1 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
4 new files use the everwhere possible.
7 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
8 src/log_form.C src/lyx.C:
11 * src/buffer.C (runLaTeX): remove func
13 * src/PaperLayout.C: removed file
14 * src/ParagraphExtra.C: likewise
15 * src/bullet_forms.C: likewise
16 * src/bullet_forms.h: likewise
17 * src/bullet_forms_cb.C: likewise
19 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
20 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
23 * several files: remove all traces of the old fd_form_paragraph,
24 and functions belonging to that.
26 * several files: remove all traces of the old fd_form_document,
27 and functions belonging to that.
29 * several files: constify local variables were possible.
31 * several files: remove all code that was dead when NEW_EXPORT was
34 * several files: removed string::c_str in as many places as
37 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
38 (e): be a bit more outspoken when patching
39 (updatesrc): only move files if changed.
41 * forms/layout_forms.h.patch: regenerated
43 * forms/layout_forms.fd: remove form_document and form_paragraph
44 and form_quotes and form_paper and form_table_options and
47 * forms/form1.fd: remove form_table
49 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
50 the fdui->... rewrite. Update some comments to xforms 0.88
52 * forms/bullet_forms.C.patch: removed file
53 * forms/bullet_forms.fd: likewise
54 * forms/bullet_forms.h.patch: likewise
56 * development/Code_rules/Rules: added a section on switch
57 statements. Updated some comment to xforms 0.88.
59 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
61 * src/buffer.C (readFile): make sure that the whole version number
62 is read after \lyxformat (even when it contains a comma)
64 * lib/ui/default.ui: change shortcut of math menu to M-a.
66 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
68 * src/vspace.C (nextToken): use isStrDbl() to check for proper
71 * src/LyXView.C (updateWindowTitle): show the full files name in
72 window title, limited to 30 characters.
74 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
75 When a number of characters has been given, we should not assume
76 that the string is 0-terminated.
78 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
79 calls (fixes some memory leaks)
81 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
84 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
86 * src/converter.C (GetReachable): fix typo.
88 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
89 understand ',' instead of '.'.
90 (GetInteger): rewrite to use strToInt().
92 2000-09-26 Juergen Vigna <jug@sad.it>
94 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
95 better visibility and error-message on wrong VSpace input.
97 * src/language.C (initL): added english again.
99 2000-09-25 Juergen Vigna <jug@sad.it>
101 * src/frontends/kde/Dialogs.C (Dialogs):
102 * src/frontends/gnome/Dialogs.C (Dialogs):
103 * src/frontends/kde/Makefile.am:
104 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
106 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
108 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
110 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
112 * src/frontends/xforms/FormParagraph.C:
113 * src/frontends/xforms/FormParagraph.h:
114 * src/frontends/xforms/form_paragraph.C:
115 * src/frontends/xforms/form_paragraph.h:
116 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
119 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
121 * src/tabular.C (OldFormatRead): forgot to delete the temporary
122 Paragraph-Data after use.
124 * src/insets/insettext.C (LocalDispatch): don't set the layout on
125 non breakable paragraphs.
127 2000-09-25 Garst R. Reese <reese@isn.net>
129 * src/language.C (initL): added missing language_country codes.
131 2000-09-25 Juergen Vigna <jug@sad.it>
133 * src/insets/insettext.C (InsetText):
134 (deleteLyXText): remove the not released LyXText structure!
136 2000-09-24 Marko Vendelin <markov@ioc.ee>
138 * src/frontends/gnome/mainapp.C
139 * src/frontends/gnome/mainapp.h: added support for keyboard
142 * src/frontends/gnome/FormCitation.C
143 * src/frontends/gnome/FormCitation.h
144 * src/frontends/gnome/Makefile.am
145 * src/frontends/gnome/pixbutton.h: completed the rewrite of
146 FormCitation to use "action area" in mainapp window
148 * src/frontends/gnome/Menubar_pimpl.C
149 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
152 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
154 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
155 width/descent/ascent values if name is empty.
156 (mathed_string_height): Use std::max.
158 2000-09-25 Allan Rae <rae@lyx.org>
160 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
161 segfault. This will be completely redesigned soon.
163 * sigc++: updated libsigc++. Fixes struct timespec bug.
165 * development/tools/makeLyXsigc.sh: .cvsignore addition
167 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
169 * several files: removed almost all traces of the old table
172 * src/TableLayout.C: removed file
174 2000-09-22 Juergen Vigna <jug@sad.it>
176 * src/frontends/kde/Dialogs.C: added credits forms.
178 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
180 * src/frontends/gnome/Dialogs.C: added some forms.
182 * src/spellchecker.C (init_spell_checker): set language in pspell code
183 (RunSpellChecker): some modifications for setting language string.
185 * src/language.[Ch]: added language_country code.
187 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
189 * src/frontends/Dialogs.h: added new signal showError.
190 Rearranged existing signals in some sort of alphabetical order.
192 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
193 FormError.[Ch], form_error.[Ch]
194 * src/frontends/xforms/forms/makefile: added new file form_error.fd
195 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
197 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
198 dialogs. I think that this can be used as the base to all these
201 * src/frontends/xforms/FormError.[Ch]
202 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
203 implementation of InsetError dialog.
205 * src/insets/inseterror.[Ch]: rendered GUI-independent.
207 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
208 * src/frontends/kde/Makefile.am: ditto
210 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
212 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
213 macrobf. This fixes a bug of invisible text.
215 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
217 * lib/doc/LaTeXConfig.lyx.in: updated.
219 * src/language.C (initL): remove language "francais" and change a
220 bit the names of the two other french variations.
222 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
223 string that may not be 0-terminated.
225 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
227 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
229 2000-09-20 Marko Vendelin <markov@ioc.ee>
231 * src/frontends/gnome/FormCitation.C
232 * src/frontends/gnome/FormIndex.C
233 * src/frontends/gnome/FormToc.C
234 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
235 the variable initialization to shut up the warnings
237 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
239 * src/table.[Ch]: deleted files
241 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
244 2000-09-18 Juergen Vigna <jug@sad.it>
246 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
247 problems with selection. Inserted new LFUN_PASTESELECTION.
248 (InsetButtonPress): inserted handling of middle mouse-button paste.
250 * src/spellchecker.C: changed word to word.c_str().
252 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
254 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
255 included in the ``make dist'' tarball.
257 2000-09-15 Juergen Vigna <jug@sad.it>
259 * src/CutAndPaste.C (cutSelection): small fix return the right
260 end position after cut inside one paragraph only.
262 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
263 we are locked as otherwise we don't have a valid cursor position!
265 * src/insets/figinset.C (draw): small bugfix but why is this needed???
267 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
269 * src/frontends/kde/FormRef.C: added using directive.
270 * src/frontends/kde/FormToc.C: ditto
272 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
274 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
277 2000-09-19 Marko Vendelin <markov@ioc.ee>
279 * src/frontends/gnome/Menubar_pimpl.C
280 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
281 Toc, ViewFormats, UpdateFormats, and ExportFormats.
283 * src/frontends/gnome/mainapp.C
284 * src/frontends/gnome/mainapp.h: support for menu update used
287 * src/frontends/gnome/mainapp.C
288 * src/frontends/gnome/mainapp.h: support for "action" area in the
289 main window. This area is used by small simple dialogs, such as
292 * src/frontends/gnome/FormIndex.C
293 * src/frontends/gnome/FormIndex.h
294 * src/frontends/gnome/FormUrl.C
295 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
298 * src/frontends/gnome/FormCitation.C
299 * src/frontends/gnome/FormCitation.h: rewrite to use main window
300 action area. Only "Insert new citation" is implemented.
304 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
306 * src/buffer.C (Dispatch): fix call to Dispatch
307 * src/insets/insetref.C (Edit): likewise
308 * src/insets/insetparent.C (Edit): likewise
309 * src/insets/insetinclude.C (include_cb): likewise
310 * src/frontends/xforms/FormUrl.C (apply): likewise
311 * src/frontends/xforms/FormToc.C (apply): likewise
312 * src/frontends/xforms/FormRef.C (apply): likewise
313 * src/frontends/xforms/FormIndex.C (apply): likewise
314 * src/frontends/xforms/FormCitation.C (apply): likewise
315 * src/lyxserver.C (callback): likewise
316 * src/lyxfunc.C (processKeySym): likewise
319 * src/lyx_cb.C (LayoutsCB): likewise
321 * Makefile.am (sourcedoc): small change
323 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
325 * src/main.C (main): Don't make an empty GUIRunTime object. all
326 methods are static. constify a bit remove unneded using + headers.
328 * src/tabular.C: some more const to local vars move some loop vars
330 * src/spellchecker.C: added some c_str after some word for pspell
332 * src/frontends/GUIRunTime.h: add new static method setDefaults
333 * src/frontends/xforms/GUIRunTime.C (setDefaults):
334 * src/frontends/kde/GUIRunTime.C (setDefaults):
335 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
337 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
338 with strnew in arg, use correct emptystring when calling SetName.
340 * several files: remove all commented code with relation to
341 HAVE_SSTREAM beeing false. We now only support stringstream and
344 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
346 * src/lyxfunc.C: construct correctly the automatic new file
349 * src/text2.C (IsStringInText): change type of variable i to shut
352 * src/support/sstream.h: do not use namespaces if the compiler
353 does not support them.
355 2000-09-15 Marko Vendelin <markov@ioc.ee>
356 * src/frontends/gnome/FormCitation.C
357 * src/frontends/gnome/FormCitation.h
358 * src/frontends/gnome/diainsertcitation_interface.c
359 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
360 regexp support to FormCitation [Gnome].
362 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
365 * configure.in: remove unused KDE/GTKGUI define
367 * src/frontends/kde/FormRef.C
368 * src/frontends/kde/FormRef.h
369 * src/frontends/kde/formrefdialog.C
370 * src/frontends/kde/formrefdialog.h: double click will
371 go to reference, now it is possible to change a cross-ref
374 * src/frontends/kde/FormToc.C
375 * src/frontends/kde/FormToc.h
376 * src/frontends/kde/formtocdialog.C
377 * src/frontends/kde/formtocdialog.h: add a depth
380 * src/frontends/kde/Makefile.am: add QtLyXView.h
383 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
385 * src/frontends/kde/FormCitation.h: added some using directives.
387 * src/frontends/kde/FormToc.h: corrected definition of doTree.
389 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
392 * src/mathed/math_defs.h: redefine SetAlign to use string rather
395 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
397 * src/buffer.C (pop_tag): revert for the second time a change by
398 Lars, who seems to really hate having non-local loop variables :)
400 * src/Lsstream.h: add "using" statements.
402 * src/support/copy.C (copy): add a bunch of std:: qualifiers
403 * src/buffer.C (writeFile): ditto
405 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
407 * src/buffer.C (writeFile): try to fix the locale modified format
408 number to always be as we want it.
410 * src/WorkArea.C (work_area_handler): try to workaround the bugs
411 in XForms 0.89. C-space is now working again.
413 * src/Lsstream.h src/support/sstream.h: new files.
415 * also commented out all cases where strstream were used.
417 * src/Bullet.h (c_str): remove method.
419 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
421 * a lot of files: get rid of "char const *" and "char *" is as
422 many places as possible. We only want to use them in interaction
423 with system of other libraries, not inside lyx.
425 * a lot of files: return const object is not of pod type. This
426 helps ensure that temporary objects is not modified. And fits well
427 with "programming by contract".
429 * configure.in: check for the locale header too
431 * Makefile.am (sourcedoc): new tag for generation of doc++
434 2000-09-14 Juergen Vigna <jug@sad.it>
436 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
437 callback to check which combo called it and do the right action.
439 * src/combox.C (combo_cb): added combo * to the callbacks.
440 (Hide): moved call of callback after Ungrab of the pointer.
442 * src/intl.h: removed LCombo2 function.
444 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
445 function as this can now be handled in one function.
447 * src/combox.h: added Combox * to callback prototype.
449 * src/frontends/xforms/Toolbar_pimpl.C:
450 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
452 2000-09-14 Garst Reese <reese@isn.net>
454 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
455 moved usepackage{xxx}'s to beginning of file. Changed left margin
456 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
457 underlining from title. Thanks to John Culleton for useful suggestions.
459 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
461 * src/lyxlex_pimpl.C (setFile): change error message to debug
464 2000-09-13 Juergen Vigna <jug@sad.it>
466 * src/frontends/xforms/FormDocument.C: implemented choice_class
467 as combox and give callback to combo_language so OK/Apply is activated
470 * src/bufferlist.C (newFile): small fix so already named files
471 (via an open call) are not requested to be named again on the
474 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
476 * src/frontends/kde/Makefile.am
477 * src/frontends/kde/FormRef.C
478 * src/frontends/kde/FormRef.h
479 * src/frontends/kde/formrefdialog.C
480 * src/frontends/kde/formrefdialog.h: implement
483 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
485 * src/frontends/kde/formtocdialog.C
486 * src/frontends/kde/formtocdialog.h
487 * src/frontends/kde/FormToc.C
488 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
490 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
492 * src/frontends/kde/FormCitation.C: fix thinko
493 where we didn't always display the reference text
496 * src/frontends/kde/formurldialog.C
497 * src/frontends/kde/formurldialog.h
498 * src/frontends/kde/FormUrl.C
499 * src/frontends/kde/FormUrl.h: minor cleanups
501 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
503 * src/frontends/kde/Makefile.am
504 * src/frontends/kde/FormToc.C
505 * src/frontends/kde/FormToc.h
506 * src/frontends/kde/FormCitation.C
507 * src/frontends/kde/FormCitation.h
508 * src/frontends/kde/FormIndex.C
509 * src/frontends/kde/FormIndex.h
510 * src/frontends/kde/formtocdialog.C
511 * src/frontends/kde/formtocdialog.h
512 * src/frontends/kde/formcitationdialog.C
513 * src/frontends/kde/formcitationdialog.h
514 * src/frontends/kde/formindexdialog.C
515 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
517 2000-09-12 Juergen Vigna <jug@sad.it>
519 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
522 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
524 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
527 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
529 * src/converter.C (Add, Convert): Added support for converter flags:
530 needaux, resultdir, resultfile.
531 (Convert): Added new parameter view_file.
532 (dvips_options): Fixed letter paper option.
534 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
535 (Export, GetExportableFormats, GetViewableFormats): Added support
538 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
540 (easyParse): Fixed to work with new export code.
542 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
545 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
547 * lib/bind/*.bind: Replaced
548 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
549 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
551 2000-09-11 Juergen Vigna <jug@sad.it>
553 * src/lyx_gui.C (runTime): uses global guiruntime variable.
555 * src/main.C (main): now GUII defines global guiruntime!
557 * src/frontends/gnome/GUIRunTime.C (initApplication):
558 * src/frontends/kde/GUIRunTime.C (initApplication):
559 * src/frontends/xforms/GUIRunTime.C (initApplication):
560 * src/frontends/GUIRunTime.h: added new function initApplication.
562 * src/spellchecker.C (sc_accept_word): change to add_to_session.
564 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
566 2000-09-08 Juergen Vigna <jug@sad.it>
568 * src/lyx_gui.C (create_forms): don't display the "default" entry as
569 we have already "Reset".
571 * src/language.C (initL): inserted "default" language and made this
572 THE default language (and not american!)
574 * src/paragraph.C: inserted handling of "default" language!
576 * src/lyxfont.C: ditto
580 * src/paragraph.C: output the \\par only if we have a following
581 paragraph otherwise it's not needed.
583 2000-09-05 Juergen Vigna <jug@sad.it>
585 * config/pspell.m4: added entry to lyx-flags
587 * src/spellchecker.C: modified version from Kevin for using pspell
589 2000-09-01 Marko Vendelin <markov@ioc.ee>
590 * src/frontends/gnome/Makefile.am
591 * src/frontends/gnome/FormCitation.C
592 * src/frontends/gnome/FormCitation.h
593 * src/frontends/gnome/diainsertcitation_callbacks.c
594 * src/frontends/gnome/diainsertcitation_callbacks.h
595 * src/frontends/gnome/diainsertcitation_interface.c
596 * src/frontends/gnome/diainsertcitation_interface.h
597 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
598 dialog for Gnome frontend
600 * src/main.C: Gnome libraries require keeping application name
601 and its version as strings
603 * src/frontends/gnome/mainapp.C: Change the name of the main window
604 from GnomeLyX to PACKAGE
606 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
608 * src/frontends/Liason.C: add "using: declaration.
610 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
612 * src/mathed/math_macro.C (Metrics): Set the size of the template
614 * src/mathed/formulamacro.C (Latex): Fixed the returned value
616 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
618 * src/converter.C (add_options): New function.
619 (SetViewer): Change $$FName into '$$FName'.
620 (View): Add options when running xdvi
621 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
622 (Convert): The 3rd parameter is now the desired filename. Converts
623 calls to lyx::rename if necessary.
624 Add options when running dvips.
625 (dvi_papersize,dvips_options): New methods.
627 * src/exporter.C (Export): Use getLatexName() instead of fileName().
629 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
630 using a call to Converter::dvips_options.
631 Fixed to work with nex export code.
634 * src/support/rename.C: New files
636 * src/support/syscall.h
637 * src/support/syscall.C: Added Starttype SystemDontWait.
639 * lib/ui/default.ui: Changed to work with new export code
641 * lib/configure.m4: Changed to work with new export code
643 * src/encoding.C: Changed latex name for iso8859_7 encoding.
645 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
647 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
648 so that code compiles with DEC cxx.
650 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
651 to work correctly! Also now supports the additional elements
654 2000-09-01 Allan Rae <rae@lyx.org>
656 * src/frontends/ButtonPolicies.C: renamed all the references to
657 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
659 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
660 since it's a const not a type.
662 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
664 2000-08-31 Juergen Vigna <jug@sad.it>
666 * src/insets/figinset.C: Various changes to look if the filename has
667 an extension and if not add it for inline previewing.
669 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
671 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
672 make buttonStatus and isReadOnly be const methods. (also reflect
673 this in derived classes.)
675 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
676 (nextState): change to be static inline, pass the StateMachine as
678 (PreferencesPolicy): remove casts
679 (OkCancelPolicy): remvoe casts
680 (OkCancelReadOnlyPolicy): remove casts
681 (NoRepeatedApplyReadOnlyPolicy): remove casts
682 (OkApplyCancelReadOnlyPolicy): remove casts
683 (OkApplyCancelPolicy): remove casts
684 (NoRepeatedApplyPolicy): remove casts
686 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
688 * src/converter.C: added some using directives
690 * src/frontends/ButtonPolicies.C: changes to overcome
691 "need lvalue" error with DEC c++
693 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
694 to WMHideCB for DEC c++
696 * src/frontends/xforms/Menubar_pimpl.C: added using directive
698 * src/frontends/xforms/forms/form_document.C.patch: use C callback
699 to BulletBMTableCB for DEC c++
701 2000-08-31 Allan Rae <rae@lyx.org>
703 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
704 character dialog separately from old document dialogs combo_language.
707 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
709 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
710 Removed LFUN_REF_CREATE.
712 * src/MenuBackend.C: Added new tags: toc and references
714 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
715 (add_lastfiles, add_documents, add_formats): Removed the unused smn
717 (add_toc, add_references): New methods.
718 (create_submenu): Handle correctly the case when there is a
719 seperator after optional menu items.
721 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
722 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
723 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
725 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
727 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
729 * src/converter.[Ch]: New file for converting between different
732 * src/export.[Ch]: New file for exporting a LyX file to different
735 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
736 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
737 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
738 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
739 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
740 RunDocBook, MenuExport.
742 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
743 Exporter::Preview methods if NEW_EXPORT is defined.
745 * src/buffer.C (Dispatch): Use Exporter::Export.
747 * src/lyxrc.C: Added new tags: \converter and \viewer.
750 * src/LyXAction.C: Define new lyx-function: buffer-update.
751 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
752 when NEW_EXPORT is defined.
754 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
756 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
758 * lib/ui/default.ui: Added submenus "view" and "update" to the
761 * src/filetools.C (GetExtension): New function.
763 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
765 2000-08-29 Allan Rae <rae@lyx.org>
767 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
769 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
770 (EnableDocumentLayout): removed
771 (DisableDocumentLayout): removed
772 (build): make use of ButtonController's read-only handling to
773 de/activate various objects. Replaces both of the above functions.
775 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
776 (readOnly): was read_only
777 (refresh): fixed dumb mistakes with read_only_ handling
779 * src/frontends/xforms/forms/form_document.fd:
780 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
781 tabbed dialogs so the tabs look more like tabs and so its easier to
782 work out which is the current tab.
784 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
785 segfault with form_table
787 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
789 2000-08-28 Juergen Vigna <jug@sad.it>
791 * acconfig.h: added USE_PSPELL.
793 * src/config.h.in: added USE_PSPELL.
795 * autogen.sh: added pspell.m4
797 * config/pspell.m4: new file.
799 * src/spellchecker.C: implemented support for pspell libary.
801 2000-08-25 Juergen Vigna <jug@sad.it>
803 * src/LyXAction.C (init): renamed LFUN_TABLE to
804 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
806 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
808 * src/lyxscreen.h: add force_clear variable and fuction to force
809 a clear area when redrawing in LyXText.
811 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
813 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
815 * some whitespace and comment changes.
817 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
819 * src/buffer.C: up te LYX_FORMAT to 2.17
821 2000-08-23 Juergen Vigna <jug@sad.it>
823 * src/BufferView_pimpl.C (tripleClick): disable this when in a
826 * src/insets/insettabular.C (pasteSelection): delete the insets
827 LyXText as it is not valid anymore.
828 (copySelection): new function.
829 (pasteSelection): new function.
830 (cutSelection): new function.
831 (LocalDispatch): implemented cut/copy/paste of cell selections.
833 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
834 don't have a LyXText.
836 * src/LyXAction.C (init): a NEW_TABULAR define too much.
838 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
841 2000-08-22 Juergen Vigna <jug@sad.it>
843 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
844 ifdef form_table out if NEW_TABULAR.
846 2000-08-21 Juergen Vigna <jug@sad.it>
848 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
849 (draw): fixed draw position so that the cursor is positioned in the
851 (InsetMotionNotify): hide/show cursor so the position is updated.
852 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
853 using cellstart() function where it should be used.
855 * src/insets/insettext.C (draw): ditto.
857 * src/tabular.C: fixed initialization of some missing variables and
858 made BoxType into an enum.
860 2000-08-22 Marko Vendelin <markov@ioc.ee>
861 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
862 stock menu item using action numerical value, not its string
866 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
868 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
869 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
871 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
873 * src/frontends/xforms/GUIRunTime.C: new file
875 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
876 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
878 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
880 * src/frontends/kde/GUIRunTime.C: new file
882 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
883 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
885 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
887 * src/frontends/gnome/GUIRunTime.C: new file
889 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
892 * src/frontends/GUIRunTime.h: removed constructor and destructor,
893 small change to documetentation.
895 * src/frontends/GUIRunTime.C: removed file
897 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
899 * src/lyxparagraph.h: enable NEW_TABULAR as default
901 * src/lyxfunc.C (processKeySym): remove some commented code
903 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
904 NEW_TABULAR around the fd_form_table_options.
906 * src/lyx_gui.C (runTime): call the static member function as
907 GUIRunTime::runTime().
909 2000-08-21 Allan Rae <rae@lyx.org>
911 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
914 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
916 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
918 2000-08-21 Allan Rae <rae@lyx.org>
920 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
922 * src/frontends/xforms/FormPreferences.C (build): use setOK
923 * src/frontends/xforms/FormDocument.C (build): use setOK
924 (FormDocument): use the appropriate policy.
926 2000-08-21 Allan Rae <rae@lyx.org>
928 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
929 automatic [de]activation of arbitrary objects when in a read-only state.
931 * src/frontends/ButtonPolicies.h: More documentation
932 (isReadOnly): added to support the above.
934 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
936 2000-08-18 Juergen Vigna <jug@sad.it>
938 * src/insets/insettabular.C (getStatus): changed to return func_status.
940 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
941 display toggle menu entries if they are.
943 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
944 new document layout now.
946 * src/lyxfunc.C: ditto
948 * src/lyx_gui_misc.C: ditto
950 * src/lyx_gui.C: ditto
952 * lib/ui/default.ui: removed paper and quotes layout as they are now
953 all in the document layout tabbed folder.
955 * src/frontends/xforms/forms/form_document.fd: added Restore
956 button and callbacks for all inputs for Allan's ButtonPolicy.
958 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
959 (CheckChoiceClass): added missing params setting on class change.
960 (UpdateLayoutDocument): added for updating the layout on params.
961 (build): forgot to RETURN_ALWAYS input_doc_spacing.
962 (FormDocument): Implemented Allan's ButtonPolicy with the
965 2000-08-17 Allan Rae <rae@lyx.org>
967 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
968 so we can at least see the credits again.
970 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
971 controller calls for the appropriate callbacks. Note that since Ok
972 calls apply followed by cancel, and apply isn't a valid input for the
973 APPLIED state, the bc_ calls have to be made in the static callback not
974 within each of the real callbacks.
976 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
977 (setOk): renamed from setOkay()
979 2000-08-17 Juergen Vigna <jug@sad.it>
981 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
982 in the implementation part.
983 (composeUIInfo): don't show optional menu-items.
985 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
987 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
989 * src/bufferview_funcs.C (CurrentState): fixed to show also the
990 text-state when in a text-inset.
992 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
994 2000-08-17 Marko Vendelin <markov@ioc.ee>
995 * src/frontends/gnome/FormIndex.C
996 * src/frontends/gnome/FormIndex.h
997 * src/frontends/gnome/FormToc.C
998 * src/frontends/gnome/FormToc.h
999 * src/frontends/gnome/dialogs
1000 * src/frontends/gnome/diatoc_callbacks.c
1001 * src/frontends/gnome/diatoc_callbacks.h
1002 * src/frontends/gnome/diainsertindex_callbacks.h
1003 * src/frontends/gnome/diainsertindex_callbacks.c
1004 * src/frontends/gnome/diainsertindex_interface.c
1005 * src/frontends/gnome/diainsertindex_interface.h
1006 * src/frontends/gnome/diatoc_interface.h
1007 * src/frontends/gnome/diatoc_interface.c
1008 * src/frontends/gnome/Makefile.am: Table of Contents and
1009 Insert Index dialogs implementation for Gnome frontend
1011 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1013 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1015 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1018 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1020 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1021 destructor. Don't definde if you don't need it
1022 (processEvents): made static, non-blocking events processing for
1024 (runTime): static method. event loop for xforms
1025 * similar as above for kde and gnome.
1027 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1028 new Pimpl is correct
1029 (runTime): new method calss the real frontends runtime func.
1031 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1033 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1035 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1037 2000-08-16 Juergen Vigna <jug@sad.it>
1039 * src/lyx_gui.C (runTime): added GUII RunTime support.
1041 * src/frontends/Makefile.am:
1042 * src/frontends/GUIRunTime.[Ch]:
1043 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1044 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1045 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1047 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1049 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1050 as this is already set in ${FRONTEND_INCLUDE} if needed.
1052 * configure.in (CPPFLAGS): setting the include dir for the frontend
1053 directory and don't set FRONTEND=xforms for now as this is executed
1056 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1058 * src/frontends/kde/Makefile.am:
1059 * src/frontends/kde/FormUrl.C:
1060 * src/frontends/kde/FormUrl.h:
1061 * src/frontends/kde/formurldialog.h:
1062 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1064 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1066 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1068 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1070 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1073 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1075 * src/WorkArea.C (work_area_handler): more work to get te
1076 FL_KEYBOARD to work with xforms 0.88 too, please test.
1078 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1080 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1082 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1085 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1087 * src/Timeout.h: remove Qt::emit hack.
1089 * several files: changes to allo doc++ compilation
1091 * src/lyxfunc.C (processKeySym): new method
1092 (processKeyEvent): comment out if FL_REVISION < 89
1094 * src/WorkArea.C: change some debugging levels.
1095 (WorkArea): set wantkey to FL_KEY_ALL
1096 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1097 clearer code and the use of compose with XForms 0.89. Change to
1098 use signals instead of calling methods in bufferview directly.
1100 * src/Painter.C: change some debugging levels.
1102 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1105 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1106 (workAreaKeyPress): new method
1108 2000-08-14 Juergen Vigna <jug@sad.it>
1110 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1112 * config/kde.m4: addes some features
1114 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1115 include missing xforms dialogs.
1117 * src/Timeout.h: a hack to be able to compile with qt/kde.
1119 * sigc++/.cvsignore: added acinclude.m4
1121 * lib/.cvsignore: added listerros
1123 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1124 xforms tree as objects are needed for other frontends.
1126 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1127 linking with not yet implemented xforms objects.
1129 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1131 2000-08-14 Baruch Even <baruch.even@writeme.com>
1133 * src/frontends/xforms/FormGraphics.h:
1134 * src/frontends/xforms/FormGraphics.C:
1135 * src/frontends/xforms/RadioButtonGroup.h:
1136 * src/frontends/xforms/RadioButtonGroup.C:
1137 * src/insets/insetgraphics.h:
1138 * src/insets/insetgraphics.C:
1139 * src/insets/insetgraphicsParams.h:
1140 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1141 instead of spaces, and various other indentation issues to make the
1142 sources more consistent.
