gnome/FormError.C
744 * src/frontends/gnome/FormError.h
745 * src/frontends/gnome/FormIndex.C
746 * src/frontends/gnome/FormIndex.h
747 * src/frontends/gnome/FormPrint.C
748 * src/frontends/gnome/FormPrint.h
749 * src/frontends/gnome/FormRef.C
750 * src/frontends/gnome/FormRef.h
751 * src/frontends/gnome/FormToc.C
752 * src/frontends/gnome/FormToc.h
753 * src/frontends/gnome/FormUrl.C
754 * src/frontends/gnome/FormUrl.h
755 * src/frontends/gnome/Menubar_pimpl.C
756 * src/frontends/gnome/mainapp.C
757 * src/frontends/gnome/mainapp.h
758 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
759 changing update() to updateSlot() where appropriate
761 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
763 * src/frontends/xforms/FormPreferences.[Ch]:
764 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
767 2000-10-28 Juergen Vigna <jug@sad.it>
769 * src/insets/insettabular.C (draw): fixed drawing bug.
771 * src/insets/insettext.C (clear):
773 (SetParagraphData): clearing the TEXT buffers when deleting the
774 paragraphs used by it.
776 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
778 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
780 2000-10-27 Juergen Vigna <jug@sad.it>
782 * src/tabular.C (~LyXTabular): removed not needed anymore.
784 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
787 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
789 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
792 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
795 * src/frontends/xforms/FormPreferences.[Ch]:
796 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
797 Reorganised as modules based on tabs. Much easier to follow the
798 flow and to add new tabs. Added warning and feedback messages.
801 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
803 * src/tabular.h (DocBook): add std:: qualifier.
805 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
807 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
808 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
811 * insettabular.C (DocBook): uses the tabular methods to export
814 * src/insets/insettext.h
815 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
817 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
819 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
822 * src/lyxfunc.C (MenuNew): lessen the scope of fname
823 moved misplaced AllowInput two lines up.
825 * src/buffer.C (readFile): compare float with float, not with int
827 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
829 * src/minibuffer.C: add "using SigC::slot" statement.
831 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
833 * src/frontends/xforms/forms/README: updated section about make.
835 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
836 Tidied some forms up, made two of form_tabular's tabs more
837 self-consistent, fixed Jean-Marc's size problem in form_preferences,
838 fixed translation problem with "Column".
840 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
842 * src/minibuffer.h: use Timeout instead of the xforms timer
844 (setTimer) rewrite for the Timeout, change to unsigned arg
845 (set): change to unsigned timer arg
848 * src/minibuffer.C (TimerCB): removed func
849 (C_MiniBuffer_TimerCB): removed func
850 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
851 (peek_event): use a switch statement
852 (add): don't use fl_add_timer.
853 (Set): rewrite to use the Timeout
856 * src/Timeout.[Ch] (setType): return a Timeout &
857 (setTimeout): ditto, change to unsigned arg for timeout
859 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
861 * src/mathed/formula.C (mathed_string_width): Use string instead
862 of a constant size char array.
864 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
866 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
867 the two recently added operator<< for SMInput and State.
869 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
871 (OkCancelPolicy): ditto
872 (OkCancelReadOnlyPolicy): ditto
873 (NoRepeatedApplyReadOnlyPolicy): ditto
874 (OkApplyCancelReadOnlyPolicy): ditto
875 (OkApplyCancelPolicy): ditto
876 (NoRepeatedApplyPolicy): ditto
878 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
880 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
881 add the usual std:: qualifiers.
883 2000-10-25 Juergen Vigna <jug@sad.it>
885 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
887 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
889 * src/support/filetools.C (MakeRelPath): change some types to
892 * src/frontends/ButtonPolicies.h (operator<<): new operator for
893 ButtonPolicy::SMInput and ButtonPolicy::State.
895 * src/FontLoader.C (reset): small cleanup
896 (unload): small cleanup
898 * src/FontInfo.C (getFontname): initialize error to 10000.0
900 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
902 * src/frontends/xforms/FormPreferences.[Ch]:
903 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
904 TeX encoding and default paper size sections.
906 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
908 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
911 * src/frontends/xforms/FormError.C (disconnect): use erase() to
912 make the message_ empty.
913 (FormError): don't initialize message_ in initializer list.
915 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
917 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
919 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
921 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
923 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
925 * src/frontends/kde/*data.[Ch]: _("") is not
928 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
930 * src/buffer.C: removed redundant using directive.
932 * src/frontends/DialogBase.h: revert to original definition of
935 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
936 stuff into two classes, one for each dialog, requires a new
937 element in the dialogs vector, FormTabularCreate.
939 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
942 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
943 method. Continues Allan's idea, but means that derived classes
944 don't need to worry about "update or hide?".
946 * src/frontends/xforms/FormError.C (showInset): add connection
949 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
950 one for each dialog. FormTabular now contains main tabular dialog
953 * src/frontends/xforms/FormTabularCreate.[Ch]:
954 * src/frontends/xforms/forms/form_tabular_create.fd: the create
957 * src/frontends/xforms/FormGraphics.[Ch]:
958 * src/frontends/xforms/forms/form_graphics.fd
959 * src/frontends/xforms/FormTabular.[Ch]:
960 * src/frontends/xforms/forms/form_tabular.fd: made daughter
961 classes of FormInset.
963 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
964 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
966 * src/frontends/xforms/Makefile.am:
967 * src/frontends/xforms/forms/makefile: added new files.
969 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
970 variable. added Signal0 hide signal, in keeping with other GUI-I
973 * src/support/lstrings.h: removed redundant std:: qualifier as
974 it's already declared in Lsstream.h.
976 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
978 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
982 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
984 * src/tabular.C (Ascii): minimize scope of cell.
986 * src/BufferView2.C (nextWord): return string() instead of 0;
988 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
990 * src/converter.h: add a std:: qualifier
992 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
994 * src/importer.[Ch]: New files. Used for importing files into LyX.
996 * src/lyxfunc.C (doImport): Use the new Importer class.
998 * src/converter.h: Add shortcut member to the Format class.
999 Used for holding the menu shortcut.
1001 * src/converter.C and other files: Made a distinction between
1002 format name and format extension. New formats can be defined using
1003 the \format lyxrc tag.
1004 Added two new converter flags: latex and disable.
1006 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1008 * src/support/lyxlib.h: unify namespace/struct implementation.
1009 Remove extra declarations.
1011 * src/support/chdir.C (chdir): remove version taking char const *
1013 * src/support/rename.C: ditto.
1014 * src/support/lyxsum.C: ditto.
1016 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1018 * src/frontends/xforms/FormBase.[Ch]:
1019 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1020 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1021 work only for the next call to fl_show_form(). The correct place to set
1022 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1023 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1024 from FormBase have the minimum size set; no more stupid crashes with
1027 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1029 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1031 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1033 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1035 * src/support/lyxlib.h: changed second argument of mkdir to
1036 unsigned long int (unsigned int would probably have been enough,
1037 but...). Removed <sys/types.h> header.
1038 * src/support/mkdir.C (mkdir): ditto.
1042 2000-10-19 Juergen Vigna <jug@sad.it>
1044 * src/lyxfunc.C (MenuNew): small fix (form John)
1046 * src/screen.C (Update): removed unneeded code.
1048 * src/tabular.C (Ascii): refixed int != uint bug!
1050 * src/support/lyxlib.h: added sys/types.h include for now permits
1051 compiling, but I don't like this!
1053 2000-10-18 Juergen Vigna <jug@sad.it>
1055 * src/text2.C (ClearSelection): if we clear the selection we need
1056 more refresh so set the status apropriately
1058 * src/insets/insettext.C (draw): hopefully finally fixed draw
1061 2000-10-12 Juergen Vigna <jug@sad.it>
1063 * src/insets/insettext.C (draw): another small fix and make a block
1064 so that variables are localized.
1066 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1068 * src/support/lstrings.C (lowercase, uppercase):
1069 use explicit casts to remove compiler warnings.
1071 * src/support/LRegex.C (Impl):
1072 * src/support/StrPool.C (add):
1073 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1074 (AddPath, MakeDisplayPath):
1075 * src/support/lstrings.C (prefixIs, subst):
1076 use correct type to remove compiler warnings.
1078 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1080 * src/support/lyxlib.h:
1081 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1082 portability and to remove compiler warning with DEC cxx.
1084 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1086 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1088 * src/minibuffer.C (peek_event): retun 1 when there has been a
1089 mouseclick in the minibuffer.
1093 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1095 * src/frontends/xforms/FormParagraph.C: more space above/below
1098 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1100 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1101 a char only if real_current_font was changed.
1103 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1105 * NEWS: update somewhat for 1.1.6
1107 * lib/ui/default.ui: clean up.
1109 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1111 * lib/CREDITS: clean up
1113 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1115 * src/combox.[Ch] (select): changed argument back to int
1116 * src/combox.C (peek_event): removed num_bytes as it is declared but
1119 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1120 modified calls to Combox::select() to remove warnings about type
1123 * src/insets/insetbutton.C (width): explicit cast to remove warning
1124 about type conversion.
1126 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1129 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1130 sel_pos_end, refering to cursor position are changed to
1131 LyXParagraph::size_type.
1133 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1134 consistent with LyXCursor::pos().
1135 (inset_pos): changed to LyXParagraph::size_type for same reason.
1137 * src/insets/insettext.C (resizeLyXText): changed some temporary
1138 variables refing to cursor position to LyXParagraph::size_type.
1140 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1142 * src/frontends/kde/<various>: The Great Renaming,
1145 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1147 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1149 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1151 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1152 0 when there are no arguments.
1154 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1156 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1157 to segfaults when pressing Ok in InsetBibtex dialog.
1159 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1161 * forms/layout_forms.fd:
1162 * src/layout_forms.C (create_form_form_character): small change to use
1163 labelframe rather than engraved frame + text
1165 * src/lyx_gui.C (create_forms): initialise choice_language with some
1166 arbitrary value to prevent segfault when dialog is shown.
1168 2000-10-16 Baruch Even <baruch.even@writeme.com>
1170 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1171 is no resulting file. This pertains only to LaTeX output.
1173 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1175 * src/text.C (Backspace): Make sure that the row of the cursor is
1178 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1181 * src/lyx_gui.C (init): Prevent a crash when only one font from
1182 menu/popup fonts is not found.
1184 * lib/lyxrc.example: Add an example for binding a key for language
1187 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1189 * src/converter.C (GetReachable): Changed the returned type to
1191 (IsReachable): New method
1193 * src/MenuBackend.C (expand): Handle formats that appear more
1196 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1198 * src/frontends/support/Makefile.am
1199 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1202 * lib/CREDITS: add Garst Reese.
1204 * src/support/snprintf.h: add extern "C" {} around the definitions.
1206 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1208 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1211 * src/frontends/xforms/FormDocument.C:
1212 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1213 compile without "conversion to integral type of smaller size"
1216 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1218 * src/text.C (GetColumnNearX): Fixed disabled code.
1220 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1222 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1225 * src/support/snprintf.[ch]: new files
1227 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1229 * src/frontends/kde/formprintdialog.C: add
1230 file browser for selecting postscript output
1232 * src/frontends/kde/formprintdialogdata.C:
1233 * src/frontends/kde/formprintdialogdata.h: re-generate
1236 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1238 * src/frontends/gnome/Makefile.am:
1239 * src/frontends/kde/Makefile.am: FormCommand.C
1240 disappeared from xforms
1242 * src/frontends/kde/FormCitation.C:
1243 * src/frontends/kde/FormIndex.C: read-only
1246 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1248 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1251 * src/bufferlist.C: add using directive.
1253 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1255 * src/support/lyxfunctional.h: version of class_fun for void
1256 returns added, const versions of back_inseter_fun and compare_fun
1259 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1261 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1263 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1265 * ChangeLog: cleanup.
1267 * lib/CREDITS: update to add all the contributors we've forgotten.
1268 I have obviously missed some, so tell me whether there were
1271 2000-10-13 Marko Vendelin <markov@ioc.ee>
1273 * src/frontends/gnome/FormCitation.C
1274 * src/frontends/gnome/FormCitation.h
1275 * src/frontends/gnome/FormError.C
1276 * src/frontends/gnome/FormIndex.C
1277 * src/frontends/gnome/FormRef.C
1278 * src/frontends/gnome/FormRef.h
1279 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1281 * src/frontends/gnome/FormCitation.C
1282 * src/frontends/gnome/FormCopyright.C
1283 * src/frontends/gnome/FormError.C
1284 * src/frontends/gnome/FormIndex.C
1285 * src/frontends/gnome/FormRef.C
1286 * src/frontends/gnome/FormToc.C
1287 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1290 * src/frontends/gnome/Menubar_pimpl.C
1291 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1294 2000-10-11 Baruch Even <baruch.even@writeme.com>
1297 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1298 to convey its real action.
1300 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1301 clear the minibuffer and prepare to enter a command.
1303 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1304 the rename from ExecCommand to PrepareForCommand.
1305 * src/lyxfunc.C (Dispatch): ditto.
1307 2000-10-11 Baruch Even <baruch.even@writeme.com>
1309 * src/buffer.C (writeFile): Added test for errors on writing, this
1310 catches all errors and not only file system full errors as intended.
1312 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1314 * src/lyx_gui.C (create_forms): better fix for crash with
1315 translated interface.
1317 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1319 * src/frontends/kde/Makefile.am:
1320 * src/frontends/kde/FormCopyright.C:
1321 * src/frontends/kde/formcopyrightdialog.C:
1322 * src/frontends/kde/formcopyrightdialog.h:
1323 * src/frontends/kde/formcopyrightdialogdata.C:
1324 * src/frontends/kde/formcopyrightdialogdata.h:
1325 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1326 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1327 copyright to use qtarch
1329 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1331 * src/encoding.C (read): Fixed bug that caused an error message at
1332 the end of the file.
1334 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1336 * lib/lyxrc.example: Fixed hebrew example.
1338 2000-10-13 Allan Rae <rae@lyx.org>
1340 * src/frontends/xforms/FormPreferences.C (input): reworking the
1342 (build, update, apply): New inputs in various tabfolders
1344 * src/frontends/xforms/FormToc.C: use new button policy.
1345 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1346 dialogs that either can't use any existing policy or where it just
1349 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1352 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1353 added a bool parameter which is ignored.
1355 * src/buffer.C (setReadonly):
1356 * src/BufferView_pimpl.C (buffer):
1357 * src/frontends/kde/FormCopyright.h (update):
1358 * src/frontends/kde/FormCitation.[Ch] (update):
1359 * src/frontends/kde/FormIndex.[Ch] (update):
1360 * src/frontends/kde/FormPrint.[Ch] (update):
1361 * src/frontends/kde/FormRef.[Ch] (update):
1362 * src/frontends/kde/FormToc.[Ch] (update):
1363 * src/frontends/kde/FormUrl.[Ch] (update):
1364 * src/frontends/gnome/FormCopyright.h (update):
1365 * src/frontends/gnome/FormCitation.[Ch] (update):
1366 * src/frontends/gnome/FormError.[Ch] (update):
1367 * src/frontends/gnome/FormIndex.[Ch] (update):
1368 * src/frontends/gnome/FormPrint.[Ch] (update):
1369 * src/frontends/gnome/FormRef.h (update):
1370 * src/frontends/gnome/FormToc.[Ch] (update):
1371 * src/frontends/gnome/FormUrl.[Ch] (update):
1372 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1373 to updateBufferDependent and DialogBase
1375 * src/frontends/xforms/FormCitation.[hC]:
1376 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1377 * src/frontends/xforms/FormError.[Ch]:
1378 * src/frontends/xforms/FormGraphics.[Ch]:
1379 * src/frontends/xforms/FormIndex.[Ch]:
1380 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1381 and fixed readOnly handling.
1382 * src/frontends/xforms/FormPrint.[Ch]:
1383 * src/frontends/xforms/FormRef.[Ch]:
1384 * src/frontends/xforms/FormTabular.[Ch]:
1385 * src/frontends/xforms/FormToc.[Ch]:
1386 * src/frontends/xforms/FormUrl.[Ch]:
1387 * src/frontends/xforms/FormInset.[Ch]:
1388 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1389 form of updateBufferDependent.
1391 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1392 if form()->visible just in case someone does stuff to the form in a
1395 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1396 the buttoncontroller for everything the enum used to be used for.
1397 (update) It would seem we need to force all dialogs to use a bool
1398 parameter or have two update functions. I chose to go with one.
1399 I did try removing update() from here and FormBase and defining the
1400 appropriate update signatures in FormBaseB[DI] but then ran into the
1401 problem of the update() call in FormBase::show(). Whatever I did
1402 to get around that would require another function and that just
1403 got more confusing. Hence the decision to make everyone have an
1404 update(bool). An alternative might have been to override show() in
1405 FormBaseB[DI] and that would allow the different and appropriate
1408 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1409 true == buffer change occurred. I decided against using a default
1410 template parameter since not all compilers support that at present.
1412 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1414 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1415 army knife" by removing functionality.
1416 (clearStore): removed. All such housekeeping on hide()ing the dialog
1417 is to be carried out by overloaded disconnect() methods.
1418 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1419 superceded by Baruch's neat test (FormGraphics) to update an existing
1420 dialog if a new signal is recieved rather than block all new signals
1422 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1423 only to Inset dialogs.
1424 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1425 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1427 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1429 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1430 as a base class to all inset dialogs. Used solely to connect/disconnect
1431 the Inset::hide signal and to define what action to take on receipt of
1432 a UpdateBufferDependent signal.
1433 (FormCommand): now derived from FormInset.
1435 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1438 * src/frontends/xforms/FormCopyright.[Ch]:
1439 * src/frontends/xforms/FormPreferences.[Ch]:
1440 now derived from FormBaseBI.
1442 * src/frontends/xforms/FormDocument.[Ch]:
1443 * src/frontends/xforms/FormParagraph.[Ch]:
1444 * src/frontends/xforms/FormPrint.[Ch]:
1445 now derived from FormBaseBD.
1447 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1449 * src/frontends/xforms/FormCitation.[Ch]:
1450 * src/frontends/xforms/FormError.[Ch]:
1451 * src/frontends/xforms/FormRef.[Ch]:
1452 * src/frontends/xforms/FormToc.[Ch]:
1453 (clearStore): reworked as disconnect().
1455 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1458 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1460 * src/converter.C (runLaTeX): constify buffer argument
1463 * src/frontends/support/Makefile.am (INCLUDES): fix.
1465 * src/buffer.h: add std:: qualifier
1466 * src/insets/figinset.C (addpidwait): ditto
1467 * src/MenuBackend.C: ditto
1468 * src/buffer.C: ditto
1469 * src/bufferlist.C: ditto
1470 * src/layout.C: ditto
1471 * src/lyxfunc.C: ditto
1473 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1475 * src/lyxtext.h (bidi_level): change return type to
1476 LyXParagraph::size_type.
1478 * src/lyxparagraph.h: change size_type to
1479 TextContainer::difference_type. This should really be
1480 TextContainer::size_type, but we need currently to support signed
1483 2000-10-11 Marko Vendelin <markov@ioc.ee>
1484 * src/frontends/gnome/FormError.h
1485 * src/frontends/gnome/FormRef.C
1486 * src/frontends/gnome/FormRef.h
1487 * src/frontends/gnome/FormError.C
1488 * src/frontends/gnome/Makefile.am
1489 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1490 to Gnome frontend. Both dialogs use "action" area.
1492 2000-10-12 Baruch Even <baruch.even@writeme.com>
1494 * src/graphics/GraphicsCacheItem_pimpl.C:
1495 * src/graphics/Renderer.C:
1496 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1499 2000-10-12 Juergen Vigna <jug@sad.it>
1501 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1502 visible when selecting).
1504 * development/Code_rules/Rules: fixed some typos.
1506 2000-10-09 Baruch Even <baruch.even@writeme.com>
1508 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1509 compiling on egcs 1.1.2 possible.
1511 * src/filedlg.C (comp_direntry::operator() ): ditto.
1513 2000-08-31 Baruch Even <baruch.even@writeme.com>
1515 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1518 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1519 transient it now only gets freed when the object is destructed.
1521 2000-08-24 Baruch Even <baruch.even@writeme.com>
1523 * src/frontends/FormGraphics.h:
1524 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1527 2000-08-20 Baruch Even <baruch.even@writeme.com>
1529 * src/insets/insetgraphics.C:
1530 (draw): Added messages to the drawn rectangle to report status.
1531 (updateInset): Disabled the use of the inline graphics,
1534 2000-08-17 Baruch Even <baruch.even@writeme.com>
1536 * src/frontends/support: Directory added for the support of GUII LyX.
1538 * src/frontends/support/LyXImage.h:
1539 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1542 * src/frontends/support/LyXImage_X.h:
1543 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1544 version of LyXImage, this uses the Xlib Pixmap.
1546 * src/PainterBase.h:
1547 * src/PainterBase.C:
1549 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1550 replacement to Pixmap.
1552 * src/insets/insetgraphics.h:
1553 * src/insets/insetgraphics.C:
1554 * src/graphics/GraphicsCacheItem.h:
1555 * src/graphics/GraphicsCacheItem.C:
1556 * src/graphics/GraphicsCacheItem_pimpl.h:
1557 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1560 * src/graphics/GraphicsCacheItem.h:
1561 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1562 another copy of the object.
1564 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1565 of cacheHandle, this fixed a bug that sent LyX crashing.
1567 * src/graphics/XPM_Renderer.h:
1568 * src/graphics/XPM_Renderer.C:
1569 * src/graphics/EPS_Renderer.h:
1570 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1572 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1574 * src/lyxfunc.C (processKeySym): only handle the
1575 lockinginset/inset stuff if we have a buffer and text loaded...
1577 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1579 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1581 * src/support/lyxfunctional.h: add operator= that takes a reference
1583 * src/lyxserver.C (mkfifo): make first arg const
1585 * src/layout.h: renamed name(...) to setName(...) to work around
1588 * src/buffer.C (setFileName): had to change name of function to
1589 work around bugs in egcs. (renamed from fileName)
1591 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1593 * src/support/translator.h: move helper template classes to
1594 lyxfunctional.h, include "support/lyxfunctional.h"
1596 * src/support/lyxmanip.h: add delaration of fmt
1598 * src/support/lyxfunctional.h: new file
1599 (class_fun_t): new template class
1600 (class_fun): helper template function
1601 (back_insert_fun_iterator): new template class
1602 (back_inserter_fun): helper template function
1603 (compare_memfun_t): new template class
1604 (compare_memfun): helper template function
1605 (equal_1st_in_pair): moved here from translator
1606 (equal_2nd_in_pair): moved here from translator
1608 * src/support/fmt.C: new file
1609 (fmt): new func, can be used for a printf substitute when still
1610 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1612 * src/support/StrPool.C: add some comments
1614 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1617 * src/insets/figinset.C (addpidwait): use std::copy with
1618 ostream_iterator to fill the pidwaitlist
1620 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1622 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1625 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1628 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1630 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1631 (class_update): ditto
1632 (BulletPanel): ditto
1633 (CheckChoiceClass): move initialization of tc and tct
1635 * src/tabular.C: remove current_view
1636 (OldFormatRead): similar to right below [istream::ignore]
1638 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1639 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1640 unused [istream::ignore]
1642 * src/lyxfunc.C: include "support/lyxfunctional.h"
1643 (getInsetByCode): use std::find_if and compare_memfun
1645 * src/lyxfont.C (stateText): remove c_str()
1647 * src/lyx_main.C (setDebuggingLevel): make static
1648 (commandLineHelp): make static
1650 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1651 Screen* together with fl_get_display() and fl_screen
1653 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1654 togheter with fl_get_display() and fl_screen
1655 (create_forms): remove c_str()
1657 * src/layout.C: include "support/lyxfunctional.h"
1658 (hasLayout): use std::find_if and compare_memfun
1659 (GetLayout): use std::find_if and comapre_memfun
1660 (delete_layout): use std::remove_if and compare_memfun
1661 (NumberOfClass): use std:.find_if and compare_memfun
1663 * src/gettext.h: change for the new functions
1665 * src/gettext.C: new file, make _(char const * str) and _(string
1666 const & str) real functions.
1668 * src/font.C (width): rewrite slightly to avoid one extra variable
1670 * src/debug.C: initialize Debug::ANY here
1672 * src/commandtags.h: update number comments
1674 * src/combox.h (get): make const func
1676 (getline): make const
1678 * src/combox.C (input_cb): handle case where fl_get_input can
1681 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1682 "support/lyxfunctional.h", remove current_view variable.
1683 (resize): use std::for_each with std::mem_fun
1684 (getFileNames): use std::copy with back_inserter_fun
1685 (getBuffer): change arg type to unsigned int
1686 (emergencyWriteAll): call emergencyWrite with std::for_each and
1688 (emergencyWrite): new method, the for loop in emergencyWriteAll
1690 (exists): use std::find_if with compare_memfun
1691 (getBuffer): use std::find_if and compare_memfun
1693 * src/buffer.h: add typedefs for iterator_category, value_type
1694 difference_type, pointer and reference for inset_iterator
1695 add postfix ++ for inset_iterator
1696 make inset_iterator::getPos() const
1698 * src/buffer.C: added support/lyxmanip.h
1699 (readFile): use lyxerr << fmt instead of printf
1700 (makeLaTeXFile): use std::copy to write out encodings
1702 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1704 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1705 free and the char * temp.
1706 (hasMenu): use std::find_if and compare_memfun
1709 * src/Makefile.am (lyx_SOURCES): added gettext.C
1711 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1712 string::insert small change to avoid temporary
1714 * src/LColor.C (getGUIName): remove c_str()
1716 * several files: change all occurrences of fl_display to
1719 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1720 that -pedantic is not used for gcc 2.97 (cvs gcc)
1722 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1724 2000-10-11 Allan Rae <rae@lyx.org>
1726 * src/frontends/xforms/FormPreferences.C (input): template path must be
1727 a readable directory. It doesn't need to be writeable.
1728 (build, delete, update, apply): New inputs in the various tabfolders
1730 * src/frontends/xforms/forms/form_preferences.fd:
1731 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1732 several new entries to existing folders. Shuffled some existing stuff
1735 * src/frontends/xforms/forms/form_print.fd:
1736 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1737 Should probably rework PrinterParams as well. Note that the switch to
1738 collated is effectively the same as !unsorted so changing PrinterParams
1739 will require a lot of fiddly changes to reverse the existing logic.
1741 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1743 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1745 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1747 2000-10-10 Allan Rae <rae@lyx.org>
1750 * src/lyxfunc.C (Dispatch):
1752 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1755 * src/lyxrc.C (output): Only write the differences between system lyxrc
1756 and the users settings.
1759 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1761 I'll rewrite this later, after 1.1.6 probably, to keep a single
1762 LyXRC but two instances of a LyXRCStruct.
1764 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1766 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1768 * src/tabular.h: add a few std:: qualifiers.
1770 * src/encoding.C: add using directive.
1771 * src/language.C: ditto.
1773 * src/insets/insetquotes.C (Validate): use languages->lang()
1774 instead of only language.
1776 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1778 * lib/languages: New file.
1780 * lib/encodings: New file.
1782 * src/language.C (Languages): New class.
1783 (read): New method. Reads the languages from the 'languages' file.
1785 * src/encoding.C (Encodings): New class.
1786 (read): New method. Reads the encodings from the 'encodings' file.
1788 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1791 * src/bufferparams.h and a lot of files: Deleted the member language,
1792 and renamed language_info to language
1794 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1795 * src/lyxfont.C (latexWriteStartChanges): ditto.
1796 * src/paragraph.C (validate,TeXOnePar): ditto.
1798 * src/lyxfont.C (update): Restored deleted code.
1800 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1802 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1804 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1806 * src/insets/figinset.[Ch]:
1807 * src/insets/insetinclude.[Ch]:
1808 * src/insets/insetinclude.[Ch]:
1809 * src/insets/insetparent.[Ch]:
1810 * src/insets/insetref.[Ch]:
1811 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1813 * src/insets/*.[Ch]:
1814 * src/mathed/formula.[Ch]:
1815 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1817 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1818 * src/lyx_cb.C (FigureApplyCB):
1819 * src/lyxfunc.C (getStatus, Dispatch):
1820 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1823 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1825 * src/converter.[Ch] (Formats::View):
1826 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1828 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1829 *current_view->buffer(). This will change later, but this patch is way
1832 2000-10-09 Juergen Vigna <jug@sad.it>
1834 * src/text.C (GetRow): small fix.
1836 * src/BufferView_pimpl.C (cursorPrevious):
1837 (cursorNext): added LyXText parameter to function.
1839 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1840 keypress depending on cursor position.
1842 2000-10-06 Juergen Vigna <jug@sad.it>
1844 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1845 (copySelection): redone this function and also copy ascii representa-
1848 * src/tabular.C (Ascii):
1852 (print_n_chars): new functions to realize the ascii export of tabulars.
1854 2000-10-05 Juergen Vigna <jug@sad.it>
1856 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1857 if we don't have a buffer.
1859 2000-10-10 Allan Rae <rae@lyx.org>
1861 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1862 with closing dialog. It seems that nested tabfolders require hiding
1863 of inner tabfolders before hiding the dialog itself. Actually all I
1864 did was hide the active outer folder.
1866 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1867 unless there really is a buffer. hideBufferDependent is called
1870 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1871 POTFILES.in stays in $(srcdir).
1873 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1875 * lib/lyxrc.example: Few changes.
1877 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1879 * src/BufferView_pimpl.C (buffer): only need one the
1880 updateBufferDependent signal to be emitted once! Moved to the end of
1881 the method to allow bv_->text to be updated first.
1883 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1884 and hSignal_ with Dialogs * and BufferDependency variables.
1885 New Buffer * parent_, initialised when the dialog is launched. Used to
1886 check whether to update() or hide() dialog in the new, private
1887 updateOrHide() method that is connected to the updateBufferDependent
1888 signal. Daughter classes dictate what to do using the
1889 ChangedBufferAction enum, passed to the c-tor.
1891 * src/frontends/xforms/FormCitation.C:
1892 * src/frontends/xforms/FormCommand.C:
1893 * src/frontends/xforms/FormCopyright.C:
1894 * src/frontends/xforms/FormDocument.C:
1895 * src/frontends/xforms/FormError.C:
1896 * src/frontends/xforms/FormIndex.C:
1897 * src/frontends/xforms/FormPreferences.C:
1898 * src/frontends/xforms/FormPrint.C:
1899 * src/frontends/xforms/FormRef.C:
1900 * src/frontends/xforms/FormToc.C:
1901 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1904 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1905 ChangedBufferAction enum.
1907 * src/frontends/xforms/FormParagraph.[Ch]
1908 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1911 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1913 * lib/bind/cua.bind: fix a bit.
1914 * lib/bind/emacs.bind: ditto.
1916 * lib/bind/menus.bind: remove real menu entries from there.
1918 * src/spellchecker.C: make sure we only include strings.h when
1921 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1923 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1924 function. It enlarges the maximum number of pup when needed.
1925 (add_toc2): Open a new menu if maximum number of items per menu has
1928 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1930 * src/frontends/kde/FormPrint.C: fix error reporting
1932 * src/frontends/xforms/FormDocument.C: fix compiler
1935 * lib/.cvsignore: add Literate.nw
1937 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1940 * bufferview_funcs.[Ch]
1943 * text2.C: Add support for numbers in RTL text.
1945 2000-10-06 Allan Rae <rae@lyx.org>
1947 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1948 to be gettext.m4 friendly again. ext_l10n.h is now
1949 generated into $top_srcdir instead of $top_builddir
1950 so that lyx.pot will be built correctly -- without
1951 duplicate parsing of ext_l10n.h.
1953 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1955 * src/frontends/kde/FormCitation.C: make the dialog
1956 behave more sensibly
1958 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1960 * config/kde.m4: fix consecutive ./configure runs,
1961 look for qtarch, fix library order
1963 * src/frontends/kde/Makefile.am: tidy up,
1964 add Print dialog, add .dlg dependencies
1966 * src/frontends/kde/FormPrint.C:
1967 * src/frontends/kde/FormPrint.h:
1968 * src/frontends/kde/formprintdialog.C:
1969 * src/frontends/kde/formprintdialog.h:
1970 * src/frontends/kde/formprintdialogdata.C:
1971 * src/frontends/kde/formprintdialogdata.h:
1972 * src/frontends/kde/dlg/formprintdialog.dlg: add
1975 * src/frontends/kde/dlg/README: Added explanatory readme
1977 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1978 script to double-check qtarch's output
1980 * src/frontends/kde/formindexdialog.C:
1981 * src/frontends/kde/formindexdialogdata.C:
1982 * src/frontends/kde/formindexdialogdata.h:
1983 * src/frontends/kde/dlg/formindexdialog.dlg: update
1984 for qtarch, minor fixes
1986 2000-10-05 Allan Rae <rae@lyx.org>
1988 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1989 dialogs when switching buffers update them instead. It's up to each
1990 dialog to decide if it should still be visible or not.
1991 update() should return a bool to control visiblity within show().
1992 Or perhaps better to set a member variable and use that to control
1995 * lib/build-listerrors: create an empty "listerrors" file just to stop
1996 make trying to regenerate it all the time if you don't have noweb
1999 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2001 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2002 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2003 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2004 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2005 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2007 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2009 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2011 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2012 deleting buffer. Closes all buffer-dependent dialogs.
2014 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2016 * src/frontends/xforms/FormCitation.[Ch]:
2017 * src/frontends/xforms/FormPreferences.[Ch]:
2018 * src/frontends/xforms/FormPrint.[Ch]:
2019 * src/frontends/xforms/FormRef.[Ch]:
2020 * src/frontends/xforms/FormUrl.[Ch]: ditto
2022 * src/frontends/xforms/FormDocument.[Ch]:
2023 * src/frontends/xforms/forms/form_document.C.patch:
2024 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2025 pass through a single input() function.
2027 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2029 * lib/build-listerrors: return status as OK
2031 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2033 * lib/lyxrc.example: Updated to new export code
2035 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2037 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2040 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2043 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2044 LyX-Code is defined.
2045 * lib/layouts/amsbook.layout: ditto.
2047 * boost/Makefile.am: fix typo.
2049 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2051 (add_lastfiles): removed.
2052 (add_documents): removed.
2053 (add_formats): removed.
2055 * src/frontends/Menubar.C: remove useless "using" directive.
2057 * src/MenuBackend.h: add a new MenuItem constructor.
2059 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2062 2000-10-04 Allan Rae <rae@lyx.org>
2064 * lib/Makefile.am (listerrors):
2065 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2066 I haven't got notangle installed so Kayvan please test. The output
2067 should end up in $builddir. This also allows people who don't have
2068 noweb installed to complete the make process without error.
2070 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2071 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2072 by JMarc's picky compiler.
2074 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2077 * src/insets/insettabular.C (setPos): change for loop to not use
2078 sequencing operator. Please check this Jürgen.
2080 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2082 * src/insets/insetcite.C (getScreenLabel): ditto
2083 * src/support/filetools.C (QuoteName): ditto
2084 (ChangeExtension): ditto
2086 * src/BufferView_pimpl.C (scrollCB): make heigt int
2088 * src/BufferView2.C (insertInset): comment out unused arg
2090 * boost/Makefile.am (EXTRADIST): new variable
2092 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2094 * src/exporter.C (IsExportable): Fixed
2096 * lib/configure.m4: Small fix
2098 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2100 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2101 * src/insets/insetbib.C (bibitemWidest): ditto.
2102 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2104 2000-10-03 Juergen Vigna <jug@sad.it>
2106 * src/BufferView2.C (theLockingInset): removed const because of
2107 Agnus's compile problems.
2109 * src/insets/insettext.C (LocalDispatch): set the language of the
2110 surronding paragraph on inserting the first character.
