1 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
6 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
8 * src/mathed/math_inset.h: move LString.h to be included first
10 * src/insets/insetfloat.C: adjust for change in private variable names
12 * src/frontends/xforms/xform_helpers.h : don't include config.h
14 * src/frontends/xforms/xform_helpers.C: adjust the order of
15 includes, some whitespace changes.
18 * src/trans.C (Load): constify filename and res
20 * src/text2.C (SetCounter): call Floating::name()
22 * src/screen.C: change to not use owner from WorkArea, but from
25 * src/lyxfunc.C: adjust because of changes in Intl.
27 * src/intl.h: make trans a object instead of pointer, inlucd
28 trans_mgr.h in this file.
29 (getTrans): return a reference to TransManager
31 * src/intl.C: don't include trans_mgr.h here
32 modify calls to trans to work on object instead of on pointer
34 * src/WorkArea.h: add using for Signal1
35 comment out forward decl of BufferView.
37 remove class variable owner_ and getter method for this.
39 * src/WorkArea.C: don't include BufferView.h
40 (WorkArea): change to not take a BufferView.h, use signals
42 (scroll_cb): emit signal
44 * src/LaTeXFeatures.C: include Floatlist.h
45 (getPackages): only load flot.sty when needed
46 (getMacros): prepare for outputting the correct code to preamble.
48 * src/Floating.h: make all variables private + rename to var_.
49 (Floating): default ctor
50 (Floating): complex ctor to set a complete Floating
56 * src/FloatList.C (FloatList): use Floating's constructor
59 (newFloat): call type()
60 (defaultPlacement): call placement()
61 (operator): new operator
63 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
64 (scrollUp): call pimpl's scrollCB
66 (pasteClipboard): constify clip
68 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
69 (insertErrors): constify desctext, errortext, msgtxt and errorrow
70 (open_new_inset): delete some commented code.
72 * src/BufferView.[Ch] (enterView): comment out
75 (workAreaMotionNotify): ditto
76 (workAreaButtonPress): ditto
79 (workAreaButtonRelease): ditto
80 (workAreaExpose): ditto
82 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
83 to compile with cvs gcc (2.97).
85 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
87 * lib/ui/default.ui: menu structure cleanup.
89 * lib/languages: add description of entries.
91 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
93 * src/insets/ExternalTemplate.C (readTemplates): change debug
95 (readTemplate): use lyxlex.printError to report read errors.
98 * src/insets/insetexternal.C (Read): suppress debug message when
101 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
103 * src/insets/insetinclude.C (Ascii): New method. Currently
104 supports only verbatim input.
106 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
108 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
110 2000-12-22 Juergen Vigna <jug@sad.it>
112 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
113 have a selection and button == 3.
114 (UpdateLocal): if what == INIT clear selection if existent!
115 (InsetButtonPress): don't activate the cell inset on button==3
117 (LocalDispatch): move curor up/down if exiting an inset which this
120 2000-12-20 Juergen Vigna <jug@sad.it>
122 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
123 calling for the math-panel (do not unlock the math-inset if locked)!
125 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
126 text-insets (with x-offset).
128 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
129 alignment of multicolumn-cells.
131 2000-12-19 Juergen Vigna <jug@sad.it>
133 * src/lyxfunc.C (Dispatch):
134 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
137 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
139 * src/WorkArea.C (work_area_handler): simplify the key/keysym
140 handling for XForms 0.89, this might have rendered some cases
141 unusable. I have at least deadkeys, accent-xxx and KP_x working.
142 Please report proplems.
144 * src/lyxfunc.C (processKeySym): make the self-insert handling
147 2000-12-18 Baruch Even <baruch.even@writeme.com>
149 * src/LaTeX.C (deplog): fix spelling errors
150 * src/text2.C (CutSelection): ditto
151 * src/lyxfunc.C (Dispatch): ditto
153 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
155 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
157 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
158 and h_align in default init.
159 adjust calls to MathedRowSt
161 * src/mathed/math_iter.C: adjust calls to MathedRowSt
162 * src/mathed/math_iter.h (getAD): ditto
164 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
165 methods setBaseline, ascent, descent
166 (class MathMatrixInset): remove method GetAlign, change h_align
169 * src/lyxfunc.C (processKeySym): discover the correct argument if
170 the action is LFUN_SELFINSERT
172 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
174 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
177 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
179 * src/support/copy.C: don't include filetools.h
181 * lib/images: revert to old banner, drop the cucumber.
183 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
185 * src/converter.C (Formats::View): Change the current directory to
186 the directory of the file.
188 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
190 * src/kbsequence.C (addkey): also clear sequence and modifiers if
193 * src/BufferView2.C (theLockingInset): return 0 if text is 0
195 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
197 * Many files: Fix RTL support for insettext.
199 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
201 * README: add mention of broken ghostscript versions, remove
202 reference to non-existent BUGS file
204 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
206 * src/support/lstrings.C (compare_no_case): small fix. When passed
207 length, should use it in the size comparison.
209 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
211 * src/insets/insetexternal.C (getScreenLabel): Return a default
212 value if the template label is empty.
214 * src/lyxlookup.C: do not condition on FL_REVISION.
217 * src/sp_form.C: fix the font size of some text entries
219 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
220 after TOC when there is no TOC.
222 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
223 bind file if it has not been done yet.
224 (read): remove local bindFile variable. Try to fix the handling of
225 RC_BIND and RC_BINDFILE.
227 * src/lyx_main.C (init): use readBindFileIfNeeded().
229 * lib/languages: Change description of german to "German (new
232 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
234 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
235 "Apply" buttons if arg is non-zero.
237 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
238 launching the popup if sufficient info is passed to
239 LFUN_CITATION_CREATE.
241 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
243 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
244 labels (disabled in 1.1.6).
246 * src/lyxrc.[Ch]: New variable label_init_length
248 * mathed/formula.C (LocalDispatch): Preserve the label when
249 changing from display math to eqnarray (however, the label
250 do not appear at the first line, as one might expects, but at the
252 (LocalDispatch): When inserting a label to a formula which already
253 have a label, the old label is used as default value.
254 Also, if the label is changed, then all references to the label
257 * src/mathed/math_iter.C (setLabel): Allow to set the label
258 even if it is empty. This is needed to allow deletion of a label
261 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
262 refernces only if the old label appears once in the document.
264 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
266 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
267 <gehlert@Rcs1.urz.tu-dresden.de>
269 * src/frontends/xforms/FormBase.C: comment out debug.h
271 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
272 code in xform_helpers instead.
273 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
275 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
276 Use N_(), rather than _() when creating strings to pass to browseFile()
277 because browseFile calls gettext() itself now.
279 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
280 display the filename correctly.
282 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
284 * src/converter.C (Move): New method. Used to move file or files
285 from temp dir to the output dir. (this fixes the bug that
286 exporting linuxdoc/docbook document to html would not move all
287 html file from temp directory).
289 * src/support/filetools.C (DirList): Fixed.
291 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
293 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
295 * src/converter.C (Add): Remove $$i when setting latex_command.
297 * src/text.C (IsBoundary): Return false when pos = 0.
299 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
301 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
303 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
305 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
306 need to empty the fields to turn off use of the geometry package!
308 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
310 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
311 (Buffer const &), not a (BufferParams const &) and so fix a crash
312 caused by using current_view before it had been initialised. Not
313 the best way to do this, but much easier than changing
314 Inset::Clone(Buffer const &) to Inset::Clone().
317 * src/tabular.C: changed call to CopyIntoMinibuffer().
319 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
321 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
323 * src/lyxfunc.C (getStatus): disable insertion of floats in a
326 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
328 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
329 changed filter for screen fonts input filter from int to float
331 * src/frontends/xforms/input_validators.c: removed.
332 * src/frontends/xforms/input_validators.C: new file. Can now call C++
333 functions from within the filter functions.
335 * src/frontends/xforms/input_validators.[Ch]
336 (fl_unsigned_float_filter): new filter function.
338 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
339 confused now! And if you think I'm going to do this in
340 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
342 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
344 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
346 * src/WorkArea.C (work_area_handler): don't handle button requests
347 if xbutton.button == 0
349 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
351 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
352 It creates a lot of interesting problems.
354 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
356 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
357 the menu exists in the current menubar before opening it.
359 * src/MenuBackend.C (hasSubmenu): new method.
361 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
362 action value by offsetting actions by a large constant (so that
363 bogs choice result will be less than this constant).
365 * lib/bind/fi_menus.bind: more cleanup to menus.
366 * lib/bind/sciword.bind: ditto.
367 * lib/bind/xemacs.bind: ditto.
368 * lib/bind/emacs.bind: ditto.
369 * lib/bind/pt_menus.bind: ditto.
370 * lib/bind/hu_menus.bind: ditto.
372 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
374 * INSTALL: update PROBLEMS section.
376 * src/lyxlookup.h: remove condition on xforms version, since we
377 should not include it if not appropriate.
379 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
381 * src/LColor.C: "latex text" -> "latex inset" (from
384 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
386 * src/frontends/kde/FormTabularCreate.C:
387 * src/frontends/kde/citationdlg.C:
388 * src/frontends/kde/copyrightdlg.C:
389 * src/frontends/kde/paradlg.C:
390 * src/frontends/kde/paraextradlg.C:
391 * src/frontends/kde/parageneraldlg.C:
392 * src/frontends/kde/printdlg.C:
393 * src/frontends/kde/refdlg.C:
394 * src/frontends/kde/tabcreatedlg.C:
395 * src/frontends/kde/tocdlg.C:
396 * src/frontends/kde/urldlg.C: add necessary headers
399 * src/frontends/kde/dlg/emptytable.C:
400 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
401 default parameters (from Angus Leeming)
403 * src/frontends/kde/dlg/moc/.cvsignore:
404 * src/frontends/kde/dlg/.cvsignore:
405 * src/frontends/kde/moc/.cvsignore: fix the library name
408 * src/frontends/kde/paradlg.C:
409 * src/frontends/kde/parageneraldlg.C:
410 * src/frontends/kde/dlg/para.dlg:
411 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
413 * src/frontends/kde/dlg/README: clarified qtarch version
415 * src/frontends/kde/dlg/Makefile.am: removed the
416 dlg rules as they created spontaneous rebuilds
417 (not a good idea as it requires qtarch)
419 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
421 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
422 fixlevel along with xforms version.
424 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
425 xforms version is strictly less than 0.89.5.
426 * src/lyx_gui.C (LyXGUI): ditto.
427 * src/LyXView.C (show): ditto.
429 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
431 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
432 movement in inset in RTL text.
433 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
434 (workAreaButtonRelease): Do not open a float when there is a selection.
436 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
438 * src/spellchecker.C (RunSpellChecker): Open all floats before
441 * src/text.C (InsertChar): Consider "," as a part of a number
442 (for LTR numbers in RTL text code).
443 (IsBoundary): Fixed (and simplified).
444 (InsertChar): Recalculate cursor boundary.
447 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
449 * src/spellchecker.C: fix figures with pspell enabled
451 * src/insets/figinset.C: workaround for gs hang xforms bug
453 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
455 * lib/bind/??_menus.bind: comment out the entries corresponding to
456 real menus. They should be eventually removed, but I'll let the
457 language maintainers do that.
459 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
461 * src/frontends/kde/parageneraldlg.C:
462 * src/frontends/kde/parageneraldlg.h: don't use
463 a derived class for SpaceAbove/Below
465 * src/frontends/kde/dlg/README: add some info
467 * src/frontends/kde/dlg/*: update data files, update
470 * src/frontends/kde/dlg/moc/Makefile.am: add
473 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
475 * configure.in: add new KDE Makefiles
476 * src/vspace.h: return GlueLength not a normal one
477 * src/support/lstrings.h:
478 * src/support/lstrings.C: add isStrUnsignedInt(),
481 * src/frontends/kde/*: big reorganisation, update
482 FormParagraph, add FormTabCreate
484 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
486 * lib/ui/default.ui: small grammatical change.
488 * src/frontends/xforms/xform_macros.h: removed.
490 * src/frontends/xforms/FormBase.C:
491 * src/frontends/xforms/FormPreferences.C:
492 * src/frontends/xforms/Makefile.am: changes associated with removing
493 xform_macros.h. Should make Lars' debugging a little easier.
495 * src/frontends/xforms/FormPreferences.C:
496 * src/frontends/xforms/FormPreferences.h:
497 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
498 longer use X11 color name database. HSV and RGB dials/sliders.
499 Please let this be the end of this!
501 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
503 * Several files: Allow compilation when the compiler doesn't
506 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
509 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
510 command line options.
512 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
514 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
515 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
518 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
520 * src/frontends/xforms/FormRef.C (updateBrowser):
521 * src/frontends/xforms/forms/form_ref.fd: try clicking on
522 different insets with the sort key active. Now apply this patch!
524 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
526 * src/frontends/xforms/FormPrint.C: set to valid()
527 when we update from the passed parameters.
529 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
531 * src/LColor.C (getFromGUIName): internationalise the comparison.
533 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
534 FormPreferences choice.
536 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
539 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
541 * src/lyxrc.C: more detail for the printer program config
544 * src/LColor.C: ert->latex text. LColor needs a big revamp
545 but will have to wait till after 1.1.6
547 * src/buffer.C: bring up a dialog if we load a document
548 with an un-installed text class, rather than just complain
551 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
553 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
554 the browser form for a combox in a tabbed folder. Bug fix courtesy of
555 Steve Lamont <spl@ncmir.ucsd.edu>.
557 * src/frontends/xforms/FormDocument.C (build):
558 * src/frontends/xforms/FormPreferences.C (Language::build):
559 pass tabfolders to Combox::add() in order to use this work around.
561 * src/frontends/xforms/FormCitation.C (connect): remove max size
563 (update): sort list of bibliography keys.
565 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
567 No max size limitation. Same popup for new and existing insets. Fixes
568 bugs reported by Rob Lahaye.
570 * src/frontends/xforms/FormCitation.C (c-tor):
571 * src/frontends/xforms/FormCopyright.C (c-tor):
572 * src/frontends/xforms/FormError.C (c-tor):
573 * src/frontends/xforms/FormGraphics.C (c-tor):
574 * src/frontends/xforms/FormIndex.C (c-tor):
575 * src/frontends/xforms/FormRef.C (c-tor):
576 * src/frontends/xforms/FormToc.C (c-tor):
577 * src/frontends/xforms/FormUrl.C (c-tor):
578 use correct policy for ButtonController.
580 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
582 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
585 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
587 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
588 Some resizing changes.
590 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
592 * configure.in: fix typo
594 * lib/languages: add ukraninian and change no to no_NO
596 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
598 * src/bufferview_funcs.C (FontSize): use setLyXSize
600 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
602 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
603 to check for systems where mkstemp() is available but not declared
604 in headers. The new autoconf macro lyx_CHECK_DECL can be used
605 to check for declarations in headers.
607 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
609 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
611 * forms/makefile: added bibforms.fd, include_form.fd.
612 Removed lyx_sendfax.fd.
614 * src/LaTeXLog.C (ShowLatexLog):
615 * src/LyXAction.C (init):
616 * src/bufferparams.C (readLanguage): altered messages as suggested by
619 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
622 * src/credits.C: made fd_form_credits non-static, so that it can be
623 redrawn should the xforms colors be re-mapped.
624 * src/spellchecker.C ditto fd_form_spell_options.
626 * src/filedlg.[Ch] (redraw):
627 * src/intl.[Ch] (redraw):
628 * src/lyxfr0.[Ch] (redraw):
629 * src/insets/figinset.[Ch] (redraw):
630 * src/insets/insetexternal.[Ch] (redraw):
631 new methods, connected to Dialogs::redrawGUI.
633 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
634 to be connected to Dialogs::redrawGUI.
636 * src/frontends/xforms/FormCitation.C (build):
637 * src/frontends/xforms/FormCopyright.C (build):
638 * src/frontends/xforms/FormError.C (build):
639 * src/frontends/xforms/FormGraphics.C (build):
640 * src/frontends/xforms/FormIndex.C (build):
641 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
642 * src/frontends/xforms/FormToc.C (build):
643 * src/frontends/xforms/FormUrl.C (build):
644 use the ButtonController correctly.
646 * src/frontends/xforms/FormCopyright.C (build):
647 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
648 the .fd file and into build().
650 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
652 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
654 * src/frontends/xforms/forms/form_citation.fd:
655 * src/frontends/xforms/forms/form_copyright.fd:
656 * src/frontends/xforms/forms/form_error.fd:
657 * src/frontends/xforms/forms/form_graphics.fd:
658 * src/frontends/xforms/forms/form_index.fd:
659 * src/frontends/xforms/forms/form_toc.fd:
660 * src/frontends/xforms/forms/form_url.fd:
661 renamed some of the objects. Named others explicitly for the first time.
662 Added Restore and Apply buttons where appropriate.
664 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
667 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
669 * src/version.h: try the pre2 again
671 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
673 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
675 * src/frontends/kde/FormParagraph.C: added using directive.
677 * src/frontends/kde/paradlg.C: added config.h and using directive.
679 * src/frontends/kde/paradlg.h: added std::qualifier.
681 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
683 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
685 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
687 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
689 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
691 * src/version.h: set back to 1.1.6cvs
693 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
695 * src/version.h: set to 1.1.6pre2
697 2000-11-20 Marko Vendelin <markov@ioc.ee>
699 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
701 * src/frontends/gnome/Makefile.am: updated list of XForms object files
703 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
705 * src/LColor.C (init):
706 * src/lyxrc.C (getDescription): changed some comments as suggested by
709 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
710 disconnect the redrawGUI signal in best-practice fashion.
712 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
713 long_opts_tab to reflect the change in name of this tabfolder, as
714 suggested by John Levon.
715 (connect, disconnect): new methods. Don't do much at present other than
716 ensuring that we can't resize the dialog. This just makes xforms go
718 (lots of methods in Colors): made void rather than bool. The idea is
719 to have an isOk() function that keeps track of whether any input is
720 genuinely invalid and should therefore block Save, Apply.
721 Easier to manipulate the counters rapidly.
722 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
723 compiler will like this code. Much cleaner way of doing things.
725 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
727 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
728 rather than simple counters, following suggestion by John Levon.
730 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
731 than engraved frame + text.
733 * src/frontends/xforms/forms/makefile: removed spurious command.
735 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
737 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
739 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
742 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
744 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
745 see what Lars has changed and what is just white space!
746 Now used X directly to ascertain the RGB color associated with the
748 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
750 Added some sort capability.
751 The X11 color name database input is only displayed if the database
752 isn't found in the standard place.
753 Got rid of struct compare_converter; it wasn't used.
754 Probably some other stuff that I've forgotten.
756 * src/frontends/xforms/FormPreferences.h: changed the names of some
757 methods in the Colors struct. Added a couple of structs to help sort
758 colors by name and by RGBColor.
760 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
761 functions into a new class RWInfo.
763 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
764 The dialog is now almost navigable using the keyboard. Unfortunately,
765 the cursor has to be inside a browser for it to be activated. There is
766 no visual feedback for the key shortcuts to the arrow keys (use
767 Alt-appropriate arrow key, Alt-x).
769 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
772 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
773 xform_helpers.[Ch]. See above.
775 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
777 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
779 * src/screen.C (setCursorColor): new method. Sets the color of the
781 (ShowManualCursor): call it.
782 Constify some local variables.
784 * src/LColor.[Ch] (LColor): add entry for cursor
785 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
788 2000-11-19 Juergen Vigna <jug@sad.it>
790 * src/insets/insettabular.C (draw): fixed text border redraw problem.
791 (calculate_dimensions_of_cells): try to boost up when inserting chars.
793 2000-11-15 Rob Lahaye <lahaye@postech.edu>
795 * lib/ui/default.ui: OptItem used for Fax entry
797 2000-11-17 Matej Cepl <cepl@bigfoot.com>
799 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
801 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
803 * src/vspace.C (nextToken): fix so it can handle length phrases like
804 "10mm+-20mm", "40inplus16mmminus10cm" etc.
806 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
808 * src/frontends/xforms/FormPreferences.C: constify several variables
809 (BrowserLyX): rewrite to not need the choice variable
810 (Modify): rewrite to not need the choide variable
811 (compare_converter): make operator const
813 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
814 correct the writing of \set_color
815 (getDescription): return a const string
817 * src/kbsequence.[Ch] (addkey): remove dead code
819 * src/Painter.C (text): remove some commented code
821 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
823 * src/ColorHandler.[Ch]: removed some header files from .h file.
824 Included LColor.h in .C file.
826 * src/LColor.[Ch]: made class copyable so that I could create a
827 system_lcolor instance.
829 * src/Painter.h: removed LColor.h.
831 * src/lyx_gui.C (create_forms): used AddName.
833 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
834 of user preferences/lyxrc file.
836 * src/lyxrc.C (output): output changes to lcolor.
838 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
840 Moved class xformColor to files xform_helpers.[Ch]. These files,
841 Color.[Ch], could now be moved into src if they would be useful to
844 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
845 Also moved FormPreferences::browseFile here as it can be used by any
846 xform dialog with a "Browse" button. FormGraphics is a perfect example.
848 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
849 ReadableFile): changed the FormPreferences methods a little and moved
850 them here as they'll be useful elsewhere also.
852 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
853 Removed some header files and used forward declarations instead.
855 Removed some methods as they'll be useful elsewhere (see above).
857 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
858 Can also now modify the LyX LColors. However, for reasons that I don't
859 yet understand, it appears that we can use
860 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
861 present. The problem appears to lie in ColorHandler, because I can
862 change the color using LColor.SetColor(). Similarly, when reading in a
863 preferences file with some set_color instances, I'll get a warning
864 like: Color sea green is undefined or may not be redefined
865 Bad lyxrc set_color for sea green
867 Once the buffer is loaded, however, I can happily change to this color.
869 Finally, it appears that I have to set the color of "inset frame"
870 explicitly, or it oscillates from "black" to "indian red" with each
873 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
875 * ANNOUNCE: corrected a spelling mistake.
877 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
880 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
882 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
884 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
887 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
888 match the requirements from the standard better. This is required
889 to work with gnu libstdc++-v3
891 * src/frontends/xforms/FormPreferences.C: add explict pair
892 arguments to browse calls. include support/lyxmanip.h remvoe
893 extern fmt. whitespace changes. reorder variables in
894 FormPreferences.h, to match initalizaton order.
896 * several files: constify more local variables.
898 * src/buffer.C: remove some commented functions.
900 * src/DepTable.C (remove_files_with_extension): temporary
901 work around for gcc 2.97
902 * src/filedlg.C (find): ditto
903 * src/Variables.C (set): ditto
904 * src/LyXAction.C (searchActionArg): ditto
905 (retrieveActionArg): ditto
907 * configure.in: check for mktemp too
909 * UPGRADING: prepare for 1.1.6
911 * Makefile.am (lgbtags): add backup tags for when etags are
912 different than usual.
914 * ANNOUNCE: prepare for 1.1.6
916 * src/support/tempname.C (make_tempfile): new function, wrapper
917 around mkstemp and mktemp. Only mkstemp has been tested.
920 2000-11-14 Rob Lahaye <lahaye@postech.edu>
922 * default.ui: capitalized some menu items to improve shortcuts.
924 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
926 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
928 * src/frontends/xforms/Dialogs.C: add "using" directive.
930 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
932 * src/filedlg.C (Select): highlight suggested file in browser, if
935 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
936 each tab folder is encapsulated in its own class.
937 The Language keymaps are now chosen using a text input and a
938 browser button, rather than a Combox.
939 All the browser buttons are now functional, although LyXFileDlg
940 still needs to be modified to make it straighhtforward to return a
941 directory if that is what is desired.
943 * src/frontends/xforms/forms/form_preferences.fd: use text input
944 and browse button to input the Language keymaps. Add a few
945 callbacks for the browse buttons.
947 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
949 * src/support/tempname.C (tempName): small changes to make it
950 safer. remove the '.' before XXXXXX
952 * src/support/filetools.C (TmpFileName): remove func
955 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
956 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
957 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
958 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
960 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
963 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
966 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
967 for bp (this fixes a reproducible hard crash)
969 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
972 * src/frontends/xforms/FormBase.h: make bp_ private
973 (FormBaseBI): remove default for bp
976 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
979 * src/frontends/xforms/Color.C (RGBColor): made several vars
980 const, changed initialization of j to allow it to be const
983 * several files: added const to local variables.
985 * src/lyx_cb.C: removed several function prototypes and moved them
989 (UpdateLayoutPreamble):
991 (MenuInsertLabel): add BufferView as arguemnt
992 (LayoutsCB): make tmp const
994 * src/layout_forms.h: regenerated
996 * src/debug.C: add Debug::FILES
997 (showLevel) (showTags): translate the desc
999 * src/debug.h: add FILES as debug target
1001 * src/bufferlist.C: use current_view as an interim measure becuase
1002 of added arguments to MenuWrite and MenuWriteAs
1004 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1006 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1008 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1009 libstdc++ is compiled with.
1011 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1013 * lib/layouts/docbook-book.layout
1014 * lib/layouts/docbook.layout
1015 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1016 those paragraphs are expresse as SGML comments <!-- -->.
1018 * src/LaTeXFeatures.h
1019 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1020 parameter, this allows to express all the include files as relative
1021 paths to the master buffer. The verbatim insert works as the other
1024 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1026 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1028 (MakeDocBookFile): top_element is always written. Some clean up, as
1029 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1031 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1032 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1033 a reference is written instead of the name.
1034 (Validate): use the relative path for the filename.
1036 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1039 * src/support/filetools.h
1040 * src/support/filetools.C (IsSGMLFilename): added.
1043 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1045 * development/OS2/quick_fix.patch:
1046 * lib/configure.cmd:
1047 * README.OS2: quick update to the OS/2 port.
1049 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1051 * src/converter.C: add "using" directive.
1053 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1054 (compare_converter): add "int" as return type.
1056 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1059 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1061 * src/lyx_gui.C (create_forms): map the xform colours, should a
1062 mapping exist. Ie, call XformColor::read().
1064 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1065 and struct HSV as HSVColor.
1066 (XformColor::read, XformColor::write) : new methods that
1067 input/output any changes to the cform GUI colors.
1069 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1072 * src/frontends/xforms/FormPreferences.C Lots of little changes
1073 associated with the changed name of the RGB and HSV structs. Can
1074 now save changes to xforms GUI to file. Commented out
1075 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1076 used currently anyway.
1078 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1080 * src/converter.C: A lot of changes:
1081 - It is no longer possible to choose between two or more ways to
1082 export to some format (the new code uses only the shortest path).
1083 However, it is still possible to choose between pdflatex/ps2pdf
1084 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1085 - Added several methods that makes the FormPreferences code simpler.
1086 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1088 * src/exporter.C (Export): lyxrc.use_pdf is set before
1089 makeLaTeXFile is called. This works but not very nice.
1091 * src/frontends/xforms/FormPreferences.C: The formats/converters
1092 tabs are now fully functional.
1094 * src/buffer.C (getTocList): Add numbers to the captions.
1096 * lib/lyxrc.example: Removed fax section
1098 * src/support/rename.C (rename): Delete the old file if lyx::copy
1101 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1103 * lib/ui/default.ui: minor polishing.
1105 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1107 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1110 * lib/Makefile.am (DOCINST): do not install everything in the
1111 documentation directory.
1113 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1115 * src/bufferlist.C (newFile): set the filename to the constructed
1118 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1119 constructed "newfileXX.lyx" name to the dialog
1121 * src/frontends/DialogBase.h: make update() non-abstract so
1122 KDE doesn't need to implement two update methods for every form
1124 * src/frontends/kde/Makefile.am: add missing xforms objects
1127 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1129 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1131 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1132 structs RGB and HSV. May not be the best place for these files.
1133 Perhaps move them into src ?
1135 * src/frontends/xforms/Makefile.am: added new files.
1137 * src/frontends/xforms/forms/form_preferences.fd:
1138 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1139 replaced all instances of "colour" with "color"!
1141 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1144 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1145 tab. Can now alter the colors of the xform's GUI on the fly. With
1146 the aid of a single static Signal (see below), can "Apply" these
1147 changes to all currently open dialogs. (Well, to all of the NEW
1148 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1149 subsequently opened dialogs will, of course, also have the new
1150 color scheme. Cannot yet save (or load) the choices to file, so
1151 they are lost when exiting LyX.
1153 * src/frontends/Dialogs.h:
1154 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1155 Used to trigger a redraw of any dialogs connected to it because,
1156 for example, the GUI colours have been re-mapped.
1158 * src/frontends/xforms/FormBase.[Ch]:
1159 * src/frontends/xforms/FormDocument.[Ch]:
1160 * src/frontends/xforms/FormParagraph.[Ch]:
1161 * src/frontends/xforms/FormPreferences.[Ch]:
1162 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1163 method, to be connected to Dialogs::redrawGUI. Method must be
1164 virtual, because dialogs with tabbed folders need to redraw the
1165 forms of each tab folder.
1167 * src/LyXView.C (d-tor):
1168 * src/frontends/xforms/FormBase.C (d-tor): connected
1169 Dialogs::redrawGUI signal to redraw().
1171 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1172 removed Assert, because it is identical to that in FormBase.
1174 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1176 * lib/ui/default.ui: minor polishing.
1178 2000-11-10 Juergen Vigna <jug@sad.it>
1180 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1181 (deleteLyXText): ditto
1183 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1184 selection on mouse-button-3.
1186 * src/insets/insettabular.h: new function clearSelection(), use this
1187 functions inside insettabular.C.
1189 * src/insets/insettabular.C (TabularFeatures): clear the selection
1190 on remove_row/column.
1192 * src/insets/inset.C (scroll): fixed some scroll stuff.
1194 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1196 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1198 * lib/CREDITS: add Yves Bastide
1200 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1202 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1203 check whether C library functions are in the global namespace.
1205 * configure.in: calls it.
1207 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1208 #ifndef __GLIBCPP__.
1210 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1212 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1213 iterators to prevent crash.
1215 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1217 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1219 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1220 shortcut for xforms CB to the preemptive or post-handler function.
1222 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1223 removed the HIDDEN_TIMER as it's no longer used.
1224 Various other small changes.
1226 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1227 preemptive handler to obtain feedback, rather than the post-handler.
1228 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1230 Formats tab is now complete. Converters tab is nearly so.
1232 2000-11-09 Juergen Vigna <jug@sad.it>
1234 * src/insets/insettext.C (~InsetText):
1237 (SetParagraphData): set cache.second to 0 after deleting it!
1238 (getLyXText): check if cache.second is not 0 if finding it.
1240 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1242 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1243 lyxlex to parse the rgb.txt file.
1246 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1247 replace the default '#' comment character.
1249 * src/support/tempname.C: add "using" directive
1250 * src/frontends/ButtonPolicies.C: ditto.
1252 * src/support/filetools.C (DirList): add an explicit cast to avoid
1253 a compile error (probably not the right fix)
1255 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1257 * src/support/filetools.C (DirList): implement using system functions
1259 * src/support/tempname.C: new file
1261 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1263 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1265 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1268 * src/frontends/xforms/ButtonController.C: new file
1270 * src/os2_defines.h: remove getcwd define
1272 * src/lyxvc.C: include support/lyxlib.h
1273 (showLog): use lyx::tempName
1275 * src/lyx_cb.C: comment out includes that we don't need
1276 (AutoSave): use lyx::tempName
1278 * src/filedlg.C: include support/lyxlib.h
1279 (Reread): use lyx::getcwd
1281 * src/converter.C: include support/filetools.h
1282 (add_options): change to static inline, make tail const
1283 (Add): make old_viewer const
1284 (GetAllFormats): make it a const method, use const_iterator
1285 (enable): make static inline
1286 (SplitFormat): make using_format const
1288 * src/LaTeX.C (run): use lyx::getcwd
1290 * configure.in: check for mkstemp as well
1292 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1294 * src/converter.[Ch] (GetAllCommands): new method.
1296 * src/support/filetools.[Ch] (DirList): new method.
1298 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1299 functionality to the converters tab.
1300 The formats tab is now nearly complete.
1301 The kbmap choices in Languages tab now display the contents of
1302 system_lyxdir/kbd/*.kmap in readable form.
1304 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1305 Moved some variables into the class.
1307 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1308 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1309 colour of active folder to lighter grey instead. Any takers?
1310 (form_colours): added an "Apply" button.
1311 (form_converters): added a "Flags" input field.
1312 (form_formats): added a "Shortcut" input field. Note that we can't use
1313 names such as "input_shortcut" as this buggers up the sed script stuff.
1315 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1323 * src/lyx_sendfax_main.C:
1326 * src/spellchecker.C:
1327 * src/insets/figinset.C:
1328 * src/insets/insetbib.C:
1329 * src/insets/insetexternal.C:
1330 * src/insets/insetinclude.C:
1331 * src/insets/insetinfo.C:
1332 * src/mathed/math_panel.C:
1333 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1334 all "daughter" dialogs now have identical "feel".
1336 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1338 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1339 used (and was only used in one place prior to this patch. Incorrectly!)
1341 * src/frontends/xforms/FormDocument.C: changed some instances of
1342 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1343 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1344 for options_->input_float_placement. This fixes a bug reported by
1347 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1348 functionality into d-tor.
1350 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1351 input of numerals also.
1353 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1354 fl_set_form_atclose(). Can now close dialog from window manager,
1355 fixing a bug reported by Rob Lahaye.
1357 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1359 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1360 are no longer dark. Haven't yet worked out how to lighten the colour of
1361 the active tabfolder. Any ideas anybody?
1362 Adjusted Colours tab a little.
1363 Added Shortcut field to converters tab. Note that we can't create an
1364 fdesign label like "input_shortcut" as this buggers up the sed-script
1367 * src/frontends/xforms/FormPreferences.[Ch]:
1368 (feedback): fixed crash due to to ob=0.
1369 (LanguagesXXX): the kbmap choices now contain the files
1370 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1371 be replaced by an input with a file browse button, but since the browse
1372 buttons don'y yet work, this'll do for the moment.
1373 (FormatsXXX): think that this is now nearly fully functional.
1374 Some points/questions though:
1375 1. Does "Apply" remove formats if no longer present?
1376 2. I think that the browser should list the GUI names rather than the
1378 3. Must ensure that we can't delete Formats used by an existing
1381 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1382 if this is the best way to do this.
1384 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1386 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1388 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1389 for variable assignment.
1391 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1393 * src/lib/ui/default.ui: added sub/superscripts to menu as
1394 Insert->Special characters and cleaned-up the file a bit
1396 2000-11-07 Allan Rae <rae@lyx.org>
1398 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1399 ob isn't 0 before using it. See comments in function.
1401 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1403 * src/frontends/xforms/form_*.C: regenerated
1405 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1407 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1409 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1410 compiling with gcc-2.96
1412 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1414 * src/support/lyxstring.C: add a couple "using" directives.
1416 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1417 a .c_str() here too for good measure.
1418 * src/Spacing.C (set): ditto.
1419 * src/lyxfunc.C (Dispatch): ditto.
1421 * src/insets/insettabular.C (copySelection): change .str() to
1422 .str().c_str() to fix problems with lyxstring.
1423 * src/support/filetools.C (GetFileContents): ditto.
1424 * src/buffer.C (asciiParagraph): ditto.
1425 * src/paragraph.C (String): ditto.
1427 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1428 * lib/bind/sciword.bind: ditto.
1430 * src/LyXAction.C (init): remove "symbol-insert" function, which
1431 shared LFUN_INSERT_MATH with "math-insert".
1433 * lib/configure.m4: == is not a valid operator for command test.
1435 * src/lyxrc.C: add using directive.
1437 * src/converter.h: add std:: qualifier.
1439 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1441 * src/converter.[Ch] and other files: Change the Format class to a
1442 real class, and create two instances: formats and system_format.
1444 * src/lyxrc.C (output): Output the difference between formats and
1447 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1448 (buildFormats): Insert formats into browser.
1449 (inputFormats): Made the browser and add button functional.
1450 (applyFormats): Update formats from format_vec.
1452 * src/converter.C: Changed all (*it). to it->
1453 (Format::dummy): New method.
1454 (Format::importer): New format flag.
1455 (Formats::GetAllFormats): New method.
1456 (Formats::Add): Delete format from the map if prettyname is empty.
1457 (Converter::Convert): Print an error message if moving the file fails.
1458 (Converter::GetReachableTo): New method
1460 * src/MenuBackend.[Ch]: Add support for importformats tag.
1462 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1464 * lib/configure.m4: Add word->tex and ps->fax converters.
1466 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1467 Return fax to file menu.
1471 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1473 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1476 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1479 * src/lyxfunc.C (processKeyEvent): removed
1481 * src/bufferlist.C (emergencyWrite): removed the out commented
1482 emergency write code.
1484 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1486 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1488 * many files: change formatting to be a bit more uniform for
1489 if,while,for,switch statements, remove some parantesis not needed.
1492 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1494 * config/kde.m4: make config more robust when KDEDIR is set
1496 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1498 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1499 not returned a pixmap for "math-insert".
1501 * src/LyXAction.C (init): sort the entries a bit.
1503 2000-11-03 Juergen Vigna <jug@sad.it>
1505 * src/insets/insettabular.h: added fixed number to update codes so
1506 that update is only in one direction.
1508 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1511 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1512 before call to edit because of redraw.
1514 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1516 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1518 * lib/ui/default.ui: Populate "edit_float" menu
1520 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1522 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1523 "floats-operate". The name is ugly (and the func also), but this
1524 is just a band-aid until we switch to new insets.
1526 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1528 * lib/ui/default.ui: update again the menu layout (fix some
1531 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1533 * src/MenuBackend.h (fulllabel): new method.
1535 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1536 the menu shortcuts of a menu are unique and whether they
1537 correspond to a letter of the label.
1538 (expand): call checkShortcuts when debugging.
1540 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1542 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1544 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1546 * lib/examples/*.lyx : '\language default' => '\language english'
1548 * lib/examples/it_splash.lyx : except where it should be italian
1550 * lib/templates/*.lyx : the same
1552 * doc/*.lyx* : the same
1554 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1556 * lib/bind/menus.bind: remove the Layout menu entries, which I
1557 somehow forgot earlier.
1559 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1561 * lib/ui/old-default.ui: keep the old one here for reference (to
1564 * lib/ui/default.ui: update the menu layout
1566 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1568 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1569 Can now Apply to different insets without closing the dialog.
1571 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1572 Can't actually DO anything with them yet, but I'd like a little
1575 * src/frontends/xforms/input_validators.[ch]
1576 (fl_lowercase_filter): new.
1578 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1580 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1581 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1583 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1585 2000-11-02 Juergen Vigna <jug@sad.it>
1587 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1588 on char insertion as it has already be updated by bv->updateInset().
1590 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1591 if an inset inside was updated.
1593 * lib/configure.cmd: commented out fax-search code
1595 2000-11-01 Yves Bastide <stid@acm.org>
1597 * src/tabular.C (OldFormatRead): set tabular language to the
1600 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1602 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1603 class names with non-letter characters (from Yves Bastide).
1605 * lib/ui/default.ui: change Item to OptItem in import menu.
1606 Comment out fax stuff.
1608 * lib/configure.m4: comment out fax-related stuff.
1610 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1612 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1613 useful xforms helper functions. At present contains only formatted().
1614 Input a string and it returns it with line breaks so that in fits
1617 * src/frontends/xforms/Makefile.am: add new files.
1619 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1620 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1623 * src/frontends/xforms/FormPreferences.[Ch]:
1624 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1625 but lots of little clean ups. Removed enum State. Make use of
1626 formatted(). Constify lots of methods. Perhaps best of all: removed
1627 requirement for that horrible reinterpret_cast from pointer to long in
1630 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1632 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1633 conditionalize build on xforms < 0.89
1635 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1637 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1639 * src/LyXAction.C (init): comment out fax
1641 * src/lyxrc.h: comment out the fax enums
1642 comment out the fax variables
1644 * src/commandtags.h: comment out LFUN_FAX
1646 * src/lyxrc.C: disable fax variables.
1647 (read): disable parsing of fax variables
1648 (output): disable writing of fax variables
1649 (getFeedback): now description for fax variables
1651 * src/lyxfunc.C: comment out MenuFax
1652 (Dispatch): disable LFUN_FAX
1654 * src/lyx_cb.C (MenuFax): comment out
1656 * src/WorkArea.C: add <cctype>
1657 (work_area_handler): better key handling, should be ok now.
1658 for accented chars + etc
1660 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1661 lyx_sendfax.h and lyx_sendfax_man.C
1663 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1664 (show): don't call InitLyXLookup when using xforms 0.89
1666 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1668 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1670 * src/support/filetools.C (GetFileContents): close to dummy change
1672 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1674 * src/trans.C (AddDeadkey): workaround stupid compilers.
1676 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1678 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1679 of two-sided document.
1681 2000-10-31 Juergen Vigna <jug@sad.it>
1683 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1685 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1686 xposition to the Edit call.
1688 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1690 * src/trans.C (AddDeadkey): cast explicitly to char.
