1 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
6 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
9 * src/lyxfunc.C (processKeyEvent): removed
11 * src/bufferlist.C (emergencyWrite): removed the out commented
14 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
16 * src/LyXView.[Ch]: remove the outcommented raw_callback code
18 * many files: change formatting to be a bit more uniform for
19 if,while,for,switch statements, remove some parantesis not needed.
22 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
24 * config/kde.m4: make config more robust when KDEDIR is set
26 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
28 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
29 not returned a pixmap for "math-insert".
31 * src/LyXAction.C (init): sort the entries a bit.
33 2000-11-03 Juergen Vigna <jug@sad.it>
35 * src/insets/insettabular.h: added fixed number to update codes so
36 that update is only in one direction.
38 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
41 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
42 before call to edit because of redraw.
44 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
46 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
48 * lib/ui/default.ui: Populate "edit_float" menu
50 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
52 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
53 "floats-operate". The name is ugly (and the func also), but this
54 is just a band-aid until we switch to new insets.
56 2000-11-03 Rob Lahaye <lahaye@postech.edu>
58 * lib/ui/default.ui: update again the menu layout (fix some
61 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
63 * src/MenuBackend.h (fulllabel): new method.
65 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
66 the menu shortcuts of a menu are unique and whether they
67 correspond to a letter of the label.
68 (expand): call checkShortcuts when debugging.
70 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
72 * src/insets/insettext.C (InsetButtonPress): shut off warning.
74 2000-11-02 Lior Silberman <lior@Princeton.EDU>
76 * lib/examples/*.lyx : '\language default' => '\language english'
78 * lib/examples/it_splash.lyx : except where it should be italian
80 * lib/templates/*.lyx : the same
82 * doc/*.lyx* : the same
84 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
86 * lib/bind/menus.bind: remove the Layout menu entries, which I
87 somehow forgot earlier.
89 2000-11-03 Rob Lahaye <lahaye@postech.edu>
91 * lib/ui/old-default.ui: keep the old one here for reference (to
94 * lib/ui/default.ui: update the menu layout
96 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
98 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
99 Can now Apply to different insets without closing the dialog.
101 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
102 Can't actually DO anything with them yet, but I'd like a little
105 * src/frontends/xforms/input_validators.[ch]
106 (fl_lowercase_filter): new.
108 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
110 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
111 of MATH_CODE. This fixes a bug with math-macros in RTL text.
113 * src/text.C (PrepareToPrint): Show math-macros block aligned.
115 2000-11-02 Juergen Vigna <jug@sad.it>
117 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
118 on char insertion as it has already be updated by bv->updateInset().
120 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
121 if an inset inside was updated.
123 * lib/configure.cmd: commented out fax-search code
125 2000-11-01 Yves Bastide <stid@acm.org>
127 * src/tabular.C (OldFormatRead): set tabular language to the
130 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
132 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
133 class names with non-letter characters (from Yves Bastide).
135 * lib/ui/default.ui: change Item to OptItem in import menu.
136 Comment out fax stuff.
138 * lib/configure.m4: comment out fax-related stuff.
140 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
142 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
143 useful xforms helper functions. At present contains only formatted().
144 Input a string and it returns it with line breaks so that in fits
147 * src/frontends/xforms/Makefile.am: add new files.
149 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
150 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
153 * src/frontends/xforms/FormPreferences.[Ch]:
154 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
155 but lots of little clean ups. Removed enum State. Make use of
156 formatted(). Constify lots of methods. Perhaps best of all: removed
157 requirement for that horrible reinterpret_cast from pointer to long in
160 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
162 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
163 conditionalize build on xforms < 0.89
165 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
167 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
169 * src/LyXAction.C (init): comment out fax
171 * src/lyxrc.h: comment out the fax enums
172 comment out the fax variables
174 * src/commandtags.h: comment out LFUN_FAX
176 * src/lyxrc.C: disable fax variables.
177 (read): disable parsing of fax variables
178 (output): disable writing of fax variables
179 (getFeedback): now description for fax variables
181 * src/lyxfunc.C: comment out MenuFax
182 (Dispatch): disable LFUN_FAX
184 * src/lyx_cb.C (MenuFax): comment out
186 * src/WorkArea.C: add <cctype>
187 (work_area_handler): better key handling, should be ok now.
188 for accented chars + etc
190 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
191 lyx_sendfax.h and lyx_sendfax_man.C
193 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
194 (show): don't call InitLyXLookup when using xforms 0.89
196 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
198 * src/trans.C (AddDeadkey): better fix, the other one could crash...
200 * src/support/filetools.C (GetFileContents): close to dummy change
202 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
204 * src/trans.C (AddDeadkey): workaround stupid compilers.
206 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
208 * src/frontends/xforms/FormDocument.C (class_update): fix setting
209 of two-sided document.
211 2000-10-31 Juergen Vigna <jug@sad.it>
213 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
215 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
216 xposition to the Edit call.
218 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
220 * src/trans.C (AddDeadkey): cast explicitly to char.
222 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
224 * src/tabular.C (AsciiBottomHLine): simplify?
225 (AsciiTopHLine): simplify?
226 (print_n_chars): simplify
227 (DocBook): remove most of the << endl; we should flush the stream
228 as seldom as possible.
230 (TeXBottomHLine): ditto
233 (write_attribute): try a templified version.
234 (set_row_column_number_info): lesson scope of variables
236 * src/support/lstrings.h (tostr): new specialization of tostr
238 * src/trans.C (AddDeadkey): slightly cleaner fix.
240 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
242 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
243 '%%' in Toc menu labels.
246 * src/insets/insetlatexaccent.C (draw): Correct rendering when
247 font_norm is iso10646-1.
249 * src/font.C (ascent): Fixed for 16bit fonts
250 (descent,lbearing,rbearing): ditto
252 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
254 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
255 (getFeedback): new static method.
257 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
258 Now use combox rather than choice to display languages.
259 Feedback is now output using a new timer callback mechanism, identical
260 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
262 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
264 * src/minibuffer.C: fix for older compilers
266 2000-10-30 Juergen Vigna <jug@sad.it>
268 * src/insets/insettext.C (InsertInset): fixed this as the cursor
269 has to be Left of the inset otherwise LyXText won't find it!
271 * src/BufferView2.C (open_new_inset): delete the inset if it can
274 2000-10-30 Rob Lahaye <lahaye@postech.edu>
278 2000-10-29 Marko Vendelin <markov@ioc.ee>
279 * src/frontends/gnome/FormCitation.C
280 * src/frontends/gnome/FormCitation.h
281 * src/frontends/gnome/FormCopyright.C
282 * src/frontends/gnome/FormCopyright.h
283 * src/frontends/gnome/FormError.C
284 * src/frontends/gnome/FormError.h
285 * src/frontends/gnome/FormIndex.C
286 * src/frontends/gnome/FormIndex.h
287 * src/frontends/gnome/FormPrint.C
288 * src/frontends/gnome/FormPrint.h
289 * src/frontends/gnome/FormRef.C
290 * src/frontends/gnome/FormRef.h
291 * src/frontends/gnome/FormToc.C
292 * src/frontends/gnome/FormToc.h
293 * src/frontends/gnome/FormUrl.C
294 * src/frontends/gnome/FormUrl.h
295 * src/frontends/gnome/Menubar_pimpl.C
296 * src/frontends/gnome/mainapp.C
297 * src/frontends/gnome/mainapp.h
298 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
299 changing update() to updateSlot() where appropriate
301 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
303 * src/frontends/xforms/FormPreferences.[Ch]:
304 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
307 2000-10-28 Juergen Vigna <jug@sad.it>
309 * src/insets/insettabular.C (draw): fixed drawing bug.
311 * src/insets/insettext.C (clear):
313 (SetParagraphData): clearing the TEXT buffers when deleting the
314 paragraphs used by it.
316 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
318 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
320 2000-10-27 Juergen Vigna <jug@sad.it>
322 * src/tabular.C (~LyXTabular): removed not needed anymore.
324 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
327 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
329 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
332 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
335 * src/frontends/xforms/FormPreferences.[Ch]:
336 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
337 Reorganised as modules based on tabs. Much easier to follow the
338 flow and to add new tabs. Added warning and feedback messages.
341 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
343 * src/tabular.h (DocBook): add std:: qualifier.
345 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
347 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
348 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
351 * insettabular.C (DocBook): uses the tabular methods to export
354 * src/insets/insettext.h
355 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
357 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
359 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
362 * src/lyxfunc.C (MenuNew): lessen the scope of fname
363 moved misplaced AllowInput two lines up.
365 * src/buffer.C (readFile): compare float with float, not with int
367 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
369 * src/minibuffer.C: add "using SigC::slot" statement.
371 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
373 * src/frontends/xforms/forms/README: updated section about make.
375 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
376 Tidied some forms up, made two of form_tabular's tabs more
377 self-consistent, fixed Jean-Marc's size problem in form_preferences,
378 fixed translation problem with "Column".
380 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
382 * src/minibuffer.h: use Timeout instead of the xforms timer
384 (setTimer) rewrite for the Timeout, change to unsigned arg
385 (set): change to unsigned timer arg
388 * src/minibuffer.C (TimerCB): removed func
389 (C_MiniBuffer_TimerCB): removed func
390 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
391 (peek_event): use a switch statement
392 (add): don't use fl_add_timer.
393 (Set): rewrite to use the Timeout
396 * src/Timeout.[Ch] (setType): return a Timeout &
397 (setTimeout): ditto, change to unsigned arg for timeout
399 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
401 * src/mathed/formula.C (mathed_string_width): Use string instead
402 of a constant size char array.
404 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
406 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
407 the two recently added operator<< for SMInput and State.
409 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
411 (OkCancelPolicy): ditto
412 (OkCancelReadOnlyPolicy): ditto
413 (NoRepeatedApplyReadOnlyPolicy): ditto
414 (OkApplyCancelReadOnlyPolicy): ditto
415 (OkApplyCancelPolicy): ditto
416 (NoRepeatedApplyPolicy): ditto
418 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
420 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
421 add the usual std:: qualifiers.
423 2000-10-25 Juergen Vigna <jug@sad.it>
425 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
427 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * src/support/filetools.C (MakeRelPath): change some types to
432 * src/frontends/ButtonPolicies.h (operator<<): new operator for
433 ButtonPolicy::SMInput and ButtonPolicy::State.
435 * src/FontLoader.C (reset): small cleanup
436 (unload): small cleanup
438 * src/FontInfo.C (getFontname): initialize error to 10000.0
440 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
442 * src/frontends/xforms/FormPreferences.[Ch]:
443 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
444 TeX encoding and default paper size sections.
446 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
448 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
451 * src/frontends/xforms/FormError.C (disconnect): use erase() to
452 make the message_ empty.
453 (FormError): don't initialize message_ in initializer list.
455 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
457 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
459 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
461 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
463 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
465 * src/frontends/kde/*data.[Ch]: _("") is not
468 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
470 * src/buffer.C: removed redundant using directive.
472 * src/frontends/DialogBase.h: revert to original definition of
475 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
476 stuff into two classes, one for each dialog, requires a new
477 element in the dialogs vector, FormTabularCreate.
479 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
482 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
483 method. Continues Allan's idea, but means that derived classes
484 don't need to worry about "update or hide?".
486 * src/frontends/xforms/FormError.C (showInset): add connection
489 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
490 one for each dialog. FormTabular now contains main tabular dialog
493 * src/frontends/xforms/FormTabularCreate.[Ch]:
494 * src/frontends/xforms/forms/form_tabular_create.fd: the create
497 * src/frontends/xforms/FormGraphics.[Ch]:
498 * src/frontends/xforms/forms/form_graphics.fd
499 * src/frontends/xforms/FormTabular.[Ch]:
500 * src/frontends/xforms/forms/form_tabular.fd: made daughter
501 classes of FormInset.
503 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
504 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
506 * src/frontends/xforms/Makefile.am:
507 * src/frontends/xforms/forms/makefile: added new files.
509 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
510 variable. added Signal0 hide signal, in keeping with other GUI-I
513 * src/support/lstrings.h: removed redundant std:: qualifier as
514 it's already declared in Lsstream.h.
516 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
518 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
522 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
524 * src/tabular.C (Ascii): minimize scope of cell.
526 * src/BufferView2.C (nextWord): return string() instead of 0;
528 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
530 * src/converter.h: add a std:: qualifier
532 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
534 * src/importer.[Ch]: New files. Used for importing files into LyX.
536 * src/lyxfunc.C (doImport): Use the new Importer class.
538 * src/converter.h: Add shortcut member to the Format class.
539 Used for holding the menu shortcut.
541 * src/converter.C and other files: Made a distinction between
542 format name and format extension. New formats can be defined using
543 the \format lyxrc tag.
544 Added two new converter flags: latex and disable.
546 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
548 * src/support/lyxlib.h: unify namespace/struct implementation.
549 Remove extra declarations.
551 * src/support/chdir.C (chdir): remove version taking char const *
553 * src/support/rename.C: ditto.
554 * src/support/lyxsum.C: ditto.
556 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
558 * src/frontends/xforms/FormBase.[Ch]:
559 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
560 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
561 work only for the next call to fl_show_form(). The correct place to set
562 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
563 done. FormBase also stores minw_, minh_ itself. All dialogs derived
564 from FormBase have the minimum size set; no more stupid crashes with
567 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
569 * lib/ui/default.ui: fix shortcut for Insert->Include File.
571 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
573 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
575 * src/support/lyxlib.h: changed second argument of mkdir to
576 unsigned long int (unsigned int would probably have been enough,
577 but...). Removed <sys/types.h> header.
578 * src/support/mkdir.C (mkdir): ditto.
582 2000-10-19 Juergen Vigna <jug@sad.it>
584 * src/lyxfunc.C (MenuNew): small fix (form John)
586 * src/screen.C (Update): removed unneeded code.
588 * src/tabular.C (Ascii): refixed int != uint bug!
590 * src/support/lyxlib.h: added sys/types.h include for now permits
591 compiling, but I don't like this!
593 2000-10-18 Juergen Vigna <jug@sad.it>
595 * src/text2.C (ClearSelection): if we clear the selection we need
596 more refresh so set the status apropriately
598 * src/insets/insettext.C (draw): hopefully finally fixed draw
601 2000-10-12 Juergen Vigna <jug@sad.it>
603 * src/insets/insettext.C (draw): another small fix and make a block
604 so that variables are localized.
606 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
608 * src/support/lstrings.C (lowercase, uppercase):
609 use explicit casts to remove compiler warnings.
611 * src/support/LRegex.C (Impl):
612 * src/support/StrPool.C (add):
613 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
614 (AddPath, MakeDisplayPath):
615 * src/support/lstrings.C (prefixIs, subst):
616 use correct type to remove compiler warnings.
618 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
620 * src/support/lyxlib.h:
621 * src/support/mkdir.C (mkdir): change parameter to mode_t for
622 portability and to remove compiler warning with DEC cxx.
624 * src/support/FileInfo.[Ch] (flagRWX): ditto.
626 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
628 * src/minibuffer.C (peek_event): retun 1 when there has been a
629 mouseclick in the minibuffer.
633 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
635 * src/frontends/xforms/FormParagraph.C: more space above/below
638 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
640 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
641 a char only if real_current_font was changed.
643 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
645 * NEWS: update somewhat for 1.1.6
647 * lib/ui/default.ui: clean up.
649 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
651 * lib/CREDITS: clean up
653 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
655 * src/combox.[Ch] (select): changed argument back to int
656 * src/combox.C (peek_event): removed num_bytes as it is declared but
659 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
660 modified calls to Combox::select() to remove warnings about type
663 * src/insets/insetbutton.C (width): explicit cast to remove warning
664 about type conversion.
666 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
669 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
670 sel_pos_end, refering to cursor position are changed to
671 LyXParagraph::size_type.
673 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
674 consistent with LyXCursor::pos().
675 (inset_pos): changed to LyXParagraph::size_type for same reason.
677 * src/insets/insettext.C (resizeLyXText): changed some temporary
678 variables refing to cursor position to LyXParagraph::size_type.
680 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
682 * src/frontends/kde/<various>: The Great Renaming,
685 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
687 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
689 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
691 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
692 0 when there are no arguments.
694 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
696 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
697 to segfaults when pressing Ok in InsetBibtex dialog.
699 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
701 * forms/layout_forms.fd:
702 * src/layout_forms.C (create_form_form_character): small change to use
703 labelframe rather than engraved frame + text
705 * src/lyx_gui.C (create_forms): initialise choice_language with some
706 arbitrary value to prevent segfault when dialog is shown.
708 2000-10-16 Baruch Even <baruch.even@writeme.com>
710 * src/converter.C (runLaTeX, scanLog): Added a warning when there
711 is no resulting file. This pertains only to LaTeX output.
713 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
715 * src/text.C (Backspace): Make sure that the row of the cursor is
718 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
721 * src/lyx_gui.C (init): Prevent a crash when only one font from
722 menu/popup fonts is not found.
724 * lib/lyxrc.example: Add an example for binding a key for language
727 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
729 * src/converter.C (GetReachable): Changed the returned type to
731 (IsReachable): New method
733 * src/MenuBackend.C (expand): Handle formats that appear more
736 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
738 * src/frontends/support/Makefile.am
739 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
742 * lib/CREDITS: add Garst Reese.
744 * src/support/snprintf.h: add extern "C" {} around the definitions.
746 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
748 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
751 * src/frontends/xforms/FormDocument.C:
752 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
753 compile without "conversion to integral type of smaller size"
756 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
758 * src/text.C (GetColumnNearX): Fixed disabled code.
760 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
762 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
765 * src/support/snprintf.[ch]: new files
767 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
769 * src/frontends/kde/formprintdialog.C: add
770 file browser for selecting postscript output
772 * src/frontends/kde/formprintdialogdata.C:
773 * src/frontends/kde/formprintdialogdata.h: re-generate
776 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
778 * src/frontends/gnome/Makefile.am:
779 * src/frontends/kde/Makefile.am: FormCommand.C
780 disappeared from xforms
782 * src/frontends/kde/FormCitation.C:
783 * src/frontends/kde/FormIndex.C: read-only
786 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
788 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
791 * src/bufferlist.C: add using directive.
793 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
795 * src/support/lyxfunctional.h: version of class_fun for void
796 returns added, const versions of back_inseter_fun and compare_fun
799 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
801 * src/frontends/xforms/FormInset.C (showInset): fix typo.
803 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
805 * ChangeLog: cleanup.
807 * lib/CREDITS: update to add all the contributors we've forgotten.
808 I have obviously missed some, so tell me whether there were
811 2000-10-13 Marko Vendelin <markov@ioc.ee>
813 * src/frontends/gnome/FormCitation.C
814 * src/frontends/gnome/FormCitation.h
815 * src/frontends/gnome/FormError.C
816 * src/frontends/gnome/FormIndex.C
817 * src/frontends/gnome/FormRef.C
818 * src/frontends/gnome/FormRef.h
819 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
821 * src/frontends/gnome/FormCitation.C
822 * src/frontends/gnome/FormCopyright.C
823 * src/frontends/gnome/FormError.C
824 * src/frontends/gnome/FormIndex.C
825 * src/frontends/gnome/FormRef.C
826 * src/frontends/gnome/FormToc.C
827 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
830 * src/frontends/gnome/Menubar_pimpl.C
831 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
834 2000-10-11 Baruch Even <baruch.even@writeme.com>
837 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
838 to convey its real action.
840 * src/minibuffer.C (peek_event): Added action when mouse clicks to
841 clear the minibuffer and prepare to enter a command.
843 * src/mathed/formula.C (LocalDispatch): Changed to conform with
844 the rename from ExecCommand to PrepareForCommand.
845 * src/lyxfunc.C (Dispatch): ditto.
847 2000-10-11 Baruch Even <baruch.even@writeme.com>
849 * src/buffer.C (writeFile): Added test for errors on writing, this
850 catches all errors and not only file system full errors as intended.
852 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
854 * src/lyx_gui.C (create_forms): better fix for crash with
855 translated interface.
857 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
859 * src/frontends/kde/Makefile.am:
860 * src/frontends/kde/FormCopyright.C:
861 * src/frontends/kde/formcopyrightdialog.C:
862 * src/frontends/kde/formcopyrightdialog.h:
863 * src/frontends/kde/formcopyrightdialogdata.C:
864 * src/frontends/kde/formcopyrightdialogdata.h:
865 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
866 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
867 copyright to use qtarch
869 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
871 * src/encoding.C (read): Fixed bug that caused an error message at
874 * po/Makefile.in.in: Fixed rule for ext_l10n.h
876 * lib/lyxrc.example: Fixed hebrew example.
878 2000-10-13 Allan Rae <rae@lyx.org>
880 * src/frontends/xforms/FormPreferences.C (input): reworking the
882 (build, update, apply): New inputs in various tabfolders
884 * src/frontends/xforms/FormToc.C: use new button policy.
885 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
886 dialogs that either can't use any existing policy or where it just
889 * src/frontends/xforms/FormTabular.h: removed copyright notice that
892 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
893 added a bool parameter which is ignored.
895 * src/buffer.C (setReadonly):
896 * src/BufferView_pimpl.C (buffer):
897 * src/frontends/kde/FormCopyright.h (update):
898 * src/frontends/kde/FormCitation.[Ch] (update):
899 * src/frontends/kde/FormIndex.[Ch] (update):
900 * src/frontends/kde/FormPrint.[Ch] (update):
901 * src/frontends/kde/FormRef.[Ch] (update):
902 * src/frontends/kde/FormToc.[Ch] (update):
903 * src/frontends/kde/FormUrl.[Ch] (update):
904 * src/frontends/gnome/FormCopyright.h (update):
905 * src/frontends/gnome/FormCitation.[Ch] (update):
906 * src/frontends/gnome/FormError.[Ch] (update):
907 * src/frontends/gnome/FormIndex.[Ch] (update):
908 * src/frontends/gnome/FormPrint.[Ch] (update):
909 * src/frontends/gnome/FormRef.h (update):
910 * src/frontends/gnome/FormToc.[Ch] (update):
911 * src/frontends/gnome/FormUrl.[Ch] (update):
912 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
913 to updateBufferDependent and DialogBase
915 * src/frontends/xforms/FormCitation.[hC]:
916 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
917 * src/frontends/xforms/FormError.[Ch]:
918 * src/frontends/xforms/FormGraphics.[Ch]:
919 * src/frontends/xforms/FormIndex.[Ch]:
920 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
921 and fixed readOnly handling.
922 * src/frontends/xforms/FormPrint.[Ch]:
923 * src/frontends/xforms/FormRef.[Ch]:
924 * src/frontends/xforms/FormTabular.[Ch]:
925 * src/frontends/xforms/FormToc.[Ch]:
926 * src/frontends/xforms/FormUrl.[Ch]:
927 * src/frontends/xforms/FormInset.[Ch]:
928 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
929 form of updateBufferDependent.
931 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
932 if form()->visible just in case someone does stuff to the form in a
935 * src/frontends/DialogBase.h (enum): removed enum since we can now use
936 the buttoncontroller for everything the enum used to be used for.
937 (update) It would seem we need to force all dialogs to use a bool
938 parameter or have two update functions. I chose to go with one.
939 I did try removing update() from here and FormBase and defining the
940 appropriate update signatures in FormBaseB[DI] but then ran into the
941 problem of the update() call in FormBase::show(). Whatever I did
942 to get around that would require another function and that just
943 got more confusing. Hence the decision to make everyone have an
944 update(bool). An alternative might have been to override show() in
945 FormBaseB[DI] and that would allow the different and appropriate
948 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
949 true == buffer change occurred. I decided against using a default
950 template parameter since not all compilers support that at present.
952 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
954 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
955 army knife" by removing functionality.
956 (clearStore): removed. All such housekeeping on hide()ing the dialog
957 is to be carried out by overloaded disconnect() methods.
958 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
959 superceded by Baruch's neat test (FormGraphics) to update an existing
960 dialog if a new signal is recieved rather than block all new signals
962 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
963 only to Inset dialogs.
964 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
965 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
967 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
969 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
970 as a base class to all inset dialogs. Used solely to connect/disconnect
971 the Inset::hide signal and to define what action to take on receipt of
972 a UpdateBufferDependent signal.
973 (FormCommand): now derived from FormInset.
975 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
978 * src/frontends/xforms/FormCopyright.[Ch]:
979 * src/frontends/xforms/FormPreferences.[Ch]:
980 now derived from FormBaseBI.
982 * src/frontends/xforms/FormDocument.[Ch]:
983 * src/frontends/xforms/FormParagraph.[Ch]:
984 * src/frontends/xforms/FormPrint.[Ch]:
985 now derived from FormBaseBD.
987 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
989 * src/frontends/xforms/FormCitation.[Ch]:
990 * src/frontends/xforms/FormError.[Ch]:
991 * src/frontends/xforms/FormRef.[Ch]:
992 * src/frontends/xforms/FormToc.[Ch]:
993 (clearStore): reworked as disconnect().
995 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
998 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1000 * src/converter.C (runLaTeX): constify buffer argument
1003 * src/frontends/support/Makefile.am (INCLUDES): fix.
1005 * src/buffer.h: add std:: qualifier
1006 * src/insets/figinset.C (addpidwait): ditto
1007 * src/MenuBackend.C: ditto
1008 * src/buffer.C: ditto
1009 * src/bufferlist.C: ditto
1010 * src/layout.C: ditto
1011 * src/lyxfunc.C: ditto
1013 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1015 * src/lyxtext.h (bidi_level): change return type to
1016 LyXParagraph::size_type.
1018 * src/lyxparagraph.h: change size_type to
1019 TextContainer::difference_type. This should really be
1020 TextContainer::size_type, but we need currently to support signed
1023 2000-10-11 Marko Vendelin <markov@ioc.ee>
1024 * src/frontends/gnome/FormError.h
1025 * src/frontends/gnome/FormRef.C
1026 * src/frontends/gnome/FormRef.h
1027 * src/frontends/gnome/FormError.C
1028 * src/frontends/gnome/Makefile.am
1029 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1030 to Gnome frontend. Both dialogs use "action" area.
1032 2000-10-12 Baruch Even <baruch.even@writeme.com>
1034 * src/graphics/GraphicsCacheItem_pimpl.C:
1035 * src/graphics/Renderer.C:
1036 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1039 2000-10-12 Juergen Vigna <jug@sad.it>
1041 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1042 visible when selecting).
1044 * development/Code_rules/Rules: fixed some typos.
1046 2000-10-09 Baruch Even <baruch.even@writeme.com>
1048 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1049 compiling on egcs 1.1.2 possible.
1051 * src/filedlg.C (comp_direntry::operator() ): ditto.
1053 2000-08-31 Baruch Even <baruch.even@writeme.com>
1055 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1058 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1059 transient it now only gets freed when the object is destructed.
1061 2000-08-24 Baruch Even <baruch.even@writeme.com>
1063 * src/frontends/FormGraphics.h:
1064 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1067 2000-08-20 Baruch Even <baruch.even@writeme.com>
1069 * src/insets/insetgraphics.C:
1070 (draw): Added messages to the drawn rectangle to report status.
1071 (updateInset): Disabled the use of the inline graphics,
1074 2000-08-17 Baruch Even <baruch.even@writeme.com>
1076 * src/frontends/support: Directory added for the support of GUII LyX.
1078 * src/frontends/support/LyXImage.h:
1079 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1082 * src/frontends/support/LyXImage_X.h:
1083 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1084 version of LyXImage, this uses the Xlib Pixmap.
1086 * src/PainterBase.h:
1087 * src/PainterBase.C:
1089 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1090 replacement to Pixmap.
1092 * src/insets/insetgraphics.h:
1093 * src/insets/insetgraphics.C:
1094 * src/graphics/GraphicsCacheItem.h:
1095 * src/graphics/GraphicsCacheItem.C:
1096 * src/graphics/GraphicsCacheItem_pimpl.h:
1097 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1100 * src/graphics/GraphicsCacheItem.h:
1101 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1102 another copy of the object.
1104 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1105 of cacheHandle, this fixed a bug that sent LyX crashing.
1107 * src/graphics/XPM_Renderer.h:
1108 * src/graphics/XPM_Renderer.C:
1109 * src/graphics/EPS_Renderer.h:
1110 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1112 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1114 * src/lyxfunc.C (processKeySym): only handle the
1115 lockinginset/inset stuff if we have a buffer and text loaded...
1117 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1119 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1121 * src/support/lyxfunctional.h: add operator= that takes a reference
1123 * src/lyxserver.C (mkfifo): make first arg const
1125 * src/layout.h: renamed name(...) to setName(...) to work around
1128 * src/buffer.C (setFileName): had to change name of function to
1129 work around bugs in egcs. (renamed from fileName)
1131 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1133 * src/support/translator.h: move helper template classes to
1134 lyxfunctional.h, include "support/lyxfunctional.h"
1136 * src/support/lyxmanip.h: add delaration of fmt
1138 * src/support/lyxfunctional.h: new file
1139 (class_fun_t): new template class
1140 (class_fun): helper template function
1141 (back_insert_fun_iterator): new template class
1142 (back_inserter_fun): helper template function
1143 (compare_memfun_t): new template class
1144 (compare_memfun): helper template function
1145 (equal_1st_in_pair): moved here from translator
1146 (equal_2nd_in_pair): moved here from translator
1148 * src/support/fmt.C: new file
1149 (fmt): new func, can be used for a printf substitute when still
1150 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1152 * src/support/StrPool.C: add some comments
1154 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1157 * src/insets/figinset.C (addpidwait): use std::copy with
1158 ostream_iterator to fill the pidwaitlist
1160 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1162 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1165 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1168 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1170 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1171 (class_update): ditto
1172 (BulletPanel): ditto
1173 (CheckChoiceClass): move initialization of tc and tct
1175 * src/tabular.C: remove current_view
1176 (OldFormatRead): similar to right below [istream::ignore]
1178 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1179 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1180 unused [istream::ignore]
1182 * src/lyxfunc.C: include "support/lyxfunctional.h"
1183 (getInsetByCode): use std::find_if and compare_memfun
1185 * src/lyxfont.C (stateText): remove c_str()
1187 * src/lyx_main.C (setDebuggingLevel): make static
1188 (commandLineHelp): make static
1190 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1191 Screen* together with fl_get_display() and fl_screen
1193 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1194 togheter with fl_get_display() and fl_screen
1195 (create_forms): remove c_str()
1197 * src/layout.C: include "support/lyxfunctional.h"
1198 (hasLayout): use std::find_if and compare_memfun
1199 (GetLayout): use std::find_if and comapre_memfun
1200 (delete_layout): use std::remove_if and compare_memfun
1201 (NumberOfClass): use std:.find_if and compare_memfun
1203 * src/gettext.h: change for the new functions
1205 * src/gettext.C: new file, make _(char const * str) and _(string
1206 const & str) real functions.
1208 * src/font.C (width): rewrite slightly to avoid one extra variable
1210 * src/debug.C: initialize Debug::ANY here
1212 * src/commandtags.h: update number comments
1214 * src/combox.h (get): make const func
1216 (getline): make const
1218 * src/combox.C (input_cb): handle case where fl_get_input can
1221 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1222 "support/lyxfunctional.h", remove current_view variable.
1223 (resize): use std::for_each with std::mem_fun
1224 (getFileNames): use std::copy with back_inserter_fun
1225 (getBuffer): change arg type to unsigned int
1226 (emergencyWriteAll): call emergencyWrite with std::for_each and
1228 (emergencyWrite): new method, the for loop in emergencyWriteAll
1230 (exists): use std::find_if with compare_memfun
1231 (getBuffer): use std::find_if and compare_memfun
1233 * src/buffer.h: add typedefs for iterator_category, value_type
1234 difference_type, pointer and reference for inset_iterator
1235 add postfix ++ for inset_iterator
1236 make inset_iterator::getPos() const
1238 * src/buffer.C: added support/lyxmanip.h
1239 (readFile): use lyxerr << fmt instead of printf
1240 (makeLaTeXFile): use std::copy to write out encodings
1242 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1244 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1245 free and the char * temp.
1246 (hasMenu): use std::find_if and compare_memfun
1249 * src/Makefile.am (lyx_SOURCES): added gettext.C
1251 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1252 string::insert small change to avoid temporary
1254 * src/LColor.C (getGUIName): remove c_str()
1256 * several files: change all occurrences of fl_display to
1259 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1260 that -pedantic is not used for gcc 2.97 (cvs gcc)
1262 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1264 2000-10-11 Allan Rae <rae@lyx.org>
1266 * src/frontends/xforms/FormPreferences.C (input): template path must be
1267 a readable directory. It doesn't need to be writeable.
1268 (build, delete, update, apply): New inputs in the various tabfolders
1270 * src/frontends/xforms/forms/form_preferences.fd:
1271 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1272 several new entries to existing folders. Shuffled some existing stuff
1275 * src/frontends/xforms/forms/form_print.fd:
1276 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1277 Should probably rework PrinterParams as well. Note that the switch to
1278 collated is effectively the same as !unsorted so changing PrinterParams
1279 will require a lot of fiddly changes to reverse the existing logic.
1281 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1283 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1285 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1287 2000-10-10 Allan Rae <rae@lyx.org>
1290 * src/lyxfunc.C (Dispatch):
1292 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1295 * src/lyxrc.C (output): Only write the differences between system lyxrc
1296 and the users settings.
1299 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1301 I'll rewrite this later, after 1.1.6 probably, to keep a single
1302 LyXRC but two instances of a LyXRCStruct.
1304 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1306 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1308 * src/tabular.h: add a few std:: qualifiers.
1310 * src/encoding.C: add using directive.
1311 * src/language.C: ditto.
1313 * src/insets/insetquotes.C (Validate): use languages->lang()
1314 instead of only language.
1316 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1318 * lib/languages: New file.
1320 * lib/encodings: New file.
1322 * src/language.C (Languages): New class.
1323 (read): New method. Reads the languages from the 'languages' file.
1325 * src/encoding.C (Encodings): New class.
1326 (read): New method. Reads the encodings from the 'encodings' file.
1328 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1331 * src/bufferparams.h and a lot of files: Deleted the member language,
1332 and renamed language_info to language
1334 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1335 * src/lyxfont.C (latexWriteStartChanges): ditto.
1336 * src/paragraph.C (validate,TeXOnePar): ditto.
1338 * src/lyxfont.C (update): Restored deleted code.
1340 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1342 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1344 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1346 * src/insets/figinset.[Ch]:
1347 * src/insets/insetinclude.[Ch]:
1348 * src/insets/insetinclude.[Ch]:
1349 * src/insets/insetparent.[Ch]:
1350 * src/insets/insetref.[Ch]:
1351 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1353 * src/insets/*.[Ch]:
1354 * src/mathed/formula.[Ch]:
1355 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1357 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1358 * src/lyx_cb.C (FigureApplyCB):
1359 * src/lyxfunc.C (getStatus, Dispatch):
1360 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1363 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1365 * src/converter.[Ch] (Formats::View):
1366 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1368 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1369 *current_view->buffer(). This will change later, but this patch is way
1372 2000-10-09 Juergen Vigna <jug@sad.it>
1374 * src/text.C (GetRow): small fix.
1376 * src/BufferView_pimpl.C (cursorPrevious):
1377 (cursorNext): added LyXText parameter to function.
1379 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1380 keypress depending on cursor position.
1382 2000-10-06 Juergen Vigna <jug@sad.it>
1384 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1385 (copySelection): redone this function and also copy ascii representa-
1388 * src/tabular.C (Ascii):
1392 (print_n_chars): new functions to realize the ascii export of tabulars.
1394 2000-10-05 Juergen Vigna <jug@sad.it>
1396 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1397 if we don't have a buffer.
1399 2000-10-10 Allan Rae <rae@lyx.org>
1401 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1402 with closing dialog. It seems that nested tabfolders require hiding
1403 of inner tabfolders before hiding the dialog itself. Actually all I
1404 did was hide the active outer folder.
