1 2000-10-02 Juergen Vigna <jug@sad.it>
3 * src/insets/insettext.C (SetFont): better support.
5 * src/insets/insettabular.C (draw): fixed drawing of single cell.
7 * src/screen.C (DrawOneRow): some uint refixes!
9 2000-10-02 Allan Rae <rae@lyx.org>
11 * boost/.cvsignore: ignore Makefile as well
13 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
14 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
16 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
17 Left this one out by accident.
19 * src/frontends/xforms/FormBase.h (restore): default to calling
20 update() since that will restore the original/currently-applied values.
21 Any input() triggered error messages will require the derived classes
22 to redefine restore().
24 * src/frontends/xforms/FormDocument.C: initialize a few variables to
25 avoid a segfault. combo_doc_class is the main concern.
27 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
29 * Simplify build-listerrors in view of GUI-less export ability!
31 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
33 * src/lyx_main.C (easyParse): Disable gui when exporting
35 * src/insets/figinset.C:
39 * src/tabular.C: Changes to allow no-gui.
41 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
43 * src/support/utility.hpp: removed file
44 * src/support/block.h: removed file
46 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
49 * src/mathed/formula.C: add support/lyxlib.h
50 * src/mathed/formulamacro.C: ditto
52 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
53 * src/lyxparagraph.h: ditto
55 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
56 * src/frontends/Makefile.am (INCLUDES): ditto
57 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
58 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
59 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
60 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
61 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
62 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
64 * src/BufferView.h: use boost/utility.hpp
67 * src/LyXAction.h: ditto
68 * src/LyXView.h: ditto
69 * src/bufferlist.h: ditto
70 * src/lastfiles.h: ditto
72 * src/lyx_gui.h: ditto
73 * src/lyx_main.h: ditto
76 * src/frontends/ButtonPolicies.h: ditto
77 * src/frontends/Dialogs.h: ditto
78 * src/frontends/xforms/FormBase.h: ditto
79 * src/frontends/xforms/FormGraphics.h: ditto
80 * src/frontends/xforms/FormParagraph.h: ditto
81 * src/frontends/xforms/FormTabular.h: ditto
82 * src/graphics/GraphicsCache.h: ditto
83 * src/graphics/Renderer.h: ditto
84 * src/insets/ExternalTemplate.h: ditto
85 * src/insets/insetcommand.h: ditto
86 * src/support/path.h: ditto
88 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
89 and introduce clause for 2.97.
91 * boost/libs/README: new file
93 * boost/boost/utility.hpp: new file
95 * boost/boost/config.hpp: new file
97 * boost/boost/array.hpp: new file
99 * boost/Makefile.am: new file
101 * boost/.cvsignore: new file
103 * configure.in (AC_OUTPUT): add boost/Makefile
105 * Makefile.am (SUBDIRS): add boost
107 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
109 * src/support/lstrings.C (suffixIs): Fixed.
111 2000-10-01 Allan Rae <rae@lyx.org>
113 * src/PrinterParams.h: moved things around to avoid the "can't
114 inline call" warning.
116 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
117 into doc++ documentation.
119 * src/frontends/xforms/FormCommand.[Ch]: support button policy
121 * src/frontends/xforms/FormRef.C: make use of button controller
122 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
123 cleaned up button controller usage.
124 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
125 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
126 use the button controller
128 * src/frontends/xforms/forms/*.fd: and associated generated files
129 updated to reflect changes to FormBase. Some other FormXxxx files
130 also got minor updates to reflect changes to FormBase.
132 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
133 (hide): made virtual.
134 (input): return a bool. true == valid input
135 (RestoreCB, restore): new
136 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
137 Changes to allow derived dialogs to use a ButtonController and
138 make sense when doing so: OK button calls ok() and so on.
140 * src/frontends/xforms/ButtonController.h (class ButtonController):
141 Switch from template implementation to taking Policy parameter.
142 Allows FormBase to provide a ButtonController for any dialog.
144 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
145 Probably should rename connect and disconnect.
146 (apply): use the radio button groups
147 (form): needed by FormBase
148 (build): setup the radio button groups
150 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
152 * several files: type canges to reduce the number of warnings and
153 to unify type hangling a bit. Still much to do.
155 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
157 * lib/images/*: rename a bunch of icons to match Dekel converter
160 * src/buffer.C (SimpleLinuxDocOnePar): add a const qualifier to
163 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
165 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
167 * sigc++/handle.h: ditto for class Handle.
169 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
171 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
173 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
175 * src/intl.C (InitKeyMapper): Correct the value of n due to the
176 removal of the "default" language.
178 * src/combox.h (getline): Check that sel > 0
180 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
182 * lib/examples/docbook_example.lyx
183 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
185 * lib/layouts/docbook-book.layout: new docbook book layout.
187 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
189 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
191 * src/insets/figinset.C (DocBook):fixed small typo.
193 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
195 * src/insets/insetinclude.h: string include_label doesn't need to be
198 2000-09-29 Allan Rae <rae@lyx.org>
200 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
201 Allow derived type to control connection and disconnection from signals
202 of its choice if desired.
204 2000-09-28 Juergen Vigna <jug@sad.it>
206 * src/insets/insettabular.C (update): fixed cursor setting when
207 the_locking_inset changed.
208 (draw): made this a bit cleaner.
209 (InsetButtonPress): fixed!
211 * various files: added LyXText Parameter to fitCursor call.
213 * src/BufferView.C (fitCursor): added LyXText parameter.
215 * src/insets/insettabular.C (draw): small draw fix.
217 * src/tabular.C: right setting of left/right celllines.
219 * src/tabular.[Ch]: fixed various types in funcions and structures.
220 * src/insets/insettabular.C: ditto
221 * src/frontends/xforms/FormTabular.C: ditto
223 2000-09-28 Allan Rae <rae@lyx.org>
225 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
226 that the #ifdef's had been applied to part of what should have been
227 a complete condition. It's possible there are other tests that
228 were specific to tables that are also wrong now that InsetTabular is
229 being used. Now we need to fix the output of '\n' after a table in a
230 float for the same reason as the original condition:
231 "don't insert this if we would be adding it before or after a table
232 in a float. This little trick is needed in order to allow use of
233 tables in \subfigures or \subtables."
234 Juergen can you check this?
236 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
238 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
239 outputed to the ostream.
241 * several files: fixed types based on warnings from cxx
243 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
245 * src/frontends/kde/Makefile.am: fix rule for
246 formindexdialogdata_moc.C
248 * src/.cvsignore: add ext_l10n.h to ignore
250 * acconfig.h: stop messing with __STRICT_ANSI__
251 * config/gnome.m4: remove option to set -ansi
252 * config/kde.m4: remove option to set -ansi
253 * config/lyxinclude.m4: don't set -ansi
255 2000-09-27 Juergen Vigna <jug@sad.it>
257 * various files: remove "default" language check.
259 * src/insets/insetquotes.C: removed use of current_view.
261 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
262 the one should have red ears by now!
264 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
265 in more then one paragraph. Fixed cursor-movement/selection.
267 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
268 paragraphs inside a text inset.
270 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
271 text-inset if this owner is an inset.
273 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
275 * src/Bullet.h: changed type of font, character and size to int
277 * src/buffer.C (asciiParagraph): remove actcell and fname1.
279 * src/insets/inseturl.[Ch]:
280 * src/insets/insetref.[Ch]:
281 * src/insets/insetlabel.[Ch]: add linelen to Ascii
283 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
285 * src/buffer.C (readFile): block-if statement rearranged to minimise
286 bloat. Patch does not reverse Jean-Marc's change ;-)
288 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
289 Class rewritten to store pointers to hide/update signals directly,
290 rather than Dialogs *. Also defined an enum to ease use. All xforms
291 forms can now be derived from this class.
293 * src/frontends/xforms/FormCommand.[Ch]
294 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
296 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
299 * src/frontends/xforms/forms/form_citation.fd
300 * src/frontends/xforms/forms/form_copyright.fd
301 * src/frontends/xforms/forms/form_error.fd
302 * src/frontends/xforms/forms/form_index.fd
303 * src/frontends/xforms/forms/form_ref.fd
304 * src/frontends/xforms/forms/form_toc.fd
305 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
307 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
309 * src/insets/insetfoot.C: removed redundent using directive.
311 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
313 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
314 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
316 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
317 created in the constructors in different groups. Then set() just
318 have to show the groups as needed. This fixes the redraw problems
319 (and is how the old menu code worked).
321 * src/support/lyxlib.h: declare the methods as static when we do
324 2000-09-26 Juergen Vigna <jug@sad.it>
326 * src/buffer.C (asciiParagraph): new function.
327 (writeFileAscii): new function with parameter ostream.
328 (writeFileAscii): use now asciiParagraph.
330 * various inset files: added the linelen parameter to the Ascii-func.
332 * src/tabular.C (Write): fixed error in writing file introduced by
333 the last changes from Lars.
335 * lib/bind/menus.bind: removed not supported functions.
337 * src/insets/insettext.C (Ascii): implemented this function.
339 * src/insets/lyxinset.h (Ascii): added linelen parameter.
341 * src/tabular.C (write_attribute[int,string,bool]): new functions.
342 (Write): use of the write_attribute functions.
344 * src/bufferlist.C (close): fixed reasking question!
346 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
348 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
349 new files use the everwhere possible.
352 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
353 src/log_form.C src/lyx.C:
356 * src/buffer.C (runLaTeX): remove func
358 * src/PaperLayout.C: removed file
359 * src/ParagraphExtra.C: likewise
360 * src/bullet_forms.C: likewise
361 * src/bullet_forms.h: likewise
362 * src/bullet_forms_cb.C: likewise
364 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
365 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
368 * several files: remove all traces of the old fd_form_paragraph,
369 and functions belonging to that.
371 * several files: remove all traces of the old fd_form_document,
372 and functions belonging to that.
374 * several files: constify local variables were possible.
376 * several files: remove all code that was dead when NEW_EXPORT was
379 * several files: removed string::c_str in as many places as
382 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
383 (e): be a bit more outspoken when patching
384 (updatesrc): only move files if changed.
386 * forms/layout_forms.h.patch: regenerated
388 * forms/layout_forms.fd: remove form_document and form_paragraph
389 and form_quotes and form_paper and form_table_options and
392 * forms/form1.fd: remove form_table
394 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
395 the fdui->... rewrite. Update some comments to xforms 0.88
397 * forms/bullet_forms.C.patch: removed file
398 * forms/bullet_forms.fd: likewise
399 * forms/bullet_forms.h.patch: likewise
401 * development/Code_rules/Rules: added a section on switch
402 statements. Updated some comment to xforms 0.88.
404 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
406 * src/buffer.C (readFile): make sure that the whole version number
407 is read after \lyxformat (even when it contains a comma)
409 * lib/ui/default.ui: change shortcut of math menu to M-a.
411 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
413 * src/vspace.C (nextToken): use isStrDbl() to check for proper
416 * src/LyXView.C (updateWindowTitle): show the full files name in
417 window title, limited to 30 characters.
419 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
420 When a number of characters has been given, we should not assume
421 that the string is 0-terminated.
423 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
424 calls (fixes some memory leaks)
426 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
427 trans member on exit.
429 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
431 * src/converter.C (GetReachable): fix typo.
433 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
434 understand ',' instead of '.'.
435 (GetInteger): rewrite to use strToInt().
437 2000-09-26 Juergen Vigna <jug@sad.it>
439 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
440 better visibility and error-message on wrong VSpace input.
442 * src/language.C (initL): added english again.
444 2000-09-25 Juergen Vigna <jug@sad.it>
446 * src/frontends/kde/Dialogs.C (Dialogs):
447 * src/frontends/gnome/Dialogs.C (Dialogs):
448 * src/frontends/kde/Makefile.am:
449 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
451 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
453 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
455 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
457 * src/frontends/xforms/FormParagraph.C:
458 * src/frontends/xforms/FormParagraph.h:
459 * src/frontends/xforms/form_paragraph.C:
460 * src/frontends/xforms/form_paragraph.h:
461 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
464 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
466 * src/tabular.C (OldFormatRead): forgot to delete the temporary
467 Paragraph-Data after use.
469 * src/insets/insettext.C (LocalDispatch): don't set the layout on
470 non breakable paragraphs.
472 2000-09-25 Garst R. Reese <reese@isn.net>
474 * src/language.C (initL): added missing language_country codes.
476 2000-09-25 Juergen Vigna <jug@sad.it>
478 * src/insets/insettext.C (InsetText):
479 (deleteLyXText): remove the not released LyXText structure!
481 2000-09-24 Marko Vendelin <markov@ioc.ee>
483 * src/frontends/gnome/mainapp.C
484 * src/frontends/gnome/mainapp.h: added support for keyboard
487 * src/frontends/gnome/FormCitation.C
488 * src/frontends/gnome/FormCitation.h
489 * src/frontends/gnome/Makefile.am
490 * src/frontends/gnome/pixbutton.h: completed the rewrite of
491 FormCitation to use "action area" in mainapp window
493 * src/frontends/gnome/Menubar_pimpl.C
494 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
497 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
499 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
500 width/descent/ascent values if name is empty.
501 (mathed_string_height): Use std::max.
503 2000-09-25 Allan Rae <rae@lyx.org>
505 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
506 segfault. This will be completely redesigned soon.
508 * sigc++: updated libsigc++. Fixes struct timespec bug.
510 * development/tools/makeLyXsigc.sh: .cvsignore addition
512 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
514 * several files: removed almost all traces of the old table
517 * src/TableLayout.C: removed file
519 2000-09-22 Juergen Vigna <jug@sad.it>
521 * src/frontends/kde/Dialogs.C: added credits forms.
523 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
525 * src/frontends/gnome/Dialogs.C: added some forms.
527 * src/spellchecker.C (init_spell_checker): set language in pspell code
528 (RunSpellChecker): some modifications for setting language string.
530 * src/language.[Ch]: added language_country code.
532 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
534 * src/frontends/Dialogs.h: added new signal showError.
535 Rearranged existing signals in some sort of alphabetical order.
537 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
538 FormError.[Ch], form_error.[Ch]
539 * src/frontends/xforms/forms/makefile: added new file form_error.fd
540 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
542 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
543 dialogs. I think that this can be used as the base to all these
546 * src/frontends/xforms/FormError.[Ch]
547 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
548 implementation of InsetError dialog.
550 * src/insets/inseterror.[Ch]: rendered GUI-independent.
552 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
553 * src/frontends/kde/Makefile.am: ditto
555 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
557 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
558 macrobf. This fixes a bug of invisible text.
560 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
562 * lib/doc/LaTeXConfig.lyx.in: updated.
564 * src/language.C (initL): remove language "francais" and change a
565 bit the names of the two other french variations.
567 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
568 string that may not be 0-terminated.
570 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
572 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
574 2000-09-20 Marko Vendelin <markov@ioc.ee>
576 * src/frontends/gnome/FormCitation.C
577 * src/frontends/gnome/FormIndex.C
578 * src/frontends/gnome/FormToc.C
579 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
580 the variable initialization to shut up the warnings
582 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
584 * src/table.[Ch]: deleted files
586 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
589 2000-09-18 Juergen Vigna <jug@sad.it>
591 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
592 problems with selection. Inserted new LFUN_PASTESELECTION.
593 (InsetButtonPress): inserted handling of middle mouse-button paste.
595 * src/spellchecker.C: changed word to word.c_str().
597 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
599 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
600 included in the ``make dist'' tarball.
602 2000-09-15 Juergen Vigna <jug@sad.it>
604 * src/CutAndPaste.C (cutSelection): small fix return the right
605 end position after cut inside one paragraph only.
607 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
608 we are locked as otherwise we don't have a valid cursor position!
610 * src/insets/figinset.C (draw): small bugfix but why is this needed???
612 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
614 * src/frontends/kde/FormRef.C: added using directive.
615 * src/frontends/kde/FormToc.C: ditto
617 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
619 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
621 2000-09-19 Marko Vendelin <markov@ioc.ee>
623 * src/frontends/gnome/Menubar_pimpl.C
624 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
625 Toc, ViewFormats, UpdateFormats, and ExportFormats.
627 * src/frontends/gnome/mainapp.C
628 * src/frontends/gnome/mainapp.h: support for menu update used
631 * src/frontends/gnome/mainapp.C
632 * src/frontends/gnome/mainapp.h: support for "action" area in the
633 main window. This area is used by small simple dialogs, such as
636 * src/frontends/gnome/FormIndex.C
637 * src/frontends/gnome/FormIndex.h
638 * src/frontends/gnome/FormUrl.C
639 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
642 * src/frontends/gnome/FormCitation.C
643 * src/frontends/gnome/FormCitation.h: rewrite to use main window
644 action area. Only "Insert new citation" is implemented.
646 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
648 * src/buffer.C (Dispatch): fix call to Dispatch
649 * src/insets/insetref.C (Edit): likewise
650 * src/insets/insetparent.C (Edit): likewise
651 * src/insets/insetinclude.C (include_cb): likewise
652 * src/frontends/xforms/FormUrl.C (apply): likewise
653 * src/frontends/xforms/FormToc.C (apply): likewise
654 * src/frontends/xforms/FormRef.C (apply): likewise
655 * src/frontends/xforms/FormIndex.C (apply): likewise
656 * src/frontends/xforms/FormCitation.C (apply): likewise
657 * src/lyxserver.C (callback): likewise
658 * src/lyxfunc.C (processKeySym): likewise
661 * src/lyx_cb.C (LayoutsCB): likewise
663 * Makefile.am (sourcedoc): small change
665 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
667 * src/main.C (main): Don't make an empty GUIRunTime object. all
668 methods are static. constify a bit remove unneded using + headers.
670 * src/tabular.C: some more const to local vars move some loop vars
672 * src/spellchecker.C: added some c_str after some word for pspell
674 * src/frontends/GUIRunTime.h: add new static method setDefaults
675 * src/frontends/xforms/GUIRunTime.C (setDefaults):
676 * src/frontends/kde/GUIRunTime.C (setDefaults):
677 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
679 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
680 with strnew in arg, use correct emptystring when calling SetName.
682 * several files: remove all commented code with relation to
683 HAVE_SSTREAM beeing false. We now only support stringstream and
686 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
688 * src/lyxfunc.C: construct correctly the automatic new file
691 * src/text2.C (IsStringInText): change type of variable i to shut
694 * src/support/sstream.h: do not use namespaces if the compiler
695 does not support them.
697 2000-09-15 Marko Vendelin <markov@ioc.ee>
698 * src/frontends/gnome/FormCitation.C
699 * src/frontends/gnome/FormCitation.h
700 * src/frontends/gnome/diainsertcitation_interface.c
701 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
702 regexp support to FormCitation [Gnome].
704 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
707 * configure.in: remove unused KDE/GTKGUI define
709 * src/frontends/kde/FormRef.C
710 * src/frontends/kde/FormRef.h
711 * src/frontends/kde/formrefdialog.C
712 * src/frontends/kde/formrefdialog.h: double click will
713 go to reference, now it is possible to change a cross-ref
716 * src/frontends/kde/FormToc.C
717 * src/frontends/kde/FormToc.h
718 * src/frontends/kde/formtocdialog.C
719 * src/frontends/kde/formtocdialog.h: add a depth
722 * src/frontends/kde/Makefile.am: add QtLyXView.h
725 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
727 * src/frontends/kde/FormCitation.h: added some using directives.
729 * src/frontends/kde/FormToc.h: corrected definition of doTree.
731 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
734 * src/mathed/math_defs.h: redefine SetAlign to use string rather
737 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
739 * src/buffer.C (pop_tag): revert for the second time a change by
740 Lars, who seems to really hate having non-local loop variables :)
742 * src/Lsstream.h: add "using" statements.
744 * src/support/copy.C (copy): add a bunch of std:: qualifiers
745 * src/buffer.C (writeFile): ditto
747 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
749 * src/buffer.C (writeFile): try to fix the locale modified format
750 number to always be as we want it.
752 * src/WorkArea.C (work_area_handler): try to workaround the bugs
753 in XForms 0.89. C-space is now working again.
755 * src/Lsstream.h src/support/sstream.h: new files.
757 * also commented out all cases where strstream were used.
759 * src/Bullet.h (c_str): remove method.
761 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
763 * a lot of files: get rid of "char const *" and "char *" is as
764 many places as possible. We only want to use them in interaction
765 with system of other libraries, not inside lyx.
767 * a lot of files: return const object is not of pod type. This
768 helps ensure that temporary objects is not modified. And fits well
769 with "programming by contract".
771 * configure.in: check for the locale header too
773 * Makefile.am (sourcedoc): new tag for generation of doc++
776 2000-09-14 Juergen Vigna <jug@sad.it>
778 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
779 callback to check which combo called it and do the right action.
781 * src/combox.C (combo_cb): added combo * to the callbacks.
782 (Hide): moved call of callback after Ungrab of the pointer.
784 * src/intl.h: removed LCombo2 function.
786 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
787 function as this can now be handled in one function.
789 * src/combox.h: added Combox * to callback prototype.
791 * src/frontends/xforms/Toolbar_pimpl.C:
792 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
794 2000-09-14 Garst Reese <reese@isn.net>
796 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
797 moved usepackage{xxx}'s to beginning of file. Changed left margin
798 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
799 underlining from title. Thanks to John Culleton for useful suggestions.
801 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
803 * src/lyxlex_pimpl.C (setFile): change error message to debug
806 2000-09-13 Juergen Vigna <jug@sad.it>
808 * src/frontends/xforms/FormDocument.C: implemented choice_class
809 as combox and give callback to combo_language so OK/Apply is activated
812 * src/bufferlist.C (newFile): small fix so already named files
813 (via an open call) are not requested to be named again on the
816 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
818 * src/frontends/kde/Makefile.am
819 * src/frontends/kde/FormRef.C
820 * src/frontends/kde/FormRef.h
821 * src/frontends/kde/formrefdialog.C
822 * src/frontends/kde/formrefdialog.h: implement
825 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
827 * src/frontends/kde/formtocdialog.C
828 * src/frontends/kde/formtocdialog.h
829 * src/frontends/kde/FormToc.C
830 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
832 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
834 * src/frontends/kde/FormCitation.C: fix thinko
835 where we didn't always display the reference text
838 * src/frontends/kde/formurldialog.C
839 * src/frontends/kde/formurldialog.h
840 * src/frontends/kde/FormUrl.C
841 * src/frontends/kde/FormUrl.h: minor cleanups
843 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
845 * src/frontends/kde/Makefile.am
846 * src/frontends/kde/FormToc.C
847 * src/frontends/kde/FormToc.h
848 * src/frontends/kde/FormCitation.C
849 * src/frontends/kde/FormCitation.h
850 * src/frontends/kde/FormIndex.C
851 * src/frontends/kde/FormIndex.h
852 * src/frontends/kde/formtocdialog.C
853 * src/frontends/kde/formtocdialog.h
854 * src/frontends/kde/formcitationdialog.C
855 * src/frontends/kde/formcitationdialog.h
856 * src/frontends/kde/formindexdialog.C
857 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
859 2000-09-12 Juergen Vigna <jug@sad.it>
861 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
864 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
866 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
869 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
871 * src/converter.C (Add, Convert): Added support for converter flags:
872 needaux, resultdir, resultfile.
873 (Convert): Added new parameter view_file.
874 (dvips_options): Fixed letter paper option.
876 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
877 (Export, GetExportableFormats, GetViewableFormats): Added support
880 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
882 (easyParse): Fixed to work with new export code.
884 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
887 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
889 * lib/bind/*.bind: Replaced
890 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
891 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
893 2000-09-11 Juergen Vigna <jug@sad.it>
895 * src/lyx_gui.C (runTime): uses global guiruntime variable.
897 * src/main.C (main): now GUII defines global guiruntime!
899 * src/frontends/gnome/GUIRunTime.C (initApplication):
900 * src/frontends/kde/GUIRunTime.C (initApplication):
901 * src/frontends/xforms/GUIRunTime.C (initApplication):
902 * src/frontends/GUIRunTime.h: added new function initApplication.
904 * src/spellchecker.C (sc_accept_word): change to add_to_session.
906 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
908 2000-09-08 Juergen Vigna <jug@sad.it>
910 * src/lyx_gui.C (create_forms): don't display the "default" entry as
911 we have already "Reset".
913 * src/language.C (initL): inserted "default" language and made this
914 THE default language (and not american!)
916 * src/paragraph.C: inserted handling of "default" language!
918 * src/lyxfont.C: ditto
922 * src/paragraph.C: output the \\par only if we have a following
923 paragraph otherwise it's not needed.
925 2000-09-05 Juergen Vigna <jug@sad.it>
927 * config/pspell.m4: added entry to lyx-flags
929 * src/spellchecker.C: modified version from Kevin for using pspell
931 2000-09-01 Marko Vendelin <markov@ioc.ee>
932 * src/frontends/gnome/Makefile.am
933 * src/frontends/gnome/FormCitation.C
934 * src/frontends/gnome/FormCitation.h
935 * src/frontends/gnome/diainsertcitation_callbacks.c
936 * src/frontends/gnome/diainsertcitation_callbacks.h
937 * src/frontends/gnome/diainsertcitation_interface.c
938 * src/frontends/gnome/diainsertcitation_interface.h
939 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
940 dialog for Gnome frontend
942 * src/main.C: Gnome libraries require keeping application name
943 and its version as strings
945 * src/frontends/gnome/mainapp.C: Change the name of the main window
946 from GnomeLyX to PACKAGE
948 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
950 * src/frontends/Liason.C: add "using: declaration.
952 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
954 * src/mathed/math_macro.C (Metrics): Set the size of the template
956 * src/mathed/formulamacro.C (Latex): Fixed the returned value
958 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
960 * src/converter.C (add_options): New function.
961 (SetViewer): Change $$FName into '$$FName'.
962 (View): Add options when running xdvi
963 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
964 (Convert): The 3rd parameter is now the desired filename. Converts
965 calls to lyx::rename if necessary.
966 Add options when running dvips.
967 (dvi_papersize,dvips_options): New methods.
969 * src/exporter.C (Export): Use getLatexName() instead of fileName().
971 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
972 using a call to Converter::dvips_options.
973 Fixed to work with nex export code.
976 * src/support/rename.C: New files
978 * src/support/syscall.h
979 * src/support/syscall.C: Added Starttype SystemDontWait.
981 * lib/ui/default.ui: Changed to work with new export code
983 * lib/configure.m4: Changed to work with new export code
985 * src/encoding.C: Changed latex name for iso8859_7 encoding.
987 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
989 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
990 so that code compiles with DEC cxx.
992 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
993 to work correctly! Also now supports the additional elements
996 2000-09-01 Allan Rae <rae@lyx.org>
998 * src/frontends/ButtonPolicies.C: renamed all the references to
999 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1001 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1002 since it's a const not a type.
1004 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1006 2000-08-31 Juergen Vigna <jug@sad.it>
1008 * src/insets/figinset.C: Various changes to look if the filename has
1009 an extension and if not add it for inline previewing.
1011 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1013 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1014 make buttonStatus and isReadOnly be const methods. (also reflect
1015 this in derived classes.)
1017 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1018 (nextState): change to be static inline, pass the StateMachine as
1020 (PreferencesPolicy): remove casts
1021 (OkCancelPolicy): remvoe casts
1022 (OkCancelReadOnlyPolicy): remove casts
1023 (NoRepeatedApplyReadOnlyPolicy): remove casts
1024 (OkApplyCancelReadOnlyPolicy): remove casts
1025 (OkApplyCancelPolicy): remove casts
1026 (NoRepeatedApplyPolicy): remove casts
1028 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1030 * src/converter.C: added some using directives
1032 * src/frontends/ButtonPolicies.C: changes to overcome
1033 "need lvalue" error with DEC c++
1035 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1036 to WMHideCB for DEC c++
1038 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1040 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1041 to BulletBMTableCB for DEC c++
1043 2000-08-31 Allan Rae <rae@lyx.org>
1045 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1046 character dialog separately from old document dialogs combo_language.
1049 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1051 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1052 Removed LFUN_REF_CREATE.
1054 * src/MenuBackend.C: Added new tags: toc and references
1056 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1057 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1059 (add_toc, add_references): New methods.
1060 (create_submenu): Handle correctly the case when there is a
1061 seperator after optional menu items.
1063 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1064 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1065 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1067 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1069 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1071 * src/converter.[Ch]: New file for converting between different
1074 * src/export.[Ch]: New file for exporting a LyX file to different
1077 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1078 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1079 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1080 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1081 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1082 RunDocBook, MenuExport.
1084 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1085 Exporter::Preview methods if NEW_EXPORT is defined.
1087 * src/buffer.C (Dispatch): Use Exporter::Export.
1089 * src/lyxrc.C: Added new tags: \converter and \viewer.
1092 * src/LyXAction.C: Define new lyx-function: buffer-update.
1093 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1094 when NEW_EXPORT is defined.
1096 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1098 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1100 * lib/ui/default.ui: Added submenus "view" and "update" to the
1103 * src/filetools.C (GetExtension): New function.
1105 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1107 2000-08-29 Allan Rae <rae@lyx.org>
1109 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1111 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1112 (EnableDocumentLayout): removed
1113 (DisableDocumentLayout): removed
1114 (build): make use of ButtonController's read-only handling to
1115 de/activate various objects. Replaces both of the above functions.
1117 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1118 (readOnly): was read_only
1119 (refresh): fixed dumb mistakes with read_only_ handling
1121 * src/frontends/xforms/forms/form_document.fd:
1122 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1123 tabbed dialogs so the tabs look more like tabs and so its easier to
1124 work out which is the current tab.
1126 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1127 segfault with form_table
1129 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1131 2000-08-28 Juergen Vigna <jug@sad.it>
1133 * acconfig.h: added USE_PSPELL.
1135 * src/config.h.in: added USE_PSPELL.
1137 * autogen.sh: added pspell.m4
1139 * config/pspell.m4: new file.
1141 * src/spellchecker.C: implemented support for pspell libary.
1143 2000-08-25 Juergen Vigna <jug@sad.it>
1145 * src/LyXAction.C (init): renamed LFUN_TABLE to
1146 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1148 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1150 * src/lyxscreen.h: add force_clear variable and fuction to force
1151 a clear area when redrawing in LyXText.
1153 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1155 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1157 * some whitespace and comment changes.
1159 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1161 * src/buffer.C: up te LYX_FORMAT to 2.17
1163 2000-08-23 Juergen Vigna <jug@sad.it>
1165 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1168 * src/insets/insettabular.C (pasteSelection): delete the insets
1169 LyXText as it is not valid anymore.
1170 (copySelection): new function.
1171 (pasteSelection): new function.
1172 (cutSelection): new function.