1692 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * src/tabular.C (AsciiBottomHLine): simplify?
1695 (AsciiTopHLine): simplify?
1696 (print_n_chars): simplify
1697 (DocBook): remove most of the << endl; we should flush the stream
1698 as seldom as possible.
1700 (TeXBottomHLine): ditto
1701 (TeXTopHLine): ditto
1703 (write_attribute): try a templified version.
1704 (set_row_column_number_info): lesson scope of variables
1706 * src/support/lstrings.h (tostr): new specialization of tostr
1708 * src/trans.C (AddDeadkey): slightly cleaner fix.
1710 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1712 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1713 '%%' in Toc menu labels.
1716 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1717 font_norm is iso10646-1.
1719 * src/font.C (ascent): Fixed for 16bit fonts
1720 (descent,lbearing,rbearing): ditto
1722 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1724 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1725 (getFeedback): new static method.
1727 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1728 Now use combox rather than choice to display languages.
1729 Feedback is now output using a new timer callback mechanism, identical
1730 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1732 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1734 * src/minibuffer.C: fix for older compilers
1736 2000-10-30 Juergen Vigna <jug@sad.it>
1738 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1739 has to be Left of the inset otherwise LyXText won't find it!
1741 * src/BufferView2.C (open_new_inset): delete the inset if it can
1744 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1746 * lyx.man: fix typo.
1748 2000-10-29 Marko Vendelin <markov@ioc.ee>
1749 * src/frontends/gnome/FormCitation.C
1750 * src/frontends/gnome/FormCitation.h
1751 * src/frontends/gnome/FormCopyright.C
1752 * src/frontends/gnome/FormCopyright.h
1753 * src/frontends/gnome/FormError.C
1754 * src/frontends/gnome/FormError.h
1755 * src/frontends/gnome/FormIndex.C
1756 * src/frontends/gnome/FormIndex.h
1757 * src/frontends/gnome/FormPrint.C
1758 * src/frontends/gnome/FormPrint.h
1759 * src/frontends/gnome/FormRef.C
1760 * src/frontends/gnome/FormRef.h
1761 * src/frontends/gnome/FormToc.C
1762 * src/frontends/gnome/FormToc.h
1763 * src/frontends/gnome/FormUrl.C
1764 * src/frontends/gnome/FormUrl.h
1765 * src/frontends/gnome/Menubar_pimpl.C
1766 * src/frontends/gnome/mainapp.C
1767 * src/frontends/gnome/mainapp.h
1768 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1769 changing update() to updateSlot() where appropriate
1771 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1773 * src/frontends/xforms/FormPreferences.[Ch]:
1774 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1777 2000-10-28 Juergen Vigna <jug@sad.it>
1779 * src/insets/insettabular.C (draw): fixed drawing bug.
1781 * src/insets/insettext.C (clear):
1783 (SetParagraphData): clearing the TEXT buffers when deleting the
1784 paragraphs used by it.
1786 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1788 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1790 2000-10-27 Juergen Vigna <jug@sad.it>
1792 * src/tabular.C (~LyXTabular): removed not needed anymore.
1794 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1797 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1799 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1802 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1805 * src/frontends/xforms/FormPreferences.[Ch]:
1806 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1807 Reorganised as modules based on tabs. Much easier to follow the
1808 flow and to add new tabs. Added warning and feedback messages.
1811 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1813 * src/tabular.h (DocBook): add std:: qualifier.
1815 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1817 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1818 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1821 * insettabular.C (DocBook): uses the tabular methods to export
1824 * src/insets/insettext.h
1825 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1827 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1829 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1832 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1833 moved misplaced AllowInput two lines up.
1835 * src/buffer.C (readFile): compare float with float, not with int
1837 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1839 * src/minibuffer.C: add "using SigC::slot" statement.
1841 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1843 * src/frontends/xforms/forms/README: updated section about make.
1845 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1846 Tidied some forms up, made two of form_tabular's tabs more
1847 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1848 fixed translation problem with "Column".
1850 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1852 * src/minibuffer.h: use Timeout instead of the xforms timer
1854 (setTimer) rewrite for the Timeout, change to unsigned arg
1855 (set): change to unsigned timer arg
1858 * src/minibuffer.C (TimerCB): removed func
1859 (C_MiniBuffer_TimerCB): removed func
1860 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1861 (peek_event): use a switch statement
1862 (add): don't use fl_add_timer.
1863 (Set): rewrite to use the Timeout
1866 * src/Timeout.[Ch] (setType): return a Timeout &
1867 (setTimeout): ditto, change to unsigned arg for timeout
1869 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1871 * src/mathed/formula.C (mathed_string_width): Use string instead
1872 of a constant size char array.
1874 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1876 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1877 the two recently added operator<< for SMInput and State.
1879 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1881 (OkCancelPolicy): ditto
1882 (OkCancelReadOnlyPolicy): ditto
1883 (NoRepeatedApplyReadOnlyPolicy): ditto
1884 (OkApplyCancelReadOnlyPolicy): ditto
1885 (OkApplyCancelPolicy): ditto
1886 (NoRepeatedApplyPolicy): ditto
1888 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1890 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1891 add the usual std:: qualifiers.
1893 2000-10-25 Juergen Vigna <jug@sad.it>
1895 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1897 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1899 * src/support/filetools.C (MakeRelPath): change some types to
1902 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1903 ButtonPolicy::SMInput and ButtonPolicy::State.
1905 * src/FontLoader.C (reset): small cleanup
1906 (unload): small cleanup
1908 * src/FontInfo.C (getFontname): initialize error to 10000.0
1910 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1912 * src/frontends/xforms/FormPreferences.[Ch]:
1913 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1914 TeX encoding and default paper size sections.
1916 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1918 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1921 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1922 make the message_ empty.
1923 (FormError): don't initialize message_ in initializer list.
1925 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1927 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1929 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1931 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1933 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1935 * src/frontends/kde/*data.[Ch]: _("") is not
1938 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1940 * src/buffer.C: removed redundant using directive.
1942 * src/frontends/DialogBase.h: revert to original definition of
1945 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1946 stuff into two classes, one for each dialog, requires a new
1947 element in the dialogs vector, FormTabularCreate.
1949 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1952 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1953 method. Continues Allan's idea, but means that derived classes
1954 don't need to worry about "update or hide?".
1956 * src/frontends/xforms/FormError.C (showInset): add connection
1959 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1960 one for each dialog. FormTabular now contains main tabular dialog
1963 * src/frontends/xforms/FormTabularCreate.[Ch]:
1964 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1967 * src/frontends/xforms/FormGraphics.[Ch]:
1968 * src/frontends/xforms/forms/form_graphics.fd
1969 * src/frontends/xforms/FormTabular.[Ch]:
1970 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1971 classes of FormInset.
1973 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1974 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1976 * src/frontends/xforms/Makefile.am:
1977 * src/frontends/xforms/forms/makefile: added new files.
1979 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1980 variable. added Signal0 hide signal, in keeping with other GUI-I
1983 * src/support/lstrings.h: removed redundant std:: qualifier as
1984 it's already declared in Lsstream.h.
1986 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1988 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1992 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1994 * src/tabular.C (Ascii): minimize scope of cell.
1996 * src/BufferView2.C (nextWord): return string() instead of 0;
1998 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2000 * src/converter.h: add a std:: qualifier
2002 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2004 * src/importer.[Ch]: New files. Used for importing files into LyX.
2006 * src/lyxfunc.C (doImport): Use the new Importer class.
2008 * src/converter.h: Add shortcut member to the Format class.
2009 Used for holding the menu shortcut.
2011 * src/converter.C and other files: Made a distinction between
2012 format name and format extension. New formats can be defined using
2013 the \format lyxrc tag.
2014 Added two new converter flags: latex and disable.
2016 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2018 * src/support/lyxlib.h: unify namespace/struct implementation.
2019 Remove extra declarations.
2021 * src/support/chdir.C (chdir): remove version taking char const *
2023 * src/support/rename.C: ditto.
2024 * src/support/lyxsum.C: ditto.
2026 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2028 * src/frontends/xforms/FormBase.[Ch]:
2029 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2030 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2031 work only for the next call to fl_show_form(). The correct place to set
2032 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2033 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2034 from FormBase have the minimum size set; no more stupid crashes with
2037 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2039 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2041 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2043 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2045 * src/support/lyxlib.h: changed second argument of mkdir to
2046 unsigned long int (unsigned int would probably have been enough,
2047 but...). Removed <sys/types.h> header.
2048 * src/support/mkdir.C (mkdir): ditto.
2052 2000-10-19 Juergen Vigna <jug@sad.it>
2054 * src/lyxfunc.C (MenuNew): small fix (form John)
2056 * src/screen.C (Update): removed unneeded code.
2058 * src/tabular.C (Ascii): refixed int != uint bug!
2060 * src/support/lyxlib.h: added sys/types.h include for now permits
2061 compiling, but I don't like this!
2063 2000-10-18 Juergen Vigna <jug@sad.it>
2065 * src/text2.C (ClearSelection): if we clear the selection we need
2066 more refresh so set the status apropriately
2068 * src/insets/insettext.C (draw): hopefully finally fixed draw
2071 2000-10-12 Juergen Vigna <jug@sad.it>
2073 * src/insets/insettext.C (draw): another small fix and make a block
2074 so that variables are localized.
2076 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2078 * src/support/lstrings.C (lowercase, uppercase):
2079 use explicit casts to remove compiler warnings.
2081 * src/support/LRegex.C (Impl):
2082 * src/support/StrPool.C (add):
2083 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2084 (AddPath, MakeDisplayPath):
2085 * src/support/lstrings.C (prefixIs, subst):
2086 use correct type to remove compiler warnings.
2088 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2090 * src/support/lyxlib.h:
2091 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2092 portability and to remove compiler warning with DEC cxx.
2094 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2096 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2098 * src/minibuffer.C (peek_event): retun 1 when there has been a
2099 mouseclick in the minibuffer.
2103 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2105 * src/frontends/xforms/FormParagraph.C: more space above/below
2108 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2110 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2111 a char only if real_current_font was changed.
2113 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2115 * NEWS: update somewhat for 1.1.6
2117 * lib/ui/default.ui: clean up.
2119 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2121 * lib/CREDITS: clean up
2123 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2125 * src/combox.[Ch] (select): changed argument back to int
2126 * src/combox.C (peek_event): removed num_bytes as it is declared but
2129 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2130 modified calls to Combox::select() to remove warnings about type
2133 * src/insets/insetbutton.C (width): explicit cast to remove warning
2134 about type conversion.
2136 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2139 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2140 sel_pos_end, refering to cursor position are changed to
2141 LyXParagraph::size_type.
2143 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2144 consistent with LyXCursor::pos().
2145 (inset_pos): changed to LyXParagraph::size_type for same reason.
2147 * src/insets/insettext.C (resizeLyXText): changed some temporary
2148 variables refing to cursor position to LyXParagraph::size_type.
2150 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2152 * src/frontends/kde/<various>: The Great Renaming,
2155 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2157 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2159 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2161 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2162 0 when there are no arguments.
2164 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2166 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2167 to segfaults when pressing Ok in InsetBibtex dialog.
2169 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2171 * forms/layout_forms.fd:
2172 * src/layout_forms.C (create_form_form_character): small change to use
2173 labelframe rather than engraved frame + text
2175 * src/lyx_gui.C (create_forms): initialise choice_language with some
2176 arbitrary value to prevent segfault when dialog is shown.
2178 2000-10-16 Baruch Even <baruch.even@writeme.com>
2180 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2181 is no resulting file. This pertains only to LaTeX output.
2183 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2185 * src/text.C (Backspace): Make sure that the row of the cursor is
2188 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2191 * src/lyx_gui.C (init): Prevent a crash when only one font from
2192 menu/popup fonts is not found.
2194 * lib/lyxrc.example: Add an example for binding a key for language
2197 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2199 * src/converter.C (GetReachable): Changed the returned type to
2201 (IsReachable): New method
2203 * src/MenuBackend.C (expand): Handle formats that appear more
2206 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2208 * src/frontends/support/Makefile.am
2209 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2212 * lib/CREDITS: add Garst Reese.
2214 * src/support/snprintf.h: add extern "C" {} around the definitions.
2216 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2218 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2221 * src/frontends/xforms/FormDocument.C:
2222 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2223 compile without "conversion to integral type of smaller size"
2226 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2228 * src/text.C (GetColumnNearX): Fixed disabled code.
2230 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2232 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2235 * src/support/snprintf.[ch]: new files
2237 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2239 * src/frontends/kde/formprintdialog.C: add
2240 file browser for selecting postscript output
2242 * src/frontends/kde/formprintdialogdata.C:
2243 * src/frontends/kde/formprintdialogdata.h: re-generate
2246 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2248 * src/frontends/gnome/Makefile.am:
2249 * src/frontends/kde/Makefile.am: FormCommand.C
2250 disappeared from xforms
2252 * src/frontends/kde/FormCitation.C:
2253 * src/frontends/kde/FormIndex.C: read-only
2256 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2258 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2261 * src/bufferlist.C: add using directive.
2263 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2265 * src/support/lyxfunctional.h: version of class_fun for void
2266 returns added, const versions of back_inseter_fun and compare_fun
2269 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2271 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2273 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2275 * ChangeLog: cleanup.
2277 * lib/CREDITS: update to add all the contributors we've forgotten.
2278 I have obviously missed some, so tell me whether there were
2281 2000-10-13 Marko Vendelin <markov@ioc.ee>
2283 * src/frontends/gnome/FormCitation.C
2284 * src/frontends/gnome/FormCitation.h
2285 * src/frontends/gnome/FormError.C
2286 * src/frontends/gnome/FormIndex.C
2287 * src/frontends/gnome/FormRef.C
2288 * src/frontends/gnome/FormRef.h
2289 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2291 * src/frontends/gnome/FormCitation.C
2292 * src/frontends/gnome/FormCopyright.C
2293 * src/frontends/gnome/FormError.C
2294 * src/frontends/gnome/FormIndex.C
2295 * src/frontends/gnome/FormRef.C
2296 * src/frontends/gnome/FormToc.C
2297 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2300 * src/frontends/gnome/Menubar_pimpl.C
2301 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2304 2000-10-11 Baruch Even <baruch.even@writeme.com>
2307 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2308 to convey its real action.
2310 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2311 clear the minibuffer and prepare to enter a command.
2313 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2314 the rename from ExecCommand to PrepareForCommand.
2315 * src/lyxfunc.C (Dispatch): ditto.
2317 2000-10-11 Baruch Even <baruch.even@writeme.com>
2319 * src/buffer.C (writeFile): Added test for errors on writing, this
2320 catches all errors and not only file system full errors as intended.
2322 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2324 * src/lyx_gui.C (create_forms): better fix for crash with
2325 translated interface.
2327 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2329 * src/frontends/kde/Makefile.am:
2330 * src/frontends/kde/FormCopyright.C:
2331 * src/frontends/kde/formcopyrightdialog.C:
2332 * src/frontends/kde/formcopyrightdialog.h:
2333 * src/frontends/kde/formcopyrightdialogdata.C:
2334 * src/frontends/kde/formcopyrightdialogdata.h:
2335 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2336 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2337 copyright to use qtarch
2339 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2341 * src/encoding.C (read): Fixed bug that caused an error message at
2342 the end of the file.
2344 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2346 * lib/lyxrc.example: Fixed hebrew example.
2348 2000-10-13 Allan Rae <rae@lyx.org>
2350 * src/frontends/xforms/FormPreferences.C (input): reworking the
2352 (build, update, apply): New inputs in various tabfolders
2354 * src/frontends/xforms/FormToc.C: use new button policy.
2355 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2356 dialogs that either can't use any existing policy or where it just
2359 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2362 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2363 added a bool parameter which is ignored.
2365 * src/buffer.C (setReadonly):
2366 * src/BufferView_pimpl.C (buffer):
2367 * src/frontends/kde/FormCopyright.h (update):
2368 * src/frontends/kde/FormCitation.[Ch] (update):
2369 * src/frontends/kde/FormIndex.[Ch] (update):
2370 * src/frontends/kde/FormPrint.[Ch] (update):
2371 * src/frontends/kde/FormRef.[Ch] (update):
2372 * src/frontends/kde/FormToc.[Ch] (update):
2373 * src/frontends/kde/FormUrl.[Ch] (update):
2374 * src/frontends/gnome/FormCopyright.h (update):
2375 * src/frontends/gnome/FormCitation.[Ch] (update):
2376 * src/frontends/gnome/FormError.[Ch] (update):
2377 * src/frontends/gnome/FormIndex.[Ch] (update):
2378 * src/frontends/gnome/FormPrint.[Ch] (update):
2379 * src/frontends/gnome/FormRef.h (update):
2380 * src/frontends/gnome/FormToc.[Ch] (update):
2381 * src/frontends/gnome/FormUrl.[Ch] (update):
2382 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2383 to updateBufferDependent and DialogBase
2385 * src/frontends/xforms/FormCitation.[hC]:
2386 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2387 * src/frontends/xforms/FormError.[Ch]:
2388 * src/frontends/xforms/FormGraphics.[Ch]:
2389 * src/frontends/xforms/FormIndex.[Ch]:
2390 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2391 and fixed readOnly handling.
2392 * src/frontends/xforms/FormPrint.[Ch]:
2393 * src/frontends/xforms/FormRef.[Ch]:
2394 * src/frontends/xforms/FormTabular.[Ch]:
2395 * src/frontends/xforms/FormToc.[Ch]:
2396 * src/frontends/xforms/FormUrl.[Ch]:
2397 * src/frontends/xforms/FormInset.[Ch]:
2398 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2399 form of updateBufferDependent.
2401 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2402 if form()->visible just in case someone does stuff to the form in a
2405 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2406 the buttoncontroller for everything the enum used to be used for.
2407 (update) It would seem we need to force all dialogs to use a bool
2408 parameter or have two update functions. I chose to go with one.
2409 I did try removing update() from here and FormBase and defining the
2410 appropriate update signatures in FormBaseB[DI] but then ran into the
2411 problem of the update() call in FormBase::show(). Whatever I did
2412 to get around that would require another function and that just
2413 got more confusing. Hence the decision to make everyone have an
2414 update(bool). An alternative might have been to override show() in
2415 FormBaseB[DI] and that would allow the different and appropriate
2418 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2419 true == buffer change occurred. I decided against using a default
2420 template parameter since not all compilers support that at present.
2422 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2424 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2425 army knife" by removing functionality.
2426 (clearStore): removed. All such housekeeping on hide()ing the dialog
2427 is to be carried out by overloaded disconnect() methods.
2428 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2429 superceded by Baruch's neat test (FormGraphics) to update an existing
2430 dialog if a new signal is recieved rather than block all new signals
2432 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2433 only to Inset dialogs.
2434 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2435 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2437 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2439 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2440 as a base class to all inset dialogs. Used solely to connect/disconnect
2441 the Inset::hide signal and to define what action to take on receipt of
2442 a UpdateBufferDependent signal.
2443 (FormCommand): now derived from FormInset.
2445 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2448 * src/frontends/xforms/FormCopyright.[Ch]:
2449 * src/frontends/xforms/FormPreferences.[Ch]:
2450 now derived from FormBaseBI.
2452 * src/frontends/xforms/FormDocument.[Ch]:
2453 * src/frontends/xforms/FormParagraph.[Ch]:
2454 * src/frontends/xforms/FormPrint.[Ch]:
2455 now derived from FormBaseBD.
2457 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2459 * src/frontends/xforms/FormCitation.[Ch]:
2460 * src/frontends/xforms/FormError.[Ch]:
2461 * src/frontends/xforms/FormRef.[Ch]:
2462 * src/frontends/xforms/FormToc.[Ch]:
2463 (clearStore): reworked as disconnect().
2465 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2468 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2470 * src/converter.C (runLaTeX): constify buffer argument
2473 * src/frontends/support/Makefile.am (INCLUDES): fix.
2475 * src/buffer.h: add std:: qualifier
2476 * src/insets/figinset.C (addpidwait): ditto
2477 * src/MenuBackend.C: ditto
2478 * src/buffer.C: ditto
2479 * src/bufferlist.C: ditto
2480 * src/layout.C: ditto
2481 * src/lyxfunc.C: ditto
2483 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2485 * src/lyxtext.h (bidi_level): change return type to
2486 LyXParagraph::size_type.
2488 * src/lyxparagraph.h: change size_type to
2489 TextContainer::difference_type. This should really be
2490 TextContainer::size_type, but we need currently to support signed
2493 2000-10-11 Marko Vendelin <markov@ioc.ee>
2494 * src/frontends/gnome/FormError.h
2495 * src/frontends/gnome/FormRef.C
2496 * src/frontends/gnome/FormRef.h
2497 * src/frontends/gnome/FormError.C
2498 * src/frontends/gnome/Makefile.am
2499 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2500 to Gnome frontend. Both dialogs use "action" area.
2502 2000-10-12 Baruch Even <baruch.even@writeme.com>
2504 * src/graphics/GraphicsCacheItem_pimpl.C:
2505 * src/graphics/Renderer.C:
2506 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2509 2000-10-12 Juergen Vigna <jug@sad.it>
2511 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2512 visible when selecting).
2514 * development/Code_rules/Rules: fixed some typos.
2516 2000-10-09 Baruch Even <baruch.even@writeme.com>
2518 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2519 compiling on egcs 1.1.2 possible.
2521 * src/filedlg.C (comp_direntry::operator() ): ditto.
2523 2000-08-31 Baruch Even <baruch.even@writeme.com>
2525 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2528 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2529 transient it now only gets freed when the object is destructed.
2531 2000-08-24 Baruch Even <baruch.even@writeme.com>
2533 * src/frontends/FormGraphics.h:
2534 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2537 2000-08-20 Baruch Even <baruch.even@writeme.com>
2539 * src/insets/insetgraphics.C:
2540 (draw): Added messages to the drawn rectangle to report status.
2541 (updateInset): Disabled the use of the inline graphics,
2544 2000-08-17 Baruch Even <baruch.even@writeme.com>
2546 * src/frontends/support: Directory added for the support of GUII LyX.
2548 * src/frontends/support/LyXImage.h:
2549 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2552 * src/frontends/support/LyXImage_X.h:
2553 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2554 version of LyXImage, this uses the Xlib Pixmap.
2556 * src/PainterBase.h:
2557 * src/PainterBase.C:
2559 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2560 replacement to Pixmap.
2562 * src/insets/insetgraphics.h:
2563 * src/insets/insetgraphics.C:
2564 * src/graphics/GraphicsCacheItem.h:
2565 * src/graphics/GraphicsCacheItem.C:
2566 * src/graphics/GraphicsCacheItem_pimpl.h:
2567 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2570 * src/graphics/GraphicsCacheItem.h:
2571 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2572 another copy of the object.
2574 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2575 of cacheHandle, this fixed a bug that sent LyX crashing.
2577 * src/graphics/XPM_Renderer.h:
2578 * src/graphics/XPM_Renderer.C:
2579 * src/graphics/EPS_Renderer.h:
2580 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2582 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2584 * src/lyxfunc.C (processKeySym): only handle the
2585 lockinginset/inset stuff if we have a buffer and text loaded...
2587 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2589 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2591 * src/support/lyxfunctional.h: add operator= that takes a reference
2593 * src/lyxserver.C (mkfifo): make first arg const
2595 * src/layout.h: renamed name(...) to setName(...) to work around
2598 * src/buffer.C (setFileName): had to change name of function to
2599 work around bugs in egcs. (renamed from fileName)
2601 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2603 * src/support/translator.h: move helper template classes to
2604 lyxfunctional.h, include "support/lyxfunctional.h"
2606 * src/support/lyxmanip.h: add delaration of fmt
2608 * src/support/lyxfunctional.h: new file
2609 (class_fun_t): new template class
2610 (class_fun): helper template function
2611 (back_insert_fun_iterator): new template class
2612 (back_inserter_fun): helper template function
2613 (compare_memfun_t): new template class
2614 (compare_memfun): helper template function
2615 (equal_1st_in_pair): moved here from translator
2616 (equal_2nd_in_pair): moved here from translator
2618 * src/support/fmt.C: new file
2619 (fmt): new func, can be used for a printf substitute when still
2620 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2622 * src/support/StrPool.C: add some comments
2624 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2627 * src/insets/figinset.C (addpidwait): use std::copy with
2628 ostream_iterator to fill the pidwaitlist
2630 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2632 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2635 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2638 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2640 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2641 (class_update): ditto
2642 (BulletPanel): ditto
2643 (CheckChoiceClass): move initialization of tc and tct
2645 * src/tabular.C: remove current_view
2646 (OldFormatRead): similar to right below [istream::ignore]
2648 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2649 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2650 unused [istream::ignore]
2652 * src/lyxfunc.C: include "support/lyxfunctional.h"
2653 (getInsetByCode): use std::find_if and compare_memfun
2655 * src/lyxfont.C (stateText): remove c_str()
2657 * src/lyx_main.C (setDebuggingLevel): make static
2658 (commandLineHelp): make static
2660 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2661 Screen* together with fl_get_display() and fl_screen
2663 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2664 togheter with fl_get_display() and fl_screen
2665 (create_forms): remove c_str()
2667 * src/layout.C: include "support/lyxfunctional.h"
2668 (hasLayout): use std::find_if and compare_memfun
2669 (GetLayout): use std::find_if and comapre_memfun
2670 (delete_layout): use std::remove_if and compare_memfun
2671 (NumberOfClass): use std:.find_if and compare_memfun
2673 * src/gettext.h: change for the new functions
2675 * src/gettext.C: new file, make _(char const * str) and _(string
2676 const & str) real functions.
2678 * src/font.C (width): rewrite slightly to avoid one extra variable
2680 * src/debug.C: initialize Debug::ANY here
2682 * src/commandtags.h: update number comments
2684 * src/combox.h (get): make const func
2686 (getline): make const
2688 * src/combox.C (input_cb): handle case where fl_get_input can
2691 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2692 "support/lyxfunctional.h", remove current_view variable.
2693 (resize): use std::for_each with std::mem_fun
2694 (getFileNames): use std::copy with back_inserter_fun
2695 (getBuffer): change arg type to unsigned int
2696 (emergencyWriteAll): call emergencyWrite with std::for_each and
2698 (emergencyWrite): new method, the for loop in emergencyWriteAll
2700 (exists): use std::find_if with compare_memfun
2701 (getBuffer): use std::find_if and compare_memfun
2703 * src/buffer.h: add typedefs for iterator_category, value_type
2704 difference_type, pointer and reference for inset_iterator
2705 add postfix ++ for inset_iterator
2706 make inset_iterator::getPos() const
2708 * src/buffer.C: added support/lyxmanip.h
2709 (readFile): use lyxerr << fmt instead of printf
2710 (makeLaTeXFile): use std::copy to write out encodings
2712 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2714 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2715 free and the char * temp.
2716 (hasMenu): use std::find_if and compare_memfun
2719 * src/Makefile.am (lyx_SOURCES): added gettext.C
2721 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2722 string::insert small change to avoid temporary
2724 * src/LColor.C (getGUIName): remove c_str()
2726 * several files: change all occurrences of fl_display to
2729 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2730 that -pedantic is not used for gcc 2.97 (cvs gcc)
2732 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2734 2000-10-11 Allan Rae <rae@lyx.org>
2736 * src/frontends/xforms/FormPreferences.C (input): template path must be
2737 a readable directory. It doesn't need to be writeable.
2738 (build, delete, update, apply): New inputs in the various tabfolders
2740 * src/frontends/xforms/forms/form_preferences.fd:
2741 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2742 several new entries to existing folders. Shuffled some existing stuff
2745 * src/frontends/xforms/forms/form_print.fd:
2746 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2747 Should probably rework PrinterParams as well. Note that the switch to
2748 collated is effectively the same as !unsorted so changing PrinterParams
2749 will require a lot of fiddly changes to reverse the existing logic.
2751 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2753 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2755 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2757 2000-10-10 Allan Rae <rae@lyx.org>
2760 * src/lyxfunc.C (Dispatch):
2762 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2765 * src/lyxrc.C (output): Only write the differences between system lyxrc
2766 and the users settings.
2769 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2771 I'll rewrite this later, after 1.1.6 probably, to keep a single
2772 LyXRC but two instances of a LyXRCStruct.
2774 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2776 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2778 * src/tabular.h: add a few std:: qualifiers.
2780 * src/encoding.C: add using directive.
2781 * src/language.C: ditto.
2783 * src/insets/insetquotes.C (Validate): use languages->lang()
2784 instead of only language.
2786 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2788 * lib/languages: New file.
2790 * lib/encodings: New file.
2792 * src/language.C (Languages): New class.
2793 (read): New method. Reads the languages from the 'languages' file.
2795 * src/encoding.C (Encodings): New class.
2796 (read): New method. Reads the encodings from the 'encodings' file.
2798 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2801 * src/bufferparams.h and a lot of files: Deleted the member language,
2802 and renamed language_info to language
2804 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2805 * src/lyxfont.C (latexWriteStartChanges): ditto.
2806 * src/paragraph.C (validate,TeXOnePar): ditto.
2808 * src/lyxfont.C (update): Restored deleted code.
2810 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2812 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2814 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2816 * src/insets/figinset.[Ch]:
2817 * src/insets/insetinclude.[Ch]:
2818 * src/insets/insetinclude.[Ch]:
2819 * src/insets/insetparent.[Ch]:
2820 * src/insets/insetref.[Ch]:
2821 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2823 * src/insets/*.[Ch]:
2824 * src/mathed/formula.[Ch]:
2825 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2827 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2828 * src/lyx_cb.C (FigureApplyCB):
2829 * src/lyxfunc.C (getStatus, Dispatch):
2830 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2833 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2835 * src/converter.[Ch] (Formats::View):
2836 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2838 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2839 *current_view->buffer(). This will change later, but this patch is way
2842 2000-10-09 Juergen Vigna <jug@sad.it>
2844 * src/text.C (GetRow): small fix.
2846 * src/BufferView_pimpl.C (cursorPrevious):
2847 (cursorNext): added LyXText parameter to function.
2849 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2850 keypress depending on cursor position.
2852 2000-10-06 Juergen Vigna <jug@sad.it>
2854 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2855 (copySelection): redone this function and also copy ascii representa-
2858 * src/tabular.C (Ascii):
2862 (print_n_chars): new functions to realize the ascii export of tabulars.
2864 2000-10-05 Juergen Vigna <jug@sad.it>
2866 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2867 if we don't have a buffer.
2869 2000-10-10 Allan Rae <rae@lyx.org>
2871 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2872 with closing dialog. It seems that nested tabfolders require hiding
2873 of inner tabfolders before hiding the dialog itself. Actually all I
2874 did was hide the active outer folder.
2876 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2877 unless there really is a buffer. hideBufferDependent is called
2880 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2881 POTFILES.in stays in $(srcdir).
2883 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2885 * lib/lyxrc.example: Few changes.
2887 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2889 * src/BufferView_pimpl.C (buffer): only need one the
2890 updateBufferDependent signal to be emitted once! Moved to the end of
2891 the method to allow bv_->text to be updated first.
2893 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2894 and hSignal_ with Dialogs * and BufferDependency variables.
2895 New Buffer * parent_, initialised when the dialog is launched. Used to
2896 check whether to update() or hide() dialog in the new, private
2897 updateOrHide() method that is connected to the updateBufferDependent
2898 signal. Daughter classes dictate what to do using the
2899 ChangedBufferAction enum, passed to the c-tor.
2901 * src/frontends/xforms/FormCitation.C:
2902 * src/frontends/xforms/FormCommand.C:
2903 * src/frontends/xforms/FormCopyright.C:
2904 * src/frontends/xforms/FormDocument.C:
2905 * src/frontends/xforms/FormError.C:
2906 * src/frontends/xforms/FormIndex.C:
2907 * src/frontends/xforms/FormPreferences.C:
2908 * src/frontends/xforms/FormPrint.C:
2909 * src/frontends/xforms/FormRef.C:
2910 * src/frontends/xforms/FormToc.C:
2911 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2914 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2915 ChangedBufferAction enum.
2917 * src/frontends/xforms/FormParagraph.[Ch]
2918 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2921 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2923 * lib/bind/cua.bind: fix a bit.
2924 * lib/bind/emacs.bind: ditto.
2926 * lib/bind/menus.bind: remove real menu entries from there.
2928 * src/spellchecker.C: make sure we only include strings.h when
2931 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2933 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2934 function. It enlarges the maximum number of pup when needed.
2935 (add_toc2): Open a new menu if maximum number of items per menu has
2938 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2940 * src/frontends/kde/FormPrint.C: fix error reporting
2942 * src/frontends/xforms/FormDocument.C: fix compiler
2945 * lib/.cvsignore: add Literate.nw
2947 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2950 * bufferview_funcs.[Ch]
2953 * text2.C: Add support for numbers in RTL text.
2955 2000-10-06 Allan Rae <rae@lyx.org>
2957 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2958 to be gettext.m4 friendly again. ext_l10n.h is now
2959 generated into $top_srcdir instead of $top_builddir
2960 so that lyx.pot will be built correctly -- without
2961 duplicate parsing of ext_l10n.h.
2963 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2965 * src/frontends/kde/FormCitation.C: make the dialog
2966 behave more sensibly
2968 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2970 * config/kde.m4: fix consecutive ./configure runs,
2971 look for qtarch, fix library order
2973 * src/frontends/kde/Makefile.am: tidy up,
2974 add Print dialog, add .dlg dependencies
2976 * src/frontends/kde/FormPrint.C:
2977 * src/frontends/kde/FormPrint.h:
2978 * src/frontends/kde/formprintdialog.C:
2979 * src/frontends/kde/formprintdialog.h:
2980 * src/frontends/kde/formprintdialogdata.C:
2981 * src/frontends/kde/formprintdialogdata.h:
2982 * src/frontends/kde/dlg/formprintdialog.dlg: add
2985 * src/frontends/kde/dlg/README: Added explanatory readme
2987 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2988 script to double-check qtarch's output
2990 * src/frontends/kde/formindexdialog.C:
2991 * src/frontends/kde/formindexdialogdata.C:
2992 * src/frontends/kde/formindexdialogdata.h:
2993 * src/frontends/kde/dlg/formindexdialog.dlg: update
2994 for qtarch, minor fixes
2996 2000-10-05 Allan Rae <rae@lyx.org>
2998 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2999 dialogs when switching buffers update them instead. It's up to each
3000 dialog to decide if it should still be visible or not.
3001 update() should return a bool to control visiblity within show().
3002 Or perhaps better to set a member variable and use that to control
3005 * lib/build-listerrors: create an empty "listerrors" file just to stop
3006 make trying to regenerate it all the time if you don't have noweb
3009 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3011 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3012 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3013 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3014 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3015 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3017 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3019 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3021 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3022 deleting buffer. Closes all buffer-dependent dialogs.
3024 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3026 * src/frontends/xforms/FormCitation.[Ch]:
3027 * src/frontends/xforms/FormPreferences.[Ch]:
3028 * src/frontends/xforms/FormPrint.[Ch]:
3029 * src/frontends/xforms/FormRef.[Ch]:
3030 * src/frontends/xforms/FormUrl.[Ch]: ditto
3032 * src/frontends/xforms/FormDocument.[Ch]:
3033 * src/frontends/xforms/forms/form_document.C.patch:
3034 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3035 pass through a single input() function.
3037 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3039 * lib/build-listerrors: return status as OK
3041 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3043 * lib/lyxrc.example: Updated to new export code
3045 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3047 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3050 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3053 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3054 LyX-Code is defined.
3055 * lib/layouts/amsbook.layout: ditto.
3057 * boost/Makefile.am: fix typo.
3059 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3061 (add_lastfiles): removed.
3062 (add_documents): removed.
3063 (add_formats): removed.
3065 * src/frontends/Menubar.C: remove useless "using" directive.
3067 * src/MenuBackend.h: add a new MenuItem constructor.
3069 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3072 2000-10-04 Allan Rae <rae@lyx.org>
3074 * lib/Makefile.am (listerrors):
3075 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3076 I haven't got notangle installed so Kayvan please test. The output
3077 should end up in $builddir. This also allows people who don't have
3078 noweb installed to complete the make process without error.
3080 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3081 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3082 by JMarc's picky compiler.
3084 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3087 * src/insets/insettabular.C (setPos): change for loop to not use
3088 sequencing operator. Please check this Jürgen.
3090 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3092 * src/insets/insetcite.C (getScreenLabel): ditto
3093 * src/support/filetools.C (QuoteName): ditto
3094 (ChangeExtension): ditto
3096 * src/BufferView_pimpl.C (scrollCB): make heigt int
3098 * src/BufferView2.C (insertInset): comment out unused arg
3100 * boost/Makefile.am (EXTRADIST): new variable
3102 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3104 * src/exporter.C (IsExportable): Fixed
3106 * lib/configure.m4: Small fix
3108 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3110 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3111 * src/insets/insetbib.C (bibitemWidest): ditto.
3112 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3114 2000-10-03 Juergen Vigna <jug@sad.it>
3116 * src/BufferView2.C (theLockingInset): removed const because of
3117 Agnus's compile problems.
3119 * src/insets/insettext.C (LocalDispatch): set the language of the
3120 surronding paragraph on inserting the first character.
3122 * various files: changed use of BufferView::the_locking_inset.
3124 * src/BufferView2.C (theLockingInset):
3125 (theLockingInset): new functions.
3127 * src/BufferView.h: removed the_locking_inset.
3129 * src/lyxtext.h: added the_locking_inset
3131 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3133 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3135 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3137 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3138 * src/mathed/math_cursor.C (IsAlpha): ditto.
3139 * src/mathed/math_inset.C (strnew): ditto.
3140 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3141 (IMetrics): cxp set but never used; removed.
3142 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3143 that the variable in question has been removed also!
3146 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3147 using the Buffer * passed to Latex(), using the BufferView * passed to
3148 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3150 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3151 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3153 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3154 * src/buffer.C (readInset): used new InsetBibtex c-tor
3155 * (getBibkeyList): used new InsetBibtex::getKeys
3157 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3160 * lib/build-listerrors
3162 * src/exporter.C: Add literate programming support to the export code
3165 * src/lyx_cb.C: Remove old literate code.
3167 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3170 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3171 * src/converter.C (View, Convert): Use QuoteName.
3173 * src/insets/figinset.C (Preview): Use Formats::View.
3175 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3177 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3179 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3180 the top of the function, because compaq cxx complains that the
3181 "goto exit_with_message" when the function is disabled bypasses
3183 (MenuNew): try a better fix for the generation of new file names.
3184 This time, I used AddName() instead of AddPath(), hoping Juergen
3187 2000-10-03 Allan Rae <rae@lyx.org>
3189 * src/frontends/xforms/forms/form_preferences.fd:
3190 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3191 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3192 "Look and Feel"->"General" but will need to be split up further into
3193 general output and general input tabs. Current plan is for four outer
3194 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3195 stuff; "Inputs" for input and import configuration; "Outputs" for
3196 output and export configuration; and one more whatever is left over
3197 called "General". The leftovers at present look like being which
3198 viewers to use, spellchecker, language support and might be better
3199 named "Support". I've put "Paths" in "Inputs" for the moment as this
3200 seems reasonable for now at least.
3201 One problem remains: X error kills LyX when you close Preferences.
3203 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3205 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3206 qualifier from form()
3207 * src/frontends/xforms/FormCitation.[Ch]:
3208 * src/frontends/xforms/FormCopyright.[Ch]:
3209 * src/frontends/xforms/FormDocument.[Ch]:
3210 * src/frontends/xforms/FormError.[Ch]:
3211 * src/frontends/xforms/FormIndex.[Ch]:
3212 * src/frontends/xforms/FormPreferences.[Ch]:
3213 * src/frontends/xforms/FormPrint.[Ch]:
3214 * src/frontends/xforms/FormRef.[Ch]:
3215 * src/frontends/xforms/FormToc.[Ch]:
3216 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3218 * src/frontends/xforms/FormCitation.[Ch]:
3219 * src/frontends/xforms/FormIndex.[Ch]:
3220 * src/frontends/xforms/FormRef.[Ch]:
3221 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3222 with Allan's naming policy
3224 * src/frontends/xforms/FormCitation.C: some static casts to remove
3227 2000-10-02 Juergen Vigna <jug@sad.it>
3229 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3230 now you can type or do stuff inside the table-cell also when in dummy
3231 position, fixed visible cursor.
3233 * src/insets/insettext.C (Edit): fixing cursor-view position.
3235 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3236 be used for equal functions in lyxfunc and insettext.
3238 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3240 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3242 * src/frontends/gnome/FormCitation.h:
3243 * src/frontends/gnome/FormCopyright.h:
3244 * src/frontends/gnome/FormIndex.h:
3245 * src/frontends/gnome/FormPrint.h:
3246 * src/frontends/gnome/FormToc.h:
3247 * src/frontends/gnome/FormUrl.h:
3248 * src/frontends/kde/FormCitation.h:
3249 * src/frontends/kde/FormCopyright.h:
3250 * src/frontends/kde/FormIndex.h:
3251 * src/frontends/kde/FormRef.h:
3252 * src/frontends/kde/FormToc.h:
3253 * src/frontends/kde/FormUrl.h: fix remaining users of
3256 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3258 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3259 from depth argument.