1144 2000-08-14 Marko Vendelin <markov@ioc.ee>
1146 * src/frontends/gnome/dialogs/diaprint.glade
1147 * src/frontends/gnome/FormPrint.C
1148 * src/frontends/gnome/FormPrint.h
1149 * src/frontends/gnome/diaprint_callbacks.c
1150 * src/frontends/gnome/diaprint_callbacks.h
1151 * src/frontends/gnome/diaprint_interface.c
1152 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1155 * src/frontends/gnome/dialogs/diainserturl.glade
1156 * src/frontends/gnome/FormUrl.C
1157 * src/frontends/gnome/FormUrl.h
1158 * src/frontends/gnome/diainserturl_callbacks.c
1159 * src/frontends/gnome/diainserturl_callbacks.h
1160 * src/frontends/gnome/diainserturl_interface.c
1161 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1162 Gnome implementation
1164 * src/frontends/gnome/Dialogs.C
1165 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1166 all other dialogs. Copy all unimplemented dialogs from Xforms
1169 * src/frontends/gnome/support.c
1170 * src/frontends/gnome/support.h: support files generated by Glade
1174 * config/gnome.m4: Gnome configuration scripts
1176 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1177 configure --help message
1179 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1180 only if there are no events pendling in Gnome/Gtk. This enhances
1181 the performance of menus.
1184 2000-08-14 Allan Rae <rae@lyx.org>
1186 * lib/Makefile.am: listerrors cleaning
1188 * lib/listerrors: removed -- generated file
1189 * acinclude.m4: ditto
1190 * sigc++/acinclude.m4: ditto
1192 * src/frontends/xforms/forms/form_citation.fd:
1193 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1196 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1197 `updatesrc` and now we have a `test` target that does what `updatesrc`
1198 used to do. I didn't like having an install target that wasn't related
1201 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1202 on all except FormGraphics. This may yet happen. Followed by a major
1203 cleanup including using FL_TRANSIENT for most of the dialogs. More
1204 changes to come when the ButtonController below is introduced.
1206 * src/frontends/xforms/ButtonController.h: New file for managing up to
1207 four buttons on a dialog according to an externally defined policy.
1208 * src/frontends/xforms/Makefile.am: added above
1210 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1211 Apply and Cancel/Close buttons and everything in between and beyond.
1212 * src/frontends/Makefile.am: added above.
1214 * src/frontends/xforms/forms/form_preferences.fd:
1215 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1216 and removed variable 'status' as a result. Fixed the set_minsize thing.
1217 Use the new screen-font-update after checking screen fonts were changed
1218 Added a "Restore" button to restore the original lyxrc values while
1219 editing. This restores everything not just the last input changed.
1220 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1222 * src/LyXAction.C: screen-font-update added for updating buffers after
1223 screen font settings have been changed.
1224 * src/commandtags.h: ditto
1225 * src/lyxfunc.C: ditto
1227 * forms/lyx.fd: removed screen fonts dialog.
1228 * src/lyx_gui.C: ditto
1229 * src/menus.[Ch]: ditto
1230 * src/lyx.[Ch]: ditto
1231 * src/lyx_cb.C: ditto + code from here moved to make
1232 screen-font-update. And people wonder why progress on GUII is
1233 slow. Look at how scattered this stuff was! It takes forever
1236 * forms/fdfix.sh: Fixup the spacing after commas.
1237 * forms/makefile: Remove date from generated files. Fewer clashes now.
1238 * forms/bullet_forms.C.patch: included someones handwritten changes
1240 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1241 once I've discovered why LyXRC was made noncopyable.
1242 * src/lyx_main.C: ditto
1244 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1246 * src/frontends/xforms/forms/fdfix.sh:
1247 * src/frontends/xforms/forms/fdfixh.sed:
1248 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1249 * src/frontends/xforms/Form*.[hC]:
1250 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1251 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1252 provide a destructor for the struct FD_form_xxxx. Another version of
1253 the set_[max|min]size workaround and a few other cleanups. Actually,
1254 Angus' patch from 20000809.
1256 2000-08-13 Baruch Even <baruch.even@writeme.com>
1258 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1261 2000-08-11 Juergen Vigna <jug@sad.it>
1263 * src/insets/insetgraphics.C (InsetGraphics): changing init
1264 order because of warnings.
1266 * src/frontends/xforms/forms/makefile: adding patching .C with
1269 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1270 from .C.patch to .c.patch
1272 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1273 order because of warning.
1275 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1277 * src/frontends/Liason.C (setMinibuffer): new helper function
1279 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1281 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1283 * lib/ui/default.ui: commented out PaperLayout entry
1285 * src/frontends/xforms/form_document.[Ch]: new added files
1287 * src/frontends/xforms/FormDocument.[Ch]: ditto
1289 * src/frontends/xforms/forms/form_document.fd: ditto
1291 * src/frontends/xforms/forms/form_document.C.patch: ditto
1293 2000-08-10 Juergen Vigna <jug@sad.it>
1295 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1296 (InsetGraphics): initialized cacheHandle to 0.
1297 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1299 2000-08-10 Baruch Even <baruch.even@writeme.com>
1301 * src/graphics/GraphicsCache.h:
1302 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1303 correctly as a cache.
1305 * src/graphics/GraphicsCacheItem.h:
1306 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1309 * src/graphics/GraphicsCacheItem_pimpl.h:
1310 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1313 * src/insets/insetgraphics.h:
1314 * src/insets/insetgraphics.C: Changed from using a signal notification
1315 to polling when image is not loaded.
1317 2000-08-10 Allan Rae <rae@lyx.org>
1319 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1320 that there are two functions that have to been taken out of line by
1321 hand and aren't taken care of in the script. (Just a reminder note)
1323 * sigc++/macros/*.h.m4: Updated as above.
1325 2000-08-09 Juergen Vigna <jug@sad.it>
1327 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1329 * src/insets/insettabular.C: make drawing of single cell smarter.
1331 2000-08-09 Marko Vendelin <markov@ioc.ee>
1332 * src/frontends/gnome/Menubar_pimpl.C
1333 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1334 implementation: new files
1336 * src/frontends/gnome/mainapp.C
1337 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1340 * src/main.C: create Gnome main window
1342 * src/frontends/xforms/Menubar_pimpl.h
1343 * src/frontends/Menubar.C
1344 * src/frontends/Menubar.h: added method Menubar::update that calls
1345 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1347 * src/LyXView.C: calls Menubar::update to update the state
1350 * src/frontends/gnome/Makefile.am: added new files
1352 * src/frontends/Makefile.am: added frontend compiler options
1354 2000-08-08 Juergen Vigna <jug@sad.it>
1356 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1358 * src/bufferlist.C (close):
1359 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1360 documents if exiting without saving.
1362 * src/buffer.C (save): use removeAutosaveFile()
1364 * src/support/filetools.C (removeAutosaveFile): new function.
1366 * src/lyx_cb.C (MenuWrite): returns a bool now.
1367 (MenuWriteAs): check if file could really be saved and revert to the
1369 (MenuWriteAs): removing old autosavefile if existant.
1371 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1372 before Goto toggle declaration, because of compiler warning.
1374 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1376 * src/lyxfunc.C (MenuNew): small fix.
1378 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1380 * src/bufferlist.C (newFile):
1381 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1383 * src/lyxrc.C: added new_ask_filename tag
1385 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1387 * src/lyx.fd: removed code pertaining to form_ref
1388 * src/lyx.[Ch]: ditto
1389 * src/lyx_cb.C: ditto
1390 * src/lyx_gui.C: ditto
1391 * src/lyx_gui_misc.C: ditto
1393 * src/BufferView_pimpl.C (restorePosition): update buffer only
1396 * src/commandtags.h (LFUN_REFTOGGLE): removed
1397 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1398 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1399 (LFUN_REFBACK): renamed LFUN_REF_BACK
1401 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1402 * src/menus.C: ditto
1403 * src/lyxfunc.C (Dispatch): ditto.
1404 InsertRef dialog is now GUI-independent.
1406 * src/texrow.C: added using std::endl;
1408 * src/insets/insetref.[Ch]: strip out large amounts of code.
1409 The inset is now a container and this functionality is now
1410 managed by a new FormRef dialog
1412 * src/frontends/Dialogs.h (showRef, createRef): new signals
1414 * src/frontends/xforms/FormIndex.[Ch],
1415 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1416 when setting dialog's min/max size
1417 * src/frontends/xforms/FormIndex.[Ch]: ditto
1419 * src/frontends/xforms/FormRef.[Ch],
1420 src/frontends/xforms/forms/form_ref.fd: new xforms
1421 implementation of an InsetRef dialog
1423 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1426 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1427 ios::nocreate is not part of the standard. Removed.
1429 2000-08-07 Baruch Even <baruch.even@writeme.com>
1431 * src/graphics/Renderer.h:
1432 * src/graphics/Renderer.C: Added base class for rendering of different
1433 image formats into Pixmaps.
1435 * src/graphics/XPM_Renderer.h:
1436 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1437 in a different class.
1439 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1440 easily add support for other formats.
1442 * src/insets/figinset.C: plugged a leak of an X resource.
1444 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1446 * src/CutAndPaste.[Ch]: make all metods static.
1448 * development/Code_rules/Rules: more work, added section on
1449 Exceptions, and a References section.
1451 * a lot of header files: work to make doc++ able to generate the
1452 source documentation, some workarounds of doc++ problems. Doc++ is
1453 now able to generate the documentation.
1455 2000-08-07 Juergen Vigna <jug@sad.it>
1457 * src/insets/insettabular.C (recomputeTextInsets): removed function
1459 * src/tabular.C (SetWidthOfMulticolCell):
1461 (calculate_width_of_column_NMC): fixed return value so that it really
1462 only returns true if the column-width has changed (there where
1463 problems with muliticolumn-cells in this column).
1465 2000-08-04 Juergen Vigna <jug@sad.it>
1467 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1468 also on the scrollstatus of the inset.
1469 (workAreaMotionNotify): ditto.
1471 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1473 2000-08-01 Juergen Vigna <jug@sad.it>
1475 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1477 * src/commandtags.h:
1478 * src/LyXAction.C (init):
1479 * src/insets/inset.C (LocalDispatch): added support for
1482 * src/insets/inset.C (scroll): new functions.
1484 * src/insets/insettext.C (removeNewlines): new function.
1485 (SetAutoBreakRows): removes forced newlines in the text of the
1486 paragraph if autoBreakRows is set to false.
1488 * src/tabular.C (Latex): generates a parbox around the cell contents
1491 * src/frontends/xforms/FormTabular.C (local_update): removed
1492 the radio_useparbox button.
1494 * src/tabular.C (UseParbox): new function
1496 2000-08-06 Baruch Even <baruch.even@writeme.com>
1498 * src/graphics/GraphicsCache.h:
1499 * src/graphics/GraphicsCache.C:
1500 * src/graphics/GraphicsCacheItem.h:
1501 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1504 * src/insets/insetgraphics.h:
1505 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1506 drawing of the inline image.
1508 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1509 into the wrong position.
1511 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1514 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1516 * src/support/translator.h: move all typedefs to public section
1518 * src/support/filetools.C (MakeLatexName): return string const
1520 (TmpFileName): ditto
1521 (FileOpenSearch): ditto
1523 (LibFileSearch): ditto
1524 (i18nLibFileSearch): ditto
1527 (CreateTmpDir): ditto
1528 (CreateBufferTmpDir): ditto
1529 (CreateLyXTmpDir): ditto
1532 (MakeAbsPath): ditto
1534 (OnlyFilename): ditto
1536 (NormalizePath): ditto
1537 (CleanupPath): ditto
1538 (GetFileContents): ditto
1539 (ReplaceEnvironmentPath): ditto
1540 (MakeRelPath): ditto
1542 (ChangeExtension): ditto
1543 (MakeDisplayPath): ditto
1544 (do_popen): return cmdret const
1545 (findtexfile): return string const
1547 * src/support/DebugStream.h: add some /// to please doc++
1549 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1551 * src/texrow.C (same_rownumber): functor to use with find_if
1552 (getIdFromRow): rewritten to use find_if and to not update the
1553 positions. return true if row is found
1554 (increasePos): new method, use to update positions
1556 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1558 * src/lyxlex_pimpl.C (verifyTable): new method
1561 (GetString): return string const
1562 (pushTable): rewrite to use std::stack
1564 (setFile): better check
1567 * src/lyxlex.h: make LyXLex noncopyable
1569 * src/lyxlex.C (text): return char const * const
1570 (GetString): return string const
1571 (getLongString): return string const
1573 * src/lyx_gui_misc.C (askForText): return pair<...> const
1575 * src/lastfiles.[Ch] (operator): return string const
1577 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1578 istringstream not char const *.
1579 move token.end() out of loop.
1580 (readFile): move initializaton of token
1582 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1583 getIdFromRow is successful.
1585 * lib/bind/emacs.bind: don't include menus bind
1587 * development/Code_rules/Rules: the beginnings of making this
1588 better and covering more of the unwritten rules that we have.
1590 * development/Code_rules/Recommendations: a couple of wording
1593 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1595 * src/support/strerror.c: remove C++ comment.
1597 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1599 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1600 LFUN_INDEX_INSERT_LAST
1602 * src/texrow.C (getIdFromRow): changed from const_iterator to
1603 iterator, allowing code to compile with DEC cxx
1605 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1606 stores part of the class, as suggested by Allan. Will allow
1608 (apply): test to apply uses InsetCommandParams operator!=
1610 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1611 (apply): test to apply uses InsetCommandParams operator!=
1613 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1614 stores part of the class.
1615 (update): removed limits on min/max size.
1617 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1618 (apply): test to apply uses InsetCommandParams operator!=
1620 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1621 (Read, Write, scanCommand, getCommand): moved functionality
1622 into InsetCommandParams.
1624 (getScreenLabel): made pure virtual
1625 new InsetCommandParams operators== and !=
1627 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1628 c-tors based on InsetCommandParams. Removed others.
1629 * src/insets/insetinclude.[Ch]: ditto
1630 * src/insets/insetlabel.[Ch]: ditto
1631 * src/insets/insetparent.[Ch]: ditto
1632 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1634 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1635 insets derived from InsetCommand created using similar c-tors
1636 based on InsetCommandParams
1637 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1638 * src/menus.C (ShowRefsMenu): ditto
1639 * src/paragraph.C (Clone): ditto
1640 * src/text2.C (SetCounter): ditto
1641 * src/lyxfunc.C (Dispatch) ditto
1642 Also recreated old InsetIndex behaviour exactly. Can now
1643 index-insert at the start of a paragraph and index-insert-last
1644 without launching the pop-up.
1646 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1648 * lib/lyxrc.example: mark te pdf options as non functional.
1650 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1651 (isStrDbl): move tmpstr.end() out of loop.
1652 (strToDbl): move intialization of tmpstr
1653 (lowercase): return string const and move tmp.end() out of loop.
1654 (uppercase): return string const and move tmp.edn() out of loop.
1655 (prefixIs): add assertion
1660 (containsOnly): ditto
1661 (containsOnly): ditto
1662 (containsOnly): ditto
1663 (countChar): make last arg char not char const
1664 (token): return string const
1665 (subst): return string const, move tmp.end() out of loop.
1666 (subst): return string const, add assertion
1667 (strip): return string const
1668 (frontStrip): return string const, add assertion
1669 (frontStrip): return string const
1674 * src/support/lstrings.C: add inclde "LAssert.h"
1675 (isStrInt): move tmpstr.end() out of loop.
1677 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1678 toollist.end() out of loop.
1679 (deactivate): move toollist.end() out of loop.
1680 (update): move toollist.end() out of loop.
1681 (updateLayoutList): move tc.end() out of loop.
1682 (add): move toollist.end() out of loop.
1684 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1685 md.end() out of loop.
1687 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1689 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1692 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1693 (Erase): move insetlist.end() out of loop.
1695 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1696 ref to const string as first arg. Move initialization of some
1697 variables, whitespace changes.
1699 * src/kbmap.C (defkey): move table.end() out of loop.
1700 (kb_keymap): move table.end() out of loop.
1701 (findbinding): move table.end() out of loop.
1703 * src/MenuBackend.C (hasMenu): move end() out of loop.
1704 (getMenu): move end() out of loop.
1705 (getMenu): move menulist_.end() out of loop.
1707 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1709 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1712 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1713 (getFromLyXName): move infotab.end() out of loop.
1715 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1716 -fvtable-thunks -ffunction-sections -fdata-sections
1718 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1720 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1723 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1725 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1727 * src/frontends/xforms/FormCitation.[Ch],
1728 src/frontends/xforms/FormIndex.[Ch],
1729 src/frontends/xforms/FormToc.[Ch],
1730 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1732 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1734 * src/commandtags.h: renamed, created some flags for citation
1737 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1739 * src/lyxfunc.C (dispatch): use signals to insert index entry
1741 * src/frontends/Dialogs.h: new signal createIndex
1743 * src/frontends/xforms/FormCommand.[Ch],
1744 src/frontends/xforms/FormCitation.[Ch],
1745 src/frontends/xforms/FormToc.[Ch],
1746 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1748 * src/insets/insetindex.[Ch]: GUI-independent
1750 * src/frontends/xforms/FormIndex.[Ch],
1751 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1754 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1756 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1757 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1759 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1761 * src/insets/insetref.C (Latex): rewrite so that there is now
1762 question that a initialization is requested.
1764 * src/insets/insetcommand.h: reenable the hide signal
1766 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1768 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1769 fix handling of shortcuts (many bugs :)
1770 (add_lastfiles): ditto.
1772 * lib/ui/default.ui: fix a few shortcuts.
1774 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1776 * Makefile.am: Fix ``rpmdist'' target to return the exit
1777 status of the ``rpm'' command, instead of the last command in
1778 the chain (the ``rm lyx.xpm'' command, which always returns
1781 2000-08-02 Allan Rae <rae@lyx.org>
1783 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1784 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1785 * src/frontends/xforms/FormToc.C (FormToc): ditto
1787 * src/frontends/xforms/Makefile.am: A few forgotten files
1789 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1790 Signals-not-copyable-problem Lars' started commenting out.
1792 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1794 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1796 * src/insets/insetcommand.h: Signals is not copyable so anoter
1797 scheme for automatic hiding of forms must be used.
1799 * src/frontends/xforms/FormCitation.h: don't inerit from
1800 noncopyable, FormCommand already does that.
1801 * src/frontends/xforms/FormToc.h: ditto
1802 * src/frontends/xforms/FormUrl.h: ditto
1804 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1806 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1808 * src/insets/insetcommand.h (hide): new SigC::Signal0
1809 (d-tor) new virtual destructor emits hide signal
1811 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1812 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1814 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1815 LOF and LOT. Inset is now GUI-independent
1817 * src/insets/insetloa.[Ch]: redundant
1818 * src/insets/insetlof.[Ch]: ditto
1819 * src/insets/insetlot.[Ch]: ditto
1821 * src/frontends/xforms/forms/form_url.fd: tweaked!
1822 * src/frontends/xforms/forms/form_citation.fd: ditto
1824 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1825 dialogs dealing with InsetCommand insets
1827 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1828 FormCommand base class
1829 * src/frontends/xforms/FormUrl.[Ch]: ditto
1831 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1833 * src/frontends/xforms/FormToc.[Ch]: ditto
1835 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1836 passed a generic InsetCommand pointer
1837 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1839 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1840 and modified InsetTOC class
1841 * src/buffer.C: ditto
1843 * forms/lyx.fd: strip out old FD_form_toc code
1844 * src/lyx_gui_misc.C: ditto
1845 * src/lyx_gui.C: ditto
1846 * src/lyx_cb.C: ditto
1847 * src/lyx.[Ch]: ditto
1849 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1851 * src/support/utility.hpp: tr -d '\r'
1853 2000-08-01 Juergen Vigna <jug@sad.it>
1855 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1857 * src/commandtags.h:
1858 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1859 LFUN_TABULAR_FEATURES.
1861 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1862 LFUN_LAYOUT_TABULAR.
1864 * src/insets/insettabular.C (getStatus): implemented helper function.
1866 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1868 2000-07-31 Juergen Vigna <jug@sad.it>
1870 * src/text.C (draw): fixed screen update problem for text-insets.
1872 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1873 something changed probably this has to be added in various other
1876 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1878 2000-07-31 Baruch Even <baruch.even@writeme.com>
1880 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1881 templates to satisfy compaq cxx.
1884 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1886 * src/support/translator.h (equal_1st_in_pair::operator()): take
1887 const ref pair_type as arg.
1888 (equal_2nd_in_pair::operator()): ditto
1889 (Translator::~Translator): remove empty d-tor.
1891 * src/graphics/GraphicsCache.C: move include config.h to top, also
1892 put initialization of GraphicsCache::singleton here.
1893 (~GraphicsCache): move here
1894 (addFile): take const ref as arg
1897 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1899 * src/BufferView2.C (insertLyXFile): change te with/without header
1902 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1904 * src/frontends/xforms/FormGraphics.C (apply): add some
1905 static_cast. Not very nice, but required by compaq cxx.
1907 * src/frontends/xforms/RadioButtonGroup.h: include header
1908 <utility> instead of <pair.h>
1910 * src/insets/insetgraphicsParams.C: add using directive.
1911 (readResize): change return type to void.
1912 (readOrigin): ditto.
1914 * src/lyxfunc.C (getStatus): add missing break for build-program
1915 function; add test for Literate for export functions.
1917 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1918 entries in Options menu.
1920 2000-07-31 Baruch Even <baruch.even@writeme.com>
1922 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1923 protect against auto-allocation; release icon when needed.
1925 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1927 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1928 on usual typewriter.
1930 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1931 earlier czech.kmap), useful only for programming.
1933 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1935 * src/frontends/xforms/FormCitation.h: fix conditioning around
1938 2000-07-31 Juergen Vigna <jug@sad.it>
1940 * src/frontends/xforms/FormTabular.C (local_update): changed
1941 radio_linebreaks to radio_useparbox and added radio_useminipage.
1943 * src/tabular.C: made support for using minipages/parboxes.
1945 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1947 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1949 (descent): so the cursor is in the middle.
1950 (width): bit smaller box.
1952 * src/insets/insetgraphics.h: added display() function.
1954 2000-07-31 Baruch Even <baruch.even@writeme.com>
1956 * src/frontends/Dialogs.h: Added showGraphics signals.
1958 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1959 xforms form definition of the graphics dialog.
1961 * src/frontends/xforms/FormGraphics.h:
1962 * src/frontends/xforms/FormGraphics.C: Added files, the
1963 GUIndependent code of InsetGraphics
1965 * src/insets/insetgraphics.h:
1966 * src/insets/insetgraphics.C: Major writing to make it work.
1968 * src/insets/insetgraphicsParams.h:
1969 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1970 struct between InsetGraphics and GUI.
1972 * src/LaTeXFeatures.h:
1973 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1974 support for graphicx package.
1976 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1977 for the graphics inset.
1979 * src/support/translator.h: Added file, used in
1980 InsetGraphicsParams. this is a template to translate between two
1983 * src/frontends/xforms/RadioButtonGroup.h:
1984 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1985 way to easily control a radio button group.
1987 2000-07-28 Juergen Vigna <jug@sad.it>
1989 * src/insets/insettabular.C (LocalDispatch):
1990 (TabularFeatures): added support for lyx-functions of tabular features.
1991 (cellstart): refixed this function after someone wrongly changed it.
1993 * src/commandtags.h:
1994 * src/LyXAction.C (init): added support for tabular-features
1996 2000-07-28 Allan Rae <rae@lyx.org>
1998 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1999 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2000 triggers the callback for input checking. As a result we sometimes get
2001 "LyX: This shouldn't happen..." printed to cerr.
2002 (input): Started using status variable since I only free() on
2003 destruction. Some input checking for paths and font sizes.
2005 * src/frontends/xforms/FormPreferences.h: Use status to control
2006 activation of Ok and Apply
2008 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2009 callback. Also resized to stop segfaults with 0.88. The problem is
2010 that xforms-0.88 requires the folder to be wide enough to fit all the
2011 tabs. If it isn't it causes all sorts of problems.
2013 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2015 * src/frontends/xforms/forms/README: Reflect reality.
2017 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2018 * src/frontends/xforms/forms/makefile: ditto.
2020 * src/commandtags.h: Get access to new Preferences dialog
2021 * src/LyXAction.C: ditto
2022 * src/lyxfunc.C: ditto
2023 * lib/ui/default.ui: ditto
2025 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2027 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2029 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2032 * src/frontends/xforms/form_url.[Ch]: added.
2034 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2036 * src/insets/insetbib.h: fixed bug in previous commit
2038 * src/frontends/xforms/FormUrl.h: ditto
2040 * src/frontends/xforms/FormPrint.h: ditto
2042 * src/frontends/xforms/FormPreferences.h: ditto
2044 * src/frontends/xforms/FormCopyright.h: ditto
2046 * src/frontends/xforms/FormCitation.C: ditto
2048 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2049 private copyconstructor and private default contructor
2051 * src/support/Makefile.am: add utility.hpp
2053 * src/support/utility.hpp: new file from boost
2055 * src/insets/insetbib.h: set owner in clone
2057 * src/frontends/xforms/FormCitation.C: added missing include
2060 * src/insets/form_url.[Ch]: removed
2062 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2064 * development/lyx.spec.in
2065 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2066 file/directory re-organization.
2068 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2070 * src/insets/insetcommand.[Ch]: moved the string data and
2071 associated manipulation methods into a new stand-alone class
2072 InsetCommandParams. This class has two additional methods
2073 getAsString() and setFromString() allowing the contents to be
2074 moved around as a single string.
2075 (addContents) method removed.
2076 (setContents) method no longer virtual.
2078 * src/buffer.C (readInset): made use of new InsetCitation,
2079 InsetUrl constructors based on InsetCommandParams.
2081 * src/commandtags.h: add LFUN_INSERT_URL
2083 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2084 independent InsetUrl and use InsetCommandParams to extract
2085 string info and create new Insets.
2087 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2089 * src/frontends/xforms/FormCitation.C (apply): uses
2092 * src/frontends/xforms/form_url.C
2093 * src/frontends/xforms/form_url.h
2094 * src/frontends/xforms/FormUrl.h
2095 * src/frontends/xforms/FormUrl.C
2096 * src/frontends/xforms/forms/form_url.fd: new files
2098 * src/insets/insetcite.[Ch]: removed unused constructors.
2100 * src/insets/insetinclude.[Ch]: no longer store filename
2102 * src/insets/inseturl.[Ch]: GUI-independent.
2104 2000-07-26 Juergen Vigna <jug@sad.it>
2105 * renamed frontend from gtk to gnome as it is that what is realized
2106 and did the necessary changes in the files.
2108 2000-07-26 Marko Vendelin <markov@ioc.ee>
2110 * configure.in: cleaning up gnome configuration scripts
2112 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2114 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2115 shortcuts syndrom by redrawing them explicitely (a better solution
2116 would be appreciated).
2118 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2120 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2123 * src/lyx_cb.C (MenuExport): change html export to do the right
2124 thing depending of the document type (instead of having
2125 html-linuxdoc and html-docbook).
2126 * src/lyxfunc.C (getStatus): update for html
2127 * lib/ui/default.ui: simplify due to the above change.
2128 * src/menus.C (ShowFileMenu): update too (in case we need it).
2130 * src/MenuBackend.C (read): if a menu is defined twice, add the
2131 new entries to the exiting one.
2133 2000-07-26 Juergen Vigna <jug@sad.it>
2135 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2137 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2138 and return a bool if it did actual save the file.
2139 (AutoSave): don't autosave a unnamed doc.
2141 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2142 check if this is an UNNAMED new file and react to it.
2143 (newFile): set buffer to unnamed and change to not mark a new
2144 buffer dirty if I didn't do anything with it.
2146 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2148 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2150 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2151 friend as per Angus's patch posted to lyx-devel.
2153 * src/ext_l10n.h: updated
2155 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2156 gettext on the style string right before inserting them into the
2159 * autogen.sh: add code to extract style strings form layout files,
2160 not good enough yet.
2162 * src/frontends/gtk/.cvsignore: add MAKEFILE
2164 * src/MenuBackend.C (read): run the label strings through gettext
2165 before storing them in the containers.
2167 * src/ext_l10n.h: new file
2169 * autogen.sh : generate the ext_l10n.h file here
2171 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2173 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2176 * lib/ui/default.ui: fix a couple of typos.
2178 * config/gnome/gtk.m4: added (and added to the list of files in
2181 * src/insets/insetinclude.C (unique_id): fix when we are using
2182 lyxstring instead of basic_string<>.
2183 * src/insets/insettext.C (LocalDispatch): ditto.
2184 * src/support/filetools.C: ditto.
2186 * lib/configure.m4: create the ui/ directory if necessary.
2188 * src/LyXView.[Ch] (updateToolbar): new method.
2190 * src/BufferView_pimpl.C (buffer): update the toolbar when
2191 opening/closing buffer.
2193 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2195 * src/LyXAction.C (getActionName): enhance to return also the name
2196 and options of pseudo-actions.
2197 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2199 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2200 as an example of what is possible). Used in File->Build too (more
2201 useful) and in the import/export menus (to mimick the complicated
2202 handling of linuxdoc and friends). Try to update all the entries.
2204 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2207 * src/MenuBackend.C (read): Parse the new OptItem tag.
2209 * src/MenuBackend.h: Add a new optional_ data member (used if the
2210 entry should be omitted when the lyxfunc is disabled).
2212 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2213 function, used as a shortcut.
2214 (create_submenu): align correctly the shortcuts on the widest
2217 * src/MenuBackend.h: MenuItem.label() only returns the label of
2218 the menu without shortcut; new method shortcut().