1173 (LocalDispatch): implemented cut/copy/paste of cell selections.
1175 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1176 don't have a LyXText.
1178 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1180 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1183 2000-08-22 Juergen Vigna <jug@sad.it>
1185 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1186 ifdef form_table out if NEW_TABULAR.
1188 2000-08-21 Juergen Vigna <jug@sad.it>
1190 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1191 (draw): fixed draw position so that the cursor is positioned in the
1193 (InsetMotionNotify): hide/show cursor so the position is updated.
1194 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1195 using cellstart() function where it should be used.
1197 * src/insets/insettext.C (draw): ditto.
1199 * src/tabular.C: fixed initialization of some missing variables and
1200 made BoxType into an enum.
1202 2000-08-22 Marko Vendelin <markov@ioc.ee>
1203 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1204 stock menu item using action numerical value, not its string
1208 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1210 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1211 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1213 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1215 * src/frontends/xforms/GUIRunTime.C: new file
1217 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1218 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1220 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1222 * src/frontends/kde/GUIRunTime.C: new file
1224 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1225 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1227 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1229 * src/frontends/gnome/GUIRunTime.C: new file
1231 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1234 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1235 small change to documetentation.
1237 * src/frontends/GUIRunTime.C: removed file
1239 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1241 * src/lyxparagraph.h: enable NEW_TABULAR as default
1243 * src/lyxfunc.C (processKeySym): remove some commented code
1245 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1246 NEW_TABULAR around the fd_form_table_options.
1248 * src/lyx_gui.C (runTime): call the static member function as
1249 GUIRunTime::runTime().
1251 2000-08-21 Allan Rae <rae@lyx.org>
1253 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1256 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1258 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1260 2000-08-21 Allan Rae <rae@lyx.org>
1262 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1263 keep Garst happy ;-)
1264 * src/frontends/xforms/FormPreferences.C (build): use setOK
1265 * src/frontends/xforms/FormDocument.C (build): use setOK
1266 (FormDocument): use the appropriate policy.
1268 2000-08-21 Allan Rae <rae@lyx.org>
1270 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1271 automatic [de]activation of arbitrary objects when in a read-only state.
1273 * src/frontends/ButtonPolicies.h: More documentation
1274 (isReadOnly): added to support the above.
1276 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1278 2000-08-18 Juergen Vigna <jug@sad.it>
1280 * src/insets/insettabular.C (getStatus): changed to return func_status.
1282 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1283 display toggle menu entries if they are.
1285 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1286 new document layout now.
1288 * src/lyxfunc.C: ditto
1290 * src/lyx_gui_misc.C: ditto
1292 * src/lyx_gui.C: ditto
1294 * lib/ui/default.ui: removed paper and quotes layout as they are now
1295 all in the document layout tabbed folder.
1297 * src/frontends/xforms/forms/form_document.fd: added Restore
1298 button and callbacks for all inputs for Allan's ButtonPolicy.
1300 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1301 (CheckChoiceClass): added missing params setting on class change.
1302 (UpdateLayoutDocument): added for updating the layout on params.
1303 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1304 (FormDocument): Implemented Allan's ButtonPolicy with the
1307 2000-08-17 Allan Rae <rae@lyx.org>
1309 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1310 so we can at least see the credits again.
1312 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1313 controller calls for the appropriate callbacks. Note that since Ok
1314 calls apply followed by cancel, and apply isn't a valid input for the
1315 APPLIED state, the bc_ calls have to be made in the static callback not
1316 within each of the real callbacks.
1318 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1319 (setOk): renamed from setOkay()
1321 2000-08-17 Juergen Vigna <jug@sad.it>
1323 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1324 in the implementation part.
1325 (composeUIInfo): don't show optional menu-items.
1327 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1329 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1331 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1332 text-state when in a text-inset.
1334 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1336 2000-08-17 Marko Vendelin <markov@ioc.ee>
1337 * src/frontends/gnome/FormIndex.C
1338 * src/frontends/gnome/FormIndex.h
1339 * src/frontends/gnome/FormToc.C
1340 * src/frontends/gnome/FormToc.h
1341 * src/frontends/gnome/dialogs
1342 * src/frontends/gnome/diatoc_callbacks.c
1343 * src/frontends/gnome/diatoc_callbacks.h
1344 * src/frontends/gnome/diainsertindex_callbacks.h
1345 * src/frontends/gnome/diainsertindex_callbacks.c
1346 * src/frontends/gnome/diainsertindex_interface.c
1347 * src/frontends/gnome/diainsertindex_interface.h
1348 * src/frontends/gnome/diatoc_interface.h
1349 * src/frontends/gnome/diatoc_interface.c
1350 * src/frontends/gnome/Makefile.am: Table of Contents and
1351 Insert Index dialogs implementation for Gnome frontend
1353 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1355 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1357 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1360 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1362 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1363 destructor. Don't definde if you don't need it
1364 (processEvents): made static, non-blocking events processing for
1366 (runTime): static method. event loop for xforms
1367 * similar as above for kde and gnome.
1369 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1370 new Pimpl is correct
1371 (runTime): new method calss the real frontends runtime func.
1373 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1375 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1377 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1379 2000-08-16 Juergen Vigna <jug@sad.it>
1381 * src/lyx_gui.C (runTime): added GUII RunTime support.
1383 * src/frontends/Makefile.am:
1384 * src/frontends/GUIRunTime.[Ch]:
1385 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1386 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1387 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1389 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1391 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1392 as this is already set in ${FRONTEND_INCLUDE} if needed.
1394 * configure.in (CPPFLAGS): setting the include dir for the frontend
1395 directory and don't set FRONTEND=xforms for now as this is executed
1398 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1400 * src/frontends/kde/Makefile.am:
1401 * src/frontends/kde/FormUrl.C:
1402 * src/frontends/kde/FormUrl.h:
1403 * src/frontends/kde/formurldialog.h:
1404 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1406 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1408 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1410 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1412 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1415 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1417 * src/WorkArea.C (work_area_handler): more work to get te
1418 FL_KEYBOARD to work with xforms 0.88 too, please test.
1420 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1422 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1424 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1427 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1429 * src/Timeout.h: remove Qt::emit hack.
1431 * several files: changes to allo doc++ compilation
1433 * src/lyxfunc.C (processKeySym): new method
1434 (processKeyEvent): comment out if FL_REVISION < 89
1436 * src/WorkArea.C: change some debugging levels.
1437 (WorkArea): set wantkey to FL_KEY_ALL
1438 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1439 clearer code and the use of compose with XForms 0.89. Change to
1440 use signals instead of calling methods in bufferview directly.
1442 * src/Painter.C: change some debugging levels.
1444 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1447 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1448 (workAreaKeyPress): new method
1450 2000-08-14 Juergen Vigna <jug@sad.it>
1452 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1454 * config/kde.m4: addes some features
1456 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1457 include missing xforms dialogs.
1459 * src/Timeout.h: a hack to be able to compile with qt/kde.
1461 * sigc++/.cvsignore: added acinclude.m4
1463 * lib/.cvsignore: added listerros
1465 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1466 xforms tree as objects are needed for other frontends.
1468 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1469 linking with not yet implemented xforms objects.
1471 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1473 2000-08-14 Baruch Even <baruch.even@writeme.com>
1475 * src/frontends/xforms/FormGraphics.h:
1476 * src/frontends/xforms/FormGraphics.C:
1477 * src/frontends/xforms/RadioButtonGroup.h:
1478 * src/frontends/xforms/RadioButtonGroup.C:
1479 * src/insets/insetgraphics.h:
1480 * src/insets/insetgraphics.C:
1481 * src/insets/insetgraphicsParams.h:
1482 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1483 instead of spaces, and various other indentation issues to make the
1484 sources more consistent.
1486 2000-08-14 Marko Vendelin <markov@ioc.ee>
1488 * src/frontends/gnome/dialogs/diaprint.glade
1489 * src/frontends/gnome/FormPrint.C
1490 * src/frontends/gnome/FormPrint.h
1491 * src/frontends/gnome/diaprint_callbacks.c
1492 * src/frontends/gnome/diaprint_callbacks.h
1493 * src/frontends/gnome/diaprint_interface.c
1494 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1497 * src/frontends/gnome/dialogs/diainserturl.glade
1498 * src/frontends/gnome/FormUrl.C
1499 * src/frontends/gnome/FormUrl.h
1500 * src/frontends/gnome/diainserturl_callbacks.c
1501 * src/frontends/gnome/diainserturl_callbacks.h
1502 * src/frontends/gnome/diainserturl_interface.c
1503 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1504 Gnome implementation
1506 * src/frontends/gnome/Dialogs.C
1507 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1508 all other dialogs. Copy all unimplemented dialogs from Xforms
1511 * src/frontends/gnome/support.c
1512 * src/frontends/gnome/support.h: support files generated by Glade
1516 * config/gnome.m4: Gnome configuration scripts
1518 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1519 configure --help message
1521 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1522 only if there are no events pendling in Gnome/Gtk. This enhances
1523 the performance of menus.
1526 2000-08-14 Allan Rae <rae@lyx.org>
1528 * lib/Makefile.am: listerrors cleaning
1530 * lib/listerrors: removed -- generated file
1531 * acinclude.m4: ditto
1532 * sigc++/acinclude.m4: ditto
1534 * src/frontends/xforms/forms/form_citation.fd:
1535 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1538 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1539 `updatesrc` and now we have a `test` target that does what `updatesrc`
1540 used to do. I didn't like having an install target that wasn't related
1543 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1544 on all except FormGraphics. This may yet happen. Followed by a major
1545 cleanup including using FL_TRANSIENT for most of the dialogs. More
1546 changes to come when the ButtonController below is introduced.
1548 * src/frontends/xforms/ButtonController.h: New file for managing up to
1549 four buttons on a dialog according to an externally defined policy.
1550 * src/frontends/xforms/Makefile.am: added above
1552 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1553 Apply and Cancel/Close buttons and everything in between and beyond.
1554 * src/frontends/Makefile.am: added above.
1556 * src/frontends/xforms/forms/form_preferences.fd:
1557 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1558 and removed variable 'status' as a result. Fixed the set_minsize thing.
1559 Use the new screen-font-update after checking screen fonts were changed
1560 Added a "Restore" button to restore the original lyxrc values while
1561 editing. This restores everything not just the last input changed.
1562 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1564 * src/LyXAction.C: screen-font-update added for updating buffers after
1565 screen font settings have been changed.
1566 * src/commandtags.h: ditto
1567 * src/lyxfunc.C: ditto
1569 * forms/lyx.fd: removed screen fonts dialog.
1570 * src/lyx_gui.C: ditto
1571 * src/menus.[Ch]: ditto
1572 * src/lyx.[Ch]: ditto
1573 * src/lyx_cb.C: ditto + code from here moved to make
1574 screen-font-update. And people wonder why progress on GUII is
1575 slow. Look at how scattered this stuff was! It takes forever
1578 * forms/fdfix.sh: Fixup the spacing after commas.
1579 * forms/makefile: Remove date from generated files. Fewer clashes now.
1580 * forms/bullet_forms.C.patch: included someones handwritten changes
1582 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1583 once I've discovered why LyXRC was made noncopyable.
1584 * src/lyx_main.C: ditto
1586 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1588 * src/frontends/xforms/forms/fdfix.sh:
1589 * src/frontends/xforms/forms/fdfixh.sed:
1590 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1591 * src/frontends/xforms/Form*.[hC]:
1592 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1593 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1594 provide a destructor for the struct FD_form_xxxx. Another version of
1595 the set_[max|min]size workaround and a few other cleanups. Actually,
1596 Angus' patch from 20000809.
1598 2000-08-13 Baruch Even <baruch.even@writeme.com>
1600 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1603 2000-08-11 Juergen Vigna <jug@sad.it>
1605 * src/insets/insetgraphics.C (InsetGraphics): changing init
1606 order because of warnings.
1608 * src/frontends/xforms/forms/makefile: adding patching .C with
1611 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1612 from .C.patch to .c.patch
1614 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1615 order because of warning.
1617 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1619 * src/frontends/Liason.C (setMinibuffer): new helper function
1621 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1623 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1625 * lib/ui/default.ui: commented out PaperLayout entry
1627 * src/frontends/xforms/form_document.[Ch]: new added files
1629 * src/frontends/xforms/FormDocument.[Ch]: ditto
1631 * src/frontends/xforms/forms/form_document.fd: ditto
1633 * src/frontends/xforms/forms/form_document.C.patch: ditto
1635 2000-08-10 Juergen Vigna <jug@sad.it>
1637 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1638 (InsetGraphics): initialized cacheHandle to 0.
1639 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1641 2000-08-10 Baruch Even <baruch.even@writeme.com>
1643 * src/graphics/GraphicsCache.h:
1644 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1645 correctly as a cache.
1647 * src/graphics/GraphicsCacheItem.h:
1648 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1651 * src/graphics/GraphicsCacheItem_pimpl.h:
1652 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1655 * src/insets/insetgraphics.h:
1656 * src/insets/insetgraphics.C: Changed from using a signal notification
1657 to polling when image is not loaded.
1659 2000-08-10 Allan Rae <rae@lyx.org>
1661 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1662 that there are two functions that have to been taken out of line by
1663 hand and aren't taken care of in the script. (Just a reminder note)
1665 * sigc++/macros/*.h.m4: Updated as above.
1667 2000-08-09 Juergen Vigna <jug@sad.it>
1669 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1671 * src/insets/insettabular.C: make drawing of single cell smarter.
1673 2000-08-09 Marko Vendelin <markov@ioc.ee>
1674 * src/frontends/gnome/Menubar_pimpl.C
1675 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1676 implementation: new files
1678 * src/frontends/gnome/mainapp.C
1679 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1682 * src/main.C: create Gnome main window
1684 * src/frontends/xforms/Menubar_pimpl.h
1685 * src/frontends/Menubar.C
1686 * src/frontends/Menubar.h: added method Menubar::update that calls
1687 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1689 * src/LyXView.C: calls Menubar::update to update the state
1692 * src/frontends/gnome/Makefile.am: added new files
1694 * src/frontends/Makefile.am: added frontend compiler options
1696 2000-08-08 Juergen Vigna <jug@sad.it>
1698 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1700 * src/bufferlist.C (close):
1701 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1702 documents if exiting without saving.
1704 * src/buffer.C (save): use removeAutosaveFile()
1706 * src/support/filetools.C (removeAutosaveFile): new function.
1708 * src/lyx_cb.C (MenuWrite): returns a bool now.
1709 (MenuWriteAs): check if file could really be saved and revert to the
1711 (MenuWriteAs): removing old autosavefile if existant.
1713 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1714 before Goto toggle declaration, because of compiler warning.
1716 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1718 * src/lyxfunc.C (MenuNew): small fix.
1720 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1722 * src/bufferlist.C (newFile):
1723 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1725 * src/lyxrc.C: added new_ask_filename tag
1727 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1729 * src/lyx.fd: removed code pertaining to form_ref
1730 * src/lyx.[Ch]: ditto
1731 * src/lyx_cb.C: ditto
1732 * src/lyx_gui.C: ditto
1733 * src/lyx_gui_misc.C: ditto
1735 * src/BufferView_pimpl.C (restorePosition): update buffer only
1738 * src/commandtags.h (LFUN_REFTOGGLE): removed
1739 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1740 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1741 (LFUN_REFBACK): renamed LFUN_REF_BACK
1743 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1744 * src/menus.C: ditto
1745 * src/lyxfunc.C (Dispatch): ditto.
1746 InsertRef dialog is now GUI-independent.
1748 * src/texrow.C: added using std::endl;
1750 * src/insets/insetref.[Ch]: strip out large amounts of code.
1751 The inset is now a container and this functionality is now
1752 managed by a new FormRef dialog
1754 * src/frontends/Dialogs.h (showRef, createRef): new signals
1756 * src/frontends/xforms/FormIndex.[Ch],
1757 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1758 when setting dialog's min/max size
1759 * src/frontends/xforms/FormIndex.[Ch]: ditto
1761 * src/frontends/xforms/FormRef.[Ch],
1762 src/frontends/xforms/forms/form_ref.fd: new xforms
1763 implementation of an InsetRef dialog
1765 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1768 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1769 ios::nocreate is not part of the standard. Removed.
1771 2000-08-07 Baruch Even <baruch.even@writeme.com>
1773 * src/graphics/Renderer.h:
1774 * src/graphics/Renderer.C: Added base class for rendering of different
1775 image formats into Pixmaps.
1777 * src/graphics/XPM_Renderer.h:
1778 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1779 in a different class.
1781 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1782 easily add support for other formats.
1784 * src/insets/figinset.C: plugged a leak of an X resource.
1786 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1788 * src/CutAndPaste.[Ch]: make all metods static.
1790 * development/Code_rules/Rules: more work, added section on
1791 Exceptions, and a References section.
1793 * a lot of header files: work to make doc++ able to generate the
1794 source documentation, some workarounds of doc++ problems. Doc++ is
1795 now able to generate the documentation.
1797 2000-08-07 Juergen Vigna <jug@sad.it>
1799 * src/insets/insettabular.C (recomputeTextInsets): removed function
1801 * src/tabular.C (SetWidthOfMulticolCell):
1803 (calculate_width_of_column_NMC): fixed return value so that it really
1804 only returns true if the column-width has changed (there where
1805 problems with muliticolumn-cells in this column).
1807 2000-08-04 Juergen Vigna <jug@sad.it>
1809 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1810 also on the scrollstatus of the inset.
1811 (workAreaMotionNotify): ditto.
1813 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1815 2000-08-01 Juergen Vigna <jug@sad.it>
1817 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1819 * src/commandtags.h:
1820 * src/LyXAction.C (init):
1821 * src/insets/inset.C (LocalDispatch): added support for
1824 * src/insets/inset.C (scroll): new functions.
1826 * src/insets/insettext.C (removeNewlines): new function.
1827 (SetAutoBreakRows): removes forced newlines in the text of the
1828 paragraph if autoBreakRows is set to false.
1830 * src/tabular.C (Latex): generates a parbox around the cell contents
1833 * src/frontends/xforms/FormTabular.C (local_update): removed
1834 the radio_useparbox button.
1836 * src/tabular.C (UseParbox): new function
1838 2000-08-06 Baruch Even <baruch.even@writeme.com>
1840 * src/graphics/GraphicsCache.h:
1841 * src/graphics/GraphicsCache.C:
1842 * src/graphics/GraphicsCacheItem.h:
1843 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1846 * src/insets/insetgraphics.h:
1847 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1848 drawing of the inline image.
1850 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1851 into the wrong position.
1853 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1856 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1858 * src/support/translator.h: move all typedefs to public section
1860 * src/support/filetools.C (MakeLatexName): return string const
1862 (TmpFileName): ditto
1863 (FileOpenSearch): ditto
1865 (LibFileSearch): ditto
1866 (i18nLibFileSearch): ditto
1869 (CreateTmpDir): ditto
1870 (CreateBufferTmpDir): ditto
1871 (CreateLyXTmpDir): ditto
1874 (MakeAbsPath): ditto
1876 (OnlyFilename): ditto
1878 (NormalizePath): ditto
1879 (CleanupPath): ditto
1880 (GetFileContents): ditto
1881 (ReplaceEnvironmentPath): ditto
1882 (MakeRelPath): ditto
1884 (ChangeExtension): ditto
1885 (MakeDisplayPath): ditto
1886 (do_popen): return cmdret const
1887 (findtexfile): return string const
1889 * src/support/DebugStream.h: add some /// to please doc++
1891 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1893 * src/texrow.C (same_rownumber): functor to use with find_if
1894 (getIdFromRow): rewritten to use find_if and to not update the
1895 positions. return true if row is found
1896 (increasePos): new method, use to update positions
1898 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1900 * src/lyxlex_pimpl.C (verifyTable): new method
1903 (GetString): return string const
1904 (pushTable): rewrite to use std::stack
1906 (setFile): better check
1909 * src/lyxlex.h: make LyXLex noncopyable
1911 * src/lyxlex.C (text): return char const * const
1912 (GetString): return string const
1913 (getLongString): return string const
1915 * src/lyx_gui_misc.C (askForText): return pair<...> const
1917 * src/lastfiles.[Ch] (operator): return string const
1919 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1920 istringstream not char const *.
1921 move token.end() out of loop.
1922 (readFile): move initializaton of token
1924 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1925 getIdFromRow is successful.
1927 * lib/bind/emacs.bind: don't include menus bind
1929 * development/Code_rules/Rules: the beginnings of making this
1930 better and covering more of the unwritten rules that we have.
1932 * development/Code_rules/Recommendations: a couple of wording
1935 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1937 * src/support/strerror.c: remove C++ comment.
1939 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1941 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1942 LFUN_INDEX_INSERT_LAST
1944 * src/texrow.C (getIdFromRow): changed from const_iterator to
1945 iterator, allowing code to compile with DEC cxx
1947 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1948 stores part of the class, as suggested by Allan. Will allow
1950 (apply): test to apply uses InsetCommandParams operator!=
1952 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1953 (apply): test to apply uses InsetCommandParams operator!=
1955 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1956 stores part of the class.
1957 (update): removed limits on min/max size.
1959 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1960 (apply): test to apply uses InsetCommandParams operator!=
1962 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1963 (Read, Write, scanCommand, getCommand): moved functionality
1964 into InsetCommandParams.
1966 (getScreenLabel): made pure virtual
1967 new InsetCommandParams operators== and !=
1969 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1970 c-tors based on InsetCommandParams. Removed others.
1971 * src/insets/insetinclude.[Ch]: ditto
1972 * src/insets/insetlabel.[Ch]: ditto
1973 * src/insets/insetparent.[Ch]: ditto
1974 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1976 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1977 insets derived from InsetCommand created using similar c-tors
1978 based on InsetCommandParams
1979 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1980 * src/menus.C (ShowRefsMenu): ditto
1981 * src/paragraph.C (Clone): ditto
1982 * src/text2.C (SetCounter): ditto
1983 * src/lyxfunc.C (Dispatch) ditto
1984 Also recreated old InsetIndex behaviour exactly. Can now
1985 index-insert at the start of a paragraph and index-insert-last
1986 without launching the pop-up.
1988 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1990 * lib/lyxrc.example: mark te pdf options as non functional.
1992 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1993 (isStrDbl): move tmpstr.end() out of loop.
1994 (strToDbl): move intialization of tmpstr
1995 (lowercase): return string const and move tmp.end() out of loop.
1996 (uppercase): return string const and move tmp.edn() out of loop.
1997 (prefixIs): add assertion
2002 (containsOnly): ditto
2003 (containsOnly): ditto
2004 (containsOnly): ditto
2005 (countChar): make last arg char not char const
2006 (token): return string const
2007 (subst): return string const, move tmp.end() out of loop.
2008 (subst): return string const, add assertion
2009 (strip): return string const
2010 (frontStrip): return string const, add assertion
2011 (frontStrip): return string const
2016 * src/support/lstrings.C: add inclde "LAssert.h"
2017 (isStrInt): move tmpstr.end() out of loop.
2019 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2020 toollist.end() out of loop.
2021 (deactivate): move toollist.end() out of loop.
2022 (update): move toollist.end() out of loop.
2023 (updateLayoutList): move tc.end() out of loop.
2024 (add): move toollist.end() out of loop.
2026 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2027 md.end() out of loop.
2029 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2031 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2034 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2035 (Erase): move insetlist.end() out of loop.
2037 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2038 ref to const string as first arg. Move initialization of some
2039 variables, whitespace changes.
2041 * src/kbmap.C (defkey): move table.end() out of loop.
2042 (kb_keymap): move table.end() out of loop.
2043 (findbinding): move table.end() out of loop.
2045 * src/MenuBackend.C (hasMenu): move end() out of loop.
2046 (getMenu): move end() out of loop.
2047 (getMenu): move menulist_.end() out of loop.
2049 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2051 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2054 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2055 (getFromLyXName): move infotab.end() out of loop.
2057 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2058 -fvtable-thunks -ffunction-sections -fdata-sections
2060 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2062 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2065 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2067 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2069 * src/frontends/xforms/FormCitation.[Ch],
2070 src/frontends/xforms/FormIndex.[Ch],
2071 src/frontends/xforms/FormToc.[Ch],
2072 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2074 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2076 * src/commandtags.h: renamed, created some flags for citation
2079 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2081 * src/lyxfunc.C (dispatch): use signals to insert index entry
2083 * src/frontends/Dialogs.h: new signal createIndex
2085 * src/frontends/xforms/FormCommand.[Ch],
2086 src/frontends/xforms/FormCitation.[Ch],
2087 src/frontends/xforms/FormToc.[Ch],
2088 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2090 * src/insets/insetindex.[Ch]: GUI-independent
2092 * src/frontends/xforms/FormIndex.[Ch],
2093 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2096 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2098 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2099 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2101 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2103 * src/insets/insetref.C (Latex): rewrite so that there is now
2104 question that a initialization is requested.
2106 * src/insets/insetcommand.h: reenable the hide signal
2108 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2110 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2111 fix handling of shortcuts (many bugs :)
2112 (add_lastfiles): ditto.
2114 * lib/ui/default.ui: fix a few shortcuts.
2116 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2118 * Makefile.am: Fix ``rpmdist'' target to return the exit
2119 status of the ``rpm'' command, instead of the last command in
2120 the chain (the ``rm lyx.xpm'' command, which always returns
2123 2000-08-02 Allan Rae <rae@lyx.org>
2125 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2126 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2127 * src/frontends/xforms/FormToc.C (FormToc): ditto
2129 * src/frontends/xforms/Makefile.am: A few forgotten files
2131 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2132 Signals-not-copyable-problem Lars' started commenting out.
2134 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2136 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2138 * src/insets/insetcommand.h: Signals is not copyable so anoter
2139 scheme for automatic hiding of forms must be used.
2141 * src/frontends/xforms/FormCitation.h: don't inerit from
2142 noncopyable, FormCommand already does that.
2143 * src/frontends/xforms/FormToc.h: ditto
2144 * src/frontends/xforms/FormUrl.h: ditto
2146 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2148 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2150 * src/insets/insetcommand.h (hide): new SigC::Signal0
2151 (d-tor) new virtual destructor emits hide signal
2153 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2154 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2156 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2157 LOF and LOT. Inset is now GUI-independent
2159 * src/insets/insetloa.[Ch]: redundant
2160 * src/insets/insetlof.[Ch]: ditto
2161 * src/insets/insetlot.[Ch]: ditto
2163 * src/frontends/xforms/forms/form_url.fd: tweaked!
2164 * src/frontends/xforms/forms/form_citation.fd: ditto
2166 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2167 dialogs dealing with InsetCommand insets
2169 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2170 FormCommand base class
2171 * src/frontends/xforms/FormUrl.[Ch]: ditto
2173 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2175 * src/frontends/xforms/FormToc.[Ch]: ditto
2177 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2178 passed a generic InsetCommand pointer
2179 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2181 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2182 and modified InsetTOC class
2183 * src/buffer.C: ditto
2185 * forms/lyx.fd: strip out old FD_form_toc code
2186 * src/lyx_gui_misc.C: ditto
2187 * src/lyx_gui.C: ditto
2188 * src/lyx_cb.C: ditto
2189 * src/lyx.[Ch]: ditto
2191 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2193 * src/support/utility.hpp: tr -d '\r'
2195 2000-08-01 Juergen Vigna <jug@sad.it>
2197 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2199 * src/commandtags.h:
2200 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2201 LFUN_TABULAR_FEATURES.
2203 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2204 LFUN_LAYOUT_TABULAR.
2206 * src/insets/insettabular.C (getStatus): implemented helper function.
2208 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2210 2000-07-31 Juergen Vigna <jug@sad.it>
2212 * src/text.C (draw): fixed screen update problem for text-insets.
2214 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2215 something changed probably this has to be added in various other
2218 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2220 2000-07-31 Baruch Even <baruch.even@writeme.com>
2222 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2223 templates to satisfy compaq cxx.
2226 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2228 * src/support/translator.h (equal_1st_in_pair::operator()): take
2229 const ref pair_type as arg.
2230 (equal_2nd_in_pair::operator()): ditto
2231 (Translator::~Translator): remove empty d-tor.
2233 * src/graphics/GraphicsCache.C: move include config.h to top, also
2234 put initialization of GraphicsCache::singleton here.
2235 (~GraphicsCache): move here
2236 (addFile): take const ref as arg
2239 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2241 * src/BufferView2.C (insertLyXFile): change te with/without header
2244 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2246 * src/frontends/xforms/FormGraphics.C (apply): add some
2247 static_cast. Not very nice, but required by compaq cxx.
2249 * src/frontends/xforms/RadioButtonGroup.h: include header
2250 <utility> instead of <pair.h>
2252 * src/insets/insetgraphicsParams.C: add using directive.
2253 (readResize): change return type to void.
2254 (readOrigin): ditto.
2256 * src/lyxfunc.C (getStatus): add missing break for build-program
2257 function; add test for Literate for export functions.
2259 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2260 entries in Options menu.
2262 2000-07-31 Baruch Even <baruch.even@writeme.com>
2264 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2265 protect against auto-allocation; release icon when needed.
2267 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2269 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2270 on usual typewriter.
2272 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2273 earlier czech.kmap), useful only for programming.
2275 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2277 * src/frontends/xforms/FormCitation.h: fix conditioning around
2280 2000-07-31 Juergen Vigna <jug@sad.it>
2282 * src/frontends/xforms/FormTabular.C (local_update): changed
2283 radio_linebreaks to radio_useparbox and added radio_useminipage.
2285 * src/tabular.C: made support for using minipages/parboxes.
2287 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2289 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2291 (descent): so the cursor is in the middle.
2292 (width): bit smaller box.
2294 * src/insets/insetgraphics.h: added display() function.
2296 2000-07-31 Baruch Even <baruch.even@writeme.com>
2298 * src/frontends/Dialogs.h: Added showGraphics signals.
2300 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2301 xforms form definition of the graphics dialog.
2303 * src/frontends/xforms/FormGraphics.h:
2304 * src/frontends/xforms/FormGraphics.C: Added files, the
2305 GUIndependent code of InsetGraphics
2307 * src/insets/insetgraphics.h:
2308 * src/insets/insetgraphics.C: Major writing to make it work.
2310 * src/insets/insetgraphicsParams.h:
2311 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2312 struct between InsetGraphics and GUI.
2314 * src/LaTeXFeatures.h:
2315 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2316 support for graphicx package.
2318 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2319 for the graphics inset.
2321 * src/support/translator.h: Added file, used in
2322 InsetGraphicsParams. this is a template to translate between two
2325 * src/frontends/xforms/RadioButtonGroup.h:
2326 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2327 way to easily control a radio button group.