3260 (DocBookHandleCaption): ditto.
3261 (DocBookHandleFootnote): ditto.
3262 (SimpleDocBookOnePar): ditto.
3264 * src/frontends/xforms/FormDocument.h (form): remove extra
3265 FormDocument:: qualifier.
3267 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3269 * sigc++/handle.h: ditto.
3271 * src/lyx_gui_misc.C: add "using" directive.
3273 * src/cheaders/cstddef: new file, needed by the boost library (for
3276 2000-10-02 Juergen Vigna <jug@sad.it>
3278 * src/insets/insettext.C (SetFont): better support.
3280 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3282 * src/screen.C (DrawOneRow): some uint refixes!
3284 2000-10-02 Allan Rae <rae@lyx.org>
3286 * boost/.cvsignore: ignore Makefile as well
3288 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3289 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3291 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3292 Left this one out by accident.
3294 * src/frontends/xforms/FormBase.h (restore): default to calling
3295 update() since that will restore the original/currently-applied values.
3296 Any input() triggered error messages will require the derived classes
3297 to redefine restore().
3299 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3300 avoid a segfault. combo_doc_class is the main concern.
3302 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3304 * Simplify build-listerrors in view of GUI-less export ability!
3306 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3308 * src/lyx_main.C (easyParse): Disable gui when exporting
3310 * src/insets/figinset.C:
3313 * src/lyx_gui_misc.C
3314 * src/tabular.C: Changes to allow no-gui.
3316 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3318 * src/support/utility.hpp: removed file
3319 * src/support/block.h: removed file
3321 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3324 * src/mathed/formula.C: add support/lyxlib.h
3325 * src/mathed/formulamacro.C: ditto
3327 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3328 * src/lyxparagraph.h: ditto
3330 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3331 * src/frontends/Makefile.am (INCLUDES): ditto
3332 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3333 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3334 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3335 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3336 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3337 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3339 * src/BufferView.h: use boost/utility.hpp
3340 * src/LColor.h: ditto
3341 * src/LaTeX.h: ditto
3342 * src/LyXAction.h: ditto
3343 * src/LyXView.h: ditto
3344 * src/bufferlist.h: ditto
3345 * src/lastfiles.h: ditto
3346 * src/layout.h: ditto
3347 * src/lyx_gui.h: ditto
3348 * src/lyx_main.h: ditto
3349 * src/lyxlex.h: ditto
3350 * src/lyxrc.h: ditto
3351 * src/frontends/ButtonPolicies.h: ditto
3352 * src/frontends/Dialogs.h: ditto
3353 * src/frontends/xforms/FormBase.h: ditto
3354 * src/frontends/xforms/FormGraphics.h: ditto
3355 * src/frontends/xforms/FormParagraph.h: ditto
3356 * src/frontends/xforms/FormTabular.h: ditto
3357 * src/graphics/GraphicsCache.h: ditto
3358 * src/graphics/Renderer.h: ditto
3359 * src/insets/ExternalTemplate.h: ditto
3360 * src/insets/insetcommand.h: ditto
3361 * src/support/path.h: ditto
3363 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3364 and introduce clause for 2.97.
3366 * boost/libs/README: new file
3368 * boost/boost/utility.hpp: new file
3370 * boost/boost/config.hpp: new file
3372 * boost/boost/array.hpp: new file
3374 * boost/Makefile.am: new file
3376 * boost/.cvsignore: new file
3378 * configure.in (AC_OUTPUT): add boost/Makefile
3380 * Makefile.am (SUBDIRS): add boost
3382 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3384 * src/support/lstrings.C (suffixIs): Fixed.
3386 2000-10-01 Allan Rae <rae@lyx.org>
3388 * src/PrinterParams.h: moved things around to avoid the "can't
3389 inline call" warning.
3391 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3392 into doc++ documentation.
3394 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3396 * src/frontends/xforms/FormRef.C: make use of button controller
3397 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3398 cleaned up button controller usage.
3399 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3400 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3401 use the button controller
3403 * src/frontends/xforms/forms/*.fd: and associated generated files
3404 updated to reflect changes to FormBase. Some other FormXxxx files
3405 also got minor updates to reflect changes to FormBase.
3407 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3408 (hide): made virtual.
3409 (input): return a bool. true == valid input
3410 (RestoreCB, restore): new
3411 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3412 Changes to allow derived dialogs to use a ButtonController and
3413 make sense when doing so: OK button calls ok() and so on.
3415 * src/frontends/xforms/ButtonController.h (class ButtonController):
3416 Switch from template implementation to taking Policy parameter.
3417 Allows FormBase to provide a ButtonController for any dialog.
3419 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3420 Probably should rename connect and disconnect.
3421 (apply): use the radio button groups
3422 (form): needed by FormBase
3423 (build): setup the radio button groups
3425 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3427 * several files: type changes to reduce the number of warnings and
3428 to unify type hangling a bit. Still much to do.
3430 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3432 * lib/images/*: rename a bunch of icons to match Dekel converter
3435 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3438 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3440 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3442 * sigc++/handle.h: ditto for class Handle.
3444 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3446 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3448 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3450 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3451 removal of the "default" language.
3453 * src/combox.h (getline): Check that sel > 0
3455 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3457 * lib/examples/docbook_example.lyx
3458 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3460 * lib/layouts/docbook-book.layout: new docbook book layout.
3462 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3464 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3466 * src/insets/figinset.C (DocBook):fixed small typo.
3468 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3470 * src/insets/insetinclude.h: string include_label doesn't need to be
3473 2000-09-29 Allan Rae <rae@lyx.org>
3475 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3476 Allow derived type to control connection and disconnection from signals
3477 of its choice if desired.
3479 2000-09-28 Juergen Vigna <jug@sad.it>
3481 * src/insets/insettabular.C (update): fixed cursor setting when
3482 the_locking_inset changed.
3483 (draw): made this a bit cleaner.
3484 (InsetButtonPress): fixed!
3486 * various files: added LyXText Parameter to fitCursor call.
3488 * src/BufferView.C (fitCursor): added LyXText parameter.
3490 * src/insets/insettabular.C (draw): small draw fix.
3492 * src/tabular.C: right setting of left/right celllines.
3494 * src/tabular.[Ch]: fixed various types in funcions and structures.
3495 * src/insets/insettabular.C: ditto
3496 * src/frontends/xforms/FormTabular.C: ditto
3498 2000-09-28 Allan Rae <rae@lyx.org>
3500 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3501 that the #ifdef's had been applied to part of what should have been
3502 a complete condition. It's possible there are other tests that
3503 were specific to tables that are also wrong now that InsetTabular is
3504 being used. Now we need to fix the output of '\n' after a table in a
3505 float for the same reason as the original condition:
3506 "don't insert this if we would be adding it before or after a table
3507 in a float. This little trick is needed in order to allow use of
3508 tables in \subfigures or \subtables."
3509 Juergen can you check this?
3511 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3514 output to the ostream.
3516 * several files: fixed types based on warnings from cxx
3518 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3520 * src/frontends/kde/Makefile.am: fix rule for
3521 formindexdialogdata_moc.C
3523 * src/.cvsignore: add ext_l10n.h to ignore
3525 * acconfig.h: stop messing with __STRICT_ANSI__
3526 * config/gnome.m4: remove option to set -ansi
3527 * config/kde.m4: remove option to set -ansi
3528 * config/lyxinclude.m4: don't set -ansi
3530 2000-09-27 Juergen Vigna <jug@sad.it>
3532 * various files: remove "default" language check.
3534 * src/insets/insetquotes.C: removed use of current_view.
3536 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3537 the one should have red ears by now!
3539 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3540 in more then one paragraph. Fixed cursor-movement/selection.
3542 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3543 paragraphs inside a text inset.
3545 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3546 text-inset if this owner is an inset.
3548 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3550 * src/Bullet.h: changed type of font, character and size to int
3552 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3554 * src/insets/inseturl.[Ch]:
3555 * src/insets/insetref.[Ch]:
3556 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3558 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3560 * src/buffer.C (readFile): block-if statement rearranged to minimise
3561 bloat. Patch does not reverse Jean-Marc's change ;-)
3563 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3564 Class rewritten to store pointers to hide/update signals directly,
3565 rather than Dialogs *. Also defined an enum to ease use. All xforms
3566 forms can now be derived from this class.
3568 * src/frontends/xforms/FormCommand.[Ch]
3569 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3571 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3574 * src/frontends/xforms/forms/form_citation.fd
3575 * src/frontends/xforms/forms/form_copyright.fd
3576 * src/frontends/xforms/forms/form_error.fd
3577 * src/frontends/xforms/forms/form_index.fd
3578 * src/frontends/xforms/forms/form_ref.fd
3579 * src/frontends/xforms/forms/form_toc.fd
3580 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3582 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3584 * src/insets/insetfoot.C: removed redundent using directive.
3586 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3588 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3589 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3591 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3592 created in the constructors in different groups. Then set() just
3593 have to show the groups as needed. This fixes the redraw problems
3594 (and is how the old menu code worked).
3596 * src/support/lyxlib.h: declare the methods as static when we do
3597 not have namespaces.
3599 2000-09-26 Juergen Vigna <jug@sad.it>
3601 * src/buffer.C (asciiParagraph): new function.
3602 (writeFileAscii): new function with parameter ostream.
3603 (writeFileAscii): use now asciiParagraph.
3605 * various inset files: added the linelen parameter to the Ascii-func.
3607 * src/tabular.C (Write): fixed error in writing file introduced by
3608 the last changes from Lars.
3610 * lib/bind/menus.bind: removed not supported functions.
3612 * src/insets/insettext.C (Ascii): implemented this function.
3614 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3616 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3617 (Write): use of the write_attribute functions.
3619 * src/bufferlist.C (close): fixed reasking question!
3621 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3623 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3624 new files use the everwhere possible.
3627 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3628 src/log_form.C src/lyx.C:
3631 * src/buffer.C (runLaTeX): remove func
3633 * src/PaperLayout.C: removed file
3634 * src/ParagraphExtra.C: likewise
3635 * src/bullet_forms.C: likewise
3636 * src/bullet_forms.h: likewise
3637 * src/bullet_forms_cb.C: likewise
3639 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3640 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3643 * several files: remove all traces of the old fd_form_paragraph,
3644 and functions belonging to that.
3646 * several files: remove all traces of the old fd_form_document,
3647 and functions belonging to that.
3649 * several files: constify local variables were possible.
3651 * several files: remove all code that was dead when NEW_EXPORT was
3654 * several files: removed string::c_str in as many places as
3657 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3658 (e): be a bit more outspoken when patching
3659 (updatesrc): only move files if changed.
3661 * forms/layout_forms.h.patch: regenerated
3663 * forms/layout_forms.fd: remove form_document and form_paragraph
3664 and form_quotes and form_paper and form_table_options and
3665 form_paragraph_extra
3667 * forms/form1.fd: remove form_table
3669 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3670 the fdui->... rewrite. Update some comments to xforms 0.88
3672 * forms/bullet_forms.C.patch: removed file
3673 * forms/bullet_forms.fd: likewise
3674 * forms/bullet_forms.h.patch: likewise
3676 * development/Code_rules/Rules: added a section on switch
3677 statements. Updated some comment to xforms 0.88.
3679 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3681 * src/buffer.C (readFile): make sure that the whole version number
3682 is read after \lyxformat (even when it contains a comma)
3684 * lib/ui/default.ui: change shortcut of math menu to M-a.
3686 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3688 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3691 * src/LyXView.C (updateWindowTitle): show the full files name in
3692 window title, limited to 30 characters.
3694 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3695 When a number of characters has been given, we should not assume
3696 that the string is 0-terminated.
3698 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3699 calls (fixes some memory leaks)
3701 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3702 trans member on exit.
3704 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3706 * src/converter.C (GetReachable): fix typo.
3708 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3709 understand ',' instead of '.'.
3710 (GetInteger): rewrite to use strToInt().
3712 2000-09-26 Juergen Vigna <jug@sad.it>
3714 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3715 better visibility and error-message on wrong VSpace input.
3717 * src/language.C (initL): added english again.
3719 2000-09-25 Juergen Vigna <jug@sad.it>
3721 * src/frontends/kde/Dialogs.C (Dialogs):
3722 * src/frontends/gnome/Dialogs.C (Dialogs):
3723 * src/frontends/kde/Makefile.am:
3724 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3726 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3728 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3730 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3732 * src/frontends/xforms/FormParagraph.C:
3733 * src/frontends/xforms/FormParagraph.h:
3734 * src/frontends/xforms/form_paragraph.C:
3735 * src/frontends/xforms/form_paragraph.h:
3736 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3739 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3741 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3742 Paragraph-Data after use.
3744 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3745 non breakable paragraphs.
3747 2000-09-25 Garst R. Reese <reese@isn.net>
3749 * src/language.C (initL): added missing language_country codes.
3751 2000-09-25 Juergen Vigna <jug@sad.it>
3753 * src/insets/insettext.C (InsetText):
3754 (deleteLyXText): remove the not released LyXText structure!
3756 2000-09-24 Marko Vendelin <markov@ioc.ee>
3758 * src/frontends/gnome/mainapp.C
3759 * src/frontends/gnome/mainapp.h: added support for keyboard
3762 * src/frontends/gnome/FormCitation.C
3763 * src/frontends/gnome/FormCitation.h
3764 * src/frontends/gnome/Makefile.am
3765 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3766 FormCitation to use "action area" in mainapp window
3768 * src/frontends/gnome/Menubar_pimpl.C
3769 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3772 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3774 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3775 width/descent/ascent values if name is empty.
3776 (mathed_string_height): Use std::max.
3778 2000-09-25 Allan Rae <rae@lyx.org>
3780 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3781 segfault. This will be completely redesigned soon.
3783 * sigc++: updated libsigc++. Fixes struct timespec bug.
3785 * development/tools/makeLyXsigc.sh: .cvsignore addition
3787 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3789 * several files: removed almost all traces of the old table
3792 * src/TableLayout.C: removed file
3794 2000-09-22 Juergen Vigna <jug@sad.it>
3796 * src/frontends/kde/Dialogs.C: added credits forms.
3798 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3800 * src/frontends/gnome/Dialogs.C: added some forms.
3802 * src/spellchecker.C (init_spell_checker): set language in pspell code
3803 (RunSpellChecker): some modifications for setting language string.
3805 * src/language.[Ch]: added language_country code.
3807 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3809 * src/frontends/Dialogs.h: added new signal showError.
3810 Rearranged existing signals in some sort of alphabetical order.
3812 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3813 FormError.[Ch], form_error.[Ch]
3814 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3815 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3817 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3818 dialogs. I think that this can be used as the base to all these
3821 * src/frontends/xforms/FormError.[Ch]
3822 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3823 implementation of InsetError dialog.
3825 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3827 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3828 * src/frontends/kde/Makefile.am: ditto
3830 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3832 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3833 macrobf. This fixes a bug of invisible text.
3835 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3837 * lib/doc/LaTeXConfig.lyx.in: updated.
3839 * src/language.C (initL): remove language "francais" and change a
3840 bit the names of the two other french variations.
3842 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3843 string that may not be 0-terminated.
3845 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3847 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3849 2000-09-20 Marko Vendelin <markov@ioc.ee>
3851 * src/frontends/gnome/FormCitation.C
3852 * src/frontends/gnome/FormIndex.C
3853 * src/frontends/gnome/FormToc.C
3854 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3855 the variable initialization to shut up the warnings
3857 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3859 * src/table.[Ch]: deleted files
3861 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3864 2000-09-18 Juergen Vigna <jug@sad.it>
3866 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3867 problems with selection. Inserted new LFUN_PASTESELECTION.
3868 (InsetButtonPress): inserted handling of middle mouse-button paste.
3870 * src/spellchecker.C: changed word to word.c_str().
3872 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3874 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3875 included in the ``make dist'' tarball.
3877 2000-09-15 Juergen Vigna <jug@sad.it>
3879 * src/CutAndPaste.C (cutSelection): small fix return the right
3880 end position after cut inside one paragraph only.
3882 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3883 we are locked as otherwise we don't have a valid cursor position!
3885 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3887 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3889 * src/frontends/kde/FormRef.C: added using directive.
3890 * src/frontends/kde/FormToc.C: ditto
3892 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3894 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3896 2000-09-19 Marko Vendelin <markov@ioc.ee>
3898 * src/frontends/gnome/Menubar_pimpl.C
3899 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3900 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3902 * src/frontends/gnome/mainapp.C
3903 * src/frontends/gnome/mainapp.h: support for menu update used
3906 * src/frontends/gnome/mainapp.C
3907 * src/frontends/gnome/mainapp.h: support for "action" area in the
3908 main window. This area is used by small simple dialogs, such as
3911 * src/frontends/gnome/FormIndex.C
3912 * src/frontends/gnome/FormIndex.h
3913 * src/frontends/gnome/FormUrl.C
3914 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3917 * src/frontends/gnome/FormCitation.C
3918 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3919 action area. Only "Insert new citation" is implemented.
3921 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3923 * src/buffer.C (Dispatch): fix call to Dispatch
3924 * src/insets/insetref.C (Edit): likewise
3925 * src/insets/insetparent.C (Edit): likewise
3926 * src/insets/insetinclude.C (include_cb): likewise
3927 * src/frontends/xforms/FormUrl.C (apply): likewise
3928 * src/frontends/xforms/FormToc.C (apply): likewise
3929 * src/frontends/xforms/FormRef.C (apply): likewise
3930 * src/frontends/xforms/FormIndex.C (apply): likewise
3931 * src/frontends/xforms/FormCitation.C (apply): likewise
3932 * src/lyxserver.C (callback): likewise
3933 * src/lyxfunc.C (processKeySym): likewise
3934 (Dispatch): likewise
3935 (Dispatch): likewise
3936 * src/lyx_cb.C (LayoutsCB): likewise
3938 * Makefile.am (sourcedoc): small change
3940 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3942 * src/main.C (main): Don't make an empty GUIRunTime object. all
3943 methods are static. constify a bit remove unneded using + headers.
3945 * src/tabular.C: some more const to local vars move some loop vars
3947 * src/spellchecker.C: added some c_str after some word for pspell
3949 * src/frontends/GUIRunTime.h: add new static method setDefaults
3950 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3951 * src/frontends/kde/GUIRunTime.C (setDefaults):
3952 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3954 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3955 with strnew in arg, use correct emptystring when calling SetName.
3957 * several files: remove all commented code with relation to
3958 HAVE_SSTREAM beeing false. We now only support stringstream and
3961 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3963 * src/lyxfunc.C: construct correctly the automatic new file
3966 * src/text2.C (IsStringInText): change type of variable i to shut
3969 * src/support/sstream.h: do not use namespaces if the compiler
3970 does not support them.
3972 2000-09-15 Marko Vendelin <markov@ioc.ee>
3973 * src/frontends/gnome/FormCitation.C
3974 * src/frontends/gnome/FormCitation.h
3975 * src/frontends/gnome/diainsertcitation_interface.c
3976 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3977 regexp support to FormCitation [Gnome].
3979 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3982 * configure.in: remove unused KDE/GTKGUI define
3984 * src/frontends/kde/FormRef.C
3985 * src/frontends/kde/FormRef.h
3986 * src/frontends/kde/formrefdialog.C
3987 * src/frontends/kde/formrefdialog.h: double click will
3988 go to reference, now it is possible to change a cross-ref
3991 * src/frontends/kde/FormToc.C
3992 * src/frontends/kde/FormToc.h
3993 * src/frontends/kde/formtocdialog.C
3994 * src/frontends/kde/formtocdialog.h: add a depth
3997 * src/frontends/kde/Makefile.am: add QtLyXView.h
4000 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4002 * src/frontends/kde/FormCitation.h: added some using directives.
4004 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4006 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4009 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4012 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4014 * src/buffer.C (pop_tag): revert for the second time a change by
4015 Lars, who seems to really hate having non-local loop variables :)
4017 * src/Lsstream.h: add "using" statements.
4019 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4020 * src/buffer.C (writeFile): ditto
4022 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4024 * src/buffer.C (writeFile): try to fix the locale modified format
4025 number to always be as we want it.
4027 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4028 in XForms 0.89. C-space is now working again.
4030 * src/Lsstream.h src/support/sstream.h: new files.
4032 * also commented out all cases where strstream were used.
4034 * src/Bullet.h (c_str): remove method.
4036 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4038 * a lot of files: get rid of "char const *" and "char *" is as
4039 many places as possible. We only want to use them in interaction
4040 with system of other libraries, not inside lyx.
4042 * a lot of files: return const object is not of pod type. This
4043 helps ensure that temporary objects is not modified. And fits well
4044 with "programming by contract".
4046 * configure.in: check for the locale header too
4048 * Makefile.am (sourcedoc): new tag for generation of doc++
4051 2000-09-14 Juergen Vigna <jug@sad.it>
4053 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4054 callback to check which combo called it and do the right action.
4056 * src/combox.C (combo_cb): added combo * to the callbacks.
4057 (Hide): moved call of callback after Ungrab of the pointer.
4059 * src/intl.h: removed LCombo2 function.
4061 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4062 function as this can now be handled in one function.
4064 * src/combox.h: added Combox * to callback prototype.
4066 * src/frontends/xforms/Toolbar_pimpl.C:
4067 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4069 2000-09-14 Garst Reese <reese@isn.net>
4071 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4072 moved usepackage{xxx}'s to beginning of file. Changed left margin
4073 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4074 underlining from title. Thanks to John Culleton for useful suggestions.
4076 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4078 * src/lyxlex_pimpl.C (setFile): change error message to debug
4081 2000-09-13 Juergen Vigna <jug@sad.it>
4083 * src/frontends/xforms/FormDocument.C: implemented choice_class
4084 as combox and give callback to combo_language so OK/Apply is activated
4087 * src/bufferlist.C (newFile): small fix so already named files
4088 (via an open call) are not requested to be named again on the
4091 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4093 * src/frontends/kde/Makefile.am
4094 * src/frontends/kde/FormRef.C
4095 * src/frontends/kde/FormRef.h
4096 * src/frontends/kde/formrefdialog.C
4097 * src/frontends/kde/formrefdialog.h: implement
4100 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4102 * src/frontends/kde/formtocdialog.C
4103 * src/frontends/kde/formtocdialog.h
4104 * src/frontends/kde/FormToc.C
4105 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4107 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4109 * src/frontends/kde/FormCitation.C: fix thinko
4110 where we didn't always display the reference text
4113 * src/frontends/kde/formurldialog.C
4114 * src/frontends/kde/formurldialog.h
4115 * src/frontends/kde/FormUrl.C
4116 * src/frontends/kde/FormUrl.h: minor cleanups
4118 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4120 * src/frontends/kde/Makefile.am
4121 * src/frontends/kde/FormToc.C
4122 * src/frontends/kde/FormToc.h
4123 * src/frontends/kde/FormCitation.C
4124 * src/frontends/kde/FormCitation.h
4125 * src/frontends/kde/FormIndex.C
4126 * src/frontends/kde/FormIndex.h
4127 * src/frontends/kde/formtocdialog.C
4128 * src/frontends/kde/formtocdialog.h
4129 * src/frontends/kde/formcitationdialog.C
4130 * src/frontends/kde/formcitationdialog.h
4131 * src/frontends/kde/formindexdialog.C
4132 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4134 2000-09-12 Juergen Vigna <jug@sad.it>
4136 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4139 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4141 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4144 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4146 * src/converter.C (Add, Convert): Added support for converter flags:
4147 needaux, resultdir, resultfile.
4148 (Convert): Added new parameter view_file.
4149 (dvips_options): Fixed letter paper option.
4151 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4152 (Export, GetExportableFormats, GetViewableFormats): Added support
4155 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4157 (easyParse): Fixed to work with new export code.
4159 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4162 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4164 * lib/bind/*.bind: Replaced
4165 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4166 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4168 2000-09-11 Juergen Vigna <jug@sad.it>
4170 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4172 * src/main.C (main): now GUII defines global guiruntime!
4174 * src/frontends/gnome/GUIRunTime.C (initApplication):
4175 * src/frontends/kde/GUIRunTime.C (initApplication):
4176 * src/frontends/xforms/GUIRunTime.C (initApplication):
4177 * src/frontends/GUIRunTime.h: added new function initApplication.
4179 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4181 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4183 2000-09-08 Juergen Vigna <jug@sad.it>
4185 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4186 we have already "Reset".
4188 * src/language.C (initL): inserted "default" language and made this
4189 THE default language (and not american!)
4191 * src/paragraph.C: inserted handling of "default" language!
4193 * src/lyxfont.C: ditto
4197 * src/paragraph.C: output the \\par only if we have a following
4198 paragraph otherwise it's not needed.
4200 2000-09-05 Juergen Vigna <jug@sad.it>
4202 * config/pspell.m4: added entry to lyx-flags
4204 * src/spellchecker.C: modified version from Kevin for using pspell
4206 2000-09-01 Marko Vendelin <markov@ioc.ee>
4207 * src/frontends/gnome/Makefile.am
4208 * src/frontends/gnome/FormCitation.C
4209 * src/frontends/gnome/FormCitation.h
4210 * src/frontends/gnome/diainsertcitation_callbacks.c
4211 * src/frontends/gnome/diainsertcitation_callbacks.h
4212 * src/frontends/gnome/diainsertcitation_interface.c
4213 * src/frontends/gnome/diainsertcitation_interface.h
4214 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4215 dialog for Gnome frontend
4217 * src/main.C: Gnome libraries require keeping application name
4218 and its version as strings
4220 * src/frontends/gnome/mainapp.C: Change the name of the main window
4221 from GnomeLyX to PACKAGE
4223 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4225 * src/frontends/Liason.C: add "using: declaration.
4227 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4229 * src/mathed/math_macro.C (Metrics): Set the size of the template
4231 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4233 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4235 * src/converter.C (add_options): New function.
4236 (SetViewer): Change $$FName into '$$FName'.
4237 (View): Add options when running xdvi
4238 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4239 (Convert): The 3rd parameter is now the desired filename. Converts
4240 calls to lyx::rename if necessary.
4241 Add options when running dvips.
4242 (dvi_papersize,dvips_options): New methods.
4244 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4246 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4247 using a call to Converter::dvips_options.
4248 Fixed to work with nex export code.
4250 * src/support/copy.C
4251 * src/support/rename.C: New files
4253 * src/support/syscall.h
4254 * src/support/syscall.C: Added Starttype SystemDontWait.
4256 * lib/ui/default.ui: Changed to work with new export code
4258 * lib/configure.m4: Changed to work with new export code
4260 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4262 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4264 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4265 so that code compiles with DEC cxx.
4267 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4268 to work correctly! Also now supports the additional elements
4271 2000-09-01 Allan Rae <rae@lyx.org>
4273 * src/frontends/ButtonPolicies.C: renamed all the references to
4274 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4276 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4277 since it's a const not a type.
4279 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4281 2000-08-31 Juergen Vigna <jug@sad.it>
4283 * src/insets/figinset.C: Various changes to look if the filename has
4284 an extension and if not add it for inline previewing.
4286 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4288 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4289 make buttonStatus and isReadOnly be const methods. (also reflect
4290 this in derived classes.)
4292 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4293 (nextState): change to be static inline, pass the StateMachine as
4295 (PreferencesPolicy): remove casts
4296 (OkCancelPolicy): remvoe casts
4297 (OkCancelReadOnlyPolicy): remove casts
4298 (NoRepeatedApplyReadOnlyPolicy): remove casts
4299 (OkApplyCancelReadOnlyPolicy): remove casts
4300 (OkApplyCancelPolicy): remove casts
4301 (NoRepeatedApplyPolicy): remove casts
4303 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4305 * src/converter.C: added some using directives
4307 * src/frontends/ButtonPolicies.C: changes to overcome
4308 "need lvalue" error with DEC c++
4310 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4311 to WMHideCB for DEC c++
4313 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4315 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4316 to BulletBMTableCB for DEC c++
4318 2000-08-31 Allan Rae <rae@lyx.org>
4320 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4321 character dialog separately from old document dialogs combo_language.
4324 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4326 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4327 Removed LFUN_REF_CREATE.
4329 * src/MenuBackend.C: Added new tags: toc and references
4331 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4332 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4334 (add_toc, add_references): New methods.
4335 (create_submenu): Handle correctly the case when there is a
4336 seperator after optional menu items.
4338 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4339 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4340 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4342 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4344 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4346 * src/converter.[Ch]: New file for converting between different
4349 * src/export.[Ch]: New file for exporting a LyX file to different
4352 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4353 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4354 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4355 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4356 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4357 RunDocBook, MenuExport.
4359 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4360 Exporter::Preview methods if NEW_EXPORT is defined.
4362 * src/buffer.C (Dispatch): Use Exporter::Export.
4364 * src/lyxrc.C: Added new tags: \converter and \viewer.
4367 * src/LyXAction.C: Define new lyx-function: buffer-update.
4368 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4369 when NEW_EXPORT is defined.
4371 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4373 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4375 * lib/ui/default.ui: Added submenus "view" and "update" to the
4378 * src/filetools.C (GetExtension): New function.
4380 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4382 2000-08-29 Allan Rae <rae@lyx.org>
4384 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4386 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4387 (EnableDocumentLayout): removed
4388 (DisableDocumentLayout): removed
4389 (build): make use of ButtonController's read-only handling to
4390 de/activate various objects. Replaces both of the above functions.
4392 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4393 (readOnly): was read_only
4394 (refresh): fixed dumb mistakes with read_only_ handling
4396 * src/frontends/xforms/forms/form_document.fd:
4397 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4398 tabbed dialogs so the tabs look more like tabs and so its easier to
4399 work out which is the current tab.
4401 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4402 segfault with form_table
4404 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4406 2000-08-28 Juergen Vigna <jug@sad.it>
4408 * acconfig.h: added USE_PSPELL.
4410 * src/config.h.in: added USE_PSPELL.
4412 * autogen.sh: added pspell.m4
4414 * config/pspell.m4: new file.
4416 * src/spellchecker.C: implemented support for pspell libary.
4418 2000-08-25 Juergen Vigna <jug@sad.it>
4420 * src/LyXAction.C (init): renamed LFUN_TABLE to
4421 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4423 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4425 * src/lyxscreen.h: add force_clear variable and fuction to force
4426 a clear area when redrawing in LyXText.
4428 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4430 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4432 * some whitespace and comment changes.
4434 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4436 * src/buffer.C: up te LYX_FORMAT to 2.17
4438 2000-08-23 Juergen Vigna <jug@sad.it>
4440 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4443 * src/insets/insettabular.C (pasteSelection): delete the insets
4444 LyXText as it is not valid anymore.
4445 (copySelection): new function.
4446 (pasteSelection): new function.
4447 (cutSelection): new function.
4448 (LocalDispatch): implemented cut/copy/paste of cell selections.
4450 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4451 don't have a LyXText.
4453 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4455 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4458 2000-08-22 Juergen Vigna <jug@sad.it>
4460 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4461 ifdef form_table out if NEW_TABULAR.
4463 2000-08-21 Juergen Vigna <jug@sad.it>
4465 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4466 (draw): fixed draw position so that the cursor is positioned in the
4468 (InsetMotionNotify): hide/show cursor so the position is updated.
4469 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4470 using cellstart() function where it should be used.
4472 * src/insets/insettext.C (draw): ditto.
4474 * src/tabular.C: fixed initialization of some missing variables and
4475 made BoxType into an enum.
4477 2000-08-22 Marko Vendelin <markov@ioc.ee>
4478 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4479 stock menu item using action numerical value, not its string
4483 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4486 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4488 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4490 * src/frontends/xforms/GUIRunTime.C: new file
4492 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4493 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4495 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4497 * src/frontends/kde/GUIRunTime.C: new file
4499 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4500 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4502 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4504 * src/frontends/gnome/GUIRunTime.C: new file
4506 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4509 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4510 small change to documetentation.
4512 * src/frontends/GUIRunTime.C: removed file
4514 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4516 * src/lyxparagraph.h: enable NEW_TABULAR as default
4518 * src/lyxfunc.C (processKeySym): remove some commented code
4520 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4521 NEW_TABULAR around the fd_form_table_options.
4523 * src/lyx_gui.C (runTime): call the static member function as
4524 GUIRunTime::runTime().
4526 2000-08-21 Allan Rae <rae@lyx.org>
4528 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4531 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4533 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4535 2000-08-21 Allan Rae <rae@lyx.org>
4537 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4538 keep Garst happy ;-)
4539 * src/frontends/xforms/FormPreferences.C (build): use setOK
4540 * src/frontends/xforms/FormDocument.C (build): use setOK
4541 (FormDocument): use the appropriate policy.
4543 2000-08-21 Allan Rae <rae@lyx.org>
4545 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4546 automatic [de]activation of arbitrary objects when in a read-only state.
4548 * src/frontends/ButtonPolicies.h: More documentation
4549 (isReadOnly): added to support the above.
4551 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4553 2000-08-18 Juergen Vigna <jug@sad.it>
4555 * src/insets/insettabular.C (getStatus): changed to return func_status.
4557 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4558 display toggle menu entries if they are.
4560 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4561 new document layout now.
4563 * src/lyxfunc.C: ditto
4565 * src/lyx_gui_misc.C: ditto
4567 * src/lyx_gui.C: ditto
4569 * lib/ui/default.ui: removed paper and quotes layout as they are now
4570 all in the document layout tabbed folder.
4572 * src/frontends/xforms/forms/form_document.fd: added Restore
4573 button and callbacks for all inputs for Allan's ButtonPolicy.
4575 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4576 (CheckChoiceClass): added missing params setting on class change.
4577 (UpdateLayoutDocument): added for updating the layout on params.
4578 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4579 (FormDocument): Implemented Allan's ButtonPolicy with the
4582 2000-08-17 Allan Rae <rae@lyx.org>
4584 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4585 so we can at least see the credits again.
4587 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4588 controller calls for the appropriate callbacks. Note that since Ok
4589 calls apply followed by cancel, and apply isn't a valid input for the
4590 APPLIED state, the bc_ calls have to be made in the static callback not
4591 within each of the real callbacks.
4593 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4594 (setOk): renamed from setOkay()
4596 2000-08-17 Juergen Vigna <jug@sad.it>
4598 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4599 in the implementation part.
4600 (composeUIInfo): don't show optional menu-items.
4602 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4604 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4606 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4607 text-state when in a text-inset.
4609 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4611 2000-08-17 Marko Vendelin <markov@ioc.ee>
4612 * src/frontends/gnome/FormIndex.C
4613 * src/frontends/gnome/FormIndex.h
4614 * src/frontends/gnome/FormToc.C
4615 * src/frontends/gnome/FormToc.h
4616 * src/frontends/gnome/dialogs
4617 * src/frontends/gnome/diatoc_callbacks.c
4618 * src/frontends/gnome/diatoc_callbacks.h
4619 * src/frontends/gnome/diainsertindex_callbacks.h
4620 * src/frontends/gnome/diainsertindex_callbacks.c
4621 * src/frontends/gnome/diainsertindex_interface.c
4622 * src/frontends/gnome/diainsertindex_interface.h
4623 * src/frontends/gnome/diatoc_interface.h
4624 * src/frontends/gnome/diatoc_interface.c
4625 * src/frontends/gnome/Makefile.am: Table of Contents and
4626 Insert Index dialogs implementation for Gnome frontend
4628 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4630 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4632 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4635 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4637 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4638 destructor. Don't definde if you don't need it
4639 (processEvents): made static, non-blocking events processing for
4641 (runTime): static method. event loop for xforms
4642 * similar as above for kde and gnome.
4644 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4645 new Pimpl is correct
4646 (runTime): new method calss the real frontends runtime func.
4648 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4650 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4652 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4654 2000-08-16 Juergen Vigna <jug@sad.it>
4656 * src/lyx_gui.C (runTime): added GUII RunTime support.
4658 * src/frontends/Makefile.am:
4659 * src/frontends/GUIRunTime.[Ch]:
4660 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4661 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4662 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4664 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4666 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4667 as this is already set in ${FRONTEND_INCLUDE} if needed.
4669 * configure.in (CPPFLAGS): setting the include dir for the frontend
4670 directory and don't set FRONTEND=xforms for now as this is executed
4673 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4675 * src/frontends/kde/Makefile.am:
4676 * src/frontends/kde/FormUrl.C:
4677 * src/frontends/kde/FormUrl.h:
4678 * src/frontends/kde/formurldialog.h:
4679 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4681 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4683 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4685 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4687 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4690 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4692 * src/WorkArea.C (work_area_handler): more work to get te
4693 FL_KEYBOARD to work with xforms 0.88 too, please test.
4695 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4697 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4699 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4702 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4704 * src/Timeout.h: remove Qt::emit hack.
4706 * several files: changes to allo doc++ compilation
4708 * src/lyxfunc.C (processKeySym): new method
4709 (processKeyEvent): comment out if FL_REVISION < 89
4711 * src/WorkArea.C: change some debugging levels.
4712 (WorkArea): set wantkey to FL_KEY_ALL
4713 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4714 clearer code and the use of compose with XForms 0.89. Change to
4715 use signals instead of calling methods in bufferview directly.
4717 * src/Painter.C: change some debugging levels.
4719 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4722 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4723 (workAreaKeyPress): new method
4725 2000-08-14 Juergen Vigna <jug@sad.it>
4727 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4729 * config/kde.m4: addes some features
4731 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4732 include missing xforms dialogs.
4734 * src/Timeout.h: a hack to be able to compile with qt/kde.
4736 * sigc++/.cvsignore: added acinclude.m4
4738 * lib/.cvsignore: added listerros
4740 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4741 xforms tree as objects are needed for other frontends.
4743 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4744 linking with not yet implemented xforms objects.
4746 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4748 2000-08-14 Baruch Even <baruch.even@writeme.com>
4750 * src/frontends/xforms/FormGraphics.h:
4751 * src/frontends/xforms/FormGraphics.C:
4752 * src/frontends/xforms/RadioButtonGroup.h:
4753 * src/frontends/xforms/RadioButtonGroup.C:
4754 * src/insets/insetgraphics.h:
4755 * src/insets/insetgraphics.C:
4756 * src/insets/insetgraphicsParams.h:
4757 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4758 instead of spaces, and various other indentation issues to make the
4759 sources more consistent.
4761 2000-08-14 Marko Vendelin <markov@ioc.ee>
4763 * src/frontends/gnome/dialogs/diaprint.glade
4764 * src/frontends/gnome/FormPrint.C
4765 * src/frontends/gnome/FormPrint.h
4766 * src/frontends/gnome/diaprint_callbacks.c
4767 * src/frontends/gnome/diaprint_callbacks.h
4768 * src/frontends/gnome/diaprint_interface.c
4769 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4772 * src/frontends/gnome/dialogs/diainserturl.glade
4773 * src/frontends/gnome/FormUrl.C
4774 * src/frontends/gnome/FormUrl.h
4775 * src/frontends/gnome/diainserturl_callbacks.c
4776 * src/frontends/gnome/diainserturl_callbacks.h
4777 * src/frontends/gnome/diainserturl_interface.c
4778 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4779 Gnome implementation
4781 * src/frontends/gnome/Dialogs.C
4782 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4783 all other dialogs. Copy all unimplemented dialogs from Xforms
4786 * src/frontends/gnome/support.c
4787 * src/frontends/gnome/support.h: support files generated by Glade
4791 * config/gnome.m4: Gnome configuration scripts
4793 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4794 configure --help message
4796 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4797 only if there are no events pendling in Gnome/Gtk. This enhances
4798 the performance of menus.
4801 2000-08-14 Allan Rae <rae@lyx.org>
4803 * lib/Makefile.am: listerrors cleaning
4805 * lib/listerrors: removed -- generated file
4806 * acinclude.m4: ditto
4807 * sigc++/acinclude.m4: ditto
4809 * src/frontends/xforms/forms/form_citation.fd:
4810 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4813 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4814 `updatesrc` and now we have a `test` target that does what `updatesrc`
4815 used to do. I didn't like having an install target that wasn't related
4818 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4819 on all except FormGraphics. This may yet happen. Followed by a major
4820 cleanup including using FL_TRANSIENT for most of the dialogs. More
4821 changes to come when the ButtonController below is introduced.
4823 * src/frontends/xforms/ButtonController.h: New file for managing up to
4824 four buttons on a dialog according to an externally defined policy.
4825 * src/frontends/xforms/Makefile.am: added above
4827 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4828 Apply and Cancel/Close buttons and everything in between and beyond.
4829 * src/frontends/Makefile.am: added above.
4831 * src/frontends/xforms/forms/form_preferences.fd:
4832 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4833 and removed variable 'status' as a result. Fixed the set_minsize thing.
4834 Use the new screen-font-update after checking screen fonts were changed
4835 Added a "Restore" button to restore the original lyxrc values while
4836 editing. This restores everything not just the last input changed.