1406 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1407 unless there really is a buffer. hideBufferDependent is called
1410 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1411 POTFILES.in stays in $(srcdir).
1413 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1415 * lib/lyxrc.example: Few changes.
1417 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1419 * src/BufferView_pimpl.C (buffer): only need one the
1420 updateBufferDependent signal to be emitted once! Moved to the end of
1421 the method to allow bv_->text to be updated first.
1423 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1424 and hSignal_ with Dialogs * and BufferDependency variables.
1425 New Buffer * parent_, initialised when the dialog is launched. Used to
1426 check whether to update() or hide() dialog in the new, private
1427 updateOrHide() method that is connected to the updateBufferDependent
1428 signal. Daughter classes dictate what to do using the
1429 ChangedBufferAction enum, passed to the c-tor.
1431 * src/frontends/xforms/FormCitation.C:
1432 * src/frontends/xforms/FormCommand.C:
1433 * src/frontends/xforms/FormCopyright.C:
1434 * src/frontends/xforms/FormDocument.C:
1435 * src/frontends/xforms/FormError.C:
1436 * src/frontends/xforms/FormIndex.C:
1437 * src/frontends/xforms/FormPreferences.C:
1438 * src/frontends/xforms/FormPrint.C:
1439 * src/frontends/xforms/FormRef.C:
1440 * src/frontends/xforms/FormToc.C:
1441 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1444 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1445 ChangedBufferAction enum.
1447 * src/frontends/xforms/FormParagraph.[Ch]
1448 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1451 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1453 * lib/bind/cua.bind: fix a bit.
1454 * lib/bind/emacs.bind: ditto.
1456 * lib/bind/menus.bind: remove real menu entries from there.
1458 * src/spellchecker.C: make sure we only include strings.h when
1461 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1463 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1464 function. It enlarges the maximum number of pup when needed.
1465 (add_toc2): Open a new menu if maximum number of items per menu has
1468 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1470 * src/frontends/kde/FormPrint.C: fix error reporting
1472 * src/frontends/xforms/FormDocument.C: fix compiler
1475 * lib/.cvsignore: add Literate.nw
1477 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1480 * bufferview_funcs.[Ch]
1483 * text2.C: Add support for numbers in RTL text.
1485 2000-10-06 Allan Rae <rae@lyx.org>
1487 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1488 to be gettext.m4 friendly again. ext_l10n.h is now
1489 generated into $top_srcdir instead of $top_builddir
1490 so that lyx.pot will be built correctly -- without
1491 duplicate parsing of ext_l10n.h.
1493 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1495 * src/frontends/kde/FormCitation.C: make the dialog
1496 behave more sensibly
1498 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1500 * config/kde.m4: fix consecutive ./configure runs,
1501 look for qtarch, fix library order
1503 * src/frontends/kde/Makefile.am: tidy up,
1504 add Print dialog, add .dlg dependencies
1506 * src/frontends/kde/FormPrint.C:
1507 * src/frontends/kde/FormPrint.h:
1508 * src/frontends/kde/formprintdialog.C:
1509 * src/frontends/kde/formprintdialog.h:
1510 * src/frontends/kde/formprintdialogdata.C:
1511 * src/frontends/kde/formprintdialogdata.h:
1512 * src/frontends/kde/dlg/formprintdialog.dlg: add
1515 * src/frontends/kde/dlg/README: Added explanatory readme
1517 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1518 script to double-check qtarch's output
1520 * src/frontends/kde/formindexdialog.C:
1521 * src/frontends/kde/formindexdialogdata.C:
1522 * src/frontends/kde/formindexdialogdata.h:
1523 * src/frontends/kde/dlg/formindexdialog.dlg: update
1524 for qtarch, minor fixes
1526 2000-10-05 Allan Rae <rae@lyx.org>
1528 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1529 dialogs when switching buffers update them instead. It's up to each
1530 dialog to decide if it should still be visible or not.
1531 update() should return a bool to control visiblity within show().
1532 Or perhaps better to set a member variable and use that to control
1535 * lib/build-listerrors: create an empty "listerrors" file just to stop
1536 make trying to regenerate it all the time if you don't have noweb
1539 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1541 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1542 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1543 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1544 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1545 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1547 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1549 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1551 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1552 deleting buffer. Closes all buffer-dependent dialogs.
1554 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1556 * src/frontends/xforms/FormCitation.[Ch]:
1557 * src/frontends/xforms/FormPreferences.[Ch]:
1558 * src/frontends/xforms/FormPrint.[Ch]:
1559 * src/frontends/xforms/FormRef.[Ch]:
1560 * src/frontends/xforms/FormUrl.[Ch]: ditto
1562 * src/frontends/xforms/FormDocument.[Ch]:
1563 * src/frontends/xforms/forms/form_document.C.patch:
1564 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1565 pass through a single input() function.
1567 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1569 * lib/build-listerrors: return status as OK
1571 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1573 * lib/lyxrc.example: Updated to new export code
1575 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1577 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1580 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1583 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1584 LyX-Code is defined.
1585 * lib/layouts/amsbook.layout: ditto.
1587 * boost/Makefile.am: fix typo.
1589 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1591 (add_lastfiles): removed.
1592 (add_documents): removed.
1593 (add_formats): removed.
1595 * src/frontends/Menubar.C: remove useless "using" directive.
1597 * src/MenuBackend.h: add a new MenuItem constructor.
1599 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1602 2000-10-04 Allan Rae <rae@lyx.org>
1604 * lib/Makefile.am (listerrors):
1605 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1606 I haven't got notangle installed so Kayvan please test. The output
1607 should end up in $builddir. This also allows people who don't have
1608 noweb installed to complete the make process without error.
1610 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1611 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1612 by JMarc's picky compiler.
1614 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1617 * src/insets/insettabular.C (setPos): change for loop to not use
1618 sequencing operator. Please check this Jürgen.
1620 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1622 * src/insets/insetcite.C (getScreenLabel): ditto
1623 * src/support/filetools.C (QuoteName): ditto
1624 (ChangeExtension): ditto
1626 * src/BufferView_pimpl.C (scrollCB): make heigt int
1628 * src/BufferView2.C (insertInset): comment out unused arg
1630 * boost/Makefile.am (EXTRADIST): new variable
1632 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1634 * src/exporter.C (IsExportable): Fixed
1636 * lib/configure.m4: Small fix
1638 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1640 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1641 * src/insets/insetbib.C (bibitemWidest): ditto.
1642 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1644 2000-10-03 Juergen Vigna <jug@sad.it>
1646 * src/BufferView2.C (theLockingInset): removed const because of
1647 Agnus's compile problems.
1649 * src/insets/insettext.C (LocalDispatch): set the language of the
1650 surronding paragraph on inserting the first character.
1652 * various files: changed use of BufferView::the_locking_inset.
1654 * src/BufferView2.C (theLockingInset):
1655 (theLockingInset): new functions.
1657 * src/BufferView.h: removed the_locking_inset.
1659 * src/lyxtext.h: added the_locking_inset
1661 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1663 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1665 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1667 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1668 * src/mathed/math_cursor.C (IsAlpha): ditto.
1669 * src/mathed/math_inset.C (strnew): ditto.
1670 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1671 (IMetrics): cxp set but never used; removed.
1672 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1673 that the variable in question has been removed also!
1676 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1677 using the Buffer * passed to Latex(), using the BufferView * passed to
1678 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1680 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1681 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1683 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1684 * src/buffer.C (readInset): used new InsetBibtex c-tor
1685 * (getBibkeyList): used new InsetBibtex::getKeys
1687 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1690 * lib/build-listerrors
1692 * src/exporter.C: Add literate programming support to the export code
1695 * src/lyx_cb.C: Remove old literate code.
1697 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1700 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1701 * src/converter.C (View, Convert): Use QuoteName.
1703 * src/insets/figinset.C (Preview): Use Formats::View.
1705 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1707 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1709 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1710 the top of the function, because compaq cxx complains that the
1711 "goto exit_with_message" when the function is disabled bypasses
1713 (MenuNew): try a better fix for the generation of new file names.
1714 This time, I used AddName() instead of AddPath(), hoping Juergen
1717 2000-10-03 Allan Rae <rae@lyx.org>
1719 * src/frontends/xforms/forms/form_preferences.fd:
1720 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1721 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1722 "Look and Feel"->"General" but will need to be split up further into
1723 general output and general input tabs. Current plan is for four outer
1724 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1725 stuff; "Inputs" for input and import configuration; "Outputs" for
1726 output and export configuration; and one more whatever is left over
1727 called "General". The leftovers at present look like being which
1728 viewers to use, spellchecker, language support and might be better
1729 named "Support". I've put "Paths" in "Inputs" for the moment as this
1730 seems reasonable for now at least.
1731 One problem remains: X error kills LyX when you close Preferences.
1733 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1735 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1736 qualifier from form()
1737 * src/frontends/xforms/FormCitation.[Ch]:
1738 * src/frontends/xforms/FormCopyright.[Ch]:
1739 * src/frontends/xforms/FormDocument.[Ch]:
1740 * src/frontends/xforms/FormError.[Ch]:
1741 * src/frontends/xforms/FormIndex.[Ch]:
1742 * src/frontends/xforms/FormPreferences.[Ch]:
1743 * src/frontends/xforms/FormPrint.[Ch]:
1744 * src/frontends/xforms/FormRef.[Ch]:
1745 * src/frontends/xforms/FormToc.[Ch]:
1746 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1748 * src/frontends/xforms/FormCitation.[Ch]:
1749 * src/frontends/xforms/FormIndex.[Ch]:
1750 * src/frontends/xforms/FormRef.[Ch]:
1751 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1752 with Allan's naming policy
1754 * src/frontends/xforms/FormCitation.C: some static casts to remove
1757 2000-10-02 Juergen Vigna <jug@sad.it>
1759 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1760 now you can type or do stuff inside the table-cell also when in dummy
1761 position, fixed visible cursor.
1763 * src/insets/insettext.C (Edit): fixing cursor-view position.
1765 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1766 be used for equal functions in lyxfunc and insettext.
1768 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1770 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1772 * src/frontends/gnome/FormCitation.h:
1773 * src/frontends/gnome/FormCopyright.h:
1774 * src/frontends/gnome/FormIndex.h:
1775 * src/frontends/gnome/FormPrint.h:
1776 * src/frontends/gnome/FormToc.h:
1777 * src/frontends/gnome/FormUrl.h:
1778 * src/frontends/kde/FormCitation.h:
1779 * src/frontends/kde/FormCopyright.h:
1780 * src/frontends/kde/FormIndex.h:
1781 * src/frontends/kde/FormRef.h:
1782 * src/frontends/kde/FormToc.h:
1783 * src/frontends/kde/FormUrl.h: fix remaining users of
1786 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1788 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1789 from depth argument.
1790 (DocBookHandleCaption): ditto.
1791 (DocBookHandleFootnote): ditto.
1792 (SimpleDocBookOnePar): ditto.
1794 * src/frontends/xforms/FormDocument.h (form): remove extra
1795 FormDocument:: qualifier.
1797 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1799 * sigc++/handle.h: ditto.
1801 * src/lyx_gui_misc.C: add "using" directive.
1803 * src/cheaders/cstddef: new file, needed by the boost library (for
1806 2000-10-02 Juergen Vigna <jug@sad.it>
1808 * src/insets/insettext.C (SetFont): better support.
1810 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1812 * src/screen.C (DrawOneRow): some uint refixes!
1814 2000-10-02 Allan Rae <rae@lyx.org>
1816 * boost/.cvsignore: ignore Makefile as well
1818 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1819 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1821 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1822 Left this one out by accident.
1824 * src/frontends/xforms/FormBase.h (restore): default to calling
1825 update() since that will restore the original/currently-applied values.
1826 Any input() triggered error messages will require the derived classes
1827 to redefine restore().
1829 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1830 avoid a segfault. combo_doc_class is the main concern.
1832 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1834 * Simplify build-listerrors in view of GUI-less export ability!
1836 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1838 * src/lyx_main.C (easyParse): Disable gui when exporting
1840 * src/insets/figinset.C:
1843 * src/lyx_gui_misc.C
1844 * src/tabular.C: Changes to allow no-gui.
1846 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1848 * src/support/utility.hpp: removed file
1849 * src/support/block.h: removed file
1851 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1854 * src/mathed/formula.C: add support/lyxlib.h
1855 * src/mathed/formulamacro.C: ditto
1857 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1858 * src/lyxparagraph.h: ditto
1860 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1861 * src/frontends/Makefile.am (INCLUDES): ditto
1862 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1863 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1864 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1865 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1866 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1867 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1869 * src/BufferView.h: use boost/utility.hpp
1870 * src/LColor.h: ditto
1871 * src/LaTeX.h: ditto
1872 * src/LyXAction.h: ditto
1873 * src/LyXView.h: ditto
1874 * src/bufferlist.h: ditto
1875 * src/lastfiles.h: ditto
1876 * src/layout.h: ditto
1877 * src/lyx_gui.h: ditto
1878 * src/lyx_main.h: ditto
1879 * src/lyxlex.h: ditto
1880 * src/lyxrc.h: ditto
1881 * src/frontends/ButtonPolicies.h: ditto
1882 * src/frontends/Dialogs.h: ditto
1883 * src/frontends/xforms/FormBase.h: ditto
1884 * src/frontends/xforms/FormGraphics.h: ditto
1885 * src/frontends/xforms/FormParagraph.h: ditto
1886 * src/frontends/xforms/FormTabular.h: ditto
1887 * src/graphics/GraphicsCache.h: ditto
1888 * src/graphics/Renderer.h: ditto
1889 * src/insets/ExternalTemplate.h: ditto
1890 * src/insets/insetcommand.h: ditto
1891 * src/support/path.h: ditto
1893 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1894 and introduce clause for 2.97.
1896 * boost/libs/README: new file
1898 * boost/boost/utility.hpp: new file
1900 * boost/boost/config.hpp: new file
1902 * boost/boost/array.hpp: new file
1904 * boost/Makefile.am: new file
1906 * boost/.cvsignore: new file
1908 * configure.in (AC_OUTPUT): add boost/Makefile
1910 * Makefile.am (SUBDIRS): add boost
1912 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1914 * src/support/lstrings.C (suffixIs): Fixed.
1916 2000-10-01 Allan Rae <rae@lyx.org>
1918 * src/PrinterParams.h: moved things around to avoid the "can't
1919 inline call" warning.
1921 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1922 into doc++ documentation.
1924 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1926 * src/frontends/xforms/FormRef.C: make use of button controller
1927 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1928 cleaned up button controller usage.
1929 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1930 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1931 use the button controller
1933 * src/frontends/xforms/forms/*.fd: and associated generated files
1934 updated to reflect changes to FormBase. Some other FormXxxx files
1935 also got minor updates to reflect changes to FormBase.
1937 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1938 (hide): made virtual.
1939 (input): return a bool. true == valid input
1940 (RestoreCB, restore): new
1941 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1942 Changes to allow derived dialogs to use a ButtonController and
1943 make sense when doing so: OK button calls ok() and so on.
1945 * src/frontends/xforms/ButtonController.h (class ButtonController):
1946 Switch from template implementation to taking Policy parameter.
1947 Allows FormBase to provide a ButtonController for any dialog.
1949 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1950 Probably should rename connect and disconnect.
1951 (apply): use the radio button groups
1952 (form): needed by FormBase
1953 (build): setup the radio button groups
1955 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1957 * several files: type changes to reduce the number of warnings and
1958 to unify type hangling a bit. Still much to do.
1960 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1962 * lib/images/*: rename a bunch of icons to match Dekel converter
1965 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1968 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1970 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1972 * sigc++/handle.h: ditto for class Handle.
1974 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1976 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1978 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1980 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1981 removal of the "default" language.
1983 * src/combox.h (getline): Check that sel > 0
1985 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1987 * lib/examples/docbook_example.lyx
1988 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1990 * lib/layouts/docbook-book.layout: new docbook book layout.
1992 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1994 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1996 * src/insets/figinset.C (DocBook):fixed small typo.
1998 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2000 * src/insets/insetinclude.h: string include_label doesn't need to be
2003 2000-09-29 Allan Rae <rae@lyx.org>
2005 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2006 Allow derived type to control connection and disconnection from signals
2007 of its choice if desired.
2009 2000-09-28 Juergen Vigna <jug@sad.it>
2011 * src/insets/insettabular.C (update): fixed cursor setting when
2012 the_locking_inset changed.
2013 (draw): made this a bit cleaner.
2014 (InsetButtonPress): fixed!
2016 * various files: added LyXText Parameter to fitCursor call.
2018 * src/BufferView.C (fitCursor): added LyXText parameter.
2020 * src/insets/insettabular.C (draw): small draw fix.
2022 * src/tabular.C: right setting of left/right celllines.
2024 * src/tabular.[Ch]: fixed various types in funcions and structures.
2025 * src/insets/insettabular.C: ditto
2026 * src/frontends/xforms/FormTabular.C: ditto
2028 2000-09-28 Allan Rae <rae@lyx.org>
2030 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2031 that the #ifdef's had been applied to part of what should have been
2032 a complete condition. It's possible there are other tests that
2033 were specific to tables that are also wrong now that InsetTabular is
2034 being used. Now we need to fix the output of '\n' after a table in a
2035 float for the same reason as the original condition:
2036 "don't insert this if we would be adding it before or after a table
2037 in a float. This little trick is needed in order to allow use of
2038 tables in \subfigures or \subtables."
2039 Juergen can you check this?
2041 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2043 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2044 output to the ostream.
2046 * several files: fixed types based on warnings from cxx
2048 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2050 * src/frontends/kde/Makefile.am: fix rule for
2051 formindexdialogdata_moc.C
2053 * src/.cvsignore: add ext_l10n.h to ignore
2055 * acconfig.h: stop messing with __STRICT_ANSI__
2056 * config/gnome.m4: remove option to set -ansi
2057 * config/kde.m4: remove option to set -ansi
2058 * config/lyxinclude.m4: don't set -ansi
2060 2000-09-27 Juergen Vigna <jug@sad.it>
2062 * various files: remove "default" language check.
2064 * src/insets/insetquotes.C: removed use of current_view.
2066 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2067 the one should have red ears by now!
2069 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2070 in more then one paragraph. Fixed cursor-movement/selection.
2072 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2073 paragraphs inside a text inset.
2075 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2076 text-inset if this owner is an inset.
2078 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2080 * src/Bullet.h: changed type of font, character and size to int
2082 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2084 * src/insets/inseturl.[Ch]:
2085 * src/insets/insetref.[Ch]:
2086 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2088 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2090 * src/buffer.C (readFile): block-if statement rearranged to minimise
2091 bloat. Patch does not reverse Jean-Marc's change ;-)
2093 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2094 Class rewritten to store pointers to hide/update signals directly,
2095 rather than Dialogs *. Also defined an enum to ease use. All xforms
2096 forms can now be derived from this class.
2098 * src/frontends/xforms/FormCommand.[Ch]
2099 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2101 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2104 * src/frontends/xforms/forms/form_citation.fd
2105 * src/frontends/xforms/forms/form_copyright.fd
2106 * src/frontends/xforms/forms/form_error.fd
2107 * src/frontends/xforms/forms/form_index.fd
2108 * src/frontends/xforms/forms/form_ref.fd
2109 * src/frontends/xforms/forms/form_toc.fd
2110 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2112 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2114 * src/insets/insetfoot.C: removed redundent using directive.
2116 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2118 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2119 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2121 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2122 created in the constructors in different groups. Then set() just
2123 have to show the groups as needed. This fixes the redraw problems
2124 (and is how the old menu code worked).
2126 * src/support/lyxlib.h: declare the methods as static when we do
2127 not have namespaces.
2129 2000-09-26 Juergen Vigna <jug@sad.it>
2131 * src/buffer.C (asciiParagraph): new function.
2132 (writeFileAscii): new function with parameter ostream.
2133 (writeFileAscii): use now asciiParagraph.
2135 * various inset files: added the linelen parameter to the Ascii-func.
2137 * src/tabular.C (Write): fixed error in writing file introduced by
2138 the last changes from Lars.
2140 * lib/bind/menus.bind: removed not supported functions.
2142 * src/insets/insettext.C (Ascii): implemented this function.
2144 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2146 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2147 (Write): use of the write_attribute functions.
2149 * src/bufferlist.C (close): fixed reasking question!
2151 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2153 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2154 new files use the everwhere possible.
2157 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2158 src/log_form.C src/lyx.C:
2161 * src/buffer.C (runLaTeX): remove func
2163 * src/PaperLayout.C: removed file
2164 * src/ParagraphExtra.C: likewise
2165 * src/bullet_forms.C: likewise
2166 * src/bullet_forms.h: likewise
2167 * src/bullet_forms_cb.C: likewise
2169 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2170 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2173 * several files: remove all traces of the old fd_form_paragraph,
2174 and functions belonging to that.
2176 * several files: remove all traces of the old fd_form_document,
2177 and functions belonging to that.
2179 * several files: constify local variables were possible.
2181 * several files: remove all code that was dead when NEW_EXPORT was
2184 * several files: removed string::c_str in as many places as
2187 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2188 (e): be a bit more outspoken when patching
2189 (updatesrc): only move files if changed.
2191 * forms/layout_forms.h.patch: regenerated
2193 * forms/layout_forms.fd: remove form_document and form_paragraph
2194 and form_quotes and form_paper and form_table_options and
2195 form_paragraph_extra
2197 * forms/form1.fd: remove form_table
2199 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2200 the fdui->... rewrite. Update some comments to xforms 0.88
2202 * forms/bullet_forms.C.patch: removed file
2203 * forms/bullet_forms.fd: likewise
2204 * forms/bullet_forms.h.patch: likewise
2206 * development/Code_rules/Rules: added a section on switch
2207 statements. Updated some comment to xforms 0.88.
2209 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2211 * src/buffer.C (readFile): make sure that the whole version number
2212 is read after \lyxformat (even when it contains a comma)
2214 * lib/ui/default.ui: change shortcut of math menu to M-a.
2216 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2218 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2221 * src/LyXView.C (updateWindowTitle): show the full files name in
2222 window title, limited to 30 characters.
2224 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2225 When a number of characters has been given, we should not assume
2226 that the string is 0-terminated.
2228 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2229 calls (fixes some memory leaks)
2231 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2232 trans member on exit.
2234 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2236 * src/converter.C (GetReachable): fix typo.
2238 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2239 understand ',' instead of '.'.
2240 (GetInteger): rewrite to use strToInt().
2242 2000-09-26 Juergen Vigna <jug@sad.it>
2244 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2245 better visibility and error-message on wrong VSpace input.
2247 * src/language.C (initL): added english again.
2249 2000-09-25 Juergen Vigna <jug@sad.it>
2251 * src/frontends/kde/Dialogs.C (Dialogs):
2252 * src/frontends/gnome/Dialogs.C (Dialogs):
2253 * src/frontends/kde/Makefile.am:
2254 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2256 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2258 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2260 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2262 * src/frontends/xforms/FormParagraph.C:
2263 * src/frontends/xforms/FormParagraph.h:
2264 * src/frontends/xforms/form_paragraph.C:
2265 * src/frontends/xforms/form_paragraph.h:
2266 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2269 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2271 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2272 Paragraph-Data after use.
2274 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2275 non breakable paragraphs.
2277 2000-09-25 Garst R. Reese <reese@isn.net>
2279 * src/language.C (initL): added missing language_country codes.
2281 2000-09-25 Juergen Vigna <jug@sad.it>
2283 * src/insets/insettext.C (InsetText):
2284 (deleteLyXText): remove the not released LyXText structure!
2286 2000-09-24 Marko Vendelin <markov@ioc.ee>
2288 * src/frontends/gnome/mainapp.C
2289 * src/frontends/gnome/mainapp.h: added support for keyboard
2292 * src/frontends/gnome/FormCitation.C
2293 * src/frontends/gnome/FormCitation.h
2294 * src/frontends/gnome/Makefile.am
2295 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2296 FormCitation to use "action area" in mainapp window
2298 * src/frontends/gnome/Menubar_pimpl.C
2299 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2302 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2304 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2305 width/descent/ascent values if name is empty.
2306 (mathed_string_height): Use std::max.
2308 2000-09-25 Allan Rae <rae@lyx.org>
2310 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2311 segfault. This will be completely redesigned soon.
2313 * sigc++: updated libsigc++. Fixes struct timespec bug.
2315 * development/tools/makeLyXsigc.sh: .cvsignore addition
2317 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2319 * several files: removed almost all traces of the old table
2322 * src/TableLayout.C: removed file
2324 2000-09-22 Juergen Vigna <jug@sad.it>
2326 * src/frontends/kde/Dialogs.C: added credits forms.
2328 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2330 * src/frontends/gnome/Dialogs.C: added some forms.
2332 * src/spellchecker.C (init_spell_checker): set language in pspell code
2333 (RunSpellChecker): some modifications for setting language string.
2335 * src/language.[Ch]: added language_country code.
2337 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2339 * src/frontends/Dialogs.h: added new signal showError.
2340 Rearranged existing signals in some sort of alphabetical order.
2342 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2343 FormError.[Ch], form_error.[Ch]
2344 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2345 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2347 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2348 dialogs. I think that this can be used as the base to all these
2351 * src/frontends/xforms/FormError.[Ch]
2352 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2353 implementation of InsetError dialog.
2355 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2357 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2358 * src/frontends/kde/Makefile.am: ditto
2360 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2362 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2363 macrobf. This fixes a bug of invisible text.
2365 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2367 * lib/doc/LaTeXConfig.lyx.in: updated.
2369 * src/language.C (initL): remove language "francais" and change a
2370 bit the names of the two other french variations.
2372 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2373 string that may not be 0-terminated.
2375 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2377 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2379 2000-09-20 Marko Vendelin <markov@ioc.ee>
2381 * src/frontends/gnome/FormCitation.C
2382 * src/frontends/gnome/FormIndex.C
2383 * src/frontends/gnome/FormToc.C
2384 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2385 the variable initialization to shut up the warnings
2387 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2389 * src/table.[Ch]: deleted files
2391 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2394 2000-09-18 Juergen Vigna <jug@sad.it>
2396 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2397 problems with selection. Inserted new LFUN_PASTESELECTION.
2398 (InsetButtonPress): inserted handling of middle mouse-button paste.
2400 * src/spellchecker.C: changed word to word.c_str().
2402 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2404 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2405 included in the ``make dist'' tarball.
2407 2000-09-15 Juergen Vigna <jug@sad.it>
2409 * src/CutAndPaste.C (cutSelection): small fix return the right
2410 end position after cut inside one paragraph only.
2412 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2413 we are locked as otherwise we don't have a valid cursor position!
2415 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2417 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2419 * src/frontends/kde/FormRef.C: added using directive.
2420 * src/frontends/kde/FormToc.C: ditto
2422 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2424 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2426 2000-09-19 Marko Vendelin <markov@ioc.ee>
2428 * src/frontends/gnome/Menubar_pimpl.C
2429 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2430 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2432 * src/frontends/gnome/mainapp.C
2433 * src/frontends/gnome/mainapp.h: support for menu update used
2436 * src/frontends/gnome/mainapp.C
2437 * src/frontends/gnome/mainapp.h: support for "action" area in the
2438 main window. This area is used by small simple dialogs, such as
2441 * src/frontends/gnome/FormIndex.C
2442 * src/frontends/gnome/FormIndex.h
2443 * src/frontends/gnome/FormUrl.C
2444 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2447 * src/frontends/gnome/FormCitation.C
2448 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2449 action area. Only "Insert new citation" is implemented.
2451 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2453 * src/buffer.C (Dispatch): fix call to Dispatch
2454 * src/insets/insetref.C (Edit): likewise
2455 * src/insets/insetparent.C (Edit): likewise
2456 * src/insets/insetinclude.C (include_cb): likewise
2457 * src/frontends/xforms/FormUrl.C (apply): likewise
2458 * src/frontends/xforms/FormToc.C (apply): likewise
2459 * src/frontends/xforms/FormRef.C (apply): likewise
2460 * src/frontends/xforms/FormIndex.C (apply): likewise
2461 * src/frontends/xforms/FormCitation.C (apply): likewise
2462 * src/lyxserver.C (callback): likewise
2463 * src/lyxfunc.C (processKeySym): likewise
2464 (Dispatch): likewise
2465 (Dispatch): likewise
2466 * src/lyx_cb.C (LayoutsCB): likewise
2468 * Makefile.am (sourcedoc): small change
2470 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2472 * src/main.C (main): Don't make an empty GUIRunTime object. all
2473 methods are static. constify a bit remove unneded using + headers.
2475 * src/tabular.C: some more const to local vars move some loop vars
2477 * src/spellchecker.C: added some c_str after some word for pspell
2479 * src/frontends/GUIRunTime.h: add new static method setDefaults
2480 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2481 * src/frontends/kde/GUIRunTime.C (setDefaults):
2482 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2484 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2485 with strnew in arg, use correct emptystring when calling SetName.
2487 * several files: remove all commented code with relation to
2488 HAVE_SSTREAM beeing false. We now only support stringstream and
2491 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2493 * src/lyxfunc.C: construct correctly the automatic new file
2496 * src/text2.C (IsStringInText): change type of variable i to shut
2499 * src/support/sstream.h: do not use namespaces if the compiler
2500 does not support them.
2502 2000-09-15 Marko Vendelin <markov@ioc.ee>
2503 * src/frontends/gnome/FormCitation.C
2504 * src/frontends/gnome/FormCitation.h
2505 * src/frontends/gnome/diainsertcitation_interface.c
2506 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2507 regexp support to FormCitation [Gnome].
2509 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2512 * configure.in: remove unused KDE/GTKGUI define
2514 * src/frontends/kde/FormRef.C
2515 * src/frontends/kde/FormRef.h
2516 * src/frontends/kde/formrefdialog.C
2517 * src/frontends/kde/formrefdialog.h: double click will
2518 go to reference, now it is possible to change a cross-ref
2521 * src/frontends/kde/FormToc.C
2522 * src/frontends/kde/FormToc.h
2523 * src/frontends/kde/formtocdialog.C
2524 * src/frontends/kde/formtocdialog.h: add a depth
2527 * src/frontends/kde/Makefile.am: add QtLyXView.h
2530 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2532 * src/frontends/kde/FormCitation.h: added some using directives.
2534 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2536 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2539 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2542 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2544 * src/buffer.C (pop_tag): revert for the second time a change by
2545 Lars, who seems to really hate having non-local loop variables :)
2547 * src/Lsstream.h: add "using" statements.
2549 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2550 * src/buffer.C (writeFile): ditto
2552 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2554 * src/buffer.C (writeFile): try to fix the locale modified format
2555 number to always be as we want it.
2557 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2558 in XForms 0.89. C-space is now working again.
2560 * src/Lsstream.h src/support/sstream.h: new files.
2562 * also commented out all cases where strstream were used.
2564 * src/Bullet.h (c_str): remove method.
2566 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2568 * a lot of files: get rid of "char const *" and "char *" is as
2569 many places as possible. We only want to use them in interaction
2570 with system of other libraries, not inside lyx.
2572 * a lot of files: return const object is not of pod type. This
2573 helps ensure that temporary objects is not modified. And fits well
2574 with "programming by contract".
2576 * configure.in: check for the locale header too
2578 * Makefile.am (sourcedoc): new tag for generation of doc++
2581 2000-09-14 Juergen Vigna <jug@sad.it>
2583 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2584 callback to check which combo called it and do the right action.
2586 * src/combox.C (combo_cb): added combo * to the callbacks.
2587 (Hide): moved call of callback after Ungrab of the pointer.
2589 * src/intl.h: removed LCombo2 function.
2591 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2592 function as this can now be handled in one function.
2594 * src/combox.h: added Combox * to callback prototype.
2596 * src/frontends/xforms/Toolbar_pimpl.C:
2597 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2599 2000-09-14 Garst Reese <reese@isn.net>
2601 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2602 moved usepackage{xxx}'s to beginning of file. Changed left margin
2603 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2604 underlining from title. Thanks to John Culleton for useful suggestions.
2606 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2608 * src/lyxlex_pimpl.C (setFile): change error message to debug
2611 2000-09-13 Juergen Vigna <jug@sad.it>
2613 * src/frontends/xforms/FormDocument.C: implemented choice_class
2614 as combox and give callback to combo_language so OK/Apply is activated
2617 * src/bufferlist.C (newFile): small fix so already named files
2618 (via an open call) are not requested to be named again on the
2621 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2623 * src/frontends/kde/Makefile.am
2624 * src/frontends/kde/FormRef.C
2625 * src/frontends/kde/FormRef.h
2626 * src/frontends/kde/formrefdialog.C
2627 * src/frontends/kde/formrefdialog.h: implement
2630 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2632 * src/frontends/kde/formtocdialog.C
2633 * src/frontends/kde/formtocdialog.h
2634 * src/frontends/kde/FormToc.C
2635 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2637 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2639 * src/frontends/kde/FormCitation.C: fix thinko
2640 where we didn't always display the reference text
2643 * src/frontends/kde/formurldialog.C
2644 * src/frontends/kde/formurldialog.h
2645 * src/frontends/kde/FormUrl.C
2646 * src/frontends/kde/FormUrl.h: minor cleanups
2648 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2650 * src/frontends/kde/Makefile.am
2651 * src/frontends/kde/FormToc.C
2652 * src/frontends/kde/FormToc.h
2653 * src/frontends/kde/FormCitation.C
2654 * src/frontends/kde/FormCitation.h
2655 * src/frontends/kde/FormIndex.C
2656 * src/frontends/kde/FormIndex.h
2657 * src/frontends/kde/formtocdialog.C
2658 * src/frontends/kde/formtocdialog.h
2659 * src/frontends/kde/formcitationdialog.C
2660 * src/frontends/kde/formcitationdialog.h
2661 * src/frontends/kde/formindexdialog.C
2662 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2664 2000-09-12 Juergen Vigna <jug@sad.it>
2666 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2669 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2671 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2674 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2676 * src/converter.C (Add, Convert): Added support for converter flags:
2677 needaux, resultdir, resultfile.
2678 (Convert): Added new parameter view_file.
2679 (dvips_options): Fixed letter paper option.
2681 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2682 (Export, GetExportableFormats, GetViewableFormats): Added support
2685 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2687 (easyParse): Fixed to work with new export code.
2689 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2692 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2694 * lib/bind/*.bind: Replaced
2695 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2696 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2698 2000-09-11 Juergen Vigna <jug@sad.it>
2700 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2702 * src/main.C (main): now GUII defines global guiruntime!
2704 * src/frontends/gnome/GUIRunTime.C (initApplication):
2705 * src/frontends/kde/GUIRunTime.C (initApplication):
2706 * src/frontends/xforms/GUIRunTime.C (initApplication):
2707 * src/frontends/GUIRunTime.h: added new function initApplication.
2709 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2711 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2713 2000-09-08 Juergen Vigna <jug@sad.it>
2715 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2716 we have already "Reset".
2718 * src/language.C (initL): inserted "default" language and made this
2719 THE default language (and not american!)
2721 * src/paragraph.C: inserted handling of "default" language!
2723 * src/lyxfont.C: ditto
2727 * src/paragraph.C: output the \\par only if we have a following
2728 paragraph otherwise it's not needed.