2329 2000-07-28 Juergen Vigna <jug@sad.it>
2331 * src/insets/insettabular.C (LocalDispatch):
2332 (TabularFeatures): added support for lyx-functions of tabular features.
2333 (cellstart): refixed this function after someone wrongly changed it.
2335 * src/commandtags.h:
2336 * src/LyXAction.C (init): added support for tabular-features
2338 2000-07-28 Allan Rae <rae@lyx.org>
2340 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2341 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2342 triggers the callback for input checking. As a result we sometimes get
2343 "LyX: This shouldn't happen..." printed to cerr.
2344 (input): Started using status variable since I only free() on
2345 destruction. Some input checking for paths and font sizes.
2347 * src/frontends/xforms/FormPreferences.h: Use status to control
2348 activation of Ok and Apply
2350 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2351 callback. Also resized to stop segfaults with 0.88. The problem is
2352 that xforms-0.88 requires the folder to be wide enough to fit all the
2353 tabs. If it isn't it causes all sorts of problems.
2355 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2357 * src/frontends/xforms/forms/README: Reflect reality.
2359 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2360 * src/frontends/xforms/forms/makefile: ditto.
2362 * src/commandtags.h: Get access to new Preferences dialog
2363 * src/LyXAction.C: ditto
2364 * src/lyxfunc.C: ditto
2365 * lib/ui/default.ui: ditto
2367 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2369 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2371 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2374 * src/frontends/xforms/form_url.[Ch]: added.
2376 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2378 * src/insets/insetbib.h: fixed bug in previous commit
2380 * src/frontends/xforms/FormUrl.h: ditto
2382 * src/frontends/xforms/FormPrint.h: ditto
2384 * src/frontends/xforms/FormPreferences.h: ditto
2386 * src/frontends/xforms/FormCopyright.h: ditto
2388 * src/frontends/xforms/FormCitation.C: ditto
2390 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2391 private copyconstructor and private default contructor
2393 * src/support/Makefile.am: add utility.hpp
2395 * src/support/utility.hpp: new file from boost
2397 * src/insets/insetbib.h: set owner in clone
2399 * src/frontends/xforms/FormCitation.C: added missing include
2402 * src/insets/form_url.[Ch]: removed
2404 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2406 * development/lyx.spec.in
2407 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2408 file/directory re-organization.
2410 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2412 * src/insets/insetcommand.[Ch]: moved the string data and
2413 associated manipulation methods into a new stand-alone class
2414 InsetCommandParams. This class has two additional methods
2415 getAsString() and setFromString() allowing the contents to be
2416 moved around as a single string.
2417 (addContents) method removed.
2418 (setContents) method no longer virtual.
2420 * src/buffer.C (readInset): made use of new InsetCitation,
2421 InsetUrl constructors based on InsetCommandParams.
2423 * src/commandtags.h: add LFUN_INSERT_URL
2425 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2426 independent InsetUrl and use InsetCommandParams to extract
2427 string info and create new Insets.
2429 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2431 * src/frontends/xforms/FormCitation.C (apply): uses
2434 * src/frontends/xforms/form_url.C
2435 * src/frontends/xforms/form_url.h
2436 * src/frontends/xforms/FormUrl.h
2437 * src/frontends/xforms/FormUrl.C
2438 * src/frontends/xforms/forms/form_url.fd: new files
2440 * src/insets/insetcite.[Ch]: removed unused constructors.
2442 * src/insets/insetinclude.[Ch]: no longer store filename
2444 * src/insets/inseturl.[Ch]: GUI-independent.
2446 2000-07-26 Juergen Vigna <jug@sad.it>
2447 * renamed frontend from gtk to gnome as it is that what is realized
2448 and did the necessary changes in the files.
2450 2000-07-26 Marko Vendelin <markov@ioc.ee>
2452 * configure.in: cleaning up gnome configuration scripts
2454 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2456 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2457 shortcuts syndrom by redrawing them explicitely (a better solution
2458 would be appreciated).
2460 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2462 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2465 * src/lyx_cb.C (MenuExport): change html export to do the right
2466 thing depending of the document type (instead of having
2467 html-linuxdoc and html-docbook).
2468 * src/lyxfunc.C (getStatus): update for html
2469 * lib/ui/default.ui: simplify due to the above change.
2470 * src/menus.C (ShowFileMenu): update too (in case we need it).
2472 * src/MenuBackend.C (read): if a menu is defined twice, add the
2473 new entries to the exiting one.
2475 2000-07-26 Juergen Vigna <jug@sad.it>
2477 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2479 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2480 and return a bool if it did actual save the file.
2481 (AutoSave): don't autosave a unnamed doc.
2483 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2484 check if this is an UNNAMED new file and react to it.
2485 (newFile): set buffer to unnamed and change to not mark a new
2486 buffer dirty if I didn't do anything with it.
2488 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2490 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2492 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2493 friend as per Angus's patch posted to lyx-devel.
2495 * src/ext_l10n.h: updated
2497 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2498 gettext on the style string right before inserting them into the
2501 * autogen.sh: add code to extract style strings form layout files,
2502 not good enough yet.
2504 * src/frontends/gtk/.cvsignore: add MAKEFILE
2506 * src/MenuBackend.C (read): run the label strings through gettext
2507 before storing them in the containers.
2509 * src/ext_l10n.h: new file
2511 * autogen.sh : generate the ext_l10n.h file here
2513 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2515 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2518 * lib/ui/default.ui: fix a couple of typos.
2520 * config/gnome/gtk.m4: added (and added to the list of files in
2523 * src/insets/insetinclude.C (unique_id): fix when we are using
2524 lyxstring instead of basic_string<>.
2525 * src/insets/insettext.C (LocalDispatch): ditto.
2526 * src/support/filetools.C: ditto.
2528 * lib/configure.m4: create the ui/ directory if necessary.
2530 * src/LyXView.[Ch] (updateToolbar): new method.
2532 * src/BufferView_pimpl.C (buffer): update the toolbar when
2533 opening/closing buffer.
2535 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2537 * src/LyXAction.C (getActionName): enhance to return also the name
2538 and options of pseudo-actions.
2539 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2541 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2542 as an example of what is possible). Used in File->Build too (more
2543 useful) and in the import/export menus (to mimick the complicated
2544 handling of linuxdoc and friends). Try to update all the entries.
2546 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2549 * src/MenuBackend.C (read): Parse the new OptItem tag.
2551 * src/MenuBackend.h: Add a new optional_ data member (used if the
2552 entry should be omitted when the lyxfunc is disabled).
2554 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2555 function, used as a shortcut.
2556 (create_submenu): align correctly the shortcuts on the widest
2559 * src/MenuBackend.h: MenuItem.label() only returns the label of
2560 the menu without shortcut; new method shortcut().
2562 2000-07-14 Marko Vendelin <markov@ioc.ee>
2564 * src/frontends/gtk/Dialogs.C:
2565 * src/frontends/gtk/FormCopyright.C:
2566 * src/frontends/gtk/FormCopyright.h:
2567 * src/frontends/gtk/Makefile.am: added these source-files for the
2568 Gtk/Gnome support of the Copyright-Dialog.
2570 * src/main.C: added Gnome::Main initialization if using
2571 Gtk/Gnome frontend-GUI.
2573 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2575 * config/gnome/aclocal-include.m4
2576 * config/gnome/compiler-flags.m4
2577 * config/gnome/curses.m4
2578 * config/gnome/gnome--.m4
2579 * config/gnome/gnome-bonobo-check.m4
2580 * config/gnome/gnome-common.m4
2581 * config/gnome/gnome-fileutils.m4
2582 * config/gnome/gnome-ghttp-check.m4
2583 * config/gnome/gnome-gnorba-check.m4
2584 * config/gnome/gnome-guile-checks.m4
2585 * config/gnome/gnome-libgtop-check.m4
2586 * config/gnome/gnome-objc-checks.m4
2587 * config/gnome/gnome-orbit-check.m4
2588 * config/gnome/gnome-print-check.m4
2589 * config/gnome/gnome-pthread-check.m4
2590 * config/gnome/gnome-support.m4
2591 * config/gnome/gnome-undelfs.m4
2592 * config/gnome/gnome-vfs.m4
2593 * config/gnome/gnome-x-checks.m4
2594 * config/gnome/gnome-xml-check.m4
2595 * config/gnome/gnome.m4
2596 * config/gnome/gperf-check.m4
2597 * config/gnome/gtk--.m4
2598 * config/gnome/linger.m4
2599 * config/gnome/need-declaration.m4: added configuration scripts
2600 for Gtk/Gnome frontend-GUI
2602 * configure.in: added support for the --with-frontend=gtk option
2604 * autogen.sh: added config/gnome/* to list of config-files
2606 * acconfig.h: added define for GTKGUI-support
2608 * config/lyxinclude.m4: added --with-frontend[=value] option value
2609 for Gtk/Gnome frontend-GUI support.
2611 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2613 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2617 * src/paragraph.C (GetChar): remove non-const version
2619 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2620 (search_kw): use it.
2622 * src/lyx_main.C (init): if "preferences" exist, read that instead
2624 (ReadRcFile): return bool if the file could be read ok.
2625 (ReadUIFile): add a check to see if lex file is set ok.
2627 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2628 bastring can be used instead of lyxstring (still uses the old code
2629 if std::string is good enough or if lyxstring is used.)
2631 * src/encoding.C: make the arrays static, move ininle functions
2633 * src/encoding.h: from here.
2635 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2636 (parseSingleLyXformat2Token): move inset parsing to separate method
2637 (readInset): new private method
2639 * src/Variables.h: remove virtual from get().
2641 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2642 access to NEW_INSETS and NEW_TABULAR
2644 * src/MenuBackend.h: remove superfluous forward declaration of
2645 MenuItem. Add documentations tags "///", remove empty MenuItem
2646 destructor, remove private default contructor.
2648 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2650 (read): more string mlabel and mname to where they are used
2651 (read): remove unused variables mlabel and mname
2652 (defaults): unconditional clear, make menusetup take advantage of
2653 add returning Menu &.
2655 * src/LyXView.h: define NEW_MENUBAR as default
2657 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2658 to NEW_INSETS and NEW_TABULAR.
2659 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2660 defined. Change some of the "xxxx-inset-insert" functions names to
2663 * several files: more enahncements to NEW_INSETS and the resulting
2666 * lib/lyxrc.example (\date_insert_format): move to misc section
2668 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2669 bastring and use AC_CACHE_CHECK.
2670 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2671 the system have the newest methods. uses AC_CACHE_CHECK
2672 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2673 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2674 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2676 * configure.in: add LYX_CXX_GOOD_STD_STRING
2678 * acinclude.m4: recreated
2680 2000-07-24 Amir Karger
2682 * README: add Hebrew, Arabic kmaps
2685 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2687 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2690 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2692 * Lot of files: add pragma interface/implementation.
2694 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2696 * lib/ui/default.ui: new file (ans new directory). Contains the
2697 default menu and toolbar.
2699 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2700 global space. Toolbars are now read (as menus) in ui files.
2702 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2704 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2705 is disabled because the document is read-only. We want to have the
2706 toggle state of the function anyway.
2707 (getStatus): add code for LFUN_VC* functions (mimicking what is
2708 done in old-style menus)
2710 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2711 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2713 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2714 * src/BufferView_pimpl.C: ditto.
2715 * src/lyxfunc.C: ditto.
2717 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2718 default). This replaces old-style menus by new ones.
2720 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2721 MenuItem. Contain the data structure of a menu.
2723 * src/insets/insettext.C: use LyXView::setLayout instead of
2724 accessing directly the toolbar combox.
2725 * src/lyxfunc.C (Dispatch): ditto.
2727 * src/LyXView.C (setLayout): new method, which just calls
2728 Toolbar::setLayout().
2729 (updateLayoutChoice): move part of this method in Toolbar.
2731 * src/toolbar.[Ch]: removed.
2733 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2734 implementation the toolbar.
2736 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2737 the toolbar. It might make sense to merge it with ToolbarDefaults
2739 (setLayout): new function.
2740 (updateLayoutList): ditto.
2741 (openLayoutList): ditto.
2743 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2744 xforms implementation of the toolbar.
2745 (get_toolbar_func): comment out, since I do not
2746 know what it is good for.
2748 * src/ToolbarDefaults.h: Add the ItemType enum.
2750 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2751 for a list of allocated C strings. Used in Menubar xforms
2752 implementation to avoid memory leaks.
2754 * src/support/lstrings.[Ch] (uppercase): new version taking and
2758 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2759 * lib/bind/emacs.bind: ditto.
2761 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2763 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2764 forward decl of LyXView.
2766 * src/toolbar.C (toolbarItem): moved from toolbar.h
2767 (toolbarItem::clean): ditto
2768 (toolbarItem::~toolbarItem): ditto
2769 (toolbarItem::operator): ditto
2771 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2773 * src/paragraph.h: control the NEW_TABULAR define from here
2775 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2776 USE_TABULAR_INSETS to NEW_TABULAR
2778 * src/ToolbarDefaults.C: add include "lyxlex.h"
2780 * files using the old table/tabular: use NEW_TABULAR to control
2781 compilation of old tabular stuff.
2783 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2786 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2787 planemet in reading of old style floats, fix the \end_deeper
2788 problem when reading old style floats.
2790 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2792 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2794 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2796 * lib/bind/sciword.bind: updated.
2798 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2800 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2801 layout write problem
2803 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2805 * src/Makefile.am (INCLUDES): remove image directory from include
2808 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2809 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2811 * src/LyXView.C (create_form_form_main): read the application icon
2814 * lib/images/*.xpm: change the icons to use transparent color for
2817 * src/toolbar.C (update): change the color of the button when it
2820 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2822 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2823 setting explicitely the minibuffer.
2824 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2826 * src/LyXView.C (showState): new function. Shows font information
2827 in minibuffer and update toolbar state.
2828 (LyXView): call Toolbar::update after creating the
2831 * src/toolbar.C: change toollist to be a vector instead of a
2833 (BubbleTimerCB): get help string directly from the callback
2834 argument of the corresponding icon (which is the action)
2835 (set): remove unnecessary ugliness.
2836 (update): new function. update the icons (depressed, disabled)
2837 depending of the status of the corresponding action.
2839 * src/toolbar.h: remove help in toolbarItem
2841 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2843 * src/Painter.C (text): Added code for using symbol glyphs from
2844 iso10646 fonts. Currently diabled.
2846 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2849 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2850 magyar,turkish and usorbian.
2852 * src/paragraph.C (isMultiLingual): Made more efficient.
2854 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2857 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2858 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2859 Also changed the prototype to "bool math_insert_greek(char)".
2861 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2863 * lots of files: apply the NEW_INSETS on all code that will not be
2864 needed when we move to use the new insets. Enable the define in
2865 lyxparagrah.h to try it.
2867 * src/insets/insettabular.C (cellstart): change to be a static
2869 (InsetTabular): initialize buffer in the initializer list.
2871 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2873 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2874 form_print.h out of the header file. Replaced with forward
2875 declarations of the relevant struct.
2877 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2880 * src/commandtags.h: do not include "debug.h" which does not
2881 belong there. #include it in some other places because of this
2884 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2886 * src/insets/insetcaption.C: add a couple "using" directives.
2888 * src/toolbar.C (add): get the help text directly from lyxaction.
2890 (setPixmap): new function. Loads from disk and sets a pixmap on a
2891 botton; the name of the pixmap file is derived from the command
2894 * src/toolbar.h: remove members isBitmap and pixmap from
2897 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2898 * lib/images/: move many files from images/banner.xpm.
2900 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2902 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2903 * src/toolbar.C: ditto.
2904 * configure.in: ditto.
2905 * INSTALL: document.
2907 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2908 the spellchecker popup is closed from the WM.
2910 2000-07-19 Juergen Vigna <jug@sad.it>
2912 * src/insets/insetfloat.C (Write): small fix because we use the
2913 insetname for the type now!
2915 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2917 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2920 * src/frontends/Dialogs.h: removed hideCitation signal
2922 * src/insets/insetcite.h: added hide signal
2924 * src/insets/insetcite.C (~InsetCitation): emits new signal
2925 (getScreenLabel): "intelligent" label should now fit on the screen!
2927 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2929 * src/frontends/xforms/FormCitation.C (showInset): connects
2930 hide() to the inset's hide signal
2931 (show): modified to use fl_set_object_position rather than
2932 fl_set_object_geometry wherever possible
2934 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2936 * src/insets/lyxinset.h: add caption code
2938 * src/insets/insetfloat.C (type): new method
2940 * src/insets/insetcaption.C (Write): new method
2942 (LyxCode): new method
2944 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2945 to get it right together with using the FloatList.
2947 * src/commandtags.h: add LFUN_INSET_CAPTION
2948 * src/lyxfunc.C (Dispatch): handle it
2950 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2953 * src/Variables.[Ch]: make expand take a const reference, remove
2954 the destructor, some whitespace changes.
2956 * src/LyXAction.C (init): add caption-inset-insert
2958 * src/FloatList.C (FloatList): update the default floats a bit.
2960 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2962 * src/Variables.[Ch]: new files. Intended to be used for language
2963 specific strings (like \chaptername) and filename substitution in
2966 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2968 * lib/kbd/american.kmap: update
2970 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2972 * src/bufferparams.[Ch]: remove member allowAccents.
2974 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2976 * src/LaTeXLog.C: use the log_form.h header.
2977 * src/lyx_gui.C: ditto.
2978 * src/lyx_gui_misc.C: ditto.
2979 * src/lyxvc.h: ditto.
2981 * forms/log_form.fd: new file, created from latexoptions.fd. I
2982 kept the log popup and nuked the options form.
2984 * src/{la,}texoptions.[Ch]: removed.
2985 * src/lyx_cb.C (LaTeXOptions): ditto
2987 * src/lyx_gui.C (create_forms): do not handle the
2988 fd_latex_options form.
2990 2000-07-18 Juergen Vigna <jug@sad.it>
2992 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2993 name of the inset so that it can be requested outside (text2.C).
2995 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2998 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3000 * src/mathed/formula.h (ConvertFont): constify
3002 * src/mathed/formula.C (Read): add warning if \end_inset is not
3003 found on expected place.
3005 * src/insets/lyxinset.h (ConvertFont): consify
3007 * src/insets/insetquotes.C (ConvertFont): constify
3008 * src/insets/insetquotes.h: ditto
3010 * src/insets/insetinfo.h: add labelfont
3012 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3013 (ascent): use labelfont
3017 (Write): make .lyx file a bit nicer
3019 * src/insets/insetfloat.C (Write): simplify somewhat...
3020 (Read): add warning if arg is not found
3022 * src/insets/insetcollapsable.C: add using std::max
3023 (Read): move string token and add warning in arg is not found
3024 (draw): use std::max to get the right ty
3025 (getMaxWidth): simplify by using std::max
3027 * src/insets/insetsection.h: new file
3028 * src/insets/insetsection.C: new file
3029 * src/insets/insetcaption.h: new file
3030 * src/insets/insetcaption.C: new file
3032 * src/insets/inset.C (ConvertFont): constify signature
3034 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3035 insetcaption.[Ch] and insetsection.[Ch]
3037 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3038 uses to use LABEL_COUNTER_CHAPTER instead.
3039 * src/text2.C (SetCounter): here
3041 * src/counters.h: new file
3042 * src/counters.C: new file
3043 * src/Sectioning.h: new file
3044 * src/Sectioning.C: new file
3046 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3048 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3050 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3053 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3056 2000-07-17 Juergen Vigna <jug@sad.it>
3058 * src/tabular.C (Validate): check if array-package is needed.
3059 (SetVAlignment): added support for vertical alignment.
3060 (SetLTFoot): better support for longtable header/footers
3061 (Latex): modified to support added features.
3063 * src/LaTeXFeatures.[Ch]: added array-package.
3065 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3067 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3070 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3072 * configure.in: do not forget to put a space after -isystem.
3074 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3076 * lib/kbd/arabic.kmap: a few fixes.
3078 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3080 * some whitespace chagnes to a number of files.
3082 * src/support/DebugStream.h: change to make it easier for
3083 doc++ to parse correctly.
3084 * src/support/lyxstring.h: ditto
3086 * src/mathed/math_utils.C (compara): change to have only one
3088 (MathedLookupBOP): change because of the above.
3090 * src/mathed/math_delim.C (math_deco_compare): change to have only
3092 (search_deco): change becasue of the above.
3094 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3095 instead of manually coded one.
3097 * src/insets/insetquotes.C (Read): read the \end_inset too
3099 * src/insets/insetlatex.h: remove file
3100 * src/insets/insetlatex.C: remove file
3102 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3104 (InsetPrintIndex): remove destructor
3106 * src/insets/insetinclude.h: remove default constructor
3108 * src/insets/insetfloat.C: work to make it work better
3110 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3112 * src/insets/insetcite.h (InsetCitation): remove default constructor
3114 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3116 * src/text.C (GetColumnNearX): comment out some currently unused code.
3118 * src/paragraph.C (writeFile): move some initializations closer to
3120 (CutIntoMinibuffer): small change to use new matchIT operator
3124 (InsertInset): ditto
3127 (InsetIterator): ditto
3128 (Erase): small change to use new matchFT operator
3130 (GetFontSettings): ditto
3131 (HighestFontInRange): ditto
3134 * src/lyxparagraph.h: some chars changed to value_type
3135 (matchIT): because of some stronger checking (perhaps too strong)
3136 in SGI STL, the two operator() unified to one.
3139 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3141 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3142 the last inset read added
3143 (parseSingleLyXformat2Token): some more (future) compability code added
3144 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3145 (parseSingleLyXformat2Token): set last_inset_read
3146 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3147 (parseSingleLyXformat2Token): don't double intializw string next_token
3149 * src/TextCache.C (text_fits::operator()): add const's to the signature
3150 (has_buffer::operator()): ditto
3152 * src/Floating.h: add some comments on the class
3154 * src/FloatList.[Ch] (typeExist): new method
3157 * src/BackStack.h: added default constructor, wanted by Gcc.
3159 2000-07-14 Juergen Vigna <jug@sad.it>
3161 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3163 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3165 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3166 do a redraw when the window is resized!
3167 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3169 * src/insets/insettext.C (resizeLyXText): added function to correctly
3170 being able to resize the LyXWindow.
3172 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3174 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3176 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3177 crashes when closing dialog to a deleted inset.
3179 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3180 method! Now similar to other insets.
3182 2000-07-13 Juergen Vigna <jug@sad.it>
3184 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3186 * lib/examples/Literate.lyx: small patch!
3188 * src/insets/insetbib.C (Read): added this function because of wrong
3189 Write (without [begin|end]_inset).
3191 2000-07-11 Juergen Vigna <jug@sad.it>
3193 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3194 as the insertInset could not be good!
3196 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3197 the bool param should not be last.
3199 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3201 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3202 did submit that to Karl).
3204 * configure.in: use -isystem instead of -I for X headers. This
3205 fixes a problem on solaris with a recent gcc;
3206 put the front-end code after the X detection code;
3207 configure in sigc++ before lib/
3209 * src/lyx_main.C (commandLineHelp): remove -display from command
3212 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3214 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3215 Also put in Makefile rules for building the ``listerrors''
3216 program for parsing errors from literate programs written in LyX.
3218 * lib/build-listerrors: Added small shell script as part of compile
3219 process. This builds a working ``listerrors'' binary if noweb is
3220 installed and either 1) the VNC X server is installed on the machine,
3221 or 2) the user is compiling from within a GUI. The existence of a GUI
3222 is necessary to use the ``lyx --export'' feature for now. This
3223 hack can be removed once ``lyx --export'' no longer requires a GUI to
3226 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3228 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3229 now passed back correctly from gcc and placed "under" error
3230 buttons in a Literate LyX source.
3232 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3234 * src/text.C (GetColumnNearX): Better behavior when a RTL
3235 paragraph is ended by LTR text.
3237 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3240 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3242 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3243 true when clipboard is empty.
3245 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3247 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3248 row of the paragraph.
3249 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3250 to prevent calculation of bidi tables
3252 2000-07-07 Juergen Vigna <jug@sad.it>
3254 * src/screen.C (ToggleSelection): added y_offset and x_offset
3257 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3260 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3262 * src/insets/insettext.C: fixed Layout-Display!
3264 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3266 * configure.in: add check for strings.h header.
3268 * src/spellchecker.C: include <strings.h> in order to have a
3269 definition for bzero().
3271 2000-07-07 Juergen Vigna <jug@sad.it>
3273 * src/insets/insettext.C (draw): set the status of the bv->text to
3274 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3276 * src/screen.C (DrawOneRow):
3277 (DrawFromTo): redraw the actual row if something has changed in it
3280 * src/text.C (draw): call an update of the toplevel-inset if something
3281 has changed inside while drawing.
3283 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3285 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3287 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3288 processing inside class.
3290 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3291 processing inside class.
3293 * src/insets/insetindex.h new struct Holder, consistent with other
3296 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3297 citation dialog from main code and placed it in src/frontends/xforms.
3298 Dialog launched through signals instead of callbacks
3300 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3302 * lyx.man: update the options description.
3304 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3306 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3307 handle neg values, set min width to 590, add doc about -display
3309 2000-07-05 Juergen Vigna <jug@sad.it>
3311 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3312 calls to BufferView *.
3314 * src/insets/insettext.C (checkAndActivateInset): small fix non
3315 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3317 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3318 their \end_inset token!
3320 2000-07-04 edscott <edscott@imp.mx>
3322 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3323 lib/lyxrc.example: added option \wheel_jump
3325 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3327 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3328 remove support for -width,-height,-xpos and -ypos.
3330 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3332 * src/encoding.[Ch]: New files.
3334 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3335 (text): Call to the underline() method only when needed.
3337 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3339 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3340 encoding(s) for the document.
3342 * src/bufferparams.C (BufferParams): Changed default value of
3345 * src/language.C (newLang): Removed.
3346 (items[]): Added encoding information for all defined languages.
3348 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3349 encoding choice button.
3351 * src/lyxrc.h (font_norm_type): New member variable.
3352 (set_font_norm_type): New method.
3354 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3355 paragraphs with different encodings.
3357 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3358 (TransformChar): Changed to work correctly with Arabic points.
3359 (draw): Added support for drawing Arabic points.
3360 (draw): Removed code for drawing underbars (this is done by
3363 * src/support/textutils.h (IsPrintableNonspace): New function.
3365 * src/BufferView_pimpl.h: Added "using SigC::Object".
3366 * src/LyXView.h: ditto.
3368 * src/insets/insetinclude.h (include_label): Changed to mutable.
3370 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3372 * src/mathed/math_iter.h: remove empty destructor
3374 * src/mathed/math_cursor.h: remove empty destructor
3376 * src/insets/lyxinset.h: add THEOREM_CODE
3378 * src/insets/insettheorem.[Ch]: new files
3380 * src/insets/insetminipage.C: (InsertInset): remove
3382 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3384 (InsertInset): remove
3386 * src/insets/insetlist.C: (InsertList): remove
3388 * src/insets/insetfootlike.[Ch]: new files
3390 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3393 (InsertInset): ditto
3395 * src/insets/insetert.C: remove include Painter.h, reindent
3396 (InsertInset): move to header
3398 * src/insets/insetcollapsable.h: remove explicit from default
3399 contructor, remove empty destructor, add InsertInset
3401 * src/insets/insetcollapsable.C (InsertInset): new func
3403 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3405 * src/vspace.h: add explicit to constructor
3407 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3408 \textcompwordmark, please test this.
3410 * src/lyxrc.C: set ascii_linelen to 65 by default
3412 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3414 * src/commandtags.h: add LFUN_INSET_THEOREM
3416 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3417 (makeLinuxDocFile): remove _some_ of the nice logic
3418 (makeDocBookFile): ditto
3420 * src/Painter.[Ch]: (~Painter): removed
3422 * src/LyXAction.C (init): entry for insettheorem added
3424 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3426 (deplog): code to detect files generated by LaTeX, needs testing
3429 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3431 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3433 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3435 * src/LaTeX.C (deplog): Add a check for files that are going to be
3436 created by the first latex run, part of the project to remove the
3439 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3440 contents to the extension list.
3442 2000-07-04 Juergen Vigna <jug@sad.it>
3444 * src/text.C (NextBreakPoint): added support for needFullRow()
3446 * src/insets/lyxinset.h: added needFullRow()
3448 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3451 * src/insets/insettext.C: lots of changes for update!
3453 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3455 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3457 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3459 * src/insets/insetinclude.C (InsetInclude): fixed
3460 initialization of include_label.
3461 (unique_id): now returns a string.
3463 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3465 * src/LaTeXFeatures.h: new member IncludedFiles, for
3466 a map of key, included file name.
3468 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3469 with the included files for inclusion in SGML preamble,
3470 i. e., linuxdoc and docbook.
3473 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3474 nice (is the generated linuxdoc code to be exported?), that
3475 allows to remove column, and only_body that will be true for
3476 slave documents. Insets are allowed inside SGML font type.
3477 New handling of the SGML preamble for included files.
3478 (makeDocBookFile): the same for docbook.
3480 * src/insets/insetinclude.h:
3481 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3483 (DocBook): new export methods.
3485 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3486 and makeDocBookFile.
3488 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3489 formats to export with command line argument -x.
3491 2000-06-29 Juergen Vigna <jug@sad.it>
3493 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3494 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3496 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3497 region could already been cleared by an inset!
3499 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3501 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3504 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3506 (cursorToggle): remove special handling of lyx focus.
3508 2000-06-28 Juergen Vigna <jug@sad.it>
3510 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3513 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3515 * src/insets/insetindex.C (Edit): add a callback when popup is
3518 * src/insets/insettext.C (LocalDispatch):
3519 * src/insets/insetmarginal.h:
3520 * src/insets/insetlist.h:
3521 * src/insets/insetfoot.h:
3522 * src/insets/insetfloat.h:
3523 * src/insets/insetert.h: add a missing std:: qualifier.
3525 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3527 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3530 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3532 * src/insets/insettext.C (Read): remove tmptok unused variable
3533 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3534 (InsertInset): change for new InsetInset code
3536 * src/insets/insettext.h: add TEXT inline method
3538 * src/insets/insettext.C: remove TEXT macro
3540 * src/insets/insetmarginal.C (Write): new method
3541 (Latex): change output slightly
3543 * src/insets/insetfoot.C (Write): new method
3544 (Latex): change output slightly (don't use endl when no need)
3546 * src/insets/insetert.C (Write): new method
3548 * src/insets/insetcollapsable.h: make button_length, button_top_y
3549 and button_bottm_y protected.