2112 * various files: changed use of BufferView::the_locking_inset.
2114 * src/BufferView2.C (theLockingInset):
2115 (theLockingInset): new functions.
2117 * src/BufferView.h: removed the_locking_inset.
2119 * src/lyxtext.h: added the_locking_inset
2121 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2123 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2125 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2127 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2128 * src/mathed/math_cursor.C (IsAlpha): ditto.
2129 * src/mathed/math_inset.C (strnew): ditto.
2130 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2131 (IMetrics): cxp set but never used; removed.
2132 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2133 that the variable in question has been removed also!
2136 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2137 using the Buffer * passed to Latex(), using the BufferView * passed to
2138 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2140 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2141 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2143 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2144 * src/buffer.C (readInset): used new InsetBibtex c-tor
2145 * (getBibkeyList): used new InsetBibtex::getKeys
2147 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2150 * lib/build-listerrors
2152 * src/exporter.C: Add literate programming support to the export code
2155 * src/lyx_cb.C: Remove old literate code.
2157 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2160 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2161 * src/converter.C (View, Convert): Use QuoteName.
2163 * src/insets/figinset.C (Preview): Use Formats::View.
2165 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2167 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2169 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2170 the top of the function, because compaq cxx complains that the
2171 "goto exit_with_message" when the function is disabled bypasses
2173 (MenuNew): try a better fix for the generation of new file names.
2174 This time, I used AddName() instead of AddPath(), hoping Juergen
2177 2000-10-03 Allan Rae <rae@lyx.org>
2179 * src/frontends/xforms/forms/form_preferences.fd:
2180 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2181 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2182 "Look and Feel"->"General" but will need to be split up further into
2183 general output and general input tabs. Current plan is for four outer
2184 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2185 stuff; "Inputs" for input and import configuration; "Outputs" for
2186 output and export configuration; and one more whatever is left over
2187 called "General". The leftovers at present look like being which
2188 viewers to use, spellchecker, language support and might be better
2189 named "Support". I've put "Paths" in "Inputs" for the moment as this
2190 seems reasonable for now at least.
2191 One problem remains: X error kills LyX when you close Preferences.
2193 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2195 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2196 qualifier from form()
2197 * src/frontends/xforms/FormCitation.[Ch]:
2198 * src/frontends/xforms/FormCopyright.[Ch]:
2199 * src/frontends/xforms/FormDocument.[Ch]:
2200 * src/frontends/xforms/FormError.[Ch]:
2201 * src/frontends/xforms/FormIndex.[Ch]:
2202 * src/frontends/xforms/FormPreferences.[Ch]:
2203 * src/frontends/xforms/FormPrint.[Ch]:
2204 * src/frontends/xforms/FormRef.[Ch]:
2205 * src/frontends/xforms/FormToc.[Ch]:
2206 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2208 * src/frontends/xforms/FormCitation.[Ch]:
2209 * src/frontends/xforms/FormIndex.[Ch]:
2210 * src/frontends/xforms/FormRef.[Ch]:
2211 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2212 with Allan's naming policy
2214 * src/frontends/xforms/FormCitation.C: some static casts to remove
2217 2000-10-02 Juergen Vigna <jug@sad.it>
2219 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2220 now you can type or do stuff inside the table-cell also when in dummy
2221 position, fixed visible cursor.
2223 * src/insets/insettext.C (Edit): fixing cursor-view position.
2225 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2226 be used for equal functions in lyxfunc and insettext.
2228 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2230 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2232 * src/frontends/gnome/FormCitation.h:
2233 * src/frontends/gnome/FormCopyright.h:
2234 * src/frontends/gnome/FormIndex.h:
2235 * src/frontends/gnome/FormPrint.h:
2236 * src/frontends/gnome/FormToc.h:
2237 * src/frontends/gnome/FormUrl.h:
2238 * src/frontends/kde/FormCitation.h:
2239 * src/frontends/kde/FormCopyright.h:
2240 * src/frontends/kde/FormIndex.h:
2241 * src/frontends/kde/FormRef.h:
2242 * src/frontends/kde/FormToc.h:
2243 * src/frontends/kde/FormUrl.h: fix remaining users of
2246 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2248 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2249 from depth argument.
2250 (DocBookHandleCaption): ditto.
2251 (DocBookHandleFootnote): ditto.
2252 (SimpleDocBookOnePar): ditto.
2254 * src/frontends/xforms/FormDocument.h (form): remove extra
2255 FormDocument:: qualifier.
2257 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2259 * sigc++/handle.h: ditto.
2261 * src/lyx_gui_misc.C: add "using" directive.
2263 * src/cheaders/cstddef: new file, needed by the boost library (for
2266 2000-10-02 Juergen Vigna <jug@sad.it>
2268 * src/insets/insettext.C (SetFont): better support.
2270 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2272 * src/screen.C (DrawOneRow): some uint refixes!
2274 2000-10-02 Allan Rae <rae@lyx.org>
2276 * boost/.cvsignore: ignore Makefile as well
2278 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2279 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2281 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2282 Left this one out by accident.
2284 * src/frontends/xforms/FormBase.h (restore): default to calling
2285 update() since that will restore the original/currently-applied values.
2286 Any input() triggered error messages will require the derived classes
2287 to redefine restore().
2289 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2290 avoid a segfault. combo_doc_class is the main concern.
2292 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2294 * Simplify build-listerrors in view of GUI-less export ability!
2296 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2298 * src/lyx_main.C (easyParse): Disable gui when exporting
2300 * src/insets/figinset.C:
2303 * src/lyx_gui_misc.C
2304 * src/tabular.C: Changes to allow no-gui.
2306 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2308 * src/support/utility.hpp: removed file
2309 * src/support/block.h: removed file
2311 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2314 * src/mathed/formula.C: add support/lyxlib.h
2315 * src/mathed/formulamacro.C: ditto
2317 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2318 * src/lyxparagraph.h: ditto
2320 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2321 * src/frontends/Makefile.am (INCLUDES): ditto
2322 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2323 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2324 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2325 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2326 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2327 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2329 * src/BufferView.h: use boost/utility.hpp
2330 * src/LColor.h: ditto
2331 * src/LaTeX.h: ditto
2332 * src/LyXAction.h: ditto
2333 * src/LyXView.h: ditto
2334 * src/bufferlist.h: ditto
2335 * src/lastfiles.h: ditto
2336 * src/layout.h: ditto
2337 * src/lyx_gui.h: ditto
2338 * src/lyx_main.h: ditto
2339 * src/lyxlex.h: ditto
2340 * src/lyxrc.h: ditto
2341 * src/frontends/ButtonPolicies.h: ditto
2342 * src/frontends/Dialogs.h: ditto
2343 * src/frontends/xforms/FormBase.h: ditto
2344 * src/frontends/xforms/FormGraphics.h: ditto
2345 * src/frontends/xforms/FormParagraph.h: ditto
2346 * src/frontends/xforms/FormTabular.h: ditto
2347 * src/graphics/GraphicsCache.h: ditto
2348 * src/graphics/Renderer.h: ditto
2349 * src/insets/ExternalTemplate.h: ditto
2350 * src/insets/insetcommand.h: ditto
2351 * src/support/path.h: ditto
2353 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2354 and introduce clause for 2.97.
2356 * boost/libs/README: new file
2358 * boost/boost/utility.hpp: new file
2360 * boost/boost/config.hpp: new file
2362 * boost/boost/array.hpp: new file
2364 * boost/Makefile.am: new file
2366 * boost/.cvsignore: new file
2368 * configure.in (AC_OUTPUT): add boost/Makefile
2370 * Makefile.am (SUBDIRS): add boost
2372 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2374 * src/support/lstrings.C (suffixIs): Fixed.
2376 2000-10-01 Allan Rae <rae@lyx.org>
2378 * src/PrinterParams.h: moved things around to avoid the "can't
2379 inline call" warning.
2381 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2382 into doc++ documentation.
2384 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2386 * src/frontends/xforms/FormRef.C: make use of button controller
2387 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2388 cleaned up button controller usage.
2389 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2390 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2391 use the button controller
2393 * src/frontends/xforms/forms/*.fd: and associated generated files
2394 updated to reflect changes to FormBase. Some other FormXxxx files
2395 also got minor updates to reflect changes to FormBase.
2397 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2398 (hide): made virtual.
2399 (input): return a bool. true == valid input
2400 (RestoreCB, restore): new
2401 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2402 Changes to allow derived dialogs to use a ButtonController and
2403 make sense when doing so: OK button calls ok() and so on.
2405 * src/frontends/xforms/ButtonController.h (class ButtonController):
2406 Switch from template implementation to taking Policy parameter.
2407 Allows FormBase to provide a ButtonController for any dialog.
2409 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2410 Probably should rename connect and disconnect.
2411 (apply): use the radio button groups
2412 (form): needed by FormBase
2413 (build): setup the radio button groups
2415 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2417 * several files: type changes to reduce the number of warnings and
2418 to unify type hangling a bit. Still much to do.
2420 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2422 * lib/images/*: rename a bunch of icons to match Dekel converter
2425 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2428 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2430 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2432 * sigc++/handle.h: ditto for class Handle.
2434 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2436 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2438 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2440 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2441 removal of the "default" language.
2443 * src/combox.h (getline): Check that sel > 0
2445 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2447 * lib/examples/docbook_example.lyx
2448 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2450 * lib/layouts/docbook-book.layout: new docbook book layout.
2452 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2454 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2456 * src/insets/figinset.C (DocBook):fixed small typo.
2458 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2460 * src/insets/insetinclude.h: string include_label doesn't need to be
2463 2000-09-29 Allan Rae <rae@lyx.org>
2465 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2466 Allow derived type to control connection and disconnection from signals
2467 of its choice if desired.
2469 2000-09-28 Juergen Vigna <jug@sad.it>
2471 * src/insets/insettabular.C (update): fixed cursor setting when
2472 the_locking_inset changed.
2473 (draw): made this a bit cleaner.
2474 (InsetButtonPress): fixed!
2476 * various files: added LyXText Parameter to fitCursor call.
2478 * src/BufferView.C (fitCursor): added LyXText parameter.
2480 * src/insets/insettabular.C (draw): small draw fix.
2482 * src/tabular.C: right setting of left/right celllines.
2484 * src/tabular.[Ch]: fixed various types in funcions and structures.
2485 * src/insets/insettabular.C: ditto
2486 * src/frontends/xforms/FormTabular.C: ditto
2488 2000-09-28 Allan Rae <rae@lyx.org>
2490 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2491 that the #ifdef's had been applied to part of what should have been
2492 a complete condition. It's possible there are other tests that
2493 were specific to tables that are also wrong now that InsetTabular is
2494 being used. Now we need to fix the output of '\n' after a table in a
2495 float for the same reason as the original condition:
2496 "don't insert this if we would be adding it before or after a table
2497 in a float. This little trick is needed in order to allow use of
2498 tables in \subfigures or \subtables."
2499 Juergen can you check this?
2501 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2503 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2504 output to the ostream.
2506 * several files: fixed types based on warnings from cxx
2508 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2510 * src/frontends/kde/Makefile.am: fix rule for
2511 formindexdialogdata_moc.C
2513 * src/.cvsignore: add ext_l10n.h to ignore
2515 * acconfig.h: stop messing with __STRICT_ANSI__
2516 * config/gnome.m4: remove option to set -ansi
2517 * config/kde.m4: remove option to set -ansi
2518 * config/lyxinclude.m4: don't set -ansi
2520 2000-09-27 Juergen Vigna <jug@sad.it>
2522 * various files: remove "default" language check.
2524 * src/insets/insetquotes.C: removed use of current_view.
2526 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2527 the one should have red ears by now!
2529 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2530 in more then one paragraph. Fixed cursor-movement/selection.
2532 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2533 paragraphs inside a text inset.
2535 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2536 text-inset if this owner is an inset.
2538 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2540 * src/Bullet.h: changed type of font, character and size to int
2542 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2544 * src/insets/inseturl.[Ch]:
2545 * src/insets/insetref.[Ch]:
2546 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2548 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2550 * src/buffer.C (readFile): block-if statement rearranged to minimise
2551 bloat. Patch does not reverse Jean-Marc's change ;-)
2553 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2554 Class rewritten to store pointers to hide/update signals directly,
2555 rather than Dialogs *. Also defined an enum to ease use. All xforms
2556 forms can now be derived from this class.
2558 * src/frontends/xforms/FormCommand.[Ch]
2559 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2561 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2564 * src/frontends/xforms/forms/form_citation.fd
2565 * src/frontends/xforms/forms/form_copyright.fd
2566 * src/frontends/xforms/forms/form_error.fd
2567 * src/frontends/xforms/forms/form_index.fd
2568 * src/frontends/xforms/forms/form_ref.fd
2569 * src/frontends/xforms/forms/form_toc.fd
2570 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2572 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2574 * src/insets/insetfoot.C: removed redundent using directive.
2576 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2578 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2579 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2581 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2582 created in the constructors in different groups. Then set() just
2583 have to show the groups as needed. This fixes the redraw problems
2584 (and is how the old menu code worked).
2586 * src/support/lyxlib.h: declare the methods as static when we do
2587 not have namespaces.
2589 2000-09-26 Juergen Vigna <jug@sad.it>
2591 * src/buffer.C (asciiParagraph): new function.
2592 (writeFileAscii): new function with parameter ostream.
2593 (writeFileAscii): use now asciiParagraph.
2595 * various inset files: added the linelen parameter to the Ascii-func.
2597 * src/tabular.C (Write): fixed error in writing file introduced by
2598 the last changes from Lars.
2600 * lib/bind/menus.bind: removed not supported functions.
2602 * src/insets/insettext.C (Ascii): implemented this function.
2604 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2606 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2607 (Write): use of the write_attribute functions.
2609 * src/bufferlist.C (close): fixed reasking question!
2611 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2613 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2614 new files use the everwhere possible.
2617 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2618 src/log_form.C src/lyx.C:
2621 * src/buffer.C (runLaTeX): remove func
2623 * src/PaperLayout.C: removed file
2624 * src/ParagraphExtra.C: likewise
2625 * src/bullet_forms.C: likewise
2626 * src/bullet_forms.h: likewise
2627 * src/bullet_forms_cb.C: likewise
2629 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2630 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2633 * several files: remove all traces of the old fd_form_paragraph,
2634 and functions belonging to that.
2636 * several files: remove all traces of the old fd_form_document,
2637 and functions belonging to that.
2639 * several files: constify local variables were possible.
2641 * several files: remove all code that was dead when NEW_EXPORT was
2644 * several files: removed string::c_str in as many places as
2647 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2648 (e): be a bit more outspoken when patching
2649 (updatesrc): only move files if changed.
2651 * forms/layout_forms.h.patch: regenerated
2653 * forms/layout_forms.fd: remove form_document and form_paragraph
2654 and form_quotes and form_paper and form_table_options and
2655 form_paragraph_extra
2657 * forms/form1.fd: remove form_table
2659 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2660 the fdui->... rewrite. Update some comments to xforms 0.88
2662 * forms/bullet_forms.C.patch: removed file
2663 * forms/bullet_forms.fd: likewise
2664 * forms/bullet_forms.h.patch: likewise
2666 * development/Code_rules/Rules: added a section on switch
2667 statements. Updated some comment to xforms 0.88.
2669 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2671 * src/buffer.C (readFile): make sure that the whole version number
2672 is read after \lyxformat (even when it contains a comma)
2674 * lib/ui/default.ui: change shortcut of math menu to M-a.
2676 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2678 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2681 * src/LyXView.C (updateWindowTitle): show the full files name in
2682 window title, limited to 30 characters.
2684 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2685 When a number of characters has been given, we should not assume
2686 that the string is 0-terminated.
2688 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2689 calls (fixes some memory leaks)
2691 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2692 trans member on exit.
2694 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2696 * src/converter.C (GetReachable): fix typo.
2698 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2699 understand ',' instead of '.'.
2700 (GetInteger): rewrite to use strToInt().
2702 2000-09-26 Juergen Vigna <jug@sad.it>
2704 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2705 better visibility and error-message on wrong VSpace input.
2707 * src/language.C (initL): added english again.
2709 2000-09-25 Juergen Vigna <jug@sad.it>
2711 * src/frontends/kde/Dialogs.C (Dialogs):
2712 * src/frontends/gnome/Dialogs.C (Dialogs):
2713 * src/frontends/kde/Makefile.am:
2714 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2716 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2718 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2720 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2722 * src/frontends/xforms/FormParagraph.C:
2723 * src/frontends/xforms/FormParagraph.h:
2724 * src/frontends/xforms/form_paragraph.C:
2725 * src/frontends/xforms/form_paragraph.h:
2726 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2729 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2731 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2732 Paragraph-Data after use.
2734 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2735 non breakable paragraphs.
2737 2000-09-25 Garst R. Reese <reese@isn.net>
2739 * src/language.C (initL): added missing language_country codes.
2741 2000-09-25 Juergen Vigna <jug@sad.it>
2743 * src/insets/insettext.C (InsetText):
2744 (deleteLyXText): remove the not released LyXText structure!
2746 2000-09-24 Marko Vendelin <markov@ioc.ee>
2748 * src/frontends/gnome/mainapp.C
2749 * src/frontends/gnome/mainapp.h: added support for keyboard
2752 * src/frontends/gnome/FormCitation.C
2753 * src/frontends/gnome/FormCitation.h
2754 * src/frontends/gnome/Makefile.am
2755 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2756 FormCitation to use "action area" in mainapp window
2758 * src/frontends/gnome/Menubar_pimpl.C
2759 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2762 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2764 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2765 width/descent/ascent values if name is empty.
2766 (mathed_string_height): Use std::max.
2768 2000-09-25 Allan Rae <rae@lyx.org>
2770 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2771 segfault. This will be completely redesigned soon.
2773 * sigc++: updated libsigc++. Fixes struct timespec bug.
2775 * development/tools/makeLyXsigc.sh: .cvsignore addition
2777 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2779 * several files: removed almost all traces of the old table
2782 * src/TableLayout.C: removed file
2784 2000-09-22 Juergen Vigna <jug@sad.it>
2786 * src/frontends/kde/Dialogs.C: added credits forms.
2788 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2790 * src/frontends/gnome/Dialogs.C: added some forms.
2792 * src/spellchecker.C (init_spell_checker): set language in pspell code
2793 (RunSpellChecker): some modifications for setting language string.
2795 * src/language.[Ch]: added language_country code.
2797 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2799 * src/frontends/Dialogs.h: added new signal showError.
2800 Rearranged existing signals in some sort of alphabetical order.
2802 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2803 FormError.[Ch], form_error.[Ch]
2804 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2805 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2807 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2808 dialogs. I think that this can be used as the base to all these
2811 * src/frontends/xforms/FormError.[Ch]
2812 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2813 implementation of InsetError dialog.
2815 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2817 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2818 * src/frontends/kde/Makefile.am: ditto
2820 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2822 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2823 macrobf. This fixes a bug of invisible text.
2825 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2827 * lib/doc/LaTeXConfig.lyx.in: updated.
2829 * src/language.C (initL): remove language "francais" and change a
2830 bit the names of the two other french variations.
2832 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2833 string that may not be 0-terminated.
2835 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2837 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2839 2000-09-20 Marko Vendelin <markov@ioc.ee>
2841 * src/frontends/gnome/FormCitation.C
2842 * src/frontends/gnome/FormIndex.C
2843 * src/frontends/gnome/FormToc.C
2844 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2845 the variable initialization to shut up the warnings
2847 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2849 * src/table.[Ch]: deleted files
2851 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2854 2000-09-18 Juergen Vigna <jug@sad.it>
2856 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2857 problems with selection. Inserted new LFUN_PASTESELECTION.
2858 (InsetButtonPress): inserted handling of middle mouse-button paste.
2860 * src/spellchecker.C: changed word to word.c_str().
2862 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2864 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2865 included in the ``make dist'' tarball.
2867 2000-09-15 Juergen Vigna <jug@sad.it>
2869 * src/CutAndPaste.C (cutSelection): small fix return the right
2870 end position after cut inside one paragraph only.
2872 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2873 we are locked as otherwise we don't have a valid cursor position!
2875 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2877 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2879 * src/frontends/kde/FormRef.C: added using directive.
2880 * src/frontends/kde/FormToc.C: ditto
2882 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2884 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2886 2000-09-19 Marko Vendelin <markov@ioc.ee>
2888 * src/frontends/gnome/Menubar_pimpl.C
2889 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2890 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2892 * src/frontends/gnome/mainapp.C
2893 * src/frontends/gnome/mainapp.h: support for menu update used
2896 * src/frontends/gnome/mainapp.C
2897 * src/frontends/gnome/mainapp.h: support for "action" area in the
2898 main window. This area is used by small simple dialogs, such as
2901 * src/frontends/gnome/FormIndex.C
2902 * src/frontends/gnome/FormIndex.h
2903 * src/frontends/gnome/FormUrl.C
2904 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2907 * src/frontends/gnome/FormCitation.C
2908 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2909 action area. Only "Insert new citation" is implemented.
2911 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2913 * src/buffer.C (Dispatch): fix call to Dispatch
2914 * src/insets/insetref.C (Edit): likewise
2915 * src/insets/insetparent.C (Edit): likewise
2916 * src/insets/insetinclude.C (include_cb): likewise
2917 * src/frontends/xforms/FormUrl.C (apply): likewise
2918 * src/frontends/xforms/FormToc.C (apply): likewise
2919 * src/frontends/xforms/FormRef.C (apply): likewise
2920 * src/frontends/xforms/FormIndex.C (apply): likewise
2921 * src/frontends/xforms/FormCitation.C (apply): likewise
2922 * src/lyxserver.C (callback): likewise
2923 * src/lyxfunc.C (processKeySym): likewise
2924 (Dispatch): likewise
2925 (Dispatch): likewise
2926 * src/lyx_cb.C (LayoutsCB): likewise
2928 * Makefile.am (sourcedoc): small change
2930 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2932 * src/main.C (main): Don't make an empty GUIRunTime object. all
2933 methods are static. constify a bit remove unneded using + headers.
2935 * src/tabular.C: some more const to local vars move some loop vars
2937 * src/spellchecker.C: added some c_str after some word for pspell
2939 * src/frontends/GUIRunTime.h: add new static method setDefaults
2940 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2941 * src/frontends/kde/GUIRunTime.C (setDefaults):
2942 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2944 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2945 with strnew in arg, use correct emptystring when calling SetName.
2947 * several files: remove all commented code with relation to
2948 HAVE_SSTREAM beeing false. We now only support stringstream and
2951 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2953 * src/lyxfunc.C: construct correctly the automatic new file
2956 * src/text2.C (IsStringInText): change type of variable i to shut
2959 * src/support/sstream.h: do not use namespaces if the compiler
2960 does not support them.
2962 2000-09-15 Marko Vendelin <markov@ioc.ee>
2963 * src/frontends/gnome/FormCitation.C
2964 * src/frontends/gnome/FormCitation.h
2965 * src/frontends/gnome/diainsertcitation_interface.c
2966 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2967 regexp support to FormCitation [Gnome].
2969 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2972 * configure.in: remove unused KDE/GTKGUI define
2974 * src/frontends/kde/FormRef.C
2975 * src/frontends/kde/FormRef.h
2976 * src/frontends/kde/formrefdialog.C
2977 * src/frontends/kde/formrefdialog.h: double click will
2978 go to reference, now it is possible to change a cross-ref
2981 * src/frontends/kde/FormToc.C
2982 * src/frontends/kde/FormToc.h
2983 * src/frontends/kde/formtocdialog.C
2984 * src/frontends/kde/formtocdialog.h: add a depth
2987 * src/frontends/kde/Makefile.am: add QtLyXView.h
2990 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2992 * src/frontends/kde/FormCitation.h: added some using directives.
2994 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2996 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2999 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3002 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3004 * src/buffer.C (pop_tag): revert for the second time a change by
3005 Lars, who seems to really hate having non-local loop variables :)
3007 * src/Lsstream.h: add "using" statements.
3009 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3010 * src/buffer.C (writeFile): ditto
3012 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3014 * src/buffer.C (writeFile): try to fix the locale modified format
3015 number to always be as we want it.
3017 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3018 in XForms 0.89. C-space is now working again.
3020 * src/Lsstream.h src/support/sstream.h: new files.
3022 * also commented out all cases where strstream were used.
3024 * src/Bullet.h (c_str): remove method.
3026 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3028 * a lot of files: get rid of "char const *" and "char *" is as
3029 many places as possible. We only want to use them in interaction
3030 with system of other libraries, not inside lyx.
3032 * a lot of files: return const object is not of pod type. This
3033 helps ensure that temporary objects is not modified. And fits well
3034 with "programming by contract".
3036 * configure.in: check for the locale header too
3038 * Makefile.am (sourcedoc): new tag for generation of doc++
3041 2000-09-14 Juergen Vigna <jug@sad.it>
3043 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3044 callback to check which combo called it and do the right action.
3046 * src/combox.C (combo_cb): added combo * to the callbacks.
3047 (Hide): moved call of callback after Ungrab of the pointer.
3049 * src/intl.h: removed LCombo2 function.
3051 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3052 function as this can now be handled in one function.
3054 * src/combox.h: added Combox * to callback prototype.
3056 * src/frontends/xforms/Toolbar_pimpl.C:
3057 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3059 2000-09-14 Garst Reese <reese@isn.net>
3061 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3062 moved usepackage{xxx}'s to beginning of file. Changed left margin
3063 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3064 underlining from title. Thanks to John Culleton for useful suggestions.
3066 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3068 * src/lyxlex_pimpl.C (setFile): change error message to debug
3071 2000-09-13 Juergen Vigna <jug@sad.it>
3073 * src/frontends/xforms/FormDocument.C: implemented choice_class
3074 as combox and give callback to combo_language so OK/Apply is activated
3077 * src/bufferlist.C (newFile): small fix so already named files
3078 (via an open call) are not requested to be named again on the
3081 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3083 * src/frontends/kde/Makefile.am
3084 * src/frontends/kde/FormRef.C
3085 * src/frontends/kde/FormRef.h
3086 * src/frontends/kde/formrefdialog.C
3087 * src/frontends/kde/formrefdialog.h: implement
3090 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3092 * src/frontends/kde/formtocdialog.C
3093 * src/frontends/kde/formtocdialog.h
3094 * src/frontends/kde/FormToc.C
3095 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3097 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3099 * src/frontends/kde/FormCitation.C: fix thinko
3100 where we didn't always display the reference text
3103 * src/frontends/kde/formurldialog.C
3104 * src/frontends/kde/formurldialog.h
3105 * src/frontends/kde/FormUrl.C
3106 * src/frontends/kde/FormUrl.h: minor cleanups
3108 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3110 * src/frontends/kde/Makefile.am
3111 * src/frontends/kde/FormToc.C
3112 * src/frontends/kde/FormToc.h
3113 * src/frontends/kde/FormCitation.C
3114 * src/frontends/kde/FormCitation.h
3115 * src/frontends/kde/FormIndex.C
3116 * src/frontends/kde/FormIndex.h
3117 * src/frontends/kde/formtocdialog.C
3118 * src/frontends/kde/formtocdialog.h
3119 * src/frontends/kde/formcitationdialog.C
3120 * src/frontends/kde/formcitationdialog.h
3121 * src/frontends/kde/formindexdialog.C
3122 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3124 2000-09-12 Juergen Vigna <jug@sad.it>
3126 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3129 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3131 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3134 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3136 * src/converter.C (Add, Convert): Added support for converter flags:
3137 needaux, resultdir, resultfile.
3138 (Convert): Added new parameter view_file.
3139 (dvips_options): Fixed letter paper option.
3141 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3142 (Export, GetExportableFormats, GetViewableFormats): Added support
3145 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3147 (easyParse): Fixed to work with new export code.
3149 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3152 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3154 * lib/bind/*.bind: Replaced
3155 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3156 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3158 2000-09-11 Juergen Vigna <jug@sad.it>
3160 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3162 * src/main.C (main): now GUII defines global guiruntime!
3164 * src/frontends/gnome/GUIRunTime.C (initApplication):
3165 * src/frontends/kde/GUIRunTime.C (initApplication):
3166 * src/frontends/xforms/GUIRunTime.C (initApplication):
3167 * src/frontends/GUIRunTime.h: added new function initApplication.
3169 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3171 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3173 2000-09-08 Juergen Vigna <jug@sad.it>
3175 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3176 we have already "Reset".
3178 * src/language.C (initL): inserted "default" language and made this
3179 THE default language (and not american!)
3181 * src/paragraph.C: inserted handling of "default" language!
3183 * src/lyxfont.C: ditto
3187 * src/paragraph.C: output the \\par only if we have a following
3188 paragraph otherwise it's not needed.
3190 2000-09-05 Juergen Vigna <jug@sad.it>
3192 * config/pspell.m4: added entry to lyx-flags
3194 * src/spellchecker.C: modified version from Kevin for using pspell
3196 2000-09-01 Marko Vendelin <markov@ioc.ee>
3197 * src/frontends/gnome/Makefile.am
3198 * src/frontends/gnome/FormCitation.C
3199 * src/frontends/gnome/FormCitation.h
3200 * src/frontends/gnome/diainsertcitation_callbacks.c
3201 * src/frontends/gnome/diainsertcitation_callbacks.h
3202 * src/frontends/gnome/diainsertcitation_interface.c
3203 * src/frontends/gnome/diainsertcitation_interface.h
3204 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3205 dialog for Gnome frontend
3207 * src/main.C: Gnome libraries require keeping application name
3208 and its version as strings
3210 * src/frontends/gnome/mainapp.C: Change the name of the main window
3211 from GnomeLyX to PACKAGE
3213 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3215 * src/frontends/Liason.C: add "using: declaration.
3217 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3219 * src/mathed/math_macro.C (Metrics): Set the size of the template
3221 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3223 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3225 * src/converter.C (add_options): New function.
3226 (SetViewer): Change $$FName into '$$FName'.
3227 (View): Add options when running xdvi
3228 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3229 (Convert): The 3rd parameter is now the desired filename. Converts
3230 calls to lyx::rename if necessary.
3231 Add options when running dvips.
3232 (dvi_papersize,dvips_options): New methods.
3234 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3236 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3237 using a call to Converter::dvips_options.
3238 Fixed to work with nex export code.
3240 * src/support/copy.C
3241 * src/support/rename.C: New files
3243 * src/support/syscall.h
3244 * src/support/syscall.C: Added Starttype SystemDontWait.
3246 * lib/ui/default.ui: Changed to work with new export code
3248 * lib/configure.m4: Changed to work with new export code
3250 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3252 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3254 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3255 so that code compiles with DEC cxx.
3257 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3258 to work correctly! Also now supports the additional elements
3261 2000-09-01 Allan Rae <rae@lyx.org>
3263 * src/frontends/ButtonPolicies.C: renamed all the references to
3264 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3266 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3267 since it's a const not a type.
3269 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3271 2000-08-31 Juergen Vigna <jug@sad.it>
3273 * src/insets/figinset.C: Various changes to look if the filename has
3274 an extension and if not add it for inline previewing.
3276 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3278 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3279 make buttonStatus and isReadOnly be const methods. (also reflect
3280 this in derived classes.)
3282 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3283 (nextState): change to be static inline, pass the StateMachine as
3285 (PreferencesPolicy): remove casts
3286 (OkCancelPolicy): remvoe casts
3287 (OkCancelReadOnlyPolicy): remove casts
3288 (NoRepeatedApplyReadOnlyPolicy): remove casts
3289 (OkApplyCancelReadOnlyPolicy): remove casts
3290 (OkApplyCancelPolicy): remove casts
3291 (NoRepeatedApplyPolicy): remove casts
3293 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3295 * src/converter.C: added some using directives
3297 * src/frontends/ButtonPolicies.C: changes to overcome
3298 "need lvalue" error with DEC c++
3300 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3301 to WMHideCB for DEC c++
3303 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3305 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3306 to BulletBMTableCB for DEC c++
3308 2000-08-31 Allan Rae <rae@lyx.org>
3310 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3311 character dialog separately from old document dialogs combo_language.
3314 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3316 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3317 Removed LFUN_REF_CREATE.
3319 * src/MenuBackend.C: Added new tags: toc and references
3321 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3322 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3324 (add_toc, add_references): New methods.
3325 (create_submenu): Handle correctly the case when there is a
3326 seperator after optional menu items.
3328 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3329 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3330 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3332 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3334 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3336 * src/converter.[Ch]: New file for converting between different
3339 * src/export.[Ch]: New file for exporting a LyX file to different
3342 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3343 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3344 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3345 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3346 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3347 RunDocBook, MenuExport.
3349 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3350 Exporter::Preview methods if NEW_EXPORT is defined.
3352 * src/buffer.C (Dispatch): Use Exporter::Export.
3354 * src/lyxrc.C: Added new tags: \converter and \viewer.
3357 * src/LyXAction.C: Define new lyx-function: buffer-update.
3358 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3359 when NEW_EXPORT is defined.
3361 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3363 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3365 * lib/ui/default.ui: Added submenus "view" and "update" to the
3368 * src/filetools.C (GetExtension): New function.
3370 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3372 2000-08-29 Allan Rae <rae@lyx.org>
3374 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3376 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3377 (EnableDocumentLayout): removed
3378 (DisableDocumentLayout): removed
3379 (build): make use of ButtonController's read-only handling to
3380 de/activate various objects. Replaces both of the above functions.
3382 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3383 (readOnly): was read_only
3384 (refresh): fixed dumb mistakes with read_only_ handling
3386 * src/frontends/xforms/forms/form_document.fd:
3387 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3388 tabbed dialogs so the tabs look more like tabs and so its easier to
3389 work out which is the current tab.
3391 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3392 segfault with form_table
3394 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3396 2000-08-28 Juergen Vigna <jug@sad.it>
3398 * acconfig.h: added USE_PSPELL.
3400 * src/config.h.in: added USE_PSPELL.
3402 * autogen.sh: added pspell.m4
3404 * config/pspell.m4: new file.
3406 * src/spellchecker.C: implemented support for pspell libary.
3408 2000-08-25 Juergen Vigna <jug@sad.it>
3410 * src/LyXAction.C (init): renamed LFUN_TABLE to
3411 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3413 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3415 * src/lyxscreen.h: add force_clear variable and fuction to force
3416 a clear area when redrawing in LyXText.
3418 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3420 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3422 * some whitespace and comment changes.
3424 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3426 * src/buffer.C: up te LYX_FORMAT to 2.17
3428 2000-08-23 Juergen Vigna <jug@sad.it>
3430 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3433 * src/insets/insettabular.C (pasteSelection): delete the insets
3434 LyXText as it is not valid anymore.
3435 (copySelection): new function.
3436 (pasteSelection): new function.
3437 (cutSelection): new function.
3438 (LocalDispatch): implemented cut/copy/paste of cell selections.
3440 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3441 don't have a LyXText.
3443 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3445 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3448 2000-08-22 Juergen Vigna <jug@sad.it>
3450 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3451 ifdef form_table out if NEW_TABULAR.
3453 2000-08-21 Juergen Vigna <jug@sad.it>
3455 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3456 (draw): fixed draw position so that the cursor is positioned in the
3458 (InsetMotionNotify): hide/show cursor so the position is updated.
3459 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3460 using cellstart() function where it should be used.
3462 * src/insets/insettext.C (draw): ditto.
3464 * src/tabular.C: fixed initialization of some missing variables and
3465 made BoxType into an enum.