2730 2000-09-05 Juergen Vigna <jug@sad.it>
2732 * config/pspell.m4: added entry to lyx-flags
2734 * src/spellchecker.C: modified version from Kevin for using pspell
2736 2000-09-01 Marko Vendelin <markov@ioc.ee>
2737 * src/frontends/gnome/Makefile.am
2738 * src/frontends/gnome/FormCitation.C
2739 * src/frontends/gnome/FormCitation.h
2740 * src/frontends/gnome/diainsertcitation_callbacks.c
2741 * src/frontends/gnome/diainsertcitation_callbacks.h
2742 * src/frontends/gnome/diainsertcitation_interface.c
2743 * src/frontends/gnome/diainsertcitation_interface.h
2744 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2745 dialog for Gnome frontend
2747 * src/main.C: Gnome libraries require keeping application name
2748 and its version as strings
2750 * src/frontends/gnome/mainapp.C: Change the name of the main window
2751 from GnomeLyX to PACKAGE
2753 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2755 * src/frontends/Liason.C: add "using: declaration.
2757 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2759 * src/mathed/math_macro.C (Metrics): Set the size of the template
2761 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2763 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2765 * src/converter.C (add_options): New function.
2766 (SetViewer): Change $$FName into '$$FName'.
2767 (View): Add options when running xdvi
2768 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2769 (Convert): The 3rd parameter is now the desired filename. Converts
2770 calls to lyx::rename if necessary.
2771 Add options when running dvips.
2772 (dvi_papersize,dvips_options): New methods.
2774 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2776 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2777 using a call to Converter::dvips_options.
2778 Fixed to work with nex export code.
2780 * src/support/copy.C
2781 * src/support/rename.C: New files
2783 * src/support/syscall.h
2784 * src/support/syscall.C: Added Starttype SystemDontWait.
2786 * lib/ui/default.ui: Changed to work with new export code
2788 * lib/configure.m4: Changed to work with new export code
2790 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2792 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2794 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2795 so that code compiles with DEC cxx.
2797 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2798 to work correctly! Also now supports the additional elements
2801 2000-09-01 Allan Rae <rae@lyx.org>
2803 * src/frontends/ButtonPolicies.C: renamed all the references to
2804 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2806 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2807 since it's a const not a type.
2809 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2811 2000-08-31 Juergen Vigna <jug@sad.it>
2813 * src/insets/figinset.C: Various changes to look if the filename has
2814 an extension and if not add it for inline previewing.
2816 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2818 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2819 make buttonStatus and isReadOnly be const methods. (also reflect
2820 this in derived classes.)
2822 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2823 (nextState): change to be static inline, pass the StateMachine as
2825 (PreferencesPolicy): remove casts
2826 (OkCancelPolicy): remvoe casts
2827 (OkCancelReadOnlyPolicy): remove casts
2828 (NoRepeatedApplyReadOnlyPolicy): remove casts
2829 (OkApplyCancelReadOnlyPolicy): remove casts
2830 (OkApplyCancelPolicy): remove casts
2831 (NoRepeatedApplyPolicy): remove casts
2833 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2835 * src/converter.C: added some using directives
2837 * src/frontends/ButtonPolicies.C: changes to overcome
2838 "need lvalue" error with DEC c++
2840 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2841 to WMHideCB for DEC c++
2843 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2845 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2846 to BulletBMTableCB for DEC c++
2848 2000-08-31 Allan Rae <rae@lyx.org>
2850 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2851 character dialog separately from old document dialogs combo_language.
2854 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2856 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2857 Removed LFUN_REF_CREATE.
2859 * src/MenuBackend.C: Added new tags: toc and references
2861 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2862 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2864 (add_toc, add_references): New methods.
2865 (create_submenu): Handle correctly the case when there is a
2866 seperator after optional menu items.
2868 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2869 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2870 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2872 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2874 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2876 * src/converter.[Ch]: New file for converting between different
2879 * src/export.[Ch]: New file for exporting a LyX file to different
2882 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2883 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2884 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2885 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2886 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2887 RunDocBook, MenuExport.
2889 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2890 Exporter::Preview methods if NEW_EXPORT is defined.
2892 * src/buffer.C (Dispatch): Use Exporter::Export.
2894 * src/lyxrc.C: Added new tags: \converter and \viewer.
2897 * src/LyXAction.C: Define new lyx-function: buffer-update.
2898 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2899 when NEW_EXPORT is defined.
2901 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2903 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2905 * lib/ui/default.ui: Added submenus "view" and "update" to the
2908 * src/filetools.C (GetExtension): New function.
2910 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2912 2000-08-29 Allan Rae <rae@lyx.org>
2914 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2916 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2917 (EnableDocumentLayout): removed
2918 (DisableDocumentLayout): removed
2919 (build): make use of ButtonController's read-only handling to
2920 de/activate various objects. Replaces both of the above functions.
2922 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2923 (readOnly): was read_only
2924 (refresh): fixed dumb mistakes with read_only_ handling
2926 * src/frontends/xforms/forms/form_document.fd:
2927 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2928 tabbed dialogs so the tabs look more like tabs and so its easier to
2929 work out which is the current tab.
2931 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2932 segfault with form_table
2934 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2936 2000-08-28 Juergen Vigna <jug@sad.it>
2938 * acconfig.h: added USE_PSPELL.
2940 * src/config.h.in: added USE_PSPELL.
2942 * autogen.sh: added pspell.m4
2944 * config/pspell.m4: new file.
2946 * src/spellchecker.C: implemented support for pspell libary.
2948 2000-08-25 Juergen Vigna <jug@sad.it>
2950 * src/LyXAction.C (init): renamed LFUN_TABLE to
2951 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2953 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2955 * src/lyxscreen.h: add force_clear variable and fuction to force
2956 a clear area when redrawing in LyXText.
2958 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2960 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2962 * some whitespace and comment changes.
2964 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2966 * src/buffer.C: up te LYX_FORMAT to 2.17
2968 2000-08-23 Juergen Vigna <jug@sad.it>
2970 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2973 * src/insets/insettabular.C (pasteSelection): delete the insets
2974 LyXText as it is not valid anymore.
2975 (copySelection): new function.
2976 (pasteSelection): new function.
2977 (cutSelection): new function.
2978 (LocalDispatch): implemented cut/copy/paste of cell selections.
2980 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2981 don't have a LyXText.
2983 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2985 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2988 2000-08-22 Juergen Vigna <jug@sad.it>
2990 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2991 ifdef form_table out if NEW_TABULAR.
2993 2000-08-21 Juergen Vigna <jug@sad.it>
2995 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2996 (draw): fixed draw position so that the cursor is positioned in the
2998 (InsetMotionNotify): hide/show cursor so the position is updated.
2999 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3000 using cellstart() function where it should be used.
3002 * src/insets/insettext.C (draw): ditto.
3004 * src/tabular.C: fixed initialization of some missing variables and
3005 made BoxType into an enum.
3007 2000-08-22 Marko Vendelin <markov@ioc.ee>
3008 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3009 stock menu item using action numerical value, not its string
3013 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3015 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3016 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3018 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3020 * src/frontends/xforms/GUIRunTime.C: new file
3022 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3023 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3025 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3027 * src/frontends/kde/GUIRunTime.C: new file
3029 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3030 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3032 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3034 * src/frontends/gnome/GUIRunTime.C: new file
3036 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3039 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3040 small change to documetentation.
3042 * src/frontends/GUIRunTime.C: removed file
3044 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3046 * src/lyxparagraph.h: enable NEW_TABULAR as default
3048 * src/lyxfunc.C (processKeySym): remove some commented code
3050 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3051 NEW_TABULAR around the fd_form_table_options.
3053 * src/lyx_gui.C (runTime): call the static member function as
3054 GUIRunTime::runTime().
3056 2000-08-21 Allan Rae <rae@lyx.org>
3058 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3061 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3063 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3065 2000-08-21 Allan Rae <rae@lyx.org>
3067 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3068 keep Garst happy ;-)
3069 * src/frontends/xforms/FormPreferences.C (build): use setOK
3070 * src/frontends/xforms/FormDocument.C (build): use setOK
3071 (FormDocument): use the appropriate policy.
3073 2000-08-21 Allan Rae <rae@lyx.org>
3075 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3076 automatic [de]activation of arbitrary objects when in a read-only state.
3078 * src/frontends/ButtonPolicies.h: More documentation
3079 (isReadOnly): added to support the above.
3081 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3083 2000-08-18 Juergen Vigna <jug@sad.it>
3085 * src/insets/insettabular.C (getStatus): changed to return func_status.
3087 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3088 display toggle menu entries if they are.
3090 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3091 new document layout now.
3093 * src/lyxfunc.C: ditto
3095 * src/lyx_gui_misc.C: ditto
3097 * src/lyx_gui.C: ditto
3099 * lib/ui/default.ui: removed paper and quotes layout as they are now
3100 all in the document layout tabbed folder.
3102 * src/frontends/xforms/forms/form_document.fd: added Restore
3103 button and callbacks for all inputs for Allan's ButtonPolicy.
3105 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3106 (CheckChoiceClass): added missing params setting on class change.
3107 (UpdateLayoutDocument): added for updating the layout on params.
3108 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3109 (FormDocument): Implemented Allan's ButtonPolicy with the
3112 2000-08-17 Allan Rae <rae@lyx.org>
3114 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3115 so we can at least see the credits again.
3117 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3118 controller calls for the appropriate callbacks. Note that since Ok
3119 calls apply followed by cancel, and apply isn't a valid input for the
3120 APPLIED state, the bc_ calls have to be made in the static callback not
3121 within each of the real callbacks.
3123 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3124 (setOk): renamed from setOkay()
3126 2000-08-17 Juergen Vigna <jug@sad.it>
3128 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3129 in the implementation part.
3130 (composeUIInfo): don't show optional menu-items.
3132 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3134 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3136 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3137 text-state when in a text-inset.
3139 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3141 2000-08-17 Marko Vendelin <markov@ioc.ee>
3142 * src/frontends/gnome/FormIndex.C
3143 * src/frontends/gnome/FormIndex.h
3144 * src/frontends/gnome/FormToc.C
3145 * src/frontends/gnome/FormToc.h
3146 * src/frontends/gnome/dialogs
3147 * src/frontends/gnome/diatoc_callbacks.c
3148 * src/frontends/gnome/diatoc_callbacks.h
3149 * src/frontends/gnome/diainsertindex_callbacks.h
3150 * src/frontends/gnome/diainsertindex_callbacks.c
3151 * src/frontends/gnome/diainsertindex_interface.c
3152 * src/frontends/gnome/diainsertindex_interface.h
3153 * src/frontends/gnome/diatoc_interface.h
3154 * src/frontends/gnome/diatoc_interface.c
3155 * src/frontends/gnome/Makefile.am: Table of Contents and
3156 Insert Index dialogs implementation for Gnome frontend
3158 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3160 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3162 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3165 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3167 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3168 destructor. Don't definde if you don't need it
3169 (processEvents): made static, non-blocking events processing for
3171 (runTime): static method. event loop for xforms
3172 * similar as above for kde and gnome.
3174 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3175 new Pimpl is correct
3176 (runTime): new method calss the real frontends runtime func.
3178 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3180 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3182 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3184 2000-08-16 Juergen Vigna <jug@sad.it>
3186 * src/lyx_gui.C (runTime): added GUII RunTime support.
3188 * src/frontends/Makefile.am:
3189 * src/frontends/GUIRunTime.[Ch]:
3190 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3191 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3192 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3194 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3196 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3197 as this is already set in ${FRONTEND_INCLUDE} if needed.
3199 * configure.in (CPPFLAGS): setting the include dir for the frontend
3200 directory and don't set FRONTEND=xforms for now as this is executed
3203 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3205 * src/frontends/kde/Makefile.am:
3206 * src/frontends/kde/FormUrl.C:
3207 * src/frontends/kde/FormUrl.h:
3208 * src/frontends/kde/formurldialog.h:
3209 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3211 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3213 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3215 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3217 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3220 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3222 * src/WorkArea.C (work_area_handler): more work to get te
3223 FL_KEYBOARD to work with xforms 0.88 too, please test.
3225 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3227 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3229 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3232 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3234 * src/Timeout.h: remove Qt::emit hack.
3236 * several files: changes to allo doc++ compilation
3238 * src/lyxfunc.C (processKeySym): new method
3239 (processKeyEvent): comment out if FL_REVISION < 89
3241 * src/WorkArea.C: change some debugging levels.
3242 (WorkArea): set wantkey to FL_KEY_ALL
3243 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3244 clearer code and the use of compose with XForms 0.89. Change to
3245 use signals instead of calling methods in bufferview directly.
3247 * src/Painter.C: change some debugging levels.
3249 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3252 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3253 (workAreaKeyPress): new method
3255 2000-08-14 Juergen Vigna <jug@sad.it>
3257 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3259 * config/kde.m4: addes some features
3261 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3262 include missing xforms dialogs.
3264 * src/Timeout.h: a hack to be able to compile with qt/kde.
3266 * sigc++/.cvsignore: added acinclude.m4
3268 * lib/.cvsignore: added listerros
3270 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3271 xforms tree as objects are needed for other frontends.
3273 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3274 linking with not yet implemented xforms objects.
3276 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3278 2000-08-14 Baruch Even <baruch.even@writeme.com>
3280 * src/frontends/xforms/FormGraphics.h:
3281 * src/frontends/xforms/FormGraphics.C:
3282 * src/frontends/xforms/RadioButtonGroup.h:
3283 * src/frontends/xforms/RadioButtonGroup.C:
3284 * src/insets/insetgraphics.h:
3285 * src/insets/insetgraphics.C:
3286 * src/insets/insetgraphicsParams.h:
3287 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3288 instead of spaces, and various other indentation issues to make the
3289 sources more consistent.
3291 2000-08-14 Marko Vendelin <markov@ioc.ee>
3293 * src/frontends/gnome/dialogs/diaprint.glade
3294 * src/frontends/gnome/FormPrint.C
3295 * src/frontends/gnome/FormPrint.h
3296 * src/frontends/gnome/diaprint_callbacks.c
3297 * src/frontends/gnome/diaprint_callbacks.h
3298 * src/frontends/gnome/diaprint_interface.c
3299 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3302 * src/frontends/gnome/dialogs/diainserturl.glade
3303 * src/frontends/gnome/FormUrl.C
3304 * src/frontends/gnome/FormUrl.h
3305 * src/frontends/gnome/diainserturl_callbacks.c
3306 * src/frontends/gnome/diainserturl_callbacks.h
3307 * src/frontends/gnome/diainserturl_interface.c
3308 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3309 Gnome implementation
3311 * src/frontends/gnome/Dialogs.C
3312 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3313 all other dialogs. Copy all unimplemented dialogs from Xforms
3316 * src/frontends/gnome/support.c
3317 * src/frontends/gnome/support.h: support files generated by Glade
3321 * config/gnome.m4: Gnome configuration scripts
3323 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3324 configure --help message
3326 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3327 only if there are no events pendling in Gnome/Gtk. This enhances
3328 the performance of menus.
3331 2000-08-14 Allan Rae <rae@lyx.org>
3333 * lib/Makefile.am: listerrors cleaning
3335 * lib/listerrors: removed -- generated file
3336 * acinclude.m4: ditto
3337 * sigc++/acinclude.m4: ditto
3339 * src/frontends/xforms/forms/form_citation.fd:
3340 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3343 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3344 `updatesrc` and now we have a `test` target that does what `updatesrc`
3345 used to do. I didn't like having an install target that wasn't related
3348 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3349 on all except FormGraphics. This may yet happen. Followed by a major
3350 cleanup including using FL_TRANSIENT for most of the dialogs. More
3351 changes to come when the ButtonController below is introduced.
3353 * src/frontends/xforms/ButtonController.h: New file for managing up to
3354 four buttons on a dialog according to an externally defined policy.
3355 * src/frontends/xforms/Makefile.am: added above
3357 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3358 Apply and Cancel/Close buttons and everything in between and beyond.
3359 * src/frontends/Makefile.am: added above.
3361 * src/frontends/xforms/forms/form_preferences.fd:
3362 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3363 and removed variable 'status' as a result. Fixed the set_minsize thing.
3364 Use the new screen-font-update after checking screen fonts were changed
3365 Added a "Restore" button to restore the original lyxrc values while
3366 editing. This restores everything not just the last input changed.
3367 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3369 * src/LyXAction.C: screen-font-update added for updating buffers after
3370 screen font settings have been changed.
3371 * src/commandtags.h: ditto
3372 * src/lyxfunc.C: ditto
3374 * forms/lyx.fd: removed screen fonts dialog.
3375 * src/lyx_gui.C: ditto
3376 * src/menus.[Ch]: ditto
3377 * src/lyx.[Ch]: ditto
3378 * src/lyx_cb.C: ditto + code from here moved to make
3379 screen-font-update. And people wonder why progress on GUII is
3380 slow. Look at how scattered this stuff was! It takes forever
3383 * forms/fdfix.sh: Fixup the spacing after commas.
3384 * forms/makefile: Remove date from generated files. Fewer clashes now.
3385 * forms/bullet_forms.C.patch: included someones handwritten changes
3387 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3388 once I've discovered why LyXRC was made noncopyable.
3389 * src/lyx_main.C: ditto
3391 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3393 * src/frontends/xforms/forms/fdfix.sh:
3394 * src/frontends/xforms/forms/fdfixh.sed:
3395 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3396 * src/frontends/xforms/Form*.[hC]:
3397 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3398 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3399 provide a destructor for the struct FD_form_xxxx. Another version of
3400 the set_[max|min]size workaround and a few other cleanups. Actually,
3401 Angus' patch from 20000809.
3403 2000-08-13 Baruch Even <baruch.even@writeme.com>
3405 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3408 2000-08-11 Juergen Vigna <jug@sad.it>
3410 * src/insets/insetgraphics.C (InsetGraphics): changing init
3411 order because of warnings.
3413 * src/frontends/xforms/forms/makefile: adding patching .C with
3416 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3417 from .C.patch to .c.patch
3419 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3420 order because of warning.
3422 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3424 * src/frontends/Liason.C (setMinibuffer): new helper function
3426 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3428 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3430 * lib/ui/default.ui: commented out PaperLayout entry
3432 * src/frontends/xforms/form_document.[Ch]: new added files
3434 * src/frontends/xforms/FormDocument.[Ch]: ditto
3436 * src/frontends/xforms/forms/form_document.fd: ditto
3438 * src/frontends/xforms/forms/form_document.C.patch: ditto
3440 2000-08-10 Juergen Vigna <jug@sad.it>
3442 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3443 (InsetGraphics): initialized cacheHandle to 0.
3444 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3446 2000-08-10 Baruch Even <baruch.even@writeme.com>
3448 * src/graphics/GraphicsCache.h:
3449 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3450 correctly as a cache.
3452 * src/graphics/GraphicsCacheItem.h:
3453 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3456 * src/graphics/GraphicsCacheItem_pimpl.h:
3457 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3460 * src/insets/insetgraphics.h:
3461 * src/insets/insetgraphics.C: Changed from using a signal notification
3462 to polling when image is not loaded.
3464 2000-08-10 Allan Rae <rae@lyx.org>
3466 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3467 that there are two functions that have to been taken out of line by
3468 hand and aren't taken care of in the script. (Just a reminder note)
3470 * sigc++/macros/*.h.m4: Updated as above.
3472 2000-08-09 Juergen Vigna <jug@sad.it>
3474 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3476 * src/insets/insettabular.C: make drawing of single cell smarter.
3478 2000-08-09 Marko Vendelin <markov@ioc.ee>
3479 * src/frontends/gnome/Menubar_pimpl.C
3480 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3481 implementation: new files
3483 * src/frontends/gnome/mainapp.C
3484 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3487 * src/main.C: create Gnome main window
3489 * src/frontends/xforms/Menubar_pimpl.h
3490 * src/frontends/Menubar.C
3491 * src/frontends/Menubar.h: added method Menubar::update that calls
3492 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3494 * src/LyXView.C: calls Menubar::update to update the state
3497 * src/frontends/gnome/Makefile.am: added new files
3499 * src/frontends/Makefile.am: added frontend compiler options
3501 2000-08-08 Juergen Vigna <jug@sad.it>
3503 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3505 * src/bufferlist.C (close):
3506 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3507 documents if exiting without saving.
3509 * src/buffer.C (save): use removeAutosaveFile()
3511 * src/support/filetools.C (removeAutosaveFile): new function.
3513 * src/lyx_cb.C (MenuWrite): returns a bool now.
3514 (MenuWriteAs): check if file could really be saved and revert to the
3516 (MenuWriteAs): removing old autosavefile if existant.
3518 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3519 before Goto toggle declaration, because of compiler warning.
3521 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3523 * src/lyxfunc.C (MenuNew): small fix.
3525 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3527 * src/bufferlist.C (newFile):
3528 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3530 * src/lyxrc.C: added new_ask_filename tag
3532 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3534 * src/lyx.fd: removed code pertaining to form_ref
3535 * src/lyx.[Ch]: ditto
3536 * src/lyx_cb.C: ditto
3537 * src/lyx_gui.C: ditto
3538 * src/lyx_gui_misc.C: ditto
3540 * src/BufferView_pimpl.C (restorePosition): update buffer only
3543 * src/commandtags.h (LFUN_REFTOGGLE): removed
3544 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3545 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3546 (LFUN_REFBACK): renamed LFUN_REF_BACK
3548 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3549 * src/menus.C: ditto
3550 * src/lyxfunc.C (Dispatch): ditto.
3551 InsertRef dialog is now GUI-independent.
3553 * src/texrow.C: added using std::endl;
3555 * src/insets/insetref.[Ch]: strip out large amounts of code.
3556 The inset is now a container and this functionality is now
3557 managed by a new FormRef dialog
3559 * src/frontends/Dialogs.h (showRef, createRef): new signals
3561 * src/frontends/xforms/FormIndex.[Ch],
3562 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3563 when setting dialog's min/max size
3564 * src/frontends/xforms/FormIndex.[Ch]: ditto
3566 * src/frontends/xforms/FormRef.[Ch],
3567 src/frontends/xforms/forms/form_ref.fd: new xforms
3568 implementation of an InsetRef dialog
3570 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3573 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3574 ios::nocreate is not part of the standard. Removed.
3576 2000-08-07 Baruch Even <baruch.even@writeme.com>
3578 * src/graphics/Renderer.h:
3579 * src/graphics/Renderer.C: Added base class for rendering of different
3580 image formats into Pixmaps.
3582 * src/graphics/XPM_Renderer.h:
3583 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3584 in a different class.
3586 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3587 easily add support for other formats.
3589 * src/insets/figinset.C: plugged a leak of an X resource.
3591 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3593 * src/CutAndPaste.[Ch]: make all metods static.
3595 * development/Code_rules/Rules: more work, added section on
3596 Exceptions, and a References section.
3598 * a lot of header files: work to make doc++ able to generate the
3599 source documentation, some workarounds of doc++ problems. Doc++ is
3600 now able to generate the documentation.
3602 2000-08-07 Juergen Vigna <jug@sad.it>
3604 * src/insets/insettabular.C (recomputeTextInsets): removed function
3606 * src/tabular.C (SetWidthOfMulticolCell):
3608 (calculate_width_of_column_NMC): fixed return value so that it really
3609 only returns true if the column-width has changed (there where
3610 problems with muliticolumn-cells in this column).
3612 2000-08-04 Juergen Vigna <jug@sad.it>
3614 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3615 also on the scrollstatus of the inset.
3616 (workAreaMotionNotify): ditto.
3618 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3620 2000-08-01 Juergen Vigna <jug@sad.it>
3622 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3624 * src/commandtags.h:
3625 * src/LyXAction.C (init):
3626 * src/insets/inset.C (LocalDispatch): added support for
3629 * src/insets/inset.C (scroll): new functions.
3631 * src/insets/insettext.C (removeNewlines): new function.
3632 (SetAutoBreakRows): removes forced newlines in the text of the
3633 paragraph if autoBreakRows is set to false.
3635 * src/tabular.C (Latex): generates a parbox around the cell contents
3638 * src/frontends/xforms/FormTabular.C (local_update): removed
3639 the radio_useparbox button.
3641 * src/tabular.C (UseParbox): new function
3643 2000-08-06 Baruch Even <baruch.even@writeme.com>
3645 * src/graphics/GraphicsCache.h:
3646 * src/graphics/GraphicsCache.C:
3647 * src/graphics/GraphicsCacheItem.h:
3648 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3651 * src/insets/insetgraphics.h:
3652 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3653 and the drawing of the inline image.
3655 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3656 loaded into the wrong position.
3658 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3661 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3663 * src/support/translator.h: move all typedefs to public section
3665 * src/support/filetools.C (MakeLatexName): return string const
3667 (TmpFileName): ditto
3668 (FileOpenSearch): ditto
3670 (LibFileSearch): ditto
3671 (i18nLibFileSearch): ditto
3674 (CreateTmpDir): ditto
3675 (CreateBufferTmpDir): ditto
3676 (CreateLyXTmpDir): ditto
3679 (MakeAbsPath): ditto
3681 (OnlyFilename): ditto
3683 (NormalizePath): ditto
3684 (CleanupPath): ditto
3685 (GetFileContents): ditto
3686 (ReplaceEnvironmentPath): ditto
3687 (MakeRelPath): ditto
3689 (ChangeExtension): ditto
3690 (MakeDisplayPath): ditto
3691 (do_popen): return cmdret const
3692 (findtexfile): return string const
3694 * src/support/DebugStream.h: add some /// to please doc++
3696 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3698 * src/texrow.C (same_rownumber): functor to use with find_if
3699 (getIdFromRow): rewritten to use find_if and to not update the
3700 positions. return true if row is found
3701 (increasePos): new method, use to update positions
3703 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3705 * src/lyxlex_pimpl.C (verifyTable): new method
3708 (GetString): return string const
3709 (pushTable): rewrite to use std::stack
3711 (setFile): better check
3714 * src/lyxlex.h: make LyXLex noncopyable
3716 * src/lyxlex.C (text): return char const * const
3717 (GetString): return string const
3718 (getLongString): return string const
3720 * src/lyx_gui_misc.C (askForText): return pair<...> const
3722 * src/lastfiles.[Ch] (operator): return string const
3724 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3725 istringstream not char const *.
3726 move token.end() out of loop.
3727 (readFile): move initializaton of token
3729 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3730 getIdFromRow is successful.
3732 * lib/bind/emacs.bind: don't include menus bind
3734 * development/Code_rules/Rules: the beginnings of making this
3735 better and covering more of the unwritten rules that we have.
3737 * development/Code_rules/Recommendations: a couple of wording
3740 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3742 * src/support/strerror.c: remove C++ comment.
3744 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3746 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3747 LFUN_INDEX_INSERT_LAST
3749 * src/texrow.C (getIdFromRow): changed from const_iterator to
3750 iterator, allowing code to compile with DEC cxx
3752 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3753 stores part of the class, as suggested by Allan. Will allow
3755 (apply): test to apply uses InsetCommandParams operator!=
3757 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3758 (apply): test to apply uses InsetCommandParams operator!=
3760 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3761 stores part of the class.
3762 (update): removed limits on min/max size.
3764 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3765 (apply): test to apply uses InsetCommandParams operator!=
3767 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3768 (Read, Write, scanCommand, getCommand): moved functionality
3769 into InsetCommandParams.
3771 (getScreenLabel): made pure virtual
3772 new InsetCommandParams operators== and !=
3774 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3775 c-tors based on InsetCommandParams. Removed others.
3776 * src/insets/insetinclude.[Ch]: ditto
3777 * src/insets/insetlabel.[Ch]: ditto
3778 * src/insets/insetparent.[Ch]: ditto
3779 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3781 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3782 insets derived from InsetCommand created using similar c-tors
3783 based on InsetCommandParams
3784 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3785 * src/menus.C (ShowRefsMenu): ditto
3786 * src/paragraph.C (Clone): ditto
3787 * src/text2.C (SetCounter): ditto
3788 * src/lyxfunc.C (Dispatch) ditto
3789 Also recreated old InsetIndex behaviour exactly. Can now
3790 index-insert at the start of a paragraph and index-insert-last
3791 without launching the pop-up.
3793 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3795 * lib/lyxrc.example: mark te pdf options as non functional.
3797 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3798 (isStrDbl): move tmpstr.end() out of loop.
3799 (strToDbl): move intialization of tmpstr
3800 (lowercase): return string const and move tmp.end() out of loop.
3801 (uppercase): return string const and move tmp.edn() out of loop.
3802 (prefixIs): add assertion
3807 (containsOnly): ditto
3808 (containsOnly): ditto
3809 (containsOnly): ditto
3810 (countChar): make last arg char not char const
3811 (token): return string const
3812 (subst): return string const, move tmp.end() out of loop.
3813 (subst): return string const, add assertion
3814 (strip): return string const
3815 (frontStrip): return string const, add assertion
3816 (frontStrip): return string const
3821 * src/support/lstrings.C: add inclde "LAssert.h"
3822 (isStrInt): move tmpstr.end() out of loop.
3824 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3825 toollist.end() out of loop.
3826 (deactivate): move toollist.end() out of loop.
3827 (update): move toollist.end() out of loop.
3828 (updateLayoutList): move tc.end() out of loop.
3829 (add): move toollist.end() out of loop.
3831 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3832 md.end() out of loop.
3834 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3836 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3839 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3840 (Erase): move insetlist.end() out of loop.
3842 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3843 ref to const string as first arg. Move initialization of some
3844 variables, whitespace changes.
3846 * src/kbmap.C (defkey): move table.end() out of loop.
3847 (kb_keymap): move table.end() out of loop.
3848 (findbinding): move table.end() out of loop.
3850 * src/MenuBackend.C (hasMenu): move end() out of loop.
3851 (getMenu): move end() out of loop.
3852 (getMenu): move menulist_.end() out of loop.
3854 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3856 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3859 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3860 (getFromLyXName): move infotab.end() out of loop.
3862 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3863 -fvtable-thunks -ffunction-sections -fdata-sections
3865 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3867 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3870 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3872 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3874 * src/frontends/xforms/FormCitation.[Ch],
3875 src/frontends/xforms/FormIndex.[Ch],
3876 src/frontends/xforms/FormToc.[Ch],
3877 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3879 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3881 * src/commandtags.h: renamed, created some flags for citation
3884 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3886 * src/lyxfunc.C (dispatch): use signals to insert index entry
3888 * src/frontends/Dialogs.h: new signal createIndex
3890 * src/frontends/xforms/FormCommand.[Ch],
3891 src/frontends/xforms/FormCitation.[Ch],
3892 src/frontends/xforms/FormToc.[Ch],
3893 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3895 * src/insets/insetindex.[Ch]: GUI-independent
3897 * src/frontends/xforms/FormIndex.[Ch],
3898 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3901 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3903 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3904 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3906 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3908 * src/insets/insetref.C (Latex): rewrite so that there is now
3909 question that a initialization is requested.
3911 * src/insets/insetcommand.h: reenable the hide signal
3913 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3915 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3916 fix handling of shortcuts (many bugs :)
3917 (add_lastfiles): ditto.
3919 * lib/ui/default.ui: fix a few shortcuts.
3921 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3923 * Makefile.am: Fix ``rpmdist'' target to return the exit
3924 status of the ``rpm'' command, instead of the last command in
3925 the chain (the ``rm lyx.xpm'' command, which always returns
3928 2000-08-02 Allan Rae <rae@lyx.org>
3930 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3931 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3932 * src/frontends/xforms/FormToc.C (FormToc): ditto
3934 * src/frontends/xforms/Makefile.am: A few forgotten files
3936 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3937 Signals-not-copyable-problem Lars' started commenting out.
3939 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3941 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3943 * src/insets/insetcommand.h: Signals is not copyable so anoter
3944 scheme for automatic hiding of forms must be used.
3946 * src/frontends/xforms/FormCitation.h: don't inerit from
3947 noncopyable, FormCommand already does that.
3948 * src/frontends/xforms/FormToc.h: ditto
3949 * src/frontends/xforms/FormUrl.h: ditto
3951 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3953 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3955 * src/insets/insetcommand.h (hide): new SigC::Signal0
3956 (d-tor) new virtual destructor emits hide signal
3958 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3959 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3961 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3962 LOF and LOT. Inset is now GUI-independent
3964 * src/insets/insetloa.[Ch]: redundant
3965 * src/insets/insetlof.[Ch]: ditto
3966 * src/insets/insetlot.[Ch]: ditto
3968 * src/frontends/xforms/forms/form_url.fd: tweaked!
3969 * src/frontends/xforms/forms/form_citation.fd: ditto
3971 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3972 dialogs dealing with InsetCommand insets
3974 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3975 FormCommand base class
3976 * src/frontends/xforms/FormUrl.[Ch]: ditto
3978 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3980 * src/frontends/xforms/FormToc.[Ch]: ditto
3982 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3983 passed a generic InsetCommand pointer
3984 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3986 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3987 and modified InsetTOC class
3988 * src/buffer.C: ditto
3990 * forms/lyx.fd: strip out old FD_form_toc code
3991 * src/lyx_gui_misc.C: ditto
3992 * src/lyx_gui.C: ditto
3993 * src/lyx_cb.C: ditto
3994 * src/lyx.[Ch]: ditto
3996 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3998 * src/support/utility.hpp: tr -d '\r'
4000 2000-08-01 Juergen Vigna <jug@sad.it>
4002 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4004 * src/commandtags.h:
4005 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4006 LFUN_TABULAR_FEATURES.
4008 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4009 LFUN_LAYOUT_TABULAR.
4011 * src/insets/insettabular.C (getStatus): implemented helper function.
4013 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4015 2000-07-31 Juergen Vigna <jug@sad.it>
4017 * src/text.C (draw): fixed screen update problem for text-insets.
4019 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4020 something changed probably this has to be added in various other
4023 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4025 2000-07-31 Baruch Even <baruch.even@writeme.com>
4027 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4028 templates to satisfy compaq cxx.
4031 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4033 * src/support/translator.h (equal_1st_in_pair::operator()): take
4034 const ref pair_type as arg.
4035 (equal_2nd_in_pair::operator()): ditto
4036 (Translator::~Translator): remove empty d-tor.
4038 * src/graphics/GraphicsCache.C: move include config.h to top, also
4039 put initialization of GraphicsCache::singleton here.
4040 (~GraphicsCache): move here
4041 (addFile): take const ref as arg
4044 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4046 * src/BufferView2.C (insertLyXFile): change te with/without header
4049 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4051 * src/frontends/xforms/FormGraphics.C (apply): add some
4052 static_cast. Not very nice, but required by compaq cxx.
4054 * src/frontends/xforms/RadioButtonGroup.h: include header
4055 <utility> instead of <pair.h>
4057 * src/insets/insetgraphicsParams.C: add using directive.
4058 (readResize): change return type to void.
4059 (readOrigin): ditto.
4061 * src/lyxfunc.C (getStatus): add missing break for build-program
4062 function; add test for Literate for export functions.
4064 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4065 entries in Options menu.
4067 2000-07-31 Baruch Even <baruch.even@writeme.com>
4069 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4070 protect against auto-allocation; release icon when needed.
4072 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4074 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4075 on usual typewriter.
4077 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4078 earlier czech.kmap), useful only for programming.
4080 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4082 * src/frontends/xforms/FormCitation.h: fix conditioning around
4085 2000-07-31 Juergen Vigna <jug@sad.it>
4087 * src/frontends/xforms/FormTabular.C (local_update): changed
4088 radio_linebreaks to radio_useparbox and added radio_useminipage.
4090 * src/tabular.C: made support for using minipages/parboxes.
4092 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4094 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4096 (descent): so the cursor is in the middle.
4097 (width): bit smaller box.
4099 * src/insets/insetgraphics.h: added display() function.
4101 2000-07-31 Baruch Even <baruch.even@writeme.com>
4103 * src/frontends/Dialogs.h: Added showGraphics signals.
4105 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4106 xforms form definition of the graphics dialog.
4108 * src/frontends/xforms/FormGraphics.h:
4109 * src/frontends/xforms/FormGraphics.C: Added files, the
4110 GUIndependent code of InsetGraphics
4112 * src/insets/insetgraphics.h:
4113 * src/insets/insetgraphics.C: Major writing to make it work.