3551 * src/insets/insetcollapsable.C (Write): simplify code by using
3552 tostr. Also do not output the float name, the children class
3553 should to that to get control over own arguments
3555 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3556 src/insets/insetminipage.[Ch]:
3559 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3561 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3563 * src/Makefile.am (lyx_SOURCES): add the new files
3565 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3566 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3567 * src/commandtags.h: ditto
3569 * src/LaTeXFeatures.h: add a std::set of used floattypes
3571 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3573 * src/FloatList.[Ch] src/Floating.h: new files
3575 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3577 * src/lyx_cb.C (TableApplyCB): ditto
3579 * src/text2.C: ditto
3580 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3581 (parseSingleLyXformat2Token): ditto + add code for
3582 backwards compability for old float styles + add code for new insets
3584 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3586 (InsertInset(size_type, Inset *, LyXFont)): new method
3587 (InsetChar(size_type, char)): changed to use the other InsetChar
3588 with a LyXFont(ALL_INHERIT).
3589 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3590 insert the META_INSET.
3592 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3594 * sigc++/thread.h (Threads): from here
3596 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3597 definition out of line
3598 * sigc++/scope.h: from here
3600 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3602 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3603 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3605 * Makefile.am (bindist): new target.
3607 * INSTALL: add instructions for doing a binary distribution.
3609 * development/tools/README.bin.example: update a bit.
3611 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3614 * lib/lyxrc.example: new lyxrc tag \set_color.
3616 * src/lyxfunc.C (Dispatch):
3617 * src/commandtags.h:
3618 * src/LyXAction.C: new lyxfunc "set-color".
3620 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3621 and an x11name given as strings.
3623 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3624 cache when a color is changed.
3626 2000-06-26 Juergen Vigna <jug@sad.it>
3628 * src/lyxrow.C (width): added this functions and variable.
3630 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3633 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3635 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3637 * images/undo_bw.xpm: new icon.
3638 * images/redo_bw.xpm: ditto.
3640 * configure.in (INSTALL_SCRIPT): change value to
3641 ${INSTALL} to avoid failures of install-script target.
3642 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3644 * src/BufferView.h: add a magic "friend" declaration to please
3647 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3649 * forms/cite.fd: modified to allow resizing without messing
3652 * src/insetcite.C: Uses code from cite.fd almost without
3654 User can now resize dialog in the x-direction.
3655 Resizing the dialog in the y-direction is prevented, as the
3656 code does this intelligently already.
3658 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3660 * INSTALL: remove obsolete entry in "problems" section.
3662 * lib/examples/sl_*.lyx: update of the slovenian examples.
3664 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3666 2000-06-23 Juergen Vigna <jug@sad.it>
3668 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3670 * src/buffer.C (resize): delete the LyXText of textinsets.
3672 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3674 * src/insets/lyxinset.h: added another parameter 'cleared' to
3675 the draw() function.
3677 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3678 unlocking inset in inset.
3680 2000-06-22 Juergen Vigna <jug@sad.it>
3682 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3683 of insets and moved first to LyXText.
3685 * src/mathed/formulamacro.[Ch]:
3686 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3688 2000-06-21 Juergen Vigna <jug@sad.it>
3690 * src/text.C (GetVisibleRow): look if I should clear the area or not
3691 using Inset::doClearArea() function.
3693 * src/insets/lyxinset.h: added doClearArea() function and
3694 modified draw(Painter &, ...) to draw(BufferView *, ...)
3696 * src/text2.C (UpdateInset): return bool insted of int
3698 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3700 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3701 combox in the character popup
3703 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3704 BufferParams const & params
3706 2000-06-20 Juergen Vigna <jug@sad.it>
3708 * src/insets/insettext.C (SetParagraphData): set insetowner on
3711 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3713 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3714 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3716 (form_main_): remove
3718 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3719 (create_form_form_main): remove FD_form_main stuff, connect to
3720 autosave_timeout signal
3722 * src/LyXView.[Ch] (getMainForm): remove
3723 (UpdateTimerCB): remove
3724 * src/BufferView_pimpl.h: inherit from SigC::Object
3726 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3727 signal instead of callback
3729 * src/BufferView.[Ch] (cursorToggleCB): remove
3731 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3733 * src/BufferView_pimpl.C: changes because of the one below
3735 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3736 instead of storing a pointer to a LyXText.
3738 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3740 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3742 * src/lyxparagraph.h
3744 * src/paragraph.C: Changed fontlist to a sorted vector.
3746 2000-06-19 Juergen Vigna <jug@sad.it>
3748 * src/BufferView.h: added screen() function.
3750 * src/insets/insettext.C (LocalDispatch): some selection code
3753 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3755 * src/insets/insettext.C (SetParagraphData):
3757 (InsetText): fixes for multiple paragraphs.
3759 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3761 * development/lyx.spec.in: Call configure with ``--without-warnings''
3762 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3763 This should be fine, however, since we generally don't want to be
3764 verbose when making an RPM.
3766 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3768 * lib/scripts/fig2pstex.py: New file
3770 2000-06-16 Juergen Vigna <jug@sad.it>
3772 * src/insets/insettabular.C (UpdateLocal):
3773 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3774 (LocalDispatch): Changed all functions to use LyXText.
3776 2000-06-15 Juergen Vigna <jug@sad.it>
3778 * src/text.C (SetHeightOfRow): call inset::update before requesting
3781 * src/insets/insettext.C (update):
3782 * src/insets/insettabular.C (update): added implementation
3784 * src/insets/lyxinset.h: added update function
3786 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3788 * src/text.C (SelectNextWord): protect against null pointers with
3789 old-style string streams. (fix from Paul Theo Gonciari
3792 * src/cite.[Ch]: remove erroneous files.
3794 * lib/configure.m4: update the list of created directories.
3796 * src/lyxrow.C: include <config.h>
3797 * src/lyxcursor.C: ditto.
3799 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3801 * lib/examples/decimal.lyx: new example file from Mike.
3803 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3804 to find template definitions (from Dekel)
3806 * src/frontends/.cvsignore: add a few things.
3808 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3810 * src/Timeout.C (TimeOut): remove default argument.
3812 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3815 * src/insets/ExternalTemplate.C: add a "using" directive.
3817 * src/lyx_main.h: remove the act_ struct, which seems unused
3820 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3822 * LyX Developers Meeting: All files changed, due to random C++ (by
3823 coincidence) code generator script.
3825 - external inset (cool!)
3826 - initial online editing of preferences
3827 - insettabular breaks insettext(s contents)
3829 - some DocBook fixes
3830 - example files update
3831 - other cool stuff, create a diff and look for yourself.
3833 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3835 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3836 -1 this is a non-line-breaking textinset.
3838 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3839 if there is no width set.
3841 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3843 * Lots of files: Merged the dialogbase branch.
3845 2000-06-09 Allan Rae <rae@lyx.org>
3847 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3848 and the Dispatch methods that used it.
3850 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3851 access to functions formerly kept in Dispatch.
3853 2000-05-19 Allan Rae <rae@lyx.org>
3855 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3856 made to_page and count_copies integers again. from_page remains a
3857 string however because I want to allow entry of a print range like
3858 "1,4,22-25" using this field.
3860 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3861 and printer-params-get. These aren't useful from the minibuffer but
3862 could be used by a script/LyXServer app provided it passes a suitable
3863 auto_mem_buffer. I guess I should take a look at how the LyXServer
3864 works and make it support xtl buffers.
3866 * sigc++/: updated to libsigc++-1.0.1
3868 * src/xtl/: updated to xtl-1.3.pl.11
3870 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3871 those changes done to the files in src/ are actually recreated when
3872 they get regenerated. Please don't ever accept a patch that changes a
3873 dialog unless that patch includes the changes to the corresponding *.fd
3876 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3877 stringOnlyContains, renamed it and generalised it.
3879 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3880 branch. Removed the remaining old form_print code.
3882 2000-04-26 Allan Rae <rae@lyx.org>
3884 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3885 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3887 2000-04-25 Allan Rae <rae@lyx.org>
3889 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3890 against a base of xtl-1.3.pl.4
3892 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3893 filter the Id: entries so they still show the xtl version number
3896 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3897 into the src/xtl code. Patch still pending with José (XTL)
3899 2000-04-24 Allan Rae <rae@lyx.org>
3901 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3902 both more generic and much safer. Use the new template functions.
3903 * src/buffer.[Ch] (Dispatch): ditto.
3905 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3906 and mem buffer more intelligently. Also a little general cleanup.
3909 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3910 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3911 * src/xtl/Makefile.am: ditto.
3912 * src/xtl/.cvsignore: ditto.
3913 * src/Makefile.am: ditto.
3915 * src/PrinterParams.h: Removed the macros member functions. Added a
3916 testInvariant member function. A bit of tidying up and commenting.
3917 Included Angus's idea for fixing operation with egcs-1.1.2.
3919 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3920 cool expansion of XTL's mem_buffer to support automatic memory
3921 management within the buffer itself. Removed the various macros and
3922 replaced them with template functions that use either auto_mem_buffer
3923 or mem_buffer depending on a #define. The mem_buffer support will
3924 disappear as soon as the auto_mem_buffer is confirmed to be good on
3925 other platforms/compilers. That is, it's there so you've got something
3928 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3929 effectively forked XTL. However I expect José will include my code
3930 into the next major release. Also fixed a memory leak.
3931 * src/xtl/text.h: ditto.
3932 * src/xtl/xdr.h: ditto.
3933 * src/xtl/giop.h: ditto.
3935 2000-04-16 Allan Rae <rae@lyx.org>
3937 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3938 by autogen.sh and removed by maintainer-clean anyway.
3939 * .cvsignore, sigc++/.cvsignore: Support the above.
3941 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3943 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3945 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3946 macros, renamed static callback-target member functions to suit new
3947 scheme and made them public.
3948 * src/frontends/xforms/forms/form_print.fd: ditto.
3949 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3951 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3954 * src/xtl/: New directory containing a minimal distribution of XTL.
3955 This is XTL-1.3.pl.4.
3957 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3959 2000-04-15 Allan Rae <rae@lyx.org>
3961 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3963 * sigc++/: Updated to libsigc++-1.0.0
3965 2000-04-14 Allan Rae <rae@lyx.org>
3967 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3968 use the generic ones in future. I'll modify my conversion script.
3970 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3972 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3973 (CloseAllBufferRelatedDialogs): Renamed.
3974 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3976 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3977 of the generic ones. These are the same ones my conversion script
3980 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3981 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3982 * src/buffer.C (Dispatch): ditto
3984 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3985 functions for updating and hiding buffer dependent dialogs.
3986 * src/BufferView.C (buffer): ditto
3987 * src/buffer.C (setReadonly): ditto
3988 * src/lyxfunc.C (CloseBuffer): ditto
3990 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3991 Dialogs.h, and hence all the SigC stuff, into every file that includes
3992 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3994 * src/BufferView2.C: reduce the number of headers included by buffer.h
3996 2000-04-11 Allan Rae <rae@lyx.org>
3998 * src/frontends/xforms/xform_macros.h: A small collection of macros
3999 for building C callbacks.
4001 * src/frontends/xforms/Makefile.am: Added above file.
4003 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4004 scheme again. This time it should work for JMarc. If this is
4005 successful I'll revise my conversion script to automate some of this.
4006 The static member functions in the class also have to be public for
4007 this scheme will work. If the scheme works (it's almost identical to
4008 the way BufferView::cursorToggleCB is handled so it should work) then
4009 FormCopyright and FormPrint will be ready for inclusion into the main
4010 trunk immediately after 1.1.5 is released -- provided we're prepared
4011 for complaints about lame compilers not handling XTL.
4013 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4015 2000-04-07 Allan Rae <rae@lyx.org>
4017 * config/lyxinclude.m4: A bit more tidying up (Angus)
4019 * src/LString.h: JMarc's <string> header fix
4021 * src/PrinterParams.h: Used string for most data to remove some
4022 ugly code in the Print dialog and avoid even uglier code when
4023 appending the ints to a string for output.
4025 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4026 and moved "default:" back to the end of switch statement. Cleaned
4027 up the printing so it uses the right function calls and so the
4028 "print to file" option actually puts the file in the right directory.
4030 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4032 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4033 and Ok+Apply button control into a separate method: input (Angus).
4034 (input) Cleaned it up and improved it to be very thorough now.
4035 (All CB) static_cast used instead of C style cast (Angus). This will
4036 probably change again once we've worked out how to keep gcc-2.8.1 happy
4037 with real C callbacks.
4038 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4039 ignore some of the bool settings and has random numbers instead. Needs
4040 some more investigation. Added other input length checks and checking
4041 of file and printer names.
4043 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4044 would link (Angus). Seems the old code doesn't compile with the pragma
4045 statement either. Separated callback entries from internal methods.
4047 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4049 2000-03-17 Allan Rae <rae@lyx.org>
4051 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4052 need it? Maybe it could go in Dialogs instead? I could make it a
4053 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4054 values to get the bool return value.
4055 (Dispatch): New overloaded method for xtl support.
4057 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4058 extern "C" callback instead of static member functions. Hopefully,
4059 JMarc will be able to compile this. I haven't changed
4060 forms/form_copyright.fd yet. Breaking one of my own rules already.
4062 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4063 because they aren't useful from the minibuffer. Maybe a LyXServer
4064 might want a help message though?
4066 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4068 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4069 xtl which needs both rtti and exceptions.
4071 * src/support/Makefile.am:
4072 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4074 * src/frontends/xforms/input_validators.[ch]: input filters and
4075 validators. These conrol what keys are valid in input boxes.
4076 Use them and write some more. Much better idea than waiting till
4077 after the user has pressed Ok to say that the input fields don't make
4080 * src/frontends/xforms/Makefile.am:
4081 * src/frontends/xforms/forms/form_print.fd:
4082 * src/frontends/xforms/forms/makefile:
4083 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4084 new scheme. Still have to make sure I haven't missed anything from
4085 the current implementation.
4087 * src/Makefile.am, src/PrinterParams.h: New data store.
4089 * other files: Added a couple of copyright notices.
4091 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4093 * src/insets/insetbib.h: move Holder struct in public space.
4095 * src/frontends/include/DialogBase.h: use SigC:: only when
4096 SIGC_CXX_NAMESPACES is defined.
4097 * src/frontends/include/Dialogs.h: ditto.
4099 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4101 * src/frontends/xforms/FormCopyright.[Ch]: do not
4102 mention SigC:: explicitely.
4104 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4106 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4107 deals with testing KDE in main configure.in
4108 * configure.in: ditto.
4110 2000-02-22 Allan Rae <rae@lyx.org>
4112 * Lots of files: Merged from HEAD
4114 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4115 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4117 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4119 * sigc++/: new minidist.
4121 2000-02-14 Allan Rae <rae@lyx.org>
4123 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4125 2000-02-08 Juergen Vigna <jug@sad.it>
4127 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4128 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4130 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4131 for this port and so it is much easier for other people to port
4132 dialogs in a common development environment.
4134 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4135 the QT/KDE implementation.
4137 * src/frontends/kde/Dialogs.C:
4138 * src/frontends/kde/FormCopyright.C:
4139 * src/frontends/kde/FormCopyright.h:
4140 * src/frontends/kde/Makefile.am:
4141 * src/frontends/kde/formcopyrightdialog.C:
4142 * src/frontends/kde/formcopyrightdialog.h:
4143 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4144 for the kde support of the Copyright-Dialog.
4146 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4147 subdir-substitution instead of hardcoded 'xforms' as we now have also
4150 * src/frontends/include/DialogBase.h (Object): just commented the
4151 label after #endif (nasty warning and I don't like warnings ;)
4153 * src/main.C (main): added KApplication initialization if using
4156 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4157 For now only the KDE event-loop is added if frontend==kde.
4159 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4161 * configure.in: added support for the --with-frontend[=value] option
4163 * autogen.sh: added kde.m4 file to list of config-files
4165 * acconfig.h: added define for KDEGUI-support
4167 * config/kde.m4: added configuration functions for KDE-port
4169 * config/lyxinclude.m4: added --with-frontend[=value] option with
4170 support for xforms and KDE.
4172 2000-02-08 Allan Rae <rae@lyx.org>
4174 * all Makefile.am: Fixed up so the make targets dist, distclean,
4175 install and uninstall all work even if builddir != srcdir. Still
4176 have a new sigc++ minidist update to come.
4178 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4180 2000-02-01 Allan Rae <rae@lyx.org>
4182 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4183 Many mods to get builddir != srcdir working.
4185 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4186 for building on NT and so we can do the builddir != srcdir stuff.
4188 2000-01-30 Allan Rae <rae@lyx.org>
4190 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4191 This will stay in "rae" branch. We probably don't really need it in
4192 the main trunk as anyone who wants to help programming it should get
4193 a full library installed also. So they can check both included and
4194 system supplied library compilation.
4196 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4197 Added a 'mini' distribution of libsigc++. If you feel the urge to
4198 change something in these directories - Resist it. If you can't
4199 resist the urge then you should modify the following script and rebuild
4200 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4201 all happen. Still uses a hacked version of libsigc++'s configure.in.
4202 I'm quite happy with the results. I'm not sure the extra work to turn
4203 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4204 worth the trouble and would probably lead to extra maintenance
4206 I haven't tested the following important make targets: install, dist.
4207 Not ready for prime time but very close. Maybe 1.1.5.
4209 * development/tools/makeLyXsigc.sh: A shell script to automatically
4210 generate our mini-dist of libsigc++. It can only be used with a CVS
4211 checkout of libsigc++ not a tarball distribution. It's well commented.
4212 This will end up as part of the libsigc++ distribution so other apps
4213 can easily have an included mini-dist. If someone makes mods to the
4214 sigc++ subpackage without modifying this script to generate those
4215 changes I'll be very upset!
4217 * src/frontends/: Started the gui/system indep structure.
4219 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4220 to access the gui-indep dialogs are in this class. Much improved
4221 design compared to previous revision. Lars, please refrain from
4222 moving this header into src/ like you did with Popups.h last time.
4224 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4226 * src/frontends/xforms/: Started the gui-indep system with a single
4227 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4230 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4231 Here you'll find a very useful makefile and automated fdfix.sh that
4232 makes updating dailogs a no-brainer -- provided you follow the rules
4233 set out in the README. I'm thinking about adding another script to
4234 automatically generate skeleton code for a new dialog given just the
4237 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4238 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4239 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4241 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * src/support/LSubstring.C (operator): simplify
4245 * src/lyxtext.h: removed bparams, use buffer_->params instead
4247 * src/lyxrow.h: make Row a real class, move all variables to
4248 private and use accessors.
4250 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4252 (isRightToLeftPar): ditto
4253 (ChangeLanguage): ditto
4254 (isMultiLingual): ditto
4257 (SimpleTeXOnePar): ditto
4258 (TeXEnvironment): ditto
4259 (GetEndLabel): ditto
4261 (SetOnlyLayout): ditto
4262 (BreakParagraph): ditto
4263 (BreakParagraphConservative): ditto
4264 (GetFontSettings): ditto
4266 (CopyIntoMinibuffer): ditto
4267 (CutIntoMinibuffer): ditto
4268 (PasteParagraph): ditto
4269 (SetPExtraType): ditto
4270 (UnsetPExtraType): ditto
4271 (DocBookContTableRows): ditto
4272 (SimpleDocBookOneTablePar): ditto
4274 (TeXFootnote): ditto
4275 (SimpleTeXOneTablePar): ditto
4276 (TeXContTableRows): ditto
4277 (SimpleTeXSpecialChars): ditto
4280 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4281 to private and use accessors.
4283 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4284 this, we did not use it anymore and has not been for ages. Just a
4285 waste of cpu cycles.
4287 * src/language.h: make Language a real class, move all variables
4288 to private and use accessors.
4290 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4291 (create_view): remove
4292 (update): some changes for new timer
4293 (cursorToggle): use new timer
4294 (beforeChange): change for new timer
4296 * src/BufferView.h (cursorToggleCB): removed last paramter because
4299 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4300 (cursorToggleCB): change because of new timer code
4302 * lib/CREDITS: updated own mailaddress
4304 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4306 * src/support/filetools.C (PutEnv): fix the code in case neither
4307 putenv() nor setenv() have been found.
4309 * INSTALL: mention the install-strip Makefile target.
4311 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4312 read-only documents.
4314 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4316 * lib/reLyX/configure.in (VERSION): avoid using a previously
4317 generated reLyX wrapper to find out $prefix.
4319 * lib/examples/eu_adibide_lyx-atua.lyx:
4320 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4321 translation of the Tutorial (Dooteo)
4323 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4325 * forms/cite.fd: new citation dialog
4327 * src/insetcite.[Ch]: the new citation dialog is moved into
4330 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4333 * src/insets/insetcommand.h: data members made private.
4335 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4337 * LyX 1.1.5 released
4339 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4341 * src/version.h (LYX_RELEASE): to 1.1.5
4343 * src/spellchecker.C (RunSpellChecker): return false if the
4344 spellchecker dies upon creation.
4346 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4348 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4349 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4353 * lib/CREDITS: update entry for Martin Vermeer.
4355 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4357 * src/text.C (draw): Draw foreign language bars at the bottom of
4358 the row instead of at the baseline.
4360 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4362 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * lib/bind/de_menus.bind: updated
4366 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4368 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4370 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4372 * src/menus.C (Limit_string_length): New function
4373 (ShowTocMenu): Limit the number of items/length of items in the
4376 * src/paragraph.C (String): Correct result for a paragraph inside
4379 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4381 * src/bufferlist.C (close): test of buf->getuser() == NULL
4383 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4385 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4386 Do not call to SetCursor when the paragraph is a closed footnote!
4388 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4390 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4393 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4395 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4398 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4399 reference popup, that activates the reference-back action
4401 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4403 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4404 the menus. Also fixed a bug.
4406 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4407 the math panels when switching buffers (unless new buffer is readonly).
4409 * src/BufferView.C (NoSavedPositions)
4410 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4412 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4414 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4415 less of dvi dirty or not.
4417 * src/trans_mgr.[Ch] (insert): change first parameter to string
4420 * src/chset.[Ch] (encodeString): add const to first parameter
4422 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4424 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4428 * src/LaTeX.C (deplog): better searching for dependency files in
4429 the latex log. Uses now regexps.
4431 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4432 instead of the box hack or \hfill.
4434 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4436 * src/lyxfunc.C (doImportHelper): do not create the file before
4437 doing the actual import.
4438 (doImportASCIIasLines): create a new file before doing the insert.
4439 (doImportASCIIasParagraphs): ditto.
4441 * lib/lyxrc.example: remove mention of non-existing commands
4443 * lyx.man: remove mention of color-related switches.
4445 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4447 * src/lyx_gui.C: remove all the color-related ressources, which
4448 are not used anymore.
4450 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4453 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4455 * src/lyxrc.C (read): Add a missing break in the switch
4457 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4459 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4461 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4464 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4466 * src/text.C (draw): draw bars under foreign language words.
4468 * src/LColor.[Ch]: add LColor::language
4470 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4472 * src/lyxcursor.h (boundary): New member variable
4474 * src/text.C (IsBoundary): New methods
4476 * src/text.C: Use the above for currect cursor movement when there
4477 is both RTL & LTR text.
4479 * src/text2.C: ditto
4481 * src/bufferview_funcs.C (ToggleAndShow): ditto
4483 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4485 * src/text.C (DeleteLineForward): set selection to true to avoid
4486 that DeleteEmptyParagraphMechanism does some magic. This is how it
4487 is done in all other functions, and seems reasonable.
4488 (DeleteWordForward): do not jump over non-word stuff, since
4489 CursorRightOneWord() already does it.
4491 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4492 DeleteWordBackward, since they seem safe to me (since selection is
4493 set to "true") DeleteEmptyParagraphMechanism does nothing.
4495 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4497 * src/lyx_main.C (easyParse): simplify the code by factoring the
4498 part that removes parameters from the command line.
4499 (LyX): check wether wrong command line options have been given.
4501 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4503 * src/lyx_main.C : add support for specifying user LyX
4504 directory via command line option -userdir.
4506 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4508 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4509 the number of items per popup.
4510 (Add_to_refs_menu): Ditto.
4512 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4514 * src/lyxparagraph.h: renamed ClearParagraph() to
4515 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4516 textclass as parameter, and do nothing if free_spacing is
4517 true. This fixes part of the line-delete-forward problems.
4519 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4520 (pasteSelection): ditto.
4521 (SwitchLayoutsBetweenClasses): more translatable strings.
4523 * src/text2.C (CutSelection): use StripLeadingSpaces.
4524 (PasteSelection): ditto.
4525 (DeleteEmptyParagraphMechanism): ditto.
4527 2000-05-26 Juergen Vigna <jug@sad.it>
4529 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4530 is not needed in tabular insets.
4532 * src/insets/insettabular.C (TabularFeatures): added missing features.
4534 * src/tabular.C (DeleteColumn):
4536 (AppendRow): implemented this functions
4537 (cellsturct::operator=): clone the inset too;
4539 2000-05-23 Juergen Vigna <jug@sad.it>
4541 * src/insets/insettabular.C (LocalDispatch): better selection support
4542 when having multicolumn-cells.
4544 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4546 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4548 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4550 * src/ColorHandler.C (getGCForeground): put more test into _()
4552 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4555 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4558 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4560 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4561 there are no labels, or when buffer is readonly.
4563 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4564 there are no labels, buffer is SGML, or when buffer is readonly.
4566 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4568 * src/LColor.C (LColor): change a couple of grey40 to grey60
4569 (LColor): rewore initalization to make compiles go some magnitude
4571 (getGUIName): don't use gettext until we need the string.
4573 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4575 * src/Bullet.[Ch]: Fixed a small bug.
4577 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4579 * src/paragraph.C (String): Several fixes/improvements
4581 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4583 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4585 * src/paragraph.C (String): give more correct output.
4587 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4589 * src/lyxfont.C (stateText) Do not output the language if it is
4590 eqaul to the language of the document.
4592 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4593 between two paragraphs with the same language.
4595 * src/paragraph.C (getParLanguage) Return a correct answer for an
4596 empty dummy paragraph.
4598 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4601 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4604 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4605 the menus/popup, if requested fonts are unavailable.
4607 2000-05-22 Juergen Vigna <jug@sad.it>
4609 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4610 movement support (Up/Down/Tab/Shift-Tab).
4611 (LocalDispatch): added also preliminari cursor-selection.
4613 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4615 * src/paragraph.C (PasteParagraph): Hopefully now right!
4617 2000-05-22 Garst R. Reese <reese@isn.net>
4619 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4620 of list, change all references to Environment to Command
4621 * tex/hollywood.cls : rewrite environments as commands, add
4622 \uppercase to interiorshot and exteriorshot to force uppecase.
4623 * tex/broadway.cls : rewrite environments as commands. Tweak
4626 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4628 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4629 size of items: use a constant intead of the hardcoded 40, and more
4630 importantly do not remove the %m and %x tags added at the end.
4631 (Add_to_refs_menu): use vector::size_type instead of
4632 unsigned int as basic types for the variables. _Please_ do not
4633 assume that size_t is equal to unsigned int. On an alpha, this is
4634 unsigned long, which is _not_ the same.
4636 * src/language.C (initL): remove language "hungarian", since it
4637 seems that "magyar" is better.
4639 2000-05-22 Juergen Vigna <jug@sad.it>
4641 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4643 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4646 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4647 next was deleted but not set to 0.
4649 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4651 * src/language.C (initL): change the initialization of languages
4652 so that compiles goes _fast_.
4654 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4657 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4659 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4663 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4665 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4667 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4671 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4674 * src/insets/insetlo*.[Ch]: Made editable
4676 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4678 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4679 the current selection.
4681 * src/BufferView_pimpl.C (stuffClipboard): new method
4683 * src/BufferView.C (stuffClipboard): new method
4685 * src/paragraph.C (String): new method
4687 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4688 LColor::ignore when lyxname is not found.
4690 * src/BufferView.C (pasteSelection): new method
4692 * src/BufferView_pimpl.C (pasteSelection): new method
4694 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4696 * src/WorkArea.C (request_clipboard_cb): new static function
4697 (getClipboard): new method
4698 (putClipboard): new method
4700 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4702 * LyX 1.1.5pre2 released
4704 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4706 * src/vspace.C (operator=): removed
4707 (operator=): removed
4709 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4711 * src/layout.C (NumberOfClass): manually set the type in make_pair
4712 (NumberOfLayout): ditto
4714 * src/language.C: use the Language constructor for ignore_lang
4716 * src/language.h: add constructors to struct Language
4718 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4720 * src/text2.C (SetCursorIntern): comment out #warning
4722 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4724 * src/mathed/math_iter.h: initialize sx and sw to 0
4726 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4728 * forms/lyx.fd: Redesign of form_ref
4730 * src/LaTeXFeatures.[Ch]
4734 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4737 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4738 and Buffer::inset_iterator.
4740 * src/menus.C: Added new menus: TOC and Refs.
4742 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4744 * src/buffer.C (getTocList): New method.
4746 * src/BufferView2.C (ChangeRefs): New method.
4748 * src/buffer.C (getLabelList): New method. It replaces the old
4749 getReferenceList. The return type is vector<string> instead of
4752 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4753 the old getLabel() and GetNumberOfLabels() methods.
4754 * src/insets/insetlabel.C (getLabelList): ditto
4755 * src/mathed/formula.C (getLabelList): ditto
4757 * src/paragraph.C (String): New method.
4759 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4760 Uses the new getTocList() method.
4761 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4762 which automatically updates the contents of the browser.
4763 (RefUpdateCB): Use the new getLabelList method.
4765 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4767 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4769 * src/spellchecker.C: Added using std::reverse;
4771 2000-05-19 Juergen Vigna <jug@sad.it>
4773 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4775 * src/insets/insettext.C (computeTextRows): small fix for display of
4776 1 character after a newline.
4778 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4781 2000-05-18 Juergen Vigna <jug@sad.it>
4783 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4784 when changing width of column.
4786 * src/tabular.C (set_row_column_number_info): setting of
4787 autobreak rows if necessary.
4789 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4791 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4793 * src/vc-backend.*: renamed stat() to status() and vcstat to
4794 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4795 compilation broke. The new name seems more relevant, anyway.
4797 2000-05-17 Juergen Vigna <jug@sad.it>
4799 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4800 which was wrong if the removing caused removing of rows!
4802 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4803 (pushToken): new function.
4805 * src/text2.C (CutSelection): fix problem discovered with purify
4807 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4809 * src/debug.C (showTags): enlarge the first column, now that we
4810 have 6-digits debug codes.
4812 * lib/layouts/hollywood.layout:
4813 * lib/tex/hollywood.cls:
4814 * lib/tex/brodway.cls:
4815 * lib/layouts/brodway.layout: more commands and fewer
4816 environments. Preambles moved in the .cls files. Broadway now has
4817 more options on scene numbering and less whitespace (from Garst)
4819 * src/insets/insetbib.C (getKeys): make sure that we are in the
4820 document directory, in case the bib file is there.
