1 2001-01-09 Juergen Vigna <jug@sad.it>
3 * src/tabular.C (OldFormatRead): convert the footer/header information
5 (getTokenValue): chaned this functions again.
6 (string2type): added a bunch of this functions per type.
7 (Write): use type2string and write columns first.
8 (type2string): added a bunch of this functions per type.
10 (TeXTopHLine): check row parameter.
12 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
14 * src/tabular.C (getTokenValue): Fix crash with malformed files.
15 (Read): Read the rotate attribute.
17 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
19 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
20 class switching; do not do anything if class has not been changed.
22 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
24 * lib/build-listerrors: Exit if literate-article doesn't appear in
27 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
29 * src/combox.h (getline): small fix for sun CC 6.0
30 * src/combox.C (input_cb): ditto.
31 * src/spellchecker.C (sigchldhandler): ditto.
33 * src/lyx_main.C (init): do not query for creation of user
34 directory when running without a GUI.
36 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
38 * src/mathed/formula.C (LocalDispatch): Toggle font properties.
40 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
42 * BufferView2.C (open_new_inset): Added 2nd argument.
43 (getParentText, getParentLanguage): New methods.
45 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
46 LFUN_INSET_TABULAR for RTL text.
48 * src/tabular.C (Latex): Put \R{} around RTL cells.
50 * src/text2.C (InsertInset): Change cursor position for highly
53 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
54 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
56 * src/insets/insettabular.C (LocalDispatch): When dispatching
57 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
58 locked, then the insettext of the new cell will be locked.
59 (moveLeft, moveRight): Fixed for RTL tabulars.
60 (moveNextCell, movePrevCell): Ditto.
61 (isRightToLeft): New method.
63 * src/insets/insettext.C (LocalDispatch): Fixed handling of
64 non-dispatched function in the locking inset.
65 (Edit): If the inset is empty set the language of the current font
66 to the language to the surronding text (this code was moved from
67 LocalDispatch to allow the user to change the languaeg before
69 (moveRight, moveLeft): Fixed for RTL text.
70 (checkAndActivateInset): Fixed.
72 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
74 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
76 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
80 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
81 around some ispell code.
83 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
84 Unitialized Memory Read in purify.
86 * lib/examples/nl_splash.lyx: update from Tino Meinen.
88 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
90 * src/frontends/xforms/FormDocument.C (FormDocument::build):
91 Disable class_->choice_doc_class and language_->choice_language to
92 allow using the class/language combox with keyboard.
94 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
96 * src/support/snprintf.c (va_copy): only define va_copy if undefined
98 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
100 * src/lyxvc.C (showLog): give the tempfile a mask
102 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
105 * src/support/filetools.C (IsDirWriteable): give the tempfile a
106 mask and unlink the tempfile after use.
108 2001-01-04 Juergen Vigna <jug@sad.it>
110 * src/insets/insettabular.C (resetPos): an extra scroll, but we
111 really should redo all this scrolling code!
112 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
114 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
117 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
118 (pasteSelection): pay attention to multicolumn cells.
119 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
121 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
123 * src/mathed/math_panel.C (deco_cb): check the decoration index is
126 * src/frontends/xforms/FormPreferences.C (feedback): apply
127 formatting to the translated string, not to the original one.
128 (printWarning): ditto.
130 * src/gettext.C (_): translate empty string with empty string.
132 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
137 * UPGRADING: mention that tabular format has been changed.
139 2001-01-03 Juergen Vigna <jug@sad.it>
141 * src/insets/insettabular.C (InsetButtonPress): look for button==2
142 and do Clipboard Paste!
144 * src/insets/insettext.C (SetText): added function.
146 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
147 new LFUN_PASTESELECTION.
149 * src/insets/insettext.C (draw): don't clear if top_x changes.
151 * src/insets/insettabular.C (draw): clear only if the inset didn't
152 change in the draw routine.
154 * src/insets/insettext.C (width): make the width dependant on the
157 * src/text.C (draw): comment out the UpdateInset call.
159 * src/screen.C (DrawOneRow):
160 (DrawFromTo): check for bv->text->status not text->status.
162 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
163 dimensions of ascent-descent for the whole row.
165 * src/insets/insettext.C (draw): check also for need_update == INIT.
167 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
169 * Makefile.am (EXTRA_DIST): add autogen.sh
171 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
173 * development/OS2/quick_fix.patch:
174 * lib/configure.cmd: update OS/2 support files.
176 2001-01-02 Juergen Vigna <jug@sad.it>
178 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
180 * src/tabular.C (TeXTopHLine):
181 (TeXBottomHLine): fixed Lars new code.
183 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
185 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
186 from this function and added a BufferView * parameter.
188 * src/mathed/math_symbols.C (math_insert_symbol): ditto
190 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
192 * src/version.h: set to pre3
194 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
196 * src/Makefile.am (lyx_SOURCES): added Floating.C
198 * src/Floating.h: moved all the inlines to Floating.C
200 * src/Floating.C: new file
202 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
204 * src/frontends/xforms/FormPreferences.C (feedback): fix
205 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
207 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
209 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
212 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
214 * src/mathed/math_inset.h: move LString.h to be included first
216 * src/insets/insetfloat.C: adjust for change in private variable names
218 * src/frontends/xforms/xform_helpers.h : don't include config.h
220 * src/frontends/xforms/xform_helpers.C: adjust the order of
221 includes, some whitespace changes.
223 * src/trans.C (Load): constify filename and res
225 * src/text2.C (SetCounter): call Floating::name()
227 * src/screen.C: change to not use owner from WorkArea, but from
230 * src/lyxfunc.C: adjust because of changes in Intl.
232 * src/intl.h: make trans a object instead of pointer, inlucd
233 trans_mgr.h in this file.
234 (getTrans): return a reference to TransManager
236 * src/intl.C: don't include trans_mgr.h here
237 modify calls to trans to work on object instead of on pointer
239 * src/WorkArea.h: add using for Signal1
240 comment out forward decl of BufferView.
242 remove class variable owner_ and getter method for this.
244 * src/WorkArea.C: don't include BufferView.h
245 (WorkArea): change to not take a BufferView.h, use signals
247 (scroll_cb): emit signal
249 * src/LaTeXFeatures.C: include Floatlist.h
250 (getPackages): only load float.sty when needed
251 (getMacros): prepare for outputting the correct code to preamble.
253 * src/Floating.h: make all variables private + rename to var_.
254 (Floating): default ctor
255 (Floating): complex ctor to set a complete Floating
261 * src/FloatList.C (FloatList): use Floating's constructor
264 (newFloat): call type()
265 (defaultPlacement): call placement()
266 (operator): new operator
268 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
269 (scrollUp): call pimpl's scrollCB
271 (pasteClipboard): constify clip
273 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
274 (insertErrors): constify desctext, errortext, msgtxt and errorrow
275 (open_new_inset): delete some commented code.
277 * src/BufferView.[Ch] (enterView): comment out
280 (workAreaMotionNotify): ditto
281 (workAreaButtonPress): ditto
284 (workAreaButtonRelease): ditto
285 (workAreaExpose): ditto
287 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
288 to compile with cvs gcc (2.97).
290 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
292 * lib/ui/default.ui: menu structure cleanup.
294 * lib/languages: add description of entries.
296 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
298 * src/insets/ExternalTemplate.C (readTemplates): change debug
300 (readTemplate): use lyxlex.printError to report read errors.
303 * src/insets/insetexternal.C (Read): suppress debug message when
306 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
308 * src/insets/insetinclude.C (Ascii): New method. Currently
309 supports only verbatim input.
311 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
313 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
315 2000-12-22 Juergen Vigna <jug@sad.it>
317 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
318 have a selection and button == 3.
319 (UpdateLocal): if what == INIT clear selection if existent!
320 (InsetButtonPress): don't activate the cell inset on button==3
322 (LocalDispatch): move curor up/down if exiting an inset which this
325 2000-12-20 Juergen Vigna <jug@sad.it>
327 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
328 calling for the math-panel (do not unlock the math-inset if locked)!
330 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
331 text-insets (with x-offset).
333 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
334 alignment of multicolumn-cells.
336 2000-12-19 Juergen Vigna <jug@sad.it>
338 * src/lyxfunc.C (Dispatch):
339 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
342 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
344 * src/WorkArea.C (work_area_handler): simplify the key/keysym
345 handling for XForms 0.89, this might have rendered some cases
346 unusable. I have at least deadkeys, accent-xxx and KP_x working.
347 Please report proplems.
349 * src/lyxfunc.C (processKeySym): make the self-insert handling
352 2000-12-18 Baruch Even <baruch.even@writeme.com>
354 * src/LaTeX.C (deplog): fix spelling errors
355 * src/text2.C (CutSelection): ditto
356 * src/lyxfunc.C (Dispatch): ditto
358 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
360 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
362 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
363 and h_align in default init.
364 adjust calls to MathedRowSt
366 * src/mathed/math_iter.C: adjust calls to MathedRowSt
367 * src/mathed/math_iter.h (getAD): ditto
369 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
370 methods setBaseline, ascent, descent
371 (class MathMatrixInset): remove method GetAlign, change h_align
374 * src/lyxfunc.C (processKeySym): discover the correct argument if
375 the action is LFUN_SELFINSERT
377 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
379 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
382 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
384 * src/support/copy.C: don't include filetools.h
386 * lib/images: revert to old banner, drop the cucumber.
388 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
390 * src/converter.C (Formats::View): Change the current directory to
391 the directory of the file.
393 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
395 * src/kbsequence.C (addkey): also clear sequence and modifiers if
398 * src/BufferView2.C (theLockingInset): return 0 if text is 0
400 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
402 * Many files: Fix RTL support for insettext.
404 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
406 * README: add mention of broken ghostscript versions, remove
407 reference to non-existent BUGS file
409 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
411 * src/support/lstrings.C (compare_no_case): small fix. When passed
412 length, should use it in the size comparison.
414 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
416 * src/insets/insetexternal.C (getScreenLabel): Return a default
417 value if the template label is empty.
419 * src/lyxlookup.C: do not condition on FL_REVISION.
422 * src/sp_form.C: fix the font size of some text entries
424 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
425 after TOC when there is no TOC.
427 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
428 bind file if it has not been done yet.
429 (read): remove local bindFile variable. Try to fix the handling of
430 RC_BIND and RC_BINDFILE.
432 * src/lyx_main.C (init): use readBindFileIfNeeded().
434 * lib/languages: Change description of german to "German (new
437 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
439 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
440 "Apply" buttons if arg is non-zero.
442 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
443 launching the popup if sufficient info is passed to
444 LFUN_CITATION_CREATE.
446 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
448 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
449 labels (disabled in 1.1.6).
451 * src/lyxrc.[Ch]: New variable label_init_length
453 * mathed/formula.C (LocalDispatch): Preserve the label when
454 changing from display math to eqnarray (however, the label
455 do not appear at the first line, as one might expects, but at the
457 (LocalDispatch): When inserting a label to a formula which already
458 have a label, the old label is used as default value.
459 Also, if the label is changed, then all references to the label
462 * src/mathed/math_iter.C (setLabel): Allow to set the label
463 even if it is empty. This is needed to allow deletion of a label
466 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
467 refernces only if the old label appears once in the document.
469 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
471 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
472 <gehlert@Rcs1.urz.tu-dresden.de>
474 * src/frontends/xforms/FormBase.C: comment out debug.h
476 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
477 code in xform_helpers instead.
478 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
480 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
481 Use N_(), rather than _() when creating strings to pass to browseFile()
482 because browseFile calls gettext() itself now.
484 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
485 display the filename correctly.
487 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
489 * src/converter.C (Move): New method. Used to move file or files
490 from temp dir to the output dir. (this fixes the bug that
491 exporting linuxdoc/docbook document to html would not move all
492 html file from temp directory).
494 * src/support/filetools.C (DirList): Fixed.
496 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
498 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
500 * src/converter.C (Add): Remove $$i when setting latex_command.
502 * src/text.C (IsBoundary): Return false when pos = 0.
504 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
506 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
508 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
510 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
511 need to empty the fields to turn off use of the geometry package!
513 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
515 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
516 (Buffer const &), not a (BufferParams const &) and so fix a crash
517 caused by using current_view before it had been initialised. Not
518 the best way to do this, but much easier than changing
519 Inset::Clone(Buffer const &) to Inset::Clone().
522 * src/tabular.C: changed call to CopyIntoMinibuffer().
524 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
526 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
528 * src/lyxfunc.C (getStatus): disable insertion of floats in a
531 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
533 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
534 changed filter for screen fonts input filter from int to float
536 * src/frontends/xforms/input_validators.c: removed.
537 * src/frontends/xforms/input_validators.C: new file. Can now call C++
538 functions from within the filter functions.
540 * src/frontends/xforms/input_validators.[Ch]
541 (fl_unsigned_float_filter): new filter function.
543 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
544 confused now! And if you think I'm going to do this in
545 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
547 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
549 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
551 * src/WorkArea.C (work_area_handler): don't handle button requests
552 if xbutton.button == 0
554 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
556 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
557 It creates a lot of interesting problems.
559 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
561 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
562 the menu exists in the current menubar before opening it.
564 * src/MenuBackend.C (hasSubmenu): new method.
566 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
567 action value by offsetting actions by a large constant (so that
568 bogs choice result will be less than this constant).
570 * lib/bind/fi_menus.bind: more cleanup to menus.
571 * lib/bind/sciword.bind: ditto.
572 * lib/bind/xemacs.bind: ditto.
573 * lib/bind/emacs.bind: ditto.
574 * lib/bind/pt_menus.bind: ditto.
575 * lib/bind/hu_menus.bind: ditto.
577 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
579 * INSTALL: update PROBLEMS section.
581 * src/lyxlookup.h: remove condition on xforms version, since we
582 should not include it if not appropriate.
584 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
586 * src/LColor.C: "latex text" -> "latex inset" (from
589 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
591 * src/frontends/kde/FormTabularCreate.C:
592 * src/frontends/kde/citationdlg.C:
593 * src/frontends/kde/copyrightdlg.C:
594 * src/frontends/kde/paradlg.C:
595 * src/frontends/kde/paraextradlg.C:
596 * src/frontends/kde/parageneraldlg.C:
597 * src/frontends/kde/printdlg.C:
598 * src/frontends/kde/refdlg.C:
599 * src/frontends/kde/tabcreatedlg.C:
600 * src/frontends/kde/tocdlg.C:
601 * src/frontends/kde/urldlg.C: add necessary headers
604 * src/frontends/kde/dlg/emptytable.C:
605 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
606 default parameters (from Angus Leeming)
608 * src/frontends/kde/dlg/moc/.cvsignore:
609 * src/frontends/kde/dlg/.cvsignore:
610 * src/frontends/kde/moc/.cvsignore: fix the library name
613 * src/frontends/kde/paradlg.C:
614 * src/frontends/kde/parageneraldlg.C:
615 * src/frontends/kde/dlg/para.dlg:
616 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
618 * src/frontends/kde/dlg/README: clarified qtarch version
620 * src/frontends/kde/dlg/Makefile.am: removed the
621 dlg rules as they created spontaneous rebuilds
622 (not a good idea as it requires qtarch)
624 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
626 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
627 fixlevel along with xforms version.
629 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
630 xforms version is strictly less than 0.89.5.
631 * src/lyx_gui.C (LyXGUI): ditto.
632 * src/LyXView.C (show): ditto.
634 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
636 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
637 movement in inset in RTL text.
638 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
639 (workAreaButtonRelease): Do not open a float when there is a selection.
641 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
643 * src/spellchecker.C (RunSpellChecker): Open all floats before
646 * src/text.C (InsertChar): Consider "," as a part of a number
647 (for LTR numbers in RTL text code).
648 (IsBoundary): Fixed (and simplified).
649 (InsertChar): Recalculate cursor boundary.
652 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
654 * src/spellchecker.C: fix figures with pspell enabled
656 * src/insets/figinset.C: workaround for gs hang xforms bug
658 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
660 * lib/bind/??_menus.bind: comment out the entries corresponding to
661 real menus. They should be eventually removed, but I'll let the
662 language maintainers do that.
664 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
666 * src/frontends/kde/parageneraldlg.C:
667 * src/frontends/kde/parageneraldlg.h: don't use
668 a derived class for SpaceAbove/Below
670 * src/frontends/kde/dlg/README: add some info
672 * src/frontends/kde/dlg/*: update data files, update
675 * src/frontends/kde/dlg/moc/Makefile.am: add
678 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
680 * configure.in: add new KDE Makefiles
681 * src/vspace.h: return GlueLength not a normal one
682 * src/support/lstrings.h:
683 * src/support/lstrings.C: add isStrUnsignedInt(),
686 * src/frontends/kde/*: big reorganisation, update
687 FormParagraph, add FormTabCreate
689 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
691 * lib/ui/default.ui: small grammatical change.
693 * src/frontends/xforms/xform_macros.h: removed.
695 * src/frontends/xforms/FormBase.C:
696 * src/frontends/xforms/FormPreferences.C:
697 * src/frontends/xforms/Makefile.am: changes associated with removing
698 xform_macros.h. Should make Lars' debugging a little easier.
700 * src/frontends/xforms/FormPreferences.C:
701 * src/frontends/xforms/FormPreferences.h:
702 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
703 longer use X11 color name database. HSV and RGB dials/sliders.
704 Please let this be the end of this!
706 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
708 * Several files: Allow compilation when the compiler doesn't
711 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
714 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
715 command line options.
717 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
719 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
720 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
723 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
725 * src/frontends/xforms/FormRef.C (updateBrowser):
726 * src/frontends/xforms/forms/form_ref.fd: try clicking on
727 different insets with the sort key active. Now apply this patch!
729 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
731 * src/frontends/xforms/FormPrint.C: set to valid()
732 when we update from the passed parameters.
734 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
736 * src/LColor.C (getFromGUIName): internationalise the comparison.
738 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
739 FormPreferences choice.
741 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
744 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
746 * src/lyxrc.C: more detail for the printer program config
749 * src/LColor.C: ert->latex text. LColor needs a big revamp
750 but will have to wait till after 1.1.6
752 * src/buffer.C: bring up a dialog if we load a document
753 with an un-installed text class, rather than just complain
756 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
758 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
759 the browser form for a combox in a tabbed folder. Bug fix courtesy of
760 Steve Lamont <spl@ncmir.ucsd.edu>.
762 * src/frontends/xforms/FormDocument.C (build):
763 * src/frontends/xforms/FormPreferences.C (Language::build):
764 pass tabfolders to Combox::add() in order to use this work around.
766 * src/frontends/xforms/FormCitation.C (connect): remove max size
768 (update): sort list of bibliography keys.
770 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
772 No max size limitation. Same popup for new and existing insets. Fixes
773 bugs reported by Rob Lahaye.
775 * src/frontends/xforms/FormCitation.C (c-tor):
776 * src/frontends/xforms/FormCopyright.C (c-tor):
777 * src/frontends/xforms/FormError.C (c-tor):
778 * src/frontends/xforms/FormGraphics.C (c-tor):
779 * src/frontends/xforms/FormIndex.C (c-tor):
780 * src/frontends/xforms/FormRef.C (c-tor):
781 * src/frontends/xforms/FormToc.C (c-tor):
782 * src/frontends/xforms/FormUrl.C (c-tor):
783 use correct policy for ButtonController.
785 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
787 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
790 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
792 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
793 Some resizing changes.
795 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
797 * configure.in: fix typo
799 * lib/languages: add ukraninian and change no to no_NO
801 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
803 * src/bufferview_funcs.C (FontSize): use setLyXSize
805 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
807 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
808 to check for systems where mkstemp() is available but not declared
809 in headers. The new autoconf macro lyx_CHECK_DECL can be used
810 to check for declarations in headers.
812 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
814 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
816 * forms/makefile: added bibforms.fd, include_form.fd.
817 Removed lyx_sendfax.fd.
819 * src/LaTeXLog.C (ShowLatexLog):
820 * src/LyXAction.C (init):
821 * src/bufferparams.C (readLanguage): altered messages as suggested by
824 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
827 * src/credits.C: made fd_form_credits non-static, so that it can be
828 redrawn should the xforms colors be re-mapped.
829 * src/spellchecker.C ditto fd_form_spell_options.
831 * src/filedlg.[Ch] (redraw):
832 * src/intl.[Ch] (redraw):
833 * src/lyxfr0.[Ch] (redraw):
834 * src/insets/figinset.[Ch] (redraw):
835 * src/insets/insetexternal.[Ch] (redraw):
836 new methods, connected to Dialogs::redrawGUI.
838 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
839 to be connected to Dialogs::redrawGUI.
841 * src/frontends/xforms/FormCitation.C (build):
842 * src/frontends/xforms/FormCopyright.C (build):
843 * src/frontends/xforms/FormError.C (build):
844 * src/frontends/xforms/FormGraphics.C (build):
845 * src/frontends/xforms/FormIndex.C (build):
846 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
847 * src/frontends/xforms/FormToc.C (build):
848 * src/frontends/xforms/FormUrl.C (build):
849 use the ButtonController correctly.
851 * src/frontends/xforms/FormCopyright.C (build):
852 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
853 the .fd file and into build().
855 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
857 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
859 * src/frontends/xforms/forms/form_citation.fd:
860 * src/frontends/xforms/forms/form_copyright.fd:
861 * src/frontends/xforms/forms/form_error.fd:
862 * src/frontends/xforms/forms/form_graphics.fd:
863 * src/frontends/xforms/forms/form_index.fd:
864 * src/frontends/xforms/forms/form_toc.fd:
865 * src/frontends/xforms/forms/form_url.fd:
866 renamed some of the objects. Named others explicitly for the first time.
867 Added Restore and Apply buttons where appropriate.
869 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
872 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
874 * src/version.h: try the pre2 again
876 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
878 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
880 * src/frontends/kde/FormParagraph.C: added using directive.
882 * src/frontends/kde/paradlg.C: added config.h and using directive.
884 * src/frontends/kde/paradlg.h: added std::qualifier.
886 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
888 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
892 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
894 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
896 * src/version.h: set back to 1.1.6cvs
898 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
900 * src/version.h: set to 1.1.6pre2
902 2000-11-20 Marko Vendelin <markov@ioc.ee>
904 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
906 * src/frontends/gnome/Makefile.am: updated list of XForms object files
908 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
910 * src/LColor.C (init):
911 * src/lyxrc.C (getDescription): changed some comments as suggested by
914 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
915 disconnect the redrawGUI signal in best-practice fashion.
917 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
918 long_opts_tab to reflect the change in name of this tabfolder, as
919 suggested by John Levon.
920 (connect, disconnect): new methods. Don't do much at present other than
921 ensuring that we can't resize the dialog. This just makes xforms go
923 (lots of methods in Colors): made void rather than bool. The idea is
924 to have an isOk() function that keeps track of whether any input is
925 genuinely invalid and should therefore block Save, Apply.
926 Easier to manipulate the counters rapidly.
927 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
928 compiler will like this code. Much cleaner way of doing things.
930 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
932 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
933 rather than simple counters, following suggestion by John Levon.
935 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
936 than engraved frame + text.
938 * src/frontends/xforms/forms/makefile: removed spurious command.
940 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
942 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
944 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
947 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
949 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
950 see what Lars has changed and what is just white space!
951 Now used X directly to ascertain the RGB color associated with the
953 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
955 Added some sort capability.
956 The X11 color name database input is only displayed if the database
957 isn't found in the standard place.
958 Got rid of struct compare_converter; it wasn't used.
959 Probably some other stuff that I've forgotten.
961 * src/frontends/xforms/FormPreferences.h: changed the names of some
962 methods in the Colors struct. Added a couple of structs to help sort
963 colors by name and by RGBColor.
965 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
966 functions into a new class RWInfo.
968 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
969 The dialog is now almost navigable using the keyboard. Unfortunately,
970 the cursor has to be inside a browser for it to be activated. There is
971 no visual feedback for the key shortcuts to the arrow keys (use
972 Alt-appropriate arrow key, Alt-x).
974 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
977 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
978 xform_helpers.[Ch]. See above.
980 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
982 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
984 * src/screen.C (setCursorColor): new method. Sets the color of the
986 (ShowManualCursor): call it.
987 Constify some local variables.
989 * src/LColor.[Ch] (LColor): add entry for cursor
990 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
993 2000-11-19 Juergen Vigna <jug@sad.it>
995 * src/insets/insettabular.C (draw): fixed text border redraw problem.
996 (calculate_dimensions_of_cells): try to boost up when inserting chars.
998 2000-11-15 Rob Lahaye <lahaye@postech.edu>
1000 * lib/ui/default.ui: OptItem used for Fax entry
1002 2000-11-17 Matej Cepl <cepl@bigfoot.com>
1004 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
1006 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
1008 * src/vspace.C (nextToken): fix so it can handle length phrases like
1009 "10mm+-20mm", "40inplus16mmminus10cm" etc.
1011 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1013 * src/frontends/xforms/FormPreferences.C: constify several variables
1014 (BrowserLyX): rewrite to not need the choice variable
1015 (Modify): rewrite to not need the choide variable
1016 (compare_converter): make operator const
1018 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
1019 correct the writing of \set_color
1020 (getDescription): return a const string
1022 * src/kbsequence.[Ch] (addkey): remove dead code
1024 * src/Painter.C (text): remove some commented code
1026 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1028 * src/ColorHandler.[Ch]: removed some header files from .h file.
1029 Included LColor.h in .C file.
1031 * src/LColor.[Ch]: made class copyable so that I could create a
1032 system_lcolor instance.
1034 * src/Painter.h: removed LColor.h.
1036 * src/lyx_gui.C (create_forms): used AddName.
1038 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1039 of user preferences/lyxrc file.
1041 * src/lyxrc.C (output): output changes to lcolor.
1043 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1045 Moved class xformColor to files xform_helpers.[Ch]. These files,
1046 Color.[Ch], could now be moved into src if they would be useful to
1049 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1050 Also moved FormPreferences::browseFile here as it can be used by any
1051 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1053 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1054 ReadableFile): changed the FormPreferences methods a little and moved
1055 them here as they'll be useful elsewhere also.
1057 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1058 Removed some header files and used forward declarations instead.
1060 Removed some methods as they'll be useful elsewhere (see above).
1062 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1063 Can also now modify the LyX LColors. However, for reasons that I don't
1064 yet understand, it appears that we can use
1065 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1066 present. The problem appears to lie in ColorHandler, because I can
1067 change the color using LColor.SetColor(). Similarly, when reading in a
1068 preferences file with some set_color instances, I'll get a warning
1069 like: Color sea green is undefined or may not be redefined
1070 Bad lyxrc set_color for sea green
1072 Once the buffer is loaded, however, I can happily change to this color.
1074 Finally, it appears that I have to set the color of "inset frame"
1075 explicitly, or it oscillates from "black" to "indian red" with each
1078 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1080 * ANNOUNCE: corrected a spelling mistake.
1082 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1085 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1087 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1089 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1092 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1093 match the requirements from the standard better. This is required
1094 to work with gnu libstdc++-v3
1096 * src/frontends/xforms/FormPreferences.C: add explict pair
1097 arguments to browse calls. include support/lyxmanip.h remvoe
1098 extern fmt. whitespace changes. reorder variables in
1099 FormPreferences.h, to match initalizaton order.
1101 * several files: constify more local variables.
1103 * src/buffer.C: remove some commented functions.
1105 * src/DepTable.C (remove_files_with_extension): temporary
1106 work around for gcc 2.97
1107 * src/filedlg.C (find): ditto
1108 * src/Variables.C (set): ditto
1109 * src/LyXAction.C (searchActionArg): ditto
1110 (retrieveActionArg): ditto
1112 * configure.in: check for mktemp too
1114 * UPGRADING: prepare for 1.1.6
1116 * Makefile.am (lgbtags): add backup tags for when etags are
1117 different than usual.
1119 * ANNOUNCE: prepare for 1.1.6
1121 * src/support/tempname.C (make_tempfile): new function, wrapper
1122 around mkstemp and mktemp. Only mkstemp has been tested.
1123 (tempName): call it.
1125 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1127 * default.ui: capitalized some menu items to improve shortcuts.
1129 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1131 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1133 * src/frontends/xforms/Dialogs.C: add "using" directive.
1135 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1137 * src/filedlg.C (Select): highlight suggested file in browser, if
1140 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1141 each tab folder is encapsulated in its own class.
1142 The Language keymaps are now chosen using a text input and a
1143 browser button, rather than a Combox.
1144 All the browser buttons are now functional, although LyXFileDlg
1145 still needs to be modified to make it straighhtforward to return a
1146 directory if that is what is desired.
1148 * src/frontends/xforms/forms/form_preferences.fd: use text input
1149 and browse button to input the Language keymaps. Add a few
1150 callbacks for the browse buttons.
1152 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1154 * src/support/tempname.C (tempName): small changes to make it
1155 safer. remove the '.' before XXXXXX
1157 * src/support/filetools.C (TmpFileName): remove func
1160 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1161 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1162 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1163 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1165 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1166 (FormCommand): ditto
1168 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1171 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1172 for bp (this fixes a reproducible hard crash)
1174 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1177 * src/frontends/xforms/FormBase.h: make bp_ private
1178 (FormBaseBI): remove default for bp
1181 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1184 * src/frontends/xforms/Color.C (RGBColor): made several vars
1185 const, changed initialization of j to allow it to be const
1188 * several files: added const to local variables.
1190 * src/lyx_cb.C: removed several function prototypes and moved them
1194 (UpdateLayoutPreamble):
1196 (MenuInsertLabel): add BufferView as arguemnt
1197 (LayoutsCB): make tmp const
1199 * src/layout_forms.h: regenerated
1201 * src/debug.C: add Debug::FILES
1202 (showLevel) (showTags): translate the desc
1204 * src/debug.h: add FILES as debug target
1206 * src/bufferlist.C: use current_view as an interim measure becuase
1207 of added arguments to MenuWrite and MenuWriteAs
1209 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1211 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1213 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1214 libstdc++ is compiled with.
1216 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1218 * lib/layouts/docbook-book.layout
1219 * lib/layouts/docbook.layout
1220 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1221 those paragraphs are expresse as SGML comments <!-- -->.
1223 * src/LaTeXFeatures.h
1224 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1225 parameter, this allows to express all the include files as relative
1226 paths to the master buffer. The verbatim insert works as the other
1229 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1231 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1233 (MakeDocBookFile): top_element is always written. Some clean up, as
1234 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1236 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1237 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1238 a reference is written instead of the name.
1239 (Validate): use the relative path for the filename.
1241 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1244 * src/support/filetools.h
1245 * src/support/filetools.C (IsSGMLFilename): added.
1248 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1250 * development/OS2/quick_fix.patch:
1251 * lib/configure.cmd:
1252 * README.OS2: quick update to the OS/2 port.
1254 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1256 * src/converter.C: add "using" directive.
1258 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1259 (compare_converter): add "int" as return type.
1261 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1264 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1266 * src/lyx_gui.C (create_forms): map the xform colours, should a
1267 mapping exist. Ie, call XformColor::read().
1269 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1270 and struct HSV as HSVColor.
1271 (XformColor::read, XformColor::write) : new methods that
1272 input/output any changes to the cform GUI colors.
1274 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1277 * src/frontends/xforms/FormPreferences.C Lots of little changes
1278 associated with the changed name of the RGB and HSV structs. Can
1279 now save changes to xforms GUI to file. Commented out
1280 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1281 used currently anyway.
1283 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1285 * src/converter.C: A lot of changes:
1286 - It is no longer possible to choose between two or more ways to
1287 export to some format (the new code uses only the shortest path).
1288 However, it is still possible to choose between pdflatex/ps2pdf
1289 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1290 - Added several methods that makes the FormPreferences code simpler.
1291 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1293 * src/exporter.C (Export): lyxrc.use_pdf is set before
1294 makeLaTeXFile is called. This works but not very nice.
1296 * src/frontends/xforms/FormPreferences.C: The formats/converters
1297 tabs are now fully functional.
1299 * src/buffer.C (getTocList): Add numbers to the captions.
1301 * lib/lyxrc.example: Removed fax section
1303 * src/support/rename.C (rename): Delete the old file if lyx::copy
1306 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1308 * lib/ui/default.ui: minor polishing.
1310 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1312 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1315 * lib/Makefile.am (DOCINST): do not install everything in the
1316 documentation directory.
1318 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1320 * src/bufferlist.C (newFile): set the filename to the constructed
1323 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1324 constructed "newfileXX.lyx" name to the dialog
1326 * src/frontends/DialogBase.h: make update() non-abstract so
1327 KDE doesn't need to implement two update methods for every form
1329 * src/frontends/kde/Makefile.am: add missing xforms objects
1332 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1334 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1336 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1337 structs RGB and HSV. May not be the best place for these files.
1338 Perhaps move them into src ?
1340 * src/frontends/xforms/Makefile.am: added new files.
1342 * src/frontends/xforms/forms/form_preferences.fd:
1343 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1344 replaced all instances of "colour" with "color"!
1346 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1349 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1350 tab. Can now alter the colors of the xform's GUI on the fly. With
1351 the aid of a single static Signal (see below), can "Apply" these
1352 changes to all currently open dialogs. (Well, to all of the NEW
1353 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1354 subsequently opened dialogs will, of course, also have the new
1355 color scheme. Cannot yet save (or load) the choices to file, so
1356 they are lost when exiting LyX.
1358 * src/frontends/Dialogs.h:
1359 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1360 Used to trigger a redraw of any dialogs connected to it because,
1361 for example, the GUI colours have been re-mapped.
1363 * src/frontends/xforms/FormBase.[Ch]:
1364 * src/frontends/xforms/FormDocument.[Ch]:
1365 * src/frontends/xforms/FormParagraph.[Ch]:
1366 * src/frontends/xforms/FormPreferences.[Ch]:
1367 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1368 method, to be connected to Dialogs::redrawGUI. Method must be
1369 virtual, because dialogs with tabbed folders need to redraw the
1370 forms of each tab folder.
1372 * src/LyXView.C (d-tor):
1373 * src/frontends/xforms/FormBase.C (d-tor): connected
1374 Dialogs::redrawGUI signal to redraw().
1376 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1377 removed Assert, because it is identical to that in FormBase.
1379 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1381 * lib/ui/default.ui: minor polishing.
1383 2000-11-10 Juergen Vigna <jug@sad.it>
1385 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1386 (deleteLyXText): ditto
1388 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1389 selection on mouse-button-3.
1391 * src/insets/insettabular.h: new function clearSelection(), use this
1392 functions inside insettabular.C.
1394 * src/insets/insettabular.C (TabularFeatures): clear the selection
1395 on remove_row/column.
1397 * src/insets/inset.C (scroll): fixed some scroll stuff.
1399 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1401 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1403 * lib/CREDITS: add Yves Bastide
1405 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1407 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1408 check whether C library functions are in the global namespace.
1410 * configure.in: calls it.
1412 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1413 #ifndef __GLIBCPP__.
1415 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1417 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1418 iterators to prevent crash.
1420 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1422 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1424 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1425 shortcut for xforms CB to the preemptive or post-handler function.
1427 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1428 removed the HIDDEN_TIMER as it's no longer used.
1429 Various other small changes.
1431 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1432 preemptive handler to obtain feedback, rather than the post-handler.
1433 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1435 Formats tab is now complete. Converters tab is nearly so.
1437 2000-11-09 Juergen Vigna <jug@sad.it>
1439 * src/insets/insettext.C (~InsetText):
1442 (SetParagraphData): set cache.second to 0 after deleting it!
1443 (getLyXText): check if cache.second is not 0 if finding it.
1445 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1447 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1448 lyxlex to parse the rgb.txt file.
1451 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1452 replace the default '#' comment character.
1454 * src/support/tempname.C: add "using" directive
1455 * src/frontends/ButtonPolicies.C: ditto.
1457 * src/support/filetools.C (DirList): add an explicit cast to avoid
1458 a compile error (probably not the right fix)
1460 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1462 * src/support/filetools.C (DirList): implement using system functions
1464 * src/support/tempname.C: new file
1466 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1468 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1470 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1473 * src/frontends/xforms/ButtonController.C: new file
1475 * src/os2_defines.h: remove getcwd define
1477 * src/lyxvc.C: include support/lyxlib.h
1478 (showLog): use lyx::tempName
1480 * src/lyx_cb.C: comment out includes that we don't need
1481 (AutoSave): use lyx::tempName
1483 * src/filedlg.C: include support/lyxlib.h
1484 (Reread): use lyx::getcwd
1486 * src/converter.C: include support/filetools.h
1487 (add_options): change to static inline, make tail const
1488 (Add): make old_viewer const
1489 (GetAllFormats): make it a const method, use const_iterator
1490 (enable): make static inline
1491 (SplitFormat): make using_format const
1493 * src/LaTeX.C (run): use lyx::getcwd
1495 * configure.in: check for mkstemp as well
1497 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1499 * src/converter.[Ch] (GetAllCommands): new method.
1501 * src/support/filetools.[Ch] (DirList): new method.
1503 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1504 functionality to the converters tab.
1505 The formats tab is now nearly complete.
1506 The kbmap choices in Languages tab now display the contents of
1507 system_lyxdir/kbd/*.kmap in readable form.
1509 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1510 Moved some variables into the class.
1512 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1513 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1514 colour of active folder to lighter grey instead. Any takers?
1515 (form_colours): added an "Apply" button.
1516 (form_converters): added a "Flags" input field.
1517 (form_formats): added a "Shortcut" input field. Note that we can't use
1518 names such as "input_shortcut" as this buggers up the sed script stuff.
1520 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1528 * src/lyx_sendfax_main.C:
1531 * src/spellchecker.C:
1532 * src/insets/figinset.C:
1533 * src/insets/insetbib.C:
1534 * src/insets/insetexternal.C:
1535 * src/insets/insetinclude.C:
1536 * src/insets/insetinfo.C:
1537 * src/mathed/math_panel.C:
1538 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1539 all "daughter" dialogs now have identical "feel".
1541 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1543 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1544 used (and was only used in one place prior to this patch. Incorrectly!)
1546 * src/frontends/xforms/FormDocument.C: changed some instances of
1547 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1548 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1549 for options_->input_float_placement. This fixes a bug reported by
1552 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1553 functionality into d-tor.
1555 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1556 input of numerals also.
1558 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1559 fl_set_form_atclose(). Can now close dialog from window manager,
1560 fixing a bug reported by Rob Lahaye.
1562 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1564 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1565 are no longer dark. Haven't yet worked out how to lighten the colour of
1566 the active tabfolder. Any ideas anybody?
1567 Adjusted Colours tab a little.
1568 Added Shortcut field to converters tab. Note that we can't create an
1569 fdesign label like "input_shortcut" as this buggers up the sed-script
1572 * src/frontends/xforms/FormPreferences.[Ch]:
1573 (feedback): fixed crash due to to ob=0.
1574 (LanguagesXXX): the kbmap choices now contain the files
1575 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1576 be replaced by an input with a file browse button, but since the browse
1577 buttons don'y yet work, this'll do for the moment.
1578 (FormatsXXX): think that this is now nearly fully functional.
1579 Some points/questions though:
1580 1. Does "Apply" remove formats if no longer present?
1581 2. I think that the browser should list the GUI names rather than the
1583 3. Must ensure that we can't delete Formats used by an existing
1586 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1587 if this is the best way to do this.
1589 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1591 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1593 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1594 for variable assignment.
1596 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1598 * src/lib/ui/default.ui: added sub/superscripts to menu as
1599 Insert->Special characters and cleaned-up the file a bit
1601 2000-11-07 Allan Rae <rae@lyx.org>
1603 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1604 ob isn't 0 before using it. See comments in function.
1606 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1608 * src/frontends/xforms/form_*.C: regenerated
1610 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1612 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1614 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1615 compiling with gcc-2.96
1617 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1619 * src/support/lyxstring.C: add a couple "using" directives.
1621 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1622 a .c_str() here too for good measure.
1623 * src/Spacing.C (set): ditto.
1624 * src/lyxfunc.C (Dispatch): ditto.
1626 * src/insets/insettabular.C (copySelection): change .str() to
1627 .str().c_str() to fix problems with lyxstring.
1628 * src/support/filetools.C (GetFileContents): ditto.
1629 * src/buffer.C (asciiParagraph): ditto.
1630 * src/paragraph.C (String): ditto.
1632 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1633 * lib/bind/sciword.bind: ditto.
1635 * src/LyXAction.C (init): remove "symbol-insert" function, which
1636 shared LFUN_INSERT_MATH with "math-insert".
1638 * lib/configure.m4: == is not a valid operator for command test.
1640 * src/lyxrc.C: add using directive.
1642 * src/converter.h: add std:: qualifier.
1644 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1646 * src/converter.[Ch] and other files: Change the Format class to a
1647 real class, and create two instances: formats and system_format.
1649 * src/lyxrc.C (output): Output the difference between formats and
1652 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1653 (buildFormats): Insert formats into browser.
1654 (inputFormats): Made the browser and add button functional.
1655 (applyFormats): Update formats from format_vec.
1657 * src/converter.C: Changed all (*it). to it->
1658 (Format::dummy): New method.
1659 (Format::importer): New format flag.
1660 (Formats::GetAllFormats): New method.
1661 (Formats::Add): Delete format from the map if prettyname is empty.
1662 (Converter::Convert): Print an error message if moving the file fails.
1663 (Converter::GetReachableTo): New method
1665 * src/MenuBackend.[Ch]: Add support for importformats tag.
1667 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1669 * lib/configure.m4: Add word->tex and ps->fax converters.
1671 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1672 Return fax to file menu.
1676 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1678 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1681 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1684 * src/lyxfunc.C (processKeyEvent): removed
1686 * src/bufferlist.C (emergencyWrite): removed the out commented
1687 emergency write code.