4115 * src/insets/insetgraphicsParams.h:
4116 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4117 struct between InsetGraphics and GUI.
4119 * src/LaTeXFeatures.h:
4120 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4121 support for graphicx package.
4123 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4124 for the graphics inset.
4126 * src/support/translator.h: Added file, used in
4127 InsetGraphicsParams. this is a template to translate between two
4130 * src/frontends/xforms/RadioButtonGroup.h:
4131 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4132 way to easily control a radio button group.
4134 2000-07-28 Juergen Vigna <jug@sad.it>
4136 * src/insets/insettabular.C (LocalDispatch):
4137 (TabularFeatures): added support for lyx-functions of tabular features.
4138 (cellstart): refixed this function after someone wrongly changed it.
4140 * src/commandtags.h:
4141 * src/LyXAction.C (init): added support for tabular-features
4143 2000-07-28 Allan Rae <rae@lyx.org>
4145 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4146 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4147 triggers the callback for input checking. As a result we sometimes get
4148 "LyX: This shouldn't happen..." printed to cerr.
4149 (input): Started using status variable since I only free() on
4150 destruction. Some input checking for paths and font sizes.
4152 * src/frontends/xforms/FormPreferences.h: Use status to control
4153 activation of Ok and Apply
4155 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4156 callback. Also resized to stop segfaults with 0.88. The problem is
4157 that xforms-0.88 requires the folder to be wide enough to fit all the
4158 tabs. If it isn't it causes all sorts of problems.
4160 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4162 * src/frontends/xforms/forms/README: Reflect reality.
4164 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4165 * src/frontends/xforms/forms/makefile: ditto.
4167 * src/commandtags.h: Get access to new Preferences dialog
4168 * src/LyXAction.C: ditto
4169 * src/lyxfunc.C: ditto
4170 * lib/ui/default.ui: ditto
4172 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4174 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4176 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4179 * src/frontends/xforms/form_url.[Ch]: added.
4181 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4183 * src/insets/insetbib.h: fixed bug in previous commit
4185 * src/frontends/xforms/FormUrl.h: ditto
4187 * src/frontends/xforms/FormPrint.h: ditto
4189 * src/frontends/xforms/FormPreferences.h: ditto
4191 * src/frontends/xforms/FormCopyright.h: ditto
4193 * src/frontends/xforms/FormCitation.C: ditto
4195 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4196 private copyconstructor and private default contructor
4198 * src/support/Makefile.am: add utility.hpp
4200 * src/support/utility.hpp: new file from boost
4202 * src/insets/insetbib.h: set owner in clone
4204 * src/frontends/xforms/FormCitation.C: added missing include
4207 * src/insets/form_url.[Ch]: removed
4209 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4211 * development/lyx.spec.in
4212 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4213 file/directory re-organization.
4215 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4217 * src/insets/insetcommand.[Ch]: moved the string data and
4218 associated manipulation methods into a new stand-alone class
4219 InsetCommandParams. This class has two additional methods
4220 getAsString() and setFromString() allowing the contents to be
4221 moved around as a single string.
4222 (addContents) method removed.
4223 (setContents) method no longer virtual.
4225 * src/buffer.C (readInset): made use of new InsetCitation,
4226 InsetUrl constructors based on InsetCommandParams.
4228 * src/commandtags.h: add LFUN_INSERT_URL
4230 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4231 independent InsetUrl and use InsetCommandParams to extract
4232 string info and create new Insets.
4234 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4236 * src/frontends/xforms/FormCitation.C (apply): uses
4239 * src/frontends/xforms/form_url.C
4240 * src/frontends/xforms/form_url.h
4241 * src/frontends/xforms/FormUrl.h
4242 * src/frontends/xforms/FormUrl.C
4243 * src/frontends/xforms/forms/form_url.fd: new files
4245 * src/insets/insetcite.[Ch]: removed unused constructors.
4247 * src/insets/insetinclude.[Ch]: no longer store filename
4249 * src/insets/inseturl.[Ch]: GUI-independent.
4251 2000-07-26 Juergen Vigna <jug@sad.it>
4252 * renamed frontend from gtk to gnome as it is that what is realized
4253 and did the necessary changes in the files.
4255 2000-07-26 Marko Vendelin <markov@ioc.ee>
4257 * configure.in: cleaning up gnome configuration scripts
4259 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4261 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4262 shortcuts syndrom by redrawing them explicitely (a better solution
4263 would be appreciated).
4265 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4267 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4270 * src/lyx_cb.C (MenuExport): change html export to do the right
4271 thing depending of the document type (instead of having
4272 html-linuxdoc and html-docbook).
4273 * src/lyxfunc.C (getStatus): update for html
4274 * lib/ui/default.ui: simplify due to the above change.
4275 * src/menus.C (ShowFileMenu): update too (in case we need it).
4277 * src/MenuBackend.C (read): if a menu is defined twice, add the
4278 new entries to the exiting one.
4280 2000-07-26 Juergen Vigna <jug@sad.it>
4282 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4284 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4285 and return a bool if it did actual save the file.
4286 (AutoSave): don't autosave a unnamed doc.
4288 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4289 check if this is an UNNAMED new file and react to it.
4290 (newFile): set buffer to unnamed and change to not mark a new
4291 buffer dirty if I didn't do anything with it.
4293 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4295 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4297 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4298 friend as per Angus's patch posted to lyx-devel.
4300 * src/ext_l10n.h: updated
4302 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4303 gettext on the style string right before inserting them into the
4306 * autogen.sh: add code to extract style strings form layout files,
4307 not good enough yet.
4309 * src/frontends/gtk/.cvsignore: add MAKEFILE
4311 * src/MenuBackend.C (read): run the label strings through gettext
4312 before storing them in the containers.
4314 * src/ext_l10n.h: new file
4316 * autogen.sh : generate the ext_l10n.h file here
4318 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4320 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4323 * lib/ui/default.ui: fix a couple of typos.
4325 * config/gnome/gtk.m4: added (and added to the list of files in
4328 * src/insets/insetinclude.C (unique_id): fix when we are using
4329 lyxstring instead of basic_string<>.
4330 * src/insets/insettext.C (LocalDispatch): ditto.
4331 * src/support/filetools.C: ditto.
4333 * lib/configure.m4: create the ui/ directory if necessary.
4335 * src/LyXView.[Ch] (updateToolbar): new method.
4337 * src/BufferView_pimpl.C (buffer): update the toolbar when
4338 opening/closing buffer.
4340 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4342 * src/LyXAction.C (getActionName): enhance to return also the name
4343 and options of pseudo-actions.
4344 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4346 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4347 as an example of what is possible). Used in File->Build too (more
4348 useful) and in the import/export menus (to mimick the complicated
4349 handling of linuxdoc and friends). Try to update all the entries.
4351 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4354 * src/MenuBackend.C (read): Parse the new OptItem tag.
4356 * src/MenuBackend.h: Add a new optional_ data member (used if the
4357 entry should be omitted when the lyxfunc is disabled).
4359 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4360 function, used as a shortcut.
4361 (create_submenu): align correctly the shortcuts on the widest
4364 * src/MenuBackend.h: MenuItem.label() only returns the label of
4365 the menu without shortcut; new method shortcut().
4367 2000-07-14 Marko Vendelin <markov@ioc.ee>
4369 * src/frontends/gtk/Dialogs.C:
4370 * src/frontends/gtk/FormCopyright.C:
4371 * src/frontends/gtk/FormCopyright.h:
4372 * src/frontends/gtk/Makefile.am: added these source-files for the
4373 Gtk/Gnome support of the Copyright-Dialog.
4375 * src/main.C: added Gnome::Main initialization if using
4376 Gtk/Gnome frontend-GUI.
4378 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4380 * config/gnome/aclocal-include.m4
4381 * config/gnome/compiler-flags.m4
4382 * config/gnome/curses.m4
4383 * config/gnome/gnome--.m4
4384 * config/gnome/gnome-bonobo-check.m4
4385 * config/gnome/gnome-common.m4
4386 * config/gnome/gnome-fileutils.m4
4387 * config/gnome/gnome-ghttp-check.m4
4388 * config/gnome/gnome-gnorba-check.m4
4389 * config/gnome/gnome-guile-checks.m4
4390 * config/gnome/gnome-libgtop-check.m4
4391 * config/gnome/gnome-objc-checks.m4
4392 * config/gnome/gnome-orbit-check.m4
4393 * config/gnome/gnome-print-check.m4
4394 * config/gnome/gnome-pthread-check.m4
4395 * config/gnome/gnome-support.m4
4396 * config/gnome/gnome-undelfs.m4
4397 * config/gnome/gnome-vfs.m4
4398 * config/gnome/gnome-x-checks.m4
4399 * config/gnome/gnome-xml-check.m4
4400 * config/gnome/gnome.m4
4401 * config/gnome/gperf-check.m4
4402 * config/gnome/gtk--.m4
4403 * config/gnome/linger.m4
4404 * config/gnome/need-declaration.m4: added configuration scripts
4405 for Gtk/Gnome frontend-GUI
4407 * configure.in: added support for the --with-frontend=gtk option
4409 * autogen.sh: added config/gnome/* to list of config-files
4411 * acconfig.h: added define for GTKGUI-support
4413 * config/lyxinclude.m4: added --with-frontend[=value] option value
4414 for Gtk/Gnome frontend-GUI support.
4416 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4418 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4422 * src/paragraph.C (GetChar): remove non-const version
4424 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4425 (search_kw): use it.
4427 * src/lyx_main.C (init): if "preferences" exist, read that instead
4429 (ReadRcFile): return bool if the file could be read ok.
4430 (ReadUIFile): add a check to see if lex file is set ok.
4432 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4433 bastring can be used instead of lyxstring (still uses the old code
4434 if std::string is good enough or if lyxstring is used.)
4436 * src/encoding.C: make the arrays static, move ininle functions
4438 * src/encoding.h: from here.
4440 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4441 (parseSingleLyXformat2Token): move inset parsing to separate method
4442 (readInset): new private method
4444 * src/Variables.h: remove virtual from get().
4446 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4447 access to NEW_INSETS and NEW_TABULAR
4449 * src/MenuBackend.h: remove superfluous forward declaration of
4450 MenuItem. Add documentations tags "///", remove empty MenuItem
4451 destructor, remove private default contructor.
4453 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4455 (read): more string mlabel and mname to where they are used
4456 (read): remove unused variables mlabel and mname
4457 (defaults): unconditional clear, make menusetup take advantage of
4458 add returning Menu &.
4460 * src/LyXView.h: define NEW_MENUBAR as default
4462 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4463 to NEW_INSETS and NEW_TABULAR.
4464 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4465 defined. Change some of the "xxxx-inset-insert" functions names to
4468 * several files: more enahncements to NEW_INSETS and the resulting
4471 * lib/lyxrc.example (\date_insert_format): move to misc section
4473 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4474 bastring and use AC_CACHE_CHECK.
4475 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4476 the system have the newest methods. uses AC_CACHE_CHECK
4477 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4478 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4479 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4481 * configure.in: add LYX_CXX_GOOD_STD_STRING
4483 * acinclude.m4: recreated
4485 2000-07-24 Amir Karger <karger@lyx.org>
4487 * README: add Hebrew, Arabic kmaps
4490 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4492 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4495 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4497 * Lot of files: add pragma interface/implementation.
4499 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4501 * lib/ui/default.ui: new file (ans new directory). Contains the
4502 default menu and toolbar.
4504 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4505 global space. Toolbars are now read (as menus) in ui files.
4507 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4509 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4510 is disabled because the document is read-only. We want to have the
4511 toggle state of the function anyway.
4512 (getStatus): add code for LFUN_VC* functions (mimicking what is
4513 done in old-style menus)
4515 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4516 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4518 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4519 * src/BufferView_pimpl.C: ditto.
4520 * src/lyxfunc.C: ditto.
4522 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4523 default). This replaces old-style menus by new ones.
4525 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4526 MenuItem. Contain the data structure of a menu.
4528 * src/insets/insettext.C: use LyXView::setLayout instead of
4529 accessing directly the toolbar combox.
4530 * src/lyxfunc.C (Dispatch): ditto.
4532 * src/LyXView.C (setLayout): new method, which just calls
4533 Toolbar::setLayout().
4534 (updateLayoutChoice): move part of this method in Toolbar.
4536 * src/toolbar.[Ch]: removed.
4538 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4539 implementation the toolbar.
4541 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4542 the toolbar. It might make sense to merge it with ToolbarDefaults
4544 (setLayout): new function.
4545 (updateLayoutList): ditto.
4546 (openLayoutList): ditto.
4548 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4549 xforms implementation of the toolbar.
4550 (get_toolbar_func): comment out, since I do not
4551 know what it is good for.
4553 * src/ToolbarDefaults.h: Add the ItemType enum.
4555 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4556 for a list of allocated C strings. Used in Menubar xforms
4557 implementation to avoid memory leaks.
4559 * src/support/lstrings.[Ch] (uppercase): new version taking and
4563 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4564 * lib/bind/emacs.bind: ditto.
4566 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4568 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4569 forward decl of LyXView.
4571 * src/toolbar.C (toolbarItem): moved from toolbar.h
4572 (toolbarItem::clean): ditto
4573 (toolbarItem::~toolbarItem): ditto
4574 (toolbarItem::operator): ditto
4576 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4578 * src/paragraph.h: control the NEW_TABULAR define from here
4580 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4581 USE_TABULAR_INSETS to NEW_TABULAR
4583 * src/ToolbarDefaults.C: add include "lyxlex.h"
4585 * files using the old table/tabular: use NEW_TABULAR to control
4586 compilation of old tabular stuff.
4588 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4591 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4592 planemet in reading of old style floats, fix the \end_deeper
4593 problem when reading old style floats.
4595 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4597 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4599 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4601 * lib/bind/sciword.bind: updated.
4603 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4605 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4606 layout write problem
4608 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4610 * src/Makefile.am (INCLUDES): remove image directory from include
4613 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4614 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4616 * src/LyXView.C (create_form_form_main): read the application icon
4619 * lib/images/*.xpm: change the icons to use transparent color for
4622 * src/toolbar.C (update): change the color of the button when it
4625 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4627 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4628 setting explicitely the minibuffer.
4629 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4631 * src/LyXView.C (showState): new function. Shows font information
4632 in minibuffer and update toolbar state.
4633 (LyXView): call Toolbar::update after creating the
4636 * src/toolbar.C: change toollist to be a vector instead of a
4638 (BubbleTimerCB): get help string directly from the callback
4639 argument of the corresponding icon (which is the action)
4640 (set): remove unnecessary ugliness.
4641 (update): new function. update the icons (depressed, disabled)
4642 depending of the status of the corresponding action.
4644 * src/toolbar.h: remove help in toolbarItem
4646 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4648 * src/Painter.C (text): Added code for using symbol glyphs from
4649 iso10646 fonts. Currently diabled.
4651 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4654 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4655 magyar,turkish and usorbian.
4657 * src/paragraph.C (isMultiLingual): Made more efficient.
4659 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4662 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4663 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4664 Also changed the prototype to "bool math_insert_greek(char)".
4666 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4668 * lots of files: apply the NEW_INSETS on all code that will not be
4669 needed when we move to use the new insets. Enable the define in
4670 lyxparagrah.h to try it.
4672 * src/insets/insettabular.C (cellstart): change to be a static
4674 (InsetTabular): initialize buffer in the initializer list.
4676 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4678 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4679 form_print.h out of the header file. Replaced with forward
4680 declarations of the relevant struct.
4682 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4685 * src/commandtags.h: do not include "debug.h" which does not
4686 belong there. #include it in some other places because of this
4689 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4691 * src/insets/insetcaption.C: add a couple "using" directives.
4693 * src/toolbar.C (add): get the help text directly from lyxaction.
4695 (setPixmap): new function. Loads from disk and sets a pixmap on a
4696 botton; the name of the pixmap file is derived from the command
4699 * src/toolbar.h: remove members isBitmap and pixmap from
4702 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4703 * lib/images/: move many files from images/banner.xpm.
4705 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4707 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4708 * src/toolbar.C: ditto.
4709 * configure.in: ditto.
4710 * INSTALL: document.
4712 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4713 the spellchecker popup is closed from the WM.
4715 2000-07-19 Juergen Vigna <jug@sad.it>
4717 * src/insets/insetfloat.C (Write): small fix because we use the
4718 insetname for the type now!
4720 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4722 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4725 * src/frontends/Dialogs.h: removed hideCitation signal
4727 * src/insets/insetcite.h: added hide signal
4729 * src/insets/insetcite.C (~InsetCitation): emits new signal
4730 (getScreenLabel): "intelligent" label should now fit on the screen!
4732 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4734 * src/frontends/xforms/FormCitation.C (showInset): connects
4735 hide() to the inset's hide signal
4736 (show): modified to use fl_set_object_position rather than
4737 fl_set_object_geometry wherever possible
4739 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4741 * src/insets/lyxinset.h: add caption code
4743 * src/insets/insetfloat.C (type): new method
4745 * src/insets/insetcaption.C (Write): new method
4747 (LyxCode): new method
4749 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4750 to get it right together with using the FloatList.
4752 * src/commandtags.h: add LFUN_INSET_CAPTION
4753 * src/lyxfunc.C (Dispatch): handle it
4755 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4758 * src/Variables.[Ch]: make expand take a const reference, remove
4759 the destructor, some whitespace changes.
4761 * src/LyXAction.C (init): add caption-inset-insert
4763 * src/FloatList.C (FloatList): update the default floats a bit.
4765 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4767 * src/Variables.[Ch]: new files. Intended to be used for language
4768 specific strings (like \chaptername) and filename substitution in
4771 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4773 * lib/kbd/american.kmap: update
4775 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4777 * src/bufferparams.[Ch]: remove member allowAccents.
4779 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4781 * src/LaTeXLog.C: use the log_form.h header.
4782 * src/lyx_gui.C: ditto.
4783 * src/lyx_gui_misc.C: ditto.
4784 * src/lyxvc.h: ditto.
4786 * forms/log_form.fd: new file, created from latexoptions.fd. I
4787 kept the log popup and nuked the options form.
4789 * src/{la,}texoptions.[Ch]: removed.
4790 * src/lyx_cb.C (LaTeXOptions): ditto
4792 * src/lyx_gui.C (create_forms): do not handle the
4793 fd_latex_options form.
4795 2000-07-18 Juergen Vigna <jug@sad.it>
4797 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4798 name of the inset so that it can be requested outside (text2.C).
4800 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4803 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4805 * src/mathed/formula.h (ConvertFont): constify
4807 * src/mathed/formula.C (Read): add warning if \end_inset is not
4808 found on expected place.
4810 * src/insets/lyxinset.h (ConvertFont): consify
4812 * src/insets/insetquotes.C (ConvertFont): constify
4813 * src/insets/insetquotes.h: ditto
4815 * src/insets/insetinfo.h: add labelfont
4817 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4818 (ascent): use labelfont
4822 (Write): make .lyx file a bit nicer
4824 * src/insets/insetfloat.C (Write): simplify somewhat...
4825 (Read): add warning if arg is not found
4827 * src/insets/insetcollapsable.C: add using std::max
4828 (Read): move string token and add warning in arg is not found
4829 (draw): use std::max to get the right ty
4830 (getMaxWidth): simplify by using std::max
4832 * src/insets/insetsection.h: new file
4833 * src/insets/insetsection.C: new file
4834 * src/insets/insetcaption.h: new file
4835 * src/insets/insetcaption.C: new file
4837 * src/insets/inset.C (ConvertFont): constify signature
4839 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4840 insetcaption.[Ch] and insetsection.[Ch]
4842 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4843 uses to use LABEL_COUNTER_CHAPTER instead.
4844 * src/text2.C (SetCounter): here
4846 * src/counters.h: new file
4847 * src/counters.C: new file
4848 * src/Sectioning.h: new file
4849 * src/Sectioning.C: new file
4851 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4853 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4855 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4858 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4861 2000-07-17 Juergen Vigna <jug@sad.it>
4863 * src/tabular.C (Validate): check if array-package is needed.
4864 (SetVAlignment): added support for vertical alignment.
4865 (SetLTFoot): better support for longtable header/footers
4866 (Latex): modified to support added features.
4868 * src/LaTeXFeatures.[Ch]: added array-package.
4870 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4872 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4875 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4877 * configure.in: do not forget to put a space after -isystem.
4879 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4881 * lib/kbd/arabic.kmap: a few fixes.
4883 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4885 * some whitespace chagnes to a number of files.
4887 * src/support/DebugStream.h: change to make it easier for
4888 doc++ to parse correctly.
4889 * src/support/lyxstring.h: ditto
4891 * src/mathed/math_utils.C (compara): change to have only one
4893 (MathedLookupBOP): change because of the above.
4895 * src/mathed/math_delim.C (math_deco_compare): change to have only
4897 (search_deco): change becasue of the above.
4899 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4900 instead of manually coded one.
4902 * src/insets/insetquotes.C (Read): read the \end_inset too
4904 * src/insets/insetlatex.h: remove file
4905 * src/insets/insetlatex.C: remove file
4907 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4909 (InsetPrintIndex): remove destructor
4911 * src/insets/insetinclude.h: remove default constructor
4913 * src/insets/insetfloat.C: work to make it work better
4915 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4917 * src/insets/insetcite.h (InsetCitation): remove default constructor
4919 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4921 * src/text.C (GetColumnNearX): comment out some currently unused code.
4923 * src/paragraph.C (writeFile): move some initializations closer to
4925 (CutIntoMinibuffer): small change to use new matchIT operator
4929 (InsertInset): ditto
4932 (InsetIterator): ditto
4933 (Erase): small change to use new matchFT operator
4935 (GetFontSettings): ditto
4936 (HighestFontInRange): ditto
4939 * src/lyxparagraph.h: some chars changed to value_type
4940 (matchIT): because of some stronger checking (perhaps too strong)
4941 in SGI STL, the two operator() unified to one.
4944 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4946 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4947 the last inset read added
4948 (parseSingleLyXformat2Token): some more (future) compability code added
4949 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4950 (parseSingleLyXformat2Token): set last_inset_read
4951 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4952 (parseSingleLyXformat2Token): don't double intializw string next_token
4954 * src/TextCache.C (text_fits::operator()): add const's to the signature
4955 (has_buffer::operator()): ditto
4957 * src/Floating.h: add some comments on the class
4959 * src/FloatList.[Ch] (typeExist): new method
4962 * src/BackStack.h: added default constructor, wanted by Gcc.
4964 2000-07-14 Juergen Vigna <jug@sad.it>
4966 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4968 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4970 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4971 do a redraw when the window is resized!
4972 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4974 * src/insets/insettext.C (resizeLyXText): added function to correctly
4975 being able to resize the LyXWindow.
4977 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4979 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4981 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4982 crashes when closing dialog to a deleted inset.
4984 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4985 method! Now similar to other insets.
4987 2000-07-13 Juergen Vigna <jug@sad.it>
4989 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4991 * lib/examples/Literate.lyx: small patch!
4993 * src/insets/insetbib.C (Read): added this function because of wrong
4994 Write (without [begin|end]_inset).
4996 2000-07-11 Juergen Vigna <jug@sad.it>
4998 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4999 as the insertInset could not be good!
5001 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5002 the bool param should not be last.
5004 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5006 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5007 did submit that to Karl).
5009 * configure.in: use -isystem instead of -I for X headers. This
5010 fixes a problem on solaris with a recent gcc;
5011 put the front-end code after the X detection code;
5012 configure in sigc++ before lib/
5014 * src/lyx_main.C (commandLineHelp): remove -display from command
5017 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5019 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5020 Also put in Makefile rules for building the ``listerrors''
5021 program for parsing errors from literate programs written in LyX.
5023 * lib/build-listerrors: Added small shell script as part of compile
5024 process. This builds a working ``listerrors'' binary if noweb is
5025 installed and either 1) the VNC X server is installed on the machine,
5026 or 2) the user is compiling from within a GUI. The existence of a GUI
5027 is necessary to use the ``lyx --export'' feature for now. This
5028 hack can be removed once ``lyx --export'' no longer requires a GUI to
5031 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5033 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5034 now passed back correctly from gcc and placed "under" error
5035 buttons in a Literate LyX source.
5037 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5039 * src/text.C (GetColumnNearX): Better behavior when a RTL
5040 paragraph is ended by LTR text.
5042 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5045 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5047 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5048 true when clipboard is empty.
5050 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5052 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5053 row of the paragraph.
5054 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5055 to prevent calculation of bidi tables
5057 2000-07-07 Juergen Vigna <jug@sad.it>
5059 * src/screen.C (ToggleSelection): added y_offset and x_offset
5062 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5065 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5067 * src/insets/insettext.C: fixed Layout-Display!
5069 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5071 * configure.in: add check for strings.h header.
5073 * src/spellchecker.C: include <strings.h> in order to have a
5074 definition for bzero().
5076 2000-07-07 Juergen Vigna <jug@sad.it>
5078 * src/insets/insettext.C (draw): set the status of the bv->text to
5079 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5081 * src/screen.C (DrawOneRow):
5082 (DrawFromTo): redraw the actual row if something has changed in it
5085 * src/text.C (draw): call an update of the toplevel-inset if something
5086 has changed inside while drawing.
5088 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5090 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5092 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5093 processing inside class.
5095 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5096 processing inside class.
5098 * src/insets/insetindex.h new struct Holder, consistent with other
5101 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5102 citation dialog from main code and placed it in src/frontends/xforms.
5103 Dialog launched through signals instead of callbacks
5105 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5107 * lyx.man: update the options description.
5109 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5111 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5112 handle neg values, set min width to 590, add doc about -display
5114 2000-07-05 Juergen Vigna <jug@sad.it>
5116 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5117 calls to BufferView *.
5119 * src/insets/insettext.C (checkAndActivateInset): small fix non
5120 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5122 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5123 their \end_inset token!
5125 2000-07-04 edscott <edscott@imp.mx>
5127 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5128 lib/lyxrc.example: added option \wheel_jump
5130 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5132 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5133 remove support for -width,-height,-xpos and -ypos.
5135 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5137 * src/encoding.[Ch]: New files.
5139 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5140 (text): Call to the underline() method only when needed.
5142 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5144 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5145 encoding(s) for the document.
5147 * src/bufferparams.C (BufferParams): Changed default value of
5150 * src/language.C (newLang): Removed.
5151 (items[]): Added encoding information for all defined languages.
5153 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5154 encoding choice button.
5156 * src/lyxrc.h (font_norm_type): New member variable.
5157 (set_font_norm_type): New method.
5159 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5160 paragraphs with different encodings.
5162 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5163 (TransformChar): Changed to work correctly with Arabic points.
5164 (draw): Added support for drawing Arabic points.
5165 (draw): Removed code for drawing underbars (this is done by
5168 * src/support/textutils.h (IsPrintableNonspace): New function.
5170 * src/BufferView_pimpl.h: Added "using SigC::Object".
5171 * src/LyXView.h: ditto.
5173 * src/insets/insetinclude.h (include_label): Changed to mutable.
5175 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/mathed/math_iter.h: remove empty destructor
5179 * src/mathed/math_cursor.h: remove empty destructor
5181 * src/insets/lyxinset.h: add THEOREM_CODE
5183 * src/insets/insettheorem.[Ch]: new files
5185 * src/insets/insetminipage.C: (InsertInset): remove
5187 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5189 (InsertInset): remove
5191 * src/insets/insetlist.C: (InsertList): remove
5193 * src/insets/insetfootlike.[Ch]: new files
5195 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5198 (InsertInset): ditto
5200 * src/insets/insetert.C: remove include Painter.h, reindent
5201 (InsertInset): move to header
5203 * src/insets/insetcollapsable.h: remove explicit from default
5204 contructor, remove empty destructor, add InsertInset
5206 * src/insets/insetcollapsable.C (InsertInset): new func
5208 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5210 * src/vspace.h: add explicit to constructor
5212 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5213 \textcompwordmark, please test this.
5215 * src/lyxrc.C: set ascii_linelen to 65 by default
5217 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5219 * src/commandtags.h: add LFUN_INSET_THEOREM
5221 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5222 (makeLinuxDocFile): remove _some_ of the nice logic
5223 (makeDocBookFile): ditto
5225 * src/Painter.[Ch]: (~Painter): removed
5227 * src/LyXAction.C (init): entry for insettheorem added
5229 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5231 (deplog): code to detect files generated by LaTeX, needs testing
5234 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5236 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5238 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5240 * src/LaTeX.C (deplog): Add a check for files that are going to be
5241 created by the first latex run, part of the project to remove the
5244 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5245 contents to the extension list.
5247 2000-07-04 Juergen Vigna <jug@sad.it>
5249 * src/text.C (NextBreakPoint): added support for needFullRow()
5251 * src/insets/lyxinset.h: added needFullRow()
5253 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5256 * src/insets/insettext.C: lots of changes for update!
5258 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5260 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5262 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5264 * src/insets/insetinclude.C (InsetInclude): fixed
5265 initialization of include_label.
5266 (unique_id): now returns a string.
5268 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5270 * src/LaTeXFeatures.h: new member IncludedFiles, for
5271 a map of key, included file name.
5273 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5274 with the included files for inclusion in SGML preamble,
5275 i. e., linuxdoc and docbook.
5278 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5279 nice (is the generated linuxdoc code to be exported?), that
5280 allows to remove column, and only_body that will be true for
5281 slave documents. Insets are allowed inside SGML font type.
5282 New handling of the SGML preamble for included files.
5283 (makeDocBookFile): the same for docbook.
5285 * src/insets/insetinclude.h:
5286 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5288 (DocBook): new export methods.
5290 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5291 and makeDocBookFile.
5293 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5294 formats to export with command line argument -x.
5296 2000-06-29 Juergen Vigna <jug@sad.it>
5298 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5299 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5301 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5302 region could already been cleared by an inset!
5304 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5306 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5309 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5311 (cursorToggle): remove special handling of lyx focus.
5313 2000-06-28 Juergen Vigna <jug@sad.it>
5315 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5318 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5320 * src/insets/insetindex.C (Edit): add a callback when popup is
5323 * src/insets/insettext.C (LocalDispatch):
5324 * src/insets/insetmarginal.h:
5325 * src/insets/insetlist.h:
5326 * src/insets/insetfoot.h:
5327 * src/insets/insetfloat.h:
5328 * src/insets/insetert.h: add a missing std:: qualifier.
5330 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5335 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5337 * src/insets/insettext.C (Read): remove tmptok unused variable
5338 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5339 (InsertInset): change for new InsetInset code
5341 * src/insets/insettext.h: add TEXT inline method
5343 * src/insets/insettext.C: remove TEXT macro
5345 * src/insets/insetmarginal.C (Write): new method
5346 (Latex): change output slightly
5348 * src/insets/insetfoot.C (Write): new method
5349 (Latex): change output slightly (don't use endl when no need)
5351 * src/insets/insetert.C (Write): new method
5353 * src/insets/insetcollapsable.h: make button_length, button_top_y
5354 and button_bottm_y protected.
5356 * src/insets/insetcollapsable.C (Write): simplify code by using
5357 tostr. Also do not output the float name, the children class
5358 should to that to get control over own arguments
5360 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5361 src/insets/insetminipage.[Ch]:
5364 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5366 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5368 * src/Makefile.am (lyx_SOURCES): add the new files
5370 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5371 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5372 * src/commandtags.h: ditto
5374 * src/LaTeXFeatures.h: add a std::set of used floattypes
5376 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5378 * src/FloatList.[Ch] src/Floating.h: new files
5380 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5382 * src/lyx_cb.C (TableApplyCB): ditto
5384 * src/text2.C: ditto
5385 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5386 (parseSingleLyXformat2Token): ditto + add code for
5387 backwards compability for old float styles + add code for new insets
5389 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5391 (InsertInset(size_type, Inset *, LyXFont)): new method
5392 (InsetChar(size_type, char)): changed to use the other InsetChar
5393 with a LyXFont(ALL_INHERIT).
5394 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5395 insert the META_INSET.
5397 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5399 * sigc++/thread.h (Threads): from here
5401 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5402 definition out of line
5403 * sigc++/scope.h: from here
5405 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5407 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5408 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5410 * Makefile.am (bindist): new target.
5412 * INSTALL: add instructions for doing a binary distribution.
5414 * development/tools/README.bin.example: update a bit.
5416 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5419 * lib/lyxrc.example: new lyxrc tag \set_color.
5421 * src/lyxfunc.C (Dispatch):
5422 * src/commandtags.h:
5423 * src/LyXAction.C: new lyxfunc "set-color".
5425 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5426 and an x11name given as strings.
5428 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5429 cache when a color is changed.
5431 2000-06-26 Juergen Vigna <jug@sad.it>
5433 * src/lyxrow.C (width): added this functions and variable.
5435 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5438 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5440 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5442 * images/undo_bw.xpm: new icon.
5443 * images/redo_bw.xpm: ditto.
5445 * configure.in (INSTALL_SCRIPT): change value to
5446 ${INSTALL} to avoid failures of install-script target.
5447 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5449 * src/BufferView.h: add a magic "friend" declaration to please
5452 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5454 * forms/cite.fd: modified to allow resizing without messing
5457 * src/insetcite.C: Uses code from cite.fd almost without
5459 User can now resize dialog in the x-direction.
5460 Resizing the dialog in the y-direction is prevented, as the
5461 code does this intelligently already.
5463 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5465 * INSTALL: remove obsolete entry in "problems" section.
5467 * lib/examples/sl_*.lyx: update of the slovenian examples.
5469 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5471 2000-06-23 Juergen Vigna <jug@sad.it>
5473 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5475 * src/buffer.C (resize): delete the LyXText of textinsets.
5477 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5479 * src/insets/lyxinset.h: added another parameter 'cleared' to
5480 the draw() function.
5482 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5483 unlocking inset in inset.
5485 2000-06-22 Juergen Vigna <jug@sad.it>
5487 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5488 of insets and moved first to LyXText.
5490 * src/mathed/formulamacro.[Ch]:
5491 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5493 2000-06-21 Juergen Vigna <jug@sad.it>
5495 * src/text.C (GetVisibleRow): look if I should clear the area or not
5496 using Inset::doClearArea() function.
5498 * src/insets/lyxinset.h: added doClearArea() function and
5499 modified draw(Painter &, ...) to draw(BufferView *, ...)
5501 * src/text2.C (UpdateInset): return bool insted of int
5503 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5505 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5506 combox in the character popup
5508 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5509 BufferParams const & params
5511 2000-06-20 Juergen Vigna <jug@sad.it>
5513 * src/insets/insettext.C (SetParagraphData): set insetowner on
5516 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5518 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5519 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5521 (form_main_): remove
5523 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5524 (create_form_form_main): remove FD_form_main stuff, connect to
5525 autosave_timeout signal
5527 * src/LyXView.[Ch] (getMainForm): remove
5528 (UpdateTimerCB): remove
5529 * src/BufferView_pimpl.h: inherit from SigC::Object
5531 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5532 signal instead of callback
5534 * src/BufferView.[Ch] (cursorToggleCB): remove
5536 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * src/BufferView_pimpl.C: changes because of the one below
5540 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5541 instead of storing a pointer to a LyXText.
5543 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5545 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5547 * src/lyxparagraph.h
5549 * src/paragraph.C: Changed fontlist to a sorted vector.
5551 2000-06-19 Juergen Vigna <jug@sad.it>
5553 * src/BufferView.h: added screen() function.
5555 * src/insets/insettext.C (LocalDispatch): some selection code
5558 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5560 * src/insets/insettext.C (SetParagraphData):
5562 (InsetText): fixes for multiple paragraphs.
5564 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5566 * development/lyx.spec.in: Call configure with ``--without-warnings''
5567 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5568 This should be fine, however, since we generally don't want to be
5569 verbose when making an RPM.