4822 * src/insets/insetbib.C (Latex): revert bogus change.
4824 2000-05-16 Juergen Vigna <jug@sad.it>
4826 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4827 the TabularLayout on cursor move.
4829 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4831 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4834 (draw): fixed cursor position and drawing so that the cursor is
4835 visible when before the tabular-inset.
4837 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4838 when creating from old insettext.
4840 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4842 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4844 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4845 * lib/tex/brodway.cls: ditto
4847 * lib/layouts/brodway.layout: change alignment of parenthical
4850 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4852 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4853 versions 0.88 and 0.89 are supported.
4855 2000-05-15 Juergen Vigna <jug@sad.it>
4857 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4860 * src/insets/insettext.C (computeTextRows): redone completely this
4861 function in a much cleaner way, because of problems when having a
4863 (draw): added a frame border when the inset is locked.
4864 (SetDrawLockedFrame): this sets if we draw the border or not.
4865 (SetFrameColor): this sets the frame color (default=insetframe).
4867 * src/insets/lyxinset.h: added x() and y() functions which return
4868 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4869 function which is needed to see if we have a locking inset of some
4870 type in this inset (needed for now in insettabular).
4872 * src/vspace.C (inPixels): the same function also without a BufferView
4873 parameter as so it is easier to use it in some ocasions.
4875 * src/lyxfunc.C: changed all places where insertInset was used so
4876 that now if it couldn't be inserted it is deleted!
4878 * src/TabularLayout.C:
4879 * src/TableLayout.C: added support for new tabular-inset!
4881 * src/BufferView2.C (insertInset): this now returns a bool if the
4882 inset was really inserted!!!
4884 * src/tabular.C (GetLastCellInRow):
4885 (GetFirstCellInRow): new helper functions.
4886 (Latex): implemented for new tabular class.
4890 (TeXTopHLine): new Latex() helper functions.
4892 2000-05-12 Juergen Vigna <jug@sad.it>
4894 * src/mathed/formulamacro.C (Read):
4895 * src/mathed/formula.C (Read): read also the \end_inset here!
4897 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4899 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4900 crush when saving formulae with unbalanced parenthesis.
4902 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4904 * src/layout.C: Add new keyword "endlabelstring" to layout file
4906 * src/text.C (GetVisibleRow): Draw endlabel string.
4908 * lib/layouts/broadway.layout
4909 * lib/layouts/hollywood.layout: Added endlabel for the
4910 Parenthetical layout.
4912 * lib/layouts/heb-article.layout: Do not use slanted font shape
4913 for Theorem like environments.
4915 * src/buffer.C (makeLaTeXFile): Always add "american" to
4916 the UsedLanguages list if document language is RTL.
4918 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4920 * add addendum to README.OS2 and small patch (from SMiyata)
4922 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4924 * many files: correct the calls to ChangeExtension().
4926 * src/support/filetools.C (ChangeExtension): remove the no_path
4927 argument, which does not belong there. Use OnlyFileName() instead.
4929 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4930 files when LaTeXing a non-nice latex file.
4932 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4933 a chain of "if". Return false when deadkeys are not handled.
4935 * src/lyx_main.C (LyX): adapted the code for default bindings.
4937 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4938 bindings for basic functionality (except deadkeys).
4939 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4941 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4942 several methods: handle override_x_deadkeys.
4944 * src/lyxrc.h: remove the "bindings" map, which did not make much
4945 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4947 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4949 * src/lyxfont.C (stateText): use a saner method to determine
4950 whether the font is "default". Seems to fix the crash with DEC
4953 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4955 2000-05-08 Juergen Vigna <jug@sad.it>
4957 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4958 TabularLayoutMenu with mouse-button-3
4959 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4961 * src/TabularLayout.C: added this file for having a Layout for
4964 2000-05-05 Juergen Vigna <jug@sad.it>
4966 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4967 recalculating inset-widths.
4968 (TabularFeatures): activated this function so that I can change
4969 tabular-features via menu.
4971 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4972 that I can test some functions with the Table menu.
4974 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 * src/lyxfont.C (stateText): guard against stupid c++libs.
4978 * src/tabular.C: add using std::vector
4979 some whitespace changes, + removed som autogenerated code.
4981 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4983 2000-05-05 Juergen Vigna <jug@sad.it>
4985 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4986 row, columns and cellstructures.
4988 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4990 * lib/lyxrc.example: remove obsolete entries.
4992 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4993 reading of protected_separator for free_spacing.
4995 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4997 * src/text.C (draw): do not display an exclamation mark in the
4998 margin for margin notes. This is confusing, ugly and
5001 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5002 AMS math' is checked.
5004 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5005 name to see whether including the amsmath package is needed.
5007 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5009 * src/paragraph.C (validate): Compute UsedLanguages correctly
5010 (don't insert the american language if it doesn't appear in the
5013 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5014 The argument of \thanks{} command is considered moving argument
5016 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5019 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5021 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5022 for appendix/minipage/depth. The lines can be now both in the footnote
5023 frame, and outside the frame.
5025 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5028 2000-05-05 Juergen Vigna <jug@sad.it>
5030 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5031 neede only in tabular.[Ch].
5033 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5035 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5037 (Write): write '~' for PROTECTED_SEPARATOR
5039 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5041 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5044 * src/mathed/formula.C (drawStr): rename size to siz.
5046 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5047 possibly fix a bug by not changing the pflags = flags to piflags =
5050 2000-05-05 Juergen Vigna <jug@sad.it>
5052 * src/insets/insetbib.C: moved using directive
5054 * src/ImportNoweb.C: small fix for being able to compile (missing
5057 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5059 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5060 to use clear, since we don't depend on this in the code. Add test
5063 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5065 * (various *.C files): add using std::foo directives to please dec
5068 * replace calls to string::clear() to string::erase() (Angus)
5070 * src/cheaders/cmath: modified to provide std::abs.
5072 2000-05-04 Juergen Vigna <jug@sad.it>
5074 * src/insets/insettext.C: Prepared all for inserting of multiple
5075 paragraphs. Still display stuff to do (alignment and other things),
5076 but I would like to use LyXText to do this when we cleaned out the
5077 table-support stuff.
5079 * src/insets/insettabular.C: Changed lot of stuff and added lots
5080 of functionality still a lot to do.
5082 * src/tabular.C: Various functions changed name and moved to be
5083 const functions. Added new Read and Write functions and changed
5084 lots of things so it works good with tabular-insets (also removed
5085 some stuff which is not needed anymore * hacks *).
5087 * src/lyxcursor.h: added operators == and != which just look if
5088 par and pos are (not) equal.
5090 * src/buffer.C (latexParagraphs): inserted this function to latex
5091 all paragraphs form par to endpar as then I can use this too for
5094 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5095 so that I can call this to from text insets with their own cursor.
5097 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5098 output off all paragraphs (because of the fix below)!
5100 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5101 the very last paragraph (this could be also the last paragraph of an
5104 * src/texrow.h: added rows() call which returns the count-variable.
5106 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5108 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5110 * lib/configure.m4: better autodetection of DocBook tools.
5112 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5114 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5116 * src/lyx_cb.C: add using std::reverse;
5118 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5121 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5122 selected files. Should fix repeated errors from generated files.
5124 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5126 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5128 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5129 the spellchecker popup.
5131 * lib/lyxrc.example: Removed the \number_inset section
5133 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5135 * src/insets/figinset.C (various): Use IsFileReadable() to make
5136 sure that the file actually exist. Relying on ghostscripts errors
5137 is a bad idea since they can lead to X server crashes.
5139 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5141 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5144 * lib/lyxrc.example: smallish typo in description of
5145 \view_dvi_paper_option
5147 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5150 * src/lyxfunc.C: doImportHelper to factor out common code of the
5151 various import methods. New functions doImportASCIIasLines,
5152 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5153 doImportLinuxDoc for the format specific parts.
5156 * buffer.C: Dispatch returns now a bool to indicate success
5159 * lyx_gui.C: Add getLyXView() for member access
5161 * lyx_main.C: Change logic for batch commands: First try
5162 Buffer::Dispatch (possibly without GUI), if that fails, use
5165 * lyx_main.C: Add support for --import command line switch.
5166 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5167 Available Formats: Everything accepted by 'buffer-import <format>'
5169 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5171 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5174 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5175 documents will be reformatted upon reentry.
5177 2000-04-27 Juergen Vigna <jug@sad.it>
5179 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5180 correctly only last pos this was a bug.
5182 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5184 * release of lyx-1.1.5pre1
5186 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5188 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5190 * src/menus.C: revert the change of naming (Figure->Graphic...)
5191 from 2000-04-11. It was incomplete and bad.
5193 * src/LColor.[Ch]: add LColor::depthbar.
5194 * src/text.C (GetVisibleRow): use it.
5196 * README: update the languages list.
5198 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5200 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5203 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5205 * README: remove sections that were just wrong.
5207 * src/text2.C (GetRowNearY): remove currentrow code
5209 * src/text.C (GetRow): remove currentrow code
5211 * src/screen.C (Update): rewritten a bit.
5212 (SmallUpdate): removed func
5214 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5216 (FullRebreak): return bool
5217 (currentrow): remove var
5218 (currentrow_y): ditto
5220 * src/lyxscreen.h (Draw): change arg to unsigned long
5221 (FitCursor): return bool
5222 (FitManualCursor): ditto
5223 (Smallpdate): remove func
5224 (first): change to unsigned long
5225 (DrawOneRow): change second arg to long (from long &)
5226 (screen_refresh_y): remove var
5227 (scree_refresh_row): ditto
5229 * src/lyxrow.h: change baseline to usigned int from unsigned
5230 short, this brings some implicit/unsigned issues out in the open.
5232 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5234 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5235 instead of smallUpdate.
5237 * src/lyxcursor.h: change y to unsigned long
5239 * src/buffer.h: don't call updateScrollbar after fitcursor
5241 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5242 where they are used. Removed "\\direction", this was not present
5243 in 1.1.4 and is already obsolete. Commented out some code that I
5244 believe to never be called.
5245 (runLiterate): don't call updateScrollbar after fitCursor
5247 (buildProgram): ditto
5250 * src/WorkArea.h (workWidth): change return val to unsigned
5253 (redraw): remove the button redraws
5254 (setScrollbarValue): change for scrollbar
5255 (getScrollbarValue): change for scrollbar
5256 (getScrollbarBounds): change for scrollbar
5258 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5259 (C_WorkArea_down_cb): removed func
5260 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5261 (resize): change for scrollbar
5262 (setScrollbar): ditto
5263 (setScrollbarBounds): ditto
5264 (setScrollbarIncrements): ditto
5265 (up_cb): removed func
5266 (down_cb): removed func
5267 (scroll_cb): change for scrollbar
5268 (work_area_handler): ditto
5270 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5271 when FitCursor did something.
5272 (updateScrollbar): some unsigned changes
5273 (downCB): removed func
5274 (scrollUpOnePage): removed func
5275 (scrollDownOnePage): remvoed func
5276 (workAreaMotionNotify): don't call screen->FitCursor but use
5277 fitCursor instead. and bool return val
5278 (workAreaButtonPress): ditto
5279 (workAreaButtonRelease): some unsigned changes
5280 (checkInsetHit): ditto
5281 (workAreaExpose): ditto
5282 (update): parts rewritten, comments about the signed char arg added
5283 (smallUpdate): removed func
5284 (cursorPrevious): call needed updateScrollbar
5287 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5290 * src/BufferView.[Ch] (upCB): removed func
5291 (downCB): removed func
5292 (smallUpdate): removed func
5294 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5296 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5297 currentrow, currentrow_y optimization. This did not help a lot and
5298 if we want to do this kind of optimization we should rather use
5299 cursor.row instead of the currentrow.
5301 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5302 buffer spacing and klyx spacing support.
5304 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5306 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5309 2000-04-26 Juergen Vigna <jug@sad.it>
5311 * src/insets/figinset.C: fixes to Lars sstream changes!
5313 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5315 * A lot of files: Added Ascii(ostream &) methods to all inset
5316 classes. Used when exporting to ASCII.
5318 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5319 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5322 * src/text2.C (ToggleFree): Disabled implicit word selection when
5323 there is a change in the language
5325 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5326 no output was generated for end-of-sentence inset.
5328 * src/insets/lyxinset.h
5331 * src/paragraph.C: Removed the insetnumber code
5333 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5335 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5337 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5338 no_babel and no_epsfig completely from the file.
5339 (parseSingleLyXformat2Token): add handling for per-paragraph
5340 spacing as written by klyx.
5342 * src/insets/figinset.C: applied patch by Andre. Made it work with
5345 2000-04-20 Juergen Vigna <jug@sad.it>
5347 * src/insets/insettext.C (cutSelection):
5348 (copySelection): Fixed with selection from right to left.
5349 (draw): now the rows are not recalculated at every draw.
5350 (computeTextRows): for now reset the inset-owner here (this is
5351 important for an undo or copy where the inset-owner is not set
5354 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5355 motion to the_locking_inset screen->first was forgotten, this was
5356 not important till we got multiline insets.
5358 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5360 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5361 code seems to be alright (it is code changed by Dekel, and the
5362 intent is indeed that all macros should be defined \protect'ed)
5364 * NEWS: a bit of reorganisation of the new user-visible features.
5366 2000-04-19 Juergen Vigna <jug@sad.it>
5368 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5369 position. Set the inset_owner of the used paragraph so that it knows
5370 that it is inside an inset. Fixed cursor handling with mouse and
5371 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5372 and cleanups to make TextInsets work better.
5374 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5375 Changed parameters of various functions and added LockInsetInInset().
5377 * src/insets/insettext.C:
5379 * src/insets/insetcollapsable.h:
5380 * src/insets/insetcollapsable.C:
5381 * src/insets/insetfoot.h:
5382 * src/insets/insetfoot.C:
5383 * src/insets/insetert.h:
5384 * src/insets/insetert.C: cleaned up the code so that it works now
5385 correctly with insettext.
5387 * src/insets/inset.C:
5388 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5389 that insets in insets are supported right.
5392 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5394 * src/paragraph.C: some small fixes
5396 * src/debug.h: inserted INSETS debug info
5398 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5399 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5401 * src/commandtags.h:
5402 * src/LyXAction.C: insert code for InsetTabular.
5404 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5405 not Button1MotionMask.
5406 (workAreaButtonRelease): send always a InsetButtonRelease event to
5408 (checkInsetHit): some setCursor fixes (always with insets).
5410 * src/BufferView2.C (lockInset): returns a bool now and extended for
5411 locking insets inside insets.
5412 (showLockedInsetCursor): it is important to have the cursor always
5413 before the locked inset.
5414 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5416 * src/BufferView.h: made lockInset return a bool.
5418 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5420 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5421 that is used also internally but can be called as public to have back
5422 a cursor pos which is not set internally.
5423 (SetCursorIntern): Changed to use above function.
5425 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5427 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5432 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5433 patches for things that should be in or should be changed.
5435 * src/* [insetfiles]: change "usigned char fragile" to bool
5436 fragile. There was only one point that could that be questioned
5437 and that is commented in formulamacro.C. Grep for "CHECK".
5439 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5440 (DeleteBuffer): take it out of CutAndPaste and make it static.
5442 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5444 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5445 output the spacing envir commands. Also the new commands used in
5446 the LaTeX output makes the result better.
5448 * src/Spacing.C (writeEnvirBegin): new method
5449 (writeEnvirEnd): new method
5451 2000-04-18 Juergen Vigna <jug@sad.it>
5453 * src/CutAndPaste.C: made textclass a static member of the class
5454 as otherwise it is not accesed right!!!
5456 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5458 * forms/layout_forms.fd
5459 * src/layout_forms.h
5460 * src/layout_forms.C (create_form_form_character)
5461 * src/lyx_cb.C (UserFreeFont)
5462 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5463 documents (in the layout->character popup).
5465 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5467 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5468 \spell_command was in fact not honored (from Kevin Atkinson).
5470 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5473 * src/lyx_gui.h: make lyxViews private (Angus)
5475 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5477 * src/mathed/math_write.C
5478 (MathMatrixInset::Write) Put \protect before \begin{array} and
5479 \end{array} if fragile
5480 (MathParInset::Write): Put \protect before \\ if fragile
5482 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5484 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5485 initialization if the LyXColorHandler must be done after the
5486 connections to the XServer has been established.
5488 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5489 get the background pixel from the lyxColorhandler so that the
5490 figures are rendered with the correct background color.
5491 (NextToken): removed functions.
5492 (GetPSSizes): use ifs >> string instead of NextToken.
5494 * src/Painter.[Ch]: the color cache moved out of this file.
5496 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5499 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5501 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5502 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5504 * src/BufferView.C (enterView): new func
5505 (leaveView): new func
5507 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5509 (leaveView): new func, undefines xterm cursor when approp.
5511 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5512 (AllowInput): delete the Workarea cursor handling from this func.
5514 * src/Painter.C (underline): draw a slimer underline in most cases.
5516 * src/lyx_main.C (error_handler): use extern "C"
5518 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5520 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5521 sent directly to me.
5523 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5524 to the list by Dekel.
5526 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5529 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5530 methods from lyx_cb.here.
5532 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5535 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5537 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5538 instead of using current_view directly.
5540 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5542 * src/LyXAction.C (init): add the paragraph-spacing command.
5544 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5546 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5548 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5549 different from the documents.
5551 * src/text.C (SetHeightOfRow): take paragraph spacing into
5552 account, paragraph spacing takes precedence over buffer spacing
5553 (GetVisibleRow): ditto
5555 * src/paragraph.C (writeFile): output the spacing parameter too.
5556 (validate): set the correct features if spacing is used in the
5558 (Clear): set spacing to default
5559 (MakeSameLayout): spacing too
5560 (HasSameLayout): spacing too
5561 (SetLayout): spacing too
5562 (TeXOnePar): output the spacing commands
5564 * src/lyxparagraph.h: added a spacing variable for use with
5565 per-paragraph spacing.
5567 * src/Spacing.h: add a Default spacing and a method to check if
5568 the current spacing is default. also added an operator==
5570 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5573 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5575 * src/lyxserver.C (callback): fix dispatch of functions
5577 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5578 printf() into lyxerr call.
5580 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5583 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5584 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5585 the "Float" from each of the subitems.
5586 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5588 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5589 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5590 documented the change so that the workaround can be nuked later.
5592 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5595 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5597 * src/buffer.C (getLatexName): ditto
5598 (setReadonly): ditto
5600 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5602 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5603 avoid some uses of current_view. Added also a bufferParams()
5604 method to get at this.
5606 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5608 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5610 * src/lyxparagraph.[Ch]: removed
5611 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5612 with operators used by lower_bound and
5613 upper_bound in InsetTable's
5614 Make struct InsetTable private again. Used matchpos.
5616 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5618 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5619 document, the language of existing text is changed (unless the
5620 document is multi-lingual)
5622 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5624 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5626 * A lot of files: A rewrite of the Right-to-Left support.
5628 2000-04-10 Juergen Vigna <jug@sad.it>
5630 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5631 misplaced cursor when inset in inset is locked.
5633 * src/insets/insettext.C (LocalDispatch): small fix so that a
5634 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5636 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5637 footnote font should be decreased in size twice when displaying.
5639 * src/insets/insettext.C (GetDrawFont): inserted this function as
5640 the drawing-font may differ from the real paragraph font.
5642 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5643 insets (inset in inset!).
5645 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5646 function here because we don't want footnotes inside footnotes.
5648 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5650 (init): now set the inset_owner in paragraph.C
5651 (LocalDispatch): added some resetPos() in the right position
5654 (pasteSelection): changed to use the new CutAndPaste-Class.
5656 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5657 which tells if it is allowed to insert another inset inside this one.
5659 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5660 SwitchLayoutsBetweenClasses.
5662 * src/text2.C (InsertInset): checking of the new paragraph-function
5664 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5665 is not needed anymore here!
5668 (PasteSelection): redone (also with #ifdef) so that now this uses
5669 the CutAndPaste-Class.
5670 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5673 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5674 from/to text/insets.
5676 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5677 so that the paragraph knows if it is inside an (text)-inset.
5678 (InsertFromMinibuffer): changed return-value to bool as now it
5679 may happen that an inset is not inserted in the paragraph.
5680 (InsertInsetAllowed): this checks if it is allowed to insert an
5681 inset in this paragraph.
5683 (BreakParagraphConservative):
5684 (BreakParagraph) : small change for the above change of the return
5685 value of InsertFromMinibuffer.
5687 * src/lyxparagraph.h: added inset_owner and the functions to handle
5688 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5690 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5692 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5693 functions from BufferView to BufferView::Pimpl to ease maintence.
5695 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5696 correctly. Also use SetCursorIntern instead of SetCursor.
5698 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5701 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5703 * src/WorkArea.C (belowMouse): manually implement below mouse.
5705 * src/*: Add "explicit" on several constructors, I added probably
5706 some unneeded ones. A couple of changes to code because of this.
5708 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5709 implementation and private parts from the users of BufferView. Not
5712 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5713 implementation and private parts from the users of LyXLex. Not
5716 * src/BufferView_pimpl.[Ch]: new files
5718 * src/lyxlex_pimpl.[Ch]: new files
5720 * src/LyXView.[Ch]: some inline functions move out-of-line
5722 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5724 * src/lyxparagraph.h: make struct InsetTable public.
5726 * src/support/lyxstring.h: change lyxstring::difference_type to be
5727 ptrdiff_t. Add std:: modifiers to streams.
5729 * src/font.C: include the <cctype> header, for islower() and
5732 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/font.[Ch]: new files. Contains the metric functions for
5735 fonts, takes a LyXFont as parameter. Better separation of concepts.
5737 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5738 changes because of this.
5740 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5742 * src/*: compile with -Winline and move functions that don't
5745 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5748 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5750 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5751 (various files changed because of this)
5753 * src/Painter.C (text): fixed the drawing of smallcaps.
5755 * src/lyxfont.[Ch] (drawText): removed unused member func.
5758 * src/*.C: added needed "using" statements and "std::" qualifiers.
5760 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5762 * src/*.h: removed all use of "using" from header files use
5763 qualifier std:: instead.
5765 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5767 * src/text.C (Backspace): some additional cleanups (we already
5768 know whether cursor.pos is 0 or not).
5770 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5771 automake does not provide one).
5773 * src/bmtable.h: replace C++ comments with C comments.
5775 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5777 * src/screen.C (ShowCursor): Change the shape of the cursor if
5778 the current language is not equal to the language of the document.
5779 (If the cursor change its shape unexpectedly, then you've found a bug)
5781 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5784 * src/insets/insetnumber.[Ch]: New files.
5786 * src/LyXAction.C (init)
5787 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5790 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5792 * src/lyxparagraph.h
5793 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5794 (the vector is kept sorted).
5796 * src/text.C (GetVisibleRow): Draw selection correctly when there
5797 is both LTR and RTL text.
5799 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5800 which is much faster.
5802 * src/text.C (GetVisibleRow and other): Do not draw the last space
5803 in a row if the direction of the last letter is not equal to the
5804 direction of the paragraph.
5806 * src/lyxfont.C (latexWriteStartChanges):
5807 Check that font language is not equal to basefont language.
5808 (latexWriteEndChanges): ditto
5810 * src/lyx_cb.C (StyleReset): Don't change the language while using
5811 the font-default command.
5813 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5814 empty paragraph before a footnote.
5816 * src/insets/insetcommand.C (draw): Increase x correctly.
5818 * src/screen.C (ShowCursor): Change cursor shape if
5819 current language != document language.
5821 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5823 2000-03-31 Juergen Vigna <jug@sad.it>
5825 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5826 (Clone): changed mode how the paragraph-data is copied to the
5827 new clone-paragraph.
5829 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5830 GetInset(pos) with no inset anymore there (in inset UNDO)
5832 * src/insets/insetcommand.C (draw): small fix as here x is
5833 incremented not as much as width() returns (2 before, 2 behind = 4)
5835 2000-03-30 Juergen Vigna <jug@sad.it>
5837 * src/insets/insettext.C (InsetText): small fix in initialize
5838 widthOffset (should not be done in the init() function)
5840 2000-03-29 Amir Karger <karger@lyx.org>
5842 * lib/examples/it_ItemizeBullets.lyx: translation by
5845 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5847 2000-03-29 Juergen Vigna <jug@sad.it>
5849 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5851 * src/insets/insetfoot.C (Clone): small change as for the below
5852 new init function in the text-inset
5854 * src/insets/insettext.C (init): new function as I've seen that
5855 clone did not copy the Paragraph-Data!
5856 (LocalDispatch): Added code so that now we have some sort of Undo
5857 functionality (well actually we HAVE Undo ;)
5859 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5861 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5863 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5866 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5868 * src/main.C: added a runtime check that verifies that the xforms
5869 header used when building LyX and the library used when running
5870 LyX match. Exit with a message if they don't match. This is a
5871 version number check only.
5873 * src/buffer.C (save): Don't allocate memory on the heap for
5874 struct utimbuf times.
5876 * *: some using changes, use iosfwd instead of the real headers.
5878 * src/lyxfont.C use char const * instead of string for the static
5879 strings. Rewrite some functions to use sstream.
5881 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5883 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5886 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5888 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5889 of Geodesy (from Martin Vermeer)
5891 * lib/layouts/svjour.inc: include file for the Springer svjour
5892 class. It can be used to support journals other than JoG.
5894 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5895 Miskiewicz <misiek@pld.org.pl>)
5896 * lib/reLyX/Makefile.am: ditto.
5898 2000-03-27 Juergen Vigna <jug@sad.it>
5900 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5901 also some modifications with operations on selected text.
5903 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5904 problems with clicking on insets (last famous words ;)
5906 * src/insets/insetcommand.C (draw):
5907 (width): Changed to have a bit of space before and after the inset so
5908 that the blinking cursor can be seen (otherwise it was hidden)
5910 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5912 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5913 would not be added to the link list when an installed gettext (not
5914 part of libc) is found.
5916 2000-03-24 Juergen Vigna <jug@sad.it>
5918 * src/insets/insetcollapsable.C (Edit):
5919 * src/mathed/formula.C (InsetButtonRelease):
5920 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5923 * src/BufferView.C (workAreaButtonPress):
5924 (workAreaButtonRelease):
5925 (checkInsetHit): Finally fixed the clicking on insets be handled
5928 * src/insets/insetert.C (Edit): inserted this call so that ERT
5929 insets work always with LaTeX-font
5931 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5933 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5934 caused lyx to startup with no GUI in place, causing in a crash
5935 upon startup when called with arguments.
5937 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5939 * src/FontLoader.C: better initialization of dummyXFontStruct.
5941 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5943 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5944 for linuxdoc and docbook import and export format options.
5946 * lib/lyxrc.example Example of default values for the previous flags.
5948 * src/lyx_cb.C Use those flags instead of the hardwired values for
5949 linuxdoc and docbook export.
5951 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5954 * src/menus.C Added menus entries for the new import/exports formats.
5956 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5958 * src/lyxrc.*: Added support for running without Gui
5961 * src/FontLoader.C: sensible defaults if no fonts are needed
5963 * src/lyx_cb.C: New function ShowMessage (writes either to the
5964 minibuffer or cout in case of no gui
5965 New function AskOverwrite for common stuff
5966 Consequently various changes to call these functions
5968 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5969 wild guess at sensible screen resolution when having no gui
5971 * src/lyxfont.C: no gui, no fonts... set some defaults
5973 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5975 * src/LColor.C: made the command inset background a bit lighter.
5977 2000-03-20 Hartmut Goebel <goebel@noris.net>
5979 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5980 stdstruct.inc. Koma-Script added some title elements which
5981 otherwise have been listed below "bibliography". This split allows
5982 adding title elements to where they belong.
5984 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5985 define the additional tilte elements and then include
5988 * many other layout files: changed to include stdtitle.inc just
5989 before stdstruct.inc.
5991 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5993 * src/buffer.C: (save) Added the option to store all backup files
5994 in a single directory
5996 * src/lyxrc.[Ch]: Added variable \backupdir_path
5998 * lib/lyxrc.example: Added descriptions of recently added variables
6000 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6001 bibtex inset, not closing the bibtex popup when deleting the inset)
6003 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6005 * src/lyx_cb.C: add a couple using directives.
6007 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6008 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6009 import based on the filename.
6011 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6012 file would be imported at start, if the filename where of a sgml file.
6014 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6016 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6018 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6019 * src/lyxfont.h Replaced the member variable bits.direction by the
6020 member variable lang. Made many changes in other files.
6021 This allows having a multi-lingual document
6023 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6024 that change the current language to <l>.
6025 Removed the command "font-rtl"
6027 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6028 format for Hebrew documents)
6030 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6031 When auto_mathmode is "true", pressing a digit key in normal mode
6032 will cause entering into mathmode.
6033 If auto_mathmode is "rtl" then this behavior will be active only
6034 when writing right-to-left text.
6036 * src/text2.C (InsertStringA) The string is inserted using the
6039 * src/paragraph.C (GetEndLabel) Gives a correct result for
6040 footnote paragraphs.
6042 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6044 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6046 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6047 front of PasteParagraph. Never insert a ' '. This should at least
6048 fix some cause for the segfaults that we have been experiencing,
6049 it also fixes backspace behaviour slightly. (Phu!)
6051 * src/support/lstrings.C (compare_no_case): some change to make it
6052 compile with gcc 2.95.2 and stdlibc++-v3
6054 * src/text2.C (MeltFootnoteEnvironment): change type o
6055 first_footnote_par_is_not_empty to bool.
6057 * src/lyxparagraph.h: make text private. Changes in other files
6059 (fitToSize): new function
6060 (setContentsFromPar): new function
6061 (clearContents): new function
6062 (SetChar): new function
6064 * src/paragraph.C (readSimpleWholeFile): deleted.
6066 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6067 the file, just use a simple string instead. Also read the file in
6068 a more maintainable manner.
6070 * src/text2.C (InsertStringA): deleted.
6071 (InsertStringB): deleted.
6073 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6075 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6076 RedoParagraphs from the doublespace handling part, just set status
6077 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6078 done, but perhaps not like this.)
6080 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6082 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6083 character when inserting an inset.
6085 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * src/bufferparams.C (readLanguage): now takes "default" into
6090 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6091 also initialize the toplevel_keymap with the default bindings from
6094 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6096 * all files using lyxrc: have lyxrc as a real variable and not a
6097 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6100 * src/lyxrc.C: remove double call to defaultKeyBindings
6102 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6103 toolbar defauls using lyxlex. Remove enums, structs, functions
6106 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6107 toolbar defaults. Also store default keybindings in a map.