2220 2000-07-14 Marko Vendelin <markov@ioc.ee>
2222 * src/frontends/gtk/Dialogs.C:
2223 * src/frontends/gtk/FormCopyright.C:
2224 * src/frontends/gtk/FormCopyright.h:
2225 * src/frontends/gtk/Makefile.am: added these source-files for the
2226 Gtk/Gnome support of the Copyright-Dialog.
2228 * src/main.C: added Gnome::Main initialization if using
2229 Gtk/Gnome frontend-GUI.
2231 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2233 * config/gnome/aclocal-include.m4
2234 * config/gnome/compiler-flags.m4
2235 * config/gnome/curses.m4
2236 * config/gnome/gnome--.m4
2237 * config/gnome/gnome-bonobo-check.m4
2238 * config/gnome/gnome-common.m4
2239 * config/gnome/gnome-fileutils.m4
2240 * config/gnome/gnome-ghttp-check.m4
2241 * config/gnome/gnome-gnorba-check.m4
2242 * config/gnome/gnome-guile-checks.m4
2243 * config/gnome/gnome-libgtop-check.m4
2244 * config/gnome/gnome-objc-checks.m4
2245 * config/gnome/gnome-orbit-check.m4
2246 * config/gnome/gnome-print-check.m4
2247 * config/gnome/gnome-pthread-check.m4
2248 * config/gnome/gnome-support.m4
2249 * config/gnome/gnome-undelfs.m4
2250 * config/gnome/gnome-vfs.m4
2251 * config/gnome/gnome-x-checks.m4
2252 * config/gnome/gnome-xml-check.m4
2253 * config/gnome/gnome.m4
2254 * config/gnome/gperf-check.m4
2255 * config/gnome/gtk--.m4
2256 * config/gnome/linger.m4
2257 * config/gnome/need-declaration.m4: added configuration scripts
2258 for Gtk/Gnome frontend-GUI
2260 * configure.in: added support for the --with-frontend=gtk option
2262 * autogen.sh: added config/gnome/* to list of config-files
2264 * acconfig.h: added define for GTKGUI-support
2266 * config/lyxinclude.m4: added --with-frontend[=value] option value
2267 for Gtk/Gnome frontend-GUI support.
2269 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2271 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2275 * src/paragraph.C (GetChar): remove non-const version
2277 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2278 (search_kw): use it.
2280 * src/lyx_main.C (init): if "preferences" exist, read that instead
2282 (ReadRcFile): return bool if the file could be read ok.
2283 (ReadUIFile): add a check to see if lex file is set ok.
2285 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2286 bastring can be used instead of lyxstring (still uses the old code
2287 if std::string is good enough or if lyxstring is used.)
2289 * src/encoding.C: make the arrays static, move ininle functions
2291 * src/encoding.h: from here.
2293 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2294 (parseSingleLyXformat2Token): move inset parsing to separate method
2295 (readInset): new private method
2297 * src/Variables.h: remove virtual from get().
2299 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2300 access to NEW_INSETS and NEW_TABULAR
2302 * src/MenuBackend.h: remove superfluous forward declaration of
2303 MenuItem. Add documentations tags "///", remove empty MenuItem
2304 destructor, remove private default contructor.
2306 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2308 (read): more string mlabel and mname to where they are used
2309 (read): remove unused variables mlabel and mname
2310 (defaults): unconditional clear, make menusetup take advantage of
2311 add returning Menu &.
2313 * src/LyXView.h: define NEW_MENUBAR as default
2315 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2316 to NEW_INSETS and NEW_TABULAR.
2317 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2318 defined. Change some of the "xxxx-inset-insert" functions names to
2321 * several files: more enahncements to NEW_INSETS and the resulting
2324 * lib/lyxrc.example (\date_insert_format): move to misc section
2326 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2327 bastring and use AC_CACHE_CHECK.
2328 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2329 the system have the newest methods. uses AC_CACHE_CHECK
2330 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2331 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2332 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2334 * configure.in: add LYX_CXX_GOOD_STD_STRING
2336 * acinclude.m4: recreated
2338 2000-07-24 Amir Karger
2340 * README: add Hebrew, Arabic kmaps
2343 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2345 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2348 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2350 * Lot of files: add pragma interface/implementation.
2352 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2354 * lib/ui/default.ui: new file (ans new directory). Contains the
2355 default menu and toolbar.
2357 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2358 global space. Toolbars are now read (as menus) in ui files.
2360 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2362 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2363 is disabled because the document is read-only. We want to have the
2364 toggle state of the function anyway.
2365 (getStatus): add code for LFUN_VC* functions (mimicking what is
2366 done in old-style menus)
2368 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2369 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2371 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2372 * src/BufferView_pimpl.C: ditto.
2373 * src/lyxfunc.C: ditto.
2375 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2376 default). This replaces old-style menus by new ones.
2378 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2379 MenuItem. Contain the data structure of a menu.
2381 * src/insets/insettext.C: use LyXView::setLayout instead of
2382 accessing directly the toolbar combox.
2383 * src/lyxfunc.C (Dispatch): ditto.
2385 * src/LyXView.C (setLayout): new method, which just calls
2386 Toolbar::setLayout().
2387 (updateLayoutChoice): move part of this method in Toolbar.
2389 * src/toolbar.[Ch]: removed.
2391 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2392 implementation the toolbar.
2394 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2395 the toolbar. It might make sense to merge it with ToolbarDefaults
2397 (setLayout): new function.
2398 (updateLayoutList): ditto.
2399 (openLayoutList): ditto.
2401 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2402 xforms implementation of the toolbar.
2403 (get_toolbar_func): comment out, since I do not
2404 know what it is good for.
2406 * src/ToolbarDefaults.h: Add the ItemType enum.
2408 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2409 for a list of allocated C strings. Used in Menubar xforms
2410 implementation to avoid memory leaks.
2412 * src/support/lstrings.[Ch] (uppercase): new version taking and
2416 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2417 * lib/bind/emacs.bind: ditto.
2419 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2422 forward decl of LyXView.
2424 * src/toolbar.C (toolbarItem): moved from toolbar.h
2425 (toolbarItem::clean): ditto
2426 (toolbarItem::~toolbarItem): ditto
2427 (toolbarItem::operator): ditto
2429 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2431 * src/paragraph.h: control the NEW_TABULAR define from here
2433 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2434 USE_TABULAR_INSETS to NEW_TABULAR
2436 * src/ToolbarDefaults.C: add include "lyxlex.h"
2438 * files using the old table/tabular: use NEW_TABULAR to control
2439 compilation of old tabular stuff.
2441 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2444 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2445 planemet in reading of old style floats, fix the \end_deeper
2446 problem when reading old style floats.
2448 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2450 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2452 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2454 * lib/bind/sciword.bind: updated.
2456 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2458 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2459 layout write problem
2461 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2463 * src/Makefile.am (INCLUDES): remove image directory from include
2466 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2467 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2469 * src/LyXView.C (create_form_form_main): read the application icon
2472 * lib/images/*.xpm: change the icons to use transparent color for
2475 * src/toolbar.C (update): change the color of the button when it
2478 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2480 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2481 setting explicitely the minibuffer.
2482 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2484 * src/LyXView.C (showState): new function. Shows font information
2485 in minibuffer and update toolbar state.
2486 (LyXView): call Toolbar::update after creating the
2489 * src/toolbar.C: change toollist to be a vector instead of a
2491 (BubbleTimerCB): get help string directly from the callback
2492 argument of the corresponding icon (which is the action)
2493 (set): remove unnecessary ugliness.
2494 (update): new function. update the icons (depressed, disabled)
2495 depending of the status of the corresponding action.
2497 * src/toolbar.h: remove help in toolbarItem
2499 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2501 * src/Painter.C (text): Added code for using symbol glyphs from
2502 iso10646 fonts. Currently diabled.
2504 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2507 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2508 magyar,turkish and usorbian.
2510 * src/paragraph.C (isMultiLingual): Made more efficient.
2512 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2515 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2516 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2517 Also changed the prototype to "bool math_insert_greek(char)".
2519 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2521 * lots of files: apply the NEW_INSETS on all code that will not be
2522 needed when we move to use the new insets. Enable the define in
2523 lyxparagrah.h to try it.
2525 * src/insets/insettabular.C (cellstart): change to be a static
2527 (InsetTabular): initialize buffer in the initializer list.
2529 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2531 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2532 form_print.h out of the header file. Replaced with forward
2533 declarations of the relevant struct.
2535 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2538 * src/commandtags.h: do not include "debug.h" which does not
2539 belong there. #include it in some other places because of this
2542 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2544 * src/insets/insetcaption.C: add a couple "using" directives.
2546 * src/toolbar.C (add): get the help text directly from lyxaction.
2548 (setPixmap): new function. Loads from disk and sets a pixmap on a
2549 botton; the name of the pixmap file is derived from the command
2552 * src/toolbar.h: remove members isBitmap and pixmap from
2555 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2556 * lib/images/: move many files from images/banner.xpm.
2558 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2560 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2561 * src/toolbar.C: ditto.
2562 * configure.in: ditto.
2563 * INSTALL: document.
2565 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2566 the spellchecker popup is closed from the WM.
2568 2000-07-19 Juergen Vigna <jug@sad.it>
2570 * src/insets/insetfloat.C (Write): small fix because we use the
2571 insetname for the type now!
2573 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2575 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2578 * src/frontends/Dialogs.h: removed hideCitation signal
2580 * src/insets/insetcite.h: added hide signal
2582 * src/insets/insetcite.C (~InsetCitation): emits new signal
2583 (getScreenLabel): "intelligent" label should now fit on the screen!
2585 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2587 * src/frontends/xforms/FormCitation.C (showInset): connects
2588 hide() to the inset's hide signal
2589 (show): modified to use fl_set_object_position rather than
2590 fl_set_object_geometry wherever possible
2592 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2594 * src/insets/lyxinset.h: add caption code
2596 * src/insets/insetfloat.C (type): new method
2598 * src/insets/insetcaption.C (Write): new method
2600 (LyxCode): new method
2602 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2603 to get it right together with using the FloatList.
2605 * src/commandtags.h: add LFUN_INSET_CAPTION
2606 * src/lyxfunc.C (Dispatch): handle it
2608 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2611 * src/Variables.[Ch]: make expand take a const reference, remove
2612 the destructor, some whitespace changes.
2614 * src/LyXAction.C (init): add caption-inset-insert
2616 * src/FloatList.C (FloatList): update the default floats a bit.
2618 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2620 * src/Variables.[Ch]: new files. Intended to be used for language
2621 specific strings (like \chaptername) and filename substitution in
2624 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2626 * lib/kbd/american.kmap: update
2628 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2630 * src/bufferparams.[Ch]: remove member allowAccents.
2632 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2634 * src/LaTeXLog.C: use the log_form.h header.
2635 * src/lyx_gui.C: ditto.
2636 * src/lyx_gui_misc.C: ditto.
2637 * src/lyxvc.h: ditto.
2639 * forms/log_form.fd: new file, created from latexoptions.fd. I
2640 kept the log popup and nuked the options form.
2642 * src/{la,}texoptions.[Ch]: removed.
2643 * src/lyx_cb.C (LaTeXOptions): ditto
2645 * src/lyx_gui.C (create_forms): do not handle the
2646 fd_latex_options form.
2648 2000-07-18 Juergen Vigna <jug@sad.it>
2650 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2651 name of the inset so that it can be requested outside (text2.C).
2653 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2656 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2658 * src/mathed/formula.h (ConvertFont): constify
2660 * src/mathed/formula.C (Read): add warning if \end_inset is not
2661 found on expected place.
2663 * src/insets/lyxinset.h (ConvertFont): consify
2665 * src/insets/insetquotes.C (ConvertFont): constify
2666 * src/insets/insetquotes.h: ditto
2668 * src/insets/insetinfo.h: add labelfont
2670 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2671 (ascent): use labelfont
2675 (Write): make .lyx file a bit nicer
2677 * src/insets/insetfloat.C (Write): simplify somewhat...
2678 (Read): add warning if arg is not found
2680 * src/insets/insetcollapsable.C: add using std::max
2681 (Read): move string token and add warning in arg is not found
2682 (draw): use std::max to get the right ty
2683 (getMaxWidth): simplify by using std::max
2685 * src/insets/insetsection.h: new file
2686 * src/insets/insetsection.C: new file
2687 * src/insets/insetcaption.h: new file
2688 * src/insets/insetcaption.C: new file
2690 * src/insets/inset.C (ConvertFont): constify signature
2692 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2693 insetcaption.[Ch] and insetsection.[Ch]
2695 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2696 uses to use LABEL_COUNTER_CHAPTER instead.
2697 * src/text2.C (SetCounter): here
2699 * src/counters.h: new file
2700 * src/counters.C: new file
2701 * src/Sectioning.h: new file
2702 * src/Sectioning.C: new file
2704 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2706 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2708 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2711 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2714 2000-07-17 Juergen Vigna <jug@sad.it>
2716 * src/tabular.C (Validate): check if array-package is needed.
2717 (SetVAlignment): added support for vertical alignment.
2718 (SetLTFoot): better support for longtable header/footers
2719 (Latex): modified to support added features.
2721 * src/LaTeXFeatures.[Ch]: added array-package.
2723 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2725 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2728 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2730 * configure.in: do not forget to put a space after -isystem.
2732 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2734 * lib/kbd/arabic.kmap: a few fixes.
2736 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2738 * some whitespace chagnes to a number of files.
2740 * src/support/DebugStream.h: change to make it easier for
2741 doc++ to parse correctly.
2742 * src/support/lyxstring.h: ditto
2744 * src/mathed/math_utils.C (compara): change to have only one
2746 (MathedLookupBOP): change because of the above.
2748 * src/mathed/math_delim.C (math_deco_compare): change to have only
2750 (search_deco): change becasue of the above.
2752 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2753 instead of manually coded one.
2755 * src/insets/insetquotes.C (Read): read the \end_inset too
2757 * src/insets/insetlatex.h: remove file
2758 * src/insets/insetlatex.C: remove file
2760 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2762 (InsetPrintIndex): remove destructor
2764 * src/insets/insetinclude.h: remove default constructor
2766 * src/insets/insetfloat.C: work to make it work better
2768 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2770 * src/insets/insetcite.h (InsetCitation): remove default constructor
2772 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2774 * src/text.C (GetColumnNearX): comment out some currently unused code.
2776 * src/paragraph.C (writeFile): move some initializations closer to
2778 (CutIntoMinibuffer): small change to use new matchIT operator
2782 (InsertInset): ditto
2785 (InsetIterator): ditto
2786 (Erase): small change to use new matchFT operator
2788 (GetFontSettings): ditto
2789 (HighestFontInRange): ditto
2792 * src/lyxparagraph.h: some chars changed to value_type
2793 (matchIT): because of some stronger checking (perhaps too strong)
2794 in SGI STL, the two operator() unified to one.
2797 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2799 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2800 the last inset read added
2801 (parseSingleLyXformat2Token): some more (future) compability code added
2802 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2803 (parseSingleLyXformat2Token): set last_inset_read
2804 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2805 (parseSingleLyXformat2Token): don't double intializw string next_token
2807 * src/TextCache.C (text_fits::operator()): add const's to the signature
2808 (has_buffer::operator()): ditto
2810 * src/Floating.h: add some comments on the class
2812 * src/FloatList.[Ch] (typeExist): new method
2815 * src/BackStack.h: added default constructor, wanted by Gcc.
2817 2000-07-14 Juergen Vigna <jug@sad.it>
2819 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2821 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2823 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2824 do a redraw when the window is resized!
2825 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2827 * src/insets/insettext.C (resizeLyXText): added function to correctly
2828 being able to resize the LyXWindow.
2830 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2832 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2834 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2835 crashes when closing dialog to a deleted inset.
2837 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2838 method! Now similar to other insets.
2840 2000-07-13 Juergen Vigna <jug@sad.it>
2842 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2844 * lib/examples/Literate.lyx: small patch!
2846 * src/insets/insetbib.C (Read): added this function because of wrong
2847 Write (without [begin|end]_inset).
2849 2000-07-11 Juergen Vigna <jug@sad.it>
2851 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2852 as the insertInset could not be good!
2854 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2855 the bool param should not be last.
2857 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2859 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2860 did submit that to Karl).
2862 * configure.in: use -isystem instead of -I for X headers. This
2863 fixes a problem on solaris with a recent gcc;
2864 put the front-end code after the X detection code;
2865 configure in sigc++ before lib/
2867 * src/lyx_main.C (commandLineHelp): remove -display from command
2870 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2872 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2873 Also put in Makefile rules for building the ``listerrors''
2874 program for parsing errors from literate programs written in LyX.
2876 * lib/build-listerrors: Added small shell script as part of compile
2877 process. This builds a working ``listerrors'' binary if noweb is
2878 installed and either 1) the VNC X server is installed on the machine,
2879 or 2) the user is compiling from within a GUI. The existence of a GUI
2880 is necessary to use the ``lyx --export'' feature for now. This
2881 hack can be removed once ``lyx --export'' no longer requires a GUI to
2884 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2886 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2887 now passed back correctly from gcc and placed "under" error
2888 buttons in a Literate LyX source.
2890 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2892 * src/text.C (GetColumnNearX): Better behavior when a RTL
2893 paragraph is ended by LTR text.
2895 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2898 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2900 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2901 true when clipboard is empty.
2903 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2905 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2906 row of the paragraph.
2907 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2908 to prevent calculation of bidi tables
2910 2000-07-07 Juergen Vigna <jug@sad.it>
2912 * src/screen.C (ToggleSelection): added y_offset and x_offset
2915 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2918 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2920 * src/insets/insettext.C: fixed Layout-Display!
2922 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2924 * configure.in: add check for strings.h header.
2926 * src/spellchecker.C: include <strings.h> in order to have a
2927 definition for bzero().
2929 2000-07-07 Juergen Vigna <jug@sad.it>
2931 * src/insets/insettext.C (draw): set the status of the bv->text to
2932 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2934 * src/screen.C (DrawOneRow):
2935 (DrawFromTo): redraw the actual row if something has changed in it
2938 * src/text.C (draw): call an update of the toplevel-inset if something
2939 has changed inside while drawing.
2941 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2943 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2945 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2946 processing inside class.
2948 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2949 processing inside class.
2951 * src/insets/insetindex.h new struct Holder, consistent with other
2954 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2955 citation dialog from main code and placed it in src/frontends/xforms.
2956 Dialog launched through signals instead of callbacks
2958 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2960 * lyx.man: update the options description.
2962 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2964 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2965 handle neg values, set min width to 590, add doc about -display
2967 2000-07-05 Juergen Vigna <jug@sad.it>
2969 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2970 calls to BufferView *.
2972 * src/insets/insettext.C (checkAndActivateInset): small fix non
2973 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2975 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2976 their \end_inset token!
2978 2000-07-04 edscott <edscott@imp.mx>
2980 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2981 lib/lyxrc.example: added option \wheel_jump
2983 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2985 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2986 remove support for -width,-height,-xpos and -ypos.
2988 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2990 * src/encoding.[Ch]: New files.
2992 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2993 (text): Call to the underline() method only when needed.
2995 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2997 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2998 encoding(s) for the document.
3000 * src/bufferparams.C (BufferParams): Changed default value of
3003 * src/language.C (newLang): Removed.
3004 (items[]): Added encoding information for all defined languages.
3006 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3007 encoding choice button.
3009 * src/lyxrc.h (font_norm_type): New member variable.
3010 (set_font_norm_type): New method.
3012 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3013 paragraphs with different encodings.
3015 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3016 (TransformChar): Changed to work correctly with Arabic points.
3017 (draw): Added support for drawing Arabic points.
3018 (draw): Removed code for drawing underbars (this is done by
3021 * src/support/textutils.h (IsPrintableNonspace): New function.
3023 * src/BufferView_pimpl.h: Added "using SigC::Object".
3024 * src/LyXView.h: ditto.
3026 * src/insets/insetinclude.h (include_label): Changed to mutable.
3028 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3030 * src/mathed/math_iter.h: remove empty destructor
3032 * src/mathed/math_cursor.h: remove empty destructor
3034 * src/insets/lyxinset.h: add THEOREM_CODE
3036 * src/insets/insettheorem.[Ch]: new files
3038 * src/insets/insetminipage.C: (InsertInset): remove
3040 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3042 (InsertInset): remove
3044 * src/insets/insetlist.C: (InsertList): remove
3046 * src/insets/insetfootlike.[Ch]: new files
3048 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3051 (InsertInset): ditto
3053 * src/insets/insetert.C: remove include Painter.h, reindent
3054 (InsertInset): move to header
3056 * src/insets/insetcollapsable.h: remove explicit from default
3057 contructor, remove empty destructor, add InsertInset
3059 * src/insets/insetcollapsable.C (InsertInset): new func
3061 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3063 * src/vspace.h: add explicit to constructor
3065 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3066 \textcompwordmark, please test this.
3068 * src/lyxrc.C: set ascii_linelen to 65 by default
3070 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3072 * src/commandtags.h: add LFUN_INSET_THEOREM
3074 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3075 (makeLinuxDocFile): remove _some_ of the nice logic
3076 (makeDocBookFile): ditto
3078 * src/Painter.[Ch]: (~Painter): removed
3080 * src/LyXAction.C (init): entry for insettheorem added
3082 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3084 (deplog): code to detect files generated by LaTeX, needs testing
3087 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3089 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3091 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3093 * src/LaTeX.C (deplog): Add a check for files that are going to be
3094 created by the first latex run, part of the project to remove the
3097 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3098 contents to the extension list.
3100 2000-07-04 Juergen Vigna <jug@sad.it>
3102 * src/text.C (NextBreakPoint): added support for needFullRow()
3104 * src/insets/lyxinset.h: added needFullRow()
3106 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3109 * src/insets/insettext.C: lots of changes for update!
3111 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3113 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3115 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3117 * src/insets/insetinclude.C (InsetInclude): fixed
3118 initialization of include_label.
3119 (unique_id): now returns a string.
3121 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3123 * src/LaTeXFeatures.h: new member IncludedFiles, for
3124 a map of key, included file name.
3126 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3127 with the included files for inclusion in SGML preamble,
3128 i. e., linuxdoc and docbook.
3131 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3132 nice (is the generated linuxdoc code to be exported?), that
3133 allows to remove column, and only_body that will be true for
3134 slave documents. Insets are allowed inside SGML font type.
3135 New handling of the SGML preamble for included files.
3136 (makeDocBookFile): the same for docbook.
3138 * src/insets/insetinclude.h:
3139 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3141 (DocBook): new export methods.
3143 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3144 and makeDocBookFile.
3146 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3147 formats to export with command line argument -x.
3149 2000-06-29 Juergen Vigna <jug@sad.it>
3151 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3152 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3154 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3155 region could already been cleared by an inset!
3157 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3159 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3162 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3164 (cursorToggle): remove special handling of lyx focus.
3166 2000-06-28 Juergen Vigna <jug@sad.it>
3168 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3171 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3173 * src/insets/insetindex.C (Edit): add a callback when popup is
3176 * src/insets/insettext.C (LocalDispatch):
3177 * src/insets/insetmarginal.h:
3178 * src/insets/insetlist.h:
3179 * src/insets/insetfoot.h:
3180 * src/insets/insetfloat.h:
3181 * src/insets/insetert.h: add a missing std:: qualifier.
3183 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3185 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3188 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3190 * src/insets/insettext.C (Read): remove tmptok unused variable
3191 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3192 (InsertInset): change for new InsetInset code
3194 * src/insets/insettext.h: add TEXT inline method
3196 * src/insets/insettext.C: remove TEXT macro
3198 * src/insets/insetmarginal.C (Write): new method
3199 (Latex): change output slightly
3201 * src/insets/insetfoot.C (Write): new method
3202 (Latex): change output slightly (don't use endl when no need)
3204 * src/insets/insetert.C (Write): new method
3206 * src/insets/insetcollapsable.h: make button_length, button_top_y
3207 and button_bottm_y protected.
3209 * src/insets/insetcollapsable.C (Write): simplify code by using
3210 tostr. Also do not output the float name, the children class
3211 should to that to get control over own arguments
3213 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3214 src/insets/insetminipage.[Ch]:
3217 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3219 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3221 * src/Makefile.am (lyx_SOURCES): add the new files
3223 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3224 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3225 * src/commandtags.h: ditto
3227 * src/LaTeXFeatures.h: add a std::set of used floattypes
3229 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3231 * src/FloatList.[Ch] src/Floating.h: new files
3233 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3235 * src/lyx_cb.C (TableApplyCB): ditto
3237 * src/text2.C: ditto
3238 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3239 (parseSingleLyXformat2Token): ditto + add code for
3240 backwards compability for old float styles + add code for new insets
3242 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3244 (InsertInset(size_type, Inset *, LyXFont)): new method
3245 (InsetChar(size_type, char)): changed to use the other InsetChar
3246 with a LyXFont(ALL_INHERIT).
3247 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3248 insert the META_INSET.
3250 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3252 * sigc++/thread.h (Threads): from here
3254 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3255 definition out of line
3256 * sigc++/scope.h: from here
3258 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3260 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3261 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3263 * Makefile.am (bindist): new target.
3265 * INSTALL: add instructions for doing a binary distribution.
3267 * development/tools/README.bin.example: update a bit.
3269 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3272 * lib/lyxrc.example: new lyxrc tag \set_color.
3274 * src/lyxfunc.C (Dispatch):
3275 * src/commandtags.h:
3276 * src/LyXAction.C: new lyxfunc "set-color".
3278 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3279 and an x11name given as strings.
3281 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3282 cache when a color is changed.
3284 2000-06-26 Juergen Vigna <jug@sad.it>
3286 * src/lyxrow.C (width): added this functions and variable.
3288 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3291 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3293 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3295 * images/undo_bw.xpm: new icon.
3296 * images/redo_bw.xpm: ditto.
3298 * configure.in (INSTALL_SCRIPT): change value to
3299 ${INSTALL} to avoid failures of install-script target.
3300 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3302 * src/BufferView.h: add a magic "friend" declaration to please
3305 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3307 * forms/cite.fd: modified to allow resizing without messing
3310 * src/insetcite.C: Uses code from cite.fd almost without
3312 User can now resize dialog in the x-direction.
3313 Resizing the dialog in the y-direction is prevented, as the
3314 code does this intelligently already.
3316 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3318 * INSTALL: remove obsolete entry in "problems" section.
3320 * lib/examples/sl_*.lyx: update of the slovenian examples.
3322 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3324 2000-06-23 Juergen Vigna <jug@sad.it>
3326 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3328 * src/buffer.C (resize): delete the LyXText of textinsets.
3330 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3332 * src/insets/lyxinset.h: added another parameter 'cleared' to
3333 the draw() function.
3335 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3336 unlocking inset in inset.
3338 2000-06-22 Juergen Vigna <jug@sad.it>
3340 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3341 of insets and moved first to LyXText.
3343 * src/mathed/formulamacro.[Ch]:
3344 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3346 2000-06-21 Juergen Vigna <jug@sad.it>
3348 * src/text.C (GetVisibleRow): look if I should clear the area or not
3349 using Inset::doClearArea() function.
3351 * src/insets/lyxinset.h: added doClearArea() function and
3352 modified draw(Painter &, ...) to draw(BufferView *, ...)
3354 * src/text2.C (UpdateInset): return bool insted of int
3356 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3358 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3359 combox in the character popup
3361 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3362 BufferParams const & params
3364 2000-06-20 Juergen Vigna <jug@sad.it>
3366 * src/insets/insettext.C (SetParagraphData): set insetowner on
3369 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3371 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3372 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3374 (form_main_): remove
3376 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3377 (create_form_form_main): remove FD_form_main stuff, connect to
3378 autosave_timeout signal
3380 * src/LyXView.[Ch] (getMainForm): remove
3381 (UpdateTimerCB): remove
3382 * src/BufferView_pimpl.h: inherit from SigC::Object
3384 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3385 signal instead of callback
3387 * src/BufferView.[Ch] (cursorToggleCB): remove
3389 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3391 * src/BufferView_pimpl.C: changes because of the one below
3393 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3394 instead of storing a pointer to a LyXText.
3396 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3398 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3400 * src/lyxparagraph.h
3402 * src/paragraph.C: Changed fontlist to a sorted vector.
3404 2000-06-19 Juergen Vigna <jug@sad.it>
3406 * src/BufferView.h: added screen() function.
3408 * src/insets/insettext.C (LocalDispatch): some selection code
3411 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3413 * src/insets/insettext.C (SetParagraphData):
3415 (InsetText): fixes for multiple paragraphs.
3417 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3419 * development/lyx.spec.in: Call configure with ``--without-warnings''
3420 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3421 This should be fine, however, since we generally don't want to be
3422 verbose when making an RPM.
3424 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3426 * lib/scripts/fig2pstex.py: New file
3428 2000-06-16 Juergen Vigna <jug@sad.it>
3430 * src/insets/insettabular.C (UpdateLocal):
3431 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3432 (LocalDispatch): Changed all functions to use LyXText.
3434 2000-06-15 Juergen Vigna <jug@sad.it>
3436 * src/text.C (SetHeightOfRow): call inset::update before requesting
3439 * src/insets/insettext.C (update):
3440 * src/insets/insettabular.C (update): added implementation
3442 * src/insets/lyxinset.h: added update function
3444 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3446 * src/text.C (SelectNextWord): protect against null pointers with
3447 old-style string streams. (fix from Paul Theo Gonciari
3450 * src/cite.[Ch]: remove erroneous files.
3452 * lib/configure.m4: update the list of created directories.
3454 * src/lyxrow.C: include <config.h>
3455 * src/lyxcursor.C: ditto.
3457 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3459 * lib/examples/decimal.lyx: new example file from Mike.