5571 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5573 * lib/scripts/fig2pstex.py: New file
5575 2000-06-16 Juergen Vigna <jug@sad.it>
5577 * src/insets/insettabular.C (UpdateLocal):
5578 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5579 (LocalDispatch): Changed all functions to use LyXText.
5581 2000-06-15 Juergen Vigna <jug@sad.it>
5583 * src/text.C (SetHeightOfRow): call inset::update before requesting
5586 * src/insets/insettext.C (update):
5587 * src/insets/insettabular.C (update): added implementation
5589 * src/insets/lyxinset.h: added update function
5591 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5593 * src/text.C (SelectNextWord): protect against null pointers with
5594 old-style string streams. (fix from Paul Theo Gonciari
5597 * src/cite.[Ch]: remove erroneous files.
5599 * lib/configure.m4: update the list of created directories.
5601 * src/lyxrow.C: include <config.h>
5602 * src/lyxcursor.C: ditto.
5604 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5606 * lib/examples/decimal.lyx: new example file from Mike.
5608 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5609 to find template definitions (from Dekel)
5611 * src/frontends/.cvsignore: add a few things.
5613 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5615 * src/Timeout.C (TimeOut): remove default argument.
5617 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5620 * src/insets/ExternalTemplate.C: add a "using" directive.
5622 * src/lyx_main.h: remove the act_ struct, which seems unused
5625 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5627 * LyX Developers Meeting: All files changed, due to random C++ (by
5628 coincidence) code generator script.
5630 - external inset (cool!)
5631 - initial online editing of preferences
5632 - insettabular breaks insettext(s contents)
5634 - some DocBook fixes
5635 - example files update
5636 - other cool stuff, create a diff and look for yourself.
5638 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5640 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5641 -1 this is a non-line-breaking textinset.
5643 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5644 if there is no width set.
5646 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5648 * Lots of files: Merged the dialogbase branch.
5650 2000-06-09 Allan Rae <rae@lyx.org>
5652 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5653 and the Dispatch methods that used it.
5655 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5656 access to functions formerly kept in Dispatch.
5658 2000-05-19 Allan Rae <rae@lyx.org>
5660 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5661 made to_page and count_copies integers again. from_page remains a
5662 string however because I want to allow entry of a print range like
5663 "1,4,22-25" using this field.
5665 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5666 and printer-params-get. These aren't useful from the minibuffer but
5667 could be used by a script/LyXServer app provided it passes a suitable
5668 auto_mem_buffer. I guess I should take a look at how the LyXServer
5669 works and make it support xtl buffers.
5671 * sigc++/: updated to libsigc++-1.0.1
5673 * src/xtl/: updated to xtl-1.3.pl.11
5675 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5676 those changes done to the files in src/ are actually recreated when
5677 they get regenerated. Please don't ever accept a patch that changes a
5678 dialog unless that patch includes the changes to the corresponding *.fd
5681 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5682 stringOnlyContains, renamed it and generalised it.
5684 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5685 branch. Removed the remaining old form_print code.
5687 2000-04-26 Allan Rae <rae@lyx.org>
5689 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5690 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5692 2000-04-25 Allan Rae <rae@lyx.org>
5694 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5695 against a base of xtl-1.3.pl.4
5697 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5698 filter the Id: entries so they still show the xtl version number
5701 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5702 into the src/xtl code. Patch still pending with José (XTL)
5704 2000-04-24 Allan Rae <rae@lyx.org>
5706 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5707 both more generic and much safer. Use the new template functions.
5708 * src/buffer.[Ch] (Dispatch): ditto.
5710 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5711 and mem buffer more intelligently. Also a little general cleanup.
5714 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5715 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5716 * src/xtl/Makefile.am: ditto.
5717 * src/xtl/.cvsignore: ditto.
5718 * src/Makefile.am: ditto.
5720 * src/PrinterParams.h: Removed the macros member functions. Added a
5721 testInvariant member function. A bit of tidying up and commenting.
5722 Included Angus's idea for fixing operation with egcs-1.1.2.
5724 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5725 cool expansion of XTL's mem_buffer to support automatic memory
5726 management within the buffer itself. Removed the various macros and
5727 replaced them with template functions that use either auto_mem_buffer
5728 or mem_buffer depending on a #define. The mem_buffer support will
5729 disappear as soon as the auto_mem_buffer is confirmed to be good on
5730 other platforms/compilers. That is, it's there so you've got something
5733 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5734 effectively forked XTL. However I expect José will include my code
5735 into the next major release. Also fixed a memory leak.
5736 * src/xtl/text.h: ditto.
5737 * src/xtl/xdr.h: ditto.
5738 * src/xtl/giop.h: ditto.
5740 2000-04-16 Allan Rae <rae@lyx.org>
5742 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5743 by autogen.sh and removed by maintainer-clean anyway.
5744 * .cvsignore, sigc++/.cvsignore: Support the above.
5746 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5748 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5750 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5751 macros, renamed static callback-target member functions to suit new
5752 scheme and made them public.
5753 * src/frontends/xforms/forms/form_print.fd: ditto.
5754 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5756 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5759 * src/xtl/: New directory containing a minimal distribution of XTL.
5760 This is XTL-1.3.pl.4.
5762 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5764 2000-04-15 Allan Rae <rae@lyx.org>
5766 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5768 * sigc++/: Updated to libsigc++-1.0.0
5770 2000-04-14 Allan Rae <rae@lyx.org>
5772 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5773 use the generic ones in future. I'll modify my conversion script.
5775 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5777 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5778 (CloseAllBufferRelatedDialogs): Renamed.
5779 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5781 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5782 of the generic ones. These are the same ones my conversion script
5785 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5786 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5787 * src/buffer.C (Dispatch): ditto
5789 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5790 functions for updating and hiding buffer dependent dialogs.
5791 * src/BufferView.C (buffer): ditto
5792 * src/buffer.C (setReadonly): ditto
5793 * src/lyxfunc.C (CloseBuffer): ditto
5795 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5796 Dialogs.h, and hence all the SigC stuff, into every file that includes
5797 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5799 * src/BufferView2.C: reduce the number of headers included by buffer.h
5801 2000-04-11 Allan Rae <rae@lyx.org>
5803 * src/frontends/xforms/xform_macros.h: A small collection of macros
5804 for building C callbacks.
5806 * src/frontends/xforms/Makefile.am: Added above file.
5808 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5809 scheme again. This time it should work for JMarc. If this is
5810 successful I'll revise my conversion script to automate some of this.
5811 The static member functions in the class also have to be public for
5812 this scheme will work. If the scheme works (it's almost identical to
5813 the way BufferView::cursorToggleCB is handled so it should work) then
5814 FormCopyright and FormPrint will be ready for inclusion into the main
5815 trunk immediately after 1.1.5 is released -- provided we're prepared
5816 for complaints about lame compilers not handling XTL.
5818 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5820 2000-04-07 Allan Rae <rae@lyx.org>
5822 * config/lyxinclude.m4: A bit more tidying up (Angus)
5824 * src/LString.h: JMarc's <string> header fix
5826 * src/PrinterParams.h: Used string for most data to remove some
5827 ugly code in the Print dialog and avoid even uglier code when
5828 appending the ints to a string for output.
5830 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5831 and moved "default:" back to the end of switch statement. Cleaned
5832 up the printing so it uses the right function calls and so the
5833 "print to file" option actually puts the file in the right directory.
5835 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5837 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5838 and Ok+Apply button control into a separate method: input (Angus).
5839 (input) Cleaned it up and improved it to be very thorough now.
5840 (All CB) static_cast used instead of C style cast (Angus). This will
5841 probably change again once we've worked out how to keep gcc-2.8.1 happy
5842 with real C callbacks.
5843 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5844 ignore some of the bool settings and has random numbers instead. Needs
5845 some more investigation. Added other input length checks and checking
5846 of file and printer names.
5848 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5849 would link (Angus). Seems the old code doesn't compile with the pragma
5850 statement either. Separated callback entries from internal methods.
5852 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5854 2000-03-17 Allan Rae <rae@lyx.org>
5856 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5857 need it? Maybe it could go in Dialogs instead? I could make it a
5858 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5859 values to get the bool return value.
5860 (Dispatch): New overloaded method for xtl support.
5862 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5863 extern "C" callback instead of static member functions. Hopefully,
5864 JMarc will be able to compile this. I haven't changed
5865 forms/form_copyright.fd yet. Breaking one of my own rules already.
5867 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5868 because they aren't useful from the minibuffer. Maybe a LyXServer
5869 might want a help message though?
5871 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5873 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5874 xtl which needs both rtti and exceptions.
5876 * src/support/Makefile.am:
5877 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5879 * src/frontends/xforms/input_validators.[ch]: input filters and
5880 validators. These conrol what keys are valid in input boxes.
5881 Use them and write some more. Much better idea than waiting till
5882 after the user has pressed Ok to say that the input fields don't make
5885 * src/frontends/xforms/Makefile.am:
5886 * src/frontends/xforms/forms/form_print.fd:
5887 * src/frontends/xforms/forms/makefile:
5888 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5889 new scheme. Still have to make sure I haven't missed anything from
5890 the current implementation.
5892 * src/Makefile.am, src/PrinterParams.h: New data store.
5894 * other files: Added a couple of copyright notices.
5896 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5898 * src/insets/insetbib.h: move Holder struct in public space.
5900 * src/frontends/include/DialogBase.h: use SigC:: only when
5901 SIGC_CXX_NAMESPACES is defined.
5902 * src/frontends/include/Dialogs.h: ditto.
5904 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5906 * src/frontends/xforms/FormCopyright.[Ch]: do not
5907 mention SigC:: explicitely.
5909 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5911 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5912 deals with testing KDE in main configure.in
5913 * configure.in: ditto.
5915 2000-02-22 Allan Rae <rae@lyx.org>
5917 * Lots of files: Merged from HEAD
5919 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5920 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5922 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5924 * sigc++/: new minidist.
5926 2000-02-14 Allan Rae <rae@lyx.org>
5928 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5930 2000-02-08 Juergen Vigna <jug@sad.it>
5932 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5933 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5935 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5936 for this port and so it is much easier for other people to port
5937 dialogs in a common development environment.
5939 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5940 the QT/KDE implementation.
5942 * src/frontends/kde/Dialogs.C:
5943 * src/frontends/kde/FormCopyright.C:
5944 * src/frontends/kde/FormCopyright.h:
5945 * src/frontends/kde/Makefile.am:
5946 * src/frontends/kde/formcopyrightdialog.C:
5947 * src/frontends/kde/formcopyrightdialog.h:
5948 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5949 for the kde support of the Copyright-Dialog.
5951 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5952 subdir-substitution instead of hardcoded 'xforms' as we now have also
5955 * src/frontends/include/DialogBase.h (Object): just commented the
5956 label after #endif (nasty warning and I don't like warnings ;)
5958 * src/main.C (main): added KApplication initialization if using
5961 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5962 For now only the KDE event-loop is added if frontend==kde.
5964 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5966 * configure.in: added support for the --with-frontend[=value] option
5968 * autogen.sh: added kde.m4 file to list of config-files
5970 * acconfig.h: added define for KDEGUI-support
5972 * config/kde.m4: added configuration functions for KDE-port
5974 * config/lyxinclude.m4: added --with-frontend[=value] option with
5975 support for xforms and KDE.
5977 2000-02-08 Allan Rae <rae@lyx.org>
5979 * all Makefile.am: Fixed up so the make targets dist, distclean,
5980 install and uninstall all work even if builddir != srcdir. Still
5981 have a new sigc++ minidist update to come.
5983 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5985 2000-02-01 Allan Rae <rae@lyx.org>
5987 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5988 Many mods to get builddir != srcdir working.
5990 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5991 for building on NT and so we can do the builddir != srcdir stuff.
5993 2000-01-30 Allan Rae <rae@lyx.org>
5995 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5996 This will stay in "rae" branch. We probably don't really need it in
5997 the main trunk as anyone who wants to help programming it should get
5998 a full library installed also. So they can check both included and
5999 system supplied library compilation.
6001 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6002 Added a 'mini' distribution of libsigc++. If you feel the urge to
6003 change something in these directories - Resist it. If you can't
6004 resist the urge then you should modify the following script and rebuild
6005 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6006 all happen. Still uses a hacked version of libsigc++'s configure.in.
6007 I'm quite happy with the results. I'm not sure the extra work to turn
6008 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6009 worth the trouble and would probably lead to extra maintenance
6011 I haven't tested the following important make targets: install, dist.
6012 Not ready for prime time but very close. Maybe 1.1.5.
6014 * development/tools/makeLyXsigc.sh: A shell script to automatically
6015 generate our mini-dist of libsigc++. It can only be used with a CVS
6016 checkout of libsigc++ not a tarball distribution. It's well commented.
6017 This will end up as part of the libsigc++ distribution so other apps
6018 can easily have an included mini-dist. If someone makes mods to the
6019 sigc++ subpackage without modifying this script to generate those
6020 changes I'll be very upset!
6022 * src/frontends/: Started the gui/system indep structure.
6024 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6025 to access the gui-indep dialogs are in this class. Much improved
6026 design compared to previous revision. Lars, please refrain from
6027 moving this header into src/ like you did with Popups.h last time.
6029 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6031 * src/frontends/xforms/: Started the gui-indep system with a single
6032 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6035 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6036 Here you'll find a very useful makefile and automated fdfix.sh that
6037 makes updating dailogs a no-brainer -- provided you follow the rules
6038 set out in the README. I'm thinking about adding another script to
6039 automatically generate skeleton code for a new dialog given just the
6042 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6043 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6044 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6046 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6048 * src/support/LSubstring.C (operator): simplify
6050 * src/lyxtext.h: removed bparams, use buffer_->params instead
6052 * src/lyxrow.h: make Row a real class, move all variables to
6053 private and use accessors.
6055 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6057 (isRightToLeftPar): ditto
6058 (ChangeLanguage): ditto
6059 (isMultiLingual): ditto
6062 (SimpleTeXOnePar): ditto
6063 (TeXEnvironment): ditto
6064 (GetEndLabel): ditto
6066 (SetOnlyLayout): ditto
6067 (BreakParagraph): ditto
6068 (BreakParagraphConservative): ditto
6069 (GetFontSettings): ditto
6071 (CopyIntoMinibuffer): ditto
6072 (CutIntoMinibuffer): ditto
6073 (PasteParagraph): ditto
6074 (SetPExtraType): ditto
6075 (UnsetPExtraType): ditto
6076 (DocBookContTableRows): ditto
6077 (SimpleDocBookOneTablePar): ditto
6079 (TeXFootnote): ditto
6080 (SimpleTeXOneTablePar): ditto
6081 (TeXContTableRows): ditto
6082 (SimpleTeXSpecialChars): ditto
6085 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6086 to private and use accessors.
6088 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6089 this, we did not use it anymore and has not been for ages. Just a
6090 waste of cpu cycles.
6092 * src/language.h: make Language a real class, move all variables
6093 to private and use accessors.
6095 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6096 (create_view): remove
6097 (update): some changes for new timer
6098 (cursorToggle): use new timer
6099 (beforeChange): change for new timer
6101 * src/BufferView.h (cursorToggleCB): removed last paramter because
6104 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6105 (cursorToggleCB): change because of new timer code
6107 * lib/CREDITS: updated own mailaddress
6109 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6111 * src/support/filetools.C (PutEnv): fix the code in case neither
6112 putenv() nor setenv() have been found.
6114 * INSTALL: mention the install-strip Makefile target.
6116 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6117 read-only documents.
6119 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6121 * lib/reLyX/configure.in (VERSION): avoid using a previously
6122 generated reLyX wrapper to find out $prefix.
6124 * lib/examples/eu_adibide_lyx-atua.lyx:
6125 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6126 translation of the Tutorial (Dooteo)
6128 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6130 * forms/cite.fd: new citation dialog
6132 * src/insetcite.[Ch]: the new citation dialog is moved into
6135 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6138 * src/insets/insetcommand.h: data members made private.
6140 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6142 * LyX 1.1.5 released
6144 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6146 * src/version.h (LYX_RELEASE): to 1.1.5
6148 * src/spellchecker.C (RunSpellChecker): return false if the
6149 spellchecker dies upon creation.
6151 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6153 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6154 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6158 * lib/CREDITS: update entry for Martin Vermeer.
6160 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6162 * src/text.C (draw): Draw foreign language bars at the bottom of
6163 the row instead of at the baseline.
6165 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6167 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6169 * lib/bind/de_menus.bind: updated
6171 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6173 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6175 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6177 * src/menus.C (Limit_string_length): New function
6178 (ShowTocMenu): Limit the number of items/length of items in the
6181 * src/paragraph.C (String): Correct result for a paragraph inside
6184 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6186 * src/bufferlist.C (close): test of buf->getuser() == NULL
6188 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6190 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6191 Do not call to SetCursor when the paragraph is a closed footnote!
6193 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6195 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6198 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6200 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6203 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6204 reference popup, that activates the reference-back action
6206 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6208 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6209 the menus. Also fixed a bug.
6211 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6212 the math panels when switching buffers (unless new buffer is readonly).
6214 * src/BufferView.C (NoSavedPositions)
6215 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6217 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6219 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6220 less of dvi dirty or not.
6222 * src/trans_mgr.[Ch] (insert): change first parameter to string
6225 * src/chset.[Ch] (encodeString): add const to first parameter
6227 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6233 * src/LaTeX.C (deplog): better searching for dependency files in
6234 the latex log. Uses now regexps.
6236 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6237 instead of the box hack or \hfill.
6239 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6241 * src/lyxfunc.C (doImportHelper): do not create the file before
6242 doing the actual import.
6243 (doImportASCIIasLines): create a new file before doing the insert.
6244 (doImportASCIIasParagraphs): ditto.
6246 * lib/lyxrc.example: remove mention of non-existing commands
6248 * lyx.man: remove mention of color-related switches.
6250 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6252 * src/lyx_gui.C: remove all the color-related ressources, which
6253 are not used anymore.
6255 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6258 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6260 * src/lyxrc.C (read): Add a missing break in the switch
6262 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6264 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6266 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6269 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6271 * src/text.C (draw): draw bars under foreign language words.
6273 * src/LColor.[Ch]: add LColor::language
6275 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6277 * src/lyxcursor.h (boundary): New member variable
6279 * src/text.C (IsBoundary): New methods
6281 * src/text.C: Use the above for currect cursor movement when there
6282 is both RTL & LTR text.
6284 * src/text2.C: ditto
6286 * src/bufferview_funcs.C (ToggleAndShow): ditto
6288 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6290 * src/text.C (DeleteLineForward): set selection to true to avoid
6291 that DeleteEmptyParagraphMechanism does some magic. This is how it
6292 is done in all other functions, and seems reasonable.
6293 (DeleteWordForward): do not jump over non-word stuff, since
6294 CursorRightOneWord() already does it.
6296 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6297 DeleteWordBackward, since they seem safe to me (since selection is
6298 set to "true") DeleteEmptyParagraphMechanism does nothing.
6300 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6302 * src/lyx_main.C (easyParse): simplify the code by factoring the
6303 part that removes parameters from the command line.
6304 (LyX): check wether wrong command line options have been given.
6306 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6308 * src/lyx_main.C : add support for specifying user LyX
6309 directory via command line option -userdir.
6311 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6313 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6314 the number of items per popup.
6315 (Add_to_refs_menu): Ditto.
6317 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6319 * src/lyxparagraph.h: renamed ClearParagraph() to
6320 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6321 textclass as parameter, and do nothing if free_spacing is
6322 true. This fixes part of the line-delete-forward problems.
6324 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6325 (pasteSelection): ditto.
6326 (SwitchLayoutsBetweenClasses): more translatable strings.
6328 * src/text2.C (CutSelection): use StripLeadingSpaces.
6329 (PasteSelection): ditto.
6330 (DeleteEmptyParagraphMechanism): ditto.
6332 2000-05-26 Juergen Vigna <jug@sad.it>
6334 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6335 is not needed in tabular insets.
6337 * src/insets/insettabular.C (TabularFeatures): added missing features.
6339 * src/tabular.C (DeleteColumn):
6341 (AppendRow): implemented this functions
6342 (cellsturct::operator=): clone the inset too;
6344 2000-05-23 Juergen Vigna <jug@sad.it>
6346 * src/insets/insettabular.C (LocalDispatch): better selection support
6347 when having multicolumn-cells.
6349 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6351 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6353 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6355 * src/ColorHandler.C (getGCForeground): put more test into _()
6357 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6360 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6363 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6365 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6366 there are no labels, or when buffer is readonly.
6368 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6369 there are no labels, buffer is SGML, or when buffer is readonly.
6371 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * src/LColor.C (LColor): change a couple of grey40 to grey60
6374 (LColor): rewore initalization to make compiles go some magnitude
6376 (getGUIName): don't use gettext until we need the string.
6378 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6380 * src/Bullet.[Ch]: Fixed a small bug.
6382 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6384 * src/paragraph.C (String): Several fixes/improvements
6386 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6388 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6390 * src/paragraph.C (String): give more correct output.
6392 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6394 * src/lyxfont.C (stateText) Do not output the language if it is
6395 eqaul to the language of the document.
6397 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6398 between two paragraphs with the same language.
6400 * src/paragraph.C (getParLanguage) Return a correct answer for an
6401 empty dummy paragraph.
6403 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6406 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6409 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6410 the menus/popup, if requested fonts are unavailable.
6412 2000-05-22 Juergen Vigna <jug@sad.it>
6414 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6415 movement support (Up/Down/Tab/Shift-Tab).
6416 (LocalDispatch): added also preliminari cursor-selection.
6418 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6420 * src/paragraph.C (PasteParagraph): Hopefully now right!
6422 2000-05-22 Garst R. Reese <reese@isn.net>
6424 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6425 of list, change all references to Environment to Command
6426 * tex/hollywood.cls : rewrite environments as commands, add
6427 \uppercase to interiorshot and exteriorshot to force uppecase.
6428 * tex/broadway.cls : rewrite environments as commands. Tweak
6431 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6433 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6434 size of items: use a constant intead of the hardcoded 40, and more
6435 importantly do not remove the %m and %x tags added at the end.
6436 (Add_to_refs_menu): use vector::size_type instead of
6437 unsigned int as basic types for the variables. _Please_ do not
6438 assume that size_t is equal to unsigned int. On an alpha, this is
6439 unsigned long, which is _not_ the same.
6441 * src/language.C (initL): remove language "hungarian", since it
6442 seems that "magyar" is better.
6444 2000-05-22 Juergen Vigna <jug@sad.it>
6446 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6448 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6451 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6452 next was deleted but not set to 0.
6454 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6456 * src/language.C (initL): change the initialization of languages
6457 so that compiles goes _fast_.
6459 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6462 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6464 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6468 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6470 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6472 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6476 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6479 * src/insets/insetlo*.[Ch]: Made editable
6481 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6483 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6484 the current selection.
6486 * src/BufferView_pimpl.C (stuffClipboard): new method
6488 * src/BufferView.C (stuffClipboard): new method
6490 * src/paragraph.C (String): new method
6492 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6493 LColor::ignore when lyxname is not found.
6495 * src/BufferView.C (pasteSelection): new method
6497 * src/BufferView_pimpl.C (pasteSelection): new method
6499 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6501 * src/WorkArea.C (request_clipboard_cb): new static function
6502 (getClipboard): new method
6503 (putClipboard): new method
6505 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6507 * LyX 1.1.5pre2 released
6509 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6511 * src/vspace.C (operator=): removed
6512 (operator=): removed
6514 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6516 * src/layout.C (NumberOfClass): manually set the type in make_pair
6517 (NumberOfLayout): ditto
6519 * src/language.C: use the Language constructor for ignore_lang
6521 * src/language.h: add constructors to struct Language
6523 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6525 * src/text2.C (SetCursorIntern): comment out #warning
6527 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6529 * src/mathed/math_iter.h: initialize sx and sw to 0
6531 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6533 * forms/lyx.fd: Redesign of form_ref
6535 * src/LaTeXFeatures.[Ch]
6539 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6542 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6543 and Buffer::inset_iterator.
6545 * src/menus.C: Added new menus: TOC and Refs.
6547 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6549 * src/buffer.C (getTocList): New method.
6551 * src/BufferView2.C (ChangeRefs): New method.
6553 * src/buffer.C (getLabelList): New method. It replaces the old
6554 getReferenceList. The return type is vector<string> instead of
6557 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6558 the old getLabel() and GetNumberOfLabels() methods.
6559 * src/insets/insetlabel.C (getLabelList): ditto
6560 * src/mathed/formula.C (getLabelList): ditto
6562 * src/paragraph.C (String): New method.
6564 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6565 Uses the new getTocList() method.
6566 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6567 which automatically updates the contents of the browser.
6568 (RefUpdateCB): Use the new getLabelList method.
6570 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6572 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6574 * src/spellchecker.C: Added using std::reverse;
6576 2000-05-19 Juergen Vigna <jug@sad.it>
6578 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6580 * src/insets/insettext.C (computeTextRows): small fix for display of
6581 1 character after a newline.
6583 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6586 2000-05-18 Juergen Vigna <jug@sad.it>
6588 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6589 when changing width of column.
6591 * src/tabular.C (set_row_column_number_info): setting of
6592 autobreak rows if necessary.
6594 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6596 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6598 * src/vc-backend.*: renamed stat() to status() and vcstat to
6599 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6600 compilation broke. The new name seems more relevant, anyway.
6602 2000-05-17 Juergen Vigna <jug@sad.it>
6604 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6605 which was wrong if the removing caused removing of rows!
6607 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6608 (pushToken): new function.
6610 * src/text2.C (CutSelection): fix problem discovered with purify
6612 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6614 * src/debug.C (showTags): enlarge the first column, now that we
6615 have 6-digits debug codes.
6617 * lib/layouts/hollywood.layout:
6618 * lib/tex/hollywood.cls:
6619 * lib/tex/brodway.cls:
6620 * lib/layouts/brodway.layout: more commands and fewer
6621 environments. Preambles moved in the .cls files. Broadway now has
6622 more options on scene numbering and less whitespace (from Garst)
6624 * src/insets/insetbib.C (getKeys): make sure that we are in the
6625 document directory, in case the bib file is there.
6627 * src/insets/insetbib.C (Latex): revert bogus change.
6629 2000-05-16 Juergen Vigna <jug@sad.it>
6631 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6632 the TabularLayout on cursor move.
6634 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6636 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6639 (draw): fixed cursor position and drawing so that the cursor is
6640 visible when before the tabular-inset.
6642 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6643 when creating from old insettext.
6645 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6647 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6649 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6650 * lib/tex/brodway.cls: ditto
6652 * lib/layouts/brodway.layout: change alignment of parenthical
6655 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6657 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6658 versions 0.88 and 0.89 are supported.
6660 2000-05-15 Juergen Vigna <jug@sad.it>
6662 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6665 * src/insets/insettext.C (computeTextRows): redone completely this
6666 function in a much cleaner way, because of problems when having a
6668 (draw): added a frame border when the inset is locked.
6669 (SetDrawLockedFrame): this sets if we draw the border or not.
6670 (SetFrameColor): this sets the frame color (default=insetframe).
6672 * src/insets/lyxinset.h: added x() and y() functions which return
6673 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6674 function which is needed to see if we have a locking inset of some
6675 type in this inset (needed for now in insettabular).
6677 * src/vspace.C (inPixels): the same function also without a BufferView
6678 parameter as so it is easier to use it in some ocasions.
6680 * src/lyxfunc.C: changed all places where insertInset was used so
6681 that now if it couldn't be inserted it is deleted!
6683 * src/TabularLayout.C:
6684 * src/TableLayout.C: added support for new tabular-inset!
6686 * src/BufferView2.C (insertInset): this now returns a bool if the
6687 inset was really inserted!!!
6689 * src/tabular.C (GetLastCellInRow):
6690 (GetFirstCellInRow): new helper functions.
6691 (Latex): implemented for new tabular class.
6695 (TeXTopHLine): new Latex() helper functions.
6697 2000-05-12 Juergen Vigna <jug@sad.it>
6699 * src/mathed/formulamacro.C (Read):
6700 * src/mathed/formula.C (Read): read also the \end_inset here!
6702 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6704 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6705 crush when saving formulae with unbalanced parenthesis.
6707 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6709 * src/layout.C: Add new keyword "endlabelstring" to layout file
6711 * src/text.C (GetVisibleRow): Draw endlabel string.
6713 * lib/layouts/broadway.layout
6714 * lib/layouts/hollywood.layout: Added endlabel for the
6715 Parenthetical layout.
6717 * lib/layouts/heb-article.layout: Do not use slanted font shape
6718 for Theorem like environments.
6720 * src/buffer.C (makeLaTeXFile): Always add "american" to
6721 the UsedLanguages list if document language is RTL.
6723 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6725 * add addendum to README.OS2 and small patch (from SMiyata)
6727 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6729 * many files: correct the calls to ChangeExtension().
6731 * src/support/filetools.C (ChangeExtension): remove the no_path
6732 argument, which does not belong there. Use OnlyFileName() instead.
6734 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6735 files when LaTeXing a non-nice latex file.
6737 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6738 a chain of "if". Return false when deadkeys are not handled.
6740 * src/lyx_main.C (LyX): adapted the code for default bindings.
6742 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6743 bindings for basic functionality (except deadkeys).
6744 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6746 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6747 several methods: handle override_x_deadkeys.
6749 * src/lyxrc.h: remove the "bindings" map, which did not make much
6750 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6752 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6754 * src/lyxfont.C (stateText): use a saner method to determine
6755 whether the font is "default". Seems to fix the crash with DEC
6758 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6760 2000-05-08 Juergen Vigna <jug@sad.it>
6762 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6763 TabularLayoutMenu with mouse-button-3
6764 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6766 * src/TabularLayout.C: added this file for having a Layout for
6769 2000-05-05 Juergen Vigna <jug@sad.it>
6771 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6772 recalculating inset-widths.
6773 (TabularFeatures): activated this function so that I can change
6774 tabular-features via menu.
6776 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6777 that I can test some functions with the Table menu.
6779 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6781 * src/lyxfont.C (stateText): guard against stupid c++libs.
6783 * src/tabular.C: add using std::vector
6784 some whitespace changes, + removed som autogenerated code.
6786 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6788 2000-05-05 Juergen Vigna <jug@sad.it>
6790 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6791 row, columns and cellstructures.
6793 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6795 * lib/lyxrc.example: remove obsolete entries.
6797 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6798 reading of protected_separator for free_spacing.
6800 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6802 * src/text.C (draw): do not display an exclamation mark in the
6803 margin for margin notes. This is confusing, ugly and
6806 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6807 AMS math' is checked.
6809 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6810 name to see whether including the amsmath package is needed.
6812 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6814 * src/paragraph.C (validate): Compute UsedLanguages correctly
6815 (don't insert the american language if it doesn't appear in the
6818 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6819 The argument of \thanks{} command is considered moving argument
6821 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6824 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6826 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6827 for appendix/minipage/depth. The lines can be now both in the footnote
6828 frame, and outside the frame.
6830 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6833 2000-05-05 Juergen Vigna <jug@sad.it>
6835 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6836 neede only in tabular.[Ch].
6838 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6840 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6842 (Write): write '~' for PROTECTED_SEPARATOR
6844 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6846 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6849 * src/mathed/formula.C (drawStr): rename size to siz.
6851 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6852 possibly fix a bug by not changing the pflags = flags to piflags =
6855 2000-05-05 Juergen Vigna <jug@sad.it>
6857 * src/insets/insetbib.C: moved using directive
6859 * src/ImportNoweb.C: small fix for being able to compile (missing
6862 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6865 to use clear, since we don't depend on this in the code. Add test
6868 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6870 * (various *.C files): add using std::foo directives to please dec
6873 * replace calls to string::clear() to string::erase() (Angus)
6875 * src/cheaders/cmath: modified to provide std::abs.
6877 2000-05-04 Juergen Vigna <jug@sad.it>
6879 * src/insets/insettext.C: Prepared all for inserting of multiple
6880 paragraphs. Still display stuff to do (alignment and other things),
6881 but I would like to use LyXText to do this when we cleaned out the
6882 table-support stuff.
6884 * src/insets/insettabular.C: Changed lot of stuff and added lots
6885 of functionality still a lot to do.
6887 * src/tabular.C: Various functions changed name and moved to be
6888 const functions. Added new Read and Write functions and changed
6889 lots of things so it works good with tabular-insets (also removed
6890 some stuff which is not needed anymore * hacks *).
6892 * src/lyxcursor.h: added operators == and != which just look if
6893 par and pos are (not) equal.
6895 * src/buffer.C (latexParagraphs): inserted this function to latex
6896 all paragraphs form par to endpar as then I can use this too for
6899 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6900 so that I can call this to from text insets with their own cursor.
6902 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6903 output off all paragraphs (because of the fix below)!
6905 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6906 the very last paragraph (this could be also the last paragraph of an
6909 * src/texrow.h: added rows() call which returns the count-variable.
6911 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6913 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6915 * lib/configure.m4: better autodetection of DocBook tools.
6917 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6919 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6921 * src/lyx_cb.C: add using std::reverse;
6923 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6926 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6927 selected files. Should fix repeated errors from generated files.
6929 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6931 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6933 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6934 the spellchecker popup.
6936 * lib/lyxrc.example: Removed the \number_inset section
6938 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6940 * src/insets/figinset.C (various): Use IsFileReadable() to make
6941 sure that the file actually exist. Relying on ghostscripts errors
6942 is a bad idea since they can lead to X server crashes.
6944 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6946 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6949 * lib/lyxrc.example: smallish typo in description of
6950 \view_dvi_paper_option
6952 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6955 * src/lyxfunc.C: doImportHelper to factor out common code of the
6956 various import methods. New functions doImportASCIIasLines,
6957 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6958 doImportLinuxDoc for the format specific parts.
6961 * buffer.C: Dispatch returns now a bool to indicate success
6964 * lyx_gui.C: Add getLyXView() for member access
6966 * lyx_main.C: Change logic for batch commands: First try
6967 Buffer::Dispatch (possibly without GUI), if that fails, use
6970 * lyx_main.C: Add support for --import command line switch.
6971 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6972 Available Formats: Everything accepted by 'buffer-import <format>'
6974 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6979 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6980 documents will be reformatted upon reentry.
6982 2000-04-27 Juergen Vigna <jug@sad.it>
6984 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6985 correctly only last pos this was a bug.
6987 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6989 * release of lyx-1.1.5pre1
6991 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6993 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6995 * src/menus.C: revert the change of naming (Figure->Graphic...)
6996 from 2000-04-11. It was incomplete and bad.
6998 * src/LColor.[Ch]: add LColor::depthbar.
6999 * src/text.C (GetVisibleRow): use it.
7001 * README: update the languages list.
7003 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7005 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7008 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7010 * README: remove sections that were just wrong.
7012 * src/text2.C (GetRowNearY): remove currentrow code
7014 * src/text.C (GetRow): remove currentrow code
7016 * src/screen.C (Update): rewritten a bit.
7017 (SmallUpdate): removed func
7019 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7021 (FullRebreak): return bool
7022 (currentrow): remove var
7023 (currentrow_y): ditto
7025 * src/lyxscreen.h (Draw): change arg to unsigned long
7026 (FitCursor): return bool
7027 (FitManualCursor): ditto
7028 (Smallpdate): remove func
7029 (first): change to unsigned long
7030 (DrawOneRow): change second arg to long (from long &)
7031 (screen_refresh_y): remove var
7032 (scree_refresh_row): ditto
7034 * src/lyxrow.h: change baseline to usigned int from unsigned
7035 short, this brings some implicit/unsigned issues out in the open.
7037 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7039 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7040 instead of smallUpdate.
7042 * src/lyxcursor.h: change y to unsigned long
7044 * src/buffer.h: don't call updateScrollbar after fitcursor
7046 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7047 where they are used. Removed "\\direction", this was not present
7048 in 1.1.4 and is already obsolete. Commented out some code that I
7049 believe to never be called.