6109 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6110 storing the toolbar defaults without any xforms dependencies.
6112 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6113 applied. Changed to use iterators.
6115 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6117 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6118 systems that don't have LINGUAS set to begin with.
6120 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6122 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6123 the list by Dekel Tsur.
6125 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6127 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6128 * src/insets/form_graphics.C: ditto.
6130 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6132 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6134 * src/bufferparams.C (readLanguage): use the new language map
6136 * src/intl.C (InitKeyMapper): use the new language map
6138 * src/lyx_gui.C (create_forms): use the new language map
6140 * src/language.[Ch]: New files. Used for holding the information
6141 about each language. Now! Use this new language map enhance it and
6142 make it really usable for our needs.
6144 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6146 * screen.C (ShowCursor): Removed duplicate code.
6147 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6148 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6150 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6153 * src/text.C Added TransformChar method. Used for rendering Arabic
6154 text correctly (change the glyphs of the letter according to the
6155 position in the word)
6160 * src/lyxrc.C Added lyxrc command {language_command_begin,
6161 language_command_end,language_command_ltr,language_command_rtl,
6162 language_package} which allows the use of either arabtex or Omega
6165 * src/lyx_gui.C (init)
6167 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6168 to use encoding for menu fonts which is different than the encoding
6171 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6172 do not load the babel package.
6173 To write an English document with Hebrew/Arabic, change the document
6174 language to "english".
6176 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6177 (alphaCounter): changed to return char
6178 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6180 * lib/lyxrc.example Added examples for Hebrew/Arabic
6183 * src/layout.C Added layout command endlabeltype
6185 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6187 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6189 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6191 * src/mathed/math_delim.C (search_deco): return a
6192 math_deco_struct* instead of index.
6194 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6196 * All files with a USE_OSTREAM_ONLY within: removed all code that
6197 was unused when USE_OSTREAM_ONLY is defined.
6199 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6200 of any less. Removed header and using.
6202 * src/text.C (GetVisibleRow): draw the string "Page Break
6203 (top/bottom)" on screen when drawing a pagebreak line.
6205 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6207 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6209 * src/mathed/math_macro.C (draw): do some cast magic.
6212 * src/mathed/math_defs.h: change byte* argument to byte const*.
6214 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6216 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6217 know it is right to return InsetFoot* too, but cxx does not like
6220 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6222 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6224 * src/mathed/math_delim.C: change == to proper assignment.
6226 2000-03-09 Juergen Vigna <jug@sad.it>
6228 * src/insets/insettext.C (setPos): fixed various cursor positioning
6229 problems (via mouse and cursor-keys)
6230 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6231 inset (still a small display problem but it works ;)
6233 * src/insets/insetcollapsable.C (draw): added button_top_y and
6234 button_bottom_y to have correct values for clicking on the inset.
6236 * src/support/lyxalgo.h: commented out 'using std::less'
6238 2000-03-08 Juergen Vigna <jug@sad.it>
6240 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6241 Button-Release event closes as it is alos the Release-Event
6244 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6246 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6248 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6249 can add multiple spaces in Scrap (literate programming) styles...
6250 which, by the way, is how I got hooked on LyX to begin with.
6252 * src/mathed/formula.C (Write): Added dummy variable to an
6253 inset::Latex() call.
6254 (Latex): Add free_spacing boolean to inset::Latex()
6256 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6258 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6259 virtual function to include the free_spacing boolean from
6260 the containing paragraph's style.
6262 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6263 Added free_spacing boolean arg to match inset.h
6265 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6266 Added free_spacing boolean arg to match inset.h
6268 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6269 Added free_spacing boolean and made sure that if in a free_spacing
6270 paragraph, that we output normal space if there is a protected space.
6272 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6273 Added free_spacing boolean arg to match inset.h
6275 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6276 Added free_spacing boolean arg to match inset.h
6278 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6279 Added free_spacing boolean arg to match inset.h
6281 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6282 Added free_spacing boolean arg to match inset.h
6284 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6285 Added free_spacing boolean arg to match inset.h
6287 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6288 free_spacing boolean arg to match inset.h
6290 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6291 Added free_spacing boolean arg to match inset.h
6293 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6294 Added free_spacing boolean arg to match inset.h
6296 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6297 Added free_spacing boolean arg to match inset.h
6299 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6300 Added free_spacing boolean arg to match inset.h
6302 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6303 Added free_spacing boolean arg to match inset.h
6305 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6306 free_spacing boolean arg to match inset.h
6308 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6309 free_spacing boolean arg to match inset.h
6311 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6312 ignore free_spacing paragraphs. The user's spaces are left
6315 * src/text.C (InsertChar): Fixed the free_spacing layout
6316 attribute behavior. Now, if free_spacing is set, you can
6317 add multiple spaces in a paragraph with impunity (and they
6318 get output verbatim).
6319 (SelectSelectedWord): Added dummy argument to inset::Latex()
6322 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6325 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6326 paragraph layouts now only input a simple space instead.
6327 Special character insets don't make any sense in free-spacing
6330 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6331 hard-spaces in the *input* file to simple spaces if the layout
6332 is free-spacing. This converts old files which had to have
6333 hard-spaces in free-spacing layouts where a simple space was
6335 (writeFileAscii): Added free_spacing check to pass to the newly
6336 reworked inset::Latex(...) methods. The inset::Latex() code
6337 ensures that hard-spaces in free-spacing paragraphs get output
6338 as spaces (rather than "~").
6340 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * src/mathed/math_delim.C (draw): draw the empty placeholder
6343 delims with a onoffdash line.
6344 (struct math_deco_compare): struct that holds the "functors" used
6345 for the sort and the binary search in math_deco_table.
6346 (class init_deco_table): class used for initial sort of the
6348 (search_deco): use lower_bound to do a binary search in the
6351 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6353 * src/lyxrc.C: a small secret thingie...
6355 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6356 and to not flush the stream as often as it used to.
6358 * src/support/lyxalgo.h: new file
6359 (sorted): template function used for checking if a sequence is
6360 sorted or not. Two versions with and without user supplied
6361 compare. Uses same compare as std::sort.
6363 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6364 it and give warning on lyxerr.
6366 (struct compare_tags): struct with function operators used for
6367 checking if sorted, sorting and lower_bound.
6368 (search_kw): use lower_bound instead of manually implemented
6371 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6373 * src/insets/insetcollapsable.h: fix Clone() declaration.
6374 * src/insets/insetfoot.h: ditto.
6376 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6378 2000-03-08 Juergen Vigna <jug@sad.it>
6380 * src/insets/lyxinset.h: added owner call which tells us if
6381 this inset is inside another inset. Changed also the return-type
6382 of Editable to an enum so it tells clearer what the return-value is.
6384 * src/insets/insettext.C (computeTextRows): fixed computing of
6385 textinsets which split automatically on more rows.
6387 * src/insets/insetert.[Ch]: changed this to be of BaseType
6390 * src/insets/insetfoot.[Ch]: added footnote inset
6392 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6393 collapsable insets (like footnote, ert, ...)
6395 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6397 * src/lyxdraw.h: remvoe file
6399 * src/lyxdraw.C: remove file
6401 * src/insets/insettext.C: added <algorithm>.
6403 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6405 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6406 (matrix_cb): case MM_OK use string stream
6408 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6411 * src/mathed/math_macro.C (draw): use string stream
6412 (Metrics): use string stream
6414 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6415 directly to the ostream.
6417 * src/vspace.C (asString): use string stream.
6418 (asString): use string stream
6419 (asLatexString): use string stream
6421 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6422 setting Spacing::Other.
6424 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6425 sprintf when creating the stretch vale.
6427 * src/text2.C (alphaCounter): changed to return a string and to
6428 not use a static variable internally. Also fixed a one-off bug.
6429 (SetCounter): changed the drawing of the labels to use string
6430 streams instead of sprintf.
6432 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6433 manipulator to use a scheme that does not require library support.
6434 This is also the way it is done in the new GNU libstdc++. Should
6435 work with DEC cxx now.
6437 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6439 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6440 end. This fixes a bug.
6442 * src/mathed (all files concerned with file writing): apply the
6443 USE_OSTREAM_ONLY changes to mathed too.
6445 * src/support/DebugStream.h: make the constructor explicit.
6447 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6448 count and ostream squashed.
6450 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6454 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6455 ostringstream uses STL strings, and we might not.
6457 * src/insets/insetspecialchar.C: add using directive.
6458 * src/insets/insettext.C: ditto.
6460 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6462 * lib/layouts/seminar.layout: feeble attempt at a layout for
6463 seminar.cls, far from completet and could really use some looking
6464 at from people used to write layout files.
6466 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6467 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6468 a lot nicer and works nicely with ostreams.
6470 * src/mathed/formula.C (draw): a slightly different solution that
6471 the one posted to the list, but I think this one works too. (font
6472 size wrong in headers.)
6474 * src/insets/insettext.C (computeTextRows): some fiddling on
6475 Jürgens turf, added some comments that he should read.
6477 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6478 used and it gave compiler warnings.
6479 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6482 * src/lyx_gui.C (create_forms): do the right thing when
6483 show_banner is true/false.
6485 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6486 show_banner is false.
6488 * most file writing files: Now use iostreams to do almost all of
6489 the writing. Also instead of passing string &, we now use
6490 stringstreams. mathed output is still not adapted to iostreams.
6491 This change can be turned off by commenting out all the occurences
6492 of the "#define USE_OSTREAM_ONLY 1" lines.
6494 * src/WorkArea.C (createPixmap): don't output debug messages.
6495 (WorkArea): don't output debug messages.
6497 * lib/lyxrc.example: added a comment about the new variable
6500 * development/Code_rules/Rules: Added some more commente about how
6501 to build class interfaces and on how better encapsulation can be
6504 2000-03-03 Juergen Vigna <jug@sad.it>
6506 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6507 automatically with the width of the LyX-Window
6509 * src/insets/insettext.C (computeTextRows): fixed update bug in
6510 displaying text-insets (scrollvalues where not initialized!)
6512 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6514 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6515 id in the check of the result from lower_bound is not enough since
6516 lower_bound can return last too, and then res->id will not be a
6519 * all insets and some code that use them: I have conditionalized
6520 removed the Latex(string & out, ...) this means that only the
6521 Latex(ostream &, ...) will be used. This is a work in progress to
6522 move towards using streams for all output of files.
6524 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6527 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6529 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6530 routine (this fixes bug where greek letters were surrounded by too
6533 * src/support/filetools.C (findtexfile): change a bit the search
6534 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6535 no longer passed to kpsewhich, we may have to change that later.
6537 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6538 warning options to avoid problems with X header files (from Angus
6540 * acinclude.m4: regenerated.
6542 2000-03-02 Juergen Vigna <jug@sad.it>
6544 * src/insets/insettext.C (WriteParagraphData): Using the
6545 par->writeFile() function for writing paragraph-data.
6546 (Read): Using buffer->parseSingleLyXformat2Token()-function
6547 for parsing paragraph data!
6549 * src/buffer.C (readLyXformat2): removed all parse data and using
6550 the new parseSingleLyXformat2Token()-function.
6551 (parseSingleLyXformat2Token): added this function to parse (read)
6552 lyx-file-format (this is called also from text-insets now!)
6554 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6556 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6559 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6560 directly instead of going through a func. One very bad thing: a
6561 static LyXFindReplace, but I don't know where to place it.
6563 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6564 string instead of char[]. Also changed to static.
6565 (GetSelectionOrWordAtCursor): changed to static inline
6566 (SetSelectionOverLenChars): ditto.
6568 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6569 current_view and global variables. both classes has changed names
6570 and LyXFindReplace is not inherited from SearchForm.
6572 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6573 fl_form_search form.
6575 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6577 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6579 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6580 bound (from Kayvan).
6582 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6584 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6586 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6588 * some things that I should comment but the local pub says head to
6591 * comment out all code that belongs to the Roff code for Ascii
6592 export of tables. (this is unused)
6594 * src/LyXView.C: use correct type for global variable
6595 current_layout. (LyXTextClass::size_type)
6597 * some code to get the new insetgraphics closer to working I'd be
6598 grateful for any help.
6600 * src/BufferView2.C (insertInset): use the return type of
6601 NumberOfLayout properly. (also changes in other files)
6603 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6604 this as a test. I want to know what breaks because of this.
6606 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6608 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6610 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6611 to use a \makebox in the label, this allows proper justification
6612 with out using protected spaces or multiple hfills. Now it is
6613 "label" for left justified, "\hfill label\hfill" for center, and
6614 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6615 should be changed accordingly.
6617 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6619 * src/lyxtext.h: change SetLayout() to take a
6620 LyXTextClass::size_type instead of a char (when there is more than
6621 127 layouts in a class); also change type of copylayouttype.
6622 * src/text2.C (SetLayout): ditto.
6623 * src/LyXView.C (updateLayoutChoice): ditto.
6625 * src/LaTeX.C (scanLogFile): errors where the line number was not
6626 given just after the '!'-line were ignored (from Dekel Tsur).
6628 * lib/lyxrc.example: fix description of \date_insert_format
6630 * lib/layouts/llncs.layout: new layout, contributed by Martin
6633 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6635 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6636 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6637 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6638 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6639 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6640 paragraph.C, text.C, text2.C)
6642 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6644 * src/insets/insettext.C (LocalDispatch): remove extra break
6647 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6648 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6650 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6651 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6653 * src/insets/insetbib.h: move InsetBibkey::Holder and
6654 InsetCitation::Holder in public space.
6656 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6658 * src/insets/insettext.h: small change to get the new files from
6659 Juergen to compile (use "string", not "class string").
6661 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6662 const & as parameter to LocalDispatch, use LyXFont const & as
6663 paramter to some other func. This also had impacto on lyxinsets.h
6664 and the two mathed insets.
6666 2000-02-24 Juergen Vigna <jug@sad.it>
6669 * src/commandtags.h:
6671 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6675 * src/BufferView2.C: added/updated code for various inset-functions
6677 * src/insets/insetert.[Ch]: added implementation of InsetERT
6679 * src/insets/insettext.[Ch]: added implementation of InsetText
6681 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6682 (draw): added preliminary code for inset scrolling not finshed yet
6684 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6685 as it is in lyxfunc.C now
6687 * src/insets/lyxinset.h: Added functions for text-insets
6689 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6691 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6692 BufferView and reimplement the list as a queue put inside its own
6695 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6697 * several files: use the new interface to the "updateinsetlist"
6699 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6701 (work_area_handler): call BufferView::trippleClick on trippleclick.
6703 * src/BufferView.C (doubleClick): new function, selects word on
6705 (trippleClick): new function, selects line on trippleclick.
6707 2000-02-22 Allan Rae <rae@lyx.org>
6709 * lib/bind/xemacs.bind: buffer-previous not supported
6711 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6713 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6716 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/bufferlist.C: get rid of current_view from this file
6720 * src/spellchecker.C: get rid of current_view from this file
6722 * src/vspace.C: get rid of current_view from this file
6723 (inPixels): added BufferView parameter for this func
6724 (asLatexCommand): added a BufferParams for this func
6726 * src/text.C src/text2.C: get rid of current_view from these
6729 * src/lyxfont.C (getFontDirection): move this function here from
6732 * src/bufferparams.C (getDocumentDirection): move this function
6735 * src/paragraph.C (getParDirection): move this function here from
6737 (getLetterDirection): ditto
6739 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6741 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6742 resize due to wrong pixmap beeing used. Also took the opurtunity
6743 to make the LyXScreen stateless on regard to WorkArea and some
6744 general cleanup in the same files.
6746 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6748 * src/Makefile.am: add missing direction.h
6750 * src/PainterBase.h: made the width functions const.
6752 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6755 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6757 * src/insets/insetlatexaccent.C (draw): make the accents draw
6758 better, at present this will only work well with iso8859-1.
6760 * several files: remove the old drawing code, now we use the new
6763 * several files: remove support for mono_video, reverse_video and
6766 2000-02-17 Juergen Vigna <jug@sad.it>
6768 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6769 int ** as we have to return the pointer, otherwise we have only
6770 NULL pointers in the returning function.
6772 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6774 * src/LaTeX.C (operator()): quote file name when running latex.
6776 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6778 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6779 (bubble tip), this removes our special handling of this.
6781 * Remove all code that is unused now that we have the new
6782 workarea. (Code that are not active when NEW_WA is defined.)
6784 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6786 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6788 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6789 nonexisting layout; correctly redirect obsoleted layouts.
6791 * lib/lyxrc.example: document \view_dvi_paper_option
6793 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6796 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6797 (PreviewDVI): handle the view_dvi_paper_option variable.
6798 [Both from Roland Krause]
6800 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6802 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6803 char const *, int, LyXFont)
6804 (text(int, int, string, LyXFont)): ditto
6806 * src/text.C (InsertCharInTable): attempt to fix the double-space
6807 feature in tables too.
6808 (BackspaceInTable): ditto.
6809 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6811 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6815 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6816 newly found text in textcache to this.
6817 (buffer): set the owner of the text put into the textcache to 0
6819 * src/insets/figinset.C (draw): fixed the drawing of figures with
6822 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6823 drawing of mathframe, hfills, protected space, table lines. I have
6824 now no outstanding drawing problems with the new Painter code.
6826 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6828 * src/PainterBase.C (ellipse, circle): do not specify the default
6831 * src/LColor.h: add using directive.
6833 * src/Painter.[Ch]: change return type of methods from Painter& to
6834 PainterBase&. Add a using directive.
6836 * src/WorkArea.C: wrap xforms callbacks in C functions
6839 * lib/layouts/foils.layout: font fix and simplifications from Carl
6842 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6844 * a lot of files: The Painter, LColor and WorkArea from the old
6845 devel branch has been ported to lyx-devel. Some new files and a
6846 lot of #ifdeffed code. The new workarea is enabled by default, but
6847 if you want to test the new Painter and LColor you have to compile
6848 with USE_PAINTER defined (do this in config.h f.ex.) There are
6849 still some rought edges, and I'd like some help to clear those
6850 out. It looks stable (loads and displays the Userguide very well).
6853 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6855 * src/buffer.C (pop_tag): revert to the previous implementation
6856 (use a global variable for both loops).
6858 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6860 * src/lyxrc.C (LyXRC): change slightly default date format.
6862 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6863 there is an English text with a footnote that starts with a Hebrew
6864 paragraph, or vice versa.
6865 (TeXFootnote): ditto.
6867 * src/text.C (LeftMargin): allow for negative values for
6868 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6871 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6872 for input encoding (cyrillic)
6874 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6876 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6879 * src/toolbar.C (set): ditto
6880 * src/insets/insetbib.C (create_form_citation_form): ditto
6882 * lib/CREDITS: added Dekel Tsur.
6884 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6885 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6886 hebrew supports files from Dekel Tsur.
6888 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6889 <tzafrir@technion.ac.il>
6891 * src/lyxrc.C: put \date_insert_format at the right place.
6893 * src/buffer.C (makeLaTeXFile): fix the handling of
6894 BufferParams::sides when writing out latex files.
6896 * src/BufferView2.C: add a "using" directive.
6898 * src/support/lyxsum.C (sum): when we use lyxstring,
6899 ostringstream::str needs an additional .c_str().
6901 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6903 * src/support/filetools.C (ChangeExtension): patch from Etienne
6906 * src/TextCache.C (show): remove const_cast and make second
6907 parameter non-const LyXText *.
6909 * src/TextCache.h: use non const LyXText in show.
6911 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6914 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6916 * src/support/lyxsum.C: rework to be more flexible.
6918 * several places: don't check if a pointer is 0 if you are going
6921 * src/text.C: remove some dead code.
6923 * src/insets/figinset.C: remove some dead code
6925 * src/buffer.C: move the BufferView funcs to BufferView2.C
6926 remove all support for insetlatexdel
6927 remove support for oldpapersize stuff
6928 made some member funcs const
6930 * src/kbmap.C: use a std::list to store the bindings in.
6932 * src/BufferView2.C: new file
6934 * src/kbsequence.[Ch]: new files
6936 * src/LyXAction.C + others: remove all trace of buffer-previous
6938 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6939 only have one copy in the binary of this table.
6941 * hebrew patch: moved some functions from LyXText to more
6942 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6944 * several files: remove support for XForms older than 0.88
6946 remove some #if 0 #endif code
6948 * src/TextCache.[Ch]: new file. Holds the textcache.
6950 * src/BufferView.C: changes to use the new TextCache interface.
6951 (waitForX): remove the now unused code.
6953 * src/BackStack.h: remove some commented code
6955 * lib/bind/emacs.bind: remove binding for buffer-previous
6957 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6959 * applied the hebrew patch.
6961 * src/lyxrow.h: make sure that all Row variables are initialized.
6963 * src/text2.C (TextHandleUndo): comment out a delete, this might
6964 introduce a memory leak, but should also help us to not try to
6965 read freed memory. We need to look at this one.
6967 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6968 (LyXParagraph): initalize footnotekind.
6970 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6971 forgot this when applying the patch. Please heed the warnings.
6973 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6974 (aka. reformat problem)
6976 * src/bufferlist.C (exists): made const, and use const_iterator
6977 (isLoaded): new func.
6978 (release): use std::find to find the correct buffer.
6980 * src/bufferlist.h: made getState a const func.
6981 made empty a const func.
6982 made exists a const func.
6985 2000-02-01 Juergen Vigna <jug@sad.it>
6987 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6989 * po/it.po: updated a bit the italian po file and also changed the
6990 'file nuovo' for newfile to 'filenuovo' without a space, this did
6993 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6994 for the new insert_date command.
6996 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6997 from jdblair, to insert a date into the current text conforming to
6998 a strftime format (for now only considering the locale-set and not
6999 the document-language).
7001 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7003 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7004 Bounds Read error seen by purify. The problem was that islower is
7005 a macros which takes an unsigned char and uses it as an index for
7006 in array of characters properties (and is thus subject to the
7010 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7011 correctly the paper sides radio buttons.
7012 (UpdateDocumentButtons): ditto.
7014 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/kbmap.C (getsym + others): change to return unsigned int,
7017 returning a long can give problems on 64 bit systems. (I assume
7018 that int is 32bit on 64bit systems)
7020 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7022 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7023 LyXLookupString to be zero-terminated. Really fixes problems seen
7026 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7028 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7029 write a (char*)0 to the lyxerr stream.
7031 * src/lastfiles.C: move algorithm before the using statemets.
7033 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7035 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7036 complains otherwise).
7037 * src/table.C: ditto
7039 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7042 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7043 that I removed earlier... It is really needed.
7045 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7047 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7049 * INSTALL: update xforms home page URL.
7051 * lib/configure.m4: fix a bug with unreadable layout files.
7053 * src/table.C (calculate_width_of_column): add "using std::max"
7056 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7058 * several files: marked several lines with "DEL LINE", this is
7059 lines that can be deleted without changing anything.
7060 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7061 checks this anyway */
7064 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7066 * src/DepTable.C (update): add a "+" at the end when the checksum
7067 is different. (debugging string only)
7069 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7070 the next inset to not be displayed. This should also fix the list
7071 of labels in the "Insert Crossreference" dialog.
7073 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7075 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7076 when regex was not found.
7078 * src/support/lstrings.C (lowercase): use handcoded transform always.
7081 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7082 old_cursor.par->prev could be 0.
7084 * several files: changed post inc/dec to pre inc/dec
7086 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7087 write the lastfiles to file.
7089 * src/BufferView.C (buffer): only show TextCache info when debugging
7091 (resizeCurrentBuffer): ditto
7092 (workAreaExpose): ditto
7094 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7096 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7098 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7099 a bit better by removing the special case for \i and \j.
7101 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7103 * src/lyx_main.C (easyParse): remove test for bad comand line
7104 options, since this broke all xforms-related parsing.
7106 * src/kbmap.C (getsym): set return type to unsigned long, as
7107 declared in header. On an alpha, long is _not_ the same as int.
7109 * src/support/LOstream.h: add a "using std::flush;"
7111 * src/insets/figinset.C: ditto.
7113 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7115 * src/bufferlist.C (write): use blinding fast file copy instead of
7116 "a char at a time", now we are doing it the C++ way.
7118 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7119 std::list<int> instead.
7120 (addpidwait): reflect move to std::list<int>
7121 (sigchldchecker): ditto
7123 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7126 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7127 that obviously was wrong...
7129 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7130 c, this avoids warnings with purify and islower.
7132 * src/insets/figinset.C: rename struct queue to struct
7133 queue_element and rewrite to use a std::queue. gsqueue is now a
7134 std::queue<queue_element>
7135 (runqueue): reflect move to std::queue
7138 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7139 we would get "1" "0" instead of "true" "false. Also make the tostr
7142 2000-01-21 Juergen Vigna <jug@sad.it>
7144 * src/buffer.C (writeFileAscii): Disabled code for special groff
7145 handling of tabulars till I fix this in table.C
7147 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7149 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7151 * src/support/lyxlib.h: ditto.
7153 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7155 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7156 and 'j' look better. This might fix the "macron" bug that has been
7159 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7160 functions as one template function. Delete the old versions.
7162 * src/support/lyxsum.C: move using std::ifstream inside
7165 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7168 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7170 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7172 * src/insets/figinset.C (InitFigures): use new instead of malloc
7173 to allocate memory for figures and bitmaps.
7174 (DoneFigures): use delete[] instead of free to deallocate memory
7175 for figures and bitmaps.
7176 (runqueue): use new to allocate
7177 (getfigdata): use new/delete[] instead of malloc/free
7178 (RegisterFigure): ditto
7180 * some files: moved some declarations closer to first use, small
7181 whitespace changes use preincrement instead of postincrement where
7182 it does not make a difference.
7184 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7185 step on the way to use stl::containers for key maps.
7187 * src/bufferlist.h: add a typedef for const_iterator and const
7188 versions of begin and end.
7190 * src/bufferlist.[Ch]: change name of member variable _state to
7191 state_. (avoid reserved names)
7193 (getFileNames): returns the filenames of the buffers in a vector.
7195 * configure.in (ALL_LINGUAS): added ro
7197 * src/support/putenv.C: new file
7199 * src/support/mkdir.C: new file
7201 2000-01-20 Allan Rae <rae@lyx.org>
7203 * lib/layouts/IEEEtran.layout: Added several theorem environments
7205 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7206 couple of minor additions.
7208 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7209 (except for those in footnotes of course)
7211 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7213 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7215 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7216 std::sort and std::lower_bound instead of qsort and handwritten
7218 (struct compara): struct that holds the functors used by std::sort
7219 and std::lower_bound in MathedLookupBOP.
7221 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7223 * src/support/LAssert.h: do not do partial specialization. We do
7226 * src/support/lyxlib.h: note that lyx::getUserName() and
7227 lyx::date() are not in use right now. Should these be suppressed?
7229 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7230 (makeLinuxDocFile): do not put date and user name in linuxdoc
7233 * src/support/lyxlib.h (kill): change first argument to long int,
7234 since that's what solaris uses.
7236 * src/support/kill.C (kill): fix declaration to match prototype.
7238 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7239 actually check whether namespaces are supported. This is not what
7242 * src/support/lyxsum.C: add a using directive.
7244 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7246 * src/support/kill.C: if we have namespace support we don't have
7247 to include lyxlib.h.
7249 * src/support/lyxlib.h: use namespace lyx if supported.
7251 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7253 * src/support/date.C: new file
7255 * src/support/chdir.C: new file
7257 * src/support/getUserName.C: new file
7259 * src/support/getcwd.C: new file
7261 * src/support/abort.C: new file
7263 * src/support/kill.C: new file
7265 * src/support/lyxlib.h: moved all the functions in this file
7266 insede struct lyx. Added also kill and abort to this struct. This
7267 is a way to avoid the "kill is not defined in <csignal>", we make
7268 C++ wrappers for functions that are not ANSI C or ANSI C++.
7270 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7271 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7272 lyx it has been renamed to sum.
7274 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7276 * src/text.C: add using directives for std::min and std::max.
7278 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7280 * src/texrow.C (getIdFromRow): actually return something useful in
7281 id and pos. Hopefully fixes the bug with positionning of errorbox
7284 * src/lyx_main.C (easyParse): output an error and exit if an
7285 incorrect command line option has been given.
7287 * src/spellchecker.C (ispell_check_word): document a memory leak.
7289 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7290 where a "struct utimbuf" is allocated with "new" and deleted with
7293 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7295 * src/text2.C (CutSelection): don't delete double spaces.
7296 (PasteSelection): ditto
7297 (CopySelection): ditto
7299 * src/text.C (Backspace): don't delete double spaces.
7301 * src/lyxlex.C (next): fix a bug that were only present with
7302 conformant std::istream::get to read comment lines, use
7303 std::istream::getline instead. This seems to fix the problem.
7305 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7308 allowed to insert space before space" editing problem. Please read
7309 commends at the beginning of the function. Comments about usage
7312 * src/text.C (InsertChar): fix for the "not allowed to insert
7313 space before space" editing problem.
7315 * src/text2.C (DeleteEmptyParagraphMechanism): when
7316 IsEmptyTableRow can only return false this last "else if" will
7317 always be a no-op. Commented out.
7319 * src/text.C (RedoParagraph): As far as I can understand tmp
7320 cursor is not really needed.
7322 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7323 present it could only return false anyway.
7324 (several functions): Did something not so smart...added a const
7325 specifier on a lot of methods.
7327 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7328 and add a tmp->text.resize. The LyXParagraph constructor does the
7330 (BreakParagraphConservative): ditto
7332 * src/support/path.h (Path): add a define so that the wrong usage
7333 "Path("/tmp") will be flagged as a compilation error:
7334 "`unnamed_Path' undeclared (first use this function)"
7336 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7338 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7339 which was bogus for several reasons.
7341 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7345 * autogen.sh: do not use "type -path" (what's that anyway?).
7347 * src/support/filetools.C (findtexfile): remove extraneous space
7348 which caused a kpsewhich warning (at least with kpathsea version
7351 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7353 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7355 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7357 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7359 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7361 * src/paragraph.C (BreakParagraph): do not reserve space on text
7362 if we don't need to (otherwise, if pos_end < pos, we end up
7363 reserving huge amounts of memory due to bad unsigned karma).
7364 (BreakParagraphConservative): ditto, although I have not seen
7365 evidence the bug can happen here.
7367 * src/lyxparagraph.h: add a using std::list.
7369 2000-01-11 Juergen Vigna <jug@sad.it>
7371 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7374 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * src/vc-backend.C (doVCCommand): change to be static and take one
7377 more parameter: the path to chdir too be fore executing the command.
7378 (retrive): new function equiv to "co -r"
7380 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7381 file_not_found_hook is true.
