1 2000-10-19 Juergen Vigna <jug@sad.it>
3 * src/lyxfunc.C (MenuNew): small fix (form John)
5 * src/screen.C (Update): removed unneeded code.
7 * src/tabular.C (Ascii): refixed int != uint bug!
9 * src/support/lyxlib.h: added sys/types.h include for now permits
10 compiling, but I don't like this!
12 2000-10-18 Juergen Vigna <jug@sad.it>
14 * src/text2.C (ClearSelection): if we clear the selection we need
15 more refresh so set the status aprpriate
17 * src/insets/insettext.C (draw): hopefully finally fixed draw
20 2000-10-12 Juergen Vigna <jug@sad.it>
22 * src/insets/insettext.C (draw): another small fix and make a block
23 so that variables are localized.
25 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
26 * src/support/lstrings.C (lowercase, uppercase):
27 use explicit casts to remove compiler warnings.
29 * src/support/LRegex.C (Impl):
30 * src/support/StrPool.C (add):
31 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
32 (AddPath, MakeDisplayPath):
33 * src/support/lstrings.C (prefixIs, subst):
34 use correct type to remove compiler warnings.
36 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
38 * src/support/lyxlib.h:
39 * src/support/mkdir.C (mkdir): change parameter to mode_t for
40 portability and to remove compiler warning with DEC cxx.
42 * src/support/FileInfo.[Ch] (flagRWX): ditto.
44 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
46 * src/minibuffer.C (peek_event): retun 1 when there has been a
47 mouseclick in the minibuffer.
51 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
53 * src/frontends/xforms/FormParagraph.C: more space above/below
56 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
58 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
59 a char only if real_current_font was changed.
61 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
63 * NEWS: update somewhat for 1.1.6
65 * lib/ui/default.ui: clean up.
67 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
69 * lib/CREDITS: clean up
71 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
73 * src/combox.[Ch] (select): changed argument back to int
74 * src/combox.C (peek_event): removed num_bytes as it is declared but
77 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
78 modified calls to Combox::select() to remove warnings about type
81 * src/insets/insetbutton.C (width): explicit cast to remove warning
82 about type conversion.
84 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
87 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
88 sel_pos_end, refering to cursor position are changed to
89 LyXParagraph::size_type.
91 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
92 consistent with LyXCursor::pos().
93 (inset_pos): changed to LyXParagraph::size_type for same reason.
95 * src/insets/insettext.C (resizeLyXText): changed some temporary
96 variables refing to cursor position to LyXParagraph::size_type.
98 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
100 * src/frontends/kde/<various>: The Great Renaming,
103 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
105 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
107 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
109 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
110 0 when there are no arguments.
112 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
114 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
115 to segfaults when pressing Ok in InsetBibtex dialog.
117 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
119 * forms/layout_forms.fd:
120 * src/layout_forms.C (create_form_form_character): small change to use
121 labelframe rather than engraved frame + text
123 * src/lyx_gui.C (create_forms): initialise choice_language with some
124 arbitrary value to prevent segfault when dialog is shown.
126 2000-10-16 Baruch Even <baruch.even@writeme.com>
128 * src/converter.C (runLaTeX, scanLog): Added a warning when there
129 is no resulting file. This pertains only to LaTeX output.
131 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
133 * src/text.C (Backspace): Make sure that the row of the cursor is
136 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
139 * src/lyx_gui.C (init): Prevent a crash when only one font from
140 menu/popup fonts is not found.
142 * lib/lyxrc.example: Add an example for binding a key for language
145 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
147 * src/converter.C (GetReachable): Changed the returned type to
149 (IsReachable): New method
151 * src/MenuBackend.C (expand): Handle formats that appear more
154 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
156 * src/frontends/support/Makefile.am
157 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
160 * lib/CREDITS: add Garst Reese.
162 * src/support/snprintf.h: add extern "C" {} around the definitions.
164 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
166 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
169 * src/frontends/xforms/FormDocument.C:
170 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
171 compile without "conversion to integral type of smaller size"
174 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
176 * src/text.C (GetColumnNearX): Fixed disabled code.
178 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
180 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
183 * src/support/snprintf.[ch]: new files
185 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
187 * src/frontends/kde/formprintdialog.C: add
188 file browser for selecting postscript output
190 * src/frontends/kde/formprintdialogdata.C:
191 * src/frontends/kde/formprintdialogdata.h: re-generate
194 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
196 * src/frontends/gnome/Makefile.am:
197 * src/frontends/kde/Makefile.am: FormCommand.C
198 disappeared from xforms
200 * src/frontends/kde/FormCitation.C:
201 * src/frontends/kde/FormIndex.C: read-only
204 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
206 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
209 * src/bufferlist.C: add using directive.
211 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
213 * src/support/lyxfunctional.h: version of class_fun for void
214 returns added, const versions of back_inseter_fun and compare_fun
217 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
219 * src/frontends/xforms/FormInset.C (showInset): fix typo.
221 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
223 * ChangeLog: cleanup.
225 * lib/CREDITS: update to add all the contributors we've forgotten.
226 I have obviously missed some, so tell me whether there were
229 2000-10-13 Marko Vendelin <markov@ioc.ee>
231 * src/frontends/gnome/FormCitation.C
232 * src/frontends/gnome/FormCitation.h
233 * src/frontends/gnome/FormError.C
234 * src/frontends/gnome/FormIndex.C
235 * src/frontends/gnome/FormRef.C
236 * src/frontends/gnome/FormRef.h
237 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
239 * src/frontends/gnome/FormCitation.C
240 * src/frontends/gnome/FormCopyright.C
241 * src/frontends/gnome/FormError.C
242 * src/frontends/gnome/FormIndex.C
243 * src/frontends/gnome/FormRef.C
244 * src/frontends/gnome/FormToc.C
245 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
248 * src/frontends/gnome/Menubar_pimpl.C
249 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
252 2000-10-11 Baruch Even <baruch.even@writeme.com>
255 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
256 to convey its real action.
258 * src/minibuffer.C (peek_event): Added action when mouse clicks to
259 clear the minibuffer and prepare to enter a command.
261 * src/mathed/formula.C (LocalDispatch): Changed to conform with
262 the rename from ExecCommand to PrepareForCommand.
263 * src/lyxfunc.C (Dispatch): ditto.
265 2000-10-11 Baruch Even <baruch.even@writeme.com>
267 * src/buffer.C (writeFile): Added test for errors on writing, this
268 catches all errors and not only file system full errors as intended.
270 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
272 * src/lyx_gui.C (create_forms): better fix for crash with
273 translated interface.
275 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
277 * src/frontends/kde/Makefile.am:
278 * src/frontends/kde/FormCopyright.C:
279 * src/frontends/kde/formcopyrightdialog.C:
280 * src/frontends/kde/formcopyrightdialog.h:
281 * src/frontends/kde/formcopyrightdialogdata.C:
282 * src/frontends/kde/formcopyrightdialogdata.h:
283 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
284 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
285 copyright to use qtarch
287 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
289 * src/encoding.C (read): Fixed bug that caused an error message at
292 * po/Makefile.in.in: Fixed rule for ext_l10n.h
294 * lib/lyxrc.example: Fixed hebrew example.
296 2000-10-13 Allan Rae <rae@lyx.org>
298 * src/frontends/xforms/FormPreferences.C (input): reworking the
300 (build, update, apply): New inputs in various tabfolders
302 * src/frontends/xforms/FormToc.C: use new button policy.
303 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
304 dialogs that either can't use any existing policy or where it just
307 * src/frontends/xforms/FormTabular.h: removed copyright notice that
310 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
311 added a bool parameter which is ignored.
313 * src/buffer.C (setReadonly):
314 * src/BufferView_pimpl.C (buffer):
315 * src/frontends/kde/FormCopyright.h (update):
316 * src/frontends/kde/FormCitation.[Ch] (update):
317 * src/frontends/kde/FormIndex.[Ch] (update):
318 * src/frontends/kde/FormPrint.[Ch] (update):
319 * src/frontends/kde/FormRef.[Ch] (update):
320 * src/frontends/kde/FormToc.[Ch] (update):
321 * src/frontends/kde/FormUrl.[Ch] (update):
322 * src/frontends/gnome/FormCopyright.h (update):
323 * src/frontends/gnome/FormCitation.[Ch] (update):
324 * src/frontends/gnome/FormError.[Ch] (update):
325 * src/frontends/gnome/FormIndex.[Ch] (update):
326 * src/frontends/gnome/FormPrint.[Ch] (update):
327 * src/frontends/gnome/FormRef.h (update):
328 * src/frontends/gnome/FormToc.[Ch] (update):
329 * src/frontends/gnome/FormUrl.[Ch] (update):
330 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
331 to updateBufferDependent and DialogBase
333 * src/frontends/xforms/FormCitation.[hC]:
334 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
335 * src/frontends/xforms/FormError.[Ch]:
336 * src/frontends/xforms/FormGraphics.[Ch]:
337 * src/frontends/xforms/FormIndex.[Ch]:
338 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
339 and fixed readOnly handling.
340 * src/frontends/xforms/FormPrint.[Ch]:
341 * src/frontends/xforms/FormRef.[Ch]:
342 * src/frontends/xforms/FormTabular.[Ch]:
343 * src/frontends/xforms/FormToc.[Ch]:
344 * src/frontends/xforms/FormUrl.[Ch]:
345 * src/frontends/xforms/FormInset.[Ch]:
346 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
347 form of updateBufferDependent.
349 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
350 if form()->visible just in case someone does stuff to the form in a
353 * src/frontends/DialogBase.h (enum): removed enum since we can now use
354 the buttoncontroller for everything the enum used to be used for.
355 (update) It would seem we need to force all dialogs to use a bool
356 parameter or have two update functions. I chose to go with one.
357 I did try removing update() from here and FormBase and defining the
358 appropriate update signatures in FormBaseB[DI] but then ran into the
359 problem of the update() call in FormBase::show(). Whatever I did
360 to get around that would require another function and that just
361 got more confusing. Hence the decision to make everyone have an
362 update(bool). An alternative might have been to override show() in
363 FormBaseB[DI] and that would allow the different and appropriate
366 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
367 true == buffer change occurred. I decided against using a default
368 template parameter since not all compilers support that at present.
370 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
372 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
373 army knife" by removing functionality.
374 (clearStore): removed. All such housekeeping on hide()ing the dialog
375 is to be carried out by overloaded disconnect() methods.
376 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
377 superceded by Baruch's neat test (FormGraphics) to update an existing
378 dialog if a new signal is recieved rather than block all new signals
380 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
381 only to Inset dialogs.
382 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
383 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
385 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
387 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
388 as a base class to all inset dialogs. Used solely to connect/disconnect
389 the Inset::hide signal and to define what action to take on receipt of
390 a UpdateBufferDependent signal.
391 (FormCommand): now derived from FormInset.
393 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
396 * src/frontends/xforms/FormCopyright.[Ch]:
397 * src/frontends/xforms/FormPreferences.[Ch]:
398 now derived from FormBaseBI.
400 * src/frontends/xforms/FormDocument.[Ch]:
401 * src/frontends/xforms/FormParagraph.[Ch]:
402 * src/frontends/xforms/FormPrint.[Ch]:
403 now derived from FormBaseBD.
405 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
407 * src/frontends/xforms/FormCitation.[Ch]:
408 * src/frontends/xforms/FormError.[Ch]:
409 * src/frontends/xforms/FormRef.[Ch]:
410 * src/frontends/xforms/FormToc.[Ch]:
411 (clearStore): reworked as disconnect().
413 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
416 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
418 * src/converter.C (runLaTeX): constify buffer argument
421 * src/frontends/support/Makefile.am (INCLUDES): fix.
423 * src/buffer.h: add std:: qualifier
424 * src/insets/figinset.C (addpidwait): ditto
425 * src/MenuBackend.C: ditto
426 * src/buffer.C: ditto
427 * src/bufferlist.C: ditto
428 * src/layout.C: ditto
429 * src/lyxfunc.C: ditto
431 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
433 * src/lyxtext.h (bidi_level): change return type to
434 LyXParagraph::size_type.
436 * src/lyxparagraph.h: change size_type to
437 TextContainer::difference_type. This should really be
438 TextContainer::size_type, but we need currently to support signed
441 2000-10-11 Marko Vendelin <markov@ioc.ee>
442 * src/frontends/gnome/FormError.h
443 * src/frontends/gnome/FormRef.C
444 * src/frontends/gnome/FormRef.h
445 * src/frontends/gnome/FormError.C
446 * src/frontends/gnome/Makefile.am
447 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
448 to Gnome frontend. Both dialogs use "action" area.
450 2000-10-12 Baruch Even <baruch.even@writeme.com>
452 * src/graphics/GraphicsCacheItem_pimpl.C:
453 * src/graphics/Renderer.C:
454 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
457 2000-10-12 Juergen Vigna <jug@sad.it>
459 * src/insets/insettext.C (draw): fixed drawing bug (specifically
460 visible when selecting).
462 * development/Code_rules/Rules: fixed some typos.
464 2000-10-09 Baruch Even <baruch.even@writeme.com>
466 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
467 compiling on egcs 1.1.2 possible.
469 * src/filedlg.C (comp_direntry::operator() ): ditto.
471 2000-08-31 Baruch Even <baruch.even@writeme.com>
473 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
476 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
477 transient it now only gets freed when the object is destructed.
479 2000-08-24 Baruch Even <baruch.even@writeme.com>
481 * src/frontends/FormGraphics.h:
482 * src/frontends/FormGraphics.C: Changed to use ButtonController and
485 2000-08-20 Baruch Even <baruch.even@writeme.com>
487 * src/insets/insetgraphics.C:
488 (draw): Added messages to the drawn rectangle to report status.
489 (updateInset): Disabled the use of the inline graphics,
492 2000-08-17 Baruch Even <baruch.even@writeme.com>
494 * src/frontends/support: Directory added for the support of GUII LyX.
496 * src/frontends/support/LyXImage.h:
497 * src/frontends/support/LyXImage.C: Base class for GUII holding of
500 * src/frontends/support/LyXImage_X.h:
501 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
502 version of LyXImage, this uses the Xlib Pixmap.
507 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
508 replacement to Pixmap.
510 * src/insets/insetgraphics.h:
511 * src/insets/insetgraphics.C:
512 * src/graphics/GraphicsCacheItem.h:
513 * src/graphics/GraphicsCacheItem.C:
514 * src/graphics/GraphicsCacheItem_pimpl.h:
515 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
518 * src/graphics/GraphicsCacheItem.h:
519 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
520 another copy of the object.
522 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
523 of cacheHandle, this fixed a bug that sent LyX crashing.
525 * src/graphics/XPM_Renderer.h:
526 * src/graphics/XPM_Renderer.C:
527 * src/graphics/EPS_Renderer.h:
528 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
530 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
532 * src/lyxfunc.C (processKeySym): only handle the
533 lockinginset/inset stuff if we have a buffer and text loaded...
535 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
537 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
539 * src/support/lyxfunctional.h: add operator= that takes a reference
541 * src/lyxserver.C (mkfifo): make first arg const
543 * src/layout.h: renamed name(...) to setName(...) to work around
546 * src/buffer.C (setFileName): had to change name of function to
547 work around bugs in egcs. (renamed from fileName)
549 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
551 * src/support/translator.h: move helper template classes to
552 lyxfunctional.h, include "support/lyxfunctional.h"
554 * src/support/lyxmanip.h: add delaration of fmt
556 * src/support/lyxfunctional.h: new file
557 (class_fun_t): new template class
558 (class_fun): helper template function
559 (back_insert_fun_iterator): new template class
560 (back_inserter_fun): helper template function
561 (compare_memfun_t): new template class
562 (compare_memfun): helper template function
563 (equal_1st_in_pair): moved here from translator
564 (equal_2nd_in_pair): moved here from translator
566 * src/support/fmt.C: new file
567 (fmt): new func, can be used for a printf substitute when still
568 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
570 * src/support/StrPool.C: add some comments
572 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
575 * src/insets/figinset.C (addpidwait): use std::copy with
576 ostream_iterator to fill the pidwaitlist
578 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
580 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
583 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
586 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
588 * src/frontends/xforms/FormDocument.C (build): remove c_str()
589 (class_update): ditto
591 (CheckChoiceClass): move initialization of tc and tct
593 * src/tabular.C: remove current_view
594 (OldFormatRead): similar to right below [istream::ignore]
596 * src/lyxlex_pimpl.C (next): add code for faster skipping of
597 chars, unfortunately this is buggy on gcc 2.95.2, so currently
598 unused [istream::ignore]
600 * src/lyxfunc.C: include "support/lyxfunctional.h"
601 (getInsetByCode): use std::find_if and compare_memfun
603 * src/lyxfont.C (stateText): remove c_str()
605 * src/lyx_main.C (setDebuggingLevel): make static
606 (commandLineHelp): make static
608 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
609 Screen* together with fl_get_display() and fl_screen
611 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
612 togheter with fl_get_display() and fl_screen
613 (create_forms): remove c_str()
615 * src/layout.C: include "support/lyxfunctional.h"
616 (hasLayout): use std::find_if and compare_memfun
617 (GetLayout): use std::find_if and comapre_memfun
618 (delete_layout): use std::remove_if and compare_memfun
619 (NumberOfClass): use std:.find_if and compare_memfun
621 * src/gettext.h: change for the new functions
623 * src/gettext.C: new file, make _(char const * str) and _(string
624 const & str) real functions.
626 * src/font.C (width): rewrite slightly to avoid one extra variable
628 * src/debug.C: initialize Debug::ANY here
630 * src/commandtags.h: update number comments
632 * src/combox.h (get): make const func
634 (getline): make const
636 * src/combox.C (input_cb): handle case where fl_get_input can
639 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
640 "support/lyxfunctional.h", remove current_view variable.
641 (resize): use std::for_each with std::mem_fun
642 (getFileNames): use std::copy with back_inserter_fun
643 (getBuffer): change arg type to unsigned int
644 (emergencyWriteAll): call emergencyWrite with std::for_each and
646 (emergencyWrite): new method, the for loop in emergencyWriteAll
648 (exists): use std::find_if with compare_memfun
649 (getBuffer): use std::find_if and compare_memfun
651 * src/buffer.h: add typedefs for iterator_category, value_type
652 difference_type, pointer and reference for inset_iterator
653 add postfix ++ for inset_iterator
654 make inset_iterator::getPos() const
656 * src/buffer.C: added support/lyxmanip.h
657 (readFile): use lyxerr << fmt instead of printf
658 (makeLaTeXFile): use std::copy to write out encodings
660 * src/Painter.C (text): rewrite slightly to avoid extra font variable
662 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
663 free and the char * temp.
664 (hasMenu): use std::find_if and compare_memfun
667 * src/Makefile.am (lyx_SOURCES): added gettext.C
669 * src/LyXAction.C (retrieveActionArg): clear the arg, use
670 string::insert small change to avoid temporary
672 * src/LColor.C (getGUIName): remove c_str()
674 * several files: change all occurrences of fl_display to
677 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
678 that -pedantic is not used for gcc 2.97 (cvs gcc)
680 * boost/Makefile.am: begin slowly to prepare for a real boost lib
682 2000-10-11 Allan Rae <rae@lyx.org>
684 * src/frontends/xforms/FormPreferences.C (input): template path must be
685 a readable directory. It doesn't need to be writeable.
686 (build, delete, update, apply): New inputs in the various tabfolders
688 * src/frontends/xforms/forms/form_preferences.fd:
689 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
690 several new entries to existing folders. Shuffled some existing stuff
693 * src/frontends/xforms/forms/form_print.fd:
694 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
695 Should probably rework PrinterParams as well. Note that the switch to
696 collated is effectively the same as !unsorted so changing PrinterParams
697 will require a lot of fiddly changes to reverse the existing logic.
699 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
701 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
703 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
705 2000-10-10 Allan Rae <rae@lyx.org>
708 * src/lyxfunc.C (Dispatch):
710 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
713 * src/lyxrc.C (output): Only write the differences between system lyxrc
714 and the users settings.
717 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
719 I'll rewrite this later, after 1.1.6 probably, to keep a single
720 LyXRC but two instances of a LyXRCStruct.
722 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
724 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
726 * src/tabular.h: add a few std:: qualifiers.
728 * src/encoding.C: add using directive.
729 * src/language.C: ditto.
731 * src/insets/insetquotes.C (Validate): use languages->lang()
732 instead of only language.
734 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
736 * lib/languages: New file.
738 * lib/encodings: New file.
740 * src/language.C (Languages): New class.
741 (read): New method. Reads the languages from the 'languages' file.
743 * src/encoding.C (Encodings): New class.
744 (read): New method. Reads the encodings from the 'encodings' file.
746 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
749 * src/bufferparams.h and a lot of files: Deleted the member language,
750 and renamed language_info to language
752 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
753 * src/lyxfont.C (latexWriteStartChanges): ditto.
754 * src/paragraph.C (validate,TeXOnePar): ditto.
756 * src/lyxfont.C (update): Restored deleted code.
758 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
760 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
762 * src/BufferView_pimpl.C (buffer): cleaned up a little.
764 * src/insets/figinset.[Ch]:
765 * src/insets/insetinclude.[Ch]:
766 * src/insets/insetinclude.[Ch]:
767 * src/insets/insetparent.[Ch]:
768 * src/insets/insetref.[Ch]:
769 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
772 * src/mathed/formula.[Ch]:
773 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
775 * src/buffer.C (parseSingleLyXformat2Token, readInset):
776 * src/lyx_cb.C (FigureApplyCB):
777 * src/lyxfunc.C (getStatus, Dispatch):
778 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
781 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
783 * src/converter.[Ch] (Formats::View):
784 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
786 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
787 *current_view->buffer(). This will change later, but this patch is way
790 2000-10-09 Juergen Vigna <jug@sad.it>
792 * src/text.C (GetRow): small fix.
794 * src/BufferView_pimpl.C (cursorPrevious):
795 (cursorNext): added LyXText parameter to function.
797 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
798 keypress depending on cursor position.
800 2000-10-06 Juergen Vigna <jug@sad.it>
802 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
803 (copySelection): redone this function and also copy ascii representa-
806 * src/tabular.C (Ascii):
810 (print_n_chars): new functions to realize the ascii export of tabulars.
812 2000-10-05 Juergen Vigna <jug@sad.it>
814 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
815 if we don't have a buffer.
817 2000-10-10 Allan Rae <rae@lyx.org>
819 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
820 with closing dialog. It seems that nested tabfolders require hiding
821 of inner tabfolders before hiding the dialog itself. Actually all I
822 did was hide the active outer folder.
824 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
825 unless there really is a buffer. hideBufferDependent is called
828 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
829 POTFILES.in stays in $(srcdir).
831 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
833 * lib/lyxrc.example: Few changes.
835 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
837 * src/BufferView_pimpl.C (buffer): only need one the
838 updateBufferDependent signal to be emitted once! Moved to the end of
839 the method to allow bv_->text to be updated first.
841 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
842 and hSignal_ with Dialogs * and BufferDependency variables.
843 New Buffer * parent_, initialised when the dialog is launched. Used to
844 check whether to update() or hide() dialog in the new, private
845 updateOrHide() method that is connected to the updateBufferDependent
846 signal. Daughter classes dictate what to do using the
847 ChangedBufferAction enum, passed to the c-tor.
849 * src/frontends/xforms/FormCitation.C:
850 * src/frontends/xforms/FormCommand.C:
851 * src/frontends/xforms/FormCopyright.C:
852 * src/frontends/xforms/FormDocument.C:
853 * src/frontends/xforms/FormError.C:
854 * src/frontends/xforms/FormIndex.C:
855 * src/frontends/xforms/FormPreferences.C:
856 * src/frontends/xforms/FormPrint.C:
857 * src/frontends/xforms/FormRef.C:
858 * src/frontends/xforms/FormToc.C:
859 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
862 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
863 ChangedBufferAction enum.
865 * src/frontends/xforms/FormParagraph.[Ch]
866 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
869 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
871 * lib/bind/cua.bind: fix a bit.
872 * lib/bind/emacs.bind: ditto.
874 * lib/bind/menus.bind: remove real menu entries from there.
876 * src/spellchecker.C: make sure we only include strings.h when
879 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
881 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
882 function. It enlarges the maximum number of pup when needed.
883 (add_toc2): Open a new menu if maximum number of items per menu has
886 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
888 * src/frontends/kde/FormPrint.C: fix error reporting
890 * src/frontends/xforms/FormDocument.C: fix compiler
893 * lib/.cvsignore: add Literate.nw
895 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
898 * bufferview_funcs.[Ch]
901 * text2.C: Add support for numbers in RTL text.
903 2000-10-06 Allan Rae <rae@lyx.org>
905 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
906 to be gettext.m4 friendly again. ext_l10n.h is now
907 generated into $top_srcdir instead of $top_builddir
908 so that lyx.pot will be built correctly -- without
909 duplicate parsing of ext_l10n.h.
911 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
913 * src/frontends/kde/FormCitation.C: make the dialog
916 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
918 * config/kde.m4: fix consecutive ./configure runs,
919 look for qtarch, fix library order
921 * src/frontends/kde/Makefile.am: tidy up,
922 add Print dialog, add .dlg dependencies
924 * src/frontends/kde/FormPrint.C:
925 * src/frontends/kde/FormPrint.h:
926 * src/frontends/kde/formprintdialog.C:
927 * src/frontends/kde/formprintdialog.h:
928 * src/frontends/kde/formprintdialogdata.C:
929 * src/frontends/kde/formprintdialogdata.h:
930 * src/frontends/kde/dlg/formprintdialog.dlg: add
933 * src/frontends/kde/dlg/README: Added explanatory readme
935 * src/frontends/kde/dlg/checkinitorder.pl: small perl
936 script to double-check qtarch's output
938 * src/frontends/kde/formindexdialog.C:
939 * src/frontends/kde/formindexdialogdata.C:
940 * src/frontends/kde/formindexdialogdata.h:
941 * src/frontends/kde/dlg/formindexdialog.dlg: update
942 for qtarch, minor fixes
944 2000-10-05 Allan Rae <rae@lyx.org>
946 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
947 dialogs when switching buffers update them instead. It's up to each
948 dialog to decide if it should still be visible or not.
949 update() should return a bool to control visiblity within show().
950 Or perhaps better to set a member variable and use that to control
953 * lib/build-listerrors: create an empty "listerrors" file just to stop
954 make trying to regenerate it all the time if you don't have noweb
957 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
959 * po/Makefile.in.in (ext_l10n.h): added a rule to build
960 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
961 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
962 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
963 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
965 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
967 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
969 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
970 deleting buffer. Closes all buffer-dependent dialogs.
972 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
974 * src/frontends/xforms/FormCitation.[Ch]:
975 * src/frontends/xforms/FormPreferences.[Ch]:
976 * src/frontends/xforms/FormPrint.[Ch]:
977 * src/frontends/xforms/FormRef.[Ch]:
978 * src/frontends/xforms/FormUrl.[Ch]: ditto
980 * src/frontends/xforms/FormDocument.[Ch]:
981 * src/frontends/xforms/forms/form_document.C.patch:
982 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
983 pass through a single input() function.
985 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
987 * lib/build-listerrors: return status as OK
989 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
991 * lib/lyxrc.example: Updated to new export code
993 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
995 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
998 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1001 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1002 LyX-Code is defined.
1003 * lib/layouts/amsbook.layout: ditto.
1005 * boost/Makefile.am: fix typo.
1007 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1009 (add_lastfiles): removed.
1010 (add_documents): removed.
1011 (add_formats): removed.
1013 * src/frontends/Menubar.C: remove useless "using" directive.
1015 * src/MenuBackend.h: add a new MenuItem constructor.
1017 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1020 2000-10-04 Allan Rae <rae@lyx.org>
1022 * lib/Makefile.am (listerrors):
1023 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1024 I haven't got notangle installed so Kayvan please test. The output
1025 should end up in $builddir. This also allows people who don't have
1026 noweb installed to complete the make process without error.
1028 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1029 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1030 by JMarc's picky compiler.
1032 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1035 * src/insets/insettabular.C (setPos): change for loop to not use
1036 sequencing operator. Please check this Jürgen.
1038 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1040 * src/insets/insetcite.C (getScreenLabel): ditto
1041 * src/support/filetools.C (QuoteName): ditto
1042 (ChangeExtension): ditto
1044 * src/BufferView_pimpl.C (scrollCB): make heigt int
1046 * src/BufferView2.C (insertInset): comment out unused arg
1048 * boost/Makefile.am (EXTRADIST): new variable
1050 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1052 * src/exporter.C (IsExportable): Fixed
1054 * lib/configure.m4: Small fix
1056 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1058 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1059 * src/insets/insetbib.C (bibitemWidest): ditto.
1060 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1062 2000-10-03 Juergen Vigna <jug@sad.it>
1064 * src/BufferView2.C (theLockingInset): removed const because of
1065 Agnus's compile problems.
1067 * src/insets/insettext.C (LocalDispatch): set the language of the
1068 surronding paragraph on inserting the first character.
1070 * various files: changed use of BufferView::the_locking_inset.
1072 * src/BufferView2.C (theLockingInset):
1073 (theLockingInset): new functions.
1075 * src/BufferView.h: removed the_locking_inset.
1077 * src/lyxtext.h: added the_locking_inset
1079 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1081 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1083 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1085 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1086 * src/mathed/math_cursor.C (IsAlpha): ditto.
1087 * src/mathed/math_inset.C (strnew): ditto.
1088 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1089 (IMetrics): cxp set but never used; removed.
1090 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1091 that the variable in question has been removed also!
1094 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1095 using the Buffer * passed to Latex(), using the BufferView * passed to
1096 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1098 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1099 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1101 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1102 * src/buffer.C (readInset): used new InsetBibtex c-tor
1103 * (getBibkeyList): used new InsetBibtex::getKeys
1105 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1108 * lib/build-listerrors
1110 * src/exporter.C: Add literate programming support to the export code
1113 * src/lyx_cb.C: Remove old literate code.
1115 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1118 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1119 * src/converter.C (View, Convert): Use QuoteName.
1121 * src/insets/figinset.C (Preview): Use Formats::View.
1123 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1125 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1127 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1128 the top of the function, because compaq cxx complains that the
1129 "goto exit_with_message" when the function is disabled bypasses
1131 (MenuNew): try a better fix for the generation of new file names.
1132 This time, I used AddName() instead of AddPath(), hoping Juergen
1135 2000-10-03 Allan Rae <rae@lyx.org>
1137 * src/frontends/xforms/forms/form_preferences.fd:
1138 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1139 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1140 "Look and Feel"->"General" but will need to be split up further into
1141 general output and general input tabs. Current plan is for four outer
1142 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1143 stuff; "Inputs" for input and import configuration; "Outputs" for
1144 output and export configuration; and one more whatever is left over
1145 called "General". The leftovers at present look like being which
1146 viewers to use, spellchecker, language support and might be better
1147 named "Support". I've put "Paths" in "Inputs" for the moment as this
1148 seems reasonable for now at least.
1149 One problem remains: X error kills LyX when you close Preferences.
1151 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1153 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1154 qualifier from form()
1155 * src/frontends/xforms/FormCitation.[Ch]:
1156 * src/frontends/xforms/FormCopyright.[Ch]:
1157 * src/frontends/xforms/FormDocument.[Ch]:
1158 * src/frontends/xforms/FormError.[Ch]:
1159 * src/frontends/xforms/FormIndex.[Ch]:
1160 * src/frontends/xforms/FormPreferences.[Ch]:
1161 * src/frontends/xforms/FormPrint.[Ch]:
1162 * src/frontends/xforms/FormRef.[Ch]:
1163 * src/frontends/xforms/FormToc.[Ch]:
1164 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1166 * src/frontends/xforms/FormCitation.[Ch]:
1167 * src/frontends/xforms/FormIndex.[Ch]:
1168 * src/frontends/xforms/FormRef.[Ch]:
1169 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1170 with Allan's naming policy
1172 * src/frontends/xforms/FormCitation.C: some static casts to remove
1175 2000-10-02 Juergen Vigna <jug@sad.it>
1177 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1178 now you can type or do stuff inside the table-cell also when in dummy
1179 position, fixed visible cursor.
1181 * src/insets/insettext.C (Edit): fixing cursor-view position.
1183 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1184 be used for equal functions in lyxfunc and insettext.
1186 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1188 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1190 * src/frontends/gnome/FormCitation.h:
1191 * src/frontends/gnome/FormCopyright.h:
1192 * src/frontends/gnome/FormIndex.h:
1193 * src/frontends/gnome/FormPrint.h:
1194 * src/frontends/gnome/FormToc.h:
1195 * src/frontends/gnome/FormUrl.h:
1196 * src/frontends/kde/FormCitation.h:
1197 * src/frontends/kde/FormCopyright.h:
1198 * src/frontends/kde/FormIndex.h:
1199 * src/frontends/kde/FormRef.h:
1200 * src/frontends/kde/FormToc.h:
1201 * src/frontends/kde/FormUrl.h: fix remaining users of
1204 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1206 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1207 from depth argument.
1208 (DocBookHandleCaption): ditto.
1209 (DocBookHandleFootnote): ditto.
1210 (SimpleDocBookOnePar): ditto.
1212 * src/frontends/xforms/FormDocument.h (form): remove extra
1213 FormDocument:: qualifier.
1215 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1217 * sigc++/handle.h: ditto.
1219 * src/lyx_gui_misc.C: add "using" directive.
1221 * src/cheaders/cstddef: new file, needed by the boost library (for
1224 2000-10-02 Juergen Vigna <jug@sad.it>
1226 * src/insets/insettext.C (SetFont): better support.
1228 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1230 * src/screen.C (DrawOneRow): some uint refixes!
1232 2000-10-02 Allan Rae <rae@lyx.org>
1234 * boost/.cvsignore: ignore Makefile as well
1236 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1237 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1239 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1240 Left this one out by accident.
1242 * src/frontends/xforms/FormBase.h (restore): default to calling
1243 update() since that will restore the original/currently-applied values.
1244 Any input() triggered error messages will require the derived classes
1245 to redefine restore().
1247 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1248 avoid a segfault. combo_doc_class is the main concern.
1250 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1252 * Simplify build-listerrors in view of GUI-less export ability!
1254 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1256 * src/lyx_main.C (easyParse): Disable gui when exporting
1258 * src/insets/figinset.C:
1261 * src/lyx_gui_misc.C
1262 * src/tabular.C: Changes to allow no-gui.