7050 (runLiterate): don't call updateScrollbar after fitCursor
7052 (buildProgram): ditto
7055 * src/WorkArea.h (workWidth): change return val to unsigned
7058 (redraw): remove the button redraws
7059 (setScrollbarValue): change for scrollbar
7060 (getScrollbarValue): change for scrollbar
7061 (getScrollbarBounds): change for scrollbar
7063 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7064 (C_WorkArea_down_cb): removed func
7065 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7066 (resize): change for scrollbar
7067 (setScrollbar): ditto
7068 (setScrollbarBounds): ditto
7069 (setScrollbarIncrements): ditto
7070 (up_cb): removed func
7071 (down_cb): removed func
7072 (scroll_cb): change for scrollbar
7073 (work_area_handler): ditto
7075 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7076 when FitCursor did something.
7077 (updateScrollbar): some unsigned changes
7078 (downCB): removed func
7079 (scrollUpOnePage): removed func
7080 (scrollDownOnePage): remvoed func
7081 (workAreaMotionNotify): don't call screen->FitCursor but use
7082 fitCursor instead. and bool return val
7083 (workAreaButtonPress): ditto
7084 (workAreaButtonRelease): some unsigned changes
7085 (checkInsetHit): ditto
7086 (workAreaExpose): ditto
7087 (update): parts rewritten, comments about the signed char arg added
7088 (smallUpdate): removed func
7089 (cursorPrevious): call needed updateScrollbar
7092 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7095 * src/BufferView.[Ch] (upCB): removed func
7096 (downCB): removed func
7097 (smallUpdate): removed func
7099 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7102 currentrow, currentrow_y optimization. This did not help a lot and
7103 if we want to do this kind of optimization we should rather use
7104 cursor.row instead of the currentrow.
7106 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7107 buffer spacing and klyx spacing support.
7109 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7111 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7114 2000-04-26 Juergen Vigna <jug@sad.it>
7116 * src/insets/figinset.C: fixes to Lars sstream changes!
7118 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7120 * A lot of files: Added Ascii(ostream &) methods to all inset
7121 classes. Used when exporting to ASCII.
7123 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7124 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7127 * src/text2.C (ToggleFree): Disabled implicit word selection when
7128 there is a change in the language
7130 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7131 no output was generated for end-of-sentence inset.
7133 * src/insets/lyxinset.h
7136 * src/paragraph.C: Removed the insetnumber code
7138 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7140 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7142 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7143 no_babel and no_epsfig completely from the file.
7144 (parseSingleLyXformat2Token): add handling for per-paragraph
7145 spacing as written by klyx.
7147 * src/insets/figinset.C: applied patch by Andre. Made it work with
7150 2000-04-20 Juergen Vigna <jug@sad.it>
7152 * src/insets/insettext.C (cutSelection):
7153 (copySelection): Fixed with selection from right to left.
7154 (draw): now the rows are not recalculated at every draw.
7155 (computeTextRows): for now reset the inset-owner here (this is
7156 important for an undo or copy where the inset-owner is not set
7159 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7160 motion to the_locking_inset screen->first was forgotten, this was
7161 not important till we got multiline insets.
7163 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7166 code seems to be alright (it is code changed by Dekel, and the
7167 intent is indeed that all macros should be defined \protect'ed)
7169 * NEWS: a bit of reorganisation of the new user-visible features.
7171 2000-04-19 Juergen Vigna <jug@sad.it>
7173 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7174 position. Set the inset_owner of the used paragraph so that it knows
7175 that it is inside an inset. Fixed cursor handling with mouse and
7176 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7177 and cleanups to make TextInsets work better.
7179 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7180 Changed parameters of various functions and added LockInsetInInset().
7182 * src/insets/insettext.C:
7184 * src/insets/insetcollapsable.h:
7185 * src/insets/insetcollapsable.C:
7186 * src/insets/insetfoot.h:
7187 * src/insets/insetfoot.C:
7188 * src/insets/insetert.h:
7189 * src/insets/insetert.C: cleaned up the code so that it works now
7190 correctly with insettext.
7192 * src/insets/inset.C:
7193 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7194 that insets in insets are supported right.
7197 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7199 * src/paragraph.C: some small fixes
7201 * src/debug.h: inserted INSETS debug info
7203 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7204 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7206 * src/commandtags.h:
7207 * src/LyXAction.C: insert code for InsetTabular.
7209 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7210 not Button1MotionMask.
7211 (workAreaButtonRelease): send always a InsetButtonRelease event to
7213 (checkInsetHit): some setCursor fixes (always with insets).
7215 * src/BufferView2.C (lockInset): returns a bool now and extended for
7216 locking insets inside insets.
7217 (showLockedInsetCursor): it is important to have the cursor always
7218 before the locked inset.
7219 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7221 * src/BufferView.h: made lockInset return a bool.
7223 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7225 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7226 that is used also internally but can be called as public to have back
7227 a cursor pos which is not set internally.
7228 (SetCursorIntern): Changed to use above function.
7230 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7232 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7237 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7238 patches for things that should be in or should be changed.
7240 * src/* [insetfiles]: change "usigned char fragile" to bool
7241 fragile. There was only one point that could that be questioned
7242 and that is commented in formulamacro.C. Grep for "CHECK".
7244 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7245 (DeleteBuffer): take it out of CutAndPaste and make it static.
7247 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7249 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7250 output the spacing envir commands. Also the new commands used in
7251 the LaTeX output makes the result better.
7253 * src/Spacing.C (writeEnvirBegin): new method
7254 (writeEnvirEnd): new method
7256 2000-04-18 Juergen Vigna <jug@sad.it>
7258 * src/CutAndPaste.C: made textclass a static member of the class
7259 as otherwise it is not accesed right!!!
7261 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7263 * forms/layout_forms.fd
7264 * src/layout_forms.h
7265 * src/layout_forms.C (create_form_form_character)
7266 * src/lyx_cb.C (UserFreeFont)
7267 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7268 documents (in the layout->character popup).
7270 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7273 \spell_command was in fact not honored (from Kevin Atkinson).
7275 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7278 * src/lyx_gui.h: make lyxViews private (Angus)
7280 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7282 * src/mathed/math_write.C
7283 (MathMatrixInset::Write) Put \protect before \begin{array} and
7284 \end{array} if fragile
7285 (MathParInset::Write): Put \protect before \\ if fragile
7287 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7289 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7290 initialization if the LyXColorHandler must be done after the
7291 connections to the XServer has been established.
7293 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7294 get the background pixel from the lyxColorhandler so that the
7295 figures are rendered with the correct background color.
7296 (NextToken): removed functions.
7297 (GetPSSizes): use ifs >> string instead of NextToken.
7299 * src/Painter.[Ch]: the color cache moved out of this file.
7301 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7304 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7306 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7307 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7309 * src/BufferView.C (enterView): new func
7310 (leaveView): new func
7312 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7314 (leaveView): new func, undefines xterm cursor when approp.
7316 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7317 (AllowInput): delete the Workarea cursor handling from this func.
7319 * src/Painter.C (underline): draw a slimer underline in most cases.
7321 * src/lyx_main.C (error_handler): use extern "C"
7323 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7325 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7326 sent directly to me.
7328 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7329 to the list by Dekel.
7331 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7334 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7335 methods from lyx_cb.here.
7337 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7340 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7342 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7343 instead of using current_view directly.
7345 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7347 * src/LyXAction.C (init): add the paragraph-spacing command.
7349 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7351 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7353 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7354 different from the documents.
7356 * src/text.C (SetHeightOfRow): take paragraph spacing into
7357 account, paragraph spacing takes precedence over buffer spacing
7358 (GetVisibleRow): ditto
7360 * src/paragraph.C (writeFile): output the spacing parameter too.
7361 (validate): set the correct features if spacing is used in the
7363 (Clear): set spacing to default
7364 (MakeSameLayout): spacing too
7365 (HasSameLayout): spacing too
7366 (SetLayout): spacing too
7367 (TeXOnePar): output the spacing commands
7369 * src/lyxparagraph.h: added a spacing variable for use with
7370 per-paragraph spacing.
7372 * src/Spacing.h: add a Default spacing and a method to check if
7373 the current spacing is default. also added an operator==
7375 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7378 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * src/lyxserver.C (callback): fix dispatch of functions
7382 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7383 printf() into lyxerr call.
7385 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7388 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7389 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7390 the "Float" from each of the subitems.
7391 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7393 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7394 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7395 documented the change so that the workaround can be nuked later.
7397 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7400 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7402 * src/buffer.C (getLatexName): ditto
7403 (setReadonly): ditto
7405 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7407 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7408 avoid some uses of current_view. Added also a bufferParams()
7409 method to get at this.
7411 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7413 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7415 * src/lyxparagraph.[Ch]: removed
7416 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7417 with operators used by lower_bound and
7418 upper_bound in InsetTable's
7419 Make struct InsetTable private again. Used matchpos.
7421 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7423 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7424 document, the language of existing text is changed (unless the
7425 document is multi-lingual)
7427 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7429 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7431 * A lot of files: A rewrite of the Right-to-Left support.
7433 2000-04-10 Juergen Vigna <jug@sad.it>
7435 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7436 misplaced cursor when inset in inset is locked.
7438 * src/insets/insettext.C (LocalDispatch): small fix so that a
7439 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7441 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7442 footnote font should be decreased in size twice when displaying.
7444 * src/insets/insettext.C (GetDrawFont): inserted this function as
7445 the drawing-font may differ from the real paragraph font.
7447 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7448 insets (inset in inset!).
7450 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7451 function here because we don't want footnotes inside footnotes.
7453 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7455 (init): now set the inset_owner in paragraph.C
7456 (LocalDispatch): added some resetPos() in the right position
7459 (pasteSelection): changed to use the new CutAndPaste-Class.
7461 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7462 which tells if it is allowed to insert another inset inside this one.
7464 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7465 SwitchLayoutsBetweenClasses.
7467 * src/text2.C (InsertInset): checking of the new paragraph-function
7469 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7470 is not needed anymore here!
7473 (PasteSelection): redone (also with #ifdef) so that now this uses
7474 the CutAndPaste-Class.
7475 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7478 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7479 from/to text/insets.
7481 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7482 so that the paragraph knows if it is inside an (text)-inset.
7483 (InsertFromMinibuffer): changed return-value to bool as now it
7484 may happen that an inset is not inserted in the paragraph.
7485 (InsertInsetAllowed): this checks if it is allowed to insert an
7486 inset in this paragraph.
7488 (BreakParagraphConservative):
7489 (BreakParagraph) : small change for the above change of the return
7490 value of InsertFromMinibuffer.
7492 * src/lyxparagraph.h: added inset_owner and the functions to handle
7493 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7495 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7497 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7498 functions from BufferView to BufferView::Pimpl to ease maintence.
7500 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7501 correctly. Also use SetCursorIntern instead of SetCursor.
7503 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7506 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7508 * src/WorkArea.C (belowMouse): manually implement below mouse.
7510 * src/*: Add "explicit" on several constructors, I added probably
7511 some unneeded ones. A couple of changes to code because of this.
7513 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7514 implementation and private parts from the users of BufferView. Not
7517 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7518 implementation and private parts from the users of LyXLex. Not
7521 * src/BufferView_pimpl.[Ch]: new files
7523 * src/lyxlex_pimpl.[Ch]: new files
7525 * src/LyXView.[Ch]: some inline functions move out-of-line
7527 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7529 * src/lyxparagraph.h: make struct InsetTable public.
7531 * src/support/lyxstring.h: change lyxstring::difference_type to be
7532 ptrdiff_t. Add std:: modifiers to streams.
7534 * src/font.C: include the <cctype> header, for islower() and
7537 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7539 * src/font.[Ch]: new files. Contains the metric functions for
7540 fonts, takes a LyXFont as parameter. Better separation of concepts.
7542 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7543 changes because of this.
7545 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7547 * src/*: compile with -Winline and move functions that don't
7550 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7553 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7555 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7556 (various files changed because of this)
7558 * src/Painter.C (text): fixed the drawing of smallcaps.
7560 * src/lyxfont.[Ch] (drawText): removed unused member func.
7563 * src/*.C: added needed "using" statements and "std::" qualifiers.
7565 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7567 * src/*.h: removed all use of "using" from header files use
7568 qualifier std:: instead.
7570 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7572 * src/text.C (Backspace): some additional cleanups (we already
7573 know whether cursor.pos is 0 or not).
7575 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7576 automake does not provide one).
7578 * src/bmtable.h: replace C++ comments with C comments.
7580 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7582 * src/screen.C (ShowCursor): Change the shape of the cursor if
7583 the current language is not equal to the language of the document.
7584 (If the cursor change its shape unexpectedly, then you've found a bug)
7586 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7589 * src/insets/insetnumber.[Ch]: New files.
7591 * src/LyXAction.C (init)
7592 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7595 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7597 * src/lyxparagraph.h
7598 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7599 (the vector is kept sorted).
7601 * src/text.C (GetVisibleRow): Draw selection correctly when there
7602 is both LTR and RTL text.
7604 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7605 which is much faster.
7607 * src/text.C (GetVisibleRow and other): Do not draw the last space
7608 in a row if the direction of the last letter is not equal to the
7609 direction of the paragraph.
7611 * src/lyxfont.C (latexWriteStartChanges):
7612 Check that font language is not equal to basefont language.
7613 (latexWriteEndChanges): ditto
7615 * src/lyx_cb.C (StyleReset): Don't change the language while using
7616 the font-default command.
7618 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7619 empty paragraph before a footnote.
7621 * src/insets/insetcommand.C (draw): Increase x correctly.
7623 * src/screen.C (ShowCursor): Change cursor shape if
7624 current language != document language.
7626 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7628 2000-03-31 Juergen Vigna <jug@sad.it>
7630 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7631 (Clone): changed mode how the paragraph-data is copied to the
7632 new clone-paragraph.
7634 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7635 GetInset(pos) with no inset anymore there (in inset UNDO)
7637 * src/insets/insetcommand.C (draw): small fix as here x is
7638 incremented not as much as width() returns (2 before, 2 behind = 4)
7640 2000-03-30 Juergen Vigna <jug@sad.it>
7642 * src/insets/insettext.C (InsetText): small fix in initialize
7643 widthOffset (should not be done in the init() function)
7645 2000-03-29 Amir Karger <karger@lyx.org>
7647 * lib/examples/it_ItemizeBullets.lyx: translation by
7650 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7652 2000-03-29 Juergen Vigna <jug@sad.it>
7654 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7656 * src/insets/insetfoot.C (Clone): small change as for the below
7657 new init function in the text-inset
7659 * src/insets/insettext.C (init): new function as I've seen that
7660 clone did not copy the Paragraph-Data!
7661 (LocalDispatch): Added code so that now we have some sort of Undo
7662 functionality (well actually we HAVE Undo ;)
7664 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7666 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7668 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7671 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7673 * src/main.C: added a runtime check that verifies that the xforms
7674 header used when building LyX and the library used when running
7675 LyX match. Exit with a message if they don't match. This is a
7676 version number check only.
7678 * src/buffer.C (save): Don't allocate memory on the heap for
7679 struct utimbuf times.
7681 * *: some using changes, use iosfwd instead of the real headers.
7683 * src/lyxfont.C use char const * instead of string for the static
7684 strings. Rewrite some functions to use sstream.
7686 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7688 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7691 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7693 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7694 of Geodesy (from Martin Vermeer)
7696 * lib/layouts/svjour.inc: include file for the Springer svjour
7697 class. It can be used to support journals other than JoG.
7699 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7700 Miskiewicz <misiek@pld.org.pl>)
7701 * lib/reLyX/Makefile.am: ditto.
7703 2000-03-27 Juergen Vigna <jug@sad.it>
7705 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7706 also some modifications with operations on selected text.
7708 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7709 problems with clicking on insets (last famous words ;)
7711 * src/insets/insetcommand.C (draw):
7712 (width): Changed to have a bit of space before and after the inset so
7713 that the blinking cursor can be seen (otherwise it was hidden)
7715 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7717 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7718 would not be added to the link list when an installed gettext (not
7719 part of libc) is found.
7721 2000-03-24 Juergen Vigna <jug@sad.it>
7723 * src/insets/insetcollapsable.C (Edit):
7724 * src/mathed/formula.C (InsetButtonRelease):
7725 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7728 * src/BufferView.C (workAreaButtonPress):
7729 (workAreaButtonRelease):
7730 (checkInsetHit): Finally fixed the clicking on insets be handled
7733 * src/insets/insetert.C (Edit): inserted this call so that ERT
7734 insets work always with LaTeX-font
7736 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7738 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7739 caused lyx to startup with no GUI in place, causing in a crash
7740 upon startup when called with arguments.
7742 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7744 * src/FontLoader.C: better initialization of dummyXFontStruct.
7746 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7748 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7749 for linuxdoc and docbook import and export format options.
7751 * lib/lyxrc.example Example of default values for the previous flags.
7753 * src/lyx_cb.C Use those flags instead of the hardwired values for
7754 linuxdoc and docbook export.
7756 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7759 * src/menus.C Added menus entries for the new import/exports formats.
7761 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7763 * src/lyxrc.*: Added support for running without Gui
7766 * src/FontLoader.C: sensible defaults if no fonts are needed
7768 * src/lyx_cb.C: New function ShowMessage (writes either to the
7769 minibuffer or cout in case of no gui
7770 New function AskOverwrite for common stuff
7771 Consequently various changes to call these functions
7773 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7774 wild guess at sensible screen resolution when having no gui
7776 * src/lyxfont.C: no gui, no fonts... set some defaults
7778 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7780 * src/LColor.C: made the command inset background a bit lighter.
7782 2000-03-20 Hartmut Goebel <goebel@noris.net>
7784 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7785 stdstruct.inc. Koma-Script added some title elements which
7786 otherwise have been listed below "bibliography". This split allows
7787 adding title elements to where they belong.
7789 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7790 define the additional title elements and then include
7793 * many other layout files: changed to include stdtitle.inc just
7794 before stdstruct.inc.
7796 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7798 * src/buffer.C: (save) Added the option to store all backup files
7799 in a single directory
7801 * src/lyxrc.[Ch]: Added variable \backupdir_path
7803 * lib/lyxrc.example: Added descriptions of recently added variables
7805 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7806 bibtex inset, not closing the bibtex popup when deleting the inset)
7808 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7810 * src/lyx_cb.C: add a couple using directives.
7812 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7813 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7814 import based on the filename.
7816 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7817 file would be imported at start, if the filename where of a sgml file.
7819 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7821 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7823 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7824 * src/lyxfont.h Replaced the member variable bits.direction by the
7825 member variable lang. Made many changes in other files.
7826 This allows having a multi-lingual document
7828 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7829 that change the current language to <l>.
7830 Removed the command "font-rtl"
7832 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7833 format for Hebrew documents)
7835 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7836 When auto_mathmode is "true", pressing a digit key in normal mode
7837 will cause entering into mathmode.
7838 If auto_mathmode is "rtl" then this behavior will be active only
7839 when writing right-to-left text.
7841 * src/text2.C (InsertStringA) The string is inserted using the
7844 * src/paragraph.C (GetEndLabel) Gives a correct result for
7845 footnote paragraphs.
7847 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7849 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7851 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7852 front of PasteParagraph. Never insert a ' '. This should at least
7853 fix some cause for the segfaults that we have been experiencing,
7854 it also fixes backspace behaviour slightly. (Phu!)
7856 * src/support/lstrings.C (compare_no_case): some change to make it
7857 compile with gcc 2.95.2 and stdlibc++-v3
7859 * src/text2.C (MeltFootnoteEnvironment): change type o
7860 first_footnote_par_is_not_empty to bool.
7862 * src/lyxparagraph.h: make text private. Changes in other files
7864 (fitToSize): new function
7865 (setContentsFromPar): new function
7866 (clearContents): new function
7867 (SetChar): new function
7869 * src/paragraph.C (readSimpleWholeFile): deleted.
7871 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7872 the file, just use a simple string instead. Also read the file in
7873 a more maintainable manner.
7875 * src/text2.C (InsertStringA): deleted.
7876 (InsertStringB): deleted.
7878 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7881 RedoParagraphs from the doublespace handling part, just set status
7882 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7883 done, but perhaps not like this.)
7885 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7887 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7888 character when inserting an inset.
7890 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7892 * src/bufferparams.C (readLanguage): now takes "default" into
7895 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7896 also initialize the toplevel_keymap with the default bindings from
7899 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7901 * all files using lyxrc: have lyxrc as a real variable and not a
7902 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7905 * src/lyxrc.C: remove double call to defaultKeyBindings
7907 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7908 toolbar defauls using lyxlex. Remove enums, structs, functions
7911 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7912 toolbar defaults. Also store default keybindings in a map.
7914 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7915 storing the toolbar defaults without any xforms dependencies.
7917 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7918 applied. Changed to use iterators.
7920 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7922 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7923 systems that don't have LINGUAS set to begin with.
7925 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7928 the list by Dekel Tsur.
7930 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7932 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7933 * src/insets/form_graphics.C: ditto.
7935 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7937 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7939 * src/bufferparams.C (readLanguage): use the new language map
7941 * src/intl.C (InitKeyMapper): use the new language map
7943 * src/lyx_gui.C (create_forms): use the new language map
7945 * src/language.[Ch]: New files. Used for holding the information
7946 about each language. Now! Use this new language map enhance it and
7947 make it really usable for our needs.
7949 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7951 * screen.C (ShowCursor): Removed duplicate code.
7952 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7953 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7955 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7958 * src/text.C Added TransformChar method. Used for rendering Arabic
7959 text correctly (change the glyphs of the letter according to the
7960 position in the word)
7965 * src/lyxrc.C Added lyxrc command {language_command_begin,
7966 language_command_end,language_command_ltr,language_command_rtl,
7967 language_package} which allows the use of either arabtex or Omega
7970 * src/lyx_gui.C (init)
7972 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7973 to use encoding for menu fonts which is different than the encoding
7976 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7977 do not load the babel package.
7978 To write an English document with Hebrew/Arabic, change the document
7979 language to "english".
7981 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7982 (alphaCounter): changed to return char
7983 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7985 * lib/lyxrc.example Added examples for Hebrew/Arabic
7988 * src/layout.C Added layout command endlabeltype
7990 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7992 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7994 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7996 * src/mathed/math_delim.C (search_deco): return a
7997 math_deco_struct* instead of index.
7999 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8001 * All files with a USE_OSTREAM_ONLY within: removed all code that
8002 was unused when USE_OSTREAM_ONLY is defined.
8004 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8005 of any less. Removed header and using.
8007 * src/text.C (GetVisibleRow): draw the string "Page Break
8008 (top/bottom)" on screen when drawing a pagebreak line.
8010 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8012 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8014 * src/mathed/math_macro.C (draw): do some cast magic.
8017 * src/mathed/math_defs.h: change byte* argument to byte const*.
8019 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8021 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8022 know it is right to return InsetFoot* too, but cxx does not like
8025 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8027 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8029 * src/mathed/math_delim.C: change == to proper assignment.
8031 2000-03-09 Juergen Vigna <jug@sad.it>
8033 * src/insets/insettext.C (setPos): fixed various cursor positioning
8034 problems (via mouse and cursor-keys)
8035 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8036 inset (still a small display problem but it works ;)
8038 * src/insets/insetcollapsable.C (draw): added button_top_y and
8039 button_bottom_y to have correct values for clicking on the inset.
8041 * src/support/lyxalgo.h: commented out 'using std::less'
8043 2000-03-08 Juergen Vigna <jug@sad.it>
8045 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8046 Button-Release event closes as it is alos the Release-Event
8049 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8051 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8053 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8054 can add multiple spaces in Scrap (literate programming) styles...
8055 which, by the way, is how I got hooked on LyX to begin with.
8057 * src/mathed/formula.C (Write): Added dummy variable to an
8058 inset::Latex() call.
8059 (Latex): Add free_spacing boolean to inset::Latex()
8061 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8063 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8064 virtual function to include the free_spacing boolean from
8065 the containing paragraph's style.
8067 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8068 Added free_spacing boolean arg to match inset.h
8070 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8071 Added free_spacing boolean arg to match inset.h
8073 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8074 Added free_spacing boolean and made sure that if in a free_spacing
8075 paragraph, that we output normal space if there is a protected space.
8077 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8078 Added free_spacing boolean arg to match inset.h
8080 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8081 Added free_spacing boolean arg to match inset.h
8083 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8084 Added free_spacing boolean arg to match inset.h
8086 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8087 Added free_spacing boolean arg to match inset.h
8089 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8090 Added free_spacing boolean arg to match inset.h
8092 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8093 free_spacing boolean arg to match inset.h
8095 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8096 Added free_spacing boolean arg to match inset.h
8098 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8099 Added free_spacing boolean arg to match inset.h
8101 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8102 Added free_spacing boolean arg to match inset.h
8104 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8105 Added free_spacing boolean arg to match inset.h
8107 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8108 Added free_spacing boolean arg to match inset.h
8110 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8111 free_spacing boolean arg to match inset.h
8113 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8114 free_spacing boolean arg to match inset.h
8116 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8117 ignore free_spacing paragraphs. The user's spaces are left
8120 * src/text.C (InsertChar): Fixed the free_spacing layout
8121 attribute behavior. Now, if free_spacing is set, you can
8122 add multiple spaces in a paragraph with impunity (and they
8123 get output verbatim).
8124 (SelectSelectedWord): Added dummy argument to inset::Latex()
8127 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8130 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8131 paragraph layouts now only input a simple space instead.
8132 Special character insets don't make any sense in free-spacing
8135 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8136 hard-spaces in the *input* file to simple spaces if the layout
8137 is free-spacing. This converts old files which had to have
8138 hard-spaces in free-spacing layouts where a simple space was
8140 (writeFileAscii): Added free_spacing check to pass to the newly
8141 reworked inset::Latex(...) methods. The inset::Latex() code
8142 ensures that hard-spaces in free-spacing paragraphs get output
8143 as spaces (rather than "~").
8145 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8147 * src/mathed/math_delim.C (draw): draw the empty placeholder
8148 delims with a onoffdash line.
8149 (struct math_deco_compare): struct that holds the "functors" used
8150 for the sort and the binary search in math_deco_table.
8151 (class init_deco_table): class used for initial sort of the
8153 (search_deco): use lower_bound to do a binary search in the
8156 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8158 * src/lyxrc.C: a small secret thingie...
8160 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8161 and to not flush the stream as often as it used to.
8163 * src/support/lyxalgo.h: new file
8164 (sorted): template function used for checking if a sequence is
8165 sorted or not. Two versions with and without user supplied
8166 compare. Uses same compare as std::sort.
8168 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8169 it and give warning on lyxerr.
8171 (struct compare_tags): struct with function operators used for
8172 checking if sorted, sorting and lower_bound.
8173 (search_kw): use lower_bound instead of manually implemented
8176 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8178 * src/insets/insetcollapsable.h: fix Clone() declaration.
8179 * src/insets/insetfoot.h: ditto.
8181 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8183 2000-03-08 Juergen Vigna <jug@sad.it>
8185 * src/insets/lyxinset.h: added owner call which tells us if
8186 this inset is inside another inset. Changed also the return-type
8187 of Editable to an enum so it tells clearer what the return-value is.
8189 * src/insets/insettext.C (computeTextRows): fixed computing of
8190 textinsets which split automatically on more rows.
8192 * src/insets/insetert.[Ch]: changed this to be of BaseType
8195 * src/insets/insetfoot.[Ch]: added footnote inset
8197 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8198 collapsable insets (like footnote, ert, ...)
8200 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8202 * src/lyxdraw.h: remvoe file
8204 * src/lyxdraw.C: remove file
8206 * src/insets/insettext.C: added <algorithm>.
8208 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8210 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8211 (matrix_cb): case MM_OK use string stream
8213 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8216 * src/mathed/math_macro.C (draw): use string stream
8217 (Metrics): use string stream
8219 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8220 directly to the ostream.
8222 * src/vspace.C (asString): use string stream.
8223 (asString): use string stream
8224 (asLatexString): use string stream
8226 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8227 setting Spacing::Other.
8229 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8230 sprintf when creating the stretch vale.
8232 * src/text2.C (alphaCounter): changed to return a string and to
8233 not use a static variable internally. Also fixed a one-off bug.
8234 (SetCounter): changed the drawing of the labels to use string
8235 streams instead of sprintf.
8237 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8238 manipulator to use a scheme that does not require library support.
8239 This is also the way it is done in the new GNU libstdc++. Should
8240 work with DEC cxx now.
8242 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8244 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8245 end. This fixes a bug.
8247 * src/mathed (all files concerned with file writing): apply the
8248 USE_OSTREAM_ONLY changes to mathed too.
8250 * src/support/DebugStream.h: make the constructor explicit.
8252 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8253 count and ostream squashed.
8255 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8257 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8259 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8260 ostringstream uses STL strings, and we might not.
8262 * src/insets/insetspecialchar.C: add using directive.
8263 * src/insets/insettext.C: ditto.
8265 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8267 * lib/layouts/seminar.layout: feeble attempt at a layout for
8268 seminar.cls, far from completet and could really use some looking
8269 at from people used to write layout files.
8271 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8272 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8273 a lot nicer and works nicely with ostreams.
8275 * src/mathed/formula.C (draw): a slightly different solution that
8276 the one posted to the list, but I think this one works too. (font
8277 size wrong in headers.)
8279 * src/insets/insettext.C (computeTextRows): some fiddling on
8280 Jürgens turf, added some comments that he should read.
8282 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8283 used and it gave compiler warnings.
8284 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8287 * src/lyx_gui.C (create_forms): do the right thing when
8288 show_banner is true/false.
8290 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8291 show_banner is false.
8293 * most file writing files: Now use iostreams to do almost all of
8294 the writing. Also instead of passing string &, we now use
8295 stringstreams. mathed output is still not adapted to iostreams.
8296 This change can be turned off by commenting out all the occurences
8297 of the "#define USE_OSTREAM_ONLY 1" lines.
8299 * src/WorkArea.C (createPixmap): don't output debug messages.
8300 (WorkArea): don't output debug messages.
8302 * lib/lyxrc.example: added a comment about the new variable
8305 * development/Code_rules/Rules: Added some more commente about how
8306 to build class interfaces and on how better encapsulation can be
8309 2000-03-03 Juergen Vigna <jug@sad.it>
8311 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8312 automatically with the width of the LyX-Window
8314 * src/insets/insettext.C (computeTextRows): fixed update bug in
8315 displaying text-insets (scrollvalues where not initialized!)
8317 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8319 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8320 id in the check of the result from lower_bound is not enough since
8321 lower_bound can return last too, and then res->id will not be a
8324 * all insets and some code that use them: I have conditionalized
8325 removed the Latex(string & out, ...) this means that only the
8326 Latex(ostream &, ...) will be used. This is a work in progress to
8327 move towards using streams for all output of files.
8329 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8332 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8334 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8335 routine (this fixes bug where greek letters were surrounded by too
8338 * src/support/filetools.C (findtexfile): change a bit the search
8339 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8340 no longer passed to kpsewhich, we may have to change that later.
8342 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8343 warning options to avoid problems with X header files (from Angus
8345 * acinclude.m4: regenerated.
8347 2000-03-02 Juergen Vigna <jug@sad.it>
8349 * src/insets/insettext.C (WriteParagraphData): Using the
8350 par->writeFile() function for writing paragraph-data.
8351 (Read): Using buffer->parseSingleLyXformat2Token()-function
8352 for parsing paragraph data!
8354 * src/buffer.C (readLyXformat2): removed all parse data and using
8355 the new parseSingleLyXformat2Token()-function.
8356 (parseSingleLyXformat2Token): added this function to parse (read)
8357 lyx-file-format (this is called also from text-insets now!)
8359 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8364 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8365 directly instead of going through a func. One very bad thing: a
8366 static LyXFindReplace, but I don't know where to place it.
8368 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8369 string instead of char[]. Also changed to static.
8370 (GetSelectionOrWordAtCursor): changed to static inline
8371 (SetSelectionOverLenChars): ditto.
8373 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8374 current_view and global variables. both classes has changed names
8375 and LyXFindReplace is not inherited from SearchForm.
8377 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8378 fl_form_search form.
8380 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8382 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8385 bound (from Kayvan).
8387 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8389 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8391 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8393 * some things that I should comment but the local pub says head to
8396 * comment out all code that belongs to the Roff code for Ascii
8397 export of tables. (this is unused)
8399 * src/LyXView.C: use correct type for global variable
8400 current_layout. (LyXTextClass::size_type)
8402 * some code to get the new insetgraphics closer to working I'd be
8403 grateful for any help.
8405 * src/BufferView2.C (insertInset): use the return type of
8406 NumberOfLayout properly. (also changes in other files)
8408 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8409 this as a test. I want to know what breaks because of this.
8411 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8413 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8415 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8416 to use a \makebox in the label, this allows proper justification
8417 with out using protected spaces or multiple hfills. Now it is
8418 "label" for left justified, "\hfill label\hfill" for center, and
8419 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8420 should be changed accordingly.
8422 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8424 * src/lyxtext.h: change SetLayout() to take a
8425 LyXTextClass::size_type instead of a char (when there is more than
8426 127 layouts in a class); also change type of copylayouttype.
8427 * src/text2.C (SetLayout): ditto.
8428 * src/LyXView.C (updateLayoutChoice): ditto.
8430 * src/LaTeX.C (scanLogFile): errors where the line number was not
8431 given just after the '!'-line were ignored (from Dekel Tsur).
8433 * lib/lyxrc.example: fix description of \date_insert_format
8435 * lib/layouts/llncs.layout: new layout, contributed by Martin
8438 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8440 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8441 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8442 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8443 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8444 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8445 paragraph.C, text.C, text2.C)
8447 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8449 * src/insets/insettext.C (LocalDispatch): remove extra break
8452 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8453 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8455 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8456 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8458 * src/insets/insetbib.h: move InsetBibkey::Holder and
8459 InsetCitation::Holder in public space.
8461 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * src/insets/insettext.h: small change to get the new files from
8464 Juergen to compile (use "string", not "class string").
8466 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8467 const & as parameter to LocalDispatch, use LyXFont const & as
8468 paramter to some other func. This also had impacto on lyxinsets.h
8469 and the two mathed insets.
8471 2000-02-24 Juergen Vigna <jug@sad.it>
8474 * src/commandtags.h:
8476 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8480 * src/BufferView2.C: added/updated code for various inset-functions
8482 * src/insets/insetert.[Ch]: added implementation of InsetERT
8484 * src/insets/insettext.[Ch]: added implementation of InsetText
8486 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8487 (draw): added preliminary code for inset scrolling not finshed yet
8489 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8490 as it is in lyxfunc.C now
8492 * src/insets/lyxinset.h: Added functions for text-insets
8494 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8497 BufferView and reimplement the list as a queue put inside its own
8500 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8502 * several files: use the new interface to the "updateinsetlist"
8504 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8506 (work_area_handler): call BufferView::trippleClick on trippleclick.
8508 * src/BufferView.C (doubleClick): new function, selects word on
8510 (trippleClick): new function, selects line on trippleclick.
8512 2000-02-22 Allan Rae <rae@lyx.org>
8514 * lib/bind/xemacs.bind: buffer-previous not supported
8516 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8518 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8521 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8523 * src/bufferlist.C: get rid of current_view from this file
8525 * src/spellchecker.C: get rid of current_view from this file
8527 * src/vspace.C: get rid of current_view from this file
8528 (inPixels): added BufferView parameter for this func
8529 (asLatexCommand): added a BufferParams for this func
8531 * src/text.C src/text2.C: get rid of current_view from these
8534 * src/lyxfont.C (getFontDirection): move this function here from
8537 * src/bufferparams.C (getDocumentDirection): move this function
8540 * src/paragraph.C (getParDirection): move this function here from
8542 (getLetterDirection): ditto
8544 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8546 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8547 resize due to wrong pixmap beeing used. Also took the opurtunity
8548 to make the LyXScreen stateless on regard to WorkArea and some
8549 general cleanup in the same files.