4837 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4839 * src/LyXAction.C: screen-font-update added for updating buffers after
4840 screen font settings have been changed.
4841 * src/commandtags.h: ditto
4842 * src/lyxfunc.C: ditto
4844 * forms/lyx.fd: removed screen fonts dialog.
4845 * src/lyx_gui.C: ditto
4846 * src/menus.[Ch]: ditto
4847 * src/lyx.[Ch]: ditto
4848 * src/lyx_cb.C: ditto + code from here moved to make
4849 screen-font-update. And people wonder why progress on GUII is
4850 slow. Look at how scattered this stuff was! It takes forever
4853 * forms/fdfix.sh: Fixup the spacing after commas.
4854 * forms/makefile: Remove date from generated files. Fewer clashes now.
4855 * forms/bullet_forms.C.patch: included someones handwritten changes
4857 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4858 once I've discovered why LyXRC was made noncopyable.
4859 * src/lyx_main.C: ditto
4861 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4863 * src/frontends/xforms/forms/fdfix.sh:
4864 * src/frontends/xforms/forms/fdfixh.sed:
4865 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4866 * src/frontends/xforms/Form*.[hC]:
4867 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4868 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4869 provide a destructor for the struct FD_form_xxxx. Another version of
4870 the set_[max|min]size workaround and a few other cleanups. Actually,
4871 Angus' patch from 20000809.
4873 2000-08-13 Baruch Even <baruch.even@writeme.com>
4875 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4878 2000-08-11 Juergen Vigna <jug@sad.it>
4880 * src/insets/insetgraphics.C (InsetGraphics): changing init
4881 order because of warnings.
4883 * src/frontends/xforms/forms/makefile: adding patching .C with
4886 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4887 from .C.patch to .c.patch
4889 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4890 order because of warning.
4892 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4894 * src/frontends/Liason.C (setMinibuffer): new helper function
4896 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4898 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4900 * lib/ui/default.ui: commented out PaperLayout entry
4902 * src/frontends/xforms/form_document.[Ch]: new added files
4904 * src/frontends/xforms/FormDocument.[Ch]: ditto
4906 * src/frontends/xforms/forms/form_document.fd: ditto
4908 * src/frontends/xforms/forms/form_document.C.patch: ditto
4910 2000-08-10 Juergen Vigna <jug@sad.it>
4912 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4913 (InsetGraphics): initialized cacheHandle to 0.
4914 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4916 2000-08-10 Baruch Even <baruch.even@writeme.com>
4918 * src/graphics/GraphicsCache.h:
4919 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4920 correctly as a cache.
4922 * src/graphics/GraphicsCacheItem.h:
4923 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4926 * src/graphics/GraphicsCacheItem_pimpl.h:
4927 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4930 * src/insets/insetgraphics.h:
4931 * src/insets/insetgraphics.C: Changed from using a signal notification
4932 to polling when image is not loaded.
4934 2000-08-10 Allan Rae <rae@lyx.org>
4936 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4937 that there are two functions that have to been taken out of line by
4938 hand and aren't taken care of in the script. (Just a reminder note)
4940 * sigc++/macros/*.h.m4: Updated as above.
4942 2000-08-09 Juergen Vigna <jug@sad.it>
4944 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4946 * src/insets/insettabular.C: make drawing of single cell smarter.
4948 2000-08-09 Marko Vendelin <markov@ioc.ee>
4949 * src/frontends/gnome/Menubar_pimpl.C
4950 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4951 implementation: new files
4953 * src/frontends/gnome/mainapp.C
4954 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4957 * src/main.C: create Gnome main window
4959 * src/frontends/xforms/Menubar_pimpl.h
4960 * src/frontends/Menubar.C
4961 * src/frontends/Menubar.h: added method Menubar::update that calls
4962 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4964 * src/LyXView.C: calls Menubar::update to update the state
4967 * src/frontends/gnome/Makefile.am: added new files
4969 * src/frontends/Makefile.am: added frontend compiler options
4971 2000-08-08 Juergen Vigna <jug@sad.it>
4973 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4975 * src/bufferlist.C (close):
4976 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4977 documents if exiting without saving.
4979 * src/buffer.C (save): use removeAutosaveFile()
4981 * src/support/filetools.C (removeAutosaveFile): new function.
4983 * src/lyx_cb.C (MenuWrite): returns a bool now.
4984 (MenuWriteAs): check if file could really be saved and revert to the
4986 (MenuWriteAs): removing old autosavefile if existant.
4988 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4989 before Goto toggle declaration, because of compiler warning.
4991 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4993 * src/lyxfunc.C (MenuNew): small fix.
4995 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4997 * src/bufferlist.C (newFile):
4998 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5000 * src/lyxrc.C: added new_ask_filename tag
5002 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5004 * src/lyx.fd: removed code pertaining to form_ref
5005 * src/lyx.[Ch]: ditto
5006 * src/lyx_cb.C: ditto
5007 * src/lyx_gui.C: ditto
5008 * src/lyx_gui_misc.C: ditto
5010 * src/BufferView_pimpl.C (restorePosition): update buffer only
5013 * src/commandtags.h (LFUN_REFTOGGLE): removed
5014 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5015 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5016 (LFUN_REFBACK): renamed LFUN_REF_BACK
5018 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5019 * src/menus.C: ditto
5020 * src/lyxfunc.C (Dispatch): ditto.
5021 InsertRef dialog is now GUI-independent.
5023 * src/texrow.C: added using std::endl;
5025 * src/insets/insetref.[Ch]: strip out large amounts of code.
5026 The inset is now a container and this functionality is now
5027 managed by a new FormRef dialog
5029 * src/frontends/Dialogs.h (showRef, createRef): new signals
5031 * src/frontends/xforms/FormIndex.[Ch],
5032 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5033 when setting dialog's min/max size
5034 * src/frontends/xforms/FormIndex.[Ch]: ditto
5036 * src/frontends/xforms/FormRef.[Ch],
5037 src/frontends/xforms/forms/form_ref.fd: new xforms
5038 implementation of an InsetRef dialog
5040 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5043 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5044 ios::nocreate is not part of the standard. Removed.
5046 2000-08-07 Baruch Even <baruch.even@writeme.com>
5048 * src/graphics/Renderer.h:
5049 * src/graphics/Renderer.C: Added base class for rendering of different
5050 image formats into Pixmaps.
5052 * src/graphics/XPM_Renderer.h:
5053 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5054 in a different class.
5056 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5057 easily add support for other formats.
5059 * src/insets/figinset.C: plugged a leak of an X resource.
5061 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5063 * src/CutAndPaste.[Ch]: make all metods static.
5065 * development/Code_rules/Rules: more work, added section on
5066 Exceptions, and a References section.
5068 * a lot of header files: work to make doc++ able to generate the
5069 source documentation, some workarounds of doc++ problems. Doc++ is
5070 now able to generate the documentation.
5072 2000-08-07 Juergen Vigna <jug@sad.it>
5074 * src/insets/insettabular.C (recomputeTextInsets): removed function
5076 * src/tabular.C (SetWidthOfMulticolCell):
5078 (calculate_width_of_column_NMC): fixed return value so that it really
5079 only returns true if the column-width has changed (there where
5080 problems with muliticolumn-cells in this column).
5082 2000-08-04 Juergen Vigna <jug@sad.it>
5084 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5085 also on the scrollstatus of the inset.
5086 (workAreaMotionNotify): ditto.
5088 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5090 2000-08-01 Juergen Vigna <jug@sad.it>
5092 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5094 * src/commandtags.h:
5095 * src/LyXAction.C (init):
5096 * src/insets/inset.C (LocalDispatch): added support for
5099 * src/insets/inset.C (scroll): new functions.
5101 * src/insets/insettext.C (removeNewlines): new function.
5102 (SetAutoBreakRows): removes forced newlines in the text of the
5103 paragraph if autoBreakRows is set to false.
5105 * src/tabular.C (Latex): generates a parbox around the cell contents
5108 * src/frontends/xforms/FormTabular.C (local_update): removed
5109 the radio_useparbox button.
5111 * src/tabular.C (UseParbox): new function
5113 2000-08-06 Baruch Even <baruch.even@writeme.com>
5115 * src/graphics/GraphicsCache.h:
5116 * src/graphics/GraphicsCache.C:
5117 * src/graphics/GraphicsCacheItem.h:
5118 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5121 * src/insets/insetgraphics.h:
5122 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5123 and the drawing of the inline image.
5125 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5126 loaded into the wrong position.
5128 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5131 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5133 * src/support/translator.h: move all typedefs to public section
5135 * src/support/filetools.C (MakeLatexName): return string const
5137 (TmpFileName): ditto
5138 (FileOpenSearch): ditto
5140 (LibFileSearch): ditto
5141 (i18nLibFileSearch): ditto
5144 (CreateTmpDir): ditto
5145 (CreateBufferTmpDir): ditto
5146 (CreateLyXTmpDir): ditto
5149 (MakeAbsPath): ditto
5151 (OnlyFilename): ditto
5153 (NormalizePath): ditto
5154 (CleanupPath): ditto
5155 (GetFileContents): ditto
5156 (ReplaceEnvironmentPath): ditto
5157 (MakeRelPath): ditto
5159 (ChangeExtension): ditto
5160 (MakeDisplayPath): ditto
5161 (do_popen): return cmdret const
5162 (findtexfile): return string const
5164 * src/support/DebugStream.h: add some /// to please doc++
5166 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5168 * src/texrow.C (same_rownumber): functor to use with find_if
5169 (getIdFromRow): rewritten to use find_if and to not update the
5170 positions. return true if row is found
5171 (increasePos): new method, use to update positions
5173 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5175 * src/lyxlex_pimpl.C (verifyTable): new method
5178 (GetString): return string const
5179 (pushTable): rewrite to use std::stack
5181 (setFile): better check
5184 * src/lyxlex.h: make LyXLex noncopyable
5186 * src/lyxlex.C (text): return char const * const
5187 (GetString): return string const
5188 (getLongString): return string const
5190 * src/lyx_gui_misc.C (askForText): return pair<...> const
5192 * src/lastfiles.[Ch] (operator): return string const
5194 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5195 istringstream not char const *.
5196 move token.end() out of loop.
5197 (readFile): move initializaton of token
5199 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5200 getIdFromRow is successful.
5202 * lib/bind/emacs.bind: don't include menus bind
5204 * development/Code_rules/Rules: the beginnings of making this
5205 better and covering more of the unwritten rules that we have.
5207 * development/Code_rules/Recommendations: a couple of wording
5210 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5212 * src/support/strerror.c: remove C++ comment.
5214 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5216 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5217 LFUN_INDEX_INSERT_LAST
5219 * src/texrow.C (getIdFromRow): changed from const_iterator to
5220 iterator, allowing code to compile with DEC cxx
5222 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5223 stores part of the class, as suggested by Allan. Will allow
5225 (apply): test to apply uses InsetCommandParams operator!=
5227 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5228 (apply): test to apply uses InsetCommandParams operator!=
5230 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5231 stores part of the class.
5232 (update): removed limits on min/max size.
5234 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5235 (apply): test to apply uses InsetCommandParams operator!=
5237 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5238 (Read, Write, scanCommand, getCommand): moved functionality
5239 into InsetCommandParams.
5241 (getScreenLabel): made pure virtual
5242 new InsetCommandParams operators== and !=
5244 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5245 c-tors based on InsetCommandParams. Removed others.
5246 * src/insets/insetinclude.[Ch]: ditto
5247 * src/insets/insetlabel.[Ch]: ditto
5248 * src/insets/insetparent.[Ch]: ditto
5249 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5251 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5252 insets derived from InsetCommand created using similar c-tors
5253 based on InsetCommandParams
5254 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5255 * src/menus.C (ShowRefsMenu): ditto
5256 * src/paragraph.C (Clone): ditto
5257 * src/text2.C (SetCounter): ditto
5258 * src/lyxfunc.C (Dispatch) ditto
5259 Also recreated old InsetIndex behaviour exactly. Can now
5260 index-insert at the start of a paragraph and index-insert-last
5261 without launching the pop-up.
5263 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5265 * lib/lyxrc.example: mark te pdf options as non functional.
5267 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5268 (isStrDbl): move tmpstr.end() out of loop.
5269 (strToDbl): move intialization of tmpstr
5270 (lowercase): return string const and move tmp.end() out of loop.
5271 (uppercase): return string const and move tmp.edn() out of loop.
5272 (prefixIs): add assertion
5277 (containsOnly): ditto
5278 (containsOnly): ditto
5279 (containsOnly): ditto
5280 (countChar): make last arg char not char const
5281 (token): return string const
5282 (subst): return string const, move tmp.end() out of loop.
5283 (subst): return string const, add assertion
5284 (strip): return string const
5285 (frontStrip): return string const, add assertion
5286 (frontStrip): return string const
5291 * src/support/lstrings.C: add inclde "LAssert.h"
5292 (isStrInt): move tmpstr.end() out of loop.
5294 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5295 toollist.end() out of loop.
5296 (deactivate): move toollist.end() out of loop.
5297 (update): move toollist.end() out of loop.
5298 (updateLayoutList): move tc.end() out of loop.
5299 (add): move toollist.end() out of loop.
5301 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5302 md.end() out of loop.
5304 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5306 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5309 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5310 (Erase): move insetlist.end() out of loop.
5312 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5313 ref to const string as first arg. Move initialization of some
5314 variables, whitespace changes.
5316 * src/kbmap.C (defkey): move table.end() out of loop.
5317 (kb_keymap): move table.end() out of loop.
5318 (findbinding): move table.end() out of loop.
5320 * src/MenuBackend.C (hasMenu): move end() out of loop.
5321 (getMenu): move end() out of loop.
5322 (getMenu): move menulist_.end() out of loop.
5324 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5326 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5329 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5330 (getFromLyXName): move infotab.end() out of loop.
5332 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5333 -fvtable-thunks -ffunction-sections -fdata-sections
5335 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5337 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5340 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5342 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5344 * src/frontends/xforms/FormCitation.[Ch],
5345 src/frontends/xforms/FormIndex.[Ch],
5346 src/frontends/xforms/FormToc.[Ch],
5347 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5349 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5351 * src/commandtags.h: renamed, created some flags for citation
5354 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5356 * src/lyxfunc.C (dispatch): use signals to insert index entry
5358 * src/frontends/Dialogs.h: new signal createIndex
5360 * src/frontends/xforms/FormCommand.[Ch],
5361 src/frontends/xforms/FormCitation.[Ch],
5362 src/frontends/xforms/FormToc.[Ch],
5363 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5365 * src/insets/insetindex.[Ch]: GUI-independent
5367 * src/frontends/xforms/FormIndex.[Ch],
5368 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5371 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5373 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5374 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5376 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5378 * src/insets/insetref.C (Latex): rewrite so that there is now
5379 question that a initialization is requested.
5381 * src/insets/insetcommand.h: reenable the hide signal
5383 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5385 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5386 fix handling of shortcuts (many bugs :)
5387 (add_lastfiles): ditto.
5389 * lib/ui/default.ui: fix a few shortcuts.
5391 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5393 * Makefile.am: Fix ``rpmdist'' target to return the exit
5394 status of the ``rpm'' command, instead of the last command in
5395 the chain (the ``rm lyx.xpm'' command, which always returns
5398 2000-08-02 Allan Rae <rae@lyx.org>
5400 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5401 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5402 * src/frontends/xforms/FormToc.C (FormToc): ditto
5404 * src/frontends/xforms/Makefile.am: A few forgotten files
5406 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5407 Signals-not-copyable-problem Lars' started commenting out.
5409 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5411 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5413 * src/insets/insetcommand.h: Signals is not copyable so anoter
5414 scheme for automatic hiding of forms must be used.
5416 * src/frontends/xforms/FormCitation.h: don't inerit from
5417 noncopyable, FormCommand already does that.
5418 * src/frontends/xforms/FormToc.h: ditto
5419 * src/frontends/xforms/FormUrl.h: ditto
5421 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5423 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5425 * src/insets/insetcommand.h (hide): new SigC::Signal0
5426 (d-tor) new virtual destructor emits hide signal
5428 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5429 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5431 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5432 LOF and LOT. Inset is now GUI-independent
5434 * src/insets/insetloa.[Ch]: redundant
5435 * src/insets/insetlof.[Ch]: ditto
5436 * src/insets/insetlot.[Ch]: ditto
5438 * src/frontends/xforms/forms/form_url.fd: tweaked!
5439 * src/frontends/xforms/forms/form_citation.fd: ditto
5441 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5442 dialogs dealing with InsetCommand insets
5444 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5445 FormCommand base class
5446 * src/frontends/xforms/FormUrl.[Ch]: ditto
5448 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5450 * src/frontends/xforms/FormToc.[Ch]: ditto
5452 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5453 passed a generic InsetCommand pointer
5454 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5456 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5457 and modified InsetTOC class
5458 * src/buffer.C: ditto
5460 * forms/lyx.fd: strip out old FD_form_toc code
5461 * src/lyx_gui_misc.C: ditto
5462 * src/lyx_gui.C: ditto
5463 * src/lyx_cb.C: ditto
5464 * src/lyx.[Ch]: ditto
5466 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5468 * src/support/utility.hpp: tr -d '\r'
5470 2000-08-01 Juergen Vigna <jug@sad.it>
5472 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5474 * src/commandtags.h:
5475 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5476 LFUN_TABULAR_FEATURES.
5478 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5479 LFUN_LAYOUT_TABULAR.
5481 * src/insets/insettabular.C (getStatus): implemented helper function.
5483 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5485 2000-07-31 Juergen Vigna <jug@sad.it>
5487 * src/text.C (draw): fixed screen update problem for text-insets.
5489 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5490 something changed probably this has to be added in various other
5493 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5495 2000-07-31 Baruch Even <baruch.even@writeme.com>
5497 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5498 templates to satisfy compaq cxx.
5501 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5503 * src/support/translator.h (equal_1st_in_pair::operator()): take
5504 const ref pair_type as arg.
5505 (equal_2nd_in_pair::operator()): ditto
5506 (Translator::~Translator): remove empty d-tor.
5508 * src/graphics/GraphicsCache.C: move include config.h to top, also
5509 put initialization of GraphicsCache::singleton here.
5510 (~GraphicsCache): move here
5511 (addFile): take const ref as arg
5514 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5516 * src/BufferView2.C (insertLyXFile): change te with/without header
5519 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5521 * src/frontends/xforms/FormGraphics.C (apply): add some
5522 static_cast. Not very nice, but required by compaq cxx.
5524 * src/frontends/xforms/RadioButtonGroup.h: include header
5525 <utility> instead of <pair.h>
5527 * src/insets/insetgraphicsParams.C: add using directive.
5528 (readResize): change return type to void.
5529 (readOrigin): ditto.
5531 * src/lyxfunc.C (getStatus): add missing break for build-program
5532 function; add test for Literate for export functions.
5534 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5535 entries in Options menu.
5537 2000-07-31 Baruch Even <baruch.even@writeme.com>
5539 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5540 protect against auto-allocation; release icon when needed.
5542 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5544 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5545 on usual typewriter.
5547 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5548 earlier czech.kmap), useful only for programming.
5550 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5552 * src/frontends/xforms/FormCitation.h: fix conditioning around
5555 2000-07-31 Juergen Vigna <jug@sad.it>
5557 * src/frontends/xforms/FormTabular.C (local_update): changed
5558 radio_linebreaks to radio_useparbox and added radio_useminipage.
5560 * src/tabular.C: made support for using minipages/parboxes.
5562 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5564 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5566 (descent): so the cursor is in the middle.
5567 (width): bit smaller box.
5569 * src/insets/insetgraphics.h: added display() function.
5571 2000-07-31 Baruch Even <baruch.even@writeme.com>
5573 * src/frontends/Dialogs.h: Added showGraphics signals.
5575 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5576 xforms form definition of the graphics dialog.
5578 * src/frontends/xforms/FormGraphics.h:
5579 * src/frontends/xforms/FormGraphics.C: Added files, the
5580 GUIndependent code of InsetGraphics
5582 * src/insets/insetgraphics.h:
5583 * src/insets/insetgraphics.C: Major writing to make it work.
5585 * src/insets/insetgraphicsParams.h:
5586 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5587 struct between InsetGraphics and GUI.
5589 * src/LaTeXFeatures.h:
5590 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5591 support for graphicx package.
5593 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5594 for the graphics inset.
5596 * src/support/translator.h: Added file, used in
5597 InsetGraphicsParams. this is a template to translate between two
5600 * src/frontends/xforms/RadioButtonGroup.h:
5601 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5602 way to easily control a radio button group.
5604 2000-07-28 Juergen Vigna <jug@sad.it>
5606 * src/insets/insettabular.C (LocalDispatch):
5607 (TabularFeatures): added support for lyx-functions of tabular features.
5608 (cellstart): refixed this function after someone wrongly changed it.
5610 * src/commandtags.h:
5611 * src/LyXAction.C (init): added support for tabular-features
5613 2000-07-28 Allan Rae <rae@lyx.org>
5615 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5616 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5617 triggers the callback for input checking. As a result we sometimes get
5618 "LyX: This shouldn't happen..." printed to cerr.
5619 (input): Started using status variable since I only free() on
5620 destruction. Some input checking for paths and font sizes.
5622 * src/frontends/xforms/FormPreferences.h: Use status to control
5623 activation of Ok and Apply
5625 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5626 callback. Also resized to stop segfaults with 0.88. The problem is
5627 that xforms-0.88 requires the folder to be wide enough to fit all the
5628 tabs. If it isn't it causes all sorts of problems.
5630 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5632 * src/frontends/xforms/forms/README: Reflect reality.
5634 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5635 * src/frontends/xforms/forms/makefile: ditto.
5637 * src/commandtags.h: Get access to new Preferences dialog
5638 * src/LyXAction.C: ditto
5639 * src/lyxfunc.C: ditto
5640 * lib/ui/default.ui: ditto
5642 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5644 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5646 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5649 * src/frontends/xforms/form_url.[Ch]: added.
5651 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5653 * src/insets/insetbib.h: fixed bug in previous commit
5655 * src/frontends/xforms/FormUrl.h: ditto
5657 * src/frontends/xforms/FormPrint.h: ditto
5659 * src/frontends/xforms/FormPreferences.h: ditto
5661 * src/frontends/xforms/FormCopyright.h: ditto
5663 * src/frontends/xforms/FormCitation.C: ditto
5665 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5666 private copyconstructor and private default contructor
5668 * src/support/Makefile.am: add utility.hpp
5670 * src/support/utility.hpp: new file from boost
5672 * src/insets/insetbib.h: set owner in clone
5674 * src/frontends/xforms/FormCitation.C: added missing include
5677 * src/insets/form_url.[Ch]: removed
5679 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5681 * development/lyx.spec.in
5682 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5683 file/directory re-organization.
5685 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5687 * src/insets/insetcommand.[Ch]: moved the string data and
5688 associated manipulation methods into a new stand-alone class
5689 InsetCommandParams. This class has two additional methods
5690 getAsString() and setFromString() allowing the contents to be
5691 moved around as a single string.
5692 (addContents) method removed.
5693 (setContents) method no longer virtual.
5695 * src/buffer.C (readInset): made use of new InsetCitation,
5696 InsetUrl constructors based on InsetCommandParams.
5698 * src/commandtags.h: add LFUN_INSERT_URL
5700 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5701 independent InsetUrl and use InsetCommandParams to extract
5702 string info and create new Insets.
5704 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5706 * src/frontends/xforms/FormCitation.C (apply): uses
5709 * src/frontends/xforms/form_url.C
5710 * src/frontends/xforms/form_url.h
5711 * src/frontends/xforms/FormUrl.h
5712 * src/frontends/xforms/FormUrl.C
5713 * src/frontends/xforms/forms/form_url.fd: new files
5715 * src/insets/insetcite.[Ch]: removed unused constructors.
5717 * src/insets/insetinclude.[Ch]: no longer store filename
5719 * src/insets/inseturl.[Ch]: GUI-independent.
5721 2000-07-26 Juergen Vigna <jug@sad.it>
5722 * renamed frontend from gtk to gnome as it is that what is realized
5723 and did the necessary changes in the files.
5725 2000-07-26 Marko Vendelin <markov@ioc.ee>
5727 * configure.in: cleaning up gnome configuration scripts
5729 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5731 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5732 shortcuts syndrom by redrawing them explicitely (a better solution
5733 would be appreciated).
5735 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5737 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5740 * src/lyx_cb.C (MenuExport): change html export to do the right
5741 thing depending of the document type (instead of having
5742 html-linuxdoc and html-docbook).
5743 * src/lyxfunc.C (getStatus): update for html
5744 * lib/ui/default.ui: simplify due to the above change.
5745 * src/menus.C (ShowFileMenu): update too (in case we need it).
5747 * src/MenuBackend.C (read): if a menu is defined twice, add the
5748 new entries to the exiting one.
5750 2000-07-26 Juergen Vigna <jug@sad.it>
5752 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5754 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5755 and return a bool if it did actual save the file.
5756 (AutoSave): don't autosave a unnamed doc.
5758 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5759 check if this is an UNNAMED new file and react to it.
5760 (newFile): set buffer to unnamed and change to not mark a new
5761 buffer dirty if I didn't do anything with it.
5763 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5765 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5767 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5768 friend as per Angus's patch posted to lyx-devel.
5770 * src/ext_l10n.h: updated
5772 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5773 gettext on the style string right before inserting them into the
5776 * autogen.sh: add code to extract style strings form layout files,
5777 not good enough yet.
5779 * src/frontends/gtk/.cvsignore: add MAKEFILE
5781 * src/MenuBackend.C (read): run the label strings through gettext
5782 before storing them in the containers.
5784 * src/ext_l10n.h: new file
5786 * autogen.sh : generate the ext_l10n.h file here
5788 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5790 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5793 * lib/ui/default.ui: fix a couple of typos.
5795 * config/gnome/gtk.m4: added (and added to the list of files in
5798 * src/insets/insetinclude.C (unique_id): fix when we are using
5799 lyxstring instead of basic_string<>.
5800 * src/insets/insettext.C (LocalDispatch): ditto.
5801 * src/support/filetools.C: ditto.
5803 * lib/configure.m4: create the ui/ directory if necessary.
5805 * src/LyXView.[Ch] (updateToolbar): new method.
5807 * src/BufferView_pimpl.C (buffer): update the toolbar when
5808 opening/closing buffer.
5810 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5812 * src/LyXAction.C (getActionName): enhance to return also the name
5813 and options of pseudo-actions.
5814 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5816 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5817 as an example of what is possible). Used in File->Build too (more
5818 useful) and in the import/export menus (to mimick the complicated
5819 handling of linuxdoc and friends). Try to update all the entries.
5821 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5824 * src/MenuBackend.C (read): Parse the new OptItem tag.
5826 * src/MenuBackend.h: Add a new optional_ data member (used if the
5827 entry should be omitted when the lyxfunc is disabled).
5829 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5830 function, used as a shortcut.
5831 (create_submenu): align correctly the shortcuts on the widest
5834 * src/MenuBackend.h: MenuItem.label() only returns the label of
5835 the menu without shortcut; new method shortcut().
5837 2000-07-14 Marko Vendelin <markov@ioc.ee>
5839 * src/frontends/gtk/Dialogs.C:
5840 * src/frontends/gtk/FormCopyright.C:
5841 * src/frontends/gtk/FormCopyright.h:
5842 * src/frontends/gtk/Makefile.am: added these source-files for the
5843 Gtk/Gnome support of the Copyright-Dialog.
5845 * src/main.C: added Gnome::Main initialization if using
5846 Gtk/Gnome frontend-GUI.
5848 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5850 * config/gnome/aclocal-include.m4
5851 * config/gnome/compiler-flags.m4
5852 * config/gnome/curses.m4
5853 * config/gnome/gnome--.m4
5854 * config/gnome/gnome-bonobo-check.m4
5855 * config/gnome/gnome-common.m4
5856 * config/gnome/gnome-fileutils.m4
5857 * config/gnome/gnome-ghttp-check.m4
5858 * config/gnome/gnome-gnorba-check.m4
5859 * config/gnome/gnome-guile-checks.m4
5860 * config/gnome/gnome-libgtop-check.m4
5861 * config/gnome/gnome-objc-checks.m4
5862 * config/gnome/gnome-orbit-check.m4
5863 * config/gnome/gnome-print-check.m4
5864 * config/gnome/gnome-pthread-check.m4
5865 * config/gnome/gnome-support.m4
5866 * config/gnome/gnome-undelfs.m4
5867 * config/gnome/gnome-vfs.m4
5868 * config/gnome/gnome-x-checks.m4
5869 * config/gnome/gnome-xml-check.m4
5870 * config/gnome/gnome.m4
5871 * config/gnome/gperf-check.m4
5872 * config/gnome/gtk--.m4
5873 * config/gnome/linger.m4
5874 * config/gnome/need-declaration.m4: added configuration scripts
5875 for Gtk/Gnome frontend-GUI
5877 * configure.in: added support for the --with-frontend=gtk option
5879 * autogen.sh: added config/gnome/* to list of config-files
5881 * acconfig.h: added define for GTKGUI-support
5883 * config/lyxinclude.m4: added --with-frontend[=value] option value
5884 for Gtk/Gnome frontend-GUI support.
5886 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5888 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5892 * src/paragraph.C (GetChar): remove non-const version
5894 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5895 (search_kw): use it.
5897 * src/lyx_main.C (init): if "preferences" exist, read that instead
5899 (ReadRcFile): return bool if the file could be read ok.
5900 (ReadUIFile): add a check to see if lex file is set ok.
5902 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5903 bastring can be used instead of lyxstring (still uses the old code
5904 if std::string is good enough or if lyxstring is used.)
5906 * src/encoding.C: make the arrays static, move ininle functions
5908 * src/encoding.h: from here.
5910 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5911 (parseSingleLyXformat2Token): move inset parsing to separate method
5912 (readInset): new private method
5914 * src/Variables.h: remove virtual from get().
5916 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5917 access to NEW_INSETS and NEW_TABULAR
5919 * src/MenuBackend.h: remove superfluous forward declaration of
5920 MenuItem. Add documentations tags "///", remove empty MenuItem
5921 destructor, remove private default contructor.
5923 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5925 (read): more string mlabel and mname to where they are used
5926 (read): remove unused variables mlabel and mname
5927 (defaults): unconditional clear, make menusetup take advantage of
5928 add returning Menu &.
5930 * src/LyXView.h: define NEW_MENUBAR as default
5932 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5933 to NEW_INSETS and NEW_TABULAR.
5934 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5935 defined. Change some of the "xxxx-inset-insert" functions names to
5938 * several files: more enahncements to NEW_INSETS and the resulting
5941 * lib/lyxrc.example (\date_insert_format): move to misc section
5943 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5944 bastring and use AC_CACHE_CHECK.
5945 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5946 the system have the newest methods. uses AC_CACHE_CHECK
5947 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5948 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5949 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5951 * configure.in: add LYX_CXX_GOOD_STD_STRING
5953 * acinclude.m4: recreated
5955 2000-07-24 Amir Karger <karger@lyx.org>
5957 * README: add Hebrew, Arabic kmaps
5960 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5962 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5965 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5967 * Lot of files: add pragma interface/implementation.
5969 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5971 * lib/ui/default.ui: new file (ans new directory). Contains the
5972 default menu and toolbar.
5974 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5975 global space. Toolbars are now read (as menus) in ui files.
5977 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5979 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5980 is disabled because the document is read-only. We want to have the
5981 toggle state of the function anyway.
5982 (getStatus): add code for LFUN_VC* functions (mimicking what is
5983 done in old-style menus)
5985 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5986 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5988 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5989 * src/BufferView_pimpl.C: ditto.
5990 * src/lyxfunc.C: ditto.
5992 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5993 default). This replaces old-style menus by new ones.
5995 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5996 MenuItem. Contain the data structure of a menu.
5998 * src/insets/insettext.C: use LyXView::setLayout instead of
5999 accessing directly the toolbar combox.
6000 * src/lyxfunc.C (Dispatch): ditto.
6002 * src/LyXView.C (setLayout): new method, which just calls
6003 Toolbar::setLayout().
6004 (updateLayoutChoice): move part of this method in Toolbar.
6006 * src/toolbar.[Ch]: removed.
6008 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6009 implementation the toolbar.
6011 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6012 the toolbar. It might make sense to merge it with ToolbarDefaults
6014 (setLayout): new function.
6015 (updateLayoutList): ditto.
6016 (openLayoutList): ditto.
6018 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6019 xforms implementation of the toolbar.
6020 (get_toolbar_func): comment out, since I do not
6021 know what it is good for.
6023 * src/ToolbarDefaults.h: Add the ItemType enum.
6025 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6026 for a list of allocated C strings. Used in Menubar xforms
6027 implementation to avoid memory leaks.
6029 * src/support/lstrings.[Ch] (uppercase): new version taking and
6033 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6034 * lib/bind/emacs.bind: ditto.
6036 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6038 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6039 forward decl of LyXView.
6041 * src/toolbar.C (toolbarItem): moved from toolbar.h
6042 (toolbarItem::clean): ditto
6043 (toolbarItem::~toolbarItem): ditto
6044 (toolbarItem::operator): ditto
6046 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6048 * src/paragraph.h: control the NEW_TABULAR define from here
6050 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6051 USE_TABULAR_INSETS to NEW_TABULAR
6053 * src/ToolbarDefaults.C: add include "lyxlex.h"
6055 * files using the old table/tabular: use NEW_TABULAR to control
6056 compilation of old tabular stuff.
6058 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6061 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6062 planemet in reading of old style floats, fix the \end_deeper
6063 problem when reading old style floats.
6065 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6067 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6069 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6071 * lib/bind/sciword.bind: updated.
6073 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6075 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6076 layout write problem
6078 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6080 * src/Makefile.am (INCLUDES): remove image directory from include
6083 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6084 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6086 * src/LyXView.C (create_form_form_main): read the application icon
6089 * lib/images/*.xpm: change the icons to use transparent color for
6092 * src/toolbar.C (update): change the color of the button when it
6095 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6097 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6098 setting explicitely the minibuffer.
6099 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6101 * src/LyXView.C (showState): new function. Shows font information
6102 in minibuffer and update toolbar state.
6103 (LyXView): call Toolbar::update after creating the
6106 * src/toolbar.C: change toollist to be a vector instead of a
6108 (BubbleTimerCB): get help string directly from the callback
6109 argument of the corresponding icon (which is the action)
6110 (set): remove unnecessary ugliness.
6111 (update): new function. update the icons (depressed, disabled)
6112 depending of the status of the corresponding action.
6114 * src/toolbar.h: remove help in toolbarItem
6116 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6118 * src/Painter.C (text): Added code for using symbol glyphs from
6119 iso10646 fonts. Currently diabled.
6121 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6124 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6125 magyar,turkish and usorbian.
6127 * src/paragraph.C (isMultiLingual): Made more efficient.
6129 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6132 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6133 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6134 Also changed the prototype to "bool math_insert_greek(char)".
6136 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6138 * lots of files: apply the NEW_INSETS on all code that will not be
6139 needed when we move to use the new insets. Enable the define in
6140 lyxparagrah.h to try it.
6142 * src/insets/insettabular.C (cellstart): change to be a static
6144 (InsetTabular): initialize buffer in the initializer list.
6146 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6148 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6149 form_print.h out of the header file. Replaced with forward
6150 declarations of the relevant struct.
6152 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6155 * src/commandtags.h: do not include "debug.h" which does not
6156 belong there. #include it in some other places because of this
6159 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6161 * src/insets/insetcaption.C: add a couple "using" directives.
6163 * src/toolbar.C (add): get the help text directly from lyxaction.
6165 (setPixmap): new function. Loads from disk and sets a pixmap on a
6166 botton; the name of the pixmap file is derived from the command
6169 * src/toolbar.h: remove members isBitmap and pixmap from
6172 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6173 * lib/images/: move many files from images/banner.xpm.
6175 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6177 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6178 * src/toolbar.C: ditto.
6179 * configure.in: ditto.
6180 * INSTALL: document.
6182 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6183 the spellchecker popup is closed from the WM.
6185 2000-07-19 Juergen Vigna <jug@sad.it>
6187 * src/insets/insetfloat.C (Write): small fix because we use the
6188 insetname for the type now!
6190 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6192 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6195 * src/frontends/Dialogs.h: removed hideCitation signal
6197 * src/insets/insetcite.h: added hide signal
6199 * src/insets/insetcite.C (~InsetCitation): emits new signal
6200 (getScreenLabel): "intelligent" label should now fit on the screen!
6202 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6204 * src/frontends/xforms/FormCitation.C (showInset): connects
6205 hide() to the inset's hide signal
6206 (show): modified to use fl_set_object_position rather than
6207 fl_set_object_geometry wherever possible
6209 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6211 * src/insets/lyxinset.h: add caption code
6213 * src/insets/insetfloat.C (type): new method
6215 * src/insets/insetcaption.C (Write): new method
6217 (LyxCode): new method
6219 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6220 to get it right together with using the FloatList.
6222 * src/commandtags.h: add LFUN_INSET_CAPTION
6223 * src/lyxfunc.C (Dispatch): handle it
6225 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6228 * src/Variables.[Ch]: make expand take a const reference, remove
6229 the destructor, some whitespace changes.
6231 * src/LyXAction.C (init): add caption-inset-insert
6233 * src/FloatList.C (FloatList): update the default floats a bit.
6235 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6237 * src/Variables.[Ch]: new files. Intended to be used for language
6238 specific strings (like \chaptername) and filename substitution in
6241 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6243 * lib/kbd/american.kmap: update
6245 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6247 * src/bufferparams.[Ch]: remove member allowAccents.
6249 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6251 * src/LaTeXLog.C: use the log_form.h header.
6252 * src/lyx_gui.C: ditto.
6253 * src/lyx_gui_misc.C: ditto.
6254 * src/lyxvc.h: ditto.
6256 * forms/log_form.fd: new file, created from latexoptions.fd. I
6257 kept the log popup and nuked the options form.
6259 * src/{la,}texoptions.[Ch]: removed.
6260 * src/lyx_cb.C (LaTeXOptions): ditto
6262 * src/lyx_gui.C (create_forms): do not handle the
6263 fd_latex_options form.
6265 2000-07-18 Juergen Vigna <jug@sad.it>
6267 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6268 name of the inset so that it can be requested outside (text2.C).
6270 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6273 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6275 * src/mathed/formula.h (ConvertFont): constify
6277 * src/mathed/formula.C (Read): add warning if \end_inset is not
6278 found on expected place.
6280 * src/insets/lyxinset.h (ConvertFont): consify
6282 * src/insets/insetquotes.C (ConvertFont): constify
6283 * src/insets/insetquotes.h: ditto
6285 * src/insets/insetinfo.h: add labelfont
6287 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6288 (ascent): use labelfont
6292 (Write): make .lyx file a bit nicer
6294 * src/insets/insetfloat.C (Write): simplify somewhat...
6295 (Read): add warning if arg is not found
6297 * src/insets/insetcollapsable.C: add using std::max
6298 (Read): move string token and add warning in arg is not found
6299 (draw): use std::max to get the right ty
6300 (getMaxWidth): simplify by using std::max
6302 * src/insets/insetsection.h: new file
6303 * src/insets/insetsection.C: new file
6304 * src/insets/insetcaption.h: new file
6305 * src/insets/insetcaption.C: new file
6307 * src/insets/inset.C (ConvertFont): constify signature
6309 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6310 insetcaption.[Ch] and insetsection.[Ch]
6312 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6313 uses to use LABEL_COUNTER_CHAPTER instead.
6314 * src/text2.C (SetCounter): here
6316 * src/counters.h: new file
6317 * src/counters.C: new file
6318 * src/Sectioning.h: new file
6319 * src/Sectioning.C: new file
6321 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6323 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6325 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6328 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6331 2000-07-17 Juergen Vigna <jug@sad.it>
6333 * src/tabular.C (Validate): check if array-package is needed.
6334 (SetVAlignment): added support for vertical alignment.
6335 (SetLTFoot): better support for longtable header/footers
6336 (Latex): modified to support added features.
6338 * src/LaTeXFeatures.[Ch]: added array-package.
6340 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6342 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6345 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6347 * configure.in: do not forget to put a space after -isystem.
6349 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6351 * lib/kbd/arabic.kmap: a few fixes.
6353 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6355 * some whitespace chagnes to a number of files.
6357 * src/support/DebugStream.h: change to make it easier for
6358 doc++ to parse correctly.
6359 * src/support/lyxstring.h: ditto
6361 * src/mathed/math_utils.C (compara): change to have only one
6363 (MathedLookupBOP): change because of the above.
6365 * src/mathed/math_delim.C (math_deco_compare): change to have only
6367 (search_deco): change becasue of the above.
6369 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6370 instead of manually coded one.