3467 2000-08-22 Marko Vendelin <markov@ioc.ee>
3468 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3469 stock menu item using action numerical value, not its string
3473 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3475 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3476 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3478 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3480 * src/frontends/xforms/GUIRunTime.C: new file
3482 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3483 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3485 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3487 * src/frontends/kde/GUIRunTime.C: new file
3489 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3490 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3492 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3494 * src/frontends/gnome/GUIRunTime.C: new file
3496 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3499 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3500 small change to documetentation.
3502 * src/frontends/GUIRunTime.C: removed file
3504 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3506 * src/lyxparagraph.h: enable NEW_TABULAR as default
3508 * src/lyxfunc.C (processKeySym): remove some commented code
3510 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3511 NEW_TABULAR around the fd_form_table_options.
3513 * src/lyx_gui.C (runTime): call the static member function as
3514 GUIRunTime::runTime().
3516 2000-08-21 Allan Rae <rae@lyx.org>
3518 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3521 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3523 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3525 2000-08-21 Allan Rae <rae@lyx.org>
3527 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3528 keep Garst happy ;-)
3529 * src/frontends/xforms/FormPreferences.C (build): use setOK
3530 * src/frontends/xforms/FormDocument.C (build): use setOK
3531 (FormDocument): use the appropriate policy.
3533 2000-08-21 Allan Rae <rae@lyx.org>
3535 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3536 automatic [de]activation of arbitrary objects when in a read-only state.
3538 * src/frontends/ButtonPolicies.h: More documentation
3539 (isReadOnly): added to support the above.
3541 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3543 2000-08-18 Juergen Vigna <jug@sad.it>
3545 * src/insets/insettabular.C (getStatus): changed to return func_status.
3547 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3548 display toggle menu entries if they are.
3550 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3551 new document layout now.
3553 * src/lyxfunc.C: ditto
3555 * src/lyx_gui_misc.C: ditto
3557 * src/lyx_gui.C: ditto
3559 * lib/ui/default.ui: removed paper and quotes layout as they are now
3560 all in the document layout tabbed folder.
3562 * src/frontends/xforms/forms/form_document.fd: added Restore
3563 button and callbacks for all inputs for Allan's ButtonPolicy.
3565 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3566 (CheckChoiceClass): added missing params setting on class change.
3567 (UpdateLayoutDocument): added for updating the layout on params.
3568 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3569 (FormDocument): Implemented Allan's ButtonPolicy with the
3572 2000-08-17 Allan Rae <rae@lyx.org>
3574 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3575 so we can at least see the credits again.
3577 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3578 controller calls for the appropriate callbacks. Note that since Ok
3579 calls apply followed by cancel, and apply isn't a valid input for the
3580 APPLIED state, the bc_ calls have to be made in the static callback not
3581 within each of the real callbacks.
3583 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3584 (setOk): renamed from setOkay()
3586 2000-08-17 Juergen Vigna <jug@sad.it>
3588 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3589 in the implementation part.
3590 (composeUIInfo): don't show optional menu-items.
3592 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3594 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3596 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3597 text-state when in a text-inset.
3599 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3601 2000-08-17 Marko Vendelin <markov@ioc.ee>
3602 * src/frontends/gnome/FormIndex.C
3603 * src/frontends/gnome/FormIndex.h
3604 * src/frontends/gnome/FormToc.C
3605 * src/frontends/gnome/FormToc.h
3606 * src/frontends/gnome/dialogs
3607 * src/frontends/gnome/diatoc_callbacks.c
3608 * src/frontends/gnome/diatoc_callbacks.h
3609 * src/frontends/gnome/diainsertindex_callbacks.h
3610 * src/frontends/gnome/diainsertindex_callbacks.c
3611 * src/frontends/gnome/diainsertindex_interface.c
3612 * src/frontends/gnome/diainsertindex_interface.h
3613 * src/frontends/gnome/diatoc_interface.h
3614 * src/frontends/gnome/diatoc_interface.c
3615 * src/frontends/gnome/Makefile.am: Table of Contents and
3616 Insert Index dialogs implementation for Gnome frontend
3618 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3620 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3622 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3625 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3627 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3628 destructor. Don't definde if you don't need it
3629 (processEvents): made static, non-blocking events processing for
3631 (runTime): static method. event loop for xforms
3632 * similar as above for kde and gnome.
3634 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3635 new Pimpl is correct
3636 (runTime): new method calss the real frontends runtime func.
3638 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3640 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3642 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3644 2000-08-16 Juergen Vigna <jug@sad.it>
3646 * src/lyx_gui.C (runTime): added GUII RunTime support.
3648 * src/frontends/Makefile.am:
3649 * src/frontends/GUIRunTime.[Ch]:
3650 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3651 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3652 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3654 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3656 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3657 as this is already set in ${FRONTEND_INCLUDE} if needed.
3659 * configure.in (CPPFLAGS): setting the include dir for the frontend
3660 directory and don't set FRONTEND=xforms for now as this is executed
3663 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3665 * src/frontends/kde/Makefile.am:
3666 * src/frontends/kde/FormUrl.C:
3667 * src/frontends/kde/FormUrl.h:
3668 * src/frontends/kde/formurldialog.h:
3669 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3671 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3673 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3675 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3677 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3680 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3682 * src/WorkArea.C (work_area_handler): more work to get te
3683 FL_KEYBOARD to work with xforms 0.88 too, please test.
3685 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3687 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3689 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3692 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3694 * src/Timeout.h: remove Qt::emit hack.
3696 * several files: changes to allo doc++ compilation
3698 * src/lyxfunc.C (processKeySym): new method
3699 (processKeyEvent): comment out if FL_REVISION < 89
3701 * src/WorkArea.C: change some debugging levels.
3702 (WorkArea): set wantkey to FL_KEY_ALL
3703 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3704 clearer code and the use of compose with XForms 0.89. Change to
3705 use signals instead of calling methods in bufferview directly.
3707 * src/Painter.C: change some debugging levels.
3709 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3712 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3713 (workAreaKeyPress): new method
3715 2000-08-14 Juergen Vigna <jug@sad.it>
3717 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3719 * config/kde.m4: addes some features
3721 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3722 include missing xforms dialogs.
3724 * src/Timeout.h: a hack to be able to compile with qt/kde.
3726 * sigc++/.cvsignore: added acinclude.m4
3728 * lib/.cvsignore: added listerros
3730 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3731 xforms tree as objects are needed for other frontends.
3733 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3734 linking with not yet implemented xforms objects.
3736 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3738 2000-08-14 Baruch Even <baruch.even@writeme.com>
3740 * src/frontends/xforms/FormGraphics.h:
3741 * src/frontends/xforms/FormGraphics.C:
3742 * src/frontends/xforms/RadioButtonGroup.h:
3743 * src/frontends/xforms/RadioButtonGroup.C:
3744 * src/insets/insetgraphics.h:
3745 * src/insets/insetgraphics.C:
3746 * src/insets/insetgraphicsParams.h:
3747 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3748 instead of spaces, and various other indentation issues to make the
3749 sources more consistent.
3751 2000-08-14 Marko Vendelin <markov@ioc.ee>
3753 * src/frontends/gnome/dialogs/diaprint.glade
3754 * src/frontends/gnome/FormPrint.C
3755 * src/frontends/gnome/FormPrint.h
3756 * src/frontends/gnome/diaprint_callbacks.c
3757 * src/frontends/gnome/diaprint_callbacks.h
3758 * src/frontends/gnome/diaprint_interface.c
3759 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3762 * src/frontends/gnome/dialogs/diainserturl.glade
3763 * src/frontends/gnome/FormUrl.C
3764 * src/frontends/gnome/FormUrl.h
3765 * src/frontends/gnome/diainserturl_callbacks.c
3766 * src/frontends/gnome/diainserturl_callbacks.h
3767 * src/frontends/gnome/diainserturl_interface.c
3768 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3769 Gnome implementation
3771 * src/frontends/gnome/Dialogs.C
3772 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3773 all other dialogs. Copy all unimplemented dialogs from Xforms
3776 * src/frontends/gnome/support.c
3777 * src/frontends/gnome/support.h: support files generated by Glade
3781 * config/gnome.m4: Gnome configuration scripts
3783 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3784 configure --help message
3786 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3787 only if there are no events pendling in Gnome/Gtk. This enhances
3788 the performance of menus.
3791 2000-08-14 Allan Rae <rae@lyx.org>
3793 * lib/Makefile.am: listerrors cleaning
3795 * lib/listerrors: removed -- generated file
3796 * acinclude.m4: ditto
3797 * sigc++/acinclude.m4: ditto
3799 * src/frontends/xforms/forms/form_citation.fd:
3800 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3803 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3804 `updatesrc` and now we have a `test` target that does what `updatesrc`
3805 used to do. I didn't like having an install target that wasn't related
3808 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3809 on all except FormGraphics. This may yet happen. Followed by a major
3810 cleanup including using FL_TRANSIENT for most of the dialogs. More
3811 changes to come when the ButtonController below is introduced.
3813 * src/frontends/xforms/ButtonController.h: New file for managing up to
3814 four buttons on a dialog according to an externally defined policy.
3815 * src/frontends/xforms/Makefile.am: added above
3817 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3818 Apply and Cancel/Close buttons and everything in between and beyond.
3819 * src/frontends/Makefile.am: added above.
3821 * src/frontends/xforms/forms/form_preferences.fd:
3822 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3823 and removed variable 'status' as a result. Fixed the set_minsize thing.
3824 Use the new screen-font-update after checking screen fonts were changed
3825 Added a "Restore" button to restore the original lyxrc values while
3826 editing. This restores everything not just the last input changed.
3827 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3829 * src/LyXAction.C: screen-font-update added for updating buffers after
3830 screen font settings have been changed.
3831 * src/commandtags.h: ditto
3832 * src/lyxfunc.C: ditto
3834 * forms/lyx.fd: removed screen fonts dialog.
3835 * src/lyx_gui.C: ditto
3836 * src/menus.[Ch]: ditto
3837 * src/lyx.[Ch]: ditto
3838 * src/lyx_cb.C: ditto + code from here moved to make
3839 screen-font-update. And people wonder why progress on GUII is
3840 slow. Look at how scattered this stuff was! It takes forever
3843 * forms/fdfix.sh: Fixup the spacing after commas.
3844 * forms/makefile: Remove date from generated files. Fewer clashes now.
3845 * forms/bullet_forms.C.patch: included someones handwritten changes
3847 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3848 once I've discovered why LyXRC was made noncopyable.
3849 * src/lyx_main.C: ditto
3851 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3853 * src/frontends/xforms/forms/fdfix.sh:
3854 * src/frontends/xforms/forms/fdfixh.sed:
3855 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3856 * src/frontends/xforms/Form*.[hC]:
3857 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3858 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3859 provide a destructor for the struct FD_form_xxxx. Another version of
3860 the set_[max|min]size workaround and a few other cleanups. Actually,
3861 Angus' patch from 20000809.
3863 2000-08-13 Baruch Even <baruch.even@writeme.com>
3865 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3868 2000-08-11 Juergen Vigna <jug@sad.it>
3870 * src/insets/insetgraphics.C (InsetGraphics): changing init
3871 order because of warnings.
3873 * src/frontends/xforms/forms/makefile: adding patching .C with
3876 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3877 from .C.patch to .c.patch
3879 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3880 order because of warning.
3882 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3884 * src/frontends/Liason.C (setMinibuffer): new helper function
3886 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3888 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3890 * lib/ui/default.ui: commented out PaperLayout entry
3892 * src/frontends/xforms/form_document.[Ch]: new added files
3894 * src/frontends/xforms/FormDocument.[Ch]: ditto
3896 * src/frontends/xforms/forms/form_document.fd: ditto
3898 * src/frontends/xforms/forms/form_document.C.patch: ditto
3900 2000-08-10 Juergen Vigna <jug@sad.it>
3902 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3903 (InsetGraphics): initialized cacheHandle to 0.
3904 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3906 2000-08-10 Baruch Even <baruch.even@writeme.com>
3908 * src/graphics/GraphicsCache.h:
3909 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3910 correctly as a cache.
3912 * src/graphics/GraphicsCacheItem.h:
3913 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3916 * src/graphics/GraphicsCacheItem_pimpl.h:
3917 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3920 * src/insets/insetgraphics.h:
3921 * src/insets/insetgraphics.C: Changed from using a signal notification
3922 to polling when image is not loaded.
3924 2000-08-10 Allan Rae <rae@lyx.org>
3926 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3927 that there are two functions that have to been taken out of line by
3928 hand and aren't taken care of in the script. (Just a reminder note)
3930 * sigc++/macros/*.h.m4: Updated as above.
3932 2000-08-09 Juergen Vigna <jug@sad.it>
3934 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3936 * src/insets/insettabular.C: make drawing of single cell smarter.
3938 2000-08-09 Marko Vendelin <markov@ioc.ee>
3939 * src/frontends/gnome/Menubar_pimpl.C
3940 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3941 implementation: new files
3943 * src/frontends/gnome/mainapp.C
3944 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3947 * src/main.C: create Gnome main window
3949 * src/frontends/xforms/Menubar_pimpl.h
3950 * src/frontends/Menubar.C
3951 * src/frontends/Menubar.h: added method Menubar::update that calls
3952 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3954 * src/LyXView.C: calls Menubar::update to update the state
3957 * src/frontends/gnome/Makefile.am: added new files
3959 * src/frontends/Makefile.am: added frontend compiler options
3961 2000-08-08 Juergen Vigna <jug@sad.it>
3963 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3965 * src/bufferlist.C (close):
3966 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3967 documents if exiting without saving.
3969 * src/buffer.C (save): use removeAutosaveFile()
3971 * src/support/filetools.C (removeAutosaveFile): new function.
3973 * src/lyx_cb.C (MenuWrite): returns a bool now.
3974 (MenuWriteAs): check if file could really be saved and revert to the
3976 (MenuWriteAs): removing old autosavefile if existant.
3978 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3979 before Goto toggle declaration, because of compiler warning.
3981 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3983 * src/lyxfunc.C (MenuNew): small fix.
3985 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3987 * src/bufferlist.C (newFile):
3988 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3990 * src/lyxrc.C: added new_ask_filename tag
3992 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3994 * src/lyx.fd: removed code pertaining to form_ref
3995 * src/lyx.[Ch]: ditto
3996 * src/lyx_cb.C: ditto
3997 * src/lyx_gui.C: ditto
3998 * src/lyx_gui_misc.C: ditto
4000 * src/BufferView_pimpl.C (restorePosition): update buffer only
4003 * src/commandtags.h (LFUN_REFTOGGLE): removed
4004 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4005 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4006 (LFUN_REFBACK): renamed LFUN_REF_BACK
4008 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4009 * src/menus.C: ditto
4010 * src/lyxfunc.C (Dispatch): ditto.
4011 InsertRef dialog is now GUI-independent.
4013 * src/texrow.C: added using std::endl;
4015 * src/insets/insetref.[Ch]: strip out large amounts of code.
4016 The inset is now a container and this functionality is now
4017 managed by a new FormRef dialog
4019 * src/frontends/Dialogs.h (showRef, createRef): new signals
4021 * src/frontends/xforms/FormIndex.[Ch],
4022 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4023 when setting dialog's min/max size
4024 * src/frontends/xforms/FormIndex.[Ch]: ditto
4026 * src/frontends/xforms/FormRef.[Ch],
4027 src/frontends/xforms/forms/form_ref.fd: new xforms
4028 implementation of an InsetRef dialog
4030 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4033 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4034 ios::nocreate is not part of the standard. Removed.
4036 2000-08-07 Baruch Even <baruch.even@writeme.com>
4038 * src/graphics/Renderer.h:
4039 * src/graphics/Renderer.C: Added base class for rendering of different
4040 image formats into Pixmaps.
4042 * src/graphics/XPM_Renderer.h:
4043 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4044 in a different class.
4046 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4047 easily add support for other formats.
4049 * src/insets/figinset.C: plugged a leak of an X resource.
4051 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4053 * src/CutAndPaste.[Ch]: make all metods static.
4055 * development/Code_rules/Rules: more work, added section on
4056 Exceptions, and a References section.
4058 * a lot of header files: work to make doc++ able to generate the
4059 source documentation, some workarounds of doc++ problems. Doc++ is
4060 now able to generate the documentation.
4062 2000-08-07 Juergen Vigna <jug@sad.it>
4064 * src/insets/insettabular.C (recomputeTextInsets): removed function
4066 * src/tabular.C (SetWidthOfMulticolCell):
4068 (calculate_width_of_column_NMC): fixed return value so that it really
4069 only returns true if the column-width has changed (there where
4070 problems with muliticolumn-cells in this column).
4072 2000-08-04 Juergen Vigna <jug@sad.it>
4074 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4075 also on the scrollstatus of the inset.
4076 (workAreaMotionNotify): ditto.
4078 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4080 2000-08-01 Juergen Vigna <jug@sad.it>
4082 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4084 * src/commandtags.h:
4085 * src/LyXAction.C (init):
4086 * src/insets/inset.C (LocalDispatch): added support for
4089 * src/insets/inset.C (scroll): new functions.
4091 * src/insets/insettext.C (removeNewlines): new function.
4092 (SetAutoBreakRows): removes forced newlines in the text of the
4093 paragraph if autoBreakRows is set to false.
4095 * src/tabular.C (Latex): generates a parbox around the cell contents
4098 * src/frontends/xforms/FormTabular.C (local_update): removed
4099 the radio_useparbox button.
4101 * src/tabular.C (UseParbox): new function
4103 2000-08-06 Baruch Even <baruch.even@writeme.com>
4105 * src/graphics/GraphicsCache.h:
4106 * src/graphics/GraphicsCache.C:
4107 * src/graphics/GraphicsCacheItem.h:
4108 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4111 * src/insets/insetgraphics.h:
4112 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4113 and the drawing of the inline image.
4115 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4116 loaded into the wrong position.
4118 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4121 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4123 * src/support/translator.h: move all typedefs to public section
4125 * src/support/filetools.C (MakeLatexName): return string const
4127 (TmpFileName): ditto
4128 (FileOpenSearch): ditto
4130 (LibFileSearch): ditto
4131 (i18nLibFileSearch): ditto
4134 (CreateTmpDir): ditto
4135 (CreateBufferTmpDir): ditto
4136 (CreateLyXTmpDir): ditto
4139 (MakeAbsPath): ditto
4141 (OnlyFilename): ditto
4143 (NormalizePath): ditto
4144 (CleanupPath): ditto
4145 (GetFileContents): ditto
4146 (ReplaceEnvironmentPath): ditto
4147 (MakeRelPath): ditto
4149 (ChangeExtension): ditto
4150 (MakeDisplayPath): ditto
4151 (do_popen): return cmdret const
4152 (findtexfile): return string const
4154 * src/support/DebugStream.h: add some /// to please doc++
4156 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4158 * src/texrow.C (same_rownumber): functor to use with find_if
4159 (getIdFromRow): rewritten to use find_if and to not update the
4160 positions. return true if row is found
4161 (increasePos): new method, use to update positions
4163 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4165 * src/lyxlex_pimpl.C (verifyTable): new method
4168 (GetString): return string const
4169 (pushTable): rewrite to use std::stack
4171 (setFile): better check
4174 * src/lyxlex.h: make LyXLex noncopyable
4176 * src/lyxlex.C (text): return char const * const
4177 (GetString): return string const
4178 (getLongString): return string const
4180 * src/lyx_gui_misc.C (askForText): return pair<...> const
4182 * src/lastfiles.[Ch] (operator): return string const
4184 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4185 istringstream not char const *.
4186 move token.end() out of loop.
4187 (readFile): move initializaton of token
4189 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4190 getIdFromRow is successful.
4192 * lib/bind/emacs.bind: don't include menus bind
4194 * development/Code_rules/Rules: the beginnings of making this
4195 better and covering more of the unwritten rules that we have.
4197 * development/Code_rules/Recommendations: a couple of wording
4200 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4202 * src/support/strerror.c: remove C++ comment.
4204 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4206 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4207 LFUN_INDEX_INSERT_LAST
4209 * src/texrow.C (getIdFromRow): changed from const_iterator to
4210 iterator, allowing code to compile with DEC cxx
4212 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4213 stores part of the class, as suggested by Allan. Will allow
4215 (apply): test to apply uses InsetCommandParams operator!=
4217 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4218 (apply): test to apply uses InsetCommandParams operator!=
4220 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4221 stores part of the class.
4222 (update): removed limits on min/max size.
4224 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4225 (apply): test to apply uses InsetCommandParams operator!=
4227 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4228 (Read, Write, scanCommand, getCommand): moved functionality
4229 into InsetCommandParams.
4231 (getScreenLabel): made pure virtual
4232 new InsetCommandParams operators== and !=
4234 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4235 c-tors based on InsetCommandParams. Removed others.
4236 * src/insets/insetinclude.[Ch]: ditto
4237 * src/insets/insetlabel.[Ch]: ditto
4238 * src/insets/insetparent.[Ch]: ditto
4239 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4241 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4242 insets derived from InsetCommand created using similar c-tors
4243 based on InsetCommandParams
4244 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4245 * src/menus.C (ShowRefsMenu): ditto
4246 * src/paragraph.C (Clone): ditto
4247 * src/text2.C (SetCounter): ditto
4248 * src/lyxfunc.C (Dispatch) ditto
4249 Also recreated old InsetIndex behaviour exactly. Can now
4250 index-insert at the start of a paragraph and index-insert-last
4251 without launching the pop-up.
4253 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4255 * lib/lyxrc.example: mark te pdf options as non functional.
4257 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4258 (isStrDbl): move tmpstr.end() out of loop.
4259 (strToDbl): move intialization of tmpstr
4260 (lowercase): return string const and move tmp.end() out of loop.
4261 (uppercase): return string const and move tmp.edn() out of loop.
4262 (prefixIs): add assertion
4267 (containsOnly): ditto
4268 (containsOnly): ditto
4269 (containsOnly): ditto
4270 (countChar): make last arg char not char const
4271 (token): return string const
4272 (subst): return string const, move tmp.end() out of loop.
4273 (subst): return string const, add assertion
4274 (strip): return string const
4275 (frontStrip): return string const, add assertion
4276 (frontStrip): return string const
4281 * src/support/lstrings.C: add inclde "LAssert.h"
4282 (isStrInt): move tmpstr.end() out of loop.
4284 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4285 toollist.end() out of loop.
4286 (deactivate): move toollist.end() out of loop.
4287 (update): move toollist.end() out of loop.
4288 (updateLayoutList): move tc.end() out of loop.
4289 (add): move toollist.end() out of loop.
4291 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4292 md.end() out of loop.
4294 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4296 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4299 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4300 (Erase): move insetlist.end() out of loop.
4302 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4303 ref to const string as first arg. Move initialization of some
4304 variables, whitespace changes.
4306 * src/kbmap.C (defkey): move table.end() out of loop.
4307 (kb_keymap): move table.end() out of loop.
4308 (findbinding): move table.end() out of loop.
4310 * src/MenuBackend.C (hasMenu): move end() out of loop.
4311 (getMenu): move end() out of loop.
4312 (getMenu): move menulist_.end() out of loop.
4314 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4316 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4319 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4320 (getFromLyXName): move infotab.end() out of loop.
4322 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4323 -fvtable-thunks -ffunction-sections -fdata-sections
4325 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4327 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4330 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4332 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4334 * src/frontends/xforms/FormCitation.[Ch],
4335 src/frontends/xforms/FormIndex.[Ch],
4336 src/frontends/xforms/FormToc.[Ch],
4337 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4339 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4341 * src/commandtags.h: renamed, created some flags for citation
4344 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4346 * src/lyxfunc.C (dispatch): use signals to insert index entry
4348 * src/frontends/Dialogs.h: new signal createIndex
4350 * src/frontends/xforms/FormCommand.[Ch],
4351 src/frontends/xforms/FormCitation.[Ch],
4352 src/frontends/xforms/FormToc.[Ch],
4353 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4355 * src/insets/insetindex.[Ch]: GUI-independent
4357 * src/frontends/xforms/FormIndex.[Ch],
4358 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4361 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4363 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4364 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4366 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4368 * src/insets/insetref.C (Latex): rewrite so that there is now
4369 question that a initialization is requested.
4371 * src/insets/insetcommand.h: reenable the hide signal
4373 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4375 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4376 fix handling of shortcuts (many bugs :)
4377 (add_lastfiles): ditto.
4379 * lib/ui/default.ui: fix a few shortcuts.
4381 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4383 * Makefile.am: Fix ``rpmdist'' target to return the exit
4384 status of the ``rpm'' command, instead of the last command in
4385 the chain (the ``rm lyx.xpm'' command, which always returns
4388 2000-08-02 Allan Rae <rae@lyx.org>
4390 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4391 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4392 * src/frontends/xforms/FormToc.C (FormToc): ditto
4394 * src/frontends/xforms/Makefile.am: A few forgotten files
4396 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4397 Signals-not-copyable-problem Lars' started commenting out.
4399 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4401 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4403 * src/insets/insetcommand.h: Signals is not copyable so anoter
4404 scheme for automatic hiding of forms must be used.
4406 * src/frontends/xforms/FormCitation.h: don't inerit from
4407 noncopyable, FormCommand already does that.
4408 * src/frontends/xforms/FormToc.h: ditto
4409 * src/frontends/xforms/FormUrl.h: ditto
4411 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4413 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4415 * src/insets/insetcommand.h (hide): new SigC::Signal0
4416 (d-tor) new virtual destructor emits hide signal
4418 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4419 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4421 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4422 LOF and LOT. Inset is now GUI-independent
4424 * src/insets/insetloa.[Ch]: redundant
4425 * src/insets/insetlof.[Ch]: ditto
4426 * src/insets/insetlot.[Ch]: ditto
4428 * src/frontends/xforms/forms/form_url.fd: tweaked!
4429 * src/frontends/xforms/forms/form_citation.fd: ditto
4431 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4432 dialogs dealing with InsetCommand insets
4434 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4435 FormCommand base class
4436 * src/frontends/xforms/FormUrl.[Ch]: ditto
4438 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4440 * src/frontends/xforms/FormToc.[Ch]: ditto
4442 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4443 passed a generic InsetCommand pointer
4444 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4446 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4447 and modified InsetTOC class
4448 * src/buffer.C: ditto
4450 * forms/lyx.fd: strip out old FD_form_toc code
4451 * src/lyx_gui_misc.C: ditto
4452 * src/lyx_gui.C: ditto
4453 * src/lyx_cb.C: ditto
4454 * src/lyx.[Ch]: ditto
4456 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4458 * src/support/utility.hpp: tr -d '\r'
4460 2000-08-01 Juergen Vigna <jug@sad.it>
4462 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4464 * src/commandtags.h:
4465 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4466 LFUN_TABULAR_FEATURES.
4468 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4469 LFUN_LAYOUT_TABULAR.
4471 * src/insets/insettabular.C (getStatus): implemented helper function.
4473 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4475 2000-07-31 Juergen Vigna <jug@sad.it>
4477 * src/text.C (draw): fixed screen update problem for text-insets.
4479 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4480 something changed probably this has to be added in various other
4483 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4485 2000-07-31 Baruch Even <baruch.even@writeme.com>
4487 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4488 templates to satisfy compaq cxx.
4491 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4493 * src/support/translator.h (equal_1st_in_pair::operator()): take
4494 const ref pair_type as arg.
4495 (equal_2nd_in_pair::operator()): ditto
4496 (Translator::~Translator): remove empty d-tor.
4498 * src/graphics/GraphicsCache.C: move include config.h to top, also
4499 put initialization of GraphicsCache::singleton here.
4500 (~GraphicsCache): move here
4501 (addFile): take const ref as arg
4504 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4506 * src/BufferView2.C (insertLyXFile): change te with/without header
4509 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4511 * src/frontends/xforms/FormGraphics.C (apply): add some
4512 static_cast. Not very nice, but required by compaq cxx.
4514 * src/frontends/xforms/RadioButtonGroup.h: include header
4515 <utility> instead of <pair.h>
4517 * src/insets/insetgraphicsParams.C: add using directive.
4518 (readResize): change return type to void.
4519 (readOrigin): ditto.
4521 * src/lyxfunc.C (getStatus): add missing break for build-program
4522 function; add test for Literate for export functions.
4524 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4525 entries in Options menu.
4527 2000-07-31 Baruch Even <baruch.even@writeme.com>
4529 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4530 protect against auto-allocation; release icon when needed.
4532 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4534 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4535 on usual typewriter.
4537 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4538 earlier czech.kmap), useful only for programming.
4540 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4542 * src/frontends/xforms/FormCitation.h: fix conditioning around
4545 2000-07-31 Juergen Vigna <jug@sad.it>
4547 * src/frontends/xforms/FormTabular.C (local_update): changed
4548 radio_linebreaks to radio_useparbox and added radio_useminipage.
4550 * src/tabular.C: made support for using minipages/parboxes.
4552 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4554 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4556 (descent): so the cursor is in the middle.
4557 (width): bit smaller box.
4559 * src/insets/insetgraphics.h: added display() function.
4561 2000-07-31 Baruch Even <baruch.even@writeme.com>
4563 * src/frontends/Dialogs.h: Added showGraphics signals.
4565 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4566 xforms form definition of the graphics dialog.
4568 * src/frontends/xforms/FormGraphics.h:
4569 * src/frontends/xforms/FormGraphics.C: Added files, the
4570 GUIndependent code of InsetGraphics
4572 * src/insets/insetgraphics.h:
4573 * src/insets/insetgraphics.C: Major writing to make it work.
4575 * src/insets/insetgraphicsParams.h:
4576 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4577 struct between InsetGraphics and GUI.
4579 * src/LaTeXFeatures.h:
4580 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4581 support for graphicx package.
4583 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4584 for the graphics inset.
4586 * src/support/translator.h: Added file, used in
4587 InsetGraphicsParams. this is a template to translate between two
4590 * src/frontends/xforms/RadioButtonGroup.h:
4591 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4592 way to easily control a radio button group.
4594 2000-07-28 Juergen Vigna <jug@sad.it>
4596 * src/insets/insettabular.C (LocalDispatch):
4597 (TabularFeatures): added support for lyx-functions of tabular features.
4598 (cellstart): refixed this function after someone wrongly changed it.
4600 * src/commandtags.h:
4601 * src/LyXAction.C (init): added support for tabular-features
4603 2000-07-28 Allan Rae <rae@lyx.org>
4605 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4606 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4607 triggers the callback for input checking. As a result we sometimes get
4608 "LyX: This shouldn't happen..." printed to cerr.
4609 (input): Started using status variable since I only free() on
4610 destruction. Some input checking for paths and font sizes.
4612 * src/frontends/xforms/FormPreferences.h: Use status to control
4613 activation of Ok and Apply
4615 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4616 callback. Also resized to stop segfaults with 0.88. The problem is
4617 that xforms-0.88 requires the folder to be wide enough to fit all the
4618 tabs. If it isn't it causes all sorts of problems.
4620 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4622 * src/frontends/xforms/forms/README: Reflect reality.
4624 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4625 * src/frontends/xforms/forms/makefile: ditto.
4627 * src/commandtags.h: Get access to new Preferences dialog
4628 * src/LyXAction.C: ditto
4629 * src/lyxfunc.C: ditto
4630 * lib/ui/default.ui: ditto
4632 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4634 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4636 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4639 * src/frontends/xforms/form_url.[Ch]: added.
4641 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4643 * src/insets/insetbib.h: fixed bug in previous commit
4645 * src/frontends/xforms/FormUrl.h: ditto
4647 * src/frontends/xforms/FormPrint.h: ditto
4649 * src/frontends/xforms/FormPreferences.h: ditto
4651 * src/frontends/xforms/FormCopyright.h: ditto
4653 * src/frontends/xforms/FormCitation.C: ditto
4655 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4656 private copyconstructor and private default contructor
4658 * src/support/Makefile.am: add utility.hpp
4660 * src/support/utility.hpp: new file from boost
4662 * src/insets/insetbib.h: set owner in clone
4664 * src/frontends/xforms/FormCitation.C: added missing include
4667 * src/insets/form_url.[Ch]: removed
4669 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4671 * development/lyx.spec.in
4672 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4673 file/directory re-organization.
4675 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4677 * src/insets/insetcommand.[Ch]: moved the string data and
4678 associated manipulation methods into a new stand-alone class
4679 InsetCommandParams. This class has two additional methods
4680 getAsString() and setFromString() allowing the contents to be
4681 moved around as a single string.
4682 (addContents) method removed.
4683 (setContents) method no longer virtual.
4685 * src/buffer.C (readInset): made use of new InsetCitation,
4686 InsetUrl constructors based on InsetCommandParams.
4688 * src/commandtags.h: add LFUN_INSERT_URL
4690 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4691 independent InsetUrl and use InsetCommandParams to extract
4692 string info and create new Insets.
4694 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4696 * src/frontends/xforms/FormCitation.C (apply): uses
4699 * src/frontends/xforms/form_url.C
4700 * src/frontends/xforms/form_url.h
4701 * src/frontends/xforms/FormUrl.h
4702 * src/frontends/xforms/FormUrl.C
4703 * src/frontends/xforms/forms/form_url.fd: new files
4705 * src/insets/insetcite.[Ch]: removed unused constructors.
4707 * src/insets/insetinclude.[Ch]: no longer store filename
4709 * src/insets/inseturl.[Ch]: GUI-independent.
4711 2000-07-26 Juergen Vigna <jug@sad.it>
4712 * renamed frontend from gtk to gnome as it is that what is realized
4713 and did the necessary changes in the files.
4715 2000-07-26 Marko Vendelin <markov@ioc.ee>
4717 * configure.in: cleaning up gnome configuration scripts
4719 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4721 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4722 shortcuts syndrom by redrawing them explicitely (a better solution
4723 would be appreciated).
4725 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4727 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4730 * src/lyx_cb.C (MenuExport): change html export to do the right
4731 thing depending of the document type (instead of having
4732 html-linuxdoc and html-docbook).
4733 * src/lyxfunc.C (getStatus): update for html
4734 * lib/ui/default.ui: simplify due to the above change.
4735 * src/menus.C (ShowFileMenu): update too (in case we need it).
4737 * src/MenuBackend.C (read): if a menu is defined twice, add the
4738 new entries to the exiting one.
4740 2000-07-26 Juergen Vigna <jug@sad.it>
4742 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4744 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4745 and return a bool if it did actual save the file.
4746 (AutoSave): don't autosave a unnamed doc.
4748 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4749 check if this is an UNNAMED new file and react to it.
4750 (newFile): set buffer to unnamed and change to not mark a new
4751 buffer dirty if I didn't do anything with it.
4753 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4755 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4757 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4758 friend as per Angus's patch posted to lyx-devel.
4760 * src/ext_l10n.h: updated
4762 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4763 gettext on the style string right before inserting them into the
4766 * autogen.sh: add code to extract style strings form layout files,
4767 not good enough yet.
4769 * src/frontends/gtk/.cvsignore: add MAKEFILE
4771 * src/MenuBackend.C (read): run the label strings through gettext
4772 before storing them in the containers.
4774 * src/ext_l10n.h: new file
4776 * autogen.sh : generate the ext_l10n.h file here
4778 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4780 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4783 * lib/ui/default.ui: fix a couple of typos.
4785 * config/gnome/gtk.m4: added (and added to the list of files in
4788 * src/insets/insetinclude.C (unique_id): fix when we are using
4789 lyxstring instead of basic_string<>.
4790 * src/insets/insettext.C (LocalDispatch): ditto.
4791 * src/support/filetools.C: ditto.
4793 * lib/configure.m4: create the ui/ directory if necessary.
4795 * src/LyXView.[Ch] (updateToolbar): new method.
4797 * src/BufferView_pimpl.C (buffer): update the toolbar when
4798 opening/closing buffer.