3461 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3462 to find template definitions (from Dekel)
3464 * src/frontends/.cvsignore: add a few things.
3466 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3468 * src/Timeout.C (TimeOut): remove default argument.
3470 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3473 * src/insets/ExternalTemplate.C: add a "using" directive.
3475 * src/lyx_main.h: remove the act_ struct, which seems unused
3478 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3480 * LyX Developers Meeting: All files changed, due to random C++ (by
3481 coincidence) code generator script.
3483 - external inset (cool!)
3484 - initial online editing of preferences
3485 - insettabular breaks insettext(s contents)
3487 - some DocBook fixes
3488 - example files update
3489 - other cool stuff, create a diff and look for yourself.
3491 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3493 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3494 -1 this is a non-line-breaking textinset.
3496 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3497 if there is no width set.
3499 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3501 * Lots of files: Merged the dialogbase branch.
3503 2000-06-09 Allan Rae <rae@lyx.org>
3505 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3506 and the Dispatch methods that used it.
3508 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3509 access to functions formerly kept in Dispatch.
3511 2000-05-19 Allan Rae <rae@lyx.org>
3513 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3514 made to_page and count_copies integers again. from_page remains a
3515 string however because I want to allow entry of a print range like
3516 "1,4,22-25" using this field.
3518 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3519 and printer-params-get. These aren't useful from the minibuffer but
3520 could be used by a script/LyXServer app provided it passes a suitable
3521 auto_mem_buffer. I guess I should take a look at how the LyXServer
3522 works and make it support xtl buffers.
3524 * sigc++/: updated to libsigc++-1.0.1
3526 * src/xtl/: updated to xtl-1.3.pl.11
3528 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3529 those changes done to the files in src/ are actually recreated when
3530 they get regenerated. Please don't ever accept a patch that changes a
3531 dialog unless that patch includes the changes to the corresponding *.fd
3534 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3535 stringOnlyContains, renamed it and generalised it.
3537 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3538 branch. Removed the remaining old form_print code.
3540 2000-04-26 Allan Rae <rae@lyx.org>
3542 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3543 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3545 2000-04-25 Allan Rae <rae@lyx.org>
3547 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3548 against a base of xtl-1.3.pl.4
3550 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3551 filter the Id: entries so they still show the xtl version number
3554 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3555 into the src/xtl code. Patch still pending with José (XTL)
3557 2000-04-24 Allan Rae <rae@lyx.org>
3559 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3560 both more generic and much safer. Use the new template functions.
3561 * src/buffer.[Ch] (Dispatch): ditto.
3563 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3564 and mem buffer more intelligently. Also a little general cleanup.
3567 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3568 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3569 * src/xtl/Makefile.am: ditto.
3570 * src/xtl/.cvsignore: ditto.
3571 * src/Makefile.am: ditto.
3573 * src/PrinterParams.h: Removed the macros member functions. Added a
3574 testInvariant member function. A bit of tidying up and commenting.
3575 Included Angus's idea for fixing operation with egcs-1.1.2.
3577 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3578 cool expansion of XTL's mem_buffer to support automatic memory
3579 management within the buffer itself. Removed the various macros and
3580 replaced them with template functions that use either auto_mem_buffer
3581 or mem_buffer depending on a #define. The mem_buffer support will
3582 disappear as soon as the auto_mem_buffer is confirmed to be good on
3583 other platforms/compilers. That is, it's there so you've got something
3586 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3587 effectively forked XTL. However I expect José will include my code
3588 into the next major release. Also fixed a memory leak.
3589 * src/xtl/text.h: ditto.
3590 * src/xtl/xdr.h: ditto.
3591 * src/xtl/giop.h: ditto.
3593 2000-04-16 Allan Rae <rae@lyx.org>
3595 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3596 by autogen.sh and removed by maintainer-clean anyway.
3597 * .cvsignore, sigc++/.cvsignore: Support the above.
3599 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3601 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3603 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3604 macros, renamed static callback-target member functions to suit new
3605 scheme and made them public.
3606 * src/frontends/xforms/forms/form_print.fd: ditto.
3607 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3609 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3612 * src/xtl/: New directory containing a minimal distribution of XTL.
3613 This is XTL-1.3.pl.4.
3615 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3617 2000-04-15 Allan Rae <rae@lyx.org>
3619 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3621 * sigc++/: Updated to libsigc++-1.0.0
3623 2000-04-14 Allan Rae <rae@lyx.org>
3625 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3626 use the generic ones in future. I'll modify my conversion script.
3628 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3630 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3631 (CloseAllBufferRelatedDialogs): Renamed.
3632 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3634 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3635 of the generic ones. These are the same ones my conversion script
3638 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3639 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3640 * src/buffer.C (Dispatch): ditto
3642 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3643 functions for updating and hiding buffer dependent dialogs.
3644 * src/BufferView.C (buffer): ditto
3645 * src/buffer.C (setReadonly): ditto
3646 * src/lyxfunc.C (CloseBuffer): ditto
3648 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3649 Dialogs.h, and hence all the SigC stuff, into every file that includes
3650 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3652 * src/BufferView2.C: reduce the number of headers included by buffer.h
3654 2000-04-11 Allan Rae <rae@lyx.org>
3656 * src/frontends/xforms/xform_macros.h: A small collection of macros
3657 for building C callbacks.
3659 * src/frontends/xforms/Makefile.am: Added above file.
3661 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3662 scheme again. This time it should work for JMarc. If this is
3663 successful I'll revise my conversion script to automate some of this.
3664 The static member functions in the class also have to be public for
3665 this scheme will work. If the scheme works (it's almost identical to
3666 the way BufferView::cursorToggleCB is handled so it should work) then
3667 FormCopyright and FormPrint will be ready for inclusion into the main
3668 trunk immediately after 1.1.5 is released -- provided we're prepared
3669 for complaints about lame compilers not handling XTL.
3671 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3673 2000-04-07 Allan Rae <rae@lyx.org>
3675 * config/lyxinclude.m4: A bit more tidying up (Angus)
3677 * src/LString.h: JMarc's <string> header fix
3679 * src/PrinterParams.h: Used string for most data to remove some
3680 ugly code in the Print dialog and avoid even uglier code when
3681 appending the ints to a string for output.
3683 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3684 and moved "default:" back to the end of switch statement. Cleaned
3685 up the printing so it uses the right function calls and so the
3686 "print to file" option actually puts the file in the right directory.
3688 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3690 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3691 and Ok+Apply button control into a separate method: input (Angus).
3692 (input) Cleaned it up and improved it to be very thorough now.
3693 (All CB) static_cast used instead of C style cast (Angus). This will
3694 probably change again once we've worked out how to keep gcc-2.8.1 happy
3695 with real C callbacks.
3696 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3697 ignore some of the bool settings and has random numbers instead. Needs
3698 some more investigation. Added other input length checks and checking
3699 of file and printer names.
3701 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3702 would link (Angus). Seems the old code doesn't compile with the pragma
3703 statement either. Separated callback entries from internal methods.
3705 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3707 2000-03-17 Allan Rae <rae@lyx.org>
3709 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3710 need it? Maybe it could go in Dialogs instead? I could make it a
3711 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3712 values to get the bool return value.
3713 (Dispatch): New overloaded method for xtl support.
3715 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3716 extern "C" callback instead of static member functions. Hopefully,
3717 JMarc will be able to compile this. I haven't changed
3718 forms/form_copyright.fd yet. Breaking one of my own rules already.
3720 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3721 because they aren't useful from the minibuffer. Maybe a LyXServer
3722 might want a help message though?
3724 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3726 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3727 xtl which needs both rtti and exceptions.
3729 * src/support/Makefile.am:
3730 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3732 * src/frontends/xforms/input_validators.[ch]: input filters and
3733 validators. These conrol what keys are valid in input boxes.
3734 Use them and write some more. Much better idea than waiting till
3735 after the user has pressed Ok to say that the input fields don't make
3738 * src/frontends/xforms/Makefile.am:
3739 * src/frontends/xforms/forms/form_print.fd:
3740 * src/frontends/xforms/forms/makefile:
3741 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3742 new scheme. Still have to make sure I haven't missed anything from
3743 the current implementation.
3745 * src/Makefile.am, src/PrinterParams.h: New data store.
3747 * other files: Added a couple of copyright notices.
3749 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3751 * src/insets/insetbib.h: move Holder struct in public space.
3753 * src/frontends/include/DialogBase.h: use SigC:: only when
3754 SIGC_CXX_NAMESPACES is defined.
3755 * src/frontends/include/Dialogs.h: ditto.
3757 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3759 * src/frontends/xforms/FormCopyright.[Ch]: do not
3760 mention SigC:: explicitely.
3762 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3764 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3765 deals with testing KDE in main configure.in
3766 * configure.in: ditto.
3768 2000-02-22 Allan Rae <rae@lyx.org>
3770 * Lots of files: Merged from HEAD
3772 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3773 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3775 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3777 * sigc++/: new minidist.
3779 2000-02-14 Allan Rae <rae@lyx.org>
3781 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3783 2000-02-08 Juergen Vigna <jug@sad.it>
3785 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3786 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3788 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3789 for this port and so it is much easier for other people to port
3790 dialogs in a common development environment.
3792 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3793 the QT/KDE implementation.
3795 * src/frontends/kde/Dialogs.C:
3796 * src/frontends/kde/FormCopyright.C:
3797 * src/frontends/kde/FormCopyright.h:
3798 * src/frontends/kde/Makefile.am:
3799 * src/frontends/kde/formcopyrightdialog.C:
3800 * src/frontends/kde/formcopyrightdialog.h:
3801 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3802 for the kde support of the Copyright-Dialog.
3804 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3805 subdir-substitution instead of hardcoded 'xforms' as we now have also
3808 * src/frontends/include/DialogBase.h (Object): just commented the
3809 label after #endif (nasty warning and I don't like warnings ;)
3811 * src/main.C (main): added KApplication initialization if using
3814 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3815 For now only the KDE event-loop is added if frontend==kde.
3817 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3819 * configure.in: added support for the --with-frontend[=value] option
3821 * autogen.sh: added kde.m4 file to list of config-files
3823 * acconfig.h: added define for KDEGUI-support
3825 * config/kde.m4: added configuration functions for KDE-port
3827 * config/lyxinclude.m4: added --with-frontend[=value] option with
3828 support for xforms and KDE.
3830 2000-02-08 Allan Rae <rae@lyx.org>
3832 * all Makefile.am: Fixed up so the make targets dist, distclean,
3833 install and uninstall all work even if builddir != srcdir. Still
3834 have a new sigc++ minidist update to come.
3836 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3838 2000-02-01 Allan Rae <rae@lyx.org>
3840 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3841 Many mods to get builddir != srcdir working.
3843 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3844 for building on NT and so we can do the builddir != srcdir stuff.
3846 2000-01-30 Allan Rae <rae@lyx.org>
3848 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3849 This will stay in "rae" branch. We probably don't really need it in
3850 the main trunk as anyone who wants to help programming it should get
3851 a full library installed also. So they can check both included and
3852 system supplied library compilation.
3854 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3855 Added a 'mini' distribution of libsigc++. If you feel the urge to
3856 change something in these directories - Resist it. If you can't
3857 resist the urge then you should modify the following script and rebuild
3858 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3859 all happen. Still uses a hacked version of libsigc++'s configure.in.
3860 I'm quite happy with the results. I'm not sure the extra work to turn
3861 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3862 worth the trouble and would probably lead to extra maintenance
3864 I haven't tested the following important make targets: install, dist.
3865 Not ready for prime time but very close. Maybe 1.1.5.
3867 * development/tools/makeLyXsigc.sh: A shell script to automatically
3868 generate our mini-dist of libsigc++. It can only be used with a CVS
3869 checkout of libsigc++ not a tarball distribution. It's well commented.
3870 This will end up as part of the libsigc++ distribution so other apps
3871 can easily have an included mini-dist. If someone makes mods to the
3872 sigc++ subpackage without modifying this script to generate those
3873 changes I'll be very upset!
3875 * src/frontends/: Started the gui/system indep structure.
3877 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3878 to access the gui-indep dialogs are in this class. Much improved
3879 design compared to previous revision. Lars, please refrain from
3880 moving this header into src/ like you did with Popups.h last time.
3882 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3884 * src/frontends/xforms/: Started the gui-indep system with a single
3885 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3888 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3889 Here you'll find a very useful makefile and automated fdfix.sh that
3890 makes updating dailogs a no-brainer -- provided you follow the rules
3891 set out in the README. I'm thinking about adding another script to
3892 automatically generate skeleton code for a new dialog given just the
3895 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3896 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3897 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3899 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3901 * src/support/LSubstring.C (operator): simplify
3903 * src/lyxtext.h: removed bparams, use buffer_->params instead
3905 * src/lyxrow.h: make Row a real class, move all variables to
3906 private and use accessors.
3908 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3910 (isRightToLeftPar): ditto
3911 (ChangeLanguage): ditto
3912 (isMultiLingual): ditto
3915 (SimpleTeXOnePar): ditto
3916 (TeXEnvironment): ditto
3917 (GetEndLabel): ditto
3919 (SetOnlyLayout): ditto
3920 (BreakParagraph): ditto
3921 (BreakParagraphConservative): ditto
3922 (GetFontSettings): ditto
3924 (CopyIntoMinibuffer): ditto
3925 (CutIntoMinibuffer): ditto
3926 (PasteParagraph): ditto
3927 (SetPExtraType): ditto
3928 (UnsetPExtraType): ditto
3929 (DocBookContTableRows): ditto
3930 (SimpleDocBookOneTablePar): ditto
3932 (TeXFootnote): ditto
3933 (SimpleTeXOneTablePar): ditto
3934 (TeXContTableRows): ditto
3935 (SimpleTeXSpecialChars): ditto
3938 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3939 to private and use accessors.
3941 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3942 this, we did not use it anymore and has not been for ages. Just a
3943 waste of cpu cycles.
3945 * src/language.h: make Language a real class, move all variables
3946 to private and use accessors.
3948 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3949 (create_view): remove
3950 (update): some changes for new timer
3951 (cursorToggle): use new timer
3952 (beforeChange): change for new timer
3954 * src/BufferView.h (cursorToggleCB): removed last paramter because
3957 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3958 (cursorToggleCB): change because of new timer code
3960 * lib/CREDITS: updated own mailaddress
3962 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3964 * src/support/filetools.C (PutEnv): fix the code in case neither
3965 putenv() nor setenv() have been found.
3967 * INSTALL: mention the install-strip Makefile target.
3969 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3970 read-only documents.
3972 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3974 * lib/reLyX/configure.in (VERSION): avoid using a previously
3975 generated reLyX wrapper to find out $prefix.
3977 * lib/examples/eu_adibide_lyx-atua.lyx:
3978 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3979 translation of the Tutorial (Dooteo)
3981 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3983 * forms/cite.fd: new citation dialog
3985 * src/insetcite.[Ch]: the new citation dialog is moved into
3988 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3991 * src/insets/insetcommand.h: data members made private.
3993 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3995 * LyX 1.1.5 released
3997 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3999 * src/version.h (LYX_RELEASE): to 1.1.5
4001 * src/spellchecker.C (RunSpellChecker): return false if the
4002 spellchecker dies upon creation.
4004 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4006 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4007 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4011 * lib/CREDITS: update entry for Martin Vermeer.
4013 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4015 * src/text.C (draw): Draw foreign language bars at the bottom of
4016 the row instead of at the baseline.
4018 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4020 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4022 * lib/bind/de_menus.bind: updated
4024 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4026 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4028 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4030 * src/menus.C (Limit_string_length): New function
4031 (ShowTocMenu): Limit the number of items/length of items in the
4034 * src/paragraph.C (String): Correct result for a paragraph inside
4037 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4039 * src/bufferlist.C (close): test of buf->getuser() == NULL
4041 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4043 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4044 Do not call to SetCursor when the paragraph is a closed footnote!
4046 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4048 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4051 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4053 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4056 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4057 reference popup, that activates the reference-back action
4059 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4061 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4062 the menus. Also fixed a bug.
4064 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4065 the math panels when switching buffers (unless new buffer is readonly).
4067 * src/BufferView.C (NoSavedPositions)
4068 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4070 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4072 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4073 less of dvi dirty or not.
4075 * src/trans_mgr.[Ch] (insert): change first parameter to string
4078 * src/chset.[Ch] (encodeString): add const to first parameter
4080 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4082 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4086 * src/LaTeX.C (deplog): better searching for dependency files in
4087 the latex log. Uses now regexps.
4089 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4090 instead of the box hack or \hfill.
4092 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4094 * src/lyxfunc.C (doImportHelper): do not create the file before
4095 doing the actual import.
4096 (doImportASCIIasLines): create a new file before doing the insert.
4097 (doImportASCIIasParagraphs): ditto.
4099 * lib/lyxrc.example: remove mention of non-existing commands
4101 * lyx.man: remove mention of color-related switches.
4103 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4105 * src/lyx_gui.C: remove all the color-related ressources, which
4106 are not used anymore.
4108 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4111 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4113 * src/lyxrc.C (read): Add a missing break in the switch
4115 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4117 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4119 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4122 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4124 * src/text.C (draw): draw bars under foreign language words.
4126 * src/LColor.[Ch]: add LColor::language
4128 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4130 * src/lyxcursor.h (boundary): New member variable
4132 * src/text.C (IsBoundary): New methods
4134 * src/text.C: Use the above for currect cursor movement when there
4135 is both RTL & LTR text.
4137 * src/text2.C: ditto
4139 * src/bufferview_funcs.C (ToggleAndShow): ditto
4141 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4143 * src/text.C (DeleteLineForward): set selection to true to avoid
4144 that DeleteEmptyParagraphMechanism does some magic. This is how it
4145 is done in all other functions, and seems reasonable.
4146 (DeleteWordForward): do not jump over non-word stuff, since
4147 CursorRightOneWord() already does it.
4149 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4150 DeleteWordBackward, since they seem safe to me (since selection is
4151 set to "true") DeleteEmptyParagraphMechanism does nothing.
4153 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4155 * src/lyx_main.C (easyParse): simplify the code by factoring the
4156 part that removes parameters from the command line.
4157 (LyX): check wether wrong command line options have been given.
4159 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4161 * src/lyx_main.C : add support for specifying user LyX
4162 directory via command line option -userdir.
4164 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4166 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4167 the number of items per popup.
4168 (Add_to_refs_menu): Ditto.
4170 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4172 * src/lyxparagraph.h: renamed ClearParagraph() to
4173 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4174 textclass as parameter, and do nothing if free_spacing is
4175 true. This fixes part of the line-delete-forward problems.
4177 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4178 (pasteSelection): ditto.
4179 (SwitchLayoutsBetweenClasses): more translatable strings.
4181 * src/text2.C (CutSelection): use StripLeadingSpaces.
4182 (PasteSelection): ditto.
4183 (DeleteEmptyParagraphMechanism): ditto.
4185 2000-05-26 Juergen Vigna <jug@sad.it>
4187 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4188 is not needed in tabular insets.
4190 * src/insets/insettabular.C (TabularFeatures): added missing features.
4192 * src/tabular.C (DeleteColumn):
4194 (AppendRow): implemented this functions
4195 (cellsturct::operator=): clone the inset too;
4197 2000-05-23 Juergen Vigna <jug@sad.it>
4199 * src/insets/insettabular.C (LocalDispatch): better selection support
4200 when having multicolumn-cells.
4202 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4204 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4206 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4208 * src/ColorHandler.C (getGCForeground): put more test into _()
4210 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4213 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4216 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4218 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4219 there are no labels, or when buffer is readonly.
4221 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4222 there are no labels, buffer is SGML, or when buffer is readonly.
4224 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4226 * src/LColor.C (LColor): change a couple of grey40 to grey60
4227 (LColor): rewore initalization to make compiles go some magnitude
4229 (getGUIName): don't use gettext until we need the string.
4231 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4233 * src/Bullet.[Ch]: Fixed a small bug.
4235 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4237 * src/paragraph.C (String): Several fixes/improvements
4239 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4241 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * src/paragraph.C (String): give more correct output.
4245 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4247 * src/lyxfont.C (stateText) Do not output the language if it is
4248 eqaul to the language of the document.
4250 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4251 between two paragraphs with the same language.
4253 * src/paragraph.C (getParLanguage) Return a correct answer for an
4254 empty dummy paragraph.
4256 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4259 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4262 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4263 the menus/popup, if requested fonts are unavailable.
4265 2000-05-22 Juergen Vigna <jug@sad.it>
4267 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4268 movement support (Up/Down/Tab/Shift-Tab).
4269 (LocalDispatch): added also preliminari cursor-selection.
4271 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4273 * src/paragraph.C (PasteParagraph): Hopefully now right!
4275 2000-05-22 Garst R. Reese <reese@isn.net>
4277 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4278 of list, change all references to Environment to Command
4279 * tex/hollywood.cls : rewrite environments as commands, add
4280 \uppercase to interiorshot and exteriorshot to force uppecase.
4281 * tex/broadway.cls : rewrite environments as commands. Tweak
4284 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4286 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4287 size of items: use a constant intead of the hardcoded 40, and more
4288 importantly do not remove the %m and %x tags added at the end.
4289 (Add_to_refs_menu): use vector::size_type instead of
4290 unsigned int as basic types for the variables. _Please_ do not
4291 assume that size_t is equal to unsigned int. On an alpha, this is
4292 unsigned long, which is _not_ the same.
4294 * src/language.C (initL): remove language "hungarian", since it
4295 seems that "magyar" is better.
4297 2000-05-22 Juergen Vigna <jug@sad.it>
4299 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4301 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4304 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4305 next was deleted but not set to 0.
4307 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4309 * src/language.C (initL): change the initialization of languages
4310 so that compiles goes _fast_.
4312 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4315 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4317 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4321 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4323 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4325 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4329 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4332 * src/insets/insetlo*.[Ch]: Made editable
4334 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4336 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4337 the current selection.
4339 * src/BufferView_pimpl.C (stuffClipboard): new method
4341 * src/BufferView.C (stuffClipboard): new method
4343 * src/paragraph.C (String): new method
4345 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4346 LColor::ignore when lyxname is not found.
4348 * src/BufferView.C (pasteSelection): new method
4350 * src/BufferView_pimpl.C (pasteSelection): new method
4352 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4354 * src/WorkArea.C (request_clipboard_cb): new static function
4355 (getClipboard): new method
4356 (putClipboard): new method
4358 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4360 * LyX 1.1.5pre2 released
4362 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * src/vspace.C (operator=): removed
4365 (operator=): removed
4367 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4369 * src/layout.C (NumberOfClass): manually set the type in make_pair
4370 (NumberOfLayout): ditto
4372 * src/language.C: use the Language constructor for ignore_lang
4374 * src/language.h: add constructors to struct Language
4376 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4378 * src/text2.C (SetCursorIntern): comment out #warning
4380 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4382 * src/mathed/math_iter.h: initialize sx and sw to 0
4384 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4386 * forms/lyx.fd: Redesign of form_ref
4388 * src/LaTeXFeatures.[Ch]
4392 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4395 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4396 and Buffer::inset_iterator.
4398 * src/menus.C: Added new menus: TOC and Refs.
4400 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4402 * src/buffer.C (getTocList): New method.
4404 * src/BufferView2.C (ChangeRefs): New method.
4406 * src/buffer.C (getLabelList): New method. It replaces the old
4407 getReferenceList. The return type is vector<string> instead of
4410 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4411 the old getLabel() and GetNumberOfLabels() methods.
4412 * src/insets/insetlabel.C (getLabelList): ditto
4413 * src/mathed/formula.C (getLabelList): ditto
4415 * src/paragraph.C (String): New method.
4417 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4418 Uses the new getTocList() method.
4419 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4420 which automatically updates the contents of the browser.
4421 (RefUpdateCB): Use the new getLabelList method.
4423 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4425 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4427 * src/spellchecker.C: Added using std::reverse;
4429 2000-05-19 Juergen Vigna <jug@sad.it>
4431 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4433 * src/insets/insettext.C (computeTextRows): small fix for display of
4434 1 character after a newline.
4436 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4439 2000-05-18 Juergen Vigna <jug@sad.it>
4441 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4442 when changing width of column.
4444 * src/tabular.C (set_row_column_number_info): setting of
4445 autobreak rows if necessary.
4447 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4449 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4451 * src/vc-backend.*: renamed stat() to status() and vcstat to
4452 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4453 compilation broke. The new name seems more relevant, anyway.
4455 2000-05-17 Juergen Vigna <jug@sad.it>
4457 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4458 which was wrong if the removing caused removing of rows!
4460 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4461 (pushToken): new function.
4463 * src/text2.C (CutSelection): fix problem discovered with purify
4465 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4467 * src/debug.C (showTags): enlarge the first column, now that we
4468 have 6-digits debug codes.
4470 * lib/layouts/hollywood.layout:
4471 * lib/tex/hollywood.cls:
4472 * lib/tex/brodway.cls:
4473 * lib/layouts/brodway.layout: more commands and fewer
4474 environments. Preambles moved in the .cls files. Broadway now has
4475 more options on scene numbering and less whitespace (from Garst)
4477 * src/insets/insetbib.C (getKeys): make sure that we are in the
4478 document directory, in case the bib file is there.
4480 * src/insets/insetbib.C (Latex): revert bogus change.
4482 2000-05-16 Juergen Vigna <jug@sad.it>
4484 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4485 the TabularLayout on cursor move.
4487 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4489 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4492 (draw): fixed cursor position and drawing so that the cursor is
4493 visible when before the tabular-inset.
4495 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4496 when creating from old insettext.
4498 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4500 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4502 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4503 * lib/tex/brodway.cls: ditto
4505 * lib/layouts/brodway.layout: change alignment of parenthical
4508 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4510 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4511 versions 0.88 and 0.89 are supported.
4513 2000-05-15 Juergen Vigna <jug@sad.it>
4515 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4518 * src/insets/insettext.C (computeTextRows): redone completely this
4519 function in a much cleaner way, because of problems when having a
4521 (draw): added a frame border when the inset is locked.
4522 (SetDrawLockedFrame): this sets if we draw the border or not.
4523 (SetFrameColor): this sets the frame color (default=insetframe).
4525 * src/insets/lyxinset.h: added x() and y() functions which return
4526 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4527 function which is needed to see if we have a locking inset of some
4528 type in this inset (needed for now in insettabular).
4530 * src/vspace.C (inPixels): the same function also without a BufferView
4531 parameter as so it is easier to use it in some ocasions.
4533 * src/lyxfunc.C: changed all places where insertInset was used so
4534 that now if it couldn't be inserted it is deleted!
4536 * src/TabularLayout.C:
4537 * src/TableLayout.C: added support for new tabular-inset!
4539 * src/BufferView2.C (insertInset): this now returns a bool if the
4540 inset was really inserted!!!
4542 * src/tabular.C (GetLastCellInRow):
4543 (GetFirstCellInRow): new helper functions.
4544 (Latex): implemented for new tabular class.
4548 (TeXTopHLine): new Latex() helper functions.
4550 2000-05-12 Juergen Vigna <jug@sad.it>
4552 * src/mathed/formulamacro.C (Read):
4553 * src/mathed/formula.C (Read): read also the \end_inset here!
4555 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4557 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4558 crush when saving formulae with unbalanced parenthesis.
4560 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4562 * src/layout.C: Add new keyword "endlabelstring" to layout file
4564 * src/text.C (GetVisibleRow): Draw endlabel string.
4566 * lib/layouts/broadway.layout
4567 * lib/layouts/hollywood.layout: Added endlabel for the
4568 Parenthetical layout.
4570 * lib/layouts/heb-article.layout: Do not use slanted font shape
4571 for Theorem like environments.
4573 * src/buffer.C (makeLaTeXFile): Always add "american" to
4574 the UsedLanguages list if document language is RTL.
4576 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4578 * add addendum to README.OS2 and small patch (from SMiyata)
4580 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4582 * many files: correct the calls to ChangeExtension().
4584 * src/support/filetools.C (ChangeExtension): remove the no_path
4585 argument, which does not belong there. Use OnlyFileName() instead.
4587 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4588 files when LaTeXing a non-nice latex file.
4590 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4591 a chain of "if". Return false when deadkeys are not handled.
4593 * src/lyx_main.C (LyX): adapted the code for default bindings.
4595 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4596 bindings for basic functionality (except deadkeys).
4597 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4599 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4600 several methods: handle override_x_deadkeys.
4602 * src/lyxrc.h: remove the "bindings" map, which did not make much
4603 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4605 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4607 * src/lyxfont.C (stateText): use a saner method to determine
4608 whether the font is "default". Seems to fix the crash with DEC
4611 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4613 2000-05-08 Juergen Vigna <jug@sad.it>
4615 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4616 TabularLayoutMenu with mouse-button-3
4617 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4619 * src/TabularLayout.C: added this file for having a Layout for
4622 2000-05-05 Juergen Vigna <jug@sad.it>
4624 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4625 recalculating inset-widths.
4626 (TabularFeatures): activated this function so that I can change
4627 tabular-features via menu.
4629 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4630 that I can test some functions with the Table menu.
4632 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4634 * src/lyxfont.C (stateText): guard against stupid c++libs.
4636 * src/tabular.C: add using std::vector
4637 some whitespace changes, + removed som autogenerated code.
4639 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4641 2000-05-05 Juergen Vigna <jug@sad.it>
4643 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4644 row, columns and cellstructures.
4646 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4648 * lib/lyxrc.example: remove obsolete entries.
4650 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4651 reading of protected_separator for free_spacing.