6372 * src/insets/insetquotes.C (Read): read the \end_inset too
6374 * src/insets/insetlatex.h: remove file
6375 * src/insets/insetlatex.C: remove file
6377 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6379 (InsetPrintIndex): remove destructor
6381 * src/insets/insetinclude.h: remove default constructor
6383 * src/insets/insetfloat.C: work to make it work better
6385 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6387 * src/insets/insetcite.h (InsetCitation): remove default constructor
6389 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6391 * src/text.C (GetColumnNearX): comment out some currently unused code.
6393 * src/paragraph.C (writeFile): move some initializations closer to
6395 (CutIntoMinibuffer): small change to use new matchIT operator
6399 (InsertInset): ditto
6402 (InsetIterator): ditto
6403 (Erase): small change to use new matchFT operator
6405 (GetFontSettings): ditto
6406 (HighestFontInRange): ditto
6409 * src/lyxparagraph.h: some chars changed to value_type
6410 (matchIT): because of some stronger checking (perhaps too strong)
6411 in SGI STL, the two operator() unified to one.
6414 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6416 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6417 the last inset read added
6418 (parseSingleLyXformat2Token): some more (future) compability code added
6419 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6420 (parseSingleLyXformat2Token): set last_inset_read
6421 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6422 (parseSingleLyXformat2Token): don't double intializw string next_token
6424 * src/TextCache.C (text_fits::operator()): add const's to the signature
6425 (has_buffer::operator()): ditto
6427 * src/Floating.h: add some comments on the class
6429 * src/FloatList.[Ch] (typeExist): new method
6432 * src/BackStack.h: added default constructor, wanted by Gcc.
6434 2000-07-14 Juergen Vigna <jug@sad.it>
6436 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6438 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6440 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6441 do a redraw when the window is resized!
6442 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6444 * src/insets/insettext.C (resizeLyXText): added function to correctly
6445 being able to resize the LyXWindow.
6447 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6449 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6451 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6452 crashes when closing dialog to a deleted inset.
6454 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6455 method! Now similar to other insets.
6457 2000-07-13 Juergen Vigna <jug@sad.it>
6459 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6461 * lib/examples/Literate.lyx: small patch!
6463 * src/insets/insetbib.C (Read): added this function because of wrong
6464 Write (without [begin|end]_inset).
6466 2000-07-11 Juergen Vigna <jug@sad.it>
6468 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6469 as the insertInset could not be good!
6471 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6472 the bool param should not be last.
6474 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6476 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6477 did submit that to Karl).
6479 * configure.in: use -isystem instead of -I for X headers. This
6480 fixes a problem on solaris with a recent gcc;
6481 put the front-end code after the X detection code;
6482 configure in sigc++ before lib/
6484 * src/lyx_main.C (commandLineHelp): remove -display from command
6487 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6489 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6490 Also put in Makefile rules for building the ``listerrors''
6491 program for parsing errors from literate programs written in LyX.
6493 * lib/build-listerrors: Added small shell script as part of compile
6494 process. This builds a working ``listerrors'' binary if noweb is
6495 installed and either 1) the VNC X server is installed on the machine,
6496 or 2) the user is compiling from within a GUI. The existence of a GUI
6497 is necessary to use the ``lyx --export'' feature for now. This
6498 hack can be removed once ``lyx --export'' no longer requires a GUI to
6501 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6503 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6504 now passed back correctly from gcc and placed "under" error
6505 buttons in a Literate LyX source.
6507 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6509 * src/text.C (GetColumnNearX): Better behavior when a RTL
6510 paragraph is ended by LTR text.
6512 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6515 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6517 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6518 true when clipboard is empty.
6520 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6522 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6523 row of the paragraph.
6524 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6525 to prevent calculation of bidi tables
6527 2000-07-07 Juergen Vigna <jug@sad.it>
6529 * src/screen.C (ToggleSelection): added y_offset and x_offset
6532 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6535 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6537 * src/insets/insettext.C: fixed Layout-Display!
6539 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6541 * configure.in: add check for strings.h header.
6543 * src/spellchecker.C: include <strings.h> in order to have a
6544 definition for bzero().
6546 2000-07-07 Juergen Vigna <jug@sad.it>
6548 * src/insets/insettext.C (draw): set the status of the bv->text to
6549 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6551 * src/screen.C (DrawOneRow):
6552 (DrawFromTo): redraw the actual row if something has changed in it
6555 * src/text.C (draw): call an update of the toplevel-inset if something
6556 has changed inside while drawing.
6558 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6560 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6562 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6563 processing inside class.
6565 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6566 processing inside class.
6568 * src/insets/insetindex.h new struct Holder, consistent with other
6571 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6572 citation dialog from main code and placed it in src/frontends/xforms.
6573 Dialog launched through signals instead of callbacks
6575 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6577 * lyx.man: update the options description.
6579 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6581 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6582 handle neg values, set min width to 590, add doc about -display
6584 2000-07-05 Juergen Vigna <jug@sad.it>
6586 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6587 calls to BufferView *.
6589 * src/insets/insettext.C (checkAndActivateInset): small fix non
6590 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6592 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6593 their \end_inset token!
6595 2000-07-04 edscott <edscott@imp.mx>
6597 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6598 lib/lyxrc.example: added option \wheel_jump
6600 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6602 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6603 remove support for -width,-height,-xpos and -ypos.
6605 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6607 * src/encoding.[Ch]: New files.
6609 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6610 (text): Call to the underline() method only when needed.
6612 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6614 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6615 encoding(s) for the document.
6617 * src/bufferparams.C (BufferParams): Changed default value of
6620 * src/language.C (newLang): Removed.
6621 (items[]): Added encoding information for all defined languages.
6623 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6624 encoding choice button.
6626 * src/lyxrc.h (font_norm_type): New member variable.
6627 (set_font_norm_type): New method.
6629 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6630 paragraphs with different encodings.
6632 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6633 (TransformChar): Changed to work correctly with Arabic points.
6634 (draw): Added support for drawing Arabic points.
6635 (draw): Removed code for drawing underbars (this is done by
6638 * src/support/textutils.h (IsPrintableNonspace): New function.
6640 * src/BufferView_pimpl.h: Added "using SigC::Object".
6641 * src/LyXView.h: ditto.
6643 * src/insets/insetinclude.h (include_label): Changed to mutable.
6645 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6647 * src/mathed/math_iter.h: remove empty destructor
6649 * src/mathed/math_cursor.h: remove empty destructor
6651 * src/insets/lyxinset.h: add THEOREM_CODE
6653 * src/insets/insettheorem.[Ch]: new files
6655 * src/insets/insetminipage.C: (InsertInset): remove
6657 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6659 (InsertInset): remove
6661 * src/insets/insetlist.C: (InsertList): remove
6663 * src/insets/insetfootlike.[Ch]: new files
6665 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6668 (InsertInset): ditto
6670 * src/insets/insetert.C: remove include Painter.h, reindent
6671 (InsertInset): move to header
6673 * src/insets/insetcollapsable.h: remove explicit from default
6674 contructor, remove empty destructor, add InsertInset
6676 * src/insets/insetcollapsable.C (InsertInset): new func
6678 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6680 * src/vspace.h: add explicit to constructor
6682 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6683 \textcompwordmark, please test this.
6685 * src/lyxrc.C: set ascii_linelen to 65 by default
6687 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6689 * src/commandtags.h: add LFUN_INSET_THEOREM
6691 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6692 (makeLinuxDocFile): remove _some_ of the nice logic
6693 (makeDocBookFile): ditto
6695 * src/Painter.[Ch]: (~Painter): removed
6697 * src/LyXAction.C (init): entry for insettheorem added
6699 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6701 (deplog): code to detect files generated by LaTeX, needs testing
6704 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6706 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6708 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6710 * src/LaTeX.C (deplog): Add a check for files that are going to be
6711 created by the first latex run, part of the project to remove the
6714 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6715 contents to the extension list.
6717 2000-07-04 Juergen Vigna <jug@sad.it>
6719 * src/text.C (NextBreakPoint): added support for needFullRow()
6721 * src/insets/lyxinset.h: added needFullRow()
6723 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6726 * src/insets/insettext.C: lots of changes for update!
6728 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6730 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6732 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6734 * src/insets/insetinclude.C (InsetInclude): fixed
6735 initialization of include_label.
6736 (unique_id): now returns a string.
6738 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6740 * src/LaTeXFeatures.h: new member IncludedFiles, for
6741 a map of key, included file name.
6743 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6744 with the included files for inclusion in SGML preamble,
6745 i. e., linuxdoc and docbook.
6748 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6749 nice (is the generated linuxdoc code to be exported?), that
6750 allows to remove column, and only_body that will be true for
6751 slave documents. Insets are allowed inside SGML font type.
6752 New handling of the SGML preamble for included files.
6753 (makeDocBookFile): the same for docbook.
6755 * src/insets/insetinclude.h:
6756 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6758 (DocBook): new export methods.
6760 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6761 and makeDocBookFile.
6763 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6764 formats to export with command line argument -x.
6766 2000-06-29 Juergen Vigna <jug@sad.it>
6768 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6769 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6771 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6772 region could already been cleared by an inset!
6774 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6776 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6779 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6781 (cursorToggle): remove special handling of lyx focus.
6783 2000-06-28 Juergen Vigna <jug@sad.it>
6785 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6788 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6790 * src/insets/insetindex.C (Edit): add a callback when popup is
6793 * src/insets/insettext.C (LocalDispatch):
6794 * src/insets/insetmarginal.h:
6795 * src/insets/insetlist.h:
6796 * src/insets/insetfoot.h:
6797 * src/insets/insetfloat.h:
6798 * src/insets/insetert.h: add a missing std:: qualifier.
6800 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6802 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6805 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6807 * src/insets/insettext.C (Read): remove tmptok unused variable
6808 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6809 (InsertInset): change for new InsetInset code
6811 * src/insets/insettext.h: add TEXT inline method
6813 * src/insets/insettext.C: remove TEXT macro
6815 * src/insets/insetmarginal.C (Write): new method
6816 (Latex): change output slightly
6818 * src/insets/insetfoot.C (Write): new method
6819 (Latex): change output slightly (don't use endl when no need)
6821 * src/insets/insetert.C (Write): new method
6823 * src/insets/insetcollapsable.h: make button_length, button_top_y
6824 and button_bottm_y protected.
6826 * src/insets/insetcollapsable.C (Write): simplify code by using
6827 tostr. Also do not output the float name, the children class
6828 should to that to get control over own arguments
6830 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6831 src/insets/insetminipage.[Ch]:
6834 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6836 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6838 * src/Makefile.am (lyx_SOURCES): add the new files
6840 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6841 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6842 * src/commandtags.h: ditto
6844 * src/LaTeXFeatures.h: add a std::set of used floattypes
6846 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6848 * src/FloatList.[Ch] src/Floating.h: new files
6850 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6852 * src/lyx_cb.C (TableApplyCB): ditto
6854 * src/text2.C: ditto
6855 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6856 (parseSingleLyXformat2Token): ditto + add code for
6857 backwards compability for old float styles + add code for new insets
6859 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6861 (InsertInset(size_type, Inset *, LyXFont)): new method
6862 (InsetChar(size_type, char)): changed to use the other InsetChar
6863 with a LyXFont(ALL_INHERIT).
6864 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6865 insert the META_INSET.
6867 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6869 * sigc++/thread.h (Threads): from here
6871 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6872 definition out of line
6873 * sigc++/scope.h: from here
6875 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6877 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6878 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6880 * Makefile.am (bindist): new target.
6882 * INSTALL: add instructions for doing a binary distribution.
6884 * development/tools/README.bin.example: update a bit.
6886 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6889 * lib/lyxrc.example: new lyxrc tag \set_color.
6891 * src/lyxfunc.C (Dispatch):
6892 * src/commandtags.h:
6893 * src/LyXAction.C: new lyxfunc "set-color".
6895 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6896 and an x11name given as strings.
6898 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6899 cache when a color is changed.
6901 2000-06-26 Juergen Vigna <jug@sad.it>
6903 * src/lyxrow.C (width): added this functions and variable.
6905 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6908 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6910 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6912 * images/undo_bw.xpm: new icon.
6913 * images/redo_bw.xpm: ditto.
6915 * configure.in (INSTALL_SCRIPT): change value to
6916 ${INSTALL} to avoid failures of install-script target.
6917 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6919 * src/BufferView.h: add a magic "friend" declaration to please
6922 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6924 * forms/cite.fd: modified to allow resizing without messing
6927 * src/insetcite.C: Uses code from cite.fd almost without
6929 User can now resize dialog in the x-direction.
6930 Resizing the dialog in the y-direction is prevented, as the
6931 code does this intelligently already.
6933 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * INSTALL: remove obsolete entry in "problems" section.
6937 * lib/examples/sl_*.lyx: update of the slovenian examples.
6939 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6941 2000-06-23 Juergen Vigna <jug@sad.it>
6943 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6945 * src/buffer.C (resize): delete the LyXText of textinsets.
6947 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6949 * src/insets/lyxinset.h: added another parameter 'cleared' to
6950 the draw() function.
6952 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6953 unlocking inset in inset.
6955 2000-06-22 Juergen Vigna <jug@sad.it>
6957 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6958 of insets and moved first to LyXText.
6960 * src/mathed/formulamacro.[Ch]:
6961 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6963 2000-06-21 Juergen Vigna <jug@sad.it>
6965 * src/text.C (GetVisibleRow): look if I should clear the area or not
6966 using Inset::doClearArea() function.
6968 * src/insets/lyxinset.h: added doClearArea() function and
6969 modified draw(Painter &, ...) to draw(BufferView *, ...)
6971 * src/text2.C (UpdateInset): return bool insted of int
6973 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6975 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6976 combox in the character popup
6978 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6979 BufferParams const & params
6981 2000-06-20 Juergen Vigna <jug@sad.it>
6983 * src/insets/insettext.C (SetParagraphData): set insetowner on
6986 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6988 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6989 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6991 (form_main_): remove
6993 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6994 (create_form_form_main): remove FD_form_main stuff, connect to
6995 autosave_timeout signal
6997 * src/LyXView.[Ch] (getMainForm): remove
6998 (UpdateTimerCB): remove
6999 * src/BufferView_pimpl.h: inherit from SigC::Object
7001 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7002 signal instead of callback
7004 * src/BufferView.[Ch] (cursorToggleCB): remove
7006 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7008 * src/BufferView_pimpl.C: changes because of the one below
7010 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7011 instead of storing a pointer to a LyXText.
7013 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7015 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7017 * src/lyxparagraph.h
7019 * src/paragraph.C: Changed fontlist to a sorted vector.
7021 2000-06-19 Juergen Vigna <jug@sad.it>
7023 * src/BufferView.h: added screen() function.
7025 * src/insets/insettext.C (LocalDispatch): some selection code
7028 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7030 * src/insets/insettext.C (SetParagraphData):
7032 (InsetText): fixes for multiple paragraphs.
7034 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7036 * development/lyx.spec.in: Call configure with ``--without-warnings''
7037 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7038 This should be fine, however, since we generally don't want to be
7039 verbose when making an RPM.
7041 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7043 * lib/scripts/fig2pstex.py: New file
7045 2000-06-16 Juergen Vigna <jug@sad.it>
7047 * src/insets/insettabular.C (UpdateLocal):
7048 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7049 (LocalDispatch): Changed all functions to use LyXText.
7051 2000-06-15 Juergen Vigna <jug@sad.it>
7053 * src/text.C (SetHeightOfRow): call inset::update before requesting
7056 * src/insets/insettext.C (update):
7057 * src/insets/insettabular.C (update): added implementation
7059 * src/insets/lyxinset.h: added update function
7061 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7063 * src/text.C (SelectNextWord): protect against null pointers with
7064 old-style string streams. (fix from Paul Theo Gonciari
7067 * src/cite.[Ch]: remove erroneous files.
7069 * lib/configure.m4: update the list of created directories.
7071 * src/lyxrow.C: include <config.h>
7072 * src/lyxcursor.C: ditto.
7074 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7076 * lib/examples/decimal.lyx: new example file from Mike.
7078 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7079 to find template definitions (from Dekel)
7081 * src/frontends/.cvsignore: add a few things.
7083 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7085 * src/Timeout.C (TimeOut): remove default argument.
7087 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7090 * src/insets/ExternalTemplate.C: add a "using" directive.
7092 * src/lyx_main.h: remove the act_ struct, which seems unused
7095 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * LyX Developers Meeting: All files changed, due to random C++ (by
7098 coincidence) code generator script.
7100 - external inset (cool!)
7101 - initial online editing of preferences
7102 - insettabular breaks insettext(s contents)
7104 - some DocBook fixes
7105 - example files update
7106 - other cool stuff, create a diff and look for yourself.
7108 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7110 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7111 -1 this is a non-line-breaking textinset.
7113 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7114 if there is no width set.
7116 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7118 * Lots of files: Merged the dialogbase branch.
7120 2000-06-09 Allan Rae <rae@lyx.org>
7122 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7123 and the Dispatch methods that used it.
7125 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7126 access to functions formerly kept in Dispatch.
7128 2000-05-19 Allan Rae <rae@lyx.org>
7130 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7131 made to_page and count_copies integers again. from_page remains a
7132 string however because I want to allow entry of a print range like
7133 "1,4,22-25" using this field.
7135 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7136 and printer-params-get. These aren't useful from the minibuffer but
7137 could be used by a script/LyXServer app provided it passes a suitable
7138 auto_mem_buffer. I guess I should take a look at how the LyXServer
7139 works and make it support xtl buffers.
7141 * sigc++/: updated to libsigc++-1.0.1
7143 * src/xtl/: updated to xtl-1.3.pl.11
7145 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7146 those changes done to the files in src/ are actually recreated when
7147 they get regenerated. Please don't ever accept a patch that changes a
7148 dialog unless that patch includes the changes to the corresponding *.fd
7151 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7152 stringOnlyContains, renamed it and generalised it.
7154 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7155 branch. Removed the remaining old form_print code.
7157 2000-04-26 Allan Rae <rae@lyx.org>
7159 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7160 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7162 2000-04-25 Allan Rae <rae@lyx.org>
7164 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7165 against a base of xtl-1.3.pl.4
7167 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7168 filter the Id: entries so they still show the xtl version number
7171 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7172 into the src/xtl code. Patch still pending with José (XTL)
7174 2000-04-24 Allan Rae <rae@lyx.org>
7176 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7177 both more generic and much safer. Use the new template functions.
7178 * src/buffer.[Ch] (Dispatch): ditto.
7180 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7181 and mem buffer more intelligently. Also a little general cleanup.
7184 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7185 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7186 * src/xtl/Makefile.am: ditto.
7187 * src/xtl/.cvsignore: ditto.
7188 * src/Makefile.am: ditto.
7190 * src/PrinterParams.h: Removed the macros member functions. Added a
7191 testInvariant member function. A bit of tidying up and commenting.
7192 Included Angus's idea for fixing operation with egcs-1.1.2.
7194 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7195 cool expansion of XTL's mem_buffer to support automatic memory
7196 management within the buffer itself. Removed the various macros and
7197 replaced them with template functions that use either auto_mem_buffer
7198 or mem_buffer depending on a #define. The mem_buffer support will
7199 disappear as soon as the auto_mem_buffer is confirmed to be good on
7200 other platforms/compilers. That is, it's there so you've got something
7203 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7204 effectively forked XTL. However I expect José will include my code
7205 into the next major release. Also fixed a memory leak.
7206 * src/xtl/text.h: ditto.
7207 * src/xtl/xdr.h: ditto.
7208 * src/xtl/giop.h: ditto.
7210 2000-04-16 Allan Rae <rae@lyx.org>
7212 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7213 by autogen.sh and removed by maintainer-clean anyway.
7214 * .cvsignore, sigc++/.cvsignore: Support the above.
7216 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7218 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7220 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7221 macros, renamed static callback-target member functions to suit new
7222 scheme and made them public.
7223 * src/frontends/xforms/forms/form_print.fd: ditto.
7224 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7226 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7229 * src/xtl/: New directory containing a minimal distribution of XTL.
7230 This is XTL-1.3.pl.4.
7232 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7234 2000-04-15 Allan Rae <rae@lyx.org>
7236 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7238 * sigc++/: Updated to libsigc++-1.0.0
7240 2000-04-14 Allan Rae <rae@lyx.org>
7242 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7243 use the generic ones in future. I'll modify my conversion script.
7245 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7247 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7248 (CloseAllBufferRelatedDialogs): Renamed.
7249 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7251 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7252 of the generic ones. These are the same ones my conversion script
7255 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7256 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7257 * src/buffer.C (Dispatch): ditto
7259 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7260 functions for updating and hiding buffer dependent dialogs.
7261 * src/BufferView.C (buffer): ditto
7262 * src/buffer.C (setReadonly): ditto
7263 * src/lyxfunc.C (CloseBuffer): ditto
7265 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7266 Dialogs.h, and hence all the SigC stuff, into every file that includes
7267 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7269 * src/BufferView2.C: reduce the number of headers included by buffer.h
7271 2000-04-11 Allan Rae <rae@lyx.org>
7273 * src/frontends/xforms/xform_macros.h: A small collection of macros
7274 for building C callbacks.
7276 * src/frontends/xforms/Makefile.am: Added above file.
7278 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7279 scheme again. This time it should work for JMarc. If this is
7280 successful I'll revise my conversion script to automate some of this.
7281 The static member functions in the class also have to be public for
7282 this scheme will work. If the scheme works (it's almost identical to
7283 the way BufferView::cursorToggleCB is handled so it should work) then
7284 FormCopyright and FormPrint will be ready for inclusion into the main
7285 trunk immediately after 1.1.5 is released -- provided we're prepared
7286 for complaints about lame compilers not handling XTL.
7288 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7290 2000-04-07 Allan Rae <rae@lyx.org>
7292 * config/lyxinclude.m4: A bit more tidying up (Angus)
7294 * src/LString.h: JMarc's <string> header fix
7296 * src/PrinterParams.h: Used string for most data to remove some
7297 ugly code in the Print dialog and avoid even uglier code when
7298 appending the ints to a string for output.
7300 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7301 and moved "default:" back to the end of switch statement. Cleaned
7302 up the printing so it uses the right function calls and so the
7303 "print to file" option actually puts the file in the right directory.
7305 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7307 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7308 and Ok+Apply button control into a separate method: input (Angus).
7309 (input) Cleaned it up and improved it to be very thorough now.
7310 (All CB) static_cast used instead of C style cast (Angus). This will
7311 probably change again once we've worked out how to keep gcc-2.8.1 happy
7312 with real C callbacks.
7313 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7314 ignore some of the bool settings and has random numbers instead. Needs
7315 some more investigation. Added other input length checks and checking
7316 of file and printer names.
7318 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7319 would link (Angus). Seems the old code doesn't compile with the pragma
7320 statement either. Separated callback entries from internal methods.
7322 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7324 2000-03-17 Allan Rae <rae@lyx.org>
7326 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7327 need it? Maybe it could go in Dialogs instead? I could make it a
7328 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7329 values to get the bool return value.
7330 (Dispatch): New overloaded method for xtl support.
7332 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7333 extern "C" callback instead of static member functions. Hopefully,
7334 JMarc will be able to compile this. I haven't changed
7335 forms/form_copyright.fd yet. Breaking one of my own rules already.
7337 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7338 because they aren't useful from the minibuffer. Maybe a LyXServer
7339 might want a help message though?
7341 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7343 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7344 xtl which needs both rtti and exceptions.
7346 * src/support/Makefile.am:
7347 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7349 * src/frontends/xforms/input_validators.[ch]: input filters and
7350 validators. These conrol what keys are valid in input boxes.
7351 Use them and write some more. Much better idea than waiting till
7352 after the user has pressed Ok to say that the input fields don't make
7355 * src/frontends/xforms/Makefile.am:
7356 * src/frontends/xforms/forms/form_print.fd:
7357 * src/frontends/xforms/forms/makefile:
7358 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7359 new scheme. Still have to make sure I haven't missed anything from
7360 the current implementation.
7362 * src/Makefile.am, src/PrinterParams.h: New data store.
7364 * other files: Added a couple of copyright notices.
7366 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7368 * src/insets/insetbib.h: move Holder struct in public space.
7370 * src/frontends/include/DialogBase.h: use SigC:: only when
7371 SIGC_CXX_NAMESPACES is defined.
7372 * src/frontends/include/Dialogs.h: ditto.
7374 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7376 * src/frontends/xforms/FormCopyright.[Ch]: do not
7377 mention SigC:: explicitely.
7379 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7381 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7382 deals with testing KDE in main configure.in
7383 * configure.in: ditto.
7385 2000-02-22 Allan Rae <rae@lyx.org>
7387 * Lots of files: Merged from HEAD
7389 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7390 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7392 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7394 * sigc++/: new minidist.
7396 2000-02-14 Allan Rae <rae@lyx.org>
7398 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7400 2000-02-08 Juergen Vigna <jug@sad.it>
7402 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7403 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7405 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7406 for this port and so it is much easier for other people to port
7407 dialogs in a common development environment.
7409 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7410 the QT/KDE implementation.
7412 * src/frontends/kde/Dialogs.C:
7413 * src/frontends/kde/FormCopyright.C:
7414 * src/frontends/kde/FormCopyright.h:
7415 * src/frontends/kde/Makefile.am:
7416 * src/frontends/kde/formcopyrightdialog.C:
7417 * src/frontends/kde/formcopyrightdialog.h:
7418 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7419 for the kde support of the Copyright-Dialog.
7421 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7422 subdir-substitution instead of hardcoded 'xforms' as we now have also
7425 * src/frontends/include/DialogBase.h (Object): just commented the
7426 label after #endif (nasty warning and I don't like warnings ;)
7428 * src/main.C (main): added KApplication initialization if using
7431 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7432 For now only the KDE event-loop is added if frontend==kde.
7434 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7436 * configure.in: added support for the --with-frontend[=value] option
7438 * autogen.sh: added kde.m4 file to list of config-files
7440 * acconfig.h: added define for KDEGUI-support
7442 * config/kde.m4: added configuration functions for KDE-port
7444 * config/lyxinclude.m4: added --with-frontend[=value] option with
7445 support for xforms and KDE.
7447 2000-02-08 Allan Rae <rae@lyx.org>
7449 * all Makefile.am: Fixed up so the make targets dist, distclean,
7450 install and uninstall all work even if builddir != srcdir. Still
7451 have a new sigc++ minidist update to come.
7453 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7455 2000-02-01 Allan Rae <rae@lyx.org>
7457 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7458 Many mods to get builddir != srcdir working.
7460 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7461 for building on NT and so we can do the builddir != srcdir stuff.
7463 2000-01-30 Allan Rae <rae@lyx.org>
7465 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7466 This will stay in "rae" branch. We probably don't really need it in
7467 the main trunk as anyone who wants to help programming it should get
7468 a full library installed also. So they can check both included and
7469 system supplied library compilation.
7471 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7472 Added a 'mini' distribution of libsigc++. If you feel the urge to
7473 change something in these directories - Resist it. If you can't
7474 resist the urge then you should modify the following script and rebuild
7475 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7476 all happen. Still uses a hacked version of libsigc++'s configure.in.
7477 I'm quite happy with the results. I'm not sure the extra work to turn
7478 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7479 worth the trouble and would probably lead to extra maintenance
7481 I haven't tested the following important make targets: install, dist.
7482 Not ready for prime time but very close. Maybe 1.1.5.
7484 * development/tools/makeLyXsigc.sh: A shell script to automatically
7485 generate our mini-dist of libsigc++. It can only be used with a CVS
7486 checkout of libsigc++ not a tarball distribution. It's well commented.
7487 This will end up as part of the libsigc++ distribution so other apps
7488 can easily have an included mini-dist. If someone makes mods to the
7489 sigc++ subpackage without modifying this script to generate those
7490 changes I'll be very upset!
7492 * src/frontends/: Started the gui/system indep structure.
7494 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7495 to access the gui-indep dialogs are in this class. Much improved
7496 design compared to previous revision. Lars, please refrain from
7497 moving this header into src/ like you did with Popups.h last time.
7499 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7501 * src/frontends/xforms/: Started the gui-indep system with a single
7502 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7505 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7506 Here you'll find a very useful makefile and automated fdfix.sh that
7507 makes updating dailogs a no-brainer -- provided you follow the rules
7508 set out in the README. I'm thinking about adding another script to
7509 automatically generate skeleton code for a new dialog given just the
7512 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7513 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7514 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7516 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7518 * src/support/LSubstring.C (operator): simplify
7520 * src/lyxtext.h: removed bparams, use buffer_->params instead
7522 * src/lyxrow.h: make Row a real class, move all variables to
7523 private and use accessors.
7525 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7527 (isRightToLeftPar): ditto
7528 (ChangeLanguage): ditto
7529 (isMultiLingual): ditto
7532 (SimpleTeXOnePar): ditto
7533 (TeXEnvironment): ditto
7534 (GetEndLabel): ditto
7536 (SetOnlyLayout): ditto
7537 (BreakParagraph): ditto
7538 (BreakParagraphConservative): ditto
7539 (GetFontSettings): ditto
7541 (CopyIntoMinibuffer): ditto
7542 (CutIntoMinibuffer): ditto
7543 (PasteParagraph): ditto
7544 (SetPExtraType): ditto
7545 (UnsetPExtraType): ditto
7546 (DocBookContTableRows): ditto
7547 (SimpleDocBookOneTablePar): ditto
7549 (TeXFootnote): ditto
7550 (SimpleTeXOneTablePar): ditto
7551 (TeXContTableRows): ditto
7552 (SimpleTeXSpecialChars): ditto
7555 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7556 to private and use accessors.
7558 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7559 this, we did not use it anymore and has not been for ages. Just a
7560 waste of cpu cycles.
7562 * src/language.h: make Language a real class, move all variables
7563 to private and use accessors.
7565 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7566 (create_view): remove
7567 (update): some changes for new timer
7568 (cursorToggle): use new timer
7569 (beforeChange): change for new timer
7571 * src/BufferView.h (cursorToggleCB): removed last paramter because
7574 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7575 (cursorToggleCB): change because of new timer code
7577 * lib/CREDITS: updated own mailaddress
7579 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7581 * src/support/filetools.C (PutEnv): fix the code in case neither
7582 putenv() nor setenv() have been found.
7584 * INSTALL: mention the install-strip Makefile target.
7586 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7587 read-only documents.
7589 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7591 * lib/reLyX/configure.in (VERSION): avoid using a previously
7592 generated reLyX wrapper to find out $prefix.
7594 * lib/examples/eu_adibide_lyx-atua.lyx:
7595 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7596 translation of the Tutorial (Dooteo)
7598 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7600 * forms/cite.fd: new citation dialog
7602 * src/insetcite.[Ch]: the new citation dialog is moved into
7605 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7608 * src/insets/insetcommand.h: data members made private.
7610 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7612 * LyX 1.1.5 released
7614 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7616 * src/version.h (LYX_RELEASE): to 1.1.5
7618 * src/spellchecker.C (RunSpellChecker): return false if the
7619 spellchecker dies upon creation.
7621 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7623 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7624 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7628 * lib/CREDITS: update entry for Martin Vermeer.
7630 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7632 * src/text.C (draw): Draw foreign language bars at the bottom of
7633 the row instead of at the baseline.
7635 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7637 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7639 * lib/bind/de_menus.bind: updated
7641 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7643 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7645 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7647 * src/menus.C (Limit_string_length): New function
7648 (ShowTocMenu): Limit the number of items/length of items in the
7651 * src/paragraph.C (String): Correct result for a paragraph inside
7654 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7656 * src/bufferlist.C (close): test of buf->getuser() == NULL
7658 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7660 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7661 Do not call to SetCursor when the paragraph is a closed footnote!
7663 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7665 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7668 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7670 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7673 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7674 reference popup, that activates the reference-back action
7676 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7678 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7679 the menus. Also fixed a bug.
7681 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7682 the math panels when switching buffers (unless new buffer is readonly).
7684 * src/BufferView.C (NoSavedPositions)
7685 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7687 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7689 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7690 less of dvi dirty or not.
7692 * src/trans_mgr.[Ch] (insert): change first parameter to string
7695 * src/chset.[Ch] (encodeString): add const to first parameter
7697 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7699 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7703 * src/LaTeX.C (deplog): better searching for dependency files in
7704 the latex log. Uses now regexps.
7706 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7707 instead of the box hack or \hfill.
7709 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7711 * src/lyxfunc.C (doImportHelper): do not create the file before
7712 doing the actual import.
7713 (doImportASCIIasLines): create a new file before doing the insert.
7714 (doImportASCIIasParagraphs): ditto.
7716 * lib/lyxrc.example: remove mention of non-existing commands
7718 * lyx.man: remove mention of color-related switches.
7720 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7722 * src/lyx_gui.C: remove all the color-related ressources, which
7723 are not used anymore.
7725 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7728 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7730 * src/lyxrc.C (read): Add a missing break in the switch
7732 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7734 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7736 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7739 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7741 * src/text.C (draw): draw bars under foreign language words.
7743 * src/LColor.[Ch]: add LColor::language
7745 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7747 * src/lyxcursor.h (boundary): New member variable
7749 * src/text.C (IsBoundary): New methods
7751 * src/text.C: Use the above for currect cursor movement when there
7752 is both RTL & LTR text.
7754 * src/text2.C: ditto
7756 * src/bufferview_funcs.C (ToggleAndShow): ditto
7758 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7760 * src/text.C (DeleteLineForward): set selection to true to avoid
7761 that DeleteEmptyParagraphMechanism does some magic. This is how it
7762 is done in all other functions, and seems reasonable.
7763 (DeleteWordForward): do not jump over non-word stuff, since
7764 CursorRightOneWord() already does it.
7766 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7767 DeleteWordBackward, since they seem safe to me (since selection is
7768 set to "true") DeleteEmptyParagraphMechanism does nothing.
7770 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7772 * src/lyx_main.C (easyParse): simplify the code by factoring the
7773 part that removes parameters from the command line.
7774 (LyX): check wether wrong command line options have been given.
7776 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7778 * src/lyx_main.C : add support for specifying user LyX
7779 directory via command line option -userdir.
7781 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7783 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7784 the number of items per popup.
7785 (Add_to_refs_menu): Ditto.
7787 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7789 * src/lyxparagraph.h: renamed ClearParagraph() to
7790 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7791 textclass as parameter, and do nothing if free_spacing is
7792 true. This fixes part of the line-delete-forward problems.
7794 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7795 (pasteSelection): ditto.
7796 (SwitchLayoutsBetweenClasses): more translatable strings.
7798 * src/text2.C (CutSelection): use StripLeadingSpaces.
7799 (PasteSelection): ditto.
7800 (DeleteEmptyParagraphMechanism): ditto.
7802 2000-05-26 Juergen Vigna <jug@sad.it>
7804 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7805 is not needed in tabular insets.
7807 * src/insets/insettabular.C (TabularFeatures): added missing features.
7809 * src/tabular.C (DeleteColumn):
7811 (AppendRow): implemented this functions
7812 (cellsturct::operator=): clone the inset too;
7814 2000-05-23 Juergen Vigna <jug@sad.it>
7816 * src/insets/insettabular.C (LocalDispatch): better selection support
7817 when having multicolumn-cells.
7819 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7821 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7823 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7825 * src/ColorHandler.C (getGCForeground): put more test into _()
7827 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7830 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7833 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7835 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7836 there are no labels, or when buffer is readonly.
7838 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7839 there are no labels, buffer is SGML, or when buffer is readonly.
7841 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/LColor.C (LColor): change a couple of grey40 to grey60
7844 (LColor): rewore initalization to make compiles go some magnitude
7846 (getGUIName): don't use gettext until we need the string.
7848 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7850 * src/Bullet.[Ch]: Fixed a small bug.
7852 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7854 * src/paragraph.C (String): Several fixes/improvements
7856 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7858 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7860 * src/paragraph.C (String): give more correct output.
7862 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7864 * src/lyxfont.C (stateText) Do not output the language if it is
7865 eqaul to the language of the document.
7867 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7868 between two paragraphs with the same language.
7870 * src/paragraph.C (getParLanguage) Return a correct answer for an
7871 empty dummy paragraph.
7873 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7876 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7879 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7880 the menus/popup, if requested fonts are unavailable.
7882 2000-05-22 Juergen Vigna <jug@sad.it>
7884 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7885 movement support (Up/Down/Tab/Shift-Tab).
7886 (LocalDispatch): added also preliminari cursor-selection.
7888 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7890 * src/paragraph.C (PasteParagraph): Hopefully now right!
7892 2000-05-22 Garst R. Reese <reese@isn.net>
7894 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7895 of list, change all references to Environment to Command
7896 * tex/hollywood.cls : rewrite environments as commands, add
7897 \uppercase to interiorshot and exteriorshot to force uppecase.
7898 * tex/broadway.cls : rewrite environments as commands. Tweak
7901 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7903 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7904 size of items: use a constant intead of the hardcoded 40, and more
7905 importantly do not remove the %m and %x tags added at the end.
7906 (Add_to_refs_menu): use vector::size_type instead of
7907 unsigned int as basic types for the variables. _Please_ do not
7908 assume that size_t is equal to unsigned int. On an alpha, this is
7909 unsigned long, which is _not_ the same.
7911 * src/language.C (initL): remove language "hungarian", since it
7912 seems that "magyar" is better.
7914 2000-05-22 Juergen Vigna <jug@sad.it>
7916 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7918 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7921 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7922 next was deleted but not set to 0.
7924 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/language.C (initL): change the initialization of languages
7927 so that compiles goes _fast_.
7929 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7932 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7934 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7940 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7942 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7946 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7949 * src/insets/insetlo*.[Ch]: Made editable
7951 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7953 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7954 the current selection.
7956 * src/BufferView_pimpl.C (stuffClipboard): new method
7958 * src/BufferView.C (stuffClipboard): new method
7960 * src/paragraph.C (String): new method
7962 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7963 LColor::ignore when lyxname is not found.
7965 * src/BufferView.C (pasteSelection): new method
7967 * src/BufferView_pimpl.C (pasteSelection): new method
7969 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7971 * src/WorkArea.C (request_clipboard_cb): new static function
7972 (getClipboard): new method
7973 (putClipboard): new method
7975 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7977 * LyX 1.1.5pre2 released
7979 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7981 * src/vspace.C (operator=): removed
7982 (operator=): removed
7984 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7986 * src/layout.C (NumberOfClass): manually set the type in make_pair
7987 (NumberOfLayout): ditto
7989 * src/language.C: use the Language constructor for ignore_lang
7991 * src/language.h: add constructors to struct Language
7993 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7995 * src/text2.C (SetCursorIntern): comment out #warning
7997 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7999 * src/mathed/math_iter.h: initialize sx and sw to 0
8001 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8003 * forms/lyx.fd: Redesign of form_ref
8005 * src/LaTeXFeatures.[Ch]
8009 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8012 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8013 and Buffer::inset_iterator.
8015 * src/menus.C: Added new menus: TOC and Refs.
8017 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8019 * src/buffer.C (getTocList): New method.
8021 * src/BufferView2.C (ChangeRefs): New method.
8023 * src/buffer.C (getLabelList): New method. It replaces the old
8024 getReferenceList. The return type is vector<string> instead of
8027 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8028 the old getLabel() and GetNumberOfLabels() methods.
8029 * src/insets/insetlabel.C (getLabelList): ditto
8030 * src/mathed/formula.C (getLabelList): ditto
8032 * src/paragraph.C (String): New method.
8034 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8035 Uses the new getTocList() method.
8036 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8037 which automatically updates the contents of the browser.
8038 (RefUpdateCB): Use the new getLabelList method.
8040 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8042 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8044 * src/spellchecker.C: Added using std::reverse;
8046 2000-05-19 Juergen Vigna <jug@sad.it>
8048 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8050 * src/insets/insettext.C (computeTextRows): small fix for display of
8051 1 character after a newline.
8053 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8056 2000-05-18 Juergen Vigna <jug@sad.it>
8058 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8059 when changing width of column.
8061 * src/tabular.C (set_row_column_number_info): setting of
8062 autobreak rows if necessary.
8064 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8066 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8068 * src/vc-backend.*: renamed stat() to status() and vcstat to
8069 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8070 compilation broke. The new name seems more relevant, anyway.
8072 2000-05-17 Juergen Vigna <jug@sad.it>
8074 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8075 which was wrong if the removing caused removing of rows!
8077 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8078 (pushToken): new function.
8080 * src/text2.C (CutSelection): fix problem discovered with purify
8082 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8084 * src/debug.C (showTags): enlarge the first column, now that we
8085 have 6-digits debug codes.
8087 * lib/layouts/hollywood.layout:
8088 * lib/tex/hollywood.cls:
8089 * lib/tex/brodway.cls:
8090 * lib/layouts/brodway.layout: more commands and fewer
8091 environments. Preambles moved in the .cls files. Broadway now has
8092 more options on scene numbering and less whitespace (from Garst)
8094 * src/insets/insetbib.C (getKeys): make sure that we are in the
8095 document directory, in case the bib file is there.