1689 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1691 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1693 * many files: change formatting to be a bit more uniform for
1694 if,while,for,switch statements, remove some parantesis not needed.
1697 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1699 * config/kde.m4: make config more robust when KDEDIR is set
1701 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1703 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1704 not returned a pixmap for "math-insert".
1706 * src/LyXAction.C (init): sort the entries a bit.
1708 2000-11-03 Juergen Vigna <jug@sad.it>
1710 * src/insets/insettabular.h: added fixed number to update codes so
1711 that update is only in one direction.
1713 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1716 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1717 before call to edit because of redraw.
1719 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1721 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1723 * lib/ui/default.ui: Populate "edit_float" menu
1725 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1727 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1728 "floats-operate". The name is ugly (and the func also), but this
1729 is just a band-aid until we switch to new insets.
1731 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1733 * lib/ui/default.ui: update again the menu layout (fix some
1736 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1738 * src/MenuBackend.h (fulllabel): new method.
1740 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1741 the menu shortcuts of a menu are unique and whether they
1742 correspond to a letter of the label.
1743 (expand): call checkShortcuts when debugging.
1745 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1747 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1749 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1751 * lib/examples/*.lyx : '\language default' => '\language english'
1753 * lib/examples/it_splash.lyx : except where it should be italian
1755 * lib/templates/*.lyx : the same
1757 * doc/*.lyx* : the same
1759 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1761 * lib/bind/menus.bind: remove the Layout menu entries, which I
1762 somehow forgot earlier.
1764 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1766 * lib/ui/old-default.ui: keep the old one here for reference (to
1769 * lib/ui/default.ui: update the menu layout
1771 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1773 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1774 Can now Apply to different insets without closing the dialog.
1776 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1777 Can't actually DO anything with them yet, but I'd like a little
1780 * src/frontends/xforms/input_validators.[ch]
1781 (fl_lowercase_filter): new.
1783 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1785 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1786 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1788 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1790 2000-11-02 Juergen Vigna <jug@sad.it>
1792 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1793 on char insertion as it has already be updated by bv->updateInset().
1795 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1796 if an inset inside was updated.
1798 * lib/configure.cmd: commented out fax-search code
1800 2000-11-01 Yves Bastide <stid@acm.org>
1802 * src/tabular.C (OldFormatRead): set tabular language to the
1805 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1807 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1808 class names with non-letter characters (from Yves Bastide).
1810 * lib/ui/default.ui: change Item to OptItem in import menu.
1811 Comment out fax stuff.
1813 * lib/configure.m4: comment out fax-related stuff.
1815 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1817 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1818 useful xforms helper functions. At present contains only formatted().
1819 Input a string and it returns it with line breaks so that in fits
1822 * src/frontends/xforms/Makefile.am: add new files.
1824 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1825 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1828 * src/frontends/xforms/FormPreferences.[Ch]:
1829 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1830 but lots of little clean ups. Removed enum State. Make use of
1831 formatted(). Constify lots of methods. Perhaps best of all: removed
1832 requirement for that horrible reinterpret_cast from pointer to long in
1835 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1837 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1838 conditionalize build on xforms < 0.89
1840 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1842 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1844 * src/LyXAction.C (init): comment out fax
1846 * src/lyxrc.h: comment out the fax enums
1847 comment out the fax variables
1849 * src/commandtags.h: comment out LFUN_FAX
1851 * src/lyxrc.C: disable fax variables.
1852 (read): disable parsing of fax variables
1853 (output): disable writing of fax variables
1854 (getFeedback): now description for fax variables
1856 * src/lyxfunc.C: comment out MenuFax
1857 (Dispatch): disable LFUN_FAX
1859 * src/lyx_cb.C (MenuFax): comment out
1861 * src/WorkArea.C: add <cctype>
1862 (work_area_handler): better key handling, should be ok now.
1863 for accented chars + etc
1865 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1866 lyx_sendfax.h and lyx_sendfax_man.C
1868 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1869 (show): don't call InitLyXLookup when using xforms 0.89
1871 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1873 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1875 * src/support/filetools.C (GetFileContents): close to dummy change
1877 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1879 * src/trans.C (AddDeadkey): workaround stupid compilers.
1881 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1883 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1884 of two-sided document.
1886 2000-10-31 Juergen Vigna <jug@sad.it>
1888 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1890 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1891 xposition to the Edit call.
1893 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1895 * src/trans.C (AddDeadkey): cast explicitly to char.
1897 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1899 * src/tabular.C (AsciiBottomHLine): simplify?
1900 (AsciiTopHLine): simplify?
1901 (print_n_chars): simplify
1902 (DocBook): remove most of the << endl; we should flush the stream
1903 as seldom as possible.
1905 (TeXBottomHLine): ditto
1906 (TeXTopHLine): ditto
1908 (write_attribute): try a templified version.
1909 (set_row_column_number_info): lesson scope of variables
1911 * src/support/lstrings.h (tostr): new specialization of tostr
1913 * src/trans.C (AddDeadkey): slightly cleaner fix.
1915 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1917 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1918 '%%' in Toc menu labels.
1921 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1922 font_norm is iso10646-1.
1924 * src/font.C (ascent): Fixed for 16bit fonts
1925 (descent,lbearing,rbearing): ditto
1927 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1929 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1930 (getFeedback): new static method.
1932 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1933 Now use combox rather than choice to display languages.
1934 Feedback is now output using a new timer callback mechanism, identical
1935 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1937 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1939 * src/minibuffer.C: fix for older compilers
1941 2000-10-30 Juergen Vigna <jug@sad.it>
1943 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1944 has to be Left of the inset otherwise LyXText won't find it!
1946 * src/BufferView2.C (open_new_inset): delete the inset if it can
1949 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1951 * lyx.man: fix typo.
1953 2000-10-29 Marko Vendelin <markov@ioc.ee>
1954 * src/frontends/gnome/FormCitation.C
1955 * src/frontends/gnome/FormCitation.h
1956 * src/frontends/gnome/FormCopyright.C
1957 * src/frontends/gnome/FormCopyright.h
1958 * src/frontends/gnome/FormError.C
1959 * src/frontends/gnome/FormError.h
1960 * src/frontends/gnome/FormIndex.C
1961 * src/frontends/gnome/FormIndex.h
1962 * src/frontends/gnome/FormPrint.C
1963 * src/frontends/gnome/FormPrint.h
1964 * src/frontends/gnome/FormRef.C
1965 * src/frontends/gnome/FormRef.h
1966 * src/frontends/gnome/FormToc.C
1967 * src/frontends/gnome/FormToc.h
1968 * src/frontends/gnome/FormUrl.C
1969 * src/frontends/gnome/FormUrl.h
1970 * src/frontends/gnome/Menubar_pimpl.C
1971 * src/frontends/gnome/mainapp.C
1972 * src/frontends/gnome/mainapp.h
1973 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1974 changing update() to updateSlot() where appropriate
1976 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1978 * src/frontends/xforms/FormPreferences.[Ch]:
1979 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1982 2000-10-28 Juergen Vigna <jug@sad.it>
1984 * src/insets/insettabular.C (draw): fixed drawing bug.
1986 * src/insets/insettext.C (clear):
1988 (SetParagraphData): clearing the TEXT buffers when deleting the
1989 paragraphs used by it.
1991 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1993 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1995 2000-10-27 Juergen Vigna <jug@sad.it>
1997 * src/tabular.C (~LyXTabular): removed not needed anymore.
1999 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
2002 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2004 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
2007 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
2010 * src/frontends/xforms/FormPreferences.[Ch]:
2011 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
2012 Reorganised as modules based on tabs. Much easier to follow the
2013 flow and to add new tabs. Added warning and feedback messages.
2016 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2018 * src/tabular.h (DocBook): add std:: qualifier.
2020 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
2022 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
2023 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
2026 * insettabular.C (DocBook): uses the tabular methods to export
2029 * src/insets/insettext.h
2030 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
2032 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2034 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
2037 * src/lyxfunc.C (MenuNew): lessen the scope of fname
2038 moved misplaced AllowInput two lines up.
2040 * src/buffer.C (readFile): compare float with float, not with int
2042 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2044 * src/minibuffer.C: add "using SigC::slot" statement.
2046 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2048 * src/frontends/xforms/forms/README: updated section about make.
2050 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2051 Tidied some forms up, made two of form_tabular's tabs more
2052 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2053 fixed translation problem with "Column".
2055 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2057 * src/minibuffer.h: use Timeout instead of the xforms timer
2059 (setTimer) rewrite for the Timeout, change to unsigned arg
2060 (set): change to unsigned timer arg
2063 * src/minibuffer.C (TimerCB): removed func
2064 (C_MiniBuffer_TimerCB): removed func
2065 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2066 (peek_event): use a switch statement
2067 (add): don't use fl_add_timer.
2068 (Set): rewrite to use the Timeout
2071 * src/Timeout.[Ch] (setType): return a Timeout &
2072 (setTimeout): ditto, change to unsigned arg for timeout
2074 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2076 * src/mathed/formula.C (mathed_string_width): Use string instead
2077 of a constant size char array.
2079 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2081 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2082 the two recently added operator<< for SMInput and State.
2084 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2086 (OkCancelPolicy): ditto
2087 (OkCancelReadOnlyPolicy): ditto
2088 (NoRepeatedApplyReadOnlyPolicy): ditto
2089 (OkApplyCancelReadOnlyPolicy): ditto
2090 (OkApplyCancelPolicy): ditto
2091 (NoRepeatedApplyPolicy): ditto
2093 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2095 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2096 add the usual std:: qualifiers.
2098 2000-10-25 Juergen Vigna <jug@sad.it>
2100 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2102 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2104 * src/support/filetools.C (MakeRelPath): change some types to
2107 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2108 ButtonPolicy::SMInput and ButtonPolicy::State.
2110 * src/FontLoader.C (reset): small cleanup
2111 (unload): small cleanup
2113 * src/FontInfo.C (getFontname): initialize error to 10000.0
2115 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2117 * src/frontends/xforms/FormPreferences.[Ch]:
2118 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2119 TeX encoding and default paper size sections.
2121 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2123 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2126 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2127 make the message_ empty.
2128 (FormError): don't initialize message_ in initializer list.
2130 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2132 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2134 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2136 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2138 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2140 * src/frontends/kde/*data.[Ch]: _("") is not
2143 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2145 * src/buffer.C: removed redundant using directive.
2147 * src/frontends/DialogBase.h: revert to original definition of
2150 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2151 stuff into two classes, one for each dialog, requires a new
2152 element in the dialogs vector, FormTabularCreate.
2154 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2157 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2158 method. Continues Allan's idea, but means that derived classes
2159 don't need to worry about "update or hide?".
2161 * src/frontends/xforms/FormError.C (showInset): add connection
2164 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2165 one for each dialog. FormTabular now contains main tabular dialog
2168 * src/frontends/xforms/FormTabularCreate.[Ch]:
2169 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2172 * src/frontends/xforms/FormGraphics.[Ch]:
2173 * src/frontends/xforms/forms/form_graphics.fd
2174 * src/frontends/xforms/FormTabular.[Ch]:
2175 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2176 classes of FormInset.
2178 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2179 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2181 * src/frontends/xforms/Makefile.am:
2182 * src/frontends/xforms/forms/makefile: added new files.
2184 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2185 variable. added Signal0 hide signal, in keeping with other GUI-I
2188 * src/support/lstrings.h: removed redundant std:: qualifier as
2189 it's already declared in Lsstream.h.
2191 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2193 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2197 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2199 * src/tabular.C (Ascii): minimize scope of cell.
2201 * src/BufferView2.C (nextWord): return string() instead of 0;
2203 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2205 * src/converter.h: add a std:: qualifier
2207 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2209 * src/importer.[Ch]: New files. Used for importing files into LyX.
2211 * src/lyxfunc.C (doImport): Use the new Importer class.
2213 * src/converter.h: Add shortcut member to the Format class.
2214 Used for holding the menu shortcut.
2216 * src/converter.C and other files: Made a distinction between
2217 format name and format extension. New formats can be defined using
2218 the \format lyxrc tag.
2219 Added two new converter flags: latex and disable.
2221 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2223 * src/support/lyxlib.h: unify namespace/struct implementation.
2224 Remove extra declarations.
2226 * src/support/chdir.C (chdir): remove version taking char const *
2228 * src/support/rename.C: ditto.
2229 * src/support/lyxsum.C: ditto.
2231 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2233 * src/frontends/xforms/FormBase.[Ch]:
2234 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2235 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2236 work only for the next call to fl_show_form(). The correct place to set
2237 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2238 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2239 from FormBase have the minimum size set; no more stupid crashes with
2242 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2244 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2246 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2248 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2250 * src/support/lyxlib.h: changed second argument of mkdir to
2251 unsigned long int (unsigned int would probably have been enough,
2252 but...). Removed <sys/types.h> header.
2253 * src/support/mkdir.C (mkdir): ditto.
2257 2000-10-19 Juergen Vigna <jug@sad.it>
2259 * src/lyxfunc.C (MenuNew): small fix (form John)
2261 * src/screen.C (Update): removed unneeded code.
2263 * src/tabular.C (Ascii): refixed int != uint bug!
2265 * src/support/lyxlib.h: added sys/types.h include for now permits
2266 compiling, but I don't like this!
2268 2000-10-18 Juergen Vigna <jug@sad.it>
2270 * src/text2.C (ClearSelection): if we clear the selection we need
2271 more refresh so set the status apropriately
2273 * src/insets/insettext.C (draw): hopefully finally fixed draw
2276 2000-10-12 Juergen Vigna <jug@sad.it>
2278 * src/insets/insettext.C (draw): another small fix and make a block
2279 so that variables are localized.
2281 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2283 * src/support/lstrings.C (lowercase, uppercase):
2284 use explicit casts to remove compiler warnings.
2286 * src/support/LRegex.C (Impl):
2287 * src/support/StrPool.C (add):
2288 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2289 (AddPath, MakeDisplayPath):
2290 * src/support/lstrings.C (prefixIs, subst):
2291 use correct type to remove compiler warnings.
2293 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2295 * src/support/lyxlib.h:
2296 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2297 portability and to remove compiler warning with DEC cxx.
2299 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2301 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2303 * src/minibuffer.C (peek_event): retun 1 when there has been a
2304 mouseclick in the minibuffer.
2308 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2310 * src/frontends/xforms/FormParagraph.C: more space above/below
2313 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2315 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2316 a char only if real_current_font was changed.
2318 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2320 * NEWS: update somewhat for 1.1.6
2322 * lib/ui/default.ui: clean up.
2324 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2326 * lib/CREDITS: clean up
2328 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2330 * src/combox.[Ch] (select): changed argument back to int
2331 * src/combox.C (peek_event): removed num_bytes as it is declared but
2334 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2335 modified calls to Combox::select() to remove warnings about type
2338 * src/insets/insetbutton.C (width): explicit cast to remove warning
2339 about type conversion.
2341 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2344 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2345 sel_pos_end, refering to cursor position are changed to
2346 LyXParagraph::size_type.
2348 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2349 consistent with LyXCursor::pos().
2350 (inset_pos): changed to LyXParagraph::size_type for same reason.
2352 * src/insets/insettext.C (resizeLyXText): changed some temporary
2353 variables refing to cursor position to LyXParagraph::size_type.
2355 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2357 * src/frontends/kde/<various>: The Great Renaming,
2360 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2362 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2364 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2366 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2367 0 when there are no arguments.
2369 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2371 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2372 to segfaults when pressing Ok in InsetBibtex dialog.
2374 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2376 * forms/layout_forms.fd:
2377 * src/layout_forms.C (create_form_form_character): small change to use
2378 labelframe rather than engraved frame + text
2380 * src/lyx_gui.C (create_forms): initialise choice_language with some
2381 arbitrary value to prevent segfault when dialog is shown.
2383 2000-10-16 Baruch Even <baruch.even@writeme.com>
2385 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2386 is no resulting file. This pertains only to LaTeX output.
2388 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2390 * src/text.C (Backspace): Make sure that the row of the cursor is
2393 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2396 * src/lyx_gui.C (init): Prevent a crash when only one font from
2397 menu/popup fonts is not found.
2399 * lib/lyxrc.example: Add an example for binding a key for language
2402 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2404 * src/converter.C (GetReachable): Changed the returned type to
2406 (IsReachable): New method
2408 * src/MenuBackend.C (expand): Handle formats that appear more
2411 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2413 * src/frontends/support/Makefile.am
2414 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2417 * lib/CREDITS: add Garst Reese.
2419 * src/support/snprintf.h: add extern "C" {} around the definitions.
2421 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2423 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2426 * src/frontends/xforms/FormDocument.C:
2427 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2428 compile without "conversion to integral type of smaller size"
2431 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2433 * src/text.C (GetColumnNearX): Fixed disabled code.
2435 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2437 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2440 * src/support/snprintf.[ch]: new files
2442 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2444 * src/frontends/kde/formprintdialog.C: add
2445 file browser for selecting postscript output
2447 * src/frontends/kde/formprintdialogdata.C:
2448 * src/frontends/kde/formprintdialogdata.h: re-generate
2451 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2453 * src/frontends/gnome/Makefile.am:
2454 * src/frontends/kde/Makefile.am: FormCommand.C
2455 disappeared from xforms
2457 * src/frontends/kde/FormCitation.C:
2458 * src/frontends/kde/FormIndex.C: read-only
2461 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2463 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2466 * src/bufferlist.C: add using directive.
2468 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2470 * src/support/lyxfunctional.h: version of class_fun for void
2471 returns added, const versions of back_inseter_fun and compare_fun
2474 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2476 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2478 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2480 * ChangeLog: cleanup.
2482 * lib/CREDITS: update to add all the contributors we've forgotten.
2483 I have obviously missed some, so tell me whether there were
2486 2000-10-13 Marko Vendelin <markov@ioc.ee>
2488 * src/frontends/gnome/FormCitation.C
2489 * src/frontends/gnome/FormCitation.h
2490 * src/frontends/gnome/FormError.C
2491 * src/frontends/gnome/FormIndex.C
2492 * src/frontends/gnome/FormRef.C
2493 * src/frontends/gnome/FormRef.h
2494 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2496 * src/frontends/gnome/FormCitation.C
2497 * src/frontends/gnome/FormCopyright.C
2498 * src/frontends/gnome/FormError.C
2499 * src/frontends/gnome/FormIndex.C
2500 * src/frontends/gnome/FormRef.C
2501 * src/frontends/gnome/FormToc.C
2502 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2505 * src/frontends/gnome/Menubar_pimpl.C
2506 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2509 2000-10-11 Baruch Even <baruch.even@writeme.com>
2512 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2513 to convey its real action.
2515 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2516 clear the minibuffer and prepare to enter a command.
2518 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2519 the rename from ExecCommand to PrepareForCommand.
2520 * src/lyxfunc.C (Dispatch): ditto.
2522 2000-10-11 Baruch Even <baruch.even@writeme.com>
2524 * src/buffer.C (writeFile): Added test for errors on writing, this
2525 catches all errors and not only file system full errors as intended.
2527 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2529 * src/lyx_gui.C (create_forms): better fix for crash with
2530 translated interface.
2532 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2534 * src/frontends/kde/Makefile.am:
2535 * src/frontends/kde/FormCopyright.C:
2536 * src/frontends/kde/formcopyrightdialog.C:
2537 * src/frontends/kde/formcopyrightdialog.h:
2538 * src/frontends/kde/formcopyrightdialogdata.C:
2539 * src/frontends/kde/formcopyrightdialogdata.h:
2540 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2541 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2542 copyright to use qtarch
2544 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2546 * src/encoding.C (read): Fixed bug that caused an error message at
2547 the end of the file.
2549 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2551 * lib/lyxrc.example: Fixed hebrew example.
2553 2000-10-13 Allan Rae <rae@lyx.org>
2555 * src/frontends/xforms/FormPreferences.C (input): reworking the
2557 (build, update, apply): New inputs in various tabfolders
2559 * src/frontends/xforms/FormToc.C: use new button policy.
2560 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2561 dialogs that either can't use any existing policy or where it just
2564 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2567 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2568 added a bool parameter which is ignored.
2570 * src/buffer.C (setReadonly):
2571 * src/BufferView_pimpl.C (buffer):
2572 * src/frontends/kde/FormCopyright.h (update):
2573 * src/frontends/kde/FormCitation.[Ch] (update):
2574 * src/frontends/kde/FormIndex.[Ch] (update):
2575 * src/frontends/kde/FormPrint.[Ch] (update):
2576 * src/frontends/kde/FormRef.[Ch] (update):
2577 * src/frontends/kde/FormToc.[Ch] (update):
2578 * src/frontends/kde/FormUrl.[Ch] (update):
2579 * src/frontends/gnome/FormCopyright.h (update):
2580 * src/frontends/gnome/FormCitation.[Ch] (update):
2581 * src/frontends/gnome/FormError.[Ch] (update):
2582 * src/frontends/gnome/FormIndex.[Ch] (update):
2583 * src/frontends/gnome/FormPrint.[Ch] (update):
2584 * src/frontends/gnome/FormRef.h (update):
2585 * src/frontends/gnome/FormToc.[Ch] (update):
2586 * src/frontends/gnome/FormUrl.[Ch] (update):
2587 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2588 to updateBufferDependent and DialogBase
2590 * src/frontends/xforms/FormCitation.[hC]:
2591 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2592 * src/frontends/xforms/FormError.[Ch]:
2593 * src/frontends/xforms/FormGraphics.[Ch]:
2594 * src/frontends/xforms/FormIndex.[Ch]:
2595 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2596 and fixed readOnly handling.
2597 * src/frontends/xforms/FormPrint.[Ch]:
2598 * src/frontends/xforms/FormRef.[Ch]:
2599 * src/frontends/xforms/FormTabular.[Ch]:
2600 * src/frontends/xforms/FormToc.[Ch]:
2601 * src/frontends/xforms/FormUrl.[Ch]:
2602 * src/frontends/xforms/FormInset.[Ch]:
2603 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2604 form of updateBufferDependent.
2606 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2607 if form()->visible just in case someone does stuff to the form in a
2610 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2611 the buttoncontroller for everything the enum used to be used for.
2612 (update) It would seem we need to force all dialogs to use a bool
2613 parameter or have two update functions. I chose to go with one.
2614 I did try removing update() from here and FormBase and defining the
2615 appropriate update signatures in FormBaseB[DI] but then ran into the
2616 problem of the update() call in FormBase::show(). Whatever I did
2617 to get around that would require another function and that just
2618 got more confusing. Hence the decision to make everyone have an
2619 update(bool). An alternative might have been to override show() in
2620 FormBaseB[DI] and that would allow the different and appropriate
2623 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2624 true == buffer change occurred. I decided against using a default
2625 template parameter since not all compilers support that at present.
2627 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2629 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2630 army knife" by removing functionality.
2631 (clearStore): removed. All such housekeeping on hide()ing the dialog
2632 is to be carried out by overloaded disconnect() methods.
2633 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2634 superceded by Baruch's neat test (FormGraphics) to update an existing
2635 dialog if a new signal is recieved rather than block all new signals
2637 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2638 only to Inset dialogs.
2639 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2640 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2642 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2644 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2645 as a base class to all inset dialogs. Used solely to connect/disconnect
2646 the Inset::hide signal and to define what action to take on receipt of
2647 a UpdateBufferDependent signal.
2648 (FormCommand): now derived from FormInset.
2650 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2653 * src/frontends/xforms/FormCopyright.[Ch]:
2654 * src/frontends/xforms/FormPreferences.[Ch]:
2655 now derived from FormBaseBI.
2657 * src/frontends/xforms/FormDocument.[Ch]:
2658 * src/frontends/xforms/FormParagraph.[Ch]:
2659 * src/frontends/xforms/FormPrint.[Ch]:
2660 now derived from FormBaseBD.
2662 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2664 * src/frontends/xforms/FormCitation.[Ch]:
2665 * src/frontends/xforms/FormError.[Ch]:
2666 * src/frontends/xforms/FormRef.[Ch]:
2667 * src/frontends/xforms/FormToc.[Ch]:
2668 (clearStore): reworked as disconnect().
2670 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2673 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2675 * src/converter.C (runLaTeX): constify buffer argument
2678 * src/frontends/support/Makefile.am (INCLUDES): fix.
2680 * src/buffer.h: add std:: qualifier
2681 * src/insets/figinset.C (addpidwait): ditto
2682 * src/MenuBackend.C: ditto
2683 * src/buffer.C: ditto
2684 * src/bufferlist.C: ditto
2685 * src/layout.C: ditto
2686 * src/lyxfunc.C: ditto
2688 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2690 * src/lyxtext.h (bidi_level): change return type to
2691 LyXParagraph::size_type.
2693 * src/lyxparagraph.h: change size_type to
2694 TextContainer::difference_type. This should really be
2695 TextContainer::size_type, but we need currently to support signed
2698 2000-10-11 Marko Vendelin <markov@ioc.ee>
2699 * src/frontends/gnome/FormError.h
2700 * src/frontends/gnome/FormRef.C
2701 * src/frontends/gnome/FormRef.h
2702 * src/frontends/gnome/FormError.C
2703 * src/frontends/gnome/Makefile.am
2704 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2705 to Gnome frontend. Both dialogs use "action" area.
2707 2000-10-12 Baruch Even <baruch.even@writeme.com>
2709 * src/graphics/GraphicsCacheItem_pimpl.C:
2710 * src/graphics/Renderer.C:
2711 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2714 2000-10-12 Juergen Vigna <jug@sad.it>
2716 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2717 visible when selecting).
2719 * development/Code_rules/Rules: fixed some typos.
2721 2000-10-09 Baruch Even <baruch.even@writeme.com>
2723 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2724 compiling on egcs 1.1.2 possible.
2726 * src/filedlg.C (comp_direntry::operator() ): ditto.
2728 2000-08-31 Baruch Even <baruch.even@writeme.com>
2730 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2733 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2734 transient it now only gets freed when the object is destructed.
2736 2000-08-24 Baruch Even <baruch.even@writeme.com>
2738 * src/frontends/FormGraphics.h:
2739 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2742 2000-08-20 Baruch Even <baruch.even@writeme.com>
2744 * src/insets/insetgraphics.C:
2745 (draw): Added messages to the drawn rectangle to report status.
2746 (updateInset): Disabled the use of the inline graphics,
2749 2000-08-17 Baruch Even <baruch.even@writeme.com>
2751 * src/frontends/support: Directory added for the support of GUII LyX.
2753 * src/frontends/support/LyXImage.h:
2754 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2757 * src/frontends/support/LyXImage_X.h:
2758 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2759 version of LyXImage, this uses the Xlib Pixmap.
2761 * src/PainterBase.h:
2762 * src/PainterBase.C:
2764 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2765 replacement to Pixmap.
2767 * src/insets/insetgraphics.h:
2768 * src/insets/insetgraphics.C:
2769 * src/graphics/GraphicsCacheItem.h:
2770 * src/graphics/GraphicsCacheItem.C:
2771 * src/graphics/GraphicsCacheItem_pimpl.h:
2772 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2775 * src/graphics/GraphicsCacheItem.h:
2776 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2777 another copy of the object.
2779 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2780 of cacheHandle, this fixed a bug that sent LyX crashing.
2782 * src/graphics/XPM_Renderer.h:
2783 * src/graphics/XPM_Renderer.C:
2784 * src/graphics/EPS_Renderer.h:
2785 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2787 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2789 * src/lyxfunc.C (processKeySym): only handle the
2790 lockinginset/inset stuff if we have a buffer and text loaded...
2792 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2794 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2796 * src/support/lyxfunctional.h: add operator= that takes a reference
2798 * src/lyxserver.C (mkfifo): make first arg const
2800 * src/layout.h: renamed name(...) to setName(...) to work around
2803 * src/buffer.C (setFileName): had to change name of function to
2804 work around bugs in egcs. (renamed from fileName)
2806 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2808 * src/support/translator.h: move helper template classes to
2809 lyxfunctional.h, include "support/lyxfunctional.h"
2811 * src/support/lyxmanip.h: add delaration of fmt
2813 * src/support/lyxfunctional.h: new file
2814 (class_fun_t): new template class
2815 (class_fun): helper template function
2816 (back_insert_fun_iterator): new template class
2817 (back_inserter_fun): helper template function
2818 (compare_memfun_t): new template class
2819 (compare_memfun): helper template function
2820 (equal_1st_in_pair): moved here from translator
2821 (equal_2nd_in_pair): moved here from translator
2823 * src/support/fmt.C: new file
2824 (fmt): new func, can be used for a printf substitute when still
2825 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2827 * src/support/StrPool.C: add some comments
2829 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2832 * src/insets/figinset.C (addpidwait): use std::copy with
2833 ostream_iterator to fill the pidwaitlist
2835 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2837 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2840 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2843 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2845 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2846 (class_update): ditto
2847 (BulletPanel): ditto
2848 (CheckChoiceClass): move initialization of tc and tct
2850 * src/tabular.C: remove current_view
2851 (OldFormatRead): similar to right below [istream::ignore]
2853 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2854 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2855 unused [istream::ignore]
2857 * src/lyxfunc.C: include "support/lyxfunctional.h"
2858 (getInsetByCode): use std::find_if and compare_memfun
2860 * src/lyxfont.C (stateText): remove c_str()
2862 * src/lyx_main.C (setDebuggingLevel): make static
2863 (commandLineHelp): make static
2865 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2866 Screen* together with fl_get_display() and fl_screen
2868 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2869 togheter with fl_get_display() and fl_screen
2870 (create_forms): remove c_str()
2872 * src/layout.C: include "support/lyxfunctional.h"
2873 (hasLayout): use std::find_if and compare_memfun
2874 (GetLayout): use std::find_if and comapre_memfun
2875 (delete_layout): use std::remove_if and compare_memfun
2876 (NumberOfClass): use std:.find_if and compare_memfun
2878 * src/gettext.h: change for the new functions
2880 * src/gettext.C: new file, make _(char const * str) and _(string
2881 const & str) real functions.
2883 * src/font.C (width): rewrite slightly to avoid one extra variable
2885 * src/debug.C: initialize Debug::ANY here
2887 * src/commandtags.h: update number comments
2889 * src/combox.h (get): make const func
2891 (getline): make const
2893 * src/combox.C (input_cb): handle case where fl_get_input can
2896 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2897 "support/lyxfunctional.h", remove current_view variable.
2898 (resize): use std::for_each with std::mem_fun
2899 (getFileNames): use std::copy with back_inserter_fun
2900 (getBuffer): change arg type to unsigned int
2901 (emergencyWriteAll): call emergencyWrite with std::for_each and
2903 (emergencyWrite): new method, the for loop in emergencyWriteAll
2905 (exists): use std::find_if with compare_memfun
2906 (getBuffer): use std::find_if and compare_memfun
2908 * src/buffer.h: add typedefs for iterator_category, value_type
2909 difference_type, pointer and reference for inset_iterator
2910 add postfix ++ for inset_iterator
2911 make inset_iterator::getPos() const
2913 * src/buffer.C: added support/lyxmanip.h
2914 (readFile): use lyxerr << fmt instead of printf
2915 (makeLaTeXFile): use std::copy to write out encodings
2917 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2919 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2920 free and the char * temp.
2921 (hasMenu): use std::find_if and compare_memfun
2924 * src/Makefile.am (lyx_SOURCES): added gettext.C
2926 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2927 string::insert small change to avoid temporary
2929 * src/LColor.C (getGUIName): remove c_str()
2931 * several files: change all occurrences of fl_display to
2934 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2935 that -pedantic is not used for gcc 2.97 (cvs gcc)
2937 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2939 2000-10-11 Allan Rae <rae@lyx.org>
2941 * src/frontends/xforms/FormPreferences.C (input): template path must be
2942 a readable directory. It doesn't need to be writeable.
2943 (build, delete, update, apply): New inputs in the various tabfolders
2945 * src/frontends/xforms/forms/form_preferences.fd:
2946 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2947 several new entries to existing folders. Shuffled some existing stuff
2950 * src/frontends/xforms/forms/form_print.fd:
2951 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2952 Should probably rework PrinterParams as well. Note that the switch to
2953 collated is effectively the same as !unsorted so changing PrinterParams
2954 will require a lot of fiddly changes to reverse the existing logic.
2956 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2958 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2960 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2962 2000-10-10 Allan Rae <rae@lyx.org>
2965 * src/lyxfunc.C (Dispatch):
2967 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2970 * src/lyxrc.C (output): Only write the differences between system lyxrc
2971 and the users settings.
2974 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2976 I'll rewrite this later, after 1.1.6 probably, to keep a single
2977 LyXRC but two instances of a LyXRCStruct.
2979 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2981 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2983 * src/tabular.h: add a few std:: qualifiers.
2985 * src/encoding.C: add using directive.
2986 * src/language.C: ditto.
2988 * src/insets/insetquotes.C (Validate): use languages->lang()
2989 instead of only language.
2991 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2993 * lib/languages: New file.
2995 * lib/encodings: New file.
2997 * src/language.C (Languages): New class.
2998 (read): New method. Reads the languages from the 'languages' file.
3000 * src/encoding.C (Encodings): New class.
3001 (read): New method. Reads the encodings from the 'encodings' file.
3003 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
3006 * src/bufferparams.h and a lot of files: Deleted the member language,
3007 and renamed language_info to language
3009 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
3010 * src/lyxfont.C (latexWriteStartChanges): ditto.
3011 * src/paragraph.C (validate,TeXOnePar): ditto.
3013 * src/lyxfont.C (update): Restored deleted code.
3015 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
3017 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3019 * src/BufferView_pimpl.C (buffer): cleaned up a little.
3021 * src/insets/figinset.[Ch]:
3022 * src/insets/insetinclude.[Ch]:
3023 * src/insets/insetinclude.[Ch]:
3024 * src/insets/insetparent.[Ch]:
3025 * src/insets/insetref.[Ch]:
3026 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
3028 * src/insets/*.[Ch]:
3029 * src/mathed/formula.[Ch]:
3030 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
3032 * src/buffer.C (parseSingleLyXformat2Token, readInset):
3033 * src/lyx_cb.C (FigureApplyCB):
3034 * src/lyxfunc.C (getStatus, Dispatch):
3035 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
3038 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3040 * src/converter.[Ch] (Formats::View):
3041 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3043 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3044 *current_view->buffer(). This will change later, but this patch is way
3047 2000-10-09 Juergen Vigna <jug@sad.it>
3049 * src/text.C (GetRow): small fix.
3051 * src/BufferView_pimpl.C (cursorPrevious):
3052 (cursorNext): added LyXText parameter to function.
3054 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3055 keypress depending on cursor position.
3057 2000-10-06 Juergen Vigna <jug@sad.it>
3059 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3060 (copySelection): redone this function and also copy ascii representa-
3063 * src/tabular.C (Ascii):
3067 (print_n_chars): new functions to realize the ascii export of tabulars.
3069 2000-10-05 Juergen Vigna <jug@sad.it>
3071 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3072 if we don't have a buffer.
3074 2000-10-10 Allan Rae <rae@lyx.org>
3076 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3077 with closing dialog. It seems that nested tabfolders require hiding
3078 of inner tabfolders before hiding the dialog itself. Actually all I
3079 did was hide the active outer folder.
3081 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3082 unless there really is a buffer. hideBufferDependent is called
3085 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3086 POTFILES.in stays in $(srcdir).
3088 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3090 * lib/lyxrc.example: Few changes.
3092 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3094 * src/BufferView_pimpl.C (buffer): only need one the
3095 updateBufferDependent signal to be emitted once! Moved to the end of
3096 the method to allow bv_->text to be updated first.
3098 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3099 and hSignal_ with Dialogs * and BufferDependency variables.
3100 New Buffer * parent_, initialised when the dialog is launched. Used to
3101 check whether to update() or hide() dialog in the new, private
3102 updateOrHide() method that is connected to the updateBufferDependent
3103 signal. Daughter classes dictate what to do using the
3104 ChangedBufferAction enum, passed to the c-tor.
3106 * src/frontends/xforms/FormCitation.C:
3107 * src/frontends/xforms/FormCommand.C:
3108 * src/frontends/xforms/FormCopyright.C:
3109 * src/frontends/xforms/FormDocument.C:
3110 * src/frontends/xforms/FormError.C:
3111 * src/frontends/xforms/FormIndex.C:
3112 * src/frontends/xforms/FormPreferences.C:
3113 * src/frontends/xforms/FormPrint.C:
3114 * src/frontends/xforms/FormRef.C:
3115 * src/frontends/xforms/FormToc.C:
3116 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3119 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3120 ChangedBufferAction enum.
3122 * src/frontends/xforms/FormParagraph.[Ch]
3123 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3126 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3128 * lib/bind/cua.bind: fix a bit.
3129 * lib/bind/emacs.bind: ditto.
3131 * lib/bind/menus.bind: remove real menu entries from there.
3133 * src/spellchecker.C: make sure we only include strings.h when
3136 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3138 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3139 function. It enlarges the maximum number of pup when needed.
3140 (add_toc2): Open a new menu if maximum number of items per menu has
3143 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3145 * src/frontends/kde/FormPrint.C: fix error reporting
3147 * src/frontends/xforms/FormDocument.C: fix compiler
3150 * lib/.cvsignore: add Literate.nw
3152 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3155 * bufferview_funcs.[Ch]
3158 * text2.C: Add support for numbers in RTL text.
3160 2000-10-06 Allan Rae <rae@lyx.org>
3162 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3163 to be gettext.m4 friendly again. ext_l10n.h is now
3164 generated into $top_srcdir instead of $top_builddir
3165 so that lyx.pot will be built correctly -- without
3166 duplicate parsing of ext_l10n.h.
3168 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3170 * src/frontends/kde/FormCitation.C: make the dialog
3171 behave more sensibly
3173 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3175 * config/kde.m4: fix consecutive ./configure runs,
3176 look for qtarch, fix library order
3178 * src/frontends/kde/Makefile.am: tidy up,
3179 add Print dialog, add .dlg dependencies
3181 * src/frontends/kde/FormPrint.C:
3182 * src/frontends/kde/FormPrint.h:
3183 * src/frontends/kde/formprintdialog.C:
3184 * src/frontends/kde/formprintdialog.h:
3185 * src/frontends/kde/formprintdialogdata.C:
3186 * src/frontends/kde/formprintdialogdata.h:
3187 * src/frontends/kde/dlg/formprintdialog.dlg: add
3190 * src/frontends/kde/dlg/README: Added explanatory readme
3192 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3193 script to double-check qtarch's output
3195 * src/frontends/kde/formindexdialog.C:
3196 * src/frontends/kde/formindexdialogdata.C:
3197 * src/frontends/kde/formindexdialogdata.h:
3198 * src/frontends/kde/dlg/formindexdialog.dlg: update
3199 for qtarch, minor fixes
3201 2000-10-05 Allan Rae <rae@lyx.org>
3203 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3204 dialogs when switching buffers update them instead. It's up to each
3205 dialog to decide if it should still be visible or not.
3206 update() should return a bool to control visiblity within show().
3207 Or perhaps better to set a member variable and use that to control
3210 * lib/build-listerrors: create an empty "listerrors" file just to stop
3211 make trying to regenerate it all the time if you don't have noweb
3214 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3216 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3217 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3218 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3219 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3220 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3222 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3224 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3226 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3227 deleting buffer. Closes all buffer-dependent dialogs.
3229 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3231 * src/frontends/xforms/FormCitation.[Ch]:
3232 * src/frontends/xforms/FormPreferences.[Ch]:
3233 * src/frontends/xforms/FormPrint.[Ch]:
3234 * src/frontends/xforms/FormRef.[Ch]:
3235 * src/frontends/xforms/FormUrl.[Ch]: ditto
3237 * src/frontends/xforms/FormDocument.[Ch]:
3238 * src/frontends/xforms/forms/form_document.C.patch:
3239 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3240 pass through a single input() function.
3242 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3244 * lib/build-listerrors: return status as OK
3246 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3248 * lib/lyxrc.example: Updated to new export code
3250 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3252 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3255 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3258 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3259 LyX-Code is defined.
3260 * lib/layouts/amsbook.layout: ditto.
3262 * boost/Makefile.am: fix typo.
3264 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3266 (add_lastfiles): removed.
3267 (add_documents): removed.
3268 (add_formats): removed.
3270 * src/frontends/Menubar.C: remove useless "using" directive.
3272 * src/MenuBackend.h: add a new MenuItem constructor.
3274 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3277 2000-10-04 Allan Rae <rae@lyx.org>
3279 * lib/Makefile.am (listerrors):
3280 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3281 I haven't got notangle installed so Kayvan please test. The output
3282 should end up in $builddir. This also allows people who don't have
3283 noweb installed to complete the make process without error.
3285 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3286 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3287 by JMarc's picky compiler.
3289 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3292 * src/insets/insettabular.C (setPos): change for loop to not use
3293 sequencing operator. Please check this Jürgen.
3295 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3297 * src/insets/insetcite.C (getScreenLabel): ditto
3298 * src/support/filetools.C (QuoteName): ditto
3299 (ChangeExtension): ditto
3301 * src/BufferView_pimpl.C (scrollCB): make heigt int
3303 * src/BufferView2.C (insertInset): comment out unused arg
3305 * boost/Makefile.am (EXTRADIST): new variable
3307 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3309 * src/exporter.C (IsExportable): Fixed
3311 * lib/configure.m4: Small fix
3313 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3315 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3316 * src/insets/insetbib.C (bibitemWidest): ditto.
3317 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3319 2000-10-03 Juergen Vigna <jug@sad.it>
3321 * src/BufferView2.C (theLockingInset): removed const because of
3322 Agnus's compile problems.
3324 * src/insets/insettext.C (LocalDispatch): set the language of the
3325 surronding paragraph on inserting the first character.
3327 * various files: changed use of BufferView::the_locking_inset.