4653 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4655 * src/text.C (draw): do not display an exclamation mark in the
4656 margin for margin notes. This is confusing, ugly and
4659 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4660 AMS math' is checked.
4662 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4663 name to see whether including the amsmath package is needed.
4665 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4667 * src/paragraph.C (validate): Compute UsedLanguages correctly
4668 (don't insert the american language if it doesn't appear in the
4671 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4672 The argument of \thanks{} command is considered moving argument
4674 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4677 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4679 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4680 for appendix/minipage/depth. The lines can be now both in the footnote
4681 frame, and outside the frame.
4683 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4686 2000-05-05 Juergen Vigna <jug@sad.it>
4688 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4689 neede only in tabular.[Ch].
4691 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4693 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4695 (Write): write '~' for PROTECTED_SEPARATOR
4697 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4699 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4702 * src/mathed/formula.C (drawStr): rename size to siz.
4704 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4705 possibly fix a bug by not changing the pflags = flags to piflags =
4708 2000-05-05 Juergen Vigna <jug@sad.it>
4710 * src/insets/insetbib.C: moved using directive
4712 * src/ImportNoweb.C: small fix for being able to compile (missing
4715 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4717 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4718 to use clear, since we don't depend on this in the code. Add test
4721 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4723 * (various *.C files): add using std::foo directives to please dec
4726 * replace calls to string::clear() to string::erase() (Angus)
4728 * src/cheaders/cmath: modified to provide std::abs.
4730 2000-05-04 Juergen Vigna <jug@sad.it>
4732 * src/insets/insettext.C: Prepared all for inserting of multiple
4733 paragraphs. Still display stuff to do (alignment and other things),
4734 but I would like to use LyXText to do this when we cleaned out the
4735 table-support stuff.
4737 * src/insets/insettabular.C: Changed lot of stuff and added lots
4738 of functionality still a lot to do.
4740 * src/tabular.C: Various functions changed name and moved to be
4741 const functions. Added new Read and Write functions and changed
4742 lots of things so it works good with tabular-insets (also removed
4743 some stuff which is not needed anymore * hacks *).
4745 * src/lyxcursor.h: added operators == and != which just look if
4746 par and pos are (not) equal.
4748 * src/buffer.C (latexParagraphs): inserted this function to latex
4749 all paragraphs form par to endpar as then I can use this too for
4752 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4753 so that I can call this to from text insets with their own cursor.
4755 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4756 output off all paragraphs (because of the fix below)!
4758 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4759 the very last paragraph (this could be also the last paragraph of an
4762 * src/texrow.h: added rows() call which returns the count-variable.
4764 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4766 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4768 * lib/configure.m4: better autodetection of DocBook tools.
4770 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4774 * src/lyx_cb.C: add using std::reverse;
4776 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4779 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4780 selected files. Should fix repeated errors from generated files.
4782 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4784 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4786 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4787 the spellchecker popup.
4789 * lib/lyxrc.example: Removed the \number_inset section
4791 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4793 * src/insets/figinset.C (various): Use IsFileReadable() to make
4794 sure that the file actually exist. Relying on ghostscripts errors
4795 is a bad idea since they can lead to X server crashes.
4797 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4799 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4802 * lib/lyxrc.example: smallish typo in description of
4803 \view_dvi_paper_option
4805 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4808 * src/lyxfunc.C: doImportHelper to factor out common code of the
4809 various import methods. New functions doImportASCIIasLines,
4810 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4811 doImportLinuxDoc for the format specific parts.
4814 * buffer.C: Dispatch returns now a bool to indicate success
4817 * lyx_gui.C: Add getLyXView() for member access
4819 * lyx_main.C: Change logic for batch commands: First try
4820 Buffer::Dispatch (possibly without GUI), if that fails, use
4823 * lyx_main.C: Add support for --import command line switch.
4824 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4825 Available Formats: Everything accepted by 'buffer-import <format>'
4827 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4829 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4832 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4833 documents will be reformatted upon reentry.
4835 2000-04-27 Juergen Vigna <jug@sad.it>
4837 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4838 correctly only last pos this was a bug.
4840 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4842 * release of lyx-1.1.5pre1
4844 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4846 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4848 * src/menus.C: revert the change of naming (Figure->Graphic...)
4849 from 2000-04-11. It was incomplete and bad.
4851 * src/LColor.[Ch]: add LColor::depthbar.
4852 * src/text.C (GetVisibleRow): use it.
4854 * README: update the languages list.
4856 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4858 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4861 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4863 * README: remove sections that were just wrong.
4865 * src/text2.C (GetRowNearY): remove currentrow code
4867 * src/text.C (GetRow): remove currentrow code
4869 * src/screen.C (Update): rewritten a bit.
4870 (SmallUpdate): removed func
4872 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4874 (FullRebreak): return bool
4875 (currentrow): remove var
4876 (currentrow_y): ditto
4878 * src/lyxscreen.h (Draw): change arg to unsigned long
4879 (FitCursor): return bool
4880 (FitManualCursor): ditto
4881 (Smallpdate): remove func
4882 (first): change to unsigned long
4883 (DrawOneRow): change second arg to long (from long &)
4884 (screen_refresh_y): remove var
4885 (scree_refresh_row): ditto
4887 * src/lyxrow.h: change baseline to usigned int from unsigned
4888 short, this brings some implicit/unsigned issues out in the open.
4890 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4892 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4893 instead of smallUpdate.
4895 * src/lyxcursor.h: change y to unsigned long
4897 * src/buffer.h: don't call updateScrollbar after fitcursor
4899 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4900 where they are used. Removed "\\direction", this was not present
4901 in 1.1.4 and is already obsolete. Commented out some code that I
4902 believe to never be called.
4903 (runLiterate): don't call updateScrollbar after fitCursor
4905 (buildProgram): ditto
4908 * src/WorkArea.h (workWidth): change return val to unsigned
4911 (redraw): remove the button redraws
4912 (setScrollbarValue): change for scrollbar
4913 (getScrollbarValue): change for scrollbar
4914 (getScrollbarBounds): change for scrollbar
4916 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4917 (C_WorkArea_down_cb): removed func
4918 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4919 (resize): change for scrollbar
4920 (setScrollbar): ditto
4921 (setScrollbarBounds): ditto
4922 (setScrollbarIncrements): ditto
4923 (up_cb): removed func
4924 (down_cb): removed func
4925 (scroll_cb): change for scrollbar
4926 (work_area_handler): ditto
4928 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4929 when FitCursor did something.
4930 (updateScrollbar): some unsigned changes
4931 (downCB): removed func
4932 (scrollUpOnePage): removed func
4933 (scrollDownOnePage): remvoed func
4934 (workAreaMotionNotify): don't call screen->FitCursor but use
4935 fitCursor instead. and bool return val
4936 (workAreaButtonPress): ditto
4937 (workAreaButtonRelease): some unsigned changes
4938 (checkInsetHit): ditto
4939 (workAreaExpose): ditto
4940 (update): parts rewritten, comments about the signed char arg added
4941 (smallUpdate): removed func
4942 (cursorPrevious): call needed updateScrollbar
4945 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4948 * src/BufferView.[Ch] (upCB): removed func
4949 (downCB): removed func
4950 (smallUpdate): removed func
4952 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4954 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4955 currentrow, currentrow_y optimization. This did not help a lot and
4956 if we want to do this kind of optimization we should rather use
4957 cursor.row instead of the currentrow.
4959 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4960 buffer spacing and klyx spacing support.
4962 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4964 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4967 2000-04-26 Juergen Vigna <jug@sad.it>
4969 * src/insets/figinset.C: fixes to Lars sstream changes!
4971 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4973 * A lot of files: Added Ascii(ostream &) methods to all inset
4974 classes. Used when exporting to ASCII.
4976 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4977 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4980 * src/text2.C (ToggleFree): Disabled implicit word selection when
4981 there is a change in the language
4983 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4984 no output was generated for end-of-sentence inset.
4986 * src/insets/lyxinset.h
4989 * src/paragraph.C: Removed the insetnumber code
4991 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4993 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4995 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4996 no_babel and no_epsfig completely from the file.
4997 (parseSingleLyXformat2Token): add handling for per-paragraph
4998 spacing as written by klyx.
5000 * src/insets/figinset.C: applied patch by Andre. Made it work with
5003 2000-04-20 Juergen Vigna <jug@sad.it>
5005 * src/insets/insettext.C (cutSelection):
5006 (copySelection): Fixed with selection from right to left.
5007 (draw): now the rows are not recalculated at every draw.
5008 (computeTextRows): for now reset the inset-owner here (this is
5009 important for an undo or copy where the inset-owner is not set
5012 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5013 motion to the_locking_inset screen->first was forgotten, this was
5014 not important till we got multiline insets.
5016 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5018 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5019 code seems to be alright (it is code changed by Dekel, and the
5020 intent is indeed that all macros should be defined \protect'ed)
5022 * NEWS: a bit of reorganisation of the new user-visible features.
5024 2000-04-19 Juergen Vigna <jug@sad.it>
5026 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5027 position. Set the inset_owner of the used paragraph so that it knows
5028 that it is inside an inset. Fixed cursor handling with mouse and
5029 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5030 and cleanups to make TextInsets work better.
5032 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5033 Changed parameters of various functions and added LockInsetInInset().
5035 * src/insets/insettext.C:
5037 * src/insets/insetcollapsable.h:
5038 * src/insets/insetcollapsable.C:
5039 * src/insets/insetfoot.h:
5040 * src/insets/insetfoot.C:
5041 * src/insets/insetert.h:
5042 * src/insets/insetert.C: cleaned up the code so that it works now
5043 correctly with insettext.
5045 * src/insets/inset.C:
5046 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5047 that insets in insets are supported right.
5050 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5052 * src/paragraph.C: some small fixes
5054 * src/debug.h: inserted INSETS debug info
5056 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5057 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5059 * src/commandtags.h:
5060 * src/LyXAction.C: insert code for InsetTabular.
5062 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5063 not Button1MotionMask.
5064 (workAreaButtonRelease): send always a InsetButtonRelease event to
5066 (checkInsetHit): some setCursor fixes (always with insets).
5068 * src/BufferView2.C (lockInset): returns a bool now and extended for
5069 locking insets inside insets.
5070 (showLockedInsetCursor): it is important to have the cursor always
5071 before the locked inset.
5072 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5074 * src/BufferView.h: made lockInset return a bool.
5076 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5078 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5079 that is used also internally but can be called as public to have back
5080 a cursor pos which is not set internally.
5081 (SetCursorIntern): Changed to use above function.
5083 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5085 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5090 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5091 patches for things that should be in or should be changed.
5093 * src/* [insetfiles]: change "usigned char fragile" to bool
5094 fragile. There was only one point that could that be questioned
5095 and that is commented in formulamacro.C. Grep for "CHECK".
5097 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5098 (DeleteBuffer): take it out of CutAndPaste and make it static.
5100 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5102 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5103 output the spacing envir commands. Also the new commands used in
5104 the LaTeX output makes the result better.
5106 * src/Spacing.C (writeEnvirBegin): new method
5107 (writeEnvirEnd): new method
5109 2000-04-18 Juergen Vigna <jug@sad.it>
5111 * src/CutAndPaste.C: made textclass a static member of the class
5112 as otherwise it is not accesed right!!!
5114 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5116 * forms/layout_forms.fd
5117 * src/layout_forms.h
5118 * src/layout_forms.C (create_form_form_character)
5119 * src/lyx_cb.C (UserFreeFont)
5120 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5121 documents (in the layout->character popup).
5123 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5125 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5126 \spell_command was in fact not honored (from Kevin Atkinson).
5128 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5131 * src/lyx_gui.h: make lyxViews private (Angus)
5133 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5135 * src/mathed/math_write.C
5136 (MathMatrixInset::Write) Put \protect before \begin{array} and
5137 \end{array} if fragile
5138 (MathParInset::Write): Put \protect before \\ if fragile
5140 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5142 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5143 initialization if the LyXColorHandler must be done after the
5144 connections to the XServer has been established.
5146 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5147 get the background pixel from the lyxColorhandler so that the
5148 figures are rendered with the correct background color.
5149 (NextToken): removed functions.
5150 (GetPSSizes): use ifs >> string instead of NextToken.
5152 * src/Painter.[Ch]: the color cache moved out of this file.
5154 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5157 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5159 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5160 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5162 * src/BufferView.C (enterView): new func
5163 (leaveView): new func
5165 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5167 (leaveView): new func, undefines xterm cursor when approp.
5169 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5170 (AllowInput): delete the Workarea cursor handling from this func.
5172 * src/Painter.C (underline): draw a slimer underline in most cases.
5174 * src/lyx_main.C (error_handler): use extern "C"
5176 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5178 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5179 sent directly to me.
5181 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5182 to the list by Dekel.
5184 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5187 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5188 methods from lyx_cb.here.
5190 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5193 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5196 instead of using current_view directly.
5198 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5200 * src/LyXAction.C (init): add the paragraph-spacing command.
5202 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5204 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5206 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5207 different from the documents.
5209 * src/text.C (SetHeightOfRow): take paragraph spacing into
5210 account, paragraph spacing takes precedence over buffer spacing
5211 (GetVisibleRow): ditto
5213 * src/paragraph.C (writeFile): output the spacing parameter too.
5214 (validate): set the correct features if spacing is used in the
5216 (Clear): set spacing to default
5217 (MakeSameLayout): spacing too
5218 (HasSameLayout): spacing too
5219 (SetLayout): spacing too
5220 (TeXOnePar): output the spacing commands
5222 * src/lyxparagraph.h: added a spacing variable for use with
5223 per-paragraph spacing.
5225 * src/Spacing.h: add a Default spacing and a method to check if
5226 the current spacing is default. also added an operator==
5228 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5231 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5233 * src/lyxserver.C (callback): fix dispatch of functions
5235 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5236 printf() into lyxerr call.
5238 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5241 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5242 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5243 the "Float" from each of the subitems.
5244 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5246 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5247 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5248 documented the change so that the workaround can be nuked later.
5250 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5253 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5255 * src/buffer.C (getLatexName): ditto
5256 (setReadonly): ditto
5258 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5260 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5261 avoid some uses of current_view. Added also a bufferParams()
5262 method to get at this.
5264 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5266 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5268 * src/lyxparagraph.[Ch]: removed
5269 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5270 with operators used by lower_bound and
5271 upper_bound in InsetTable's
5272 Make struct InsetTable private again. Used matchpos.
5274 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5276 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5277 document, the language of existing text is changed (unless the
5278 document is multi-lingual)
5280 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5282 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5284 * A lot of files: A rewrite of the Right-to-Left support.
5286 2000-04-10 Juergen Vigna <jug@sad.it>
5288 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5289 misplaced cursor when inset in inset is locked.
5291 * src/insets/insettext.C (LocalDispatch): small fix so that a
5292 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5294 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5295 footnote font should be decreased in size twice when displaying.
5297 * src/insets/insettext.C (GetDrawFont): inserted this function as
5298 the drawing-font may differ from the real paragraph font.
5300 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5301 insets (inset in inset!).
5303 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5304 function here because we don't want footnotes inside footnotes.
5306 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5308 (init): now set the inset_owner in paragraph.C
5309 (LocalDispatch): added some resetPos() in the right position
5312 (pasteSelection): changed to use the new CutAndPaste-Class.
5314 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5315 which tells if it is allowed to insert another inset inside this one.
5317 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5318 SwitchLayoutsBetweenClasses.
5320 * src/text2.C (InsertInset): checking of the new paragraph-function
5322 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5323 is not needed anymore here!
5326 (PasteSelection): redone (also with #ifdef) so that now this uses
5327 the CutAndPaste-Class.
5328 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5331 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5332 from/to text/insets.
5334 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5335 so that the paragraph knows if it is inside an (text)-inset.
5336 (InsertFromMinibuffer): changed return-value to bool as now it
5337 may happen that an inset is not inserted in the paragraph.
5338 (InsertInsetAllowed): this checks if it is allowed to insert an
5339 inset in this paragraph.
5341 (BreakParagraphConservative):
5342 (BreakParagraph) : small change for the above change of the return
5343 value of InsertFromMinibuffer.
5345 * src/lyxparagraph.h: added inset_owner and the functions to handle
5346 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5348 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5350 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5351 functions from BufferView to BufferView::Pimpl to ease maintence.
5353 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5354 correctly. Also use SetCursorIntern instead of SetCursor.
5356 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5359 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5361 * src/WorkArea.C (belowMouse): manually implement below mouse.
5363 * src/*: Add "explicit" on several constructors, I added probably
5364 some unneeded ones. A couple of changes to code because of this.
5366 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5367 implementation and private parts from the users of BufferView. Not
5370 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5371 implementation and private parts from the users of LyXLex. Not
5374 * src/BufferView_pimpl.[Ch]: new files
5376 * src/lyxlex_pimpl.[Ch]: new files
5378 * src/LyXView.[Ch]: some inline functions move out-of-line
5380 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5382 * src/lyxparagraph.h: make struct InsetTable public.
5384 * src/support/lyxstring.h: change lyxstring::difference_type to be
5385 ptrdiff_t. Add std:: modifiers to streams.
5387 * src/font.C: include the <cctype> header, for islower() and
5390 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5392 * src/font.[Ch]: new files. Contains the metric functions for
5393 fonts, takes a LyXFont as parameter. Better separation of concepts.
5395 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5396 changes because of this.
5398 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5400 * src/*: compile with -Winline and move functions that don't
5403 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5406 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5408 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5409 (various files changed because of this)
5411 * src/Painter.C (text): fixed the drawing of smallcaps.
5413 * src/lyxfont.[Ch] (drawText): removed unused member func.
5416 * src/*.C: added needed "using" statements and "std::" qualifiers.
5418 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5420 * src/*.h: removed all use of "using" from header files use
5421 qualifier std:: instead.
5423 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5425 * src/text.C (Backspace): some additional cleanups (we already
5426 know whether cursor.pos is 0 or not).
5428 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5429 automake does not provide one).
5431 * src/bmtable.h: replace C++ comments with C comments.
5433 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5435 * src/screen.C (ShowCursor): Change the shape of the cursor if
5436 the current language is not equal to the language of the document.
5437 (If the cursor change its shape unexpectedly, then you've found a bug)
5439 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5442 * src/insets/insetnumber.[Ch]: New files.
5444 * src/LyXAction.C (init)
5445 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5448 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5450 * src/lyxparagraph.h
5451 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5452 (the vector is kept sorted).
5454 * src/text.C (GetVisibleRow): Draw selection correctly when there
5455 is both LTR and RTL text.
5457 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5458 which is much faster.
5460 * src/text.C (GetVisibleRow and other): Do not draw the last space
5461 in a row if the direction of the last letter is not equal to the
5462 direction of the paragraph.
5464 * src/lyxfont.C (latexWriteStartChanges):
5465 Check that font language is not equal to basefont language.
5466 (latexWriteEndChanges): ditto
5468 * src/lyx_cb.C (StyleReset): Don't change the language while using
5469 the font-default command.
5471 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5472 empty paragraph before a footnote.
5474 * src/insets/insetcommand.C (draw): Increase x correctly.
5476 * src/screen.C (ShowCursor): Change cursor shape if
5477 current language != document language.
5479 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5481 2000-03-31 Juergen Vigna <jug@sad.it>
5483 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5484 (Clone): changed mode how the paragraph-data is copied to the
5485 new clone-paragraph.
5487 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5488 GetInset(pos) with no inset anymore there (in inset UNDO)
5490 * src/insets/insetcommand.C (draw): small fix as here x is
5491 incremented not as much as width() returns (2 before, 2 behind = 4)
5493 2000-03-30 Juergen Vigna <jug@sad.it>
5495 * src/insets/insettext.C (InsetText): small fix in initialize
5496 widthOffset (should not be done in the init() function)
5498 2000-03-29 Amir Karger <karger@lyx.org>
5500 * lib/examples/it_ItemizeBullets.lyx: translation by
5503 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5505 2000-03-29 Juergen Vigna <jug@sad.it>
5507 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5509 * src/insets/insetfoot.C (Clone): small change as for the below
5510 new init function in the text-inset
5512 * src/insets/insettext.C (init): new function as I've seen that
5513 clone did not copy the Paragraph-Data!
5514 (LocalDispatch): Added code so that now we have some sort of Undo
5515 functionality (well actually we HAVE Undo ;)
5517 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5519 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5521 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5524 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5526 * src/main.C: added a runtime check that verifies that the xforms
5527 header used when building LyX and the library used when running
5528 LyX match. Exit with a message if they don't match. This is a
5529 version number check only.
5531 * src/buffer.C (save): Don't allocate memory on the heap for
5532 struct utimbuf times.
5534 * *: some using changes, use iosfwd instead of the real headers.
5536 * src/lyxfont.C use char const * instead of string for the static
5537 strings. Rewrite some functions to use sstream.
5539 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5541 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5544 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5546 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5547 of Geodesy (from Martin Vermeer)
5549 * lib/layouts/svjour.inc: include file for the Springer svjour
5550 class. It can be used to support journals other than JoG.
5552 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5553 Miskiewicz <misiek@pld.org.pl>)
5554 * lib/reLyX/Makefile.am: ditto.
5556 2000-03-27 Juergen Vigna <jug@sad.it>
5558 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5559 also some modifications with operations on selected text.
5561 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5562 problems with clicking on insets (last famous words ;)
5564 * src/insets/insetcommand.C (draw):
5565 (width): Changed to have a bit of space before and after the inset so
5566 that the blinking cursor can be seen (otherwise it was hidden)
5568 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5570 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5571 would not be added to the link list when an installed gettext (not
5572 part of libc) is found.
5574 2000-03-24 Juergen Vigna <jug@sad.it>
5576 * src/insets/insetcollapsable.C (Edit):
5577 * src/mathed/formula.C (InsetButtonRelease):
5578 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5581 * src/BufferView.C (workAreaButtonPress):
5582 (workAreaButtonRelease):
5583 (checkInsetHit): Finally fixed the clicking on insets be handled
5586 * src/insets/insetert.C (Edit): inserted this call so that ERT
5587 insets work always with LaTeX-font
5589 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5591 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5592 caused lyx to startup with no GUI in place, causing in a crash
5593 upon startup when called with arguments.
5595 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5597 * src/FontLoader.C: better initialization of dummyXFontStruct.
5599 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5601 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5602 for linuxdoc and docbook import and export format options.
5604 * lib/lyxrc.example Example of default values for the previous flags.
5606 * src/lyx_cb.C Use those flags instead of the hardwired values for
5607 linuxdoc and docbook export.
5609 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5612 * src/menus.C Added menus entries for the new import/exports formats.
5614 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5616 * src/lyxrc.*: Added support for running without Gui
5619 * src/FontLoader.C: sensible defaults if no fonts are needed
5621 * src/lyx_cb.C: New function ShowMessage (writes either to the
5622 minibuffer or cout in case of no gui
5623 New function AskOverwrite for common stuff
5624 Consequently various changes to call these functions
5626 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5627 wild guess at sensible screen resolution when having no gui
5629 * src/lyxfont.C: no gui, no fonts... set some defaults
5631 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5633 * src/LColor.C: made the command inset background a bit lighter.
5635 2000-03-20 Hartmut Goebel <goebel@noris.net>
5637 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5638 stdstruct.inc. Koma-Script added some title elements which
5639 otherwise have been listed below "bibliography". This split allows
5640 adding title elements to where they belong.
5642 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5643 define the additional tilte elements and then include
5646 * many other layout files: changed to include stdtitle.inc just
5647 before stdstruct.inc.
5649 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5651 * src/buffer.C: (save) Added the option to store all backup files
5652 in a single directory
5654 * src/lyxrc.[Ch]: Added variable \backupdir_path
5656 * lib/lyxrc.example: Added descriptions of recently added variables
5658 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5659 bibtex inset, not closing the bibtex popup when deleting the inset)
5661 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5663 * src/lyx_cb.C: add a couple using directives.
5665 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5666 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5667 import based on the filename.
5669 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5670 file would be imported at start, if the filename where of a sgml file.
5672 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5674 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5676 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5677 * src/lyxfont.h Replaced the member variable bits.direction by the
5678 member variable lang. Made many changes in other files.
5679 This allows having a multi-lingual document
5681 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5682 that change the current language to <l>.
5683 Removed the command "font-rtl"
5685 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5686 format for Hebrew documents)
5688 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5689 When auto_mathmode is "true", pressing a digit key in normal mode
5690 will cause entering into mathmode.
5691 If auto_mathmode is "rtl" then this behavior will be active only
5692 when writing right-to-left text.
5694 * src/text2.C (InsertStringA) The string is inserted using the
5697 * src/paragraph.C (GetEndLabel) Gives a correct result for
5698 footnote paragraphs.
5700 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5702 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5704 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5705 front of PasteParagraph. Never insert a ' '. This should at least
5706 fix some cause for the segfaults that we have been experiencing,
5707 it also fixes backspace behaviour slightly. (Phu!)
5709 * src/support/lstrings.C (compare_no_case): some change to make it
5710 compile with gcc 2.95.2 and stdlibc++-v3
5712 * src/text2.C (MeltFootnoteEnvironment): change type o
5713 first_footnote_par_is_not_empty to bool.
5715 * src/lyxparagraph.h: make text private. Changes in other files
5717 (fitToSize): new function
5718 (setContentsFromPar): new function
5719 (clearContents): new function
5720 (SetChar): new function
5722 * src/paragraph.C (readSimpleWholeFile): deleted.
5724 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5725 the file, just use a simple string instead. Also read the file in
5726 a more maintainable manner.
5728 * src/text2.C (InsertStringA): deleted.
5729 (InsertStringB): deleted.
5731 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5733 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5734 RedoParagraphs from the doublespace handling part, just set status
5735 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5736 done, but perhaps not like this.)
5738 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5740 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5741 character when inserting an inset.
5743 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5745 * src/bufferparams.C (readLanguage): now takes "default" into
5748 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5749 also initialize the toplevel_keymap with the default bindings from
5752 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5754 * all files using lyxrc: have lyxrc as a real variable and not a
5755 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5758 * src/lyxrc.C: remove double call to defaultKeyBindings
5760 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5761 toolbar defauls using lyxlex. Remove enums, structs, functions
5764 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5765 toolbar defaults. Also store default keybindings in a map.
5767 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5768 storing the toolbar defaults without any xforms dependencies.
5770 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5771 applied. Changed to use iterators.
5773 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5775 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5776 systems that don't have LINGUAS set to begin with.
5778 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5780 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5781 the list by Dekel Tsur.
5783 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5785 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5786 * src/insets/form_graphics.C: ditto.
5788 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5790 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/bufferparams.C (readLanguage): use the new language map
5794 * src/intl.C (InitKeyMapper): use the new language map
5796 * src/lyx_gui.C (create_forms): use the new language map
5798 * src/language.[Ch]: New files. Used for holding the information
5799 about each language. Now! Use this new language map enhance it and
5800 make it really usable for our needs.
5802 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5804 * screen.C (ShowCursor): Removed duplicate code.
5805 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5806 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5808 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5811 * src/text.C Added TransformChar method. Used for rendering Arabic
5812 text correctly (change the glyphs of the letter according to the
5813 position in the word)
5818 * src/lyxrc.C Added lyxrc command {language_command_begin,
5819 language_command_end,language_command_ltr,language_command_rtl,
5820 language_package} which allows the use of either arabtex or Omega
5823 * src/lyx_gui.C (init)
5825 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5826 to use encoding for menu fonts which is different than the encoding
5829 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5830 do not load the babel package.
5831 To write an English document with Hebrew/Arabic, change the document
5832 language to "english".
5834 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5835 (alphaCounter): changed to return char
5836 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5838 * lib/lyxrc.example Added examples for Hebrew/Arabic
5841 * src/layout.C Added layout command endlabeltype
5843 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5845 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5847 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5849 * src/mathed/math_delim.C (search_deco): return a
5850 math_deco_struct* instead of index.
5852 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5854 * All files with a USE_OSTREAM_ONLY within: removed all code that
5855 was unused when USE_OSTREAM_ONLY is defined.
5857 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5858 of any less. Removed header and using.
5860 * src/text.C (GetVisibleRow): draw the string "Page Break
5861 (top/bottom)" on screen when drawing a pagebreak line.
5863 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5865 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5867 * src/mathed/math_macro.C (draw): do some cast magic.
5870 * src/mathed/math_defs.h: change byte* argument to byte const*.
5872 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5874 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5875 know it is right to return InsetFoot* too, but cxx does not like
5878 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5880 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5882 * src/mathed/math_delim.C: change == to proper assignment.
5884 2000-03-09 Juergen Vigna <jug@sad.it>
5886 * src/insets/insettext.C (setPos): fixed various cursor positioning
5887 problems (via mouse and cursor-keys)
5888 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5889 inset (still a small display problem but it works ;)
5891 * src/insets/insetcollapsable.C (draw): added button_top_y and
5892 button_bottom_y to have correct values for clicking on the inset.
5894 * src/support/lyxalgo.h: commented out 'using std::less'
5896 2000-03-08 Juergen Vigna <jug@sad.it>
5898 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5899 Button-Release event closes as it is alos the Release-Event
5902 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5904 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5906 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5907 can add multiple spaces in Scrap (literate programming) styles...
5908 which, by the way, is how I got hooked on LyX to begin with.
5910 * src/mathed/formula.C (Write): Added dummy variable to an
5911 inset::Latex() call.
5912 (Latex): Add free_spacing boolean to inset::Latex()
5914 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5916 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5917 virtual function to include the free_spacing boolean from
5918 the containing paragraph's style.