4800 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4802 * src/LyXAction.C (getActionName): enhance to return also the name
4803 and options of pseudo-actions.
4804 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4806 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4807 as an example of what is possible). Used in File->Build too (more
4808 useful) and in the import/export menus (to mimick the complicated
4809 handling of linuxdoc and friends). Try to update all the entries.
4811 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4814 * src/MenuBackend.C (read): Parse the new OptItem tag.
4816 * src/MenuBackend.h: Add a new optional_ data member (used if the
4817 entry should be omitted when the lyxfunc is disabled).
4819 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4820 function, used as a shortcut.
4821 (create_submenu): align correctly the shortcuts on the widest
4824 * src/MenuBackend.h: MenuItem.label() only returns the label of
4825 the menu without shortcut; new method shortcut().
4827 2000-07-14 Marko Vendelin <markov@ioc.ee>
4829 * src/frontends/gtk/Dialogs.C:
4830 * src/frontends/gtk/FormCopyright.C:
4831 * src/frontends/gtk/FormCopyright.h:
4832 * src/frontends/gtk/Makefile.am: added these source-files for the
4833 Gtk/Gnome support of the Copyright-Dialog.
4835 * src/main.C: added Gnome::Main initialization if using
4836 Gtk/Gnome frontend-GUI.
4838 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4840 * config/gnome/aclocal-include.m4
4841 * config/gnome/compiler-flags.m4
4842 * config/gnome/curses.m4
4843 * config/gnome/gnome--.m4
4844 * config/gnome/gnome-bonobo-check.m4
4845 * config/gnome/gnome-common.m4
4846 * config/gnome/gnome-fileutils.m4
4847 * config/gnome/gnome-ghttp-check.m4
4848 * config/gnome/gnome-gnorba-check.m4
4849 * config/gnome/gnome-guile-checks.m4
4850 * config/gnome/gnome-libgtop-check.m4
4851 * config/gnome/gnome-objc-checks.m4
4852 * config/gnome/gnome-orbit-check.m4
4853 * config/gnome/gnome-print-check.m4
4854 * config/gnome/gnome-pthread-check.m4
4855 * config/gnome/gnome-support.m4
4856 * config/gnome/gnome-undelfs.m4
4857 * config/gnome/gnome-vfs.m4
4858 * config/gnome/gnome-x-checks.m4
4859 * config/gnome/gnome-xml-check.m4
4860 * config/gnome/gnome.m4
4861 * config/gnome/gperf-check.m4
4862 * config/gnome/gtk--.m4
4863 * config/gnome/linger.m4
4864 * config/gnome/need-declaration.m4: added configuration scripts
4865 for Gtk/Gnome frontend-GUI
4867 * configure.in: added support for the --with-frontend=gtk option
4869 * autogen.sh: added config/gnome/* to list of config-files
4871 * acconfig.h: added define for GTKGUI-support
4873 * config/lyxinclude.m4: added --with-frontend[=value] option value
4874 for Gtk/Gnome frontend-GUI support.
4876 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4878 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4882 * src/paragraph.C (GetChar): remove non-const version
4884 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4885 (search_kw): use it.
4887 * src/lyx_main.C (init): if "preferences" exist, read that instead
4889 (ReadRcFile): return bool if the file could be read ok.
4890 (ReadUIFile): add a check to see if lex file is set ok.
4892 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4893 bastring can be used instead of lyxstring (still uses the old code
4894 if std::string is good enough or if lyxstring is used.)
4896 * src/encoding.C: make the arrays static, move ininle functions
4898 * src/encoding.h: from here.
4900 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4901 (parseSingleLyXformat2Token): move inset parsing to separate method
4902 (readInset): new private method
4904 * src/Variables.h: remove virtual from get().
4906 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4907 access to NEW_INSETS and NEW_TABULAR
4909 * src/MenuBackend.h: remove superfluous forward declaration of
4910 MenuItem. Add documentations tags "///", remove empty MenuItem
4911 destructor, remove private default contructor.
4913 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4915 (read): more string mlabel and mname to where they are used
4916 (read): remove unused variables mlabel and mname
4917 (defaults): unconditional clear, make menusetup take advantage of
4918 add returning Menu &.
4920 * src/LyXView.h: define NEW_MENUBAR as default
4922 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4923 to NEW_INSETS and NEW_TABULAR.
4924 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4925 defined. Change some of the "xxxx-inset-insert" functions names to
4928 * several files: more enahncements to NEW_INSETS and the resulting
4931 * lib/lyxrc.example (\date_insert_format): move to misc section
4933 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4934 bastring and use AC_CACHE_CHECK.
4935 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4936 the system have the newest methods. uses AC_CACHE_CHECK
4937 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4938 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4939 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4941 * configure.in: add LYX_CXX_GOOD_STD_STRING
4943 * acinclude.m4: recreated
4945 2000-07-24 Amir Karger <karger@lyx.org>
4947 * README: add Hebrew, Arabic kmaps
4950 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4952 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4955 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4957 * Lot of files: add pragma interface/implementation.
4959 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4961 * lib/ui/default.ui: new file (ans new directory). Contains the
4962 default menu and toolbar.
4964 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4965 global space. Toolbars are now read (as menus) in ui files.
4967 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4969 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4970 is disabled because the document is read-only. We want to have the
4971 toggle state of the function anyway.
4972 (getStatus): add code for LFUN_VC* functions (mimicking what is
4973 done in old-style menus)
4975 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4976 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4978 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4979 * src/BufferView_pimpl.C: ditto.
4980 * src/lyxfunc.C: ditto.
4982 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4983 default). This replaces old-style menus by new ones.
4985 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4986 MenuItem. Contain the data structure of a menu.
4988 * src/insets/insettext.C: use LyXView::setLayout instead of
4989 accessing directly the toolbar combox.
4990 * src/lyxfunc.C (Dispatch): ditto.
4992 * src/LyXView.C (setLayout): new method, which just calls
4993 Toolbar::setLayout().
4994 (updateLayoutChoice): move part of this method in Toolbar.
4996 * src/toolbar.[Ch]: removed.
4998 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4999 implementation the toolbar.
5001 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5002 the toolbar. It might make sense to merge it with ToolbarDefaults
5004 (setLayout): new function.
5005 (updateLayoutList): ditto.
5006 (openLayoutList): ditto.
5008 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5009 xforms implementation of the toolbar.
5010 (get_toolbar_func): comment out, since I do not
5011 know what it is good for.
5013 * src/ToolbarDefaults.h: Add the ItemType enum.
5015 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5016 for a list of allocated C strings. Used in Menubar xforms
5017 implementation to avoid memory leaks.
5019 * src/support/lstrings.[Ch] (uppercase): new version taking and
5023 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5024 * lib/bind/emacs.bind: ditto.
5026 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5028 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5029 forward decl of LyXView.
5031 * src/toolbar.C (toolbarItem): moved from toolbar.h
5032 (toolbarItem::clean): ditto
5033 (toolbarItem::~toolbarItem): ditto
5034 (toolbarItem::operator): ditto
5036 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5038 * src/paragraph.h: control the NEW_TABULAR define from here
5040 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5041 USE_TABULAR_INSETS to NEW_TABULAR
5043 * src/ToolbarDefaults.C: add include "lyxlex.h"
5045 * files using the old table/tabular: use NEW_TABULAR to control
5046 compilation of old tabular stuff.
5048 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5051 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5052 planemet in reading of old style floats, fix the \end_deeper
5053 problem when reading old style floats.
5055 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5057 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5059 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5061 * lib/bind/sciword.bind: updated.
5063 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5066 layout write problem
5068 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5070 * src/Makefile.am (INCLUDES): remove image directory from include
5073 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5074 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5076 * src/LyXView.C (create_form_form_main): read the application icon
5079 * lib/images/*.xpm: change the icons to use transparent color for
5082 * src/toolbar.C (update): change the color of the button when it
5085 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5087 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5088 setting explicitely the minibuffer.
5089 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5091 * src/LyXView.C (showState): new function. Shows font information
5092 in minibuffer and update toolbar state.
5093 (LyXView): call Toolbar::update after creating the
5096 * src/toolbar.C: change toollist to be a vector instead of a
5098 (BubbleTimerCB): get help string directly from the callback
5099 argument of the corresponding icon (which is the action)
5100 (set): remove unnecessary ugliness.
5101 (update): new function. update the icons (depressed, disabled)
5102 depending of the status of the corresponding action.
5104 * src/toolbar.h: remove help in toolbarItem
5106 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5108 * src/Painter.C (text): Added code for using symbol glyphs from
5109 iso10646 fonts. Currently diabled.
5111 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5114 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5115 magyar,turkish and usorbian.
5117 * src/paragraph.C (isMultiLingual): Made more efficient.
5119 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5122 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5123 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5124 Also changed the prototype to "bool math_insert_greek(char)".
5126 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5128 * lots of files: apply the NEW_INSETS on all code that will not be
5129 needed when we move to use the new insets. Enable the define in
5130 lyxparagrah.h to try it.
5132 * src/insets/insettabular.C (cellstart): change to be a static
5134 (InsetTabular): initialize buffer in the initializer list.
5136 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5138 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5139 form_print.h out of the header file. Replaced with forward
5140 declarations of the relevant struct.
5142 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5145 * src/commandtags.h: do not include "debug.h" which does not
5146 belong there. #include it in some other places because of this
5149 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5151 * src/insets/insetcaption.C: add a couple "using" directives.
5153 * src/toolbar.C (add): get the help text directly from lyxaction.
5155 (setPixmap): new function. Loads from disk and sets a pixmap on a
5156 botton; the name of the pixmap file is derived from the command
5159 * src/toolbar.h: remove members isBitmap and pixmap from
5162 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5163 * lib/images/: move many files from images/banner.xpm.
5165 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5167 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5168 * src/toolbar.C: ditto.
5169 * configure.in: ditto.
5170 * INSTALL: document.
5172 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5173 the spellchecker popup is closed from the WM.
5175 2000-07-19 Juergen Vigna <jug@sad.it>
5177 * src/insets/insetfloat.C (Write): small fix because we use the
5178 insetname for the type now!
5180 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5182 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5185 * src/frontends/Dialogs.h: removed hideCitation signal
5187 * src/insets/insetcite.h: added hide signal
5189 * src/insets/insetcite.C (~InsetCitation): emits new signal
5190 (getScreenLabel): "intelligent" label should now fit on the screen!
5192 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5194 * src/frontends/xforms/FormCitation.C (showInset): connects
5195 hide() to the inset's hide signal
5196 (show): modified to use fl_set_object_position rather than
5197 fl_set_object_geometry wherever possible
5199 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5201 * src/insets/lyxinset.h: add caption code
5203 * src/insets/insetfloat.C (type): new method
5205 * src/insets/insetcaption.C (Write): new method
5207 (LyxCode): new method
5209 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5210 to get it right together with using the FloatList.
5212 * src/commandtags.h: add LFUN_INSET_CAPTION
5213 * src/lyxfunc.C (Dispatch): handle it
5215 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5218 * src/Variables.[Ch]: make expand take a const reference, remove
5219 the destructor, some whitespace changes.
5221 * src/LyXAction.C (init): add caption-inset-insert
5223 * src/FloatList.C (FloatList): update the default floats a bit.
5225 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5227 * src/Variables.[Ch]: new files. Intended to be used for language
5228 specific strings (like \chaptername) and filename substitution in
5231 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5233 * lib/kbd/american.kmap: update
5235 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5237 * src/bufferparams.[Ch]: remove member allowAccents.
5239 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5241 * src/LaTeXLog.C: use the log_form.h header.
5242 * src/lyx_gui.C: ditto.
5243 * src/lyx_gui_misc.C: ditto.
5244 * src/lyxvc.h: ditto.
5246 * forms/log_form.fd: new file, created from latexoptions.fd. I
5247 kept the log popup and nuked the options form.
5249 * src/{la,}texoptions.[Ch]: removed.
5250 * src/lyx_cb.C (LaTeXOptions): ditto
5252 * src/lyx_gui.C (create_forms): do not handle the
5253 fd_latex_options form.
5255 2000-07-18 Juergen Vigna <jug@sad.it>
5257 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5258 name of the inset so that it can be requested outside (text2.C).
5260 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5263 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5265 * src/mathed/formula.h (ConvertFont): constify
5267 * src/mathed/formula.C (Read): add warning if \end_inset is not
5268 found on expected place.
5270 * src/insets/lyxinset.h (ConvertFont): consify
5272 * src/insets/insetquotes.C (ConvertFont): constify
5273 * src/insets/insetquotes.h: ditto
5275 * src/insets/insetinfo.h: add labelfont
5277 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5278 (ascent): use labelfont
5282 (Write): make .lyx file a bit nicer
5284 * src/insets/insetfloat.C (Write): simplify somewhat...
5285 (Read): add warning if arg is not found
5287 * src/insets/insetcollapsable.C: add using std::max
5288 (Read): move string token and add warning in arg is not found
5289 (draw): use std::max to get the right ty
5290 (getMaxWidth): simplify by using std::max
5292 * src/insets/insetsection.h: new file
5293 * src/insets/insetsection.C: new file
5294 * src/insets/insetcaption.h: new file
5295 * src/insets/insetcaption.C: new file
5297 * src/insets/inset.C (ConvertFont): constify signature
5299 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5300 insetcaption.[Ch] and insetsection.[Ch]
5302 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5303 uses to use LABEL_COUNTER_CHAPTER instead.
5304 * src/text2.C (SetCounter): here
5306 * src/counters.h: new file
5307 * src/counters.C: new file
5308 * src/Sectioning.h: new file
5309 * src/Sectioning.C: new file
5311 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5313 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5315 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5318 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5321 2000-07-17 Juergen Vigna <jug@sad.it>
5323 * src/tabular.C (Validate): check if array-package is needed.
5324 (SetVAlignment): added support for vertical alignment.
5325 (SetLTFoot): better support for longtable header/footers
5326 (Latex): modified to support added features.
5328 * src/LaTeXFeatures.[Ch]: added array-package.
5330 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5332 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5335 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5337 * configure.in: do not forget to put a space after -isystem.
5339 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5341 * lib/kbd/arabic.kmap: a few fixes.
5343 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5345 * some whitespace chagnes to a number of files.
5347 * src/support/DebugStream.h: change to make it easier for
5348 doc++ to parse correctly.
5349 * src/support/lyxstring.h: ditto
5351 * src/mathed/math_utils.C (compara): change to have only one
5353 (MathedLookupBOP): change because of the above.
5355 * src/mathed/math_delim.C (math_deco_compare): change to have only
5357 (search_deco): change becasue of the above.
5359 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5360 instead of manually coded one.
5362 * src/insets/insetquotes.C (Read): read the \end_inset too
5364 * src/insets/insetlatex.h: remove file
5365 * src/insets/insetlatex.C: remove file
5367 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5369 (InsetPrintIndex): remove destructor
5371 * src/insets/insetinclude.h: remove default constructor
5373 * src/insets/insetfloat.C: work to make it work better
5375 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5377 * src/insets/insetcite.h (InsetCitation): remove default constructor
5379 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5381 * src/text.C (GetColumnNearX): comment out some currently unused code.
5383 * src/paragraph.C (writeFile): move some initializations closer to
5385 (CutIntoMinibuffer): small change to use new matchIT operator
5389 (InsertInset): ditto
5392 (InsetIterator): ditto
5393 (Erase): small change to use new matchFT operator
5395 (GetFontSettings): ditto
5396 (HighestFontInRange): ditto
5399 * src/lyxparagraph.h: some chars changed to value_type
5400 (matchIT): because of some stronger checking (perhaps too strong)
5401 in SGI STL, the two operator() unified to one.
5404 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5406 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5407 the last inset read added
5408 (parseSingleLyXformat2Token): some more (future) compability code added
5409 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5410 (parseSingleLyXformat2Token): set last_inset_read
5411 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5412 (parseSingleLyXformat2Token): don't double intializw string next_token
5414 * src/TextCache.C (text_fits::operator()): add const's to the signature
5415 (has_buffer::operator()): ditto
5417 * src/Floating.h: add some comments on the class
5419 * src/FloatList.[Ch] (typeExist): new method
5422 * src/BackStack.h: added default constructor, wanted by Gcc.
5424 2000-07-14 Juergen Vigna <jug@sad.it>
5426 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5428 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5430 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5431 do a redraw when the window is resized!
5432 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5434 * src/insets/insettext.C (resizeLyXText): added function to correctly
5435 being able to resize the LyXWindow.
5437 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5439 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5441 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5442 crashes when closing dialog to a deleted inset.
5444 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5445 method! Now similar to other insets.
5447 2000-07-13 Juergen Vigna <jug@sad.it>
5449 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5451 * lib/examples/Literate.lyx: small patch!
5453 * src/insets/insetbib.C (Read): added this function because of wrong
5454 Write (without [begin|end]_inset).
5456 2000-07-11 Juergen Vigna <jug@sad.it>
5458 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5459 as the insertInset could not be good!
5461 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5462 the bool param should not be last.
5464 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5466 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5467 did submit that to Karl).
5469 * configure.in: use -isystem instead of -I for X headers. This
5470 fixes a problem on solaris with a recent gcc;
5471 put the front-end code after the X detection code;
5472 configure in sigc++ before lib/
5474 * src/lyx_main.C (commandLineHelp): remove -display from command
5477 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5479 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5480 Also put in Makefile rules for building the ``listerrors''
5481 program for parsing errors from literate programs written in LyX.
5483 * lib/build-listerrors: Added small shell script as part of compile
5484 process. This builds a working ``listerrors'' binary if noweb is
5485 installed and either 1) the VNC X server is installed on the machine,
5486 or 2) the user is compiling from within a GUI. The existence of a GUI
5487 is necessary to use the ``lyx --export'' feature for now. This
5488 hack can be removed once ``lyx --export'' no longer requires a GUI to
5491 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5493 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5494 now passed back correctly from gcc and placed "under" error
5495 buttons in a Literate LyX source.
5497 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5499 * src/text.C (GetColumnNearX): Better behavior when a RTL
5500 paragraph is ended by LTR text.
5502 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5505 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5507 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5508 true when clipboard is empty.
5510 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5512 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5513 row of the paragraph.
5514 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5515 to prevent calculation of bidi tables
5517 2000-07-07 Juergen Vigna <jug@sad.it>
5519 * src/screen.C (ToggleSelection): added y_offset and x_offset
5522 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5525 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5527 * src/insets/insettext.C: fixed Layout-Display!
5529 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5531 * configure.in: add check for strings.h header.
5533 * src/spellchecker.C: include <strings.h> in order to have a
5534 definition for bzero().
5536 2000-07-07 Juergen Vigna <jug@sad.it>
5538 * src/insets/insettext.C (draw): set the status of the bv->text to
5539 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5541 * src/screen.C (DrawOneRow):
5542 (DrawFromTo): redraw the actual row if something has changed in it
5545 * src/text.C (draw): call an update of the toplevel-inset if something
5546 has changed inside while drawing.
5548 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5550 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5552 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5553 processing inside class.
5555 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5556 processing inside class.
5558 * src/insets/insetindex.h new struct Holder, consistent with other
5561 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5562 citation dialog from main code and placed it in src/frontends/xforms.
5563 Dialog launched through signals instead of callbacks
5565 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5567 * lyx.man: update the options description.
5569 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5571 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5572 handle neg values, set min width to 590, add doc about -display
5574 2000-07-05 Juergen Vigna <jug@sad.it>
5576 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5577 calls to BufferView *.
5579 * src/insets/insettext.C (checkAndActivateInset): small fix non
5580 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5582 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5583 their \end_inset token!
5585 2000-07-04 edscott <edscott@imp.mx>
5587 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5588 lib/lyxrc.example: added option \wheel_jump
5590 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5592 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5593 remove support for -width,-height,-xpos and -ypos.
5595 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5597 * src/encoding.[Ch]: New files.
5599 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5600 (text): Call to the underline() method only when needed.
5602 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5604 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5605 encoding(s) for the document.
5607 * src/bufferparams.C (BufferParams): Changed default value of
5610 * src/language.C (newLang): Removed.
5611 (items[]): Added encoding information for all defined languages.
5613 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5614 encoding choice button.
5616 * src/lyxrc.h (font_norm_type): New member variable.
5617 (set_font_norm_type): New method.
5619 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5620 paragraphs with different encodings.
5622 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5623 (TransformChar): Changed to work correctly with Arabic points.
5624 (draw): Added support for drawing Arabic points.
5625 (draw): Removed code for drawing underbars (this is done by
5628 * src/support/textutils.h (IsPrintableNonspace): New function.
5630 * src/BufferView_pimpl.h: Added "using SigC::Object".
5631 * src/LyXView.h: ditto.
5633 * src/insets/insetinclude.h (include_label): Changed to mutable.
5635 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5637 * src/mathed/math_iter.h: remove empty destructor
5639 * src/mathed/math_cursor.h: remove empty destructor
5641 * src/insets/lyxinset.h: add THEOREM_CODE
5643 * src/insets/insettheorem.[Ch]: new files
5645 * src/insets/insetminipage.C: (InsertInset): remove
5647 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5649 (InsertInset): remove
5651 * src/insets/insetlist.C: (InsertList): remove
5653 * src/insets/insetfootlike.[Ch]: new files
5655 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5658 (InsertInset): ditto
5660 * src/insets/insetert.C: remove include Painter.h, reindent
5661 (InsertInset): move to header
5663 * src/insets/insetcollapsable.h: remove explicit from default
5664 contructor, remove empty destructor, add InsertInset
5666 * src/insets/insetcollapsable.C (InsertInset): new func
5668 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5670 * src/vspace.h: add explicit to constructor
5672 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5673 \textcompwordmark, please test this.
5675 * src/lyxrc.C: set ascii_linelen to 65 by default
5677 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5679 * src/commandtags.h: add LFUN_INSET_THEOREM
5681 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5682 (makeLinuxDocFile): remove _some_ of the nice logic
5683 (makeDocBookFile): ditto
5685 * src/Painter.[Ch]: (~Painter): removed
5687 * src/LyXAction.C (init): entry for insettheorem added
5689 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5691 (deplog): code to detect files generated by LaTeX, needs testing
5694 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5696 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5698 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5700 * src/LaTeX.C (deplog): Add a check for files that are going to be
5701 created by the first latex run, part of the project to remove the
5704 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5705 contents to the extension list.
5707 2000-07-04 Juergen Vigna <jug@sad.it>
5709 * src/text.C (NextBreakPoint): added support for needFullRow()
5711 * src/insets/lyxinset.h: added needFullRow()
5713 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5716 * src/insets/insettext.C: lots of changes for update!
5718 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5720 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5722 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5724 * src/insets/insetinclude.C (InsetInclude): fixed
5725 initialization of include_label.
5726 (unique_id): now returns a string.
5728 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5730 * src/LaTeXFeatures.h: new member IncludedFiles, for
5731 a map of key, included file name.
5733 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5734 with the included files for inclusion in SGML preamble,
5735 i. e., linuxdoc and docbook.
5738 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5739 nice (is the generated linuxdoc code to be exported?), that
5740 allows to remove column, and only_body that will be true for
5741 slave documents. Insets are allowed inside SGML font type.
5742 New handling of the SGML preamble for included files.
5743 (makeDocBookFile): the same for docbook.
5745 * src/insets/insetinclude.h:
5746 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5748 (DocBook): new export methods.
5750 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5751 and makeDocBookFile.
5753 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5754 formats to export with command line argument -x.
5756 2000-06-29 Juergen Vigna <jug@sad.it>
5758 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5759 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5761 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5762 region could already been cleared by an inset!
5764 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5766 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5769 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5771 (cursorToggle): remove special handling of lyx focus.
5773 2000-06-28 Juergen Vigna <jug@sad.it>
5775 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5778 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5780 * src/insets/insetindex.C (Edit): add a callback when popup is
5783 * src/insets/insettext.C (LocalDispatch):
5784 * src/insets/insetmarginal.h:
5785 * src/insets/insetlist.h:
5786 * src/insets/insetfoot.h:
5787 * src/insets/insetfloat.h:
5788 * src/insets/insetert.h: add a missing std:: qualifier.
5790 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5795 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5797 * src/insets/insettext.C (Read): remove tmptok unused variable
5798 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5799 (InsertInset): change for new InsetInset code
5801 * src/insets/insettext.h: add TEXT inline method
5803 * src/insets/insettext.C: remove TEXT macro
5805 * src/insets/insetmarginal.C (Write): new method
5806 (Latex): change output slightly
5808 * src/insets/insetfoot.C (Write): new method
5809 (Latex): change output slightly (don't use endl when no need)
5811 * src/insets/insetert.C (Write): new method
5813 * src/insets/insetcollapsable.h: make button_length, button_top_y
5814 and button_bottm_y protected.
5816 * src/insets/insetcollapsable.C (Write): simplify code by using
5817 tostr. Also do not output the float name, the children class
5818 should to that to get control over own arguments
5820 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5821 src/insets/insetminipage.[Ch]:
5824 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5826 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5828 * src/Makefile.am (lyx_SOURCES): add the new files
5830 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5831 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5832 * src/commandtags.h: ditto
5834 * src/LaTeXFeatures.h: add a std::set of used floattypes
5836 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5838 * src/FloatList.[Ch] src/Floating.h: new files
5840 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5842 * src/lyx_cb.C (TableApplyCB): ditto
5844 * src/text2.C: ditto
5845 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5846 (parseSingleLyXformat2Token): ditto + add code for
5847 backwards compability for old float styles + add code for new insets
5849 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5851 (InsertInset(size_type, Inset *, LyXFont)): new method
5852 (InsetChar(size_type, char)): changed to use the other InsetChar
5853 with a LyXFont(ALL_INHERIT).
5854 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5855 insert the META_INSET.
5857 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5859 * sigc++/thread.h (Threads): from here
5861 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5862 definition out of line
5863 * sigc++/scope.h: from here
5865 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5867 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5868 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5870 * Makefile.am (bindist): new target.
5872 * INSTALL: add instructions for doing a binary distribution.
5874 * development/tools/README.bin.example: update a bit.
5876 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5879 * lib/lyxrc.example: new lyxrc tag \set_color.
5881 * src/lyxfunc.C (Dispatch):
5882 * src/commandtags.h:
5883 * src/LyXAction.C: new lyxfunc "set-color".
5885 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5886 and an x11name given as strings.
5888 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5889 cache when a color is changed.
5891 2000-06-26 Juergen Vigna <jug@sad.it>
5893 * src/lyxrow.C (width): added this functions and variable.
5895 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5898 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5900 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5902 * images/undo_bw.xpm: new icon.
5903 * images/redo_bw.xpm: ditto.
5905 * configure.in (INSTALL_SCRIPT): change value to
5906 ${INSTALL} to avoid failures of install-script target.
5907 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5909 * src/BufferView.h: add a magic "friend" declaration to please
5912 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5914 * forms/cite.fd: modified to allow resizing without messing
5917 * src/insetcite.C: Uses code from cite.fd almost without
5919 User can now resize dialog in the x-direction.
5920 Resizing the dialog in the y-direction is prevented, as the
5921 code does this intelligently already.
5923 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5925 * INSTALL: remove obsolete entry in "problems" section.
5927 * lib/examples/sl_*.lyx: update of the slovenian examples.
5929 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5931 2000-06-23 Juergen Vigna <jug@sad.it>
5933 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5935 * src/buffer.C (resize): delete the LyXText of textinsets.
5937 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5939 * src/insets/lyxinset.h: added another parameter 'cleared' to
5940 the draw() function.
5942 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5943 unlocking inset in inset.
5945 2000-06-22 Juergen Vigna <jug@sad.it>
5947 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5948 of insets and moved first to LyXText.
5950 * src/mathed/formulamacro.[Ch]:
5951 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5953 2000-06-21 Juergen Vigna <jug@sad.it>
5955 * src/text.C (GetVisibleRow): look if I should clear the area or not
5956 using Inset::doClearArea() function.
5958 * src/insets/lyxinset.h: added doClearArea() function and
5959 modified draw(Painter &, ...) to draw(BufferView *, ...)
5961 * src/text2.C (UpdateInset): return bool insted of int
5963 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5965 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5966 combox in the character popup
5968 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5969 BufferParams const & params
5971 2000-06-20 Juergen Vigna <jug@sad.it>
5973 * src/insets/insettext.C (SetParagraphData): set insetowner on
5976 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5978 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5979 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5981 (form_main_): remove
5983 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5984 (create_form_form_main): remove FD_form_main stuff, connect to
5985 autosave_timeout signal
5987 * src/LyXView.[Ch] (getMainForm): remove
5988 (UpdateTimerCB): remove
5989 * src/BufferView_pimpl.h: inherit from SigC::Object
5991 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5992 signal instead of callback
5994 * src/BufferView.[Ch] (cursorToggleCB): remove
5996 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5998 * src/BufferView_pimpl.C: changes because of the one below
6000 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6001 instead of storing a pointer to a LyXText.
6003 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6005 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6007 * src/lyxparagraph.h
6009 * src/paragraph.C: Changed fontlist to a sorted vector.
6011 2000-06-19 Juergen Vigna <jug@sad.it>
6013 * src/BufferView.h: added screen() function.
6015 * src/insets/insettext.C (LocalDispatch): some selection code
6018 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6020 * src/insets/insettext.C (SetParagraphData):
6022 (InsetText): fixes for multiple paragraphs.
6024 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6026 * development/lyx.spec.in: Call configure with ``--without-warnings''
6027 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6028 This should be fine, however, since we generally don't want to be
6029 verbose when making an RPM.
6031 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6033 * lib/scripts/fig2pstex.py: New file
6035 2000-06-16 Juergen Vigna <jug@sad.it>
6037 * src/insets/insettabular.C (UpdateLocal):
6038 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6039 (LocalDispatch): Changed all functions to use LyXText.
6041 2000-06-15 Juergen Vigna <jug@sad.it>
6043 * src/text.C (SetHeightOfRow): call inset::update before requesting
6046 * src/insets/insettext.C (update):
6047 * src/insets/insettabular.C (update): added implementation
6049 * src/insets/lyxinset.h: added update function
6051 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6053 * src/text.C (SelectNextWord): protect against null pointers with
6054 old-style string streams. (fix from Paul Theo Gonciari
6057 * src/cite.[Ch]: remove erroneous files.
6059 * lib/configure.m4: update the list of created directories.
6061 * src/lyxrow.C: include <config.h>
6062 * src/lyxcursor.C: ditto.
6064 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6066 * lib/examples/decimal.lyx: new example file from Mike.
6068 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6069 to find template definitions (from Dekel)
6071 * src/frontends/.cvsignore: add a few things.
6073 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6075 * src/Timeout.C (TimeOut): remove default argument.
6077 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6080 * src/insets/ExternalTemplate.C: add a "using" directive.
6082 * src/lyx_main.h: remove the act_ struct, which seems unused
6085 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * LyX Developers Meeting: All files changed, due to random C++ (by
6088 coincidence) code generator script.
6090 - external inset (cool!)
6091 - initial online editing of preferences
6092 - insettabular breaks insettext(s contents)
6094 - some DocBook fixes
6095 - example files update
6096 - other cool stuff, create a diff and look for yourself.
6098 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6100 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6101 -1 this is a non-line-breaking textinset.
6103 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6104 if there is no width set.
6106 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * Lots of files: Merged the dialogbase branch.
6110 2000-06-09 Allan Rae <rae@lyx.org>
6112 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6113 and the Dispatch methods that used it.
6115 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6116 access to functions formerly kept in Dispatch.
6118 2000-05-19 Allan Rae <rae@lyx.org>
6120 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6121 made to_page and count_copies integers again. from_page remains a
6122 string however because I want to allow entry of a print range like
6123 "1,4,22-25" using this field.
6125 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6126 and printer-params-get. These aren't useful from the minibuffer but
6127 could be used by a script/LyXServer app provided it passes a suitable
6128 auto_mem_buffer. I guess I should take a look at how the LyXServer
6129 works and make it support xtl buffers.
6131 * sigc++/: updated to libsigc++-1.0.1
6133 * src/xtl/: updated to xtl-1.3.pl.11
6135 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6136 those changes done to the files in src/ are actually recreated when
6137 they get regenerated. Please don't ever accept a patch that changes a
6138 dialog unless that patch includes the changes to the corresponding *.fd
6141 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6142 stringOnlyContains, renamed it and generalised it.
6144 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6145 branch. Removed the remaining old form_print code.
6147 2000-04-26 Allan Rae <rae@lyx.org>
6149 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6150 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6152 2000-04-25 Allan Rae <rae@lyx.org>
6154 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6155 against a base of xtl-1.3.pl.4
6157 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6158 filter the Id: entries so they still show the xtl version number
6161 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6162 into the src/xtl code. Patch still pending with José (XTL)
6164 2000-04-24 Allan Rae <rae@lyx.org>
6166 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6167 both more generic and much safer. Use the new template functions.
6168 * src/buffer.[Ch] (Dispatch): ditto.
6170 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6171 and mem buffer more intelligently. Also a little general cleanup.
6174 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6175 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6176 * src/xtl/Makefile.am: ditto.
6177 * src/xtl/.cvsignore: ditto.
6178 * src/Makefile.am: ditto.
6180 * src/PrinterParams.h: Removed the macros member functions. Added a
6181 testInvariant member function. A bit of tidying up and commenting.
6182 Included Angus's idea for fixing operation with egcs-1.1.2.
6184 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6185 cool expansion of XTL's mem_buffer to support automatic memory
6186 management within the buffer itself. Removed the various macros and
6187 replaced them with template functions that use either auto_mem_buffer
6188 or mem_buffer depending on a #define. The mem_buffer support will
6189 disappear as soon as the auto_mem_buffer is confirmed to be good on
6190 other platforms/compilers. That is, it's there so you've got something
6193 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6194 effectively forked XTL. However I expect José will include my code
6195 into the next major release. Also fixed a memory leak.
6196 * src/xtl/text.h: ditto.
6197 * src/xtl/xdr.h: ditto.
6198 * src/xtl/giop.h: ditto.
6200 2000-04-16 Allan Rae <rae@lyx.org>
6202 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6203 by autogen.sh and removed by maintainer-clean anyway.
6204 * .cvsignore, sigc++/.cvsignore: Support the above.
6206 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6208 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6210 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6211 macros, renamed static callback-target member functions to suit new
6212 scheme and made them public.
6213 * src/frontends/xforms/forms/form_print.fd: ditto.
6214 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6216 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6219 * src/xtl/: New directory containing a minimal distribution of XTL.
6220 This is XTL-1.3.pl.4.
6222 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6224 2000-04-15 Allan Rae <rae@lyx.org>
6226 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6228 * sigc++/: Updated to libsigc++-1.0.0
6230 2000-04-14 Allan Rae <rae@lyx.org>
6232 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6233 use the generic ones in future. I'll modify my conversion script.
6235 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6237 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6238 (CloseAllBufferRelatedDialogs): Renamed.
6239 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6241 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6242 of the generic ones. These are the same ones my conversion script
6245 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6246 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6247 * src/buffer.C (Dispatch): ditto
6249 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6250 functions for updating and hiding buffer dependent dialogs.
6251 * src/BufferView.C (buffer): ditto
6252 * src/buffer.C (setReadonly): ditto
6253 * src/lyxfunc.C (CloseBuffer): ditto
6255 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6256 Dialogs.h, and hence all the SigC stuff, into every file that includes
6257 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6259 * src/BufferView2.C: reduce the number of headers included by buffer.h
6261 2000-04-11 Allan Rae <rae@lyx.org>
6263 * src/frontends/xforms/xform_macros.h: A small collection of macros
6264 for building C callbacks.
6266 * src/frontends/xforms/Makefile.am: Added above file.