3329 * src/BufferView2.C (theLockingInset):
3330 (theLockingInset): new functions.
3332 * src/BufferView.h: removed the_locking_inset.
3334 * src/lyxtext.h: added the_locking_inset
3336 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3338 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3340 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3342 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3343 * src/mathed/math_cursor.C (IsAlpha): ditto.
3344 * src/mathed/math_inset.C (strnew): ditto.
3345 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3346 (IMetrics): cxp set but never used; removed.
3347 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3348 that the variable in question has been removed also!
3351 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3352 using the Buffer * passed to Latex(), using the BufferView * passed to
3353 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3355 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3356 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3358 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3359 * src/buffer.C (readInset): used new InsetBibtex c-tor
3360 * (getBibkeyList): used new InsetBibtex::getKeys
3362 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3365 * lib/build-listerrors
3367 * src/exporter.C: Add literate programming support to the export code
3370 * src/lyx_cb.C: Remove old literate code.
3372 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3375 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3376 * src/converter.C (View, Convert): Use QuoteName.
3378 * src/insets/figinset.C (Preview): Use Formats::View.
3380 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3382 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3384 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3385 the top of the function, because compaq cxx complains that the
3386 "goto exit_with_message" when the function is disabled bypasses
3388 (MenuNew): try a better fix for the generation of new file names.
3389 This time, I used AddName() instead of AddPath(), hoping Juergen
3392 2000-10-03 Allan Rae <rae@lyx.org>
3394 * src/frontends/xforms/forms/form_preferences.fd:
3395 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3396 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3397 "Look and Feel"->"General" but will need to be split up further into
3398 general output and general input tabs. Current plan is for four outer
3399 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3400 stuff; "Inputs" for input and import configuration; "Outputs" for
3401 output and export configuration; and one more whatever is left over
3402 called "General". The leftovers at present look like being which
3403 viewers to use, spellchecker, language support and might be better
3404 named "Support". I've put "Paths" in "Inputs" for the moment as this
3405 seems reasonable for now at least.
3406 One problem remains: X error kills LyX when you close Preferences.
3408 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3410 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3411 qualifier from form()
3412 * src/frontends/xforms/FormCitation.[Ch]:
3413 * src/frontends/xforms/FormCopyright.[Ch]:
3414 * src/frontends/xforms/FormDocument.[Ch]:
3415 * src/frontends/xforms/FormError.[Ch]:
3416 * src/frontends/xforms/FormIndex.[Ch]:
3417 * src/frontends/xforms/FormPreferences.[Ch]:
3418 * src/frontends/xforms/FormPrint.[Ch]:
3419 * src/frontends/xforms/FormRef.[Ch]:
3420 * src/frontends/xforms/FormToc.[Ch]:
3421 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3423 * src/frontends/xforms/FormCitation.[Ch]:
3424 * src/frontends/xforms/FormIndex.[Ch]:
3425 * src/frontends/xforms/FormRef.[Ch]:
3426 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3427 with Allan's naming policy
3429 * src/frontends/xforms/FormCitation.C: some static casts to remove
3432 2000-10-02 Juergen Vigna <jug@sad.it>
3434 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3435 now you can type or do stuff inside the table-cell also when in dummy
3436 position, fixed visible cursor.
3438 * src/insets/insettext.C (Edit): fixing cursor-view position.
3440 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3441 be used for equal functions in lyxfunc and insettext.
3443 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3445 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3447 * src/frontends/gnome/FormCitation.h:
3448 * src/frontends/gnome/FormCopyright.h:
3449 * src/frontends/gnome/FormIndex.h:
3450 * src/frontends/gnome/FormPrint.h:
3451 * src/frontends/gnome/FormToc.h:
3452 * src/frontends/gnome/FormUrl.h:
3453 * src/frontends/kde/FormCitation.h:
3454 * src/frontends/kde/FormCopyright.h:
3455 * src/frontends/kde/FormIndex.h:
3456 * src/frontends/kde/FormRef.h:
3457 * src/frontends/kde/FormToc.h:
3458 * src/frontends/kde/FormUrl.h: fix remaining users of
3461 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3463 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3464 from depth argument.
3465 (DocBookHandleCaption): ditto.
3466 (DocBookHandleFootnote): ditto.
3467 (SimpleDocBookOnePar): ditto.
3469 * src/frontends/xforms/FormDocument.h (form): remove extra
3470 FormDocument:: qualifier.
3472 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3474 * sigc++/handle.h: ditto.
3476 * src/lyx_gui_misc.C: add "using" directive.
3478 * src/cheaders/cstddef: new file, needed by the boost library (for
3481 2000-10-02 Juergen Vigna <jug@sad.it>
3483 * src/insets/insettext.C (SetFont): better support.
3485 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3487 * src/screen.C (DrawOneRow): some uint refixes!
3489 2000-10-02 Allan Rae <rae@lyx.org>
3491 * boost/.cvsignore: ignore Makefile as well
3493 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3494 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3496 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3497 Left this one out by accident.
3499 * src/frontends/xforms/FormBase.h (restore): default to calling
3500 update() since that will restore the original/currently-applied values.
3501 Any input() triggered error messages will require the derived classes
3502 to redefine restore().
3504 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3505 avoid a segfault. combo_doc_class is the main concern.
3507 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3509 * Simplify build-listerrors in view of GUI-less export ability!
3511 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3513 * src/lyx_main.C (easyParse): Disable gui when exporting
3515 * src/insets/figinset.C:
3518 * src/lyx_gui_misc.C
3519 * src/tabular.C: Changes to allow no-gui.
3521 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3523 * src/support/utility.hpp: removed file
3524 * src/support/block.h: removed file
3526 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3529 * src/mathed/formula.C: add support/lyxlib.h
3530 * src/mathed/formulamacro.C: ditto
3532 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3533 * src/lyxparagraph.h: ditto
3535 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3536 * src/frontends/Makefile.am (INCLUDES): ditto
3537 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3538 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3539 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3540 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3541 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3542 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3544 * src/BufferView.h: use boost/utility.hpp
3545 * src/LColor.h: ditto
3546 * src/LaTeX.h: ditto
3547 * src/LyXAction.h: ditto
3548 * src/LyXView.h: ditto
3549 * src/bufferlist.h: ditto
3550 * src/lastfiles.h: ditto
3551 * src/layout.h: ditto
3552 * src/lyx_gui.h: ditto
3553 * src/lyx_main.h: ditto
3554 * src/lyxlex.h: ditto
3555 * src/lyxrc.h: ditto
3556 * src/frontends/ButtonPolicies.h: ditto
3557 * src/frontends/Dialogs.h: ditto
3558 * src/frontends/xforms/FormBase.h: ditto
3559 * src/frontends/xforms/FormGraphics.h: ditto
3560 * src/frontends/xforms/FormParagraph.h: ditto
3561 * src/frontends/xforms/FormTabular.h: ditto
3562 * src/graphics/GraphicsCache.h: ditto
3563 * src/graphics/Renderer.h: ditto
3564 * src/insets/ExternalTemplate.h: ditto
3565 * src/insets/insetcommand.h: ditto
3566 * src/support/path.h: ditto
3568 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3569 and introduce clause for 2.97.
3571 * boost/libs/README: new file
3573 * boost/boost/utility.hpp: new file
3575 * boost/boost/config.hpp: new file
3577 * boost/boost/array.hpp: new file
3579 * boost/Makefile.am: new file
3581 * boost/.cvsignore: new file
3583 * configure.in (AC_OUTPUT): add boost/Makefile
3585 * Makefile.am (SUBDIRS): add boost
3587 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3589 * src/support/lstrings.C (suffixIs): Fixed.
3591 2000-10-01 Allan Rae <rae@lyx.org>
3593 * src/PrinterParams.h: moved things around to avoid the "can't
3594 inline call" warning.
3596 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3597 into doc++ documentation.
3599 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3601 * src/frontends/xforms/FormRef.C: make use of button controller
3602 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3603 cleaned up button controller usage.
3604 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3605 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3606 use the button controller
3608 * src/frontends/xforms/forms/*.fd: and associated generated files
3609 updated to reflect changes to FormBase. Some other FormXxxx files
3610 also got minor updates to reflect changes to FormBase.
3612 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3613 (hide): made virtual.
3614 (input): return a bool. true == valid input
3615 (RestoreCB, restore): new
3616 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3617 Changes to allow derived dialogs to use a ButtonController and
3618 make sense when doing so: OK button calls ok() and so on.
3620 * src/frontends/xforms/ButtonController.h (class ButtonController):
3621 Switch from template implementation to taking Policy parameter.
3622 Allows FormBase to provide a ButtonController for any dialog.
3624 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3625 Probably should rename connect and disconnect.
3626 (apply): use the radio button groups
3627 (form): needed by FormBase
3628 (build): setup the radio button groups
3630 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3632 * several files: type changes to reduce the number of warnings and
3633 to unify type hangling a bit. Still much to do.
3635 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3637 * lib/images/*: rename a bunch of icons to match Dekel converter
3640 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3643 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3645 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3647 * sigc++/handle.h: ditto for class Handle.
3649 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3651 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3653 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3655 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3656 removal of the "default" language.
3658 * src/combox.h (getline): Check that sel > 0
3660 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3662 * lib/examples/docbook_example.lyx
3663 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3665 * lib/layouts/docbook-book.layout: new docbook book layout.
3667 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3669 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3671 * src/insets/figinset.C (DocBook):fixed small typo.
3673 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3675 * src/insets/insetinclude.h: string include_label doesn't need to be
3678 2000-09-29 Allan Rae <rae@lyx.org>
3680 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3681 Allow derived type to control connection and disconnection from signals
3682 of its choice if desired.
3684 2000-09-28 Juergen Vigna <jug@sad.it>
3686 * src/insets/insettabular.C (update): fixed cursor setting when
3687 the_locking_inset changed.
3688 (draw): made this a bit cleaner.
3689 (InsetButtonPress): fixed!
3691 * various files: added LyXText Parameter to fitCursor call.
3693 * src/BufferView.C (fitCursor): added LyXText parameter.
3695 * src/insets/insettabular.C (draw): small draw fix.
3697 * src/tabular.C: right setting of left/right celllines.
3699 * src/tabular.[Ch]: fixed various types in funcions and structures.
3700 * src/insets/insettabular.C: ditto
3701 * src/frontends/xforms/FormTabular.C: ditto
3703 2000-09-28 Allan Rae <rae@lyx.org>
3705 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3706 that the #ifdef's had been applied to part of what should have been
3707 a complete condition. It's possible there are other tests that
3708 were specific to tables that are also wrong now that InsetTabular is
3709 being used. Now we need to fix the output of '\n' after a table in a
3710 float for the same reason as the original condition:
3711 "don't insert this if we would be adding it before or after a table
3712 in a float. This little trick is needed in order to allow use of
3713 tables in \subfigures or \subtables."
3714 Juergen can you check this?
3716 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3718 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3719 output to the ostream.
3721 * several files: fixed types based on warnings from cxx
3723 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3725 * src/frontends/kde/Makefile.am: fix rule for
3726 formindexdialogdata_moc.C
3728 * src/.cvsignore: add ext_l10n.h to ignore
3730 * acconfig.h: stop messing with __STRICT_ANSI__
3731 * config/gnome.m4: remove option to set -ansi
3732 * config/kde.m4: remove option to set -ansi
3733 * config/lyxinclude.m4: don't set -ansi
3735 2000-09-27 Juergen Vigna <jug@sad.it>
3737 * various files: remove "default" language check.
3739 * src/insets/insetquotes.C: removed use of current_view.
3741 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3742 the one should have red ears by now!
3744 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3745 in more then one paragraph. Fixed cursor-movement/selection.
3747 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3748 paragraphs inside a text inset.
3750 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3751 text-inset if this owner is an inset.
3753 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3755 * src/Bullet.h: changed type of font, character and size to int
3757 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3759 * src/insets/inseturl.[Ch]:
3760 * src/insets/insetref.[Ch]:
3761 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3763 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3765 * src/buffer.C (readFile): block-if statement rearranged to minimise
3766 bloat. Patch does not reverse Jean-Marc's change ;-)
3768 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3769 Class rewritten to store pointers to hide/update signals directly,
3770 rather than Dialogs *. Also defined an enum to ease use. All xforms
3771 forms can now be derived from this class.
3773 * src/frontends/xforms/FormCommand.[Ch]
3774 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3776 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3779 * src/frontends/xforms/forms/form_citation.fd
3780 * src/frontends/xforms/forms/form_copyright.fd
3781 * src/frontends/xforms/forms/form_error.fd
3782 * src/frontends/xforms/forms/form_index.fd
3783 * src/frontends/xforms/forms/form_ref.fd
3784 * src/frontends/xforms/forms/form_toc.fd
3785 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3787 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3789 * src/insets/insetfoot.C: removed redundent using directive.
3791 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3793 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3794 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3796 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3797 created in the constructors in different groups. Then set() just
3798 have to show the groups as needed. This fixes the redraw problems
3799 (and is how the old menu code worked).
3801 * src/support/lyxlib.h: declare the methods as static when we do
3802 not have namespaces.
3804 2000-09-26 Juergen Vigna <jug@sad.it>
3806 * src/buffer.C (asciiParagraph): new function.
3807 (writeFileAscii): new function with parameter ostream.
3808 (writeFileAscii): use now asciiParagraph.
3810 * various inset files: added the linelen parameter to the Ascii-func.
3812 * src/tabular.C (Write): fixed error in writing file introduced by
3813 the last changes from Lars.
3815 * lib/bind/menus.bind: removed not supported functions.
3817 * src/insets/insettext.C (Ascii): implemented this function.
3819 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3821 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3822 (Write): use of the write_attribute functions.
3824 * src/bufferlist.C (close): fixed reasking question!
3826 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3828 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3829 new files use the everwhere possible.
3832 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3833 src/log_form.C src/lyx.C:
3836 * src/buffer.C (runLaTeX): remove func
3838 * src/PaperLayout.C: removed file
3839 * src/ParagraphExtra.C: likewise
3840 * src/bullet_forms.C: likewise
3841 * src/bullet_forms.h: likewise
3842 * src/bullet_forms_cb.C: likewise
3844 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3845 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3848 * several files: remove all traces of the old fd_form_paragraph,
3849 and functions belonging to that.
3851 * several files: remove all traces of the old fd_form_document,
3852 and functions belonging to that.
3854 * several files: constify local variables were possible.
3856 * several files: remove all code that was dead when NEW_EXPORT was
3859 * several files: removed string::c_str in as many places as
3862 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3863 (e): be a bit more outspoken when patching
3864 (updatesrc): only move files if changed.
3866 * forms/layout_forms.h.patch: regenerated
3868 * forms/layout_forms.fd: remove form_document and form_paragraph
3869 and form_quotes and form_paper and form_table_options and
3870 form_paragraph_extra
3872 * forms/form1.fd: remove form_table
3874 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3875 the fdui->... rewrite. Update some comments to xforms 0.88
3877 * forms/bullet_forms.C.patch: removed file
3878 * forms/bullet_forms.fd: likewise
3879 * forms/bullet_forms.h.patch: likewise
3881 * development/Code_rules/Rules: added a section on switch
3882 statements. Updated some comment to xforms 0.88.
3884 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3886 * src/buffer.C (readFile): make sure that the whole version number
3887 is read after \lyxformat (even when it contains a comma)
3889 * lib/ui/default.ui: change shortcut of math menu to M-a.
3891 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3893 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3896 * src/LyXView.C (updateWindowTitle): show the full files name in
3897 window title, limited to 30 characters.
3899 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3900 When a number of characters has been given, we should not assume
3901 that the string is 0-terminated.
3903 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3904 calls (fixes some memory leaks)
3906 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3907 trans member on exit.
3909 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3911 * src/converter.C (GetReachable): fix typo.
3913 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3914 understand ',' instead of '.'.
3915 (GetInteger): rewrite to use strToInt().
3917 2000-09-26 Juergen Vigna <jug@sad.it>
3919 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3920 better visibility and error-message on wrong VSpace input.
3922 * src/language.C (initL): added english again.
3924 2000-09-25 Juergen Vigna <jug@sad.it>
3926 * src/frontends/kde/Dialogs.C (Dialogs):
3927 * src/frontends/gnome/Dialogs.C (Dialogs):
3928 * src/frontends/kde/Makefile.am:
3929 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3931 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3933 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3935 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3937 * src/frontends/xforms/FormParagraph.C:
3938 * src/frontends/xforms/FormParagraph.h:
3939 * src/frontends/xforms/form_paragraph.C:
3940 * src/frontends/xforms/form_paragraph.h:
3941 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3944 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3946 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3947 Paragraph-Data after use.
3949 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3950 non breakable paragraphs.
3952 2000-09-25 Garst R. Reese <reese@isn.net>
3954 * src/language.C (initL): added missing language_country codes.
3956 2000-09-25 Juergen Vigna <jug@sad.it>
3958 * src/insets/insettext.C (InsetText):
3959 (deleteLyXText): remove the not released LyXText structure!
3961 2000-09-24 Marko Vendelin <markov@ioc.ee>
3963 * src/frontends/gnome/mainapp.C
3964 * src/frontends/gnome/mainapp.h: added support for keyboard
3967 * src/frontends/gnome/FormCitation.C
3968 * src/frontends/gnome/FormCitation.h
3969 * src/frontends/gnome/Makefile.am
3970 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3971 FormCitation to use "action area" in mainapp window
3973 * src/frontends/gnome/Menubar_pimpl.C
3974 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3977 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3979 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3980 width/descent/ascent values if name is empty.
3981 (mathed_string_height): Use std::max.
3983 2000-09-25 Allan Rae <rae@lyx.org>
3985 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3986 segfault. This will be completely redesigned soon.
3988 * sigc++: updated libsigc++. Fixes struct timespec bug.
3990 * development/tools/makeLyXsigc.sh: .cvsignore addition
3992 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3994 * several files: removed almost all traces of the old table
3997 * src/TableLayout.C: removed file
3999 2000-09-22 Juergen Vigna <jug@sad.it>
4001 * src/frontends/kde/Dialogs.C: added credits forms.
4003 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
4005 * src/frontends/gnome/Dialogs.C: added some forms.
4007 * src/spellchecker.C (init_spell_checker): set language in pspell code
4008 (RunSpellChecker): some modifications for setting language string.
4010 * src/language.[Ch]: added language_country code.
4012 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
4014 * src/frontends/Dialogs.h: added new signal showError.
4015 Rearranged existing signals in some sort of alphabetical order.
4017 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
4018 FormError.[Ch], form_error.[Ch]
4019 * src/frontends/xforms/forms/makefile: added new file form_error.fd
4020 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
4022 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
4023 dialogs. I think that this can be used as the base to all these
4026 * src/frontends/xforms/FormError.[Ch]
4027 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
4028 implementation of InsetError dialog.
4030 * src/insets/inseterror.[Ch]: rendered GUI-independent.
4032 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
4033 * src/frontends/kde/Makefile.am: ditto
4035 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
4037 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
4038 macrobf. This fixes a bug of invisible text.
4040 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4042 * lib/doc/LaTeXConfig.lyx.in: updated.
4044 * src/language.C (initL): remove language "francais" and change a
4045 bit the names of the two other french variations.
4047 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4048 string that may not be 0-terminated.
4050 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4052 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4054 2000-09-20 Marko Vendelin <markov@ioc.ee>
4056 * src/frontends/gnome/FormCitation.C
4057 * src/frontends/gnome/FormIndex.C
4058 * src/frontends/gnome/FormToc.C
4059 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4060 the variable initialization to shut up the warnings
4062 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4064 * src/table.[Ch]: deleted files
4066 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4069 2000-09-18 Juergen Vigna <jug@sad.it>
4071 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4072 problems with selection. Inserted new LFUN_PASTESELECTION.
4073 (InsetButtonPress): inserted handling of middle mouse-button paste.
4075 * src/spellchecker.C: changed word to word.c_str().
4077 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4079 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4080 included in the ``make dist'' tarball.
4082 2000-09-15 Juergen Vigna <jug@sad.it>
4084 * src/CutAndPaste.C (cutSelection): small fix return the right
4085 end position after cut inside one paragraph only.
4087 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4088 we are locked as otherwise we don't have a valid cursor position!
4090 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4092 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4094 * src/frontends/kde/FormRef.C: added using directive.
4095 * src/frontends/kde/FormToc.C: ditto
4097 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4099 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4101 2000-09-19 Marko Vendelin <markov@ioc.ee>
4103 * src/frontends/gnome/Menubar_pimpl.C
4104 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4105 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4107 * src/frontends/gnome/mainapp.C
4108 * src/frontends/gnome/mainapp.h: support for menu update used
4111 * src/frontends/gnome/mainapp.C
4112 * src/frontends/gnome/mainapp.h: support for "action" area in the
4113 main window. This area is used by small simple dialogs, such as
4116 * src/frontends/gnome/FormIndex.C
4117 * src/frontends/gnome/FormIndex.h
4118 * src/frontends/gnome/FormUrl.C
4119 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4122 * src/frontends/gnome/FormCitation.C
4123 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4124 action area. Only "Insert new citation" is implemented.
4126 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4128 * src/buffer.C (Dispatch): fix call to Dispatch
4129 * src/insets/insetref.C (Edit): likewise
4130 * src/insets/insetparent.C (Edit): likewise
4131 * src/insets/insetinclude.C (include_cb): likewise
4132 * src/frontends/xforms/FormUrl.C (apply): likewise
4133 * src/frontends/xforms/FormToc.C (apply): likewise
4134 * src/frontends/xforms/FormRef.C (apply): likewise
4135 * src/frontends/xforms/FormIndex.C (apply): likewise
4136 * src/frontends/xforms/FormCitation.C (apply): likewise
4137 * src/lyxserver.C (callback): likewise
4138 * src/lyxfunc.C (processKeySym): likewise
4139 (Dispatch): likewise
4140 (Dispatch): likewise
4141 * src/lyx_cb.C (LayoutsCB): likewise
4143 * Makefile.am (sourcedoc): small change
4145 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4147 * src/main.C (main): Don't make an empty GUIRunTime object. all
4148 methods are static. constify a bit remove unneded using + headers.
4150 * src/tabular.C: some more const to local vars move some loop vars
4152 * src/spellchecker.C: added some c_str after some word for pspell
4154 * src/frontends/GUIRunTime.h: add new static method setDefaults
4155 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4156 * src/frontends/kde/GUIRunTime.C (setDefaults):
4157 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4159 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4160 with strnew in arg, use correct emptystring when calling SetName.
4162 * several files: remove all commented code with relation to
4163 HAVE_SSTREAM beeing false. We now only support stringstream and
4166 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4168 * src/lyxfunc.C: construct correctly the automatic new file
4171 * src/text2.C (IsStringInText): change type of variable i to shut
4174 * src/support/sstream.h: do not use namespaces if the compiler
4175 does not support them.
4177 2000-09-15 Marko Vendelin <markov@ioc.ee>
4178 * src/frontends/gnome/FormCitation.C
4179 * src/frontends/gnome/FormCitation.h
4180 * src/frontends/gnome/diainsertcitation_interface.c
4181 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4182 regexp support to FormCitation [Gnome].
4184 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4187 * configure.in: remove unused KDE/GTKGUI define
4189 * src/frontends/kde/FormRef.C
4190 * src/frontends/kde/FormRef.h
4191 * src/frontends/kde/formrefdialog.C
4192 * src/frontends/kde/formrefdialog.h: double click will
4193 go to reference, now it is possible to change a cross-ref
4196 * src/frontends/kde/FormToc.C
4197 * src/frontends/kde/FormToc.h
4198 * src/frontends/kde/formtocdialog.C
4199 * src/frontends/kde/formtocdialog.h: add a depth
4202 * src/frontends/kde/Makefile.am: add QtLyXView.h
4205 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4207 * src/frontends/kde/FormCitation.h: added some using directives.
4209 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4211 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4214 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4217 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4219 * src/buffer.C (pop_tag): revert for the second time a change by
4220 Lars, who seems to really hate having non-local loop variables :)
4222 * src/Lsstream.h: add "using" statements.
4224 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4225 * src/buffer.C (writeFile): ditto
4227 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4229 * src/buffer.C (writeFile): try to fix the locale modified format
4230 number to always be as we want it.
4232 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4233 in XForms 0.89. C-space is now working again.
4235 * src/Lsstream.h src/support/sstream.h: new files.
4237 * also commented out all cases where strstream were used.
4239 * src/Bullet.h (c_str): remove method.
4241 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4243 * a lot of files: get rid of "char const *" and "char *" is as
4244 many places as possible. We only want to use them in interaction
4245 with system of other libraries, not inside lyx.
4247 * a lot of files: return const object is not of pod type. This
4248 helps ensure that temporary objects is not modified. And fits well
4249 with "programming by contract".
4251 * configure.in: check for the locale header too
4253 * Makefile.am (sourcedoc): new tag for generation of doc++
4256 2000-09-14 Juergen Vigna <jug@sad.it>
4258 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4259 callback to check which combo called it and do the right action.
4261 * src/combox.C (combo_cb): added combo * to the callbacks.
4262 (Hide): moved call of callback after Ungrab of the pointer.
4264 * src/intl.h: removed LCombo2 function.
4266 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4267 function as this can now be handled in one function.
4269 * src/combox.h: added Combox * to callback prototype.
4271 * src/frontends/xforms/Toolbar_pimpl.C:
4272 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4274 2000-09-14 Garst Reese <reese@isn.net>
4276 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4277 moved usepackage{xxx}'s to beginning of file. Changed left margin
4278 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4279 underlining from title. Thanks to John Culleton for useful suggestions.
4281 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4283 * src/lyxlex_pimpl.C (setFile): change error message to debug
4286 2000-09-13 Juergen Vigna <jug@sad.it>
4288 * src/frontends/xforms/FormDocument.C: implemented choice_class
4289 as combox and give callback to combo_language so OK/Apply is activated
4292 * src/bufferlist.C (newFile): small fix so already named files
4293 (via an open call) are not requested to be named again on the
4296 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4298 * src/frontends/kde/Makefile.am
4299 * src/frontends/kde/FormRef.C
4300 * src/frontends/kde/FormRef.h
4301 * src/frontends/kde/formrefdialog.C
4302 * src/frontends/kde/formrefdialog.h: implement
4305 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4307 * src/frontends/kde/formtocdialog.C
4308 * src/frontends/kde/formtocdialog.h
4309 * src/frontends/kde/FormToc.C
4310 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4312 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4314 * src/frontends/kde/FormCitation.C: fix thinko
4315 where we didn't always display the reference text
4318 * src/frontends/kde/formurldialog.C
4319 * src/frontends/kde/formurldialog.h
4320 * src/frontends/kde/FormUrl.C
4321 * src/frontends/kde/FormUrl.h: minor cleanups
4323 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4325 * src/frontends/kde/Makefile.am
4326 * src/frontends/kde/FormToc.C
4327 * src/frontends/kde/FormToc.h
4328 * src/frontends/kde/FormCitation.C
4329 * src/frontends/kde/FormCitation.h
4330 * src/frontends/kde/FormIndex.C
4331 * src/frontends/kde/FormIndex.h
4332 * src/frontends/kde/formtocdialog.C
4333 * src/frontends/kde/formtocdialog.h
4334 * src/frontends/kde/formcitationdialog.C
4335 * src/frontends/kde/formcitationdialog.h
4336 * src/frontends/kde/formindexdialog.C
4337 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4339 2000-09-12 Juergen Vigna <jug@sad.it>
4341 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4344 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4346 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4349 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4351 * src/converter.C (Add, Convert): Added support for converter flags:
4352 needaux, resultdir, resultfile.
4353 (Convert): Added new parameter view_file.
4354 (dvips_options): Fixed letter paper option.
4356 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4357 (Export, GetExportableFormats, GetViewableFormats): Added support
4360 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4362 (easyParse): Fixed to work with new export code.
4364 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4367 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4369 * lib/bind/*.bind: Replaced
4370 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4371 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4373 2000-09-11 Juergen Vigna <jug@sad.it>
4375 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4377 * src/main.C (main): now GUII defines global guiruntime!
4379 * src/frontends/gnome/GUIRunTime.C (initApplication):
4380 * src/frontends/kde/GUIRunTime.C (initApplication):
4381 * src/frontends/xforms/GUIRunTime.C (initApplication):
4382 * src/frontends/GUIRunTime.h: added new function initApplication.
4384 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4386 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4388 2000-09-08 Juergen Vigna <jug@sad.it>
4390 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4391 we have already "Reset".
4393 * src/language.C (initL): inserted "default" language and made this
4394 THE default language (and not american!)
4396 * src/paragraph.C: inserted handling of "default" language!
4398 * src/lyxfont.C: ditto
4402 * src/paragraph.C: output the \\par only if we have a following
4403 paragraph otherwise it's not needed.
4405 2000-09-05 Juergen Vigna <jug@sad.it>
4407 * config/pspell.m4: added entry to lyx-flags
4409 * src/spellchecker.C: modified version from Kevin for using pspell
4411 2000-09-01 Marko Vendelin <markov@ioc.ee>
4412 * src/frontends/gnome/Makefile.am
4413 * src/frontends/gnome/FormCitation.C
4414 * src/frontends/gnome/FormCitation.h
4415 * src/frontends/gnome/diainsertcitation_callbacks.c
4416 * src/frontends/gnome/diainsertcitation_callbacks.h
4417 * src/frontends/gnome/diainsertcitation_interface.c
4418 * src/frontends/gnome/diainsertcitation_interface.h
4419 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4420 dialog for Gnome frontend
4422 * src/main.C: Gnome libraries require keeping application name
4423 and its version as strings
4425 * src/frontends/gnome/mainapp.C: Change the name of the main window
4426 from GnomeLyX to PACKAGE
4428 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4430 * src/frontends/Liason.C: add "using: declaration.
4432 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4434 * src/mathed/math_macro.C (Metrics): Set the size of the template
4436 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4438 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4440 * src/converter.C (add_options): New function.
4441 (SetViewer): Change $$FName into '$$FName'.
4442 (View): Add options when running xdvi
4443 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4444 (Convert): The 3rd parameter is now the desired filename. Converts
4445 calls to lyx::rename if necessary.
4446 Add options when running dvips.
4447 (dvi_papersize,dvips_options): New methods.
4449 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4451 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4452 using a call to Converter::dvips_options.
4453 Fixed to work with nex export code.
4455 * src/support/copy.C
4456 * src/support/rename.C: New files
4458 * src/support/syscall.h
4459 * src/support/syscall.C: Added Starttype SystemDontWait.
4461 * lib/ui/default.ui: Changed to work with new export code
4463 * lib/configure.m4: Changed to work with new export code
4465 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4467 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4469 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4470 so that code compiles with DEC cxx.
4472 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4473 to work correctly! Also now supports the additional elements
4476 2000-09-01 Allan Rae <rae@lyx.org>
4478 * src/frontends/ButtonPolicies.C: renamed all the references to
4479 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4481 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4482 since it's a const not a type.
4484 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4486 2000-08-31 Juergen Vigna <jug@sad.it>
4488 * src/insets/figinset.C: Various changes to look if the filename has
4489 an extension and if not add it for inline previewing.
4491 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4493 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4494 make buttonStatus and isReadOnly be const methods. (also reflect
4495 this in derived classes.)
4497 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4498 (nextState): change to be static inline, pass the StateMachine as
4500 (PreferencesPolicy): remove casts
4501 (OkCancelPolicy): remvoe casts
4502 (OkCancelReadOnlyPolicy): remove casts
4503 (NoRepeatedApplyReadOnlyPolicy): remove casts
4504 (OkApplyCancelReadOnlyPolicy): remove casts
4505 (OkApplyCancelPolicy): remove casts
4506 (NoRepeatedApplyPolicy): remove casts
4508 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4510 * src/converter.C: added some using directives
4512 * src/frontends/ButtonPolicies.C: changes to overcome
4513 "need lvalue" error with DEC c++
4515 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4516 to WMHideCB for DEC c++
4518 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4520 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4521 to BulletBMTableCB for DEC c++
4523 2000-08-31 Allan Rae <rae@lyx.org>
4525 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4526 character dialog separately from old document dialogs combo_language.
4529 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4531 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4532 Removed LFUN_REF_CREATE.
4534 * src/MenuBackend.C: Added new tags: toc and references
4536 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4537 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4539 (add_toc, add_references): New methods.
4540 (create_submenu): Handle correctly the case when there is a
4541 seperator after optional menu items.
4543 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4544 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4545 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4547 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4549 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4551 * src/converter.[Ch]: New file for converting between different
4554 * src/export.[Ch]: New file for exporting a LyX file to different
4557 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4558 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4559 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4560 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4561 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4562 RunDocBook, MenuExport.
4564 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4565 Exporter::Preview methods if NEW_EXPORT is defined.
4567 * src/buffer.C (Dispatch): Use Exporter::Export.
4569 * src/lyxrc.C: Added new tags: \converter and \viewer.
4572 * src/LyXAction.C: Define new lyx-function: buffer-update.
4573 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4574 when NEW_EXPORT is defined.
4576 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4578 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4580 * lib/ui/default.ui: Added submenus "view" and "update" to the
4583 * src/filetools.C (GetExtension): New function.
4585 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4587 2000-08-29 Allan Rae <rae@lyx.org>
4589 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4591 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4592 (EnableDocumentLayout): removed
4593 (DisableDocumentLayout): removed
4594 (build): make use of ButtonController's read-only handling to
4595 de/activate various objects. Replaces both of the above functions.
4597 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4598 (readOnly): was read_only
4599 (refresh): fixed dumb mistakes with read_only_ handling
4601 * src/frontends/xforms/forms/form_document.fd:
4602 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4603 tabbed dialogs so the tabs look more like tabs and so its easier to
4604 work out which is the current tab.
4606 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4607 segfault with form_table
4609 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4611 2000-08-28 Juergen Vigna <jug@sad.it>
4613 * acconfig.h: added USE_PSPELL.
4615 * src/config.h.in: added USE_PSPELL.
4617 * autogen.sh: added pspell.m4
4619 * config/pspell.m4: new file.
4621 * src/spellchecker.C: implemented support for pspell libary.
4623 2000-08-25 Juergen Vigna <jug@sad.it>
4625 * src/LyXAction.C (init): renamed LFUN_TABLE to
4626 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4628 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4630 * src/lyxscreen.h: add force_clear variable and fuction to force
4631 a clear area when redrawing in LyXText.
4633 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4635 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4637 * some whitespace and comment changes.
4639 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4641 * src/buffer.C: up te LYX_FORMAT to 2.17
4643 2000-08-23 Juergen Vigna <jug@sad.it>
4645 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4648 * src/insets/insettabular.C (pasteSelection): delete the insets
4649 LyXText as it is not valid anymore.
4650 (copySelection): new function.
4651 (pasteSelection): new function.
4652 (cutSelection): new function.
4653 (LocalDispatch): implemented cut/copy/paste of cell selections.
4655 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4656 don't have a LyXText.
4658 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4660 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4663 2000-08-22 Juergen Vigna <jug@sad.it>
4665 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4666 ifdef form_table out if NEW_TABULAR.
4668 2000-08-21 Juergen Vigna <jug@sad.it>
4670 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4671 (draw): fixed draw position so that the cursor is positioned in the
4673 (InsetMotionNotify): hide/show cursor so the position is updated.
4674 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4675 using cellstart() function where it should be used.
4677 * src/insets/insettext.C (draw): ditto.
4679 * src/tabular.C: fixed initialization of some missing variables and
4680 made BoxType into an enum.
4682 2000-08-22 Marko Vendelin <markov@ioc.ee>
4683 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4684 stock menu item using action numerical value, not its string
4688 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4690 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4691 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4693 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4695 * src/frontends/xforms/GUIRunTime.C: new file
4697 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4698 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4700 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4702 * src/frontends/kde/GUIRunTime.C: new file
4704 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4705 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4707 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4709 * src/frontends/gnome/GUIRunTime.C: new file
4711 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4714 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4715 small change to documetentation.
4717 * src/frontends/GUIRunTime.C: removed file
4719 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4721 * src/lyxparagraph.h: enable NEW_TABULAR as default
4723 * src/lyxfunc.C (processKeySym): remove some commented code
4725 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4726 NEW_TABULAR around the fd_form_table_options.
4728 * src/lyx_gui.C (runTime): call the static member function as
4729 GUIRunTime::runTime().
4731 2000-08-21 Allan Rae <rae@lyx.org>
4733 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4736 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4738 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4740 2000-08-21 Allan Rae <rae@lyx.org>
4742 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4743 keep Garst happy ;-)
4744 * src/frontends/xforms/FormPreferences.C (build): use setOK
4745 * src/frontends/xforms/FormDocument.C (build): use setOK
4746 (FormDocument): use the appropriate policy.
4748 2000-08-21 Allan Rae <rae@lyx.org>
4750 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4751 automatic [de]activation of arbitrary objects when in a read-only state.
4753 * src/frontends/ButtonPolicies.h: More documentation
4754 (isReadOnly): added to support the above.
4756 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4758 2000-08-18 Juergen Vigna <jug@sad.it>
4760 * src/insets/insettabular.C (getStatus): changed to return func_status.
4762 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4763 display toggle menu entries if they are.
4765 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4766 new document layout now.
4768 * src/lyxfunc.C: ditto
4770 * src/lyx_gui_misc.C: ditto
4772 * src/lyx_gui.C: ditto
4774 * lib/ui/default.ui: removed paper and quotes layout as they are now
4775 all in the document layout tabbed folder.
4777 * src/frontends/xforms/forms/form_document.fd: added Restore
4778 button and callbacks for all inputs for Allan's ButtonPolicy.
4780 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4781 (CheckChoiceClass): added missing params setting on class change.
4782 (UpdateLayoutDocument): added for updating the layout on params.
4783 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4784 (FormDocument): Implemented Allan's ButtonPolicy with the
4787 2000-08-17 Allan Rae <rae@lyx.org>
4789 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4790 so we can at least see the credits again.
4792 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4793 controller calls for the appropriate callbacks. Note that since Ok
4794 calls apply followed by cancel, and apply isn't a valid input for the
4795 APPLIED state, the bc_ calls have to be made in the static callback not
4796 within each of the real callbacks.
4798 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4799 (setOk): renamed from setOkay()
4801 2000-08-17 Juergen Vigna <jug@sad.it>
4803 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4804 in the implementation part.
4805 (composeUIInfo): don't show optional menu-items.
4807 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4809 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4811 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4812 text-state when in a text-inset.
4814 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4816 2000-08-17 Marko Vendelin <markov@ioc.ee>
4817 * src/frontends/gnome/FormIndex.C
4818 * src/frontends/gnome/FormIndex.h
4819 * src/frontends/gnome/FormToc.C
4820 * src/frontends/gnome/FormToc.h
4821 * src/frontends/gnome/dialogs
4822 * src/frontends/gnome/diatoc_callbacks.c
4823 * src/frontends/gnome/diatoc_callbacks.h
4824 * src/frontends/gnome/diainsertindex_callbacks.h
4825 * src/frontends/gnome/diainsertindex_callbacks.c
4826 * src/frontends/gnome/diainsertindex_interface.c
4827 * src/frontends/gnome/diainsertindex_interface.h
4828 * src/frontends/gnome/diatoc_interface.h
4829 * src/frontends/gnome/diatoc_interface.c
4830 * src/frontends/gnome/Makefile.am: Table of Contents and
4831 Insert Index dialogs implementation for Gnome frontend
4833 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4835 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4837 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4840 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4842 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4843 destructor. Don't definde if you don't need it
4844 (processEvents): made static, non-blocking events processing for
4846 (runTime): static method. event loop for xforms
4847 * similar as above for kde and gnome.
4849 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4850 new Pimpl is correct
4851 (runTime): new method calss the real frontends runtime func.
4853 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4855 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4857 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4859 2000-08-16 Juergen Vigna <jug@sad.it>
4861 * src/lyx_gui.C (runTime): added GUII RunTime support.
4863 * src/frontends/Makefile.am:
4864 * src/frontends/GUIRunTime.[Ch]:
4865 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4866 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4867 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4869 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4871 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4872 as this is already set in ${FRONTEND_INCLUDE} if needed.
4874 * configure.in (CPPFLAGS): setting the include dir for the frontend
4875 directory and don't set FRONTEND=xforms for now as this is executed
4878 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4880 * src/frontends/kde/Makefile.am:
4881 * src/frontends/kde/FormUrl.C:
4882 * src/frontends/kde/FormUrl.h:
4883 * src/frontends/kde/formurldialog.h:
4884 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4886 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4888 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4890 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4892 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4895 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4897 * src/WorkArea.C (work_area_handler): more work to get te
4898 FL_KEYBOARD to work with xforms 0.88 too, please test.
4900 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4902 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4904 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4907 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4909 * src/Timeout.h: remove Qt::emit hack.
4911 * several files: changes to allo doc++ compilation
4913 * src/lyxfunc.C (processKeySym): new method
4914 (processKeyEvent): comment out if FL_REVISION < 89
4916 * src/WorkArea.C: change some debugging levels.
4917 (WorkArea): set wantkey to FL_KEY_ALL
4918 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4919 clearer code and the use of compose with XForms 0.89. Change to
4920 use signals instead of calling methods in bufferview directly.
4922 * src/Painter.C: change some debugging levels.
4924 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4927 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4928 (workAreaKeyPress): new method
4930 2000-08-14 Juergen Vigna <jug@sad.it>
4932 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4934 * config/kde.m4: addes some features
4936 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4937 include missing xforms dialogs.
4939 * src/Timeout.h: a hack to be able to compile with qt/kde.
4941 * sigc++/.cvsignore: added acinclude.m4
4943 * lib/.cvsignore: added listerros
4945 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4946 xforms tree as objects are needed for other frontends.
4948 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4949 linking with not yet implemented xforms objects.