8551 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/Makefile.am: add missing direction.h
8555 * src/PainterBase.h: made the width functions const.
8557 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8560 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8562 * src/insets/insetlatexaccent.C (draw): make the accents draw
8563 better, at present this will only work well with iso8859-1.
8565 * several files: remove the old drawing code, now we use the new
8568 * several files: remove support for mono_video, reverse_video and
8571 2000-02-17 Juergen Vigna <jug@sad.it>
8573 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8574 int ** as we have to return the pointer, otherwise we have only
8575 NULL pointers in the returning function.
8577 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8579 * src/LaTeX.C (operator()): quote file name when running latex.
8581 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8584 (bubble tip), this removes our special handling of this.
8586 * Remove all code that is unused now that we have the new
8587 workarea. (Code that are not active when NEW_WA is defined.)
8589 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8591 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8593 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8594 nonexisting layout; correctly redirect obsoleted layouts.
8596 * lib/lyxrc.example: document \view_dvi_paper_option
8598 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8601 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8602 (PreviewDVI): handle the view_dvi_paper_option variable.
8603 [Both from Roland Krause]
8605 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8608 char const *, int, LyXFont)
8609 (text(int, int, string, LyXFont)): ditto
8611 * src/text.C (InsertCharInTable): attempt to fix the double-space
8612 feature in tables too.
8613 (BackspaceInTable): ditto.
8614 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8616 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8618 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8620 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8621 newly found text in textcache to this.
8622 (buffer): set the owner of the text put into the textcache to 0
8624 * src/insets/figinset.C (draw): fixed the drawing of figures with
8627 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8628 drawing of mathframe, hfills, protected space, table lines. I have
8629 now no outstanding drawing problems with the new Painter code.
8631 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8633 * src/PainterBase.C (ellipse, circle): do not specify the default
8636 * src/LColor.h: add using directive.
8638 * src/Painter.[Ch]: change return type of methods from Painter& to
8639 PainterBase&. Add a using directive.
8641 * src/WorkArea.C: wrap xforms callbacks in C functions
8644 * lib/layouts/foils.layout: font fix and simplifications from Carl
8647 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8649 * a lot of files: The Painter, LColor and WorkArea from the old
8650 devel branch has been ported to lyx-devel. Some new files and a
8651 lot of #ifdeffed code. The new workarea is enabled by default, but
8652 if you want to test the new Painter and LColor you have to compile
8653 with USE_PAINTER defined (do this in config.h f.ex.) There are
8654 still some rought edges, and I'd like some help to clear those
8655 out. It looks stable (loads and displays the Userguide very well).
8658 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8660 * src/buffer.C (pop_tag): revert to the previous implementation
8661 (use a global variable for both loops).
8663 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8665 * src/lyxrc.C (LyXRC): change slightly default date format.
8667 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8668 there is an English text with a footnote that starts with a Hebrew
8669 paragraph, or vice versa.
8670 (TeXFootnote): ditto.
8672 * src/text.C (LeftMargin): allow for negative values for
8673 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8676 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8677 for input encoding (cyrillic)
8679 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8681 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8684 * src/toolbar.C (set): ditto
8685 * src/insets/insetbib.C (create_form_citation_form): ditto
8687 * lib/CREDITS: added Dekel Tsur.
8689 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8690 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8691 hebrew supports files from Dekel Tsur.
8693 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8694 <tzafrir@technion.ac.il>
8696 * src/lyxrc.C: put \date_insert_format at the right place.
8698 * src/buffer.C (makeLaTeXFile): fix the handling of
8699 BufferParams::sides when writing out latex files.
8701 * src/BufferView2.C: add a "using" directive.
8703 * src/support/lyxsum.C (sum): when we use lyxstring,
8704 ostringstream::str needs an additional .c_str().
8706 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8708 * src/support/filetools.C (ChangeExtension): patch from Etienne
8711 * src/TextCache.C (show): remove const_cast and make second
8712 parameter non-const LyXText *.
8714 * src/TextCache.h: use non const LyXText in show.
8716 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8719 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8721 * src/support/lyxsum.C: rework to be more flexible.
8723 * several places: don't check if a pointer is 0 if you are going
8726 * src/text.C: remove some dead code.
8728 * src/insets/figinset.C: remove some dead code
8730 * src/buffer.C: move the BufferView funcs to BufferView2.C
8731 remove all support for insetlatexdel
8732 remove support for oldpapersize stuff
8733 made some member funcs const
8735 * src/kbmap.C: use a std::list to store the bindings in.
8737 * src/BufferView2.C: new file
8739 * src/kbsequence.[Ch]: new files
8741 * src/LyXAction.C + others: remove all trace of buffer-previous
8743 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8744 only have one copy in the binary of this table.
8746 * hebrew patch: moved some functions from LyXText to more
8747 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8749 * several files: remove support for XForms older than 0.88
8751 remove some #if 0 #endif code
8753 * src/TextCache.[Ch]: new file. Holds the textcache.
8755 * src/BufferView.C: changes to use the new TextCache interface.
8756 (waitForX): remove the now unused code.
8758 * src/BackStack.h: remove some commented code
8760 * lib/bind/emacs.bind: remove binding for buffer-previous
8762 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8764 * applied the hebrew patch.
8766 * src/lyxrow.h: make sure that all Row variables are initialized.
8768 * src/text2.C (TextHandleUndo): comment out a delete, this might
8769 introduce a memory leak, but should also help us to not try to
8770 read freed memory. We need to look at this one.
8772 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8773 (LyXParagraph): initalize footnotekind.
8775 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8776 forgot this when applying the patch. Please heed the warnings.
8778 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8779 (aka. reformat problem)
8781 * src/bufferlist.C (exists): made const, and use const_iterator
8782 (isLoaded): new func.
8783 (release): use std::find to find the correct buffer.
8785 * src/bufferlist.h: made getState a const func.
8786 made empty a const func.
8787 made exists a const func.
8790 2000-02-01 Juergen Vigna <jug@sad.it>
8792 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8794 * po/it.po: updated a bit the italian po file and also changed the
8795 'file nuovo' for newfile to 'filenuovo' without a space, this did
8798 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8799 for the new insert_date command.
8801 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8802 from jdblair, to insert a date into the current text conforming to
8803 a strftime format (for now only considering the locale-set and not
8804 the document-language).
8806 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8808 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8809 Bounds Read error seen by purify. The problem was that islower is
8810 a macros which takes an unsigned char and uses it as an index for
8811 in array of characters properties (and is thus subject to the
8815 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8816 correctly the paper sides radio buttons.
8817 (UpdateDocumentButtons): ditto.
8819 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8821 * src/kbmap.C (getsym + others): change to return unsigned int,
8822 returning a long can give problems on 64 bit systems. (I assume
8823 that int is 32bit on 64bit systems)
8825 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8827 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8828 LyXLookupString to be zero-terminated. Really fixes problems seen
8831 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8833 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8834 write a (char*)0 to the lyxerr stream.
8836 * src/lastfiles.C: move algorithm before the using statemets.
8838 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8841 complains otherwise).
8842 * src/table.C: ditto
8844 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8847 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8848 that I removed earlier... It is really needed.
8850 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8852 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * INSTALL: update xforms home page URL.
8856 * lib/configure.m4: fix a bug with unreadable layout files.
8858 * src/table.C (calculate_width_of_column): add "using std::max"
8861 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8863 * several files: marked several lines with "DEL LINE", this is
8864 lines that can be deleted without changing anything.
8865 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8866 checks this anyway */
8869 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8871 * src/DepTable.C (update): add a "+" at the end when the checksum
8872 is different. (debugging string only)
8874 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8875 the next inset to not be displayed. This should also fix the list
8876 of labels in the "Insert Crossreference" dialog.
8878 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8880 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8881 when regex was not found.
8883 * src/support/lstrings.C (lowercase): use handcoded transform always.
8886 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8887 old_cursor.par->prev could be 0.
8889 * several files: changed post inc/dec to pre inc/dec
8891 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8892 write the lastfiles to file.
8894 * src/BufferView.C (buffer): only show TextCache info when debugging
8896 (resizeCurrentBuffer): ditto
8897 (workAreaExpose): ditto
8899 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8901 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8903 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8904 a bit better by removing the special case for \i and \j.
8906 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8908 * src/lyx_main.C (easyParse): remove test for bad comand line
8909 options, since this broke all xforms-related parsing.
8911 * src/kbmap.C (getsym): set return type to unsigned long, as
8912 declared in header. On an alpha, long is _not_ the same as int.
8914 * src/support/LOstream.h: add a "using std::flush;"
8916 * src/insets/figinset.C: ditto.
8918 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/bufferlist.C (write): use blinding fast file copy instead of
8921 "a char at a time", now we are doing it the C++ way.
8923 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8924 std::list<int> instead.
8925 (addpidwait): reflect move to std::list<int>
8926 (sigchldchecker): ditto
8928 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8931 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8932 that obviously was wrong...
8934 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8935 c, this avoids warnings with purify and islower.
8937 * src/insets/figinset.C: rename struct queue to struct
8938 queue_element and rewrite to use a std::queue. gsqueue is now a
8939 std::queue<queue_element>
8940 (runqueue): reflect move to std::queue
8943 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8944 we would get "1" "0" instead of "true" "false. Also make the tostr
8947 2000-01-21 Juergen Vigna <jug@sad.it>
8949 * src/buffer.C (writeFileAscii): Disabled code for special groff
8950 handling of tabulars till I fix this in table.C
8952 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8954 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8956 * src/support/lyxlib.h: ditto.
8958 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8961 and 'j' look better. This might fix the "macron" bug that has been
8964 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8965 functions as one template function. Delete the old versions.
8967 * src/support/lyxsum.C: move using std::ifstream inside
8970 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8973 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8975 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8977 * src/insets/figinset.C (InitFigures): use new instead of malloc
8978 to allocate memory for figures and bitmaps.
8979 (DoneFigures): use delete[] instead of free to deallocate memory
8980 for figures and bitmaps.
8981 (runqueue): use new to allocate
8982 (getfigdata): use new/delete[] instead of malloc/free
8983 (RegisterFigure): ditto
8985 * some files: moved some declarations closer to first use, small
8986 whitespace changes use preincrement instead of postincrement where
8987 it does not make a difference.
8989 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8990 step on the way to use stl::containers for key maps.
8992 * src/bufferlist.h: add a typedef for const_iterator and const
8993 versions of begin and end.
8995 * src/bufferlist.[Ch]: change name of member variable _state to
8996 state_. (avoid reserved names)
8998 (getFileNames): returns the filenames of the buffers in a vector.
9000 * configure.in (ALL_LINGUAS): added ro
9002 * src/support/putenv.C: new file
9004 * src/support/mkdir.C: new file
9006 2000-01-20 Allan Rae <rae@lyx.org>
9008 * lib/layouts/IEEEtran.layout: Added several theorem environments
9010 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9011 couple of minor additions.
9013 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9014 (except for those in footnotes of course)
9016 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9018 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9020 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9021 std::sort and std::lower_bound instead of qsort and handwritten
9023 (struct compara): struct that holds the functors used by std::sort
9024 and std::lower_bound in MathedLookupBOP.
9026 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9028 * src/support/LAssert.h: do not do partial specialization. We do
9031 * src/support/lyxlib.h: note that lyx::getUserName() and
9032 lyx::date() are not in use right now. Should these be suppressed?
9034 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9035 (makeLinuxDocFile): do not put date and user name in linuxdoc
9038 * src/support/lyxlib.h (kill): change first argument to long int,
9039 since that's what solaris uses.
9041 * src/support/kill.C (kill): fix declaration to match prototype.
9043 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9044 actually check whether namespaces are supported. This is not what
9047 * src/support/lyxsum.C: add a using directive.
9049 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * src/support/kill.C: if we have namespace support we don't have
9052 to include lyxlib.h.
9054 * src/support/lyxlib.h: use namespace lyx if supported.
9056 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9058 * src/support/date.C: new file
9060 * src/support/chdir.C: new file
9062 * src/support/getUserName.C: new file
9064 * src/support/getcwd.C: new file
9066 * src/support/abort.C: new file
9068 * src/support/kill.C: new file
9070 * src/support/lyxlib.h: moved all the functions in this file
9071 insede struct lyx. Added also kill and abort to this struct. This
9072 is a way to avoid the "kill is not defined in <csignal>", we make
9073 C++ wrappers for functions that are not ANSI C or ANSI C++.
9075 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9076 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9077 lyx it has been renamed to sum.
9079 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9081 * src/text.C: add using directives for std::min and std::max.
9083 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9085 * src/texrow.C (getIdFromRow): actually return something useful in
9086 id and pos. Hopefully fixes the bug with positionning of errorbox
9089 * src/lyx_main.C (easyParse): output an error and exit if an
9090 incorrect command line option has been given.
9092 * src/spellchecker.C (ispell_check_word): document a memory leak.
9094 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9095 where a "struct utimbuf" is allocated with "new" and deleted with
9098 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9100 * src/text2.C (CutSelection): don't delete double spaces.
9101 (PasteSelection): ditto
9102 (CopySelection): ditto
9104 * src/text.C (Backspace): don't delete double spaces.
9106 * src/lyxlex.C (next): fix a bug that were only present with
9107 conformant std::istream::get to read comment lines, use
9108 std::istream::getline instead. This seems to fix the problem.
9110 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9112 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9113 allowed to insert space before space" editing problem. Please read
9114 commends at the beginning of the function. Comments about usage
9117 * src/text.C (InsertChar): fix for the "not allowed to insert
9118 space before space" editing problem.
9120 * src/text2.C (DeleteEmptyParagraphMechanism): when
9121 IsEmptyTableRow can only return false this last "else if" will
9122 always be a no-op. Commented out.
9124 * src/text.C (RedoParagraph): As far as I can understand tmp
9125 cursor is not really needed.
9127 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9128 present it could only return false anyway.
9129 (several functions): Did something not so smart...added a const
9130 specifier on a lot of methods.
9132 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9133 and add a tmp->text.resize. The LyXParagraph constructor does the
9135 (BreakParagraphConservative): ditto
9137 * src/support/path.h (Path): add a define so that the wrong usage
9138 "Path("/tmp") will be flagged as a compilation error:
9139 "`unnamed_Path' undeclared (first use this function)"
9141 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9143 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9144 which was bogus for several reasons.
9146 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9150 * autogen.sh: do not use "type -path" (what's that anyway?).
9152 * src/support/filetools.C (findtexfile): remove extraneous space
9153 which caused a kpsewhich warning (at least with kpathsea version
9156 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9158 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9160 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9162 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9164 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9166 * src/paragraph.C (BreakParagraph): do not reserve space on text
9167 if we don't need to (otherwise, if pos_end < pos, we end up
9168 reserving huge amounts of memory due to bad unsigned karma).
9169 (BreakParagraphConservative): ditto, although I have not seen
9170 evidence the bug can happen here.
9172 * src/lyxparagraph.h: add a using std::list.
9174 2000-01-11 Juergen Vigna <jug@sad.it>
9176 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9179 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/vc-backend.C (doVCCommand): change to be static and take one
9182 more parameter: the path to chdir too be fore executing the command.
9183 (retrive): new function equiv to "co -r"
9185 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9186 file_not_found_hook is true.
9188 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9190 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9191 if a file is readwrite,readonly...anything else.
9193 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9195 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9196 (CreatePostscript): name change from MenuRunDVIPS (or something)
9197 (PreviewPostscript): name change from MenuPreviewPS
9198 (PreviewDVI): name change from MenuPreviewDVI
9200 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9201 \view_pdf_command., \pdf_to_ps_command
9203 * lib/configure.m4: added search for PDF viewer, and search for
9204 PDF to PS converter.
9205 (lyxrc.defaults output): add \pdflatex_command,
9206 \view_pdf_command and \pdf_to_ps_command.
9208 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9210 * src/bufferlist.C (write): we don't use blocksize for anything so
9213 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9215 * src/support/block.h: disable operator T* (), since it causes
9216 problems with both compilers I tried. See comments in the file.
9218 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9221 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9222 variable LYX_DIR_10x to LYX_DIR_11x.
9224 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9226 * INSTALL: document --with-lyxname.
9229 * configure.in: new configure flag --with-lyxname which allows to
9230 choose the name under which lyx is installed. Default is "lyx", of
9231 course. It used to be possible to do this with --program-suffix,
9232 but the later has in fact a different meaning for autoconf.
9234 * src/support/lstrings.h (lstrchr): reformat a bit.
9236 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9237 * src/mathed/math_defs.h: ditto.
9239 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9241 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9242 true, decides if we create a backup file or not when saving. New
9243 tag and variable \pdf_mode, defaults to false. New tag and
9244 variable \pdflatex_command, defaults to pdflatex. New tag and
9245 variable \view_pdf_command, defaults to xpdf. New tag and variable
9246 \pdf_to_ps_command, defaults to pdf2ps.
9248 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9250 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9251 does not have a BufferView.
9252 (unlockInset): ditto + don't access the_locking_inset if the
9253 buffer does not have a BufferView.
9255 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9256 certain circumstances so that we don't continue a keyboard
9257 operation long after the key was released. Try f.ex. to load a
9258 large document, press PageDown for some seconds and then release
9259 it. Before this change the document would contine to scroll for
9260 some time, with this change it stops imidiatly.
9262 * src/support/block.h: don't allocate more space than needed. As
9263 long as we don't try to write to the arr[x] in a array_type arr[x]
9264 it is perfectly ok. (if you write to it you might segfault).
9265 added operator value_type*() so that is possible to pass the array
9266 to functions expecting a C-pointer.
9268 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9271 * intl/*: updated to gettext 0.10.35, tried to add our own
9272 required modifications. Please verify.
9274 * po/*: updated to gettext 0.10.35, tried to add our own required
9275 modifications. Please verify.
9277 * src/support/lstrings.C (tostr): go at fixing the problem with
9278 cxx and stringstream. When stringstream is used return
9279 oss.str().c_str() so that problems with lyxstring and basic_string
9280 are avoided. Note that the best solution would be for cxx to use
9281 basic_string all the way, but it is not conformant yet. (it seems)
9283 * src/lyx_cb.C + other files: moved several global functions to
9284 class BufferView, some have been moved to BufferView.[Ch] others
9285 are still located in lyx_cb.C. Code changes because of this. (part
9286 of "get rid of current_view project".)
9288 * src/buffer.C + other files: moved several Buffer functions to
9289 class BufferView, the functions are still present in buffer.C.
9290 Code changes because of this.
9292 * config/lcmessage.m4: updated to most recent. used when creating
9295 * config/progtest.m4: updated to most recent. used when creating
9298 * config/gettext.m4: updated to most recent. applied patch for
9301 * config/gettext.m4.patch: new file that shows what changes we
9302 have done to the local copy of gettext.m4.
9304 * config/libtool.m4: new file, used in creation of acinclude.m4
9306 * config/lyxinclude.m4: new file, this is the lyx created m4
9307 macros, used in making acinclude.m4.
9309 * autogen.sh: GNU m4 discovered as a separate task not as part of
9310 the lib/configure creation.
9311 Generate acinlucde from files in config. Actually cat
9312 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9313 easier to upgrade .m4 files that really are external.
9315 * src/Spacing.h: moved using std::istringstream to right after
9316 <sstream>. This should fix the problem seen with some compilers.
9318 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9320 * src/lyx_cb.C: began some work to remove the dependency a lot of
9321 functions have on BufferView::text, even if not really needed.
9322 (GetCurrentTextClass): removed this func, it only hid the
9325 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9326 forgot this in last commit.
9328 * src/Bullet.C (bulletEntry): use static char const *[] for the
9329 tables, becuase of this the return arg had to change to string.
9331 (~Bullet): removed unneeded destructor
9333 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9334 (insetSleep): moved from Buffer
9335 (insetWakeup): moved from Buffer
9336 (insetUnlock): moved from Buffer
9338 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9339 from Buffer to BufferView.
9341 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9343 * config/ltmain.sh: updated to version 1.3.4 of libtool
9345 * config/ltconfig: updated to version 1.3.4 of libtool
9347 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9350 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9351 Did I get that right?
9353 * src/lyxlex.h: add a "using" directive or two.
9354 * src/Spacing.h: ditto.
9355 * src/insets/figinset.C: ditto.
9356 * src/support/filetools.C: ditto.
9357 * src/support/lstrings.C: ditto.
9358 * src/BufferView.C: ditto.
9359 * src/bufferlist.C: ditto.
9360 * src/lyx_cb.C: ditto.
9361 * src/lyxlex.C: ditto.
9363 * NEWS: add some changes for 1.1.4.
9365 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9367 * src/BufferView.C: first go at a TextCache to speed up switching
9370 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9372 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9373 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9374 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9375 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9378 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9379 members of the struct are correctly initialized to 0 (detected by
9381 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9382 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9384 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9385 pidwait, since it was allocated with "new". This was potentially
9386 very bad. Thanks to Michael Schmitt for running purify for us.
9389 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9391 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9393 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9395 1999-12-30 Allan Rae <rae@lyx.org>
9397 * lib/templates/IEEEtran.lyx: minor change
9399 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9400 src/mathed/formula.C (LocalDispatch): askForText changes
9402 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9403 know when a user has cancelled input. Fixes annoying problems with
9404 inserting labels and version control.
9406 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9408 * src/support/lstrings.C (tostr): rewritten to use strstream and
9411 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9413 * src/support/filetools.C (IsFileWriteable): use fstream to check
9414 (IsDirWriteable): use fileinfo to check
9416 * src/support/filetools.h (FilePtr): whole class deleted
9418 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9420 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9422 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9424 * src/bufferlist.C (write): use ifstream and ofstream instead of
9427 * src/Spacing.h: use istrstream instead of sscanf
9429 * src/mathed/math_defs.h: change first arg to istream from FILE*
9431 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9433 * src/mathed/math_parser.C: have yyis to be an istream
9434 (LexGetArg): use istream (yyis)
9436 (mathed_parse): ditto
9437 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9439 * src/mathed/formula.C (Read): rewritten to use istream
9441 * src/mathed/formulamacro.C (Read): rewritten to use istream
9443 * src/lyxlex.h (~LyXLex): deleted desturctor
9444 (getStream): new function, returns an istream
9445 (getFile): deleted funtion
9446 (IsOK): return is.good();
9448 * src/lyxlex.C (LyXLex): delete file and owns_file
9449 (setFile): open an filebuf and assign that to a istream instead of
9451 (setStream): new function, takes an istream as arg.
9452 (setFile): deleted function
9453 (EatLine): rewritten us use istream instead of FILE*
9457 * src/table.C (LyXTable): use istream instead of FILE*
9458 (Read): rewritten to take an istream instead of FILE*
9460 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9462 * src/buffer.C (Dispatch): remove an extraneous break statement.
9464 * src/support/filetools.C (QuoteName): change to do simple
9465 'quoting'. More work is necessary. Also changed to do nothing
9466 under emx (needs fix too).
9467 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9469 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9470 config.h.in to the AC_DEFINE_UNQUOTED() call.
9471 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9472 needs char * as argument (because Solaris 7 declares it like
9475 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9476 remove definition of BZERO.
9478 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9480 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9481 defined, "lyxregex.h" if not.
9483 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9485 (REGEX): new variable that is set to regex.c lyxregex.h when
9486 AM_CONDITIONAL USE_REGEX is set.
9487 (libsupport_la_SOURCES): add $(REGEX)
9489 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9492 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9495 * configure.in: add call to LYX_REGEX
9497 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9498 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9500 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9502 * lib/bind/fi_menus.bind: new file, from
9503 pauli.virtanen@saunalahti.fi.
9505 * src/buffer.C (getBibkeyList): pass the parameter delim to
9506 InsetInclude::getKeys and InsetBibtex::getKeys.
9508 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9509 is passed to Buffer::getBibkeyList
9511 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9512 instead of the hardcoded comma.
9514 * src/insets/insetbib.C (getKeys): make sure that there are not
9515 leading blanks in bibtex keys. Normal latex does not care, but
9516 harvard.sty seems to dislike blanks at the beginning of citation
9517 keys. In particular, the retturn value of the function is
9519 * INSTALL: make it clear that libstdc++ is needed and that gcc
9520 2.7.x probably does not work.
9522 * src/support/filetools.C (findtexfile): make debug message go to
9524 * src/insets/insetbib.C (getKeys): ditto
9526 * src/debug.C (showTags): make sure that the output is correctly
9529 * configure.in: add a comment for TWO_COLOR_ICON define.
9531 * acconfig.h: remove all the entries that already defined in
9532 configure.in or acinclude.m4.
9534 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9535 to avoid user name, date and copyright.
9537 1999-12-21 Juergen Vigna <jug@sad.it>
9539 * src/table.C (Read): Now read bogus row format informations
9540 if the format is < 5 so that afterwards the table can
9541 be read by lyx but without any format-info. Fixed the
9542 crash we experienced when not doing this.
9544 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9546 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9547 (RedoDrawingOfParagraph): ditto
9548 (RedoParagraphs): ditto
9549 (RemoveTableRow): ditto
9551 * src/text.C (Fill): rename arg paperwidth -> paper_width
9553 * src/buffer.C (insertLyXFile): rename var filename -> fname
9554 (writeFile): rename arg filename -> fname
9555 (writeFileAscii): ditto
9556 (makeLaTeXFile): ditto
9557 (makeLinuxDocFile): ditto
9558 (makeDocBookFile): ditto
9560 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9563 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9565 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9568 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9569 compiled by a C compiler not C++.
9571 * src/layout.h (LyXTextClass): added typedef for const_iterator
9572 (LyXTextClassList): added typedef for const_iterator + member
9573 functions begin and end.
9575 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9576 iterators to fill the choice_class.
9577 (updateLayoutChoice): rewritten to use iterators to fill the
9578 layoutlist in the toolbar.
9580 * src/BufferView.h (BufferView::work_area_width): removed unused
9583 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9585 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9586 (sgmlCloseTag): ditto
9588 * src/support/lstrings.h: return type of countChar changed to
9591 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9592 what version of this func to use. Also made to return unsigned int.
9594 * configure.in: call LYX_STD_COUNT
9596 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9597 conforming std::count.
9599 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9601 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9602 and a subscript would give bad display (patch from Dekel Tsur
9603 <dekel@math.tau.ac.il>).
9605 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9607 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9610 * src/chset.h: add a few 'using' directives
9612 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9613 triggered when no buffer is active
9615 * src/layout.C: removed `break' after `return' in switch(), since
9618 * src/lyx_main.C (init): make sure LyX can be ran in place even
9619 when libtool has done its magic with shared libraries. Fix the
9620 test for the case when the system directory has not been found.
9622 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9623 name for the latex file.
9624 (MenuMakeHTML): ditto
9626 * src/buffer.h: add an optional boolean argument, which is passed
9629 1999-12-20 Allan Rae <rae@lyx.org>
9631 * lib/templates/IEEEtran.lyx: small correction and update.
9633 * configure.in: Attempted to use LYX_PATH_HEADER
9635 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9637 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9638 input from JMarc. Now use preprocessor to find the header.
9639 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9640 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9641 LYX_STL_STRING_FWD. See comments in file.
9643 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9645 * The global MiniBuffer * minibuffer variable is dead.
9647 * The global FD_form_main * fd_form_main variable is dead.
9649 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9651 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9653 * src/table.h: add the LOstream.h header
9654 * src/debug.h: ditto
9656 * src/LyXAction.h: change the explaination of the ReadOnly
9657 attribute: is indicates that the function _can_ be used.
9659 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9662 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9664 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9670 * src/paragraph.C (GetWord): assert on pos>=0
9673 * src/support/lyxstring.C: condition the use of an invariant on
9675 * src/support/lyxstring.h: ditto
9677 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9678 Use LAssert.h instead of plain assert().
9680 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9682 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9683 * src/support/filetools.C: ditto
9685 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9688 * INSTALL: document the new configure flags
9690 * configure.in: suppress --with-debug; add --enable-assertions
9692 * acinclude.m4: various changes in alignment of help strings.
9694 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9696 * src/kbmap.C: commented out the use of the hash map in kb_map,
9697 beginning of movement to a stl::container.
9699 * several files: removed code that was not in effect when
9700 MOVE_TEXT was defined.
9702 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9703 for escaping should not be used. We can discuss if the string
9704 should be enclosed in f.ex. [] instead of "".
9706 * src/trans_mgr.C (insert): use the new returned value from
9707 encodeString to get deadkeys and keymaps done correctly.
9709 * src/chset.C (encodeString): changed to return a pair, to tell
9710 what to use if we know the string.
9712 * src/lyxscreen.h (fillArc): new function.
9714 * src/FontInfo.C (resize): rewritten to use more std::string like
9715 structore, especially string::replace.
9717 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9720 * configure.in (chmod +x some scripts): remove config/gcc-hack
9722 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9724 * src/buffer.C (writeFile): change once again the top comment in a
9725 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9726 instead of an hardcoded version number.
9727 (makeDocBookFile): ditto
9729 * src/version.h: add new define LYX_DOCVERSION
9731 * po/de.po: update from Pit Sütterlin
9732 * lib/bind/de_menus.bind: ditto.
9734 * src/lyxfunc.C (Dispatch): call MenuExport()
9735 * src/buffer.C (Dispatch): ditto
9737 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9738 LyXFunc::Dispatch().
9739 (MenuExport): new function, moved from
9740 LyXFunc::Dispatch().
9742 * src/trans_mgr.C (insert): small cleanup
9743 * src/chset.C (loadFile): ditto
9745 * lib/kbd/iso8859-1.cdef: add missing backslashes
9747 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9749 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9750 help with placing the manually drawn accents better.
9752 (Draw): x2 and hg changed to float to minimize rounding errors and
9753 help place the accents better.
9755 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9756 unsigned short to char is just wrong...cast the char to unsigned
9757 char instead so that the two values can compare sanely. This
9758 should also make the display of insetlatexaccents better and
9759 perhaps also some other insets.
9761 (lbearing): new function
9764 1999-12-15 Allan Rae <rae@lyx.org>
9766 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9767 header that provides a wrapper around the very annoying SGI STL header
9770 * src/support/lyxstring.C, src/LString.h:
9771 removed old SGI-STL-compatability attempts.
9773 * configure.in: Use LYX_STL_STRING_FWD.
9775 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9776 stl_string_fwd.h is around and try to determine it's location.
9777 Major improvement over previous SGI STL 3.2 compatability.
9778 Three small problems remain with this function due to my zero
9779 knowledge of autoconf. JMarc and lgb see the comments in the code.
9781 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9783 * src/broken_const.h, config/hack-gcc, config/README: removed
9785 * configure.in: remove --with-gcc-hack option; do not call
9788 * INSTALL: remove documentation of --with-broken-const and
9791 * acconfig.h: remove all trace of BROKEN_CONST define
9793 * src/buffer.C (makeDocBookFile): update version number in output
9795 (SimpleDocBookOnePar): fix an assert when trying to a character
9796 access beyond string length
9799 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9801 * po/de.po: fix the Export menu
9803 * lyx.man: update the description of -dbg
9805 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9806 (commandLineHelp): updated
9807 (easyParse): show list of available debug levels if -dbg is passed
9810 * src/Makefile.am: add debug.C
9812 * src/debug.h: moved some code to debug.C
9814 * src/debug.C: new file. Contains code to set and show debug
9817 * src/layout.C: remove 'break' after 'continue' in switch
9818 statements, since these cannot be reached.
9820 1999-12-13 Allan Rae <rae@lyx.org>
9822 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9823 (in_word_set): hash() -> math_hash()
9825 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9827 * acconfig.h: Added a test for whether we are using exceptions in the
9828 current compilation run. If so USING_EXCEPTIONS is defined.
9830 * config.in: Check for existance of stl_string_fwd.h
9831 * src/LString.h: If compiling --with-included-string and SGI's
9832 STL version 3.2 is present (see above test) we need to block their
9833 forward declaration of string and supply a __get_c_string().
9834 However, it turns out this is only necessary if compiling with
9835 exceptions enabled so I've a bit more to add yet.
9837 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9838 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9839 src/support/LRegex.h, src/undo.h:
9840 Shuffle the order of the included files a little to ensure that
9841 LString.h gets included before anything that includes stl_string_fwd.h
9843 * src/support/lyxstring.C: We need to #include LString.h instead of
9844 lyxstring.h to get the necessary definition of __get_c_string.
9845 (__get_c_string): New function. This is defined static just like SGI's
9846 although why they need to do this I'm not sure. Perhaps it should be
9847 in lstrings.C instead.
9849 * lib/templates/IEEEtran.lyx: New template file.
9851 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9853 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9854 * intl/Makefile.in (MKINSTALLDIRS): ditto
9856 * src/LyXAction.C (init): changed to hold the LFUN data in a
9857 automatic array in stead of in callso to newFunc, this speeds up
9858 compilation a lot. Also all the memory used by the array is
9859 returned when the init is completed.
9861 * a lot of files: compiled with -Wold-style-cast, changed most of
9862 the reported offenders to C++ style casts. Did not change the
9863 offenders in C files.
9865 * src/trans.h (Match): change argument type to unsigned int.
9867 * src/support/DebugStream.C: fix some types on the streambufs so
9868 that it works on a conforming implementation.
9870 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9872 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9874 * src/support/lyxstring.C: remove the inline added earlier since
9875 they cause a bunch of unsatisfied symbols when linking with dec
9876 cxx. Cxx likes to have the body of inlines at the place where they
9879 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9880 accessing negative bounds in array. This fixes the crash when
9881 inserting accented characters.
9882 * src/trans.h (Match): ditto
9884 * src/buffer.C (Dispatch): since this is a void, it should not try
9885 to return anything...
9887 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9889 * src/buffer.h: removed the two friends from Buffer. Some changes
9890 because of this. Buffer::getFileName and Buffer::setFileName
9891 renamed to Buffer::fileName() and Buffer::fileName(...).
9893 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9895 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9896 and Buffer::update(short) to BufferView. This move is currently
9897 controlled by a define MOVE_TEXT, this will be removed when all
9898 shows to be ok. This move paves the way for better separation
9899 between buffer contents and buffer view. One side effect is that
9900 the BufferView needs a rebreak when swiching buffers, if we want
9901 to avoid this we can add a cache that holds pointers to LyXText's
9902 that is not currently in use.
9904 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9907 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9909 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9911 * lyx_main.C: new command line option -x (or --execute) and
9912 -e (or --export). Now direct conversion from .lyx to .tex
9913 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9914 Unfortunately, X is still needed and the GUI pops up during the
9917 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * src/Spacing.C: add a using directive to bring stream stuff into
9921 * src/paragraph.C: ditto
9922 * src/buffer.C: ditto
9924 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9925 from Lars' announcement).
9927 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9928 example files from Tino Meinen.
9930 1999-12-06 Allan Rae <rae@lyx.org>
9932 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9934 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9936 * src/support/lyxstring.C: added a lot of inline for no good
9939 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9940 latexWriteEndChanges, they were not used.
9942 * src/layout.h (operator<<): output operator for PageSides
9944 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9946 * some example files: loaded in LyX 1.0.4 and saved again to update
9947 certain constructs (table format)
9949 * a lot of files: did the change to use fstream/iostream for all
9950 writing of files. Done with a close look at Andre Poenitz's patch.
9952 * some files: whitespace changes.
9954 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9956 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9957 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9958 architecture, we provide our own. It is used unconditionnally, but
9959 I do not think this is a performance problem. Thanks to Angus
9960 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9961 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9963 (GetInset): use my_memcpy.
9967 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9968 it is easier to understand, but it uses less TeX-only constructs now.