1264 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1266 * src/support/utility.hpp: removed file
1267 * src/support/block.h: removed file
1269 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1272 * src/mathed/formula.C: add support/lyxlib.h
1273 * src/mathed/formulamacro.C: ditto
1275 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1276 * src/lyxparagraph.h: ditto
1278 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1279 * src/frontends/Makefile.am (INCLUDES): ditto
1280 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1281 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1282 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1283 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1284 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1285 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1287 * src/BufferView.h: use boost/utility.hpp
1288 * src/LColor.h: ditto
1289 * src/LaTeX.h: ditto
1290 * src/LyXAction.h: ditto
1291 * src/LyXView.h: ditto
1292 * src/bufferlist.h: ditto
1293 * src/lastfiles.h: ditto
1294 * src/layout.h: ditto
1295 * src/lyx_gui.h: ditto
1296 * src/lyx_main.h: ditto
1297 * src/lyxlex.h: ditto
1298 * src/lyxrc.h: ditto
1299 * src/frontends/ButtonPolicies.h: ditto
1300 * src/frontends/Dialogs.h: ditto
1301 * src/frontends/xforms/FormBase.h: ditto
1302 * src/frontends/xforms/FormGraphics.h: ditto
1303 * src/frontends/xforms/FormParagraph.h: ditto
1304 * src/frontends/xforms/FormTabular.h: ditto
1305 * src/graphics/GraphicsCache.h: ditto
1306 * src/graphics/Renderer.h: ditto
1307 * src/insets/ExternalTemplate.h: ditto
1308 * src/insets/insetcommand.h: ditto
1309 * src/support/path.h: ditto
1311 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1312 and introduce clause for 2.97.
1314 * boost/libs/README: new file
1316 * boost/boost/utility.hpp: new file
1318 * boost/boost/config.hpp: new file
1320 * boost/boost/array.hpp: new file
1322 * boost/Makefile.am: new file
1324 * boost/.cvsignore: new file
1326 * configure.in (AC_OUTPUT): add boost/Makefile
1328 * Makefile.am (SUBDIRS): add boost
1330 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1332 * src/support/lstrings.C (suffixIs): Fixed.
1334 2000-10-01 Allan Rae <rae@lyx.org>
1336 * src/PrinterParams.h: moved things around to avoid the "can't
1337 inline call" warning.
1339 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1340 into doc++ documentation.
1342 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1344 * src/frontends/xforms/FormRef.C: make use of button controller
1345 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1346 cleaned up button controller usage.
1347 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1348 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1349 use the button controller
1351 * src/frontends/xforms/forms/*.fd: and associated generated files
1352 updated to reflect changes to FormBase. Some other FormXxxx files
1353 also got minor updates to reflect changes to FormBase.
1355 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1356 (hide): made virtual.
1357 (input): return a bool. true == valid input
1358 (RestoreCB, restore): new
1359 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1360 Changes to allow derived dialogs to use a ButtonController and
1361 make sense when doing so: OK button calls ok() and so on.
1363 * src/frontends/xforms/ButtonController.h (class ButtonController):
1364 Switch from template implementation to taking Policy parameter.
1365 Allows FormBase to provide a ButtonController for any dialog.
1367 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1368 Probably should rename connect and disconnect.
1369 (apply): use the radio button groups
1370 (form): needed by FormBase
1371 (build): setup the radio button groups
1373 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1375 * several files: type changes to reduce the number of warnings and
1376 to unify type hangling a bit. Still much to do.
1378 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1380 * lib/images/*: rename a bunch of icons to match Dekel converter
1383 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1386 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1388 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1390 * sigc++/handle.h: ditto for class Handle.
1392 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1394 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1396 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1398 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1399 removal of the "default" language.
1401 * src/combox.h (getline): Check that sel > 0
1403 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1405 * lib/examples/docbook_example.lyx
1406 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1408 * lib/layouts/docbook-book.layout: new docbook book layout.
1410 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1412 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1414 * src/insets/figinset.C (DocBook):fixed small typo.
1416 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1418 * src/insets/insetinclude.h: string include_label doesn't need to be
1421 2000-09-29 Allan Rae <rae@lyx.org>
1423 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1424 Allow derived type to control connection and disconnection from signals
1425 of its choice if desired.
1427 2000-09-28 Juergen Vigna <jug@sad.it>
1429 * src/insets/insettabular.C (update): fixed cursor setting when
1430 the_locking_inset changed.
1431 (draw): made this a bit cleaner.
1432 (InsetButtonPress): fixed!
1434 * various files: added LyXText Parameter to fitCursor call.
1436 * src/BufferView.C (fitCursor): added LyXText parameter.
1438 * src/insets/insettabular.C (draw): small draw fix.
1440 * src/tabular.C: right setting of left/right celllines.
1442 * src/tabular.[Ch]: fixed various types in funcions and structures.
1443 * src/insets/insettabular.C: ditto
1444 * src/frontends/xforms/FormTabular.C: ditto
1446 2000-09-28 Allan Rae <rae@lyx.org>
1448 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1449 that the #ifdef's had been applied to part of what should have been
1450 a complete condition. It's possible there are other tests that
1451 were specific to tables that are also wrong now that InsetTabular is
1452 being used. Now we need to fix the output of '\n' after a table in a
1453 float for the same reason as the original condition:
1454 "don't insert this if we would be adding it before or after a table
1455 in a float. This little trick is needed in order to allow use of
1456 tables in \subfigures or \subtables."
1457 Juergen can you check this?
1459 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1461 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1462 outputed to the ostream.
1464 * several files: fixed types based on warnings from cxx
1466 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1468 * src/frontends/kde/Makefile.am: fix rule for
1469 formindexdialogdata_moc.C
1471 * src/.cvsignore: add ext_l10n.h to ignore
1473 * acconfig.h: stop messing with __STRICT_ANSI__
1474 * config/gnome.m4: remove option to set -ansi
1475 * config/kde.m4: remove option to set -ansi
1476 * config/lyxinclude.m4: don't set -ansi
1478 2000-09-27 Juergen Vigna <jug@sad.it>
1480 * various files: remove "default" language check.
1482 * src/insets/insetquotes.C: removed use of current_view.
1484 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1485 the one should have red ears by now!
1487 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1488 in more then one paragraph. Fixed cursor-movement/selection.
1490 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1491 paragraphs inside a text inset.
1493 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1494 text-inset if this owner is an inset.
1496 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1498 * src/Bullet.h: changed type of font, character and size to int
1500 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1502 * src/insets/inseturl.[Ch]:
1503 * src/insets/insetref.[Ch]:
1504 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1506 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1508 * src/buffer.C (readFile): block-if statement rearranged to minimise
1509 bloat. Patch does not reverse Jean-Marc's change ;-)
1511 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1512 Class rewritten to store pointers to hide/update signals directly,
1513 rather than Dialogs *. Also defined an enum to ease use. All xforms
1514 forms can now be derived from this class.
1516 * src/frontends/xforms/FormCommand.[Ch]
1517 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1519 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1522 * src/frontends/xforms/forms/form_citation.fd
1523 * src/frontends/xforms/forms/form_copyright.fd
1524 * src/frontends/xforms/forms/form_error.fd
1525 * src/frontends/xforms/forms/form_index.fd
1526 * src/frontends/xforms/forms/form_ref.fd
1527 * src/frontends/xforms/forms/form_toc.fd
1528 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1530 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1532 * src/insets/insetfoot.C: removed redundent using directive.
1534 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1536 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1537 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1539 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1540 created in the constructors in different groups. Then set() just
1541 have to show the groups as needed. This fixes the redraw problems
1542 (and is how the old menu code worked).
1544 * src/support/lyxlib.h: declare the methods as static when we do
1545 not have namespaces.
1547 2000-09-26 Juergen Vigna <jug@sad.it>
1549 * src/buffer.C (asciiParagraph): new function.
1550 (writeFileAscii): new function with parameter ostream.
1551 (writeFileAscii): use now asciiParagraph.
1553 * various inset files: added the linelen parameter to the Ascii-func.
1555 * src/tabular.C (Write): fixed error in writing file introduced by
1556 the last changes from Lars.
1558 * lib/bind/menus.bind: removed not supported functions.
1560 * src/insets/insettext.C (Ascii): implemented this function.
1562 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1564 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1565 (Write): use of the write_attribute functions.
1567 * src/bufferlist.C (close): fixed reasking question!
1569 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1571 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1572 new files use the everwhere possible.
1575 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1576 src/log_form.C src/lyx.C:
1579 * src/buffer.C (runLaTeX): remove func
1581 * src/PaperLayout.C: removed file
1582 * src/ParagraphExtra.C: likewise
1583 * src/bullet_forms.C: likewise
1584 * src/bullet_forms.h: likewise
1585 * src/bullet_forms_cb.C: likewise
1587 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1588 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1591 * several files: remove all traces of the old fd_form_paragraph,
1592 and functions belonging to that.
1594 * several files: remove all traces of the old fd_form_document,
1595 and functions belonging to that.
1597 * several files: constify local variables were possible.
1599 * several files: remove all code that was dead when NEW_EXPORT was
1602 * several files: removed string::c_str in as many places as
1605 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1606 (e): be a bit more outspoken when patching
1607 (updatesrc): only move files if changed.
1609 * forms/layout_forms.h.patch: regenerated
1611 * forms/layout_forms.fd: remove form_document and form_paragraph
1612 and form_quotes and form_paper and form_table_options and
1613 form_paragraph_extra
1615 * forms/form1.fd: remove form_table
1617 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1618 the fdui->... rewrite. Update some comments to xforms 0.88
1620 * forms/bullet_forms.C.patch: removed file
1621 * forms/bullet_forms.fd: likewise
1622 * forms/bullet_forms.h.patch: likewise
1624 * development/Code_rules/Rules: added a section on switch
1625 statements. Updated some comment to xforms 0.88.
1627 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1629 * src/buffer.C (readFile): make sure that the whole version number
1630 is read after \lyxformat (even when it contains a comma)
1632 * lib/ui/default.ui: change shortcut of math menu to M-a.
1634 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1636 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1639 * src/LyXView.C (updateWindowTitle): show the full files name in
1640 window title, limited to 30 characters.
1642 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1643 When a number of characters has been given, we should not assume
1644 that the string is 0-terminated.
1646 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1647 calls (fixes some memory leaks)
1649 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1650 trans member on exit.
1652 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1654 * src/converter.C (GetReachable): fix typo.
1656 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1657 understand ',' instead of '.'.
1658 (GetInteger): rewrite to use strToInt().
1660 2000-09-26 Juergen Vigna <jug@sad.it>
1662 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1663 better visibility and error-message on wrong VSpace input.
1665 * src/language.C (initL): added english again.
1667 2000-09-25 Juergen Vigna <jug@sad.it>
1669 * src/frontends/kde/Dialogs.C (Dialogs):
1670 * src/frontends/gnome/Dialogs.C (Dialogs):
1671 * src/frontends/kde/Makefile.am:
1672 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1674 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1676 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1678 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1680 * src/frontends/xforms/FormParagraph.C:
1681 * src/frontends/xforms/FormParagraph.h:
1682 * src/frontends/xforms/form_paragraph.C:
1683 * src/frontends/xforms/form_paragraph.h:
1684 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1687 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1689 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1690 Paragraph-Data after use.
1692 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1693 non breakable paragraphs.
1695 2000-09-25 Garst R. Reese <reese@isn.net>
1697 * src/language.C (initL): added missing language_country codes.
1699 2000-09-25 Juergen Vigna <jug@sad.it>
1701 * src/insets/insettext.C (InsetText):
1702 (deleteLyXText): remove the not released LyXText structure!
1704 2000-09-24 Marko Vendelin <markov@ioc.ee>
1706 * src/frontends/gnome/mainapp.C
1707 * src/frontends/gnome/mainapp.h: added support for keyboard
1710 * src/frontends/gnome/FormCitation.C
1711 * src/frontends/gnome/FormCitation.h
1712 * src/frontends/gnome/Makefile.am
1713 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1714 FormCitation to use "action area" in mainapp window
1716 * src/frontends/gnome/Menubar_pimpl.C
1717 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1720 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1722 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1723 width/descent/ascent values if name is empty.
1724 (mathed_string_height): Use std::max.
1726 2000-09-25 Allan Rae <rae@lyx.org>
1728 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1729 segfault. This will be completely redesigned soon.
1731 * sigc++: updated libsigc++. Fixes struct timespec bug.
1733 * development/tools/makeLyXsigc.sh: .cvsignore addition
1735 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1737 * several files: removed almost all traces of the old table
1740 * src/TableLayout.C: removed file
1742 2000-09-22 Juergen Vigna <jug@sad.it>
1744 * src/frontends/kde/Dialogs.C: added credits forms.
1746 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1748 * src/frontends/gnome/Dialogs.C: added some forms.
1750 * src/spellchecker.C (init_spell_checker): set language in pspell code
1751 (RunSpellChecker): some modifications for setting language string.
1753 * src/language.[Ch]: added language_country code.
1755 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1757 * src/frontends/Dialogs.h: added new signal showError.
1758 Rearranged existing signals in some sort of alphabetical order.
1760 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1761 FormError.[Ch], form_error.[Ch]
1762 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1763 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1765 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1766 dialogs. I think that this can be used as the base to all these
1769 * src/frontends/xforms/FormError.[Ch]
1770 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1771 implementation of InsetError dialog.
1773 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1775 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1776 * src/frontends/kde/Makefile.am: ditto
1778 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1780 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1781 macrobf. This fixes a bug of invisible text.
1783 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1785 * lib/doc/LaTeXConfig.lyx.in: updated.
1787 * src/language.C (initL): remove language "francais" and change a
1788 bit the names of the two other french variations.
1790 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1791 string that may not be 0-terminated.
1793 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1795 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1797 2000-09-20 Marko Vendelin <markov@ioc.ee>
1799 * src/frontends/gnome/FormCitation.C
1800 * src/frontends/gnome/FormIndex.C
1801 * src/frontends/gnome/FormToc.C
1802 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1803 the variable initialization to shut up the warnings
1805 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1807 * src/table.[Ch]: deleted files
1809 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1812 2000-09-18 Juergen Vigna <jug@sad.it>
1814 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1815 problems with selection. Inserted new LFUN_PASTESELECTION.
1816 (InsetButtonPress): inserted handling of middle mouse-button paste.
1818 * src/spellchecker.C: changed word to word.c_str().
1820 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1822 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1823 included in the ``make dist'' tarball.
1825 2000-09-15 Juergen Vigna <jug@sad.it>
1827 * src/CutAndPaste.C (cutSelection): small fix return the right
1828 end position after cut inside one paragraph only.
1830 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1831 we are locked as otherwise we don't have a valid cursor position!
1833 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1835 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1837 * src/frontends/kde/FormRef.C: added using directive.
1838 * src/frontends/kde/FormToc.C: ditto
1840 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1842 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1844 2000-09-19 Marko Vendelin <markov@ioc.ee>
1846 * src/frontends/gnome/Menubar_pimpl.C
1847 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1848 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1850 * src/frontends/gnome/mainapp.C
1851 * src/frontends/gnome/mainapp.h: support for menu update used
1854 * src/frontends/gnome/mainapp.C
1855 * src/frontends/gnome/mainapp.h: support for "action" area in the
1856 main window. This area is used by small simple dialogs, such as
1859 * src/frontends/gnome/FormIndex.C
1860 * src/frontends/gnome/FormIndex.h
1861 * src/frontends/gnome/FormUrl.C
1862 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1865 * src/frontends/gnome/FormCitation.C
1866 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1867 action area. Only "Insert new citation" is implemented.
1869 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1871 * src/buffer.C (Dispatch): fix call to Dispatch
1872 * src/insets/insetref.C (Edit): likewise
1873 * src/insets/insetparent.C (Edit): likewise
1874 * src/insets/insetinclude.C (include_cb): likewise
1875 * src/frontends/xforms/FormUrl.C (apply): likewise
1876 * src/frontends/xforms/FormToc.C (apply): likewise
1877 * src/frontends/xforms/FormRef.C (apply): likewise
1878 * src/frontends/xforms/FormIndex.C (apply): likewise
1879 * src/frontends/xforms/FormCitation.C (apply): likewise
1880 * src/lyxserver.C (callback): likewise
1881 * src/lyxfunc.C (processKeySym): likewise
1882 (Dispatch): likewise
1883 (Dispatch): likewise
1884 * src/lyx_cb.C (LayoutsCB): likewise
1886 * Makefile.am (sourcedoc): small change
1888 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1890 * src/main.C (main): Don't make an empty GUIRunTime object. all
1891 methods are static. constify a bit remove unneded using + headers.
1893 * src/tabular.C: some more const to local vars move some loop vars
1895 * src/spellchecker.C: added some c_str after some word for pspell
1897 * src/frontends/GUIRunTime.h: add new static method setDefaults
1898 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1899 * src/frontends/kde/GUIRunTime.C (setDefaults):
1900 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1902 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1903 with strnew in arg, use correct emptystring when calling SetName.
1905 * several files: remove all commented code with relation to
1906 HAVE_SSTREAM beeing false. We now only support stringstream and
1909 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1911 * src/lyxfunc.C: construct correctly the automatic new file
1914 * src/text2.C (IsStringInText): change type of variable i to shut
1917 * src/support/sstream.h: do not use namespaces if the compiler
1918 does not support them.
1920 2000-09-15 Marko Vendelin <markov@ioc.ee>
1921 * src/frontends/gnome/FormCitation.C
1922 * src/frontends/gnome/FormCitation.h
1923 * src/frontends/gnome/diainsertcitation_interface.c
1924 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1925 regexp support to FormCitation [Gnome].
1927 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1930 * configure.in: remove unused KDE/GTKGUI define
1932 * src/frontends/kde/FormRef.C
1933 * src/frontends/kde/FormRef.h
1934 * src/frontends/kde/formrefdialog.C
1935 * src/frontends/kde/formrefdialog.h: double click will
1936 go to reference, now it is possible to change a cross-ref
1939 * src/frontends/kde/FormToc.C
1940 * src/frontends/kde/FormToc.h
1941 * src/frontends/kde/formtocdialog.C
1942 * src/frontends/kde/formtocdialog.h: add a depth
1945 * src/frontends/kde/Makefile.am: add QtLyXView.h
1948 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1950 * src/frontends/kde/FormCitation.h: added some using directives.
1952 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1954 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1957 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1960 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1962 * src/buffer.C (pop_tag): revert for the second time a change by
1963 Lars, who seems to really hate having non-local loop variables :)
1965 * src/Lsstream.h: add "using" statements.
1967 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1968 * src/buffer.C (writeFile): ditto
1970 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1972 * src/buffer.C (writeFile): try to fix the locale modified format
1973 number to always be as we want it.
1975 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1976 in XForms 0.89. C-space is now working again.
1978 * src/Lsstream.h src/support/sstream.h: new files.
1980 * also commented out all cases where strstream were used.
1982 * src/Bullet.h (c_str): remove method.
1984 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1986 * a lot of files: get rid of "char const *" and "char *" is as
1987 many places as possible. We only want to use them in interaction
1988 with system of other libraries, not inside lyx.
1990 * a lot of files: return const object is not of pod type. This
1991 helps ensure that temporary objects is not modified. And fits well
1992 with "programming by contract".
1994 * configure.in: check for the locale header too
1996 * Makefile.am (sourcedoc): new tag for generation of doc++
1999 2000-09-14 Juergen Vigna <jug@sad.it>
2001 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2002 callback to check which combo called it and do the right action.
2004 * src/combox.C (combo_cb): added combo * to the callbacks.
2005 (Hide): moved call of callback after Ungrab of the pointer.
2007 * src/intl.h: removed LCombo2 function.
2009 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2010 function as this can now be handled in one function.
2012 * src/combox.h: added Combox * to callback prototype.
2014 * src/frontends/xforms/Toolbar_pimpl.C:
2015 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2017 2000-09-14 Garst Reese <reese@isn.net>
2019 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2020 moved usepackage{xxx}'s to beginning of file. Changed left margin
2021 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2022 underlining from title. Thanks to John Culleton for useful suggestions.
2024 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2026 * src/lyxlex_pimpl.C (setFile): change error message to debug
2029 2000-09-13 Juergen Vigna <jug@sad.it>
2031 * src/frontends/xforms/FormDocument.C: implemented choice_class
2032 as combox and give callback to combo_language so OK/Apply is activated
2035 * src/bufferlist.C (newFile): small fix so already named files
2036 (via an open call) are not requested to be named again on the
2039 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2041 * src/frontends/kde/Makefile.am
2042 * src/frontends/kde/FormRef.C
2043 * src/frontends/kde/FormRef.h
2044 * src/frontends/kde/formrefdialog.C
2045 * src/frontends/kde/formrefdialog.h: implement
2048 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2050 * src/frontends/kde/formtocdialog.C
2051 * src/frontends/kde/formtocdialog.h
2052 * src/frontends/kde/FormToc.C
2053 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2055 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2057 * src/frontends/kde/FormCitation.C: fix thinko
2058 where we didn't always display the reference text
2061 * src/frontends/kde/formurldialog.C
2062 * src/frontends/kde/formurldialog.h
2063 * src/frontends/kde/FormUrl.C
2064 * src/frontends/kde/FormUrl.h: minor cleanups
2066 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2068 * src/frontends/kde/Makefile.am
2069 * src/frontends/kde/FormToc.C
2070 * src/frontends/kde/FormToc.h
2071 * src/frontends/kde/FormCitation.C
2072 * src/frontends/kde/FormCitation.h
2073 * src/frontends/kde/FormIndex.C
2074 * src/frontends/kde/FormIndex.h
2075 * src/frontends/kde/formtocdialog.C
2076 * src/frontends/kde/formtocdialog.h
2077 * src/frontends/kde/formcitationdialog.C
2078 * src/frontends/kde/formcitationdialog.h
2079 * src/frontends/kde/formindexdialog.C
2080 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2082 2000-09-12 Juergen Vigna <jug@sad.it>
2084 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2087 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2089 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2092 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2094 * src/converter.C (Add, Convert): Added support for converter flags:
2095 needaux, resultdir, resultfile.
2096 (Convert): Added new parameter view_file.
2097 (dvips_options): Fixed letter paper option.
2099 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2100 (Export, GetExportableFormats, GetViewableFormats): Added support
2103 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2105 (easyParse): Fixed to work with new export code.
2107 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2110 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2112 * lib/bind/*.bind: Replaced
2113 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2114 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2116 2000-09-11 Juergen Vigna <jug@sad.it>
2118 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2120 * src/main.C (main): now GUII defines global guiruntime!
2122 * src/frontends/gnome/GUIRunTime.C (initApplication):
2123 * src/frontends/kde/GUIRunTime.C (initApplication):
2124 * src/frontends/xforms/GUIRunTime.C (initApplication):
2125 * src/frontends/GUIRunTime.h: added new function initApplication.
2127 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2129 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2131 2000-09-08 Juergen Vigna <jug@sad.it>
2133 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2134 we have already "Reset".
2136 * src/language.C (initL): inserted "default" language and made this
2137 THE default language (and not american!)
2139 * src/paragraph.C: inserted handling of "default" language!
2141 * src/lyxfont.C: ditto
2145 * src/paragraph.C: output the \\par only if we have a following
2146 paragraph otherwise it's not needed.
2148 2000-09-05 Juergen Vigna <jug@sad.it>
2150 * config/pspell.m4: added entry to lyx-flags
2152 * src/spellchecker.C: modified version from Kevin for using pspell
2154 2000-09-01 Marko Vendelin <markov@ioc.ee>
2155 * src/frontends/gnome/Makefile.am
2156 * src/frontends/gnome/FormCitation.C
2157 * src/frontends/gnome/FormCitation.h
2158 * src/frontends/gnome/diainsertcitation_callbacks.c
2159 * src/frontends/gnome/diainsertcitation_callbacks.h
2160 * src/frontends/gnome/diainsertcitation_interface.c
2161 * src/frontends/gnome/diainsertcitation_interface.h
2162 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2163 dialog for Gnome frontend
2165 * src/main.C: Gnome libraries require keeping application name
2166 and its version as strings
2168 * src/frontends/gnome/mainapp.C: Change the name of the main window
2169 from GnomeLyX to PACKAGE
2171 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2173 * src/frontends/Liason.C: add "using: declaration.
2175 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2177 * src/mathed/math_macro.C (Metrics): Set the size of the template
2179 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2181 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2183 * src/converter.C (add_options): New function.
2184 (SetViewer): Change $$FName into '$$FName'.
2185 (View): Add options when running xdvi
2186 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2187 (Convert): The 3rd parameter is now the desired filename. Converts
2188 calls to lyx::rename if necessary.
2189 Add options when running dvips.
2190 (dvi_papersize,dvips_options): New methods.
2192 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2194 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2195 using a call to Converter::dvips_options.
2196 Fixed to work with nex export code.
2198 * src/support/copy.C
2199 * src/support/rename.C: New files
2201 * src/support/syscall.h
2202 * src/support/syscall.C: Added Starttype SystemDontWait.
2204 * lib/ui/default.ui: Changed to work with new export code
2206 * lib/configure.m4: Changed to work with new export code
2208 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2210 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2212 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2213 so that code compiles with DEC cxx.
2215 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2216 to work correctly! Also now supports the additional elements
2219 2000-09-01 Allan Rae <rae@lyx.org>
2221 * src/frontends/ButtonPolicies.C: renamed all the references to
2222 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2224 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2225 since it's a const not a type.
2227 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2229 2000-08-31 Juergen Vigna <jug@sad.it>
2231 * src/insets/figinset.C: Various changes to look if the filename has
2232 an extension and if not add it for inline previewing.
2234 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2236 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2237 make buttonStatus and isReadOnly be const methods. (also reflect
2238 this in derived classes.)
2240 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2241 (nextState): change to be static inline, pass the StateMachine as
2243 (PreferencesPolicy): remove casts
2244 (OkCancelPolicy): remvoe casts
2245 (OkCancelReadOnlyPolicy): remove casts
2246 (NoRepeatedApplyReadOnlyPolicy): remove casts
2247 (OkApplyCancelReadOnlyPolicy): remove casts
2248 (OkApplyCancelPolicy): remove casts
2249 (NoRepeatedApplyPolicy): remove casts
2251 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2253 * src/converter.C: added some using directives
2255 * src/frontends/ButtonPolicies.C: changes to overcome
2256 "need lvalue" error with DEC c++
2258 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2259 to WMHideCB for DEC c++
2261 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2263 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2264 to BulletBMTableCB for DEC c++
2266 2000-08-31 Allan Rae <rae@lyx.org>
2268 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2269 character dialog separately from old document dialogs combo_language.
2272 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2274 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2275 Removed LFUN_REF_CREATE.
2277 * src/MenuBackend.C: Added new tags: toc and references
2279 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2280 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2282 (add_toc, add_references): New methods.
2283 (create_submenu): Handle correctly the case when there is a
2284 seperator after optional menu items.
2286 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2287 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2288 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2290 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2292 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2294 * src/converter.[Ch]: New file for converting between different
2297 * src/export.[Ch]: New file for exporting a LyX file to different
2300 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2301 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2302 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2303 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2304 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2305 RunDocBook, MenuExport.
2307 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2308 Exporter::Preview methods if NEW_EXPORT is defined.
2310 * src/buffer.C (Dispatch): Use Exporter::Export.
2312 * src/lyxrc.C: Added new tags: \converter and \viewer.
2315 * src/LyXAction.C: Define new lyx-function: buffer-update.
2316 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2317 when NEW_EXPORT is defined.
2319 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2321 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2323 * lib/ui/default.ui: Added submenus "view" and "update" to the
2326 * src/filetools.C (GetExtension): New function.
2328 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2330 2000-08-29 Allan Rae <rae@lyx.org>
2332 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2334 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2335 (EnableDocumentLayout): removed
2336 (DisableDocumentLayout): removed
2337 (build): make use of ButtonController's read-only handling to
2338 de/activate various objects. Replaces both of the above functions.
2340 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2341 (readOnly): was read_only
2342 (refresh): fixed dumb mistakes with read_only_ handling
2344 * src/frontends/xforms/forms/form_document.fd:
2345 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2346 tabbed dialogs so the tabs look more like tabs and so its easier to
2347 work out which is the current tab.
2349 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2350 segfault with form_table
2352 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2354 2000-08-28 Juergen Vigna <jug@sad.it>
2356 * acconfig.h: added USE_PSPELL.
2358 * src/config.h.in: added USE_PSPELL.
2360 * autogen.sh: added pspell.m4
2362 * config/pspell.m4: new file.
2364 * src/spellchecker.C: implemented support for pspell libary.
2366 2000-08-25 Juergen Vigna <jug@sad.it>
2368 * src/LyXAction.C (init): renamed LFUN_TABLE to
2369 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2371 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2373 * src/lyxscreen.h: add force_clear variable and fuction to force
2374 a clear area when redrawing in LyXText.
2376 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2378 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2380 * some whitespace and comment changes.
2382 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2384 * src/buffer.C: up te LYX_FORMAT to 2.17
2386 2000-08-23 Juergen Vigna <jug@sad.it>
2388 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2391 * src/insets/insettabular.C (pasteSelection): delete the insets
2392 LyXText as it is not valid anymore.
2393 (copySelection): new function.
2394 (pasteSelection): new function.
2395 (cutSelection): new function.
2396 (LocalDispatch): implemented cut/copy/paste of cell selections.
2398 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2399 don't have a LyXText.
2401 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2403 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2406 2000-08-22 Juergen Vigna <jug@sad.it>
2408 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2409 ifdef form_table out if NEW_TABULAR.
2411 2000-08-21 Juergen Vigna <jug@sad.it>
2413 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2414 (draw): fixed draw position so that the cursor is positioned in the
2416 (InsetMotionNotify): hide/show cursor so the position is updated.
2417 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2418 using cellstart() function where it should be used.
2420 * src/insets/insettext.C (draw): ditto.
2422 * src/tabular.C: fixed initialization of some missing variables and
2423 made BoxType into an enum.
2425 2000-08-22 Marko Vendelin <markov@ioc.ee>
2426 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2427 stock menu item using action numerical value, not its string
2431 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2433 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2434 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2436 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2438 * src/frontends/xforms/GUIRunTime.C: new file
2440 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2441 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2443 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2445 * src/frontends/kde/GUIRunTime.C: new file
2447 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2448 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2450 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2452 * src/frontends/gnome/GUIRunTime.C: new file
2454 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2457 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2458 small change to documetentation.
2460 * src/frontends/GUIRunTime.C: removed file
2462 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2464 * src/lyxparagraph.h: enable NEW_TABULAR as default
2466 * src/lyxfunc.C (processKeySym): remove some commented code
2468 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2469 NEW_TABULAR around the fd_form_table_options.
2471 * src/lyx_gui.C (runTime): call the static member function as
2472 GUIRunTime::runTime().
2474 2000-08-21 Allan Rae <rae@lyx.org>
2476 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2479 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2481 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2483 2000-08-21 Allan Rae <rae@lyx.org>
2485 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2486 keep Garst happy ;-)
2487 * src/frontends/xforms/FormPreferences.C (build): use setOK
2488 * src/frontends/xforms/FormDocument.C (build): use setOK
2489 (FormDocument): use the appropriate policy.
2491 2000-08-21 Allan Rae <rae@lyx.org>
2493 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2494 automatic [de]activation of arbitrary objects when in a read-only state.
2496 * src/frontends/ButtonPolicies.h: More documentation
2497 (isReadOnly): added to support the above.
2499 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2501 2000-08-18 Juergen Vigna <jug@sad.it>
2503 * src/insets/insettabular.C (getStatus): changed to return func_status.
2505 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2506 display toggle menu entries if they are.
2508 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2509 new document layout now.
2511 * src/lyxfunc.C: ditto
2513 * src/lyx_gui_misc.C: ditto
2515 * src/lyx_gui.C: ditto
2517 * lib/ui/default.ui: removed paper and quotes layout as they are now
2518 all in the document layout tabbed folder.
2520 * src/frontends/xforms/forms/form_document.fd: added Restore
2521 button and callbacks for all inputs for Allan's ButtonPolicy.
2523 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2524 (CheckChoiceClass): added missing params setting on class change.
2525 (UpdateLayoutDocument): added for updating the layout on params.
2526 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2527 (FormDocument): Implemented Allan's ButtonPolicy with the
2530 2000-08-17 Allan Rae <rae@lyx.org>
2532 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2533 so we can at least see the credits again.
2535 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2536 controller calls for the appropriate callbacks. Note that since Ok
2537 calls apply followed by cancel, and apply isn't a valid input for the
2538 APPLIED state, the bc_ calls have to be made in the static callback not
2539 within each of the real callbacks.
2541 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2542 (setOk): renamed from setOkay()
2544 2000-08-17 Juergen Vigna <jug@sad.it>
2546 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2547 in the implementation part.
2548 (composeUIInfo): don't show optional menu-items.
2550 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2552 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2554 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2555 text-state when in a text-inset.
2557 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2559 2000-08-17 Marko Vendelin <markov@ioc.ee>
2560 * src/frontends/gnome/FormIndex.C
2561 * src/frontends/gnome/FormIndex.h
2562 * src/frontends/gnome/FormToc.C
2563 * src/frontends/gnome/FormToc.h
2564 * src/frontends/gnome/dialogs
2565 * src/frontends/gnome/diatoc_callbacks.c
2566 * src/frontends/gnome/diatoc_callbacks.h
2567 * src/frontends/gnome/diainsertindex_callbacks.h
2568 * src/frontends/gnome/diainsertindex_callbacks.c
2569 * src/frontends/gnome/diainsertindex_interface.c
2570 * src/frontends/gnome/diainsertindex_interface.h
2571 * src/frontends/gnome/diatoc_interface.h
2572 * src/frontends/gnome/diatoc_interface.c
2573 * src/frontends/gnome/Makefile.am: Table of Contents and
2574 Insert Index dialogs implementation for Gnome frontend
2576 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2578 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2580 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2583 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2585 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2586 destructor. Don't definde if you don't need it
2587 (processEvents): made static, non-blocking events processing for
2589 (runTime): static method. event loop for xforms
2590 * similar as above for kde and gnome.
2592 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2593 new Pimpl is correct
2594 (runTime): new method calss the real frontends runtime func.
2596 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2598 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2600 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2602 2000-08-16 Juergen Vigna <jug@sad.it>
2604 * src/lyx_gui.C (runTime): added GUII RunTime support.
2606 * src/frontends/Makefile.am:
2607 * src/frontends/GUIRunTime.[Ch]:
2608 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2609 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2610 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2612 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2614 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2615 as this is already set in ${FRONTEND_INCLUDE} if needed.
2617 * configure.in (CPPFLAGS): setting the include dir for the frontend
2618 directory and don't set FRONTEND=xforms for now as this is executed
2621 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2623 * src/frontends/kde/Makefile.am:
2624 * src/frontends/kde/FormUrl.C:
2625 * src/frontends/kde/FormUrl.h:
2626 * src/frontends/kde/formurldialog.h:
2627 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2629 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2631 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2633 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2635 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2638 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2640 * src/WorkArea.C (work_area_handler): more work to get te
2641 FL_KEYBOARD to work with xforms 0.88 too, please test.
2643 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2645 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2647 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2650 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2652 * src/Timeout.h: remove Qt::emit hack.