6268 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6269 scheme again. This time it should work for JMarc. If this is
6270 successful I'll revise my conversion script to automate some of this.
6271 The static member functions in the class also have to be public for
6272 this scheme will work. If the scheme works (it's almost identical to
6273 the way BufferView::cursorToggleCB is handled so it should work) then
6274 FormCopyright and FormPrint will be ready for inclusion into the main
6275 trunk immediately after 1.1.5 is released -- provided we're prepared
6276 for complaints about lame compilers not handling XTL.
6278 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6280 2000-04-07 Allan Rae <rae@lyx.org>
6282 * config/lyxinclude.m4: A bit more tidying up (Angus)
6284 * src/LString.h: JMarc's <string> header fix
6286 * src/PrinterParams.h: Used string for most data to remove some
6287 ugly code in the Print dialog and avoid even uglier code when
6288 appending the ints to a string for output.
6290 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6291 and moved "default:" back to the end of switch statement. Cleaned
6292 up the printing so it uses the right function calls and so the
6293 "print to file" option actually puts the file in the right directory.
6295 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6297 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6298 and Ok+Apply button control into a separate method: input (Angus).
6299 (input) Cleaned it up and improved it to be very thorough now.
6300 (All CB) static_cast used instead of C style cast (Angus). This will
6301 probably change again once we've worked out how to keep gcc-2.8.1 happy
6302 with real C callbacks.
6303 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6304 ignore some of the bool settings and has random numbers instead. Needs
6305 some more investigation. Added other input length checks and checking
6306 of file and printer names.
6308 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6309 would link (Angus). Seems the old code doesn't compile with the pragma
6310 statement either. Separated callback entries from internal methods.
6312 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6314 2000-03-17 Allan Rae <rae@lyx.org>
6316 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6317 need it? Maybe it could go in Dialogs instead? I could make it a
6318 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6319 values to get the bool return value.
6320 (Dispatch): New overloaded method for xtl support.
6322 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6323 extern "C" callback instead of static member functions. Hopefully,
6324 JMarc will be able to compile this. I haven't changed
6325 forms/form_copyright.fd yet. Breaking one of my own rules already.
6327 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6328 because they aren't useful from the minibuffer. Maybe a LyXServer
6329 might want a help message though?
6331 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6333 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6334 xtl which needs both rtti and exceptions.
6336 * src/support/Makefile.am:
6337 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6339 * src/frontends/xforms/input_validators.[ch]: input filters and
6340 validators. These conrol what keys are valid in input boxes.
6341 Use them and write some more. Much better idea than waiting till
6342 after the user has pressed Ok to say that the input fields don't make
6345 * src/frontends/xforms/Makefile.am:
6346 * src/frontends/xforms/forms/form_print.fd:
6347 * src/frontends/xforms/forms/makefile:
6348 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6349 new scheme. Still have to make sure I haven't missed anything from
6350 the current implementation.
6352 * src/Makefile.am, src/PrinterParams.h: New data store.
6354 * other files: Added a couple of copyright notices.
6356 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6358 * src/insets/insetbib.h: move Holder struct in public space.
6360 * src/frontends/include/DialogBase.h: use SigC:: only when
6361 SIGC_CXX_NAMESPACES is defined.
6362 * src/frontends/include/Dialogs.h: ditto.
6364 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6366 * src/frontends/xforms/FormCopyright.[Ch]: do not
6367 mention SigC:: explicitely.
6369 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6371 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6372 deals with testing KDE in main configure.in
6373 * configure.in: ditto.
6375 2000-02-22 Allan Rae <rae@lyx.org>
6377 * Lots of files: Merged from HEAD
6379 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6380 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6382 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6384 * sigc++/: new minidist.
6386 2000-02-14 Allan Rae <rae@lyx.org>
6388 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6390 2000-02-08 Juergen Vigna <jug@sad.it>
6392 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6393 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6395 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6396 for this port and so it is much easier for other people to port
6397 dialogs in a common development environment.
6399 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6400 the QT/KDE implementation.
6402 * src/frontends/kde/Dialogs.C:
6403 * src/frontends/kde/FormCopyright.C:
6404 * src/frontends/kde/FormCopyright.h:
6405 * src/frontends/kde/Makefile.am:
6406 * src/frontends/kde/formcopyrightdialog.C:
6407 * src/frontends/kde/formcopyrightdialog.h:
6408 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6409 for the kde support of the Copyright-Dialog.
6411 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6412 subdir-substitution instead of hardcoded 'xforms' as we now have also
6415 * src/frontends/include/DialogBase.h (Object): just commented the
6416 label after #endif (nasty warning and I don't like warnings ;)
6418 * src/main.C (main): added KApplication initialization if using
6421 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6422 For now only the KDE event-loop is added if frontend==kde.
6424 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6426 * configure.in: added support for the --with-frontend[=value] option
6428 * autogen.sh: added kde.m4 file to list of config-files
6430 * acconfig.h: added define for KDEGUI-support
6432 * config/kde.m4: added configuration functions for KDE-port
6434 * config/lyxinclude.m4: added --with-frontend[=value] option with
6435 support for xforms and KDE.
6437 2000-02-08 Allan Rae <rae@lyx.org>
6439 * all Makefile.am: Fixed up so the make targets dist, distclean,
6440 install and uninstall all work even if builddir != srcdir. Still
6441 have a new sigc++ minidist update to come.
6443 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6445 2000-02-01 Allan Rae <rae@lyx.org>
6447 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6448 Many mods to get builddir != srcdir working.
6450 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6451 for building on NT and so we can do the builddir != srcdir stuff.
6453 2000-01-30 Allan Rae <rae@lyx.org>
6455 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6456 This will stay in "rae" branch. We probably don't really need it in
6457 the main trunk as anyone who wants to help programming it should get
6458 a full library installed also. So they can check both included and
6459 system supplied library compilation.
6461 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6462 Added a 'mini' distribution of libsigc++. If you feel the urge to
6463 change something in these directories - Resist it. If you can't
6464 resist the urge then you should modify the following script and rebuild
6465 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6466 all happen. Still uses a hacked version of libsigc++'s configure.in.
6467 I'm quite happy with the results. I'm not sure the extra work to turn
6468 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6469 worth the trouble and would probably lead to extra maintenance
6471 I haven't tested the following important make targets: install, dist.
6472 Not ready for prime time but very close. Maybe 1.1.5.
6474 * development/tools/makeLyXsigc.sh: A shell script to automatically
6475 generate our mini-dist of libsigc++. It can only be used with a CVS
6476 checkout of libsigc++ not a tarball distribution. It's well commented.
6477 This will end up as part of the libsigc++ distribution so other apps
6478 can easily have an included mini-dist. If someone makes mods to the
6479 sigc++ subpackage without modifying this script to generate those
6480 changes I'll be very upset!
6482 * src/frontends/: Started the gui/system indep structure.
6484 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6485 to access the gui-indep dialogs are in this class. Much improved
6486 design compared to previous revision. Lars, please refrain from
6487 moving this header into src/ like you did with Popups.h last time.
6489 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6491 * src/frontends/xforms/: Started the gui-indep system with a single
6492 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6495 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6496 Here you'll find a very useful makefile and automated fdfix.sh that
6497 makes updating dailogs a no-brainer -- provided you follow the rules
6498 set out in the README. I'm thinking about adding another script to
6499 automatically generate skeleton code for a new dialog given just the
6502 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6503 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6504 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6506 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 * src/support/LSubstring.C (operator): simplify
6510 * src/lyxtext.h: removed bparams, use buffer_->params instead
6512 * src/lyxrow.h: make Row a real class, move all variables to
6513 private and use accessors.
6515 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6517 (isRightToLeftPar): ditto
6518 (ChangeLanguage): ditto
6519 (isMultiLingual): ditto
6522 (SimpleTeXOnePar): ditto
6523 (TeXEnvironment): ditto
6524 (GetEndLabel): ditto
6526 (SetOnlyLayout): ditto
6527 (BreakParagraph): ditto
6528 (BreakParagraphConservative): ditto
6529 (GetFontSettings): ditto
6531 (CopyIntoMinibuffer): ditto
6532 (CutIntoMinibuffer): ditto
6533 (PasteParagraph): ditto
6534 (SetPExtraType): ditto
6535 (UnsetPExtraType): ditto
6536 (DocBookContTableRows): ditto
6537 (SimpleDocBookOneTablePar): ditto
6539 (TeXFootnote): ditto
6540 (SimpleTeXOneTablePar): ditto
6541 (TeXContTableRows): ditto
6542 (SimpleTeXSpecialChars): ditto
6545 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6546 to private and use accessors.
6548 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6549 this, we did not use it anymore and has not been for ages. Just a
6550 waste of cpu cycles.
6552 * src/language.h: make Language a real class, move all variables
6553 to private and use accessors.
6555 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6556 (create_view): remove
6557 (update): some changes for new timer
6558 (cursorToggle): use new timer
6559 (beforeChange): change for new timer
6561 * src/BufferView.h (cursorToggleCB): removed last paramter because
6564 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6565 (cursorToggleCB): change because of new timer code
6567 * lib/CREDITS: updated own mailaddress
6569 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6571 * src/support/filetools.C (PutEnv): fix the code in case neither
6572 putenv() nor setenv() have been found.
6574 * INSTALL: mention the install-strip Makefile target.
6576 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6577 read-only documents.
6579 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6581 * lib/reLyX/configure.in (VERSION): avoid using a previously
6582 generated reLyX wrapper to find out $prefix.
6584 * lib/examples/eu_adibide_lyx-atua.lyx:
6585 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6586 translation of the Tutorial (Dooteo)
6588 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6590 * forms/cite.fd: new citation dialog
6592 * src/insetcite.[Ch]: the new citation dialog is moved into
6595 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6598 * src/insets/insetcommand.h: data members made private.
6600 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6602 * LyX 1.1.5 released
6604 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6606 * src/version.h (LYX_RELEASE): to 1.1.5
6608 * src/spellchecker.C (RunSpellChecker): return false if the
6609 spellchecker dies upon creation.
6611 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6613 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6614 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6618 * lib/CREDITS: update entry for Martin Vermeer.
6620 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6622 * src/text.C (draw): Draw foreign language bars at the bottom of
6623 the row instead of at the baseline.
6625 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6627 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6629 * lib/bind/de_menus.bind: updated
6631 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6633 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6635 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6637 * src/menus.C (Limit_string_length): New function
6638 (ShowTocMenu): Limit the number of items/length of items in the
6641 * src/paragraph.C (String): Correct result for a paragraph inside
6644 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6646 * src/bufferlist.C (close): test of buf->getuser() == NULL
6648 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6650 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6651 Do not call to SetCursor when the paragraph is a closed footnote!
6653 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6655 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6658 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6660 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6663 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6664 reference popup, that activates the reference-back action
6666 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6668 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6669 the menus. Also fixed a bug.
6671 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6672 the math panels when switching buffers (unless new buffer is readonly).
6674 * src/BufferView.C (NoSavedPositions)
6675 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6677 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6679 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6680 less of dvi dirty or not.
6682 * src/trans_mgr.[Ch] (insert): change first parameter to string
6685 * src/chset.[Ch] (encodeString): add const to first parameter
6687 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6689 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6693 * src/LaTeX.C (deplog): better searching for dependency files in
6694 the latex log. Uses now regexps.
6696 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6697 instead of the box hack or \hfill.
6699 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6701 * src/lyxfunc.C (doImportHelper): do not create the file before
6702 doing the actual import.
6703 (doImportASCIIasLines): create a new file before doing the insert.
6704 (doImportASCIIasParagraphs): ditto.
6706 * lib/lyxrc.example: remove mention of non-existing commands
6708 * lyx.man: remove mention of color-related switches.
6710 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6712 * src/lyx_gui.C: remove all the color-related ressources, which
6713 are not used anymore.
6715 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6718 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6720 * src/lyxrc.C (read): Add a missing break in the switch
6722 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6724 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6726 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6729 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6731 * src/text.C (draw): draw bars under foreign language words.
6733 * src/LColor.[Ch]: add LColor::language
6735 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6737 * src/lyxcursor.h (boundary): New member variable
6739 * src/text.C (IsBoundary): New methods
6741 * src/text.C: Use the above for currect cursor movement when there
6742 is both RTL & LTR text.
6744 * src/text2.C: ditto
6746 * src/bufferview_funcs.C (ToggleAndShow): ditto
6748 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6750 * src/text.C (DeleteLineForward): set selection to true to avoid
6751 that DeleteEmptyParagraphMechanism does some magic. This is how it
6752 is done in all other functions, and seems reasonable.
6753 (DeleteWordForward): do not jump over non-word stuff, since
6754 CursorRightOneWord() already does it.
6756 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6757 DeleteWordBackward, since they seem safe to me (since selection is
6758 set to "true") DeleteEmptyParagraphMechanism does nothing.
6760 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * src/lyx_main.C (easyParse): simplify the code by factoring the
6763 part that removes parameters from the command line.
6764 (LyX): check wether wrong command line options have been given.
6766 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6768 * src/lyx_main.C : add support for specifying user LyX
6769 directory via command line option -userdir.
6771 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6773 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6774 the number of items per popup.
6775 (Add_to_refs_menu): Ditto.
6777 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6779 * src/lyxparagraph.h: renamed ClearParagraph() to
6780 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6781 textclass as parameter, and do nothing if free_spacing is
6782 true. This fixes part of the line-delete-forward problems.
6784 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6785 (pasteSelection): ditto.
6786 (SwitchLayoutsBetweenClasses): more translatable strings.
6788 * src/text2.C (CutSelection): use StripLeadingSpaces.
6789 (PasteSelection): ditto.
6790 (DeleteEmptyParagraphMechanism): ditto.
6792 2000-05-26 Juergen Vigna <jug@sad.it>
6794 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6795 is not needed in tabular insets.
6797 * src/insets/insettabular.C (TabularFeatures): added missing features.
6799 * src/tabular.C (DeleteColumn):
6801 (AppendRow): implemented this functions
6802 (cellsturct::operator=): clone the inset too;
6804 2000-05-23 Juergen Vigna <jug@sad.it>
6806 * src/insets/insettabular.C (LocalDispatch): better selection support
6807 when having multicolumn-cells.
6809 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6811 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6813 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6815 * src/ColorHandler.C (getGCForeground): put more test into _()
6817 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6820 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6823 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6825 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6826 there are no labels, or when buffer is readonly.
6828 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6829 there are no labels, buffer is SGML, or when buffer is readonly.
6831 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6833 * src/LColor.C (LColor): change a couple of grey40 to grey60
6834 (LColor): rewore initalization to make compiles go some magnitude
6836 (getGUIName): don't use gettext until we need the string.
6838 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6840 * src/Bullet.[Ch]: Fixed a small bug.
6842 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6844 * src/paragraph.C (String): Several fixes/improvements
6846 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6848 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6850 * src/paragraph.C (String): give more correct output.
6852 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6854 * src/lyxfont.C (stateText) Do not output the language if it is
6855 eqaul to the language of the document.
6857 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6858 between two paragraphs with the same language.
6860 * src/paragraph.C (getParLanguage) Return a correct answer for an
6861 empty dummy paragraph.
6863 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6866 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6869 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6870 the menus/popup, if requested fonts are unavailable.
6872 2000-05-22 Juergen Vigna <jug@sad.it>
6874 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6875 movement support (Up/Down/Tab/Shift-Tab).
6876 (LocalDispatch): added also preliminari cursor-selection.
6878 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6880 * src/paragraph.C (PasteParagraph): Hopefully now right!
6882 2000-05-22 Garst R. Reese <reese@isn.net>
6884 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6885 of list, change all references to Environment to Command
6886 * tex/hollywood.cls : rewrite environments as commands, add
6887 \uppercase to interiorshot and exteriorshot to force uppecase.
6888 * tex/broadway.cls : rewrite environments as commands. Tweak
6891 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6893 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6894 size of items: use a constant intead of the hardcoded 40, and more
6895 importantly do not remove the %m and %x tags added at the end.
6896 (Add_to_refs_menu): use vector::size_type instead of
6897 unsigned int as basic types for the variables. _Please_ do not
6898 assume that size_t is equal to unsigned int. On an alpha, this is
6899 unsigned long, which is _not_ the same.
6901 * src/language.C (initL): remove language "hungarian", since it
6902 seems that "magyar" is better.
6904 2000-05-22 Juergen Vigna <jug@sad.it>
6906 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6908 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6911 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6912 next was deleted but not set to 0.
6914 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6916 * src/language.C (initL): change the initialization of languages
6917 so that compiles goes _fast_.
6919 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6922 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6924 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6928 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6930 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6932 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6936 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6939 * src/insets/insetlo*.[Ch]: Made editable
6941 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6944 the current selection.
6946 * src/BufferView_pimpl.C (stuffClipboard): new method
6948 * src/BufferView.C (stuffClipboard): new method
6950 * src/paragraph.C (String): new method
6952 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6953 LColor::ignore when lyxname is not found.
6955 * src/BufferView.C (pasteSelection): new method
6957 * src/BufferView_pimpl.C (pasteSelection): new method
6959 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6961 * src/WorkArea.C (request_clipboard_cb): new static function
6962 (getClipboard): new method
6963 (putClipboard): new method
6965 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6967 * LyX 1.1.5pre2 released
6969 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6971 * src/vspace.C (operator=): removed
6972 (operator=): removed
6974 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6976 * src/layout.C (NumberOfClass): manually set the type in make_pair
6977 (NumberOfLayout): ditto
6979 * src/language.C: use the Language constructor for ignore_lang
6981 * src/language.h: add constructors to struct Language
6983 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6985 * src/text2.C (SetCursorIntern): comment out #warning
6987 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6989 * src/mathed/math_iter.h: initialize sx and sw to 0
6991 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6993 * forms/lyx.fd: Redesign of form_ref
6995 * src/LaTeXFeatures.[Ch]
6999 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7002 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7003 and Buffer::inset_iterator.
7005 * src/menus.C: Added new menus: TOC and Refs.
7007 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7009 * src/buffer.C (getTocList): New method.
7011 * src/BufferView2.C (ChangeRefs): New method.
7013 * src/buffer.C (getLabelList): New method. It replaces the old
7014 getReferenceList. The return type is vector<string> instead of
7017 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7018 the old getLabel() and GetNumberOfLabels() methods.
7019 * src/insets/insetlabel.C (getLabelList): ditto
7020 * src/mathed/formula.C (getLabelList): ditto
7022 * src/paragraph.C (String): New method.
7024 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7025 Uses the new getTocList() method.
7026 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7027 which automatically updates the contents of the browser.
7028 (RefUpdateCB): Use the new getLabelList method.
7030 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7032 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7034 * src/spellchecker.C: Added using std::reverse;
7036 2000-05-19 Juergen Vigna <jug@sad.it>
7038 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7040 * src/insets/insettext.C (computeTextRows): small fix for display of
7041 1 character after a newline.
7043 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7046 2000-05-18 Juergen Vigna <jug@sad.it>
7048 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7049 when changing width of column.
7051 * src/tabular.C (set_row_column_number_info): setting of
7052 autobreak rows if necessary.
7054 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7056 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7058 * src/vc-backend.*: renamed stat() to status() and vcstat to
7059 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7060 compilation broke. The new name seems more relevant, anyway.
7062 2000-05-17 Juergen Vigna <jug@sad.it>
7064 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7065 which was wrong if the removing caused removing of rows!
7067 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7068 (pushToken): new function.
7070 * src/text2.C (CutSelection): fix problem discovered with purify
7072 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7074 * src/debug.C (showTags): enlarge the first column, now that we
7075 have 6-digits debug codes.
7077 * lib/layouts/hollywood.layout:
7078 * lib/tex/hollywood.cls:
7079 * lib/tex/brodway.cls:
7080 * lib/layouts/brodway.layout: more commands and fewer
7081 environments. Preambles moved in the .cls files. Broadway now has
7082 more options on scene numbering and less whitespace (from Garst)
7084 * src/insets/insetbib.C (getKeys): make sure that we are in the
7085 document directory, in case the bib file is there.
7087 * src/insets/insetbib.C (Latex): revert bogus change.
7089 2000-05-16 Juergen Vigna <jug@sad.it>
7091 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7092 the TabularLayout on cursor move.
7094 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7096 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7099 (draw): fixed cursor position and drawing so that the cursor is
7100 visible when before the tabular-inset.
7102 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7103 when creating from old insettext.
7105 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7107 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7109 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7110 * lib/tex/brodway.cls: ditto
7112 * lib/layouts/brodway.layout: change alignment of parenthical
7115 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7117 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7118 versions 0.88 and 0.89 are supported.
7120 2000-05-15 Juergen Vigna <jug@sad.it>
7122 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7125 * src/insets/insettext.C (computeTextRows): redone completely this
7126 function in a much cleaner way, because of problems when having a
7128 (draw): added a frame border when the inset is locked.
7129 (SetDrawLockedFrame): this sets if we draw the border or not.
7130 (SetFrameColor): this sets the frame color (default=insetframe).
7132 * src/insets/lyxinset.h: added x() and y() functions which return
7133 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7134 function which is needed to see if we have a locking inset of some
7135 type in this inset (needed for now in insettabular).
7137 * src/vspace.C (inPixels): the same function also without a BufferView
7138 parameter as so it is easier to use it in some ocasions.
7140 * src/lyxfunc.C: changed all places where insertInset was used so
7141 that now if it couldn't be inserted it is deleted!
7143 * src/TabularLayout.C:
7144 * src/TableLayout.C: added support for new tabular-inset!
7146 * src/BufferView2.C (insertInset): this now returns a bool if the
7147 inset was really inserted!!!
7149 * src/tabular.C (GetLastCellInRow):
7150 (GetFirstCellInRow): new helper functions.
7151 (Latex): implemented for new tabular class.
7155 (TeXTopHLine): new Latex() helper functions.
7157 2000-05-12 Juergen Vigna <jug@sad.it>
7159 * src/mathed/formulamacro.C (Read):
7160 * src/mathed/formula.C (Read): read also the \end_inset here!
7162 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7164 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7165 crush when saving formulae with unbalanced parenthesis.
7167 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7169 * src/layout.C: Add new keyword "endlabelstring" to layout file
7171 * src/text.C (GetVisibleRow): Draw endlabel string.
7173 * lib/layouts/broadway.layout
7174 * lib/layouts/hollywood.layout: Added endlabel for the
7175 Parenthetical layout.
7177 * lib/layouts/heb-article.layout: Do not use slanted font shape
7178 for Theorem like environments.
7180 * src/buffer.C (makeLaTeXFile): Always add "american" to
7181 the UsedLanguages list if document language is RTL.
7183 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7185 * add addendum to README.OS2 and small patch (from SMiyata)
7187 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7189 * many files: correct the calls to ChangeExtension().
7191 * src/support/filetools.C (ChangeExtension): remove the no_path
7192 argument, which does not belong there. Use OnlyFileName() instead.
7194 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7195 files when LaTeXing a non-nice latex file.
7197 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7198 a chain of "if". Return false when deadkeys are not handled.
7200 * src/lyx_main.C (LyX): adapted the code for default bindings.
7202 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7203 bindings for basic functionality (except deadkeys).
7204 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7206 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7207 several methods: handle override_x_deadkeys.
7209 * src/lyxrc.h: remove the "bindings" map, which did not make much
7210 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7212 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7214 * src/lyxfont.C (stateText): use a saner method to determine
7215 whether the font is "default". Seems to fix the crash with DEC
7218 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7220 2000-05-08 Juergen Vigna <jug@sad.it>
7222 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7223 TabularLayoutMenu with mouse-button-3
7224 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7226 * src/TabularLayout.C: added this file for having a Layout for
7229 2000-05-05 Juergen Vigna <jug@sad.it>
7231 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7232 recalculating inset-widths.
7233 (TabularFeatures): activated this function so that I can change
7234 tabular-features via menu.
7236 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7237 that I can test some functions with the Table menu.
7239 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/lyxfont.C (stateText): guard against stupid c++libs.
7243 * src/tabular.C: add using std::vector
7244 some whitespace changes, + removed som autogenerated code.
7246 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7248 2000-05-05 Juergen Vigna <jug@sad.it>
7250 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7251 row, columns and cellstructures.
7253 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7255 * lib/lyxrc.example: remove obsolete entries.
7257 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7258 reading of protected_separator for free_spacing.
7260 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7262 * src/text.C (draw): do not display an exclamation mark in the
7263 margin for margin notes. This is confusing, ugly and
7266 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7267 AMS math' is checked.
7269 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7270 name to see whether including the amsmath package is needed.
7272 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7274 * src/paragraph.C (validate): Compute UsedLanguages correctly
7275 (don't insert the american language if it doesn't appear in the
7278 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7279 The argument of \thanks{} command is considered moving argument
7281 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7284 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7286 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7287 for appendix/minipage/depth. The lines can be now both in the footnote
7288 frame, and outside the frame.
7290 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7293 2000-05-05 Juergen Vigna <jug@sad.it>
7295 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7296 neede only in tabular.[Ch].
7298 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7300 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7302 (Write): write '~' for PROTECTED_SEPARATOR
7304 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7306 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7309 * src/mathed/formula.C (drawStr): rename size to siz.
7311 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7312 possibly fix a bug by not changing the pflags = flags to piflags =
7315 2000-05-05 Juergen Vigna <jug@sad.it>
7317 * src/insets/insetbib.C: moved using directive
7319 * src/ImportNoweb.C: small fix for being able to compile (missing
7322 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7324 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7325 to use clear, since we don't depend on this in the code. Add test
7328 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7330 * (various *.C files): add using std::foo directives to please dec
7333 * replace calls to string::clear() to string::erase() (Angus)
7335 * src/cheaders/cmath: modified to provide std::abs.
7337 2000-05-04 Juergen Vigna <jug@sad.it>
7339 * src/insets/insettext.C: Prepared all for inserting of multiple
7340 paragraphs. Still display stuff to do (alignment and other things),
7341 but I would like to use LyXText to do this when we cleaned out the
7342 table-support stuff.
7344 * src/insets/insettabular.C: Changed lot of stuff and added lots
7345 of functionality still a lot to do.
7347 * src/tabular.C: Various functions changed name and moved to be
7348 const functions. Added new Read and Write functions and changed
7349 lots of things so it works good with tabular-insets (also removed
7350 some stuff which is not needed anymore * hacks *).
7352 * src/lyxcursor.h: added operators == and != which just look if
7353 par and pos are (not) equal.
7355 * src/buffer.C (latexParagraphs): inserted this function to latex
7356 all paragraphs form par to endpar as then I can use this too for
7359 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7360 so that I can call this to from text insets with their own cursor.
7362 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7363 output off all paragraphs (because of the fix below)!
7365 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7366 the very last paragraph (this could be also the last paragraph of an
7369 * src/texrow.h: added rows() call which returns the count-variable.
7371 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7373 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7375 * lib/configure.m4: better autodetection of DocBook tools.
7377 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7379 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7381 * src/lyx_cb.C: add using std::reverse;
7383 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7386 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7387 selected files. Should fix repeated errors from generated files.
7389 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7391 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7393 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7394 the spellchecker popup.
7396 * lib/lyxrc.example: Removed the \number_inset section
7398 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7400 * src/insets/figinset.C (various): Use IsFileReadable() to make
7401 sure that the file actually exist. Relying on ghostscripts errors
7402 is a bad idea since they can lead to X server crashes.
7404 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7406 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7409 * lib/lyxrc.example: smallish typo in description of
7410 \view_dvi_paper_option
7412 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7415 * src/lyxfunc.C: doImportHelper to factor out common code of the
7416 various import methods. New functions doImportASCIIasLines,
7417 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7418 doImportLinuxDoc for the format specific parts.
7421 * buffer.C: Dispatch returns now a bool to indicate success
7424 * lyx_gui.C: Add getLyXView() for member access
7426 * lyx_main.C: Change logic for batch commands: First try
7427 Buffer::Dispatch (possibly without GUI), if that fails, use
7430 * lyx_main.C: Add support for --import command line switch.
7431 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7432 Available Formats: Everything accepted by 'buffer-import <format>'
7434 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7439 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7440 documents will be reformatted upon reentry.
7442 2000-04-27 Juergen Vigna <jug@sad.it>
7444 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7445 correctly only last pos this was a bug.
7447 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7449 * release of lyx-1.1.5pre1
7451 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7455 * src/menus.C: revert the change of naming (Figure->Graphic...)
7456 from 2000-04-11. It was incomplete and bad.
7458 * src/LColor.[Ch]: add LColor::depthbar.
7459 * src/text.C (GetVisibleRow): use it.
7461 * README: update the languages list.
7463 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7465 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7468 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * README: remove sections that were just wrong.
7472 * src/text2.C (GetRowNearY): remove currentrow code
7474 * src/text.C (GetRow): remove currentrow code
7476 * src/screen.C (Update): rewritten a bit.
7477 (SmallUpdate): removed func
7479 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7481 (FullRebreak): return bool
7482 (currentrow): remove var
7483 (currentrow_y): ditto
7485 * src/lyxscreen.h (Draw): change arg to unsigned long
7486 (FitCursor): return bool
7487 (FitManualCursor): ditto
7488 (Smallpdate): remove func
7489 (first): change to unsigned long
7490 (DrawOneRow): change second arg to long (from long &)
7491 (screen_refresh_y): remove var
7492 (scree_refresh_row): ditto
7494 * src/lyxrow.h: change baseline to usigned int from unsigned
7495 short, this brings some implicit/unsigned issues out in the open.
7497 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7499 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7500 instead of smallUpdate.
7502 * src/lyxcursor.h: change y to unsigned long
7504 * src/buffer.h: don't call updateScrollbar after fitcursor
7506 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7507 where they are used. Removed "\\direction", this was not present
7508 in 1.1.4 and is already obsolete. Commented out some code that I
7509 believe to never be called.
7510 (runLiterate): don't call updateScrollbar after fitCursor
7512 (buildProgram): ditto
7515 * src/WorkArea.h (workWidth): change return val to unsigned
7518 (redraw): remove the button redraws
7519 (setScrollbarValue): change for scrollbar
7520 (getScrollbarValue): change for scrollbar
7521 (getScrollbarBounds): change for scrollbar
7523 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7524 (C_WorkArea_down_cb): removed func
7525 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7526 (resize): change for scrollbar
7527 (setScrollbar): ditto
7528 (setScrollbarBounds): ditto
7529 (setScrollbarIncrements): ditto
7530 (up_cb): removed func
7531 (down_cb): removed func
7532 (scroll_cb): change for scrollbar
7533 (work_area_handler): ditto
7535 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7536 when FitCursor did something.
7537 (updateScrollbar): some unsigned changes
7538 (downCB): removed func
7539 (scrollUpOnePage): removed func
7540 (scrollDownOnePage): remvoed func
7541 (workAreaMotionNotify): don't call screen->FitCursor but use
7542 fitCursor instead. and bool return val
7543 (workAreaButtonPress): ditto
7544 (workAreaButtonRelease): some unsigned changes
7545 (checkInsetHit): ditto
7546 (workAreaExpose): ditto
7547 (update): parts rewritten, comments about the signed char arg added
7548 (smallUpdate): removed func
7549 (cursorPrevious): call needed updateScrollbar
7552 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7555 * src/BufferView.[Ch] (upCB): removed func
7556 (downCB): removed func
7557 (smallUpdate): removed func
7559 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7561 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7562 currentrow, currentrow_y optimization. This did not help a lot and
7563 if we want to do this kind of optimization we should rather use
7564 cursor.row instead of the currentrow.
7566 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7567 buffer spacing and klyx spacing support.
7569 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7571 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7574 2000-04-26 Juergen Vigna <jug@sad.it>
7576 * src/insets/figinset.C: fixes to Lars sstream changes!
7578 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7580 * A lot of files: Added Ascii(ostream &) methods to all inset
7581 classes. Used when exporting to ASCII.
7583 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7584 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7587 * src/text2.C (ToggleFree): Disabled implicit word selection when
7588 there is a change in the language
7590 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7591 no output was generated for end-of-sentence inset.
7593 * src/insets/lyxinset.h
7596 * src/paragraph.C: Removed the insetnumber code
7598 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7600 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7602 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7603 no_babel and no_epsfig completely from the file.
7604 (parseSingleLyXformat2Token): add handling for per-paragraph
7605 spacing as written by klyx.
7607 * src/insets/figinset.C: applied patch by Andre. Made it work with
7610 2000-04-20 Juergen Vigna <jug@sad.it>
7612 * src/insets/insettext.C (cutSelection):
7613 (copySelection): Fixed with selection from right to left.
7614 (draw): now the rows are not recalculated at every draw.
7615 (computeTextRows): for now reset the inset-owner here (this is
7616 important for an undo or copy where the inset-owner is not set
7619 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7620 motion to the_locking_inset screen->first was forgotten, this was
7621 not important till we got multiline insets.
7623 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7625 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7626 code seems to be alright (it is code changed by Dekel, and the
7627 intent is indeed that all macros should be defined \protect'ed)
7629 * NEWS: a bit of reorganisation of the new user-visible features.
7631 2000-04-19 Juergen Vigna <jug@sad.it>
7633 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7634 position. Set the inset_owner of the used paragraph so that it knows
7635 that it is inside an inset. Fixed cursor handling with mouse and
7636 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7637 and cleanups to make TextInsets work better.
7639 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7640 Changed parameters of various functions and added LockInsetInInset().
7642 * src/insets/insettext.C:
7644 * src/insets/insetcollapsable.h:
7645 * src/insets/insetcollapsable.C:
7646 * src/insets/insetfoot.h:
7647 * src/insets/insetfoot.C:
7648 * src/insets/insetert.h:
7649 * src/insets/insetert.C: cleaned up the code so that it works now
7650 correctly with insettext.
7652 * src/insets/inset.C:
7653 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7654 that insets in insets are supported right.
7657 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7659 * src/paragraph.C: some small fixes
7661 * src/debug.h: inserted INSETS debug info
7663 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7664 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7666 * src/commandtags.h:
7667 * src/LyXAction.C: insert code for InsetTabular.
7669 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7670 not Button1MotionMask.
7671 (workAreaButtonRelease): send always a InsetButtonRelease event to
7673 (checkInsetHit): some setCursor fixes (always with insets).
7675 * src/BufferView2.C (lockInset): returns a bool now and extended for
7676 locking insets inside insets.
7677 (showLockedInsetCursor): it is important to have the cursor always
7678 before the locked inset.
7679 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7681 * src/BufferView.h: made lockInset return a bool.
7683 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7685 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7686 that is used also internally but can be called as public to have back
7687 a cursor pos which is not set internally.
7688 (SetCursorIntern): Changed to use above function.
7690 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7692 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7698 patches for things that should be in or should be changed.
7700 * src/* [insetfiles]: change "usigned char fragile" to bool
7701 fragile. There was only one point that could that be questioned
7702 and that is commented in formulamacro.C. Grep for "CHECK".
7704 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7705 (DeleteBuffer): take it out of CutAndPaste and make it static.
7707 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7709 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7710 output the spacing envir commands. Also the new commands used in
7711 the LaTeX output makes the result better.
7713 * src/Spacing.C (writeEnvirBegin): new method
7714 (writeEnvirEnd): new method
7716 2000-04-18 Juergen Vigna <jug@sad.it>
7718 * src/CutAndPaste.C: made textclass a static member of the class
7719 as otherwise it is not accesed right!!!
7721 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7723 * forms/layout_forms.fd
7724 * src/layout_forms.h
7725 * src/layout_forms.C (create_form_form_character)
7726 * src/lyx_cb.C (UserFreeFont)
7727 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7728 documents (in the layout->character popup).
7730 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7732 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7733 \spell_command was in fact not honored (from Kevin Atkinson).