5920 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5921 Added free_spacing boolean arg to match inset.h
5923 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5924 Added free_spacing boolean arg to match inset.h
5926 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5927 Added free_spacing boolean and made sure that if in a free_spacing
5928 paragraph, that we output normal space if there is a protected space.
5930 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5931 Added free_spacing boolean arg to match inset.h
5933 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5934 Added free_spacing boolean arg to match inset.h
5936 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5937 Added free_spacing boolean arg to match inset.h
5939 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5940 Added free_spacing boolean arg to match inset.h
5942 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5943 Added free_spacing boolean arg to match inset.h
5945 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5946 free_spacing boolean arg to match inset.h
5948 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5949 Added free_spacing boolean arg to match inset.h
5951 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5952 Added free_spacing boolean arg to match inset.h
5954 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5955 Added free_spacing boolean arg to match inset.h
5957 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5958 Added free_spacing boolean arg to match inset.h
5960 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5961 Added free_spacing boolean arg to match inset.h
5963 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5964 free_spacing boolean arg to match inset.h
5966 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5967 free_spacing boolean arg to match inset.h
5969 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5970 ignore free_spacing paragraphs. The user's spaces are left
5973 * src/text.C (InsertChar): Fixed the free_spacing layout
5974 attribute behavior. Now, if free_spacing is set, you can
5975 add multiple spaces in a paragraph with impunity (and they
5976 get output verbatim).
5977 (SelectSelectedWord): Added dummy argument to inset::Latex()
5980 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5983 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5984 paragraph layouts now only input a simple space instead.
5985 Special character insets don't make any sense in free-spacing
5988 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5989 hard-spaces in the *input* file to simple spaces if the layout
5990 is free-spacing. This converts old files which had to have
5991 hard-spaces in free-spacing layouts where a simple space was
5993 (writeFileAscii): Added free_spacing check to pass to the newly
5994 reworked inset::Latex(...) methods. The inset::Latex() code
5995 ensures that hard-spaces in free-spacing paragraphs get output
5996 as spaces (rather than "~").
5998 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6000 * src/mathed/math_delim.C (draw): draw the empty placeholder
6001 delims with a onoffdash line.
6002 (struct math_deco_compare): struct that holds the "functors" used
6003 for the sort and the binary search in math_deco_table.
6004 (class init_deco_table): class used for initial sort of the
6006 (search_deco): use lower_bound to do a binary search in the
6009 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6011 * src/lyxrc.C: a small secret thingie...
6013 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6014 and to not flush the stream as often as it used to.
6016 * src/support/lyxalgo.h: new file
6017 (sorted): template function used for checking if a sequence is
6018 sorted or not. Two versions with and without user supplied
6019 compare. Uses same compare as std::sort.
6021 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6022 it and give warning on lyxerr.
6024 (struct compare_tags): struct with function operators used for
6025 checking if sorted, sorting and lower_bound.
6026 (search_kw): use lower_bound instead of manually implemented
6029 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6031 * src/insets/insetcollapsable.h: fix Clone() declaration.
6032 * src/insets/insetfoot.h: ditto.
6034 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6036 2000-03-08 Juergen Vigna <jug@sad.it>
6038 * src/insets/lyxinset.h: added owner call which tells us if
6039 this inset is inside another inset. Changed also the return-type
6040 of Editable to an enum so it tells clearer what the return-value is.
6042 * src/insets/insettext.C (computeTextRows): fixed computing of
6043 textinsets which split automatically on more rows.
6045 * src/insets/insetert.[Ch]: changed this to be of BaseType
6048 * src/insets/insetfoot.[Ch]: added footnote inset
6050 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6051 collapsable insets (like footnote, ert, ...)
6053 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6055 * src/lyxdraw.h: remvoe file
6057 * src/lyxdraw.C: remove file
6059 * src/insets/insettext.C: added <algorithm>.
6061 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6063 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6064 (matrix_cb): case MM_OK use string stream
6066 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6069 * src/mathed/math_macro.C (draw): use string stream
6070 (Metrics): use string stream
6072 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6073 directly to the ostream.
6075 * src/vspace.C (asString): use string stream.
6076 (asString): use string stream
6077 (asLatexString): use string stream
6079 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6080 setting Spacing::Other.
6082 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6083 sprintf when creating the stretch vale.
6085 * src/text2.C (alphaCounter): changed to return a string and to
6086 not use a static variable internally. Also fixed a one-off bug.
6087 (SetCounter): changed the drawing of the labels to use string
6088 streams instead of sprintf.
6090 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6091 manipulator to use a scheme that does not require library support.
6092 This is also the way it is done in the new GNU libstdc++. Should
6093 work with DEC cxx now.
6095 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6097 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6098 end. This fixes a bug.
6100 * src/mathed (all files concerned with file writing): apply the
6101 USE_OSTREAM_ONLY changes to mathed too.
6103 * src/support/DebugStream.h: make the constructor explicit.
6105 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6106 count and ostream squashed.
6108 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6110 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6112 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6113 ostringstream uses STL strings, and we might not.
6115 * src/insets/insetspecialchar.C: add using directive.
6116 * src/insets/insettext.C: ditto.
6118 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6120 * lib/layouts/seminar.layout: feeble attempt at a layout for
6121 seminar.cls, far from completet and could really use some looking
6122 at from people used to write layout files.
6124 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6125 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6126 a lot nicer and works nicely with ostreams.
6128 * src/mathed/formula.C (draw): a slightly different solution that
6129 the one posted to the list, but I think this one works too. (font
6130 size wrong in headers.)
6132 * src/insets/insettext.C (computeTextRows): some fiddling on
6133 Jürgens turf, added some comments that he should read.
6135 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6136 used and it gave compiler warnings.
6137 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6140 * src/lyx_gui.C (create_forms): do the right thing when
6141 show_banner is true/false.
6143 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6144 show_banner is false.
6146 * most file writing files: Now use iostreams to do almost all of
6147 the writing. Also instead of passing string &, we now use
6148 stringstreams. mathed output is still not adapted to iostreams.
6149 This change can be turned off by commenting out all the occurences
6150 of the "#define USE_OSTREAM_ONLY 1" lines.
6152 * src/WorkArea.C (createPixmap): don't output debug messages.
6153 (WorkArea): don't output debug messages.
6155 * lib/lyxrc.example: added a comment about the new variable
6158 * development/Code_rules/Rules: Added some more commente about how
6159 to build class interfaces and on how better encapsulation can be
6162 2000-03-03 Juergen Vigna <jug@sad.it>
6164 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6165 automatically with the width of the LyX-Window
6167 * src/insets/insettext.C (computeTextRows): fixed update bug in
6168 displaying text-insets (scrollvalues where not initialized!)
6170 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6172 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6173 id in the check of the result from lower_bound is not enough since
6174 lower_bound can return last too, and then res->id will not be a
6177 * all insets and some code that use them: I have conditionalized
6178 removed the Latex(string & out, ...) this means that only the
6179 Latex(ostream &, ...) will be used. This is a work in progress to
6180 move towards using streams for all output of files.
6182 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6185 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6187 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6188 routine (this fixes bug where greek letters were surrounded by too
6191 * src/support/filetools.C (findtexfile): change a bit the search
6192 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6193 no longer passed to kpsewhich, we may have to change that later.
6195 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6196 warning options to avoid problems with X header files (from Angus
6198 * acinclude.m4: regenerated.
6200 2000-03-02 Juergen Vigna <jug@sad.it>
6202 * src/insets/insettext.C (WriteParagraphData): Using the
6203 par->writeFile() function for writing paragraph-data.
6204 (Read): Using buffer->parseSingleLyXformat2Token()-function
6205 for parsing paragraph data!
6207 * src/buffer.C (readLyXformat2): removed all parse data and using
6208 the new parseSingleLyXformat2Token()-function.
6209 (parseSingleLyXformat2Token): added this function to parse (read)
6210 lyx-file-format (this is called also from text-insets now!)
6212 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6214 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6217 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6218 directly instead of going through a func. One very bad thing: a
6219 static LyXFindReplace, but I don't know where to place it.
6221 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6222 string instead of char[]. Also changed to static.
6223 (GetSelectionOrWordAtCursor): changed to static inline
6224 (SetSelectionOverLenChars): ditto.
6226 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6227 current_view and global variables. both classes has changed names
6228 and LyXFindReplace is not inherited from SearchForm.
6230 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6231 fl_form_search form.
6233 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6235 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6237 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6238 bound (from Kayvan).
6240 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6242 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6244 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6246 * some things that I should comment but the local pub says head to
6249 * comment out all code that belongs to the Roff code for Ascii
6250 export of tables. (this is unused)
6252 * src/LyXView.C: use correct type for global variable
6253 current_layout. (LyXTextClass::size_type)
6255 * some code to get the new insetgraphics closer to working I'd be
6256 grateful for any help.
6258 * src/BufferView2.C (insertInset): use the return type of
6259 NumberOfLayout properly. (also changes in other files)
6261 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6262 this as a test. I want to know what breaks because of this.
6264 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6266 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6268 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6269 to use a \makebox in the label, this allows proper justification
6270 with out using protected spaces or multiple hfills. Now it is
6271 "label" for left justified, "\hfill label\hfill" for center, and
6272 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6273 should be changed accordingly.
6275 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6277 * src/lyxtext.h: change SetLayout() to take a
6278 LyXTextClass::size_type instead of a char (when there is more than
6279 127 layouts in a class); also change type of copylayouttype.
6280 * src/text2.C (SetLayout): ditto.
6281 * src/LyXView.C (updateLayoutChoice): ditto.
6283 * src/LaTeX.C (scanLogFile): errors where the line number was not
6284 given just after the '!'-line were ignored (from Dekel Tsur).
6286 * lib/lyxrc.example: fix description of \date_insert_format
6288 * lib/layouts/llncs.layout: new layout, contributed by Martin
6291 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6293 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6294 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6295 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6296 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6297 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6298 paragraph.C, text.C, text2.C)
6300 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6302 * src/insets/insettext.C (LocalDispatch): remove extra break
6305 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6306 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6308 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6309 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6311 * src/insets/insetbib.h: move InsetBibkey::Holder and
6312 InsetCitation::Holder in public space.
6314 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6316 * src/insets/insettext.h: small change to get the new files from
6317 Juergen to compile (use "string", not "class string").
6319 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6320 const & as parameter to LocalDispatch, use LyXFont const & as
6321 paramter to some other func. This also had impacto on lyxinsets.h
6322 and the two mathed insets.
6324 2000-02-24 Juergen Vigna <jug@sad.it>
6327 * src/commandtags.h:
6329 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6333 * src/BufferView2.C: added/updated code for various inset-functions
6335 * src/insets/insetert.[Ch]: added implementation of InsetERT
6337 * src/insets/insettext.[Ch]: added implementation of InsetText
6339 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6340 (draw): added preliminary code for inset scrolling not finshed yet
6342 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6343 as it is in lyxfunc.C now
6345 * src/insets/lyxinset.h: Added functions for text-insets
6347 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6349 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6350 BufferView and reimplement the list as a queue put inside its own
6353 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6355 * several files: use the new interface to the "updateinsetlist"
6357 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6359 (work_area_handler): call BufferView::trippleClick on trippleclick.
6361 * src/BufferView.C (doubleClick): new function, selects word on
6363 (trippleClick): new function, selects line on trippleclick.
6365 2000-02-22 Allan Rae <rae@lyx.org>
6367 * lib/bind/xemacs.bind: buffer-previous not supported
6369 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6371 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6374 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6376 * src/bufferlist.C: get rid of current_view from this file
6378 * src/spellchecker.C: get rid of current_view from this file
6380 * src/vspace.C: get rid of current_view from this file
6381 (inPixels): added BufferView parameter for this func
6382 (asLatexCommand): added a BufferParams for this func
6384 * src/text.C src/text2.C: get rid of current_view from these
6387 * src/lyxfont.C (getFontDirection): move this function here from
6390 * src/bufferparams.C (getDocumentDirection): move this function
6393 * src/paragraph.C (getParDirection): move this function here from
6395 (getLetterDirection): ditto
6397 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6399 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6400 resize due to wrong pixmap beeing used. Also took the opurtunity
6401 to make the LyXScreen stateless on regard to WorkArea and some
6402 general cleanup in the same files.
6404 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6406 * src/Makefile.am: add missing direction.h
6408 * src/PainterBase.h: made the width functions const.
6410 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6413 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6415 * src/insets/insetlatexaccent.C (draw): make the accents draw
6416 better, at present this will only work well with iso8859-1.
6418 * several files: remove the old drawing code, now we use the new
6421 * several files: remove support for mono_video, reverse_video and
6424 2000-02-17 Juergen Vigna <jug@sad.it>
6426 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6427 int ** as we have to return the pointer, otherwise we have only
6428 NULL pointers in the returning function.
6430 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6432 * src/LaTeX.C (operator()): quote file name when running latex.
6434 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6436 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6437 (bubble tip), this removes our special handling of this.
6439 * Remove all code that is unused now that we have the new
6440 workarea. (Code that are not active when NEW_WA is defined.)
6442 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6444 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6446 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6447 nonexisting layout; correctly redirect obsoleted layouts.
6449 * lib/lyxrc.example: document \view_dvi_paper_option
6451 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6454 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6455 (PreviewDVI): handle the view_dvi_paper_option variable.
6456 [Both from Roland Krause]
6458 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6460 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6461 char const *, int, LyXFont)
6462 (text(int, int, string, LyXFont)): ditto
6464 * src/text.C (InsertCharInTable): attempt to fix the double-space
6465 feature in tables too.
6466 (BackspaceInTable): ditto.
6467 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6469 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6471 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6473 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6474 newly found text in textcache to this.
6475 (buffer): set the owner of the text put into the textcache to 0
6477 * src/insets/figinset.C (draw): fixed the drawing of figures with
6480 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6481 drawing of mathframe, hfills, protected space, table lines. I have
6482 now no outstanding drawing problems with the new Painter code.
6484 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6486 * src/PainterBase.C (ellipse, circle): do not specify the default
6489 * src/LColor.h: add using directive.
6491 * src/Painter.[Ch]: change return type of methods from Painter& to
6492 PainterBase&. Add a using directive.
6494 * src/WorkArea.C: wrap xforms callbacks in C functions
6497 * lib/layouts/foils.layout: font fix and simplifications from Carl
6500 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6502 * a lot of files: The Painter, LColor and WorkArea from the old
6503 devel branch has been ported to lyx-devel. Some new files and a
6504 lot of #ifdeffed code. The new workarea is enabled by default, but
6505 if you want to test the new Painter and LColor you have to compile
6506 with USE_PAINTER defined (do this in config.h f.ex.) There are
6507 still some rought edges, and I'd like some help to clear those
6508 out. It looks stable (loads and displays the Userguide very well).
6511 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6513 * src/buffer.C (pop_tag): revert to the previous implementation
6514 (use a global variable for both loops).
6516 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6518 * src/lyxrc.C (LyXRC): change slightly default date format.
6520 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6521 there is an English text with a footnote that starts with a Hebrew
6522 paragraph, or vice versa.
6523 (TeXFootnote): ditto.
6525 * src/text.C (LeftMargin): allow for negative values for
6526 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6529 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6530 for input encoding (cyrillic)
6532 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6534 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6537 * src/toolbar.C (set): ditto
6538 * src/insets/insetbib.C (create_form_citation_form): ditto
6540 * lib/CREDITS: added Dekel Tsur.
6542 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6543 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6544 hebrew supports files from Dekel Tsur.
6546 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6547 <tzafrir@technion.ac.il>
6549 * src/lyxrc.C: put \date_insert_format at the right place.
6551 * src/buffer.C (makeLaTeXFile): fix the handling of
6552 BufferParams::sides when writing out latex files.
6554 * src/BufferView2.C: add a "using" directive.
6556 * src/support/lyxsum.C (sum): when we use lyxstring,
6557 ostringstream::str needs an additional .c_str().
6559 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6561 * src/support/filetools.C (ChangeExtension): patch from Etienne
6564 * src/TextCache.C (show): remove const_cast and make second
6565 parameter non-const LyXText *.
6567 * src/TextCache.h: use non const LyXText in show.
6569 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6572 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6574 * src/support/lyxsum.C: rework to be more flexible.
6576 * several places: don't check if a pointer is 0 if you are going
6579 * src/text.C: remove some dead code.
6581 * src/insets/figinset.C: remove some dead code
6583 * src/buffer.C: move the BufferView funcs to BufferView2.C
6584 remove all support for insetlatexdel
6585 remove support for oldpapersize stuff
6586 made some member funcs const
6588 * src/kbmap.C: use a std::list to store the bindings in.
6590 * src/BufferView2.C: new file
6592 * src/kbsequence.[Ch]: new files
6594 * src/LyXAction.C + others: remove all trace of buffer-previous
6596 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6597 only have one copy in the binary of this table.
6599 * hebrew patch: moved some functions from LyXText to more
6600 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6602 * several files: remove support for XForms older than 0.88
6604 remove some #if 0 #endif code
6606 * src/TextCache.[Ch]: new file. Holds the textcache.
6608 * src/BufferView.C: changes to use the new TextCache interface.
6609 (waitForX): remove the now unused code.
6611 * src/BackStack.h: remove some commented code
6613 * lib/bind/emacs.bind: remove binding for buffer-previous
6615 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6617 * applied the hebrew patch.
6619 * src/lyxrow.h: make sure that all Row variables are initialized.
6621 * src/text2.C (TextHandleUndo): comment out a delete, this might
6622 introduce a memory leak, but should also help us to not try to
6623 read freed memory. We need to look at this one.
6625 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6626 (LyXParagraph): initalize footnotekind.
6628 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6629 forgot this when applying the patch. Please heed the warnings.
6631 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6632 (aka. reformat problem)
6634 * src/bufferlist.C (exists): made const, and use const_iterator
6635 (isLoaded): new func.
6636 (release): use std::find to find the correct buffer.
6638 * src/bufferlist.h: made getState a const func.
6639 made empty a const func.
6640 made exists a const func.
6643 2000-02-01 Juergen Vigna <jug@sad.it>
6645 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6647 * po/it.po: updated a bit the italian po file and also changed the
6648 'file nuovo' for newfile to 'filenuovo' without a space, this did
6651 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6652 for the new insert_date command.
6654 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6655 from jdblair, to insert a date into the current text conforming to
6656 a strftime format (for now only considering the locale-set and not
6657 the document-language).
6659 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6661 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6662 Bounds Read error seen by purify. The problem was that islower is
6663 a macros which takes an unsigned char and uses it as an index for
6664 in array of characters properties (and is thus subject to the
6668 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6669 correctly the paper sides radio buttons.
6670 (UpdateDocumentButtons): ditto.
6672 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6674 * src/kbmap.C (getsym + others): change to return unsigned int,
6675 returning a long can give problems on 64 bit systems. (I assume
6676 that int is 32bit on 64bit systems)
6678 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6680 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6681 LyXLookupString to be zero-terminated. Really fixes problems seen
6684 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6686 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6687 write a (char*)0 to the lyxerr stream.
6689 * src/lastfiles.C: move algorithm before the using statemets.
6691 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6694 complains otherwise).
6695 * src/table.C: ditto
6697 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6700 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6701 that I removed earlier... It is really needed.
6703 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6705 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6707 * INSTALL: update xforms home page URL.
6709 * lib/configure.m4: fix a bug with unreadable layout files.
6711 * src/table.C (calculate_width_of_column): add "using std::max"
6714 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6716 * several files: marked several lines with "DEL LINE", this is
6717 lines that can be deleted without changing anything.
6718 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6719 checks this anyway */
6722 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6724 * src/DepTable.C (update): add a "+" at the end when the checksum
6725 is different. (debugging string only)
6727 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6728 the next inset to not be displayed. This should also fix the list
6729 of labels in the "Insert Crossreference" dialog.
6731 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6734 when regex was not found.
6736 * src/support/lstrings.C (lowercase): use handcoded transform always.
6739 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6740 old_cursor.par->prev could be 0.
6742 * several files: changed post inc/dec to pre inc/dec
6744 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6745 write the lastfiles to file.
6747 * src/BufferView.C (buffer): only show TextCache info when debugging
6749 (resizeCurrentBuffer): ditto
6750 (workAreaExpose): ditto
6752 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6754 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6756 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6757 a bit better by removing the special case for \i and \j.
6759 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6761 * src/lyx_main.C (easyParse): remove test for bad comand line
6762 options, since this broke all xforms-related parsing.
6764 * src/kbmap.C (getsym): set return type to unsigned long, as
6765 declared in header. On an alpha, long is _not_ the same as int.
6767 * src/support/LOstream.h: add a "using std::flush;"
6769 * src/insets/figinset.C: ditto.
6771 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6773 * src/bufferlist.C (write): use blinding fast file copy instead of
6774 "a char at a time", now we are doing it the C++ way.
6776 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6777 std::list<int> instead.
6778 (addpidwait): reflect move to std::list<int>
6779 (sigchldchecker): ditto
6781 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6784 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6785 that obviously was wrong...
6787 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6788 c, this avoids warnings with purify and islower.
6790 * src/insets/figinset.C: rename struct queue to struct
6791 queue_element and rewrite to use a std::queue. gsqueue is now a
6792 std::queue<queue_element>
6793 (runqueue): reflect move to std::queue
6796 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6797 we would get "1" "0" instead of "true" "false. Also make the tostr
6800 2000-01-21 Juergen Vigna <jug@sad.it>
6802 * src/buffer.C (writeFileAscii): Disabled code for special groff
6803 handling of tabulars till I fix this in table.C
6805 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6807 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6809 * src/support/lyxlib.h: ditto.
6811 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6814 and 'j' look better. This might fix the "macron" bug that has been
6817 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6818 functions as one template function. Delete the old versions.
6820 * src/support/lyxsum.C: move using std::ifstream inside
6823 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6826 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6828 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6830 * src/insets/figinset.C (InitFigures): use new instead of malloc
6831 to allocate memory for figures and bitmaps.
6832 (DoneFigures): use delete[] instead of free to deallocate memory
6833 for figures and bitmaps.
6834 (runqueue): use new to allocate
6835 (getfigdata): use new/delete[] instead of malloc/free
6836 (RegisterFigure): ditto
6838 * some files: moved some declarations closer to first use, small
6839 whitespace changes use preincrement instead of postincrement where
6840 it does not make a difference.
6842 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6843 step on the way to use stl::containers for key maps.
6845 * src/bufferlist.h: add a typedef for const_iterator and const
6846 versions of begin and end.
6848 * src/bufferlist.[Ch]: change name of member variable _state to
6849 state_. (avoid reserved names)
6851 (getFileNames): returns the filenames of the buffers in a vector.
6853 * configure.in (ALL_LINGUAS): added ro
6855 * src/support/putenv.C: new file
6857 * src/support/mkdir.C: new file
6859 2000-01-20 Allan Rae <rae@lyx.org>
6861 * lib/layouts/IEEEtran.layout: Added several theorem environments
6863 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6864 couple of minor additions.
6866 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6867 (except for those in footnotes of course)
6869 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6871 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6873 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6874 std::sort and std::lower_bound instead of qsort and handwritten
6876 (struct compara): struct that holds the functors used by std::sort
6877 and std::lower_bound in MathedLookupBOP.
6879 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * src/support/LAssert.h: do not do partial specialization. We do
6884 * src/support/lyxlib.h: note that lyx::getUserName() and
6885 lyx::date() are not in use right now. Should these be suppressed?
6887 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6888 (makeLinuxDocFile): do not put date and user name in linuxdoc
6891 * src/support/lyxlib.h (kill): change first argument to long int,
6892 since that's what solaris uses.
6894 * src/support/kill.C (kill): fix declaration to match prototype.
6896 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6897 actually check whether namespaces are supported. This is not what
6900 * src/support/lyxsum.C: add a using directive.
6902 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * src/support/kill.C: if we have namespace support we don't have
6905 to include lyxlib.h.
6907 * src/support/lyxlib.h: use namespace lyx if supported.
6909 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6911 * src/support/date.C: new file
6913 * src/support/chdir.C: new file
6915 * src/support/getUserName.C: new file
6917 * src/support/getcwd.C: new file
6919 * src/support/abort.C: new file
6921 * src/support/kill.C: new file
6923 * src/support/lyxlib.h: moved all the functions in this file
6924 insede struct lyx. Added also kill and abort to this struct. This
6925 is a way to avoid the "kill is not defined in <csignal>", we make
6926 C++ wrappers for functions that are not ANSI C or ANSI C++.
6928 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6929 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6930 lyx it has been renamed to sum.
6932 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * src/text.C: add using directives for std::min and std::max.
6936 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6938 * src/texrow.C (getIdFromRow): actually return something useful in
6939 id and pos. Hopefully fixes the bug with positionning of errorbox
6942 * src/lyx_main.C (easyParse): output an error and exit if an
6943 incorrect command line option has been given.
6945 * src/spellchecker.C (ispell_check_word): document a memory leak.
6947 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6948 where a "struct utimbuf" is allocated with "new" and deleted with
6951 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6953 * src/text2.C (CutSelection): don't delete double spaces.
6954 (PasteSelection): ditto
6955 (CopySelection): ditto
6957 * src/text.C (Backspace): don't delete double spaces.
6959 * src/lyxlex.C (next): fix a bug that were only present with
6960 conformant std::istream::get to read comment lines, use
6961 std::istream::getline instead. This seems to fix the problem.
6963 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6965 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6966 allowed to insert space before space" editing problem. Please read
6967 commends at the beginning of the function. Comments about usage
6970 * src/text.C (InsertChar): fix for the "not allowed to insert
6971 space before space" editing problem.
6973 * src/text2.C (DeleteEmptyParagraphMechanism): when
6974 IsEmptyTableRow can only return false this last "else if" will
6975 always be a no-op. Commented out.
6977 * src/text.C (RedoParagraph): As far as I can understand tmp
6978 cursor is not really needed.
6980 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6981 present it could only return false anyway.
6982 (several functions): Did something not so smart...added a const
6983 specifier on a lot of methods.
6985 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6986 and add a tmp->text.resize. The LyXParagraph constructor does the
6988 (BreakParagraphConservative): ditto
6990 * src/support/path.h (Path): add a define so that the wrong usage
6991 "Path("/tmp") will be flagged as a compilation error:
6992 "`unnamed_Path' undeclared (first use this function)"
6994 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6996 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6997 which was bogus for several reasons.
6999 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7003 * autogen.sh: do not use "type -path" (what's that anyway?).
7005 * src/support/filetools.C (findtexfile): remove extraneous space
7006 which caused a kpsewhich warning (at least with kpathsea version
7009 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7011 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7013 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7015 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7017 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7019 * src/paragraph.C (BreakParagraph): do not reserve space on text
7020 if we don't need to (otherwise, if pos_end < pos, we end up
7021 reserving huge amounts of memory due to bad unsigned karma).
7022 (BreakParagraphConservative): ditto, although I have not seen
7023 evidence the bug can happen here.
7025 * src/lyxparagraph.h: add a using std::list.
7027 2000-01-11 Juergen Vigna <jug@sad.it>
7029 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7032 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7034 * src/vc-backend.C (doVCCommand): change to be static and take one
7035 more parameter: the path to chdir too be fore executing the command.
7036 (retrive): new function equiv to "co -r"
7038 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7039 file_not_found_hook is true.
7041 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7043 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7044 if a file is readwrite,readonly...anything else.
7046 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7048 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7049 (CreatePostscript): name change from MenuRunDVIPS (or something)
7050 (PreviewPostscript): name change from MenuPreviewPS
7051 (PreviewDVI): name change from MenuPreviewDVI
7053 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7054 \view_pdf_command., \pdf_to_ps_command
7056 * lib/configure.m4: added search for PDF viewer, and search for
7057 PDF to PS converter.
7058 (lyxrc.defaults output): add \pdflatex_command,
7059 \view_pdf_command and \pdf_to_ps_command.
7061 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7063 * src/bufferlist.C (write): we don't use blocksize for anything so
7066 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7068 * src/support/block.h: disable operator T* (), since it causes
7069 problems with both compilers I tried. See comments in the file.
7071 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7074 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7075 variable LYX_DIR_10x to LYX_DIR_11x.
7077 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7079 * INSTALL: document --with-lyxname.
7082 * configure.in: new configure flag --with-lyxname which allows to
7083 choose the name under which lyx is installed. Default is "lyx", of
7084 course. It used to be possible to do this with --program-suffix,
7085 but the later has in fact a different meaning for autoconf.
7087 * src/support/lstrings.h (lstrchr): reformat a bit.
7089 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7090 * src/mathed/math_defs.h: ditto.
7092 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7094 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7095 true, decides if we create a backup file or not when saving. New
7096 tag and variable \pdf_mode, defaults to false. New tag and
7097 variable \pdflatex_command, defaults to pdflatex. New tag and
7098 variable \view_pdf_command, defaults to xpdf. New tag and variable
7099 \pdf_to_ps_command, defaults to pdf2ps.
7101 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7103 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7104 does not have a BufferView.
7105 (unlockInset): ditto + don't access the_locking_inset if the
7106 buffer does not have a BufferView.
7108 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7109 certain circumstances so that we don't continue a keyboard
7110 operation long after the key was released. Try f.ex. to load a
7111 large document, press PageDown for some seconds and then release
7112 it. Before this change the document would contine to scroll for
7113 some time, with this change it stops imidiatly.
7115 * src/support/block.h: don't allocate more space than needed. As
7116 long as we don't try to write to the arr[x] in a array_type arr[x]
7117 it is perfectly ok. (if you write to it you might segfault).