4951 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4953 2000-08-14 Baruch Even <baruch.even@writeme.com>
4955 * src/frontends/xforms/FormGraphics.h:
4956 * src/frontends/xforms/FormGraphics.C:
4957 * src/frontends/xforms/RadioButtonGroup.h:
4958 * src/frontends/xforms/RadioButtonGroup.C:
4959 * src/insets/insetgraphics.h:
4960 * src/insets/insetgraphics.C:
4961 * src/insets/insetgraphicsParams.h:
4962 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4963 instead of spaces, and various other indentation issues to make the
4964 sources more consistent.
4966 2000-08-14 Marko Vendelin <markov@ioc.ee>
4968 * src/frontends/gnome/dialogs/diaprint.glade
4969 * src/frontends/gnome/FormPrint.C
4970 * src/frontends/gnome/FormPrint.h
4971 * src/frontends/gnome/diaprint_callbacks.c
4972 * src/frontends/gnome/diaprint_callbacks.h
4973 * src/frontends/gnome/diaprint_interface.c
4974 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4977 * src/frontends/gnome/dialogs/diainserturl.glade
4978 * src/frontends/gnome/FormUrl.C
4979 * src/frontends/gnome/FormUrl.h
4980 * src/frontends/gnome/diainserturl_callbacks.c
4981 * src/frontends/gnome/diainserturl_callbacks.h
4982 * src/frontends/gnome/diainserturl_interface.c
4983 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4984 Gnome implementation
4986 * src/frontends/gnome/Dialogs.C
4987 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4988 all other dialogs. Copy all unimplemented dialogs from Xforms
4991 * src/frontends/gnome/support.c
4992 * src/frontends/gnome/support.h: support files generated by Glade
4996 * config/gnome.m4: Gnome configuration scripts
4998 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4999 configure --help message
5001 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
5002 only if there are no events pendling in Gnome/Gtk. This enhances
5003 the performance of menus.
5006 2000-08-14 Allan Rae <rae@lyx.org>
5008 * lib/Makefile.am: listerrors cleaning
5010 * lib/listerrors: removed -- generated file
5011 * acinclude.m4: ditto
5012 * sigc++/acinclude.m4: ditto
5014 * src/frontends/xforms/forms/form_citation.fd:
5015 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
5018 * src/frontends/xforms/forms/makefile: I renamed the `install` target
5019 `updatesrc` and now we have a `test` target that does what `updatesrc`
5020 used to do. I didn't like having an install target that wasn't related
5023 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
5024 on all except FormGraphics. This may yet happen. Followed by a major
5025 cleanup including using FL_TRANSIENT for most of the dialogs. More
5026 changes to come when the ButtonController below is introduced.
5028 * src/frontends/xforms/ButtonController.h: New file for managing up to
5029 four buttons on a dialog according to an externally defined policy.
5030 * src/frontends/xforms/Makefile.am: added above
5032 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
5033 Apply and Cancel/Close buttons and everything in between and beyond.
5034 * src/frontends/Makefile.am: added above.
5036 * src/frontends/xforms/forms/form_preferences.fd:
5037 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
5038 and removed variable 'status' as a result. Fixed the set_minsize thing.
5039 Use the new screen-font-update after checking screen fonts were changed
5040 Added a "Restore" button to restore the original lyxrc values while
5041 editing. This restores everything not just the last input changed.
5042 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5044 * src/LyXAction.C: screen-font-update added for updating buffers after
5045 screen font settings have been changed.
5046 * src/commandtags.h: ditto
5047 * src/lyxfunc.C: ditto
5049 * forms/lyx.fd: removed screen fonts dialog.
5050 * src/lyx_gui.C: ditto
5051 * src/menus.[Ch]: ditto
5052 * src/lyx.[Ch]: ditto
5053 * src/lyx_cb.C: ditto + code from here moved to make
5054 screen-font-update. And people wonder why progress on GUII is
5055 slow. Look at how scattered this stuff was! It takes forever
5058 * forms/fdfix.sh: Fixup the spacing after commas.
5059 * forms/makefile: Remove date from generated files. Fewer clashes now.
5060 * forms/bullet_forms.C.patch: included someones handwritten changes
5062 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5063 once I've discovered why LyXRC was made noncopyable.
5064 * src/lyx_main.C: ditto
5066 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5068 * src/frontends/xforms/forms/fdfix.sh:
5069 * src/frontends/xforms/forms/fdfixh.sed:
5070 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5071 * src/frontends/xforms/Form*.[hC]:
5072 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5073 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5074 provide a destructor for the struct FD_form_xxxx. Another version of
5075 the set_[max|min]size workaround and a few other cleanups. Actually,
5076 Angus' patch from 20000809.
5078 2000-08-13 Baruch Even <baruch.even@writeme.com>
5080 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5083 2000-08-11 Juergen Vigna <jug@sad.it>
5085 * src/insets/insetgraphics.C (InsetGraphics): changing init
5086 order because of warnings.
5088 * src/frontends/xforms/forms/makefile: adding patching .C with
5091 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5092 from .C.patch to .c.patch
5094 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5095 order because of warning.
5097 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5099 * src/frontends/Liason.C (setMinibuffer): new helper function
5101 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5103 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5105 * lib/ui/default.ui: commented out PaperLayout entry
5107 * src/frontends/xforms/form_document.[Ch]: new added files
5109 * src/frontends/xforms/FormDocument.[Ch]: ditto
5111 * src/frontends/xforms/forms/form_document.fd: ditto
5113 * src/frontends/xforms/forms/form_document.C.patch: ditto
5115 2000-08-10 Juergen Vigna <jug@sad.it>
5117 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5118 (InsetGraphics): initialized cacheHandle to 0.
5119 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5121 2000-08-10 Baruch Even <baruch.even@writeme.com>
5123 * src/graphics/GraphicsCache.h:
5124 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5125 correctly as a cache.
5127 * src/graphics/GraphicsCacheItem.h:
5128 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5131 * src/graphics/GraphicsCacheItem_pimpl.h:
5132 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5135 * src/insets/insetgraphics.h:
5136 * src/insets/insetgraphics.C: Changed from using a signal notification
5137 to polling when image is not loaded.
5139 2000-08-10 Allan Rae <rae@lyx.org>
5141 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5142 that there are two functions that have to been taken out of line by
5143 hand and aren't taken care of in the script. (Just a reminder note)
5145 * sigc++/macros/*.h.m4: Updated as above.
5147 2000-08-09 Juergen Vigna <jug@sad.it>
5149 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5151 * src/insets/insettabular.C: make drawing of single cell smarter.
5153 2000-08-09 Marko Vendelin <markov@ioc.ee>
5154 * src/frontends/gnome/Menubar_pimpl.C
5155 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5156 implementation: new files
5158 * src/frontends/gnome/mainapp.C
5159 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5162 * src/main.C: create Gnome main window
5164 * src/frontends/xforms/Menubar_pimpl.h
5165 * src/frontends/Menubar.C
5166 * src/frontends/Menubar.h: added method Menubar::update that calls
5167 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5169 * src/LyXView.C: calls Menubar::update to update the state
5172 * src/frontends/gnome/Makefile.am: added new files
5174 * src/frontends/Makefile.am: added frontend compiler options
5176 2000-08-08 Juergen Vigna <jug@sad.it>
5178 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5180 * src/bufferlist.C (close):
5181 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5182 documents if exiting without saving.
5184 * src/buffer.C (save): use removeAutosaveFile()
5186 * src/support/filetools.C (removeAutosaveFile): new function.
5188 * src/lyx_cb.C (MenuWrite): returns a bool now.
5189 (MenuWriteAs): check if file could really be saved and revert to the
5191 (MenuWriteAs): removing old autosavefile if existant.
5193 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5194 before Goto toggle declaration, because of compiler warning.
5196 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5198 * src/lyxfunc.C (MenuNew): small fix.
5200 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5202 * src/bufferlist.C (newFile):
5203 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5205 * src/lyxrc.C: added new_ask_filename tag
5207 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5209 * src/lyx.fd: removed code pertaining to form_ref
5210 * src/lyx.[Ch]: ditto
5211 * src/lyx_cb.C: ditto
5212 * src/lyx_gui.C: ditto
5213 * src/lyx_gui_misc.C: ditto
5215 * src/BufferView_pimpl.C (restorePosition): update buffer only
5218 * src/commandtags.h (LFUN_REFTOGGLE): removed
5219 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5220 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5221 (LFUN_REFBACK): renamed LFUN_REF_BACK
5223 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5224 * src/menus.C: ditto
5225 * src/lyxfunc.C (Dispatch): ditto.
5226 InsertRef dialog is now GUI-independent.
5228 * src/texrow.C: added using std::endl;
5230 * src/insets/insetref.[Ch]: strip out large amounts of code.
5231 The inset is now a container and this functionality is now
5232 managed by a new FormRef dialog
5234 * src/frontends/Dialogs.h (showRef, createRef): new signals
5236 * src/frontends/xforms/FormIndex.[Ch],
5237 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5238 when setting dialog's min/max size
5239 * src/frontends/xforms/FormIndex.[Ch]: ditto
5241 * src/frontends/xforms/FormRef.[Ch],
5242 src/frontends/xforms/forms/form_ref.fd: new xforms
5243 implementation of an InsetRef dialog
5245 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5248 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5249 ios::nocreate is not part of the standard. Removed.
5251 2000-08-07 Baruch Even <baruch.even@writeme.com>
5253 * src/graphics/Renderer.h:
5254 * src/graphics/Renderer.C: Added base class for rendering of different
5255 image formats into Pixmaps.
5257 * src/graphics/XPM_Renderer.h:
5258 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5259 in a different class.
5261 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5262 easily add support for other formats.
5264 * src/insets/figinset.C: plugged a leak of an X resource.
5266 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5268 * src/CutAndPaste.[Ch]: make all metods static.
5270 * development/Code_rules/Rules: more work, added section on
5271 Exceptions, and a References section.
5273 * a lot of header files: work to make doc++ able to generate the
5274 source documentation, some workarounds of doc++ problems. Doc++ is
5275 now able to generate the documentation.
5277 2000-08-07 Juergen Vigna <jug@sad.it>
5279 * src/insets/insettabular.C (recomputeTextInsets): removed function
5281 * src/tabular.C (SetWidthOfMulticolCell):
5283 (calculate_width_of_column_NMC): fixed return value so that it really
5284 only returns true if the column-width has changed (there where
5285 problems with muliticolumn-cells in this column).
5287 2000-08-04 Juergen Vigna <jug@sad.it>
5289 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5290 also on the scrollstatus of the inset.
5291 (workAreaMotionNotify): ditto.
5293 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5295 2000-08-01 Juergen Vigna <jug@sad.it>
5297 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5299 * src/commandtags.h:
5300 * src/LyXAction.C (init):
5301 * src/insets/inset.C (LocalDispatch): added support for
5304 * src/insets/inset.C (scroll): new functions.
5306 * src/insets/insettext.C (removeNewlines): new function.
5307 (SetAutoBreakRows): removes forced newlines in the text of the
5308 paragraph if autoBreakRows is set to false.
5310 * src/tabular.C (Latex): generates a parbox around the cell contents
5313 * src/frontends/xforms/FormTabular.C (local_update): removed
5314 the radio_useparbox button.
5316 * src/tabular.C (UseParbox): new function
5318 2000-08-06 Baruch Even <baruch.even@writeme.com>
5320 * src/graphics/GraphicsCache.h:
5321 * src/graphics/GraphicsCache.C:
5322 * src/graphics/GraphicsCacheItem.h:
5323 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5326 * src/insets/insetgraphics.h:
5327 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5328 and the drawing of the inline image.
5330 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5331 loaded into the wrong position.
5333 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5336 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5338 * src/support/translator.h: move all typedefs to public section
5340 * src/support/filetools.C (MakeLatexName): return string const
5342 (TmpFileName): ditto
5343 (FileOpenSearch): ditto
5345 (LibFileSearch): ditto
5346 (i18nLibFileSearch): ditto
5349 (CreateTmpDir): ditto
5350 (CreateBufferTmpDir): ditto
5351 (CreateLyXTmpDir): ditto
5354 (MakeAbsPath): ditto
5356 (OnlyFilename): ditto
5358 (NormalizePath): ditto
5359 (CleanupPath): ditto
5360 (GetFileContents): ditto
5361 (ReplaceEnvironmentPath): ditto
5362 (MakeRelPath): ditto
5364 (ChangeExtension): ditto
5365 (MakeDisplayPath): ditto
5366 (do_popen): return cmdret const
5367 (findtexfile): return string const
5369 * src/support/DebugStream.h: add some /// to please doc++
5371 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5373 * src/texrow.C (same_rownumber): functor to use with find_if
5374 (getIdFromRow): rewritten to use find_if and to not update the
5375 positions. return true if row is found
5376 (increasePos): new method, use to update positions
5378 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5380 * src/lyxlex_pimpl.C (verifyTable): new method
5383 (GetString): return string const
5384 (pushTable): rewrite to use std::stack
5386 (setFile): better check
5389 * src/lyxlex.h: make LyXLex noncopyable
5391 * src/lyxlex.C (text): return char const * const
5392 (GetString): return string const
5393 (getLongString): return string const
5395 * src/lyx_gui_misc.C (askForText): return pair<...> const
5397 * src/lastfiles.[Ch] (operator): return string const
5399 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5400 istringstream not char const *.
5401 move token.end() out of loop.
5402 (readFile): move initializaton of token
5404 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5405 getIdFromRow is successful.
5407 * lib/bind/emacs.bind: don't include menus bind
5409 * development/Code_rules/Rules: the beginnings of making this
5410 better and covering more of the unwritten rules that we have.
5412 * development/Code_rules/Recommendations: a couple of wording
5415 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5417 * src/support/strerror.c: remove C++ comment.
5419 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5421 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5422 LFUN_INDEX_INSERT_LAST
5424 * src/texrow.C (getIdFromRow): changed from const_iterator to
5425 iterator, allowing code to compile with DEC cxx
5427 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5428 stores part of the class, as suggested by Allan. Will allow
5430 (apply): test to apply uses InsetCommandParams operator!=
5432 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5433 (apply): test to apply uses InsetCommandParams operator!=
5435 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5436 stores part of the class.
5437 (update): removed limits on min/max size.
5439 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5440 (apply): test to apply uses InsetCommandParams operator!=
5442 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5443 (Read, Write, scanCommand, getCommand): moved functionality
5444 into InsetCommandParams.
5446 (getScreenLabel): made pure virtual
5447 new InsetCommandParams operators== and !=
5449 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5450 c-tors based on InsetCommandParams. Removed others.
5451 * src/insets/insetinclude.[Ch]: ditto
5452 * src/insets/insetlabel.[Ch]: ditto
5453 * src/insets/insetparent.[Ch]: ditto
5454 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5456 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5457 insets derived from InsetCommand created using similar c-tors
5458 based on InsetCommandParams
5459 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5460 * src/menus.C (ShowRefsMenu): ditto
5461 * src/paragraph.C (Clone): ditto
5462 * src/text2.C (SetCounter): ditto
5463 * src/lyxfunc.C (Dispatch) ditto
5464 Also recreated old InsetIndex behaviour exactly. Can now
5465 index-insert at the start of a paragraph and index-insert-last
5466 without launching the pop-up.
5468 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5470 * lib/lyxrc.example: mark te pdf options as non functional.
5472 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5473 (isStrDbl): move tmpstr.end() out of loop.
5474 (strToDbl): move intialization of tmpstr
5475 (lowercase): return string const and move tmp.end() out of loop.
5476 (uppercase): return string const and move tmp.edn() out of loop.
5477 (prefixIs): add assertion
5482 (containsOnly): ditto
5483 (containsOnly): ditto
5484 (containsOnly): ditto
5485 (countChar): make last arg char not char const
5486 (token): return string const
5487 (subst): return string const, move tmp.end() out of loop.
5488 (subst): return string const, add assertion
5489 (strip): return string const
5490 (frontStrip): return string const, add assertion
5491 (frontStrip): return string const
5496 * src/support/lstrings.C: add inclde "LAssert.h"
5497 (isStrInt): move tmpstr.end() out of loop.
5499 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5500 toollist.end() out of loop.
5501 (deactivate): move toollist.end() out of loop.
5502 (update): move toollist.end() out of loop.
5503 (updateLayoutList): move tc.end() out of loop.
5504 (add): move toollist.end() out of loop.
5506 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5507 md.end() out of loop.
5509 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5511 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5514 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5515 (Erase): move insetlist.end() out of loop.
5517 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5518 ref to const string as first arg. Move initialization of some
5519 variables, whitespace changes.
5521 * src/kbmap.C (defkey): move table.end() out of loop.
5522 (kb_keymap): move table.end() out of loop.
5523 (findbinding): move table.end() out of loop.
5525 * src/MenuBackend.C (hasMenu): move end() out of loop.
5526 (getMenu): move end() out of loop.
5527 (getMenu): move menulist_.end() out of loop.
5529 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5531 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5534 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5535 (getFromLyXName): move infotab.end() out of loop.
5537 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5538 -fvtable-thunks -ffunction-sections -fdata-sections
5540 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5542 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5545 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5547 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5549 * src/frontends/xforms/FormCitation.[Ch],
5550 src/frontends/xforms/FormIndex.[Ch],
5551 src/frontends/xforms/FormToc.[Ch],
5552 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5554 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5556 * src/commandtags.h: renamed, created some flags for citation
5559 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5561 * src/lyxfunc.C (dispatch): use signals to insert index entry
5563 * src/frontends/Dialogs.h: new signal createIndex
5565 * src/frontends/xforms/FormCommand.[Ch],
5566 src/frontends/xforms/FormCitation.[Ch],
5567 src/frontends/xforms/FormToc.[Ch],
5568 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5570 * src/insets/insetindex.[Ch]: GUI-independent
5572 * src/frontends/xforms/FormIndex.[Ch],
5573 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5576 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5578 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5579 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5581 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5583 * src/insets/insetref.C (Latex): rewrite so that there is now
5584 question that a initialization is requested.
5586 * src/insets/insetcommand.h: reenable the hide signal
5588 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5590 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5591 fix handling of shortcuts (many bugs :)
5592 (add_lastfiles): ditto.
5594 * lib/ui/default.ui: fix a few shortcuts.
5596 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5598 * Makefile.am: Fix ``rpmdist'' target to return the exit
5599 status of the ``rpm'' command, instead of the last command in
5600 the chain (the ``rm lyx.xpm'' command, which always returns
5603 2000-08-02 Allan Rae <rae@lyx.org>
5605 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5606 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5607 * src/frontends/xforms/FormToc.C (FormToc): ditto
5609 * src/frontends/xforms/Makefile.am: A few forgotten files
5611 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5612 Signals-not-copyable-problem Lars' started commenting out.
5614 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5616 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5618 * src/insets/insetcommand.h: Signals is not copyable so anoter
5619 scheme for automatic hiding of forms must be used.
5621 * src/frontends/xforms/FormCitation.h: don't inerit from
5622 noncopyable, FormCommand already does that.
5623 * src/frontends/xforms/FormToc.h: ditto
5624 * src/frontends/xforms/FormUrl.h: ditto
5626 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5628 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5630 * src/insets/insetcommand.h (hide): new SigC::Signal0
5631 (d-tor) new virtual destructor emits hide signal
5633 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5634 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5636 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5637 LOF and LOT. Inset is now GUI-independent
5639 * src/insets/insetloa.[Ch]: redundant
5640 * src/insets/insetlof.[Ch]: ditto
5641 * src/insets/insetlot.[Ch]: ditto
5643 * src/frontends/xforms/forms/form_url.fd: tweaked!
5644 * src/frontends/xforms/forms/form_citation.fd: ditto
5646 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5647 dialogs dealing with InsetCommand insets
5649 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5650 FormCommand base class
5651 * src/frontends/xforms/FormUrl.[Ch]: ditto
5653 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5655 * src/frontends/xforms/FormToc.[Ch]: ditto
5657 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5658 passed a generic InsetCommand pointer
5659 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5661 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5662 and modified InsetTOC class
5663 * src/buffer.C: ditto
5665 * forms/lyx.fd: strip out old FD_form_toc code
5666 * src/lyx_gui_misc.C: ditto
5667 * src/lyx_gui.C: ditto
5668 * src/lyx_cb.C: ditto
5669 * src/lyx.[Ch]: ditto
5671 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5673 * src/support/utility.hpp: tr -d '\r'
5675 2000-08-01 Juergen Vigna <jug@sad.it>
5677 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5679 * src/commandtags.h:
5680 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5681 LFUN_TABULAR_FEATURES.
5683 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5684 LFUN_LAYOUT_TABULAR.
5686 * src/insets/insettabular.C (getStatus): implemented helper function.
5688 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5690 2000-07-31 Juergen Vigna <jug@sad.it>
5692 * src/text.C (draw): fixed screen update problem for text-insets.
5694 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5695 something changed probably this has to be added in various other
5698 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5700 2000-07-31 Baruch Even <baruch.even@writeme.com>
5702 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5703 templates to satisfy compaq cxx.
5706 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5708 * src/support/translator.h (equal_1st_in_pair::operator()): take
5709 const ref pair_type as arg.
5710 (equal_2nd_in_pair::operator()): ditto
5711 (Translator::~Translator): remove empty d-tor.
5713 * src/graphics/GraphicsCache.C: move include config.h to top, also
5714 put initialization of GraphicsCache::singleton here.
5715 (~GraphicsCache): move here
5716 (addFile): take const ref as arg
5719 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5721 * src/BufferView2.C (insertLyXFile): change te with/without header
5724 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5726 * src/frontends/xforms/FormGraphics.C (apply): add some
5727 static_cast. Not very nice, but required by compaq cxx.
5729 * src/frontends/xforms/RadioButtonGroup.h: include header
5730 <utility> instead of <pair.h>
5732 * src/insets/insetgraphicsParams.C: add using directive.
5733 (readResize): change return type to void.
5734 (readOrigin): ditto.
5736 * src/lyxfunc.C (getStatus): add missing break for build-program
5737 function; add test for Literate for export functions.
5739 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5740 entries in Options menu.
5742 2000-07-31 Baruch Even <baruch.even@writeme.com>
5744 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5745 protect against auto-allocation; release icon when needed.
5747 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5749 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5750 on usual typewriter.
5752 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5753 earlier czech.kmap), useful only for programming.
5755 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5757 * src/frontends/xforms/FormCitation.h: fix conditioning around
5760 2000-07-31 Juergen Vigna <jug@sad.it>
5762 * src/frontends/xforms/FormTabular.C (local_update): changed
5763 radio_linebreaks to radio_useparbox and added radio_useminipage.
5765 * src/tabular.C: made support for using minipages/parboxes.
5767 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5769 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5771 (descent): so the cursor is in the middle.
5772 (width): bit smaller box.
5774 * src/insets/insetgraphics.h: added display() function.
5776 2000-07-31 Baruch Even <baruch.even@writeme.com>
5778 * src/frontends/Dialogs.h: Added showGraphics signals.
5780 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5781 xforms form definition of the graphics dialog.
5783 * src/frontends/xforms/FormGraphics.h:
5784 * src/frontends/xforms/FormGraphics.C: Added files, the
5785 GUIndependent code of InsetGraphics
5787 * src/insets/insetgraphics.h:
5788 * src/insets/insetgraphics.C: Major writing to make it work.
5790 * src/insets/insetgraphicsParams.h:
5791 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5792 struct between InsetGraphics and GUI.
5794 * src/LaTeXFeatures.h:
5795 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5796 support for graphicx package.
5798 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5799 for the graphics inset.
5801 * src/support/translator.h: Added file, used in
5802 InsetGraphicsParams. this is a template to translate between two
5805 * src/frontends/xforms/RadioButtonGroup.h:
5806 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5807 way to easily control a radio button group.
5809 2000-07-28 Juergen Vigna <jug@sad.it>
5811 * src/insets/insettabular.C (LocalDispatch):
5812 (TabularFeatures): added support for lyx-functions of tabular features.
5813 (cellstart): refixed this function after someone wrongly changed it.
5815 * src/commandtags.h:
5816 * src/LyXAction.C (init): added support for tabular-features
5818 2000-07-28 Allan Rae <rae@lyx.org>
5820 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5821 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5822 triggers the callback for input checking. As a result we sometimes get
5823 "LyX: This shouldn't happen..." printed to cerr.
5824 (input): Started using status variable since I only free() on
5825 destruction. Some input checking for paths and font sizes.
5827 * src/frontends/xforms/FormPreferences.h: Use status to control
5828 activation of Ok and Apply
5830 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5831 callback. Also resized to stop segfaults with 0.88. The problem is
5832 that xforms-0.88 requires the folder to be wide enough to fit all the
5833 tabs. If it isn't it causes all sorts of problems.
5835 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5837 * src/frontends/xforms/forms/README: Reflect reality.
5839 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5840 * src/frontends/xforms/forms/makefile: ditto.
5842 * src/commandtags.h: Get access to new Preferences dialog
5843 * src/LyXAction.C: ditto
5844 * src/lyxfunc.C: ditto
5845 * lib/ui/default.ui: ditto
5847 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5849 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5851 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5854 * src/frontends/xforms/form_url.[Ch]: added.
5856 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5858 * src/insets/insetbib.h: fixed bug in previous commit
5860 * src/frontends/xforms/FormUrl.h: ditto
5862 * src/frontends/xforms/FormPrint.h: ditto
5864 * src/frontends/xforms/FormPreferences.h: ditto
5866 * src/frontends/xforms/FormCopyright.h: ditto
5868 * src/frontends/xforms/FormCitation.C: ditto
5870 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5871 private copyconstructor and private default contructor
5873 * src/support/Makefile.am: add utility.hpp
5875 * src/support/utility.hpp: new file from boost
5877 * src/insets/insetbib.h: set owner in clone
5879 * src/frontends/xforms/FormCitation.C: added missing include
5882 * src/insets/form_url.[Ch]: removed
5884 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5886 * development/lyx.spec.in
5887 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5888 file/directory re-organization.
5890 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5892 * src/insets/insetcommand.[Ch]: moved the string data and
5893 associated manipulation methods into a new stand-alone class
5894 InsetCommandParams. This class has two additional methods
5895 getAsString() and setFromString() allowing the contents to be
5896 moved around as a single string.
5897 (addContents) method removed.
5898 (setContents) method no longer virtual.
5900 * src/buffer.C (readInset): made use of new InsetCitation,
5901 InsetUrl constructors based on InsetCommandParams.
5903 * src/commandtags.h: add LFUN_INSERT_URL
5905 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5906 independent InsetUrl and use InsetCommandParams to extract
5907 string info and create new Insets.
5909 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5911 * src/frontends/xforms/FormCitation.C (apply): uses
5914 * src/frontends/xforms/form_url.C
5915 * src/frontends/xforms/form_url.h
5916 * src/frontends/xforms/FormUrl.h
5917 * src/frontends/xforms/FormUrl.C
5918 * src/frontends/xforms/forms/form_url.fd: new files
5920 * src/insets/insetcite.[Ch]: removed unused constructors.
5922 * src/insets/insetinclude.[Ch]: no longer store filename
5924 * src/insets/inseturl.[Ch]: GUI-independent.
5926 2000-07-26 Juergen Vigna <jug@sad.it>
5927 * renamed frontend from gtk to gnome as it is that what is realized
5928 and did the necessary changes in the files.
5930 2000-07-26 Marko Vendelin <markov@ioc.ee>
5932 * configure.in: cleaning up gnome configuration scripts
5934 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5936 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5937 shortcuts syndrom by redrawing them explicitely (a better solution
5938 would be appreciated).
5940 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5942 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5945 * src/lyx_cb.C (MenuExport): change html export to do the right
5946 thing depending of the document type (instead of having
5947 html-linuxdoc and html-docbook).
5948 * src/lyxfunc.C (getStatus): update for html
5949 * lib/ui/default.ui: simplify due to the above change.
5950 * src/menus.C (ShowFileMenu): update too (in case we need it).
5952 * src/MenuBackend.C (read): if a menu is defined twice, add the
5953 new entries to the exiting one.
5955 2000-07-26 Juergen Vigna <jug@sad.it>
5957 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5959 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5960 and return a bool if it did actual save the file.
5961 (AutoSave): don't autosave a unnamed doc.
5963 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5964 check if this is an UNNAMED new file and react to it.
5965 (newFile): set buffer to unnamed and change to not mark a new
5966 buffer dirty if I didn't do anything with it.
5968 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5970 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5972 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5973 friend as per Angus's patch posted to lyx-devel.
5975 * src/ext_l10n.h: updated
5977 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5978 gettext on the style string right before inserting them into the
5981 * autogen.sh: add code to extract style strings form layout files,
5982 not good enough yet.
5984 * src/frontends/gtk/.cvsignore: add MAKEFILE
5986 * src/MenuBackend.C (read): run the label strings through gettext
5987 before storing them in the containers.
5989 * src/ext_l10n.h: new file
5991 * autogen.sh : generate the ext_l10n.h file here
5993 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5995 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5998 * lib/ui/default.ui: fix a couple of typos.
6000 * config/gnome/gtk.m4: added (and added to the list of files in
6003 * src/insets/insetinclude.C (unique_id): fix when we are using
6004 lyxstring instead of basic_string<>.
6005 * src/insets/insettext.C (LocalDispatch): ditto.
6006 * src/support/filetools.C: ditto.
6008 * lib/configure.m4: create the ui/ directory if necessary.
6010 * src/LyXView.[Ch] (updateToolbar): new method.
6012 * src/BufferView_pimpl.C (buffer): update the toolbar when
6013 opening/closing buffer.
6015 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6017 * src/LyXAction.C (getActionName): enhance to return also the name
6018 and options of pseudo-actions.
6019 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
6021 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
6022 as an example of what is possible). Used in File->Build too (more
6023 useful) and in the import/export menus (to mimick the complicated
6024 handling of linuxdoc and friends). Try to update all the entries.
6026 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
6029 * src/MenuBackend.C (read): Parse the new OptItem tag.
6031 * src/MenuBackend.h: Add a new optional_ data member (used if the
6032 entry should be omitted when the lyxfunc is disabled).
6034 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
6035 function, used as a shortcut.
6036 (create_submenu): align correctly the shortcuts on the widest
6039 * src/MenuBackend.h: MenuItem.label() only returns the label of
6040 the menu without shortcut; new method shortcut().
6042 2000-07-14 Marko Vendelin <markov@ioc.ee>
6044 * src/frontends/gtk/Dialogs.C:
6045 * src/frontends/gtk/FormCopyright.C:
6046 * src/frontends/gtk/FormCopyright.h:
6047 * src/frontends/gtk/Makefile.am: added these source-files for the
6048 Gtk/Gnome support of the Copyright-Dialog.
6050 * src/main.C: added Gnome::Main initialization if using
6051 Gtk/Gnome frontend-GUI.
6053 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6055 * config/gnome/aclocal-include.m4
6056 * config/gnome/compiler-flags.m4
6057 * config/gnome/curses.m4
6058 * config/gnome/gnome--.m4
6059 * config/gnome/gnome-bonobo-check.m4
6060 * config/gnome/gnome-common.m4
6061 * config/gnome/gnome-fileutils.m4
6062 * config/gnome/gnome-ghttp-check.m4
6063 * config/gnome/gnome-gnorba-check.m4
6064 * config/gnome/gnome-guile-checks.m4
6065 * config/gnome/gnome-libgtop-check.m4
6066 * config/gnome/gnome-objc-checks.m4
6067 * config/gnome/gnome-orbit-check.m4
6068 * config/gnome/gnome-print-check.m4
6069 * config/gnome/gnome-pthread-check.m4
6070 * config/gnome/gnome-support.m4
6071 * config/gnome/gnome-undelfs.m4
6072 * config/gnome/gnome-vfs.m4
6073 * config/gnome/gnome-x-checks.m4
6074 * config/gnome/gnome-xml-check.m4
6075 * config/gnome/gnome.m4
6076 * config/gnome/gperf-check.m4
6077 * config/gnome/gtk--.m4
6078 * config/gnome/linger.m4
6079 * config/gnome/need-declaration.m4: added configuration scripts
6080 for Gtk/Gnome frontend-GUI
6082 * configure.in: added support for the --with-frontend=gtk option
6084 * autogen.sh: added config/gnome/* to list of config-files
6086 * acconfig.h: added define for GTKGUI-support
6088 * config/lyxinclude.m4: added --with-frontend[=value] option value
6089 for Gtk/Gnome frontend-GUI support.
6091 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6093 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6097 * src/paragraph.C (GetChar): remove non-const version
6099 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6100 (search_kw): use it.
6102 * src/lyx_main.C (init): if "preferences" exist, read that instead
6104 (ReadRcFile): return bool if the file could be read ok.
6105 (ReadUIFile): add a check to see if lex file is set ok.
6107 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6108 bastring can be used instead of lyxstring (still uses the old code
6109 if std::string is good enough or if lyxstring is used.)
6111 * src/encoding.C: make the arrays static, move ininle functions
6113 * src/encoding.h: from here.
6115 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6116 (parseSingleLyXformat2Token): move inset parsing to separate method
6117 (readInset): new private method
6119 * src/Variables.h: remove virtual from get().
6121 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6122 access to NEW_INSETS and NEW_TABULAR
6124 * src/MenuBackend.h: remove superfluous forward declaration of
6125 MenuItem. Add documentations tags "///", remove empty MenuItem
6126 destructor, remove private default contructor.
6128 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6130 (read): more string mlabel and mname to where they are used
6131 (read): remove unused variables mlabel and mname
6132 (defaults): unconditional clear, make menusetup take advantage of
6133 add returning Menu &.
6135 * src/LyXView.h: define NEW_MENUBAR as default
6137 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6138 to NEW_INSETS and NEW_TABULAR.
6139 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6140 defined. Change some of the "xxxx-inset-insert" functions names to
6143 * several files: more enahncements to NEW_INSETS and the resulting
6146 * lib/lyxrc.example (\date_insert_format): move to misc section
6148 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6149 bastring and use AC_CACHE_CHECK.
6150 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6151 the system have the newest methods. uses AC_CACHE_CHECK
6152 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6153 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6154 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6156 * configure.in: add LYX_CXX_GOOD_STD_STRING
6158 * acinclude.m4: recreated
6160 2000-07-24 Amir Karger <karger@lyx.org>
6162 * README: add Hebrew, Arabic kmaps
6165 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6167 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6170 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6172 * Lot of files: add pragma interface/implementation.
6174 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6176 * lib/ui/default.ui: new file (ans new directory). Contains the
6177 default menu and toolbar.
6179 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6180 global space. Toolbars are now read (as menus) in ui files.
6182 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6184 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6185 is disabled because the document is read-only. We want to have the
6186 toggle state of the function anyway.
6187 (getStatus): add code for LFUN_VC* functions (mimicking what is
6188 done in old-style menus)
6190 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6191 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6193 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6194 * src/BufferView_pimpl.C: ditto.
6195 * src/lyxfunc.C: ditto.
6197 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6198 default). This replaces old-style menus by new ones.
6200 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6201 MenuItem. Contain the data structure of a menu.
6203 * src/insets/insettext.C: use LyXView::setLayout instead of
6204 accessing directly the toolbar combox.
6205 * src/lyxfunc.C (Dispatch): ditto.
6207 * src/LyXView.C (setLayout): new method, which just calls
6208 Toolbar::setLayout().
6209 (updateLayoutChoice): move part of this method in Toolbar.
6211 * src/toolbar.[Ch]: removed.
6213 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6214 implementation the toolbar.
6216 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6217 the toolbar. It might make sense to merge it with ToolbarDefaults
6219 (setLayout): new function.
6220 (updateLayoutList): ditto.
6221 (openLayoutList): ditto.
6223 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6224 xforms implementation of the toolbar.
6225 (get_toolbar_func): comment out, since I do not
6226 know what it is good for.
6228 * src/ToolbarDefaults.h: Add the ItemType enum.
6230 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6231 for a list of allocated C strings. Used in Menubar xforms
6232 implementation to avoid memory leaks.
6234 * src/support/lstrings.[Ch] (uppercase): new version taking and
6238 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6239 * lib/bind/emacs.bind: ditto.
6241 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6243 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6244 forward decl of LyXView.
6246 * src/toolbar.C (toolbarItem): moved from toolbar.h
6247 (toolbarItem::clean): ditto
6248 (toolbarItem::~toolbarItem): ditto
6249 (toolbarItem::operator): ditto
6251 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6253 * src/paragraph.h: control the NEW_TABULAR define from here
6255 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6256 USE_TABULAR_INSETS to NEW_TABULAR
6258 * src/ToolbarDefaults.C: add include "lyxlex.h"
6260 * files using the old table/tabular: use NEW_TABULAR to control
6261 compilation of old tabular stuff.
6263 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6266 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6267 planemet in reading of old style floats, fix the \end_deeper
6268 problem when reading old style floats.
6270 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6272 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6274 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6276 * lib/bind/sciword.bind: updated.
6278 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6280 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6281 layout write problem
6283 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6285 * src/Makefile.am (INCLUDES): remove image directory from include
6288 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6289 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6291 * src/LyXView.C (create_form_form_main): read the application icon
6294 * lib/images/*.xpm: change the icons to use transparent color for
6297 * src/toolbar.C (update): change the color of the button when it
6300 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6302 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6303 setting explicitely the minibuffer.
6304 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6306 * src/LyXView.C (showState): new function. Shows font information
6307 in minibuffer and update toolbar state.
6308 (LyXView): call Toolbar::update after creating the
6311 * src/toolbar.C: change toollist to be a vector instead of a
6313 (BubbleTimerCB): get help string directly from the callback
6314 argument of the corresponding icon (which is the action)
6315 (set): remove unnecessary ugliness.
6316 (update): new function. update the icons (depressed, disabled)
6317 depending of the status of the corresponding action.
6319 * src/toolbar.h: remove help in toolbarItem
6321 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6323 * src/Painter.C (text): Added code for using symbol glyphs from
6324 iso10646 fonts. Currently diabled.
6326 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6329 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6330 magyar,turkish and usorbian.
6332 * src/paragraph.C (isMultiLingual): Made more efficient.
6334 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6337 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6338 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6339 Also changed the prototype to "bool math_insert_greek(char)".
6341 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6343 * lots of files: apply the NEW_INSETS on all code that will not be
6344 needed when we move to use the new insets. Enable the define in
6345 lyxparagrah.h to try it.
6347 * src/insets/insettabular.C (cellstart): change to be a static
6349 (InsetTabular): initialize buffer in the initializer list.
6351 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6353 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6354 form_print.h out of the header file. Replaced with forward
6355 declarations of the relevant struct.
6357 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6360 * src/commandtags.h: do not include "debug.h" which does not
6361 belong there. #include it in some other places because of this
6364 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6366 * src/insets/insetcaption.C: add a couple "using" directives.
6368 * src/toolbar.C (add): get the help text directly from lyxaction.
6370 (setPixmap): new function. Loads from disk and sets a pixmap on a
6371 botton; the name of the pixmap file is derived from the command
6374 * src/toolbar.h: remove members isBitmap and pixmap from
6377 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6378 * lib/images/: move many files from images/banner.xpm.
6380 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6382 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6383 * src/toolbar.C: ditto.
6384 * configure.in: ditto.
6385 * INSTALL: document.
6387 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6388 the spellchecker popup is closed from the WM.
6390 2000-07-19 Juergen Vigna <jug@sad.it>
6392 * src/insets/insetfloat.C (Write): small fix because we use the
6393 insetname for the type now!
6395 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6397 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6400 * src/frontends/Dialogs.h: removed hideCitation signal
6402 * src/insets/insetcite.h: added hide signal
6404 * src/insets/insetcite.C (~InsetCitation): emits new signal
6405 (getScreenLabel): "intelligent" label should now fit on the screen!
6407 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6409 * src/frontends/xforms/FormCitation.C (showInset): connects
6410 hide() to the inset's hide signal
6411 (show): modified to use fl_set_object_position rather than
6412 fl_set_object_geometry wherever possible
6414 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6416 * src/insets/lyxinset.h: add caption code
6418 * src/insets/insetfloat.C (type): new method
6420 * src/insets/insetcaption.C (Write): new method
6422 (LyxCode): new method
6424 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6425 to get it right together with using the FloatList.
6427 * src/commandtags.h: add LFUN_INSET_CAPTION
6428 * src/lyxfunc.C (Dispatch): handle it
6430 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6433 * src/Variables.[Ch]: make expand take a const reference, remove
6434 the destructor, some whitespace changes.
6436 * src/LyXAction.C (init): add caption-inset-insert
6438 * src/FloatList.C (FloatList): update the default floats a bit.
6440 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6442 * src/Variables.[Ch]: new files. Intended to be used for language
6443 specific strings (like \chaptername) and filename substitution in
6446 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6448 * lib/kbd/american.kmap: update
6450 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6452 * src/bufferparams.[Ch]: remove member allowAccents.
6454 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6456 * src/LaTeXLog.C: use the log_form.h header.
6457 * src/lyx_gui.C: ditto.
6458 * src/lyx_gui_misc.C: ditto.
6459 * src/lyxvc.h: ditto.
6461 * forms/log_form.fd: new file, created from latexoptions.fd. I
6462 kept the log popup and nuked the options form.
6464 * src/{la,}texoptions.[Ch]: removed.
6465 * src/lyx_cb.C (LaTeXOptions): ditto
6467 * src/lyx_gui.C (create_forms): do not handle the
6468 fd_latex_options form.
6470 2000-07-18 Juergen Vigna <jug@sad.it>
6472 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6473 name of the inset so that it can be requested outside (text2.C).
6475 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6478 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6480 * src/mathed/formula.h (ConvertFont): constify
6482 * src/mathed/formula.C (Read): add warning if \end_inset is not
6483 found on expected place.