7735 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7738 * src/lyx_gui.h: make lyxViews private (Angus)
7740 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7742 * src/mathed/math_write.C
7743 (MathMatrixInset::Write) Put \protect before \begin{array} and
7744 \end{array} if fragile
7745 (MathParInset::Write): Put \protect before \\ if fragile
7747 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7749 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7750 initialization if the LyXColorHandler must be done after the
7751 connections to the XServer has been established.
7753 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7754 get the background pixel from the lyxColorhandler so that the
7755 figures are rendered with the correct background color.
7756 (NextToken): removed functions.
7757 (GetPSSizes): use ifs >> string instead of NextToken.
7759 * src/Painter.[Ch]: the color cache moved out of this file.
7761 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7764 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7766 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7767 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7769 * src/BufferView.C (enterView): new func
7770 (leaveView): new func
7772 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7774 (leaveView): new func, undefines xterm cursor when approp.
7776 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7777 (AllowInput): delete the Workarea cursor handling from this func.
7779 * src/Painter.C (underline): draw a slimer underline in most cases.
7781 * src/lyx_main.C (error_handler): use extern "C"
7783 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7785 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7786 sent directly to me.
7788 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7789 to the list by Dekel.
7791 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7794 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7795 methods from lyx_cb.here.
7797 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7800 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7802 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7803 instead of using current_view directly.
7805 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7807 * src/LyXAction.C (init): add the paragraph-spacing command.
7809 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7811 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7813 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7814 different from the documents.
7816 * src/text.C (SetHeightOfRow): take paragraph spacing into
7817 account, paragraph spacing takes precedence over buffer spacing
7818 (GetVisibleRow): ditto
7820 * src/paragraph.C (writeFile): output the spacing parameter too.
7821 (validate): set the correct features if spacing is used in the
7823 (Clear): set spacing to default
7824 (MakeSameLayout): spacing too
7825 (HasSameLayout): spacing too
7826 (SetLayout): spacing too
7827 (TeXOnePar): output the spacing commands
7829 * src/lyxparagraph.h: added a spacing variable for use with
7830 per-paragraph spacing.
7832 * src/Spacing.h: add a Default spacing and a method to check if
7833 the current spacing is default. also added an operator==
7835 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7838 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7840 * src/lyxserver.C (callback): fix dispatch of functions
7842 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7843 printf() into lyxerr call.
7845 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7848 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7849 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7850 the "Float" from each of the subitems.
7851 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7853 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7854 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7855 documented the change so that the workaround can be nuked later.
7857 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7860 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7862 * src/buffer.C (getLatexName): ditto
7863 (setReadonly): ditto
7865 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7867 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7868 avoid some uses of current_view. Added also a bufferParams()
7869 method to get at this.
7871 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7873 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7875 * src/lyxparagraph.[Ch]: removed
7876 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7877 with operators used by lower_bound and
7878 upper_bound in InsetTable's
7879 Make struct InsetTable private again. Used matchpos.
7881 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7883 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7884 document, the language of existing text is changed (unless the
7885 document is multi-lingual)
7887 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7889 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7891 * A lot of files: A rewrite of the Right-to-Left support.
7893 2000-04-10 Juergen Vigna <jug@sad.it>
7895 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7896 misplaced cursor when inset in inset is locked.
7898 * src/insets/insettext.C (LocalDispatch): small fix so that a
7899 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7901 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7902 footnote font should be decreased in size twice when displaying.
7904 * src/insets/insettext.C (GetDrawFont): inserted this function as
7905 the drawing-font may differ from the real paragraph font.
7907 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7908 insets (inset in inset!).
7910 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7911 function here because we don't want footnotes inside footnotes.
7913 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7915 (init): now set the inset_owner in paragraph.C
7916 (LocalDispatch): added some resetPos() in the right position
7919 (pasteSelection): changed to use the new CutAndPaste-Class.
7921 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7922 which tells if it is allowed to insert another inset inside this one.
7924 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7925 SwitchLayoutsBetweenClasses.
7927 * src/text2.C (InsertInset): checking of the new paragraph-function
7929 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7930 is not needed anymore here!
7933 (PasteSelection): redone (also with #ifdef) so that now this uses
7934 the CutAndPaste-Class.
7935 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7938 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7939 from/to text/insets.
7941 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7942 so that the paragraph knows if it is inside an (text)-inset.
7943 (InsertFromMinibuffer): changed return-value to bool as now it
7944 may happen that an inset is not inserted in the paragraph.
7945 (InsertInsetAllowed): this checks if it is allowed to insert an
7946 inset in this paragraph.
7948 (BreakParagraphConservative):
7949 (BreakParagraph) : small change for the above change of the return
7950 value of InsertFromMinibuffer.
7952 * src/lyxparagraph.h: added inset_owner and the functions to handle
7953 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7955 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7957 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7958 functions from BufferView to BufferView::Pimpl to ease maintence.
7960 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7961 correctly. Also use SetCursorIntern instead of SetCursor.
7963 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7966 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7968 * src/WorkArea.C (belowMouse): manually implement below mouse.
7970 * src/*: Add "explicit" on several constructors, I added probably
7971 some unneeded ones. A couple of changes to code because of this.
7973 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7974 implementation and private parts from the users of BufferView. Not
7977 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7978 implementation and private parts from the users of LyXLex. Not
7981 * src/BufferView_pimpl.[Ch]: new files
7983 * src/lyxlex_pimpl.[Ch]: new files
7985 * src/LyXView.[Ch]: some inline functions move out-of-line
7987 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7989 * src/lyxparagraph.h: make struct InsetTable public.
7991 * src/support/lyxstring.h: change lyxstring::difference_type to be
7992 ptrdiff_t. Add std:: modifiers to streams.
7994 * src/font.C: include the <cctype> header, for islower() and
7997 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7999 * src/font.[Ch]: new files. Contains the metric functions for
8000 fonts, takes a LyXFont as parameter. Better separation of concepts.
8002 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8003 changes because of this.
8005 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8007 * src/*: compile with -Winline and move functions that don't
8010 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8013 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8015 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8016 (various files changed because of this)
8018 * src/Painter.C (text): fixed the drawing of smallcaps.
8020 * src/lyxfont.[Ch] (drawText): removed unused member func.
8023 * src/*.C: added needed "using" statements and "std::" qualifiers.
8025 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8027 * src/*.h: removed all use of "using" from header files use
8028 qualifier std:: instead.
8030 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8032 * src/text.C (Backspace): some additional cleanups (we already
8033 know whether cursor.pos is 0 or not).
8035 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8036 automake does not provide one).
8038 * src/bmtable.h: replace C++ comments with C comments.
8040 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8042 * src/screen.C (ShowCursor): Change the shape of the cursor if
8043 the current language is not equal to the language of the document.
8044 (If the cursor change its shape unexpectedly, then you've found a bug)
8046 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8049 * src/insets/insetnumber.[Ch]: New files.
8051 * src/LyXAction.C (init)
8052 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8055 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8057 * src/lyxparagraph.h
8058 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8059 (the vector is kept sorted).
8061 * src/text.C (GetVisibleRow): Draw selection correctly when there
8062 is both LTR and RTL text.
8064 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8065 which is much faster.
8067 * src/text.C (GetVisibleRow and other): Do not draw the last space
8068 in a row if the direction of the last letter is not equal to the
8069 direction of the paragraph.
8071 * src/lyxfont.C (latexWriteStartChanges):
8072 Check that font language is not equal to basefont language.
8073 (latexWriteEndChanges): ditto
8075 * src/lyx_cb.C (StyleReset): Don't change the language while using
8076 the font-default command.
8078 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8079 empty paragraph before a footnote.
8081 * src/insets/insetcommand.C (draw): Increase x correctly.
8083 * src/screen.C (ShowCursor): Change cursor shape if
8084 current language != document language.
8086 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8088 2000-03-31 Juergen Vigna <jug@sad.it>
8090 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8091 (Clone): changed mode how the paragraph-data is copied to the
8092 new clone-paragraph.
8094 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8095 GetInset(pos) with no inset anymore there (in inset UNDO)
8097 * src/insets/insetcommand.C (draw): small fix as here x is
8098 incremented not as much as width() returns (2 before, 2 behind = 4)
8100 2000-03-30 Juergen Vigna <jug@sad.it>
8102 * src/insets/insettext.C (InsetText): small fix in initialize
8103 widthOffset (should not be done in the init() function)
8105 2000-03-29 Amir Karger <karger@lyx.org>
8107 * lib/examples/it_ItemizeBullets.lyx: translation by
8110 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8112 2000-03-29 Juergen Vigna <jug@sad.it>
8114 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8116 * src/insets/insetfoot.C (Clone): small change as for the below
8117 new init function in the text-inset
8119 * src/insets/insettext.C (init): new function as I've seen that
8120 clone did not copy the Paragraph-Data!
8121 (LocalDispatch): Added code so that now we have some sort of Undo
8122 functionality (well actually we HAVE Undo ;)
8124 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8126 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8128 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8131 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8133 * src/main.C: added a runtime check that verifies that the xforms
8134 header used when building LyX and the library used when running
8135 LyX match. Exit with a message if they don't match. This is a
8136 version number check only.
8138 * src/buffer.C (save): Don't allocate memory on the heap for
8139 struct utimbuf times.
8141 * *: some using changes, use iosfwd instead of the real headers.
8143 * src/lyxfont.C use char const * instead of string for the static
8144 strings. Rewrite some functions to use sstream.
8146 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8148 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8151 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8153 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8154 of Geodesy (from Martin Vermeer)
8156 * lib/layouts/svjour.inc: include file for the Springer svjour
8157 class. It can be used to support journals other than JoG.
8159 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8160 Miskiewicz <misiek@pld.org.pl>)
8161 * lib/reLyX/Makefile.am: ditto.
8163 2000-03-27 Juergen Vigna <jug@sad.it>
8165 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8166 also some modifications with operations on selected text.
8168 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8169 problems with clicking on insets (last famous words ;)
8171 * src/insets/insetcommand.C (draw):
8172 (width): Changed to have a bit of space before and after the inset so
8173 that the blinking cursor can be seen (otherwise it was hidden)
8175 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8177 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8178 would not be added to the link list when an installed gettext (not
8179 part of libc) is found.
8181 2000-03-24 Juergen Vigna <jug@sad.it>
8183 * src/insets/insetcollapsable.C (Edit):
8184 * src/mathed/formula.C (InsetButtonRelease):
8185 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8188 * src/BufferView.C (workAreaButtonPress):
8189 (workAreaButtonRelease):
8190 (checkInsetHit): Finally fixed the clicking on insets be handled
8193 * src/insets/insetert.C (Edit): inserted this call so that ERT
8194 insets work always with LaTeX-font
8196 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8198 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8199 caused lyx to startup with no GUI in place, causing in a crash
8200 upon startup when called with arguments.
8202 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8204 * src/FontLoader.C: better initialization of dummyXFontStruct.
8206 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8208 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8209 for linuxdoc and docbook import and export format options.
8211 * lib/lyxrc.example Example of default values for the previous flags.
8213 * src/lyx_cb.C Use those flags instead of the hardwired values for
8214 linuxdoc and docbook export.
8216 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8219 * src/menus.C Added menus entries for the new import/exports formats.
8221 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8223 * src/lyxrc.*: Added support for running without Gui
8226 * src/FontLoader.C: sensible defaults if no fonts are needed
8228 * src/lyx_cb.C: New function ShowMessage (writes either to the
8229 minibuffer or cout in case of no gui
8230 New function AskOverwrite for common stuff
8231 Consequently various changes to call these functions
8233 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8234 wild guess at sensible screen resolution when having no gui
8236 * src/lyxfont.C: no gui, no fonts... set some defaults
8238 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8240 * src/LColor.C: made the command inset background a bit lighter.
8242 2000-03-20 Hartmut Goebel <goebel@noris.net>
8244 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8245 stdstruct.inc. Koma-Script added some title elements which
8246 otherwise have been listed below "bibliography". This split allows
8247 adding title elements to where they belong.
8249 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8250 define the additional title elements and then include
8253 * many other layout files: changed to include stdtitle.inc just
8254 before stdstruct.inc.
8256 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8258 * src/buffer.C: (save) Added the option to store all backup files
8259 in a single directory
8261 * src/lyxrc.[Ch]: Added variable \backupdir_path
8263 * lib/lyxrc.example: Added descriptions of recently added variables
8265 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8266 bibtex inset, not closing the bibtex popup when deleting the inset)
8268 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8270 * src/lyx_cb.C: add a couple using directives.
8272 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8273 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8274 import based on the filename.
8276 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8277 file would be imported at start, if the filename where of a sgml file.
8279 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8281 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8283 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8284 * src/lyxfont.h Replaced the member variable bits.direction by the
8285 member variable lang. Made many changes in other files.
8286 This allows having a multi-lingual document
8288 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8289 that change the current language to <l>.
8290 Removed the command "font-rtl"
8292 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8293 format for Hebrew documents)
8295 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8296 When auto_mathmode is "true", pressing a digit key in normal mode
8297 will cause entering into mathmode.
8298 If auto_mathmode is "rtl" then this behavior will be active only
8299 when writing right-to-left text.
8301 * src/text2.C (InsertStringA) The string is inserted using the
8304 * src/paragraph.C (GetEndLabel) Gives a correct result for
8305 footnote paragraphs.
8307 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8309 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8311 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8312 front of PasteParagraph. Never insert a ' '. This should at least
8313 fix some cause for the segfaults that we have been experiencing,
8314 it also fixes backspace behaviour slightly. (Phu!)
8316 * src/support/lstrings.C (compare_no_case): some change to make it
8317 compile with gcc 2.95.2 and stdlibc++-v3
8319 * src/text2.C (MeltFootnoteEnvironment): change type o
8320 first_footnote_par_is_not_empty to bool.
8322 * src/lyxparagraph.h: make text private. Changes in other files
8324 (fitToSize): new function
8325 (setContentsFromPar): new function
8326 (clearContents): new function
8327 (SetChar): new function
8329 * src/paragraph.C (readSimpleWholeFile): deleted.
8331 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8332 the file, just use a simple string instead. Also read the file in
8333 a more maintainable manner.
8335 * src/text2.C (InsertStringA): deleted.
8336 (InsertStringB): deleted.
8338 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8340 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8341 RedoParagraphs from the doublespace handling part, just set status
8342 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8343 done, but perhaps not like this.)
8345 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8347 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8348 character when inserting an inset.
8350 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8352 * src/bufferparams.C (readLanguage): now takes "default" into
8355 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8356 also initialize the toplevel_keymap with the default bindings from
8359 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8361 * all files using lyxrc: have lyxrc as a real variable and not a
8362 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8365 * src/lyxrc.C: remove double call to defaultKeyBindings
8367 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8368 toolbar defauls using lyxlex. Remove enums, structs, functions
8371 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8372 toolbar defaults. Also store default keybindings in a map.
8374 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8375 storing the toolbar defaults without any xforms dependencies.
8377 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8378 applied. Changed to use iterators.
8380 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8382 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8383 systems that don't have LINGUAS set to begin with.
8385 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8387 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8388 the list by Dekel Tsur.
8390 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8392 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8393 * src/insets/form_graphics.C: ditto.
8395 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8397 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8399 * src/bufferparams.C (readLanguage): use the new language map
8401 * src/intl.C (InitKeyMapper): use the new language map
8403 * src/lyx_gui.C (create_forms): use the new language map
8405 * src/language.[Ch]: New files. Used for holding the information
8406 about each language. Now! Use this new language map enhance it and
8407 make it really usable for our needs.
8409 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8411 * screen.C (ShowCursor): Removed duplicate code.
8412 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8413 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8415 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8418 * src/text.C Added TransformChar method. Used for rendering Arabic
8419 text correctly (change the glyphs of the letter according to the
8420 position in the word)
8425 * src/lyxrc.C Added lyxrc command {language_command_begin,
8426 language_command_end,language_command_ltr,language_command_rtl,
8427 language_package} which allows the use of either arabtex or Omega
8430 * src/lyx_gui.C (init)
8432 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8433 to use encoding for menu fonts which is different than the encoding
8436 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8437 do not load the babel package.
8438 To write an English document with Hebrew/Arabic, change the document
8439 language to "english".
8441 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8442 (alphaCounter): changed to return char
8443 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8445 * lib/lyxrc.example Added examples for Hebrew/Arabic
8448 * src/layout.C Added layout command endlabeltype
8450 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8452 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8454 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * src/mathed/math_delim.C (search_deco): return a
8457 math_deco_struct* instead of index.
8459 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8461 * All files with a USE_OSTREAM_ONLY within: removed all code that
8462 was unused when USE_OSTREAM_ONLY is defined.
8464 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8465 of any less. Removed header and using.
8467 * src/text.C (GetVisibleRow): draw the string "Page Break
8468 (top/bottom)" on screen when drawing a pagebreak line.
8470 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8472 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8474 * src/mathed/math_macro.C (draw): do some cast magic.
8477 * src/mathed/math_defs.h: change byte* argument to byte const*.
8479 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8481 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8482 know it is right to return InsetFoot* too, but cxx does not like
8485 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8487 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8489 * src/mathed/math_delim.C: change == to proper assignment.
8491 2000-03-09 Juergen Vigna <jug@sad.it>
8493 * src/insets/insettext.C (setPos): fixed various cursor positioning
8494 problems (via mouse and cursor-keys)
8495 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8496 inset (still a small display problem but it works ;)
8498 * src/insets/insetcollapsable.C (draw): added button_top_y and
8499 button_bottom_y to have correct values for clicking on the inset.
8501 * src/support/lyxalgo.h: commented out 'using std::less'
8503 2000-03-08 Juergen Vigna <jug@sad.it>
8505 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8506 Button-Release event closes as it is alos the Release-Event
8509 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8511 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8513 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8514 can add multiple spaces in Scrap (literate programming) styles...
8515 which, by the way, is how I got hooked on LyX to begin with.
8517 * src/mathed/formula.C (Write): Added dummy variable to an
8518 inset::Latex() call.
8519 (Latex): Add free_spacing boolean to inset::Latex()
8521 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8523 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8524 virtual function to include the free_spacing boolean from
8525 the containing paragraph's style.
8527 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8528 Added free_spacing boolean arg to match inset.h
8530 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8531 Added free_spacing boolean arg to match inset.h
8533 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8534 Added free_spacing boolean and made sure that if in a free_spacing
8535 paragraph, that we output normal space if there is a protected space.
8537 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8538 Added free_spacing boolean arg to match inset.h
8540 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8541 Added free_spacing boolean arg to match inset.h
8543 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8544 Added free_spacing boolean arg to match inset.h
8546 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8547 Added free_spacing boolean arg to match inset.h
8549 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8550 Added free_spacing boolean arg to match inset.h
8552 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8553 free_spacing boolean arg to match inset.h
8555 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8556 Added free_spacing boolean arg to match inset.h
8558 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8559 Added free_spacing boolean arg to match inset.h
8561 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8562 Added free_spacing boolean arg to match inset.h
8564 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8565 Added free_spacing boolean arg to match inset.h
8567 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8568 Added free_spacing boolean arg to match inset.h
8570 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8571 free_spacing boolean arg to match inset.h
8573 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8574 free_spacing boolean arg to match inset.h
8576 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8577 ignore free_spacing paragraphs. The user's spaces are left
8580 * src/text.C (InsertChar): Fixed the free_spacing layout
8581 attribute behavior. Now, if free_spacing is set, you can
8582 add multiple spaces in a paragraph with impunity (and they
8583 get output verbatim).
8584 (SelectSelectedWord): Added dummy argument to inset::Latex()
8587 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8590 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8591 paragraph layouts now only input a simple space instead.
8592 Special character insets don't make any sense in free-spacing
8595 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8596 hard-spaces in the *input* file to simple spaces if the layout
8597 is free-spacing. This converts old files which had to have
8598 hard-spaces in free-spacing layouts where a simple space was
8600 (writeFileAscii): Added free_spacing check to pass to the newly
8601 reworked inset::Latex(...) methods. The inset::Latex() code
8602 ensures that hard-spaces in free-spacing paragraphs get output
8603 as spaces (rather than "~").
8605 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * src/mathed/math_delim.C (draw): draw the empty placeholder
8608 delims with a onoffdash line.
8609 (struct math_deco_compare): struct that holds the "functors" used
8610 for the sort and the binary search in math_deco_table.
8611 (class init_deco_table): class used for initial sort of the
8613 (search_deco): use lower_bound to do a binary search in the
8616 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8618 * src/lyxrc.C: a small secret thingie...
8620 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8621 and to not flush the stream as often as it used to.
8623 * src/support/lyxalgo.h: new file
8624 (sorted): template function used for checking if a sequence is
8625 sorted or not. Two versions with and without user supplied
8626 compare. Uses same compare as std::sort.
8628 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8629 it and give warning on lyxerr.
8631 (struct compare_tags): struct with function operators used for
8632 checking if sorted, sorting and lower_bound.
8633 (search_kw): use lower_bound instead of manually implemented
8636 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8638 * src/insets/insetcollapsable.h: fix Clone() declaration.
8639 * src/insets/insetfoot.h: ditto.
8641 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8643 2000-03-08 Juergen Vigna <jug@sad.it>
8645 * src/insets/lyxinset.h: added owner call which tells us if
8646 this inset is inside another inset. Changed also the return-type
8647 of Editable to an enum so it tells clearer what the return-value is.
8649 * src/insets/insettext.C (computeTextRows): fixed computing of
8650 textinsets which split automatically on more rows.
8652 * src/insets/insetert.[Ch]: changed this to be of BaseType
8655 * src/insets/insetfoot.[Ch]: added footnote inset
8657 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8658 collapsable insets (like footnote, ert, ...)
8660 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8662 * src/lyxdraw.h: remvoe file
8664 * src/lyxdraw.C: remove file
8666 * src/insets/insettext.C: added <algorithm>.
8668 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8670 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8671 (matrix_cb): case MM_OK use string stream
8673 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8676 * src/mathed/math_macro.C (draw): use string stream
8677 (Metrics): use string stream
8679 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8680 directly to the ostream.
8682 * src/vspace.C (asString): use string stream.
8683 (asString): use string stream
8684 (asLatexString): use string stream
8686 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8687 setting Spacing::Other.
8689 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8690 sprintf when creating the stretch vale.
8692 * src/text2.C (alphaCounter): changed to return a string and to
8693 not use a static variable internally. Also fixed a one-off bug.
8694 (SetCounter): changed the drawing of the labels to use string
8695 streams instead of sprintf.
8697 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8698 manipulator to use a scheme that does not require library support.
8699 This is also the way it is done in the new GNU libstdc++. Should
8700 work with DEC cxx now.
8702 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8704 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8705 end. This fixes a bug.
8707 * src/mathed (all files concerned with file writing): apply the
8708 USE_OSTREAM_ONLY changes to mathed too.
8710 * src/support/DebugStream.h: make the constructor explicit.
8712 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8713 count and ostream squashed.
8715 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8717 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8719 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8720 ostringstream uses STL strings, and we might not.
8722 * src/insets/insetspecialchar.C: add using directive.
8723 * src/insets/insettext.C: ditto.
8725 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8727 * lib/layouts/seminar.layout: feeble attempt at a layout for
8728 seminar.cls, far from completet and could really use some looking
8729 at from people used to write layout files.
8731 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8732 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8733 a lot nicer and works nicely with ostreams.
8735 * src/mathed/formula.C (draw): a slightly different solution that
8736 the one posted to the list, but I think this one works too. (font
8737 size wrong in headers.)
8739 * src/insets/insettext.C (computeTextRows): some fiddling on
8740 Jürgens turf, added some comments that he should read.
8742 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8743 used and it gave compiler warnings.
8744 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8747 * src/lyx_gui.C (create_forms): do the right thing when
8748 show_banner is true/false.
8750 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8751 show_banner is false.
8753 * most file writing files: Now use iostreams to do almost all of
8754 the writing. Also instead of passing string &, we now use
8755 stringstreams. mathed output is still not adapted to iostreams.
8756 This change can be turned off by commenting out all the occurences
8757 of the "#define USE_OSTREAM_ONLY 1" lines.
8759 * src/WorkArea.C (createPixmap): don't output debug messages.
8760 (WorkArea): don't output debug messages.
8762 * lib/lyxrc.example: added a comment about the new variable
8765 * development/Code_rules/Rules: Added some more commente about how
8766 to build class interfaces and on how better encapsulation can be
8769 2000-03-03 Juergen Vigna <jug@sad.it>
8771 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8772 automatically with the width of the LyX-Window
8774 * src/insets/insettext.C (computeTextRows): fixed update bug in
8775 displaying text-insets (scrollvalues where not initialized!)
8777 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8779 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8780 id in the check of the result from lower_bound is not enough since
8781 lower_bound can return last too, and then res->id will not be a
8784 * all insets and some code that use them: I have conditionalized
8785 removed the Latex(string & out, ...) this means that only the
8786 Latex(ostream &, ...) will be used. This is a work in progress to
8787 move towards using streams for all output of files.
8789 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8792 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8794 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8795 routine (this fixes bug where greek letters were surrounded by too
8798 * src/support/filetools.C (findtexfile): change a bit the search
8799 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8800 no longer passed to kpsewhich, we may have to change that later.
8802 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8803 warning options to avoid problems with X header files (from Angus
8805 * acinclude.m4: regenerated.
8807 2000-03-02 Juergen Vigna <jug@sad.it>
8809 * src/insets/insettext.C (WriteParagraphData): Using the
8810 par->writeFile() function for writing paragraph-data.
8811 (Read): Using buffer->parseSingleLyXformat2Token()-function
8812 for parsing paragraph data!
8814 * src/buffer.C (readLyXformat2): removed all parse data and using
8815 the new parseSingleLyXformat2Token()-function.
8816 (parseSingleLyXformat2Token): added this function to parse (read)
8817 lyx-file-format (this is called also from text-insets now!)
8819 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8821 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8824 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8825 directly instead of going through a func. One very bad thing: a
8826 static LyXFindReplace, but I don't know where to place it.
8828 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8829 string instead of char[]. Also changed to static.
8830 (GetSelectionOrWordAtCursor): changed to static inline
8831 (SetSelectionOverLenChars): ditto.
8833 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8834 current_view and global variables. both classes has changed names
8835 and LyXFindReplace is not inherited from SearchForm.
8837 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8838 fl_form_search form.
8840 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8842 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8844 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8845 bound (from Kayvan).
8847 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8849 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8851 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8853 * some things that I should comment but the local pub says head to
8856 * comment out all code that belongs to the Roff code for Ascii
8857 export of tables. (this is unused)
8859 * src/LyXView.C: use correct type for global variable
8860 current_layout. (LyXTextClass::size_type)
8862 * some code to get the new insetgraphics closer to working I'd be
8863 grateful for any help.
8865 * src/BufferView2.C (insertInset): use the return type of
8866 NumberOfLayout properly. (also changes in other files)
8868 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8869 this as a test. I want to know what breaks because of this.
8871 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8873 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8875 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8876 to use a \makebox in the label, this allows proper justification
8877 with out using protected spaces or multiple hfills. Now it is
8878 "label" for left justified, "\hfill label\hfill" for center, and
8879 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8880 should be changed accordingly.
8882 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8884 * src/lyxtext.h: change SetLayout() to take a
8885 LyXTextClass::size_type instead of a char (when there is more than
8886 127 layouts in a class); also change type of copylayouttype.
8887 * src/text2.C (SetLayout): ditto.
8888 * src/LyXView.C (updateLayoutChoice): ditto.
8890 * src/LaTeX.C (scanLogFile): errors where the line number was not
8891 given just after the '!'-line were ignored (from Dekel Tsur).
8893 * lib/lyxrc.example: fix description of \date_insert_format
8895 * lib/layouts/llncs.layout: new layout, contributed by Martin
8898 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8900 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8901 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8902 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8903 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8904 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8905 paragraph.C, text.C, text2.C)
8907 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8909 * src/insets/insettext.C (LocalDispatch): remove extra break
8912 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8913 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8915 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8916 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8918 * src/insets/insetbib.h: move InsetBibkey::Holder and
8919 InsetCitation::Holder in public space.
8921 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8923 * src/insets/insettext.h: small change to get the new files from
8924 Juergen to compile (use "string", not "class string").
8926 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8927 const & as parameter to LocalDispatch, use LyXFont const & as
8928 paramter to some other func. This also had impacto on lyxinsets.h
8929 and the two mathed insets.
8931 2000-02-24 Juergen Vigna <jug@sad.it>
8934 * src/commandtags.h:
8936 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8940 * src/BufferView2.C: added/updated code for various inset-functions
8942 * src/insets/insetert.[Ch]: added implementation of InsetERT
8944 * src/insets/insettext.[Ch]: added implementation of InsetText
8946 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8947 (draw): added preliminary code for inset scrolling not finshed yet
8949 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8950 as it is in lyxfunc.C now
8952 * src/insets/lyxinset.h: Added functions for text-insets
8954 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8956 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8957 BufferView and reimplement the list as a queue put inside its own
8960 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8962 * several files: use the new interface to the "updateinsetlist"
8964 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8966 (work_area_handler): call BufferView::trippleClick on trippleclick.
8968 * src/BufferView.C (doubleClick): new function, selects word on
8970 (trippleClick): new function, selects line on trippleclick.
8972 2000-02-22 Allan Rae <rae@lyx.org>
8974 * lib/bind/xemacs.bind: buffer-previous not supported
8976 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8978 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8981 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * src/bufferlist.C: get rid of current_view from this file
8985 * src/spellchecker.C: get rid of current_view from this file
8987 * src/vspace.C: get rid of current_view from this file
8988 (inPixels): added BufferView parameter for this func
8989 (asLatexCommand): added a BufferParams for this func
8991 * src/text.C src/text2.C: get rid of current_view from these
8994 * src/lyxfont.C (getFontDirection): move this function here from
8997 * src/bufferparams.C (getDocumentDirection): move this function
9000 * src/paragraph.C (getParDirection): move this function here from
9002 (getLetterDirection): ditto
9004 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9006 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9007 resize due to wrong pixmap beeing used. Also took the opurtunity
9008 to make the LyXScreen stateless on regard to WorkArea and some
9009 general cleanup in the same files.
9011 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9013 * src/Makefile.am: add missing direction.h
9015 * src/PainterBase.h: made the width functions const.
9017 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9020 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9022 * src/insets/insetlatexaccent.C (draw): make the accents draw
9023 better, at present this will only work well with iso8859-1.
9025 * several files: remove the old drawing code, now we use the new
9028 * several files: remove support for mono_video, reverse_video and
9031 2000-02-17 Juergen Vigna <jug@sad.it>
9033 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9034 int ** as we have to return the pointer, otherwise we have only
9035 NULL pointers in the returning function.
9037 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/LaTeX.C (operator()): quote file name when running latex.
9041 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9043 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9044 (bubble tip), this removes our special handling of this.
9046 * Remove all code that is unused now that we have the new
9047 workarea. (Code that are not active when NEW_WA is defined.)
9049 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9051 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9053 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9054 nonexisting layout; correctly redirect obsoleted layouts.
9056 * lib/lyxrc.example: document \view_dvi_paper_option
9058 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9061 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9062 (PreviewDVI): handle the view_dvi_paper_option variable.
9063 [Both from Roland Krause]
9065 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9067 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9068 char const *, int, LyXFont)
9069 (text(int, int, string, LyXFont)): ditto
9071 * src/text.C (InsertCharInTable): attempt to fix the double-space
9072 feature in tables too.
9073 (BackspaceInTable): ditto.
9074 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9076 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9078 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9080 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9081 newly found text in textcache to this.
9082 (buffer): set the owner of the text put into the textcache to 0
9084 * src/insets/figinset.C (draw): fixed the drawing of figures with
9087 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9088 drawing of mathframe, hfills, protected space, table lines. I have
9089 now no outstanding drawing problems with the new Painter code.
9091 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9093 * src/PainterBase.C (ellipse, circle): do not specify the default
9096 * src/LColor.h: add using directive.
9098 * src/Painter.[Ch]: change return type of methods from Painter& to
9099 PainterBase&. Add a using directive.
9101 * src/WorkArea.C: wrap xforms callbacks in C functions
9104 * lib/layouts/foils.layout: font fix and simplifications from Carl
9107 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9109 * a lot of files: The Painter, LColor and WorkArea from the old
9110 devel branch has been ported to lyx-devel. Some new files and a
9111 lot of #ifdeffed code. The new workarea is enabled by default, but
9112 if you want to test the new Painter and LColor you have to compile
9113 with USE_PAINTER defined (do this in config.h f.ex.) There are
9114 still some rought edges, and I'd like some help to clear those
9115 out. It looks stable (loads and displays the Userguide very well).
9118 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9120 * src/buffer.C (pop_tag): revert to the previous implementation
9121 (use a global variable for both loops).
9123 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9125 * src/lyxrc.C (LyXRC): change slightly default date format.
9127 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9128 there is an English text with a footnote that starts with a Hebrew
9129 paragraph, or vice versa.
9130 (TeXFootnote): ditto.
9132 * src/text.C (LeftMargin): allow for negative values for
9133 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9136 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9137 for input encoding (cyrillic)
9139 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9141 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9144 * src/toolbar.C (set): ditto
9145 * src/insets/insetbib.C (create_form_citation_form): ditto
9147 * lib/CREDITS: added Dekel Tsur.
9149 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9150 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9151 hebrew supports files from Dekel Tsur.
9153 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9154 <tzafrir@technion.ac.il>
9156 * src/lyxrc.C: put \date_insert_format at the right place.
9158 * src/buffer.C (makeLaTeXFile): fix the handling of
9159 BufferParams::sides when writing out latex files.
9161 * src/BufferView2.C: add a "using" directive.
9163 * src/support/lyxsum.C (sum): when we use lyxstring,
9164 ostringstream::str needs an additional .c_str().
9166 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9168 * src/support/filetools.C (ChangeExtension): patch from Etienne
9171 * src/TextCache.C (show): remove const_cast and make second
9172 parameter non-const LyXText *.
9174 * src/TextCache.h: use non const LyXText in show.
9176 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9179 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/support/lyxsum.C: rework to be more flexible.
9183 * several places: don't check if a pointer is 0 if you are going
9186 * src/text.C: remove some dead code.
9188 * src/insets/figinset.C: remove some dead code
9190 * src/buffer.C: move the BufferView funcs to BufferView2.C
9191 remove all support for insetlatexdel
9192 remove support for oldpapersize stuff
9193 made some member funcs const
9195 * src/kbmap.C: use a std::list to store the bindings in.
9197 * src/BufferView2.C: new file
9199 * src/kbsequence.[Ch]: new files
9201 * src/LyXAction.C + others: remove all trace of buffer-previous
9203 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9204 only have one copy in the binary of this table.
9206 * hebrew patch: moved some functions from LyXText to more
9207 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9209 * several files: remove support for XForms older than 0.88
9211 remove some #if 0 #endif code
9213 * src/TextCache.[Ch]: new file. Holds the textcache.
9215 * src/BufferView.C: changes to use the new TextCache interface.
9216 (waitForX): remove the now unused code.
9218 * src/BackStack.h: remove some commented code
9220 * lib/bind/emacs.bind: remove binding for buffer-previous
9222 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9224 * applied the hebrew patch.
9226 * src/lyxrow.h: make sure that all Row variables are initialized.
9228 * src/text2.C (TextHandleUndo): comment out a delete, this might
9229 introduce a memory leak, but should also help us to not try to
9230 read freed memory. We need to look at this one.
9232 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9233 (LyXParagraph): initalize footnotekind.
9235 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9236 forgot this when applying the patch. Please heed the warnings.
9238 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9239 (aka. reformat problem)
9241 * src/bufferlist.C (exists): made const, and use const_iterator
9242 (isLoaded): new func.