2654 * several files: changes to allo doc++ compilation
2656 * src/lyxfunc.C (processKeySym): new method
2657 (processKeyEvent): comment out if FL_REVISION < 89
2659 * src/WorkArea.C: change some debugging levels.
2660 (WorkArea): set wantkey to FL_KEY_ALL
2661 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2662 clearer code and the use of compose with XForms 0.89. Change to
2663 use signals instead of calling methods in bufferview directly.
2665 * src/Painter.C: change some debugging levels.
2667 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2670 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2671 (workAreaKeyPress): new method
2673 2000-08-14 Juergen Vigna <jug@sad.it>
2675 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2677 * config/kde.m4: addes some features
2679 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2680 include missing xforms dialogs.
2682 * src/Timeout.h: a hack to be able to compile with qt/kde.
2684 * sigc++/.cvsignore: added acinclude.m4
2686 * lib/.cvsignore: added listerros
2688 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2689 xforms tree as objects are needed for other frontends.
2691 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2692 linking with not yet implemented xforms objects.
2694 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2696 2000-08-14 Baruch Even <baruch.even@writeme.com>
2698 * src/frontends/xforms/FormGraphics.h:
2699 * src/frontends/xforms/FormGraphics.C:
2700 * src/frontends/xforms/RadioButtonGroup.h:
2701 * src/frontends/xforms/RadioButtonGroup.C:
2702 * src/insets/insetgraphics.h:
2703 * src/insets/insetgraphics.C:
2704 * src/insets/insetgraphicsParams.h:
2705 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2706 instead of spaces, and various other indentation issues to make the
2707 sources more consistent.
2709 2000-08-14 Marko Vendelin <markov@ioc.ee>
2711 * src/frontends/gnome/dialogs/diaprint.glade
2712 * src/frontends/gnome/FormPrint.C
2713 * src/frontends/gnome/FormPrint.h
2714 * src/frontends/gnome/diaprint_callbacks.c
2715 * src/frontends/gnome/diaprint_callbacks.h
2716 * src/frontends/gnome/diaprint_interface.c
2717 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2720 * src/frontends/gnome/dialogs/diainserturl.glade
2721 * src/frontends/gnome/FormUrl.C
2722 * src/frontends/gnome/FormUrl.h
2723 * src/frontends/gnome/diainserturl_callbacks.c
2724 * src/frontends/gnome/diainserturl_callbacks.h
2725 * src/frontends/gnome/diainserturl_interface.c
2726 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2727 Gnome implementation
2729 * src/frontends/gnome/Dialogs.C
2730 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2731 all other dialogs. Copy all unimplemented dialogs from Xforms
2734 * src/frontends/gnome/support.c
2735 * src/frontends/gnome/support.h: support files generated by Glade
2739 * config/gnome.m4: Gnome configuration scripts
2741 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2742 configure --help message
2744 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2745 only if there are no events pendling in Gnome/Gtk. This enhances
2746 the performance of menus.
2749 2000-08-14 Allan Rae <rae@lyx.org>
2751 * lib/Makefile.am: listerrors cleaning
2753 * lib/listerrors: removed -- generated file
2754 * acinclude.m4: ditto
2755 * sigc++/acinclude.m4: ditto
2757 * src/frontends/xforms/forms/form_citation.fd:
2758 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2761 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2762 `updatesrc` and now we have a `test` target that does what `updatesrc`
2763 used to do. I didn't like having an install target that wasn't related
2766 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2767 on all except FormGraphics. This may yet happen. Followed by a major
2768 cleanup including using FL_TRANSIENT for most of the dialogs. More
2769 changes to come when the ButtonController below is introduced.
2771 * src/frontends/xforms/ButtonController.h: New file for managing up to
2772 four buttons on a dialog according to an externally defined policy.
2773 * src/frontends/xforms/Makefile.am: added above
2775 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2776 Apply and Cancel/Close buttons and everything in between and beyond.
2777 * src/frontends/Makefile.am: added above.
2779 * src/frontends/xforms/forms/form_preferences.fd:
2780 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2781 and removed variable 'status' as a result. Fixed the set_minsize thing.
2782 Use the new screen-font-update after checking screen fonts were changed
2783 Added a "Restore" button to restore the original lyxrc values while
2784 editing. This restores everything not just the last input changed.
2785 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2787 * src/LyXAction.C: screen-font-update added for updating buffers after
2788 screen font settings have been changed.
2789 * src/commandtags.h: ditto
2790 * src/lyxfunc.C: ditto
2792 * forms/lyx.fd: removed screen fonts dialog.
2793 * src/lyx_gui.C: ditto
2794 * src/menus.[Ch]: ditto
2795 * src/lyx.[Ch]: ditto
2796 * src/lyx_cb.C: ditto + code from here moved to make
2797 screen-font-update. And people wonder why progress on GUII is
2798 slow. Look at how scattered this stuff was! It takes forever
2801 * forms/fdfix.sh: Fixup the spacing after commas.
2802 * forms/makefile: Remove date from generated files. Fewer clashes now.
2803 * forms/bullet_forms.C.patch: included someones handwritten changes
2805 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2806 once I've discovered why LyXRC was made noncopyable.
2807 * src/lyx_main.C: ditto
2809 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2811 * src/frontends/xforms/forms/fdfix.sh:
2812 * src/frontends/xforms/forms/fdfixh.sed:
2813 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2814 * src/frontends/xforms/Form*.[hC]:
2815 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2816 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2817 provide a destructor for the struct FD_form_xxxx. Another version of
2818 the set_[max|min]size workaround and a few other cleanups. Actually,
2819 Angus' patch from 20000809.
2821 2000-08-13 Baruch Even <baruch.even@writeme.com>
2823 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2826 2000-08-11 Juergen Vigna <jug@sad.it>
2828 * src/insets/insetgraphics.C (InsetGraphics): changing init
2829 order because of warnings.
2831 * src/frontends/xforms/forms/makefile: adding patching .C with
2834 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2835 from .C.patch to .c.patch
2837 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2838 order because of warning.
2840 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2842 * src/frontends/Liason.C (setMinibuffer): new helper function
2844 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2846 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2848 * lib/ui/default.ui: commented out PaperLayout entry
2850 * src/frontends/xforms/form_document.[Ch]: new added files
2852 * src/frontends/xforms/FormDocument.[Ch]: ditto
2854 * src/frontends/xforms/forms/form_document.fd: ditto
2856 * src/frontends/xforms/forms/form_document.C.patch: ditto
2858 2000-08-10 Juergen Vigna <jug@sad.it>
2860 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2861 (InsetGraphics): initialized cacheHandle to 0.
2862 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2864 2000-08-10 Baruch Even <baruch.even@writeme.com>
2866 * src/graphics/GraphicsCache.h:
2867 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2868 correctly as a cache.
2870 * src/graphics/GraphicsCacheItem.h:
2871 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2874 * src/graphics/GraphicsCacheItem_pimpl.h:
2875 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2878 * src/insets/insetgraphics.h:
2879 * src/insets/insetgraphics.C: Changed from using a signal notification
2880 to polling when image is not loaded.
2882 2000-08-10 Allan Rae <rae@lyx.org>
2884 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2885 that there are two functions that have to been taken out of line by
2886 hand and aren't taken care of in the script. (Just a reminder note)
2888 * sigc++/macros/*.h.m4: Updated as above.
2890 2000-08-09 Juergen Vigna <jug@sad.it>
2892 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2894 * src/insets/insettabular.C: make drawing of single cell smarter.
2896 2000-08-09 Marko Vendelin <markov@ioc.ee>
2897 * src/frontends/gnome/Menubar_pimpl.C
2898 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2899 implementation: new files
2901 * src/frontends/gnome/mainapp.C
2902 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2905 * src/main.C: create Gnome main window
2907 * src/frontends/xforms/Menubar_pimpl.h
2908 * src/frontends/Menubar.C
2909 * src/frontends/Menubar.h: added method Menubar::update that calls
2910 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2912 * src/LyXView.C: calls Menubar::update to update the state
2915 * src/frontends/gnome/Makefile.am: added new files
2917 * src/frontends/Makefile.am: added frontend compiler options
2919 2000-08-08 Juergen Vigna <jug@sad.it>
2921 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2923 * src/bufferlist.C (close):
2924 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2925 documents if exiting without saving.
2927 * src/buffer.C (save): use removeAutosaveFile()
2929 * src/support/filetools.C (removeAutosaveFile): new function.
2931 * src/lyx_cb.C (MenuWrite): returns a bool now.
2932 (MenuWriteAs): check if file could really be saved and revert to the
2934 (MenuWriteAs): removing old autosavefile if existant.
2936 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2937 before Goto toggle declaration, because of compiler warning.
2939 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2941 * src/lyxfunc.C (MenuNew): small fix.
2943 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2945 * src/bufferlist.C (newFile):
2946 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2948 * src/lyxrc.C: added new_ask_filename tag
2950 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2952 * src/lyx.fd: removed code pertaining to form_ref
2953 * src/lyx.[Ch]: ditto
2954 * src/lyx_cb.C: ditto
2955 * src/lyx_gui.C: ditto
2956 * src/lyx_gui_misc.C: ditto
2958 * src/BufferView_pimpl.C (restorePosition): update buffer only
2961 * src/commandtags.h (LFUN_REFTOGGLE): removed
2962 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2963 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2964 (LFUN_REFBACK): renamed LFUN_REF_BACK
2966 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2967 * src/menus.C: ditto
2968 * src/lyxfunc.C (Dispatch): ditto.
2969 InsertRef dialog is now GUI-independent.
2971 * src/texrow.C: added using std::endl;
2973 * src/insets/insetref.[Ch]: strip out large amounts of code.
2974 The inset is now a container and this functionality is now
2975 managed by a new FormRef dialog
2977 * src/frontends/Dialogs.h (showRef, createRef): new signals
2979 * src/frontends/xforms/FormIndex.[Ch],
2980 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2981 when setting dialog's min/max size
2982 * src/frontends/xforms/FormIndex.[Ch]: ditto
2984 * src/frontends/xforms/FormRef.[Ch],
2985 src/frontends/xforms/forms/form_ref.fd: new xforms
2986 implementation of an InsetRef dialog
2988 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2991 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2992 ios::nocreate is not part of the standard. Removed.
2994 2000-08-07 Baruch Even <baruch.even@writeme.com>
2996 * src/graphics/Renderer.h:
2997 * src/graphics/Renderer.C: Added base class for rendering of different
2998 image formats into Pixmaps.
3000 * src/graphics/XPM_Renderer.h:
3001 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3002 in a different class.
3004 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3005 easily add support for other formats.
3007 * src/insets/figinset.C: plugged a leak of an X resource.
3009 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3011 * src/CutAndPaste.[Ch]: make all metods static.
3013 * development/Code_rules/Rules: more work, added section on
3014 Exceptions, and a References section.
3016 * a lot of header files: work to make doc++ able to generate the
3017 source documentation, some workarounds of doc++ problems. Doc++ is
3018 now able to generate the documentation.
3020 2000-08-07 Juergen Vigna <jug@sad.it>
3022 * src/insets/insettabular.C (recomputeTextInsets): removed function
3024 * src/tabular.C (SetWidthOfMulticolCell):
3026 (calculate_width_of_column_NMC): fixed return value so that it really
3027 only returns true if the column-width has changed (there where
3028 problems with muliticolumn-cells in this column).
3030 2000-08-04 Juergen Vigna <jug@sad.it>
3032 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3033 also on the scrollstatus of the inset.
3034 (workAreaMotionNotify): ditto.
3036 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3038 2000-08-01 Juergen Vigna <jug@sad.it>
3040 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3042 * src/commandtags.h:
3043 * src/LyXAction.C (init):
3044 * src/insets/inset.C (LocalDispatch): added support for
3047 * src/insets/inset.C (scroll): new functions.
3049 * src/insets/insettext.C (removeNewlines): new function.
3050 (SetAutoBreakRows): removes forced newlines in the text of the
3051 paragraph if autoBreakRows is set to false.
3053 * src/tabular.C (Latex): generates a parbox around the cell contents
3056 * src/frontends/xforms/FormTabular.C (local_update): removed
3057 the radio_useparbox button.
3059 * src/tabular.C (UseParbox): new function
3061 2000-08-06 Baruch Even <baruch.even@writeme.com>
3063 * src/graphics/GraphicsCache.h:
3064 * src/graphics/GraphicsCache.C:
3065 * src/graphics/GraphicsCacheItem.h:
3066 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3069 * src/insets/insetgraphics.h:
3070 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3071 and the drawing of the inline image.
3073 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3074 loaded into the wrong position.
3076 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3079 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3081 * src/support/translator.h: move all typedefs to public section
3083 * src/support/filetools.C (MakeLatexName): return string const
3085 (TmpFileName): ditto
3086 (FileOpenSearch): ditto
3088 (LibFileSearch): ditto
3089 (i18nLibFileSearch): ditto
3092 (CreateTmpDir): ditto
3093 (CreateBufferTmpDir): ditto
3094 (CreateLyXTmpDir): ditto
3097 (MakeAbsPath): ditto
3099 (OnlyFilename): ditto
3101 (NormalizePath): ditto
3102 (CleanupPath): ditto
3103 (GetFileContents): ditto
3104 (ReplaceEnvironmentPath): ditto
3105 (MakeRelPath): ditto
3107 (ChangeExtension): ditto
3108 (MakeDisplayPath): ditto
3109 (do_popen): return cmdret const
3110 (findtexfile): return string const
3112 * src/support/DebugStream.h: add some /// to please doc++
3114 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3116 * src/texrow.C (same_rownumber): functor to use with find_if
3117 (getIdFromRow): rewritten to use find_if and to not update the
3118 positions. return true if row is found
3119 (increasePos): new method, use to update positions
3121 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3123 * src/lyxlex_pimpl.C (verifyTable): new method
3126 (GetString): return string const
3127 (pushTable): rewrite to use std::stack
3129 (setFile): better check
3132 * src/lyxlex.h: make LyXLex noncopyable
3134 * src/lyxlex.C (text): return char const * const
3135 (GetString): return string const
3136 (getLongString): return string const
3138 * src/lyx_gui_misc.C (askForText): return pair<...> const
3140 * src/lastfiles.[Ch] (operator): return string const
3142 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3143 istringstream not char const *.
3144 move token.end() out of loop.
3145 (readFile): move initializaton of token
3147 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3148 getIdFromRow is successful.
3150 * lib/bind/emacs.bind: don't include menus bind
3152 * development/Code_rules/Rules: the beginnings of making this
3153 better and covering more of the unwritten rules that we have.
3155 * development/Code_rules/Recommendations: a couple of wording
3158 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3160 * src/support/strerror.c: remove C++ comment.
3162 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3164 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3165 LFUN_INDEX_INSERT_LAST
3167 * src/texrow.C (getIdFromRow): changed from const_iterator to
3168 iterator, allowing code to compile with DEC cxx
3170 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3171 stores part of the class, as suggested by Allan. Will allow
3173 (apply): test to apply uses InsetCommandParams operator!=
3175 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3176 (apply): test to apply uses InsetCommandParams operator!=
3178 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3179 stores part of the class.
3180 (update): removed limits on min/max size.
3182 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3183 (apply): test to apply uses InsetCommandParams operator!=
3185 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3186 (Read, Write, scanCommand, getCommand): moved functionality
3187 into InsetCommandParams.
3189 (getScreenLabel): made pure virtual
3190 new InsetCommandParams operators== and !=
3192 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3193 c-tors based on InsetCommandParams. Removed others.
3194 * src/insets/insetinclude.[Ch]: ditto
3195 * src/insets/insetlabel.[Ch]: ditto
3196 * src/insets/insetparent.[Ch]: ditto
3197 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3199 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3200 insets derived from InsetCommand created using similar c-tors
3201 based on InsetCommandParams
3202 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3203 * src/menus.C (ShowRefsMenu): ditto
3204 * src/paragraph.C (Clone): ditto
3205 * src/text2.C (SetCounter): ditto
3206 * src/lyxfunc.C (Dispatch) ditto
3207 Also recreated old InsetIndex behaviour exactly. Can now
3208 index-insert at the start of a paragraph and index-insert-last
3209 without launching the pop-up.
3211 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3213 * lib/lyxrc.example: mark te pdf options as non functional.
3215 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3216 (isStrDbl): move tmpstr.end() out of loop.
3217 (strToDbl): move intialization of tmpstr
3218 (lowercase): return string const and move tmp.end() out of loop.
3219 (uppercase): return string const and move tmp.edn() out of loop.
3220 (prefixIs): add assertion
3225 (containsOnly): ditto
3226 (containsOnly): ditto
3227 (containsOnly): ditto
3228 (countChar): make last arg char not char const
3229 (token): return string const
3230 (subst): return string const, move tmp.end() out of loop.
3231 (subst): return string const, add assertion
3232 (strip): return string const
3233 (frontStrip): return string const, add assertion
3234 (frontStrip): return string const
3239 * src/support/lstrings.C: add inclde "LAssert.h"
3240 (isStrInt): move tmpstr.end() out of loop.
3242 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3243 toollist.end() out of loop.
3244 (deactivate): move toollist.end() out of loop.
3245 (update): move toollist.end() out of loop.
3246 (updateLayoutList): move tc.end() out of loop.
3247 (add): move toollist.end() out of loop.
3249 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3250 md.end() out of loop.
3252 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3254 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3257 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3258 (Erase): move insetlist.end() out of loop.
3260 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3261 ref to const string as first arg. Move initialization of some
3262 variables, whitespace changes.
3264 * src/kbmap.C (defkey): move table.end() out of loop.
3265 (kb_keymap): move table.end() out of loop.
3266 (findbinding): move table.end() out of loop.
3268 * src/MenuBackend.C (hasMenu): move end() out of loop.
3269 (getMenu): move end() out of loop.
3270 (getMenu): move menulist_.end() out of loop.
3272 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3274 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3277 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3278 (getFromLyXName): move infotab.end() out of loop.
3280 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3281 -fvtable-thunks -ffunction-sections -fdata-sections
3283 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3285 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3288 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3290 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3292 * src/frontends/xforms/FormCitation.[Ch],
3293 src/frontends/xforms/FormIndex.[Ch],
3294 src/frontends/xforms/FormToc.[Ch],
3295 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3297 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3299 * src/commandtags.h: renamed, created some flags for citation
3302 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3304 * src/lyxfunc.C (dispatch): use signals to insert index entry
3306 * src/frontends/Dialogs.h: new signal createIndex
3308 * src/frontends/xforms/FormCommand.[Ch],
3309 src/frontends/xforms/FormCitation.[Ch],
3310 src/frontends/xforms/FormToc.[Ch],
3311 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3313 * src/insets/insetindex.[Ch]: GUI-independent
3315 * src/frontends/xforms/FormIndex.[Ch],
3316 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3319 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3321 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3322 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3324 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3326 * src/insets/insetref.C (Latex): rewrite so that there is now
3327 question that a initialization is requested.
3329 * src/insets/insetcommand.h: reenable the hide signal
3331 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3333 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3334 fix handling of shortcuts (many bugs :)
3335 (add_lastfiles): ditto.
3337 * lib/ui/default.ui: fix a few shortcuts.
3339 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3341 * Makefile.am: Fix ``rpmdist'' target to return the exit
3342 status of the ``rpm'' command, instead of the last command in
3343 the chain (the ``rm lyx.xpm'' command, which always returns
3346 2000-08-02 Allan Rae <rae@lyx.org>
3348 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3349 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3350 * src/frontends/xforms/FormToc.C (FormToc): ditto
3352 * src/frontends/xforms/Makefile.am: A few forgotten files
3354 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3355 Signals-not-copyable-problem Lars' started commenting out.
3357 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3359 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3361 * src/insets/insetcommand.h: Signals is not copyable so anoter
3362 scheme for automatic hiding of forms must be used.
3364 * src/frontends/xforms/FormCitation.h: don't inerit from
3365 noncopyable, FormCommand already does that.
3366 * src/frontends/xforms/FormToc.h: ditto
3367 * src/frontends/xforms/FormUrl.h: ditto
3369 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3371 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3373 * src/insets/insetcommand.h (hide): new SigC::Signal0
3374 (d-tor) new virtual destructor emits hide signal
3376 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3377 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3379 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3380 LOF and LOT. Inset is now GUI-independent
3382 * src/insets/insetloa.[Ch]: redundant
3383 * src/insets/insetlof.[Ch]: ditto
3384 * src/insets/insetlot.[Ch]: ditto
3386 * src/frontends/xforms/forms/form_url.fd: tweaked!
3387 * src/frontends/xforms/forms/form_citation.fd: ditto
3389 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3390 dialogs dealing with InsetCommand insets
3392 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3393 FormCommand base class
3394 * src/frontends/xforms/FormUrl.[Ch]: ditto
3396 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3398 * src/frontends/xforms/FormToc.[Ch]: ditto
3400 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3401 passed a generic InsetCommand pointer
3402 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3404 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3405 and modified InsetTOC class
3406 * src/buffer.C: ditto
3408 * forms/lyx.fd: strip out old FD_form_toc code
3409 * src/lyx_gui_misc.C: ditto
3410 * src/lyx_gui.C: ditto
3411 * src/lyx_cb.C: ditto
3412 * src/lyx.[Ch]: ditto
3414 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3416 * src/support/utility.hpp: tr -d '\r'
3418 2000-08-01 Juergen Vigna <jug@sad.it>
3420 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3422 * src/commandtags.h:
3423 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3424 LFUN_TABULAR_FEATURES.
3426 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3427 LFUN_LAYOUT_TABULAR.
3429 * src/insets/insettabular.C (getStatus): implemented helper function.
3431 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3433 2000-07-31 Juergen Vigna <jug@sad.it>
3435 * src/text.C (draw): fixed screen update problem for text-insets.
3437 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3438 something changed probably this has to be added in various other
3441 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3443 2000-07-31 Baruch Even <baruch.even@writeme.com>
3445 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3446 templates to satisfy compaq cxx.
3449 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3451 * src/support/translator.h (equal_1st_in_pair::operator()): take
3452 const ref pair_type as arg.
3453 (equal_2nd_in_pair::operator()): ditto
3454 (Translator::~Translator): remove empty d-tor.
3456 * src/graphics/GraphicsCache.C: move include config.h to top, also
3457 put initialization of GraphicsCache::singleton here.
3458 (~GraphicsCache): move here
3459 (addFile): take const ref as arg
3462 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3464 * src/BufferView2.C (insertLyXFile): change te with/without header
3467 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3469 * src/frontends/xforms/FormGraphics.C (apply): add some
3470 static_cast. Not very nice, but required by compaq cxx.
3472 * src/frontends/xforms/RadioButtonGroup.h: include header
3473 <utility> instead of <pair.h>
3475 * src/insets/insetgraphicsParams.C: add using directive.
3476 (readResize): change return type to void.
3477 (readOrigin): ditto.
3479 * src/lyxfunc.C (getStatus): add missing break for build-program
3480 function; add test for Literate for export functions.
3482 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3483 entries in Options menu.
3485 2000-07-31 Baruch Even <baruch.even@writeme.com>
3487 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3488 protect against auto-allocation; release icon when needed.
3490 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3492 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3493 on usual typewriter.
3495 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3496 earlier czech.kmap), useful only for programming.
3498 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3500 * src/frontends/xforms/FormCitation.h: fix conditioning around
3503 2000-07-31 Juergen Vigna <jug@sad.it>
3505 * src/frontends/xforms/FormTabular.C (local_update): changed
3506 radio_linebreaks to radio_useparbox and added radio_useminipage.
3508 * src/tabular.C: made support for using minipages/parboxes.
3510 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3512 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3514 (descent): so the cursor is in the middle.
3515 (width): bit smaller box.
3517 * src/insets/insetgraphics.h: added display() function.
3519 2000-07-31 Baruch Even <baruch.even@writeme.com>
3521 * src/frontends/Dialogs.h: Added showGraphics signals.
3523 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3524 xforms form definition of the graphics dialog.
3526 * src/frontends/xforms/FormGraphics.h:
3527 * src/frontends/xforms/FormGraphics.C: Added files, the
3528 GUIndependent code of InsetGraphics
3530 * src/insets/insetgraphics.h:
3531 * src/insets/insetgraphics.C: Major writing to make it work.
3533 * src/insets/insetgraphicsParams.h:
3534 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3535 struct between InsetGraphics and GUI.
3537 * src/LaTeXFeatures.h:
3538 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3539 support for graphicx package.
3541 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3542 for the graphics inset.
3544 * src/support/translator.h: Added file, used in
3545 InsetGraphicsParams. this is a template to translate between two
3548 * src/frontends/xforms/RadioButtonGroup.h:
3549 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3550 way to easily control a radio button group.
3552 2000-07-28 Juergen Vigna <jug@sad.it>
3554 * src/insets/insettabular.C (LocalDispatch):
3555 (TabularFeatures): added support for lyx-functions of tabular features.
3556 (cellstart): refixed this function after someone wrongly changed it.
3558 * src/commandtags.h:
3559 * src/LyXAction.C (init): added support for tabular-features
3561 2000-07-28 Allan Rae <rae@lyx.org>
3563 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3564 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3565 triggers the callback for input checking. As a result we sometimes get
3566 "LyX: This shouldn't happen..." printed to cerr.
3567 (input): Started using status variable since I only free() on
3568 destruction. Some input checking for paths and font sizes.
3570 * src/frontends/xforms/FormPreferences.h: Use status to control
3571 activation of Ok and Apply
3573 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3574 callback. Also resized to stop segfaults with 0.88. The problem is
3575 that xforms-0.88 requires the folder to be wide enough to fit all the
3576 tabs. If it isn't it causes all sorts of problems.
3578 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3580 * src/frontends/xforms/forms/README: Reflect reality.
3582 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3583 * src/frontends/xforms/forms/makefile: ditto.
3585 * src/commandtags.h: Get access to new Preferences dialog
3586 * src/LyXAction.C: ditto
3587 * src/lyxfunc.C: ditto
3588 * lib/ui/default.ui: ditto
3590 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3592 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3594 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3597 * src/frontends/xforms/form_url.[Ch]: added.
3599 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3601 * src/insets/insetbib.h: fixed bug in previous commit
3603 * src/frontends/xforms/FormUrl.h: ditto
3605 * src/frontends/xforms/FormPrint.h: ditto
3607 * src/frontends/xforms/FormPreferences.h: ditto
3609 * src/frontends/xforms/FormCopyright.h: ditto
3611 * src/frontends/xforms/FormCitation.C: ditto
3613 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3614 private copyconstructor and private default contructor
3616 * src/support/Makefile.am: add utility.hpp
3618 * src/support/utility.hpp: new file from boost
3620 * src/insets/insetbib.h: set owner in clone
3622 * src/frontends/xforms/FormCitation.C: added missing include
3625 * src/insets/form_url.[Ch]: removed
3627 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3629 * development/lyx.spec.in
3630 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3631 file/directory re-organization.
3633 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3635 * src/insets/insetcommand.[Ch]: moved the string data and
3636 associated manipulation methods into a new stand-alone class
3637 InsetCommandParams. This class has two additional methods
3638 getAsString() and setFromString() allowing the contents to be
3639 moved around as a single string.
3640 (addContents) method removed.
3641 (setContents) method no longer virtual.
3643 * src/buffer.C (readInset): made use of new InsetCitation,
3644 InsetUrl constructors based on InsetCommandParams.
3646 * src/commandtags.h: add LFUN_INSERT_URL
3648 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3649 independent InsetUrl and use InsetCommandParams to extract
3650 string info and create new Insets.
3652 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3654 * src/frontends/xforms/FormCitation.C (apply): uses
3657 * src/frontends/xforms/form_url.C
3658 * src/frontends/xforms/form_url.h
3659 * src/frontends/xforms/FormUrl.h
3660 * src/frontends/xforms/FormUrl.C
3661 * src/frontends/xforms/forms/form_url.fd: new files
3663 * src/insets/insetcite.[Ch]: removed unused constructors.
3665 * src/insets/insetinclude.[Ch]: no longer store filename
3667 * src/insets/inseturl.[Ch]: GUI-independent.
3669 2000-07-26 Juergen Vigna <jug@sad.it>
3670 * renamed frontend from gtk to gnome as it is that what is realized
3671 and did the necessary changes in the files.
3673 2000-07-26 Marko Vendelin <markov@ioc.ee>
3675 * configure.in: cleaning up gnome configuration scripts
3677 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3679 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3680 shortcuts syndrom by redrawing them explicitely (a better solution
3681 would be appreciated).
3683 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3685 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3688 * src/lyx_cb.C (MenuExport): change html export to do the right
3689 thing depending of the document type (instead of having
3690 html-linuxdoc and html-docbook).
3691 * src/lyxfunc.C (getStatus): update for html
3692 * lib/ui/default.ui: simplify due to the above change.
3693 * src/menus.C (ShowFileMenu): update too (in case we need it).
3695 * src/MenuBackend.C (read): if a menu is defined twice, add the
3696 new entries to the exiting one.
3698 2000-07-26 Juergen Vigna <jug@sad.it>
3700 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3702 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3703 and return a bool if it did actual save the file.
3704 (AutoSave): don't autosave a unnamed doc.
3706 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3707 check if this is an UNNAMED new file and react to it.
3708 (newFile): set buffer to unnamed and change to not mark a new
3709 buffer dirty if I didn't do anything with it.
3711 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3713 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3715 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3716 friend as per Angus's patch posted to lyx-devel.
3718 * src/ext_l10n.h: updated
3720 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3721 gettext on the style string right before inserting them into the
3724 * autogen.sh: add code to extract style strings form layout files,
3725 not good enough yet.
3727 * src/frontends/gtk/.cvsignore: add MAKEFILE
3729 * src/MenuBackend.C (read): run the label strings through gettext
3730 before storing them in the containers.
3732 * src/ext_l10n.h: new file
3734 * autogen.sh : generate the ext_l10n.h file here
3736 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3738 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3741 * lib/ui/default.ui: fix a couple of typos.
3743 * config/gnome/gtk.m4: added (and added to the list of files in
3746 * src/insets/insetinclude.C (unique_id): fix when we are using
3747 lyxstring instead of basic_string<>.
3748 * src/insets/insettext.C (LocalDispatch): ditto.
3749 * src/support/filetools.C: ditto.
3751 * lib/configure.m4: create the ui/ directory if necessary.
3753 * src/LyXView.[Ch] (updateToolbar): new method.
3755 * src/BufferView_pimpl.C (buffer): update the toolbar when
3756 opening/closing buffer.
3758 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3760 * src/LyXAction.C (getActionName): enhance to return also the name
3761 and options of pseudo-actions.
3762 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3764 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3765 as an example of what is possible). Used in File->Build too (more
3766 useful) and in the import/export menus (to mimick the complicated
3767 handling of linuxdoc and friends). Try to update all the entries.
3769 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3772 * src/MenuBackend.C (read): Parse the new OptItem tag.
3774 * src/MenuBackend.h: Add a new optional_ data member (used if the
3775 entry should be omitted when the lyxfunc is disabled).
3777 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3778 function, used as a shortcut.
3779 (create_submenu): align correctly the shortcuts on the widest
3782 * src/MenuBackend.h: MenuItem.label() only returns the label of
3783 the menu without shortcut; new method shortcut().
3785 2000-07-14 Marko Vendelin <markov@ioc.ee>
3787 * src/frontends/gtk/Dialogs.C:
3788 * src/frontends/gtk/FormCopyright.C:
3789 * src/frontends/gtk/FormCopyright.h:
3790 * src/frontends/gtk/Makefile.am: added these source-files for the
3791 Gtk/Gnome support of the Copyright-Dialog.
3793 * src/main.C: added Gnome::Main initialization if using
3794 Gtk/Gnome frontend-GUI.
3796 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3798 * config/gnome/aclocal-include.m4
3799 * config/gnome/compiler-flags.m4
3800 * config/gnome/curses.m4
3801 * config/gnome/gnome--.m4
3802 * config/gnome/gnome-bonobo-check.m4
3803 * config/gnome/gnome-common.m4
3804 * config/gnome/gnome-fileutils.m4
3805 * config/gnome/gnome-ghttp-check.m4
3806 * config/gnome/gnome-gnorba-check.m4
3807 * config/gnome/gnome-guile-checks.m4
3808 * config/gnome/gnome-libgtop-check.m4
3809 * config/gnome/gnome-objc-checks.m4
3810 * config/gnome/gnome-orbit-check.m4
3811 * config/gnome/gnome-print-check.m4
3812 * config/gnome/gnome-pthread-check.m4
3813 * config/gnome/gnome-support.m4
3814 * config/gnome/gnome-undelfs.m4
3815 * config/gnome/gnome-vfs.m4
3816 * config/gnome/gnome-x-checks.m4
3817 * config/gnome/gnome-xml-check.m4
3818 * config/gnome/gnome.m4
3819 * config/gnome/gperf-check.m4
3820 * config/gnome/gtk--.m4
3821 * config/gnome/linger.m4
3822 * config/gnome/need-declaration.m4: added configuration scripts
3823 for Gtk/Gnome frontend-GUI
3825 * configure.in: added support for the --with-frontend=gtk option
3827 * autogen.sh: added config/gnome/* to list of config-files
3829 * acconfig.h: added define for GTKGUI-support
3831 * config/lyxinclude.m4: added --with-frontend[=value] option value
3832 for Gtk/Gnome frontend-GUI support.
3834 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3836 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3840 * src/paragraph.C (GetChar): remove non-const version
3842 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3843 (search_kw): use it.
3845 * src/lyx_main.C (init): if "preferences" exist, read that instead
3847 (ReadRcFile): return bool if the file could be read ok.
3848 (ReadUIFile): add a check to see if lex file is set ok.
3850 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3851 bastring can be used instead of lyxstring (still uses the old code
3852 if std::string is good enough or if lyxstring is used.)
3854 * src/encoding.C: make the arrays static, move ininle functions
3856 * src/encoding.h: from here.
3858 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3859 (parseSingleLyXformat2Token): move inset parsing to separate method
3860 (readInset): new private method
3862 * src/Variables.h: remove virtual from get().
3864 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3865 access to NEW_INSETS and NEW_TABULAR
3867 * src/MenuBackend.h: remove superfluous forward declaration of
3868 MenuItem. Add documentations tags "///", remove empty MenuItem
3869 destructor, remove private default contructor.
3871 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3873 (read): more string mlabel and mname to where they are used
3874 (read): remove unused variables mlabel and mname
3875 (defaults): unconditional clear, make menusetup take advantage of
3876 add returning Menu &.
3878 * src/LyXView.h: define NEW_MENUBAR as default
3880 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3881 to NEW_INSETS and NEW_TABULAR.