6485 * src/insets/lyxinset.h (ConvertFont): consify
6487 * src/insets/insetquotes.C (ConvertFont): constify
6488 * src/insets/insetquotes.h: ditto
6490 * src/insets/insetinfo.h: add labelfont
6492 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6493 (ascent): use labelfont
6497 (Write): make .lyx file a bit nicer
6499 * src/insets/insetfloat.C (Write): simplify somewhat...
6500 (Read): add warning if arg is not found
6502 * src/insets/insetcollapsable.C: add using std::max
6503 (Read): move string token and add warning in arg is not found
6504 (draw): use std::max to get the right ty
6505 (getMaxWidth): simplify by using std::max
6507 * src/insets/insetsection.h: new file
6508 * src/insets/insetsection.C: new file
6509 * src/insets/insetcaption.h: new file
6510 * src/insets/insetcaption.C: new file
6512 * src/insets/inset.C (ConvertFont): constify signature
6514 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6515 insetcaption.[Ch] and insetsection.[Ch]
6517 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6518 uses to use LABEL_COUNTER_CHAPTER instead.
6519 * src/text2.C (SetCounter): here
6521 * src/counters.h: new file
6522 * src/counters.C: new file
6523 * src/Sectioning.h: new file
6524 * src/Sectioning.C: new file
6526 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6528 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6530 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6533 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6536 2000-07-17 Juergen Vigna <jug@sad.it>
6538 * src/tabular.C (Validate): check if array-package is needed.
6539 (SetVAlignment): added support for vertical alignment.
6540 (SetLTFoot): better support for longtable header/footers
6541 (Latex): modified to support added features.
6543 * src/LaTeXFeatures.[Ch]: added array-package.
6545 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6547 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6550 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6552 * configure.in: do not forget to put a space after -isystem.
6554 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6556 * lib/kbd/arabic.kmap: a few fixes.
6558 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6560 * some whitespace chagnes to a number of files.
6562 * src/support/DebugStream.h: change to make it easier for
6563 doc++ to parse correctly.
6564 * src/support/lyxstring.h: ditto
6566 * src/mathed/math_utils.C (compara): change to have only one
6568 (MathedLookupBOP): change because of the above.
6570 * src/mathed/math_delim.C (math_deco_compare): change to have only
6572 (search_deco): change becasue of the above.
6574 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6575 instead of manually coded one.
6577 * src/insets/insetquotes.C (Read): read the \end_inset too
6579 * src/insets/insetlatex.h: remove file
6580 * src/insets/insetlatex.C: remove file
6582 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6584 (InsetPrintIndex): remove destructor
6586 * src/insets/insetinclude.h: remove default constructor
6588 * src/insets/insetfloat.C: work to make it work better
6590 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6592 * src/insets/insetcite.h (InsetCitation): remove default constructor
6594 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6596 * src/text.C (GetColumnNearX): comment out some currently unused code.
6598 * src/paragraph.C (writeFile): move some initializations closer to
6600 (CutIntoMinibuffer): small change to use new matchIT operator
6604 (InsertInset): ditto
6607 (InsetIterator): ditto
6608 (Erase): small change to use new matchFT operator
6610 (GetFontSettings): ditto
6611 (HighestFontInRange): ditto
6614 * src/lyxparagraph.h: some chars changed to value_type
6615 (matchIT): because of some stronger checking (perhaps too strong)
6616 in SGI STL, the two operator() unified to one.
6619 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6621 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6622 the last inset read added
6623 (parseSingleLyXformat2Token): some more (future) compability code added
6624 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6625 (parseSingleLyXformat2Token): set last_inset_read
6626 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6627 (parseSingleLyXformat2Token): don't double intializw string next_token
6629 * src/TextCache.C (text_fits::operator()): add const's to the signature
6630 (has_buffer::operator()): ditto
6632 * src/Floating.h: add some comments on the class
6634 * src/FloatList.[Ch] (typeExist): new method
6637 * src/BackStack.h: added default constructor, wanted by Gcc.
6639 2000-07-14 Juergen Vigna <jug@sad.it>
6641 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6643 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6645 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6646 do a redraw when the window is resized!
6647 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6649 * src/insets/insettext.C (resizeLyXText): added function to correctly
6650 being able to resize the LyXWindow.
6652 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6654 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6656 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6657 crashes when closing dialog to a deleted inset.
6659 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6660 method! Now similar to other insets.
6662 2000-07-13 Juergen Vigna <jug@sad.it>
6664 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6666 * lib/examples/Literate.lyx: small patch!
6668 * src/insets/insetbib.C (Read): added this function because of wrong
6669 Write (without [begin|end]_inset).
6671 2000-07-11 Juergen Vigna <jug@sad.it>
6673 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6674 as the insertInset could not be good!
6676 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6677 the bool param should not be last.
6679 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6681 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6682 did submit that to Karl).
6684 * configure.in: use -isystem instead of -I for X headers. This
6685 fixes a problem on solaris with a recent gcc;
6686 put the front-end code after the X detection code;
6687 configure in sigc++ before lib/
6689 * src/lyx_main.C (commandLineHelp): remove -display from command
6692 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6694 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6695 Also put in Makefile rules for building the ``listerrors''
6696 program for parsing errors from literate programs written in LyX.
6698 * lib/build-listerrors: Added small shell script as part of compile
6699 process. This builds a working ``listerrors'' binary if noweb is
6700 installed and either 1) the VNC X server is installed on the machine,
6701 or 2) the user is compiling from within a GUI. The existence of a GUI
6702 is necessary to use the ``lyx --export'' feature for now. This
6703 hack can be removed once ``lyx --export'' no longer requires a GUI to
6706 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6708 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6709 now passed back correctly from gcc and placed "under" error
6710 buttons in a Literate LyX source.
6712 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6714 * src/text.C (GetColumnNearX): Better behavior when a RTL
6715 paragraph is ended by LTR text.
6717 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6720 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6722 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6723 true when clipboard is empty.
6725 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6727 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6728 row of the paragraph.
6729 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6730 to prevent calculation of bidi tables
6732 2000-07-07 Juergen Vigna <jug@sad.it>
6734 * src/screen.C (ToggleSelection): added y_offset and x_offset
6737 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6740 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6742 * src/insets/insettext.C: fixed Layout-Display!
6744 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6746 * configure.in: add check for strings.h header.
6748 * src/spellchecker.C: include <strings.h> in order to have a
6749 definition for bzero().
6751 2000-07-07 Juergen Vigna <jug@sad.it>
6753 * src/insets/insettext.C (draw): set the status of the bv->text to
6754 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6756 * src/screen.C (DrawOneRow):
6757 (DrawFromTo): redraw the actual row if something has changed in it
6760 * src/text.C (draw): call an update of the toplevel-inset if something
6761 has changed inside while drawing.
6763 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6765 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6767 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6768 processing inside class.
6770 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6771 processing inside class.
6773 * src/insets/insetindex.h new struct Holder, consistent with other
6776 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6777 citation dialog from main code and placed it in src/frontends/xforms.
6778 Dialog launched through signals instead of callbacks
6780 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6782 * lyx.man: update the options description.
6784 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6786 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6787 handle neg values, set min width to 590, add doc about -display
6789 2000-07-05 Juergen Vigna <jug@sad.it>
6791 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6792 calls to BufferView *.
6794 * src/insets/insettext.C (checkAndActivateInset): small fix non
6795 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6797 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6798 their \end_inset token!
6800 2000-07-04 edscott <edscott@imp.mx>
6802 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6803 lib/lyxrc.example: added option \wheel_jump
6805 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6807 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6808 remove support for -width,-height,-xpos and -ypos.
6810 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6812 * src/encoding.[Ch]: New files.
6814 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6815 (text): Call to the underline() method only when needed.
6817 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6819 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6820 encoding(s) for the document.
6822 * src/bufferparams.C (BufferParams): Changed default value of
6825 * src/language.C (newLang): Removed.
6826 (items[]): Added encoding information for all defined languages.
6828 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6829 encoding choice button.
6831 * src/lyxrc.h (font_norm_type): New member variable.
6832 (set_font_norm_type): New method.
6834 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6835 paragraphs with different encodings.
6837 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6838 (TransformChar): Changed to work correctly with Arabic points.
6839 (draw): Added support for drawing Arabic points.
6840 (draw): Removed code for drawing underbars (this is done by
6843 * src/support/textutils.h (IsPrintableNonspace): New function.
6845 * src/BufferView_pimpl.h: Added "using SigC::Object".
6846 * src/LyXView.h: ditto.
6848 * src/insets/insetinclude.h (include_label): Changed to mutable.
6850 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6852 * src/mathed/math_iter.h: remove empty destructor
6854 * src/mathed/math_cursor.h: remove empty destructor
6856 * src/insets/lyxinset.h: add THEOREM_CODE
6858 * src/insets/insettheorem.[Ch]: new files
6860 * src/insets/insetminipage.C: (InsertInset): remove
6862 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6864 (InsertInset): remove
6866 * src/insets/insetlist.C: (InsertList): remove
6868 * src/insets/insetfootlike.[Ch]: new files
6870 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6873 (InsertInset): ditto
6875 * src/insets/insetert.C: remove include Painter.h, reindent
6876 (InsertInset): move to header
6878 * src/insets/insetcollapsable.h: remove explicit from default
6879 contructor, remove empty destructor, add InsertInset
6881 * src/insets/insetcollapsable.C (InsertInset): new func
6883 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6885 * src/vspace.h: add explicit to constructor
6887 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6888 \textcompwordmark, please test this.
6890 * src/lyxrc.C: set ascii_linelen to 65 by default
6892 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6894 * src/commandtags.h: add LFUN_INSET_THEOREM
6896 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6897 (makeLinuxDocFile): remove _some_ of the nice logic
6898 (makeDocBookFile): ditto
6900 * src/Painter.[Ch]: (~Painter): removed
6902 * src/LyXAction.C (init): entry for insettheorem added
6904 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6906 (deplog): code to detect files generated by LaTeX, needs testing
6909 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6911 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6913 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6915 * src/LaTeX.C (deplog): Add a check for files that are going to be
6916 created by the first latex run, part of the project to remove the
6919 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6920 contents to the extension list.
6922 2000-07-04 Juergen Vigna <jug@sad.it>
6924 * src/text.C (NextBreakPoint): added support for needFullRow()
6926 * src/insets/lyxinset.h: added needFullRow()
6928 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6931 * src/insets/insettext.C: lots of changes for update!
6933 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6935 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6937 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6939 * src/insets/insetinclude.C (InsetInclude): fixed
6940 initialization of include_label.
6941 (unique_id): now returns a string.
6943 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6945 * src/LaTeXFeatures.h: new member IncludedFiles, for
6946 a map of key, included file name.
6948 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6949 with the included files for inclusion in SGML preamble,
6950 i. e., linuxdoc and docbook.
6953 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6954 nice (is the generated linuxdoc code to be exported?), that
6955 allows to remove column, and only_body that will be true for
6956 slave documents. Insets are allowed inside SGML font type.
6957 New handling of the SGML preamble for included files.
6958 (makeDocBookFile): the same for docbook.
6960 * src/insets/insetinclude.h:
6961 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6963 (DocBook): new export methods.
6965 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6966 and makeDocBookFile.
6968 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6969 formats to export with command line argument -x.
6971 2000-06-29 Juergen Vigna <jug@sad.it>
6973 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6974 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6976 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6977 region could already been cleared by an inset!
6979 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6981 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6984 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6986 (cursorToggle): remove special handling of lyx focus.
6988 2000-06-28 Juergen Vigna <jug@sad.it>
6990 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6993 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6995 * src/insets/insetindex.C (Edit): add a callback when popup is
6998 * src/insets/insettext.C (LocalDispatch):
6999 * src/insets/insetmarginal.h:
7000 * src/insets/insetlist.h:
7001 * src/insets/insetfoot.h:
7002 * src/insets/insetfloat.h:
7003 * src/insets/insetert.h: add a missing std:: qualifier.
7005 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7007 * src/support/lyxsum.C (sum): '\0' teminate file read when using
7010 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
7012 * src/insets/insettext.C (Read): remove tmptok unused variable
7013 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
7014 (InsertInset): change for new InsetInset code
7016 * src/insets/insettext.h: add TEXT inline method
7018 * src/insets/insettext.C: remove TEXT macro
7020 * src/insets/insetmarginal.C (Write): new method
7021 (Latex): change output slightly
7023 * src/insets/insetfoot.C (Write): new method
7024 (Latex): change output slightly (don't use endl when no need)
7026 * src/insets/insetert.C (Write): new method
7028 * src/insets/insetcollapsable.h: make button_length, button_top_y
7029 and button_bottm_y protected.
7031 * src/insets/insetcollapsable.C (Write): simplify code by using
7032 tostr. Also do not output the float name, the children class
7033 should to that to get control over own arguments
7035 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
7036 src/insets/insetminipage.[Ch]:
7039 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7041 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7043 * src/Makefile.am (lyx_SOURCES): add the new files
7045 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7046 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7047 * src/commandtags.h: ditto
7049 * src/LaTeXFeatures.h: add a std::set of used floattypes
7051 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7053 * src/FloatList.[Ch] src/Floating.h: new files
7055 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7057 * src/lyx_cb.C (TableApplyCB): ditto
7059 * src/text2.C: ditto
7060 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7061 (parseSingleLyXformat2Token): ditto + add code for
7062 backwards compability for old float styles + add code for new insets
7064 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7066 (InsertInset(size_type, Inset *, LyXFont)): new method
7067 (InsetChar(size_type, char)): changed to use the other InsetChar
7068 with a LyXFont(ALL_INHERIT).
7069 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7070 insert the META_INSET.
7072 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7074 * sigc++/thread.h (Threads): from here
7076 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7077 definition out of line
7078 * sigc++/scope.h: from here
7080 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7082 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7083 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7085 * Makefile.am (bindist): new target.
7087 * INSTALL: add instructions for doing a binary distribution.
7089 * development/tools/README.bin.example: update a bit.
7091 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7094 * lib/lyxrc.example: new lyxrc tag \set_color.
7096 * src/lyxfunc.C (Dispatch):
7097 * src/commandtags.h:
7098 * src/LyXAction.C: new lyxfunc "set-color".
7100 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7101 and an x11name given as strings.
7103 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7104 cache when a color is changed.
7106 2000-06-26 Juergen Vigna <jug@sad.it>
7108 * src/lyxrow.C (width): added this functions and variable.
7110 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7113 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7115 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7117 * images/undo_bw.xpm: new icon.
7118 * images/redo_bw.xpm: ditto.
7120 * configure.in (INSTALL_SCRIPT): change value to
7121 ${INSTALL} to avoid failures of install-script target.
7122 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7124 * src/BufferView.h: add a magic "friend" declaration to please
7127 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7129 * forms/cite.fd: modified to allow resizing without messing
7132 * src/insetcite.C: Uses code from cite.fd almost without
7134 User can now resize dialog in the x-direction.
7135 Resizing the dialog in the y-direction is prevented, as the
7136 code does this intelligently already.
7138 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7140 * INSTALL: remove obsolete entry in "problems" section.
7142 * lib/examples/sl_*.lyx: update of the slovenian examples.
7144 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7146 2000-06-23 Juergen Vigna <jug@sad.it>
7148 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7150 * src/buffer.C (resize): delete the LyXText of textinsets.
7152 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7154 * src/insets/lyxinset.h: added another parameter 'cleared' to
7155 the draw() function.
7157 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7158 unlocking inset in inset.
7160 2000-06-22 Juergen Vigna <jug@sad.it>
7162 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7163 of insets and moved first to LyXText.
7165 * src/mathed/formulamacro.[Ch]:
7166 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7168 2000-06-21 Juergen Vigna <jug@sad.it>
7170 * src/text.C (GetVisibleRow): look if I should clear the area or not
7171 using Inset::doClearArea() function.
7173 * src/insets/lyxinset.h: added doClearArea() function and
7174 modified draw(Painter &, ...) to draw(BufferView *, ...)
7176 * src/text2.C (UpdateInset): return bool insted of int
7178 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7180 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7181 combox in the character popup
7183 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7184 BufferParams const & params
7186 2000-06-20 Juergen Vigna <jug@sad.it>
7188 * src/insets/insettext.C (SetParagraphData): set insetowner on
7191 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7193 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7194 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7196 (form_main_): remove
7198 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7199 (create_form_form_main): remove FD_form_main stuff, connect to
7200 autosave_timeout signal
7202 * src/LyXView.[Ch] (getMainForm): remove
7203 (UpdateTimerCB): remove
7204 * src/BufferView_pimpl.h: inherit from SigC::Object
7206 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7207 signal instead of callback
7209 * src/BufferView.[Ch] (cursorToggleCB): remove
7211 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7213 * src/BufferView_pimpl.C: changes because of the one below
7215 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7216 instead of storing a pointer to a LyXText.
7218 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7220 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7222 * src/lyxparagraph.h
7224 * src/paragraph.C: Changed fontlist to a sorted vector.
7226 2000-06-19 Juergen Vigna <jug@sad.it>
7228 * src/BufferView.h: added screen() function.
7230 * src/insets/insettext.C (LocalDispatch): some selection code
7233 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7235 * src/insets/insettext.C (SetParagraphData):
7237 (InsetText): fixes for multiple paragraphs.
7239 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7241 * development/lyx.spec.in: Call configure with ``--without-warnings''
7242 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7243 This should be fine, however, since we generally don't want to be
7244 verbose when making an RPM.
7246 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7248 * lib/scripts/fig2pstex.py: New file
7250 2000-06-16 Juergen Vigna <jug@sad.it>
7252 * src/insets/insettabular.C (UpdateLocal):
7253 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7254 (LocalDispatch): Changed all functions to use LyXText.
7256 2000-06-15 Juergen Vigna <jug@sad.it>
7258 * src/text.C (SetHeightOfRow): call inset::update before requesting
7261 * src/insets/insettext.C (update):
7262 * src/insets/insettabular.C (update): added implementation
7264 * src/insets/lyxinset.h: added update function
7266 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7268 * src/text.C (SelectNextWord): protect against null pointers with
7269 old-style string streams. (fix from Paul Theo Gonciari
7272 * src/cite.[Ch]: remove erroneous files.
7274 * lib/configure.m4: update the list of created directories.
7276 * src/lyxrow.C: include <config.h>
7277 * src/lyxcursor.C: ditto.
7279 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7281 * lib/examples/decimal.lyx: new example file from Mike.
7283 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7284 to find template definitions (from Dekel)
7286 * src/frontends/.cvsignore: add a few things.
7288 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7290 * src/Timeout.C (TimeOut): remove default argument.
7292 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7295 * src/insets/ExternalTemplate.C: add a "using" directive.
7297 * src/lyx_main.h: remove the act_ struct, which seems unused
7300 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7302 * LyX Developers Meeting: All files changed, due to random C++ (by
7303 coincidence) code generator script.
7305 - external inset (cool!)
7306 - initial online editing of preferences
7307 - insettabular breaks insettext(s contents)
7309 - some DocBook fixes
7310 - example files update
7311 - other cool stuff, create a diff and look for yourself.
7313 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7315 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7316 -1 this is a non-line-breaking textinset.
7318 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7319 if there is no width set.
7321 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7323 * Lots of files: Merged the dialogbase branch.
7325 2000-06-09 Allan Rae <rae@lyx.org>
7327 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7328 and the Dispatch methods that used it.
7330 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7331 access to functions formerly kept in Dispatch.
7333 2000-05-19 Allan Rae <rae@lyx.org>
7335 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7336 made to_page and count_copies integers again. from_page remains a
7337 string however because I want to allow entry of a print range like
7338 "1,4,22-25" using this field.
7340 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7341 and printer-params-get. These aren't useful from the minibuffer but
7342 could be used by a script/LyXServer app provided it passes a suitable
7343 auto_mem_buffer. I guess I should take a look at how the LyXServer
7344 works and make it support xtl buffers.
7346 * sigc++/: updated to libsigc++-1.0.1
7348 * src/xtl/: updated to xtl-1.3.pl.11
7350 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7351 those changes done to the files in src/ are actually recreated when
7352 they get regenerated. Please don't ever accept a patch that changes a
7353 dialog unless that patch includes the changes to the corresponding *.fd
7356 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7357 stringOnlyContains, renamed it and generalised it.
7359 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7360 branch. Removed the remaining old form_print code.
7362 2000-04-26 Allan Rae <rae@lyx.org>
7364 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7365 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7367 2000-04-25 Allan Rae <rae@lyx.org>
7369 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7370 against a base of xtl-1.3.pl.4
7372 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7373 filter the Id: entries so they still show the xtl version number
7376 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7377 into the src/xtl code. Patch still pending with José (XTL)
7379 2000-04-24 Allan Rae <rae@lyx.org>
7381 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7382 both more generic and much safer. Use the new template functions.
7383 * src/buffer.[Ch] (Dispatch): ditto.
7385 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7386 and mem buffer more intelligently. Also a little general cleanup.
7389 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7390 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7391 * src/xtl/Makefile.am: ditto.
7392 * src/xtl/.cvsignore: ditto.
7393 * src/Makefile.am: ditto.
7395 * src/PrinterParams.h: Removed the macros member functions. Added a
7396 testInvariant member function. A bit of tidying up and commenting.
7397 Included Angus's idea for fixing operation with egcs-1.1.2.
7399 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7400 cool expansion of XTL's mem_buffer to support automatic memory
7401 management within the buffer itself. Removed the various macros and
7402 replaced them with template functions that use either auto_mem_buffer
7403 or mem_buffer depending on a #define. The mem_buffer support will
7404 disappear as soon as the auto_mem_buffer is confirmed to be good on
7405 other platforms/compilers. That is, it's there so you've got something
7408 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7409 effectively forked XTL. However I expect José will include my code
7410 into the next major release. Also fixed a memory leak.
7411 * src/xtl/text.h: ditto.
7412 * src/xtl/xdr.h: ditto.
7413 * src/xtl/giop.h: ditto.
7415 2000-04-16 Allan Rae <rae@lyx.org>
7417 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7418 by autogen.sh and removed by maintainer-clean anyway.
7419 * .cvsignore, sigc++/.cvsignore: Support the above.
7421 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7423 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7425 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7426 macros, renamed static callback-target member functions to suit new
7427 scheme and made them public.
7428 * src/frontends/xforms/forms/form_print.fd: ditto.
7429 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7431 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7434 * src/xtl/: New directory containing a minimal distribution of XTL.
7435 This is XTL-1.3.pl.4.
7437 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7439 2000-04-15 Allan Rae <rae@lyx.org>
7441 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7443 * sigc++/: Updated to libsigc++-1.0.0
7445 2000-04-14 Allan Rae <rae@lyx.org>
7447 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7448 use the generic ones in future. I'll modify my conversion script.
7450 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7452 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7453 (CloseAllBufferRelatedDialogs): Renamed.
7454 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7456 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7457 of the generic ones. These are the same ones my conversion script
7460 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7461 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7462 * src/buffer.C (Dispatch): ditto
7464 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7465 functions for updating and hiding buffer dependent dialogs.
7466 * src/BufferView.C (buffer): ditto
7467 * src/buffer.C (setReadonly): ditto
7468 * src/lyxfunc.C (CloseBuffer): ditto
7470 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7471 Dialogs.h, and hence all the SigC stuff, into every file that includes
7472 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7474 * src/BufferView2.C: reduce the number of headers included by buffer.h
7476 2000-04-11 Allan Rae <rae@lyx.org>
7478 * src/frontends/xforms/xform_macros.h: A small collection of macros
7479 for building C callbacks.
7481 * src/frontends/xforms/Makefile.am: Added above file.
7483 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7484 scheme again. This time it should work for JMarc. If this is
7485 successful I'll revise my conversion script to automate some of this.
7486 The static member functions in the class also have to be public for
7487 this scheme will work. If the scheme works (it's almost identical to
7488 the way BufferView::cursorToggleCB is handled so it should work) then
7489 FormCopyright and FormPrint will be ready for inclusion into the main
7490 trunk immediately after 1.1.5 is released -- provided we're prepared
7491 for complaints about lame compilers not handling XTL.
7493 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7495 2000-04-07 Allan Rae <rae@lyx.org>
7497 * config/lyxinclude.m4: A bit more tidying up (Angus)
7499 * src/LString.h: JMarc's <string> header fix
7501 * src/PrinterParams.h: Used string for most data to remove some
7502 ugly code in the Print dialog and avoid even uglier code when
7503 appending the ints to a string for output.
7505 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7506 and moved "default:" back to the end of switch statement. Cleaned
7507 up the printing so it uses the right function calls and so the
7508 "print to file" option actually puts the file in the right directory.
7510 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7512 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7513 and Ok+Apply button control into a separate method: input (Angus).
7514 (input) Cleaned it up and improved it to be very thorough now.
7515 (All CB) static_cast used instead of C style cast (Angus). This will
7516 probably change again once we've worked out how to keep gcc-2.8.1 happy
7517 with real C callbacks.
7518 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7519 ignore some of the bool settings and has random numbers instead. Needs
7520 some more investigation. Added other input length checks and checking
7521 of file and printer names.
7523 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7524 would link (Angus). Seems the old code doesn't compile with the pragma
7525 statement either. Separated callback entries from internal methods.
7527 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7529 2000-03-17 Allan Rae <rae@lyx.org>
7531 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7532 need it? Maybe it could go in Dialogs instead? I could make it a
7533 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7534 values to get the bool return value.
7535 (Dispatch): New overloaded method for xtl support.
7537 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7538 extern "C" callback instead of static member functions. Hopefully,
7539 JMarc will be able to compile this. I haven't changed
7540 forms/form_copyright.fd yet. Breaking one of my own rules already.
7542 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7543 because they aren't useful from the minibuffer. Maybe a LyXServer
7544 might want a help message though?
7546 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7548 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7549 xtl which needs both rtti and exceptions.
7551 * src/support/Makefile.am:
7552 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7554 * src/frontends/xforms/input_validators.[ch]: input filters and
7555 validators. These conrol what keys are valid in input boxes.
7556 Use them and write some more. Much better idea than waiting till
7557 after the user has pressed Ok to say that the input fields don't make
7560 * src/frontends/xforms/Makefile.am:
7561 * src/frontends/xforms/forms/form_print.fd:
7562 * src/frontends/xforms/forms/makefile:
7563 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7564 new scheme. Still have to make sure I haven't missed anything from
7565 the current implementation.
7567 * src/Makefile.am, src/PrinterParams.h: New data store.
7569 * other files: Added a couple of copyright notices.
7571 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7573 * src/insets/insetbib.h: move Holder struct in public space.
7575 * src/frontends/include/DialogBase.h: use SigC:: only when
7576 SIGC_CXX_NAMESPACES is defined.
7577 * src/frontends/include/Dialogs.h: ditto.
7579 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7581 * src/frontends/xforms/FormCopyright.[Ch]: do not
7582 mention SigC:: explicitely.
7584 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7586 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7587 deals with testing KDE in main configure.in
7588 * configure.in: ditto.
7590 2000-02-22 Allan Rae <rae@lyx.org>
7592 * Lots of files: Merged from HEAD
7594 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7595 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7597 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7599 * sigc++/: new minidist.
7601 2000-02-14 Allan Rae <rae@lyx.org>
7603 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7605 2000-02-08 Juergen Vigna <jug@sad.it>
7607 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7608 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7610 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7611 for this port and so it is much easier for other people to port
7612 dialogs in a common development environment.
7614 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7615 the QT/KDE implementation.
7617 * src/frontends/kde/Dialogs.C:
7618 * src/frontends/kde/FormCopyright.C:
7619 * src/frontends/kde/FormCopyright.h:
7620 * src/frontends/kde/Makefile.am:
7621 * src/frontends/kde/formcopyrightdialog.C:
7622 * src/frontends/kde/formcopyrightdialog.h:
7623 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7624 for the kde support of the Copyright-Dialog.
7626 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7627 subdir-substitution instead of hardcoded 'xforms' as we now have also
7630 * src/frontends/include/DialogBase.h (Object): just commented the
7631 label after #endif (nasty warning and I don't like warnings ;)
7633 * src/main.C (main): added KApplication initialization if using
7636 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7637 For now only the KDE event-loop is added if frontend==kde.
7639 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7641 * configure.in: added support for the --with-frontend[=value] option
7643 * autogen.sh: added kde.m4 file to list of config-files
7645 * acconfig.h: added define for KDEGUI-support
7647 * config/kde.m4: added configuration functions for KDE-port
7649 * config/lyxinclude.m4: added --with-frontend[=value] option with
7650 support for xforms and KDE.
7652 2000-02-08 Allan Rae <rae@lyx.org>
7654 * all Makefile.am: Fixed up so the make targets dist, distclean,
7655 install and uninstall all work even if builddir != srcdir. Still
7656 have a new sigc++ minidist update to come.
7658 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7660 2000-02-01 Allan Rae <rae@lyx.org>
7662 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7663 Many mods to get builddir != srcdir working.
7665 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7666 for building on NT and so we can do the builddir != srcdir stuff.
7668 2000-01-30 Allan Rae <rae@lyx.org>
7670 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7671 This will stay in "rae" branch. We probably don't really need it in
7672 the main trunk as anyone who wants to help programming it should get
7673 a full library installed also. So they can check both included and
7674 system supplied library compilation.
7676 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7677 Added a 'mini' distribution of libsigc++. If you feel the urge to
7678 change something in these directories - Resist it. If you can't
7679 resist the urge then you should modify the following script and rebuild
7680 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7681 all happen. Still uses a hacked version of libsigc++'s configure.in.
7682 I'm quite happy with the results. I'm not sure the extra work to turn
7683 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7684 worth the trouble and would probably lead to extra maintenance
7686 I haven't tested the following important make targets: install, dist.
7687 Not ready for prime time but very close. Maybe 1.1.5.
7689 * development/tools/makeLyXsigc.sh: A shell script to automatically
7690 generate our mini-dist of libsigc++. It can only be used with a CVS
7691 checkout of libsigc++ not a tarball distribution. It's well commented.
7692 This will end up as part of the libsigc++ distribution so other apps
7693 can easily have an included mini-dist. If someone makes mods to the
7694 sigc++ subpackage without modifying this script to generate those
7695 changes I'll be very upset!
7697 * src/frontends/: Started the gui/system indep structure.
7699 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7700 to access the gui-indep dialogs are in this class. Much improved
7701 design compared to previous revision. Lars, please refrain from
7702 moving this header into src/ like you did with Popups.h last time.
7704 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7706 * src/frontends/xforms/: Started the gui-indep system with a single
7707 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7710 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7711 Here you'll find a very useful makefile and automated fdfix.sh that
7712 makes updating dailogs a no-brainer -- provided you follow the rules
7713 set out in the README. I'm thinking about adding another script to
7714 automatically generate skeleton code for a new dialog given just the
7717 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7718 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7719 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7721 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/support/LSubstring.C (operator): simplify
7725 * src/lyxtext.h: removed bparams, use buffer_->params instead
7727 * src/lyxrow.h: make Row a real class, move all variables to
7728 private and use accessors.
7730 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7732 (isRightToLeftPar): ditto
7733 (ChangeLanguage): ditto
7734 (isMultiLingual): ditto
7737 (SimpleTeXOnePar): ditto
7738 (TeXEnvironment): ditto
7739 (GetEndLabel): ditto
7741 (SetOnlyLayout): ditto
7742 (BreakParagraph): ditto
7743 (BreakParagraphConservative): ditto
7744 (GetFontSettings): ditto
7746 (CopyIntoMinibuffer): ditto
7747 (CutIntoMinibuffer): ditto
7748 (PasteParagraph): ditto
7749 (SetPExtraType): ditto
7750 (UnsetPExtraType): ditto
7751 (DocBookContTableRows): ditto
7752 (SimpleDocBookOneTablePar): ditto
7754 (TeXFootnote): ditto
7755 (SimpleTeXOneTablePar): ditto
7756 (TeXContTableRows): ditto
7757 (SimpleTeXSpecialChars): ditto
7760 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7761 to private and use accessors.
7763 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7764 this, we did not use it anymore and has not been for ages. Just a
7765 waste of cpu cycles.
7767 * src/language.h: make Language a real class, move all variables
7768 to private and use accessors.
7770 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7771 (create_view): remove
7772 (update): some changes for new timer
7773 (cursorToggle): use new timer
7774 (beforeChange): change for new timer
7776 * src/BufferView.h (cursorToggleCB): removed last paramter because
7779 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7780 (cursorToggleCB): change because of new timer code
7782 * lib/CREDITS: updated own mailaddress
7784 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7786 * src/support/filetools.C (PutEnv): fix the code in case neither
7787 putenv() nor setenv() have been found.
7789 * INSTALL: mention the install-strip Makefile target.
7791 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7792 read-only documents.
7794 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7796 * lib/reLyX/configure.in (VERSION): avoid using a previously
7797 generated reLyX wrapper to find out $prefix.
7799 * lib/examples/eu_adibide_lyx-atua.lyx:
7800 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7801 translation of the Tutorial (Dooteo)
7803 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7805 * forms/cite.fd: new citation dialog
7807 * src/insetcite.[Ch]: the new citation dialog is moved into
7810 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7813 * src/insets/insetcommand.h: data members made private.
7815 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7817 * LyX 1.1.5 released
7819 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7821 * src/version.h (LYX_RELEASE): to 1.1.5
7823 * src/spellchecker.C (RunSpellChecker): return false if the
7824 spellchecker dies upon creation.
7826 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7828 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7829 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7833 * lib/CREDITS: update entry for Martin Vermeer.
7835 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7837 * src/text.C (draw): Draw foreign language bars at the bottom of
7838 the row instead of at the baseline.
7840 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7842 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * lib/bind/de_menus.bind: updated
7846 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7848 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7850 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7852 * src/menus.C (Limit_string_length): New function
7853 (ShowTocMenu): Limit the number of items/length of items in the
7856 * src/paragraph.C (String): Correct result for a paragraph inside
7859 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7861 * src/bufferlist.C (close): test of buf->getuser() == NULL
7863 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7865 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7866 Do not call to SetCursor when the paragraph is a closed footnote!
7868 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7870 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7873 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7875 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7878 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7879 reference popup, that activates the reference-back action
7881 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7883 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7884 the menus. Also fixed a bug.
7886 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7887 the math panels when switching buffers (unless new buffer is readonly).
7889 * src/BufferView.C (NoSavedPositions)
7890 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7892 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7894 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7895 less of dvi dirty or not.
7897 * src/trans_mgr.[Ch] (insert): change first parameter to string
7900 * src/chset.[Ch] (encodeString): add const to first parameter
7902 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7904 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7908 * src/LaTeX.C (deplog): better searching for dependency files in
7909 the latex log. Uses now regexps.
7911 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7912 instead of the box hack or \hfill.
7914 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7916 * src/lyxfunc.C (doImportHelper): do not create the file before
7917 doing the actual import.
7918 (doImportASCIIasLines): create a new file before doing the insert.
7919 (doImportASCIIasParagraphs): ditto.
7921 * lib/lyxrc.example: remove mention of non-existing commands
7923 * lyx.man: remove mention of color-related switches.
7925 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7927 * src/lyx_gui.C: remove all the color-related ressources, which
7928 are not used anymore.
7930 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7933 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7935 * src/lyxrc.C (read): Add a missing break in the switch
7937 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7939 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7941 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7944 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7946 * src/text.C (draw): draw bars under foreign language words.
7948 * src/LColor.[Ch]: add LColor::language
7950 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7952 * src/lyxcursor.h (boundary): New member variable
7954 * src/text.C (IsBoundary): New methods
7956 * src/text.C: Use the above for currect cursor movement when there
7957 is both RTL & LTR text.
7959 * src/text2.C: ditto
7961 * src/bufferview_funcs.C (ToggleAndShow): ditto
7963 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7965 * src/text.C (DeleteLineForward): set selection to true to avoid
7966 that DeleteEmptyParagraphMechanism does some magic. This is how it
7967 is done in all other functions, and seems reasonable.
7968 (DeleteWordForward): do not jump over non-word stuff, since
7969 CursorRightOneWord() already does it.
7971 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7972 DeleteWordBackward, since they seem safe to me (since selection is
7973 set to "true") DeleteEmptyParagraphMechanism does nothing.
7975 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7977 * src/lyx_main.C (easyParse): simplify the code by factoring the
7978 part that removes parameters from the command line.
7979 (LyX): check wether wrong command line options have been given.
7981 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7983 * src/lyx_main.C : add support for specifying user LyX
7984 directory via command line option -userdir.
7986 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7988 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7989 the number of items per popup.
7990 (Add_to_refs_menu): Ditto.
7992 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7994 * src/lyxparagraph.h: renamed ClearParagraph() to
7995 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7996 textclass as parameter, and do nothing if free_spacing is
7997 true. This fixes part of the line-delete-forward problems.
7999 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
8000 (pasteSelection): ditto.
8001 (SwitchLayoutsBetweenClasses): more translatable strings.
8003 * src/text2.C (CutSelection): use StripLeadingSpaces.
8004 (PasteSelection): ditto.
8005 (DeleteEmptyParagraphMechanism): ditto.
8007 2000-05-26 Juergen Vigna <jug@sad.it>
8009 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
8010 is not needed in tabular insets.
8012 * src/insets/insettabular.C (TabularFeatures): added missing features.
8014 * src/tabular.C (DeleteColumn):
8016 (AppendRow): implemented this functions
8017 (cellsturct::operator=): clone the inset too;
8019 2000-05-23 Juergen Vigna <jug@sad.it>
8021 * src/insets/insettabular.C (LocalDispatch): better selection support
8022 when having multicolumn-cells.
8024 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8026 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
8028 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8030 * src/ColorHandler.C (getGCForeground): put more test into _()
8032 * lib/examples/eu_splash.lyx: new file (Basque translation) from
8035 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
8038 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8040 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8041 there are no labels, or when buffer is readonly.
8043 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8044 there are no labels, buffer is SGML, or when buffer is readonly.
8046 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8048 * src/LColor.C (LColor): change a couple of grey40 to grey60
8049 (LColor): rewore initalization to make compiles go some magnitude
8051 (getGUIName): don't use gettext until we need the string.
8053 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8055 * src/Bullet.[Ch]: Fixed a small bug.
8057 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8059 * src/paragraph.C (String): Several fixes/improvements
8061 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8063 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8065 * src/paragraph.C (String): give more correct output.
8067 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8069 * src/lyxfont.C (stateText) Do not output the language if it is
8070 eqaul to the language of the document.
8072 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8073 between two paragraphs with the same language.
8075 * src/paragraph.C (getParLanguage) Return a correct answer for an
8076 empty dummy paragraph.
8078 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8081 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8084 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8085 the menus/popup, if requested fonts are unavailable.
8087 2000-05-22 Juergen Vigna <jug@sad.it>
8089 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8090 movement support (Up/Down/Tab/Shift-Tab).
8091 (LocalDispatch): added also preliminari cursor-selection.
8093 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8095 * src/paragraph.C (PasteParagraph): Hopefully now right!
8097 2000-05-22 Garst R. Reese <reese@isn.net>
8099 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8100 of list, change all references to Environment to Command
8101 * tex/hollywood.cls : rewrite environments as commands, add
8102 \uppercase to interiorshot and exteriorshot to force uppecase.
8103 * tex/broadway.cls : rewrite environments as commands. Tweak
8106 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8108 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8109 size of items: use a constant intead of the hardcoded 40, and more
8110 importantly do not remove the %m and %x tags added at the end.
8111 (Add_to_refs_menu): use vector::size_type instead of
8112 unsigned int as basic types for the variables. _Please_ do not
8113 assume that size_t is equal to unsigned int. On an alpha, this is
8114 unsigned long, which is _not_ the same.
8116 * src/language.C (initL): remove language "hungarian", since it
8117 seems that "magyar" is better.
8119 2000-05-22 Juergen Vigna <jug@sad.it>
8121 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8123 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8126 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8127 next was deleted but not set to 0.
8129 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8131 * src/language.C (initL): change the initialization of languages
8132 so that compiles goes _fast_.
8134 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8137 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8139 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8145 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8147 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8151 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8154 * src/insets/insetlo*.[Ch]: Made editable
8156 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8158 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8159 the current selection.
8161 * src/BufferView_pimpl.C (stuffClipboard): new method
8163 * src/BufferView.C (stuffClipboard): new method
8165 * src/paragraph.C (String): new method
8167 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8168 LColor::ignore when lyxname is not found.
8170 * src/BufferView.C (pasteSelection): new method
8172 * src/BufferView_pimpl.C (pasteSelection): new method
8174 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8176 * src/WorkArea.C (request_clipboard_cb): new static function
8177 (getClipboard): new method
8178 (putClipboard): new method
8180 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8182 * LyX 1.1.5pre2 released
8184 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8186 * src/vspace.C (operator=): removed
8187 (operator=): removed
8189 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8191 * src/layout.C (NumberOfClass): manually set the type in make_pair
8192 (NumberOfLayout): ditto
8194 * src/language.C: use the Language constructor for ignore_lang
8196 * src/language.h: add constructors to struct Language
8198 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8200 * src/text2.C (SetCursorIntern): comment out #warning
8202 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8204 * src/mathed/math_iter.h: initialize sx and sw to 0
8206 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8208 * forms/lyx.fd: Redesign of form_ref
8210 * src/LaTeXFeatures.[Ch]
8214 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8217 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8218 and Buffer::inset_iterator.
8220 * src/menus.C: Added new menus: TOC and Refs.
8222 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8224 * src/buffer.C (getTocList): New method.
8226 * src/BufferView2.C (ChangeRefs): New method.
8228 * src/buffer.C (getLabelList): New method. It replaces the old
8229 getReferenceList. The return type is vector<string> instead of
8232 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8233 the old getLabel() and GetNumberOfLabels() methods.