7383 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7385 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7386 if a file is readwrite,readonly...anything else.
7388 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7390 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7391 (CreatePostscript): name change from MenuRunDVIPS (or something)
7392 (PreviewPostscript): name change from MenuPreviewPS
7393 (PreviewDVI): name change from MenuPreviewDVI
7395 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7396 \view_pdf_command., \pdf_to_ps_command
7398 * lib/configure.m4: added search for PDF viewer, and search for
7399 PDF to PS converter.
7400 (lyxrc.defaults output): add \pdflatex_command,
7401 \view_pdf_command and \pdf_to_ps_command.
7403 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7405 * src/bufferlist.C (write): we don't use blocksize for anything so
7408 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7410 * src/support/block.h: disable operator T* (), since it causes
7411 problems with both compilers I tried. See comments in the file.
7413 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7416 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7417 variable LYX_DIR_10x to LYX_DIR_11x.
7419 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7421 * INSTALL: document --with-lyxname.
7424 * configure.in: new configure flag --with-lyxname which allows to
7425 choose the name under which lyx is installed. Default is "lyx", of
7426 course. It used to be possible to do this with --program-suffix,
7427 but the later has in fact a different meaning for autoconf.
7429 * src/support/lstrings.h (lstrchr): reformat a bit.
7431 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7432 * src/mathed/math_defs.h: ditto.
7434 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7437 true, decides if we create a backup file or not when saving. New
7438 tag and variable \pdf_mode, defaults to false. New tag and
7439 variable \pdflatex_command, defaults to pdflatex. New tag and
7440 variable \view_pdf_command, defaults to xpdf. New tag and variable
7441 \pdf_to_ps_command, defaults to pdf2ps.
7443 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7445 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7446 does not have a BufferView.
7447 (unlockInset): ditto + don't access the_locking_inset if the
7448 buffer does not have a BufferView.
7450 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7451 certain circumstances so that we don't continue a keyboard
7452 operation long after the key was released. Try f.ex. to load a
7453 large document, press PageDown for some seconds and then release
7454 it. Before this change the document would contine to scroll for
7455 some time, with this change it stops imidiatly.
7457 * src/support/block.h: don't allocate more space than needed. As
7458 long as we don't try to write to the arr[x] in a array_type arr[x]
7459 it is perfectly ok. (if you write to it you might segfault).
7460 added operator value_type*() so that is possible to pass the array
7461 to functions expecting a C-pointer.
7463 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7466 * intl/*: updated to gettext 0.10.35, tried to add our own
7467 required modifications. Please verify.
7469 * po/*: updated to gettext 0.10.35, tried to add our own required
7470 modifications. Please verify.
7472 * src/support/lstrings.C (tostr): go at fixing the problem with
7473 cxx and stringstream. When stringstream is used return
7474 oss.str().c_str() so that problems with lyxstring and basic_string
7475 are avoided. Note that the best solution would be for cxx to use
7476 basic_string all the way, but it is not conformant yet. (it seems)
7478 * src/lyx_cb.C + other files: moved several global functions to
7479 class BufferView, some have been moved to BufferView.[Ch] others
7480 are still located in lyx_cb.C. Code changes because of this. (part
7481 of "get rid of current_view project".)
7483 * src/buffer.C + other files: moved several Buffer functions to
7484 class BufferView, the functions are still present in buffer.C.
7485 Code changes because of this.
7487 * config/lcmessage.m4: updated to most recent. used when creating
7490 * config/progtest.m4: updated to most recent. used when creating
7493 * config/gettext.m4: updated to most recent. applied patch for
7496 * config/gettext.m4.patch: new file that shows what changes we
7497 have done to the local copy of gettext.m4.
7499 * config/libtool.m4: new file, used in creation of acinclude.m4
7501 * config/lyxinclude.m4: new file, this is the lyx created m4
7502 macros, used in making acinclude.m4.
7504 * autogen.sh: GNU m4 discovered as a separate task not as part of
7505 the lib/configure creation.
7506 Generate acinlucde from files in config. Actually cat
7507 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7508 easier to upgrade .m4 files that really are external.
7510 * src/Spacing.h: moved using std::istringstream to right after
7511 <sstream>. This should fix the problem seen with some compilers.
7513 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7515 * src/lyx_cb.C: began some work to remove the dependency a lot of
7516 functions have on BufferView::text, even if not really needed.
7517 (GetCurrentTextClass): removed this func, it only hid the
7520 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7521 forgot this in last commit.
7523 * src/Bullet.C (bulletEntry): use static char const *[] for the
7524 tables, becuase of this the return arg had to change to string.
7526 (~Bullet): removed unneeded destructor
7528 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7529 (insetSleep): moved from Buffer
7530 (insetWakeup): moved from Buffer
7531 (insetUnlock): moved from Buffer
7533 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7534 from Buffer to BufferView.
7536 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7538 * config/ltmain.sh: updated to version 1.3.4 of libtool
7540 * config/ltconfig: updated to version 1.3.4 of libtool
7542 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7545 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7546 Did I get that right?
7548 * src/lyxlex.h: add a "using" directive or two.
7549 * src/Spacing.h: ditto.
7550 * src/insets/figinset.C: ditto.
7551 * src/support/filetools.C: ditto.
7552 * src/support/lstrings.C: ditto.
7553 * src/BufferView.C: ditto.
7554 * src/bufferlist.C: ditto.
7555 * src/lyx_cb.C: ditto.
7556 * src/lyxlex.C: ditto.
7558 * NEWS: add some changes for 1.1.4.
7560 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7562 * src/BufferView.C: first go at a TextCache to speed up switching
7565 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7567 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7568 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7569 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7570 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7573 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7574 members of the struct are correctly initialized to 0 (detected by
7576 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7577 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7579 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7580 pidwait, since it was allocated with "new". This was potentially
7581 very bad. Thanks to Michael Schmitt for running purify for us.
7584 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7586 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7588 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7590 1999-12-30 Allan Rae <rae@lyx.org>
7592 * lib/templates/IEEEtran.lyx: minor change
7594 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7595 src/mathed/formula.C (LocalDispatch): askForText changes
7597 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7598 know when a user has cancelled input. Fixes annoying problems with
7599 inserting labels and version control.
7601 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7603 * src/support/lstrings.C (tostr): rewritten to use strstream and
7606 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * src/support/filetools.C (IsFileWriteable): use fstream to check
7609 (IsDirWriteable): use fileinfo to check
7611 * src/support/filetools.h (FilePtr): whole class deleted
7613 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7615 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7617 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7619 * src/bufferlist.C (write): use ifstream and ofstream instead of
7622 * src/Spacing.h: use istrstream instead of sscanf
7624 * src/mathed/math_defs.h: change first arg to istream from FILE*
7626 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7628 * src/mathed/math_parser.C: have yyis to be an istream
7629 (LexGetArg): use istream (yyis)
7631 (mathed_parse): ditto
7632 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7634 * src/mathed/formula.C (Read): rewritten to use istream
7636 * src/mathed/formulamacro.C (Read): rewritten to use istream
7638 * src/lyxlex.h (~LyXLex): deleted desturctor
7639 (getStream): new function, returns an istream
7640 (getFile): deleted funtion
7641 (IsOK): return is.good();
7643 * src/lyxlex.C (LyXLex): delete file and owns_file
7644 (setFile): open an filebuf and assign that to a istream instead of
7646 (setStream): new function, takes an istream as arg.
7647 (setFile): deleted function
7648 (EatLine): rewritten us use istream instead of FILE*
7652 * src/table.C (LyXTable): use istream instead of FILE*
7653 (Read): rewritten to take an istream instead of FILE*
7655 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7657 * src/buffer.C (Dispatch): remove an extraneous break statement.
7659 * src/support/filetools.C (QuoteName): change to do simple
7660 'quoting'. More work is necessary. Also changed to do nothing
7661 under emx (needs fix too).
7662 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7664 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7665 config.h.in to the AC_DEFINE_UNQUOTED() call.
7666 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7667 needs char * as argument (because Solaris 7 declares it like
7670 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7671 remove definition of BZERO.
7673 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7675 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7676 defined, "lyxregex.h" if not.
7678 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7680 (REGEX): new variable that is set to regex.c lyxregex.h when
7681 AM_CONDITIONAL USE_REGEX is set.
7682 (libsupport_la_SOURCES): add $(REGEX)
7684 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7687 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7690 * configure.in: add call to LYX_REGEX
7692 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7693 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7695 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7697 * lib/bind/fi_menus.bind: new file, from
7698 pauli.virtanen@saunalahti.fi.
7700 * src/buffer.C (getBibkeyList): pass the parameter delim to
7701 InsetInclude::getKeys and InsetBibtex::getKeys.
7703 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7704 is passed to Buffer::getBibkeyList
7706 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7707 instead of the hardcoded comma.
7709 * src/insets/insetbib.C (getKeys): make sure that there are not
7710 leading blanks in bibtex keys. Normal latex does not care, but
7711 harvard.sty seems to dislike blanks at the beginning of citation
7712 keys. In particular, the retturn value of the function is
7714 * INSTALL: make it clear that libstdc++ is needed and that gcc
7715 2.7.x probably does not work.
7717 * src/support/filetools.C (findtexfile): make debug message go to
7719 * src/insets/insetbib.C (getKeys): ditto
7721 * src/debug.C (showTags): make sure that the output is correctly
7724 * configure.in: add a comment for TWO_COLOR_ICON define.
7726 * acconfig.h: remove all the entries that already defined in
7727 configure.in or acinclude.m4.
7729 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7730 to avoid user name, date and copyright.
7732 1999-12-21 Juergen Vigna <jug@sad.it>
7734 * src/table.C (Read): Now read bogus row format informations
7735 if the format is < 5 so that afterwards the table can
7736 be read by lyx but without any format-info. Fixed the
7737 crash we experienced when not doing this.
7739 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7741 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7742 (RedoDrawingOfParagraph): ditto
7743 (RedoParagraphs): ditto
7744 (RemoveTableRow): ditto
7746 * src/text.C (Fill): rename arg paperwidth -> paper_width
7748 * src/buffer.C (insertLyXFile): rename var filename -> fname
7749 (writeFile): rename arg filename -> fname
7750 (writeFileAscii): ditto
7751 (makeLaTeXFile): ditto
7752 (makeLinuxDocFile): ditto
7753 (makeDocBookFile): ditto
7755 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7758 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7760 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7763 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7764 compiled by a C compiler not C++.
7766 * src/layout.h (LyXTextClass): added typedef for const_iterator
7767 (LyXTextClassList): added typedef for const_iterator + member
7768 functions begin and end.
7770 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7771 iterators to fill the choice_class.
7772 (updateLayoutChoice): rewritten to use iterators to fill the
7773 layoutlist in the toolbar.
7775 * src/BufferView.h (BufferView::work_area_width): removed unused
7778 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7780 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7781 (sgmlCloseTag): ditto
7783 * src/support/lstrings.h: return type of countChar changed to
7786 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7787 what version of this func to use. Also made to return unsigned int.
7789 * configure.in: call LYX_STD_COUNT
7791 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7792 conforming std::count.
7794 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7796 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7797 and a subscript would give bad display (patch from Dekel Tsur
7798 <dekel@math.tau.ac.il>).
7800 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7802 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7805 * src/chset.h: add a few 'using' directives
7807 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7808 triggered when no buffer is active
7810 * src/layout.C: removed `break' after `return' in switch(), since
7813 * src/lyx_main.C (init): make sure LyX can be ran in place even
7814 when libtool has done its magic with shared libraries. Fix the
7815 test for the case when the system directory has not been found.
7817 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7818 name for the latex file.
7819 (MenuMakeHTML): ditto
7821 * src/buffer.h: add an optional boolean argument, which is passed
7824 1999-12-20 Allan Rae <rae@lyx.org>
7826 * lib/templates/IEEEtran.lyx: small correction and update.
7828 * configure.in: Attempted to use LYX_PATH_HEADER
7830 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7832 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7833 input from JMarc. Now use preprocessor to find the header.
7834 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7835 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7836 LYX_STL_STRING_FWD. See comments in file.
7838 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7840 * The global MiniBuffer * minibuffer variable is dead.
7842 * The global FD_form_main * fd_form_main variable is dead.
7844 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7846 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7848 * src/table.h: add the LOstream.h header
7849 * src/debug.h: ditto
7851 * src/LyXAction.h: change the explaination of the ReadOnly
7852 attribute: is indicates that the function _can_ be used.
7854 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7857 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7859 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7865 * src/paragraph.C (GetWord): assert on pos>=0
7868 * src/support/lyxstring.C: condition the use of an invariant on
7870 * src/support/lyxstring.h: ditto
7872 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7873 Use LAssert.h instead of plain assert().
7875 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7877 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7878 * src/support/filetools.C: ditto
7880 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7883 * INSTALL: document the new configure flags
7885 * configure.in: suppress --with-debug; add --enable-assertions
7887 * acinclude.m4: various changes in alignment of help strings.
7889 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7891 * src/kbmap.C: commented out the use of the hash map in kb_map,
7892 beginning of movement to a stl::container.
7894 * several files: removed code that was not in effect when
7895 MOVE_TEXT was defined.
7897 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7898 for escaping should not be used. We can discuss if the string
7899 should be enclosed in f.ex. [] instead of "".
7901 * src/trans_mgr.C (insert): use the new returned value from
7902 encodeString to get deadkeys and keymaps done correctly.
7904 * src/chset.C (encodeString): changed to return a pair, to tell
7905 what to use if we know the string.
7907 * src/lyxscreen.h (fillArc): new function.
7909 * src/FontInfo.C (resize): rewritten to use more std::string like
7910 structore, especially string::replace.
7912 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7915 * configure.in (chmod +x some scripts): remove config/gcc-hack
7917 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7919 * src/buffer.C (writeFile): change once again the top comment in a
7920 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7921 instead of an hardcoded version number.
7922 (makeDocBookFile): ditto
7924 * src/version.h: add new define LYX_DOCVERSION
7926 * po/de.po: update from Pit Sütterlin
7927 * lib/bind/de_menus.bind: ditto.
7929 * src/lyxfunc.C (Dispatch): call MenuExport()
7930 * src/buffer.C (Dispatch): ditto
7932 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7933 LyXFunc::Dispatch().
7934 (MenuExport): new function, moved from
7935 LyXFunc::Dispatch().
7937 * src/trans_mgr.C (insert): small cleanup
7938 * src/chset.C (loadFile): ditto
7940 * lib/kbd/iso8859-1.cdef: add missing backslashes
7942 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7944 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7945 help with placing the manually drawn accents better.
7947 (Draw): x2 and hg changed to float to minimize rounding errors and
7948 help place the accents better.
7950 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7951 unsigned short to char is just wrong...cast the char to unsigned
7952 char instead so that the two values can compare sanely. This
7953 should also make the display of insetlatexaccents better and
7954 perhaps also some other insets.
7956 (lbearing): new function
7959 1999-12-15 Allan Rae <rae@lyx.org>
7961 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7962 header that provides a wrapper around the very annoying SGI STL header
7965 * src/support/lyxstring.C, src/LString.h:
7966 removed old SGI-STL-compatability attempts.
7968 * configure.in: Use LYX_STL_STRING_FWD.
7970 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7971 stl_string_fwd.h is around and try to determine it's location.
7972 Major improvement over previous SGI STL 3.2 compatability.
7973 Three small problems remain with this function due to my zero
7974 knowledge of autoconf. JMarc and lgb see the comments in the code.
7976 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7978 * src/broken_const.h, config/hack-gcc, config/README: removed
7980 * configure.in: remove --with-gcc-hack option; do not call
7983 * INSTALL: remove documentation of --with-broken-const and
7986 * acconfig.h: remove all trace of BROKEN_CONST define
7988 * src/buffer.C (makeDocBookFile): update version number in output
7990 (SimpleDocBookOnePar): fix an assert when trying to a character
7991 access beyond string length
7994 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7996 * po/de.po: fix the Export menu
7998 * lyx.man: update the description of -dbg
8000 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8001 (commandLineHelp): updated
8002 (easyParse): show list of available debug levels if -dbg is passed
8005 * src/Makefile.am: add debug.C
8007 * src/debug.h: moved some code to debug.C
8009 * src/debug.C: new file. Contains code to set and show debug
8012 * src/layout.C: remove 'break' after 'continue' in switch
8013 statements, since these cannot be reached.
8015 1999-12-13 Allan Rae <rae@lyx.org>
8017 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8018 (in_word_set): hash() -> math_hash()
8020 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8022 * acconfig.h: Added a test for whether we are using exceptions in the
8023 current compilation run. If so USING_EXCEPTIONS is defined.
8025 * config.in: Check for existance of stl_string_fwd.h
8026 * src/LString.h: If compiling --with-included-string and SGI's
8027 STL version 3.2 is present (see above test) we need to block their
8028 forward declaration of string and supply a __get_c_string().
8029 However, it turns out this is only necessary if compiling with
8030 exceptions enabled so I've a bit more to add yet.
8032 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8033 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8034 src/support/LRegex.h, src/undo.h:
8035 Shuffle the order of the included files a little to ensure that
8036 LString.h gets included before anything that includes stl_string_fwd.h
8038 * src/support/lyxstring.C: We need to #include LString.h instead of
8039 lyxstring.h to get the necessary definition of __get_c_string.
8040 (__get_c_string): New function. This is defined static just like SGI's
8041 although why they need to do this I'm not sure. Perhaps it should be
8042 in lstrings.C instead.
8044 * lib/templates/IEEEtran.lyx: New template file.
8046 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8048 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8049 * intl/Makefile.in (MKINSTALLDIRS): ditto
8051 * src/LyXAction.C (init): changed to hold the LFUN data in a
8052 automatic array in stead of in callso to newFunc, this speeds up
8053 compilation a lot. Also all the memory used by the array is
8054 returned when the init is completed.
8056 * a lot of files: compiled with -Wold-style-cast, changed most of
8057 the reported offenders to C++ style casts. Did not change the
8058 offenders in C files.
8060 * src/trans.h (Match): change argument type to unsigned int.
8062 * src/support/DebugStream.C: fix some types on the streambufs so
8063 that it works on a conforming implementation.
8065 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8067 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8069 * src/support/lyxstring.C: remove the inline added earlier since
8070 they cause a bunch of unsatisfied symbols when linking with dec
8071 cxx. Cxx likes to have the body of inlines at the place where they
8074 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8075 accessing negative bounds in array. This fixes the crash when
8076 inserting accented characters.
8077 * src/trans.h (Match): ditto
8079 * src/buffer.C (Dispatch): since this is a void, it should not try
8080 to return anything...
8082 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8084 * src/buffer.h: removed the two friends from Buffer. Some changes
8085 because of this. Buffer::getFileName and Buffer::setFileName
8086 renamed to Buffer::fileName() and Buffer::fileName(...).
8088 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8090 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8091 and Buffer::update(short) to BufferView. This move is currently
8092 controlled by a define MOVE_TEXT, this will be removed when all
8093 shows to be ok. This move paves the way for better separation
8094 between buffer contents and buffer view. One side effect is that
8095 the BufferView needs a rebreak when swiching buffers, if we want
8096 to avoid this we can add a cache that holds pointers to LyXText's
8097 that is not currently in use.
8099 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8102 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8104 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8106 * lyx_main.C: new command line option -x (or --execute) and
8107 -e (or --export). Now direct conversion from .lyx to .tex
8108 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8109 Unfortunately, X is still needed and the GUI pops up during the
8112 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8114 * src/Spacing.C: add a using directive to bring stream stuff into
8116 * src/paragraph.C: ditto
8117 * src/buffer.C: ditto
8119 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8120 from Lars' announcement).
8122 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8123 example files from Tino Meinen.
8125 1999-12-06 Allan Rae <rae@lyx.org>
8127 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8129 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8131 * src/support/lyxstring.C: added a lot of inline for no good
8134 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8135 latexWriteEndChanges, they were not used.
8137 * src/layout.h (operator<<): output operator for PageSides
8139 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8141 * some example files: loaded in LyX 1.0.4 and saved again to update
8142 certain constructs (table format)
8144 * a lot of files: did the change to use fstream/iostream for all
8145 writing of files. Done with a close look at Andre Poenitz's patch.
8147 * some files: whitespace changes.
8149 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8152 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8153 architecture, we provide our own. It is used unconditionnally, but
8154 I do not think this is a performance problem. Thanks to Angus
8155 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8156 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8158 (GetInset): use my_memcpy.
8162 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8163 it is easier to understand, but it uses less TeX-only constructs now.
8165 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8166 elements contain spaces
8168 * lib/configure: regenerated
8170 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8171 elements contain spaces; display the list of programs that are
8174 * autogen.sh: make sure lib/configure is executable
8176 * lib/examples/*: rename the tutorial examples to begin with the
8177 two-letters language code.
8179 * src/lyxfunc.C (getStatus): do not query current font if no
8182 * src/lyx_cb.C (RunScript): use QuoteName
8183 (MenuRunDvips): ditto
8184 (PrintApplyCB): ditto
8186 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8187 around argument, so that it works well with the current shell.
8188 Does not work properly with OS/2 shells currently.
8190 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8191 * src/LyXSendto.C (SendtoApplyCB): ditto
8192 * src/lyxfunc.C (Dispatch): ditto
8193 * src/buffer.C (runLaTeX): ditto
8194 (runLiterate): ditto
8195 (buildProgram): ditto
8197 * src/lyx_cb.C (RunScript): ditto
8198 (MenuMakeLaTeX): ditto
8200 * src/buffer.h (getLatexName): new method
8202 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8204 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8206 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8207 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8208 (create_math_panel): ditto
8210 * src/lyxfunc.C (getStatus): re-activate the code which gets
8211 current font and cursor; add test for export to html.
8213 * src/lyxrc.C (read): remove unreachable break statements; add a
8216 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8218 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8220 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8221 introduced by faulty regex.
8222 * src/buffer.C: ditto
8223 * src/lastfiles.C: ditto
8224 * src/paragraph.C: ditto
8225 * src/table.C: ditto
8226 * src/vspace.C: ditto
8227 * src/insets/figinset.C: ditto
8228 Note: most of these is absolutely harmless, except the one in
8229 src/mathed formula.C.
8231 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8233 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8234 operation, yielding correct results for the reLyX command.
8236 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * src/support/filetools.C (ExpandPath): removed an over eager
8240 (ReplaceEnvironmentPath): ditto
8242 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8243 shows that we are doing something fishy in our code...
8247 * src/lyxrc.C (read): use a double switch trick to get more help
8248 from the compiler. (the same trick is used in layout.C)
8249 (write): new function. opens a ofstream and pass that to output
8250 (output): new function, takes a ostream and writes the lyxrc
8251 elemts to it. uses a dummy switch to make sure no elements are
8254 * src/lyxlex.h: added a struct pushpophelper for use in functions
8255 with more than one exit point.
8257 * src/lyxlex.[Ch] (GetInteger): made it const
8261 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8263 * src/layout.[hC] : LayoutTags splitted into several enums, new
8264 methods created, better error handling cleaner use of lyxlex. Read
8267 * src/bmtable.[Ch]: change some member prototypes because of the
8268 image const changes.
8270 * commandtags.h, src/LyXAction.C (init): new function:
8271 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8272 This file is not read automatically but you can add \input
8273 preferences to your lyxrc if you want to. We need to discuss how
8276 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8277 in .aux, also remove .bib and .bst files from dependencies when
8280 * src/BufferView.C, src/LyXView.C: add const_cast several places
8281 because of changes to images.
8283 * lib/images/*: same change as for images/*
8285 * lib/lyxrc.example: Default for accept_compound is false not no.
8287 * images/*: changed to be const, however I have som misgivings
8288 about this change so it might be changed back.
8290 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8292 * lib/configure, po/POTFILES.in: regenerated
8294 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8296 * config/lib_configure.m4: removed
8298 * lib/configure.m4: new file (was config/lib_configure.m4)
8300 * configure.in: do not test for rtti, since we do not use it.
8302 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8304 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8305 doubling of allocated space scheme. This makes it faster for large
8306 strings end to use less memory for small strings. xtra rememoved.
8308 * src/insets/figinset.C (waitalarm): commented out.
8309 (GhostscriptMsg): use static_cast
8310 (GhostscriptMsg): use new instead of malloc to allocate memory for
8311 cmap. also delete the memory after use.
8313 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8315 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8316 for changes in bibtex database or style.
8317 (runBibTeX): remove all .bib and .bst files from dep before we
8319 (run): use scanAuc in when dep file already exist.
8321 * src/DepTable.C (remove_files_with_extension): new method
8324 * src/DepTable.[Ch]: made many of the methods const.
8326 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * src/bufferparams.C: make sure that the default textclass is
8329 "article". It used to be the first one by description order, but
8330 now the first one is "docbook".
8332 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8333 string; call Debug::value.
8334 (easyParse): pass complete argument to setDebuggingLevel().
8336 * src/debug.h (value): fix the code that parses debug levels.
8338 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8341 * src/LyXAction.C: use Debug::ACTION as debug channel.
8343 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8345 * NEWS: updated for the future 1.1.3 release.
8347 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8348 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8349 it should. This is of course a controversial change (since many
8350 people will find that their lyx workscreen is suddenly full of
8351 red), but done for the sake of correctness.
8353 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8354 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8356 * src/insets/inseterror.h, src/insets/inseturl.h,
8357 src/insets/insetinfo.h, src/insets/figinset.h,
8358 src/mathed/formulamacro.h, src/mathed/math_macro.h
8359 (EditMessage): add a missing const and add _() to make sure that
8362 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8363 src/insets/insetbib.C, src/support/filetools.C: add `using'
8366 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8367 doing 'Insert index of last word' at the beginning of a paragraph.
8369 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8371 * several files: white-space changes.
8373 * src/mathed/formula.C: removed IsAlpha and IsDigit
8375 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8376 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8379 * src/insets/figinset.C (GetPSSizes): don't break when
8380 "EndComments" is seen. But break when a boundingbox is read.
8382 * all classes inherited from Inset: return value of Clone
8383 changed back to Inset *.
8385 * all classes inherited form MathInset: return value of Clone
8386 changed back to MathedInset *.
8388 * src/insets/figinset.C (runqueue): use a ofstream to output the
8389 gs/ps file. Might need some setpresicion or setw. However I can
8390 see no problem with the current code.
8391 (runqueue): use sleep instead of the alarm/signal code. I just
8392 can't see the difference.
8394 * src/paragraph.C (LyXParagraph): reserve space in the new
8395 paragraph and resize the inserted paragraph to just fit.
8397 * src/lyxfunc.h (operator|=): added operator for func_status.
8399 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8400 check for readable file.
8402 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8403 check for readable file.
8404 (MenuMakeLinuxDoc): ditto
8405 (MenuMakeDocBook): ditto
8406 (MenuMakeAscii): ditto
8407 (InsertAsciiFile): split the test for openable and readable
8409 * src/bmtable.C (draw_bitmaptable): use
8410 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8412 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8413 findtexfile from LaTeX to filetools.
8415 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8416 instead of FilePtr. Needs to be verified by a literate user.
8418 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8420 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8421 (EditMessage): likewise.
8423 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8424 respectively as \textasciitilde and \textasciicircum.
8426 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8428 * src/support/lyxstring.h: made the methods that take iterators
8431 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8432 (regexMatch): made is use the real regex class.
8434 * src/support/Makefile.am: changed to use libtool
8436 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8438 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8440 (MathIsInset ++): changed several macros to be inline functions
8443 * src/mathed/Makefile.am: changed to use libtool
8445 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8447 * src/insets/inset* : Clone changed to const and return type is
8448 the true insettype not just Inset*.
8450 * src/insets/Makefile.am: changed to use libtool
8452 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8454 * src/undo.[Ch] : added empty() and changed some of the method
8457 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8459 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8460 setID use block<> for the bullets array, added const several places.
8462 * src/lyxfunc.C (getStatus): new function
8464 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8465 LyXAction, added const to several funtions.
8467 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8468 a std::map, and to store the dir items in a vector.
8470 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8473 * src/LyXView.[Ch] + other files : changed currentView to view.
8475 * src/LyXAction.[Ch] : ported from the old devel branch.
8477 * src/.cvsignore: added .libs and a.out
8479 * configure.in : changes to use libtool.
8481 * acinclude.m4 : inserted libtool.m4
8483 * .cvsignore: added libtool
8485 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8487 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8488 file name in insets and mathed directories (otherwise the
8489 dependency is not taken in account under cygwin).
8491 * src/text2.C (InsertString[AB]): make sure that we do not try to
8492 read characters past the string length.
8494 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8496 * lib/doc/LaTeXConfig.lyx.in,
8497 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8499 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8500 file saying who created them and when this heppened; this is
8501 useless and annoys tools like cvs.
8503 * lib/layouts/g-brief-{en,de}.layout,
8504 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8505 from Thomas Hartkens <thomas@hartkens.de>.
8507 * src/{insets,mathed}/Makefile.am: do not declare an empty
8508 LDFLAGS, so that it can be set at configure time (useful on Irix
8511 * lib/reLyX/configure.in: make sure that the prefix is set
8512 correctly in LYX_DIR.
8514 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8516 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8517 be used by 'command-sequence' this allows to bind a key to a
8518 sequence of LyX-commands
8519 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8521 * src/LyXAction.C: add "command-sequence"
8523 * src/LyXFunction.C: handling of "command-sequence"
8525 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8526 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8528 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8530 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8532 * src/buffer.C (writeFile): Do not output a comment giving user
8533 and date at the beginning of a .lyx file. This is useless and
8534 annoys cvs anyway; update version number to 1.1.
8536 * src/Makefile.am (LYX_DIR): add this definition, so that a
8537 default path is hardcoded in LyX.
8539 * configure.in: Use LYX_GNU_GETTEXT.
8541 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8542 AM_GNU_GETTEXT with a bug fixed.
8544 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8546 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8548 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8549 which is used to point to LyX data is now LYX_DIR_11x.
8551 * lyx.man: convert to a unix text file; small updates.
8553 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8555 * src/support/LSubstring.[Ch]: made the second arg of most of the
8556 constructors be a const reference.
8558 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8561 * src/support/lyxstring.[Ch] (swap): added missing member function
8562 and specialization of swap(str, str);
8564 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8566 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8567 trace of the old one.
8569 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8570 put the member definitions in undo.C.
8572 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8573 NEW_TEXT and have now only code that was included when this was
8576 * src/intl.C (LCombo): use static_cast
8578 (DispatchCallback): ditto
8580 * src/definitions.h: removed whole file
8582 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8584 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8585 parsing and stores in a std:map. a regex defines the file format.
8586 removed unneeded members.
8588 * src/bufferparams.h: added several enums from definitions.h here.