3882 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3883 defined. Change some of the "xxxx-inset-insert" functions names to
3886 * several files: more enahncements to NEW_INSETS and the resulting
3889 * lib/lyxrc.example (\date_insert_format): move to misc section
3891 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3892 bastring and use AC_CACHE_CHECK.
3893 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3894 the system have the newest methods. uses AC_CACHE_CHECK
3895 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3896 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3897 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3899 * configure.in: add LYX_CXX_GOOD_STD_STRING
3901 * acinclude.m4: recreated
3903 2000-07-24 Amir Karger <karger@lyx.org>
3905 * README: add Hebrew, Arabic kmaps
3908 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3910 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3913 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3915 * Lot of files: add pragma interface/implementation.
3917 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3919 * lib/ui/default.ui: new file (ans new directory). Contains the
3920 default menu and toolbar.
3922 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3923 global space. Toolbars are now read (as menus) in ui files.
3925 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3927 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3928 is disabled because the document is read-only. We want to have the
3929 toggle state of the function anyway.
3930 (getStatus): add code for LFUN_VC* functions (mimicking what is
3931 done in old-style menus)
3933 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3934 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3936 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3937 * src/BufferView_pimpl.C: ditto.
3938 * src/lyxfunc.C: ditto.
3940 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3941 default). This replaces old-style menus by new ones.
3943 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3944 MenuItem. Contain the data structure of a menu.
3946 * src/insets/insettext.C: use LyXView::setLayout instead of
3947 accessing directly the toolbar combox.
3948 * src/lyxfunc.C (Dispatch): ditto.
3950 * src/LyXView.C (setLayout): new method, which just calls
3951 Toolbar::setLayout().
3952 (updateLayoutChoice): move part of this method in Toolbar.
3954 * src/toolbar.[Ch]: removed.
3956 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3957 implementation the toolbar.
3959 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3960 the toolbar. It might make sense to merge it with ToolbarDefaults
3962 (setLayout): new function.
3963 (updateLayoutList): ditto.
3964 (openLayoutList): ditto.
3966 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3967 xforms implementation of the toolbar.
3968 (get_toolbar_func): comment out, since I do not
3969 know what it is good for.
3971 * src/ToolbarDefaults.h: Add the ItemType enum.
3973 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3974 for a list of allocated C strings. Used in Menubar xforms
3975 implementation to avoid memory leaks.
3977 * src/support/lstrings.[Ch] (uppercase): new version taking and
3981 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3982 * lib/bind/emacs.bind: ditto.
3984 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3986 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3987 forward decl of LyXView.
3989 * src/toolbar.C (toolbarItem): moved from toolbar.h
3990 (toolbarItem::clean): ditto
3991 (toolbarItem::~toolbarItem): ditto
3992 (toolbarItem::operator): ditto
3994 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3996 * src/paragraph.h: control the NEW_TABULAR define from here
3998 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3999 USE_TABULAR_INSETS to NEW_TABULAR
4001 * src/ToolbarDefaults.C: add include "lyxlex.h"
4003 * files using the old table/tabular: use NEW_TABULAR to control
4004 compilation of old tabular stuff.
4006 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4009 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4010 planemet in reading of old style floats, fix the \end_deeper
4011 problem when reading old style floats.
4013 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4015 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4017 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4019 * lib/bind/sciword.bind: updated.
4021 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4023 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4024 layout write problem
4026 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4028 * src/Makefile.am (INCLUDES): remove image directory from include
4031 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4032 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4034 * src/LyXView.C (create_form_form_main): read the application icon
4037 * lib/images/*.xpm: change the icons to use transparent color for
4040 * src/toolbar.C (update): change the color of the button when it
4043 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4045 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4046 setting explicitely the minibuffer.
4047 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4049 * src/LyXView.C (showState): new function. Shows font information
4050 in minibuffer and update toolbar state.
4051 (LyXView): call Toolbar::update after creating the
4054 * src/toolbar.C: change toollist to be a vector instead of a
4056 (BubbleTimerCB): get help string directly from the callback
4057 argument of the corresponding icon (which is the action)
4058 (set): remove unnecessary ugliness.
4059 (update): new function. update the icons (depressed, disabled)
4060 depending of the status of the corresponding action.
4062 * src/toolbar.h: remove help in toolbarItem
4064 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4066 * src/Painter.C (text): Added code for using symbol glyphs from
4067 iso10646 fonts. Currently diabled.
4069 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4072 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4073 magyar,turkish and usorbian.
4075 * src/paragraph.C (isMultiLingual): Made more efficient.
4077 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4080 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4081 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4082 Also changed the prototype to "bool math_insert_greek(char)".
4084 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4086 * lots of files: apply the NEW_INSETS on all code that will not be
4087 needed when we move to use the new insets. Enable the define in
4088 lyxparagrah.h to try it.
4090 * src/insets/insettabular.C (cellstart): change to be a static
4092 (InsetTabular): initialize buffer in the initializer list.
4094 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4096 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4097 form_print.h out of the header file. Replaced with forward
4098 declarations of the relevant struct.
4100 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4103 * src/commandtags.h: do not include "debug.h" which does not
4104 belong there. #include it in some other places because of this
4107 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4109 * src/insets/insetcaption.C: add a couple "using" directives.
4111 * src/toolbar.C (add): get the help text directly from lyxaction.
4113 (setPixmap): new function. Loads from disk and sets a pixmap on a
4114 botton; the name of the pixmap file is derived from the command
4117 * src/toolbar.h: remove members isBitmap and pixmap from
4120 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4121 * lib/images/: move many files from images/banner.xpm.
4123 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4125 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4126 * src/toolbar.C: ditto.
4127 * configure.in: ditto.
4128 * INSTALL: document.
4130 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4131 the spellchecker popup is closed from the WM.
4133 2000-07-19 Juergen Vigna <jug@sad.it>
4135 * src/insets/insetfloat.C (Write): small fix because we use the
4136 insetname for the type now!
4138 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4140 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4143 * src/frontends/Dialogs.h: removed hideCitation signal
4145 * src/insets/insetcite.h: added hide signal
4147 * src/insets/insetcite.C (~InsetCitation): emits new signal
4148 (getScreenLabel): "intelligent" label should now fit on the screen!
4150 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4152 * src/frontends/xforms/FormCitation.C (showInset): connects
4153 hide() to the inset's hide signal
4154 (show): modified to use fl_set_object_position rather than
4155 fl_set_object_geometry wherever possible
4157 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4159 * src/insets/lyxinset.h: add caption code
4161 * src/insets/insetfloat.C (type): new method
4163 * src/insets/insetcaption.C (Write): new method
4165 (LyxCode): new method
4167 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4168 to get it right together with using the FloatList.
4170 * src/commandtags.h: add LFUN_INSET_CAPTION
4171 * src/lyxfunc.C (Dispatch): handle it
4173 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4176 * src/Variables.[Ch]: make expand take a const reference, remove
4177 the destructor, some whitespace changes.
4179 * src/LyXAction.C (init): add caption-inset-insert
4181 * src/FloatList.C (FloatList): update the default floats a bit.
4183 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4185 * src/Variables.[Ch]: new files. Intended to be used for language
4186 specific strings (like \chaptername) and filename substitution in
4189 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4191 * lib/kbd/american.kmap: update
4193 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4195 * src/bufferparams.[Ch]: remove member allowAccents.
4197 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4199 * src/LaTeXLog.C: use the log_form.h header.
4200 * src/lyx_gui.C: ditto.
4201 * src/lyx_gui_misc.C: ditto.
4202 * src/lyxvc.h: ditto.
4204 * forms/log_form.fd: new file, created from latexoptions.fd. I
4205 kept the log popup and nuked the options form.
4207 * src/{la,}texoptions.[Ch]: removed.
4208 * src/lyx_cb.C (LaTeXOptions): ditto
4210 * src/lyx_gui.C (create_forms): do not handle the
4211 fd_latex_options form.
4213 2000-07-18 Juergen Vigna <jug@sad.it>
4215 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4216 name of the inset so that it can be requested outside (text2.C).
4218 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4221 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4223 * src/mathed/formula.h (ConvertFont): constify
4225 * src/mathed/formula.C (Read): add warning if \end_inset is not
4226 found on expected place.
4228 * src/insets/lyxinset.h (ConvertFont): consify
4230 * src/insets/insetquotes.C (ConvertFont): constify
4231 * src/insets/insetquotes.h: ditto
4233 * src/insets/insetinfo.h: add labelfont
4235 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4236 (ascent): use labelfont
4240 (Write): make .lyx file a bit nicer
4242 * src/insets/insetfloat.C (Write): simplify somewhat...
4243 (Read): add warning if arg is not found
4245 * src/insets/insetcollapsable.C: add using std::max
4246 (Read): move string token and add warning in arg is not found
4247 (draw): use std::max to get the right ty
4248 (getMaxWidth): simplify by using std::max
4250 * src/insets/insetsection.h: new file
4251 * src/insets/insetsection.C: new file
4252 * src/insets/insetcaption.h: new file
4253 * src/insets/insetcaption.C: new file
4255 * src/insets/inset.C (ConvertFont): constify signature
4257 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4258 insetcaption.[Ch] and insetsection.[Ch]
4260 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4261 uses to use LABEL_COUNTER_CHAPTER instead.
4262 * src/text2.C (SetCounter): here
4264 * src/counters.h: new file
4265 * src/counters.C: new file
4266 * src/Sectioning.h: new file
4267 * src/Sectioning.C: new file
4269 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4271 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4273 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4276 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4279 2000-07-17 Juergen Vigna <jug@sad.it>
4281 * src/tabular.C (Validate): check if array-package is needed.
4282 (SetVAlignment): added support for vertical alignment.
4283 (SetLTFoot): better support for longtable header/footers
4284 (Latex): modified to support added features.
4286 * src/LaTeXFeatures.[Ch]: added array-package.
4288 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4290 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4293 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4295 * configure.in: do not forget to put a space after -isystem.
4297 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4299 * lib/kbd/arabic.kmap: a few fixes.
4301 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4303 * some whitespace chagnes to a number of files.
4305 * src/support/DebugStream.h: change to make it easier for
4306 doc++ to parse correctly.
4307 * src/support/lyxstring.h: ditto
4309 * src/mathed/math_utils.C (compara): change to have only one
4311 (MathedLookupBOP): change because of the above.
4313 * src/mathed/math_delim.C (math_deco_compare): change to have only
4315 (search_deco): change becasue of the above.
4317 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4318 instead of manually coded one.
4320 * src/insets/insetquotes.C (Read): read the \end_inset too
4322 * src/insets/insetlatex.h: remove file
4323 * src/insets/insetlatex.C: remove file
4325 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4327 (InsetPrintIndex): remove destructor
4329 * src/insets/insetinclude.h: remove default constructor
4331 * src/insets/insetfloat.C: work to make it work better
4333 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4335 * src/insets/insetcite.h (InsetCitation): remove default constructor
4337 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4339 * src/text.C (GetColumnNearX): comment out some currently unused code.
4341 * src/paragraph.C (writeFile): move some initializations closer to
4343 (CutIntoMinibuffer): small change to use new matchIT operator
4347 (InsertInset): ditto
4350 (InsetIterator): ditto
4351 (Erase): small change to use new matchFT operator
4353 (GetFontSettings): ditto
4354 (HighestFontInRange): ditto
4357 * src/lyxparagraph.h: some chars changed to value_type
4358 (matchIT): because of some stronger checking (perhaps too strong)
4359 in SGI STL, the two operator() unified to one.
4362 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4364 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4365 the last inset read added
4366 (parseSingleLyXformat2Token): some more (future) compability code added
4367 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4368 (parseSingleLyXformat2Token): set last_inset_read
4369 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4370 (parseSingleLyXformat2Token): don't double intializw string next_token
4372 * src/TextCache.C (text_fits::operator()): add const's to the signature
4373 (has_buffer::operator()): ditto
4375 * src/Floating.h: add some comments on the class
4377 * src/FloatList.[Ch] (typeExist): new method
4380 * src/BackStack.h: added default constructor, wanted by Gcc.
4382 2000-07-14 Juergen Vigna <jug@sad.it>
4384 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4386 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4388 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4389 do a redraw when the window is resized!
4390 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4392 * src/insets/insettext.C (resizeLyXText): added function to correctly
4393 being able to resize the LyXWindow.
4395 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4397 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4399 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4400 crashes when closing dialog to a deleted inset.
4402 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4403 method! Now similar to other insets.
4405 2000-07-13 Juergen Vigna <jug@sad.it>
4407 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4409 * lib/examples/Literate.lyx: small patch!
4411 * src/insets/insetbib.C (Read): added this function because of wrong
4412 Write (without [begin|end]_inset).
4414 2000-07-11 Juergen Vigna <jug@sad.it>
4416 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4417 as the insertInset could not be good!
4419 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4420 the bool param should not be last.
4422 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4424 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4425 did submit that to Karl).
4427 * configure.in: use -isystem instead of -I for X headers. This
4428 fixes a problem on solaris with a recent gcc;
4429 put the front-end code after the X detection code;
4430 configure in sigc++ before lib/
4432 * src/lyx_main.C (commandLineHelp): remove -display from command
4435 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4437 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4438 Also put in Makefile rules for building the ``listerrors''
4439 program for parsing errors from literate programs written in LyX.
4441 * lib/build-listerrors: Added small shell script as part of compile
4442 process. This builds a working ``listerrors'' binary if noweb is
4443 installed and either 1) the VNC X server is installed on the machine,
4444 or 2) the user is compiling from within a GUI. The existence of a GUI
4445 is necessary to use the ``lyx --export'' feature for now. This
4446 hack can be removed once ``lyx --export'' no longer requires a GUI to
4449 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4451 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4452 now passed back correctly from gcc and placed "under" error
4453 buttons in a Literate LyX source.
4455 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4457 * src/text.C (GetColumnNearX): Better behavior when a RTL
4458 paragraph is ended by LTR text.
4460 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4463 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4465 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4466 true when clipboard is empty.
4468 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4470 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4471 row of the paragraph.
4472 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4473 to prevent calculation of bidi tables
4475 2000-07-07 Juergen Vigna <jug@sad.it>
4477 * src/screen.C (ToggleSelection): added y_offset and x_offset
4480 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4483 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4485 * src/insets/insettext.C: fixed Layout-Display!
4487 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * configure.in: add check for strings.h header.
4491 * src/spellchecker.C: include <strings.h> in order to have a
4492 definition for bzero().
4494 2000-07-07 Juergen Vigna <jug@sad.it>
4496 * src/insets/insettext.C (draw): set the status of the bv->text to
4497 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4499 * src/screen.C (DrawOneRow):
4500 (DrawFromTo): redraw the actual row if something has changed in it
4503 * src/text.C (draw): call an update of the toplevel-inset if something
4504 has changed inside while drawing.
4506 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4508 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4510 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4511 processing inside class.
4513 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4514 processing inside class.
4516 * src/insets/insetindex.h new struct Holder, consistent with other
4519 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4520 citation dialog from main code and placed it in src/frontends/xforms.
4521 Dialog launched through signals instead of callbacks
4523 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4525 * lyx.man: update the options description.
4527 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4529 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4530 handle neg values, set min width to 590, add doc about -display
4532 2000-07-05 Juergen Vigna <jug@sad.it>
4534 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4535 calls to BufferView *.
4537 * src/insets/insettext.C (checkAndActivateInset): small fix non
4538 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4540 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4541 their \end_inset token!
4543 2000-07-04 edscott <edscott@imp.mx>
4545 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4546 lib/lyxrc.example: added option \wheel_jump
4548 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4550 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4551 remove support for -width,-height,-xpos and -ypos.
4553 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4555 * src/encoding.[Ch]: New files.
4557 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4558 (text): Call to the underline() method only when needed.
4560 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4562 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4563 encoding(s) for the document.
4565 * src/bufferparams.C (BufferParams): Changed default value of
4568 * src/language.C (newLang): Removed.
4569 (items[]): Added encoding information for all defined languages.
4571 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4572 encoding choice button.
4574 * src/lyxrc.h (font_norm_type): New member variable.
4575 (set_font_norm_type): New method.
4577 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4578 paragraphs with different encodings.
4580 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4581 (TransformChar): Changed to work correctly with Arabic points.
4582 (draw): Added support for drawing Arabic points.
4583 (draw): Removed code for drawing underbars (this is done by
4586 * src/support/textutils.h (IsPrintableNonspace): New function.
4588 * src/BufferView_pimpl.h: Added "using SigC::Object".
4589 * src/LyXView.h: ditto.
4591 * src/insets/insetinclude.h (include_label): Changed to mutable.
4593 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4595 * src/mathed/math_iter.h: remove empty destructor
4597 * src/mathed/math_cursor.h: remove empty destructor
4599 * src/insets/lyxinset.h: add THEOREM_CODE
4601 * src/insets/insettheorem.[Ch]: new files
4603 * src/insets/insetminipage.C: (InsertInset): remove
4605 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4607 (InsertInset): remove
4609 * src/insets/insetlist.C: (InsertList): remove
4611 * src/insets/insetfootlike.[Ch]: new files
4613 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4616 (InsertInset): ditto
4618 * src/insets/insetert.C: remove include Painter.h, reindent
4619 (InsertInset): move to header
4621 * src/insets/insetcollapsable.h: remove explicit from default
4622 contructor, remove empty destructor, add InsertInset
4624 * src/insets/insetcollapsable.C (InsertInset): new func
4626 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4628 * src/vspace.h: add explicit to constructor
4630 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4631 \textcompwordmark, please test this.
4633 * src/lyxrc.C: set ascii_linelen to 65 by default
4635 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4637 * src/commandtags.h: add LFUN_INSET_THEOREM
4639 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4640 (makeLinuxDocFile): remove _some_ of the nice logic
4641 (makeDocBookFile): ditto
4643 * src/Painter.[Ch]: (~Painter): removed
4645 * src/LyXAction.C (init): entry for insettheorem added
4647 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4649 (deplog): code to detect files generated by LaTeX, needs testing
4652 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4654 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4656 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4658 * src/LaTeX.C (deplog): Add a check for files that are going to be
4659 created by the first latex run, part of the project to remove the
4662 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4663 contents to the extension list.
4665 2000-07-04 Juergen Vigna <jug@sad.it>
4667 * src/text.C (NextBreakPoint): added support for needFullRow()
4669 * src/insets/lyxinset.h: added needFullRow()
4671 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4674 * src/insets/insettext.C: lots of changes for update!
4676 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4678 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4680 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4682 * src/insets/insetinclude.C (InsetInclude): fixed
4683 initialization of include_label.
4684 (unique_id): now returns a string.
4686 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4688 * src/LaTeXFeatures.h: new member IncludedFiles, for
4689 a map of key, included file name.
4691 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4692 with the included files for inclusion in SGML preamble,
4693 i. e., linuxdoc and docbook.
4696 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4697 nice (is the generated linuxdoc code to be exported?), that
4698 allows to remove column, and only_body that will be true for
4699 slave documents. Insets are allowed inside SGML font type.
4700 New handling of the SGML preamble for included files.
4701 (makeDocBookFile): the same for docbook.
4703 * src/insets/insetinclude.h:
4704 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4706 (DocBook): new export methods.
4708 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4709 and makeDocBookFile.
4711 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4712 formats to export with command line argument -x.
4714 2000-06-29 Juergen Vigna <jug@sad.it>
4716 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4717 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4719 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4720 region could already been cleared by an inset!
4722 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4724 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4727 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4729 (cursorToggle): remove special handling of lyx focus.
4731 2000-06-28 Juergen Vigna <jug@sad.it>
4733 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4736 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4738 * src/insets/insetindex.C (Edit): add a callback when popup is
4741 * src/insets/insettext.C (LocalDispatch):
4742 * src/insets/insetmarginal.h:
4743 * src/insets/insetlist.h:
4744 * src/insets/insetfoot.h:
4745 * src/insets/insetfloat.h:
4746 * src/insets/insetert.h: add a missing std:: qualifier.
4748 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4750 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4753 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4755 * src/insets/insettext.C (Read): remove tmptok unused variable
4756 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4757 (InsertInset): change for new InsetInset code
4759 * src/insets/insettext.h: add TEXT inline method
4761 * src/insets/insettext.C: remove TEXT macro
4763 * src/insets/insetmarginal.C (Write): new method
4764 (Latex): change output slightly
4766 * src/insets/insetfoot.C (Write): new method
4767 (Latex): change output slightly (don't use endl when no need)
4769 * src/insets/insetert.C (Write): new method
4771 * src/insets/insetcollapsable.h: make button_length, button_top_y
4772 and button_bottm_y protected.
4774 * src/insets/insetcollapsable.C (Write): simplify code by using
4775 tostr. Also do not output the float name, the children class
4776 should to that to get control over own arguments
4778 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4779 src/insets/insetminipage.[Ch]:
4782 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4784 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4786 * src/Makefile.am (lyx_SOURCES): add the new files
4788 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4789 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4790 * src/commandtags.h: ditto
4792 * src/LaTeXFeatures.h: add a std::set of used floattypes
4794 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4796 * src/FloatList.[Ch] src/Floating.h: new files
4798 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4800 * src/lyx_cb.C (TableApplyCB): ditto
4802 * src/text2.C: ditto
4803 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4804 (parseSingleLyXformat2Token): ditto + add code for
4805 backwards compability for old float styles + add code for new insets
4807 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4809 (InsertInset(size_type, Inset *, LyXFont)): new method
4810 (InsetChar(size_type, char)): changed to use the other InsetChar
4811 with a LyXFont(ALL_INHERIT).
4812 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4813 insert the META_INSET.
4815 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4817 * sigc++/thread.h (Threads): from here
4819 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4820 definition out of line
4821 * sigc++/scope.h: from here
4823 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4825 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4826 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4828 * Makefile.am (bindist): new target.
4830 * INSTALL: add instructions for doing a binary distribution.
4832 * development/tools/README.bin.example: update a bit.
4834 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4837 * lib/lyxrc.example: new lyxrc tag \set_color.
4839 * src/lyxfunc.C (Dispatch):
4840 * src/commandtags.h:
4841 * src/LyXAction.C: new lyxfunc "set-color".
4843 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4844 and an x11name given as strings.
4846 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4847 cache when a color is changed.
4849 2000-06-26 Juergen Vigna <jug@sad.it>
4851 * src/lyxrow.C (width): added this functions and variable.
4853 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4856 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4858 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4860 * images/undo_bw.xpm: new icon.
4861 * images/redo_bw.xpm: ditto.
4863 * configure.in (INSTALL_SCRIPT): change value to
4864 ${INSTALL} to avoid failures of install-script target.
4865 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4867 * src/BufferView.h: add a magic "friend" declaration to please
4870 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4872 * forms/cite.fd: modified to allow resizing without messing
4875 * src/insetcite.C: Uses code from cite.fd almost without
4877 User can now resize dialog in the x-direction.
4878 Resizing the dialog in the y-direction is prevented, as the
4879 code does this intelligently already.
4881 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4883 * INSTALL: remove obsolete entry in "problems" section.
4885 * lib/examples/sl_*.lyx: update of the slovenian examples.
4887 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4889 2000-06-23 Juergen Vigna <jug@sad.it>
4891 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4893 * src/buffer.C (resize): delete the LyXText of textinsets.
4895 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4897 * src/insets/lyxinset.h: added another parameter 'cleared' to
4898 the draw() function.
4900 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4901 unlocking inset in inset.
4903 2000-06-22 Juergen Vigna <jug@sad.it>
4905 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4906 of insets and moved first to LyXText.
4908 * src/mathed/formulamacro.[Ch]:
4909 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4911 2000-06-21 Juergen Vigna <jug@sad.it>
4913 * src/text.C (GetVisibleRow): look if I should clear the area or not
4914 using Inset::doClearArea() function.
4916 * src/insets/lyxinset.h: added doClearArea() function and
4917 modified draw(Painter &, ...) to draw(BufferView *, ...)
4919 * src/text2.C (UpdateInset): return bool insted of int
4921 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4923 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4924 combox in the character popup
4926 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4927 BufferParams const & params
4929 2000-06-20 Juergen Vigna <jug@sad.it>
4931 * src/insets/insettext.C (SetParagraphData): set insetowner on
4934 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4936 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4937 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4939 (form_main_): remove
4941 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4942 (create_form_form_main): remove FD_form_main stuff, connect to
4943 autosave_timeout signal
4945 * src/LyXView.[Ch] (getMainForm): remove
4946 (UpdateTimerCB): remove
4947 * src/BufferView_pimpl.h: inherit from SigC::Object
4949 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4950 signal instead of callback
4952 * src/BufferView.[Ch] (cursorToggleCB): remove
4954 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4956 * src/BufferView_pimpl.C: changes because of the one below
4958 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4959 instead of storing a pointer to a LyXText.
4961 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4963 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4965 * src/lyxparagraph.h
4967 * src/paragraph.C: Changed fontlist to a sorted vector.
4969 2000-06-19 Juergen Vigna <jug@sad.it>
4971 * src/BufferView.h: added screen() function.
4973 * src/insets/insettext.C (LocalDispatch): some selection code
4976 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4978 * src/insets/insettext.C (SetParagraphData):
4980 (InsetText): fixes for multiple paragraphs.
4982 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4984 * development/lyx.spec.in: Call configure with ``--without-warnings''
4985 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4986 This should be fine, however, since we generally don't want to be
4987 verbose when making an RPM.
4989 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4991 * lib/scripts/fig2pstex.py: New file
4993 2000-06-16 Juergen Vigna <jug@sad.it>
4995 * src/insets/insettabular.C (UpdateLocal):
4996 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4997 (LocalDispatch): Changed all functions to use LyXText.
4999 2000-06-15 Juergen Vigna <jug@sad.it>
5001 * src/text.C (SetHeightOfRow): call inset::update before requesting
5004 * src/insets/insettext.C (update):
5005 * src/insets/insettabular.C (update): added implementation
5007 * src/insets/lyxinset.h: added update function
5009 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5011 * src/text.C (SelectNextWord): protect against null pointers with
5012 old-style string streams. (fix from Paul Theo Gonciari
5015 * src/cite.[Ch]: remove erroneous files.
5017 * lib/configure.m4: update the list of created directories.
5019 * src/lyxrow.C: include <config.h>
5020 * src/lyxcursor.C: ditto.
5022 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5024 * lib/examples/decimal.lyx: new example file from Mike.
5026 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5027 to find template definitions (from Dekel)
5029 * src/frontends/.cvsignore: add a few things.
5031 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5033 * src/Timeout.C (TimeOut): remove default argument.
5035 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5038 * src/insets/ExternalTemplate.C: add a "using" directive.
5040 * src/lyx_main.h: remove the act_ struct, which seems unused
5043 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5045 * LyX Developers Meeting: All files changed, due to random C++ (by
5046 coincidence) code generator script.
5048 - external inset (cool!)
5049 - initial online editing of preferences
5050 - insettabular breaks insettext(s contents)
5052 - some DocBook fixes
5053 - example files update
5054 - other cool stuff, create a diff and look for yourself.
5056 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5058 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5059 -1 this is a non-line-breaking textinset.
5061 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5062 if there is no width set.
5064 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5066 * Lots of files: Merged the dialogbase branch.
5068 2000-06-09 Allan Rae <rae@lyx.org>
5070 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5071 and the Dispatch methods that used it.
5073 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5074 access to functions formerly kept in Dispatch.
5076 2000-05-19 Allan Rae <rae@lyx.org>
5078 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5079 made to_page and count_copies integers again. from_page remains a
5080 string however because I want to allow entry of a print range like
5081 "1,4,22-25" using this field.
5083 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5084 and printer-params-get. These aren't useful from the minibuffer but
5085 could be used by a script/LyXServer app provided it passes a suitable
5086 auto_mem_buffer. I guess I should take a look at how the LyXServer
5087 works and make it support xtl buffers.
5089 * sigc++/: updated to libsigc++-1.0.1
5091 * src/xtl/: updated to xtl-1.3.pl.11
5093 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5094 those changes done to the files in src/ are actually recreated when
5095 they get regenerated. Please don't ever accept a patch that changes a
5096 dialog unless that patch includes the changes to the corresponding *.fd
5099 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5100 stringOnlyContains, renamed it and generalised it.
5102 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5103 branch. Removed the remaining old form_print code.
5105 2000-04-26 Allan Rae <rae@lyx.org>
5107 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5108 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5110 2000-04-25 Allan Rae <rae@lyx.org>
5112 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5113 against a base of xtl-1.3.pl.4
5115 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5116 filter the Id: entries so they still show the xtl version number
5119 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5120 into the src/xtl code. Patch still pending with José (XTL)
5122 2000-04-24 Allan Rae <rae@lyx.org>
5124 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5125 both more generic and much safer. Use the new template functions.
5126 * src/buffer.[Ch] (Dispatch): ditto.
5128 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5129 and mem buffer more intelligently. Also a little general cleanup.
5132 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5133 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5134 * src/xtl/Makefile.am: ditto.
5135 * src/xtl/.cvsignore: ditto.
5136 * src/Makefile.am: ditto.
5138 * src/PrinterParams.h: Removed the macros member functions. Added a
5139 testInvariant member function. A bit of tidying up and commenting.
5140 Included Angus's idea for fixing operation with egcs-1.1.2.
5142 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5143 cool expansion of XTL's mem_buffer to support automatic memory
5144 management within the buffer itself. Removed the various macros and
5145 replaced them with template functions that use either auto_mem_buffer
5146 or mem_buffer depending on a #define. The mem_buffer support will
5147 disappear as soon as the auto_mem_buffer is confirmed to be good on
5148 other platforms/compilers. That is, it's there so you've got something
5151 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5152 effectively forked XTL. However I expect José will include my code
5153 into the next major release. Also fixed a memory leak.
5154 * src/xtl/text.h: ditto.
5155 * src/xtl/xdr.h: ditto.
5156 * src/xtl/giop.h: ditto.
5158 2000-04-16 Allan Rae <rae@lyx.org>
5160 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5161 by autogen.sh and removed by maintainer-clean anyway.
5162 * .cvsignore, sigc++/.cvsignore: Support the above.
5164 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5166 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5168 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5169 macros, renamed static callback-target member functions to suit new
5170 scheme and made them public.
5171 * src/frontends/xforms/forms/form_print.fd: ditto.
5172 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5174 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5177 * src/xtl/: New directory containing a minimal distribution of XTL.
5178 This is XTL-1.3.pl.4.
5180 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5182 2000-04-15 Allan Rae <rae@lyx.org>
5184 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5186 * sigc++/: Updated to libsigc++-1.0.0
5188 2000-04-14 Allan Rae <rae@lyx.org>
5190 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5191 use the generic ones in future. I'll modify my conversion script.
5193 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5195 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5196 (CloseAllBufferRelatedDialogs): Renamed.
5197 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5199 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5200 of the generic ones. These are the same ones my conversion script
5203 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5204 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5205 * src/buffer.C (Dispatch): ditto
5207 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5208 functions for updating and hiding buffer dependent dialogs.
5209 * src/BufferView.C (buffer): ditto
5210 * src/buffer.C (setReadonly): ditto
5211 * src/lyxfunc.C (CloseBuffer): ditto
5213 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5214 Dialogs.h, and hence all the SigC stuff, into every file that includes
5215 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5217 * src/BufferView2.C: reduce the number of headers included by buffer.h
5219 2000-04-11 Allan Rae <rae@lyx.org>
5221 * src/frontends/xforms/xform_macros.h: A small collection of macros
5222 for building C callbacks.
5224 * src/frontends/xforms/Makefile.am: Added above file.
5226 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5227 scheme again. This time it should work for JMarc. If this is
5228 successful I'll revise my conversion script to automate some of this.
5229 The static member functions in the class also have to be public for
5230 this scheme will work. If the scheme works (it's almost identical to
5231 the way BufferView::cursorToggleCB is handled so it should work) then
5232 FormCopyright and FormPrint will be ready for inclusion into the main
5233 trunk immediately after 1.1.5 is released -- provided we're prepared
5234 for complaints about lame compilers not handling XTL.
5236 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5238 2000-04-07 Allan Rae <rae@lyx.org>
5240 * config/lyxinclude.m4: A bit more tidying up (Angus)
5242 * src/LString.h: JMarc's <string> header fix
5244 * src/PrinterParams.h: Used string for most data to remove some
5245 ugly code in the Print dialog and avoid even uglier code when
5246 appending the ints to a string for output.
5248 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5249 and moved "default:" back to the end of switch statement. Cleaned
5250 up the printing so it uses the right function calls and so the
5251 "print to file" option actually puts the file in the right directory.
5253 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5255 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5256 and Ok+Apply button control into a separate method: input (Angus).
5257 (input) Cleaned it up and improved it to be very thorough now.
5258 (All CB) static_cast used instead of C style cast (Angus). This will
5259 probably change again once we've worked out how to keep gcc-2.8.1 happy
5260 with real C callbacks.
5261 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5262 ignore some of the bool settings and has random numbers instead. Needs
5263 some more investigation. Added other input length checks and checking
5264 of file and printer names.
5266 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5267 would link (Angus). Seems the old code doesn't compile with the pragma
5268 statement either. Separated callback entries from internal methods.
5270 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5272 2000-03-17 Allan Rae <rae@lyx.org>
5274 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5275 need it? Maybe it could go in Dialogs instead? I could make it a
5276 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5277 values to get the bool return value.
5278 (Dispatch): New overloaded method for xtl support.
5280 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5281 extern "C" callback instead of static member functions. Hopefully,
5282 JMarc will be able to compile this. I haven't changed
5283 forms/form_copyright.fd yet. Breaking one of my own rules already.
5285 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5286 because they aren't useful from the minibuffer. Maybe a LyXServer
5287 might want a help message though?
5289 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5291 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5292 xtl which needs both rtti and exceptions.
5294 * src/support/Makefile.am:
5295 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5297 * src/frontends/xforms/input_validators.[ch]: input filters and
5298 validators. These conrol what keys are valid in input boxes.
5299 Use them and write some more. Much better idea than waiting till
5300 after the user has pressed Ok to say that the input fields don't make
5303 * src/frontends/xforms/Makefile.am:
5304 * src/frontends/xforms/forms/form_print.fd:
5305 * src/frontends/xforms/forms/makefile:
5306 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5307 new scheme. Still have to make sure I haven't missed anything from
5308 the current implementation.
5310 * src/Makefile.am, src/PrinterParams.h: New data store.
5312 * other files: Added a couple of copyright notices.
5314 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5316 * src/insets/insetbib.h: move Holder struct in public space.
5318 * src/frontends/include/DialogBase.h: use SigC:: only when
5319 SIGC_CXX_NAMESPACES is defined.
5320 * src/frontends/include/Dialogs.h: ditto.
5322 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5324 * src/frontends/xforms/FormCopyright.[Ch]: do not
5325 mention SigC:: explicitely.