8097 * src/insets/insetbib.C (Latex): revert bogus change.
8099 2000-05-16 Juergen Vigna <jug@sad.it>
8101 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8102 the TabularLayout on cursor move.
8104 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8106 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8109 (draw): fixed cursor position and drawing so that the cursor is
8110 visible when before the tabular-inset.
8112 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8113 when creating from old insettext.
8115 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8117 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8119 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8120 * lib/tex/brodway.cls: ditto
8122 * lib/layouts/brodway.layout: change alignment of parenthical
8125 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8127 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8128 versions 0.88 and 0.89 are supported.
8130 2000-05-15 Juergen Vigna <jug@sad.it>
8132 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8135 * src/insets/insettext.C (computeTextRows): redone completely this
8136 function in a much cleaner way, because of problems when having a
8138 (draw): added a frame border when the inset is locked.
8139 (SetDrawLockedFrame): this sets if we draw the border or not.
8140 (SetFrameColor): this sets the frame color (default=insetframe).
8142 * src/insets/lyxinset.h: added x() and y() functions which return
8143 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8144 function which is needed to see if we have a locking inset of some
8145 type in this inset (needed for now in insettabular).
8147 * src/vspace.C (inPixels): the same function also without a BufferView
8148 parameter as so it is easier to use it in some ocasions.
8150 * src/lyxfunc.C: changed all places where insertInset was used so
8151 that now if it couldn't be inserted it is deleted!
8153 * src/TabularLayout.C:
8154 * src/TableLayout.C: added support for new tabular-inset!
8156 * src/BufferView2.C (insertInset): this now returns a bool if the
8157 inset was really inserted!!!
8159 * src/tabular.C (GetLastCellInRow):
8160 (GetFirstCellInRow): new helper functions.
8161 (Latex): implemented for new tabular class.
8165 (TeXTopHLine): new Latex() helper functions.
8167 2000-05-12 Juergen Vigna <jug@sad.it>
8169 * src/mathed/formulamacro.C (Read):
8170 * src/mathed/formula.C (Read): read also the \end_inset here!
8172 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8174 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8175 crush when saving formulae with unbalanced parenthesis.
8177 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8179 * src/layout.C: Add new keyword "endlabelstring" to layout file
8181 * src/text.C (GetVisibleRow): Draw endlabel string.
8183 * lib/layouts/broadway.layout
8184 * lib/layouts/hollywood.layout: Added endlabel for the
8185 Parenthetical layout.
8187 * lib/layouts/heb-article.layout: Do not use slanted font shape
8188 for Theorem like environments.
8190 * src/buffer.C (makeLaTeXFile): Always add "american" to
8191 the UsedLanguages list if document language is RTL.
8193 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8195 * add addendum to README.OS2 and small patch (from SMiyata)
8197 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8199 * many files: correct the calls to ChangeExtension().
8201 * src/support/filetools.C (ChangeExtension): remove the no_path
8202 argument, which does not belong there. Use OnlyFileName() instead.
8204 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8205 files when LaTeXing a non-nice latex file.
8207 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8208 a chain of "if". Return false when deadkeys are not handled.
8210 * src/lyx_main.C (LyX): adapted the code for default bindings.
8212 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8213 bindings for basic functionality (except deadkeys).
8214 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8216 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8217 several methods: handle override_x_deadkeys.
8219 * src/lyxrc.h: remove the "bindings" map, which did not make much
8220 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8222 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8224 * src/lyxfont.C (stateText): use a saner method to determine
8225 whether the font is "default". Seems to fix the crash with DEC
8228 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8230 2000-05-08 Juergen Vigna <jug@sad.it>
8232 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8233 TabularLayoutMenu with mouse-button-3
8234 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8236 * src/TabularLayout.C: added this file for having a Layout for
8239 2000-05-05 Juergen Vigna <jug@sad.it>
8241 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8242 recalculating inset-widths.
8243 (TabularFeatures): activated this function so that I can change
8244 tabular-features via menu.
8246 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8247 that I can test some functions with the Table menu.
8249 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8251 * src/lyxfont.C (stateText): guard against stupid c++libs.
8253 * src/tabular.C: add using std::vector
8254 some whitespace changes, + removed som autogenerated code.
8256 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8258 2000-05-05 Juergen Vigna <jug@sad.it>
8260 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8261 row, columns and cellstructures.
8263 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8265 * lib/lyxrc.example: remove obsolete entries.
8267 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8268 reading of protected_separator for free_spacing.
8270 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8272 * src/text.C (draw): do not display an exclamation mark in the
8273 margin for margin notes. This is confusing, ugly and
8276 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8277 AMS math' is checked.
8279 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8280 name to see whether including the amsmath package is needed.
8282 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8284 * src/paragraph.C (validate): Compute UsedLanguages correctly
8285 (don't insert the american language if it doesn't appear in the
8288 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8289 The argument of \thanks{} command is considered moving argument
8291 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8294 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8296 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8297 for appendix/minipage/depth. The lines can be now both in the footnote
8298 frame, and outside the frame.
8300 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8303 2000-05-05 Juergen Vigna <jug@sad.it>
8305 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8306 neede only in tabular.[Ch].
8308 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8310 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8312 (Write): write '~' for PROTECTED_SEPARATOR
8314 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8316 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8319 * src/mathed/formula.C (drawStr): rename size to siz.
8321 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8322 possibly fix a bug by not changing the pflags = flags to piflags =
8325 2000-05-05 Juergen Vigna <jug@sad.it>
8327 * src/insets/insetbib.C: moved using directive
8329 * src/ImportNoweb.C: small fix for being able to compile (missing
8332 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8334 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8335 to use clear, since we don't depend on this in the code. Add test
8338 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8340 * (various *.C files): add using std::foo directives to please dec
8343 * replace calls to string::clear() to string::erase() (Angus)
8345 * src/cheaders/cmath: modified to provide std::abs.
8347 2000-05-04 Juergen Vigna <jug@sad.it>
8349 * src/insets/insettext.C: Prepared all for inserting of multiple
8350 paragraphs. Still display stuff to do (alignment and other things),
8351 but I would like to use LyXText to do this when we cleaned out the
8352 table-support stuff.
8354 * src/insets/insettabular.C: Changed lot of stuff and added lots
8355 of functionality still a lot to do.
8357 * src/tabular.C: Various functions changed name and moved to be
8358 const functions. Added new Read and Write functions and changed
8359 lots of things so it works good with tabular-insets (also removed
8360 some stuff which is not needed anymore * hacks *).
8362 * src/lyxcursor.h: added operators == and != which just look if
8363 par and pos are (not) equal.
8365 * src/buffer.C (latexParagraphs): inserted this function to latex
8366 all paragraphs form par to endpar as then I can use this too for
8369 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8370 so that I can call this to from text insets with their own cursor.
8372 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8373 output off all paragraphs (because of the fix below)!
8375 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8376 the very last paragraph (this could be also the last paragraph of an
8379 * src/texrow.h: added rows() call which returns the count-variable.
8381 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8383 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8385 * lib/configure.m4: better autodetection of DocBook tools.
8387 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8389 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8391 * src/lyx_cb.C: add using std::reverse;
8393 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8396 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8397 selected files. Should fix repeated errors from generated files.
8399 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8401 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8403 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8404 the spellchecker popup.
8406 * lib/lyxrc.example: Removed the \number_inset section
8408 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8410 * src/insets/figinset.C (various): Use IsFileReadable() to make
8411 sure that the file actually exist. Relying on ghostscripts errors
8412 is a bad idea since they can lead to X server crashes.
8414 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8416 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8419 * lib/lyxrc.example: smallish typo in description of
8420 \view_dvi_paper_option
8422 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8425 * src/lyxfunc.C: doImportHelper to factor out common code of the
8426 various import methods. New functions doImportASCIIasLines,
8427 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8428 doImportLinuxDoc for the format specific parts.
8431 * buffer.C: Dispatch returns now a bool to indicate success
8434 * lyx_gui.C: Add getLyXView() for member access
8436 * lyx_main.C: Change logic for batch commands: First try
8437 Buffer::Dispatch (possibly without GUI), if that fails, use
8440 * lyx_main.C: Add support for --import command line switch.
8441 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8442 Available Formats: Everything accepted by 'buffer-import <format>'
8444 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8446 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8449 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8450 documents will be reformatted upon reentry.
8452 2000-04-27 Juergen Vigna <jug@sad.it>
8454 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8455 correctly only last pos this was a bug.
8457 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8459 * release of lyx-1.1.5pre1
8461 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8463 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8465 * src/menus.C: revert the change of naming (Figure->Graphic...)
8466 from 2000-04-11. It was incomplete and bad.
8468 * src/LColor.[Ch]: add LColor::depthbar.
8469 * src/text.C (GetVisibleRow): use it.
8471 * README: update the languages list.
8473 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8475 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8478 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8480 * README: remove sections that were just wrong.
8482 * src/text2.C (GetRowNearY): remove currentrow code
8484 * src/text.C (GetRow): remove currentrow code
8486 * src/screen.C (Update): rewritten a bit.
8487 (SmallUpdate): removed func
8489 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8491 (FullRebreak): return bool
8492 (currentrow): remove var
8493 (currentrow_y): ditto
8495 * src/lyxscreen.h (Draw): change arg to unsigned long
8496 (FitCursor): return bool
8497 (FitManualCursor): ditto
8498 (Smallpdate): remove func
8499 (first): change to unsigned long
8500 (DrawOneRow): change second arg to long (from long &)
8501 (screen_refresh_y): remove var
8502 (scree_refresh_row): ditto
8504 * src/lyxrow.h: change baseline to usigned int from unsigned
8505 short, this brings some implicit/unsigned issues out in the open.
8507 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8509 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8510 instead of smallUpdate.
8512 * src/lyxcursor.h: change y to unsigned long
8514 * src/buffer.h: don't call updateScrollbar after fitcursor
8516 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8517 where they are used. Removed "\\direction", this was not present
8518 in 1.1.4 and is already obsolete. Commented out some code that I
8519 believe to never be called.
8520 (runLiterate): don't call updateScrollbar after fitCursor
8522 (buildProgram): ditto
8525 * src/WorkArea.h (workWidth): change return val to unsigned
8528 (redraw): remove the button redraws
8529 (setScrollbarValue): change for scrollbar
8530 (getScrollbarValue): change for scrollbar
8531 (getScrollbarBounds): change for scrollbar
8533 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8534 (C_WorkArea_down_cb): removed func
8535 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8536 (resize): change for scrollbar
8537 (setScrollbar): ditto
8538 (setScrollbarBounds): ditto
8539 (setScrollbarIncrements): ditto
8540 (up_cb): removed func
8541 (down_cb): removed func
8542 (scroll_cb): change for scrollbar
8543 (work_area_handler): ditto
8545 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8546 when FitCursor did something.
8547 (updateScrollbar): some unsigned changes
8548 (downCB): removed func
8549 (scrollUpOnePage): removed func
8550 (scrollDownOnePage): remvoed func
8551 (workAreaMotionNotify): don't call screen->FitCursor but use
8552 fitCursor instead. and bool return val
8553 (workAreaButtonPress): ditto
8554 (workAreaButtonRelease): some unsigned changes
8555 (checkInsetHit): ditto
8556 (workAreaExpose): ditto
8557 (update): parts rewritten, comments about the signed char arg added
8558 (smallUpdate): removed func
8559 (cursorPrevious): call needed updateScrollbar
8562 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8565 * src/BufferView.[Ch] (upCB): removed func
8566 (downCB): removed func
8567 (smallUpdate): removed func
8569 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8571 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8572 currentrow, currentrow_y optimization. This did not help a lot and
8573 if we want to do this kind of optimization we should rather use
8574 cursor.row instead of the currentrow.
8576 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8577 buffer spacing and klyx spacing support.
8579 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8581 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8584 2000-04-26 Juergen Vigna <jug@sad.it>
8586 * src/insets/figinset.C: fixes to Lars sstream changes!
8588 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8590 * A lot of files: Added Ascii(ostream &) methods to all inset
8591 classes. Used when exporting to ASCII.
8593 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8594 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8597 * src/text2.C (ToggleFree): Disabled implicit word selection when
8598 there is a change in the language
8600 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8601 no output was generated for end-of-sentence inset.
8603 * src/insets/lyxinset.h
8606 * src/paragraph.C: Removed the insetnumber code
8608 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8610 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8612 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8613 no_babel and no_epsfig completely from the file.
8614 (parseSingleLyXformat2Token): add handling for per-paragraph
8615 spacing as written by klyx.
8617 * src/insets/figinset.C: applied patch by Andre. Made it work with
8620 2000-04-20 Juergen Vigna <jug@sad.it>
8622 * src/insets/insettext.C (cutSelection):
8623 (copySelection): Fixed with selection from right to left.
8624 (draw): now the rows are not recalculated at every draw.
8625 (computeTextRows): for now reset the inset-owner here (this is
8626 important for an undo or copy where the inset-owner is not set
8629 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8630 motion to the_locking_inset screen->first was forgotten, this was
8631 not important till we got multiline insets.
8633 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8635 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8636 code seems to be alright (it is code changed by Dekel, and the
8637 intent is indeed that all macros should be defined \protect'ed)
8639 * NEWS: a bit of reorganisation of the new user-visible features.
8641 2000-04-19 Juergen Vigna <jug@sad.it>
8643 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8644 position. Set the inset_owner of the used paragraph so that it knows
8645 that it is inside an inset. Fixed cursor handling with mouse and
8646 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8647 and cleanups to make TextInsets work better.
8649 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8650 Changed parameters of various functions and added LockInsetInInset().
8652 * src/insets/insettext.C:
8654 * src/insets/insetcollapsable.h:
8655 * src/insets/insetcollapsable.C:
8656 * src/insets/insetfoot.h:
8657 * src/insets/insetfoot.C:
8658 * src/insets/insetert.h:
8659 * src/insets/insetert.C: cleaned up the code so that it works now
8660 correctly with insettext.
8662 * src/insets/inset.C:
8663 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8664 that insets in insets are supported right.
8667 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8669 * src/paragraph.C: some small fixes
8671 * src/debug.h: inserted INSETS debug info
8673 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8674 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8676 * src/commandtags.h:
8677 * src/LyXAction.C: insert code for InsetTabular.
8679 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8680 not Button1MotionMask.
8681 (workAreaButtonRelease): send always a InsetButtonRelease event to
8683 (checkInsetHit): some setCursor fixes (always with insets).
8685 * src/BufferView2.C (lockInset): returns a bool now and extended for
8686 locking insets inside insets.
8687 (showLockedInsetCursor): it is important to have the cursor always
8688 before the locked inset.
8689 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8691 * src/BufferView.h: made lockInset return a bool.
8693 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8695 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8696 that is used also internally but can be called as public to have back
8697 a cursor pos which is not set internally.
8698 (SetCursorIntern): Changed to use above function.
8700 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8702 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8707 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8708 patches for things that should be in or should be changed.
8710 * src/* [insetfiles]: change "usigned char fragile" to bool
8711 fragile. There was only one point that could that be questioned
8712 and that is commented in formulamacro.C. Grep for "CHECK".
8714 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8715 (DeleteBuffer): take it out of CutAndPaste and make it static.
8717 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8719 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8720 output the spacing envir commands. Also the new commands used in
8721 the LaTeX output makes the result better.
8723 * src/Spacing.C (writeEnvirBegin): new method
8724 (writeEnvirEnd): new method
8726 2000-04-18 Juergen Vigna <jug@sad.it>
8728 * src/CutAndPaste.C: made textclass a static member of the class
8729 as otherwise it is not accesed right!!!
8731 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8733 * forms/layout_forms.fd
8734 * src/layout_forms.h
8735 * src/layout_forms.C (create_form_form_character)
8736 * src/lyx_cb.C (UserFreeFont)
8737 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8738 documents (in the layout->character popup).
8740 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8742 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8743 \spell_command was in fact not honored (from Kevin Atkinson).
8745 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8748 * src/lyx_gui.h: make lyxViews private (Angus)
8750 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8752 * src/mathed/math_write.C
8753 (MathMatrixInset::Write) Put \protect before \begin{array} and
8754 \end{array} if fragile
8755 (MathParInset::Write): Put \protect before \\ if fragile
8757 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8759 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8760 initialization if the LyXColorHandler must be done after the
8761 connections to the XServer has been established.
8763 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8764 get the background pixel from the lyxColorhandler so that the
8765 figures are rendered with the correct background color.
8766 (NextToken): removed functions.
8767 (GetPSSizes): use ifs >> string instead of NextToken.
8769 * src/Painter.[Ch]: the color cache moved out of this file.
8771 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8774 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8776 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8777 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8779 * src/BufferView.C (enterView): new func
8780 (leaveView): new func
8782 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8784 (leaveView): new func, undefines xterm cursor when approp.
8786 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8787 (AllowInput): delete the Workarea cursor handling from this func.
8789 * src/Painter.C (underline): draw a slimer underline in most cases.
8791 * src/lyx_main.C (error_handler): use extern "C"
8793 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8796 sent directly to me.
8798 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8799 to the list by Dekel.
8801 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8804 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8805 methods from lyx_cb.here.
8807 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8810 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8812 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8813 instead of using current_view directly.
8815 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8817 * src/LyXAction.C (init): add the paragraph-spacing command.
8819 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8821 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8823 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8824 different from the documents.
8826 * src/text.C (SetHeightOfRow): take paragraph spacing into
8827 account, paragraph spacing takes precedence over buffer spacing
8828 (GetVisibleRow): ditto
8830 * src/paragraph.C (writeFile): output the spacing parameter too.
8831 (validate): set the correct features if spacing is used in the
8833 (Clear): set spacing to default
8834 (MakeSameLayout): spacing too
8835 (HasSameLayout): spacing too
8836 (SetLayout): spacing too
8837 (TeXOnePar): output the spacing commands
8839 * src/lyxparagraph.h: added a spacing variable for use with
8840 per-paragraph spacing.
8842 * src/Spacing.h: add a Default spacing and a method to check if
8843 the current spacing is default. also added an operator==
8845 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8848 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8850 * src/lyxserver.C (callback): fix dispatch of functions
8852 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8853 printf() into lyxerr call.
8855 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8858 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8859 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8860 the "Float" from each of the subitems.
8861 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8863 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8864 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8865 documented the change so that the workaround can be nuked later.
8867 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8870 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8872 * src/buffer.C (getLatexName): ditto
8873 (setReadonly): ditto
8875 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8877 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8878 avoid some uses of current_view. Added also a bufferParams()
8879 method to get at this.
8881 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8883 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8885 * src/lyxparagraph.[Ch]: removed
8886 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8887 with operators used by lower_bound and
8888 upper_bound in InsetTable's
8889 Make struct InsetTable private again. Used matchpos.
8891 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8893 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8894 document, the language of existing text is changed (unless the
8895 document is multi-lingual)
8897 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8899 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8901 * A lot of files: A rewrite of the Right-to-Left support.
8903 2000-04-10 Juergen Vigna <jug@sad.it>
8905 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8906 misplaced cursor when inset in inset is locked.
8908 * src/insets/insettext.C (LocalDispatch): small fix so that a
8909 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8911 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8912 footnote font should be decreased in size twice when displaying.
8914 * src/insets/insettext.C (GetDrawFont): inserted this function as
8915 the drawing-font may differ from the real paragraph font.
8917 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8918 insets (inset in inset!).
8920 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8921 function here because we don't want footnotes inside footnotes.
8923 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8925 (init): now set the inset_owner in paragraph.C
8926 (LocalDispatch): added some resetPos() in the right position
8929 (pasteSelection): changed to use the new CutAndPaste-Class.
8931 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8932 which tells if it is allowed to insert another inset inside this one.
8934 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8935 SwitchLayoutsBetweenClasses.
8937 * src/text2.C (InsertInset): checking of the new paragraph-function
8939 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8940 is not needed anymore here!
8943 (PasteSelection): redone (also with #ifdef) so that now this uses
8944 the CutAndPaste-Class.
8945 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8948 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8949 from/to text/insets.
8951 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8952 so that the paragraph knows if it is inside an (text)-inset.
8953 (InsertFromMinibuffer): changed return-value to bool as now it
8954 may happen that an inset is not inserted in the paragraph.
8955 (InsertInsetAllowed): this checks if it is allowed to insert an
8956 inset in this paragraph.
8958 (BreakParagraphConservative):
8959 (BreakParagraph) : small change for the above change of the return
8960 value of InsertFromMinibuffer.
8962 * src/lyxparagraph.h: added inset_owner and the functions to handle
8963 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8965 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8967 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8968 functions from BufferView to BufferView::Pimpl to ease maintence.
8970 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8971 correctly. Also use SetCursorIntern instead of SetCursor.
8973 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8976 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8978 * src/WorkArea.C (belowMouse): manually implement below mouse.
8980 * src/*: Add "explicit" on several constructors, I added probably
8981 some unneeded ones. A couple of changes to code because of this.
8983 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8984 implementation and private parts from the users of BufferView. Not
8987 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8988 implementation and private parts from the users of LyXLex. Not
8991 * src/BufferView_pimpl.[Ch]: new files
8993 * src/lyxlex_pimpl.[Ch]: new files
8995 * src/LyXView.[Ch]: some inline functions move out-of-line
8997 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * src/lyxparagraph.h: make struct InsetTable public.
9001 * src/support/lyxstring.h: change lyxstring::difference_type to be
9002 ptrdiff_t. Add std:: modifiers to streams.
9004 * src/font.C: include the <cctype> header, for islower() and
9007 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9009 * src/font.[Ch]: new files. Contains the metric functions for
9010 fonts, takes a LyXFont as parameter. Better separation of concepts.
9012 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9013 changes because of this.
9015 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9017 * src/*: compile with -Winline and move functions that don't
9020 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9023 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9025 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9026 (various files changed because of this)
9028 * src/Painter.C (text): fixed the drawing of smallcaps.
9030 * src/lyxfont.[Ch] (drawText): removed unused member func.
9033 * src/*.C: added needed "using" statements and "std::" qualifiers.
9035 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9037 * src/*.h: removed all use of "using" from header files use
9038 qualifier std:: instead.
9040 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9042 * src/text.C (Backspace): some additional cleanups (we already
9043 know whether cursor.pos is 0 or not).
9045 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9046 automake does not provide one).
9048 * src/bmtable.h: replace C++ comments with C comments.
9050 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9052 * src/screen.C (ShowCursor): Change the shape of the cursor if
9053 the current language is not equal to the language of the document.
9054 (If the cursor change its shape unexpectedly, then you've found a bug)
9056 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9059 * src/insets/insetnumber.[Ch]: New files.
9061 * src/LyXAction.C (init)
9062 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9065 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9067 * src/lyxparagraph.h
9068 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9069 (the vector is kept sorted).
9071 * src/text.C (GetVisibleRow): Draw selection correctly when there
9072 is both LTR and RTL text.
9074 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9075 which is much faster.
9077 * src/text.C (GetVisibleRow and other): Do not draw the last space
9078 in a row if the direction of the last letter is not equal to the
9079 direction of the paragraph.
9081 * src/lyxfont.C (latexWriteStartChanges):
9082 Check that font language is not equal to basefont language.
9083 (latexWriteEndChanges): ditto
9085 * src/lyx_cb.C (StyleReset): Don't change the language while using
9086 the font-default command.
9088 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9089 empty paragraph before a footnote.
9091 * src/insets/insetcommand.C (draw): Increase x correctly.
9093 * src/screen.C (ShowCursor): Change cursor shape if
9094 current language != document language.
9096 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9098 2000-03-31 Juergen Vigna <jug@sad.it>
9100 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9101 (Clone): changed mode how the paragraph-data is copied to the
9102 new clone-paragraph.
9104 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9105 GetInset(pos) with no inset anymore there (in inset UNDO)
9107 * src/insets/insetcommand.C (draw): small fix as here x is
9108 incremented not as much as width() returns (2 before, 2 behind = 4)
9110 2000-03-30 Juergen Vigna <jug@sad.it>
9112 * src/insets/insettext.C (InsetText): small fix in initialize
9113 widthOffset (should not be done in the init() function)
9115 2000-03-29 Amir Karger <karger@lyx.org>
9117 * lib/examples/it_ItemizeBullets.lyx: translation by
9120 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9122 2000-03-29 Juergen Vigna <jug@sad.it>
9124 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9126 * src/insets/insetfoot.C (Clone): small change as for the below
9127 new init function in the text-inset
9129 * src/insets/insettext.C (init): new function as I've seen that
9130 clone did not copy the Paragraph-Data!
9131 (LocalDispatch): Added code so that now we have some sort of Undo
9132 functionality (well actually we HAVE Undo ;)
9134 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9136 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9138 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9141 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/main.C: added a runtime check that verifies that the xforms
9144 header used when building LyX and the library used when running
9145 LyX match. Exit with a message if they don't match. This is a
9146 version number check only.
9148 * src/buffer.C (save): Don't allocate memory on the heap for
9149 struct utimbuf times.
9151 * *: some using changes, use iosfwd instead of the real headers.
9153 * src/lyxfont.C use char const * instead of string for the static
9154 strings. Rewrite some functions to use sstream.
9156 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9158 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9161 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9163 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9164 of Geodesy (from Martin Vermeer)
9166 * lib/layouts/svjour.inc: include file for the Springer svjour
9167 class. It can be used to support journals other than JoG.
9169 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9170 Miskiewicz <misiek@pld.org.pl>)
9171 * lib/reLyX/Makefile.am: ditto.
9173 2000-03-27 Juergen Vigna <jug@sad.it>
9175 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9176 also some modifications with operations on selected text.
9178 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9179 problems with clicking on insets (last famous words ;)
9181 * src/insets/insetcommand.C (draw):
9182 (width): Changed to have a bit of space before and after the inset so
9183 that the blinking cursor can be seen (otherwise it was hidden)
9185 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9187 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9188 would not be added to the link list when an installed gettext (not
9189 part of libc) is found.
9191 2000-03-24 Juergen Vigna <jug@sad.it>
9193 * src/insets/insetcollapsable.C (Edit):
9194 * src/mathed/formula.C (InsetButtonRelease):
9195 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9198 * src/BufferView.C (workAreaButtonPress):
9199 (workAreaButtonRelease):
9200 (checkInsetHit): Finally fixed the clicking on insets be handled
9203 * src/insets/insetert.C (Edit): inserted this call so that ERT
9204 insets work always with LaTeX-font
9206 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9208 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9209 caused lyx to startup with no GUI in place, causing in a crash
9210 upon startup when called with arguments.
9212 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9214 * src/FontLoader.C: better initialization of dummyXFontStruct.
9216 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9218 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9219 for linuxdoc and docbook import and export format options.
9221 * lib/lyxrc.example Example of default values for the previous flags.
9223 * src/lyx_cb.C Use those flags instead of the hardwired values for
9224 linuxdoc and docbook export.
9226 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9229 * src/menus.C Added menus entries for the new import/exports formats.
9231 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9233 * src/lyxrc.*: Added support for running without Gui
9236 * src/FontLoader.C: sensible defaults if no fonts are needed
9238 * src/lyx_cb.C: New function ShowMessage (writes either to the
9239 minibuffer or cout in case of no gui
9240 New function AskOverwrite for common stuff
9241 Consequently various changes to call these functions
9243 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9244 wild guess at sensible screen resolution when having no gui
9246 * src/lyxfont.C: no gui, no fonts... set some defaults
9248 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9250 * src/LColor.C: made the command inset background a bit lighter.
9252 2000-03-20 Hartmut Goebel <goebel@noris.net>
9254 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9255 stdstruct.inc. Koma-Script added some title elements which
9256 otherwise have been listed below "bibliography". This split allows
9257 adding title elements to where they belong.
9259 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9260 define the additional title elements and then include
9263 * many other layout files: changed to include stdtitle.inc just
9264 before stdstruct.inc.
9266 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9268 * src/buffer.C: (save) Added the option to store all backup files
9269 in a single directory
9271 * src/lyxrc.[Ch]: Added variable \backupdir_path
9273 * lib/lyxrc.example: Added descriptions of recently added variables
9275 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9276 bibtex inset, not closing the bibtex popup when deleting the inset)
9278 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9280 * src/lyx_cb.C: add a couple using directives.
9282 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9283 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9284 import based on the filename.
9286 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9287 file would be imported at start, if the filename where of a sgml file.
9289 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9291 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9293 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9294 * src/lyxfont.h Replaced the member variable bits.direction by the
9295 member variable lang. Made many changes in other files.
9296 This allows having a multi-lingual document
9298 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9299 that change the current language to <l>.
9300 Removed the command "font-rtl"
9302 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9303 format for Hebrew documents)
9305 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9306 When auto_mathmode is "true", pressing a digit key in normal mode
9307 will cause entering into mathmode.
9308 If auto_mathmode is "rtl" then this behavior will be active only
9309 when writing right-to-left text.
9311 * src/text2.C (InsertStringA) The string is inserted using the
9314 * src/paragraph.C (GetEndLabel) Gives a correct result for
9315 footnote paragraphs.
9317 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9319 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9321 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9322 front of PasteParagraph. Never insert a ' '. This should at least
9323 fix some cause for the segfaults that we have been experiencing,
9324 it also fixes backspace behaviour slightly. (Phu!)
9326 * src/support/lstrings.C (compare_no_case): some change to make it
9327 compile with gcc 2.95.2 and stdlibc++-v3
9329 * src/text2.C (MeltFootnoteEnvironment): change type o
9330 first_footnote_par_is_not_empty to bool.
9332 * src/lyxparagraph.h: make text private. Changes in other files
9334 (fitToSize): new function
9335 (setContentsFromPar): new function
9336 (clearContents): new function
9337 (SetChar): new function
9339 * src/paragraph.C (readSimpleWholeFile): deleted.
9341 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9342 the file, just use a simple string instead. Also read the file in
9343 a more maintainable manner.
9345 * src/text2.C (InsertStringA): deleted.
9346 (InsertStringB): deleted.
9348 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9350 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9351 RedoParagraphs from the doublespace handling part, just set status
9352 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9353 done, but perhaps not like this.)
9355 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9357 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9358 character when inserting an inset.
9360 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9362 * src/bufferparams.C (readLanguage): now takes "default" into
9365 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9366 also initialize the toplevel_keymap with the default bindings from
9369 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9371 * all files using lyxrc: have lyxrc as a real variable and not a
9372 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9375 * src/lyxrc.C: remove double call to defaultKeyBindings
9377 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9378 toolbar defauls using lyxlex. Remove enums, structs, functions
9381 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9382 toolbar defaults. Also store default keybindings in a map.
9384 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9385 storing the toolbar defaults without any xforms dependencies.
9387 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9388 applied. Changed to use iterators.
9390 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9392 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9393 systems that don't have LINGUAS set to begin with.
9395 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9397 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9398 the list by Dekel Tsur.
9400 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9402 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9403 * src/insets/form_graphics.C: ditto.
9405 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9407 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9409 * src/bufferparams.C (readLanguage): use the new language map
9411 * src/intl.C (InitKeyMapper): use the new language map
9413 * src/lyx_gui.C (create_forms): use the new language map
9415 * src/language.[Ch]: New files. Used for holding the information
9416 about each language. Now! Use this new language map enhance it and
9417 make it really usable for our needs.
9419 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9421 * screen.C (ShowCursor): Removed duplicate code.
9422 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9423 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9425 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9428 * src/text.C Added TransformChar method. Used for rendering Arabic
9429 text correctly (change the glyphs of the letter according to the
9430 position in the word)
9435 * src/lyxrc.C Added lyxrc command {language_command_begin,
9436 language_command_end,language_command_ltr,language_command_rtl,
9437 language_package} which allows the use of either arabtex or Omega
9440 * src/lyx_gui.C (init)
9442 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9443 to use encoding for menu fonts which is different than the encoding
9446 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9447 do not load the babel package.
9448 To write an English document with Hebrew/Arabic, change the document
9449 language to "english".
9451 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9452 (alphaCounter): changed to return char
9453 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9455 * lib/lyxrc.example Added examples for Hebrew/Arabic
9458 * src/layout.C Added layout command endlabeltype
9460 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9462 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9464 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * src/mathed/math_delim.C (search_deco): return a
9467 math_deco_struct* instead of index.
9469 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9471 * All files with a USE_OSTREAM_ONLY within: removed all code that
9472 was unused when USE_OSTREAM_ONLY is defined.
9474 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9475 of any less. Removed header and using.
9477 * src/text.C (GetVisibleRow): draw the string "Page Break
9478 (top/bottom)" on screen when drawing a pagebreak line.
9480 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9482 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9484 * src/mathed/math_macro.C (draw): do some cast magic.
9487 * src/mathed/math_defs.h: change byte* argument to byte const*.
9489 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9491 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9492 know it is right to return InsetFoot* too, but cxx does not like
9495 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9497 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9499 * src/mathed/math_delim.C: change == to proper assignment.
9501 2000-03-09 Juergen Vigna <jug@sad.it>
9503 * src/insets/insettext.C (setPos): fixed various cursor positioning
9504 problems (via mouse and cursor-keys)
9505 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9506 inset (still a small display problem but it works ;)
9508 * src/insets/insetcollapsable.C (draw): added button_top_y and
9509 button_bottom_y to have correct values for clicking on the inset.
9511 * src/support/lyxalgo.h: commented out 'using std::less'
9513 2000-03-08 Juergen Vigna <jug@sad.it>
9515 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9516 Button-Release event closes as it is alos the Release-Event
9519 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9521 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9523 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9524 can add multiple spaces in Scrap (literate programming) styles...
9525 which, by the way, is how I got hooked on LyX to begin with.
9527 * src/mathed/formula.C (Write): Added dummy variable to an
9528 inset::Latex() call.
9529 (Latex): Add free_spacing boolean to inset::Latex()
9531 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9533 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9534 virtual function to include the free_spacing boolean from
9535 the containing paragraph's style.
9537 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9538 Added free_spacing boolean arg to match inset.h
9540 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9541 Added free_spacing boolean arg to match inset.h
9543 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9544 Added free_spacing boolean and made sure that if in a free_spacing
9545 paragraph, that we output normal space if there is a protected space.
9547 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9548 Added free_spacing boolean arg to match inset.h
9550 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9551 Added free_spacing boolean arg to match inset.h
9553 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9554 Added free_spacing boolean arg to match inset.h
9556 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9557 Added free_spacing boolean arg to match inset.h
9559 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9560 Added free_spacing boolean arg to match inset.h
9562 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9563 free_spacing boolean arg to match inset.h
9565 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9566 Added free_spacing boolean arg to match inset.h
9568 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9569 Added free_spacing boolean arg to match inset.h
9571 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9572 Added free_spacing boolean arg to match inset.h
9574 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9575 Added free_spacing boolean arg to match inset.h
9577 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9578 Added free_spacing boolean arg to match inset.h
9580 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9581 free_spacing boolean arg to match inset.h
9583 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9584 free_spacing boolean arg to match inset.h
9586 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9587 ignore free_spacing paragraphs. The user's spaces are left
9590 * src/text.C (InsertChar): Fixed the free_spacing layout
9591 attribute behavior. Now, if free_spacing is set, you can
9592 add multiple spaces in a paragraph with impunity (and they
9593 get output verbatim).
9594 (SelectSelectedWord): Added dummy argument to inset::Latex()
9597 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9600 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9601 paragraph layouts now only input a simple space instead.
9602 Special character insets don't make any sense in free-spacing
9605 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9606 hard-spaces in the *input* file to simple spaces if the layout
9607 is free-spacing. This converts old files which had to have
9608 hard-spaces in free-spacing layouts where a simple space was
9610 (writeFileAscii): Added free_spacing check to pass to the newly
9611 reworked inset::Latex(...) methods. The inset::Latex() code
9612 ensures that hard-spaces in free-spacing paragraphs get output
9613 as spaces (rather than "~").
9615 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9617 * src/mathed/math_delim.C (draw): draw the empty placeholder
9618 delims with a onoffdash line.
9619 (struct math_deco_compare): struct that holds the "functors" used
9620 for the sort and the binary search in math_deco_table.
9621 (class init_deco_table): class used for initial sort of the
9623 (search_deco): use lower_bound to do a binary search in the
9626 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9628 * src/lyxrc.C: a small secret thingie...
9630 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9631 and to not flush the stream as often as it used to.
9633 * src/support/lyxalgo.h: new file
9634 (sorted): template function used for checking if a sequence is
9635 sorted or not. Two versions with and without user supplied
9636 compare. Uses same compare as std::sort.
9638 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9639 it and give warning on lyxerr.
9641 (struct compare_tags): struct with function operators used for
9642 checking if sorted, sorting and lower_bound.
9643 (search_kw): use lower_bound instead of manually implemented
9646 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9648 * src/insets/insetcollapsable.h: fix Clone() declaration.
9649 * src/insets/insetfoot.h: ditto.
9651 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9653 2000-03-08 Juergen Vigna <jug@sad.it>
9655 * src/insets/lyxinset.h: added owner call which tells us if
9656 this inset is inside another inset. Changed also the return-type
9657 of Editable to an enum so it tells clearer what the return-value is.
9659 * src/insets/insettext.C (computeTextRows): fixed computing of
9660 textinsets which split automatically on more rows.
9662 * src/insets/insetert.[Ch]: changed this to be of BaseType
9665 * src/insets/insetfoot.[Ch]: added footnote inset
9667 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9668 collapsable insets (like footnote, ert, ...)
9670 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9672 * src/lyxdraw.h: remvoe file
9674 * src/lyxdraw.C: remove file
9676 * src/insets/insettext.C: added <algorithm>.
9678 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9680 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9681 (matrix_cb): case MM_OK use string stream
9683 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9686 * src/mathed/math_macro.C (draw): use string stream
9687 (Metrics): use string stream
9689 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9690 directly to the ostream.
9692 * src/vspace.C (asString): use string stream.
9693 (asString): use string stream
9694 (asLatexString): use string stream
9696 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9697 setting Spacing::Other.
9699 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9700 sprintf when creating the stretch vale.
9702 * src/text2.C (alphaCounter): changed to return a string and to
9703 not use a static variable internally. Also fixed a one-off bug.
9704 (SetCounter): changed the drawing of the labels to use string
9705 streams instead of sprintf.
9707 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9708 manipulator to use a scheme that does not require library support.
9709 This is also the way it is done in the new GNU libstdc++. Should
9710 work with DEC cxx now.
9712 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9714 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9715 end. This fixes a bug.
9717 * src/mathed (all files concerned with file writing): apply the
9718 USE_OSTREAM_ONLY changes to mathed too.
9720 * src/support/DebugStream.h: make the constructor explicit.
9722 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9723 count and ostream squashed.
9725 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9727 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9729 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9730 ostringstream uses STL strings, and we might not.
9732 * src/insets/insetspecialchar.C: add using directive.
9733 * src/insets/insettext.C: ditto.
9735 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9737 * lib/layouts/seminar.layout: feeble attempt at a layout for
9738 seminar.cls, far from completet and could really use some looking
9739 at from people used to write layout files.
9741 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9742 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9743 a lot nicer and works nicely with ostreams.
9745 * src/mathed/formula.C (draw): a slightly different solution that
9746 the one posted to the list, but I think this one works too. (font
9747 size wrong in headers.)
9749 * src/insets/insettext.C (computeTextRows): some fiddling on
9750 Jürgens turf, added some comments that he should read.
9752 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9753 used and it gave compiler warnings.
9754 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9757 * src/lyx_gui.C (create_forms): do the right thing when
9758 show_banner is true/false.
9760 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9761 show_banner is false.
9763 * most file writing files: Now use iostreams to do almost all of
9764 the writing. Also instead of passing string &, we now use
9765 stringstreams. mathed output is still not adapted to iostreams.
9766 This change can be turned off by commenting out all the occurences
9767 of the "#define USE_OSTREAM_ONLY 1" lines.
9769 * src/WorkArea.C (createPixmap): don't output debug messages.
9770 (WorkArea): don't output debug messages.
9772 * lib/lyxrc.example: added a comment about the new variable
9775 * development/Code_rules/Rules: Added some more commente about how
9776 to build class interfaces and on how better encapsulation can be
9779 2000-03-03 Juergen Vigna <jug@sad.it>
9781 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9782 automatically with the width of the LyX-Window
9784 * src/insets/insettext.C (computeTextRows): fixed update bug in
9785 displaying text-insets (scrollvalues where not initialized!)
9787 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9789 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9790 id in the check of the result from lower_bound is not enough since
9791 lower_bound can return last too, and then res->id will not be a
9794 * all insets and some code that use them: I have conditionalized
9795 removed the Latex(string & out, ...) this means that only the
9796 Latex(ostream &, ...) will be used. This is a work in progress to
9797 move towards using streams for all output of files.
9799 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9802 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9804 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9805 routine (this fixes bug where greek letters were surrounded by too
9808 * src/support/filetools.C (findtexfile): change a bit the search
9809 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9810 no longer passed to kpsewhich, we may have to change that later.
9812 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9813 warning options to avoid problems with X header files (from Angus
9815 * acinclude.m4: regenerated.