9243 (release): use std::find to find the correct buffer.
9245 * src/bufferlist.h: made getState a const func.
9246 made empty a const func.
9247 made exists a const func.
9250 2000-02-01 Juergen Vigna <jug@sad.it>
9252 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9254 * po/it.po: updated a bit the italian po file and also changed the
9255 'file nuovo' for newfile to 'filenuovo' without a space, this did
9258 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9259 for the new insert_date command.
9261 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9262 from jdblair, to insert a date into the current text conforming to
9263 a strftime format (for now only considering the locale-set and not
9264 the document-language).
9266 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9268 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9269 Bounds Read error seen by purify. The problem was that islower is
9270 a macros which takes an unsigned char and uses it as an index for
9271 in array of characters properties (and is thus subject to the
9275 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9276 correctly the paper sides radio buttons.
9277 (UpdateDocumentButtons): ditto.
9279 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9281 * src/kbmap.C (getsym + others): change to return unsigned int,
9282 returning a long can give problems on 64 bit systems. (I assume
9283 that int is 32bit on 64bit systems)
9285 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9287 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9288 LyXLookupString to be zero-terminated. Really fixes problems seen
9291 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9293 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9294 write a (char*)0 to the lyxerr stream.
9296 * src/lastfiles.C: move algorithm before the using statemets.
9298 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9300 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9301 complains otherwise).
9302 * src/table.C: ditto
9304 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9307 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9308 that I removed earlier... It is really needed.
9310 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9312 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9314 * INSTALL: update xforms home page URL.
9316 * lib/configure.m4: fix a bug with unreadable layout files.
9318 * src/table.C (calculate_width_of_column): add "using std::max"
9321 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9323 * several files: marked several lines with "DEL LINE", this is
9324 lines that can be deleted without changing anything.
9325 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9326 checks this anyway */
9329 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9331 * src/DepTable.C (update): add a "+" at the end when the checksum
9332 is different. (debugging string only)
9334 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9335 the next inset to not be displayed. This should also fix the list
9336 of labels in the "Insert Crossreference" dialog.
9338 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9340 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9341 when regex was not found.
9343 * src/support/lstrings.C (lowercase): use handcoded transform always.
9346 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9347 old_cursor.par->prev could be 0.
9349 * several files: changed post inc/dec to pre inc/dec
9351 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9352 write the lastfiles to file.
9354 * src/BufferView.C (buffer): only show TextCache info when debugging
9356 (resizeCurrentBuffer): ditto
9357 (workAreaExpose): ditto
9359 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9361 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9363 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9364 a bit better by removing the special case for \i and \j.
9366 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9368 * src/lyx_main.C (easyParse): remove test for bad comand line
9369 options, since this broke all xforms-related parsing.
9371 * src/kbmap.C (getsym): set return type to unsigned long, as
9372 declared in header. On an alpha, long is _not_ the same as int.
9374 * src/support/LOstream.h: add a "using std::flush;"
9376 * src/insets/figinset.C: ditto.
9378 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * src/bufferlist.C (write): use blinding fast file copy instead of
9381 "a char at a time", now we are doing it the C++ way.
9383 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9384 std::list<int> instead.
9385 (addpidwait): reflect move to std::list<int>
9386 (sigchldchecker): ditto
9388 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9391 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9392 that obviously was wrong...
9394 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9395 c, this avoids warnings with purify and islower.
9397 * src/insets/figinset.C: rename struct queue to struct
9398 queue_element and rewrite to use a std::queue. gsqueue is now a
9399 std::queue<queue_element>
9400 (runqueue): reflect move to std::queue
9403 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9404 we would get "1" "0" instead of "true" "false. Also make the tostr
9407 2000-01-21 Juergen Vigna <jug@sad.it>
9409 * src/buffer.C (writeFileAscii): Disabled code for special groff
9410 handling of tabulars till I fix this in table.C
9412 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9414 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9416 * src/support/lyxlib.h: ditto.
9418 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9420 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9421 and 'j' look better. This might fix the "macron" bug that has been
9424 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9425 functions as one template function. Delete the old versions.
9427 * src/support/lyxsum.C: move using std::ifstream inside
9430 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9433 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9435 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9437 * src/insets/figinset.C (InitFigures): use new instead of malloc
9438 to allocate memory for figures and bitmaps.
9439 (DoneFigures): use delete[] instead of free to deallocate memory
9440 for figures and bitmaps.
9441 (runqueue): use new to allocate
9442 (getfigdata): use new/delete[] instead of malloc/free
9443 (RegisterFigure): ditto
9445 * some files: moved some declarations closer to first use, small
9446 whitespace changes use preincrement instead of postincrement where
9447 it does not make a difference.
9449 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9450 step on the way to use stl::containers for key maps.
9452 * src/bufferlist.h: add a typedef for const_iterator and const
9453 versions of begin and end.
9455 * src/bufferlist.[Ch]: change name of member variable _state to
9456 state_. (avoid reserved names)
9458 (getFileNames): returns the filenames of the buffers in a vector.
9460 * configure.in (ALL_LINGUAS): added ro
9462 * src/support/putenv.C: new file
9464 * src/support/mkdir.C: new file
9466 2000-01-20 Allan Rae <rae@lyx.org>
9468 * lib/layouts/IEEEtran.layout: Added several theorem environments
9470 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9471 couple of minor additions.
9473 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9474 (except for those in footnotes of course)
9476 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9478 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9480 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9481 std::sort and std::lower_bound instead of qsort and handwritten
9483 (struct compara): struct that holds the functors used by std::sort
9484 and std::lower_bound in MathedLookupBOP.
9486 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9488 * src/support/LAssert.h: do not do partial specialization. We do
9491 * src/support/lyxlib.h: note that lyx::getUserName() and
9492 lyx::date() are not in use right now. Should these be suppressed?
9494 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9495 (makeLinuxDocFile): do not put date and user name in linuxdoc
9498 * src/support/lyxlib.h (kill): change first argument to long int,
9499 since that's what solaris uses.
9501 * src/support/kill.C (kill): fix declaration to match prototype.
9503 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9504 actually check whether namespaces are supported. This is not what
9507 * src/support/lyxsum.C: add a using directive.
9509 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * src/support/kill.C: if we have namespace support we don't have
9512 to include lyxlib.h.
9514 * src/support/lyxlib.h: use namespace lyx if supported.
9516 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9518 * src/support/date.C: new file
9520 * src/support/chdir.C: new file
9522 * src/support/getUserName.C: new file
9524 * src/support/getcwd.C: new file
9526 * src/support/abort.C: new file
9528 * src/support/kill.C: new file
9530 * src/support/lyxlib.h: moved all the functions in this file
9531 insede struct lyx. Added also kill and abort to this struct. This
9532 is a way to avoid the "kill is not defined in <csignal>", we make
9533 C++ wrappers for functions that are not ANSI C or ANSI C++.
9535 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9536 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9537 lyx it has been renamed to sum.
9539 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9541 * src/text.C: add using directives for std::min and std::max.
9543 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9545 * src/texrow.C (getIdFromRow): actually return something useful in
9546 id and pos. Hopefully fixes the bug with positionning of errorbox
9549 * src/lyx_main.C (easyParse): output an error and exit if an
9550 incorrect command line option has been given.
9552 * src/spellchecker.C (ispell_check_word): document a memory leak.
9554 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9555 where a "struct utimbuf" is allocated with "new" and deleted with
9558 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9560 * src/text2.C (CutSelection): don't delete double spaces.
9561 (PasteSelection): ditto
9562 (CopySelection): ditto
9564 * src/text.C (Backspace): don't delete double spaces.
9566 * src/lyxlex.C (next): fix a bug that were only present with
9567 conformant std::istream::get to read comment lines, use
9568 std::istream::getline instead. This seems to fix the problem.
9570 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9572 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9573 allowed to insert space before space" editing problem. Please read
9574 commends at the beginning of the function. Comments about usage
9577 * src/text.C (InsertChar): fix for the "not allowed to insert
9578 space before space" editing problem.
9580 * src/text2.C (DeleteEmptyParagraphMechanism): when
9581 IsEmptyTableRow can only return false this last "else if" will
9582 always be a no-op. Commented out.
9584 * src/text.C (RedoParagraph): As far as I can understand tmp
9585 cursor is not really needed.
9587 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9588 present it could only return false anyway.
9589 (several functions): Did something not so smart...added a const
9590 specifier on a lot of methods.
9592 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9593 and add a tmp->text.resize. The LyXParagraph constructor does the
9595 (BreakParagraphConservative): ditto
9597 * src/support/path.h (Path): add a define so that the wrong usage
9598 "Path("/tmp") will be flagged as a compilation error:
9599 "`unnamed_Path' undeclared (first use this function)"
9601 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9603 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9604 which was bogus for several reasons.
9606 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9610 * autogen.sh: do not use "type -path" (what's that anyway?).
9612 * src/support/filetools.C (findtexfile): remove extraneous space
9613 which caused a kpsewhich warning (at least with kpathsea version
9616 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9618 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9620 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9622 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9624 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9626 * src/paragraph.C (BreakParagraph): do not reserve space on text
9627 if we don't need to (otherwise, if pos_end < pos, we end up
9628 reserving huge amounts of memory due to bad unsigned karma).
9629 (BreakParagraphConservative): ditto, although I have not seen
9630 evidence the bug can happen here.
9632 * src/lyxparagraph.h: add a using std::list.
9634 2000-01-11 Juergen Vigna <jug@sad.it>
9636 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9639 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9641 * src/vc-backend.C (doVCCommand): change to be static and take one
9642 more parameter: the path to chdir too be fore executing the command.
9643 (retrive): new function equiv to "co -r"
9645 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9646 file_not_found_hook is true.
9648 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9650 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9651 if a file is readwrite,readonly...anything else.
9653 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9655 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9656 (CreatePostscript): name change from MenuRunDVIPS (or something)
9657 (PreviewPostscript): name change from MenuPreviewPS
9658 (PreviewDVI): name change from MenuPreviewDVI
9660 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9661 \view_pdf_command., \pdf_to_ps_command
9663 * lib/configure.m4: added search for PDF viewer, and search for
9664 PDF to PS converter.
9665 (lyxrc.defaults output): add \pdflatex_command,
9666 \view_pdf_command and \pdf_to_ps_command.
9668 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9670 * src/bufferlist.C (write): we don't use blocksize for anything so
9673 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9675 * src/support/block.h: disable operator T* (), since it causes
9676 problems with both compilers I tried. See comments in the file.
9678 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9681 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9682 variable LYX_DIR_10x to LYX_DIR_11x.
9684 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9686 * INSTALL: document --with-lyxname.
9689 * configure.in: new configure flag --with-lyxname which allows to
9690 choose the name under which lyx is installed. Default is "lyx", of
9691 course. It used to be possible to do this with --program-suffix,
9692 but the later has in fact a different meaning for autoconf.
9694 * src/support/lstrings.h (lstrchr): reformat a bit.
9696 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9697 * src/mathed/math_defs.h: ditto.
9699 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9701 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9702 true, decides if we create a backup file or not when saving. New
9703 tag and variable \pdf_mode, defaults to false. New tag and
9704 variable \pdflatex_command, defaults to pdflatex. New tag and
9705 variable \view_pdf_command, defaults to xpdf. New tag and variable
9706 \pdf_to_ps_command, defaults to pdf2ps.
9708 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9710 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9711 does not have a BufferView.
9712 (unlockInset): ditto + don't access the_locking_inset if the
9713 buffer does not have a BufferView.
9715 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9716 certain circumstances so that we don't continue a keyboard
9717 operation long after the key was released. Try f.ex. to load a
9718 large document, press PageDown for some seconds and then release
9719 it. Before this change the document would contine to scroll for
9720 some time, with this change it stops imidiatly.
9722 * src/support/block.h: don't allocate more space than needed. As
9723 long as we don't try to write to the arr[x] in a array_type arr[x]
9724 it is perfectly ok. (if you write to it you might segfault).
9725 added operator value_type*() so that is possible to pass the array
9726 to functions expecting a C-pointer.
9728 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9731 * intl/*: updated to gettext 0.10.35, tried to add our own
9732 required modifications. Please verify.
9734 * po/*: updated to gettext 0.10.35, tried to add our own required
9735 modifications. Please verify.
9737 * src/support/lstrings.C (tostr): go at fixing the problem with
9738 cxx and stringstream. When stringstream is used return
9739 oss.str().c_str() so that problems with lyxstring and basic_string
9740 are avoided. Note that the best solution would be for cxx to use
9741 basic_string all the way, but it is not conformant yet. (it seems)
9743 * src/lyx_cb.C + other files: moved several global functions to
9744 class BufferView, some have been moved to BufferView.[Ch] others
9745 are still located in lyx_cb.C. Code changes because of this. (part
9746 of "get rid of current_view project".)
9748 * src/buffer.C + other files: moved several Buffer functions to
9749 class BufferView, the functions are still present in buffer.C.
9750 Code changes because of this.
9752 * config/lcmessage.m4: updated to most recent. used when creating
9755 * config/progtest.m4: updated to most recent. used when creating
9758 * config/gettext.m4: updated to most recent. applied patch for
9761 * config/gettext.m4.patch: new file that shows what changes we
9762 have done to the local copy of gettext.m4.
9764 * config/libtool.m4: new file, used in creation of acinclude.m4
9766 * config/lyxinclude.m4: new file, this is the lyx created m4
9767 macros, used in making acinclude.m4.
9769 * autogen.sh: GNU m4 discovered as a separate task not as part of
9770 the lib/configure creation.
9771 Generate acinlucde from files in config. Actually cat
9772 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9773 easier to upgrade .m4 files that really are external.
9775 * src/Spacing.h: moved using std::istringstream to right after
9776 <sstream>. This should fix the problem seen with some compilers.
9778 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9780 * src/lyx_cb.C: began some work to remove the dependency a lot of
9781 functions have on BufferView::text, even if not really needed.
9782 (GetCurrentTextClass): removed this func, it only hid the
9785 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9786 forgot this in last commit.
9788 * src/Bullet.C (bulletEntry): use static char const *[] for the
9789 tables, becuase of this the return arg had to change to string.
9791 (~Bullet): removed unneeded destructor
9793 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9794 (insetSleep): moved from Buffer
9795 (insetWakeup): moved from Buffer
9796 (insetUnlock): moved from Buffer
9798 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9799 from Buffer to BufferView.
9801 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9803 * config/ltmain.sh: updated to version 1.3.4 of libtool
9805 * config/ltconfig: updated to version 1.3.4 of libtool
9807 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9811 Did I get that right?
9813 * src/lyxlex.h: add a "using" directive or two.
9814 * src/Spacing.h: ditto.
9815 * src/insets/figinset.C: ditto.
9816 * src/support/filetools.C: ditto.
9817 * src/support/lstrings.C: ditto.
9818 * src/BufferView.C: ditto.
9819 * src/bufferlist.C: ditto.
9820 * src/lyx_cb.C: ditto.
9821 * src/lyxlex.C: ditto.
9823 * NEWS: add some changes for 1.1.4.
9825 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9827 * src/BufferView.C: first go at a TextCache to speed up switching
9830 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9832 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9833 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9834 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9835 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9838 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9839 members of the struct are correctly initialized to 0 (detected by
9841 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9842 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9844 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9845 pidwait, since it was allocated with "new". This was potentially
9846 very bad. Thanks to Michael Schmitt for running purify for us.
9849 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9851 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9853 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9855 1999-12-30 Allan Rae <rae@lyx.org>
9857 * lib/templates/IEEEtran.lyx: minor change
9859 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9860 src/mathed/formula.C (LocalDispatch): askForText changes
9862 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9863 know when a user has cancelled input. Fixes annoying problems with
9864 inserting labels and version control.
9866 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9868 * src/support/lstrings.C (tostr): rewritten to use strstream and
9871 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9873 * src/support/filetools.C (IsFileWriteable): use fstream to check
9874 (IsDirWriteable): use fileinfo to check
9876 * src/support/filetools.h (FilePtr): whole class deleted
9878 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9880 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9882 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9884 * src/bufferlist.C (write): use ifstream and ofstream instead of
9887 * src/Spacing.h: use istrstream instead of sscanf
9889 * src/mathed/math_defs.h: change first arg to istream from FILE*
9891 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9893 * src/mathed/math_parser.C: have yyis to be an istream
9894 (LexGetArg): use istream (yyis)
9896 (mathed_parse): ditto
9897 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9899 * src/mathed/formula.C (Read): rewritten to use istream
9901 * src/mathed/formulamacro.C (Read): rewritten to use istream
9903 * src/lyxlex.h (~LyXLex): deleted desturctor
9904 (getStream): new function, returns an istream
9905 (getFile): deleted funtion
9906 (IsOK): return is.good();
9908 * src/lyxlex.C (LyXLex): delete file and owns_file
9909 (setFile): open an filebuf and assign that to a istream instead of
9911 (setStream): new function, takes an istream as arg.
9912 (setFile): deleted function
9913 (EatLine): rewritten us use istream instead of FILE*
9917 * src/table.C (LyXTable): use istream instead of FILE*
9918 (Read): rewritten to take an istream instead of FILE*
9920 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9922 * src/buffer.C (Dispatch): remove an extraneous break statement.
9924 * src/support/filetools.C (QuoteName): change to do simple
9925 'quoting'. More work is necessary. Also changed to do nothing
9926 under emx (needs fix too).
9927 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9929 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9930 config.h.in to the AC_DEFINE_UNQUOTED() call.
9931 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9932 needs char * as argument (because Solaris 7 declares it like
9935 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9936 remove definition of BZERO.
9938 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9940 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9941 defined, "lyxregex.h" if not.
9943 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9945 (REGEX): new variable that is set to regex.c lyxregex.h when
9946 AM_CONDITIONAL USE_REGEX is set.
9947 (libsupport_la_SOURCES): add $(REGEX)
9949 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9952 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9955 * configure.in: add call to LYX_REGEX
9957 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9958 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9960 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9962 * lib/bind/fi_menus.bind: new file, from
9963 pauli.virtanen@saunalahti.fi.
9965 * src/buffer.C (getBibkeyList): pass the parameter delim to
9966 InsetInclude::getKeys and InsetBibtex::getKeys.
9968 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9969 is passed to Buffer::getBibkeyList
9971 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9972 instead of the hardcoded comma.
9974 * src/insets/insetbib.C (getKeys): make sure that there are not
9975 leading blanks in bibtex keys. Normal latex does not care, but
9976 harvard.sty seems to dislike blanks at the beginning of citation
9977 keys. In particular, the retturn value of the function is
9979 * INSTALL: make it clear that libstdc++ is needed and that gcc
9980 2.7.x probably does not work.
9982 * src/support/filetools.C (findtexfile): make debug message go to
9984 * src/insets/insetbib.C (getKeys): ditto
9986 * src/debug.C (showTags): make sure that the output is correctly
9989 * configure.in: add a comment for TWO_COLOR_ICON define.
9991 * acconfig.h: remove all the entries that already defined in
9992 configure.in or acinclude.m4.
9994 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9995 to avoid user name, date and copyright.
9997 1999-12-21 Juergen Vigna <jug@sad.it>
9999 * src/table.C (Read): Now read bogus row format informations
10000 if the format is < 5 so that afterwards the table can
10001 be read by lyx but without any format-info. Fixed the
10002 crash we experienced when not doing this.
10004 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10006 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10007 (RedoDrawingOfParagraph): ditto
10008 (RedoParagraphs): ditto
10009 (RemoveTableRow): ditto
10011 * src/text.C (Fill): rename arg paperwidth -> paper_width
10013 * src/buffer.C (insertLyXFile): rename var filename -> fname
10014 (writeFile): rename arg filename -> fname
10015 (writeFileAscii): ditto
10016 (makeLaTeXFile): ditto
10017 (makeLinuxDocFile): ditto
10018 (makeDocBookFile): ditto
10020 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10023 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10025 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10028 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10029 compiled by a C compiler not C++.
10031 * src/layout.h (LyXTextClass): added typedef for const_iterator
10032 (LyXTextClassList): added typedef for const_iterator + member
10033 functions begin and end.
10035 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10036 iterators to fill the choice_class.
10037 (updateLayoutChoice): rewritten to use iterators to fill the
10038 layoutlist in the toolbar.
10040 * src/BufferView.h (BufferView::work_area_width): removed unused
10043 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10045 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10046 (sgmlCloseTag): ditto
10048 * src/support/lstrings.h: return type of countChar changed to
10051 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10052 what version of this func to use. Also made to return unsigned int.
10054 * configure.in: call LYX_STD_COUNT
10056 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10057 conforming std::count.
10059 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10061 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10062 and a subscript would give bad display (patch from Dekel Tsur
10063 <dekel@math.tau.ac.il>).
10065 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10067 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10070 * src/chset.h: add a few 'using' directives
10072 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10073 triggered when no buffer is active
10075 * src/layout.C: removed `break' after `return' in switch(), since
10078 * src/lyx_main.C (init): make sure LyX can be ran in place even
10079 when libtool has done its magic with shared libraries. Fix the
10080 test for the case when the system directory has not been found.
10082 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10083 name for the latex file.
10084 (MenuMakeHTML): ditto
10086 * src/buffer.h: add an optional boolean argument, which is passed
10087 to ChangeExtension.
10089 1999-12-20 Allan Rae <rae@lyx.org>
10091 * lib/templates/IEEEtran.lyx: small correction and update.
10093 * configure.in: Attempted to use LYX_PATH_HEADER
10095 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10097 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10098 input from JMarc. Now use preprocessor to find the header.
10099 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10100 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10101 LYX_STL_STRING_FWD. See comments in file.
10103 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10105 * The global MiniBuffer * minibuffer variable is dead.
10107 * The global FD_form_main * fd_form_main variable is dead.
10109 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10111 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10113 * src/table.h: add the LOstream.h header
10114 * src/debug.h: ditto
10116 * src/LyXAction.h: change the explaination of the ReadOnly
10117 attribute: is indicates that the function _can_ be used.
10119 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10122 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10124 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10130 * src/paragraph.C (GetWord): assert on pos>=0
10133 * src/support/lyxstring.C: condition the use of an invariant on
10135 * src/support/lyxstring.h: ditto
10137 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10138 Use LAssert.h instead of plain assert().
10140 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10142 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10143 * src/support/filetools.C: ditto
10145 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10148 * INSTALL: document the new configure flags
10150 * configure.in: suppress --with-debug; add --enable-assertions
10152 * acinclude.m4: various changes in alignment of help strings.
10154 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10156 * src/kbmap.C: commented out the use of the hash map in kb_map,
10157 beginning of movement to a stl::container.
10159 * several files: removed code that was not in effect when
10160 MOVE_TEXT was defined.
10162 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10163 for escaping should not be used. We can discuss if the string
10164 should be enclosed in f.ex. [] instead of "".
10166 * src/trans_mgr.C (insert): use the new returned value from
10167 encodeString to get deadkeys and keymaps done correctly.
10169 * src/chset.C (encodeString): changed to return a pair, to tell
10170 what to use if we know the string.
10172 * src/lyxscreen.h (fillArc): new function.
10174 * src/FontInfo.C (resize): rewritten to use more std::string like
10175 structore, especially string::replace.
10177 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10180 * configure.in (chmod +x some scripts): remove config/gcc-hack
10182 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10184 * src/buffer.C (writeFile): change once again the top comment in a
10185 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10186 instead of an hardcoded version number.
10187 (makeDocBookFile): ditto
10189 * src/version.h: add new define LYX_DOCVERSION
10191 * po/de.po: update from Pit Sütterlin
10192 * lib/bind/de_menus.bind: ditto.
10194 * src/lyxfunc.C (Dispatch): call MenuExport()
10195 * src/buffer.C (Dispatch): ditto
10197 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10198 LyXFunc::Dispatch().
10199 (MenuExport): new function, moved from
10200 LyXFunc::Dispatch().
10202 * src/trans_mgr.C (insert): small cleanup
10203 * src/chset.C (loadFile): ditto
10205 * lib/kbd/iso8859-1.cdef: add missing backslashes
10207 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10209 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10210 help with placing the manually drawn accents better.
10212 (Draw): x2 and hg changed to float to minimize rounding errors and
10213 help place the accents better.
10215 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10216 unsigned short to char is just wrong...cast the char to unsigned
10217 char instead so that the two values can compare sanely. This
10218 should also make the display of insetlatexaccents better and
10219 perhaps also some other insets.
10221 (lbearing): new function
10224 1999-12-15 Allan Rae <rae@lyx.org>
10226 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10227 header that provides a wrapper around the very annoying SGI STL header
10230 * src/support/lyxstring.C, src/LString.h:
10231 removed old SGI-STL-compatability attempts.
10233 * configure.in: Use LYX_STL_STRING_FWD.
10235 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10236 stl_string_fwd.h is around and try to determine it's location.
10237 Major improvement over previous SGI STL 3.2 compatability.
10238 Three small problems remain with this function due to my zero
10239 knowledge of autoconf. JMarc and lgb see the comments in the code.
10241 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10243 * src/broken_const.h, config/hack-gcc, config/README: removed
10245 * configure.in: remove --with-gcc-hack option; do not call
10248 * INSTALL: remove documentation of --with-broken-const and
10251 * acconfig.h: remove all trace of BROKEN_CONST define
10253 * src/buffer.C (makeDocBookFile): update version number in output
10255 (SimpleDocBookOnePar): fix an assert when trying to a character
10256 access beyond string length
10259 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10261 * po/de.po: fix the Export menu
10263 * lyx.man: update the description of -dbg
10265 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10266 (commandLineHelp): updated
10267 (easyParse): show list of available debug levels if -dbg is passed
10270 * src/Makefile.am: add debug.C
10272 * src/debug.h: moved some code to debug.C
10274 * src/debug.C: new file. Contains code to set and show debug
10277 * src/layout.C: remove 'break' after 'continue' in switch
10278 statements, since these cannot be reached.
10280 1999-12-13 Allan Rae <rae@lyx.org>
10282 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10283 (in_word_set): hash() -> math_hash()
10285 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10287 * acconfig.h: Added a test for whether we are using exceptions in the
10288 current compilation run. If so USING_EXCEPTIONS is defined.
10290 * config.in: Check for existance of stl_string_fwd.h
10291 * src/LString.h: If compiling --with-included-string and SGI's
10292 STL version 3.2 is present (see above test) we need to block their
10293 forward declaration of string and supply a __get_c_string().
10294 However, it turns out this is only necessary if compiling with
10295 exceptions enabled so I've a bit more to add yet.
10297 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10298 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10299 src/support/LRegex.h, src/undo.h:
10300 Shuffle the order of the included files a little to ensure that
10301 LString.h gets included before anything that includes stl_string_fwd.h
10303 * src/support/lyxstring.C: We need to #include LString.h instead of
10304 lyxstring.h to get the necessary definition of __get_c_string.
10305 (__get_c_string): New function. This is defined static just like SGI's
10306 although why they need to do this I'm not sure. Perhaps it should be
10307 in lstrings.C instead.
10309 * lib/templates/IEEEtran.lyx: New template file.
10311 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10313 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10314 * intl/Makefile.in (MKINSTALLDIRS): ditto
10316 * src/LyXAction.C (init): changed to hold the LFUN data in a
10317 automatic array in stead of in callso to newFunc, this speeds up
10318 compilation a lot. Also all the memory used by the array is
10319 returned when the init is completed.
10321 * a lot of files: compiled with -Wold-style-cast, changed most of
10322 the reported offenders to C++ style casts. Did not change the
10323 offenders in C files.
10325 * src/trans.h (Match): change argument type to unsigned int.
10327 * src/support/DebugStream.C: fix some types on the streambufs so
10328 that it works on a conforming implementation.
10330 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10332 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10334 * src/support/lyxstring.C: remove the inline added earlier since
10335 they cause a bunch of unsatisfied symbols when linking with dec
10336 cxx. Cxx likes to have the body of inlines at the place where they
10339 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10340 accessing negative bounds in array. This fixes the crash when
10341 inserting accented characters.
10342 * src/trans.h (Match): ditto
10344 * src/buffer.C (Dispatch): since this is a void, it should not try
10345 to return anything...
10347 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10349 * src/buffer.h: removed the two friends from Buffer. Some changes
10350 because of this. Buffer::getFileName and Buffer::setFileName
10351 renamed to Buffer::fileName() and Buffer::fileName(...).
10353 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10355 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10356 and Buffer::update(short) to BufferView. This move is currently
10357 controlled by a define MOVE_TEXT, this will be removed when all
10358 shows to be ok. This move paves the way for better separation
10359 between buffer contents and buffer view. One side effect is that
10360 the BufferView needs a rebreak when swiching buffers, if we want
10361 to avoid this we can add a cache that holds pointers to LyXText's
10362 that is not currently in use.
10364 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10367 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10369 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10371 * lyx_main.C: new command line option -x (or --execute) and
10372 -e (or --export). Now direct conversion from .lyx to .tex
10373 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10374 Unfortunately, X is still needed and the GUI pops up during the
10377 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10379 * src/Spacing.C: add a using directive to bring stream stuff into
10381 * src/paragraph.C: ditto
10382 * src/buffer.C: ditto
10384 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10385 from Lars' announcement).
10387 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10388 example files from Tino Meinen.
10390 1999-12-06 Allan Rae <rae@lyx.org>
10392 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10394 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10396 * src/support/lyxstring.C: added a lot of inline for no good
10399 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10400 latexWriteEndChanges, they were not used.
10402 * src/layout.h (operator<<): output operator for PageSides
10404 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10406 * some example files: loaded in LyX 1.0.4 and saved again to update
10407 certain constructs (table format)
10409 * a lot of files: did the change to use fstream/iostream for all
10410 writing of files. Done with a close look at Andre Poenitz's patch.
10412 * some files: whitespace changes.
10414 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10416 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10417 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10418 architecture, we provide our own. It is used unconditionnally, but
10419 I do not think this is a performance problem. Thanks to Angus
10420 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10421 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10423 (GetInset): use my_memcpy.
10427 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10428 it is easier to understand, but it uses less TeX-only constructs now.
10430 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10431 elements contain spaces
10433 * lib/configure: regenerated
10435 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10436 elements contain spaces; display the list of programs that are
10439 * autogen.sh: make sure lib/configure is executable
10441 * lib/examples/*: rename the tutorial examples to begin with the
10442 two-letters language code.
10444 * src/lyxfunc.C (getStatus): do not query current font if no
10447 * src/lyx_cb.C (RunScript): use QuoteName
10448 (MenuRunDvips): ditto
10449 (PrintApplyCB): ditto
10451 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10452 around argument, so that it works well with the current shell.
10453 Does not work properly with OS/2 shells currently.
10455 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10456 * src/LyXSendto.C (SendtoApplyCB): ditto
10457 * src/lyxfunc.C (Dispatch): ditto
10458 * src/buffer.C (runLaTeX): ditto
10459 (runLiterate): ditto
10460 (buildProgram): ditto
10462 * src/lyx_cb.C (RunScript): ditto
10463 (MenuMakeLaTeX): ditto
10465 * src/buffer.h (getLatexName): new method
10467 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10469 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10471 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10472 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10473 (create_math_panel): ditto
10475 * src/lyxfunc.C (getStatus): re-activate the code which gets
10476 current font and cursor; add test for export to html.
10478 * src/lyxrc.C (read): remove unreachable break statements; add a
10481 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10483 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10485 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10486 introduced by faulty regex.
10487 * src/buffer.C: ditto
10488 * src/lastfiles.C: ditto
10489 * src/paragraph.C: ditto
10490 * src/table.C: ditto
10491 * src/vspace.C: ditto
10492 * src/insets/figinset.C: ditto
10493 Note: most of these is absolutely harmless, except the one in
10494 src/mathed formula.C.
10496 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10498 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10499 operation, yielding correct results for the reLyX command.
10501 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10503 * src/support/filetools.C (ExpandPath): removed an over eager
10505 (ReplaceEnvironmentPath): ditto
10507 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10508 shows that we are doing something fishy in our code...
10509 (BubblePost): ditto
10512 * src/lyxrc.C (read): use a double switch trick to get more help
10513 from the compiler. (the same trick is used in layout.C)
10514 (write): new function. opens a ofstream and pass that to output
10515 (output): new function, takes a ostream and writes the lyxrc
10516 elemts to it. uses a dummy switch to make sure no elements are
10519 * src/lyxlex.h: added a struct pushpophelper for use in functions
10520 with more than one exit point.
10522 * src/lyxlex.[Ch] (GetInteger): made it const
10526 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10528 * src/layout.[hC] : LayoutTags splitted into several enums, new
10529 methods created, better error handling cleaner use of lyxlex. Read
10532 * src/bmtable.[Ch]: change some member prototypes because of the
10533 image const changes.
10535 * commandtags.h, src/LyXAction.C (init): new function:
10536 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10537 This file is not read automatically but you can add \input
10538 preferences to your lyxrc if you want to. We need to discuss how
10541 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10542 in .aux, also remove .bib and .bst files from dependencies when
10545 * src/BufferView.C, src/LyXView.C: add const_cast several places
10546 because of changes to images.
10548 * lib/images/*: same change as for images/*
10550 * lib/lyxrc.example: Default for accept_compound is false not no.
10552 * images/*: changed to be const, however I have som misgivings
10553 about this change so it might be changed back.
10555 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10557 * lib/configure, po/POTFILES.in: regenerated
10559 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10561 * config/lib_configure.m4: removed
10563 * lib/configure.m4: new file (was config/lib_configure.m4)
10565 * configure.in: do not test for rtti, since we do not use it.
10567 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10569 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10570 doubling of allocated space scheme. This makes it faster for large
10571 strings end to use less memory for small strings. xtra rememoved.
10573 * src/insets/figinset.C (waitalarm): commented out.
10574 (GhostscriptMsg): use static_cast
10575 (GhostscriptMsg): use new instead of malloc to allocate memory for
10576 cmap. also delete the memory after use.
10578 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10580 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10581 for changes in bibtex database or style.
10582 (runBibTeX): remove all .bib and .bst files from dep before we
10584 (run): use scanAuc in when dep file already exist.
10586 * src/DepTable.C (remove_files_with_extension): new method
10587 (exist): new method
10589 * src/DepTable.[Ch]: made many of the methods const.
10591 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10593 * src/bufferparams.C: make sure that the default textclass is
10594 "article". It used to be the first one by description order, but
10595 now the first one is "docbook".
10597 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10598 string; call Debug::value.
10599 (easyParse): pass complete argument to setDebuggingLevel().
10601 * src/debug.h (value): fix the code that parses debug levels.
10603 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10606 * src/LyXAction.C: use Debug::ACTION as debug channel.
10608 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10610 * NEWS: updated for the future 1.1.3 release.
10612 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10613 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10614 it should. This is of course a controversial change (since many
10615 people will find that their lyx workscreen is suddenly full of
10616 red), but done for the sake of correctness.
10618 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10619 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10621 * src/insets/inseterror.h, src/insets/inseturl.h,
10622 src/insets/insetinfo.h, src/insets/figinset.h,
10623 src/mathed/formulamacro.h, src/mathed/math_macro.h
10624 (EditMessage): add a missing const and add _() to make sure that
10625 translation happens
10627 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10628 src/insets/insetbib.C, src/support/filetools.C: add `using'
10629 directives for cxx.
10631 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10632 doing 'Insert index of last word' at the beginning of a paragraph.
10634 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10636 * several files: white-space changes.
10638 * src/mathed/formula.C: removed IsAlpha and IsDigit
10640 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10641 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10644 * src/insets/figinset.C (GetPSSizes): don't break when
10645 "EndComments" is seen. But break when a boundingbox is read.
10647 * all classes inherited from Inset: return value of Clone
10648 changed back to Inset *.