5327 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5329 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5330 deals with testing KDE in main configure.in
5331 * configure.in: ditto.
5333 2000-02-22 Allan Rae <rae@lyx.org>
5335 * Lots of files: Merged from HEAD
5337 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5338 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5340 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5342 * sigc++/: new minidist.
5344 2000-02-14 Allan Rae <rae@lyx.org>
5346 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5348 2000-02-08 Juergen Vigna <jug@sad.it>
5350 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5351 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5353 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5354 for this port and so it is much easier for other people to port
5355 dialogs in a common development environment.
5357 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5358 the QT/KDE implementation.
5360 * src/frontends/kde/Dialogs.C:
5361 * src/frontends/kde/FormCopyright.C:
5362 * src/frontends/kde/FormCopyright.h:
5363 * src/frontends/kde/Makefile.am:
5364 * src/frontends/kde/formcopyrightdialog.C:
5365 * src/frontends/kde/formcopyrightdialog.h:
5366 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5367 for the kde support of the Copyright-Dialog.
5369 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5370 subdir-substitution instead of hardcoded 'xforms' as we now have also
5373 * src/frontends/include/DialogBase.h (Object): just commented the
5374 label after #endif (nasty warning and I don't like warnings ;)
5376 * src/main.C (main): added KApplication initialization if using
5379 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5380 For now only the KDE event-loop is added if frontend==kde.
5382 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5384 * configure.in: added support for the --with-frontend[=value] option
5386 * autogen.sh: added kde.m4 file to list of config-files
5388 * acconfig.h: added define for KDEGUI-support
5390 * config/kde.m4: added configuration functions for KDE-port
5392 * config/lyxinclude.m4: added --with-frontend[=value] option with
5393 support for xforms and KDE.
5395 2000-02-08 Allan Rae <rae@lyx.org>
5397 * all Makefile.am: Fixed up so the make targets dist, distclean,
5398 install and uninstall all work even if builddir != srcdir. Still
5399 have a new sigc++ minidist update to come.
5401 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5403 2000-02-01 Allan Rae <rae@lyx.org>
5405 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5406 Many mods to get builddir != srcdir working.
5408 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5409 for building on NT and so we can do the builddir != srcdir stuff.
5411 2000-01-30 Allan Rae <rae@lyx.org>
5413 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5414 This will stay in "rae" branch. We probably don't really need it in
5415 the main trunk as anyone who wants to help programming it should get
5416 a full library installed also. So they can check both included and
5417 system supplied library compilation.
5419 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5420 Added a 'mini' distribution of libsigc++. If you feel the urge to
5421 change something in these directories - Resist it. If you can't
5422 resist the urge then you should modify the following script and rebuild
5423 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5424 all happen. Still uses a hacked version of libsigc++'s configure.in.
5425 I'm quite happy with the results. I'm not sure the extra work to turn
5426 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5427 worth the trouble and would probably lead to extra maintenance
5429 I haven't tested the following important make targets: install, dist.
5430 Not ready for prime time but very close. Maybe 1.1.5.
5432 * development/tools/makeLyXsigc.sh: A shell script to automatically
5433 generate our mini-dist of libsigc++. It can only be used with a CVS
5434 checkout of libsigc++ not a tarball distribution. It's well commented.
5435 This will end up as part of the libsigc++ distribution so other apps
5436 can easily have an included mini-dist. If someone makes mods to the
5437 sigc++ subpackage without modifying this script to generate those
5438 changes I'll be very upset!
5440 * src/frontends/: Started the gui/system indep structure.
5442 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5443 to access the gui-indep dialogs are in this class. Much improved
5444 design compared to previous revision. Lars, please refrain from
5445 moving this header into src/ like you did with Popups.h last time.
5447 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5449 * src/frontends/xforms/: Started the gui-indep system with a single
5450 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5453 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5454 Here you'll find a very useful makefile and automated fdfix.sh that
5455 makes updating dailogs a no-brainer -- provided you follow the rules
5456 set out in the README. I'm thinking about adding another script to
5457 automatically generate skeleton code for a new dialog given just the
5460 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5461 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5462 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5464 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5466 * src/support/LSubstring.C (operator): simplify
5468 * src/lyxtext.h: removed bparams, use buffer_->params instead
5470 * src/lyxrow.h: make Row a real class, move all variables to
5471 private and use accessors.
5473 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5475 (isRightToLeftPar): ditto
5476 (ChangeLanguage): ditto
5477 (isMultiLingual): ditto
5480 (SimpleTeXOnePar): ditto
5481 (TeXEnvironment): ditto
5482 (GetEndLabel): ditto
5484 (SetOnlyLayout): ditto
5485 (BreakParagraph): ditto
5486 (BreakParagraphConservative): ditto
5487 (GetFontSettings): ditto
5489 (CopyIntoMinibuffer): ditto
5490 (CutIntoMinibuffer): ditto
5491 (PasteParagraph): ditto
5492 (SetPExtraType): ditto
5493 (UnsetPExtraType): ditto
5494 (DocBookContTableRows): ditto
5495 (SimpleDocBookOneTablePar): ditto
5497 (TeXFootnote): ditto
5498 (SimpleTeXOneTablePar): ditto
5499 (TeXContTableRows): ditto
5500 (SimpleTeXSpecialChars): ditto
5503 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5504 to private and use accessors.
5506 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5507 this, we did not use it anymore and has not been for ages. Just a
5508 waste of cpu cycles.
5510 * src/language.h: make Language a real class, move all variables
5511 to private and use accessors.
5513 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5514 (create_view): remove
5515 (update): some changes for new timer
5516 (cursorToggle): use new timer
5517 (beforeChange): change for new timer
5519 * src/BufferView.h (cursorToggleCB): removed last paramter because
5522 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5523 (cursorToggleCB): change because of new timer code
5525 * lib/CREDITS: updated own mailaddress
5527 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5529 * src/support/filetools.C (PutEnv): fix the code in case neither
5530 putenv() nor setenv() have been found.
5532 * INSTALL: mention the install-strip Makefile target.
5534 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5535 read-only documents.
5537 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5539 * lib/reLyX/configure.in (VERSION): avoid using a previously
5540 generated reLyX wrapper to find out $prefix.
5542 * lib/examples/eu_adibide_lyx-atua.lyx:
5543 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5544 translation of the Tutorial (Dooteo)
5546 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5548 * forms/cite.fd: new citation dialog
5550 * src/insetcite.[Ch]: the new citation dialog is moved into
5553 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5556 * src/insets/insetcommand.h: data members made private.
5558 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5560 * LyX 1.1.5 released
5562 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5564 * src/version.h (LYX_RELEASE): to 1.1.5
5566 * src/spellchecker.C (RunSpellChecker): return false if the
5567 spellchecker dies upon creation.
5569 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5571 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5572 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5576 * lib/CREDITS: update entry for Martin Vermeer.
5578 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5580 * src/text.C (draw): Draw foreign language bars at the bottom of
5581 the row instead of at the baseline.
5583 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5585 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5587 * lib/bind/de_menus.bind: updated
5589 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5591 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5593 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5595 * src/menus.C (Limit_string_length): New function
5596 (ShowTocMenu): Limit the number of items/length of items in the
5599 * src/paragraph.C (String): Correct result for a paragraph inside
5602 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5604 * src/bufferlist.C (close): test of buf->getuser() == NULL
5606 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5608 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5609 Do not call to SetCursor when the paragraph is a closed footnote!
5611 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5613 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5616 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5618 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5621 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5622 reference popup, that activates the reference-back action
5624 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5626 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5627 the menus. Also fixed a bug.
5629 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5630 the math panels when switching buffers (unless new buffer is readonly).
5632 * src/BufferView.C (NoSavedPositions)
5633 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5635 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5637 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5638 less of dvi dirty or not.
5640 * src/trans_mgr.[Ch] (insert): change first parameter to string
5643 * src/chset.[Ch] (encodeString): add const to first parameter
5645 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5647 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5651 * src/LaTeX.C (deplog): better searching for dependency files in
5652 the latex log. Uses now regexps.
5654 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5655 instead of the box hack or \hfill.
5657 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5659 * src/lyxfunc.C (doImportHelper): do not create the file before
5660 doing the actual import.
5661 (doImportASCIIasLines): create a new file before doing the insert.
5662 (doImportASCIIasParagraphs): ditto.
5664 * lib/lyxrc.example: remove mention of non-existing commands
5666 * lyx.man: remove mention of color-related switches.
5668 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5670 * src/lyx_gui.C: remove all the color-related ressources, which
5671 are not used anymore.
5673 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5676 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5678 * src/lyxrc.C (read): Add a missing break in the switch
5680 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5682 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5684 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5687 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5689 * src/text.C (draw): draw bars under foreign language words.
5691 * src/LColor.[Ch]: add LColor::language
5693 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5695 * src/lyxcursor.h (boundary): New member variable
5697 * src/text.C (IsBoundary): New methods
5699 * src/text.C: Use the above for currect cursor movement when there
5700 is both RTL & LTR text.
5702 * src/text2.C: ditto
5704 * src/bufferview_funcs.C (ToggleAndShow): ditto
5706 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5708 * src/text.C (DeleteLineForward): set selection to true to avoid
5709 that DeleteEmptyParagraphMechanism does some magic. This is how it
5710 is done in all other functions, and seems reasonable.
5711 (DeleteWordForward): do not jump over non-word stuff, since
5712 CursorRightOneWord() already does it.
5714 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5715 DeleteWordBackward, since they seem safe to me (since selection is
5716 set to "true") DeleteEmptyParagraphMechanism does nothing.
5718 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5720 * src/lyx_main.C (easyParse): simplify the code by factoring the
5721 part that removes parameters from the command line.
5722 (LyX): check wether wrong command line options have been given.
5724 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5726 * src/lyx_main.C : add support for specifying user LyX
5727 directory via command line option -userdir.
5729 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5731 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5732 the number of items per popup.
5733 (Add_to_refs_menu): Ditto.
5735 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5737 * src/lyxparagraph.h: renamed ClearParagraph() to
5738 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5739 textclass as parameter, and do nothing if free_spacing is
5740 true. This fixes part of the line-delete-forward problems.
5742 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5743 (pasteSelection): ditto.
5744 (SwitchLayoutsBetweenClasses): more translatable strings.
5746 * src/text2.C (CutSelection): use StripLeadingSpaces.
5747 (PasteSelection): ditto.
5748 (DeleteEmptyParagraphMechanism): ditto.
5750 2000-05-26 Juergen Vigna <jug@sad.it>
5752 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5753 is not needed in tabular insets.
5755 * src/insets/insettabular.C (TabularFeatures): added missing features.
5757 * src/tabular.C (DeleteColumn):
5759 (AppendRow): implemented this functions
5760 (cellsturct::operator=): clone the inset too;
5762 2000-05-23 Juergen Vigna <jug@sad.it>
5764 * src/insets/insettabular.C (LocalDispatch): better selection support
5765 when having multicolumn-cells.
5767 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5769 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5771 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5773 * src/ColorHandler.C (getGCForeground): put more test into _()
5775 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5778 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5781 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5783 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5784 there are no labels, or when buffer is readonly.
5786 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5787 there are no labels, buffer is SGML, or when buffer is readonly.
5789 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5791 * src/LColor.C (LColor): change a couple of grey40 to grey60
5792 (LColor): rewore initalization to make compiles go some magnitude
5794 (getGUIName): don't use gettext until we need the string.
5796 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5798 * src/Bullet.[Ch]: Fixed a small bug.
5800 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5802 * src/paragraph.C (String): Several fixes/improvements
5804 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5806 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5808 * src/paragraph.C (String): give more correct output.
5810 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5812 * src/lyxfont.C (stateText) Do not output the language if it is
5813 eqaul to the language of the document.
5815 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5816 between two paragraphs with the same language.
5818 * src/paragraph.C (getParLanguage) Return a correct answer for an
5819 empty dummy paragraph.
5821 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5824 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5827 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5828 the menus/popup, if requested fonts are unavailable.
5830 2000-05-22 Juergen Vigna <jug@sad.it>
5832 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5833 movement support (Up/Down/Tab/Shift-Tab).
5834 (LocalDispatch): added also preliminari cursor-selection.
5836 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5838 * src/paragraph.C (PasteParagraph): Hopefully now right!
5840 2000-05-22 Garst R. Reese <reese@isn.net>
5842 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5843 of list, change all references to Environment to Command
5844 * tex/hollywood.cls : rewrite environments as commands, add
5845 \uppercase to interiorshot and exteriorshot to force uppecase.
5846 * tex/broadway.cls : rewrite environments as commands. Tweak
5849 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5851 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5852 size of items: use a constant intead of the hardcoded 40, and more
5853 importantly do not remove the %m and %x tags added at the end.
5854 (Add_to_refs_menu): use vector::size_type instead of
5855 unsigned int as basic types for the variables. _Please_ do not
5856 assume that size_t is equal to unsigned int. On an alpha, this is
5857 unsigned long, which is _not_ the same.
5859 * src/language.C (initL): remove language "hungarian", since it
5860 seems that "magyar" is better.
5862 2000-05-22 Juergen Vigna <jug@sad.it>
5864 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5866 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5869 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5870 next was deleted but not set to 0.
5872 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5874 * src/language.C (initL): change the initialization of languages
5875 so that compiles goes _fast_.
5877 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5880 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5882 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5886 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5888 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5890 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5894 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5897 * src/insets/insetlo*.[Ch]: Made editable
5899 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5901 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5902 the current selection.
5904 * src/BufferView_pimpl.C (stuffClipboard): new method
5906 * src/BufferView.C (stuffClipboard): new method
5908 * src/paragraph.C (String): new method
5910 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5911 LColor::ignore when lyxname is not found.
5913 * src/BufferView.C (pasteSelection): new method
5915 * src/BufferView_pimpl.C (pasteSelection): new method
5917 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5919 * src/WorkArea.C (request_clipboard_cb): new static function
5920 (getClipboard): new method
5921 (putClipboard): new method
5923 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5925 * LyX 1.1.5pre2 released
5927 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5929 * src/vspace.C (operator=): removed
5930 (operator=): removed
5932 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5934 * src/layout.C (NumberOfClass): manually set the type in make_pair
5935 (NumberOfLayout): ditto
5937 * src/language.C: use the Language constructor for ignore_lang
5939 * src/language.h: add constructors to struct Language
5941 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5943 * src/text2.C (SetCursorIntern): comment out #warning
5945 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5947 * src/mathed/math_iter.h: initialize sx and sw to 0
5949 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5951 * forms/lyx.fd: Redesign of form_ref
5953 * src/LaTeXFeatures.[Ch]
5957 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5960 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5961 and Buffer::inset_iterator.
5963 * src/menus.C: Added new menus: TOC and Refs.
5965 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5967 * src/buffer.C (getTocList): New method.
5969 * src/BufferView2.C (ChangeRefs): New method.
5971 * src/buffer.C (getLabelList): New method. It replaces the old
5972 getReferenceList. The return type is vector<string> instead of
5975 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5976 the old getLabel() and GetNumberOfLabels() methods.
5977 * src/insets/insetlabel.C (getLabelList): ditto
5978 * src/mathed/formula.C (getLabelList): ditto
5980 * src/paragraph.C (String): New method.
5982 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5983 Uses the new getTocList() method.
5984 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5985 which automatically updates the contents of the browser.
5986 (RefUpdateCB): Use the new getLabelList method.
5988 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5990 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5992 * src/spellchecker.C: Added using std::reverse;
5994 2000-05-19 Juergen Vigna <jug@sad.it>
5996 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5998 * src/insets/insettext.C (computeTextRows): small fix for display of
5999 1 character after a newline.
6001 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6004 2000-05-18 Juergen Vigna <jug@sad.it>
6006 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6007 when changing width of column.
6009 * src/tabular.C (set_row_column_number_info): setting of
6010 autobreak rows if necessary.
6012 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6014 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6016 * src/vc-backend.*: renamed stat() to status() and vcstat to
6017 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6018 compilation broke. The new name seems more relevant, anyway.
6020 2000-05-17 Juergen Vigna <jug@sad.it>
6022 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6023 which was wrong if the removing caused removing of rows!
6025 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6026 (pushToken): new function.
6028 * src/text2.C (CutSelection): fix problem discovered with purify
6030 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6032 * src/debug.C (showTags): enlarge the first column, now that we
6033 have 6-digits debug codes.
6035 * lib/layouts/hollywood.layout:
6036 * lib/tex/hollywood.cls:
6037 * lib/tex/brodway.cls:
6038 * lib/layouts/brodway.layout: more commands and fewer
6039 environments. Preambles moved in the .cls files. Broadway now has
6040 more options on scene numbering and less whitespace (from Garst)
6042 * src/insets/insetbib.C (getKeys): make sure that we are in the
6043 document directory, in case the bib file is there.
6045 * src/insets/insetbib.C (Latex): revert bogus change.
6047 2000-05-16 Juergen Vigna <jug@sad.it>
6049 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6050 the TabularLayout on cursor move.
6052 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6054 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6057 (draw): fixed cursor position and drawing so that the cursor is
6058 visible when before the tabular-inset.
6060 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6061 when creating from old insettext.
6063 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6065 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6067 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6068 * lib/tex/brodway.cls: ditto
6070 * lib/layouts/brodway.layout: change alignment of parenthical
6073 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6075 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6076 versions 0.88 and 0.89 are supported.
6078 2000-05-15 Juergen Vigna <jug@sad.it>
6080 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6083 * src/insets/insettext.C (computeTextRows): redone completely this
6084 function in a much cleaner way, because of problems when having a
6086 (draw): added a frame border when the inset is locked.
6087 (SetDrawLockedFrame): this sets if we draw the border or not.
6088 (SetFrameColor): this sets the frame color (default=insetframe).
6090 * src/insets/lyxinset.h: added x() and y() functions which return
6091 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6092 function which is needed to see if we have a locking inset of some
6093 type in this inset (needed for now in insettabular).
6095 * src/vspace.C (inPixels): the same function also without a BufferView
6096 parameter as so it is easier to use it in some ocasions.
6098 * src/lyxfunc.C: changed all places where insertInset was used so
6099 that now if it couldn't be inserted it is deleted!
6101 * src/TabularLayout.C:
6102 * src/TableLayout.C: added support for new tabular-inset!
6104 * src/BufferView2.C (insertInset): this now returns a bool if the
6105 inset was really inserted!!!
6107 * src/tabular.C (GetLastCellInRow):
6108 (GetFirstCellInRow): new helper functions.
6109 (Latex): implemented for new tabular class.
6113 (TeXTopHLine): new Latex() helper functions.
6115 2000-05-12 Juergen Vigna <jug@sad.it>
6117 * src/mathed/formulamacro.C (Read):
6118 * src/mathed/formula.C (Read): read also the \end_inset here!
6120 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6122 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6123 crush when saving formulae with unbalanced parenthesis.
6125 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6127 * src/layout.C: Add new keyword "endlabelstring" to layout file
6129 * src/text.C (GetVisibleRow): Draw endlabel string.
6131 * lib/layouts/broadway.layout
6132 * lib/layouts/hollywood.layout: Added endlabel for the
6133 Parenthetical layout.
6135 * lib/layouts/heb-article.layout: Do not use slanted font shape
6136 for Theorem like environments.
6138 * src/buffer.C (makeLaTeXFile): Always add "american" to
6139 the UsedLanguages list if document language is RTL.
6141 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * add addendum to README.OS2 and small patch (from SMiyata)
6145 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6147 * many files: correct the calls to ChangeExtension().
6149 * src/support/filetools.C (ChangeExtension): remove the no_path
6150 argument, which does not belong there. Use OnlyFileName() instead.
6152 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6153 files when LaTeXing a non-nice latex file.
6155 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6156 a chain of "if". Return false when deadkeys are not handled.
6158 * src/lyx_main.C (LyX): adapted the code for default bindings.
6160 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6161 bindings for basic functionality (except deadkeys).
6162 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6164 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6165 several methods: handle override_x_deadkeys.
6167 * src/lyxrc.h: remove the "bindings" map, which did not make much
6168 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6170 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6172 * src/lyxfont.C (stateText): use a saner method to determine
6173 whether the font is "default". Seems to fix the crash with DEC
6176 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6178 2000-05-08 Juergen Vigna <jug@sad.it>
6180 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6181 TabularLayoutMenu with mouse-button-3
6182 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6184 * src/TabularLayout.C: added this file for having a Layout for
6187 2000-05-05 Juergen Vigna <jug@sad.it>
6189 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6190 recalculating inset-widths.
6191 (TabularFeatures): activated this function so that I can change
6192 tabular-features via menu.
6194 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6195 that I can test some functions with the Table menu.
6197 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6199 * src/lyxfont.C (stateText): guard against stupid c++libs.
6201 * src/tabular.C: add using std::vector
6202 some whitespace changes, + removed som autogenerated code.
6204 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6206 2000-05-05 Juergen Vigna <jug@sad.it>
6208 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6209 row, columns and cellstructures.
6211 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6213 * lib/lyxrc.example: remove obsolete entries.
6215 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6216 reading of protected_separator for free_spacing.
6218 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6220 * src/text.C (draw): do not display an exclamation mark in the
6221 margin for margin notes. This is confusing, ugly and
6224 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6225 AMS math' is checked.
6227 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6228 name to see whether including the amsmath package is needed.
6230 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6232 * src/paragraph.C (validate): Compute UsedLanguages correctly
6233 (don't insert the american language if it doesn't appear in the
6236 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6237 The argument of \thanks{} command is considered moving argument
6239 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6242 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6244 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6245 for appendix/minipage/depth. The lines can be now both in the footnote
6246 frame, and outside the frame.
6248 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6251 2000-05-05 Juergen Vigna <jug@sad.it>
6253 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6254 neede only in tabular.[Ch].
6256 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6260 (Write): write '~' for PROTECTED_SEPARATOR
6262 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6264 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6267 * src/mathed/formula.C (drawStr): rename size to siz.
6269 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6270 possibly fix a bug by not changing the pflags = flags to piflags =
6273 2000-05-05 Juergen Vigna <jug@sad.it>
6275 * src/insets/insetbib.C: moved using directive
6277 * src/ImportNoweb.C: small fix for being able to compile (missing
6280 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6282 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6283 to use clear, since we don't depend on this in the code. Add test
6286 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6288 * (various *.C files): add using std::foo directives to please dec
6291 * replace calls to string::clear() to string::erase() (Angus)
6293 * src/cheaders/cmath: modified to provide std::abs.
6295 2000-05-04 Juergen Vigna <jug@sad.it>
6297 * src/insets/insettext.C: Prepared all for inserting of multiple
6298 paragraphs. Still display stuff to do (alignment and other things),
6299 but I would like to use LyXText to do this when we cleaned out the
6300 table-support stuff.
6302 * src/insets/insettabular.C: Changed lot of stuff and added lots
6303 of functionality still a lot to do.
6305 * src/tabular.C: Various functions changed name and moved to be
6306 const functions. Added new Read and Write functions and changed
6307 lots of things so it works good with tabular-insets (also removed
6308 some stuff which is not needed anymore * hacks *).
6310 * src/lyxcursor.h: added operators == and != which just look if
6311 par and pos are (not) equal.
6313 * src/buffer.C (latexParagraphs): inserted this function to latex
6314 all paragraphs form par to endpar as then I can use this too for
6317 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6318 so that I can call this to from text insets with their own cursor.
6320 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6321 output off all paragraphs (because of the fix below)!
6323 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6324 the very last paragraph (this could be also the last paragraph of an
6327 * src/texrow.h: added rows() call which returns the count-variable.
6329 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6331 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6333 * lib/configure.m4: better autodetection of DocBook tools.
6335 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6337 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6339 * src/lyx_cb.C: add using std::reverse;
6341 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6344 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6345 selected files. Should fix repeated errors from generated files.
6347 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6349 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6351 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6352 the spellchecker popup.
6354 * lib/lyxrc.example: Removed the \number_inset section
6356 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6358 * src/insets/figinset.C (various): Use IsFileReadable() to make
6359 sure that the file actually exist. Relying on ghostscripts errors
6360 is a bad idea since they can lead to X server crashes.
6362 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6364 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6367 * lib/lyxrc.example: smallish typo in description of
6368 \view_dvi_paper_option
6370 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6373 * src/lyxfunc.C: doImportHelper to factor out common code of the
6374 various import methods. New functions doImportASCIIasLines,
6375 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6376 doImportLinuxDoc for the format specific parts.
6379 * buffer.C: Dispatch returns now a bool to indicate success
6382 * lyx_gui.C: Add getLyXView() for member access
6384 * lyx_main.C: Change logic for batch commands: First try
6385 Buffer::Dispatch (possibly without GUI), if that fails, use
6388 * lyx_main.C: Add support for --import command line switch.
6389 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6390 Available Formats: Everything accepted by 'buffer-import <format>'
6392 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6394 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6397 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6398 documents will be reformatted upon reentry.
6400 2000-04-27 Juergen Vigna <jug@sad.it>
6402 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6403 correctly only last pos this was a bug.
6405 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6407 * release of lyx-1.1.5pre1
6409 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6411 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6413 * src/menus.C: revert the change of naming (Figure->Graphic...)
6414 from 2000-04-11. It was incomplete and bad.
6416 * src/LColor.[Ch]: add LColor::depthbar.
6417 * src/text.C (GetVisibleRow): use it.
6419 * README: update the languages list.
6421 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6423 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6426 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6428 * README: remove sections that were just wrong.
6430 * src/text2.C (GetRowNearY): remove currentrow code
6432 * src/text.C (GetRow): remove currentrow code
6434 * src/screen.C (Update): rewritten a bit.
6435 (SmallUpdate): removed func
6437 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6439 (FullRebreak): return bool
6440 (currentrow): remove var
6441 (currentrow_y): ditto
6443 * src/lyxscreen.h (Draw): change arg to unsigned long
6444 (FitCursor): return bool
6445 (FitManualCursor): ditto
6446 (Smallpdate): remove func
6447 (first): change to unsigned long
6448 (DrawOneRow): change second arg to long (from long &)
6449 (screen_refresh_y): remove var
6450 (scree_refresh_row): ditto
6452 * src/lyxrow.h: change baseline to usigned int from unsigned
6453 short, this brings some implicit/unsigned issues out in the open.
6455 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6457 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6458 instead of smallUpdate.
6460 * src/lyxcursor.h: change y to unsigned long
6462 * src/buffer.h: don't call updateScrollbar after fitcursor
6464 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6465 where they are used. Removed "\\direction", this was not present
6466 in 1.1.4 and is already obsolete. Commented out some code that I
6467 believe to never be called.
6468 (runLiterate): don't call updateScrollbar after fitCursor
6470 (buildProgram): ditto
6473 * src/WorkArea.h (workWidth): change return val to unsigned
6476 (redraw): remove the button redraws
6477 (setScrollbarValue): change for scrollbar
6478 (getScrollbarValue): change for scrollbar
6479 (getScrollbarBounds): change for scrollbar
6481 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6482 (C_WorkArea_down_cb): removed func
6483 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6484 (resize): change for scrollbar
6485 (setScrollbar): ditto
6486 (setScrollbarBounds): ditto
6487 (setScrollbarIncrements): ditto
6488 (up_cb): removed func
6489 (down_cb): removed func
6490 (scroll_cb): change for scrollbar
6491 (work_area_handler): ditto
6493 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6494 when FitCursor did something.
6495 (updateScrollbar): some unsigned changes
6496 (downCB): removed func
6497 (scrollUpOnePage): removed func
6498 (scrollDownOnePage): remvoed func
6499 (workAreaMotionNotify): don't call screen->FitCursor but use
6500 fitCursor instead. and bool return val
6501 (workAreaButtonPress): ditto
6502 (workAreaButtonRelease): some unsigned changes
6503 (checkInsetHit): ditto
6504 (workAreaExpose): ditto
6505 (update): parts rewritten, comments about the signed char arg added
6506 (smallUpdate): removed func
6507 (cursorPrevious): call needed updateScrollbar
6510 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6513 * src/BufferView.[Ch] (upCB): removed func
6514 (downCB): removed func
6515 (smallUpdate): removed func
6517 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6519 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6520 currentrow, currentrow_y optimization. This did not help a lot and
6521 if we want to do this kind of optimization we should rather use
6522 cursor.row instead of the currentrow.
6524 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6525 buffer spacing and klyx spacing support.
6527 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6529 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6532 2000-04-26 Juergen Vigna <jug@sad.it>
6534 * src/insets/figinset.C: fixes to Lars sstream changes!
6536 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6538 * A lot of files: Added Ascii(ostream &) methods to all inset
6539 classes. Used when exporting to ASCII.
6541 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6542 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6545 * src/text2.C (ToggleFree): Disabled implicit word selection when
6546 there is a change in the language
6548 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6549 no output was generated for end-of-sentence inset.
6551 * src/insets/lyxinset.h
6554 * src/paragraph.C: Removed the insetnumber code
6556 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6558 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6560 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6561 no_babel and no_epsfig completely from the file.
6562 (parseSingleLyXformat2Token): add handling for per-paragraph
6563 spacing as written by klyx.
6565 * src/insets/figinset.C: applied patch by Andre. Made it work with
6568 2000-04-20 Juergen Vigna <jug@sad.it>
6570 * src/insets/insettext.C (cutSelection):
6571 (copySelection): Fixed with selection from right to left.
6572 (draw): now the rows are not recalculated at every draw.
6573 (computeTextRows): for now reset the inset-owner here (this is
6574 important for an undo or copy where the inset-owner is not set
6577 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6578 motion to the_locking_inset screen->first was forgotten, this was
6579 not important till we got multiline insets.
6581 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6583 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6584 code seems to be alright (it is code changed by Dekel, and the
6585 intent is indeed that all macros should be defined \protect'ed)
6587 * NEWS: a bit of reorganisation of the new user-visible features.
6589 2000-04-19 Juergen Vigna <jug@sad.it>
6591 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6592 position. Set the inset_owner of the used paragraph so that it knows
6593 that it is inside an inset. Fixed cursor handling with mouse and
6594 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6595 and cleanups to make TextInsets work better.
6597 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6598 Changed parameters of various functions and added LockInsetInInset().
6600 * src/insets/insettext.C:
6602 * src/insets/insetcollapsable.h:
6603 * src/insets/insetcollapsable.C:
6604 * src/insets/insetfoot.h:
6605 * src/insets/insetfoot.C:
6606 * src/insets/insetert.h:
6607 * src/insets/insetert.C: cleaned up the code so that it works now
6608 correctly with insettext.
6610 * src/insets/inset.C:
6611 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6612 that insets in insets are supported right.
6615 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6617 * src/paragraph.C: some small fixes
6619 * src/debug.h: inserted INSETS debug info
6621 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6622 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6624 * src/commandtags.h:
6625 * src/LyXAction.C: insert code for InsetTabular.
6627 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6628 not Button1MotionMask.
6629 (workAreaButtonRelease): send always a InsetButtonRelease event to
6631 (checkInsetHit): some setCursor fixes (always with insets).
6633 * src/BufferView2.C (lockInset): returns a bool now and extended for
6634 locking insets inside insets.
6635 (showLockedInsetCursor): it is important to have the cursor always
6636 before the locked inset.
6637 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6639 * src/BufferView.h: made lockInset return a bool.
6641 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6643 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6644 that is used also internally but can be called as public to have back
6645 a cursor pos which is not set internally.
6646 (SetCursorIntern): Changed to use above function.
6648 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6650 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6655 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6656 patches for things that should be in or should be changed.
6658 * src/* [insetfiles]: change "usigned char fragile" to bool
6659 fragile. There was only one point that could that be questioned
6660 and that is commented in formulamacro.C. Grep for "CHECK".
6662 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6663 (DeleteBuffer): take it out of CutAndPaste and make it static.
6665 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6667 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6668 output the spacing envir commands. Also the new commands used in
6669 the LaTeX output makes the result better.
6671 * src/Spacing.C (writeEnvirBegin): new method
6672 (writeEnvirEnd): new method
6674 2000-04-18 Juergen Vigna <jug@sad.it>
6676 * src/CutAndPaste.C: made textclass a static member of the class
6677 as otherwise it is not accesed right!!!
6679 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6681 * forms/layout_forms.fd
6682 * src/layout_forms.h
6683 * src/layout_forms.C (create_form_form_character)
6684 * src/lyx_cb.C (UserFreeFont)
6685 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6686 documents (in the layout->character popup).
6688 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6690 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6691 \spell_command was in fact not honored (from Kevin Atkinson).
6693 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6696 * src/lyx_gui.h: make lyxViews private (Angus)
6698 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6700 * src/mathed/math_write.C
6701 (MathMatrixInset::Write) Put \protect before \begin{array} and
6702 \end{array} if fragile
6703 (MathParInset::Write): Put \protect before \\ if fragile
6705 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6707 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6708 initialization if the LyXColorHandler must be done after the
6709 connections to the XServer has been established.
6711 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6712 get the background pixel from the lyxColorhandler so that the
6713 figures are rendered with the correct background color.
6714 (NextToken): removed functions.
6715 (GetPSSizes): use ifs >> string instead of NextToken.
6717 * src/Painter.[Ch]: the color cache moved out of this file.
6719 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6722 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6724 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6725 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6727 * src/BufferView.C (enterView): new func
6728 (leaveView): new func
6730 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6732 (leaveView): new func, undefines xterm cursor when approp.
6734 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6735 (AllowInput): delete the Workarea cursor handling from this func.
6737 * src/Painter.C (underline): draw a slimer underline in most cases.
6739 * src/lyx_main.C (error_handler): use extern "C"
6741 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6743 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6744 sent directly to me.
6746 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6747 to the list by Dekel.
6749 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6752 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6753 methods from lyx_cb.here.
6755 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6758 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6760 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6761 instead of using current_view directly.
6763 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6765 * src/LyXAction.C (init): add the paragraph-spacing command.
6767 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6769 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6771 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6772 different from the documents.
6774 * src/text.C (SetHeightOfRow): take paragraph spacing into
6775 account, paragraph spacing takes precedence over buffer spacing
6776 (GetVisibleRow): ditto
6778 * src/paragraph.C (writeFile): output the spacing parameter too.
6779 (validate): set the correct features if spacing is used in the
6781 (Clear): set spacing to default
6782 (MakeSameLayout): spacing too
6783 (HasSameLayout): spacing too
6784 (SetLayout): spacing too
6785 (TeXOnePar): output the spacing commands
6787 * src/lyxparagraph.h: added a spacing variable for use with
6788 per-paragraph spacing.
6790 * src/Spacing.h: add a Default spacing and a method to check if
6791 the current spacing is default. also added an operator==
6793 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6796 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6798 * src/lyxserver.C (callback): fix dispatch of functions
6800 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6801 printf() into lyxerr call.
6803 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6806 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6807 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6808 the "Float" from each of the subitems.