8589 Removed unsused destructor. Changed some types to use proper enum
8590 types. use block to have the temp_bullets and user_defined_bullets
8591 and to make the whole class assignable.
8593 * src/bufferparams.C (Copy): removed this functions, use a default
8596 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8599 * src/buffer.C (readLyXformat2): commend out all that have with
8600 oldpapersize to do. also comment out all that hve to do with
8601 insetlatex and insetlatexdel.
8602 (setOldPaperStuff): commented out
8604 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8606 * src/LyXAction.C: remove use of inset-latex-insert
8608 * src/mathed/math_panel.C (button_cb): use static_cast
8610 * src/insets/Makefile.am (insets_o_SOURCES): removed
8613 * src/support/lyxstring.C (helper): use the unsigned long
8614 specifier, UL, instead of a static_cast.
8616 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8618 * src/support/block.h: new file. to be used as a c-style array in
8619 classes, so that the class can be assignable.
8621 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8623 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8624 NULL, make sure to return an empty string (it is not possible to
8625 set a string to NULL).
8627 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8629 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8631 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8633 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8634 link line, so that Irix users (for example) can set it explicitely to
8637 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8638 it can be overidden at make time (static or dynamic link, for
8641 * src/vc-backend.C, src/LaTeXFeatures.h,
8642 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8643 statements to bring templates to global namespace.
8645 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8647 * src/support/lyxstring.C (operator[] const): make it standard
8650 * src/minibuffer.C (Init): changed to reflect that more
8651 information is given from the lyxvc and need not be provided here.
8653 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8655 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8657 * src/LyXView.C (UpdateTimerCB): use static_cast
8658 (KeyPressMask_raw_callback): ditto
8660 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8661 buffer_, a lot of changes because of this. currentBuffer() ->
8662 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8663 also changes to other files because of this.
8665 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8668 have no support for RCS and partial support for CVS, will be
8671 * src/insets/ several files: changes because of function name
8672 changes in Bufferview and LyXView.
8674 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8676 * src/support/LSubstring.[Ch]: new files. These implement a
8677 Substring that can be very convenient to use. i.e. is this
8679 string a = "Mary had a little sheep";
8680 Substring(a, "sheep") = "lamb";
8681 a is now "Mary has a little lamb".
8683 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8684 out patterns and subpatterns of strings. It is used by LSubstring
8685 and also by vc-backend.C
8687 * src/support/lyxstring.C: went over all the assertions used and
8688 tried to correct the wrong ones and flag which of them is required
8689 by the standard. some bugs found because of this. Also removed a
8690 couple of assertions.
8692 * src/support/Makefile.am (libsupport_a_SOURCES): added
8693 LSubstring.[Ch] and LRegex.[Ch]
8695 * src/support/FileInfo.h: have struct stat buf as an object and
8696 not a pointer to one, some changes because of this.
8698 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8699 information in layout when adding the layouts preamble to the
8702 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8705 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8706 because of bug in OS/2.
8708 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8710 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8711 \verbatim@font instead of \ttfamily, so that it can be redefined.
8713 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8714 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8715 src/layout.h, src/text2.C: add 'using' directive to bring the
8716 STL templates we need from the std:: namespace to the global one.
8717 Needed by DEC cxx in strict ansi mode.
8719 * src/support/LIstream.h,src/support/LOstream.h,
8720 src/support/lyxstring.h,src/table.h,
8721 src/lyxlookup.h: do not include <config.h> in header
8722 files. This should be done in the .C files only.
8724 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8728 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8730 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8731 from Kayvan to fix the tth invokation.
8733 * development/lyx.spec.in: updates from Kayvan to reflect the
8734 changes of file names.
8736 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * src/text2.C (InsertStringB): use std::copy
8739 (InsertStringA): use std::copy
8741 * src/bufferlist.C: use a vector to store the buffers in. This is
8742 an internal change and should not affect any other thing.
8744 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8747 * src/text.C (Fill): fix potential bug, one off bug.
8749 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8751 * src/Makefile.am (lyx_main.o): add more files it depends on.
8753 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8755 * src/support/lyxstring.C: use size_t for the reference count,
8756 size, reserved memory and xtra.
8757 (internal_compare): new private member function. Now the compare
8758 functions should work for std::strings that have embedded '\0'
8760 (compare): all compare functions rewritten to use
8763 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8765 * src/support/lyxstring.C (compare): pass c_str()
8766 (compare): pass c_str
8767 (compare): pass c_str
8769 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8771 * src/support/DebugStream.C: <config.h> was not included correctly.
8773 * lib/configure: forgot to re-generate it :( I'll make this file
8774 auto generated soon.
8776 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8781 * src/support/lyxstring.C: some changes from length() to rep->sz.
8782 avoids a function call.
8784 * src/support/filetools.C (SpaceLess): yet another version of the
8785 algorithm...now per Jean-Marc's suggestions.
8787 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8789 * src/layout.C (less_textclass_desc): functor for use in sorting
8791 (LyXTextClass::Read): sort the textclasses after reading.
8793 * src/support/filetools.C (SpaceLess): new version of the
8794 SpaceLess functions. What problems does this one give? Please
8797 * images/banner_bw.xbm: made the arrays unsigned char *
8799 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8801 * src/support/lyxstring.C (find): remove bogus assertion in the
8802 two versions of find where this has not been done yet.
8804 * src/support/lyxlib.h: add missing int return type to
8807 * src/menus.C (ShowFileMenu): disable exporting to html if no
8808 html export command is present.
8810 * config/lib_configure.m4: add a test for an HTML converter. The
8811 programs checked for are, in this order: tth, latex2html and
8814 * lib/configure: generated from config/lib_configure.m4.
8816 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8817 html converter. The parameters are now passed through $$FName and
8818 $$OutName, instead of standard input/output.
8820 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8822 * lib/lyxrc.example: update description of \html_command.
8823 add "quotes" around \screen_font_xxx font setting examples to help
8824 people who use fonts with spaces in their names.
8826 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8828 * Distribution files: updates for v1.1.2
8830 * src/support/lyxstring.C (find): remove bogus assert and return
8831 npos for the same condition.
8833 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8835 * added patch for OS/2 from SMiyata.
8837 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8839 * src/text2.C (CutSelection): make space_wrapped a bool
8840 (CutSelection): dont declare int i until we have to.
8841 (alphaCounter): return a char const *.
8843 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8845 * src/support/syscall.C (Systemcalls::kill):
8846 src/support/filetools.C (PutEnv, PutEnvPath):
8847 src/lyx_cb.C (addNewlineAndDepth):
8848 src/FontInfo.C (FontInfo::resize): condition some #warning
8849 directives with WITH_WARNINGS.
8852 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8854 * src/layout.[Ch] + several files: access to class variables
8855 limited and made accessor functions instead a lot of code changed
8856 becuase of this. Also instead of returning pointers often a const
8857 reference is returned instead.
8859 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8861 * src/Makefile.am (dist-hook): added used to remove the CVS from
8862 cheaders upon creating a dist
8863 (EXTRA_DIST): added cheaders
8865 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8866 a character not as a small integer.
8868 * src/support/lyxstring.C (find): removed Assert and added i >=
8869 rep->sz to the first if.
8871 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8873 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8874 src/LyXView.C src/buffer.C src/bufferparams.C
8875 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8876 src/text2.C src/insets/insetinclude.C:
8877 lyxlayout renamed to textclasslist.
8879 * src/layout.C: some lyxerr changes.
8881 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8882 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8883 (LyXLayoutList): removed all traces of this class.
8884 (LyXTextClass::Read): rewrote LT_STYLE
8885 (LyXTextClass::hasLayout): new function
8886 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8887 both const and nonconst version.
8888 (LyXTextClass::delete_layout): new function.
8889 (LyXTextClassList::Style): bug fix. do the right thing if layout
8891 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8892 (LyXTextClassList::NameOfLayout): ditto
8893 (LyXTextClassList::Load): ditto
8895 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8897 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8899 * src/LyXAction.C (LookupFunc): added a workaround for sun
8900 compiler, on the other hand...we don't know if the current code
8901 compiles on sun at all...
8903 * src/support/filetools.C (CleanupPath): subst fix
8905 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8908 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8909 complained about this one?
8911 * src/insets/insetinclude.C (Latex): subst fix
8913 * src/insets/insetbib.C (getKeys): subst fix
8915 * src/LyXSendto.C (SendtoApplyCB): subst fix
8917 * src/lyx_main.C (init): subst fix
8919 * src/layout.C (Read): subst fix
8921 * src/lyx_sendfax_main.C (button_send): subst fix
8923 * src/buffer.C (RoffAsciiTable): subst fix
8925 * src/lyx_cb.C (MenuFax): subst fix
8926 (PrintApplyCB): subst fix
8928 1999-10-26 Juergen Vigna <jug@sad.it>
8930 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8932 (Read): Cleaned up this code so now we read only format vestion >= 5
8934 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8936 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8937 come nobody has complained about this one?
8939 * src/insets/insetinclude.C (Latex): subst fix
8941 * src/insets/insetbib.C (getKeys): subst fix
8943 * src/lyx_main.C (init): subst fix
8945 * src/layout.C (Read): subst fix
8947 * src/buffer.C (RoffAsciiTable): subst fix
8949 * src/lyx_cb.C (MenuFax): subst fix.
8951 * src/layout.[hC] + some other files: rewrote to use
8952 std::container to store textclasses and layouts in.
8953 Simplified, removed a lot of code. Make all classes
8954 assignable. Further simplifications and review of type
8955 use still to be one.
8957 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8958 lastfiles to create the lastfiles partr of the menu.
8960 * src/lastfiles.[Ch]: rewritten to use deque to store the
8961 lastfiles in. Uses fstream for reading and writing. Simplifies
8964 * src/support/syscall.C: remove explicit cast.
8966 * src/BufferView.C (CursorToggleCB): removed code snippets that
8968 use explicat C++ style casts instead of C style casts. also use
8969 u_vdata instea of passing pointers in longs.
8971 * src/PaperLayout.C: removed code snippets that were commented out.
8973 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8975 * src/lyx_main.C: removed code snippets that wer commented out.
8977 * src/paragraph.C: removed code snippets that were commented out.
8979 * src/lyxvc.C (logClose): use static_cast
8981 (viewLog): remove explicit cast to void*
8982 (showLog): removed old commented code
8984 * src/menus.C: use static_cast instead of C style casts. use
8985 u_vdata instead of u_ldata. remove explicit cast to (long) for
8986 pointers. Removed old code that was commented out.
8988 * src/insets/inset.C: removed old commented func
8990 * src/insets/insetref.C (InsetRef): removed old code that had been
8991 commented out for a long time.
8993 (escape): removed C style cast
8995 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8997 * src/insets/insetlatex.C (Draw): removed old commented code
8998 (Read): rewritten to use string
9000 * src/insets/insetlabel.C (escape): removed C style cast
9002 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9004 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9007 * src/insets/insetinclude.h: removed a couple of stupid bools
9009 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9010 (Clone): remove C style cast
9011 (getKeys): changed list to lst because of std::list
9013 * src/insets/inseterror.C (Draw): removed som old commented code.
9015 * src/insets/insetcommand.C (Draw): removed some old commented code.
9017 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9018 commented out forever.
9019 (bibitem_cb): use static_cast instead of C style cast
9020 use of vdata changed to u_vdata.
9022 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9024 (CloseUrlCB): use static_cast instead of C style cast.
9025 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9027 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9028 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9029 (CloseInfoCB): static_cast from ob->u_vdata instead.
9030 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9033 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9034 (C_InsetError_CloseErrorCB): forward the ob parameter
9035 (CloseErrorCB): static_cast from ob->u_vdata instead.
9037 * src/vspace.h: include LString.h since we use string in this class.
9039 * src/vspace.C (lyx_advance): changed name from advance because of
9040 nameclash with stl. And since we cannot use namespaces yet...I
9041 used a lyx_ prefix instead. Expect this to change when we begin
9044 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9046 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9047 and removed now defunct constructor and deconstructor.
9049 * src/BufferView.h: have backstack as a object not as a pointer.
9050 removed initialization from constructor. added include for BackStack
9052 * development/lyx.spec.in (%build): add CFLAGS also.
9054 * src/screen.C (drawFrame): removed another warning.
9056 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9058 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9059 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9060 README and ANNOUNCE a bit for the next release. More work is
9063 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9064 unbreakable if we are in freespacing mode (LyX-Code), but not in
9067 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9069 * src/BackStack.h: fixed initialization order in constructor
9071 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9073 * acinclude.m4 (VERSION): new rules for when a version is
9074 development, added also a variable for prerelease.
9075 (warnings): we set with_warnings=yes for prereleases
9076 (lyx_opt): prereleases compile with same optimization as development
9077 (CXXFLAGS): only use pedantic if we are a development version
9079 * src/BufferView.C (restorePosition): don't do anything if the
9082 * src/BackStack.h: added member empty, use this to test if there
9083 is anything to pop...
9085 1999-10-25 Juergen Vigna <jug@sad.it>
9088 * forms/layout_forms.fd +
9089 * forms/latexoptions.fd +
9090 * lyx.fd: changed for various form resize issues
9092 * src/mathed/math_panel.C +
9093 * src/insets/inseterror.C +
9094 * src/insets/insetinfo.C +
9095 * src/insets/inseturl.C +
9096 * src/insets/inseturl.h +
9099 * src/PaperLayout.C +
9100 * src/ParagraphExtra.C +
9101 * src/TableLayout.C +
9103 * src/layout_forms.C +
9110 * src/menus.C: fixed various resize issues. So now forms can be
9111 resized savely or not be resized at all.
9113 * forms/form_url.fd +
9114 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9117 * src/insets/Makefile.am: added files form_url.[Ch]
9119 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9121 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9122 (and presumably 6.2).
9124 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9125 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9126 remaining static member callbacks.
9128 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9131 * src/support/lyxstring.h: declare struct Srep as friend of
9132 lyxstring, since DEC cxx complains otherwise.
9134 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9136 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9138 * src/LaTeX.C (run): made run_bibtex also depend on files with
9140 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9141 are put into the dependency file.
9143 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9144 the code has shown itself to work
9145 (create_ispell_pipe): removed another warning, added a comment
9148 * src/minibuffer.C (ExecutingCB): removed code that has been
9149 commented out a long time
9151 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9152 out code + a warning.
9154 * src/support/lyxstring.h: comment out the three private
9155 operators, when compiling with string ansi conforming compilers
9158 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9160 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9161 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9164 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9167 * src/mathed/math_panel.C (create_math_panel): remove explicit
9170 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9173 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9174 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9175 to XCreatePixmapFromBitmapData
9176 (fl_set_bmtable_data): change the last argument to be unsigned
9178 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9179 and bh to be unsigned int, remove explicit casts in call to
9180 XReadBitmapFileData.
9182 * images/arrows.xbm: made the arrays unsigned char *
9183 * images/varsz.xbm: ditto
9184 * images/misc.xbm: ditto
9185 * images/greek.xbm: ditto
9186 * images/dots.xbm: ditto
9187 * images/brel.xbm: ditto
9188 * images/bop.xbm: ditto
9190 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9192 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9193 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9194 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9196 (LYX_CXX_CHEADERS): added <clocale> to the test.
9198 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9202 * src/support/lyxstring.C (append): fixed something that must be a
9203 bug, rep->assign was used instead of rep->append.
9205 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9208 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9209 lyx insert double chars. Fix spotted by Kayvan.
9211 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9213 * Fixed the tth support. I messed up with the Emacs patch apply feature
9214 and omitted the changes in lyxrc.C.
9216 1999-10-22 Juergen Vigna <jug@sad.it>
9218 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9220 * src/lyx_cb.C (MenuInsertRef) +
9221 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9222 the form cannot be resized under it limits (fixes a segfault)
9224 * src/lyx.C (create_form_form_ref) +
9225 * forms/lyx.fd: Changed Gravity on name input field so that it is
9228 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9230 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9231 <ostream> and <istream>.
9233 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9234 whether <fstream> provides the latest standard features, or if we
9235 have an oldstyle library (like in egcs).
9236 (LYX_CXX_STL_STRING): fix the test.
9238 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9239 code on MODERN_STL_STREAM.
9241 * src/support/lyxstring.h: use L{I,O}stream.h.
9243 * src/support/L{I,O}stream.h: new files, designed to setup
9244 correctly streams for our use
9245 - includes the right header depending on STL capabilities
9246 - puts std::ostream and std::endl (for LOStream.h) or
9247 std::istream (LIStream.h) in toplevel namespace.
9249 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9251 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9252 was a bib file that had been changed we ensure that bibtex is run.
9253 (runBibTeX): enhanced to extract the names of the bib files and
9254 getting their absolute path and enter them into the dep file.
9255 (findtexfile): static func that is used to look for tex-files,
9256 checks for absolute patchs and tries also with kpsewhich.
9257 Alternative ways of finding the correct files are wanted. Will
9259 (do_popen): function that runs a command using popen and returns
9260 the whole output of that command in a string. Should be moved to
9263 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9264 file with extension ext has changed.
9266 * src/insets/figinset.C: added ifdef guards around the fl_free
9267 code that jug commented out. Now it is commented out when
9268 compiling with XForms == 0.89.
9270 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9271 to lyxstring.C, and only keep a forward declaration in
9272 lyxstring.h. Simplifies the header file a bit and should help a
9273 bit on compile time too. Also changes to Srep will not mandate a
9274 recompile of code just using string.
9275 (~lyxstring): definition moved here since it uses srep.
9276 (size): definition moved here since it uses srep.
9278 * src/support/lyxstring.h: removed a couple of "inline" that should
9281 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9283 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9286 1999-10-21 Juergen Vigna <jug@sad.it>
9288 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9289 set to left if I just remove the width entry (or it is empty).
9291 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9292 paragraph when having dummy paragraphs.
9294 1999-10-20 Juergen Vigna <jug@sad.it>
9296 * src/insets/figinset.C: just commented some fl_free_form calls
9297 and added warnings so that this calls should be activated later
9298 again. This avoids for now a segfault, but we have a memory leak!
9300 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9301 'const char * argument' to 'string argument', this should
9302 fix some Asserts() in lyxstring.C.
9304 * src/lyxfunc.h: Removed the function argAsString(const char *)
9305 as it is not used anymore.
9307 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9309 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9312 * src/Literate.h: some funcs moved from public to private to make
9313 interface clearer. Unneeded args removed.
9315 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9317 (scanBuildLogFile): ditto
9319 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9320 normal TeX Error. Still room for improvement.
9322 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9324 * src/buffer.C (insertErrors): changes to make the error
9325 desctription show properly.
9327 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9330 * src/support/lyxstring.C (helper): changed to use
9331 sizeof(object->rep->ref).
9332 (operator>>): changed to use a pointer instead.
9334 * src/support/lyxstring.h: changed const reference & to value_type
9335 const & lets see if that helps.
9337 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9339 * Makefile.am (rpmdist): fixed to have non static package and
9342 * src/support/lyxstring.C: removed the compilation guards
9344 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9347 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9348 conditional compile of lyxstring.Ch
9350 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9351 stupid check, but it is a lot better than the bastring hack.
9352 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9354 * several files: changed string::erase into string::clear. Not
9357 * src/chset.C (encodeString): use a char temporary instead
9359 * src/table.C (TexEndOfCell): added tostr around
9360 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9361 (TexEndOfCell): ditto
9362 (TexEndOfCell): ditto
9363 (TexEndOfCell): ditto
9364 (DocBookEndOfCell): ditto
9365 (DocBookEndOfCell): ditto
9366 (DocBookEndOfCell): ditto
9367 (DocBookEndOfCell): ditto
9369 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9371 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9373 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9374 (MenuBuildProg): added tostr around ret
9375 (MenuRunChktex): added tostr around ret
9376 (DocumentApplyCB): added tostr around ret
9378 * src/chset.C (encodeString): added tostr around t->ic
9380 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9381 (makeLaTeXFile): added tostr around tocdepth
9382 (makeLaTeXFile): added tostr around ftcound - 1
9384 * src/insets/insetbib.C (setCounter): added tostr around counter.
9386 * src/support/lyxstring.h: added an operator+=(int) to catch more
9389 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9390 (lyxstring): We DON'T allow NULL pointers.
9392 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9394 * src/mathed/math_macro.C (MathMacroArgument::Write,
9395 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9396 when writing them out.
9398 * src/LString.C: remove, since it is not used anymore.
9400 * src/support/lyxstring.C: condition the content to
9401 USE_INCLUDED_STRING macro.
9403 * src/mathed/math_symbols.C, src/support/lstrings.C,
9404 src/support/lyxstring.C: add `using' directive to specify what
9405 we need in <algorithm>. I do not think that we need to
9406 conditionalize this, but any thought is appreciated.
9408 * many files: change all callback functions to "C" linkage
9409 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9410 strict_ansi. Those who were static are now global.
9411 The case of callbacks which are static class members is
9412 trickier, since we have to make C wrappers around them (see
9413 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9414 did not finish this yet, since it defeats the purpose of
9415 encapsulation, and I am not sure what the best route is.
9417 1999-10-19 Juergen Vigna <jug@sad.it>
9419 * src/support/lyxstring.C (lyxstring): we permit to have a null
9420 pointer as assignment value and just don't assign it.
9422 * src/vspace.C (nextToken): corrected this function substituting
9423 find_first(_not)_of with find_last_of.
9425 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9426 (TableOptCloseCB) (TableSpeCloseCB):
9427 inserted fl_set_focus call for problem with fl_hide_form() in
9430 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9432 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9435 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9437 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9438 LyXLex::next() and not eatline() to get its argument.
9440 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9442 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9443 instead, use fstreams for io of the depfile, removed unneeded
9444 functions and variables.
9446 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9447 vector instead, removed all functions and variables that is not in
9450 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9452 * src/buffer.C (insertErrors): use new interface to TeXError
9454 * Makefile.am (rpmdist): added a rpmdist target
9456 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9457 per Kayvan's instructions.
9459 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9461 * src/Makefile.am: add a definition for localedir, so that locales
9462 are found after installation (Kayvan)
9464 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * development/.cvsignore: new file.
9468 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9470 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9471 C++ compiler provides wrappers for C headers and use our alternate
9474 * configure.in: use LYX_CXX_CHEADERS.
9476 * src/cheader/: new directory, populated with cname headers from
9477 libstdc++-2.8.1. They are a bit old, but probably good enough for
9478 what we want (support compilers who lack them).
9480 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9481 from includes. It turns out is was stupid.
9483 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9485 * lib/Makefile.am (install-data-local): forgot a ';'
9486 (install-data-local): forgot a '\'
9487 (libinstalldirs): needed after all. reintroduced.
9489 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * configure.in (AC_OUTPUT): added lyx.spec
9493 * development/lyx.spec: removed file
9495 * development/lyx.spec.in: new file
9497 * po/*.po: merged with lyx.pot becuase of make distcheck
9499 * lib/Makefile.am (dist-hook): added dist-hook so that
9500 documentation files will be included when doing a make
9501 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9502 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9504 more: tried to make install do the right thing, exclude CVS dirs
9507 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9508 Path would fit in more nicely.
9510 * all files that used to use pathstack: uses now Path instead.
9511 This change was a lot easier than expected.
9513 * src/support/path.h: new file
9515 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9517 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9519 * src/support/lyxstring.C (getline): Default arg was given for
9522 * Configure.cmd: removed file
9524 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9527 streams classes and types, add the proper 'using' statements when
9528 MODERN_STL is defined.
9530 * src/debug.h: move the << operator definition after the inclusion
9533 * src/support/filetools.C: include "LAssert.h", which is needed
9536 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9539 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9540 include "debug.h" to define a proper ostream.
9542 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9544 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9545 method to the SystemCall class which can kill a process, but it's
9546 not fully implemented yet.
9548 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9550 * src/support/FileInfo.h: Better documentation
9552 * src/lyxfunc.C: Added support for buffer-export html
9554 * src/menus.C: Added Export->As HTML...
9556 * lib/bind/*.bind: Added short-cut for buffer-export html
9558 * src/lyxrc.*: Added support for new \tth_command
9560 * lib/lyxrc.example: Added stuff for new \tth_command
9562 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * lib/Makefile.am (IMAGES): removed images/README
9565 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9566 installes in correct place. Check permisions is installed
9569 * src/LaTeX.C: some no-op changes moved declaration of some
9572 * src/LaTeX.h (LATEX_H): changed include guard name
9574 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9576 * lib/reLyX/Makefile.am: install noweb2lyx.
9578 * lib/Makefile.am: install configure.
9580 * lib/reLyX/configure.in: declare a config aux dir; set package
9581 name to lyx (not sure what the best solution is); generate noweb2lyx.
9583 * lib/layouts/egs.layout: fix the bibliography layout.
9585 1999-10-08 Jürgen Vigna <jug@sad.it>
9587 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9588 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9589 it returned without continuing to search the path.
9591 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9593 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9594 also fixes a bug. It is not allowed to do tricks with std::strings
9595 like: string a("hei"); &a[e]; this will not give what you
9596 think... Any reason for the complexity in this func?
9598 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9600 * Updated README and INSTALL a bit, mostly to check that my
9601 CVS rights are correctly set up.
9603 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9606 does not allow '\0' chars but lyxstring and std::string does.
9608 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9610 * autogen.sh (AUTOCONF): let the autogen script create the
9611 POTFILES.in file too. POTFILES.in should perhaps now not be
9612 included in the cvs module.
9614 * some more files changed to use C++ includes instead of C ones.
9616 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9618 (Reread): added tostr to nlink. buggy output otherwise.
9619 (Reread): added a string() around szMode when assigning to Buffer,
9620 without this I got a log of garbled info strings.
9622 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9625 * I have added several ostream & operator<<(ostream &, some_type)
9626 functions. This has been done to avoid casting and warnings when
9627 outputting enums to lyxerr. This as thus eliminated a lot of
9628 explicit casts and has made the code clearer. Among the enums
9629 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9630 mathed enums, some font enum the Debug::type enum.
9632 * src/support/lyxstring.h (clear): missing method. equivalent of
9635 * all files that contained "stderr": rewrote constructs that used
9636 stderr to use lyxerr instead. (except bmtable)
9638 * src/support/DebugStream.h (level): and the passed t with
9639 Debug::ANY to avoid spurious bits set.
9641 * src/debug.h (Debug::type value): made it accept strings of the
9644 * configure.in (Check for programs): Added a check for kpsewhich,
9645 the latex generation will use this later to better the dicovery of
9648 * src/BufferView.C (create_view): we don't need to cast this to
9649 (void*) that is done automatically.
9650 (WorkAreaButtonPress): removed some dead code.
9652 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9654 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9655 is not overwritten when translated (David Sua'rez de Lis).
9657 * lib/CREDITS: Added David Sua'rez de Lis
9659 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9661 * src/bufferparams.C (BufferParams): default input encoding is now
9664 * acinclude.m4 (cross_compiling): comment out macro
9665 LYX_GXX_STRENGTH_REDUCE.
9667 * acconfig.h: make sure that const is not defined (to empty) when
9668 we are compiling C++. Remove commented out code using SIZEOF_xx
9671 * configure.in : move the test for const and inline as late as
9672 possible so that these C tests do not interefere with C++ ones.
9673 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9674 has not been proven.
9676 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9678 * src/table.C (getDocBookAlign): remove bad default value for
9681 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9683 (ShowFileMenu2): ditto.
9685 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9688 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9690 * Most files: finished the change from the old error code to use
9691 DebugStream for all lyxerr debugging. Only minor changes remain
9692 (e.g. the setting of debug levels using strings instead of number)
9694 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9696 * src/layout.C (Add): Changed to use compare_no_case instead of
9699 * src/FontInfo.C: changed loop variable type too string::size_type.
9701 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9703 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9704 set ETAGS_ARGS to --c++
9706 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9708 * src/table.C (DocBookEndOfCell): commented out two unused variables
9710 * src/paragraph.C: commented out four unused variables.
9712 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9713 insed a if clause with type string::size_type.
9715 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9718 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9720 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9721 variable, also changed loop to go from 0 to lenght + 1, instead of
9722 -1 to length. This should be correct.
9724 * src/LaTeX.C (scanError): use string::size_type as loop variable
9727 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9728 (l.896) since y_tmp and row was not used anyway.
9730 * src/insets/insetref.C (escape): use string::size_type as loop
9733 * src/insets/insetquotes.C (Width): use string::size_type as loop
9735 (Draw): use string::size_type as loop variable type.
9737 * src/insets/insetlatexaccent.C (checkContents): use
9738 string::size_type as loop variable type.
9740 * src/insets/insetlabel.C (escape): use string::size_type as loop
9743 * src/insets/insetinfo.C: added an extern for current_view.
9745 * src/insets/insetcommand.C (scanCommand): use string::size_type
9746 as loop variable type.
9748 * most files: removed the RCS tags. With them we had to recompile
9749 a lot of files after a simple cvs commit. Also we have never used
9750 them for anything meaningful.
9752 * most files: tags-query-replace NULL 0. As adviced several plases
9753 we now use "0" instead of "NULL" in our code.
9755 * src/support/filetools.C (SpaceLess): use string::size_type as
9758 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9760 * src/paragraph.C: fixed up some more string stuff.
9762 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9764 * src/support/filetools.h: make modestr a std::string.
9766 * src/filetools.C (GetEnv): made ch really const.
9768 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9769 made code that used these use max/min from <algorithm> instead.
9771 * changed several c library include files to their equivalent c++
9772 library include files. All is not changed yet.
9774 * created a support subdir in src, put lyxstring and lstrings
9775 there + the extra files atexit, fileblock, strerror. Created
9776 Makefile.am. edited configure.in and src/Makefile.am to use this
9777 new subdir. More files moved to support.
9779 * imported som of the functions from repository lyx, filetools
9781 * ran tags-query-replace on LString -> string, corrected the bogus
9782 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9783 is still some errors in there. This is errors where too much or
9784 too litle get deleted from strings (string::erase, string::substr,
9785 string::replace), there can also be some off by one errors, or
9786 just plain wrong use of functions from lstrings. Viewing of quotes
9789 * LyX is now running fairly well with string, but there are
9790 certainly some bugs yet (see above) also string is quite different
9791 from LString among others in that it does not allow null pointers
9792 passed in and will abort if it gets any.
9794 * Added the revtex4 files I forgot when setting up the repository.
9796 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9798 * All over: Tried to clean everything up so that only the files
9799 that we really need are included in the cvs repository.
9800 * Switched to use automake.
9801 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9802 * Install has not been checked.
9804 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9806 * po/pt.po: Three errors:
9807 l.533 and l.538 format specification error
9808 l. 402 duplicate entry, I just deleted it.