8234 * src/insets/insetlabel.C (getLabelList): ditto
8235 * src/mathed/formula.C (getLabelList): ditto
8237 * src/paragraph.C (String): New method.
8239 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8240 Uses the new getTocList() method.
8241 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8242 which automatically updates the contents of the browser.
8243 (RefUpdateCB): Use the new getLabelList method.
8245 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8247 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8249 * src/spellchecker.C: Added using std::reverse;
8251 2000-05-19 Juergen Vigna <jug@sad.it>
8253 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8255 * src/insets/insettext.C (computeTextRows): small fix for display of
8256 1 character after a newline.
8258 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8261 2000-05-18 Juergen Vigna <jug@sad.it>
8263 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8264 when changing width of column.
8266 * src/tabular.C (set_row_column_number_info): setting of
8267 autobreak rows if necessary.
8269 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8271 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8273 * src/vc-backend.*: renamed stat() to status() and vcstat to
8274 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8275 compilation broke. The new name seems more relevant, anyway.
8277 2000-05-17 Juergen Vigna <jug@sad.it>
8279 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8280 which was wrong if the removing caused removing of rows!
8282 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8283 (pushToken): new function.
8285 * src/text2.C (CutSelection): fix problem discovered with purify
8287 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8289 * src/debug.C (showTags): enlarge the first column, now that we
8290 have 6-digits debug codes.
8292 * lib/layouts/hollywood.layout:
8293 * lib/tex/hollywood.cls:
8294 * lib/tex/brodway.cls:
8295 * lib/layouts/brodway.layout: more commands and fewer
8296 environments. Preambles moved in the .cls files. Broadway now has
8297 more options on scene numbering and less whitespace (from Garst)
8299 * src/insets/insetbib.C (getKeys): make sure that we are in the
8300 document directory, in case the bib file is there.
8302 * src/insets/insetbib.C (Latex): revert bogus change.
8304 2000-05-16 Juergen Vigna <jug@sad.it>
8306 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8307 the TabularLayout on cursor move.
8309 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8311 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8314 (draw): fixed cursor position and drawing so that the cursor is
8315 visible when before the tabular-inset.
8317 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8318 when creating from old insettext.
8320 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8322 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8324 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8325 * lib/tex/brodway.cls: ditto
8327 * lib/layouts/brodway.layout: change alignment of parenthical
8330 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8332 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8333 versions 0.88 and 0.89 are supported.
8335 2000-05-15 Juergen Vigna <jug@sad.it>
8337 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8340 * src/insets/insettext.C (computeTextRows): redone completely this
8341 function in a much cleaner way, because of problems when having a
8343 (draw): added a frame border when the inset is locked.
8344 (SetDrawLockedFrame): this sets if we draw the border or not.
8345 (SetFrameColor): this sets the frame color (default=insetframe).
8347 * src/insets/lyxinset.h: added x() and y() functions which return
8348 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8349 function which is needed to see if we have a locking inset of some
8350 type in this inset (needed for now in insettabular).
8352 * src/vspace.C (inPixels): the same function also without a BufferView
8353 parameter as so it is easier to use it in some ocasions.
8355 * src/lyxfunc.C: changed all places where insertInset was used so
8356 that now if it couldn't be inserted it is deleted!
8358 * src/TabularLayout.C:
8359 * src/TableLayout.C: added support for new tabular-inset!
8361 * src/BufferView2.C (insertInset): this now returns a bool if the
8362 inset was really inserted!!!
8364 * src/tabular.C (GetLastCellInRow):
8365 (GetFirstCellInRow): new helper functions.
8366 (Latex): implemented for new tabular class.
8370 (TeXTopHLine): new Latex() helper functions.
8372 2000-05-12 Juergen Vigna <jug@sad.it>
8374 * src/mathed/formulamacro.C (Read):
8375 * src/mathed/formula.C (Read): read also the \end_inset here!
8377 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8379 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8380 crush when saving formulae with unbalanced parenthesis.
8382 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8384 * src/layout.C: Add new keyword "endlabelstring" to layout file
8386 * src/text.C (GetVisibleRow): Draw endlabel string.
8388 * lib/layouts/broadway.layout
8389 * lib/layouts/hollywood.layout: Added endlabel for the
8390 Parenthetical layout.
8392 * lib/layouts/heb-article.layout: Do not use slanted font shape
8393 for Theorem like environments.
8395 * src/buffer.C (makeLaTeXFile): Always add "american" to
8396 the UsedLanguages list if document language is RTL.
8398 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8400 * add addendum to README.OS2 and small patch (from SMiyata)
8402 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8404 * many files: correct the calls to ChangeExtension().
8406 * src/support/filetools.C (ChangeExtension): remove the no_path
8407 argument, which does not belong there. Use OnlyFileName() instead.
8409 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8410 files when LaTeXing a non-nice latex file.
8412 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8413 a chain of "if". Return false when deadkeys are not handled.
8415 * src/lyx_main.C (LyX): adapted the code for default bindings.
8417 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8418 bindings for basic functionality (except deadkeys).
8419 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8421 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8422 several methods: handle override_x_deadkeys.
8424 * src/lyxrc.h: remove the "bindings" map, which did not make much
8425 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8427 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8429 * src/lyxfont.C (stateText): use a saner method to determine
8430 whether the font is "default". Seems to fix the crash with DEC
8433 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8435 2000-05-08 Juergen Vigna <jug@sad.it>
8437 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8438 TabularLayoutMenu with mouse-button-3
8439 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8441 * src/TabularLayout.C: added this file for having a Layout for
8444 2000-05-05 Juergen Vigna <jug@sad.it>
8446 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8447 recalculating inset-widths.
8448 (TabularFeatures): activated this function so that I can change
8449 tabular-features via menu.
8451 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8452 that I can test some functions with the Table menu.
8454 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * src/lyxfont.C (stateText): guard against stupid c++libs.
8458 * src/tabular.C: add using std::vector
8459 some whitespace changes, + removed som autogenerated code.
8461 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8463 2000-05-05 Juergen Vigna <jug@sad.it>
8465 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8466 row, columns and cellstructures.
8468 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8470 * lib/lyxrc.example: remove obsolete entries.
8472 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8473 reading of protected_separator for free_spacing.
8475 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8477 * src/text.C (draw): do not display an exclamation mark in the
8478 margin for margin notes. This is confusing, ugly and
8481 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8482 AMS math' is checked.
8484 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8485 name to see whether including the amsmath package is needed.
8487 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8489 * src/paragraph.C (validate): Compute UsedLanguages correctly
8490 (don't insert the american language if it doesn't appear in the
8493 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8494 The argument of \thanks{} command is considered moving argument
8496 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8499 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8501 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8502 for appendix/minipage/depth. The lines can be now both in the footnote
8503 frame, and outside the frame.
8505 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8508 2000-05-05 Juergen Vigna <jug@sad.it>
8510 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8511 neede only in tabular.[Ch].
8513 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8517 (Write): write '~' for PROTECTED_SEPARATOR
8519 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8521 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8524 * src/mathed/formula.C (drawStr): rename size to siz.
8526 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8527 possibly fix a bug by not changing the pflags = flags to piflags =
8530 2000-05-05 Juergen Vigna <jug@sad.it>
8532 * src/insets/insetbib.C: moved using directive
8534 * src/ImportNoweb.C: small fix for being able to compile (missing
8537 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8539 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8540 to use clear, since we don't depend on this in the code. Add test
8543 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8545 * (various *.C files): add using std::foo directives to please dec
8548 * replace calls to string::clear() to string::erase() (Angus)
8550 * src/cheaders/cmath: modified to provide std::abs.
8552 2000-05-04 Juergen Vigna <jug@sad.it>
8554 * src/insets/insettext.C: Prepared all for inserting of multiple
8555 paragraphs. Still display stuff to do (alignment and other things),
8556 but I would like to use LyXText to do this when we cleaned out the
8557 table-support stuff.
8559 * src/insets/insettabular.C: Changed lot of stuff and added lots
8560 of functionality still a lot to do.
8562 * src/tabular.C: Various functions changed name and moved to be
8563 const functions. Added new Read and Write functions and changed
8564 lots of things so it works good with tabular-insets (also removed
8565 some stuff which is not needed anymore * hacks *).
8567 * src/lyxcursor.h: added operators == and != which just look if
8568 par and pos are (not) equal.
8570 * src/buffer.C (latexParagraphs): inserted this function to latex
8571 all paragraphs form par to endpar as then I can use this too for
8574 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8575 so that I can call this to from text insets with their own cursor.
8577 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8578 output off all paragraphs (because of the fix below)!
8580 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8581 the very last paragraph (this could be also the last paragraph of an
8584 * src/texrow.h: added rows() call which returns the count-variable.
8586 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8588 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8590 * lib/configure.m4: better autodetection of DocBook tools.
8592 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8594 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8596 * src/lyx_cb.C: add using std::reverse;
8598 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8601 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8602 selected files. Should fix repeated errors from generated files.
8604 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8606 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8608 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8609 the spellchecker popup.
8611 * lib/lyxrc.example: Removed the \number_inset section
8613 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8615 * src/insets/figinset.C (various): Use IsFileReadable() to make
8616 sure that the file actually exist. Relying on ghostscripts errors
8617 is a bad idea since they can lead to X server crashes.
8619 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8621 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8624 * lib/lyxrc.example: smallish typo in description of
8625 \view_dvi_paper_option
8627 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8630 * src/lyxfunc.C: doImportHelper to factor out common code of the
8631 various import methods. New functions doImportASCIIasLines,
8632 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8633 doImportLinuxDoc for the format specific parts.
8636 * buffer.C: Dispatch returns now a bool to indicate success
8639 * lyx_gui.C: Add getLyXView() for member access
8641 * lyx_main.C: Change logic for batch commands: First try
8642 Buffer::Dispatch (possibly without GUI), if that fails, use
8645 * lyx_main.C: Add support for --import command line switch.
8646 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8647 Available Formats: Everything accepted by 'buffer-import <format>'
8649 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8651 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8654 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8655 documents will be reformatted upon reentry.
8657 2000-04-27 Juergen Vigna <jug@sad.it>
8659 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8660 correctly only last pos this was a bug.
8662 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8664 * release of lyx-1.1.5pre1
8666 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8668 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8670 * src/menus.C: revert the change of naming (Figure->Graphic...)
8671 from 2000-04-11. It was incomplete and bad.
8673 * src/LColor.[Ch]: add LColor::depthbar.
8674 * src/text.C (GetVisibleRow): use it.
8676 * README: update the languages list.
8678 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8680 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8683 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * README: remove sections that were just wrong.
8687 * src/text2.C (GetRowNearY): remove currentrow code
8689 * src/text.C (GetRow): remove currentrow code
8691 * src/screen.C (Update): rewritten a bit.
8692 (SmallUpdate): removed func
8694 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8696 (FullRebreak): return bool
8697 (currentrow): remove var
8698 (currentrow_y): ditto
8700 * src/lyxscreen.h (Draw): change arg to unsigned long
8701 (FitCursor): return bool
8702 (FitManualCursor): ditto
8703 (Smallpdate): remove func
8704 (first): change to unsigned long
8705 (DrawOneRow): change second arg to long (from long &)
8706 (screen_refresh_y): remove var
8707 (scree_refresh_row): ditto
8709 * src/lyxrow.h: change baseline to usigned int from unsigned
8710 short, this brings some implicit/unsigned issues out in the open.
8712 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8714 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8715 instead of smallUpdate.
8717 * src/lyxcursor.h: change y to unsigned long
8719 * src/buffer.h: don't call updateScrollbar after fitcursor
8721 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8722 where they are used. Removed "\\direction", this was not present
8723 in 1.1.4 and is already obsolete. Commented out some code that I
8724 believe to never be called.
8725 (runLiterate): don't call updateScrollbar after fitCursor
8727 (buildProgram): ditto
8730 * src/WorkArea.h (workWidth): change return val to unsigned
8733 (redraw): remove the button redraws
8734 (setScrollbarValue): change for scrollbar
8735 (getScrollbarValue): change for scrollbar
8736 (getScrollbarBounds): change for scrollbar
8738 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8739 (C_WorkArea_down_cb): removed func
8740 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8741 (resize): change for scrollbar
8742 (setScrollbar): ditto
8743 (setScrollbarBounds): ditto
8744 (setScrollbarIncrements): ditto
8745 (up_cb): removed func
8746 (down_cb): removed func
8747 (scroll_cb): change for scrollbar
8748 (work_area_handler): ditto
8750 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8751 when FitCursor did something.
8752 (updateScrollbar): some unsigned changes
8753 (downCB): removed func
8754 (scrollUpOnePage): removed func
8755 (scrollDownOnePage): remvoed func
8756 (workAreaMotionNotify): don't call screen->FitCursor but use
8757 fitCursor instead. and bool return val
8758 (workAreaButtonPress): ditto
8759 (workAreaButtonRelease): some unsigned changes
8760 (checkInsetHit): ditto
8761 (workAreaExpose): ditto
8762 (update): parts rewritten, comments about the signed char arg added
8763 (smallUpdate): removed func
8764 (cursorPrevious): call needed updateScrollbar
8767 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8770 * src/BufferView.[Ch] (upCB): removed func
8771 (downCB): removed func
8772 (smallUpdate): removed func
8774 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8776 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8777 currentrow, currentrow_y optimization. This did not help a lot and
8778 if we want to do this kind of optimization we should rather use
8779 cursor.row instead of the currentrow.
8781 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8782 buffer spacing and klyx spacing support.
8784 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8786 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8789 2000-04-26 Juergen Vigna <jug@sad.it>
8791 * src/insets/figinset.C: fixes to Lars sstream changes!
8793 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8795 * A lot of files: Added Ascii(ostream &) methods to all inset
8796 classes. Used when exporting to ASCII.
8798 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8799 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8802 * src/text2.C (ToggleFree): Disabled implicit word selection when
8803 there is a change in the language
8805 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8806 no output was generated for end-of-sentence inset.
8808 * src/insets/lyxinset.h
8811 * src/paragraph.C: Removed the insetnumber code
8813 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8815 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8817 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8818 no_babel and no_epsfig completely from the file.
8819 (parseSingleLyXformat2Token): add handling for per-paragraph
8820 spacing as written by klyx.
8822 * src/insets/figinset.C: applied patch by Andre. Made it work with
8825 2000-04-20 Juergen Vigna <jug@sad.it>
8827 * src/insets/insettext.C (cutSelection):
8828 (copySelection): Fixed with selection from right to left.
8829 (draw): now the rows are not recalculated at every draw.
8830 (computeTextRows): for now reset the inset-owner here (this is
8831 important for an undo or copy where the inset-owner is not set
8834 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8835 motion to the_locking_inset screen->first was forgotten, this was
8836 not important till we got multiline insets.
8838 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8841 code seems to be alright (it is code changed by Dekel, and the
8842 intent is indeed that all macros should be defined \protect'ed)
8844 * NEWS: a bit of reorganisation of the new user-visible features.
8846 2000-04-19 Juergen Vigna <jug@sad.it>
8848 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8849 position. Set the inset_owner of the used paragraph so that it knows
8850 that it is inside an inset. Fixed cursor handling with mouse and
8851 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8852 and cleanups to make TextInsets work better.
8854 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8855 Changed parameters of various functions and added LockInsetInInset().
8857 * src/insets/insettext.C:
8859 * src/insets/insetcollapsable.h:
8860 * src/insets/insetcollapsable.C:
8861 * src/insets/insetfoot.h:
8862 * src/insets/insetfoot.C:
8863 * src/insets/insetert.h:
8864 * src/insets/insetert.C: cleaned up the code so that it works now
8865 correctly with insettext.
8867 * src/insets/inset.C:
8868 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8869 that insets in insets are supported right.
8872 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8874 * src/paragraph.C: some small fixes
8876 * src/debug.h: inserted INSETS debug info
8878 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8879 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8881 * src/commandtags.h:
8882 * src/LyXAction.C: insert code for InsetTabular.
8884 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8885 not Button1MotionMask.
8886 (workAreaButtonRelease): send always a InsetButtonRelease event to
8888 (checkInsetHit): some setCursor fixes (always with insets).
8890 * src/BufferView2.C (lockInset): returns a bool now and extended for
8891 locking insets inside insets.
8892 (showLockedInsetCursor): it is important to have the cursor always
8893 before the locked inset.
8894 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8896 * src/BufferView.h: made lockInset return a bool.
8898 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8900 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8901 that is used also internally but can be called as public to have back
8902 a cursor pos which is not set internally.
8903 (SetCursorIntern): Changed to use above function.
8905 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8907 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8912 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8913 patches for things that should be in or should be changed.
8915 * src/* [insetfiles]: change "usigned char fragile" to bool
8916 fragile. There was only one point that could that be questioned
8917 and that is commented in formulamacro.C. Grep for "CHECK".
8919 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8920 (DeleteBuffer): take it out of CutAndPaste and make it static.
8922 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8924 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8925 output the spacing envir commands. Also the new commands used in
8926 the LaTeX output makes the result better.
8928 * src/Spacing.C (writeEnvirBegin): new method
8929 (writeEnvirEnd): new method
8931 2000-04-18 Juergen Vigna <jug@sad.it>
8933 * src/CutAndPaste.C: made textclass a static member of the class
8934 as otherwise it is not accesed right!!!
8936 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8938 * forms/layout_forms.fd
8939 * src/layout_forms.h
8940 * src/layout_forms.C (create_form_form_character)
8941 * src/lyx_cb.C (UserFreeFont)
8942 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8943 documents (in the layout->character popup).
8945 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8947 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8948 \spell_command was in fact not honored (from Kevin Atkinson).
8950 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8953 * src/lyx_gui.h: make lyxViews private (Angus)
8955 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8957 * src/mathed/math_write.C
8958 (MathMatrixInset::Write) Put \protect before \begin{array} and
8959 \end{array} if fragile
8960 (MathParInset::Write): Put \protect before \\ if fragile
8962 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8964 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8965 initialization if the LyXColorHandler must be done after the
8966 connections to the XServer has been established.
8968 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8969 get the background pixel from the lyxColorhandler so that the
8970 figures are rendered with the correct background color.
8971 (NextToken): removed functions.
8972 (GetPSSizes): use ifs >> string instead of NextToken.
8974 * src/Painter.[Ch]: the color cache moved out of this file.
8976 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8979 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8981 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8982 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8984 * src/BufferView.C (enterView): new func
8985 (leaveView): new func
8987 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8989 (leaveView): new func, undefines xterm cursor when approp.
8991 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8992 (AllowInput): delete the Workarea cursor handling from this func.
8994 * src/Painter.C (underline): draw a slimer underline in most cases.
8996 * src/lyx_main.C (error_handler): use extern "C"
8998 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9000 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
9001 sent directly to me.
9003 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
9004 to the list by Dekel.
9006 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
9009 * src/bufferview_funcs.[Ch]: two new files, moved several of the
9010 methods from lyx_cb.here.
9012 * src/lyx_cb.C: in addition to the above; removed input_prohibited
9015 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9017 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
9018 instead of using current_view directly.
9020 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
9022 * src/LyXAction.C (init): add the paragraph-spacing command.
9024 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
9026 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
9028 * src/lyx_cb.C (CurrentState): output a string when the spacing is
9029 different from the documents.
9031 * src/text.C (SetHeightOfRow): take paragraph spacing into
9032 account, paragraph spacing takes precedence over buffer spacing
9033 (GetVisibleRow): ditto
9035 * src/paragraph.C (writeFile): output the spacing parameter too.
9036 (validate): set the correct features if spacing is used in the
9038 (Clear): set spacing to default
9039 (MakeSameLayout): spacing too
9040 (HasSameLayout): spacing too
9041 (SetLayout): spacing too
9042 (TeXOnePar): output the spacing commands
9044 * src/lyxparagraph.h: added a spacing variable for use with
9045 per-paragraph spacing.
9047 * src/Spacing.h: add a Default spacing and a method to check if
9048 the current spacing is default. also added an operator==
9050 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9053 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9055 * src/lyxserver.C (callback): fix dispatch of functions
9057 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9058 printf() into lyxerr call.
9060 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9063 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9064 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9065 the "Float" from each of the subitems.
9066 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9068 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9069 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9070 documented the change so that the workaround can be nuked later.
9072 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9075 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9077 * src/buffer.C (getLatexName): ditto
9078 (setReadonly): ditto
9080 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9082 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9083 avoid some uses of current_view. Added also a bufferParams()
9084 method to get at this.
9086 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9088 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9090 * src/lyxparagraph.[Ch]: removed
9091 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9092 with operators used by lower_bound and
9093 upper_bound in InsetTable's
9094 Make struct InsetTable private again. Used matchpos.
9096 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9098 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9099 document, the language of existing text is changed (unless the
9100 document is multi-lingual)
9102 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9104 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9106 * A lot of files: A rewrite of the Right-to-Left support.
9108 2000-04-10 Juergen Vigna <jug@sad.it>
9110 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9111 misplaced cursor when inset in inset is locked.
9113 * src/insets/insettext.C (LocalDispatch): small fix so that a
9114 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9116 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9117 footnote font should be decreased in size twice when displaying.
9119 * src/insets/insettext.C (GetDrawFont): inserted this function as
9120 the drawing-font may differ from the real paragraph font.
9122 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9123 insets (inset in inset!).
9125 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9126 function here because we don't want footnotes inside footnotes.
9128 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9130 (init): now set the inset_owner in paragraph.C
9131 (LocalDispatch): added some resetPos() in the right position
9134 (pasteSelection): changed to use the new CutAndPaste-Class.
9136 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9137 which tells if it is allowed to insert another inset inside this one.
9139 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9140 SwitchLayoutsBetweenClasses.
9142 * src/text2.C (InsertInset): checking of the new paragraph-function
9144 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9145 is not needed anymore here!
9148 (PasteSelection): redone (also with #ifdef) so that now this uses
9149 the CutAndPaste-Class.
9150 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9153 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9154 from/to text/insets.
9156 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9157 so that the paragraph knows if it is inside an (text)-inset.
9158 (InsertFromMinibuffer): changed return-value to bool as now it
9159 may happen that an inset is not inserted in the paragraph.
9160 (InsertInsetAllowed): this checks if it is allowed to insert an
9161 inset in this paragraph.
9163 (BreakParagraphConservative):
9164 (BreakParagraph) : small change for the above change of the return
9165 value of InsertFromMinibuffer.
9167 * src/lyxparagraph.h: added inset_owner and the functions to handle
9168 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9170 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9172 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9173 functions from BufferView to BufferView::Pimpl to ease maintence.
9175 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9176 correctly. Also use SetCursorIntern instead of SetCursor.
9178 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9181 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9183 * src/WorkArea.C (belowMouse): manually implement below mouse.
9185 * src/*: Add "explicit" on several constructors, I added probably
9186 some unneeded ones. A couple of changes to code because of this.
9188 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9189 implementation and private parts from the users of BufferView. Not
9192 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9193 implementation and private parts from the users of LyXLex. Not
9196 * src/BufferView_pimpl.[Ch]: new files
9198 * src/lyxlex_pimpl.[Ch]: new files
9200 * src/LyXView.[Ch]: some inline functions move out-of-line
9202 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9204 * src/lyxparagraph.h: make struct InsetTable public.
9206 * src/support/lyxstring.h: change lyxstring::difference_type to be
9207 ptrdiff_t. Add std:: modifiers to streams.
9209 * src/font.C: include the <cctype> header, for islower() and
9212 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9214 * src/font.[Ch]: new files. Contains the metric functions for
9215 fonts, takes a LyXFont as parameter. Better separation of concepts.
9217 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9218 changes because of this.
9220 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9222 * src/*: compile with -Winline and move functions that don't
9225 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9228 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9230 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9231 (various files changed because of this)
9233 * src/Painter.C (text): fixed the drawing of smallcaps.
9235 * src/lyxfont.[Ch] (drawText): removed unused member func.
9238 * src/*.C: added needed "using" statements and "std::" qualifiers.
9240 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9242 * src/*.h: removed all use of "using" from header files use
9243 qualifier std:: instead.
9245 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9247 * src/text.C (Backspace): some additional cleanups (we already
9248 know whether cursor.pos is 0 or not).
9250 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9251 automake does not provide one).
9253 * src/bmtable.h: replace C++ comments with C comments.
9255 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9257 * src/screen.C (ShowCursor): Change the shape of the cursor if
9258 the current language is not equal to the language of the document.
9259 (If the cursor change its shape unexpectedly, then you've found a bug)
9261 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9264 * src/insets/insetnumber.[Ch]: New files.
9266 * src/LyXAction.C (init)
9267 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9270 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9272 * src/lyxparagraph.h
9273 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9274 (the vector is kept sorted).
9276 * src/text.C (GetVisibleRow): Draw selection correctly when there
9277 is both LTR and RTL text.
9279 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9280 which is much faster.
9282 * src/text.C (GetVisibleRow and other): Do not draw the last space
9283 in a row if the direction of the last letter is not equal to the
9284 direction of the paragraph.
9286 * src/lyxfont.C (latexWriteStartChanges):
9287 Check that font language is not equal to basefont language.
9288 (latexWriteEndChanges): ditto
9290 * src/lyx_cb.C (StyleReset): Don't change the language while using
9291 the font-default command.
9293 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9294 empty paragraph before a footnote.
9296 * src/insets/insetcommand.C (draw): Increase x correctly.
9298 * src/screen.C (ShowCursor): Change cursor shape if
9299 current language != document language.
9301 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9303 2000-03-31 Juergen Vigna <jug@sad.it>
9305 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9306 (Clone): changed mode how the paragraph-data is copied to the
9307 new clone-paragraph.
9309 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9310 GetInset(pos) with no inset anymore there (in inset UNDO)
9312 * src/insets/insetcommand.C (draw): small fix as here x is
9313 incremented not as much as width() returns (2 before, 2 behind = 4)
9315 2000-03-30 Juergen Vigna <jug@sad.it>
9317 * src/insets/insettext.C (InsetText): small fix in initialize
9318 widthOffset (should not be done in the init() function)
9320 2000-03-29 Amir Karger <karger@lyx.org>
9322 * lib/examples/it_ItemizeBullets.lyx: translation by
9325 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9327 2000-03-29 Juergen Vigna <jug@sad.it>
9329 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9331 * src/insets/insetfoot.C (Clone): small change as for the below
9332 new init function in the text-inset
9334 * src/insets/insettext.C (init): new function as I've seen that
9335 clone did not copy the Paragraph-Data!
9336 (LocalDispatch): Added code so that now we have some sort of Undo
9337 functionality (well actually we HAVE Undo ;)
9339 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9341 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9343 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9346 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9348 * src/main.C: added a runtime check that verifies that the xforms
9349 header used when building LyX and the library used when running
9350 LyX match. Exit with a message if they don't match. This is a
9351 version number check only.
9353 * src/buffer.C (save): Don't allocate memory on the heap for
9354 struct utimbuf times.
9356 * *: some using changes, use iosfwd instead of the real headers.
9358 * src/lyxfont.C use char const * instead of string for the static
9359 strings. Rewrite some functions to use sstream.
9361 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9363 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9366 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9368 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9369 of Geodesy (from Martin Vermeer)
9371 * lib/layouts/svjour.inc: include file for the Springer svjour
9372 class. It can be used to support journals other than JoG.
9374 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9375 Miskiewicz <misiek@pld.org.pl>)
9376 * lib/reLyX/Makefile.am: ditto.
9378 2000-03-27 Juergen Vigna <jug@sad.it>
9380 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9381 also some modifications with operations on selected text.
9383 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9384 problems with clicking on insets (last famous words ;)
9386 * src/insets/insetcommand.C (draw):
9387 (width): Changed to have a bit of space before and after the inset so
9388 that the blinking cursor can be seen (otherwise it was hidden)
9390 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9392 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9393 would not be added to the link list when an installed gettext (not
9394 part of libc) is found.
9396 2000-03-24 Juergen Vigna <jug@sad.it>
9398 * src/insets/insetcollapsable.C (Edit):
9399 * src/mathed/formula.C (InsetButtonRelease):
9400 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9403 * src/BufferView.C (workAreaButtonPress):
9404 (workAreaButtonRelease):
9405 (checkInsetHit): Finally fixed the clicking on insets be handled
9408 * src/insets/insetert.C (Edit): inserted this call so that ERT
9409 insets work always with LaTeX-font
9411 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9413 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9414 caused lyx to startup with no GUI in place, causing in a crash
9415 upon startup when called with arguments.
9417 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9419 * src/FontLoader.C: better initialization of dummyXFontStruct.
9421 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9423 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9424 for linuxdoc and docbook import and export format options.
9426 * lib/lyxrc.example Example of default values for the previous flags.
9428 * src/lyx_cb.C Use those flags instead of the hardwired values for
9429 linuxdoc and docbook export.
9431 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9434 * src/menus.C Added menus entries for the new import/exports formats.
9436 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9438 * src/lyxrc.*: Added support for running without Gui
9441 * src/FontLoader.C: sensible defaults if no fonts are needed
9443 * src/lyx_cb.C: New function ShowMessage (writes either to the
9444 minibuffer or cout in case of no gui
9445 New function AskOverwrite for common stuff
9446 Consequently various changes to call these functions
9448 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9449 wild guess at sensible screen resolution when having no gui
9451 * src/lyxfont.C: no gui, no fonts... set some defaults
9453 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9455 * src/LColor.C: made the command inset background a bit lighter.
9457 2000-03-20 Hartmut Goebel <goebel@noris.net>
9459 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9460 stdstruct.inc. Koma-Script added some title elements which
9461 otherwise have been listed below "bibliography". This split allows
9462 adding title elements to where they belong.
9464 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9465 define the additional title elements and then include
9468 * many other layout files: changed to include stdtitle.inc just
9469 before stdstruct.inc.
9471 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9473 * src/buffer.C: (save) Added the option to store all backup files
9474 in a single directory
9476 * src/lyxrc.[Ch]: Added variable \backupdir_path
9478 * lib/lyxrc.example: Added descriptions of recently added variables
9480 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9481 bibtex inset, not closing the bibtex popup when deleting the inset)
9483 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9485 * src/lyx_cb.C: add a couple using directives.
9487 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9488 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9489 import based on the filename.
9491 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9492 file would be imported at start, if the filename where of a sgml file.
9494 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9496 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9498 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9499 * src/lyxfont.h Replaced the member variable bits.direction by the
9500 member variable lang. Made many changes in other files.
9501 This allows having a multi-lingual document
9503 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9504 that change the current language to <l>.
9505 Removed the command "font-rtl"
9507 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9508 format for Hebrew documents)
9510 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9511 When auto_mathmode is "true", pressing a digit key in normal mode
9512 will cause entering into mathmode.
9513 If auto_mathmode is "rtl" then this behavior will be active only
9514 when writing right-to-left text.
9516 * src/text2.C (InsertStringA) The string is inserted using the
9519 * src/paragraph.C (GetEndLabel) Gives a correct result for
9520 footnote paragraphs.
9522 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9524 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9526 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9527 front of PasteParagraph. Never insert a ' '. This should at least
9528 fix some cause for the segfaults that we have been experiencing,
9529 it also fixes backspace behaviour slightly. (Phu!)
9531 * src/support/lstrings.C (compare_no_case): some change to make it
9532 compile with gcc 2.95.2 and stdlibc++-v3
9534 * src/text2.C (MeltFootnoteEnvironment): change type o
9535 first_footnote_par_is_not_empty to bool.
9537 * src/lyxparagraph.h: make text private. Changes in other files
9539 (fitToSize): new function
9540 (setContentsFromPar): new function
9541 (clearContents): new function
9542 (SetChar): new function
9544 * src/paragraph.C (readSimpleWholeFile): deleted.
9546 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9547 the file, just use a simple string instead. Also read the file in
9548 a more maintainable manner.
9550 * src/text2.C (InsertStringA): deleted.
9551 (InsertStringB): deleted.
9553 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9555 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9556 RedoParagraphs from the doublespace handling part, just set status
9557 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9558 done, but perhaps not like this.)
9560 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9562 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9563 character when inserting an inset.
9565 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9567 * src/bufferparams.C (readLanguage): now takes "default" into
9570 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9571 also initialize the toplevel_keymap with the default bindings from
9574 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9576 * all files using lyxrc: have lyxrc as a real variable and not a
9577 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9580 * src/lyxrc.C: remove double call to defaultKeyBindings
9582 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9583 toolbar defauls using lyxlex. Remove enums, structs, functions
9586 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9587 toolbar defaults. Also store default keybindings in a map.
9589 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9590 storing the toolbar defaults without any xforms dependencies.
9592 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9593 applied. Changed to use iterators.
9595 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9597 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9598 systems that don't have LINGUAS set to begin with.
9600 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9603 the list by Dekel Tsur.
9605 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9607 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9608 * src/insets/form_graphics.C: ditto.
9610 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9612 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9614 * src/bufferparams.C (readLanguage): use the new language map
9616 * src/intl.C (InitKeyMapper): use the new language map
9618 * src/lyx_gui.C (create_forms): use the new language map
9620 * src/language.[Ch]: New files. Used for holding the information
9621 about each language. Now! Use this new language map enhance it and
9622 make it really usable for our needs.
9624 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9626 * screen.C (ShowCursor): Removed duplicate code.
9627 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9628 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9630 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9633 * src/text.C Added TransformChar method. Used for rendering Arabic
9634 text correctly (change the glyphs of the letter according to the
9635 position in the word)
9640 * src/lyxrc.C Added lyxrc command {language_command_begin,
9641 language_command_end,language_command_ltr,language_command_rtl,
9642 language_package} which allows the use of either arabtex or Omega
9645 * src/lyx_gui.C (init)
9647 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9648 to use encoding for menu fonts which is different than the encoding
9651 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9652 do not load the babel package.
9653 To write an English document with Hebrew/Arabic, change the document
9654 language to "english".
9656 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9657 (alphaCounter): changed to return char
9658 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9660 * lib/lyxrc.example Added examples for Hebrew/Arabic
9663 * src/layout.C Added layout command endlabeltype
9665 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9667 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9669 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9671 * src/mathed/math_delim.C (search_deco): return a
9672 math_deco_struct* instead of index.
9674 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9676 * All files with a USE_OSTREAM_ONLY within: removed all code that
9677 was unused when USE_OSTREAM_ONLY is defined.
9679 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9680 of any less. Removed header and using.
9682 * src/text.C (GetVisibleRow): draw the string "Page Break
9683 (top/bottom)" on screen when drawing a pagebreak line.
9685 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9687 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9689 * src/mathed/math_macro.C (draw): do some cast magic.
9692 * src/mathed/math_defs.h: change byte* argument to byte const*.
9694 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9696 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9697 know it is right to return InsetFoot* too, but cxx does not like
9700 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9702 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9704 * src/mathed/math_delim.C: change == to proper assignment.
9706 2000-03-09 Juergen Vigna <jug@sad.it>
9708 * src/insets/insettext.C (setPos): fixed various cursor positioning
9709 problems (via mouse and cursor-keys)
9710 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9711 inset (still a small display problem but it works ;)
9713 * src/insets/insetcollapsable.C (draw): added button_top_y and
9714 button_bottom_y to have correct values for clicking on the inset.
9716 * src/support/lyxalgo.h: commented out 'using std::less'
9718 2000-03-08 Juergen Vigna <jug@sad.it>
9720 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9721 Button-Release event closes as it is alos the Release-Event
9724 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9726 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9728 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9729 can add multiple spaces in Scrap (literate programming) styles...
9730 which, by the way, is how I got hooked on LyX to begin with.
9732 * src/mathed/formula.C (Write): Added dummy variable to an
9733 inset::Latex() call.
9734 (Latex): Add free_spacing boolean to inset::Latex()
9736 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9738 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9739 virtual function to include the free_spacing boolean from
9740 the containing paragraph's style.
9742 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9743 Added free_spacing boolean arg to match inset.h
9745 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9746 Added free_spacing boolean arg to match inset.h
9748 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9749 Added free_spacing boolean and made sure that if in a free_spacing
9750 paragraph, that we output normal space if there is a protected space.
9752 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9753 Added free_spacing boolean arg to match inset.h
9755 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9756 Added free_spacing boolean arg to match inset.h
9758 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9759 Added free_spacing boolean arg to match inset.h
9761 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9762 Added free_spacing boolean arg to match inset.h
9764 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9765 Added free_spacing boolean arg to match inset.h
9767 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9768 free_spacing boolean arg to match inset.h
9770 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9771 Added free_spacing boolean arg to match inset.h
9773 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9774 Added free_spacing boolean arg to match inset.h
9776 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9777 Added free_spacing boolean arg to match inset.h
9779 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9780 Added free_spacing boolean arg to match inset.h
9782 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9783 Added free_spacing boolean arg to match inset.h
9785 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9786 free_spacing boolean arg to match inset.h
9788 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9789 free_spacing boolean arg to match inset.h
9791 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9792 ignore free_spacing paragraphs. The user's spaces are left
9795 * src/text.C (InsertChar): Fixed the free_spacing layout
9796 attribute behavior. Now, if free_spacing is set, you can
9797 add multiple spaces in a paragraph with impunity (and they
9798 get output verbatim).
9799 (SelectSelectedWord): Added dummy argument to inset::Latex()
9802 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9805 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9806 paragraph layouts now only input a simple space instead.
9807 Special character insets don't make any sense in free-spacing
9810 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9811 hard-spaces in the *input* file to simple spaces if the layout
9812 is free-spacing. This converts old files which had to have
9813 hard-spaces in free-spacing layouts where a simple space was
9815 (writeFileAscii): Added free_spacing check to pass to the newly
9816 reworked inset::Latex(...) methods. The inset::Latex() code
9817 ensures that hard-spaces in free-spacing paragraphs get output
9818 as spaces (rather than "~").
9820 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9822 * src/mathed/math_delim.C (draw): draw the empty placeholder
9823 delims with a onoffdash line.
9824 (struct math_deco_compare): struct that holds the "functors" used
9825 for the sort and the binary search in math_deco_table.
9826 (class init_deco_table): class used for initial sort of the
9828 (search_deco): use lower_bound to do a binary search in the
9831 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9833 * src/lyxrc.C: a small secret thingie...
9835 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9836 and to not flush the stream as often as it used to.
9838 * src/support/lyxalgo.h: new file
9839 (sorted): template function used for checking if a sequence is
9840 sorted or not. Two versions with and without user supplied
9841 compare. Uses same compare as std::sort.
9843 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9844 it and give warning on lyxerr.
9846 (struct compare_tags): struct with function operators used for
9847 checking if sorted, sorting and lower_bound.
9848 (search_kw): use lower_bound instead of manually implemented
9851 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9853 * src/insets/insetcollapsable.h: fix Clone() declaration.
9854 * src/insets/insetfoot.h: ditto.
9856 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9858 2000-03-08 Juergen Vigna <jug@sad.it>
9860 * src/insets/lyxinset.h: added owner call which tells us if
9861 this inset is inside another inset. Changed also the return-type
9862 of Editable to an enum so it tells clearer what the return-value is.
9864 * src/insets/insettext.C (computeTextRows): fixed computing of
9865 textinsets which split automatically on more rows.
9867 * src/insets/insetert.[Ch]: changed this to be of BaseType
9870 * src/insets/insetfoot.[Ch]: added footnote inset
9872 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9873 collapsable insets (like footnote, ert, ...)
9875 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9877 * src/lyxdraw.h: remvoe file
9879 * src/lyxdraw.C: remove file
9881 * src/insets/insettext.C: added <algorithm>.
9883 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9885 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9886 (matrix_cb): case MM_OK use string stream
9888 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9891 * src/mathed/math_macro.C (draw): use string stream
9892 (Metrics): use string stream
9894 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9895 directly to the ostream.
9897 * src/vspace.C (asString): use string stream.
9898 (asString): use string stream
9899 (asLatexString): use string stream
9901 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9902 setting Spacing::Other.
9904 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9905 sprintf when creating the stretch vale.
9907 * src/text2.C (alphaCounter): changed to return a string and to
9908 not use a static variable internally. Also fixed a one-off bug.
9909 (SetCounter): changed the drawing of the labels to use string
9910 streams instead of sprintf.
9912 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9913 manipulator to use a scheme that does not require library support.
9914 This is also the way it is done in the new GNU libstdc++. Should
9915 work with DEC cxx now.
9917 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9920 end. This fixes a bug.
9922 * src/mathed (all files concerned with file writing): apply the
9923 USE_OSTREAM_ONLY changes to mathed too.
9925 * src/support/DebugStream.h: make the constructor explicit.
9927 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9928 count and ostream squashed.
9930 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9932 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9934 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9935 ostringstream uses STL strings, and we might not.
9937 * src/insets/insetspecialchar.C: add using directive.
9938 * src/insets/insettext.C: ditto.
9940 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9942 * lib/layouts/seminar.layout: feeble attempt at a layout for
9943 seminar.cls, far from completet and could really use some looking
9944 at from people used to write layout files.
9946 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9947 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9948 a lot nicer and works nicely with ostreams.
9950 * src/mathed/formula.C (draw): a slightly different solution that
9951 the one posted to the list, but I think this one works too. (font
9952 size wrong in headers.)
9954 * src/insets/insettext.C (computeTextRows): some fiddling on
9955 Jürgens turf, added some comments that he should read.
9957 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9958 used and it gave compiler warnings.
9959 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9962 * src/lyx_gui.C (create_forms): do the right thing when
9963 show_banner is true/false.
9965 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9966 show_banner is false.
9968 * most file writing files: Now use iostreams to do almost all of
9969 the writing. Also instead of passing string &, we now use
9970 stringstreams. mathed output is still not adapted to iostreams.
9971 This change can be turned off by commenting out all the occurences
9972 of the "#define USE_OSTREAM_ONLY 1" lines.
9974 * src/WorkArea.C (createPixmap): don't output debug messages.
9975 (WorkArea): don't output debug messages.