6809 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6811 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6812 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6813 documented the change so that the workaround can be nuked later.
6815 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6818 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6820 * src/buffer.C (getLatexName): ditto
6821 (setReadonly): ditto
6823 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6825 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6826 avoid some uses of current_view. Added also a bufferParams()
6827 method to get at this.
6829 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6831 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6833 * src/lyxparagraph.[Ch]: removed
6834 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6835 with operators used by lower_bound and
6836 upper_bound in InsetTable's
6837 Make struct InsetTable private again. Used matchpos.
6839 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6841 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6842 document, the language of existing text is changed (unless the
6843 document is multi-lingual)
6845 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6847 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6849 * A lot of files: A rewrite of the Right-to-Left support.
6851 2000-04-10 Juergen Vigna <jug@sad.it>
6853 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6854 misplaced cursor when inset in inset is locked.
6856 * src/insets/insettext.C (LocalDispatch): small fix so that a
6857 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6859 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6860 footnote font should be decreased in size twice when displaying.
6862 * src/insets/insettext.C (GetDrawFont): inserted this function as
6863 the drawing-font may differ from the real paragraph font.
6865 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6866 insets (inset in inset!).
6868 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6869 function here because we don't want footnotes inside footnotes.
6871 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6873 (init): now set the inset_owner in paragraph.C
6874 (LocalDispatch): added some resetPos() in the right position
6877 (pasteSelection): changed to use the new CutAndPaste-Class.
6879 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6880 which tells if it is allowed to insert another inset inside this one.
6882 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6883 SwitchLayoutsBetweenClasses.
6885 * src/text2.C (InsertInset): checking of the new paragraph-function
6887 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6888 is not needed anymore here!
6891 (PasteSelection): redone (also with #ifdef) so that now this uses
6892 the CutAndPaste-Class.
6893 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6896 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6897 from/to text/insets.
6899 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6900 so that the paragraph knows if it is inside an (text)-inset.
6901 (InsertFromMinibuffer): changed return-value to bool as now it
6902 may happen that an inset is not inserted in the paragraph.
6903 (InsertInsetAllowed): this checks if it is allowed to insert an
6904 inset in this paragraph.
6906 (BreakParagraphConservative):
6907 (BreakParagraph) : small change for the above change of the return
6908 value of InsertFromMinibuffer.
6910 * src/lyxparagraph.h: added inset_owner and the functions to handle
6911 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6913 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6915 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6916 functions from BufferView to BufferView::Pimpl to ease maintence.
6918 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6919 correctly. Also use SetCursorIntern instead of SetCursor.
6921 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6924 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6926 * src/WorkArea.C (belowMouse): manually implement below mouse.
6928 * src/*: Add "explicit" on several constructors, I added probably
6929 some unneeded ones. A couple of changes to code because of this.
6931 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6932 implementation and private parts from the users of BufferView. Not
6935 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6936 implementation and private parts from the users of LyXLex. Not
6939 * src/BufferView_pimpl.[Ch]: new files
6941 * src/lyxlex_pimpl.[Ch]: new files
6943 * src/LyXView.[Ch]: some inline functions move out-of-line
6945 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6947 * src/lyxparagraph.h: make struct InsetTable public.
6949 * src/support/lyxstring.h: change lyxstring::difference_type to be
6950 ptrdiff_t. Add std:: modifiers to streams.
6952 * src/font.C: include the <cctype> header, for islower() and
6955 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6957 * src/font.[Ch]: new files. Contains the metric functions for
6958 fonts, takes a LyXFont as parameter. Better separation of concepts.
6960 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6961 changes because of this.
6963 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6965 * src/*: compile with -Winline and move functions that don't
6968 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6971 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6973 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6974 (various files changed because of this)
6976 * src/Painter.C (text): fixed the drawing of smallcaps.
6978 * src/lyxfont.[Ch] (drawText): removed unused member func.
6981 * src/*.C: added needed "using" statements and "std::" qualifiers.
6983 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6985 * src/*.h: removed all use of "using" from header files use
6986 qualifier std:: instead.
6988 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6990 * src/text.C (Backspace): some additional cleanups (we already
6991 know whether cursor.pos is 0 or not).
6993 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6994 automake does not provide one).
6996 * src/bmtable.h: replace C++ comments with C comments.
6998 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7000 * src/screen.C (ShowCursor): Change the shape of the cursor if
7001 the current language is not equal to the language of the document.
7002 (If the cursor change its shape unexpectedly, then you've found a bug)
7004 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7007 * src/insets/insetnumber.[Ch]: New files.
7009 * src/LyXAction.C (init)
7010 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7013 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7015 * src/lyxparagraph.h
7016 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7017 (the vector is kept sorted).
7019 * src/text.C (GetVisibleRow): Draw selection correctly when there
7020 is both LTR and RTL text.
7022 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7023 which is much faster.
7025 * src/text.C (GetVisibleRow and other): Do not draw the last space
7026 in a row if the direction of the last letter is not equal to the
7027 direction of the paragraph.
7029 * src/lyxfont.C (latexWriteStartChanges):
7030 Check that font language is not equal to basefont language.
7031 (latexWriteEndChanges): ditto
7033 * src/lyx_cb.C (StyleReset): Don't change the language while using
7034 the font-default command.
7036 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7037 empty paragraph before a footnote.
7039 * src/insets/insetcommand.C (draw): Increase x correctly.
7041 * src/screen.C (ShowCursor): Change cursor shape if
7042 current language != document language.
7044 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7046 2000-03-31 Juergen Vigna <jug@sad.it>
7048 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7049 (Clone): changed mode how the paragraph-data is copied to the
7050 new clone-paragraph.
7052 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7053 GetInset(pos) with no inset anymore there (in inset UNDO)
7055 * src/insets/insetcommand.C (draw): small fix as here x is
7056 incremented not as much as width() returns (2 before, 2 behind = 4)
7058 2000-03-30 Juergen Vigna <jug@sad.it>
7060 * src/insets/insettext.C (InsetText): small fix in initialize
7061 widthOffset (should not be done in the init() function)
7063 2000-03-29 Amir Karger <karger@lyx.org>
7065 * lib/examples/it_ItemizeBullets.lyx: translation by
7068 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7070 2000-03-29 Juergen Vigna <jug@sad.it>
7072 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7074 * src/insets/insetfoot.C (Clone): small change as for the below
7075 new init function in the text-inset
7077 * src/insets/insettext.C (init): new function as I've seen that
7078 clone did not copy the Paragraph-Data!
7079 (LocalDispatch): Added code so that now we have some sort of Undo
7080 functionality (well actually we HAVE Undo ;)
7082 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7084 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7086 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7089 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7091 * src/main.C: added a runtime check that verifies that the xforms
7092 header used when building LyX and the library used when running
7093 LyX match. Exit with a message if they don't match. This is a
7094 version number check only.
7096 * src/buffer.C (save): Don't allocate memory on the heap for
7097 struct utimbuf times.
7099 * *: some using changes, use iosfwd instead of the real headers.
7101 * src/lyxfont.C use char const * instead of string for the static
7102 strings. Rewrite some functions to use sstream.
7104 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7109 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7112 of Geodesy (from Martin Vermeer)
7114 * lib/layouts/svjour.inc: include file for the Springer svjour
7115 class. It can be used to support journals other than JoG.
7117 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7118 Miskiewicz <misiek@pld.org.pl>)
7119 * lib/reLyX/Makefile.am: ditto.
7121 2000-03-27 Juergen Vigna <jug@sad.it>
7123 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7124 also some modifications with operations on selected text.
7126 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7127 problems with clicking on insets (last famous words ;)
7129 * src/insets/insetcommand.C (draw):
7130 (width): Changed to have a bit of space before and after the inset so
7131 that the blinking cursor can be seen (otherwise it was hidden)
7133 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7135 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7136 would not be added to the link list when an installed gettext (not
7137 part of libc) is found.
7139 2000-03-24 Juergen Vigna <jug@sad.it>
7141 * src/insets/insetcollapsable.C (Edit):
7142 * src/mathed/formula.C (InsetButtonRelease):
7143 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7146 * src/BufferView.C (workAreaButtonPress):
7147 (workAreaButtonRelease):
7148 (checkInsetHit): Finally fixed the clicking on insets be handled
7151 * src/insets/insetert.C (Edit): inserted this call so that ERT
7152 insets work always with LaTeX-font
7154 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7156 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7157 caused lyx to startup with no GUI in place, causing in a crash
7158 upon startup when called with arguments.
7160 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7162 * src/FontLoader.C: better initialization of dummyXFontStruct.
7164 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7166 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7167 for linuxdoc and docbook import and export format options.
7169 * lib/lyxrc.example Example of default values for the previous flags.
7171 * src/lyx_cb.C Use those flags instead of the hardwired values for
7172 linuxdoc and docbook export.
7174 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7177 * src/menus.C Added menus entries for the new import/exports formats.
7179 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7181 * src/lyxrc.*: Added support for running without Gui
7184 * src/FontLoader.C: sensible defaults if no fonts are needed
7186 * src/lyx_cb.C: New function ShowMessage (writes either to the
7187 minibuffer or cout in case of no gui
7188 New function AskOverwrite for common stuff
7189 Consequently various changes to call these functions
7191 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7192 wild guess at sensible screen resolution when having no gui
7194 * src/lyxfont.C: no gui, no fonts... set some defaults
7196 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7198 * src/LColor.C: made the command inset background a bit lighter.
7200 2000-03-20 Hartmut Goebel <goebel@noris.net>
7202 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7203 stdstruct.inc. Koma-Script added some title elements which
7204 otherwise have been listed below "bibliography". This split allows
7205 adding title elements to where they belong.
7207 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7208 define the additional title elements and then include
7211 * many other layout files: changed to include stdtitle.inc just
7212 before stdstruct.inc.
7214 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7216 * src/buffer.C: (save) Added the option to store all backup files
7217 in a single directory
7219 * src/lyxrc.[Ch]: Added variable \backupdir_path
7221 * lib/lyxrc.example: Added descriptions of recently added variables
7223 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7224 bibtex inset, not closing the bibtex popup when deleting the inset)
7226 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7228 * src/lyx_cb.C: add a couple using directives.
7230 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7231 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7232 import based on the filename.
7234 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7235 file would be imported at start, if the filename where of a sgml file.
7237 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7239 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7241 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7242 * src/lyxfont.h Replaced the member variable bits.direction by the
7243 member variable lang. Made many changes in other files.
7244 This allows having a multi-lingual document
7246 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7247 that change the current language to <l>.
7248 Removed the command "font-rtl"
7250 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7251 format for Hebrew documents)
7253 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7254 When auto_mathmode is "true", pressing a digit key in normal mode
7255 will cause entering into mathmode.
7256 If auto_mathmode is "rtl" then this behavior will be active only
7257 when writing right-to-left text.
7259 * src/text2.C (InsertStringA) The string is inserted using the
7262 * src/paragraph.C (GetEndLabel) Gives a correct result for
7263 footnote paragraphs.
7265 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7267 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7269 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7270 front of PasteParagraph. Never insert a ' '. This should at least
7271 fix some cause for the segfaults that we have been experiencing,
7272 it also fixes backspace behaviour slightly. (Phu!)
7274 * src/support/lstrings.C (compare_no_case): some change to make it
7275 compile with gcc 2.95.2 and stdlibc++-v3
7277 * src/text2.C (MeltFootnoteEnvironment): change type o
7278 first_footnote_par_is_not_empty to bool.
7280 * src/lyxparagraph.h: make text private. Changes in other files
7282 (fitToSize): new function
7283 (setContentsFromPar): new function
7284 (clearContents): new function
7285 (SetChar): new function
7287 * src/paragraph.C (readSimpleWholeFile): deleted.
7289 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7290 the file, just use a simple string instead. Also read the file in
7291 a more maintainable manner.
7293 * src/text2.C (InsertStringA): deleted.
7294 (InsertStringB): deleted.
7296 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7298 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7299 RedoParagraphs from the doublespace handling part, just set status
7300 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7301 done, but perhaps not like this.)
7303 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7305 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7306 character when inserting an inset.
7308 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7310 * src/bufferparams.C (readLanguage): now takes "default" into
7313 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7314 also initialize the toplevel_keymap with the default bindings from
7317 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7319 * all files using lyxrc: have lyxrc as a real variable and not a
7320 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7323 * src/lyxrc.C: remove double call to defaultKeyBindings
7325 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7326 toolbar defauls using lyxlex. Remove enums, structs, functions
7329 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7330 toolbar defaults. Also store default keybindings in a map.
7332 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7333 storing the toolbar defaults without any xforms dependencies.
7335 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7336 applied. Changed to use iterators.
7338 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7340 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7341 systems that don't have LINGUAS set to begin with.
7343 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7345 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7346 the list by Dekel Tsur.
7348 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7350 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7351 * src/insets/form_graphics.C: ditto.
7353 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7355 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7357 * src/bufferparams.C (readLanguage): use the new language map
7359 * src/intl.C (InitKeyMapper): use the new language map
7361 * src/lyx_gui.C (create_forms): use the new language map
7363 * src/language.[Ch]: New files. Used for holding the information
7364 about each language. Now! Use this new language map enhance it and
7365 make it really usable for our needs.
7367 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7369 * screen.C (ShowCursor): Removed duplicate code.
7370 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7371 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7373 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7376 * src/text.C Added TransformChar method. Used for rendering Arabic
7377 text correctly (change the glyphs of the letter according to the
7378 position in the word)
7383 * src/lyxrc.C Added lyxrc command {language_command_begin,
7384 language_command_end,language_command_ltr,language_command_rtl,
7385 language_package} which allows the use of either arabtex or Omega
7388 * src/lyx_gui.C (init)
7390 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7391 to use encoding for menu fonts which is different than the encoding
7394 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7395 do not load the babel package.
7396 To write an English document with Hebrew/Arabic, change the document
7397 language to "english".
7399 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7400 (alphaCounter): changed to return char
7401 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7403 * lib/lyxrc.example Added examples for Hebrew/Arabic
7406 * src/layout.C Added layout command endlabeltype
7408 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7410 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7412 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7414 * src/mathed/math_delim.C (search_deco): return a
7415 math_deco_struct* instead of index.
7417 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7419 * All files with a USE_OSTREAM_ONLY within: removed all code that
7420 was unused when USE_OSTREAM_ONLY is defined.
7422 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7423 of any less. Removed header and using.
7425 * src/text.C (GetVisibleRow): draw the string "Page Break
7426 (top/bottom)" on screen when drawing a pagebreak line.
7428 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7430 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7432 * src/mathed/math_macro.C (draw): do some cast magic.
7435 * src/mathed/math_defs.h: change byte* argument to byte const*.
7437 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7439 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7440 know it is right to return InsetFoot* too, but cxx does not like
7443 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7445 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7447 * src/mathed/math_delim.C: change == to proper assignment.
7449 2000-03-09 Juergen Vigna <jug@sad.it>
7451 * src/insets/insettext.C (setPos): fixed various cursor positioning
7452 problems (via mouse and cursor-keys)
7453 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7454 inset (still a small display problem but it works ;)
7456 * src/insets/insetcollapsable.C (draw): added button_top_y and
7457 button_bottom_y to have correct values for clicking on the inset.
7459 * src/support/lyxalgo.h: commented out 'using std::less'
7461 2000-03-08 Juergen Vigna <jug@sad.it>
7463 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7464 Button-Release event closes as it is alos the Release-Event
7467 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7469 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7471 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7472 can add multiple spaces in Scrap (literate programming) styles...
7473 which, by the way, is how I got hooked on LyX to begin with.
7475 * src/mathed/formula.C (Write): Added dummy variable to an
7476 inset::Latex() call.
7477 (Latex): Add free_spacing boolean to inset::Latex()
7479 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7481 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7482 virtual function to include the free_spacing boolean from
7483 the containing paragraph's style.
7485 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7486 Added free_spacing boolean arg to match inset.h
7488 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7489 Added free_spacing boolean arg to match inset.h
7491 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7492 Added free_spacing boolean and made sure that if in a free_spacing
7493 paragraph, that we output normal space if there is a protected space.
7495 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7496 Added free_spacing boolean arg to match inset.h
7498 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7499 Added free_spacing boolean arg to match inset.h
7501 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7502 Added free_spacing boolean arg to match inset.h
7504 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7505 Added free_spacing boolean arg to match inset.h
7507 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7508 Added free_spacing boolean arg to match inset.h
7510 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7511 free_spacing boolean arg to match inset.h
7513 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7514 Added free_spacing boolean arg to match inset.h
7516 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7517 Added free_spacing boolean arg to match inset.h
7519 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7520 Added free_spacing boolean arg to match inset.h
7522 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7523 Added free_spacing boolean arg to match inset.h
7525 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7526 Added free_spacing boolean arg to match inset.h
7528 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7529 free_spacing boolean arg to match inset.h
7531 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7532 free_spacing boolean arg to match inset.h
7534 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7535 ignore free_spacing paragraphs. The user's spaces are left
7538 * src/text.C (InsertChar): Fixed the free_spacing layout
7539 attribute behavior. Now, if free_spacing is set, you can
7540 add multiple spaces in a paragraph with impunity (and they
7541 get output verbatim).
7542 (SelectSelectedWord): Added dummy argument to inset::Latex()
7545 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7548 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7549 paragraph layouts now only input a simple space instead.
7550 Special character insets don't make any sense in free-spacing
7553 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7554 hard-spaces in the *input* file to simple spaces if the layout
7555 is free-spacing. This converts old files which had to have
7556 hard-spaces in free-spacing layouts where a simple space was
7558 (writeFileAscii): Added free_spacing check to pass to the newly
7559 reworked inset::Latex(...) methods. The inset::Latex() code
7560 ensures that hard-spaces in free-spacing paragraphs get output
7561 as spaces (rather than "~").
7563 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7565 * src/mathed/math_delim.C (draw): draw the empty placeholder
7566 delims with a onoffdash line.
7567 (struct math_deco_compare): struct that holds the "functors" used
7568 for the sort and the binary search in math_deco_table.
7569 (class init_deco_table): class used for initial sort of the
7571 (search_deco): use lower_bound to do a binary search in the
7574 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7576 * src/lyxrc.C: a small secret thingie...
7578 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7579 and to not flush the stream as often as it used to.
7581 * src/support/lyxalgo.h: new file
7582 (sorted): template function used for checking if a sequence is
7583 sorted or not. Two versions with and without user supplied
7584 compare. Uses same compare as std::sort.
7586 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7587 it and give warning on lyxerr.
7589 (struct compare_tags): struct with function operators used for
7590 checking if sorted, sorting and lower_bound.
7591 (search_kw): use lower_bound instead of manually implemented
7594 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * src/insets/insetcollapsable.h: fix Clone() declaration.
7597 * src/insets/insetfoot.h: ditto.
7599 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7601 2000-03-08 Juergen Vigna <jug@sad.it>
7603 * src/insets/lyxinset.h: added owner call which tells us if
7604 this inset is inside another inset. Changed also the return-type
7605 of Editable to an enum so it tells clearer what the return-value is.
7607 * src/insets/insettext.C (computeTextRows): fixed computing of
7608 textinsets which split automatically on more rows.
7610 * src/insets/insetert.[Ch]: changed this to be of BaseType
7613 * src/insets/insetfoot.[Ch]: added footnote inset
7615 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7616 collapsable insets (like footnote, ert, ...)
7618 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 * src/lyxdraw.h: remvoe file
7622 * src/lyxdraw.C: remove file
7624 * src/insets/insettext.C: added <algorithm>.
7626 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7628 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7629 (matrix_cb): case MM_OK use string stream
7631 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7634 * src/mathed/math_macro.C (draw): use string stream
7635 (Metrics): use string stream
7637 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7638 directly to the ostream.
7640 * src/vspace.C (asString): use string stream.
7641 (asString): use string stream
7642 (asLatexString): use string stream
7644 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7645 setting Spacing::Other.
7647 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7648 sprintf when creating the stretch vale.
7650 * src/text2.C (alphaCounter): changed to return a string and to
7651 not use a static variable internally. Also fixed a one-off bug.
7652 (SetCounter): changed the drawing of the labels to use string
7653 streams instead of sprintf.
7655 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7656 manipulator to use a scheme that does not require library support.
7657 This is also the way it is done in the new GNU libstdc++. Should
7658 work with DEC cxx now.
7660 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7662 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7663 end. This fixes a bug.
7665 * src/mathed (all files concerned with file writing): apply the
7666 USE_OSTREAM_ONLY changes to mathed too.
7668 * src/support/DebugStream.h: make the constructor explicit.
7670 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7671 count and ostream squashed.
7673 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7675 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7677 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7678 ostringstream uses STL strings, and we might not.
7680 * src/insets/insetspecialchar.C: add using directive.
7681 * src/insets/insettext.C: ditto.
7683 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7685 * lib/layouts/seminar.layout: feeble attempt at a layout for
7686 seminar.cls, far from completet and could really use some looking
7687 at from people used to write layout files.
7689 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7690 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7691 a lot nicer and works nicely with ostreams.
7693 * src/mathed/formula.C (draw): a slightly different solution that
7694 the one posted to the list, but I think this one works too. (font
7695 size wrong in headers.)
7697 * src/insets/insettext.C (computeTextRows): some fiddling on
7698 Jürgens turf, added some comments that he should read.
7700 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7701 used and it gave compiler warnings.
7702 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7705 * src/lyx_gui.C (create_forms): do the right thing when
7706 show_banner is true/false.
7708 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7709 show_banner is false.
7711 * most file writing files: Now use iostreams to do almost all of
7712 the writing. Also instead of passing string &, we now use
7713 stringstreams. mathed output is still not adapted to iostreams.
7714 This change can be turned off by commenting out all the occurences
7715 of the "#define USE_OSTREAM_ONLY 1" lines.
7717 * src/WorkArea.C (createPixmap): don't output debug messages.
7718 (WorkArea): don't output debug messages.
7720 * lib/lyxrc.example: added a comment about the new variable
7723 * development/Code_rules/Rules: Added some more commente about how
7724 to build class interfaces and on how better encapsulation can be
7727 2000-03-03 Juergen Vigna <jug@sad.it>
7729 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7730 automatically with the width of the LyX-Window
7732 * src/insets/insettext.C (computeTextRows): fixed update bug in
7733 displaying text-insets (scrollvalues where not initialized!)
7735 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7738 id in the check of the result from lower_bound is not enough since
7739 lower_bound can return last too, and then res->id will not be a
7742 * all insets and some code that use them: I have conditionalized
7743 removed the Latex(string & out, ...) this means that only the
7744 Latex(ostream &, ...) will be used. This is a work in progress to
7745 move towards using streams for all output of files.
7747 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7750 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7752 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7753 routine (this fixes bug where greek letters were surrounded by too
7756 * src/support/filetools.C (findtexfile): change a bit the search
7757 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7758 no longer passed to kpsewhich, we may have to change that later.
7760 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7761 warning options to avoid problems with X header files (from Angus
7763 * acinclude.m4: regenerated.
7765 2000-03-02 Juergen Vigna <jug@sad.it>
7767 * src/insets/insettext.C (WriteParagraphData): Using the
7768 par->writeFile() function for writing paragraph-data.
7769 (Read): Using buffer->parseSingleLyXformat2Token()-function
7770 for parsing paragraph data!
7772 * src/buffer.C (readLyXformat2): removed all parse data and using
7773 the new parseSingleLyXformat2Token()-function.
7774 (parseSingleLyXformat2Token): added this function to parse (read)
7775 lyx-file-format (this is called also from text-insets now!)
7777 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7782 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7783 directly instead of going through a func. One very bad thing: a
7784 static LyXFindReplace, but I don't know where to place it.
7786 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7787 string instead of char[]. Also changed to static.
7788 (GetSelectionOrWordAtCursor): changed to static inline
7789 (SetSelectionOverLenChars): ditto.
7791 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7792 current_view and global variables. both classes has changed names
7793 and LyXFindReplace is not inherited from SearchForm.
7795 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7796 fl_form_search form.
7798 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7800 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7802 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7803 bound (from Kayvan).
7805 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7807 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7809 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7811 * some things that I should comment but the local pub says head to
7814 * comment out all code that belongs to the Roff code for Ascii
7815 export of tables. (this is unused)
7817 * src/LyXView.C: use correct type for global variable
7818 current_layout. (LyXTextClass::size_type)
7820 * some code to get the new insetgraphics closer to working I'd be
7821 grateful for any help.
7823 * src/BufferView2.C (insertInset): use the return type of
7824 NumberOfLayout properly. (also changes in other files)
7826 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7827 this as a test. I want to know what breaks because of this.
7829 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7831 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7833 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7834 to use a \makebox in the label, this allows proper justification
7835 with out using protected spaces or multiple hfills. Now it is
7836 "label" for left justified, "\hfill label\hfill" for center, and
7837 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7838 should be changed accordingly.
7840 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7842 * src/lyxtext.h: change SetLayout() to take a
7843 LyXTextClass::size_type instead of a char (when there is more than
7844 127 layouts in a class); also change type of copylayouttype.
7845 * src/text2.C (SetLayout): ditto.
7846 * src/LyXView.C (updateLayoutChoice): ditto.
7848 * src/LaTeX.C (scanLogFile): errors where the line number was not
7849 given just after the '!'-line were ignored (from Dekel Tsur).
7851 * lib/lyxrc.example: fix description of \date_insert_format
7853 * lib/layouts/llncs.layout: new layout, contributed by Martin
7856 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7858 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7859 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7860 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7861 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7862 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7863 paragraph.C, text.C, text2.C)
7865 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7867 * src/insets/insettext.C (LocalDispatch): remove extra break
7870 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7871 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7873 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7874 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7876 * src/insets/insetbib.h: move InsetBibkey::Holder and
7877 InsetCitation::Holder in public space.
7879 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7881 * src/insets/insettext.h: small change to get the new files from
7882 Juergen to compile (use "string", not "class string").
7884 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7885 const & as parameter to LocalDispatch, use LyXFont const & as
7886 paramter to some other func. This also had impacto on lyxinsets.h
7887 and the two mathed insets.
7889 2000-02-24 Juergen Vigna <jug@sad.it>
7892 * src/commandtags.h:
7894 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7898 * src/BufferView2.C: added/updated code for various inset-functions
7900 * src/insets/insetert.[Ch]: added implementation of InsetERT
7902 * src/insets/insettext.[Ch]: added implementation of InsetText
7904 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7905 (draw): added preliminary code for inset scrolling not finshed yet
7907 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7908 as it is in lyxfunc.C now
7910 * src/insets/lyxinset.h: Added functions for text-insets
7912 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7914 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7915 BufferView and reimplement the list as a queue put inside its own
7918 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7920 * several files: use the new interface to the "updateinsetlist"
7922 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7924 (work_area_handler): call BufferView::trippleClick on trippleclick.
7926 * src/BufferView.C (doubleClick): new function, selects word on
7928 (trippleClick): new function, selects line on trippleclick.
7930 2000-02-22 Allan Rae <rae@lyx.org>
7932 * lib/bind/xemacs.bind: buffer-previous not supported
7934 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7936 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7939 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/bufferlist.C: get rid of current_view from this file
7943 * src/spellchecker.C: get rid of current_view from this file
7945 * src/vspace.C: get rid of current_view from this file
7946 (inPixels): added BufferView parameter for this func
7947 (asLatexCommand): added a BufferParams for this func
7949 * src/text.C src/text2.C: get rid of current_view from these
7952 * src/lyxfont.C (getFontDirection): move this function here from
7955 * src/bufferparams.C (getDocumentDirection): move this function
7958 * src/paragraph.C (getParDirection): move this function here from
7960 (getLetterDirection): ditto
7962 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7964 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7965 resize due to wrong pixmap beeing used. Also took the opurtunity
7966 to make the LyXScreen stateless on regard to WorkArea and some
7967 general cleanup in the same files.
7969 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * src/Makefile.am: add missing direction.h
7973 * src/PainterBase.h: made the width functions const.
7975 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7978 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7980 * src/insets/insetlatexaccent.C (draw): make the accents draw
7981 better, at present this will only work well with iso8859-1.
7983 * several files: remove the old drawing code, now we use the new
7986 * several files: remove support for mono_video, reverse_video and
7989 2000-02-17 Juergen Vigna <jug@sad.it>
7991 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7992 int ** as we have to return the pointer, otherwise we have only
7993 NULL pointers in the returning function.
7995 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7997 * src/LaTeX.C (operator()): quote file name when running latex.
7999 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8001 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8002 (bubble tip), this removes our special handling of this.
8004 * Remove all code that is unused now that we have the new
8005 workarea. (Code that are not active when NEW_WA is defined.)
8007 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8009 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8011 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8012 nonexisting layout; correctly redirect obsoleted layouts.
8014 * lib/lyxrc.example: document \view_dvi_paper_option
8016 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8019 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8020 (PreviewDVI): handle the view_dvi_paper_option variable.
8021 [Both from Roland Krause]
8023 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8025 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8026 char const *, int, LyXFont)
8027 (text(int, int, string, LyXFont)): ditto
8029 * src/text.C (InsertCharInTable): attempt to fix the double-space
8030 feature in tables too.
8031 (BackspaceInTable): ditto.
8032 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8034 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8036 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8038 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8039 newly found text in textcache to this.
8040 (buffer): set the owner of the text put into the textcache to 0
8042 * src/insets/figinset.C (draw): fixed the drawing of figures with
8045 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8046 drawing of mathframe, hfills, protected space, table lines. I have
8047 now no outstanding drawing problems with the new Painter code.
8049 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8051 * src/PainterBase.C (ellipse, circle): do not specify the default
8054 * src/LColor.h: add using directive.
8056 * src/Painter.[Ch]: change return type of methods from Painter& to
8057 PainterBase&. Add a using directive.
8059 * src/WorkArea.C: wrap xforms callbacks in C functions
8062 * lib/layouts/foils.layout: font fix and simplifications from Carl
8065 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8067 * a lot of files: The Painter, LColor and WorkArea from the old
8068 devel branch has been ported to lyx-devel. Some new files and a
8069 lot of #ifdeffed code. The new workarea is enabled by default, but
8070 if you want to test the new Painter and LColor you have to compile
8071 with USE_PAINTER defined (do this in config.h f.ex.) There are
8072 still some rought edges, and I'd like some help to clear those
8073 out. It looks stable (loads and displays the Userguide very well).
8076 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/buffer.C (pop_tag): revert to the previous implementation
8079 (use a global variable for both loops).
8081 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8083 * src/lyxrc.C (LyXRC): change slightly default date format.
8085 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8086 there is an English text with a footnote that starts with a Hebrew
8087 paragraph, or vice versa.
8088 (TeXFootnote): ditto.
8090 * src/text.C (LeftMargin): allow for negative values for
8091 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8094 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8095 for input encoding (cyrillic)
8097 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8099 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8102 * src/toolbar.C (set): ditto
8103 * src/insets/insetbib.C (create_form_citation_form): ditto
8105 * lib/CREDITS: added Dekel Tsur.
8107 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8108 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8109 hebrew supports files from Dekel Tsur.
8111 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8112 <tzafrir@technion.ac.il>
8114 * src/lyxrc.C: put \date_insert_format at the right place.
8116 * src/buffer.C (makeLaTeXFile): fix the handling of
8117 BufferParams::sides when writing out latex files.
8119 * src/BufferView2.C: add a "using" directive.
8121 * src/support/lyxsum.C (sum): when we use lyxstring,
8122 ostringstream::str needs an additional .c_str().
8124 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8126 * src/support/filetools.C (ChangeExtension): patch from Etienne
8129 * src/TextCache.C (show): remove const_cast and make second
8130 parameter non-const LyXText *.
8132 * src/TextCache.h: use non const LyXText in show.
8134 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8137 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * src/support/lyxsum.C: rework to be more flexible.
8141 * several places: don't check if a pointer is 0 if you are going
8144 * src/text.C: remove some dead code.
8146 * src/insets/figinset.C: remove some dead code
8148 * src/buffer.C: move the BufferView funcs to BufferView2.C
8149 remove all support for insetlatexdel
8150 remove support for oldpapersize stuff
8151 made some member funcs const
8153 * src/kbmap.C: use a std::list to store the bindings in.
8155 * src/BufferView2.C: new file
8157 * src/kbsequence.[Ch]: new files
8159 * src/LyXAction.C + others: remove all trace of buffer-previous
8161 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8162 only have one copy in the binary of this table.
8164 * hebrew patch: moved some functions from LyXText to more
8165 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8167 * several files: remove support for XForms older than 0.88
8169 remove some #if 0 #endif code
8171 * src/TextCache.[Ch]: new file. Holds the textcache.
8173 * src/BufferView.C: changes to use the new TextCache interface.
8174 (waitForX): remove the now unused code.
8176 * src/BackStack.h: remove some commented code
8178 * lib/bind/emacs.bind: remove binding for buffer-previous
8180 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8182 * applied the hebrew patch.
8184 * src/lyxrow.h: make sure that all Row variables are initialized.
8186 * src/text2.C (TextHandleUndo): comment out a delete, this might
8187 introduce a memory leak, but should also help us to not try to
8188 read freed memory. We need to look at this one.
8190 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8191 (LyXParagraph): initalize footnotekind.
8193 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8194 forgot this when applying the patch. Please heed the warnings.
8196 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8197 (aka. reformat problem)
8199 * src/bufferlist.C (exists): made const, and use const_iterator
8200 (isLoaded): new func.
8201 (release): use std::find to find the correct buffer.
8203 * src/bufferlist.h: made getState a const func.
8204 made empty a const func.
8205 made exists a const func.
8208 2000-02-01 Juergen Vigna <jug@sad.it>
8210 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8212 * po/it.po: updated a bit the italian po file and also changed the
8213 'file nuovo' for newfile to 'filenuovo' without a space, this did
8216 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8217 for the new insert_date command.
8219 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8220 from jdblair, to insert a date into the current text conforming to
8221 a strftime format (for now only considering the locale-set and not
8222 the document-language).
8224 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8226 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8227 Bounds Read error seen by purify. The problem was that islower is
8228 a macros which takes an unsigned char and uses it as an index for
8229 in array of characters properties (and is thus subject to the
8233 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8234 correctly the paper sides radio buttons.
8235 (UpdateDocumentButtons): ditto.
8237 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8239 * src/kbmap.C (getsym + others): change to return unsigned int,
8240 returning a long can give problems on 64 bit systems. (I assume
8241 that int is 32bit on 64bit systems)
8243 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8245 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8246 LyXLookupString to be zero-terminated. Really fixes problems seen
8249 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8251 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8252 write a (char*)0 to the lyxerr stream.
8254 * src/lastfiles.C: move algorithm before the using statemets.
8256 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8258 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8259 complains otherwise).
8260 * src/table.C: ditto
8262 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8265 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8266 that I removed earlier... It is really needed.
8268 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8270 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8272 * INSTALL: update xforms home page URL.