10650 * all classes inherited form MathInset: return value of Clone
10651 changed back to MathedInset *.
10653 * src/insets/figinset.C (runqueue): use a ofstream to output the
10654 gs/ps file. Might need some setpresicion or setw. However I can
10655 see no problem with the current code.
10656 (runqueue): use sleep instead of the alarm/signal code. I just
10657 can't see the difference.
10659 * src/paragraph.C (LyXParagraph): reserve space in the new
10660 paragraph and resize the inserted paragraph to just fit.
10662 * src/lyxfunc.h (operator|=): added operator for func_status.
10664 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10665 check for readable file.
10667 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10668 check for readable file.
10669 (MenuMakeLinuxDoc): ditto
10670 (MenuMakeDocBook): ditto
10671 (MenuMakeAscii): ditto
10672 (InsertAsciiFile): split the test for openable and readable
10674 * src/bmtable.C (draw_bitmaptable): use
10675 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10677 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10678 findtexfile from LaTeX to filetools.
10680 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10681 instead of FilePtr. Needs to be verified by a literate user.
10683 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10685 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10686 (EditMessage): likewise.
10688 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10689 respectively as \textasciitilde and \textasciicircum.
10691 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10693 * src/support/lyxstring.h: made the methods that take iterators
10694 use const_iterator.
10696 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10697 (regexMatch): made is use the real regex class.
10699 * src/support/Makefile.am: changed to use libtool
10701 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10703 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10705 (MathIsInset ++): changed several macros to be inline functions
10708 * src/mathed/Makefile.am: changed to use libtool
10710 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10712 * src/insets/inset* : Clone changed to const and return type is
10713 the true insettype not just Inset*.
10715 * src/insets/Makefile.am: changed to use libtool
10717 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10719 * src/undo.[Ch] : added empty() and changed some of the method
10722 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10724 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10725 setID use block<> for the bullets array, added const several places.
10727 * src/lyxfunc.C (getStatus): new function
10729 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10730 LyXAction, added const to several funtions.
10732 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10733 a std::map, and to store the dir items in a vector.
10735 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10738 * src/LyXView.[Ch] + other files : changed currentView to view.
10740 * src/LyXAction.[Ch] : ported from the old devel branch.
10742 * src/.cvsignore: added .libs and a.out
10744 * configure.in : changes to use libtool.
10746 * acinclude.m4 : inserted libtool.m4
10748 * .cvsignore: added libtool
10750 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10752 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10753 file name in insets and mathed directories (otherwise the
10754 dependency is not taken in account under cygwin).
10756 * src/text2.C (InsertString[AB]): make sure that we do not try to
10757 read characters past the string length.
10759 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10761 * lib/doc/LaTeXConfig.lyx.in,
10762 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10764 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10765 file saying who created them and when this heppened; this is
10766 useless and annoys tools like cvs.
10768 * lib/layouts/g-brief-{en,de}.layout,
10769 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10770 from Thomas Hartkens <thomas@hartkens.de>.
10772 * src/{insets,mathed}/Makefile.am: do not declare an empty
10773 LDFLAGS, so that it can be set at configure time (useful on Irix
10776 * lib/reLyX/configure.in: make sure that the prefix is set
10777 correctly in LYX_DIR.
10779 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10781 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10782 be used by 'command-sequence' this allows to bind a key to a
10783 sequence of LyX-commands
10784 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10786 * src/LyXAction.C: add "command-sequence"
10788 * src/LyXFunction.C: handling of "command-sequence"
10790 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10791 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10793 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10795 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10797 * src/buffer.C (writeFile): Do not output a comment giving user
10798 and date at the beginning of a .lyx file. This is useless and
10799 annoys cvs anyway; update version number to 1.1.
10801 * src/Makefile.am (LYX_DIR): add this definition, so that a
10802 default path is hardcoded in LyX.
10804 * configure.in: Use LYX_GNU_GETTEXT.
10806 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10807 AM_GNU_GETTEXT with a bug fixed.
10809 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10811 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10813 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10814 which is used to point to LyX data is now LYX_DIR_11x.
10816 * lyx.man: convert to a unix text file; small updates.
10818 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10820 * src/support/LSubstring.[Ch]: made the second arg of most of the
10821 constructors be a const reference.
10823 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10826 * src/support/lyxstring.[Ch] (swap): added missing member function
10827 and specialization of swap(str, str);
10829 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10831 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10832 trace of the old one.
10834 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10835 put the member definitions in undo.C.
10837 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10838 NEW_TEXT and have now only code that was included when this was
10841 * src/intl.C (LCombo): use static_cast
10843 (DispatchCallback): ditto
10845 * src/definitions.h: removed whole file
10847 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10849 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10850 parsing and stores in a std:map. a regex defines the file format.
10851 removed unneeded members.
10853 * src/bufferparams.h: added several enums from definitions.h here.
10854 Removed unsused destructor. Changed some types to use proper enum
10855 types. use block to have the temp_bullets and user_defined_bullets
10856 and to make the whole class assignable.
10858 * src/bufferparams.C (Copy): removed this functions, use a default
10859 assignment instead.
10861 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10864 * src/buffer.C (readLyXformat2): commend out all that have with
10865 oldpapersize to do. also comment out all that hve to do with
10866 insetlatex and insetlatexdel.
10867 (setOldPaperStuff): commented out
10869 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10871 * src/LyXAction.C: remove use of inset-latex-insert
10873 * src/mathed/math_panel.C (button_cb): use static_cast
10875 * src/insets/Makefile.am (insets_o_SOURCES): removed
10878 * src/support/lyxstring.C (helper): use the unsigned long
10879 specifier, UL, instead of a static_cast.
10881 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10883 * src/support/block.h: new file. to be used as a c-style array in
10884 classes, so that the class can be assignable.
10886 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10888 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10889 NULL, make sure to return an empty string (it is not possible to
10890 set a string to NULL).
10892 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10894 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10896 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10898 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10899 link line, so that Irix users (for example) can set it explicitely to
10902 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10903 it can be overidden at make time (static or dynamic link, for
10906 * src/vc-backend.C, src/LaTeXFeatures.h,
10907 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10908 statements to bring templates to global namespace.
10910 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10912 * src/support/lyxstring.C (operator[] const): make it standard
10915 * src/minibuffer.C (Init): changed to reflect that more
10916 information is given from the lyxvc and need not be provided here.
10918 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10920 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10922 * src/LyXView.C (UpdateTimerCB): use static_cast
10923 (KeyPressMask_raw_callback): ditto
10925 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10926 buffer_, a lot of changes because of this. currentBuffer() ->
10927 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10928 also changes to other files because of this.
10930 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10932 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10933 have no support for RCS and partial support for CVS, will be
10936 * src/insets/ several files: changes because of function name
10937 changes in Bufferview and LyXView.
10939 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10941 * src/support/LSubstring.[Ch]: new files. These implement a
10942 Substring that can be very convenient to use. i.e. is this
10944 string a = "Mary had a little sheep";
10945 Substring(a, "sheep") = "lamb";
10946 a is now "Mary has a little lamb".
10948 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10949 out patterns and subpatterns of strings. It is used by LSubstring
10950 and also by vc-backend.C
10952 * src/support/lyxstring.C: went over all the assertions used and
10953 tried to correct the wrong ones and flag which of them is required
10954 by the standard. some bugs found because of this. Also removed a
10955 couple of assertions.
10957 * src/support/Makefile.am (libsupport_a_SOURCES): added
10958 LSubstring.[Ch] and LRegex.[Ch]
10960 * src/support/FileInfo.h: have struct stat buf as an object and
10961 not a pointer to one, some changes because of this.
10963 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10964 information in layout when adding the layouts preamble to the
10965 textclass preamble.
10967 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10970 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10971 because of bug in OS/2.
10973 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10975 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10976 \verbatim@font instead of \ttfamily, so that it can be redefined.
10978 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10979 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10980 src/layout.h, src/text2.C: add 'using' directive to bring the
10981 STL templates we need from the std:: namespace to the global one.
10982 Needed by DEC cxx in strict ansi mode.
10984 * src/support/LIstream.h,src/support/LOstream.h,
10985 src/support/lyxstring.h,src/table.h,
10986 src/lyxlookup.h: do not include <config.h> in header
10987 files. This should be done in the .C files only.
10989 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10993 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10995 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10996 from Kayvan to fix the tth invokation.
10998 * development/lyx.spec.in: updates from Kayvan to reflect the
10999 changes of file names.
11001 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11003 * src/text2.C (InsertStringB): use std::copy
11004 (InsertStringA): use std::copy
11006 * src/bufferlist.C: use a vector to store the buffers in. This is
11007 an internal change and should not affect any other thing.
11009 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11012 * src/text.C (Fill): fix potential bug, one off bug.
11014 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11016 * src/Makefile.am (lyx_main.o): add more files it depends on.
11018 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11020 * src/support/lyxstring.C: use size_t for the reference count,
11021 size, reserved memory and xtra.
11022 (internal_compare): new private member function. Now the compare
11023 functions should work for std::strings that have embedded '\0'
11025 (compare): all compare functions rewritten to use
11028 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11030 * src/support/lyxstring.C (compare): pass c_str()
11031 (compare): pass c_str
11032 (compare): pass c_str
11034 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11036 * src/support/DebugStream.C: <config.h> was not included correctly.
11038 * lib/configure: forgot to re-generate it :( I'll make this file
11039 auto generated soon.
11041 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11043 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11046 * src/support/lyxstring.C: some changes from length() to rep->sz.
11047 avoids a function call.
11049 * src/support/filetools.C (SpaceLess): yet another version of the
11050 algorithm...now per Jean-Marc's suggestions.
11052 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11054 * src/layout.C (less_textclass_desc): functor for use in sorting
11056 (LyXTextClass::Read): sort the textclasses after reading.
11058 * src/support/filetools.C (SpaceLess): new version of the
11059 SpaceLess functions. What problems does this one give? Please
11062 * images/banner_bw.xbm: made the arrays unsigned char *
11064 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11066 * src/support/lyxstring.C (find): remove bogus assertion in the
11067 two versions of find where this has not been done yet.
11069 * src/support/lyxlib.h: add missing int return type to
11072 * src/menus.C (ShowFileMenu): disable exporting to html if no
11073 html export command is present.
11075 * config/lib_configure.m4: add a test for an HTML converter. The
11076 programs checked for are, in this order: tth, latex2html and
11079 * lib/configure: generated from config/lib_configure.m4.
11081 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11082 html converter. The parameters are now passed through $$FName and
11083 $$OutName, instead of standard input/output.
11085 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11087 * lib/lyxrc.example: update description of \html_command.
11088 add "quotes" around \screen_font_xxx font setting examples to help
11089 people who use fonts with spaces in their names.
11091 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11093 * Distribution files: updates for v1.1.2
11095 * src/support/lyxstring.C (find): remove bogus assert and return
11096 npos for the same condition.
11098 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11100 * added patch for OS/2 from SMiyata.
11102 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11104 * src/text2.C (CutSelection): make space_wrapped a bool
11105 (CutSelection): dont declare int i until we have to.
11106 (alphaCounter): return a char const *.
11108 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11110 * src/support/syscall.C (Systemcalls::kill):
11111 src/support/filetools.C (PutEnv, PutEnvPath):
11112 src/lyx_cb.C (addNewlineAndDepth):
11113 src/FontInfo.C (FontInfo::resize): condition some #warning
11114 directives with WITH_WARNINGS.
11117 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11119 * src/layout.[Ch] + several files: access to class variables
11120 limited and made accessor functions instead a lot of code changed
11121 becuase of this. Also instead of returning pointers often a const
11122 reference is returned instead.
11124 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11126 * src/Makefile.am (dist-hook): added used to remove the CVS from
11127 cheaders upon creating a dist
11128 (EXTRA_DIST): added cheaders
11130 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11131 a character not as a small integer.
11133 * src/support/lyxstring.C (find): removed Assert and added i >=
11134 rep->sz to the first if.
11136 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11138 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11139 src/LyXView.C src/buffer.C src/bufferparams.C
11140 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11141 src/text2.C src/insets/insetinclude.C:
11142 lyxlayout renamed to textclasslist.
11144 * src/layout.C: some lyxerr changes.
11146 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11147 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11148 (LyXLayoutList): removed all traces of this class.
11149 (LyXTextClass::Read): rewrote LT_STYLE
11150 (LyXTextClass::hasLayout): new function
11151 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11152 both const and nonconst version.
11153 (LyXTextClass::delete_layout): new function.
11154 (LyXTextClassList::Style): bug fix. do the right thing if layout
11156 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11157 (LyXTextClassList::NameOfLayout): ditto
11158 (LyXTextClassList::Load): ditto
11160 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11162 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11164 * src/LyXAction.C (LookupFunc): added a workaround for sun
11165 compiler, on the other hand...we don't know if the current code
11166 compiles on sun at all...
11168 * src/support/filetools.C (CleanupPath): subst fix
11170 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11173 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11174 complained about this one?
11176 * src/insets/insetinclude.C (Latex): subst fix
11178 * src/insets/insetbib.C (getKeys): subst fix
11180 * src/LyXSendto.C (SendtoApplyCB): subst fix
11182 * src/lyx_main.C (init): subst fix
11184 * src/layout.C (Read): subst fix
11186 * src/lyx_sendfax_main.C (button_send): subst fix
11188 * src/buffer.C (RoffAsciiTable): subst fix
11190 * src/lyx_cb.C (MenuFax): subst fix
11191 (PrintApplyCB): subst fix
11193 1999-10-26 Juergen Vigna <jug@sad.it>
11195 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11197 (Read): Cleaned up this code so now we read only format vestion >= 5
11199 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11201 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11202 come nobody has complained about this one?
11204 * src/insets/insetinclude.C (Latex): subst fix
11206 * src/insets/insetbib.C (getKeys): subst fix
11208 * src/lyx_main.C (init): subst fix
11210 * src/layout.C (Read): subst fix
11212 * src/buffer.C (RoffAsciiTable): subst fix
11214 * src/lyx_cb.C (MenuFax): subst fix.
11216 * src/layout.[hC] + some other files: rewrote to use
11217 std::container to store textclasses and layouts in.
11218 Simplified, removed a lot of code. Make all classes
11219 assignable. Further simplifications and review of type
11220 use still to be one.
11222 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11223 lastfiles to create the lastfiles partr of the menu.
11225 * src/lastfiles.[Ch]: rewritten to use deque to store the
11226 lastfiles in. Uses fstream for reading and writing. Simplifies
11229 * src/support/syscall.C: remove explicit cast.
11231 * src/BufferView.C (CursorToggleCB): removed code snippets that
11232 were commented out.
11233 use explicat C++ style casts instead of C style casts. also use
11234 u_vdata instea of passing pointers in longs.
11236 * src/PaperLayout.C: removed code snippets that were commented out.
11238 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11240 * src/lyx_main.C: removed code snippets that wer commented out.
11242 * src/paragraph.C: removed code snippets that were commented out.
11244 * src/lyxvc.C (logClose): use static_cast
11246 (viewLog): remove explicit cast to void*
11247 (showLog): removed old commented code
11249 * src/menus.C: use static_cast instead of C style casts. use
11250 u_vdata instead of u_ldata. remove explicit cast to (long) for
11251 pointers. Removed old code that was commented out.
11253 * src/insets/inset.C: removed old commented func
11255 * src/insets/insetref.C (InsetRef): removed old code that had been
11256 commented out for a long time.
11258 (escape): removed C style cast
11260 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11262 * src/insets/insetlatex.C (Draw): removed old commented code
11263 (Read): rewritten to use string
11265 * src/insets/insetlabel.C (escape): removed C style cast
11267 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11269 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11270 old commented code.
11272 * src/insets/insetinclude.h: removed a couple of stupid bools
11274 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11275 (Clone): remove C style cast
11276 (getKeys): changed list to lst because of std::list
11278 * src/insets/inseterror.C (Draw): removed som old commented code.
11280 * src/insets/insetcommand.C (Draw): removed some old commented code.
11282 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11283 commented out forever.
11284 (bibitem_cb): use static_cast instead of C style cast
11285 use of vdata changed to u_vdata.
11287 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11289 (CloseUrlCB): use static_cast instead of C style cast.
11290 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11292 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11293 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11294 (CloseInfoCB): static_cast from ob->u_vdata instead.
11295 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11298 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11299 (C_InsetError_CloseErrorCB): forward the ob parameter
11300 (CloseErrorCB): static_cast from ob->u_vdata instead.
11302 * src/vspace.h: include LString.h since we use string in this class.
11304 * src/vspace.C (lyx_advance): changed name from advance because of
11305 nameclash with stl. And since we cannot use namespaces yet...I
11306 used a lyx_ prefix instead. Expect this to change when we begin
11309 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11311 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11312 and removed now defunct constructor and deconstructor.
11314 * src/BufferView.h: have backstack as a object not as a pointer.
11315 removed initialization from constructor. added include for BackStack
11317 * development/lyx.spec.in (%build): add CFLAGS also.
11319 * src/screen.C (drawFrame): removed another warning.
11321 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11323 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11324 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11325 README and ANNOUNCE a bit for the next release. More work is
11328 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11329 unbreakable if we are in freespacing mode (LyX-Code), but not in
11332 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11334 * src/BackStack.h: fixed initialization order in constructor
11336 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11338 * acinclude.m4 (VERSION): new rules for when a version is
11339 development, added also a variable for prerelease.
11340 (warnings): we set with_warnings=yes for prereleases
11341 (lyx_opt): prereleases compile with same optimization as development
11342 (CXXFLAGS): only use pedantic if we are a development version
11344 * src/BufferView.C (restorePosition): don't do anything if the
11345 backstack is empty.
11347 * src/BackStack.h: added member empty, use this to test if there
11348 is anything to pop...
11350 1999-10-25 Juergen Vigna <jug@sad.it>
11353 * forms/layout_forms.fd +
11354 * forms/latexoptions.fd +
11355 * lyx.fd: changed for various form resize issues
11357 * src/mathed/math_panel.C +
11358 * src/insets/inseterror.C +
11359 * src/insets/insetinfo.C +
11360 * src/insets/inseturl.C +
11361 * src/insets/inseturl.h +
11363 * src/LyXSendto.C +
11364 * src/PaperLayout.C +
11365 * src/ParagraphExtra.C +
11366 * src/TableLayout.C +
11368 * src/layout_forms.C +
11375 * src/menus.C: fixed various resize issues. So now forms can be
11376 resized savely or not be resized at all.
11378 * forms/form_url.fd +
11379 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11382 * src/insets/Makefile.am: added files form_url.[Ch]
11384 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11386 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11387 (and presumably 6.2).
11389 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11390 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11391 remaining static member callbacks.
11393 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11396 * src/support/lyxstring.h: declare struct Srep as friend of
11397 lyxstring, since DEC cxx complains otherwise.
11399 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11401 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11403 * src/LaTeX.C (run): made run_bibtex also depend on files with
11405 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11406 are put into the dependency file.
11408 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11409 the code has shown itself to work
11410 (create_ispell_pipe): removed another warning, added a comment
11413 * src/minibuffer.C (ExecutingCB): removed code that has been
11414 commented out a long time
11416 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11417 out code + a warning.
11419 * src/support/lyxstring.h: comment out the three private
11420 operators, when compiling with string ansi conforming compilers
11421 they make problems.
11423 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11425 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11426 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11429 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11432 * src/mathed/math_panel.C (create_math_panel): remove explicit
11435 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11438 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11439 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11440 to XCreatePixmapFromBitmapData
11441 (fl_set_bmtable_data): change the last argument to be unsigned
11443 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11444 and bh to be unsigned int, remove explicit casts in call to
11445 XReadBitmapFileData.
11447 * images/arrows.xbm: made the arrays unsigned char *
11448 * images/varsz.xbm: ditto
11449 * images/misc.xbm: ditto
11450 * images/greek.xbm: ditto
11451 * images/dots.xbm: ditto
11452 * images/brel.xbm: ditto
11453 * images/bop.xbm: ditto
11455 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11457 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11458 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11459 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11461 (LYX_CXX_CHEADERS): added <clocale> to the test.
11463 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11465 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11467 * src/support/lyxstring.C (append): fixed something that must be a
11468 bug, rep->assign was used instead of rep->append.
11470 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11473 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11474 lyx insert double chars. Fix spotted by Kayvan.
11476 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11478 * Fixed the tth support. I messed up with the Emacs patch apply feature
11479 and omitted the changes in lyxrc.C.
11481 1999-10-22 Juergen Vigna <jug@sad.it>
11483 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11485 * src/lyx_cb.C (MenuInsertRef) +
11486 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11487 the form cannot be resized under it limits (fixes a segfault)
11489 * src/lyx.C (create_form_form_ref) +
11490 * forms/lyx.fd: Changed Gravity on name input field so that it is
11493 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11495 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11496 <ostream> and <istream>.
11498 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11499 whether <fstream> provides the latest standard features, or if we
11500 have an oldstyle library (like in egcs).
11501 (LYX_CXX_STL_STRING): fix the test.
11503 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11504 code on MODERN_STL_STREAM.
11506 * src/support/lyxstring.h: use L{I,O}stream.h.
11508 * src/support/L{I,O}stream.h: new files, designed to setup
11509 correctly streams for our use
11510 - includes the right header depending on STL capabilities
11511 - puts std::ostream and std::endl (for LOStream.h) or
11512 std::istream (LIStream.h) in toplevel namespace.
11514 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11516 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11517 was a bib file that had been changed we ensure that bibtex is run.
11518 (runBibTeX): enhanced to extract the names of the bib files and
11519 getting their absolute path and enter them into the dep file.
11520 (findtexfile): static func that is used to look for tex-files,
11521 checks for absolute patchs and tries also with kpsewhich.
11522 Alternative ways of finding the correct files are wanted. Will
11524 (do_popen): function that runs a command using popen and returns
11525 the whole output of that command in a string. Should be moved to
11528 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11529 file with extension ext has changed.
11531 * src/insets/figinset.C: added ifdef guards around the fl_free
11532 code that jug commented out. Now it is commented out when
11533 compiling with XForms == 0.89.
11535 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11536 to lyxstring.C, and only keep a forward declaration in
11537 lyxstring.h. Simplifies the header file a bit and should help a
11538 bit on compile time too. Also changes to Srep will not mandate a
11539 recompile of code just using string.
11540 (~lyxstring): definition moved here since it uses srep.
11541 (size): definition moved here since it uses srep.
11543 * src/support/lyxstring.h: removed a couple of "inline" that should
11546 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11548 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11551 1999-10-21 Juergen Vigna <jug@sad.it>
11553 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11554 set to left if I just remove the width entry (or it is empty).
11556 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11557 paragraph when having dummy paragraphs.
11559 1999-10-20 Juergen Vigna <jug@sad.it>
11561 * src/insets/figinset.C: just commented some fl_free_form calls
11562 and added warnings so that this calls should be activated later
11563 again. This avoids for now a segfault, but we have a memory leak!
11565 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11566 'const char * argument' to 'string argument', this should
11567 fix some Asserts() in lyxstring.C.
11569 * src/lyxfunc.h: Removed the function argAsString(const char *)
11570 as it is not used anymore.
11572 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11574 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11577 * src/Literate.h: some funcs moved from public to private to make
11578 interface clearer. Unneeded args removed.
11580 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11582 (scanBuildLogFile): ditto
11584 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11585 normal TeX Error. Still room for improvement.
11587 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11589 * src/buffer.C (insertErrors): changes to make the error
11590 desctription show properly.
11592 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11595 * src/support/lyxstring.C (helper): changed to use
11596 sizeof(object->rep->ref).
11597 (operator>>): changed to use a pointer instead.
11599 * src/support/lyxstring.h: changed const reference & to value_type
11600 const & lets see if that helps.
11602 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11604 * Makefile.am (rpmdist): fixed to have non static package and
11607 * src/support/lyxstring.C: removed the compilation guards
11609 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11612 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11613 conditional compile of lyxstring.Ch
11615 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11616 stupid check, but it is a lot better than the bastring hack.
11617 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11619 * several files: changed string::erase into string::clear. Not
11622 * src/chset.C (encodeString): use a char temporary instead
11624 * src/table.C (TexEndOfCell): added tostr around
11625 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11626 (TexEndOfCell): ditto
11627 (TexEndOfCell): ditto
11628 (TexEndOfCell): ditto
11629 (DocBookEndOfCell): ditto
11630 (DocBookEndOfCell): ditto
11631 (DocBookEndOfCell): ditto
11632 (DocBookEndOfCell): ditto
11634 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11636 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11638 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11639 (MenuBuildProg): added tostr around ret
11640 (MenuRunChktex): added tostr around ret
11641 (DocumentApplyCB): added tostr around ret
11643 * src/chset.C (encodeString): added tostr around t->ic
11645 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11646 (makeLaTeXFile): added tostr around tocdepth
11647 (makeLaTeXFile): added tostr around ftcound - 1
11649 * src/insets/insetbib.C (setCounter): added tostr around counter.
11651 * src/support/lyxstring.h: added an operator+=(int) to catch more
11654 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11655 (lyxstring): We DON'T allow NULL pointers.
11657 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11659 * src/mathed/math_macro.C (MathMacroArgument::Write,
11660 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11661 when writing them out.
11663 * src/LString.C: remove, since it is not used anymore.
11665 * src/support/lyxstring.C: condition the content to
11666 USE_INCLUDED_STRING macro.
11668 * src/mathed/math_symbols.C, src/support/lstrings.C,
11669 src/support/lyxstring.C: add `using' directive to specify what
11670 we need in <algorithm>. I do not think that we need to
11671 conditionalize this, but any thought is appreciated.
11673 * many files: change all callback functions to "C" linkage
11674 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11675 strict_ansi. Those who were static are now global.
11676 The case of callbacks which are static class members is
11677 trickier, since we have to make C wrappers around them (see
11678 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11679 did not finish this yet, since it defeats the purpose of
11680 encapsulation, and I am not sure what the best route is.
11682 1999-10-19 Juergen Vigna <jug@sad.it>
11684 * src/support/lyxstring.C (lyxstring): we permit to have a null
11685 pointer as assignment value and just don't assign it.
11687 * src/vspace.C (nextToken): corrected this function substituting
11688 find_first(_not)_of with find_last_of.
11690 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11691 (TableOptCloseCB) (TableSpeCloseCB):
11692 inserted fl_set_focus call for problem with fl_hide_form() in
11695 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11697 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11700 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11702 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11703 LyXLex::next() and not eatline() to get its argument.
11705 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11707 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11708 instead, use fstreams for io of the depfile, removed unneeded
11709 functions and variables.
11711 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11712 vector instead, removed all functions and variables that is not in
11715 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11717 * src/buffer.C (insertErrors): use new interface to TeXError
11719 * Makefile.am (rpmdist): added a rpmdist target
11721 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11722 per Kayvan's instructions.
11724 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11726 * src/Makefile.am: add a definition for localedir, so that locales
11727 are found after installation (Kayvan)
11729 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11731 * development/.cvsignore: new file.
11733 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11735 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11736 C++ compiler provides wrappers for C headers and use our alternate
11739 * configure.in: use LYX_CXX_CHEADERS.
11741 * src/cheader/: new directory, populated with cname headers from
11742 libstdc++-2.8.1. They are a bit old, but probably good enough for
11743 what we want (support compilers who lack them).
11745 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11746 from includes. It turns out is was stupid.
11748 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11750 * lib/Makefile.am (install-data-local): forgot a ';'
11751 (install-data-local): forgot a '\'
11752 (libinstalldirs): needed after all. reintroduced.
11754 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11756 * configure.in (AC_OUTPUT): added lyx.spec
11758 * development/lyx.spec: removed file
11760 * development/lyx.spec.in: new file
11762 * po/*.po: merged with lyx.pot becuase of make distcheck
11764 * lib/Makefile.am (dist-hook): added dist-hook so that
11765 documentation files will be included when doing a make
11766 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11767 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11769 more: tried to make install do the right thing, exclude CVS dirs
11772 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11773 Path would fit in more nicely.
11775 * all files that used to use pathstack: uses now Path instead.
11776 This change was a lot easier than expected.
11778 * src/support/path.h: new file
11780 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11782 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11784 * src/support/lyxstring.C (getline): Default arg was given for
11787 * Configure.cmd: removed file
11789 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11791 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11792 streams classes and types, add the proper 'using' statements when
11793 MODERN_STL is defined.
11795 * src/debug.h: move the << operator definition after the inclusion
11798 * src/support/filetools.C: include "LAssert.h", which is needed
11801 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11804 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11805 include "debug.h" to define a proper ostream.
11807 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11809 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11810 method to the SystemCall class which can kill a process, but it's
11811 not fully implemented yet.
11813 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11815 * src/support/FileInfo.h: Better documentation
11817 * src/lyxfunc.C: Added support for buffer-export html
11819 * src/menus.C: Added Export->As HTML...
11821 * lib/bind/*.bind: Added short-cut for buffer-export html
11823 * src/lyxrc.*: Added support for new \tth_command
11825 * lib/lyxrc.example: Added stuff for new \tth_command
11827 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11829 * lib/Makefile.am (IMAGES): removed images/README
11830 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11831 installes in correct place. Check permisions is installed
11834 * src/LaTeX.C: some no-op changes moved declaration of some
11837 * src/LaTeX.h (LATEX_H): changed include guard name
11839 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11841 * lib/reLyX/Makefile.am: install noweb2lyx.
11843 * lib/Makefile.am: install configure.
11845 * lib/reLyX/configure.in: declare a config aux dir; set package
11846 name to lyx (not sure what the best solution is); generate noweb2lyx.
11848 * lib/layouts/egs.layout: fix the bibliography layout.
11850 1999-10-08 Jürgen Vigna <jug@sad.it>
11852 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11853 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11854 it returned without continuing to search the path.
11856 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11858 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11859 also fixes a bug. It is not allowed to do tricks with std::strings
11860 like: string a("hei"); &a[e]; this will not give what you
11861 think... Any reason for the complexity in this func?
11863 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11865 * Updated README and INSTALL a bit, mostly to check that my
11866 CVS rights are correctly set up.
11868 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11870 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11871 does not allow '\0' chars but lyxstring and std::string does.
11873 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11875 * autogen.sh (AUTOCONF): let the autogen script create the
11876 POTFILES.in file too. POTFILES.in should perhaps now not be
11877 included in the cvs module.
11879 * some more files changed to use C++ includes instead of C ones.
11881 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11883 (Reread): added tostr to nlink. buggy output otherwise.
11884 (Reread): added a string() around szMode when assigning to Buffer,
11885 without this I got a log of garbled info strings.
11887 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11890 * I have added several ostream & operator<<(ostream &, some_type)
11891 functions. This has been done to avoid casting and warnings when
11892 outputting enums to lyxerr. This as thus eliminated a lot of
11893 explicit casts and has made the code clearer. Among the enums
11894 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11895 mathed enums, some font enum the Debug::type enum.
11897 * src/support/lyxstring.h (clear): missing method. equivalent of
11900 * all files that contained "stderr": rewrote constructs that used
11901 stderr to use lyxerr instead. (except bmtable)
11903 * src/support/DebugStream.h (level): and the passed t with
11904 Debug::ANY to avoid spurious bits set.
11906 * src/debug.h (Debug::type value): made it accept strings of the
11907 type INFO,INIT,KEY.
11909 * configure.in (Check for programs): Added a check for kpsewhich,
11910 the latex generation will use this later to better the dicovery of
11913 * src/BufferView.C (create_view): we don't need to cast this to
11914 (void*) that is done automatically.
11915 (WorkAreaButtonPress): removed some dead code.
11917 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11919 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11920 is not overwritten when translated (David Sua'rez de Lis).
11922 * lib/CREDITS: Added David Sua'rez de Lis
11924 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11926 * src/bufferparams.C (BufferParams): default input encoding is now
11929 * acinclude.m4 (cross_compiling): comment out macro
11930 LYX_GXX_STRENGTH_REDUCE.
11932 * acconfig.h: make sure that const is not defined (to empty) when
11933 we are compiling C++. Remove commented out code using SIZEOF_xx
11936 * configure.in : move the test for const and inline as late as
11937 possible so that these C tests do not interefere with C++ ones.
11938 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11939 has not been proven.
11941 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11943 * src/table.C (getDocBookAlign): remove bad default value for
11944 isColumn parameter.
11946 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11948 (ShowFileMenu2): ditto.
11950 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11951 of files to ignore.
11953 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11955 * Most files: finished the change from the old error code to use
11956 DebugStream for all lyxerr debugging. Only minor changes remain
11957 (e.g. the setting of debug levels using strings instead of number)
11959 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11961 * src/layout.C (Add): Changed to use compare_no_case instead of
11964 * src/FontInfo.C: changed loop variable type too string::size_type.
11966 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11968 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11969 set ETAGS_ARGS to --c++
11971 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11973 * src/table.C (DocBookEndOfCell): commented out two unused variables
11975 * src/paragraph.C: commented out four unused variables.
11977 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11978 insed a if clause with type string::size_type.
11980 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11983 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11985 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11986 variable, also changed loop to go from 0 to lenght + 1, instead of
11987 -1 to length. This should be correct.
11989 * src/LaTeX.C (scanError): use string::size_type as loop variable
11992 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11993 (l.896) since y_tmp and row was not used anyway.
11995 * src/insets/insetref.C (escape): use string::size_type as loop
11998 * src/insets/insetquotes.C (Width): use string::size_type as loop
12000 (Draw): use string::size_type as loop variable type.
12002 * src/insets/insetlatexaccent.C (checkContents): use
12003 string::size_type as loop variable type.
12005 * src/insets/insetlabel.C (escape): use string::size_type as loop
12008 * src/insets/insetinfo.C: added an extern for current_view.
12010 * src/insets/insetcommand.C (scanCommand): use string::size_type
12011 as loop variable type.
12013 * most files: removed the RCS tags. With them we had to recompile
12014 a lot of files after a simple cvs commit. Also we have never used
12015 them for anything meaningful.
12017 * most files: tags-query-replace NULL 0. As adviced several plases
12018 we now use "0" instead of "NULL" in our code.
12020 * src/support/filetools.C (SpaceLess): use string::size_type as
12021 loop variable type.
12023 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12025 * src/paragraph.C: fixed up some more string stuff.
12027 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12029 * src/support/filetools.h: make modestr a std::string.
12031 * src/filetools.C (GetEnv): made ch really const.
12033 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12034 made code that used these use max/min from <algorithm> instead.
12036 * changed several c library include files to their equivalent c++
12037 library include files. All is not changed yet.
12039 * created a support subdir in src, put lyxstring and lstrings
12040 there + the extra files atexit, fileblock, strerror. Created
12041 Makefile.am. edited configure.in and src/Makefile.am to use this
12042 new subdir. More files moved to support.
12044 * imported som of the functions from repository lyx, filetools
12046 * ran tags-query-replace on LString -> string, corrected the bogus
12047 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12048 is still some errors in there. This is errors where too much or
12049 too litle get deleted from strings (string::erase, string::substr,
12050 string::replace), there can also be some off by one errors, or
12051 just plain wrong use of functions from lstrings. Viewing of quotes
12054 * LyX is now running fairly well with string, but there are
12055 certainly some bugs yet (see above) also string is quite different
12056 from LString among others in that it does not allow null pointers
12057 passed in and will abort if it gets any.
12059 * Added the revtex4 files I forgot when setting up the repository.
12061 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12063 * All over: Tried to clean everything up so that only the files
12064 that we really need are included in the cvs repository.
12065 * Switched to use automake.
12066 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12067 * Install has not been checked.
12069 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12071 * po/pt.po: Three errors:
12072 l.533 and l.538 format specification error
12073 l. 402 duplicate entry, I just deleted it.