9977 * lib/lyxrc.example: added a comment about the new variable
9980 * development/Code_rules/Rules: Added some more commente about how
9981 to build class interfaces and on how better encapsulation can be
9984 2000-03-03 Juergen Vigna <jug@sad.it>
9986 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9987 automatically with the width of the LyX-Window
9989 * src/insets/insettext.C (computeTextRows): fixed update bug in
9990 displaying text-insets (scrollvalues where not initialized!)
9992 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9994 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9995 id in the check of the result from lower_bound is not enough since
9996 lower_bound can return last too, and then res->id will not be a
9999 * all insets and some code that use them: I have conditionalized
10000 removed the Latex(string & out, ...) this means that only the
10001 Latex(ostream &, ...) will be used. This is a work in progress to
10002 move towards using streams for all output of files.
10004 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
10007 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10009 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
10010 routine (this fixes bug where greek letters were surrounded by too
10013 * src/support/filetools.C (findtexfile): change a bit the search
10014 algorithm, to fix bug introduced in 1.1.4. Note that --format is
10015 no longer passed to kpsewhich, we may have to change that later.
10017 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
10018 warning options to avoid problems with X header files (from Angus
10020 * acinclude.m4: regenerated.
10022 2000-03-02 Juergen Vigna <jug@sad.it>
10024 * src/insets/insettext.C (WriteParagraphData): Using the
10025 par->writeFile() function for writing paragraph-data.
10026 (Read): Using buffer->parseSingleLyXformat2Token()-function
10027 for parsing paragraph data!
10029 * src/buffer.C (readLyXformat2): removed all parse data and using
10030 the new parseSingleLyXformat2Token()-function.
10031 (parseSingleLyXformat2Token): added this function to parse (read)
10032 lyx-file-format (this is called also from text-insets now!)
10034 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10036 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10039 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10040 directly instead of going through a func. One very bad thing: a
10041 static LyXFindReplace, but I don't know where to place it.
10043 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10044 string instead of char[]. Also changed to static.
10045 (GetSelectionOrWordAtCursor): changed to static inline
10046 (SetSelectionOverLenChars): ditto.
10048 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10049 current_view and global variables. both classes has changed names
10050 and LyXFindReplace is not inherited from SearchForm.
10052 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10053 fl_form_search form.
10055 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10057 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10059 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10060 bound (from Kayvan).
10062 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10064 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10066 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10068 * some things that I should comment but the local pub says head to
10071 * comment out all code that belongs to the Roff code for Ascii
10072 export of tables. (this is unused)
10074 * src/LyXView.C: use correct type for global variable
10075 current_layout. (LyXTextClass::size_type)
10077 * some code to get the new insetgraphics closer to working I'd be
10078 grateful for any help.
10080 * src/BufferView2.C (insertInset): use the return type of
10081 NumberOfLayout properly. (also changes in other files)
10083 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10084 this as a test. I want to know what breaks because of this.
10086 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10088 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10090 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10091 to use a \makebox in the label, this allows proper justification
10092 with out using protected spaces or multiple hfills. Now it is
10093 "label" for left justified, "\hfill label\hfill" for center, and
10094 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10095 should be changed accordingly.
10097 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10099 * src/lyxtext.h: change SetLayout() to take a
10100 LyXTextClass::size_type instead of a char (when there is more than
10101 127 layouts in a class); also change type of copylayouttype.
10102 * src/text2.C (SetLayout): ditto.
10103 * src/LyXView.C (updateLayoutChoice): ditto.
10105 * src/LaTeX.C (scanLogFile): errors where the line number was not
10106 given just after the '!'-line were ignored (from Dekel Tsur).
10108 * lib/lyxrc.example: fix description of \date_insert_format
10110 * lib/layouts/llncs.layout: new layout, contributed by Martin
10113 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10115 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10116 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10117 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10118 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10119 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10120 paragraph.C, text.C, text2.C)
10122 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10124 * src/insets/insettext.C (LocalDispatch): remove extra break
10127 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10128 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10130 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10131 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10133 * src/insets/insetbib.h: move InsetBibkey::Holder and
10134 InsetCitation::Holder in public space.
10136 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10138 * src/insets/insettext.h: small change to get the new files from
10139 Juergen to compile (use "string", not "class string").
10141 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10142 const & as parameter to LocalDispatch, use LyXFont const & as
10143 paramter to some other func. This also had impacto on lyxinsets.h
10144 and the two mathed insets.
10146 2000-02-24 Juergen Vigna <jug@sad.it>
10149 * src/commandtags.h:
10151 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10155 * src/BufferView2.C: added/updated code for various inset-functions
10157 * src/insets/insetert.[Ch]: added implementation of InsetERT
10159 * src/insets/insettext.[Ch]: added implementation of InsetText
10161 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10162 (draw): added preliminary code for inset scrolling not finshed yet
10164 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10165 as it is in lyxfunc.C now
10167 * src/insets/lyxinset.h: Added functions for text-insets
10169 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10171 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10172 BufferView and reimplement the list as a queue put inside its own
10175 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10177 * several files: use the new interface to the "updateinsetlist"
10179 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10181 (work_area_handler): call BufferView::trippleClick on trippleclick.
10183 * src/BufferView.C (doubleClick): new function, selects word on
10185 (trippleClick): new function, selects line on trippleclick.
10187 2000-02-22 Allan Rae <rae@lyx.org>
10189 * lib/bind/xemacs.bind: buffer-previous not supported
10191 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10193 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10196 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10198 * src/bufferlist.C: get rid of current_view from this file
10200 * src/spellchecker.C: get rid of current_view from this file
10202 * src/vspace.C: get rid of current_view from this file
10203 (inPixels): added BufferView parameter for this func
10204 (asLatexCommand): added a BufferParams for this func
10206 * src/text.C src/text2.C: get rid of current_view from these
10209 * src/lyxfont.C (getFontDirection): move this function here from
10212 * src/bufferparams.C (getDocumentDirection): move this function
10215 * src/paragraph.C (getParDirection): move this function here from
10217 (getLetterDirection): ditto
10219 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10221 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10222 resize due to wrong pixmap beeing used. Also took the opurtunity
10223 to make the LyXScreen stateless on regard to WorkArea and some
10224 general cleanup in the same files.
10226 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10228 * src/Makefile.am: add missing direction.h
10230 * src/PainterBase.h: made the width functions const.
10232 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10235 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10237 * src/insets/insetlatexaccent.C (draw): make the accents draw
10238 better, at present this will only work well with iso8859-1.
10240 * several files: remove the old drawing code, now we use the new
10243 * several files: remove support for mono_video, reverse_video and
10246 2000-02-17 Juergen Vigna <jug@sad.it>
10248 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10249 int ** as we have to return the pointer, otherwise we have only
10250 NULL pointers in the returning function.
10252 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10254 * src/LaTeX.C (operator()): quote file name when running latex.
10256 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10258 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10259 (bubble tip), this removes our special handling of this.
10261 * Remove all code that is unused now that we have the new
10262 workarea. (Code that are not active when NEW_WA is defined.)
10264 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10266 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10268 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10269 nonexisting layout; correctly redirect obsoleted layouts.
10271 * lib/lyxrc.example: document \view_dvi_paper_option
10273 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10276 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10277 (PreviewDVI): handle the view_dvi_paper_option variable.
10278 [Both from Roland Krause]
10280 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10282 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10283 char const *, int, LyXFont)
10284 (text(int, int, string, LyXFont)): ditto
10286 * src/text.C (InsertCharInTable): attempt to fix the double-space
10287 feature in tables too.
10288 (BackspaceInTable): ditto.
10289 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10291 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10293 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10295 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10296 newly found text in textcache to this.
10297 (buffer): set the owner of the text put into the textcache to 0
10299 * src/insets/figinset.C (draw): fixed the drawing of figures with
10302 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10303 drawing of mathframe, hfills, protected space, table lines. I have
10304 now no outstanding drawing problems with the new Painter code.
10306 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10308 * src/PainterBase.C (ellipse, circle): do not specify the default
10311 * src/LColor.h: add using directive.
10313 * src/Painter.[Ch]: change return type of methods from Painter& to
10314 PainterBase&. Add a using directive.
10316 * src/WorkArea.C: wrap xforms callbacks in C functions
10319 * lib/layouts/foils.layout: font fix and simplifications from Carl
10322 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10324 * a lot of files: The Painter, LColor and WorkArea from the old
10325 devel branch has been ported to lyx-devel. Some new files and a
10326 lot of #ifdeffed code. The new workarea is enabled by default, but
10327 if you want to test the new Painter and LColor you have to compile
10328 with USE_PAINTER defined (do this in config.h f.ex.) There are
10329 still some rought edges, and I'd like some help to clear those
10330 out. It looks stable (loads and displays the Userguide very well).
10333 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10335 * src/buffer.C (pop_tag): revert to the previous implementation
10336 (use a global variable for both loops).
10338 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10340 * src/lyxrc.C (LyXRC): change slightly default date format.
10342 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10343 there is an English text with a footnote that starts with a Hebrew
10344 paragraph, or vice versa.
10345 (TeXFootnote): ditto.
10347 * src/text.C (LeftMargin): allow for negative values for
10348 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10351 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10352 for input encoding (cyrillic)
10354 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10356 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10359 * src/toolbar.C (set): ditto
10360 * src/insets/insetbib.C (create_form_citation_form): ditto
10362 * lib/CREDITS: added Dekel Tsur.
10364 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10365 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10366 hebrew supports files from Dekel Tsur.
10368 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10369 <tzafrir@technion.ac.il>
10371 * src/lyxrc.C: put \date_insert_format at the right place.
10373 * src/buffer.C (makeLaTeXFile): fix the handling of
10374 BufferParams::sides when writing out latex files.
10376 * src/BufferView2.C: add a "using" directive.
10378 * src/support/lyxsum.C (sum): when we use lyxstring,
10379 ostringstream::str needs an additional .c_str().
10381 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10383 * src/support/filetools.C (ChangeExtension): patch from Etienne
10386 * src/TextCache.C (show): remove const_cast and make second
10387 parameter non-const LyXText *.
10389 * src/TextCache.h: use non const LyXText in show.
10391 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10394 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10396 * src/support/lyxsum.C: rework to be more flexible.
10398 * several places: don't check if a pointer is 0 if you are going
10401 * src/text.C: remove some dead code.
10403 * src/insets/figinset.C: remove some dead code
10405 * src/buffer.C: move the BufferView funcs to BufferView2.C
10406 remove all support for insetlatexdel
10407 remove support for oldpapersize stuff
10408 made some member funcs const
10410 * src/kbmap.C: use a std::list to store the bindings in.
10412 * src/BufferView2.C: new file
10414 * src/kbsequence.[Ch]: new files
10416 * src/LyXAction.C + others: remove all trace of buffer-previous
10418 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10419 only have one copy in the binary of this table.
10421 * hebrew patch: moved some functions from LyXText to more
10422 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10424 * several files: remove support for XForms older than 0.88
10425 whitespace changes.
10426 remove some #if 0 #endif code
10428 * src/TextCache.[Ch]: new file. Holds the textcache.
10430 * src/BufferView.C: changes to use the new TextCache interface.
10431 (waitForX): remove the now unused code.
10433 * src/BackStack.h: remove some commented code
10435 * lib/bind/emacs.bind: remove binding for buffer-previous
10437 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10439 * applied the hebrew patch.
10441 * src/lyxrow.h: make sure that all Row variables are initialized.
10443 * src/text2.C (TextHandleUndo): comment out a delete, this might
10444 introduce a memory leak, but should also help us to not try to
10445 read freed memory. We need to look at this one.
10447 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10448 (LyXParagraph): initalize footnotekind.
10450 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10451 forgot this when applying the patch. Please heed the warnings.
10453 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10454 (aka. reformat problem)
10456 * src/bufferlist.C (exists): made const, and use const_iterator
10457 (isLoaded): new func.
10458 (release): use std::find to find the correct buffer.
10460 * src/bufferlist.h: made getState a const func.
10461 made empty a const func.
10462 made exists a const func.
10465 2000-02-01 Juergen Vigna <jug@sad.it>
10467 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10469 * po/it.po: updated a bit the italian po file and also changed the
10470 'file nuovo' for newfile to 'filenuovo' without a space, this did
10473 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10474 for the new insert_date command.
10476 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10477 from jdblair, to insert a date into the current text conforming to
10478 a strftime format (for now only considering the locale-set and not
10479 the document-language).
10481 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10483 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10484 Bounds Read error seen by purify. The problem was that islower is
10485 a macros which takes an unsigned char and uses it as an index for
10486 in array of characters properties (and is thus subject to the
10490 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10491 correctly the paper sides radio buttons.
10492 (UpdateDocumentButtons): ditto.
10494 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10496 * src/kbmap.C (getsym + others): change to return unsigned int,
10497 returning a long can give problems on 64 bit systems. (I assume
10498 that int is 32bit on 64bit systems)
10500 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10502 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10503 LyXLookupString to be zero-terminated. Really fixes problems seen
10504 by purify, I think.
10506 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10508 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10509 write a (char*)0 to the lyxerr stream.
10511 * src/lastfiles.C: move algorithm before the using statemets.
10513 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10515 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10516 complains otherwise).
10517 * src/table.C: ditto
10519 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10522 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10523 that I removed earlier... It is really needed.
10525 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10527 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10529 * INSTALL: update xforms home page URL.
10531 * lib/configure.m4: fix a bug with unreadable layout files.
10533 * src/table.C (calculate_width_of_column): add "using std::max"
10536 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10538 * several files: marked several lines with "DEL LINE", this is
10539 lines that can be deleted without changing anything.
10540 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10541 checks this anyway */
10544 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10546 * src/DepTable.C (update): add a "+" at the end when the checksum
10547 is different. (debugging string only)
10549 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10550 the next inset to not be displayed. This should also fix the list
10551 of labels in the "Insert Crossreference" dialog.
10553 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10555 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10556 when regex was not found.
10558 * src/support/lstrings.C (lowercase): use handcoded transform always.
10561 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10562 old_cursor.par->prev could be 0.
10564 * several files: changed post inc/dec to pre inc/dec
10566 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10567 write the lastfiles to file.
10569 * src/BufferView.C (buffer): only show TextCache info when debugging
10571 (resizeCurrentBuffer): ditto
10572 (workAreaExpose): ditto
10574 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10576 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10578 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10579 a bit better by removing the special case for \i and \j.
10581 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10583 * src/lyx_main.C (easyParse): remove test for bad comand line
10584 options, since this broke all xforms-related parsing.
10586 * src/kbmap.C (getsym): set return type to unsigned long, as
10587 declared in header. On an alpha, long is _not_ the same as int.
10589 * src/support/LOstream.h: add a "using std::flush;"
10591 * src/insets/figinset.C: ditto.
10593 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10595 * src/bufferlist.C (write): use blinding fast file copy instead of
10596 "a char at a time", now we are doing it the C++ way.
10598 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10599 std::list<int> instead.
10600 (addpidwait): reflect move to std::list<int>
10601 (sigchldchecker): ditto
10603 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10606 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10607 that obviously was wrong...
10609 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10610 c, this avoids warnings with purify and islower.
10612 * src/insets/figinset.C: rename struct queue to struct
10613 queue_element and rewrite to use a std::queue. gsqueue is now a
10614 std::queue<queue_element>
10615 (runqueue): reflect move to std::queue
10618 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10619 we would get "1" "0" instead of "true" "false. Also make the tostr
10622 2000-01-21 Juergen Vigna <jug@sad.it>
10624 * src/buffer.C (writeFileAscii): Disabled code for special groff
10625 handling of tabulars till I fix this in table.C
10627 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10629 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10631 * src/support/lyxlib.h: ditto.
10633 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10635 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10636 and 'j' look better. This might fix the "macron" bug that has been
10639 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10640 functions as one template function. Delete the old versions.
10642 * src/support/lyxsum.C: move using std::ifstream inside
10645 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10648 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10650 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10652 * src/insets/figinset.C (InitFigures): use new instead of malloc
10653 to allocate memory for figures and bitmaps.
10654 (DoneFigures): use delete[] instead of free to deallocate memory
10655 for figures and bitmaps.
10656 (runqueue): use new to allocate
10657 (getfigdata): use new/delete[] instead of malloc/free
10658 (RegisterFigure): ditto
10660 * some files: moved some declarations closer to first use, small
10661 whitespace changes use preincrement instead of postincrement where
10662 it does not make a difference.
10664 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10665 step on the way to use stl::containers for key maps.
10667 * src/bufferlist.h: add a typedef for const_iterator and const
10668 versions of begin and end.
10670 * src/bufferlist.[Ch]: change name of member variable _state to
10671 state_. (avoid reserved names)
10673 (getFileNames): returns the filenames of the buffers in a vector.
10675 * configure.in (ALL_LINGUAS): added ro
10677 * src/support/putenv.C: new file
10679 * src/support/mkdir.C: new file
10681 2000-01-20 Allan Rae <rae@lyx.org>
10683 * lib/layouts/IEEEtran.layout: Added several theorem environments
10685 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10686 couple of minor additions.
10688 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10689 (except for those in footnotes of course)
10691 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10693 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10695 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10696 std::sort and std::lower_bound instead of qsort and handwritten
10698 (struct compara): struct that holds the functors used by std::sort
10699 and std::lower_bound in MathedLookupBOP.
10701 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10703 * src/support/LAssert.h: do not do partial specialization. We do
10704 not really need it.
10706 * src/support/lyxlib.h: note that lyx::getUserName() and
10707 lyx::date() are not in use right now. Should these be suppressed?
10709 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10710 (makeLinuxDocFile): do not put date and user name in linuxdoc
10713 * src/support/lyxlib.h (kill): change first argument to long int,
10714 since that's what solaris uses.
10716 * src/support/kill.C (kill): fix declaration to match prototype.
10718 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10719 actually check whether namespaces are supported. This is not what
10722 * src/support/lyxsum.C: add a using directive.
10724 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10726 * src/support/kill.C: if we have namespace support we don't have
10727 to include lyxlib.h.
10729 * src/support/lyxlib.h: use namespace lyx if supported.
10731 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10733 * src/support/date.C: new file
10735 * src/support/chdir.C: new file
10737 * src/support/getUserName.C: new file
10739 * src/support/getcwd.C: new file
10741 * src/support/abort.C: new file
10743 * src/support/kill.C: new file
10745 * src/support/lyxlib.h: moved all the functions in this file
10746 insede struct lyx. Added also kill and abort to this struct. This
10747 is a way to avoid the "kill is not defined in <csignal>", we make
10748 C++ wrappers for functions that are not ANSI C or ANSI C++.
10750 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10751 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10752 lyx it has been renamed to sum.
10754 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10756 * src/text.C: add using directives for std::min and std::max.
10758 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10760 * src/texrow.C (getIdFromRow): actually return something useful in
10761 id and pos. Hopefully fixes the bug with positionning of errorbox
10764 * src/lyx_main.C (easyParse): output an error and exit if an
10765 incorrect command line option has been given.
10767 * src/spellchecker.C (ispell_check_word): document a memory leak.
10769 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10770 where a "struct utimbuf" is allocated with "new" and deleted with
10773 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10775 * src/text2.C (CutSelection): don't delete double spaces.
10776 (PasteSelection): ditto
10777 (CopySelection): ditto
10779 * src/text.C (Backspace): don't delete double spaces.
10781 * src/lyxlex.C (next): fix a bug that were only present with
10782 conformant std::istream::get to read comment lines, use
10783 std::istream::getline instead. This seems to fix the problem.
10785 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10787 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10788 allowed to insert space before space" editing problem. Please read
10789 commends at the beginning of the function. Comments about usage
10792 * src/text.C (InsertChar): fix for the "not allowed to insert
10793 space before space" editing problem.
10795 * src/text2.C (DeleteEmptyParagraphMechanism): when
10796 IsEmptyTableRow can only return false this last "else if" will
10797 always be a no-op. Commented out.
10799 * src/text.C (RedoParagraph): As far as I can understand tmp
10800 cursor is not really needed.
10802 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10803 present it could only return false anyway.
10804 (several functions): Did something not so smart...added a const
10805 specifier on a lot of methods.
10807 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10808 and add a tmp->text.resize. The LyXParagraph constructor does the
10810 (BreakParagraphConservative): ditto
10812 * src/support/path.h (Path): add a define so that the wrong usage
10813 "Path("/tmp") will be flagged as a compilation error:
10814 "`unnamed_Path' undeclared (first use this function)"
10816 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10818 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10819 which was bogus for several reasons.
10821 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10823 (runBibTeX): ditto.
10825 * autogen.sh: do not use "type -path" (what's that anyway?).
10827 * src/support/filetools.C (findtexfile): remove extraneous space
10828 which caused a kpsewhich warning (at least with kpathsea version
10831 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10833 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10835 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10837 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10839 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10841 * src/paragraph.C (BreakParagraph): do not reserve space on text
10842 if we don't need to (otherwise, if pos_end < pos, we end up
10843 reserving huge amounts of memory due to bad unsigned karma).
10844 (BreakParagraphConservative): ditto, although I have not seen
10845 evidence the bug can happen here.
10847 * src/lyxparagraph.h: add a using std::list.
10849 2000-01-11 Juergen Vigna <jug@sad.it>
10851 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10852 could not be found.
10854 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10856 * src/vc-backend.C (doVCCommand): change to be static and take one
10857 more parameter: the path to chdir too be fore executing the command.
10858 (retrive): new function equiv to "co -r"
10860 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10861 file_not_found_hook is true.
10863 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10865 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10866 if a file is readwrite,readonly...anything else.
10868 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10870 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10871 (CreatePostscript): name change from MenuRunDVIPS (or something)
10872 (PreviewPostscript): name change from MenuPreviewPS
10873 (PreviewDVI): name change from MenuPreviewDVI
10875 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10876 \view_pdf_command., \pdf_to_ps_command
10878 * lib/configure.m4: added search for PDF viewer, and search for
10879 PDF to PS converter.
10880 (lyxrc.defaults output): add \pdflatex_command,
10881 \view_pdf_command and \pdf_to_ps_command.
10883 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10885 * src/bufferlist.C (write): we don't use blocksize for anything so
10888 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10890 * src/support/block.h: disable operator T* (), since it causes
10891 problems with both compilers I tried. See comments in the file.
10893 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10896 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10897 variable LYX_DIR_10x to LYX_DIR_11x.
10899 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10901 * INSTALL: document --with-lyxname.
10904 * configure.in: new configure flag --with-lyxname which allows to
10905 choose the name under which lyx is installed. Default is "lyx", of
10906 course. It used to be possible to do this with --program-suffix,
10907 but the later has in fact a different meaning for autoconf.
10909 * src/support/lstrings.h (lstrchr): reformat a bit.
10911 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10912 * src/mathed/math_defs.h: ditto.
10914 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10916 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10917 true, decides if we create a backup file or not when saving. New
10918 tag and variable \pdf_mode, defaults to false. New tag and
10919 variable \pdflatex_command, defaults to pdflatex. New tag and
10920 variable \view_pdf_command, defaults to xpdf. New tag and variable
10921 \pdf_to_ps_command, defaults to pdf2ps.
10923 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10925 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10926 does not have a BufferView.
10927 (unlockInset): ditto + don't access the_locking_inset if the
10928 buffer does not have a BufferView.
10930 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10931 certain circumstances so that we don't continue a keyboard
10932 operation long after the key was released. Try f.ex. to load a
10933 large document, press PageDown for some seconds and then release
10934 it. Before this change the document would contine to scroll for
10935 some time, with this change it stops imidiatly.
10937 * src/support/block.h: don't allocate more space than needed. As
10938 long as we don't try to write to the arr[x] in a array_type arr[x]
10939 it is perfectly ok. (if you write to it you might segfault).
10940 added operator value_type*() so that is possible to pass the array
10941 to functions expecting a C-pointer.
10943 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10946 * intl/*: updated to gettext 0.10.35, tried to add our own
10947 required modifications. Please verify.
10949 * po/*: updated to gettext 0.10.35, tried to add our own required
10950 modifications. Please verify.
10952 * src/support/lstrings.C (tostr): go at fixing the problem with
10953 cxx and stringstream. When stringstream is used return
10954 oss.str().c_str() so that problems with lyxstring and basic_string
10955 are avoided. Note that the best solution would be for cxx to use
10956 basic_string all the way, but it is not conformant yet. (it seems)
10958 * src/lyx_cb.C + other files: moved several global functions to
10959 class BufferView, some have been moved to BufferView.[Ch] others
10960 are still located in lyx_cb.C. Code changes because of this. (part
10961 of "get rid of current_view project".)
10963 * src/buffer.C + other files: moved several Buffer functions to
10964 class BufferView, the functions are still present in buffer.C.
10965 Code changes because of this.
10967 * config/lcmessage.m4: updated to most recent. used when creating
10970 * config/progtest.m4: updated to most recent. used when creating
10973 * config/gettext.m4: updated to most recent. applied patch for
10976 * config/gettext.m4.patch: new file that shows what changes we
10977 have done to the local copy of gettext.m4.
10979 * config/libtool.m4: new file, used in creation of acinclude.m4
10981 * config/lyxinclude.m4: new file, this is the lyx created m4
10982 macros, used in making acinclude.m4.
10984 * autogen.sh: GNU m4 discovered as a separate task not as part of
10985 the lib/configure creation.
10986 Generate acinlucde from files in config. Actually cat
10987 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10988 easier to upgrade .m4 files that really are external.
10990 * src/Spacing.h: moved using std::istringstream to right after
10991 <sstream>. This should fix the problem seen with some compilers.
10993 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10995 * src/lyx_cb.C: began some work to remove the dependency a lot of
10996 functions have on BufferView::text, even if not really needed.
10997 (GetCurrentTextClass): removed this func, it only hid the
11000 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
11001 forgot this in last commit.
11003 * src/Bullet.C (bulletEntry): use static char const *[] for the
11004 tables, becuase of this the return arg had to change to string.
11005 (bulletSize): ditto
11006 (~Bullet): removed unneeded destructor
11008 * src/BufferView.C (beforeChange): moved from lyx_cb.C
11009 (insetSleep): moved from Buffer
11010 (insetWakeup): moved from Buffer
11011 (insetUnlock): moved from Buffer
11013 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
11014 from Buffer to BufferView.
11016 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
11018 * config/ltmain.sh: updated to version 1.3.4 of libtool
11020 * config/ltconfig: updated to version 1.3.4 of libtool
11022 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11025 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
11026 Did I get that right?
11028 * src/lyxlex.h: add a "using" directive or two.
11029 * src/Spacing.h: ditto.
11030 * src/insets/figinset.C: ditto.
11031 * src/support/filetools.C: ditto.
11032 * src/support/lstrings.C: ditto.
11033 * src/BufferView.C: ditto.
11034 * src/bufferlist.C: ditto.
11035 * src/lyx_cb.C: ditto.
11036 * src/lyxlex.C: ditto.
11038 * NEWS: add some changes for 1.1.4.
11040 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11042 * src/BufferView.C: first go at a TextCache to speed up switching
11045 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11047 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11048 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11049 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11050 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11053 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11054 members of the struct are correctly initialized to 0 (detected by
11056 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11057 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11059 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11060 pidwait, since it was allocated with "new". This was potentially
11061 very bad. Thanks to Michael Schmitt for running purify for us.
11064 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11066 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11068 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11070 1999-12-30 Allan Rae <rae@lyx.org>
11072 * lib/templates/IEEEtran.lyx: minor change
11074 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11075 src/mathed/formula.C (LocalDispatch): askForText changes
11077 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11078 know when a user has cancelled input. Fixes annoying problems with
11079 inserting labels and version control.
11081 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11083 * src/support/lstrings.C (tostr): rewritten to use strstream and
11086 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11088 * src/support/filetools.C (IsFileWriteable): use fstream to check
11089 (IsDirWriteable): use fileinfo to check
11091 * src/support/filetools.h (FilePtr): whole class deleted
11093 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11095 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11097 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11099 * src/bufferlist.C (write): use ifstream and ofstream instead of
11102 * src/Spacing.h: use istrstream instead of sscanf
11104 * src/mathed/math_defs.h: change first arg to istream from FILE*
11106 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11108 * src/mathed/math_parser.C: have yyis to be an istream
11109 (LexGetArg): use istream (yyis)
11111 (mathed_parse): ditto
11112 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11114 * src/mathed/formula.C (Read): rewritten to use istream
11116 * src/mathed/formulamacro.C (Read): rewritten to use istream
11118 * src/lyxlex.h (~LyXLex): deleted desturctor
11119 (getStream): new function, returns an istream
11120 (getFile): deleted funtion
11121 (IsOK): return is.good();
11123 * src/lyxlex.C (LyXLex): delete file and owns_file
11124 (setFile): open an filebuf and assign that to a istream instead of
11126 (setStream): new function, takes an istream as arg.
11127 (setFile): deleted function
11128 (EatLine): rewritten us use istream instead of FILE*
11132 * src/table.C (LyXTable): use istream instead of FILE*
11133 (Read): rewritten to take an istream instead of FILE*
11135 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11137 * src/buffer.C (Dispatch): remove an extraneous break statement.
11139 * src/support/filetools.C (QuoteName): change to do simple
11140 'quoting'. More work is necessary. Also changed to do nothing
11141 under emx (needs fix too).
11142 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11144 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11145 config.h.in to the AC_DEFINE_UNQUOTED() call.
11146 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11147 needs char * as argument (because Solaris 7 declares it like
11150 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11151 remove definition of BZERO.
11153 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11155 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11156 defined, "lyxregex.h" if not.
11158 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11160 (REGEX): new variable that is set to regex.c lyxregex.h when
11161 AM_CONDITIONAL USE_REGEX is set.
11162 (libsupport_la_SOURCES): add $(REGEX)
11164 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11167 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11170 * configure.in: add call to LYX_REGEX
11172 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11173 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11175 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11177 * lib/bind/fi_menus.bind: new file, from
11178 pauli.virtanen@saunalahti.fi.
11180 * src/buffer.C (getBibkeyList): pass the parameter delim to
11181 InsetInclude::getKeys and InsetBibtex::getKeys.
11183 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11184 is passed to Buffer::getBibkeyList
11186 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11187 instead of the hardcoded comma.
11189 * src/insets/insetbib.C (getKeys): make sure that there are not
11190 leading blanks in bibtex keys. Normal latex does not care, but
11191 harvard.sty seems to dislike blanks at the beginning of citation
11192 keys. In particular, the retturn value of the function is
11194 * INSTALL: make it clear that libstdc++ is needed and that gcc
11195 2.7.x probably does not work.
11197 * src/support/filetools.C (findtexfile): make debug message go to
11199 * src/insets/insetbib.C (getKeys): ditto
11201 * src/debug.C (showTags): make sure that the output is correctly
11204 * configure.in: add a comment for TWO_COLOR_ICON define.
11206 * acconfig.h: remove all the entries that already defined in
11207 configure.in or acinclude.m4.
11209 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11210 to avoid user name, date and copyright.
11212 1999-12-21 Juergen Vigna <jug@sad.it>
11214 * src/table.C (Read): Now read bogus row format informations
11215 if the format is < 5 so that afterwards the table can
11216 be read by lyx but without any format-info. Fixed the
11217 crash we experienced when not doing this.
11219 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11221 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11222 (RedoDrawingOfParagraph): ditto
11223 (RedoParagraphs): ditto
11224 (RemoveTableRow): ditto
11226 * src/text.C (Fill): rename arg paperwidth -> paper_width
11228 * src/buffer.C (insertLyXFile): rename var filename -> fname
11229 (writeFile): rename arg filename -> fname
11230 (writeFileAscii): ditto
11231 (makeLaTeXFile): ditto
11232 (makeLinuxDocFile): ditto
11233 (makeDocBookFile): ditto
11235 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11238 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11240 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11243 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11244 compiled by a C compiler not C++.
11246 * src/layout.h (LyXTextClass): added typedef for const_iterator
11247 (LyXTextClassList): added typedef for const_iterator + member
11248 functions begin and end.
11250 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11251 iterators to fill the choice_class.
11252 (updateLayoutChoice): rewritten to use iterators to fill the
11253 layoutlist in the toolbar.
11255 * src/BufferView.h (BufferView::work_area_width): removed unused
11258 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11260 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11261 (sgmlCloseTag): ditto
11263 * src/support/lstrings.h: return type of countChar changed to
11266 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11267 what version of this func to use. Also made to return unsigned int.
11269 * configure.in: call LYX_STD_COUNT
11271 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11272 conforming std::count.
11274 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11276 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11277 and a subscript would give bad display (patch from Dekel Tsur
11278 <dekel@math.tau.ac.il>).
11280 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11282 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11285 * src/chset.h: add a few 'using' directives
11287 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11288 triggered when no buffer is active
11290 * src/layout.C: removed `break' after `return' in switch(), since
11293 * src/lyx_main.C (init): make sure LyX can be ran in place even
11294 when libtool has done its magic with shared libraries. Fix the
11295 test for the case when the system directory has not been found.
11297 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11298 name for the latex file.
11299 (MenuMakeHTML): ditto
11301 * src/buffer.h: add an optional boolean argument, which is passed
11302 to ChangeExtension.
11304 1999-12-20 Allan Rae <rae@lyx.org>
11306 * lib/templates/IEEEtran.lyx: small correction and update.
11308 * configure.in: Attempted to use LYX_PATH_HEADER
11310 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11312 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11313 input from JMarc. Now use preprocessor to find the header.
11314 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11315 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11316 LYX_STL_STRING_FWD. See comments in file.
11318 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11320 * The global MiniBuffer * minibuffer variable is dead.
11322 * The global FD_form_main * fd_form_main variable is dead.
11324 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11326 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11328 * src/table.h: add the LOstream.h header
11329 * src/debug.h: ditto
11331 * src/LyXAction.h: change the explaination of the ReadOnly
11332 attribute: is indicates that the function _can_ be used.
11334 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11337 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11339 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11345 * src/paragraph.C (GetWord): assert on pos>=0
11348 * src/support/lyxstring.C: condition the use of an invariant on
11350 * src/support/lyxstring.h: ditto
11352 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11353 Use LAssert.h instead of plain assert().
11355 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11357 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11358 * src/support/filetools.C: ditto
11360 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11363 * INSTALL: document the new configure flags
11365 * configure.in: suppress --with-debug; add --enable-assertions
11367 * acinclude.m4: various changes in alignment of help strings.
11369 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11371 * src/kbmap.C: commented out the use of the hash map in kb_map,
11372 beginning of movement to a stl::container.
11374 * several files: removed code that was not in effect when
11375 MOVE_TEXT was defined.
11377 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11378 for escaping should not be used. We can discuss if the string
11379 should be enclosed in f.ex. [] instead of "".
11381 * src/trans_mgr.C (insert): use the new returned value from
11382 encodeString to get deadkeys and keymaps done correctly.
11384 * src/chset.C (encodeString): changed to return a pair, to tell
11385 what to use if we know the string.
11387 * src/lyxscreen.h (fillArc): new function.
11389 * src/FontInfo.C (resize): rewritten to use more std::string like
11390 structore, especially string::replace.
11392 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11395 * configure.in (chmod +x some scripts): remove config/gcc-hack
11397 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11399 * src/buffer.C (writeFile): change once again the top comment in a
11400 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11401 instead of an hardcoded version number.
11402 (makeDocBookFile): ditto
11404 * src/version.h: add new define LYX_DOCVERSION
11406 * po/de.po: update from Pit Sütterlin
11407 * lib/bind/de_menus.bind: ditto.
11409 * src/lyxfunc.C (Dispatch): call MenuExport()
11410 * src/buffer.C (Dispatch): ditto
11412 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11413 LyXFunc::Dispatch().
11414 (MenuExport): new function, moved from
11415 LyXFunc::Dispatch().
11417 * src/trans_mgr.C (insert): small cleanup
11418 * src/chset.C (loadFile): ditto
11420 * lib/kbd/iso8859-1.cdef: add missing backslashes
11422 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11424 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11425 help with placing the manually drawn accents better.
11427 (Draw): x2 and hg changed to float to minimize rounding errors and
11428 help place the accents better.
11430 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11431 unsigned short to char is just wrong...cast the char to unsigned
11432 char instead so that the two values can compare sanely. This
11433 should also make the display of insetlatexaccents better and
11434 perhaps also some other insets.
11436 (lbearing): new function
11439 1999-12-15 Allan Rae <rae@lyx.org>
11441 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11442 header that provides a wrapper around the very annoying SGI STL header
11445 * src/support/lyxstring.C, src/LString.h:
11446 removed old SGI-STL-compatability attempts.
11448 * configure.in: Use LYX_STL_STRING_FWD.
11450 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11451 stl_string_fwd.h is around and try to determine it's location.
11452 Major improvement over previous SGI STL 3.2 compatability.
11453 Three small problems remain with this function due to my zero
11454 knowledge of autoconf. JMarc and lgb see the comments in the code.
11456 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11458 * src/broken_const.h, config/hack-gcc, config/README: removed
11460 * configure.in: remove --with-gcc-hack option; do not call
11463 * INSTALL: remove documentation of --with-broken-const and
11466 * acconfig.h: remove all trace of BROKEN_CONST define
11468 * src/buffer.C (makeDocBookFile): update version number in output
11470 (SimpleDocBookOnePar): fix an assert when trying to a character
11471 access beyond string length
11474 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11476 * po/de.po: fix the Export menu
11478 * lyx.man: update the description of -dbg
11480 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11481 (commandLineHelp): updated
11482 (easyParse): show list of available debug levels if -dbg is passed
11485 * src/Makefile.am: add debug.C
11487 * src/debug.h: moved some code to debug.C
11489 * src/debug.C: new file. Contains code to set and show debug
11492 * src/layout.C: remove 'break' after 'continue' in switch
11493 statements, since these cannot be reached.
11495 1999-12-13 Allan Rae <rae@lyx.org>
11497 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11498 (in_word_set): hash() -> math_hash()
11500 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11502 * acconfig.h: Added a test for whether we are using exceptions in the
11503 current compilation run. If so USING_EXCEPTIONS is defined.
11505 * config.in: Check for existance of stl_string_fwd.h
11506 * src/LString.h: If compiling --with-included-string and SGI's
11507 STL version 3.2 is present (see above test) we need to block their
11508 forward declaration of string and supply a __get_c_string().
11509 However, it turns out this is only necessary if compiling with
11510 exceptions enabled so I've a bit more to add yet.
11512 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11513 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11514 src/support/LRegex.h, src/undo.h:
11515 Shuffle the order of the included files a little to ensure that
11516 LString.h gets included before anything that includes stl_string_fwd.h
11518 * src/support/lyxstring.C: We need to #include LString.h instead of
11519 lyxstring.h to get the necessary definition of __get_c_string.
11520 (__get_c_string): New function. This is defined static just like SGI's
11521 although why they need to do this I'm not sure. Perhaps it should be
11522 in lstrings.C instead.
11524 * lib/templates/IEEEtran.lyx: New template file.
11526 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11528 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11529 * intl/Makefile.in (MKINSTALLDIRS): ditto
11531 * src/LyXAction.C (init): changed to hold the LFUN data in a
11532 automatic array in stead of in callso to newFunc, this speeds up
11533 compilation a lot. Also all the memory used by the array is
11534 returned when the init is completed.
11536 * a lot of files: compiled with -Wold-style-cast, changed most of
11537 the reported offenders to C++ style casts. Did not change the
11538 offenders in C files.
11540 * src/trans.h (Match): change argument type to unsigned int.
11542 * src/support/DebugStream.C: fix some types on the streambufs so
11543 that it works on a conforming implementation.
11545 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11547 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11549 * src/support/lyxstring.C: remove the inline added earlier since
11550 they cause a bunch of unsatisfied symbols when linking with dec
11551 cxx. Cxx likes to have the body of inlines at the place where they
11554 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11555 accessing negative bounds in array. This fixes the crash when
11556 inserting accented characters.
11557 * src/trans.h (Match): ditto
11559 * src/buffer.C (Dispatch): since this is a void, it should not try
11560 to return anything...
11562 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11564 * src/buffer.h: removed the two friends from Buffer. Some changes
11565 because of this. Buffer::getFileName and Buffer::setFileName
11566 renamed to Buffer::fileName() and Buffer::fileName(...).
11568 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11570 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11571 and Buffer::update(short) to BufferView. This move is currently
11572 controlled by a define MOVE_TEXT, this will be removed when all
11573 shows to be ok. This move paves the way for better separation
11574 between buffer contents and buffer view. One side effect is that
11575 the BufferView needs a rebreak when swiching buffers, if we want
11576 to avoid this we can add a cache that holds pointers to LyXText's
11577 that is not currently in use.
11579 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11582 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11584 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11586 * lyx_main.C: new command line option -x (or --execute) and
11587 -e (or --export). Now direct conversion from .lyx to .tex
11588 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11589 Unfortunately, X is still needed and the GUI pops up during the
11592 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11594 * src/Spacing.C: add a using directive to bring stream stuff into
11596 * src/paragraph.C: ditto
11597 * src/buffer.C: ditto
11599 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11600 from Lars' announcement).
11602 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11603 example files from Tino Meinen.
11605 1999-12-06 Allan Rae <rae@lyx.org>
11607 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11609 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11611 * src/support/lyxstring.C: added a lot of inline for no good
11614 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11615 latexWriteEndChanges, they were not used.
11617 * src/layout.h (operator<<): output operator for PageSides
11619 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11621 * some example files: loaded in LyX 1.0.4 and saved again to update
11622 certain constructs (table format)
11624 * a lot of files: did the change to use fstream/iostream for all
11625 writing of files. Done with a close look at Andre Poenitz's patch.
11627 * some files: whitespace changes.
11629 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11631 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11632 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11633 architecture, we provide our own. It is used unconditionnally, but
11634 I do not think this is a performance problem. Thanks to Angus
11635 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11636 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11638 (GetInset): use my_memcpy.