8274 * lib/configure.m4: fix a bug with unreadable layout files.
8276 * src/table.C (calculate_width_of_column): add "using std::max"
8279 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8281 * several files: marked several lines with "DEL LINE", this is
8282 lines that can be deleted without changing anything.
8283 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8284 checks this anyway */
8287 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8289 * src/DepTable.C (update): add a "+" at the end when the checksum
8290 is different. (debugging string only)
8292 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8293 the next inset to not be displayed. This should also fix the list
8294 of labels in the "Insert Crossreference" dialog.
8296 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8298 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8299 when regex was not found.
8301 * src/support/lstrings.C (lowercase): use handcoded transform always.
8304 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8305 old_cursor.par->prev could be 0.
8307 * several files: changed post inc/dec to pre inc/dec
8309 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8310 write the lastfiles to file.
8312 * src/BufferView.C (buffer): only show TextCache info when debugging
8314 (resizeCurrentBuffer): ditto
8315 (workAreaExpose): ditto
8317 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8319 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8321 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8322 a bit better by removing the special case for \i and \j.
8324 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/lyx_main.C (easyParse): remove test for bad comand line
8327 options, since this broke all xforms-related parsing.
8329 * src/kbmap.C (getsym): set return type to unsigned long, as
8330 declared in header. On an alpha, long is _not_ the same as int.
8332 * src/support/LOstream.h: add a "using std::flush;"
8334 * src/insets/figinset.C: ditto.
8336 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8338 * src/bufferlist.C (write): use blinding fast file copy instead of
8339 "a char at a time", now we are doing it the C++ way.
8341 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8342 std::list<int> instead.
8343 (addpidwait): reflect move to std::list<int>
8344 (sigchldchecker): ditto
8346 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8349 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8350 that obviously was wrong...
8352 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8353 c, this avoids warnings with purify and islower.
8355 * src/insets/figinset.C: rename struct queue to struct
8356 queue_element and rewrite to use a std::queue. gsqueue is now a
8357 std::queue<queue_element>
8358 (runqueue): reflect move to std::queue
8361 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8362 we would get "1" "0" instead of "true" "false. Also make the tostr
8365 2000-01-21 Juergen Vigna <jug@sad.it>
8367 * src/buffer.C (writeFileAscii): Disabled code for special groff
8368 handling of tabulars till I fix this in table.C
8370 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8374 * src/support/lyxlib.h: ditto.
8376 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8378 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8379 and 'j' look better. This might fix the "macron" bug that has been
8382 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8383 functions as one template function. Delete the old versions.
8385 * src/support/lyxsum.C: move using std::ifstream inside
8388 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8391 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8393 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8395 * src/insets/figinset.C (InitFigures): use new instead of malloc
8396 to allocate memory for figures and bitmaps.
8397 (DoneFigures): use delete[] instead of free to deallocate memory
8398 for figures and bitmaps.
8399 (runqueue): use new to allocate
8400 (getfigdata): use new/delete[] instead of malloc/free
8401 (RegisterFigure): ditto
8403 * some files: moved some declarations closer to first use, small
8404 whitespace changes use preincrement instead of postincrement where
8405 it does not make a difference.
8407 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8408 step on the way to use stl::containers for key maps.
8410 * src/bufferlist.h: add a typedef for const_iterator and const
8411 versions of begin and end.
8413 * src/bufferlist.[Ch]: change name of member variable _state to
8414 state_. (avoid reserved names)
8416 (getFileNames): returns the filenames of the buffers in a vector.
8418 * configure.in (ALL_LINGUAS): added ro
8420 * src/support/putenv.C: new file
8422 * src/support/mkdir.C: new file
8424 2000-01-20 Allan Rae <rae@lyx.org>
8426 * lib/layouts/IEEEtran.layout: Added several theorem environments
8428 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8429 couple of minor additions.
8431 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8432 (except for those in footnotes of course)
8434 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8436 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8438 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8439 std::sort and std::lower_bound instead of qsort and handwritten
8441 (struct compara): struct that holds the functors used by std::sort
8442 and std::lower_bound in MathedLookupBOP.
8444 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8446 * src/support/LAssert.h: do not do partial specialization. We do
8449 * src/support/lyxlib.h: note that lyx::getUserName() and
8450 lyx::date() are not in use right now. Should these be suppressed?
8452 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8453 (makeLinuxDocFile): do not put date and user name in linuxdoc
8456 * src/support/lyxlib.h (kill): change first argument to long int,
8457 since that's what solaris uses.
8459 * src/support/kill.C (kill): fix declaration to match prototype.
8461 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8462 actually check whether namespaces are supported. This is not what
8465 * src/support/lyxsum.C: add a using directive.
8467 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8469 * src/support/kill.C: if we have namespace support we don't have
8470 to include lyxlib.h.
8472 * src/support/lyxlib.h: use namespace lyx if supported.
8474 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8476 * src/support/date.C: new file
8478 * src/support/chdir.C: new file
8480 * src/support/getUserName.C: new file
8482 * src/support/getcwd.C: new file
8484 * src/support/abort.C: new file
8486 * src/support/kill.C: new file
8488 * src/support/lyxlib.h: moved all the functions in this file
8489 insede struct lyx. Added also kill and abort to this struct. This
8490 is a way to avoid the "kill is not defined in <csignal>", we make
8491 C++ wrappers for functions that are not ANSI C or ANSI C++.
8493 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8494 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8495 lyx it has been renamed to sum.
8497 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8499 * src/text.C: add using directives for std::min and std::max.
8501 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8503 * src/texrow.C (getIdFromRow): actually return something useful in
8504 id and pos. Hopefully fixes the bug with positionning of errorbox
8507 * src/lyx_main.C (easyParse): output an error and exit if an
8508 incorrect command line option has been given.
8510 * src/spellchecker.C (ispell_check_word): document a memory leak.
8512 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8513 where a "struct utimbuf" is allocated with "new" and deleted with
8516 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * src/text2.C (CutSelection): don't delete double spaces.
8519 (PasteSelection): ditto
8520 (CopySelection): ditto
8522 * src/text.C (Backspace): don't delete double spaces.
8524 * src/lyxlex.C (next): fix a bug that were only present with
8525 conformant std::istream::get to read comment lines, use
8526 std::istream::getline instead. This seems to fix the problem.
8528 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8530 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8531 allowed to insert space before space" editing problem. Please read
8532 commends at the beginning of the function. Comments about usage
8535 * src/text.C (InsertChar): fix for the "not allowed to insert
8536 space before space" editing problem.
8538 * src/text2.C (DeleteEmptyParagraphMechanism): when
8539 IsEmptyTableRow can only return false this last "else if" will
8540 always be a no-op. Commented out.
8542 * src/text.C (RedoParagraph): As far as I can understand tmp
8543 cursor is not really needed.
8545 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8546 present it could only return false anyway.
8547 (several functions): Did something not so smart...added a const
8548 specifier on a lot of methods.
8550 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8551 and add a tmp->text.resize. The LyXParagraph constructor does the
8553 (BreakParagraphConservative): ditto
8555 * src/support/path.h (Path): add a define so that the wrong usage
8556 "Path("/tmp") will be flagged as a compilation error:
8557 "`unnamed_Path' undeclared (first use this function)"
8559 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8562 which was bogus for several reasons.
8564 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8568 * autogen.sh: do not use "type -path" (what's that anyway?).
8570 * src/support/filetools.C (findtexfile): remove extraneous space
8571 which caused a kpsewhich warning (at least with kpathsea version
8574 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8576 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8578 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8580 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8582 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8584 * src/paragraph.C (BreakParagraph): do not reserve space on text
8585 if we don't need to (otherwise, if pos_end < pos, we end up
8586 reserving huge amounts of memory due to bad unsigned karma).
8587 (BreakParagraphConservative): ditto, although I have not seen
8588 evidence the bug can happen here.
8590 * src/lyxparagraph.h: add a using std::list.
8592 2000-01-11 Juergen Vigna <jug@sad.it>
8594 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8597 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8599 * src/vc-backend.C (doVCCommand): change to be static and take one
8600 more parameter: the path to chdir too be fore executing the command.
8601 (retrive): new function equiv to "co -r"
8603 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8604 file_not_found_hook is true.
8606 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8608 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8609 if a file is readwrite,readonly...anything else.
8611 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8613 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8614 (CreatePostscript): name change from MenuRunDVIPS (or something)
8615 (PreviewPostscript): name change from MenuPreviewPS
8616 (PreviewDVI): name change from MenuPreviewDVI
8618 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8619 \view_pdf_command., \pdf_to_ps_command
8621 * lib/configure.m4: added search for PDF viewer, and search for
8622 PDF to PS converter.
8623 (lyxrc.defaults output): add \pdflatex_command,
8624 \view_pdf_command and \pdf_to_ps_command.
8626 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8628 * src/bufferlist.C (write): we don't use blocksize for anything so
8631 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8633 * src/support/block.h: disable operator T* (), since it causes
8634 problems with both compilers I tried. See comments in the file.
8636 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8639 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8640 variable LYX_DIR_10x to LYX_DIR_11x.
8642 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8644 * INSTALL: document --with-lyxname.
8647 * configure.in: new configure flag --with-lyxname which allows to
8648 choose the name under which lyx is installed. Default is "lyx", of
8649 course. It used to be possible to do this with --program-suffix,
8650 but the later has in fact a different meaning for autoconf.
8652 * src/support/lstrings.h (lstrchr): reformat a bit.
8654 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8655 * src/mathed/math_defs.h: ditto.
8657 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8660 true, decides if we create a backup file or not when saving. New
8661 tag and variable \pdf_mode, defaults to false. New tag and
8662 variable \pdflatex_command, defaults to pdflatex. New tag and
8663 variable \view_pdf_command, defaults to xpdf. New tag and variable
8664 \pdf_to_ps_command, defaults to pdf2ps.
8666 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8668 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8669 does not have a BufferView.
8670 (unlockInset): ditto + don't access the_locking_inset if the
8671 buffer does not have a BufferView.
8673 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8674 certain circumstances so that we don't continue a keyboard
8675 operation long after the key was released. Try f.ex. to load a
8676 large document, press PageDown for some seconds and then release
8677 it. Before this change the document would contine to scroll for
8678 some time, with this change it stops imidiatly.
8680 * src/support/block.h: don't allocate more space than needed. As
8681 long as we don't try to write to the arr[x] in a array_type arr[x]
8682 it is perfectly ok. (if you write to it you might segfault).
8683 added operator value_type*() so that is possible to pass the array
8684 to functions expecting a C-pointer.
8686 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8689 * intl/*: updated to gettext 0.10.35, tried to add our own
8690 required modifications. Please verify.
8692 * po/*: updated to gettext 0.10.35, tried to add our own required
8693 modifications. Please verify.
8695 * src/support/lstrings.C (tostr): go at fixing the problem with
8696 cxx and stringstream. When stringstream is used return
8697 oss.str().c_str() so that problems with lyxstring and basic_string
8698 are avoided. Note that the best solution would be for cxx to use
8699 basic_string all the way, but it is not conformant yet. (it seems)
8701 * src/lyx_cb.C + other files: moved several global functions to
8702 class BufferView, some have been moved to BufferView.[Ch] others
8703 are still located in lyx_cb.C. Code changes because of this. (part
8704 of "get rid of current_view project".)
8706 * src/buffer.C + other files: moved several Buffer functions to
8707 class BufferView, the functions are still present in buffer.C.
8708 Code changes because of this.
8710 * config/lcmessage.m4: updated to most recent. used when creating
8713 * config/progtest.m4: updated to most recent. used when creating
8716 * config/gettext.m4: updated to most recent. applied patch for
8719 * config/gettext.m4.patch: new file that shows what changes we
8720 have done to the local copy of gettext.m4.
8722 * config/libtool.m4: new file, used in creation of acinclude.m4
8724 * config/lyxinclude.m4: new file, this is the lyx created m4
8725 macros, used in making acinclude.m4.
8727 * autogen.sh: GNU m4 discovered as a separate task not as part of
8728 the lib/configure creation.
8729 Generate acinlucde from files in config. Actually cat
8730 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8731 easier to upgrade .m4 files that really are external.
8733 * src/Spacing.h: moved using std::istringstream to right after
8734 <sstream>. This should fix the problem seen with some compilers.
8736 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * src/lyx_cb.C: began some work to remove the dependency a lot of
8739 functions have on BufferView::text, even if not really needed.
8740 (GetCurrentTextClass): removed this func, it only hid the
8743 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8744 forgot this in last commit.
8746 * src/Bullet.C (bulletEntry): use static char const *[] for the
8747 tables, becuase of this the return arg had to change to string.
8749 (~Bullet): removed unneeded destructor
8751 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8752 (insetSleep): moved from Buffer
8753 (insetWakeup): moved from Buffer
8754 (insetUnlock): moved from Buffer
8756 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8757 from Buffer to BufferView.
8759 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8761 * config/ltmain.sh: updated to version 1.3.4 of libtool
8763 * config/ltconfig: updated to version 1.3.4 of libtool
8765 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8768 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8769 Did I get that right?
8771 * src/lyxlex.h: add a "using" directive or two.
8772 * src/Spacing.h: ditto.
8773 * src/insets/figinset.C: ditto.
8774 * src/support/filetools.C: ditto.
8775 * src/support/lstrings.C: ditto.
8776 * src/BufferView.C: ditto.
8777 * src/bufferlist.C: ditto.
8778 * src/lyx_cb.C: ditto.
8779 * src/lyxlex.C: ditto.
8781 * NEWS: add some changes for 1.1.4.
8783 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8785 * src/BufferView.C: first go at a TextCache to speed up switching
8788 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8790 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8791 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8792 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8793 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8796 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8797 members of the struct are correctly initialized to 0 (detected by
8799 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8800 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8802 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8803 pidwait, since it was allocated with "new". This was potentially
8804 very bad. Thanks to Michael Schmitt for running purify for us.
8807 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8809 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8811 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8813 1999-12-30 Allan Rae <rae@lyx.org>
8815 * lib/templates/IEEEtran.lyx: minor change
8817 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8818 src/mathed/formula.C (LocalDispatch): askForText changes
8820 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8821 know when a user has cancelled input. Fixes annoying problems with
8822 inserting labels and version control.
8824 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8826 * src/support/lstrings.C (tostr): rewritten to use strstream and
8829 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/support/filetools.C (IsFileWriteable): use fstream to check
8832 (IsDirWriteable): use fileinfo to check
8834 * src/support/filetools.h (FilePtr): whole class deleted
8836 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8838 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8840 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8842 * src/bufferlist.C (write): use ifstream and ofstream instead of
8845 * src/Spacing.h: use istrstream instead of sscanf
8847 * src/mathed/math_defs.h: change first arg to istream from FILE*
8849 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8851 * src/mathed/math_parser.C: have yyis to be an istream
8852 (LexGetArg): use istream (yyis)
8854 (mathed_parse): ditto
8855 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8857 * src/mathed/formula.C (Read): rewritten to use istream
8859 * src/mathed/formulamacro.C (Read): rewritten to use istream
8861 * src/lyxlex.h (~LyXLex): deleted desturctor
8862 (getStream): new function, returns an istream
8863 (getFile): deleted funtion
8864 (IsOK): return is.good();
8866 * src/lyxlex.C (LyXLex): delete file and owns_file
8867 (setFile): open an filebuf and assign that to a istream instead of
8869 (setStream): new function, takes an istream as arg.
8870 (setFile): deleted function
8871 (EatLine): rewritten us use istream instead of FILE*
8875 * src/table.C (LyXTable): use istream instead of FILE*
8876 (Read): rewritten to take an istream instead of FILE*
8878 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * src/buffer.C (Dispatch): remove an extraneous break statement.
8882 * src/support/filetools.C (QuoteName): change to do simple
8883 'quoting'. More work is necessary. Also changed to do nothing
8884 under emx (needs fix too).
8885 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8887 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8888 config.h.in to the AC_DEFINE_UNQUOTED() call.
8889 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8890 needs char * as argument (because Solaris 7 declares it like
8893 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8894 remove definition of BZERO.
8896 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8899 defined, "lyxregex.h" if not.
8901 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8903 (REGEX): new variable that is set to regex.c lyxregex.h when
8904 AM_CONDITIONAL USE_REGEX is set.
8905 (libsupport_la_SOURCES): add $(REGEX)
8907 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8910 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8913 * configure.in: add call to LYX_REGEX
8915 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8916 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8918 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8920 * lib/bind/fi_menus.bind: new file, from
8921 pauli.virtanen@saunalahti.fi.
8923 * src/buffer.C (getBibkeyList): pass the parameter delim to
8924 InsetInclude::getKeys and InsetBibtex::getKeys.
8926 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8927 is passed to Buffer::getBibkeyList
8929 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8930 instead of the hardcoded comma.
8932 * src/insets/insetbib.C (getKeys): make sure that there are not
8933 leading blanks in bibtex keys. Normal latex does not care, but
8934 harvard.sty seems to dislike blanks at the beginning of citation
8935 keys. In particular, the retturn value of the function is
8937 * INSTALL: make it clear that libstdc++ is needed and that gcc
8938 2.7.x probably does not work.
8940 * src/support/filetools.C (findtexfile): make debug message go to
8942 * src/insets/insetbib.C (getKeys): ditto
8944 * src/debug.C (showTags): make sure that the output is correctly
8947 * configure.in: add a comment for TWO_COLOR_ICON define.
8949 * acconfig.h: remove all the entries that already defined in
8950 configure.in or acinclude.m4.
8952 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8953 to avoid user name, date and copyright.
8955 1999-12-21 Juergen Vigna <jug@sad.it>
8957 * src/table.C (Read): Now read bogus row format informations
8958 if the format is < 5 so that afterwards the table can
8959 be read by lyx but without any format-info. Fixed the
8960 crash we experienced when not doing this.
8962 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8964 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8965 (RedoDrawingOfParagraph): ditto
8966 (RedoParagraphs): ditto
8967 (RemoveTableRow): ditto
8969 * src/text.C (Fill): rename arg paperwidth -> paper_width
8971 * src/buffer.C (insertLyXFile): rename var filename -> fname
8972 (writeFile): rename arg filename -> fname
8973 (writeFileAscii): ditto
8974 (makeLaTeXFile): ditto
8975 (makeLinuxDocFile): ditto
8976 (makeDocBookFile): ditto
8978 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8981 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8983 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8986 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8987 compiled by a C compiler not C++.
8989 * src/layout.h (LyXTextClass): added typedef for const_iterator
8990 (LyXTextClassList): added typedef for const_iterator + member
8991 functions begin and end.
8993 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8994 iterators to fill the choice_class.
8995 (updateLayoutChoice): rewritten to use iterators to fill the
8996 layoutlist in the toolbar.
8998 * src/BufferView.h (BufferView::work_area_width): removed unused
9001 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9003 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9004 (sgmlCloseTag): ditto
9006 * src/support/lstrings.h: return type of countChar changed to
9009 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9010 what version of this func to use. Also made to return unsigned int.
9012 * configure.in: call LYX_STD_COUNT
9014 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9015 conforming std::count.
9017 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9019 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9020 and a subscript would give bad display (patch from Dekel Tsur
9021 <dekel@math.tau.ac.il>).
9023 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9025 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9028 * src/chset.h: add a few 'using' directives
9030 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9031 triggered when no buffer is active
9033 * src/layout.C: removed `break' after `return' in switch(), since
9036 * src/lyx_main.C (init): make sure LyX can be ran in place even
9037 when libtool has done its magic with shared libraries. Fix the
9038 test for the case when the system directory has not been found.
9040 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9041 name for the latex file.
9042 (MenuMakeHTML): ditto
9044 * src/buffer.h: add an optional boolean argument, which is passed
9047 1999-12-20 Allan Rae <rae@lyx.org>
9049 * lib/templates/IEEEtran.lyx: small correction and update.
9051 * configure.in: Attempted to use LYX_PATH_HEADER
9053 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9055 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9056 input from JMarc. Now use preprocessor to find the header.
9057 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9058 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9059 LYX_STL_STRING_FWD. See comments in file.
9061 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9063 * The global MiniBuffer * minibuffer variable is dead.
9065 * The global FD_form_main * fd_form_main variable is dead.
9067 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9069 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9071 * src/table.h: add the LOstream.h header
9072 * src/debug.h: ditto
9074 * src/LyXAction.h: change the explaination of the ReadOnly
9075 attribute: is indicates that the function _can_ be used.
9077 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9080 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9082 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9088 * src/paragraph.C (GetWord): assert on pos>=0
9091 * src/support/lyxstring.C: condition the use of an invariant on
9093 * src/support/lyxstring.h: ditto
9095 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9096 Use LAssert.h instead of plain assert().
9098 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9100 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9101 * src/support/filetools.C: ditto
9103 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9106 * INSTALL: document the new configure flags
9108 * configure.in: suppress --with-debug; add --enable-assertions
9110 * acinclude.m4: various changes in alignment of help strings.
9112 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/kbmap.C: commented out the use of the hash map in kb_map,
9115 beginning of movement to a stl::container.
9117 * several files: removed code that was not in effect when
9118 MOVE_TEXT was defined.
9120 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9121 for escaping should not be used. We can discuss if the string
9122 should be enclosed in f.ex. [] instead of "".
9124 * src/trans_mgr.C (insert): use the new returned value from
9125 encodeString to get deadkeys and keymaps done correctly.
9127 * src/chset.C (encodeString): changed to return a pair, to tell
9128 what to use if we know the string.
9130 * src/lyxscreen.h (fillArc): new function.
9132 * src/FontInfo.C (resize): rewritten to use more std::string like
9133 structore, especially string::replace.
9135 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9138 * configure.in (chmod +x some scripts): remove config/gcc-hack
9140 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9142 * src/buffer.C (writeFile): change once again the top comment in a
9143 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9144 instead of an hardcoded version number.
9145 (makeDocBookFile): ditto
9147 * src/version.h: add new define LYX_DOCVERSION
9149 * po/de.po: update from Pit Sütterlin
9150 * lib/bind/de_menus.bind: ditto.
9152 * src/lyxfunc.C (Dispatch): call MenuExport()
9153 * src/buffer.C (Dispatch): ditto
9155 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9156 LyXFunc::Dispatch().
9157 (MenuExport): new function, moved from
9158 LyXFunc::Dispatch().
9160 * src/trans_mgr.C (insert): small cleanup
9161 * src/chset.C (loadFile): ditto
9163 * lib/kbd/iso8859-1.cdef: add missing backslashes
9165 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9168 help with placing the manually drawn accents better.
9170 (Draw): x2 and hg changed to float to minimize rounding errors and
9171 help place the accents better.
9173 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9174 unsigned short to char is just wrong...cast the char to unsigned
9175 char instead so that the two values can compare sanely. This
9176 should also make the display of insetlatexaccents better and
9177 perhaps also some other insets.
9179 (lbearing): new function
9182 1999-12-15 Allan Rae <rae@lyx.org>
9184 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9185 header that provides a wrapper around the very annoying SGI STL header
9188 * src/support/lyxstring.C, src/LString.h:
9189 removed old SGI-STL-compatability attempts.
9191 * configure.in: Use LYX_STL_STRING_FWD.
9193 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9194 stl_string_fwd.h is around and try to determine it's location.
9195 Major improvement over previous SGI STL 3.2 compatability.
9196 Three small problems remain with this function due to my zero
9197 knowledge of autoconf. JMarc and lgb see the comments in the code.
9199 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9201 * src/broken_const.h, config/hack-gcc, config/README: removed
9203 * configure.in: remove --with-gcc-hack option; do not call
9206 * INSTALL: remove documentation of --with-broken-const and
9209 * acconfig.h: remove all trace of BROKEN_CONST define
9211 * src/buffer.C (makeDocBookFile): update version number in output
9213 (SimpleDocBookOnePar): fix an assert when trying to a character
9214 access beyond string length
9217 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * po/de.po: fix the Export menu
9221 * lyx.man: update the description of -dbg
9223 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9224 (commandLineHelp): updated
9225 (easyParse): show list of available debug levels if -dbg is passed
9228 * src/Makefile.am: add debug.C
9230 * src/debug.h: moved some code to debug.C
9232 * src/debug.C: new file. Contains code to set and show debug
9235 * src/layout.C: remove 'break' after 'continue' in switch
9236 statements, since these cannot be reached.
9238 1999-12-13 Allan Rae <rae@lyx.org>
9240 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9241 (in_word_set): hash() -> math_hash()
9243 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9245 * acconfig.h: Added a test for whether we are using exceptions in the
9246 current compilation run. If so USING_EXCEPTIONS is defined.
9248 * config.in: Check for existance of stl_string_fwd.h
9249 * src/LString.h: If compiling --with-included-string and SGI's
9250 STL version 3.2 is present (see above test) we need to block their
9251 forward declaration of string and supply a __get_c_string().
9252 However, it turns out this is only necessary if compiling with
9253 exceptions enabled so I've a bit more to add yet.
9255 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9256 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9257 src/support/LRegex.h, src/undo.h:
9258 Shuffle the order of the included files a little to ensure that
9259 LString.h gets included before anything that includes stl_string_fwd.h
9261 * src/support/lyxstring.C: We need to #include LString.h instead of
9262 lyxstring.h to get the necessary definition of __get_c_string.
9263 (__get_c_string): New function. This is defined static just like SGI's
9264 although why they need to do this I'm not sure. Perhaps it should be
9265 in lstrings.C instead.
9267 * lib/templates/IEEEtran.lyx: New template file.
9269 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9271 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9272 * intl/Makefile.in (MKINSTALLDIRS): ditto
9274 * src/LyXAction.C (init): changed to hold the LFUN data in a
9275 automatic array in stead of in callso to newFunc, this speeds up
9276 compilation a lot. Also all the memory used by the array is
9277 returned when the init is completed.
9279 * a lot of files: compiled with -Wold-style-cast, changed most of
9280 the reported offenders to C++ style casts. Did not change the
9281 offenders in C files.
9283 * src/trans.h (Match): change argument type to unsigned int.
9285 * src/support/DebugStream.C: fix some types on the streambufs so
9286 that it works on a conforming implementation.
9288 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9290 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9292 * src/support/lyxstring.C: remove the inline added earlier since
9293 they cause a bunch of unsatisfied symbols when linking with dec
9294 cxx. Cxx likes to have the body of inlines at the place where they
9297 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9298 accessing negative bounds in array. This fixes the crash when
9299 inserting accented characters.
9300 * src/trans.h (Match): ditto
9302 * src/buffer.C (Dispatch): since this is a void, it should not try
9303 to return anything...
9305 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9307 * src/buffer.h: removed the two friends from Buffer. Some changes
9308 because of this. Buffer::getFileName and Buffer::setFileName
9309 renamed to Buffer::fileName() and Buffer::fileName(...).
9311 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9313 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9314 and Buffer::update(short) to BufferView. This move is currently
9315 controlled by a define MOVE_TEXT, this will be removed when all
9316 shows to be ok. This move paves the way for better separation
9317 between buffer contents and buffer view. One side effect is that
9318 the BufferView needs a rebreak when swiching buffers, if we want
9319 to avoid this we can add a cache that holds pointers to LyXText's
9320 that is not currently in use.
9322 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9325 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9327 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9329 * lyx_main.C: new command line option -x (or --execute) and
9330 -e (or --export). Now direct conversion from .lyx to .tex
9331 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9332 Unfortunately, X is still needed and the GUI pops up during the
9335 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9337 * src/Spacing.C: add a using directive to bring stream stuff into
9339 * src/paragraph.C: ditto
9340 * src/buffer.C: ditto
9342 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9343 from Lars' announcement).
9345 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9346 example files from Tino Meinen.
9348 1999-12-06 Allan Rae <rae@lyx.org>
9350 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9352 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9354 * src/support/lyxstring.C: added a lot of inline for no good
9357 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9358 latexWriteEndChanges, they were not used.
9360 * src/layout.h (operator<<): output operator for PageSides
9362 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9364 * some example files: loaded in LyX 1.0.4 and saved again to update
9365 certain constructs (table format)
9367 * a lot of files: did the change to use fstream/iostream for all
9368 writing of files. Done with a close look at Andre Poenitz's patch.
9370 * some files: whitespace changes.
9372 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9374 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9375 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9376 architecture, we provide our own. It is used unconditionnally, but
9377 I do not think this is a performance problem. Thanks to Angus
9378 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9379 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9381 (GetInset): use my_memcpy.
9385 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9386 it is easier to understand, but it uses less TeX-only constructs now.
9388 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9389 elements contain spaces
9391 * lib/configure: regenerated
9393 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9394 elements contain spaces; display the list of programs that are
9397 * autogen.sh: make sure lib/configure is executable
9399 * lib/examples/*: rename the tutorial examples to begin with the
9400 two-letters language code.
9402 * src/lyxfunc.C (getStatus): do not query current font if no
9405 * src/lyx_cb.C (RunScript): use QuoteName
9406 (MenuRunDvips): ditto
9407 (PrintApplyCB): ditto
9409 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9410 around argument, so that it works well with the current shell.
9411 Does not work properly with OS/2 shells currently.
9413 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9414 * src/LyXSendto.C (SendtoApplyCB): ditto
9415 * src/lyxfunc.C (Dispatch): ditto
9416 * src/buffer.C (runLaTeX): ditto
9417 (runLiterate): ditto
9418 (buildProgram): ditto
9420 * src/lyx_cb.C (RunScript): ditto
9421 (MenuMakeLaTeX): ditto
9423 * src/buffer.h (getLatexName): new method
9425 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9427 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9429 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9430 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9431 (create_math_panel): ditto
9433 * src/lyxfunc.C (getStatus): re-activate the code which gets
9434 current font and cursor; add test for export to html.
9436 * src/lyxrc.C (read): remove unreachable break statements; add a
9439 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9441 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9443 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9444 introduced by faulty regex.
9445 * src/buffer.C: ditto
9446 * src/lastfiles.C: ditto
9447 * src/paragraph.C: ditto
9448 * src/table.C: ditto
9449 * src/vspace.C: ditto
9450 * src/insets/figinset.C: ditto
9451 Note: most of these is absolutely harmless, except the one in
9452 src/mathed formula.C.
9454 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9456 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9457 operation, yielding correct results for the reLyX command.
9459 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * src/support/filetools.C (ExpandPath): removed an over eager
9463 (ReplaceEnvironmentPath): ditto
9465 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9466 shows that we are doing something fishy in our code...
9470 * src/lyxrc.C (read): use a double switch trick to get more help
9471 from the compiler. (the same trick is used in layout.C)
9472 (write): new function. opens a ofstream and pass that to output
9473 (output): new function, takes a ostream and writes the lyxrc
9474 elemts to it. uses a dummy switch to make sure no elements are
9477 * src/lyxlex.h: added a struct pushpophelper for use in functions
9478 with more than one exit point.
9480 * src/lyxlex.[Ch] (GetInteger): made it const
9484 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9486 * src/layout.[hC] : LayoutTags splitted into several enums, new
9487 methods created, better error handling cleaner use of lyxlex. Read
9490 * src/bmtable.[Ch]: change some member prototypes because of the
9491 image const changes.
9493 * commandtags.h, src/LyXAction.C (init): new function:
9494 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9495 This file is not read automatically but you can add \input
9496 preferences to your lyxrc if you want to. We need to discuss how
9499 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9500 in .aux, also remove .bib and .bst files from dependencies when
9503 * src/BufferView.C, src/LyXView.C: add const_cast several places
9504 because of changes to images.
9506 * lib/images/*: same change as for images/*
9508 * lib/lyxrc.example: Default for accept_compound is false not no.
9510 * images/*: changed to be const, however I have som misgivings
9511 about this change so it might be changed back.
9513 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9515 * lib/configure, po/POTFILES.in: regenerated
9517 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9519 * config/lib_configure.m4: removed
9521 * lib/configure.m4: new file (was config/lib_configure.m4)
9523 * configure.in: do not test for rtti, since we do not use it.
9525 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9527 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9528 doubling of allocated space scheme. This makes it faster for large
9529 strings end to use less memory for small strings. xtra rememoved.
9531 * src/insets/figinset.C (waitalarm): commented out.
9532 (GhostscriptMsg): use static_cast
9533 (GhostscriptMsg): use new instead of malloc to allocate memory for
9534 cmap. also delete the memory after use.
9536 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9538 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9539 for changes in bibtex database or style.
9540 (runBibTeX): remove all .bib and .bst files from dep before we
9542 (run): use scanAuc in when dep file already exist.
9544 * src/DepTable.C (remove_files_with_extension): new method
9547 * src/DepTable.[Ch]: made many of the methods const.
9549 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9551 * src/bufferparams.C: make sure that the default textclass is
9552 "article". It used to be the first one by description order, but
9553 now the first one is "docbook".
9555 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9556 string; call Debug::value.
9557 (easyParse): pass complete argument to setDebuggingLevel().
9559 * src/debug.h (value): fix the code that parses debug levels.
9561 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9564 * src/LyXAction.C: use Debug::ACTION as debug channel.
9566 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9568 * NEWS: updated for the future 1.1.3 release.
9570 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9571 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9572 it should. This is of course a controversial change (since many
9573 people will find that their lyx workscreen is suddenly full of
9574 red), but done for the sake of correctness.
9576 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9577 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9579 * src/insets/inseterror.h, src/insets/inseturl.h,
9580 src/insets/insetinfo.h, src/insets/figinset.h,
9581 src/mathed/formulamacro.h, src/mathed/math_macro.h
9582 (EditMessage): add a missing const and add _() to make sure that
9585 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9586 src/insets/insetbib.C, src/support/filetools.C: add `using'
9589 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9590 doing 'Insert index of last word' at the beginning of a paragraph.
9592 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9594 * several files: white-space changes.
9596 * src/mathed/formula.C: removed IsAlpha and IsDigit
9598 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9599 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9602 * src/insets/figinset.C (GetPSSizes): don't break when
9603 "EndComments" is seen. But break when a boundingbox is read.
9605 * all classes inherited from Inset: return value of Clone
9606 changed back to Inset *.
9608 * all classes inherited form MathInset: return value of Clone
9609 changed back to MathedInset *.
9611 * src/insets/figinset.C (runqueue): use a ofstream to output the
9612 gs/ps file. Might need some setpresicion or setw. However I can
9613 see no problem with the current code.
9614 (runqueue): use sleep instead of the alarm/signal code. I just
9615 can't see the difference.
9617 * src/paragraph.C (LyXParagraph): reserve space in the new
9618 paragraph and resize the inserted paragraph to just fit.
9620 * src/lyxfunc.h (operator|=): added operator for func_status.
9622 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9623 check for readable file.
9625 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9626 check for readable file.
9627 (MenuMakeLinuxDoc): ditto
9628 (MenuMakeDocBook): ditto
9629 (MenuMakeAscii): ditto
9630 (InsertAsciiFile): split the test for openable and readable
9632 * src/bmtable.C (draw_bitmaptable): use
9633 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9635 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9636 findtexfile from LaTeX to filetools.