9817 2000-03-02 Juergen Vigna <jug@sad.it>
9819 * src/insets/insettext.C (WriteParagraphData): Using the
9820 par->writeFile() function for writing paragraph-data.
9821 (Read): Using buffer->parseSingleLyXformat2Token()-function
9822 for parsing paragraph data!
9824 * src/buffer.C (readLyXformat2): removed all parse data and using
9825 the new parseSingleLyXformat2Token()-function.
9826 (parseSingleLyXformat2Token): added this function to parse (read)
9827 lyx-file-format (this is called also from text-insets now!)
9829 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9831 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9834 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9835 directly instead of going through a func. One very bad thing: a
9836 static LyXFindReplace, but I don't know where to place it.
9838 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9839 string instead of char[]. Also changed to static.
9840 (GetSelectionOrWordAtCursor): changed to static inline
9841 (SetSelectionOverLenChars): ditto.
9843 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9844 current_view and global variables. both classes has changed names
9845 and LyXFindReplace is not inherited from SearchForm.
9847 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9848 fl_form_search form.
9850 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9852 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9854 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9855 bound (from Kayvan).
9857 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9859 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9861 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9863 * some things that I should comment but the local pub says head to
9866 * comment out all code that belongs to the Roff code for Ascii
9867 export of tables. (this is unused)
9869 * src/LyXView.C: use correct type for global variable
9870 current_layout. (LyXTextClass::size_type)
9872 * some code to get the new insetgraphics closer to working I'd be
9873 grateful for any help.
9875 * src/BufferView2.C (insertInset): use the return type of
9876 NumberOfLayout properly. (also changes in other files)
9878 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9879 this as a test. I want to know what breaks because of this.
9881 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9883 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9885 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9886 to use a \makebox in the label, this allows proper justification
9887 with out using protected spaces or multiple hfills. Now it is
9888 "label" for left justified, "\hfill label\hfill" for center, and
9889 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9890 should be changed accordingly.
9892 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9894 * src/lyxtext.h: change SetLayout() to take a
9895 LyXTextClass::size_type instead of a char (when there is more than
9896 127 layouts in a class); also change type of copylayouttype.
9897 * src/text2.C (SetLayout): ditto.
9898 * src/LyXView.C (updateLayoutChoice): ditto.
9900 * src/LaTeX.C (scanLogFile): errors where the line number was not
9901 given just after the '!'-line were ignored (from Dekel Tsur).
9903 * lib/lyxrc.example: fix description of \date_insert_format
9905 * lib/layouts/llncs.layout: new layout, contributed by Martin
9908 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9910 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9911 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9912 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9913 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9914 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9915 paragraph.C, text.C, text2.C)
9917 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * src/insets/insettext.C (LocalDispatch): remove extra break
9922 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9923 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9925 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9926 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9928 * src/insets/insetbib.h: move InsetBibkey::Holder and
9929 InsetCitation::Holder in public space.
9931 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9933 * src/insets/insettext.h: small change to get the new files from
9934 Juergen to compile (use "string", not "class string").
9936 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9937 const & as parameter to LocalDispatch, use LyXFont const & as
9938 paramter to some other func. This also had impacto on lyxinsets.h
9939 and the two mathed insets.
9941 2000-02-24 Juergen Vigna <jug@sad.it>
9944 * src/commandtags.h:
9946 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9950 * src/BufferView2.C: added/updated code for various inset-functions
9952 * src/insets/insetert.[Ch]: added implementation of InsetERT
9954 * src/insets/insettext.[Ch]: added implementation of InsetText
9956 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9957 (draw): added preliminary code for inset scrolling not finshed yet
9959 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9960 as it is in lyxfunc.C now
9962 * src/insets/lyxinset.h: Added functions for text-insets
9964 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9966 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9967 BufferView and reimplement the list as a queue put inside its own
9970 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9972 * several files: use the new interface to the "updateinsetlist"
9974 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9976 (work_area_handler): call BufferView::trippleClick on trippleclick.
9978 * src/BufferView.C (doubleClick): new function, selects word on
9980 (trippleClick): new function, selects line on trippleclick.
9982 2000-02-22 Allan Rae <rae@lyx.org>
9984 * lib/bind/xemacs.bind: buffer-previous not supported
9986 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9988 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9991 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9993 * src/bufferlist.C: get rid of current_view from this file
9995 * src/spellchecker.C: get rid of current_view from this file
9997 * src/vspace.C: get rid of current_view from this file
9998 (inPixels): added BufferView parameter for this func
9999 (asLatexCommand): added a BufferParams for this func
10001 * src/text.C src/text2.C: get rid of current_view from these
10004 * src/lyxfont.C (getFontDirection): move this function here from
10007 * src/bufferparams.C (getDocumentDirection): move this function
10010 * src/paragraph.C (getParDirection): move this function here from
10012 (getLetterDirection): ditto
10014 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10016 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10017 resize due to wrong pixmap beeing used. Also took the opurtunity
10018 to make the LyXScreen stateless on regard to WorkArea and some
10019 general cleanup in the same files.
10021 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10023 * src/Makefile.am: add missing direction.h
10025 * src/PainterBase.h: made the width functions const.
10027 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10030 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10032 * src/insets/insetlatexaccent.C (draw): make the accents draw
10033 better, at present this will only work well with iso8859-1.
10035 * several files: remove the old drawing code, now we use the new
10038 * several files: remove support for mono_video, reverse_video and
10041 2000-02-17 Juergen Vigna <jug@sad.it>
10043 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10044 int ** as we have to return the pointer, otherwise we have only
10045 NULL pointers in the returning function.
10047 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10049 * src/LaTeX.C (operator()): quote file name when running latex.
10051 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10053 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10054 (bubble tip), this removes our special handling of this.
10056 * Remove all code that is unused now that we have the new
10057 workarea. (Code that are not active when NEW_WA is defined.)
10059 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10061 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10063 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10064 nonexisting layout; correctly redirect obsoleted layouts.
10066 * lib/lyxrc.example: document \view_dvi_paper_option
10068 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10071 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10072 (PreviewDVI): handle the view_dvi_paper_option variable.
10073 [Both from Roland Krause]
10075 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10077 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10078 char const *, int, LyXFont)
10079 (text(int, int, string, LyXFont)): ditto
10081 * src/text.C (InsertCharInTable): attempt to fix the double-space
10082 feature in tables too.
10083 (BackspaceInTable): ditto.
10084 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10086 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10088 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10090 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10091 newly found text in textcache to this.
10092 (buffer): set the owner of the text put into the textcache to 0
10094 * src/insets/figinset.C (draw): fixed the drawing of figures with
10097 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10098 drawing of mathframe, hfills, protected space, table lines. I have
10099 now no outstanding drawing problems with the new Painter code.
10101 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10103 * src/PainterBase.C (ellipse, circle): do not specify the default
10106 * src/LColor.h: add using directive.
10108 * src/Painter.[Ch]: change return type of methods from Painter& to
10109 PainterBase&. Add a using directive.
10111 * src/WorkArea.C: wrap xforms callbacks in C functions
10114 * lib/layouts/foils.layout: font fix and simplifications from Carl
10117 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10119 * a lot of files: The Painter, LColor and WorkArea from the old
10120 devel branch has been ported to lyx-devel. Some new files and a
10121 lot of #ifdeffed code. The new workarea is enabled by default, but
10122 if you want to test the new Painter and LColor you have to compile
10123 with USE_PAINTER defined (do this in config.h f.ex.) There are
10124 still some rought edges, and I'd like some help to clear those
10125 out. It looks stable (loads and displays the Userguide very well).
10128 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10130 * src/buffer.C (pop_tag): revert to the previous implementation
10131 (use a global variable for both loops).
10133 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10135 * src/lyxrc.C (LyXRC): change slightly default date format.
10137 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10138 there is an English text with a footnote that starts with a Hebrew
10139 paragraph, or vice versa.
10140 (TeXFootnote): ditto.
10142 * src/text.C (LeftMargin): allow for negative values for
10143 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10146 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10147 for input encoding (cyrillic)
10149 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10151 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10154 * src/toolbar.C (set): ditto
10155 * src/insets/insetbib.C (create_form_citation_form): ditto
10157 * lib/CREDITS: added Dekel Tsur.
10159 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10160 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10161 hebrew supports files from Dekel Tsur.
10163 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10164 <tzafrir@technion.ac.il>
10166 * src/lyxrc.C: put \date_insert_format at the right place.
10168 * src/buffer.C (makeLaTeXFile): fix the handling of
10169 BufferParams::sides when writing out latex files.
10171 * src/BufferView2.C: add a "using" directive.
10173 * src/support/lyxsum.C (sum): when we use lyxstring,
10174 ostringstream::str needs an additional .c_str().
10176 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10178 * src/support/filetools.C (ChangeExtension): patch from Etienne
10181 * src/TextCache.C (show): remove const_cast and make second
10182 parameter non-const LyXText *.
10184 * src/TextCache.h: use non const LyXText in show.
10186 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10189 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10191 * src/support/lyxsum.C: rework to be more flexible.
10193 * several places: don't check if a pointer is 0 if you are going
10196 * src/text.C: remove some dead code.
10198 * src/insets/figinset.C: remove some dead code
10200 * src/buffer.C: move the BufferView funcs to BufferView2.C
10201 remove all support for insetlatexdel
10202 remove support for oldpapersize stuff
10203 made some member funcs const
10205 * src/kbmap.C: use a std::list to store the bindings in.
10207 * src/BufferView2.C: new file
10209 * src/kbsequence.[Ch]: new files
10211 * src/LyXAction.C + others: remove all trace of buffer-previous
10213 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10214 only have one copy in the binary of this table.
10216 * hebrew patch: moved some functions from LyXText to more
10217 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10219 * several files: remove support for XForms older than 0.88
10220 whitespace changes.
10221 remove some #if 0 #endif code
10223 * src/TextCache.[Ch]: new file. Holds the textcache.
10225 * src/BufferView.C: changes to use the new TextCache interface.
10226 (waitForX): remove the now unused code.
10228 * src/BackStack.h: remove some commented code
10230 * lib/bind/emacs.bind: remove binding for buffer-previous
10232 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10234 * applied the hebrew patch.
10236 * src/lyxrow.h: make sure that all Row variables are initialized.
10238 * src/text2.C (TextHandleUndo): comment out a delete, this might
10239 introduce a memory leak, but should also help us to not try to
10240 read freed memory. We need to look at this one.
10242 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10243 (LyXParagraph): initalize footnotekind.
10245 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10246 forgot this when applying the patch. Please heed the warnings.
10248 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10249 (aka. reformat problem)
10251 * src/bufferlist.C (exists): made const, and use const_iterator
10252 (isLoaded): new func.
10253 (release): use std::find to find the correct buffer.
10255 * src/bufferlist.h: made getState a const func.
10256 made empty a const func.
10257 made exists a const func.
10260 2000-02-01 Juergen Vigna <jug@sad.it>
10262 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10264 * po/it.po: updated a bit the italian po file and also changed the
10265 'file nuovo' for newfile to 'filenuovo' without a space, this did
10268 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10269 for the new insert_date command.
10271 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10272 from jdblair, to insert a date into the current text conforming to
10273 a strftime format (for now only considering the locale-set and not
10274 the document-language).
10276 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10278 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10279 Bounds Read error seen by purify. The problem was that islower is
10280 a macros which takes an unsigned char and uses it as an index for
10281 in array of characters properties (and is thus subject to the
10285 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10286 correctly the paper sides radio buttons.
10287 (UpdateDocumentButtons): ditto.
10289 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10291 * src/kbmap.C (getsym + others): change to return unsigned int,
10292 returning a long can give problems on 64 bit systems. (I assume
10293 that int is 32bit on 64bit systems)
10295 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10297 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10298 LyXLookupString to be zero-terminated. Really fixes problems seen
10299 by purify, I think.
10301 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10303 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10304 write a (char*)0 to the lyxerr stream.
10306 * src/lastfiles.C: move algorithm before the using statemets.
10308 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10310 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10311 complains otherwise).
10312 * src/table.C: ditto
10314 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10317 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10318 that I removed earlier... It is really needed.
10320 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10322 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10324 * INSTALL: update xforms home page URL.
10326 * lib/configure.m4: fix a bug with unreadable layout files.
10328 * src/table.C (calculate_width_of_column): add "using std::max"
10331 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * several files: marked several lines with "DEL LINE", this is
10334 lines that can be deleted without changing anything.
10335 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10336 checks this anyway */
10339 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10341 * src/DepTable.C (update): add a "+" at the end when the checksum
10342 is different. (debugging string only)
10344 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10345 the next inset to not be displayed. This should also fix the list
10346 of labels in the "Insert Crossreference" dialog.
10348 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10350 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10351 when regex was not found.
10353 * src/support/lstrings.C (lowercase): use handcoded transform always.
10356 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10357 old_cursor.par->prev could be 0.
10359 * several files: changed post inc/dec to pre inc/dec
10361 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10362 write the lastfiles to file.
10364 * src/BufferView.C (buffer): only show TextCache info when debugging
10366 (resizeCurrentBuffer): ditto
10367 (workAreaExpose): ditto
10369 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10371 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10373 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10374 a bit better by removing the special case for \i and \j.
10376 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10378 * src/lyx_main.C (easyParse): remove test for bad comand line
10379 options, since this broke all xforms-related parsing.
10381 * src/kbmap.C (getsym): set return type to unsigned long, as
10382 declared in header. On an alpha, long is _not_ the same as int.
10384 * src/support/LOstream.h: add a "using std::flush;"
10386 * src/insets/figinset.C: ditto.
10388 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10390 * src/bufferlist.C (write): use blinding fast file copy instead of
10391 "a char at a time", now we are doing it the C++ way.
10393 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10394 std::list<int> instead.
10395 (addpidwait): reflect move to std::list<int>
10396 (sigchldchecker): ditto
10398 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10401 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10402 that obviously was wrong...
10404 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10405 c, this avoids warnings with purify and islower.
10407 * src/insets/figinset.C: rename struct queue to struct
10408 queue_element and rewrite to use a std::queue. gsqueue is now a
10409 std::queue<queue_element>
10410 (runqueue): reflect move to std::queue
10413 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10414 we would get "1" "0" instead of "true" "false. Also make the tostr
10417 2000-01-21 Juergen Vigna <jug@sad.it>
10419 * src/buffer.C (writeFileAscii): Disabled code for special groff
10420 handling of tabulars till I fix this in table.C
10422 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10424 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10426 * src/support/lyxlib.h: ditto.
10428 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10430 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10431 and 'j' look better. This might fix the "macron" bug that has been
10434 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10435 functions as one template function. Delete the old versions.
10437 * src/support/lyxsum.C: move using std::ifstream inside
10440 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10443 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10445 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10447 * src/insets/figinset.C (InitFigures): use new instead of malloc
10448 to allocate memory for figures and bitmaps.
10449 (DoneFigures): use delete[] instead of free to deallocate memory
10450 for figures and bitmaps.
10451 (runqueue): use new to allocate
10452 (getfigdata): use new/delete[] instead of malloc/free
10453 (RegisterFigure): ditto
10455 * some files: moved some declarations closer to first use, small
10456 whitespace changes use preincrement instead of postincrement where
10457 it does not make a difference.
10459 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10460 step on the way to use stl::containers for key maps.
10462 * src/bufferlist.h: add a typedef for const_iterator and const
10463 versions of begin and end.
10465 * src/bufferlist.[Ch]: change name of member variable _state to
10466 state_. (avoid reserved names)
10468 (getFileNames): returns the filenames of the buffers in a vector.
10470 * configure.in (ALL_LINGUAS): added ro
10472 * src/support/putenv.C: new file
10474 * src/support/mkdir.C: new file
10476 2000-01-20 Allan Rae <rae@lyx.org>
10478 * lib/layouts/IEEEtran.layout: Added several theorem environments
10480 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10481 couple of minor additions.
10483 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10484 (except for those in footnotes of course)
10486 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10488 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10490 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10491 std::sort and std::lower_bound instead of qsort and handwritten
10493 (struct compara): struct that holds the functors used by std::sort
10494 and std::lower_bound in MathedLookupBOP.
10496 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10498 * src/support/LAssert.h: do not do partial specialization. We do
10499 not really need it.
10501 * src/support/lyxlib.h: note that lyx::getUserName() and
10502 lyx::date() are not in use right now. Should these be suppressed?
10504 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10505 (makeLinuxDocFile): do not put date and user name in linuxdoc
10508 * src/support/lyxlib.h (kill): change first argument to long int,
10509 since that's what solaris uses.
10511 * src/support/kill.C (kill): fix declaration to match prototype.
10513 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10514 actually check whether namespaces are supported. This is not what
10517 * src/support/lyxsum.C: add a using directive.
10519 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10521 * src/support/kill.C: if we have namespace support we don't have
10522 to include lyxlib.h.
10524 * src/support/lyxlib.h: use namespace lyx if supported.
10526 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10528 * src/support/date.C: new file
10530 * src/support/chdir.C: new file
10532 * src/support/getUserName.C: new file
10534 * src/support/getcwd.C: new file
10536 * src/support/abort.C: new file
10538 * src/support/kill.C: new file
10540 * src/support/lyxlib.h: moved all the functions in this file
10541 insede struct lyx. Added also kill and abort to this struct. This
10542 is a way to avoid the "kill is not defined in <csignal>", we make
10543 C++ wrappers for functions that are not ANSI C or ANSI C++.
10545 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10546 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10547 lyx it has been renamed to sum.
10549 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10551 * src/text.C: add using directives for std::min and std::max.
10553 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10555 * src/texrow.C (getIdFromRow): actually return something useful in
10556 id and pos. Hopefully fixes the bug with positionning of errorbox
10559 * src/lyx_main.C (easyParse): output an error and exit if an
10560 incorrect command line option has been given.
10562 * src/spellchecker.C (ispell_check_word): document a memory leak.
10564 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10565 where a "struct utimbuf" is allocated with "new" and deleted with
10568 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10570 * src/text2.C (CutSelection): don't delete double spaces.
10571 (PasteSelection): ditto
10572 (CopySelection): ditto
10574 * src/text.C (Backspace): don't delete double spaces.
10576 * src/lyxlex.C (next): fix a bug that were only present with
10577 conformant std::istream::get to read comment lines, use
10578 std::istream::getline instead. This seems to fix the problem.
10580 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10582 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10583 allowed to insert space before space" editing problem. Please read
10584 commends at the beginning of the function. Comments about usage
10587 * src/text.C (InsertChar): fix for the "not allowed to insert
10588 space before space" editing problem.
10590 * src/text2.C (DeleteEmptyParagraphMechanism): when
10591 IsEmptyTableRow can only return false this last "else if" will
10592 always be a no-op. Commented out.
10594 * src/text.C (RedoParagraph): As far as I can understand tmp
10595 cursor is not really needed.
10597 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10598 present it could only return false anyway.
10599 (several functions): Did something not so smart...added a const
10600 specifier on a lot of methods.
10602 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10603 and add a tmp->text.resize. The LyXParagraph constructor does the
10605 (BreakParagraphConservative): ditto
10607 * src/support/path.h (Path): add a define so that the wrong usage
10608 "Path("/tmp") will be flagged as a compilation error:
10609 "`unnamed_Path' undeclared (first use this function)"
10611 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10613 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10614 which was bogus for several reasons.
10616 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10618 (runBibTeX): ditto.
10620 * autogen.sh: do not use "type -path" (what's that anyway?).
10622 * src/support/filetools.C (findtexfile): remove extraneous space
10623 which caused a kpsewhich warning (at least with kpathsea version
10626 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10628 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10630 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10632 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10634 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10636 * src/paragraph.C (BreakParagraph): do not reserve space on text
10637 if we don't need to (otherwise, if pos_end < pos, we end up
10638 reserving huge amounts of memory due to bad unsigned karma).
10639 (BreakParagraphConservative): ditto, although I have not seen
10640 evidence the bug can happen here.
10642 * src/lyxparagraph.h: add a using std::list.
10644 2000-01-11 Juergen Vigna <jug@sad.it>
10646 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10647 could not be found.
10649 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10651 * src/vc-backend.C (doVCCommand): change to be static and take one
10652 more parameter: the path to chdir too be fore executing the command.
10653 (retrive): new function equiv to "co -r"
10655 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10656 file_not_found_hook is true.
10658 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10660 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10661 if a file is readwrite,readonly...anything else.
10663 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10665 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10666 (CreatePostscript): name change from MenuRunDVIPS (or something)
10667 (PreviewPostscript): name change from MenuPreviewPS
10668 (PreviewDVI): name change from MenuPreviewDVI
10670 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10671 \view_pdf_command., \pdf_to_ps_command
10673 * lib/configure.m4: added search for PDF viewer, and search for
10674 PDF to PS converter.
10675 (lyxrc.defaults output): add \pdflatex_command,
10676 \view_pdf_command and \pdf_to_ps_command.
10678 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10680 * src/bufferlist.C (write): we don't use blocksize for anything so
10683 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10685 * src/support/block.h: disable operator T* (), since it causes
10686 problems with both compilers I tried. See comments in the file.
10688 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10691 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10692 variable LYX_DIR_10x to LYX_DIR_11x.
10694 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10696 * INSTALL: document --with-lyxname.
10699 * configure.in: new configure flag --with-lyxname which allows to
10700 choose the name under which lyx is installed. Default is "lyx", of
10701 course. It used to be possible to do this with --program-suffix,
10702 but the later has in fact a different meaning for autoconf.
10704 * src/support/lstrings.h (lstrchr): reformat a bit.
10706 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10707 * src/mathed/math_defs.h: ditto.
10709 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10711 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10712 true, decides if we create a backup file or not when saving. New
10713 tag and variable \pdf_mode, defaults to false. New tag and
10714 variable \pdflatex_command, defaults to pdflatex. New tag and
10715 variable \view_pdf_command, defaults to xpdf. New tag and variable
10716 \pdf_to_ps_command, defaults to pdf2ps.
10718 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10720 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10721 does not have a BufferView.
10722 (unlockInset): ditto + don't access the_locking_inset if the
10723 buffer does not have a BufferView.
10725 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10726 certain circumstances so that we don't continue a keyboard
10727 operation long after the key was released. Try f.ex. to load a
10728 large document, press PageDown for some seconds and then release
10729 it. Before this change the document would contine to scroll for
10730 some time, with this change it stops imidiatly.
10732 * src/support/block.h: don't allocate more space than needed. As
10733 long as we don't try to write to the arr[x] in a array_type arr[x]
10734 it is perfectly ok. (if you write to it you might segfault).
10735 added operator value_type*() so that is possible to pass the array
10736 to functions expecting a C-pointer.
10738 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10741 * intl/*: updated to gettext 0.10.35, tried to add our own
10742 required modifications. Please verify.
10744 * po/*: updated to gettext 0.10.35, tried to add our own required
10745 modifications. Please verify.
10747 * src/support/lstrings.C (tostr): go at fixing the problem with
10748 cxx and stringstream. When stringstream is used return
10749 oss.str().c_str() so that problems with lyxstring and basic_string
10750 are avoided. Note that the best solution would be for cxx to use
10751 basic_string all the way, but it is not conformant yet. (it seems)
10753 * src/lyx_cb.C + other files: moved several global functions to
10754 class BufferView, some have been moved to BufferView.[Ch] others
10755 are still located in lyx_cb.C. Code changes because of this. (part
10756 of "get rid of current_view project".)
10758 * src/buffer.C + other files: moved several Buffer functions to
10759 class BufferView, the functions are still present in buffer.C.
10760 Code changes because of this.
10762 * config/lcmessage.m4: updated to most recent. used when creating
10765 * config/progtest.m4: updated to most recent. used when creating
10768 * config/gettext.m4: updated to most recent. applied patch for
10771 * config/gettext.m4.patch: new file that shows what changes we
10772 have done to the local copy of gettext.m4.
10774 * config/libtool.m4: new file, used in creation of acinclude.m4
10776 * config/lyxinclude.m4: new file, this is the lyx created m4
10777 macros, used in making acinclude.m4.
10779 * autogen.sh: GNU m4 discovered as a separate task not as part of
10780 the lib/configure creation.
10781 Generate acinlucde from files in config. Actually cat
10782 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10783 easier to upgrade .m4 files that really are external.
10785 * src/Spacing.h: moved using std::istringstream to right after
10786 <sstream>. This should fix the problem seen with some compilers.
10788 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10790 * src/lyx_cb.C: began some work to remove the dependency a lot of
10791 functions have on BufferView::text, even if not really needed.
10792 (GetCurrentTextClass): removed this func, it only hid the
10795 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10796 forgot this in last commit.
10798 * src/Bullet.C (bulletEntry): use static char const *[] for the
10799 tables, becuase of this the return arg had to change to string.
10800 (bulletSize): ditto
10801 (~Bullet): removed unneeded destructor
10803 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10804 (insetSleep): moved from Buffer
10805 (insetWakeup): moved from Buffer
10806 (insetUnlock): moved from Buffer
10808 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10809 from Buffer to BufferView.
10811 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10813 * config/ltmain.sh: updated to version 1.3.4 of libtool
10815 * config/ltconfig: updated to version 1.3.4 of libtool
10817 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10820 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10821 Did I get that right?
10823 * src/lyxlex.h: add a "using" directive or two.
10824 * src/Spacing.h: ditto.
10825 * src/insets/figinset.C: ditto.
10826 * src/support/filetools.C: ditto.
10827 * src/support/lstrings.C: ditto.
10828 * src/BufferView.C: ditto.
10829 * src/bufferlist.C: ditto.
10830 * src/lyx_cb.C: ditto.
10831 * src/lyxlex.C: ditto.
10833 * NEWS: add some changes for 1.1.4.
10835 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10837 * src/BufferView.C: first go at a TextCache to speed up switching
10840 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10842 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10843 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10844 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10845 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10848 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10849 members of the struct are correctly initialized to 0 (detected by
10851 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10852 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10854 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10855 pidwait, since it was allocated with "new". This was potentially
10856 very bad. Thanks to Michael Schmitt for running purify for us.
10859 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10861 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10863 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10865 1999-12-30 Allan Rae <rae@lyx.org>
10867 * lib/templates/IEEEtran.lyx: minor change
10869 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10870 src/mathed/formula.C (LocalDispatch): askForText changes
10872 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10873 know when a user has cancelled input. Fixes annoying problems with
10874 inserting labels and version control.
10876 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10878 * src/support/lstrings.C (tostr): rewritten to use strstream and
10881 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * src/support/filetools.C (IsFileWriteable): use fstream to check
10884 (IsDirWriteable): use fileinfo to check
10886 * src/support/filetools.h (FilePtr): whole class deleted
10888 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10890 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10892 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10894 * src/bufferlist.C (write): use ifstream and ofstream instead of
10897 * src/Spacing.h: use istrstream instead of sscanf
10899 * src/mathed/math_defs.h: change first arg to istream from FILE*
10901 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10903 * src/mathed/math_parser.C: have yyis to be an istream
10904 (LexGetArg): use istream (yyis)
10906 (mathed_parse): ditto
10907 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10909 * src/mathed/formula.C (Read): rewritten to use istream
10911 * src/mathed/formulamacro.C (Read): rewritten to use istream
10913 * src/lyxlex.h (~LyXLex): deleted desturctor
10914 (getStream): new function, returns an istream
10915 (getFile): deleted funtion
10916 (IsOK): return is.good();
10918 * src/lyxlex.C (LyXLex): delete file and owns_file
10919 (setFile): open an filebuf and assign that to a istream instead of
10921 (setStream): new function, takes an istream as arg.
10922 (setFile): deleted function
10923 (EatLine): rewritten us use istream instead of FILE*
10927 * src/table.C (LyXTable): use istream instead of FILE*
10928 (Read): rewritten to take an istream instead of FILE*
10930 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10932 * src/buffer.C (Dispatch): remove an extraneous break statement.
10934 * src/support/filetools.C (QuoteName): change to do simple
10935 'quoting'. More work is necessary. Also changed to do nothing
10936 under emx (needs fix too).
10937 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10939 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10940 config.h.in to the AC_DEFINE_UNQUOTED() call.
10941 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10942 needs char * as argument (because Solaris 7 declares it like
10945 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10946 remove definition of BZERO.
10948 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10950 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10951 defined, "lyxregex.h" if not.
10953 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10955 (REGEX): new variable that is set to regex.c lyxregex.h when
10956 AM_CONDITIONAL USE_REGEX is set.
10957 (libsupport_la_SOURCES): add $(REGEX)
10959 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10962 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10965 * configure.in: add call to LYX_REGEX
10967 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10968 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10970 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10972 * lib/bind/fi_menus.bind: new file, from
10973 pauli.virtanen@saunalahti.fi.
10975 * src/buffer.C (getBibkeyList): pass the parameter delim to
10976 InsetInclude::getKeys and InsetBibtex::getKeys.
10978 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10979 is passed to Buffer::getBibkeyList
10981 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10982 instead of the hardcoded comma.
10984 * src/insets/insetbib.C (getKeys): make sure that there are not
10985 leading blanks in bibtex keys. Normal latex does not care, but
10986 harvard.sty seems to dislike blanks at the beginning of citation
10987 keys. In particular, the retturn value of the function is
10989 * INSTALL: make it clear that libstdc++ is needed and that gcc
10990 2.7.x probably does not work.
10992 * src/support/filetools.C (findtexfile): make debug message go to
10994 * src/insets/insetbib.C (getKeys): ditto
10996 * src/debug.C (showTags): make sure that the output is correctly
10999 * configure.in: add a comment for TWO_COLOR_ICON define.
11001 * acconfig.h: remove all the entries that already defined in
11002 configure.in or acinclude.m4.
11004 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11005 to avoid user name, date and copyright.
11007 1999-12-21 Juergen Vigna <jug@sad.it>
11009 * src/table.C (Read): Now read bogus row format informations
11010 if the format is < 5 so that afterwards the table can
11011 be read by lyx but without any format-info. Fixed the
11012 crash we experienced when not doing this.
11014 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11016 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11017 (RedoDrawingOfParagraph): ditto
11018 (RedoParagraphs): ditto
11019 (RemoveTableRow): ditto
11021 * src/text.C (Fill): rename arg paperwidth -> paper_width
11023 * src/buffer.C (insertLyXFile): rename var filename -> fname
11024 (writeFile): rename arg filename -> fname
11025 (writeFileAscii): ditto
11026 (makeLaTeXFile): ditto
11027 (makeLinuxDocFile): ditto
11028 (makeDocBookFile): ditto
11030 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11033 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11035 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11038 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11039 compiled by a C compiler not C++.
11041 * src/layout.h (LyXTextClass): added typedef for const_iterator
11042 (LyXTextClassList): added typedef for const_iterator + member
11043 functions begin and end.
11045 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11046 iterators to fill the choice_class.
11047 (updateLayoutChoice): rewritten to use iterators to fill the
11048 layoutlist in the toolbar.
11050 * src/BufferView.h (BufferView::work_area_width): removed unused
11053 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11055 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11056 (sgmlCloseTag): ditto
11058 * src/support/lstrings.h: return type of countChar changed to
11061 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11062 what version of this func to use. Also made to return unsigned int.
11064 * configure.in: call LYX_STD_COUNT
11066 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11067 conforming std::count.
11069 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11071 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11072 and a subscript would give bad display (patch from Dekel Tsur
11073 <dekel@math.tau.ac.il>).
11075 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11077 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11080 * src/chset.h: add a few 'using' directives
11082 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11083 triggered when no buffer is active
11085 * src/layout.C: removed `break' after `return' in switch(), since
11088 * src/lyx_main.C (init): make sure LyX can be ran in place even
11089 when libtool has done its magic with shared libraries. Fix the
11090 test for the case when the system directory has not been found.
11092 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11093 name for the latex file.
11094 (MenuMakeHTML): ditto
11096 * src/buffer.h: add an optional boolean argument, which is passed
11097 to ChangeExtension.
11099 1999-12-20 Allan Rae <rae@lyx.org>
11101 * lib/templates/IEEEtran.lyx: small correction and update.
11103 * configure.in: Attempted to use LYX_PATH_HEADER
11105 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11107 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11108 input from JMarc. Now use preprocessor to find the header.
11109 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11110 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11111 LYX_STL_STRING_FWD. See comments in file.
11113 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11115 * The global MiniBuffer * minibuffer variable is dead.
11117 * The global FD_form_main * fd_form_main variable is dead.
11119 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11121 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11123 * src/table.h: add the LOstream.h header
11124 * src/debug.h: ditto
11126 * src/LyXAction.h: change the explaination of the ReadOnly
11127 attribute: is indicates that the function _can_ be used.
11129 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11132 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11134 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11140 * src/paragraph.C (GetWord): assert on pos>=0
11143 * src/support/lyxstring.C: condition the use of an invariant on
11145 * src/support/lyxstring.h: ditto
11147 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11148 Use LAssert.h instead of plain assert().
11150 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11152 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11153 * src/support/filetools.C: ditto
11155 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11158 * INSTALL: document the new configure flags
11160 * configure.in: suppress --with-debug; add --enable-assertions
11162 * acinclude.m4: various changes in alignment of help strings.
11164 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11166 * src/kbmap.C: commented out the use of the hash map in kb_map,
11167 beginning of movement to a stl::container.
11169 * several files: removed code that was not in effect when
11170 MOVE_TEXT was defined.
11172 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11173 for escaping should not be used. We can discuss if the string
11174 should be enclosed in f.ex. [] instead of "".
11176 * src/trans_mgr.C (insert): use the new returned value from
11177 encodeString to get deadkeys and keymaps done correctly.
11179 * src/chset.C (encodeString): changed to return a pair, to tell
11180 what to use if we know the string.
11182 * src/lyxscreen.h (fillArc): new function.
11184 * src/FontInfo.C (resize): rewritten to use more std::string like
11185 structore, especially string::replace.
11187 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11190 * configure.in (chmod +x some scripts): remove config/gcc-hack
11192 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11194 * src/buffer.C (writeFile): change once again the top comment in a
11195 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11196 instead of an hardcoded version number.
11197 (makeDocBookFile): ditto
11199 * src/version.h: add new define LYX_DOCVERSION
11201 * po/de.po: update from Pit Sütterlin
11202 * lib/bind/de_menus.bind: ditto.
11204 * src/lyxfunc.C (Dispatch): call MenuExport()
11205 * src/buffer.C (Dispatch): ditto
11207 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11208 LyXFunc::Dispatch().
11209 (MenuExport): new function, moved from
11210 LyXFunc::Dispatch().
11212 * src/trans_mgr.C (insert): small cleanup
11213 * src/chset.C (loadFile): ditto
11215 * lib/kbd/iso8859-1.cdef: add missing backslashes
11217 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11219 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11220 help with placing the manually drawn accents better.
11222 (Draw): x2 and hg changed to float to minimize rounding errors and
11223 help place the accents better.
11225 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11226 unsigned short to char is just wrong...cast the char to unsigned
11227 char instead so that the two values can compare sanely. This
11228 should also make the display of insetlatexaccents better and
11229 perhaps also some other insets.
11231 (lbearing): new function
11234 1999-12-15 Allan Rae <rae@lyx.org>
11236 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11237 header that provides a wrapper around the very annoying SGI STL header
11240 * src/support/lyxstring.C, src/LString.h:
11241 removed old SGI-STL-compatability attempts.
11243 * configure.in: Use LYX_STL_STRING_FWD.
11245 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11246 stl_string_fwd.h is around and try to determine it's location.
11247 Major improvement over previous SGI STL 3.2 compatability.
11248 Three small problems remain with this function due to my zero
11249 knowledge of autoconf. JMarc and lgb see the comments in the code.
11251 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11253 * src/broken_const.h, config/hack-gcc, config/README: removed
11255 * configure.in: remove --with-gcc-hack option; do not call
11258 * INSTALL: remove documentation of --with-broken-const and
11261 * acconfig.h: remove all trace of BROKEN_CONST define
11263 * src/buffer.C (makeDocBookFile): update version number in output
11265 (SimpleDocBookOnePar): fix an assert when trying to a character
11266 access beyond string length
11269 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11271 * po/de.po: fix the Export menu
11273 * lyx.man: update the description of -dbg
11275 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11276 (commandLineHelp): updated
11277 (easyParse): show list of available debug levels if -dbg is passed
11280 * src/Makefile.am: add debug.C
11282 * src/debug.h: moved some code to debug.C
11284 * src/debug.C: new file. Contains code to set and show debug
11287 * src/layout.C: remove 'break' after 'continue' in switch
11288 statements, since these cannot be reached.
11290 1999-12-13 Allan Rae <rae@lyx.org>
11292 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11293 (in_word_set): hash() -> math_hash()
11295 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11297 * acconfig.h: Added a test for whether we are using exceptions in the
11298 current compilation run. If so USING_EXCEPTIONS is defined.
11300 * config.in: Check for existance of stl_string_fwd.h
11301 * src/LString.h: If compiling --with-included-string and SGI's
11302 STL version 3.2 is present (see above test) we need to block their
11303 forward declaration of string and supply a __get_c_string().
11304 However, it turns out this is only necessary if compiling with
11305 exceptions enabled so I've a bit more to add yet.
11307 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11308 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11309 src/support/LRegex.h, src/undo.h:
11310 Shuffle the order of the included files a little to ensure that
11311 LString.h gets included before anything that includes stl_string_fwd.h
11313 * src/support/lyxstring.C: We need to #include LString.h instead of
11314 lyxstring.h to get the necessary definition of __get_c_string.
11315 (__get_c_string): New function. This is defined static just like SGI's
11316 although why they need to do this I'm not sure. Perhaps it should be
11317 in lstrings.C instead.
11319 * lib/templates/IEEEtran.lyx: New template file.
11321 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11323 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11324 * intl/Makefile.in (MKINSTALLDIRS): ditto
11326 * src/LyXAction.C (init): changed to hold the LFUN data in a
11327 automatic array in stead of in callso to newFunc, this speeds up
11328 compilation a lot. Also all the memory used by the array is
11329 returned when the init is completed.
11331 * a lot of files: compiled with -Wold-style-cast, changed most of
11332 the reported offenders to C++ style casts. Did not change the
11333 offenders in C files.
11335 * src/trans.h (Match): change argument type to unsigned int.
11337 * src/support/DebugStream.C: fix some types on the streambufs so
11338 that it works on a conforming implementation.
11340 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11342 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11344 * src/support/lyxstring.C: remove the inline added earlier since
11345 they cause a bunch of unsatisfied symbols when linking with dec
11346 cxx. Cxx likes to have the body of inlines at the place where they
11349 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11350 accessing negative bounds in array. This fixes the crash when
11351 inserting accented characters.
11352 * src/trans.h (Match): ditto
11354 * src/buffer.C (Dispatch): since this is a void, it should not try
11355 to return anything...
11357 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11359 * src/buffer.h: removed the two friends from Buffer. Some changes
11360 because of this. Buffer::getFileName and Buffer::setFileName
11361 renamed to Buffer::fileName() and Buffer::fileName(...).
11363 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11365 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11366 and Buffer::update(short) to BufferView. This move is currently
11367 controlled by a define MOVE_TEXT, this will be removed when all
11368 shows to be ok. This move paves the way for better separation
11369 between buffer contents and buffer view. One side effect is that
11370 the BufferView needs a rebreak when swiching buffers, if we want
11371 to avoid this we can add a cache that holds pointers to LyXText's
11372 that is not currently in use.
11374 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11377 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11379 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11381 * lyx_main.C: new command line option -x (or --execute) and
11382 -e (or --export). Now direct conversion from .lyx to .tex
11383 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11384 Unfortunately, X is still needed and the GUI pops up during the
11387 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11389 * src/Spacing.C: add a using directive to bring stream stuff into
11391 * src/paragraph.C: ditto
11392 * src/buffer.C: ditto
11394 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11395 from Lars' announcement).
11397 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11398 example files from Tino Meinen.
11400 1999-12-06 Allan Rae <rae@lyx.org>
11402 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11404 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11406 * src/support/lyxstring.C: added a lot of inline for no good
11409 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11410 latexWriteEndChanges, they were not used.
11412 * src/layout.h (operator<<): output operator for PageSides
11414 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11416 * some example files: loaded in LyX 1.0.4 and saved again to update
11417 certain constructs (table format)
11419 * a lot of files: did the change to use fstream/iostream for all
11420 writing of files. Done with a close look at Andre Poenitz's patch.
11422 * some files: whitespace changes.
11424 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11426 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11427 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11428 architecture, we provide our own. It is used unconditionnally, but
11429 I do not think this is a performance problem. Thanks to Angus
11430 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11431 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11433 (GetInset): use my_memcpy.
11437 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11438 it is easier to understand, but it uses less TeX-only constructs now.
11440 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11441 elements contain spaces
11443 * lib/configure: regenerated
11445 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11446 elements contain spaces; display the list of programs that are
11449 * autogen.sh: make sure lib/configure is executable
11451 * lib/examples/*: rename the tutorial examples to begin with the
11452 two-letters language code.