7118 added operator value_type*() so that is possible to pass the array
7119 to functions expecting a C-pointer.
7121 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7124 * intl/*: updated to gettext 0.10.35, tried to add our own
7125 required modifications. Please verify.
7127 * po/*: updated to gettext 0.10.35, tried to add our own required
7128 modifications. Please verify.
7130 * src/support/lstrings.C (tostr): go at fixing the problem with
7131 cxx and stringstream. When stringstream is used return
7132 oss.str().c_str() so that problems with lyxstring and basic_string
7133 are avoided. Note that the best solution would be for cxx to use
7134 basic_string all the way, but it is not conformant yet. (it seems)
7136 * src/lyx_cb.C + other files: moved several global functions to
7137 class BufferView, some have been moved to BufferView.[Ch] others
7138 are still located in lyx_cb.C. Code changes because of this. (part
7139 of "get rid of current_view project".)
7141 * src/buffer.C + other files: moved several Buffer functions to
7142 class BufferView, the functions are still present in buffer.C.
7143 Code changes because of this.
7145 * config/lcmessage.m4: updated to most recent. used when creating
7148 * config/progtest.m4: updated to most recent. used when creating
7151 * config/gettext.m4: updated to most recent. applied patch for
7154 * config/gettext.m4.patch: new file that shows what changes we
7155 have done to the local copy of gettext.m4.
7157 * config/libtool.m4: new file, used in creation of acinclude.m4
7159 * config/lyxinclude.m4: new file, this is the lyx created m4
7160 macros, used in making acinclude.m4.
7162 * autogen.sh: GNU m4 discovered as a separate task not as part of
7163 the lib/configure creation.
7164 Generate acinlucde from files in config. Actually cat
7165 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7166 easier to upgrade .m4 files that really are external.
7168 * src/Spacing.h: moved using std::istringstream to right after
7169 <sstream>. This should fix the problem seen with some compilers.
7171 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/lyx_cb.C: began some work to remove the dependency a lot of
7174 functions have on BufferView::text, even if not really needed.
7175 (GetCurrentTextClass): removed this func, it only hid the
7178 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7179 forgot this in last commit.
7181 * src/Bullet.C (bulletEntry): use static char const *[] for the
7182 tables, becuase of this the return arg had to change to string.
7184 (~Bullet): removed unneeded destructor
7186 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7187 (insetSleep): moved from Buffer
7188 (insetWakeup): moved from Buffer
7189 (insetUnlock): moved from Buffer
7191 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7192 from Buffer to BufferView.
7194 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7196 * config/ltmain.sh: updated to version 1.3.4 of libtool
7198 * config/ltconfig: updated to version 1.3.4 of libtool
7200 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7203 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7204 Did I get that right?
7206 * src/lyxlex.h: add a "using" directive or two.
7207 * src/Spacing.h: ditto.
7208 * src/insets/figinset.C: ditto.
7209 * src/support/filetools.C: ditto.
7210 * src/support/lstrings.C: ditto.
7211 * src/BufferView.C: ditto.
7212 * src/bufferlist.C: ditto.
7213 * src/lyx_cb.C: ditto.
7214 * src/lyxlex.C: ditto.
7216 * NEWS: add some changes for 1.1.4.
7218 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7220 * src/BufferView.C: first go at a TextCache to speed up switching
7223 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7225 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7226 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7227 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7228 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7231 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7232 members of the struct are correctly initialized to 0 (detected by
7234 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7235 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7237 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7238 pidwait, since it was allocated with "new". This was potentially
7239 very bad. Thanks to Michael Schmitt for running purify for us.
7242 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7244 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7246 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7248 1999-12-30 Allan Rae <rae@lyx.org>
7250 * lib/templates/IEEEtran.lyx: minor change
7252 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7253 src/mathed/formula.C (LocalDispatch): askForText changes
7255 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7256 know when a user has cancelled input. Fixes annoying problems with
7257 inserting labels and version control.
7259 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7261 * src/support/lstrings.C (tostr): rewritten to use strstream and
7264 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7266 * src/support/filetools.C (IsFileWriteable): use fstream to check
7267 (IsDirWriteable): use fileinfo to check
7269 * src/support/filetools.h (FilePtr): whole class deleted
7271 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7273 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7275 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7277 * src/bufferlist.C (write): use ifstream and ofstream instead of
7280 * src/Spacing.h: use istrstream instead of sscanf
7282 * src/mathed/math_defs.h: change first arg to istream from FILE*
7284 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7286 * src/mathed/math_parser.C: have yyis to be an istream
7287 (LexGetArg): use istream (yyis)
7289 (mathed_parse): ditto
7290 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7292 * src/mathed/formula.C (Read): rewritten to use istream
7294 * src/mathed/formulamacro.C (Read): rewritten to use istream
7296 * src/lyxlex.h (~LyXLex): deleted desturctor
7297 (getStream): new function, returns an istream
7298 (getFile): deleted funtion
7299 (IsOK): return is.good();
7301 * src/lyxlex.C (LyXLex): delete file and owns_file
7302 (setFile): open an filebuf and assign that to a istream instead of
7304 (setStream): new function, takes an istream as arg.
7305 (setFile): deleted function
7306 (EatLine): rewritten us use istream instead of FILE*
7310 * src/table.C (LyXTable): use istream instead of FILE*
7311 (Read): rewritten to take an istream instead of FILE*
7313 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7315 * src/buffer.C (Dispatch): remove an extraneous break statement.
7317 * src/support/filetools.C (QuoteName): change to do simple
7318 'quoting'. More work is necessary. Also changed to do nothing
7319 under emx (needs fix too).
7320 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7322 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7323 config.h.in to the AC_DEFINE_UNQUOTED() call.
7324 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7325 needs char * as argument (because Solaris 7 declares it like
7328 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7329 remove definition of BZERO.
7331 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7333 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7334 defined, "lyxregex.h" if not.
7336 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7338 (REGEX): new variable that is set to regex.c lyxregex.h when
7339 AM_CONDITIONAL USE_REGEX is set.
7340 (libsupport_la_SOURCES): add $(REGEX)
7342 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7345 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7348 * configure.in: add call to LYX_REGEX
7350 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7351 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7353 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7355 * lib/bind/fi_menus.bind: new file, from
7356 pauli.virtanen@saunalahti.fi.
7358 * src/buffer.C (getBibkeyList): pass the parameter delim to
7359 InsetInclude::getKeys and InsetBibtex::getKeys.
7361 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7362 is passed to Buffer::getBibkeyList
7364 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7365 instead of the hardcoded comma.
7367 * src/insets/insetbib.C (getKeys): make sure that there are not
7368 leading blanks in bibtex keys. Normal latex does not care, but
7369 harvard.sty seems to dislike blanks at the beginning of citation
7370 keys. In particular, the retturn value of the function is
7372 * INSTALL: make it clear that libstdc++ is needed and that gcc
7373 2.7.x probably does not work.
7375 * src/support/filetools.C (findtexfile): make debug message go to
7377 * src/insets/insetbib.C (getKeys): ditto
7379 * src/debug.C (showTags): make sure that the output is correctly
7382 * configure.in: add a comment for TWO_COLOR_ICON define.
7384 * acconfig.h: remove all the entries that already defined in
7385 configure.in or acinclude.m4.
7387 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7388 to avoid user name, date and copyright.
7390 1999-12-21 Juergen Vigna <jug@sad.it>
7392 * src/table.C (Read): Now read bogus row format informations
7393 if the format is < 5 so that afterwards the table can
7394 be read by lyx but without any format-info. Fixed the
7395 crash we experienced when not doing this.
7397 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7399 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7400 (RedoDrawingOfParagraph): ditto
7401 (RedoParagraphs): ditto
7402 (RemoveTableRow): ditto
7404 * src/text.C (Fill): rename arg paperwidth -> paper_width
7406 * src/buffer.C (insertLyXFile): rename var filename -> fname
7407 (writeFile): rename arg filename -> fname
7408 (writeFileAscii): ditto
7409 (makeLaTeXFile): ditto
7410 (makeLinuxDocFile): ditto
7411 (makeDocBookFile): ditto
7413 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7416 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7418 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7421 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7422 compiled by a C compiler not C++.
7424 * src/layout.h (LyXTextClass): added typedef for const_iterator
7425 (LyXTextClassList): added typedef for const_iterator + member
7426 functions begin and end.
7428 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7429 iterators to fill the choice_class.
7430 (updateLayoutChoice): rewritten to use iterators to fill the
7431 layoutlist in the toolbar.
7433 * src/BufferView.h (BufferView::work_area_width): removed unused
7436 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7438 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7439 (sgmlCloseTag): ditto
7441 * src/support/lstrings.h: return type of countChar changed to
7444 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7445 what version of this func to use. Also made to return unsigned int.
7447 * configure.in: call LYX_STD_COUNT
7449 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7450 conforming std::count.
7452 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7454 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7455 and a subscript would give bad display (patch from Dekel Tsur
7456 <dekel@math.tau.ac.il>).
7458 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7460 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7463 * src/chset.h: add a few 'using' directives
7465 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7466 triggered when no buffer is active
7468 * src/layout.C: removed `break' after `return' in switch(), since
7471 * src/lyx_main.C (init): make sure LyX can be ran in place even
7472 when libtool has done its magic with shared libraries. Fix the
7473 test for the case when the system directory has not been found.
7475 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7476 name for the latex file.
7477 (MenuMakeHTML): ditto
7479 * src/buffer.h: add an optional boolean argument, which is passed
7482 1999-12-20 Allan Rae <rae@lyx.org>
7484 * lib/templates/IEEEtran.lyx: small correction and update.
7486 * configure.in: Attempted to use LYX_PATH_HEADER
7488 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7490 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7491 input from JMarc. Now use preprocessor to find the header.
7492 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7493 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7494 LYX_STL_STRING_FWD. See comments in file.
7496 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7498 * The global MiniBuffer * minibuffer variable is dead.
7500 * The global FD_form_main * fd_form_main variable is dead.
7502 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7504 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7506 * src/table.h: add the LOstream.h header
7507 * src/debug.h: ditto
7509 * src/LyXAction.h: change the explaination of the ReadOnly
7510 attribute: is indicates that the function _can_ be used.
7512 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7515 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7517 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7523 * src/paragraph.C (GetWord): assert on pos>=0
7526 * src/support/lyxstring.C: condition the use of an invariant on
7528 * src/support/lyxstring.h: ditto
7530 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7531 Use LAssert.h instead of plain assert().
7533 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7535 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7536 * src/support/filetools.C: ditto
7538 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7541 * INSTALL: document the new configure flags
7543 * configure.in: suppress --with-debug; add --enable-assertions
7545 * acinclude.m4: various changes in alignment of help strings.
7547 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7549 * src/kbmap.C: commented out the use of the hash map in kb_map,
7550 beginning of movement to a stl::container.
7552 * several files: removed code that was not in effect when
7553 MOVE_TEXT was defined.
7555 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7556 for escaping should not be used. We can discuss if the string
7557 should be enclosed in f.ex. [] instead of "".
7559 * src/trans_mgr.C (insert): use the new returned value from
7560 encodeString to get deadkeys and keymaps done correctly.
7562 * src/chset.C (encodeString): changed to return a pair, to tell
7563 what to use if we know the string.
7565 * src/lyxscreen.h (fillArc): new function.
7567 * src/FontInfo.C (resize): rewritten to use more std::string like
7568 structore, especially string::replace.
7570 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7573 * configure.in (chmod +x some scripts): remove config/gcc-hack
7575 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7577 * src/buffer.C (writeFile): change once again the top comment in a
7578 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7579 instead of an hardcoded version number.
7580 (makeDocBookFile): ditto
7582 * src/version.h: add new define LYX_DOCVERSION
7584 * po/de.po: update from Pit Sütterlin
7585 * lib/bind/de_menus.bind: ditto.
7587 * src/lyxfunc.C (Dispatch): call MenuExport()
7588 * src/buffer.C (Dispatch): ditto
7590 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7591 LyXFunc::Dispatch().
7592 (MenuExport): new function, moved from
7593 LyXFunc::Dispatch().
7595 * src/trans_mgr.C (insert): small cleanup
7596 * src/chset.C (loadFile): ditto
7598 * lib/kbd/iso8859-1.cdef: add missing backslashes
7600 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7602 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7603 help with placing the manually drawn accents better.
7605 (Draw): x2 and hg changed to float to minimize rounding errors and
7606 help place the accents better.
7608 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7609 unsigned short to char is just wrong...cast the char to unsigned
7610 char instead so that the two values can compare sanely. This
7611 should also make the display of insetlatexaccents better and
7612 perhaps also some other insets.
7614 (lbearing): new function
7617 1999-12-15 Allan Rae <rae@lyx.org>
7619 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7620 header that provides a wrapper around the very annoying SGI STL header
7623 * src/support/lyxstring.C, src/LString.h:
7624 removed old SGI-STL-compatability attempts.
7626 * configure.in: Use LYX_STL_STRING_FWD.
7628 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7629 stl_string_fwd.h is around and try to determine it's location.
7630 Major improvement over previous SGI STL 3.2 compatability.
7631 Three small problems remain with this function due to my zero
7632 knowledge of autoconf. JMarc and lgb see the comments in the code.
7634 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7636 * src/broken_const.h, config/hack-gcc, config/README: removed
7638 * configure.in: remove --with-gcc-hack option; do not call
7641 * INSTALL: remove documentation of --with-broken-const and
7644 * acconfig.h: remove all trace of BROKEN_CONST define
7646 * src/buffer.C (makeDocBookFile): update version number in output
7648 (SimpleDocBookOnePar): fix an assert when trying to a character
7649 access beyond string length
7652 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7654 * po/de.po: fix the Export menu
7656 * lyx.man: update the description of -dbg
7658 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7659 (commandLineHelp): updated
7660 (easyParse): show list of available debug levels if -dbg is passed
7663 * src/Makefile.am: add debug.C
7665 * src/debug.h: moved some code to debug.C
7667 * src/debug.C: new file. Contains code to set and show debug
7670 * src/layout.C: remove 'break' after 'continue' in switch
7671 statements, since these cannot be reached.
7673 1999-12-13 Allan Rae <rae@lyx.org>
7675 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7676 (in_word_set): hash() -> math_hash()
7678 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7680 * acconfig.h: Added a test for whether we are using exceptions in the
7681 current compilation run. If so USING_EXCEPTIONS is defined.
7683 * config.in: Check for existance of stl_string_fwd.h
7684 * src/LString.h: If compiling --with-included-string and SGI's
7685 STL version 3.2 is present (see above test) we need to block their
7686 forward declaration of string and supply a __get_c_string().
7687 However, it turns out this is only necessary if compiling with
7688 exceptions enabled so I've a bit more to add yet.
7690 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7691 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7692 src/support/LRegex.h, src/undo.h:
7693 Shuffle the order of the included files a little to ensure that
7694 LString.h gets included before anything that includes stl_string_fwd.h
7696 * src/support/lyxstring.C: We need to #include LString.h instead of
7697 lyxstring.h to get the necessary definition of __get_c_string.
7698 (__get_c_string): New function. This is defined static just like SGI's
7699 although why they need to do this I'm not sure. Perhaps it should be
7700 in lstrings.C instead.
7702 * lib/templates/IEEEtran.lyx: New template file.
7704 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7706 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7707 * intl/Makefile.in (MKINSTALLDIRS): ditto
7709 * src/LyXAction.C (init): changed to hold the LFUN data in a
7710 automatic array in stead of in callso to newFunc, this speeds up
7711 compilation a lot. Also all the memory used by the array is
7712 returned when the init is completed.
7714 * a lot of files: compiled with -Wold-style-cast, changed most of
7715 the reported offenders to C++ style casts. Did not change the
7716 offenders in C files.
7718 * src/trans.h (Match): change argument type to unsigned int.
7720 * src/support/DebugStream.C: fix some types on the streambufs so
7721 that it works on a conforming implementation.
7723 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7725 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7727 * src/support/lyxstring.C: remove the inline added earlier since
7728 they cause a bunch of unsatisfied symbols when linking with dec
7729 cxx. Cxx likes to have the body of inlines at the place where they
7732 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7733 accessing negative bounds in array. This fixes the crash when
7734 inserting accented characters.
7735 * src/trans.h (Match): ditto
7737 * src/buffer.C (Dispatch): since this is a void, it should not try
7738 to return anything...
7740 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7742 * src/buffer.h: removed the two friends from Buffer. Some changes
7743 because of this. Buffer::getFileName and Buffer::setFileName
7744 renamed to Buffer::fileName() and Buffer::fileName(...).
7746 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7748 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7749 and Buffer::update(short) to BufferView. This move is currently
7750 controlled by a define MOVE_TEXT, this will be removed when all
7751 shows to be ok. This move paves the way for better separation
7752 between buffer contents and buffer view. One side effect is that
7753 the BufferView needs a rebreak when swiching buffers, if we want
7754 to avoid this we can add a cache that holds pointers to LyXText's
7755 that is not currently in use.
7757 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7760 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7762 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7764 * lyx_main.C: new command line option -x (or --execute) and
7765 -e (or --export). Now direct conversion from .lyx to .tex
7766 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7767 Unfortunately, X is still needed and the GUI pops up during the
7770 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7772 * src/Spacing.C: add a using directive to bring stream stuff into
7774 * src/paragraph.C: ditto
7775 * src/buffer.C: ditto
7777 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7778 from Lars' announcement).
7780 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7781 example files from Tino Meinen.
7783 1999-12-06 Allan Rae <rae@lyx.org>
7785 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7787 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7789 * src/support/lyxstring.C: added a lot of inline for no good
7792 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7793 latexWriteEndChanges, they were not used.
7795 * src/layout.h (operator<<): output operator for PageSides
7797 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7799 * some example files: loaded in LyX 1.0.4 and saved again to update
7800 certain constructs (table format)
7802 * a lot of files: did the change to use fstream/iostream for all
7803 writing of files. Done with a close look at Andre Poenitz's patch.
7805 * some files: whitespace changes.
7807 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7809 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7810 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7811 architecture, we provide our own. It is used unconditionnally, but
7812 I do not think this is a performance problem. Thanks to Angus
7813 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7814 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7816 (GetInset): use my_memcpy.
7820 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7821 it is easier to understand, but it uses less TeX-only constructs now.
7823 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7824 elements contain spaces
7826 * lib/configure: regenerated
7828 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7829 elements contain spaces; display the list of programs that are
7832 * autogen.sh: make sure lib/configure is executable
7834 * lib/examples/*: rename the tutorial examples to begin with the
7835 two-letters language code.
7837 * src/lyxfunc.C (getStatus): do not query current font if no
7840 * src/lyx_cb.C (RunScript): use QuoteName
7841 (MenuRunDvips): ditto
7842 (PrintApplyCB): ditto
7844 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7845 around argument, so that it works well with the current shell.
7846 Does not work properly with OS/2 shells currently.
7848 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7849 * src/LyXSendto.C (SendtoApplyCB): ditto
7850 * src/lyxfunc.C (Dispatch): ditto
7851 * src/buffer.C (runLaTeX): ditto
7852 (runLiterate): ditto
7853 (buildProgram): ditto
7855 * src/lyx_cb.C (RunScript): ditto
7856 (MenuMakeLaTeX): ditto
7858 * src/buffer.h (getLatexName): new method
7860 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7862 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7864 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7865 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7866 (create_math_panel): ditto
7868 * src/lyxfunc.C (getStatus): re-activate the code which gets
7869 current font and cursor; add test for export to html.
7871 * src/lyxrc.C (read): remove unreachable break statements; add a
7874 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7876 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7879 introduced by faulty regex.
7880 * src/buffer.C: ditto
7881 * src/lastfiles.C: ditto
7882 * src/paragraph.C: ditto
7883 * src/table.C: ditto
7884 * src/vspace.C: ditto
7885 * src/insets/figinset.C: ditto
7886 Note: most of these is absolutely harmless, except the one in
7887 src/mathed formula.C.
7889 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7891 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7892 operation, yielding correct results for the reLyX command.
7894 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7896 * src/support/filetools.C (ExpandPath): removed an over eager
7898 (ReplaceEnvironmentPath): ditto
7900 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7901 shows that we are doing something fishy in our code...
7905 * src/lyxrc.C (read): use a double switch trick to get more help
7906 from the compiler. (the same trick is used in layout.C)
7907 (write): new function. opens a ofstream and pass that to output
7908 (output): new function, takes a ostream and writes the lyxrc
7909 elemts to it. uses a dummy switch to make sure no elements are
7912 * src/lyxlex.h: added a struct pushpophelper for use in functions
7913 with more than one exit point.
7915 * src/lyxlex.[Ch] (GetInteger): made it const
7919 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7921 * src/layout.[hC] : LayoutTags splitted into several enums, new
7922 methods created, better error handling cleaner use of lyxlex. Read
7925 * src/bmtable.[Ch]: change some member prototypes because of the
7926 image const changes.
7928 * commandtags.h, src/LyXAction.C (init): new function:
7929 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7930 This file is not read automatically but you can add \input
7931 preferences to your lyxrc if you want to. We need to discuss how
7934 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7935 in .aux, also remove .bib and .bst files from dependencies when
7938 * src/BufferView.C, src/LyXView.C: add const_cast several places
7939 because of changes to images.
7941 * lib/images/*: same change as for images/*
7943 * lib/lyxrc.example: Default for accept_compound is false not no.
7945 * images/*: changed to be const, however I have som misgivings
7946 about this change so it might be changed back.
7948 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7950 * lib/configure, po/POTFILES.in: regenerated
7952 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7954 * config/lib_configure.m4: removed
7956 * lib/configure.m4: new file (was config/lib_configure.m4)
7958 * configure.in: do not test for rtti, since we do not use it.
7960 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7963 doubling of allocated space scheme. This makes it faster for large
7964 strings end to use less memory for small strings. xtra rememoved.
7966 * src/insets/figinset.C (waitalarm): commented out.
7967 (GhostscriptMsg): use static_cast
7968 (GhostscriptMsg): use new instead of malloc to allocate memory for
7969 cmap. also delete the memory after use.
7971 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7973 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7974 for changes in bibtex database or style.
7975 (runBibTeX): remove all .bib and .bst files from dep before we
7977 (run): use scanAuc in when dep file already exist.
7979 * src/DepTable.C (remove_files_with_extension): new method
7982 * src/DepTable.[Ch]: made many of the methods const.
7984 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7986 * src/bufferparams.C: make sure that the default textclass is
7987 "article". It used to be the first one by description order, but
7988 now the first one is "docbook".
7990 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7991 string; call Debug::value.
7992 (easyParse): pass complete argument to setDebuggingLevel().
7994 * src/debug.h (value): fix the code that parses debug levels.
7996 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7999 * src/LyXAction.C: use Debug::ACTION as debug channel.
8001 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8003 * NEWS: updated for the future 1.1.3 release.
8005 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8006 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8007 it should. This is of course a controversial change (since many
8008 people will find that their lyx workscreen is suddenly full of
8009 red), but done for the sake of correctness.
8011 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8012 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8014 * src/insets/inseterror.h, src/insets/inseturl.h,
8015 src/insets/insetinfo.h, src/insets/figinset.h,
8016 src/mathed/formulamacro.h, src/mathed/math_macro.h
8017 (EditMessage): add a missing const and add _() to make sure that
8020 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8021 src/insets/insetbib.C, src/support/filetools.C: add `using'
8024 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8025 doing 'Insert index of last word' at the beginning of a paragraph.
8027 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8029 * several files: white-space changes.
8031 * src/mathed/formula.C: removed IsAlpha and IsDigit
8033 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8034 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8037 * src/insets/figinset.C (GetPSSizes): don't break when
8038 "EndComments" is seen. But break when a boundingbox is read.
8040 * all classes inherited from Inset: return value of Clone
8041 changed back to Inset *.
8043 * all classes inherited form MathInset: return value of Clone
8044 changed back to MathedInset *.
8046 * src/insets/figinset.C (runqueue): use a ofstream to output the
8047 gs/ps file. Might need some setpresicion or setw. However I can
8048 see no problem with the current code.
8049 (runqueue): use sleep instead of the alarm/signal code. I just
8050 can't see the difference.
8052 * src/paragraph.C (LyXParagraph): reserve space in the new
8053 paragraph and resize the inserted paragraph to just fit.
8055 * src/lyxfunc.h (operator|=): added operator for func_status.
8057 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8058 check for readable file.
8060 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8061 check for readable file.
8062 (MenuMakeLinuxDoc): ditto
8063 (MenuMakeDocBook): ditto
8064 (MenuMakeAscii): ditto
8065 (InsertAsciiFile): split the test for openable and readable
8067 * src/bmtable.C (draw_bitmaptable): use
8068 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8070 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8071 findtexfile from LaTeX to filetools.
8073 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8074 instead of FilePtr. Needs to be verified by a literate user.
8076 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8079 (EditMessage): likewise.
8081 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8082 respectively as \textasciitilde and \textasciicircum.
8084 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8086 * src/support/lyxstring.h: made the methods that take iterators
8089 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8090 (regexMatch): made is use the real regex class.
8092 * src/support/Makefile.am: changed to use libtool
8094 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8096 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8098 (MathIsInset ++): changed several macros to be inline functions
8101 * src/mathed/Makefile.am: changed to use libtool
8103 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8105 * src/insets/inset* : Clone changed to const and return type is
8106 the true insettype not just Inset*.
8108 * src/insets/Makefile.am: changed to use libtool
8110 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8112 * src/undo.[Ch] : added empty() and changed some of the method
8115 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8117 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8118 setID use block<> for the bullets array, added const several places.
8120 * src/lyxfunc.C (getStatus): new function
8122 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8123 LyXAction, added const to several funtions.
8125 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8126 a std::map, and to store the dir items in a vector.
8128 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8131 * src/LyXView.[Ch] + other files : changed currentView to view.
8133 * src/LyXAction.[Ch] : ported from the old devel branch.
8135 * src/.cvsignore: added .libs and a.out
8137 * configure.in : changes to use libtool.
8139 * acinclude.m4 : inserted libtool.m4
8141 * .cvsignore: added libtool
8143 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8145 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8146 file name in insets and mathed directories (otherwise the
8147 dependency is not taken in account under cygwin).
8149 * src/text2.C (InsertString[AB]): make sure that we do not try to
8150 read characters past the string length.
8152 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8154 * lib/doc/LaTeXConfig.lyx.in,
8155 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8157 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8158 file saying who created them and when this heppened; this is
8159 useless and annoys tools like cvs.
8161 * lib/layouts/g-brief-{en,de}.layout,
8162 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8163 from Thomas Hartkens <thomas@hartkens.de>.
8165 * src/{insets,mathed}/Makefile.am: do not declare an empty
8166 LDFLAGS, so that it can be set at configure time (useful on Irix
8169 * lib/reLyX/configure.in: make sure that the prefix is set
8170 correctly in LYX_DIR.
8172 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8174 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8175 be used by 'command-sequence' this allows to bind a key to a
8176 sequence of LyX-commands
8177 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8179 * src/LyXAction.C: add "command-sequence"
8181 * src/LyXFunction.C: handling of "command-sequence"
8183 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8184 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8186 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8188 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8190 * src/buffer.C (writeFile): Do not output a comment giving user
8191 and date at the beginning of a .lyx file. This is useless and
8192 annoys cvs anyway; update version number to 1.1.
8194 * src/Makefile.am (LYX_DIR): add this definition, so that a
8195 default path is hardcoded in LyX.
8197 * configure.in: Use LYX_GNU_GETTEXT.
8199 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8200 AM_GNU_GETTEXT with a bug fixed.
8202 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8204 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8206 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8207 which is used to point to LyX data is now LYX_DIR_11x.
8209 * lyx.man: convert to a unix text file; small updates.
8211 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8213 * src/support/LSubstring.[Ch]: made the second arg of most of the
8214 constructors be a const reference.
8216 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8219 * src/support/lyxstring.[Ch] (swap): added missing member function
8220 and specialization of swap(str, str);
8222 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8224 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8225 trace of the old one.
8227 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8228 put the member definitions in undo.C.
8230 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8231 NEW_TEXT and have now only code that was included when this was
8234 * src/intl.C (LCombo): use static_cast
8236 (DispatchCallback): ditto
8238 * src/definitions.h: removed whole file
8240 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8242 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8243 parsing and stores in a std:map. a regex defines the file format.
8244 removed unneeded members.
8246 * src/bufferparams.h: added several enums from definitions.h here.
8247 Removed unsused destructor. Changed some types to use proper enum
8248 types. use block to have the temp_bullets and user_defined_bullets
8249 and to make the whole class assignable.
8251 * src/bufferparams.C (Copy): removed this functions, use a default
8254 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8257 * src/buffer.C (readLyXformat2): commend out all that have with
8258 oldpapersize to do. also comment out all that hve to do with
8259 insetlatex and insetlatexdel.
8260 (setOldPaperStuff): commented out
8262 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8264 * src/LyXAction.C: remove use of inset-latex-insert
8266 * src/mathed/math_panel.C (button_cb): use static_cast
8268 * src/insets/Makefile.am (insets_o_SOURCES): removed
8271 * src/support/lyxstring.C (helper): use the unsigned long
8272 specifier, UL, instead of a static_cast.
8274 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8276 * src/support/block.h: new file. to be used as a c-style array in
8277 classes, so that the class can be assignable.
8279 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8281 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8282 NULL, make sure to return an empty string (it is not possible to
8283 set a string to NULL).