9638 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9639 instead of FilePtr. Needs to be verified by a literate user.
9641 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9643 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9644 (EditMessage): likewise.
9646 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9647 respectively as \textasciitilde and \textasciicircum.
9649 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9651 * src/support/lyxstring.h: made the methods that take iterators
9654 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9655 (regexMatch): made is use the real regex class.
9657 * src/support/Makefile.am: changed to use libtool
9659 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9661 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9663 (MathIsInset ++): changed several macros to be inline functions
9666 * src/mathed/Makefile.am: changed to use libtool
9668 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9670 * src/insets/inset* : Clone changed to const and return type is
9671 the true insettype not just Inset*.
9673 * src/insets/Makefile.am: changed to use libtool
9675 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9677 * src/undo.[Ch] : added empty() and changed some of the method
9680 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9682 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9683 setID use block<> for the bullets array, added const several places.
9685 * src/lyxfunc.C (getStatus): new function
9687 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9688 LyXAction, added const to several funtions.
9690 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9691 a std::map, and to store the dir items in a vector.
9693 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9696 * src/LyXView.[Ch] + other files : changed currentView to view.
9698 * src/LyXAction.[Ch] : ported from the old devel branch.
9700 * src/.cvsignore: added .libs and a.out
9702 * configure.in : changes to use libtool.
9704 * acinclude.m4 : inserted libtool.m4
9706 * .cvsignore: added libtool
9708 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9710 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9711 file name in insets and mathed directories (otherwise the
9712 dependency is not taken in account under cygwin).
9714 * src/text2.C (InsertString[AB]): make sure that we do not try to
9715 read characters past the string length.
9717 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9719 * lib/doc/LaTeXConfig.lyx.in,
9720 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9722 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9723 file saying who created them and when this heppened; this is
9724 useless and annoys tools like cvs.
9726 * lib/layouts/g-brief-{en,de}.layout,
9727 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9728 from Thomas Hartkens <thomas@hartkens.de>.
9730 * src/{insets,mathed}/Makefile.am: do not declare an empty
9731 LDFLAGS, so that it can be set at configure time (useful on Irix
9734 * lib/reLyX/configure.in: make sure that the prefix is set
9735 correctly in LYX_DIR.
9737 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9739 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9740 be used by 'command-sequence' this allows to bind a key to a
9741 sequence of LyX-commands
9742 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9744 * src/LyXAction.C: add "command-sequence"
9746 * src/LyXFunction.C: handling of "command-sequence"
9748 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9749 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9751 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9753 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9755 * src/buffer.C (writeFile): Do not output a comment giving user
9756 and date at the beginning of a .lyx file. This is useless and
9757 annoys cvs anyway; update version number to 1.1.
9759 * src/Makefile.am (LYX_DIR): add this definition, so that a
9760 default path is hardcoded in LyX.
9762 * configure.in: Use LYX_GNU_GETTEXT.
9764 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9765 AM_GNU_GETTEXT with a bug fixed.
9767 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9769 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9771 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9772 which is used to point to LyX data is now LYX_DIR_11x.
9774 * lyx.man: convert to a unix text file; small updates.
9776 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9778 * src/support/LSubstring.[Ch]: made the second arg of most of the
9779 constructors be a const reference.
9781 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9784 * src/support/lyxstring.[Ch] (swap): added missing member function
9785 and specialization of swap(str, str);
9787 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9789 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9790 trace of the old one.
9792 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9793 put the member definitions in undo.C.
9795 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9796 NEW_TEXT and have now only code that was included when this was
9799 * src/intl.C (LCombo): use static_cast
9801 (DispatchCallback): ditto
9803 * src/definitions.h: removed whole file
9805 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9807 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9808 parsing and stores in a std:map. a regex defines the file format.
9809 removed unneeded members.
9811 * src/bufferparams.h: added several enums from definitions.h here.
9812 Removed unsused destructor. Changed some types to use proper enum
9813 types. use block to have the temp_bullets and user_defined_bullets
9814 and to make the whole class assignable.
9816 * src/bufferparams.C (Copy): removed this functions, use a default
9819 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9822 * src/buffer.C (readLyXformat2): commend out all that have with
9823 oldpapersize to do. also comment out all that hve to do with
9824 insetlatex and insetlatexdel.
9825 (setOldPaperStuff): commented out
9827 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9829 * src/LyXAction.C: remove use of inset-latex-insert
9831 * src/mathed/math_panel.C (button_cb): use static_cast
9833 * src/insets/Makefile.am (insets_o_SOURCES): removed
9836 * src/support/lyxstring.C (helper): use the unsigned long
9837 specifier, UL, instead of a static_cast.
9839 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9841 * src/support/block.h: new file. to be used as a c-style array in
9842 classes, so that the class can be assignable.
9844 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9846 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9847 NULL, make sure to return an empty string (it is not possible to
9848 set a string to NULL).
9850 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9852 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9854 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9856 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9857 link line, so that Irix users (for example) can set it explicitely to
9860 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9861 it can be overidden at make time (static or dynamic link, for
9864 * src/vc-backend.C, src/LaTeXFeatures.h,
9865 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9866 statements to bring templates to global namespace.
9868 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9870 * src/support/lyxstring.C (operator[] const): make it standard
9873 * src/minibuffer.C (Init): changed to reflect that more
9874 information is given from the lyxvc and need not be provided here.
9876 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9878 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9880 * src/LyXView.C (UpdateTimerCB): use static_cast
9881 (KeyPressMask_raw_callback): ditto
9883 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9884 buffer_, a lot of changes because of this. currentBuffer() ->
9885 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9886 also changes to other files because of this.
9888 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9890 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9891 have no support for RCS and partial support for CVS, will be
9894 * src/insets/ several files: changes because of function name
9895 changes in Bufferview and LyXView.
9897 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9899 * src/support/LSubstring.[Ch]: new files. These implement a
9900 Substring that can be very convenient to use. i.e. is this
9902 string a = "Mary had a little sheep";
9903 Substring(a, "sheep") = "lamb";
9904 a is now "Mary has a little lamb".
9906 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9907 out patterns and subpatterns of strings. It is used by LSubstring
9908 and also by vc-backend.C
9910 * src/support/lyxstring.C: went over all the assertions used and
9911 tried to correct the wrong ones and flag which of them is required
9912 by the standard. some bugs found because of this. Also removed a
9913 couple of assertions.
9915 * src/support/Makefile.am (libsupport_a_SOURCES): added
9916 LSubstring.[Ch] and LRegex.[Ch]
9918 * src/support/FileInfo.h: have struct stat buf as an object and
9919 not a pointer to one, some changes because of this.
9921 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9922 information in layout when adding the layouts preamble to the
9925 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9928 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9929 because of bug in OS/2.
9931 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9933 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9934 \verbatim@font instead of \ttfamily, so that it can be redefined.
9936 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9937 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9938 src/layout.h, src/text2.C: add 'using' directive to bring the
9939 STL templates we need from the std:: namespace to the global one.
9940 Needed by DEC cxx in strict ansi mode.
9942 * src/support/LIstream.h,src/support/LOstream.h,
9943 src/support/lyxstring.h,src/table.h,
9944 src/lyxlookup.h: do not include <config.h> in header
9945 files. This should be done in the .C files only.
9947 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9951 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9953 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9954 from Kayvan to fix the tth invokation.
9956 * development/lyx.spec.in: updates from Kayvan to reflect the
9957 changes of file names.
9959 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9961 * src/text2.C (InsertStringB): use std::copy
9962 (InsertStringA): use std::copy
9964 * src/bufferlist.C: use a vector to store the buffers in. This is
9965 an internal change and should not affect any other thing.
9967 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9970 * src/text.C (Fill): fix potential bug, one off bug.
9972 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9974 * src/Makefile.am (lyx_main.o): add more files it depends on.
9976 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9978 * src/support/lyxstring.C: use size_t for the reference count,
9979 size, reserved memory and xtra.
9980 (internal_compare): new private member function. Now the compare
9981 functions should work for std::strings that have embedded '\0'
9983 (compare): all compare functions rewritten to use
9986 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9988 * src/support/lyxstring.C (compare): pass c_str()
9989 (compare): pass c_str
9990 (compare): pass c_str
9992 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9994 * src/support/DebugStream.C: <config.h> was not included correctly.
9996 * lib/configure: forgot to re-generate it :( I'll make this file
9997 auto generated soon.
9999 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10001 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10004 * src/support/lyxstring.C: some changes from length() to rep->sz.
10005 avoids a function call.
10007 * src/support/filetools.C (SpaceLess): yet another version of the
10008 algorithm...now per Jean-Marc's suggestions.
10010 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10012 * src/layout.C (less_textclass_desc): functor for use in sorting
10014 (LyXTextClass::Read): sort the textclasses after reading.
10016 * src/support/filetools.C (SpaceLess): new version of the
10017 SpaceLess functions. What problems does this one give? Please
10020 * images/banner_bw.xbm: made the arrays unsigned char *
10022 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10024 * src/support/lyxstring.C (find): remove bogus assertion in the
10025 two versions of find where this has not been done yet.
10027 * src/support/lyxlib.h: add missing int return type to
10030 * src/menus.C (ShowFileMenu): disable exporting to html if no
10031 html export command is present.
10033 * config/lib_configure.m4: add a test for an HTML converter. The
10034 programs checked for are, in this order: tth, latex2html and
10037 * lib/configure: generated from config/lib_configure.m4.
10039 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10040 html converter. The parameters are now passed through $$FName and
10041 $$OutName, instead of standard input/output.
10043 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10045 * lib/lyxrc.example: update description of \html_command.
10046 add "quotes" around \screen_font_xxx font setting examples to help
10047 people who use fonts with spaces in their names.
10049 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10051 * Distribution files: updates for v1.1.2
10053 * src/support/lyxstring.C (find): remove bogus assert and return
10054 npos for the same condition.
10056 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10058 * added patch for OS/2 from SMiyata.
10060 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10062 * src/text2.C (CutSelection): make space_wrapped a bool
10063 (CutSelection): dont declare int i until we have to.
10064 (alphaCounter): return a char const *.
10066 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10068 * src/support/syscall.C (Systemcalls::kill):
10069 src/support/filetools.C (PutEnv, PutEnvPath):
10070 src/lyx_cb.C (addNewlineAndDepth):
10071 src/FontInfo.C (FontInfo::resize): condition some #warning
10072 directives with WITH_WARNINGS.
10075 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10077 * src/layout.[Ch] + several files: access to class variables
10078 limited and made accessor functions instead a lot of code changed
10079 becuase of this. Also instead of returning pointers often a const
10080 reference is returned instead.
10082 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10084 * src/Makefile.am (dist-hook): added used to remove the CVS from
10085 cheaders upon creating a dist
10086 (EXTRA_DIST): added cheaders
10088 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10089 a character not as a small integer.
10091 * src/support/lyxstring.C (find): removed Assert and added i >=
10092 rep->sz to the first if.
10094 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10096 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10097 src/LyXView.C src/buffer.C src/bufferparams.C
10098 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10099 src/text2.C src/insets/insetinclude.C:
10100 lyxlayout renamed to textclasslist.
10102 * src/layout.C: some lyxerr changes.
10104 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10105 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10106 (LyXLayoutList): removed all traces of this class.
10107 (LyXTextClass::Read): rewrote LT_STYLE
10108 (LyXTextClass::hasLayout): new function
10109 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10110 both const and nonconst version.
10111 (LyXTextClass::delete_layout): new function.
10112 (LyXTextClassList::Style): bug fix. do the right thing if layout
10114 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10115 (LyXTextClassList::NameOfLayout): ditto
10116 (LyXTextClassList::Load): ditto
10118 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10120 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10122 * src/LyXAction.C (LookupFunc): added a workaround for sun
10123 compiler, on the other hand...we don't know if the current code
10124 compiles on sun at all...
10126 * src/support/filetools.C (CleanupPath): subst fix
10128 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10131 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10132 complained about this one?
10134 * src/insets/insetinclude.C (Latex): subst fix
10136 * src/insets/insetbib.C (getKeys): subst fix
10138 * src/LyXSendto.C (SendtoApplyCB): subst fix
10140 * src/lyx_main.C (init): subst fix
10142 * src/layout.C (Read): subst fix
10144 * src/lyx_sendfax_main.C (button_send): subst fix
10146 * src/buffer.C (RoffAsciiTable): subst fix
10148 * src/lyx_cb.C (MenuFax): subst fix
10149 (PrintApplyCB): subst fix
10151 1999-10-26 Juergen Vigna <jug@sad.it>
10153 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10155 (Read): Cleaned up this code so now we read only format vestion >= 5
10157 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10159 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10160 come nobody has complained about this one?
10162 * src/insets/insetinclude.C (Latex): subst fix
10164 * src/insets/insetbib.C (getKeys): subst fix
10166 * src/lyx_main.C (init): subst fix
10168 * src/layout.C (Read): subst fix
10170 * src/buffer.C (RoffAsciiTable): subst fix
10172 * src/lyx_cb.C (MenuFax): subst fix.
10174 * src/layout.[hC] + some other files: rewrote to use
10175 std::container to store textclasses and layouts in.
10176 Simplified, removed a lot of code. Make all classes
10177 assignable. Further simplifications and review of type
10178 use still to be one.
10180 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10181 lastfiles to create the lastfiles partr of the menu.
10183 * src/lastfiles.[Ch]: rewritten to use deque to store the
10184 lastfiles in. Uses fstream for reading and writing. Simplifies
10187 * src/support/syscall.C: remove explicit cast.
10189 * src/BufferView.C (CursorToggleCB): removed code snippets that
10190 were commented out.
10191 use explicat C++ style casts instead of C style casts. also use
10192 u_vdata instea of passing pointers in longs.
10194 * src/PaperLayout.C: removed code snippets that were commented out.
10196 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10198 * src/lyx_main.C: removed code snippets that wer commented out.
10200 * src/paragraph.C: removed code snippets that were commented out.
10202 * src/lyxvc.C (logClose): use static_cast
10204 (viewLog): remove explicit cast to void*
10205 (showLog): removed old commented code
10207 * src/menus.C: use static_cast instead of C style casts. use
10208 u_vdata instead of u_ldata. remove explicit cast to (long) for
10209 pointers. Removed old code that was commented out.
10211 * src/insets/inset.C: removed old commented func
10213 * src/insets/insetref.C (InsetRef): removed old code that had been
10214 commented out for a long time.
10216 (escape): removed C style cast
10218 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10220 * src/insets/insetlatex.C (Draw): removed old commented code
10221 (Read): rewritten to use string
10223 * src/insets/insetlabel.C (escape): removed C style cast
10225 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10227 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10228 old commented code.
10230 * src/insets/insetinclude.h: removed a couple of stupid bools
10232 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10233 (Clone): remove C style cast
10234 (getKeys): changed list to lst because of std::list
10236 * src/insets/inseterror.C (Draw): removed som old commented code.
10238 * src/insets/insetcommand.C (Draw): removed some old commented code.
10240 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10241 commented out forever.
10242 (bibitem_cb): use static_cast instead of C style cast
10243 use of vdata changed to u_vdata.
10245 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10247 (CloseUrlCB): use static_cast instead of C style cast.
10248 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10250 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10251 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10252 (CloseInfoCB): static_cast from ob->u_vdata instead.
10253 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10256 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10257 (C_InsetError_CloseErrorCB): forward the ob parameter
10258 (CloseErrorCB): static_cast from ob->u_vdata instead.
10260 * src/vspace.h: include LString.h since we use string in this class.
10262 * src/vspace.C (lyx_advance): changed name from advance because of
10263 nameclash with stl. And since we cannot use namespaces yet...I
10264 used a lyx_ prefix instead. Expect this to change when we begin
10267 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10269 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10270 and removed now defunct constructor and deconstructor.
10272 * src/BufferView.h: have backstack as a object not as a pointer.
10273 removed initialization from constructor. added include for BackStack
10275 * development/lyx.spec.in (%build): add CFLAGS also.
10277 * src/screen.C (drawFrame): removed another warning.
10279 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10281 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10282 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10283 README and ANNOUNCE a bit for the next release. More work is
10286 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10287 unbreakable if we are in freespacing mode (LyX-Code), but not in
10290 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10292 * src/BackStack.h: fixed initialization order in constructor
10294 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10296 * acinclude.m4 (VERSION): new rules for when a version is
10297 development, added also a variable for prerelease.
10298 (warnings): we set with_warnings=yes for prereleases
10299 (lyx_opt): prereleases compile with same optimization as development
10300 (CXXFLAGS): only use pedantic if we are a development version
10302 * src/BufferView.C (restorePosition): don't do anything if the
10303 backstack is empty.
10305 * src/BackStack.h: added member empty, use this to test if there
10306 is anything to pop...
10308 1999-10-25 Juergen Vigna <jug@sad.it>
10311 * forms/layout_forms.fd +
10312 * forms/latexoptions.fd +
10313 * lyx.fd: changed for various form resize issues
10315 * src/mathed/math_panel.C +
10316 * src/insets/inseterror.C +
10317 * src/insets/insetinfo.C +
10318 * src/insets/inseturl.C +
10319 * src/insets/inseturl.h +
10321 * src/LyXSendto.C +
10322 * src/PaperLayout.C +
10323 * src/ParagraphExtra.C +
10324 * src/TableLayout.C +
10326 * src/layout_forms.C +
10333 * src/menus.C: fixed various resize issues. So now forms can be
10334 resized savely or not be resized at all.
10336 * forms/form_url.fd +
10337 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10340 * src/insets/Makefile.am: added files form_url.[Ch]
10342 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10344 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10345 (and presumably 6.2).
10347 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10348 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10349 remaining static member callbacks.
10351 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10354 * src/support/lyxstring.h: declare struct Srep as friend of
10355 lyxstring, since DEC cxx complains otherwise.
10357 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10359 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10361 * src/LaTeX.C (run): made run_bibtex also depend on files with
10363 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10364 are put into the dependency file.
10366 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10367 the code has shown itself to work
10368 (create_ispell_pipe): removed another warning, added a comment
10371 * src/minibuffer.C (ExecutingCB): removed code that has been
10372 commented out a long time
10374 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10375 out code + a warning.
10377 * src/support/lyxstring.h: comment out the three private
10378 operators, when compiling with string ansi conforming compilers
10379 they make problems.
10381 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10383 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10384 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10387 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10390 * src/mathed/math_panel.C (create_math_panel): remove explicit
10393 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10396 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10397 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10398 to XCreatePixmapFromBitmapData
10399 (fl_set_bmtable_data): change the last argument to be unsigned
10401 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10402 and bh to be unsigned int, remove explicit casts in call to
10403 XReadBitmapFileData.
10405 * images/arrows.xbm: made the arrays unsigned char *
10406 * images/varsz.xbm: ditto
10407 * images/misc.xbm: ditto
10408 * images/greek.xbm: ditto
10409 * images/dots.xbm: ditto
10410 * images/brel.xbm: ditto
10411 * images/bop.xbm: ditto
10413 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10415 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10416 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10417 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10419 (LYX_CXX_CHEADERS): added <clocale> to the test.
10421 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10423 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10425 * src/support/lyxstring.C (append): fixed something that must be a
10426 bug, rep->assign was used instead of rep->append.
10428 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10431 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10432 lyx insert double chars. Fix spotted by Kayvan.
10434 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10436 * Fixed the tth support. I messed up with the Emacs patch apply feature
10437 and omitted the changes in lyxrc.C.
10439 1999-10-22 Juergen Vigna <jug@sad.it>
10441 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10443 * src/lyx_cb.C (MenuInsertRef) +
10444 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10445 the form cannot be resized under it limits (fixes a segfault)
10447 * src/lyx.C (create_form_form_ref) +
10448 * forms/lyx.fd: Changed Gravity on name input field so that it is
10451 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10453 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10454 <ostream> and <istream>.
10456 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10457 whether <fstream> provides the latest standard features, or if we
10458 have an oldstyle library (like in egcs).
10459 (LYX_CXX_STL_STRING): fix the test.
10461 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10462 code on MODERN_STL_STREAM.
10464 * src/support/lyxstring.h: use L{I,O}stream.h.
10466 * src/support/L{I,O}stream.h: new files, designed to setup
10467 correctly streams for our use
10468 - includes the right header depending on STL capabilities
10469 - puts std::ostream and std::endl (for LOStream.h) or
10470 std::istream (LIStream.h) in toplevel namespace.
10472 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10474 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10475 was a bib file that had been changed we ensure that bibtex is run.
10476 (runBibTeX): enhanced to extract the names of the bib files and
10477 getting their absolute path and enter them into the dep file.
10478 (findtexfile): static func that is used to look for tex-files,
10479 checks for absolute patchs and tries also with kpsewhich.
10480 Alternative ways of finding the correct files are wanted. Will
10482 (do_popen): function that runs a command using popen and returns
10483 the whole output of that command in a string. Should be moved to
10486 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10487 file with extension ext has changed.
10489 * src/insets/figinset.C: added ifdef guards around the fl_free
10490 code that jug commented out. Now it is commented out when
10491 compiling with XForms == 0.89.
10493 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10494 to lyxstring.C, and only keep a forward declaration in
10495 lyxstring.h. Simplifies the header file a bit and should help a
10496 bit on compile time too. Also changes to Srep will not mandate a
10497 recompile of code just using string.
10498 (~lyxstring): definition moved here since it uses srep.
10499 (size): definition moved here since it uses srep.
10501 * src/support/lyxstring.h: removed a couple of "inline" that should
10504 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10506 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10509 1999-10-21 Juergen Vigna <jug@sad.it>
10511 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10512 set to left if I just remove the width entry (or it is empty).
10514 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10515 paragraph when having dummy paragraphs.
10517 1999-10-20 Juergen Vigna <jug@sad.it>
10519 * src/insets/figinset.C: just commented some fl_free_form calls
10520 and added warnings so that this calls should be activated later
10521 again. This avoids for now a segfault, but we have a memory leak!
10523 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10524 'const char * argument' to 'string argument', this should
10525 fix some Asserts() in lyxstring.C.
10527 * src/lyxfunc.h: Removed the function argAsString(const char *)
10528 as it is not used anymore.
10530 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10532 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10535 * src/Literate.h: some funcs moved from public to private to make
10536 interface clearer. Unneeded args removed.
10538 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10540 (scanBuildLogFile): ditto
10542 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10543 normal TeX Error. Still room for improvement.
10545 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10547 * src/buffer.C (insertErrors): changes to make the error
10548 desctription show properly.
10550 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10553 * src/support/lyxstring.C (helper): changed to use
10554 sizeof(object->rep->ref).
10555 (operator>>): changed to use a pointer instead.
10557 * src/support/lyxstring.h: changed const reference & to value_type
10558 const & lets see if that helps.
10560 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10562 * Makefile.am (rpmdist): fixed to have non static package and
10565 * src/support/lyxstring.C: removed the compilation guards
10567 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10570 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10571 conditional compile of lyxstring.Ch
10573 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10574 stupid check, but it is a lot better than the bastring hack.
10575 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10577 * several files: changed string::erase into string::clear. Not
10580 * src/chset.C (encodeString): use a char temporary instead
10582 * src/table.C (TexEndOfCell): added tostr around
10583 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10584 (TexEndOfCell): ditto
10585 (TexEndOfCell): ditto
10586 (TexEndOfCell): ditto
10587 (DocBookEndOfCell): ditto
10588 (DocBookEndOfCell): ditto
10589 (DocBookEndOfCell): ditto
10590 (DocBookEndOfCell): ditto
10592 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10594 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10596 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10597 (MenuBuildProg): added tostr around ret
10598 (MenuRunChktex): added tostr around ret
10599 (DocumentApplyCB): added tostr around ret
10601 * src/chset.C (encodeString): added tostr around t->ic
10603 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10604 (makeLaTeXFile): added tostr around tocdepth
10605 (makeLaTeXFile): added tostr around ftcound - 1
10607 * src/insets/insetbib.C (setCounter): added tostr around counter.
10609 * src/support/lyxstring.h: added an operator+=(int) to catch more
10612 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10613 (lyxstring): We DON'T allow NULL pointers.
10615 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10617 * src/mathed/math_macro.C (MathMacroArgument::Write,
10618 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10619 when writing them out.
10621 * src/LString.C: remove, since it is not used anymore.
10623 * src/support/lyxstring.C: condition the content to
10624 USE_INCLUDED_STRING macro.
10626 * src/mathed/math_symbols.C, src/support/lstrings.C,
10627 src/support/lyxstring.C: add `using' directive to specify what
10628 we need in <algorithm>. I do not think that we need to
10629 conditionalize this, but any thought is appreciated.
10631 * many files: change all callback functions to "C" linkage
10632 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10633 strict_ansi. Those who were static are now global.
10634 The case of callbacks which are static class members is
10635 trickier, since we have to make C wrappers around them (see
10636 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10637 did not finish this yet, since it defeats the purpose of
10638 encapsulation, and I am not sure what the best route is.
10640 1999-10-19 Juergen Vigna <jug@sad.it>
10642 * src/support/lyxstring.C (lyxstring): we permit to have a null
10643 pointer as assignment value and just don't assign it.
10645 * src/vspace.C (nextToken): corrected this function substituting
10646 find_first(_not)_of with find_last_of.
10648 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10649 (TableOptCloseCB) (TableSpeCloseCB):
10650 inserted fl_set_focus call for problem with fl_hide_form() in
10653 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10655 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10658 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10660 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10661 LyXLex::next() and not eatline() to get its argument.
10663 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10665 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10666 instead, use fstreams for io of the depfile, removed unneeded
10667 functions and variables.
10669 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10670 vector instead, removed all functions and variables that is not in
10673 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10675 * src/buffer.C (insertErrors): use new interface to TeXError
10677 * Makefile.am (rpmdist): added a rpmdist target
10679 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10680 per Kayvan's instructions.
10682 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10684 * src/Makefile.am: add a definition for localedir, so that locales
10685 are found after installation (Kayvan)
10687 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10689 * development/.cvsignore: new file.
10691 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10694 C++ compiler provides wrappers for C headers and use our alternate
10697 * configure.in: use LYX_CXX_CHEADERS.
10699 * src/cheader/: new directory, populated with cname headers from
10700 libstdc++-2.8.1. They are a bit old, but probably good enough for
10701 what we want (support compilers who lack them).
10703 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10704 from includes. It turns out is was stupid.
10706 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10708 * lib/Makefile.am (install-data-local): forgot a ';'
10709 (install-data-local): forgot a '\'
10710 (libinstalldirs): needed after all. reintroduced.
10712 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10714 * configure.in (AC_OUTPUT): added lyx.spec
10716 * development/lyx.spec: removed file
10718 * development/lyx.spec.in: new file
10720 * po/*.po: merged with lyx.pot becuase of make distcheck
10722 * lib/Makefile.am (dist-hook): added dist-hook so that
10723 documentation files will be included when doing a make
10724 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10725 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10727 more: tried to make install do the right thing, exclude CVS dirs
10730 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10731 Path would fit in more nicely.
10733 * all files that used to use pathstack: uses now Path instead.
10734 This change was a lot easier than expected.
10736 * src/support/path.h: new file
10738 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10740 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10742 * src/support/lyxstring.C (getline): Default arg was given for
10745 * Configure.cmd: removed file
10747 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10749 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10750 streams classes and types, add the proper 'using' statements when
10751 MODERN_STL is defined.
10753 * src/debug.h: move the << operator definition after the inclusion
10756 * src/support/filetools.C: include "LAssert.h", which is needed
10759 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10762 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10763 include "debug.h" to define a proper ostream.
10765 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10767 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10768 method to the SystemCall class which can kill a process, but it's
10769 not fully implemented yet.
10771 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10773 * src/support/FileInfo.h: Better documentation
10775 * src/lyxfunc.C: Added support for buffer-export html
10777 * src/menus.C: Added Export->As HTML...
10779 * lib/bind/*.bind: Added short-cut for buffer-export html
10781 * src/lyxrc.*: Added support for new \tth_command
10783 * lib/lyxrc.example: Added stuff for new \tth_command
10785 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10787 * lib/Makefile.am (IMAGES): removed images/README
10788 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10789 installes in correct place. Check permisions is installed
10792 * src/LaTeX.C: some no-op changes moved declaration of some
10795 * src/LaTeX.h (LATEX_H): changed include guard name
10797 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10799 * lib/reLyX/Makefile.am: install noweb2lyx.
10801 * lib/Makefile.am: install configure.
10803 * lib/reLyX/configure.in: declare a config aux dir; set package
10804 name to lyx (not sure what the best solution is); generate noweb2lyx.
10806 * lib/layouts/egs.layout: fix the bibliography layout.
10808 1999-10-08 Jürgen Vigna <jug@sad.it>
10810 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10811 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10812 it returned without continuing to search the path.
10814 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10816 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10817 also fixes a bug. It is not allowed to do tricks with std::strings
10818 like: string a("hei"); &a[e]; this will not give what you
10819 think... Any reason for the complexity in this func?
10821 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10823 * Updated README and INSTALL a bit, mostly to check that my
10824 CVS rights are correctly set up.
10826 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10828 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10829 does not allow '\0' chars but lyxstring and std::string does.
10831 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10833 * autogen.sh (AUTOCONF): let the autogen script create the
10834 POTFILES.in file too. POTFILES.in should perhaps now not be
10835 included in the cvs module.
10837 * some more files changed to use C++ includes instead of C ones.
10839 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10841 (Reread): added tostr to nlink. buggy output otherwise.
10842 (Reread): added a string() around szMode when assigning to Buffer,
10843 without this I got a log of garbled info strings.
10845 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10848 * I have added several ostream & operator<<(ostream &, some_type)
10849 functions. This has been done to avoid casting and warnings when
10850 outputting enums to lyxerr. This as thus eliminated a lot of
10851 explicit casts and has made the code clearer. Among the enums
10852 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10853 mathed enums, some font enum the Debug::type enum.
10855 * src/support/lyxstring.h (clear): missing method. equivalent of
10858 * all files that contained "stderr": rewrote constructs that used
10859 stderr to use lyxerr instead. (except bmtable)
10861 * src/support/DebugStream.h (level): and the passed t with
10862 Debug::ANY to avoid spurious bits set.
10864 * src/debug.h (Debug::type value): made it accept strings of the
10865 type INFO,INIT,KEY.
10867 * configure.in (Check for programs): Added a check for kpsewhich,
10868 the latex generation will use this later to better the dicovery of
10871 * src/BufferView.C (create_view): we don't need to cast this to
10872 (void*) that is done automatically.
10873 (WorkAreaButtonPress): removed some dead code.
10875 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10877 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10878 is not overwritten when translated (David Sua'rez de Lis).
10880 * lib/CREDITS: Added David Sua'rez de Lis
10882 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10884 * src/bufferparams.C (BufferParams): default input encoding is now
10887 * acinclude.m4 (cross_compiling): comment out macro
10888 LYX_GXX_STRENGTH_REDUCE.
10890 * acconfig.h: make sure that const is not defined (to empty) when
10891 we are compiling C++. Remove commented out code using SIZEOF_xx
10894 * configure.in : move the test for const and inline as late as
10895 possible so that these C tests do not interefere with C++ ones.
10896 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10897 has not been proven.
10899 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10901 * src/table.C (getDocBookAlign): remove bad default value for
10902 isColumn parameter.
10904 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10906 (ShowFileMenu2): ditto.
10908 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10909 of files to ignore.
10911 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10913 * Most files: finished the change from the old error code to use
10914 DebugStream for all lyxerr debugging. Only minor changes remain
10915 (e.g. the setting of debug levels using strings instead of number)
10917 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10919 * src/layout.C (Add): Changed to use compare_no_case instead of
10922 * src/FontInfo.C: changed loop variable type too string::size_type.
10924 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10926 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10927 set ETAGS_ARGS to --c++
10929 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10931 * src/table.C (DocBookEndOfCell): commented out two unused variables
10933 * src/paragraph.C: commented out four unused variables.
10935 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10936 insed a if clause with type string::size_type.
10938 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10941 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10943 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10944 variable, also changed loop to go from 0 to lenght + 1, instead of
10945 -1 to length. This should be correct.
10947 * src/LaTeX.C (scanError): use string::size_type as loop variable
10950 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10951 (l.896) since y_tmp and row was not used anyway.
10953 * src/insets/insetref.C (escape): use string::size_type as loop
10956 * src/insets/insetquotes.C (Width): use string::size_type as loop
10958 (Draw): use string::size_type as loop variable type.
10960 * src/insets/insetlatexaccent.C (checkContents): use
10961 string::size_type as loop variable type.
10963 * src/insets/insetlabel.C (escape): use string::size_type as loop
10966 * src/insets/insetinfo.C: added an extern for current_view.
10968 * src/insets/insetcommand.C (scanCommand): use string::size_type
10969 as loop variable type.
10971 * most files: removed the RCS tags. With them we had to recompile
10972 a lot of files after a simple cvs commit. Also we have never used
10973 them for anything meaningful.
10975 * most files: tags-query-replace NULL 0. As adviced several plases
10976 we now use "0" instead of "NULL" in our code.
10978 * src/support/filetools.C (SpaceLess): use string::size_type as
10979 loop variable type.
10981 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10983 * src/paragraph.C: fixed up some more string stuff.
10985 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10987 * src/support/filetools.h: make modestr a std::string.
10989 * src/filetools.C (GetEnv): made ch really const.
10991 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10992 made code that used these use max/min from <algorithm> instead.
10994 * changed several c library include files to their equivalent c++
10995 library include files. All is not changed yet.
10997 * created a support subdir in src, put lyxstring and lstrings
10998 there + the extra files atexit, fileblock, strerror. Created
10999 Makefile.am. edited configure.in and src/Makefile.am to use this
11000 new subdir. More files moved to support.
11002 * imported som of the functions from repository lyx, filetools
11004 * ran tags-query-replace on LString -> string, corrected the bogus
11005 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11006 is still some errors in there. This is errors where too much or
11007 too litle get deleted from strings (string::erase, string::substr,
11008 string::replace), there can also be some off by one errors, or
11009 just plain wrong use of functions from lstrings. Viewing of quotes
11012 * LyX is now running fairly well with string, but there are
11013 certainly some bugs yet (see above) also string is quite different
11014 from LString among others in that it does not allow null pointers
11015 passed in and will abort if it gets any.
11017 * Added the revtex4 files I forgot when setting up the repository.
11019 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11021 * All over: Tried to clean everything up so that only the files
11022 that we really need are included in the cvs repository.
11023 * Switched to use automake.
11024 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11025 * Install has not been checked.
11027 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11029 * po/pt.po: Three errors:
11030 l.533 and l.538 format specification error
11031 l. 402 duplicate entry, I just deleted it.