11454 * src/lyxfunc.C (getStatus): do not query current font if no
11457 * src/lyx_cb.C (RunScript): use QuoteName
11458 (MenuRunDvips): ditto
11459 (PrintApplyCB): ditto
11461 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11462 around argument, so that it works well with the current shell.
11463 Does not work properly with OS/2 shells currently.
11465 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11466 * src/LyXSendto.C (SendtoApplyCB): ditto
11467 * src/lyxfunc.C (Dispatch): ditto
11468 * src/buffer.C (runLaTeX): ditto
11469 (runLiterate): ditto
11470 (buildProgram): ditto
11472 * src/lyx_cb.C (RunScript): ditto
11473 (MenuMakeLaTeX): ditto
11475 * src/buffer.h (getLatexName): new method
11477 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11479 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11481 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11482 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11483 (create_math_panel): ditto
11485 * src/lyxfunc.C (getStatus): re-activate the code which gets
11486 current font and cursor; add test for export to html.
11488 * src/lyxrc.C (read): remove unreachable break statements; add a
11491 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11493 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11495 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11496 introduced by faulty regex.
11497 * src/buffer.C: ditto
11498 * src/lastfiles.C: ditto
11499 * src/paragraph.C: ditto
11500 * src/table.C: ditto
11501 * src/vspace.C: ditto
11502 * src/insets/figinset.C: ditto
11503 Note: most of these is absolutely harmless, except the one in
11504 src/mathed formula.C.
11506 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11508 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11509 operation, yielding correct results for the reLyX command.
11511 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11513 * src/support/filetools.C (ExpandPath): removed an over eager
11515 (ReplaceEnvironmentPath): ditto
11517 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11518 shows that we are doing something fishy in our code...
11519 (BubblePost): ditto
11522 * src/lyxrc.C (read): use a double switch trick to get more help
11523 from the compiler. (the same trick is used in layout.C)
11524 (write): new function. opens a ofstream and pass that to output
11525 (output): new function, takes a ostream and writes the lyxrc
11526 elemts to it. uses a dummy switch to make sure no elements are
11529 * src/lyxlex.h: added a struct pushpophelper for use in functions
11530 with more than one exit point.
11532 * src/lyxlex.[Ch] (GetInteger): made it const
11536 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11538 * src/layout.[hC] : LayoutTags splitted into several enums, new
11539 methods created, better error handling cleaner use of lyxlex. Read
11542 * src/bmtable.[Ch]: change some member prototypes because of the
11543 image const changes.
11545 * commandtags.h, src/LyXAction.C (init): new function:
11546 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11547 This file is not read automatically but you can add \input
11548 preferences to your lyxrc if you want to. We need to discuss how
11551 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11552 in .aux, also remove .bib and .bst files from dependencies when
11555 * src/BufferView.C, src/LyXView.C: add const_cast several places
11556 because of changes to images.
11558 * lib/images/*: same change as for images/*
11560 * lib/lyxrc.example: Default for accept_compound is false not no.
11562 * images/*: changed to be const, however I have som misgivings
11563 about this change so it might be changed back.
11565 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11567 * lib/configure, po/POTFILES.in: regenerated
11569 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11571 * config/lib_configure.m4: removed
11573 * lib/configure.m4: new file (was config/lib_configure.m4)
11575 * configure.in: do not test for rtti, since we do not use it.
11577 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11579 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11580 doubling of allocated space scheme. This makes it faster for large
11581 strings end to use less memory for small strings. xtra rememoved.
11583 * src/insets/figinset.C (waitalarm): commented out.
11584 (GhostscriptMsg): use static_cast
11585 (GhostscriptMsg): use new instead of malloc to allocate memory for
11586 cmap. also delete the memory after use.
11588 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11590 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11591 for changes in bibtex database or style.
11592 (runBibTeX): remove all .bib and .bst files from dep before we
11594 (run): use scanAuc in when dep file already exist.
11596 * src/DepTable.C (remove_files_with_extension): new method
11597 (exist): new method
11599 * src/DepTable.[Ch]: made many of the methods const.
11601 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11603 * src/bufferparams.C: make sure that the default textclass is
11604 "article". It used to be the first one by description order, but
11605 now the first one is "docbook".
11607 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11608 string; call Debug::value.
11609 (easyParse): pass complete argument to setDebuggingLevel().
11611 * src/debug.h (value): fix the code that parses debug levels.
11613 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11616 * src/LyXAction.C: use Debug::ACTION as debug channel.
11618 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11620 * NEWS: updated for the future 1.1.3 release.
11622 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11623 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11624 it should. This is of course a controversial change (since many
11625 people will find that their lyx workscreen is suddenly full of
11626 red), but done for the sake of correctness.
11628 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11629 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11631 * src/insets/inseterror.h, src/insets/inseturl.h,
11632 src/insets/insetinfo.h, src/insets/figinset.h,
11633 src/mathed/formulamacro.h, src/mathed/math_macro.h
11634 (EditMessage): add a missing const and add _() to make sure that
11635 translation happens
11637 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11638 src/insets/insetbib.C, src/support/filetools.C: add `using'
11639 directives for cxx.
11641 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11642 doing 'Insert index of last word' at the beginning of a paragraph.
11644 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11646 * several files: white-space changes.
11648 * src/mathed/formula.C: removed IsAlpha and IsDigit
11650 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11651 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11654 * src/insets/figinset.C (GetPSSizes): don't break when
11655 "EndComments" is seen. But break when a boundingbox is read.
11657 * all classes inherited from Inset: return value of Clone
11658 changed back to Inset *.
11660 * all classes inherited form MathInset: return value of Clone
11661 changed back to MathedInset *.
11663 * src/insets/figinset.C (runqueue): use a ofstream to output the
11664 gs/ps file. Might need some setpresicion or setw. However I can
11665 see no problem with the current code.
11666 (runqueue): use sleep instead of the alarm/signal code. I just
11667 can't see the difference.
11669 * src/paragraph.C (LyXParagraph): reserve space in the new
11670 paragraph and resize the inserted paragraph to just fit.
11672 * src/lyxfunc.h (operator|=): added operator for func_status.
11674 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11675 check for readable file.
11677 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11678 check for readable file.
11679 (MenuMakeLinuxDoc): ditto
11680 (MenuMakeDocBook): ditto
11681 (MenuMakeAscii): ditto
11682 (InsertAsciiFile): split the test for openable and readable
11684 * src/bmtable.C (draw_bitmaptable): use
11685 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11687 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11688 findtexfile from LaTeX to filetools.
11690 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11691 instead of FilePtr. Needs to be verified by a literate user.
11693 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11695 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11696 (EditMessage): likewise.
11698 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11699 respectively as \textasciitilde and \textasciicircum.
11701 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11703 * src/support/lyxstring.h: made the methods that take iterators
11704 use const_iterator.
11706 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11707 (regexMatch): made is use the real regex class.
11709 * src/support/Makefile.am: changed to use libtool
11711 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11713 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11715 (MathIsInset ++): changed several macros to be inline functions
11718 * src/mathed/Makefile.am: changed to use libtool
11720 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11722 * src/insets/inset* : Clone changed to const and return type is
11723 the true insettype not just Inset*.
11725 * src/insets/Makefile.am: changed to use libtool
11727 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11729 * src/undo.[Ch] : added empty() and changed some of the method
11732 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11734 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11735 setID use block<> for the bullets array, added const several places.
11737 * src/lyxfunc.C (getStatus): new function
11739 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11740 LyXAction, added const to several funtions.
11742 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11743 a std::map, and to store the dir items in a vector.
11745 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11748 * src/LyXView.[Ch] + other files : changed currentView to view.
11750 * src/LyXAction.[Ch] : ported from the old devel branch.
11752 * src/.cvsignore: added .libs and a.out
11754 * configure.in : changes to use libtool.
11756 * acinclude.m4 : inserted libtool.m4
11758 * .cvsignore: added libtool
11760 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11762 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11763 file name in insets and mathed directories (otherwise the
11764 dependency is not taken in account under cygwin).
11766 * src/text2.C (InsertString[AB]): make sure that we do not try to
11767 read characters past the string length.
11769 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11771 * lib/doc/LaTeXConfig.lyx.in,
11772 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11774 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11775 file saying who created them and when this heppened; this is
11776 useless and annoys tools like cvs.
11778 * lib/layouts/g-brief-{en,de}.layout,
11779 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11780 from Thomas Hartkens <thomas@hartkens.de>.
11782 * src/{insets,mathed}/Makefile.am: do not declare an empty
11783 LDFLAGS, so that it can be set at configure time (useful on Irix
11786 * lib/reLyX/configure.in: make sure that the prefix is set
11787 correctly in LYX_DIR.
11789 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11791 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11792 be used by 'command-sequence' this allows to bind a key to a
11793 sequence of LyX-commands
11794 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11796 * src/LyXAction.C: add "command-sequence"
11798 * src/LyXFunction.C: handling of "command-sequence"
11800 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11801 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11803 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11805 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11807 * src/buffer.C (writeFile): Do not output a comment giving user
11808 and date at the beginning of a .lyx file. This is useless and
11809 annoys cvs anyway; update version number to 1.1.
11811 * src/Makefile.am (LYX_DIR): add this definition, so that a
11812 default path is hardcoded in LyX.
11814 * configure.in: Use LYX_GNU_GETTEXT.
11816 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11817 AM_GNU_GETTEXT with a bug fixed.
11819 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11821 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11823 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11824 which is used to point to LyX data is now LYX_DIR_11x.
11826 * lyx.man: convert to a unix text file; small updates.
11828 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11830 * src/support/LSubstring.[Ch]: made the second arg of most of the
11831 constructors be a const reference.
11833 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11836 * src/support/lyxstring.[Ch] (swap): added missing member function
11837 and specialization of swap(str, str);
11839 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11841 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11842 trace of the old one.
11844 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11845 put the member definitions in undo.C.
11847 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11848 NEW_TEXT and have now only code that was included when this was
11851 * src/intl.C (LCombo): use static_cast
11853 (DispatchCallback): ditto
11855 * src/definitions.h: removed whole file
11857 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11859 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11860 parsing and stores in a std:map. a regex defines the file format.
11861 removed unneeded members.
11863 * src/bufferparams.h: added several enums from definitions.h here.
11864 Removed unsused destructor. Changed some types to use proper enum
11865 types. use block to have the temp_bullets and user_defined_bullets
11866 and to make the whole class assignable.
11868 * src/bufferparams.C (Copy): removed this functions, use a default
11869 assignment instead.
11871 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11874 * src/buffer.C (readLyXformat2): commend out all that have with
11875 oldpapersize to do. also comment out all that hve to do with
11876 insetlatex and insetlatexdel.
11877 (setOldPaperStuff): commented out
11879 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11881 * src/LyXAction.C: remove use of inset-latex-insert
11883 * src/mathed/math_panel.C (button_cb): use static_cast
11885 * src/insets/Makefile.am (insets_o_SOURCES): removed
11888 * src/support/lyxstring.C (helper): use the unsigned long
11889 specifier, UL, instead of a static_cast.
11891 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11893 * src/support/block.h: new file. to be used as a c-style array in
11894 classes, so that the class can be assignable.
11896 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11898 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11899 NULL, make sure to return an empty string (it is not possible to
11900 set a string to NULL).
11902 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11904 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11906 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11908 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11909 link line, so that Irix users (for example) can set it explicitely to
11912 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11913 it can be overidden at make time (static or dynamic link, for
11916 * src/vc-backend.C, src/LaTeXFeatures.h,
11917 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11918 statements to bring templates to global namespace.
11920 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11922 * src/support/lyxstring.C (operator[] const): make it standard
11925 * src/minibuffer.C (Init): changed to reflect that more
11926 information is given from the lyxvc and need not be provided here.
11928 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11930 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11932 * src/LyXView.C (UpdateTimerCB): use static_cast
11933 (KeyPressMask_raw_callback): ditto
11935 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11936 buffer_, a lot of changes because of this. currentBuffer() ->
11937 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11938 also changes to other files because of this.
11940 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11942 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11943 have no support for RCS and partial support for CVS, will be
11946 * src/insets/ several files: changes because of function name
11947 changes in Bufferview and LyXView.
11949 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11951 * src/support/LSubstring.[Ch]: new files. These implement a
11952 Substring that can be very convenient to use. i.e. is this
11954 string a = "Mary had a little sheep";
11955 Substring(a, "sheep") = "lamb";
11956 a is now "Mary has a little lamb".
11958 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11959 out patterns and subpatterns of strings. It is used by LSubstring
11960 and also by vc-backend.C
11962 * src/support/lyxstring.C: went over all the assertions used and
11963 tried to correct the wrong ones and flag which of them is required
11964 by the standard. some bugs found because of this. Also removed a
11965 couple of assertions.
11967 * src/support/Makefile.am (libsupport_a_SOURCES): added
11968 LSubstring.[Ch] and LRegex.[Ch]
11970 * src/support/FileInfo.h: have struct stat buf as an object and
11971 not a pointer to one, some changes because of this.
11973 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11974 information in layout when adding the layouts preamble to the
11975 textclass preamble.
11977 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11980 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11981 because of bug in OS/2.
11983 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11985 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11986 \verbatim@font instead of \ttfamily, so that it can be redefined.
11988 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11989 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11990 src/layout.h, src/text2.C: add 'using' directive to bring the
11991 STL templates we need from the std:: namespace to the global one.
11992 Needed by DEC cxx in strict ansi mode.
11994 * src/support/LIstream.h,src/support/LOstream.h,
11995 src/support/lyxstring.h,src/table.h,
11996 src/lyxlookup.h: do not include <config.h> in header
11997 files. This should be done in the .C files only.
11999 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12003 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12005 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12006 from Kayvan to fix the tth invokation.
12008 * development/lyx.spec.in: updates from Kayvan to reflect the
12009 changes of file names.
12011 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12013 * src/text2.C (InsertStringB): use std::copy
12014 (InsertStringA): use std::copy
12016 * src/bufferlist.C: use a vector to store the buffers in. This is
12017 an internal change and should not affect any other thing.
12019 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12022 * src/text.C (Fill): fix potential bug, one off bug.
12024 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12026 * src/Makefile.am (lyx_main.o): add more files it depends on.
12028 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12030 * src/support/lyxstring.C: use size_t for the reference count,
12031 size, reserved memory and xtra.
12032 (internal_compare): new private member function. Now the compare
12033 functions should work for std::strings that have embedded '\0'
12035 (compare): all compare functions rewritten to use
12038 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12040 * src/support/lyxstring.C (compare): pass c_str()
12041 (compare): pass c_str
12042 (compare): pass c_str
12044 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12046 * src/support/DebugStream.C: <config.h> was not included correctly.
12048 * lib/configure: forgot to re-generate it :( I'll make this file
12049 auto generated soon.
12051 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12053 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12056 * src/support/lyxstring.C: some changes from length() to rep->sz.
12057 avoids a function call.
12059 * src/support/filetools.C (SpaceLess): yet another version of the
12060 algorithm...now per Jean-Marc's suggestions.
12062 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12064 * src/layout.C (less_textclass_desc): functor for use in sorting
12066 (LyXTextClass::Read): sort the textclasses after reading.
12068 * src/support/filetools.C (SpaceLess): new version of the
12069 SpaceLess functions. What problems does this one give? Please
12072 * images/banner_bw.xbm: made the arrays unsigned char *
12074 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12076 * src/support/lyxstring.C (find): remove bogus assertion in the
12077 two versions of find where this has not been done yet.
12079 * src/support/lyxlib.h: add missing int return type to
12082 * src/menus.C (ShowFileMenu): disable exporting to html if no
12083 html export command is present.
12085 * config/lib_configure.m4: add a test for an HTML converter. The
12086 programs checked for are, in this order: tth, latex2html and
12089 * lib/configure: generated from config/lib_configure.m4.
12091 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12092 html converter. The parameters are now passed through $$FName and
12093 $$OutName, instead of standard input/output.
12095 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12097 * lib/lyxrc.example: update description of \html_command.
12098 add "quotes" around \screen_font_xxx font setting examples to help
12099 people who use fonts with spaces in their names.
12101 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12103 * Distribution files: updates for v1.1.2
12105 * src/support/lyxstring.C (find): remove bogus assert and return
12106 npos for the same condition.
12108 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12110 * added patch for OS/2 from SMiyata.
12112 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12114 * src/text2.C (CutSelection): make space_wrapped a bool
12115 (CutSelection): dont declare int i until we have to.
12116 (alphaCounter): return a char const *.
12118 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12120 * src/support/syscall.C (Systemcalls::kill):
12121 src/support/filetools.C (PutEnv, PutEnvPath):
12122 src/lyx_cb.C (addNewlineAndDepth):
12123 src/FontInfo.C (FontInfo::resize): condition some #warning
12124 directives with WITH_WARNINGS.
12127 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12129 * src/layout.[Ch] + several files: access to class variables
12130 limited and made accessor functions instead a lot of code changed
12131 becuase of this. Also instead of returning pointers often a const
12132 reference is returned instead.
12134 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12136 * src/Makefile.am (dist-hook): added used to remove the CVS from
12137 cheaders upon creating a dist
12138 (EXTRA_DIST): added cheaders
12140 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12141 a character not as a small integer.
12143 * src/support/lyxstring.C (find): removed Assert and added i >=
12144 rep->sz to the first if.
12146 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12148 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12149 src/LyXView.C src/buffer.C src/bufferparams.C
12150 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12151 src/text2.C src/insets/insetinclude.C:
12152 lyxlayout renamed to textclasslist.
12154 * src/layout.C: some lyxerr changes.
12156 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12157 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12158 (LyXLayoutList): removed all traces of this class.
12159 (LyXTextClass::Read): rewrote LT_STYLE
12160 (LyXTextClass::hasLayout): new function
12161 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12162 both const and nonconst version.
12163 (LyXTextClass::delete_layout): new function.
12164 (LyXTextClassList::Style): bug fix. do the right thing if layout
12166 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12167 (LyXTextClassList::NameOfLayout): ditto
12168 (LyXTextClassList::Load): ditto
12170 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12172 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12174 * src/LyXAction.C (LookupFunc): added a workaround for sun
12175 compiler, on the other hand...we don't know if the current code
12176 compiles on sun at all...
12178 * src/support/filetools.C (CleanupPath): subst fix
12180 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12183 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12184 complained about this one?
12186 * src/insets/insetinclude.C (Latex): subst fix
12188 * src/insets/insetbib.C (getKeys): subst fix
12190 * src/LyXSendto.C (SendtoApplyCB): subst fix
12192 * src/lyx_main.C (init): subst fix
12194 * src/layout.C (Read): subst fix
12196 * src/lyx_sendfax_main.C (button_send): subst fix
12198 * src/buffer.C (RoffAsciiTable): subst fix
12200 * src/lyx_cb.C (MenuFax): subst fix
12201 (PrintApplyCB): subst fix
12203 1999-10-26 Juergen Vigna <jug@sad.it>
12205 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12207 (Read): Cleaned up this code so now we read only format vestion >= 5
12209 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12211 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12212 come nobody has complained about this one?
12214 * src/insets/insetinclude.C (Latex): subst fix
12216 * src/insets/insetbib.C (getKeys): subst fix
12218 * src/lyx_main.C (init): subst fix
12220 * src/layout.C (Read): subst fix
12222 * src/buffer.C (RoffAsciiTable): subst fix
12224 * src/lyx_cb.C (MenuFax): subst fix.
12226 * src/layout.[hC] + some other files: rewrote to use
12227 std::container to store textclasses and layouts in.
12228 Simplified, removed a lot of code. Make all classes
12229 assignable. Further simplifications and review of type
12230 use still to be one.
12232 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12233 lastfiles to create the lastfiles partr of the menu.
12235 * src/lastfiles.[Ch]: rewritten to use deque to store the
12236 lastfiles in. Uses fstream for reading and writing. Simplifies
12239 * src/support/syscall.C: remove explicit cast.
12241 * src/BufferView.C (CursorToggleCB): removed code snippets that
12242 were commented out.
12243 use explicat C++ style casts instead of C style casts. also use
12244 u_vdata instea of passing pointers in longs.
12246 * src/PaperLayout.C: removed code snippets that were commented out.
12248 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12250 * src/lyx_main.C: removed code snippets that wer commented out.
12252 * src/paragraph.C: removed code snippets that were commented out.
12254 * src/lyxvc.C (logClose): use static_cast
12256 (viewLog): remove explicit cast to void*
12257 (showLog): removed old commented code
12259 * src/menus.C: use static_cast instead of C style casts. use
12260 u_vdata instead of u_ldata. remove explicit cast to (long) for
12261 pointers. Removed old code that was commented out.
12263 * src/insets/inset.C: removed old commented func
12265 * src/insets/insetref.C (InsetRef): removed old code that had been
12266 commented out for a long time.
12268 (escape): removed C style cast
12270 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12272 * src/insets/insetlatex.C (Draw): removed old commented code
12273 (Read): rewritten to use string
12275 * src/insets/insetlabel.C (escape): removed C style cast
12277 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12279 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12280 old commented code.
12282 * src/insets/insetinclude.h: removed a couple of stupid bools
12284 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12285 (Clone): remove C style cast
12286 (getKeys): changed list to lst because of std::list
12288 * src/insets/inseterror.C (Draw): removed som old commented code.
12290 * src/insets/insetcommand.C (Draw): removed some old commented code.
12292 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12293 commented out forever.
12294 (bibitem_cb): use static_cast instead of C style cast
12295 use of vdata changed to u_vdata.
12297 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12299 (CloseUrlCB): use static_cast instead of C style cast.
12300 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12302 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12303 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12304 (CloseInfoCB): static_cast from ob->u_vdata instead.
12305 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12308 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12309 (C_InsetError_CloseErrorCB): forward the ob parameter
12310 (CloseErrorCB): static_cast from ob->u_vdata instead.
12312 * src/vspace.h: include LString.h since we use string in this class.
12314 * src/vspace.C (lyx_advance): changed name from advance because of
12315 nameclash with stl. And since we cannot use namespaces yet...I
12316 used a lyx_ prefix instead. Expect this to change when we begin
12319 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12321 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12322 and removed now defunct constructor and deconstructor.
12324 * src/BufferView.h: have backstack as a object not as a pointer.
12325 removed initialization from constructor. added include for BackStack
12327 * development/lyx.spec.in (%build): add CFLAGS also.
12329 * src/screen.C (drawFrame): removed another warning.
12331 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12333 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12334 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12335 README and ANNOUNCE a bit for the next release. More work is
12338 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12339 unbreakable if we are in freespacing mode (LyX-Code), but not in
12342 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12344 * src/BackStack.h: fixed initialization order in constructor
12346 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12348 * acinclude.m4 (VERSION): new rules for when a version is
12349 development, added also a variable for prerelease.
12350 (warnings): we set with_warnings=yes for prereleases
12351 (lyx_opt): prereleases compile with same optimization as development
12352 (CXXFLAGS): only use pedantic if we are a development version
12354 * src/BufferView.C (restorePosition): don't do anything if the
12355 backstack is empty.
12357 * src/BackStack.h: added member empty, use this to test if there
12358 is anything to pop...
12360 1999-10-25 Juergen Vigna <jug@sad.it>
12363 * forms/layout_forms.fd +
12364 * forms/latexoptions.fd +
12365 * lyx.fd: changed for various form resize issues
12367 * src/mathed/math_panel.C +
12368 * src/insets/inseterror.C +
12369 * src/insets/insetinfo.C +
12370 * src/insets/inseturl.C +
12371 * src/insets/inseturl.h +
12373 * src/LyXSendto.C +
12374 * src/PaperLayout.C +
12375 * src/ParagraphExtra.C +
12376 * src/TableLayout.C +
12378 * src/layout_forms.C +
12385 * src/menus.C: fixed various resize issues. So now forms can be
12386 resized savely or not be resized at all.
12388 * forms/form_url.fd +
12389 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12392 * src/insets/Makefile.am: added files form_url.[Ch]
12394 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12396 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12397 (and presumably 6.2).
12399 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12400 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12401 remaining static member callbacks.
12403 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12406 * src/support/lyxstring.h: declare struct Srep as friend of
12407 lyxstring, since DEC cxx complains otherwise.
12409 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12411 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12413 * src/LaTeX.C (run): made run_bibtex also depend on files with
12415 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12416 are put into the dependency file.
12418 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12419 the code has shown itself to work
12420 (create_ispell_pipe): removed another warning, added a comment
12423 * src/minibuffer.C (ExecutingCB): removed code that has been
12424 commented out a long time
12426 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12427 out code + a warning.
12429 * src/support/lyxstring.h: comment out the three private
12430 operators, when compiling with string ansi conforming compilers
12431 they make problems.
12433 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12435 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12436 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12439 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12442 * src/mathed/math_panel.C (create_math_panel): remove explicit
12445 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12448 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12449 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12450 to XCreatePixmapFromBitmapData
12451 (fl_set_bmtable_data): change the last argument to be unsigned
12453 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12454 and bh to be unsigned int, remove explicit casts in call to
12455 XReadBitmapFileData.
12457 * images/arrows.xbm: made the arrays unsigned char *
12458 * images/varsz.xbm: ditto
12459 * images/misc.xbm: ditto
12460 * images/greek.xbm: ditto
12461 * images/dots.xbm: ditto
12462 * images/brel.xbm: ditto
12463 * images/bop.xbm: ditto
12465 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12467 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12468 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12469 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12471 (LYX_CXX_CHEADERS): added <clocale> to the test.
12473 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12475 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12477 * src/support/lyxstring.C (append): fixed something that must be a
12478 bug, rep->assign was used instead of rep->append.
12480 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12483 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12484 lyx insert double chars. Fix spotted by Kayvan.
12486 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12488 * Fixed the tth support. I messed up with the Emacs patch apply feature
12489 and omitted the changes in lyxrc.C.
12491 1999-10-22 Juergen Vigna <jug@sad.it>
12493 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12495 * src/lyx_cb.C (MenuInsertRef) +
12496 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12497 the form cannot be resized under it limits (fixes a segfault)
12499 * src/lyx.C (create_form_form_ref) +
12500 * forms/lyx.fd: Changed Gravity on name input field so that it is
12503 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12505 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12506 <ostream> and <istream>.
12508 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12509 whether <fstream> provides the latest standard features, or if we
12510 have an oldstyle library (like in egcs).
12511 (LYX_CXX_STL_STRING): fix the test.
12513 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12514 code on MODERN_STL_STREAM.
12516 * src/support/lyxstring.h: use L{I,O}stream.h.
12518 * src/support/L{I,O}stream.h: new files, designed to setup
12519 correctly streams for our use
12520 - includes the right header depending on STL capabilities
12521 - puts std::ostream and std::endl (for LOStream.h) or
12522 std::istream (LIStream.h) in toplevel namespace.
12524 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12526 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12527 was a bib file that had been changed we ensure that bibtex is run.
12528 (runBibTeX): enhanced to extract the names of the bib files and
12529 getting their absolute path and enter them into the dep file.
12530 (findtexfile): static func that is used to look for tex-files,
12531 checks for absolute patchs and tries also with kpsewhich.
12532 Alternative ways of finding the correct files are wanted. Will
12534 (do_popen): function that runs a command using popen and returns
12535 the whole output of that command in a string. Should be moved to
12538 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12539 file with extension ext has changed.
12541 * src/insets/figinset.C: added ifdef guards around the fl_free
12542 code that jug commented out. Now it is commented out when
12543 compiling with XForms == 0.89.
12545 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12546 to lyxstring.C, and only keep a forward declaration in
12547 lyxstring.h. Simplifies the header file a bit and should help a
12548 bit on compile time too. Also changes to Srep will not mandate a
12549 recompile of code just using string.
12550 (~lyxstring): definition moved here since it uses srep.
12551 (size): definition moved here since it uses srep.
12553 * src/support/lyxstring.h: removed a couple of "inline" that should
12556 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12558 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12561 1999-10-21 Juergen Vigna <jug@sad.it>
12563 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12564 set to left if I just remove the width entry (or it is empty).
12566 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12567 paragraph when having dummy paragraphs.
12569 1999-10-20 Juergen Vigna <jug@sad.it>
12571 * src/insets/figinset.C: just commented some fl_free_form calls
12572 and added warnings so that this calls should be activated later
12573 again. This avoids for now a segfault, but we have a memory leak!
12575 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12576 'const char * argument' to 'string argument', this should
12577 fix some Asserts() in lyxstring.C.
12579 * src/lyxfunc.h: Removed the function argAsString(const char *)
12580 as it is not used anymore.
12582 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12584 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12587 * src/Literate.h: some funcs moved from public to private to make
12588 interface clearer. Unneeded args removed.
12590 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12592 (scanBuildLogFile): ditto
12594 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12595 normal TeX Error. Still room for improvement.
12597 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12599 * src/buffer.C (insertErrors): changes to make the error
12600 desctription show properly.
12602 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12605 * src/support/lyxstring.C (helper): changed to use
12606 sizeof(object->rep->ref).
12607 (operator>>): changed to use a pointer instead.
12609 * src/support/lyxstring.h: changed const reference & to value_type
12610 const & lets see if that helps.
12612 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12614 * Makefile.am (rpmdist): fixed to have non static package and
12617 * src/support/lyxstring.C: removed the compilation guards
12619 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12622 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12623 conditional compile of lyxstring.Ch
12625 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12626 stupid check, but it is a lot better than the bastring hack.
12627 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12629 * several files: changed string::erase into string::clear. Not
12632 * src/chset.C (encodeString): use a char temporary instead
12634 * src/table.C (TexEndOfCell): added tostr around
12635 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12636 (TexEndOfCell): ditto
12637 (TexEndOfCell): ditto
12638 (TexEndOfCell): ditto
12639 (DocBookEndOfCell): ditto
12640 (DocBookEndOfCell): ditto
12641 (DocBookEndOfCell): ditto
12642 (DocBookEndOfCell): ditto
12644 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12646 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12648 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12649 (MenuBuildProg): added tostr around ret
12650 (MenuRunChktex): added tostr around ret
12651 (DocumentApplyCB): added tostr around ret
12653 * src/chset.C (encodeString): added tostr around t->ic
12655 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12656 (makeLaTeXFile): added tostr around tocdepth
12657 (makeLaTeXFile): added tostr around ftcound - 1
12659 * src/insets/insetbib.C (setCounter): added tostr around counter.
12661 * src/support/lyxstring.h: added an operator+=(int) to catch more
12664 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12665 (lyxstring): We DON'T allow NULL pointers.
12667 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12669 * src/mathed/math_macro.C (MathMacroArgument::Write,
12670 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12671 when writing them out.
12673 * src/LString.C: remove, since it is not used anymore.
12675 * src/support/lyxstring.C: condition the content to
12676 USE_INCLUDED_STRING macro.
12678 * src/mathed/math_symbols.C, src/support/lstrings.C,
12679 src/support/lyxstring.C: add `using' directive to specify what
12680 we need in <algorithm>. I do not think that we need to
12681 conditionalize this, but any thought is appreciated.
12683 * many files: change all callback functions to "C" linkage
12684 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12685 strict_ansi. Those who were static are now global.
12686 The case of callbacks which are static class members is
12687 trickier, since we have to make C wrappers around them (see
12688 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12689 did not finish this yet, since it defeats the purpose of
12690 encapsulation, and I am not sure what the best route is.
12692 1999-10-19 Juergen Vigna <jug@sad.it>
12694 * src/support/lyxstring.C (lyxstring): we permit to have a null
12695 pointer as assignment value and just don't assign it.
12697 * src/vspace.C (nextToken): corrected this function substituting
12698 find_first(_not)_of with find_last_of.
12700 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12701 (TableOptCloseCB) (TableSpeCloseCB):
12702 inserted fl_set_focus call for problem with fl_hide_form() in
12705 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12707 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12710 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12712 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12713 LyXLex::next() and not eatline() to get its argument.
12715 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12717 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12718 instead, use fstreams for io of the depfile, removed unneeded
12719 functions and variables.
12721 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12722 vector instead, removed all functions and variables that is not in
12725 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12727 * src/buffer.C (insertErrors): use new interface to TeXError
12729 * Makefile.am (rpmdist): added a rpmdist target
12731 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12732 per Kayvan's instructions.
12734 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12736 * src/Makefile.am: add a definition for localedir, so that locales
12737 are found after installation (Kayvan)
12739 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12741 * development/.cvsignore: new file.
12743 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12745 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12746 C++ compiler provides wrappers for C headers and use our alternate
12749 * configure.in: use LYX_CXX_CHEADERS.
12751 * src/cheader/: new directory, populated with cname headers from
12752 libstdc++-2.8.1. They are a bit old, but probably good enough for
12753 what we want (support compilers who lack them).
12755 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12756 from includes. It turns out is was stupid.
12758 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12760 * lib/Makefile.am (install-data-local): forgot a ';'
12761 (install-data-local): forgot a '\'
12762 (libinstalldirs): needed after all. reintroduced.
12764 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12766 * configure.in (AC_OUTPUT): added lyx.spec
12768 * development/lyx.spec: removed file
12770 * development/lyx.spec.in: new file
12772 * po/*.po: merged with lyx.pot becuase of make distcheck
12774 * lib/Makefile.am (dist-hook): added dist-hook so that
12775 documentation files will be included when doing a make
12776 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12777 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12779 more: tried to make install do the right thing, exclude CVS dirs
12782 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12783 Path would fit in more nicely.
12785 * all files that used to use pathstack: uses now Path instead.
12786 This change was a lot easier than expected.
12788 * src/support/path.h: new file
12790 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12792 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12794 * src/support/lyxstring.C (getline): Default arg was given for
12797 * Configure.cmd: removed file
12799 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12801 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12802 streams classes and types, add the proper 'using' statements when
12803 MODERN_STL is defined.
12805 * src/debug.h: move the << operator definition after the inclusion
12808 * src/support/filetools.C: include "LAssert.h", which is needed
12811 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12814 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12815 include "debug.h" to define a proper ostream.
12817 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12819 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12820 method to the SystemCall class which can kill a process, but it's
12821 not fully implemented yet.
12823 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12825 * src/support/FileInfo.h: Better documentation
12827 * src/lyxfunc.C: Added support for buffer-export html
12829 * src/menus.C: Added Export->As HTML...
12831 * lib/bind/*.bind: Added short-cut for buffer-export html
12833 * src/lyxrc.*: Added support for new \tth_command
12835 * lib/lyxrc.example: Added stuff for new \tth_command
12837 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12839 * lib/Makefile.am (IMAGES): removed images/README
12840 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12841 installes in correct place. Check permisions is installed
12844 * src/LaTeX.C: some no-op changes moved declaration of some
12847 * src/LaTeX.h (LATEX_H): changed include guard name
12849 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12851 * lib/reLyX/Makefile.am: install noweb2lyx.
12853 * lib/Makefile.am: install configure.
12855 * lib/reLyX/configure.in: declare a config aux dir; set package
12856 name to lyx (not sure what the best solution is); generate noweb2lyx.
12858 * lib/layouts/egs.layout: fix the bibliography layout.
12860 1999-10-08 Jürgen Vigna <jug@sad.it>
12862 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12863 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12864 it returned without continuing to search the path.
12866 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12868 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12869 also fixes a bug. It is not allowed to do tricks with std::strings
12870 like: string a("hei"); &a[e]; this will not give what you
12871 think... Any reason for the complexity in this func?
12873 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12875 * Updated README and INSTALL a bit, mostly to check that my
12876 CVS rights are correctly set up.
12878 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12880 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12881 does not allow '\0' chars but lyxstring and std::string does.
12883 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12885 * autogen.sh (AUTOCONF): let the autogen script create the
12886 POTFILES.in file too. POTFILES.in should perhaps now not be
12887 included in the cvs module.
12889 * some more files changed to use C++ includes instead of C ones.
12891 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12893 (Reread): added tostr to nlink. buggy output otherwise.
12894 (Reread): added a string() around szMode when assigning to Buffer,
12895 without this I got a log of garbled info strings.
12897 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12900 * I have added several ostream & operator<<(ostream &, some_type)
12901 functions. This has been done to avoid casting and warnings when
12902 outputting enums to lyxerr. This as thus eliminated a lot of
12903 explicit casts and has made the code clearer. Among the enums
12904 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12905 mathed enums, some font enum the Debug::type enum.
12907 * src/support/lyxstring.h (clear): missing method. equivalent of
12910 * all files that contained "stderr": rewrote constructs that used
12911 stderr to use lyxerr instead. (except bmtable)
12913 * src/support/DebugStream.h (level): and the passed t with
12914 Debug::ANY to avoid spurious bits set.
12916 * src/debug.h (Debug::type value): made it accept strings of the
12917 type INFO,INIT,KEY.
12919 * configure.in (Check for programs): Added a check for kpsewhich,
12920 the latex generation will use this later to better the dicovery of
12923 * src/BufferView.C (create_view): we don't need to cast this to
12924 (void*) that is done automatically.
12925 (WorkAreaButtonPress): removed some dead code.
12927 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12929 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12930 is not overwritten when translated (David Sua'rez de Lis).
12932 * lib/CREDITS: Added David Sua'rez de Lis
12934 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12936 * src/bufferparams.C (BufferParams): default input encoding is now
12939 * acinclude.m4 (cross_compiling): comment out macro
12940 LYX_GXX_STRENGTH_REDUCE.
12942 * acconfig.h: make sure that const is not defined (to empty) when
12943 we are compiling C++. Remove commented out code using SIZEOF_xx
12946 * configure.in : move the test for const and inline as late as
12947 possible so that these C tests do not interefere with C++ ones.
12948 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12949 has not been proven.
12951 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12953 * src/table.C (getDocBookAlign): remove bad default value for
12954 isColumn parameter.
12956 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12958 (ShowFileMenu2): ditto.
12960 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12961 of files to ignore.
12963 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12965 * Most files: finished the change from the old error code to use
12966 DebugStream for all lyxerr debugging. Only minor changes remain
12967 (e.g. the setting of debug levels using strings instead of number)
12969 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12971 * src/layout.C (Add): Changed to use compare_no_case instead of
12974 * src/FontInfo.C: changed loop variable type too string::size_type.
12976 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12978 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12979 set ETAGS_ARGS to --c++
12981 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12983 * src/table.C (DocBookEndOfCell): commented out two unused variables
12985 * src/paragraph.C: commented out four unused variables.
12987 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12988 insed a if clause with type string::size_type.
12990 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12993 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12995 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12996 variable, also changed loop to go from 0 to lenght + 1, instead of
12997 -1 to length. This should be correct.
12999 * src/LaTeX.C (scanError): use string::size_type as loop variable
13002 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13003 (l.896) since y_tmp and row was not used anyway.
13005 * src/insets/insetref.C (escape): use string::size_type as loop
13008 * src/insets/insetquotes.C (Width): use string::size_type as loop
13010 (Draw): use string::size_type as loop variable type.
13012 * src/insets/insetlatexaccent.C (checkContents): use
13013 string::size_type as loop variable type.
13015 * src/insets/insetlabel.C (escape): use string::size_type as loop
13018 * src/insets/insetinfo.C: added an extern for current_view.
13020 * src/insets/insetcommand.C (scanCommand): use string::size_type
13021 as loop variable type.
13023 * most files: removed the RCS tags. With them we had to recompile
13024 a lot of files after a simple cvs commit. Also we have never used
13025 them for anything meaningful.
13027 * most files: tags-query-replace NULL 0. As adviced several plases
13028 we now use "0" instead of "NULL" in our code.
13030 * src/support/filetools.C (SpaceLess): use string::size_type as
13031 loop variable type.
13033 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13035 * src/paragraph.C: fixed up some more string stuff.
13037 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13039 * src/support/filetools.h: make modestr a std::string.
13041 * src/filetools.C (GetEnv): made ch really const.
13043 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13044 made code that used these use max/min from <algorithm> instead.
13046 * changed several c library include files to their equivalent c++
13047 library include files. All is not changed yet.
13049 * created a support subdir in src, put lyxstring and lstrings
13050 there + the extra files atexit, fileblock, strerror. Created
13051 Makefile.am. edited configure.in and src/Makefile.am to use this
13052 new subdir. More files moved to support.
13054 * imported som of the functions from repository lyx, filetools
13056 * ran tags-query-replace on LString -> string, corrected the bogus
13057 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13058 is still some errors in there. This is errors where too much or
13059 too litle get deleted from strings (string::erase, string::substr,
13060 string::replace), there can also be some off by one errors, or
13061 just plain wrong use of functions from lstrings. Viewing of quotes
13064 * LyX is now running fairly well with string, but there are
13065 certainly some bugs yet (see above) also string is quite different
13066 from LString among others in that it does not allow null pointers
13067 passed in and will abort if it gets any.
13069 * Added the revtex4 files I forgot when setting up the repository.
13071 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13073 * All over: Tried to clean everything up so that only the files
13074 that we really need are included in the cvs repository.
13075 * Switched to use automake.
13076 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13077 * Install has not been checked.
13079 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13081 * po/pt.po: Three errors:
13082 l.533 and l.538 format specification error
13083 l. 402 duplicate entry, I just deleted it.