8285 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8287 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8289 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8291 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8292 link line, so that Irix users (for example) can set it explicitely to
8295 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8296 it can be overidden at make time (static or dynamic link, for
8299 * src/vc-backend.C, src/LaTeXFeatures.h,
8300 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8301 statements to bring templates to global namespace.
8303 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/support/lyxstring.C (operator[] const): make it standard
8308 * src/minibuffer.C (Init): changed to reflect that more
8309 information is given from the lyxvc and need not be provided here.
8311 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8313 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8315 * src/LyXView.C (UpdateTimerCB): use static_cast
8316 (KeyPressMask_raw_callback): ditto
8318 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8319 buffer_, a lot of changes because of this. currentBuffer() ->
8320 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8321 also changes to other files because of this.
8323 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8325 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8326 have no support for RCS and partial support for CVS, will be
8329 * src/insets/ several files: changes because of function name
8330 changes in Bufferview and LyXView.
8332 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8334 * src/support/LSubstring.[Ch]: new files. These implement a
8335 Substring that can be very convenient to use. i.e. is this
8337 string a = "Mary had a little sheep";
8338 Substring(a, "sheep") = "lamb";
8339 a is now "Mary has a little lamb".
8341 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8342 out patterns and subpatterns of strings. It is used by LSubstring
8343 and also by vc-backend.C
8345 * src/support/lyxstring.C: went over all the assertions used and
8346 tried to correct the wrong ones and flag which of them is required
8347 by the standard. some bugs found because of this. Also removed a
8348 couple of assertions.
8350 * src/support/Makefile.am (libsupport_a_SOURCES): added
8351 LSubstring.[Ch] and LRegex.[Ch]
8353 * src/support/FileInfo.h: have struct stat buf as an object and
8354 not a pointer to one, some changes because of this.
8356 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8357 information in layout when adding the layouts preamble to the
8360 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8363 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8364 because of bug in OS/2.
8366 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8368 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8369 \verbatim@font instead of \ttfamily, so that it can be redefined.
8371 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8372 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8373 src/layout.h, src/text2.C: add 'using' directive to bring the
8374 STL templates we need from the std:: namespace to the global one.
8375 Needed by DEC cxx in strict ansi mode.
8377 * src/support/LIstream.h,src/support/LOstream.h,
8378 src/support/lyxstring.h,src/table.h,
8379 src/lyxlookup.h: do not include <config.h> in header
8380 files. This should be done in the .C files only.
8382 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8386 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8388 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8389 from Kayvan to fix the tth invokation.
8391 * development/lyx.spec.in: updates from Kayvan to reflect the
8392 changes of file names.
8394 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8396 * src/text2.C (InsertStringB): use std::copy
8397 (InsertStringA): use std::copy
8399 * src/bufferlist.C: use a vector to store the buffers in. This is
8400 an internal change and should not affect any other thing.
8402 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8405 * src/text.C (Fill): fix potential bug, one off bug.
8407 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8409 * src/Makefile.am (lyx_main.o): add more files it depends on.
8411 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8413 * src/support/lyxstring.C: use size_t for the reference count,
8414 size, reserved memory and xtra.
8415 (internal_compare): new private member function. Now the compare
8416 functions should work for std::strings that have embedded '\0'
8418 (compare): all compare functions rewritten to use
8421 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8423 * src/support/lyxstring.C (compare): pass c_str()
8424 (compare): pass c_str
8425 (compare): pass c_str
8427 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8429 * src/support/DebugStream.C: <config.h> was not included correctly.
8431 * lib/configure: forgot to re-generate it :( I'll make this file
8432 auto generated soon.
8434 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8436 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8439 * src/support/lyxstring.C: some changes from length() to rep->sz.
8440 avoids a function call.
8442 * src/support/filetools.C (SpaceLess): yet another version of the
8443 algorithm...now per Jean-Marc's suggestions.
8445 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * src/layout.C (less_textclass_desc): functor for use in sorting
8449 (LyXTextClass::Read): sort the textclasses after reading.
8451 * src/support/filetools.C (SpaceLess): new version of the
8452 SpaceLess functions. What problems does this one give? Please
8455 * images/banner_bw.xbm: made the arrays unsigned char *
8457 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8459 * src/support/lyxstring.C (find): remove bogus assertion in the
8460 two versions of find where this has not been done yet.
8462 * src/support/lyxlib.h: add missing int return type to
8465 * src/menus.C (ShowFileMenu): disable exporting to html if no
8466 html export command is present.
8468 * config/lib_configure.m4: add a test for an HTML converter. The
8469 programs checked for are, in this order: tth, latex2html and
8472 * lib/configure: generated from config/lib_configure.m4.
8474 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8475 html converter. The parameters are now passed through $$FName and
8476 $$OutName, instead of standard input/output.
8478 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8480 * lib/lyxrc.example: update description of \html_command.
8481 add "quotes" around \screen_font_xxx font setting examples to help
8482 people who use fonts with spaces in their names.
8484 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * Distribution files: updates for v1.1.2
8488 * src/support/lyxstring.C (find): remove bogus assert and return
8489 npos for the same condition.
8491 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8493 * added patch for OS/2 from SMiyata.
8495 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8497 * src/text2.C (CutSelection): make space_wrapped a bool
8498 (CutSelection): dont declare int i until we have to.
8499 (alphaCounter): return a char const *.
8501 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8503 * src/support/syscall.C (Systemcalls::kill):
8504 src/support/filetools.C (PutEnv, PutEnvPath):
8505 src/lyx_cb.C (addNewlineAndDepth):
8506 src/FontInfo.C (FontInfo::resize): condition some #warning
8507 directives with WITH_WARNINGS.
8510 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8512 * src/layout.[Ch] + several files: access to class variables
8513 limited and made accessor functions instead a lot of code changed
8514 becuase of this. Also instead of returning pointers often a const
8515 reference is returned instead.
8517 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8519 * src/Makefile.am (dist-hook): added used to remove the CVS from
8520 cheaders upon creating a dist
8521 (EXTRA_DIST): added cheaders
8523 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8524 a character not as a small integer.
8526 * src/support/lyxstring.C (find): removed Assert and added i >=
8527 rep->sz to the first if.
8529 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8531 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8532 src/LyXView.C src/buffer.C src/bufferparams.C
8533 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8534 src/text2.C src/insets/insetinclude.C:
8535 lyxlayout renamed to textclasslist.
8537 * src/layout.C: some lyxerr changes.
8539 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8540 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8541 (LyXLayoutList): removed all traces of this class.
8542 (LyXTextClass::Read): rewrote LT_STYLE
8543 (LyXTextClass::hasLayout): new function
8544 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8545 both const and nonconst version.
8546 (LyXTextClass::delete_layout): new function.
8547 (LyXTextClassList::Style): bug fix. do the right thing if layout
8549 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8550 (LyXTextClassList::NameOfLayout): ditto
8551 (LyXTextClassList::Load): ditto
8553 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8555 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8557 * src/LyXAction.C (LookupFunc): added a workaround for sun
8558 compiler, on the other hand...we don't know if the current code
8559 compiles on sun at all...
8561 * src/support/filetools.C (CleanupPath): subst fix
8563 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8566 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8567 complained about this one?
8569 * src/insets/insetinclude.C (Latex): subst fix
8571 * src/insets/insetbib.C (getKeys): subst fix
8573 * src/LyXSendto.C (SendtoApplyCB): subst fix
8575 * src/lyx_main.C (init): subst fix
8577 * src/layout.C (Read): subst fix
8579 * src/lyx_sendfax_main.C (button_send): subst fix
8581 * src/buffer.C (RoffAsciiTable): subst fix
8583 * src/lyx_cb.C (MenuFax): subst fix
8584 (PrintApplyCB): subst fix
8586 1999-10-26 Juergen Vigna <jug@sad.it>
8588 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8590 (Read): Cleaned up this code so now we read only format vestion >= 5
8592 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8594 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8595 come nobody has complained about this one?
8597 * src/insets/insetinclude.C (Latex): subst fix
8599 * src/insets/insetbib.C (getKeys): subst fix
8601 * src/lyx_main.C (init): subst fix
8603 * src/layout.C (Read): subst fix
8605 * src/buffer.C (RoffAsciiTable): subst fix
8607 * src/lyx_cb.C (MenuFax): subst fix.
8609 * src/layout.[hC] + some other files: rewrote to use
8610 std::container to store textclasses and layouts in.
8611 Simplified, removed a lot of code. Make all classes
8612 assignable. Further simplifications and review of type
8613 use still to be one.
8615 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8616 lastfiles to create the lastfiles partr of the menu.
8618 * src/lastfiles.[Ch]: rewritten to use deque to store the
8619 lastfiles in. Uses fstream for reading and writing. Simplifies
8622 * src/support/syscall.C: remove explicit cast.
8624 * src/BufferView.C (CursorToggleCB): removed code snippets that
8626 use explicat C++ style casts instead of C style casts. also use
8627 u_vdata instea of passing pointers in longs.
8629 * src/PaperLayout.C: removed code snippets that were commented out.
8631 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8633 * src/lyx_main.C: removed code snippets that wer commented out.
8635 * src/paragraph.C: removed code snippets that were commented out.
8637 * src/lyxvc.C (logClose): use static_cast
8639 (viewLog): remove explicit cast to void*
8640 (showLog): removed old commented code
8642 * src/menus.C: use static_cast instead of C style casts. use
8643 u_vdata instead of u_ldata. remove explicit cast to (long) for
8644 pointers. Removed old code that was commented out.
8646 * src/insets/inset.C: removed old commented func
8648 * src/insets/insetref.C (InsetRef): removed old code that had been
8649 commented out for a long time.
8651 (escape): removed C style cast
8653 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8655 * src/insets/insetlatex.C (Draw): removed old commented code
8656 (Read): rewritten to use string
8658 * src/insets/insetlabel.C (escape): removed C style cast
8660 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8662 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8665 * src/insets/insetinclude.h: removed a couple of stupid bools
8667 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8668 (Clone): remove C style cast
8669 (getKeys): changed list to lst because of std::list
8671 * src/insets/inseterror.C (Draw): removed som old commented code.
8673 * src/insets/insetcommand.C (Draw): removed some old commented code.
8675 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8676 commented out forever.
8677 (bibitem_cb): use static_cast instead of C style cast
8678 use of vdata changed to u_vdata.
8680 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8682 (CloseUrlCB): use static_cast instead of C style cast.
8683 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8685 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8686 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8687 (CloseInfoCB): static_cast from ob->u_vdata instead.
8688 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8691 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8692 (C_InsetError_CloseErrorCB): forward the ob parameter
8693 (CloseErrorCB): static_cast from ob->u_vdata instead.
8695 * src/vspace.h: include LString.h since we use string in this class.
8697 * src/vspace.C (lyx_advance): changed name from advance because of
8698 nameclash with stl. And since we cannot use namespaces yet...I
8699 used a lyx_ prefix instead. Expect this to change when we begin
8702 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8704 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8705 and removed now defunct constructor and deconstructor.
8707 * src/BufferView.h: have backstack as a object not as a pointer.
8708 removed initialization from constructor. added include for BackStack
8710 * development/lyx.spec.in (%build): add CFLAGS also.
8712 * src/screen.C (drawFrame): removed another warning.
8714 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8716 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8717 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8718 README and ANNOUNCE a bit for the next release. More work is
8721 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8722 unbreakable if we are in freespacing mode (LyX-Code), but not in
8725 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8727 * src/BackStack.h: fixed initialization order in constructor
8729 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8731 * acinclude.m4 (VERSION): new rules for when a version is
8732 development, added also a variable for prerelease.
8733 (warnings): we set with_warnings=yes for prereleases
8734 (lyx_opt): prereleases compile with same optimization as development
8735 (CXXFLAGS): only use pedantic if we are a development version
8737 * src/BufferView.C (restorePosition): don't do anything if the
8740 * src/BackStack.h: added member empty, use this to test if there
8741 is anything to pop...
8743 1999-10-25 Juergen Vigna <jug@sad.it>
8746 * forms/layout_forms.fd +
8747 * forms/latexoptions.fd +
8748 * lyx.fd: changed for various form resize issues
8750 * src/mathed/math_panel.C +
8751 * src/insets/inseterror.C +
8752 * src/insets/insetinfo.C +
8753 * src/insets/inseturl.C +
8754 * src/insets/inseturl.h +
8757 * src/PaperLayout.C +
8758 * src/ParagraphExtra.C +
8759 * src/TableLayout.C +
8761 * src/layout_forms.C +
8768 * src/menus.C: fixed various resize issues. So now forms can be
8769 resized savely or not be resized at all.
8771 * forms/form_url.fd +
8772 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8775 * src/insets/Makefile.am: added files form_url.[Ch]
8777 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8779 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8780 (and presumably 6.2).
8782 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8783 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8784 remaining static member callbacks.
8786 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8789 * src/support/lyxstring.h: declare struct Srep as friend of
8790 lyxstring, since DEC cxx complains otherwise.
8792 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8794 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8796 * src/LaTeX.C (run): made run_bibtex also depend on files with
8798 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8799 are put into the dependency file.
8801 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8802 the code has shown itself to work
8803 (create_ispell_pipe): removed another warning, added a comment
8806 * src/minibuffer.C (ExecutingCB): removed code that has been
8807 commented out a long time
8809 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8810 out code + a warning.
8812 * src/support/lyxstring.h: comment out the three private
8813 operators, when compiling with string ansi conforming compilers
8816 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8818 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8819 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8822 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8825 * src/mathed/math_panel.C (create_math_panel): remove explicit
8828 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8831 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8832 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8833 to XCreatePixmapFromBitmapData
8834 (fl_set_bmtable_data): change the last argument to be unsigned
8836 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8837 and bh to be unsigned int, remove explicit casts in call to
8838 XReadBitmapFileData.
8840 * images/arrows.xbm: made the arrays unsigned char *
8841 * images/varsz.xbm: ditto
8842 * images/misc.xbm: ditto
8843 * images/greek.xbm: ditto
8844 * images/dots.xbm: ditto
8845 * images/brel.xbm: ditto
8846 * images/bop.xbm: ditto
8848 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8850 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8851 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8852 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8854 (LYX_CXX_CHEADERS): added <clocale> to the test.
8856 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8858 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8860 * src/support/lyxstring.C (append): fixed something that must be a
8861 bug, rep->assign was used instead of rep->append.
8863 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8866 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8867 lyx insert double chars. Fix spotted by Kayvan.
8869 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8871 * Fixed the tth support. I messed up with the Emacs patch apply feature
8872 and omitted the changes in lyxrc.C.
8874 1999-10-22 Juergen Vigna <jug@sad.it>
8876 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8878 * src/lyx_cb.C (MenuInsertRef) +
8879 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8880 the form cannot be resized under it limits (fixes a segfault)
8882 * src/lyx.C (create_form_form_ref) +
8883 * forms/lyx.fd: Changed Gravity on name input field so that it is
8886 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8888 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8889 <ostream> and <istream>.
8891 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8892 whether <fstream> provides the latest standard features, or if we
8893 have an oldstyle library (like in egcs).
8894 (LYX_CXX_STL_STRING): fix the test.
8896 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8897 code on MODERN_STL_STREAM.
8899 * src/support/lyxstring.h: use L{I,O}stream.h.
8901 * src/support/L{I,O}stream.h: new files, designed to setup
8902 correctly streams for our use
8903 - includes the right header depending on STL capabilities
8904 - puts std::ostream and std::endl (for LOStream.h) or
8905 std::istream (LIStream.h) in toplevel namespace.
8907 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8909 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8910 was a bib file that had been changed we ensure that bibtex is run.
8911 (runBibTeX): enhanced to extract the names of the bib files and
8912 getting their absolute path and enter them into the dep file.
8913 (findtexfile): static func that is used to look for tex-files,
8914 checks for absolute patchs and tries also with kpsewhich.
8915 Alternative ways of finding the correct files are wanted. Will
8917 (do_popen): function that runs a command using popen and returns
8918 the whole output of that command in a string. Should be moved to
8921 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8922 file with extension ext has changed.
8924 * src/insets/figinset.C: added ifdef guards around the fl_free
8925 code that jug commented out. Now it is commented out when
8926 compiling with XForms == 0.89.
8928 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8929 to lyxstring.C, and only keep a forward declaration in
8930 lyxstring.h. Simplifies the header file a bit and should help a
8931 bit on compile time too. Also changes to Srep will not mandate a
8932 recompile of code just using string.
8933 (~lyxstring): definition moved here since it uses srep.
8934 (size): definition moved here since it uses srep.
8936 * src/support/lyxstring.h: removed a couple of "inline" that should
8939 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8941 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8944 1999-10-21 Juergen Vigna <jug@sad.it>
8946 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8947 set to left if I just remove the width entry (or it is empty).
8949 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8950 paragraph when having dummy paragraphs.
8952 1999-10-20 Juergen Vigna <jug@sad.it>
8954 * src/insets/figinset.C: just commented some fl_free_form calls
8955 and added warnings so that this calls should be activated later
8956 again. This avoids for now a segfault, but we have a memory leak!
8958 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8959 'const char * argument' to 'string argument', this should
8960 fix some Asserts() in lyxstring.C.
8962 * src/lyxfunc.h: Removed the function argAsString(const char *)
8963 as it is not used anymore.
8965 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8967 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8970 * src/Literate.h: some funcs moved from public to private to make
8971 interface clearer. Unneeded args removed.
8973 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8975 (scanBuildLogFile): ditto
8977 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8978 normal TeX Error. Still room for improvement.
8980 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8982 * src/buffer.C (insertErrors): changes to make the error
8983 desctription show properly.
8985 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8988 * src/support/lyxstring.C (helper): changed to use
8989 sizeof(object->rep->ref).
8990 (operator>>): changed to use a pointer instead.
8992 * src/support/lyxstring.h: changed const reference & to value_type
8993 const & lets see if that helps.
8995 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8997 * Makefile.am (rpmdist): fixed to have non static package and
9000 * src/support/lyxstring.C: removed the compilation guards
9002 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9005 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9006 conditional compile of lyxstring.Ch
9008 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9009 stupid check, but it is a lot better than the bastring hack.
9010 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9012 * several files: changed string::erase into string::clear. Not
9015 * src/chset.C (encodeString): use a char temporary instead
9017 * src/table.C (TexEndOfCell): added tostr around
9018 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9019 (TexEndOfCell): ditto
9020 (TexEndOfCell): ditto
9021 (TexEndOfCell): ditto
9022 (DocBookEndOfCell): ditto
9023 (DocBookEndOfCell): ditto
9024 (DocBookEndOfCell): ditto
9025 (DocBookEndOfCell): ditto
9027 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9029 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9031 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9032 (MenuBuildProg): added tostr around ret
9033 (MenuRunChktex): added tostr around ret
9034 (DocumentApplyCB): added tostr around ret
9036 * src/chset.C (encodeString): added tostr around t->ic
9038 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9039 (makeLaTeXFile): added tostr around tocdepth
9040 (makeLaTeXFile): added tostr around ftcound - 1
9042 * src/insets/insetbib.C (setCounter): added tostr around counter.
9044 * src/support/lyxstring.h: added an operator+=(int) to catch more
9047 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9048 (lyxstring): We DON'T allow NULL pointers.
9050 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9052 * src/mathed/math_macro.C (MathMacroArgument::Write,
9053 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9054 when writing them out.
9056 * src/LString.C: remove, since it is not used anymore.
9058 * src/support/lyxstring.C: condition the content to
9059 USE_INCLUDED_STRING macro.
9061 * src/mathed/math_symbols.C, src/support/lstrings.C,
9062 src/support/lyxstring.C: add `using' directive to specify what
9063 we need in <algorithm>. I do not think that we need to
9064 conditionalize this, but any thought is appreciated.
9066 * many files: change all callback functions to "C" linkage
9067 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9068 strict_ansi. Those who were static are now global.
9069 The case of callbacks which are static class members is
9070 trickier, since we have to make C wrappers around them (see
9071 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9072 did not finish this yet, since it defeats the purpose of
9073 encapsulation, and I am not sure what the best route is.
9075 1999-10-19 Juergen Vigna <jug@sad.it>
9077 * src/support/lyxstring.C (lyxstring): we permit to have a null
9078 pointer as assignment value and just don't assign it.
9080 * src/vspace.C (nextToken): corrected this function substituting
9081 find_first(_not)_of with find_last_of.
9083 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9084 (TableOptCloseCB) (TableSpeCloseCB):
9085 inserted fl_set_focus call for problem with fl_hide_form() in
9088 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9090 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9093 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9095 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9096 LyXLex::next() and not eatline() to get its argument.
9098 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9100 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9101 instead, use fstreams for io of the depfile, removed unneeded
9102 functions and variables.
9104 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9105 vector instead, removed all functions and variables that is not in
9108 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9110 * src/buffer.C (insertErrors): use new interface to TeXError
9112 * Makefile.am (rpmdist): added a rpmdist target
9114 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9115 per Kayvan's instructions.
9117 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9119 * src/Makefile.am: add a definition for localedir, so that locales
9120 are found after installation (Kayvan)
9122 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9124 * development/.cvsignore: new file.
9126 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9128 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9129 C++ compiler provides wrappers for C headers and use our alternate
9132 * configure.in: use LYX_CXX_CHEADERS.
9134 * src/cheader/: new directory, populated with cname headers from
9135 libstdc++-2.8.1. They are a bit old, but probably good enough for
9136 what we want (support compilers who lack them).
9138 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9139 from includes. It turns out is was stupid.
9141 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * lib/Makefile.am (install-data-local): forgot a ';'
9144 (install-data-local): forgot a '\'
9145 (libinstalldirs): needed after all. reintroduced.
9147 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9149 * configure.in (AC_OUTPUT): added lyx.spec
9151 * development/lyx.spec: removed file
9153 * development/lyx.spec.in: new file
9155 * po/*.po: merged with lyx.pot becuase of make distcheck
9157 * lib/Makefile.am (dist-hook): added dist-hook so that
9158 documentation files will be included when doing a make
9159 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9160 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9162 more: tried to make install do the right thing, exclude CVS dirs
9165 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9166 Path would fit in more nicely.
9168 * all files that used to use pathstack: uses now Path instead.
9169 This change was a lot easier than expected.
9171 * src/support/path.h: new file
9173 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9175 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9177 * src/support/lyxstring.C (getline): Default arg was given for
9180 * Configure.cmd: removed file
9182 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9185 streams classes and types, add the proper 'using' statements when
9186 MODERN_STL is defined.
9188 * src/debug.h: move the << operator definition after the inclusion
9191 * src/support/filetools.C: include "LAssert.h", which is needed
9194 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9197 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9198 include "debug.h" to define a proper ostream.
9200 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9202 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9203 method to the SystemCall class which can kill a process, but it's
9204 not fully implemented yet.
9206 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9208 * src/support/FileInfo.h: Better documentation
9210 * src/lyxfunc.C: Added support for buffer-export html
9212 * src/menus.C: Added Export->As HTML...
9214 * lib/bind/*.bind: Added short-cut for buffer-export html
9216 * src/lyxrc.*: Added support for new \tth_command
9218 * lib/lyxrc.example: Added stuff for new \tth_command
9220 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9222 * lib/Makefile.am (IMAGES): removed images/README
9223 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9224 installes in correct place. Check permisions is installed
9227 * src/LaTeX.C: some no-op changes moved declaration of some
9230 * src/LaTeX.h (LATEX_H): changed include guard name
9232 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9234 * lib/reLyX/Makefile.am: install noweb2lyx.
9236 * lib/Makefile.am: install configure.
9238 * lib/reLyX/configure.in: declare a config aux dir; set package
9239 name to lyx (not sure what the best solution is); generate noweb2lyx.
9241 * lib/layouts/egs.layout: fix the bibliography layout.
9243 1999-10-08 Jürgen Vigna <jug@sad.it>
9245 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9246 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9247 it returned without continuing to search the path.
9249 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9251 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9252 also fixes a bug. It is not allowed to do tricks with std::strings
9253 like: string a("hei"); &a[e]; this will not give what you
9254 think... Any reason for the complexity in this func?
9256 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9258 * Updated README and INSTALL a bit, mostly to check that my
9259 CVS rights are correctly set up.
9261 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9263 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9264 does not allow '\0' chars but lyxstring and std::string does.
9266 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9268 * autogen.sh (AUTOCONF): let the autogen script create the
9269 POTFILES.in file too. POTFILES.in should perhaps now not be
9270 included in the cvs module.
9272 * some more files changed to use C++ includes instead of C ones.
9274 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9276 (Reread): added tostr to nlink. buggy output otherwise.
9277 (Reread): added a string() around szMode when assigning to Buffer,
9278 without this I got a log of garbled info strings.
9280 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9283 * I have added several ostream & operator<<(ostream &, some_type)
9284 functions. This has been done to avoid casting and warnings when
9285 outputting enums to lyxerr. This as thus eliminated a lot of
9286 explicit casts and has made the code clearer. Among the enums
9287 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9288 mathed enums, some font enum the Debug::type enum.
9290 * src/support/lyxstring.h (clear): missing method. equivalent of
9293 * all files that contained "stderr": rewrote constructs that used
9294 stderr to use lyxerr instead. (except bmtable)
9296 * src/support/DebugStream.h (level): and the passed t with
9297 Debug::ANY to avoid spurious bits set.
9299 * src/debug.h (Debug::type value): made it accept strings of the
9302 * configure.in (Check for programs): Added a check for kpsewhich,
9303 the latex generation will use this later to better the dicovery of
9306 * src/BufferView.C (create_view): we don't need to cast this to
9307 (void*) that is done automatically.
9308 (WorkAreaButtonPress): removed some dead code.
9310 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9312 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9313 is not overwritten when translated (David Sua'rez de Lis).
9315 * lib/CREDITS: Added David Sua'rez de Lis
9317 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9319 * src/bufferparams.C (BufferParams): default input encoding is now
9322 * acinclude.m4 (cross_compiling): comment out macro
9323 LYX_GXX_STRENGTH_REDUCE.
9325 * acconfig.h: make sure that const is not defined (to empty) when
9326 we are compiling C++. Remove commented out code using SIZEOF_xx
9329 * configure.in : move the test for const and inline as late as
9330 possible so that these C tests do not interefere with C++ ones.
9331 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9332 has not been proven.
9334 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9336 * src/table.C (getDocBookAlign): remove bad default value for
9339 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9341 (ShowFileMenu2): ditto.
9343 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9346 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9348 * Most files: finished the change from the old error code to use
9349 DebugStream for all lyxerr debugging. Only minor changes remain
9350 (e.g. the setting of debug levels using strings instead of number)
9352 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9354 * src/layout.C (Add): Changed to use compare_no_case instead of
9357 * src/FontInfo.C: changed loop variable type too string::size_type.
9359 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9361 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9362 set ETAGS_ARGS to --c++
9364 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9366 * src/table.C (DocBookEndOfCell): commented out two unused variables
9368 * src/paragraph.C: commented out four unused variables.
9370 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9371 insed a if clause with type string::size_type.
9373 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9376 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9378 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9379 variable, also changed loop to go from 0 to lenght + 1, instead of
9380 -1 to length. This should be correct.
9382 * src/LaTeX.C (scanError): use string::size_type as loop variable
9385 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9386 (l.896) since y_tmp and row was not used anyway.
9388 * src/insets/insetref.C (escape): use string::size_type as loop
9391 * src/insets/insetquotes.C (Width): use string::size_type as loop
9393 (Draw): use string::size_type as loop variable type.
9395 * src/insets/insetlatexaccent.C (checkContents): use
9396 string::size_type as loop variable type.
9398 * src/insets/insetlabel.C (escape): use string::size_type as loop
9401 * src/insets/insetinfo.C: added an extern for current_view.
9403 * src/insets/insetcommand.C (scanCommand): use string::size_type
9404 as loop variable type.
9406 * most files: removed the RCS tags. With them we had to recompile
9407 a lot of files after a simple cvs commit. Also we have never used
9408 them for anything meaningful.
9410 * most files: tags-query-replace NULL 0. As adviced several plases
9411 we now use "0" instead of "NULL" in our code.
9413 * src/support/filetools.C (SpaceLess): use string::size_type as
9416 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9418 * src/paragraph.C: fixed up some more string stuff.
9420 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9422 * src/support/filetools.h: make modestr a std::string.
9424 * src/filetools.C (GetEnv): made ch really const.
9426 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9427 made code that used these use max/min from <algorithm> instead.
9429 * changed several c library include files to their equivalent c++
9430 library include files. All is not changed yet.
9432 * created a support subdir in src, put lyxstring and lstrings
9433 there + the extra files atexit, fileblock, strerror. Created
9434 Makefile.am. edited configure.in and src/Makefile.am to use this
9435 new subdir. More files moved to support.
9437 * imported som of the functions from repository lyx, filetools
9439 * ran tags-query-replace on LString -> string, corrected the bogus
9440 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9441 is still some errors in there. This is errors where too much or
9442 too litle get deleted from strings (string::erase, string::substr,
9443 string::replace), there can also be some off by one errors, or
9444 just plain wrong use of functions from lstrings. Viewing of quotes
9447 * LyX is now running fairly well with string, but there are
9448 certainly some bugs yet (see above) also string is quite different
9449 from LString among others in that it does not allow null pointers
9450 passed in and will abort if it gets any.
9452 * Added the revtex4 files I forgot when setting up the repository.
9454 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9456 * All over: Tried to clean everything up so that only the files
9457 that we really need are included in the cvs repository.
9458 * Switched to use automake.
9459 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9460 * Install has not been checked.
9462 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9464 * po/pt.po: Three errors:
9465 l.533 and l.538 format specification error
9466 l. 402 duplicate entry, I just deleted it.