11642 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11643 it is easier to understand, but it uses less TeX-only constructs now.
11645 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11646 elements contain spaces
11648 * lib/configure: regenerated
11650 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11651 elements contain spaces; display the list of programs that are
11654 * autogen.sh: make sure lib/configure is executable
11656 * lib/examples/*: rename the tutorial examples to begin with the
11657 two-letters language code.
11659 * src/lyxfunc.C (getStatus): do not query current font if no
11662 * src/lyx_cb.C (RunScript): use QuoteName
11663 (MenuRunDvips): ditto
11664 (PrintApplyCB): ditto
11666 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11667 around argument, so that it works well with the current shell.
11668 Does not work properly with OS/2 shells currently.
11670 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11671 * src/LyXSendto.C (SendtoApplyCB): ditto
11672 * src/lyxfunc.C (Dispatch): ditto
11673 * src/buffer.C (runLaTeX): ditto
11674 (runLiterate): ditto
11675 (buildProgram): ditto
11677 * src/lyx_cb.C (RunScript): ditto
11678 (MenuMakeLaTeX): ditto
11680 * src/buffer.h (getLatexName): new method
11682 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11684 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11686 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11687 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11688 (create_math_panel): ditto
11690 * src/lyxfunc.C (getStatus): re-activate the code which gets
11691 current font and cursor; add test for export to html.
11693 * src/lyxrc.C (read): remove unreachable break statements; add a
11696 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11698 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11700 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11701 introduced by faulty regex.
11702 * src/buffer.C: ditto
11703 * src/lastfiles.C: ditto
11704 * src/paragraph.C: ditto
11705 * src/table.C: ditto
11706 * src/vspace.C: ditto
11707 * src/insets/figinset.C: ditto
11708 Note: most of these is absolutely harmless, except the one in
11709 src/mathed formula.C.
11711 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11713 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11714 operation, yielding correct results for the reLyX command.
11716 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11718 * src/support/filetools.C (ExpandPath): removed an over eager
11720 (ReplaceEnvironmentPath): ditto
11722 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11723 shows that we are doing something fishy in our code...
11724 (BubblePost): ditto
11727 * src/lyxrc.C (read): use a double switch trick to get more help
11728 from the compiler. (the same trick is used in layout.C)
11729 (write): new function. opens a ofstream and pass that to output
11730 (output): new function, takes a ostream and writes the lyxrc
11731 elemts to it. uses a dummy switch to make sure no elements are
11734 * src/lyxlex.h: added a struct pushpophelper for use in functions
11735 with more than one exit point.
11737 * src/lyxlex.[Ch] (GetInteger): made it const
11741 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11743 * src/layout.[hC] : LayoutTags splitted into several enums, new
11744 methods created, better error handling cleaner use of lyxlex. Read
11747 * src/bmtable.[Ch]: change some member prototypes because of the
11748 image const changes.
11750 * commandtags.h, src/LyXAction.C (init): new function:
11751 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11752 This file is not read automatically but you can add \input
11753 preferences to your lyxrc if you want to. We need to discuss how
11756 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11757 in .aux, also remove .bib and .bst files from dependencies when
11760 * src/BufferView.C, src/LyXView.C: add const_cast several places
11761 because of changes to images.
11763 * lib/images/*: same change as for images/*
11765 * lib/lyxrc.example: Default for accept_compound is false not no.
11767 * images/*: changed to be const, however I have som misgivings
11768 about this change so it might be changed back.
11770 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11772 * lib/configure, po/POTFILES.in: regenerated
11774 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11776 * config/lib_configure.m4: removed
11778 * lib/configure.m4: new file (was config/lib_configure.m4)
11780 * configure.in: do not test for rtti, since we do not use it.
11782 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11784 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11785 doubling of allocated space scheme. This makes it faster for large
11786 strings end to use less memory for small strings. xtra rememoved.
11788 * src/insets/figinset.C (waitalarm): commented out.
11789 (GhostscriptMsg): use static_cast
11790 (GhostscriptMsg): use new instead of malloc to allocate memory for
11791 cmap. also delete the memory after use.
11793 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11795 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11796 for changes in bibtex database or style.
11797 (runBibTeX): remove all .bib and .bst files from dep before we
11799 (run): use scanAuc in when dep file already exist.
11801 * src/DepTable.C (remove_files_with_extension): new method
11802 (exist): new method
11804 * src/DepTable.[Ch]: made many of the methods const.
11806 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11808 * src/bufferparams.C: make sure that the default textclass is
11809 "article". It used to be the first one by description order, but
11810 now the first one is "docbook".
11812 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11813 string; call Debug::value.
11814 (easyParse): pass complete argument to setDebuggingLevel().
11816 * src/debug.h (value): fix the code that parses debug levels.
11818 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11821 * src/LyXAction.C: use Debug::ACTION as debug channel.
11823 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11825 * NEWS: updated for the future 1.1.3 release.
11827 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11828 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11829 it should. This is of course a controversial change (since many
11830 people will find that their lyx workscreen is suddenly full of
11831 red), but done for the sake of correctness.
11833 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11834 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11836 * src/insets/inseterror.h, src/insets/inseturl.h,
11837 src/insets/insetinfo.h, src/insets/figinset.h,
11838 src/mathed/formulamacro.h, src/mathed/math_macro.h
11839 (EditMessage): add a missing const and add _() to make sure that
11840 translation happens
11842 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11843 src/insets/insetbib.C, src/support/filetools.C: add `using'
11844 directives for cxx.
11846 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11847 doing 'Insert index of last word' at the beginning of a paragraph.
11849 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11851 * several files: white-space changes.
11853 * src/mathed/formula.C: removed IsAlpha and IsDigit
11855 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11856 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11859 * src/insets/figinset.C (GetPSSizes): don't break when
11860 "EndComments" is seen. But break when a boundingbox is read.
11862 * all classes inherited from Inset: return value of Clone
11863 changed back to Inset *.
11865 * all classes inherited form MathInset: return value of Clone
11866 changed back to MathedInset *.
11868 * src/insets/figinset.C (runqueue): use a ofstream to output the
11869 gs/ps file. Might need some setpresicion or setw. However I can
11870 see no problem with the current code.
11871 (runqueue): use sleep instead of the alarm/signal code. I just
11872 can't see the difference.
11874 * src/paragraph.C (LyXParagraph): reserve space in the new
11875 paragraph and resize the inserted paragraph to just fit.
11877 * src/lyxfunc.h (operator|=): added operator for func_status.
11879 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11880 check for readable file.
11882 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11883 check for readable file.
11884 (MenuMakeLinuxDoc): ditto
11885 (MenuMakeDocBook): ditto
11886 (MenuMakeAscii): ditto
11887 (InsertAsciiFile): split the test for openable and readable
11889 * src/bmtable.C (draw_bitmaptable): use
11890 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11892 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11893 findtexfile from LaTeX to filetools.
11895 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11896 instead of FilePtr. Needs to be verified by a literate user.
11898 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11900 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11901 (EditMessage): likewise.
11903 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11904 respectively as \textasciitilde and \textasciicircum.
11906 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11908 * src/support/lyxstring.h: made the methods that take iterators
11909 use const_iterator.
11911 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11912 (regexMatch): made is use the real regex class.
11914 * src/support/Makefile.am: changed to use libtool
11916 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11918 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11920 (MathIsInset ++): changed several macros to be inline functions
11923 * src/mathed/Makefile.am: changed to use libtool
11925 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11927 * src/insets/inset* : Clone changed to const and return type is
11928 the true insettype not just Inset*.
11930 * src/insets/Makefile.am: changed to use libtool
11932 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11934 * src/undo.[Ch] : added empty() and changed some of the method
11937 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11939 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11940 setID use block<> for the bullets array, added const several places.
11942 * src/lyxfunc.C (getStatus): new function
11944 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11945 LyXAction, added const to several funtions.
11947 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11948 a std::map, and to store the dir items in a vector.
11950 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11953 * src/LyXView.[Ch] + other files : changed currentView to view.
11955 * src/LyXAction.[Ch] : ported from the old devel branch.
11957 * src/.cvsignore: added .libs and a.out
11959 * configure.in : changes to use libtool.
11961 * acinclude.m4 : inserted libtool.m4
11963 * .cvsignore: added libtool
11965 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11967 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11968 file name in insets and mathed directories (otherwise the
11969 dependency is not taken in account under cygwin).
11971 * src/text2.C (InsertString[AB]): make sure that we do not try to
11972 read characters past the string length.
11974 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11976 * lib/doc/LaTeXConfig.lyx.in,
11977 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11979 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11980 file saying who created them and when this heppened; this is
11981 useless and annoys tools like cvs.
11983 * lib/layouts/g-brief-{en,de}.layout,
11984 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11985 from Thomas Hartkens <thomas@hartkens.de>.
11987 * src/{insets,mathed}/Makefile.am: do not declare an empty
11988 LDFLAGS, so that it can be set at configure time (useful on Irix
11991 * lib/reLyX/configure.in: make sure that the prefix is set
11992 correctly in LYX_DIR.
11994 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11996 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11997 be used by 'command-sequence' this allows to bind a key to a
11998 sequence of LyX-commands
11999 (Example: 'command-sequence math-insert alpha; math-insert beta;")
12001 * src/LyXAction.C: add "command-sequence"
12003 * src/LyXFunction.C: handling of "command-sequence"
12005 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
12006 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
12008 * src/lyxserver.C, src/minibuffer.C: Use this new interface
12010 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12012 * src/buffer.C (writeFile): Do not output a comment giving user
12013 and date at the beginning of a .lyx file. This is useless and
12014 annoys cvs anyway; update version number to 1.1.
12016 * src/Makefile.am (LYX_DIR): add this definition, so that a
12017 default path is hardcoded in LyX.
12019 * configure.in: Use LYX_GNU_GETTEXT.
12021 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
12022 AM_GNU_GETTEXT with a bug fixed.
12024 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
12026 * src/chset.C: add "using std::ifstream;" to please dec cxx.
12028 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
12029 which is used to point to LyX data is now LYX_DIR_11x.
12031 * lyx.man: convert to a unix text file; small updates.
12033 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
12035 * src/support/LSubstring.[Ch]: made the second arg of most of the
12036 constructors be a const reference.
12038 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12041 * src/support/lyxstring.[Ch] (swap): added missing member function
12042 and specialization of swap(str, str);
12044 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12046 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12047 trace of the old one.
12049 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12050 put the member definitions in undo.C.
12052 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12053 NEW_TEXT and have now only code that was included when this was
12056 * src/intl.C (LCombo): use static_cast
12058 (DispatchCallback): ditto
12060 * src/definitions.h: removed whole file
12062 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12064 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12065 parsing and stores in a std:map. a regex defines the file format.
12066 removed unneeded members.
12068 * src/bufferparams.h: added several enums from definitions.h here.
12069 Removed unsused destructor. Changed some types to use proper enum
12070 types. use block to have the temp_bullets and user_defined_bullets
12071 and to make the whole class assignable.
12073 * src/bufferparams.C (Copy): removed this functions, use a default
12074 assignment instead.
12076 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12079 * src/buffer.C (readLyXformat2): commend out all that have with
12080 oldpapersize to do. also comment out all that hve to do with
12081 insetlatex and insetlatexdel.
12082 (setOldPaperStuff): commented out
12084 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12086 * src/LyXAction.C: remove use of inset-latex-insert
12088 * src/mathed/math_panel.C (button_cb): use static_cast
12090 * src/insets/Makefile.am (insets_o_SOURCES): removed
12093 * src/support/lyxstring.C (helper): use the unsigned long
12094 specifier, UL, instead of a static_cast.
12096 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12098 * src/support/block.h: new file. to be used as a c-style array in
12099 classes, so that the class can be assignable.
12101 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12103 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12104 NULL, make sure to return an empty string (it is not possible to
12105 set a string to NULL).
12107 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12109 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12111 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12113 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12114 link line, so that Irix users (for example) can set it explicitely to
12117 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12118 it can be overidden at make time (static or dynamic link, for
12121 * src/vc-backend.C, src/LaTeXFeatures.h,
12122 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12123 statements to bring templates to global namespace.
12125 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12127 * src/support/lyxstring.C (operator[] const): make it standard
12130 * src/minibuffer.C (Init): changed to reflect that more
12131 information is given from the lyxvc and need not be provided here.
12133 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12135 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12137 * src/LyXView.C (UpdateTimerCB): use static_cast
12138 (KeyPressMask_raw_callback): ditto
12140 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12141 buffer_, a lot of changes because of this. currentBuffer() ->
12142 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12143 also changes to other files because of this.
12145 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12147 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12148 have no support for RCS and partial support for CVS, will be
12151 * src/insets/ several files: changes because of function name
12152 changes in Bufferview and LyXView.
12154 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12156 * src/support/LSubstring.[Ch]: new files. These implement a
12157 Substring that can be very convenient to use. i.e. is this
12159 string a = "Mary had a little sheep";
12160 Substring(a, "sheep") = "lamb";
12161 a is now "Mary has a little lamb".
12163 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12164 out patterns and subpatterns of strings. It is used by LSubstring
12165 and also by vc-backend.C
12167 * src/support/lyxstring.C: went over all the assertions used and
12168 tried to correct the wrong ones and flag which of them is required
12169 by the standard. some bugs found because of this. Also removed a
12170 couple of assertions.
12172 * src/support/Makefile.am (libsupport_a_SOURCES): added
12173 LSubstring.[Ch] and LRegex.[Ch]
12175 * src/support/FileInfo.h: have struct stat buf as an object and
12176 not a pointer to one, some changes because of this.
12178 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12179 information in layout when adding the layouts preamble to the
12180 textclass preamble.
12182 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12185 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12186 because of bug in OS/2.
12188 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12190 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12191 \verbatim@font instead of \ttfamily, so that it can be redefined.
12193 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12194 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12195 src/layout.h, src/text2.C: add 'using' directive to bring the
12196 STL templates we need from the std:: namespace to the global one.
12197 Needed by DEC cxx in strict ansi mode.
12199 * src/support/LIstream.h,src/support/LOstream.h,
12200 src/support/lyxstring.h,src/table.h,
12201 src/lyxlookup.h: do not include <config.h> in header
12202 files. This should be done in the .C files only.
12204 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12208 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12210 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12211 from Kayvan to fix the tth invokation.
12213 * development/lyx.spec.in: updates from Kayvan to reflect the
12214 changes of file names.
12216 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12218 * src/text2.C (InsertStringB): use std::copy
12219 (InsertStringA): use std::copy
12221 * src/bufferlist.C: use a vector to store the buffers in. This is
12222 an internal change and should not affect any other thing.
12224 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12227 * src/text.C (Fill): fix potential bug, one off bug.
12229 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12231 * src/Makefile.am (lyx_main.o): add more files it depends on.
12233 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12235 * src/support/lyxstring.C: use size_t for the reference count,
12236 size, reserved memory and xtra.
12237 (internal_compare): new private member function. Now the compare
12238 functions should work for std::strings that have embedded '\0'
12240 (compare): all compare functions rewritten to use
12243 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12245 * src/support/lyxstring.C (compare): pass c_str()
12246 (compare): pass c_str
12247 (compare): pass c_str
12249 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12251 * src/support/DebugStream.C: <config.h> was not included correctly.
12253 * lib/configure: forgot to re-generate it :( I'll make this file
12254 auto generated soon.
12256 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12258 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12261 * src/support/lyxstring.C: some changes from length() to rep->sz.
12262 avoids a function call.
12264 * src/support/filetools.C (SpaceLess): yet another version of the
12265 algorithm...now per Jean-Marc's suggestions.
12267 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12269 * src/layout.C (less_textclass_desc): functor for use in sorting
12271 (LyXTextClass::Read): sort the textclasses after reading.
12273 * src/support/filetools.C (SpaceLess): new version of the
12274 SpaceLess functions. What problems does this one give? Please
12277 * images/banner_bw.xbm: made the arrays unsigned char *
12279 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12281 * src/support/lyxstring.C (find): remove bogus assertion in the
12282 two versions of find where this has not been done yet.
12284 * src/support/lyxlib.h: add missing int return type to
12287 * src/menus.C (ShowFileMenu): disable exporting to html if no
12288 html export command is present.
12290 * config/lib_configure.m4: add a test for an HTML converter. The
12291 programs checked for are, in this order: tth, latex2html and
12294 * lib/configure: generated from config/lib_configure.m4.
12296 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12297 html converter. The parameters are now passed through $$FName and
12298 $$OutName, instead of standard input/output.
12300 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12302 * lib/lyxrc.example: update description of \html_command.
12303 add "quotes" around \screen_font_xxx font setting examples to help
12304 people who use fonts with spaces in their names.
12306 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12308 * Distribution files: updates for v1.1.2
12310 * src/support/lyxstring.C (find): remove bogus assert and return
12311 npos for the same condition.
12313 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12315 * added patch for OS/2 from SMiyata.
12317 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12319 * src/text2.C (CutSelection): make space_wrapped a bool
12320 (CutSelection): dont declare int i until we have to.
12321 (alphaCounter): return a char const *.
12323 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12325 * src/support/syscall.C (Systemcalls::kill):
12326 src/support/filetools.C (PutEnv, PutEnvPath):
12327 src/lyx_cb.C (addNewlineAndDepth):
12328 src/FontInfo.C (FontInfo::resize): condition some #warning
12329 directives with WITH_WARNINGS.
12332 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12334 * src/layout.[Ch] + several files: access to class variables
12335 limited and made accessor functions instead a lot of code changed
12336 becuase of this. Also instead of returning pointers often a const
12337 reference is returned instead.
12339 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12341 * src/Makefile.am (dist-hook): added used to remove the CVS from
12342 cheaders upon creating a dist
12343 (EXTRA_DIST): added cheaders
12345 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12346 a character not as a small integer.
12348 * src/support/lyxstring.C (find): removed Assert and added i >=
12349 rep->sz to the first if.
12351 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12353 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12354 src/LyXView.C src/buffer.C src/bufferparams.C
12355 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12356 src/text2.C src/insets/insetinclude.C:
12357 lyxlayout renamed to textclasslist.
12359 * src/layout.C: some lyxerr changes.
12361 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12362 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12363 (LyXLayoutList): removed all traces of this class.
12364 (LyXTextClass::Read): rewrote LT_STYLE
12365 (LyXTextClass::hasLayout): new function
12366 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12367 both const and nonconst version.
12368 (LyXTextClass::delete_layout): new function.
12369 (LyXTextClassList::Style): bug fix. do the right thing if layout
12371 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12372 (LyXTextClassList::NameOfLayout): ditto
12373 (LyXTextClassList::Load): ditto
12375 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12377 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12379 * src/LyXAction.C (LookupFunc): added a workaround for sun
12380 compiler, on the other hand...we don't know if the current code
12381 compiles on sun at all...
12383 * src/support/filetools.C (CleanupPath): subst fix
12385 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12388 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12389 complained about this one?
12391 * src/insets/insetinclude.C (Latex): subst fix
12393 * src/insets/insetbib.C (getKeys): subst fix
12395 * src/LyXSendto.C (SendtoApplyCB): subst fix
12397 * src/lyx_main.C (init): subst fix
12399 * src/layout.C (Read): subst fix
12401 * src/lyx_sendfax_main.C (button_send): subst fix
12403 * src/buffer.C (RoffAsciiTable): subst fix
12405 * src/lyx_cb.C (MenuFax): subst fix
12406 (PrintApplyCB): subst fix
12408 1999-10-26 Juergen Vigna <jug@sad.it>
12410 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12412 (Read): Cleaned up this code so now we read only format vestion >= 5
12414 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12416 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12417 come nobody has complained about this one?
12419 * src/insets/insetinclude.C (Latex): subst fix
12421 * src/insets/insetbib.C (getKeys): subst fix
12423 * src/lyx_main.C (init): subst fix
12425 * src/layout.C (Read): subst fix
12427 * src/buffer.C (RoffAsciiTable): subst fix
12429 * src/lyx_cb.C (MenuFax): subst fix.
12431 * src/layout.[hC] + some other files: rewrote to use
12432 std::container to store textclasses and layouts in.
12433 Simplified, removed a lot of code. Make all classes
12434 assignable. Further simplifications and review of type
12435 use still to be one.
12437 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12438 lastfiles to create the lastfiles partr of the menu.
12440 * src/lastfiles.[Ch]: rewritten to use deque to store the
12441 lastfiles in. Uses fstream for reading and writing. Simplifies
12444 * src/support/syscall.C: remove explicit cast.
12446 * src/BufferView.C (CursorToggleCB): removed code snippets that
12447 were commented out.
12448 use explicat C++ style casts instead of C style casts. also use
12449 u_vdata instea of passing pointers in longs.
12451 * src/PaperLayout.C: removed code snippets that were commented out.
12453 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12455 * src/lyx_main.C: removed code snippets that wer commented out.
12457 * src/paragraph.C: removed code snippets that were commented out.
12459 * src/lyxvc.C (logClose): use static_cast
12461 (viewLog): remove explicit cast to void*
12462 (showLog): removed old commented code
12464 * src/menus.C: use static_cast instead of C style casts. use
12465 u_vdata instead of u_ldata. remove explicit cast to (long) for
12466 pointers. Removed old code that was commented out.
12468 * src/insets/inset.C: removed old commented func
12470 * src/insets/insetref.C (InsetRef): removed old code that had been
12471 commented out for a long time.
12473 (escape): removed C style cast
12475 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12477 * src/insets/insetlatex.C (Draw): removed old commented code
12478 (Read): rewritten to use string
12480 * src/insets/insetlabel.C (escape): removed C style cast
12482 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12484 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12485 old commented code.
12487 * src/insets/insetinclude.h: removed a couple of stupid bools
12489 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12490 (Clone): remove C style cast
12491 (getKeys): changed list to lst because of std::list
12493 * src/insets/inseterror.C (Draw): removed som old commented code.
12495 * src/insets/insetcommand.C (Draw): removed some old commented code.
12497 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12498 commented out forever.
12499 (bibitem_cb): use static_cast instead of C style cast
12500 use of vdata changed to u_vdata.
12502 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12504 (CloseUrlCB): use static_cast instead of C style cast.
12505 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12507 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12508 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12509 (CloseInfoCB): static_cast from ob->u_vdata instead.
12510 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12513 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12514 (C_InsetError_CloseErrorCB): forward the ob parameter
12515 (CloseErrorCB): static_cast from ob->u_vdata instead.
12517 * src/vspace.h: include LString.h since we use string in this class.
12519 * src/vspace.C (lyx_advance): changed name from advance because of
12520 nameclash with stl. And since we cannot use namespaces yet...I
12521 used a lyx_ prefix instead. Expect this to change when we begin
12524 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12526 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12527 and removed now defunct constructor and deconstructor.
12529 * src/BufferView.h: have backstack as a object not as a pointer.
12530 removed initialization from constructor. added include for BackStack
12532 * development/lyx.spec.in (%build): add CFLAGS also.
12534 * src/screen.C (drawFrame): removed another warning.
12536 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12538 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12539 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12540 README and ANNOUNCE a bit for the next release. More work is
12543 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12544 unbreakable if we are in freespacing mode (LyX-Code), but not in
12547 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12549 * src/BackStack.h: fixed initialization order in constructor
12551 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12553 * acinclude.m4 (VERSION): new rules for when a version is
12554 development, added also a variable for prerelease.
12555 (warnings): we set with_warnings=yes for prereleases
12556 (lyx_opt): prereleases compile with same optimization as development
12557 (CXXFLAGS): only use pedantic if we are a development version
12559 * src/BufferView.C (restorePosition): don't do anything if the
12560 backstack is empty.
12562 * src/BackStack.h: added member empty, use this to test if there
12563 is anything to pop...
12565 1999-10-25 Juergen Vigna <jug@sad.it>
12568 * forms/layout_forms.fd +
12569 * forms/latexoptions.fd +
12570 * lyx.fd: changed for various form resize issues
12572 * src/mathed/math_panel.C +
12573 * src/insets/inseterror.C +
12574 * src/insets/insetinfo.C +
12575 * src/insets/inseturl.C +
12576 * src/insets/inseturl.h +
12578 * src/LyXSendto.C +
12579 * src/PaperLayout.C +
12580 * src/ParagraphExtra.C +
12581 * src/TableLayout.C +
12583 * src/layout_forms.C +
12590 * src/menus.C: fixed various resize issues. So now forms can be
12591 resized savely or not be resized at all.
12593 * forms/form_url.fd +
12594 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12597 * src/insets/Makefile.am: added files form_url.[Ch]
12599 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12601 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12602 (and presumably 6.2).
12604 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12605 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12606 remaining static member callbacks.
12608 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12611 * src/support/lyxstring.h: declare struct Srep as friend of
12612 lyxstring, since DEC cxx complains otherwise.
12614 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12616 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12618 * src/LaTeX.C (run): made run_bibtex also depend on files with
12620 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12621 are put into the dependency file.
12623 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12624 the code has shown itself to work
12625 (create_ispell_pipe): removed another warning, added a comment
12628 * src/minibuffer.C (ExecutingCB): removed code that has been
12629 commented out a long time
12631 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12632 out code + a warning.
12634 * src/support/lyxstring.h: comment out the three private
12635 operators, when compiling with string ansi conforming compilers
12636 they make problems.
12638 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12640 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12641 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12644 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12647 * src/mathed/math_panel.C (create_math_panel): remove explicit
12650 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12653 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12654 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12655 to XCreatePixmapFromBitmapData
12656 (fl_set_bmtable_data): change the last argument to be unsigned
12658 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12659 and bh to be unsigned int, remove explicit casts in call to
12660 XReadBitmapFileData.
12662 * images/arrows.xbm: made the arrays unsigned char *
12663 * images/varsz.xbm: ditto
12664 * images/misc.xbm: ditto
12665 * images/greek.xbm: ditto
12666 * images/dots.xbm: ditto
12667 * images/brel.xbm: ditto
12668 * images/bop.xbm: ditto
12670 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12672 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12673 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12674 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12676 (LYX_CXX_CHEADERS): added <clocale> to the test.
12678 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12680 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12682 * src/support/lyxstring.C (append): fixed something that must be a
12683 bug, rep->assign was used instead of rep->append.
12685 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12688 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12689 lyx insert double chars. Fix spotted by Kayvan.
12691 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12693 * Fixed the tth support. I messed up with the Emacs patch apply feature
12694 and omitted the changes in lyxrc.C.
12696 1999-10-22 Juergen Vigna <jug@sad.it>
12698 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12700 * src/lyx_cb.C (MenuInsertRef) +
12701 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12702 the form cannot be resized under it limits (fixes a segfault)
12704 * src/lyx.C (create_form_form_ref) +
12705 * forms/lyx.fd: Changed Gravity on name input field so that it is
12708 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12710 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12711 <ostream> and <istream>.
12713 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12714 whether <fstream> provides the latest standard features, or if we
12715 have an oldstyle library (like in egcs).
12716 (LYX_CXX_STL_STRING): fix the test.
12718 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12719 code on MODERN_STL_STREAM.
12721 * src/support/lyxstring.h: use L{I,O}stream.h.
12723 * src/support/L{I,O}stream.h: new files, designed to setup
12724 correctly streams for our use
12725 - includes the right header depending on STL capabilities
12726 - puts std::ostream and std::endl (for LOStream.h) or
12727 std::istream (LIStream.h) in toplevel namespace.
12729 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12731 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12732 was a bib file that had been changed we ensure that bibtex is run.
12733 (runBibTeX): enhanced to extract the names of the bib files and
12734 getting their absolute path and enter them into the dep file.
12735 (findtexfile): static func that is used to look for tex-files,
12736 checks for absolute patchs and tries also with kpsewhich.
12737 Alternative ways of finding the correct files are wanted. Will
12739 (do_popen): function that runs a command using popen and returns
12740 the whole output of that command in a string. Should be moved to
12743 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12744 file with extension ext has changed.
12746 * src/insets/figinset.C: added ifdef guards around the fl_free
12747 code that jug commented out. Now it is commented out when
12748 compiling with XForms == 0.89.
12750 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12751 to lyxstring.C, and only keep a forward declaration in
12752 lyxstring.h. Simplifies the header file a bit and should help a
12753 bit on compile time too. Also changes to Srep will not mandate a
12754 recompile of code just using string.
12755 (~lyxstring): definition moved here since it uses srep.
12756 (size): definition moved here since it uses srep.
12758 * src/support/lyxstring.h: removed a couple of "inline" that should
12761 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12763 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12766 1999-10-21 Juergen Vigna <jug@sad.it>
12768 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12769 set to left if I just remove the width entry (or it is empty).
12771 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12772 paragraph when having dummy paragraphs.
12774 1999-10-20 Juergen Vigna <jug@sad.it>
12776 * src/insets/figinset.C: just commented some fl_free_form calls
12777 and added warnings so that this calls should be activated later
12778 again. This avoids for now a segfault, but we have a memory leak!
12780 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12781 'const char * argument' to 'string argument', this should
12782 fix some Asserts() in lyxstring.C.
12784 * src/lyxfunc.h: Removed the function argAsString(const char *)
12785 as it is not used anymore.
12787 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12789 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12792 * src/Literate.h: some funcs moved from public to private to make
12793 interface clearer. Unneeded args removed.
12795 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12797 (scanBuildLogFile): ditto
12799 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12800 normal TeX Error. Still room for improvement.
12802 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12804 * src/buffer.C (insertErrors): changes to make the error
12805 desctription show properly.
12807 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12810 * src/support/lyxstring.C (helper): changed to use
12811 sizeof(object->rep->ref).
12812 (operator>>): changed to use a pointer instead.
12814 * src/support/lyxstring.h: changed const reference & to value_type
12815 const & lets see if that helps.
12817 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12819 * Makefile.am (rpmdist): fixed to have non static package and
12822 * src/support/lyxstring.C: removed the compilation guards
12824 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12827 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12828 conditional compile of lyxstring.Ch
12830 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12831 stupid check, but it is a lot better than the bastring hack.
12832 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12834 * several files: changed string::erase into string::clear. Not
12837 * src/chset.C (encodeString): use a char temporary instead
12839 * src/table.C (TexEndOfCell): added tostr around
12840 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12841 (TexEndOfCell): ditto
12842 (TexEndOfCell): ditto
12843 (TexEndOfCell): ditto
12844 (DocBookEndOfCell): ditto
12845 (DocBookEndOfCell): ditto
12846 (DocBookEndOfCell): ditto
12847 (DocBookEndOfCell): ditto
12849 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12851 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12853 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12854 (MenuBuildProg): added tostr around ret
12855 (MenuRunChktex): added tostr around ret
12856 (DocumentApplyCB): added tostr around ret
12858 * src/chset.C (encodeString): added tostr around t->ic
12860 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12861 (makeLaTeXFile): added tostr around tocdepth
12862 (makeLaTeXFile): added tostr around ftcound - 1
12864 * src/insets/insetbib.C (setCounter): added tostr around counter.
12866 * src/support/lyxstring.h: added an operator+=(int) to catch more
12869 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12870 (lyxstring): We DON'T allow NULL pointers.
12872 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12874 * src/mathed/math_macro.C (MathMacroArgument::Write,
12875 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12876 when writing them out.
12878 * src/LString.C: remove, since it is not used anymore.
12880 * src/support/lyxstring.C: condition the content to
12881 USE_INCLUDED_STRING macro.
12883 * src/mathed/math_symbols.C, src/support/lstrings.C,
12884 src/support/lyxstring.C: add `using' directive to specify what
12885 we need in <algorithm>. I do not think that we need to
12886 conditionalize this, but any thought is appreciated.
12888 * many files: change all callback functions to "C" linkage
12889 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12890 strict_ansi. Those who were static are now global.
12891 The case of callbacks which are static class members is
12892 trickier, since we have to make C wrappers around them (see
12893 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12894 did not finish this yet, since it defeats the purpose of
12895 encapsulation, and I am not sure what the best route is.
12897 1999-10-19 Juergen Vigna <jug@sad.it>
12899 * src/support/lyxstring.C (lyxstring): we permit to have a null
12900 pointer as assignment value and just don't assign it.
12902 * src/vspace.C (nextToken): corrected this function substituting
12903 find_first(_not)_of with find_last_of.
12905 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12906 (TableOptCloseCB) (TableSpeCloseCB):
12907 inserted fl_set_focus call for problem with fl_hide_form() in
12910 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12912 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12915 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12917 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12918 LyXLex::next() and not eatline() to get its argument.
12920 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12922 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12923 instead, use fstreams for io of the depfile, removed unneeded
12924 functions and variables.
12926 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12927 vector instead, removed all functions and variables that is not in
12930 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12932 * src/buffer.C (insertErrors): use new interface to TeXError
12934 * Makefile.am (rpmdist): added a rpmdist target
12936 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12937 per Kayvan's instructions.
12939 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12941 * src/Makefile.am: add a definition for localedir, so that locales
12942 are found after installation (Kayvan)
12944 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12946 * development/.cvsignore: new file.
12948 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12950 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12951 C++ compiler provides wrappers for C headers and use our alternate
12954 * configure.in: use LYX_CXX_CHEADERS.
12956 * src/cheader/: new directory, populated with cname headers from
12957 libstdc++-2.8.1. They are a bit old, but probably good enough for
12958 what we want (support compilers who lack them).
12960 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12961 from includes. It turns out is was stupid.
12963 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12965 * lib/Makefile.am (install-data-local): forgot a ';'
12966 (install-data-local): forgot a '\'
12967 (libinstalldirs): needed after all. reintroduced.
12969 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12971 * configure.in (AC_OUTPUT): added lyx.spec
12973 * development/lyx.spec: removed file
12975 * development/lyx.spec.in: new file
12977 * po/*.po: merged with lyx.pot becuase of make distcheck
12979 * lib/Makefile.am (dist-hook): added dist-hook so that
12980 documentation files will be included when doing a make
12981 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12982 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12984 more: tried to make install do the right thing, exclude CVS dirs
12987 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12988 Path would fit in more nicely.
12990 * all files that used to use pathstack: uses now Path instead.
12991 This change was a lot easier than expected.
12993 * src/support/path.h: new file
12995 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12997 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12999 * src/support/lyxstring.C (getline): Default arg was given for
13002 * Configure.cmd: removed file
13004 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13006 * src/support/DebugStream.[Ch]: remove the explicit std:: before
13007 streams classes and types, add the proper 'using' statements when
13008 MODERN_STL is defined.
13010 * src/debug.h: move the << operator definition after the inclusion
13013 * src/support/filetools.C: include "LAssert.h", which is needed
13016 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
13019 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
13020 include "debug.h" to define a proper ostream.
13022 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
13024 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
13025 method to the SystemCall class which can kill a process, but it's
13026 not fully implemented yet.
13028 * src/*.C: Changed Systemcalls::Startscript() to startscript()
13030 * src/support/FileInfo.h: Better documentation
13032 * src/lyxfunc.C: Added support for buffer-export html
13034 * src/menus.C: Added Export->As HTML...
13036 * lib/bind/*.bind: Added short-cut for buffer-export html
13038 * src/lyxrc.*: Added support for new \tth_command
13040 * lib/lyxrc.example: Added stuff for new \tth_command
13042 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13044 * lib/Makefile.am (IMAGES): removed images/README
13045 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13046 installes in correct place. Check permisions is installed
13049 * src/LaTeX.C: some no-op changes moved declaration of some
13052 * src/LaTeX.h (LATEX_H): changed include guard name
13054 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13056 * lib/reLyX/Makefile.am: install noweb2lyx.
13058 * lib/Makefile.am: install configure.
13060 * lib/reLyX/configure.in: declare a config aux dir; set package
13061 name to lyx (not sure what the best solution is); generate noweb2lyx.
13063 * lib/layouts/egs.layout: fix the bibliography layout.
13065 1999-10-08 Jürgen Vigna <jug@sad.it>
13067 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13068 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13069 it returned without continuing to search the path.
13071 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13073 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13074 also fixes a bug. It is not allowed to do tricks with std::strings
13075 like: string a("hei"); &a[e]; this will not give what you
13076 think... Any reason for the complexity in this func?
13078 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13080 * Updated README and INSTALL a bit, mostly to check that my
13081 CVS rights are correctly set up.
13083 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13085 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13086 does not allow '\0' chars but lyxstring and std::string does.
13088 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13090 * autogen.sh (AUTOCONF): let the autogen script create the
13091 POTFILES.in file too. POTFILES.in should perhaps now not be
13092 included in the cvs module.
13094 * some more files changed to use C++ includes instead of C ones.
13096 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13098 (Reread): added tostr to nlink. buggy output otherwise.
13099 (Reread): added a string() around szMode when assigning to Buffer,
13100 without this I got a log of garbled info strings.
13102 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13105 * I have added several ostream & operator<<(ostream &, some_type)
13106 functions. This has been done to avoid casting and warnings when
13107 outputting enums to lyxerr. This as thus eliminated a lot of
13108 explicit casts and has made the code clearer. Among the enums
13109 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13110 mathed enums, some font enum the Debug::type enum.
13112 * src/support/lyxstring.h (clear): missing method. equivalent of
13115 * all files that contained "stderr": rewrote constructs that used
13116 stderr to use lyxerr instead. (except bmtable)
13118 * src/support/DebugStream.h (level): and the passed t with
13119 Debug::ANY to avoid spurious bits set.
13121 * src/debug.h (Debug::type value): made it accept strings of the
13122 type INFO,INIT,KEY.
13124 * configure.in (Check for programs): Added a check for kpsewhich,
13125 the latex generation will use this later to better the dicovery of
13128 * src/BufferView.C (create_view): we don't need to cast this to
13129 (void*) that is done automatically.
13130 (WorkAreaButtonPress): removed some dead code.
13132 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13134 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13135 is not overwritten when translated (David Sua'rez de Lis).
13137 * lib/CREDITS: Added David Sua'rez de Lis
13139 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13141 * src/bufferparams.C (BufferParams): default input encoding is now
13144 * acinclude.m4 (cross_compiling): comment out macro
13145 LYX_GXX_STRENGTH_REDUCE.
13147 * acconfig.h: make sure that const is not defined (to empty) when
13148 we are compiling C++. Remove commented out code using SIZEOF_xx
13151 * configure.in : move the test for const and inline as late as
13152 possible so that these C tests do not interefere with C++ ones.
13153 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13154 has not been proven.
13156 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13158 * src/table.C (getDocBookAlign): remove bad default value for
13159 isColumn parameter.
13161 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13163 (ShowFileMenu2): ditto.
13165 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13166 of files to ignore.
13168 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13170 * Most files: finished the change from the old error code to use
13171 DebugStream for all lyxerr debugging. Only minor changes remain
13172 (e.g. the setting of debug levels using strings instead of number)
13174 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13176 * src/layout.C (Add): Changed to use compare_no_case instead of
13179 * src/FontInfo.C: changed loop variable type too string::size_type.
13181 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13183 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13184 set ETAGS_ARGS to --c++
13186 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13188 * src/table.C (DocBookEndOfCell): commented out two unused variables
13190 * src/paragraph.C: commented out four unused variables.
13192 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13193 insed a if clause with type string::size_type.
13195 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13198 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13200 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13201 variable, also changed loop to go from 0 to lenght + 1, instead of
13202 -1 to length. This should be correct.
13204 * src/LaTeX.C (scanError): use string::size_type as loop variable
13207 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13208 (l.896) since y_tmp and row was not used anyway.
13210 * src/insets/insetref.C (escape): use string::size_type as loop
13213 * src/insets/insetquotes.C (Width): use string::size_type as loop
13215 (Draw): use string::size_type as loop variable type.
13217 * src/insets/insetlatexaccent.C (checkContents): use
13218 string::size_type as loop variable type.
13220 * src/insets/insetlabel.C (escape): use string::size_type as loop
13223 * src/insets/insetinfo.C: added an extern for current_view.
13225 * src/insets/insetcommand.C (scanCommand): use string::size_type
13226 as loop variable type.
13228 * most files: removed the RCS tags. With them we had to recompile
13229 a lot of files after a simple cvs commit. Also we have never used
13230 them for anything meaningful.
13232 * most files: tags-query-replace NULL 0. As adviced several plases
13233 we now use "0" instead of "NULL" in our code.
13235 * src/support/filetools.C (SpaceLess): use string::size_type as
13236 loop variable type.
13238 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13240 * src/paragraph.C: fixed up some more string stuff.
13242 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13244 * src/support/filetools.h: make modestr a std::string.
13246 * src/filetools.C (GetEnv): made ch really const.
13248 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13249 made code that used these use max/min from <algorithm> instead.
13251 * changed several c library include files to their equivalent c++
13252 library include files. All is not changed yet.
13254 * created a support subdir in src, put lyxstring and lstrings
13255 there + the extra files atexit, fileblock, strerror. Created
13256 Makefile.am. edited configure.in and src/Makefile.am to use this
13257 new subdir. More files moved to support.
13259 * imported som of the functions from repository lyx, filetools
13261 * ran tags-query-replace on LString -> string, corrected the bogus
13262 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13263 is still some errors in there. This is errors where too much or
13264 too litle get deleted from strings (string::erase, string::substr,
13265 string::replace), there can also be some off by one errors, or
13266 just plain wrong use of functions from lstrings. Viewing of quotes
13269 * LyX is now running fairly well with string, but there are
13270 certainly some bugs yet (see above) also string is quite different
13271 from LString among others in that it does not allow null pointers
13272 passed in and will abort if it gets any.
13274 * Added the revtex4 files I forgot when setting up the repository.
13276 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13278 * All over: Tried to clean everything up so that only the files
13279 that we really need are included in the cvs repository.
13280 * Switched to use automake.
13281 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13282 * Install has not been checked.
13284 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13286 * po/pt.po: Three errors:
13287 l.533 and l.538 format specification error
13288 l. 402 duplicate entry, I just deleted it.