9970 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9971 elements contain spaces
9973 * lib/configure: regenerated
9975 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9976 elements contain spaces; display the list of programs that are
9979 * autogen.sh: make sure lib/configure is executable
9981 * lib/examples/*: rename the tutorial examples to begin with the
9982 two-letters language code.
9984 * src/lyxfunc.C (getStatus): do not query current font if no
9987 * src/lyx_cb.C (RunScript): use QuoteName
9988 (MenuRunDvips): ditto
9989 (PrintApplyCB): ditto
9991 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9992 around argument, so that it works well with the current shell.
9993 Does not work properly with OS/2 shells currently.
9995 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9996 * src/LyXSendto.C (SendtoApplyCB): ditto
9997 * src/lyxfunc.C (Dispatch): ditto
9998 * src/buffer.C (runLaTeX): ditto
9999 (runLiterate): ditto
10000 (buildProgram): ditto
10002 * src/lyx_cb.C (RunScript): ditto
10003 (MenuMakeLaTeX): ditto
10005 * src/buffer.h (getLatexName): new method
10007 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10009 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10011 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10012 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10013 (create_math_panel): ditto
10015 * src/lyxfunc.C (getStatus): re-activate the code which gets
10016 current font and cursor; add test for export to html.
10018 * src/lyxrc.C (read): remove unreachable break statements; add a
10021 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10023 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10025 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10026 introduced by faulty regex.
10027 * src/buffer.C: ditto
10028 * src/lastfiles.C: ditto
10029 * src/paragraph.C: ditto
10030 * src/table.C: ditto
10031 * src/vspace.C: ditto
10032 * src/insets/figinset.C: ditto
10033 Note: most of these is absolutely harmless, except the one in
10034 src/mathed formula.C.
10036 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10038 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10039 operation, yielding correct results for the reLyX command.
10041 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10043 * src/support/filetools.C (ExpandPath): removed an over eager
10045 (ReplaceEnvironmentPath): ditto
10047 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10048 shows that we are doing something fishy in our code...
10049 (BubblePost): ditto
10052 * src/lyxrc.C (read): use a double switch trick to get more help
10053 from the compiler. (the same trick is used in layout.C)
10054 (write): new function. opens a ofstream and pass that to output
10055 (output): new function, takes a ostream and writes the lyxrc
10056 elemts to it. uses a dummy switch to make sure no elements are
10059 * src/lyxlex.h: added a struct pushpophelper for use in functions
10060 with more than one exit point.
10062 * src/lyxlex.[Ch] (GetInteger): made it const
10066 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10068 * src/layout.[hC] : LayoutTags splitted into several enums, new
10069 methods created, better error handling cleaner use of lyxlex. Read
10072 * src/bmtable.[Ch]: change some member prototypes because of the
10073 image const changes.
10075 * commandtags.h, src/LyXAction.C (init): new function:
10076 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10077 This file is not read automatically but you can add \input
10078 preferences to your lyxrc if you want to. We need to discuss how
10081 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10082 in .aux, also remove .bib and .bst files from dependencies when
10085 * src/BufferView.C, src/LyXView.C: add const_cast several places
10086 because of changes to images.
10088 * lib/images/*: same change as for images/*
10090 * lib/lyxrc.example: Default for accept_compound is false not no.
10092 * images/*: changed to be const, however I have som misgivings
10093 about this change so it might be changed back.
10095 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10097 * lib/configure, po/POTFILES.in: regenerated
10099 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10101 * config/lib_configure.m4: removed
10103 * lib/configure.m4: new file (was config/lib_configure.m4)
10105 * configure.in: do not test for rtti, since we do not use it.
10107 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10109 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10110 doubling of allocated space scheme. This makes it faster for large
10111 strings end to use less memory for small strings. xtra rememoved.
10113 * src/insets/figinset.C (waitalarm): commented out.
10114 (GhostscriptMsg): use static_cast
10115 (GhostscriptMsg): use new instead of malloc to allocate memory for
10116 cmap. also delete the memory after use.
10118 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10120 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10121 for changes in bibtex database or style.
10122 (runBibTeX): remove all .bib and .bst files from dep before we
10124 (run): use scanAuc in when dep file already exist.
10126 * src/DepTable.C (remove_files_with_extension): new method
10127 (exist): new method
10129 * src/DepTable.[Ch]: made many of the methods const.
10131 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10133 * src/bufferparams.C: make sure that the default textclass is
10134 "article". It used to be the first one by description order, but
10135 now the first one is "docbook".
10137 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10138 string; call Debug::value.
10139 (easyParse): pass complete argument to setDebuggingLevel().
10141 * src/debug.h (value): fix the code that parses debug levels.
10143 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10146 * src/LyXAction.C: use Debug::ACTION as debug channel.
10148 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10150 * NEWS: updated for the future 1.1.3 release.
10152 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10153 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10154 it should. This is of course a controversial change (since many
10155 people will find that their lyx workscreen is suddenly full of
10156 red), but done for the sake of correctness.
10158 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10159 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10161 * src/insets/inseterror.h, src/insets/inseturl.h,
10162 src/insets/insetinfo.h, src/insets/figinset.h,
10163 src/mathed/formulamacro.h, src/mathed/math_macro.h
10164 (EditMessage): add a missing const and add _() to make sure that
10165 translation happens
10167 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10168 src/insets/insetbib.C, src/support/filetools.C: add `using'
10169 directives for cxx.
10171 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10172 doing 'Insert index of last word' at the beginning of a paragraph.
10174 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10176 * several files: white-space changes.
10178 * src/mathed/formula.C: removed IsAlpha and IsDigit
10180 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10181 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10184 * src/insets/figinset.C (GetPSSizes): don't break when
10185 "EndComments" is seen. But break when a boundingbox is read.
10187 * all classes inherited from Inset: return value of Clone
10188 changed back to Inset *.
10190 * all classes inherited form MathInset: return value of Clone
10191 changed back to MathedInset *.
10193 * src/insets/figinset.C (runqueue): use a ofstream to output the
10194 gs/ps file. Might need some setpresicion or setw. However I can
10195 see no problem with the current code.
10196 (runqueue): use sleep instead of the alarm/signal code. I just
10197 can't see the difference.
10199 * src/paragraph.C (LyXParagraph): reserve space in the new
10200 paragraph and resize the inserted paragraph to just fit.
10202 * src/lyxfunc.h (operator|=): added operator for func_status.
10204 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10205 check for readable file.
10207 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10208 check for readable file.
10209 (MenuMakeLinuxDoc): ditto
10210 (MenuMakeDocBook): ditto
10211 (MenuMakeAscii): ditto
10212 (InsertAsciiFile): split the test for openable and readable
10214 * src/bmtable.C (draw_bitmaptable): use
10215 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10217 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10218 findtexfile from LaTeX to filetools.
10220 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10221 instead of FilePtr. Needs to be verified by a literate user.
10223 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10225 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10226 (EditMessage): likewise.
10228 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10229 respectively as \textasciitilde and \textasciicircum.
10231 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10233 * src/support/lyxstring.h: made the methods that take iterators
10234 use const_iterator.
10236 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10237 (regexMatch): made is use the real regex class.
10239 * src/support/Makefile.am: changed to use libtool
10241 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10243 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10245 (MathIsInset ++): changed several macros to be inline functions
10248 * src/mathed/Makefile.am: changed to use libtool
10250 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10252 * src/insets/inset* : Clone changed to const and return type is
10253 the true insettype not just Inset*.
10255 * src/insets/Makefile.am: changed to use libtool
10257 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10259 * src/undo.[Ch] : added empty() and changed some of the method
10262 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10264 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10265 setID use block<> for the bullets array, added const several places.
10267 * src/lyxfunc.C (getStatus): new function
10269 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10270 LyXAction, added const to several funtions.
10272 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10273 a std::map, and to store the dir items in a vector.
10275 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10278 * src/LyXView.[Ch] + other files : changed currentView to view.
10280 * src/LyXAction.[Ch] : ported from the old devel branch.
10282 * src/.cvsignore: added .libs and a.out
10284 * configure.in : changes to use libtool.
10286 * acinclude.m4 : inserted libtool.m4
10288 * .cvsignore: added libtool
10290 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10292 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10293 file name in insets and mathed directories (otherwise the
10294 dependency is not taken in account under cygwin).
10296 * src/text2.C (InsertString[AB]): make sure that we do not try to
10297 read characters past the string length.
10299 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10301 * lib/doc/LaTeXConfig.lyx.in,
10302 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10304 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10305 file saying who created them and when this heppened; this is
10306 useless and annoys tools like cvs.
10308 * lib/layouts/g-brief-{en,de}.layout,
10309 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10310 from Thomas Hartkens <thomas@hartkens.de>.
10312 * src/{insets,mathed}/Makefile.am: do not declare an empty
10313 LDFLAGS, so that it can be set at configure time (useful on Irix
10316 * lib/reLyX/configure.in: make sure that the prefix is set
10317 correctly in LYX_DIR.
10319 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10321 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10322 be used by 'command-sequence' this allows to bind a key to a
10323 sequence of LyX-commands
10324 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10326 * src/LyXAction.C: add "command-sequence"
10328 * src/LyXFunction.C: handling of "command-sequence"
10330 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10331 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10333 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10335 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10337 * src/buffer.C (writeFile): Do not output a comment giving user
10338 and date at the beginning of a .lyx file. This is useless and
10339 annoys cvs anyway; update version number to 1.1.
10341 * src/Makefile.am (LYX_DIR): add this definition, so that a
10342 default path is hardcoded in LyX.
10344 * configure.in: Use LYX_GNU_GETTEXT.
10346 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10347 AM_GNU_GETTEXT with a bug fixed.
10349 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10351 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10353 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10354 which is used to point to LyX data is now LYX_DIR_11x.
10356 * lyx.man: convert to a unix text file; small updates.
10358 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10360 * src/support/LSubstring.[Ch]: made the second arg of most of the
10361 constructors be a const reference.
10363 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10366 * src/support/lyxstring.[Ch] (swap): added missing member function
10367 and specialization of swap(str, str);
10369 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10371 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10372 trace of the old one.
10374 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10375 put the member definitions in undo.C.
10377 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10378 NEW_TEXT and have now only code that was included when this was
10381 * src/intl.C (LCombo): use static_cast
10383 (DispatchCallback): ditto
10385 * src/definitions.h: removed whole file
10387 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10389 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10390 parsing and stores in a std:map. a regex defines the file format.
10391 removed unneeded members.
10393 * src/bufferparams.h: added several enums from definitions.h here.
10394 Removed unsused destructor. Changed some types to use proper enum
10395 types. use block to have the temp_bullets and user_defined_bullets
10396 and to make the whole class assignable.
10398 * src/bufferparams.C (Copy): removed this functions, use a default
10399 assignment instead.
10401 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10404 * src/buffer.C (readLyXformat2): commend out all that have with
10405 oldpapersize to do. also comment out all that hve to do with
10406 insetlatex and insetlatexdel.
10407 (setOldPaperStuff): commented out
10409 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10411 * src/LyXAction.C: remove use of inset-latex-insert
10413 * src/mathed/math_panel.C (button_cb): use static_cast
10415 * src/insets/Makefile.am (insets_o_SOURCES): removed
10418 * src/support/lyxstring.C (helper): use the unsigned long
10419 specifier, UL, instead of a static_cast.
10421 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10423 * src/support/block.h: new file. to be used as a c-style array in
10424 classes, so that the class can be assignable.
10426 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10428 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10429 NULL, make sure to return an empty string (it is not possible to
10430 set a string to NULL).
10432 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10434 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10436 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10438 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10439 link line, so that Irix users (for example) can set it explicitely to
10442 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10443 it can be overidden at make time (static or dynamic link, for
10446 * src/vc-backend.C, src/LaTeXFeatures.h,
10447 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10448 statements to bring templates to global namespace.
10450 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10452 * src/support/lyxstring.C (operator[] const): make it standard
10455 * src/minibuffer.C (Init): changed to reflect that more
10456 information is given from the lyxvc and need not be provided here.
10458 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10460 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10462 * src/LyXView.C (UpdateTimerCB): use static_cast
10463 (KeyPressMask_raw_callback): ditto
10465 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10466 buffer_, a lot of changes because of this. currentBuffer() ->
10467 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10468 also changes to other files because of this.
10470 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10472 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10473 have no support for RCS and partial support for CVS, will be
10476 * src/insets/ several files: changes because of function name
10477 changes in Bufferview and LyXView.
10479 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10481 * src/support/LSubstring.[Ch]: new files. These implement a
10482 Substring that can be very convenient to use. i.e. is this
10484 string a = "Mary had a little sheep";
10485 Substring(a, "sheep") = "lamb";
10486 a is now "Mary has a little lamb".
10488 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10489 out patterns and subpatterns of strings. It is used by LSubstring
10490 and also by vc-backend.C
10492 * src/support/lyxstring.C: went over all the assertions used and
10493 tried to correct the wrong ones and flag which of them is required
10494 by the standard. some bugs found because of this. Also removed a
10495 couple of assertions.
10497 * src/support/Makefile.am (libsupport_a_SOURCES): added
10498 LSubstring.[Ch] and LRegex.[Ch]
10500 * src/support/FileInfo.h: have struct stat buf as an object and
10501 not a pointer to one, some changes because of this.
10503 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10504 information in layout when adding the layouts preamble to the
10505 textclass preamble.
10507 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10510 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10511 because of bug in OS/2.
10513 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10515 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10516 \verbatim@font instead of \ttfamily, so that it can be redefined.
10518 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10519 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10520 src/layout.h, src/text2.C: add 'using' directive to bring the
10521 STL templates we need from the std:: namespace to the global one.
10522 Needed by DEC cxx in strict ansi mode.
10524 * src/support/LIstream.h,src/support/LOstream.h,
10525 src/support/lyxstring.h,src/table.h,
10526 src/lyxlookup.h: do not include <config.h> in header
10527 files. This should be done in the .C files only.
10529 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10533 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10535 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10536 from Kayvan to fix the tth invokation.
10538 * development/lyx.spec.in: updates from Kayvan to reflect the
10539 changes of file names.
10541 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10543 * src/text2.C (InsertStringB): use std::copy
10544 (InsertStringA): use std::copy
10546 * src/bufferlist.C: use a vector to store the buffers in. This is
10547 an internal change and should not affect any other thing.
10549 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10552 * src/text.C (Fill): fix potential bug, one off bug.
10554 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10556 * src/Makefile.am (lyx_main.o): add more files it depends on.
10558 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10560 * src/support/lyxstring.C: use size_t for the reference count,
10561 size, reserved memory and xtra.
10562 (internal_compare): new private member function. Now the compare
10563 functions should work for std::strings that have embedded '\0'
10565 (compare): all compare functions rewritten to use
10568 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10570 * src/support/lyxstring.C (compare): pass c_str()
10571 (compare): pass c_str
10572 (compare): pass c_str
10574 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10576 * src/support/DebugStream.C: <config.h> was not included correctly.
10578 * lib/configure: forgot to re-generate it :( I'll make this file
10579 auto generated soon.
10581 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10583 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10586 * src/support/lyxstring.C: some changes from length() to rep->sz.
10587 avoids a function call.
10589 * src/support/filetools.C (SpaceLess): yet another version of the
10590 algorithm...now per Jean-Marc's suggestions.
10592 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10594 * src/layout.C (less_textclass_desc): functor for use in sorting
10596 (LyXTextClass::Read): sort the textclasses after reading.
10598 * src/support/filetools.C (SpaceLess): new version of the
10599 SpaceLess functions. What problems does this one give? Please
10602 * images/banner_bw.xbm: made the arrays unsigned char *
10604 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10606 * src/support/lyxstring.C (find): remove bogus assertion in the
10607 two versions of find where this has not been done yet.
10609 * src/support/lyxlib.h: add missing int return type to
10612 * src/menus.C (ShowFileMenu): disable exporting to html if no
10613 html export command is present.
10615 * config/lib_configure.m4: add a test for an HTML converter. The
10616 programs checked for are, in this order: tth, latex2html and
10619 * lib/configure: generated from config/lib_configure.m4.
10621 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10622 html converter. The parameters are now passed through $$FName and
10623 $$OutName, instead of standard input/output.
10625 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10627 * lib/lyxrc.example: update description of \html_command.
10628 add "quotes" around \screen_font_xxx font setting examples to help
10629 people who use fonts with spaces in their names.
10631 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10633 * Distribution files: updates for v1.1.2
10635 * src/support/lyxstring.C (find): remove bogus assert and return
10636 npos for the same condition.
10638 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10640 * added patch for OS/2 from SMiyata.
10642 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10644 * src/text2.C (CutSelection): make space_wrapped a bool
10645 (CutSelection): dont declare int i until we have to.
10646 (alphaCounter): return a char const *.
10648 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10650 * src/support/syscall.C (Systemcalls::kill):
10651 src/support/filetools.C (PutEnv, PutEnvPath):
10652 src/lyx_cb.C (addNewlineAndDepth):
10653 src/FontInfo.C (FontInfo::resize): condition some #warning
10654 directives with WITH_WARNINGS.
10657 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10659 * src/layout.[Ch] + several files: access to class variables
10660 limited and made accessor functions instead a lot of code changed
10661 becuase of this. Also instead of returning pointers often a const
10662 reference is returned instead.
10664 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10666 * src/Makefile.am (dist-hook): added used to remove the CVS from
10667 cheaders upon creating a dist
10668 (EXTRA_DIST): added cheaders
10670 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10671 a character not as a small integer.
10673 * src/support/lyxstring.C (find): removed Assert and added i >=
10674 rep->sz to the first if.
10676 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10678 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10679 src/LyXView.C src/buffer.C src/bufferparams.C
10680 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10681 src/text2.C src/insets/insetinclude.C:
10682 lyxlayout renamed to textclasslist.
10684 * src/layout.C: some lyxerr changes.
10686 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10687 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10688 (LyXLayoutList): removed all traces of this class.
10689 (LyXTextClass::Read): rewrote LT_STYLE
10690 (LyXTextClass::hasLayout): new function
10691 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10692 both const and nonconst version.
10693 (LyXTextClass::delete_layout): new function.
10694 (LyXTextClassList::Style): bug fix. do the right thing if layout
10696 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10697 (LyXTextClassList::NameOfLayout): ditto
10698 (LyXTextClassList::Load): ditto
10700 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10702 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10704 * src/LyXAction.C (LookupFunc): added a workaround for sun
10705 compiler, on the other hand...we don't know if the current code
10706 compiles on sun at all...
10708 * src/support/filetools.C (CleanupPath): subst fix
10710 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10713 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10714 complained about this one?
10716 * src/insets/insetinclude.C (Latex): subst fix
10718 * src/insets/insetbib.C (getKeys): subst fix
10720 * src/LyXSendto.C (SendtoApplyCB): subst fix
10722 * src/lyx_main.C (init): subst fix
10724 * src/layout.C (Read): subst fix
10726 * src/lyx_sendfax_main.C (button_send): subst fix
10728 * src/buffer.C (RoffAsciiTable): subst fix
10730 * src/lyx_cb.C (MenuFax): subst fix
10731 (PrintApplyCB): subst fix
10733 1999-10-26 Juergen Vigna <jug@sad.it>
10735 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10737 (Read): Cleaned up this code so now we read only format vestion >= 5
10739 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10741 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10742 come nobody has complained about this one?
10744 * src/insets/insetinclude.C (Latex): subst fix
10746 * src/insets/insetbib.C (getKeys): subst fix
10748 * src/lyx_main.C (init): subst fix
10750 * src/layout.C (Read): subst fix
10752 * src/buffer.C (RoffAsciiTable): subst fix
10754 * src/lyx_cb.C (MenuFax): subst fix.
10756 * src/layout.[hC] + some other files: rewrote to use
10757 std::container to store textclasses and layouts in.
10758 Simplified, removed a lot of code. Make all classes
10759 assignable. Further simplifications and review of type
10760 use still to be one.
10762 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10763 lastfiles to create the lastfiles partr of the menu.
10765 * src/lastfiles.[Ch]: rewritten to use deque to store the
10766 lastfiles in. Uses fstream for reading and writing. Simplifies
10769 * src/support/syscall.C: remove explicit cast.
10771 * src/BufferView.C (CursorToggleCB): removed code snippets that
10772 were commented out.
10773 use explicat C++ style casts instead of C style casts. also use
10774 u_vdata instea of passing pointers in longs.
10776 * src/PaperLayout.C: removed code snippets that were commented out.
10778 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10780 * src/lyx_main.C: removed code snippets that wer commented out.
10782 * src/paragraph.C: removed code snippets that were commented out.
10784 * src/lyxvc.C (logClose): use static_cast
10786 (viewLog): remove explicit cast to void*
10787 (showLog): removed old commented code
10789 * src/menus.C: use static_cast instead of C style casts. use
10790 u_vdata instead of u_ldata. remove explicit cast to (long) for
10791 pointers. Removed old code that was commented out.
10793 * src/insets/inset.C: removed old commented func
10795 * src/insets/insetref.C (InsetRef): removed old code that had been
10796 commented out for a long time.
10798 (escape): removed C style cast
10800 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10802 * src/insets/insetlatex.C (Draw): removed old commented code
10803 (Read): rewritten to use string
10805 * src/insets/insetlabel.C (escape): removed C style cast
10807 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10809 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10810 old commented code.
10812 * src/insets/insetinclude.h: removed a couple of stupid bools
10814 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10815 (Clone): remove C style cast
10816 (getKeys): changed list to lst because of std::list
10818 * src/insets/inseterror.C (Draw): removed som old commented code.
10820 * src/insets/insetcommand.C (Draw): removed some old commented code.
10822 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10823 commented out forever.
10824 (bibitem_cb): use static_cast instead of C style cast
10825 use of vdata changed to u_vdata.
10827 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10829 (CloseUrlCB): use static_cast instead of C style cast.
10830 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10832 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10833 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10834 (CloseInfoCB): static_cast from ob->u_vdata instead.
10835 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10838 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10839 (C_InsetError_CloseErrorCB): forward the ob parameter
10840 (CloseErrorCB): static_cast from ob->u_vdata instead.
10842 * src/vspace.h: include LString.h since we use string in this class.
10844 * src/vspace.C (lyx_advance): changed name from advance because of
10845 nameclash with stl. And since we cannot use namespaces yet...I
10846 used a lyx_ prefix instead. Expect this to change when we begin
10849 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10851 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10852 and removed now defunct constructor and deconstructor.
10854 * src/BufferView.h: have backstack as a object not as a pointer.
10855 removed initialization from constructor. added include for BackStack
10857 * development/lyx.spec.in (%build): add CFLAGS also.
10859 * src/screen.C (drawFrame): removed another warning.
10861 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10863 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10864 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10865 README and ANNOUNCE a bit for the next release. More work is
10868 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10869 unbreakable if we are in freespacing mode (LyX-Code), but not in
10872 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10874 * src/BackStack.h: fixed initialization order in constructor
10876 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10878 * acinclude.m4 (VERSION): new rules for when a version is
10879 development, added also a variable for prerelease.
10880 (warnings): we set with_warnings=yes for prereleases
10881 (lyx_opt): prereleases compile with same optimization as development
10882 (CXXFLAGS): only use pedantic if we are a development version
10884 * src/BufferView.C (restorePosition): don't do anything if the
10885 backstack is empty.
10887 * src/BackStack.h: added member empty, use this to test if there
10888 is anything to pop...
10890 1999-10-25 Juergen Vigna <jug@sad.it>
10893 * forms/layout_forms.fd +
10894 * forms/latexoptions.fd +
10895 * lyx.fd: changed for various form resize issues
10897 * src/mathed/math_panel.C +
10898 * src/insets/inseterror.C +
10899 * src/insets/insetinfo.C +
10900 * src/insets/inseturl.C +
10901 * src/insets/inseturl.h +
10903 * src/LyXSendto.C +
10904 * src/PaperLayout.C +
10905 * src/ParagraphExtra.C +
10906 * src/TableLayout.C +
10908 * src/layout_forms.C +
10915 * src/menus.C: fixed various resize issues. So now forms can be
10916 resized savely or not be resized at all.
10918 * forms/form_url.fd +
10919 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10922 * src/insets/Makefile.am: added files form_url.[Ch]
10924 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10926 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10927 (and presumably 6.2).
10929 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10930 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10931 remaining static member callbacks.
10933 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10936 * src/support/lyxstring.h: declare struct Srep as friend of
10937 lyxstring, since DEC cxx complains otherwise.
10939 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10941 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10943 * src/LaTeX.C (run): made run_bibtex also depend on files with
10945 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10946 are put into the dependency file.
10948 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10949 the code has shown itself to work
10950 (create_ispell_pipe): removed another warning, added a comment
10953 * src/minibuffer.C (ExecutingCB): removed code that has been
10954 commented out a long time
10956 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10957 out code + a warning.
10959 * src/support/lyxstring.h: comment out the three private
10960 operators, when compiling with string ansi conforming compilers
10961 they make problems.
10963 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10965 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10966 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10969 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10972 * src/mathed/math_panel.C (create_math_panel): remove explicit
10975 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10978 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10979 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10980 to XCreatePixmapFromBitmapData
10981 (fl_set_bmtable_data): change the last argument to be unsigned
10983 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10984 and bh to be unsigned int, remove explicit casts in call to
10985 XReadBitmapFileData.
10987 * images/arrows.xbm: made the arrays unsigned char *
10988 * images/varsz.xbm: ditto
10989 * images/misc.xbm: ditto
10990 * images/greek.xbm: ditto
10991 * images/dots.xbm: ditto
10992 * images/brel.xbm: ditto
10993 * images/bop.xbm: ditto
10995 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10997 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10998 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10999 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11001 (LYX_CXX_CHEADERS): added <clocale> to the test.
11003 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11005 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11007 * src/support/lyxstring.C (append): fixed something that must be a
11008 bug, rep->assign was used instead of rep->append.
11010 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11013 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11014 lyx insert double chars. Fix spotted by Kayvan.
11016 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11018 * Fixed the tth support. I messed up with the Emacs patch apply feature
11019 and omitted the changes in lyxrc.C.
11021 1999-10-22 Juergen Vigna <jug@sad.it>
11023 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11025 * src/lyx_cb.C (MenuInsertRef) +
11026 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11027 the form cannot be resized under it limits (fixes a segfault)
11029 * src/lyx.C (create_form_form_ref) +
11030 * forms/lyx.fd: Changed Gravity on name input field so that it is
11033 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11035 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11036 <ostream> and <istream>.
11038 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11039 whether <fstream> provides the latest standard features, or if we
11040 have an oldstyle library (like in egcs).
11041 (LYX_CXX_STL_STRING): fix the test.
11043 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11044 code on MODERN_STL_STREAM.
11046 * src/support/lyxstring.h: use L{I,O}stream.h.
11048 * src/support/L{I,O}stream.h: new files, designed to setup
11049 correctly streams for our use
11050 - includes the right header depending on STL capabilities
11051 - puts std::ostream and std::endl (for LOStream.h) or
11052 std::istream (LIStream.h) in toplevel namespace.
11054 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11056 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11057 was a bib file that had been changed we ensure that bibtex is run.
11058 (runBibTeX): enhanced to extract the names of the bib files and
11059 getting their absolute path and enter them into the dep file.
11060 (findtexfile): static func that is used to look for tex-files,
11061 checks for absolute patchs and tries also with kpsewhich.
11062 Alternative ways of finding the correct files are wanted. Will
11064 (do_popen): function that runs a command using popen and returns
11065 the whole output of that command in a string. Should be moved to
11068 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11069 file with extension ext has changed.
11071 * src/insets/figinset.C: added ifdef guards around the fl_free
11072 code that jug commented out. Now it is commented out when
11073 compiling with XForms == 0.89.
11075 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11076 to lyxstring.C, and only keep a forward declaration in
11077 lyxstring.h. Simplifies the header file a bit and should help a
11078 bit on compile time too. Also changes to Srep will not mandate a
11079 recompile of code just using string.
11080 (~lyxstring): definition moved here since it uses srep.
11081 (size): definition moved here since it uses srep.
11083 * src/support/lyxstring.h: removed a couple of "inline" that should
11086 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11088 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11091 1999-10-21 Juergen Vigna <jug@sad.it>
11093 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11094 set to left if I just remove the width entry (or it is empty).
11096 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11097 paragraph when having dummy paragraphs.
11099 1999-10-20 Juergen Vigna <jug@sad.it>
11101 * src/insets/figinset.C: just commented some fl_free_form calls
11102 and added warnings so that this calls should be activated later
11103 again. This avoids for now a segfault, but we have a memory leak!
11105 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11106 'const char * argument' to 'string argument', this should
11107 fix some Asserts() in lyxstring.C.
11109 * src/lyxfunc.h: Removed the function argAsString(const char *)
11110 as it is not used anymore.
11112 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11114 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11117 * src/Literate.h: some funcs moved from public to private to make
11118 interface clearer. Unneeded args removed.
11120 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11122 (scanBuildLogFile): ditto
11124 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11125 normal TeX Error. Still room for improvement.
11127 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11129 * src/buffer.C (insertErrors): changes to make the error
11130 desctription show properly.
11132 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11135 * src/support/lyxstring.C (helper): changed to use
11136 sizeof(object->rep->ref).
11137 (operator>>): changed to use a pointer instead.
11139 * src/support/lyxstring.h: changed const reference & to value_type
11140 const & lets see if that helps.
11142 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11144 * Makefile.am (rpmdist): fixed to have non static package and
11147 * src/support/lyxstring.C: removed the compilation guards
11149 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11152 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11153 conditional compile of lyxstring.Ch
11155 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11156 stupid check, but it is a lot better than the bastring hack.
11157 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11159 * several files: changed string::erase into string::clear. Not
11162 * src/chset.C (encodeString): use a char temporary instead
11164 * src/table.C (TexEndOfCell): added tostr around
11165 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11166 (TexEndOfCell): ditto
11167 (TexEndOfCell): ditto
11168 (TexEndOfCell): ditto
11169 (DocBookEndOfCell): ditto
11170 (DocBookEndOfCell): ditto
11171 (DocBookEndOfCell): ditto
11172 (DocBookEndOfCell): ditto
11174 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11176 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11178 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11179 (MenuBuildProg): added tostr around ret
11180 (MenuRunChktex): added tostr around ret
11181 (DocumentApplyCB): added tostr around ret
11183 * src/chset.C (encodeString): added tostr around t->ic
11185 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11186 (makeLaTeXFile): added tostr around tocdepth
11187 (makeLaTeXFile): added tostr around ftcound - 1
11189 * src/insets/insetbib.C (setCounter): added tostr around counter.
11191 * src/support/lyxstring.h: added an operator+=(int) to catch more
11194 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11195 (lyxstring): We DON'T allow NULL pointers.
11197 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11199 * src/mathed/math_macro.C (MathMacroArgument::Write,
11200 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11201 when writing them out.
11203 * src/LString.C: remove, since it is not used anymore.
11205 * src/support/lyxstring.C: condition the content to
11206 USE_INCLUDED_STRING macro.
11208 * src/mathed/math_symbols.C, src/support/lstrings.C,
11209 src/support/lyxstring.C: add `using' directive to specify what
11210 we need in <algorithm>. I do not think that we need to
11211 conditionalize this, but any thought is appreciated.
11213 * many files: change all callback functions to "C" linkage
11214 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11215 strict_ansi. Those who were static are now global.
11216 The case of callbacks which are static class members is
11217 trickier, since we have to make C wrappers around them (see
11218 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11219 did not finish this yet, since it defeats the purpose of
11220 encapsulation, and I am not sure what the best route is.
11222 1999-10-19 Juergen Vigna <jug@sad.it>
11224 * src/support/lyxstring.C (lyxstring): we permit to have a null
11225 pointer as assignment value and just don't assign it.
11227 * src/vspace.C (nextToken): corrected this function substituting
11228 find_first(_not)_of with find_last_of.
11230 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11231 (TableOptCloseCB) (TableSpeCloseCB):
11232 inserted fl_set_focus call for problem with fl_hide_form() in
11235 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11237 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11240 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11242 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11243 LyXLex::next() and not eatline() to get its argument.
11245 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11247 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11248 instead, use fstreams for io of the depfile, removed unneeded
11249 functions and variables.
11251 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11252 vector instead, removed all functions and variables that is not in
11255 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11257 * src/buffer.C (insertErrors): use new interface to TeXError
11259 * Makefile.am (rpmdist): added a rpmdist target
11261 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11262 per Kayvan's instructions.
11264 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11266 * src/Makefile.am: add a definition for localedir, so that locales
11267 are found after installation (Kayvan)
11269 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11271 * development/.cvsignore: new file.
11273 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11275 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11276 C++ compiler provides wrappers for C headers and use our alternate
11279 * configure.in: use LYX_CXX_CHEADERS.
11281 * src/cheader/: new directory, populated with cname headers from
11282 libstdc++-2.8.1. They are a bit old, but probably good enough for
11283 what we want (support compilers who lack them).
11285 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11286 from includes. It turns out is was stupid.
11288 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11290 * lib/Makefile.am (install-data-local): forgot a ';'
11291 (install-data-local): forgot a '\'
11292 (libinstalldirs): needed after all. reintroduced.
11294 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11296 * configure.in (AC_OUTPUT): added lyx.spec
11298 * development/lyx.spec: removed file
11300 * development/lyx.spec.in: new file
11302 * po/*.po: merged with lyx.pot becuase of make distcheck
11304 * lib/Makefile.am (dist-hook): added dist-hook so that
11305 documentation files will be included when doing a make
11306 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11307 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11309 more: tried to make install do the right thing, exclude CVS dirs
11312 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11313 Path would fit in more nicely.
11315 * all files that used to use pathstack: uses now Path instead.
11316 This change was a lot easier than expected.
11318 * src/support/path.h: new file
11320 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11322 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11324 * src/support/lyxstring.C (getline): Default arg was given for
11327 * Configure.cmd: removed file
11329 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11331 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11332 streams classes and types, add the proper 'using' statements when
11333 MODERN_STL is defined.
11335 * src/debug.h: move the << operator definition after the inclusion
11338 * src/support/filetools.C: include "LAssert.h", which is needed
11341 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11344 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11345 include "debug.h" to define a proper ostream.
11347 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11349 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11350 method to the SystemCall class which can kill a process, but it's
11351 not fully implemented yet.
11353 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11355 * src/support/FileInfo.h: Better documentation
11357 * src/lyxfunc.C: Added support for buffer-export html
11359 * src/menus.C: Added Export->As HTML...
11361 * lib/bind/*.bind: Added short-cut for buffer-export html
11363 * src/lyxrc.*: Added support for new \tth_command
11365 * lib/lyxrc.example: Added stuff for new \tth_command
11367 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11369 * lib/Makefile.am (IMAGES): removed images/README
11370 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11371 installes in correct place. Check permisions is installed
11374 * src/LaTeX.C: some no-op changes moved declaration of some
11377 * src/LaTeX.h (LATEX_H): changed include guard name
11379 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11381 * lib/reLyX/Makefile.am: install noweb2lyx.
11383 * lib/Makefile.am: install configure.
11385 * lib/reLyX/configure.in: declare a config aux dir; set package
11386 name to lyx (not sure what the best solution is); generate noweb2lyx.
11388 * lib/layouts/egs.layout: fix the bibliography layout.
11390 1999-10-08 Jürgen Vigna <jug@sad.it>
11392 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11393 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11394 it returned without continuing to search the path.
11396 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11398 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11399 also fixes a bug. It is not allowed to do tricks with std::strings
11400 like: string a("hei"); &a[e]; this will not give what you
11401 think... Any reason for the complexity in this func?
11403 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11405 * Updated README and INSTALL a bit, mostly to check that my
11406 CVS rights are correctly set up.
11408 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11410 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11411 does not allow '\0' chars but lyxstring and std::string does.
11413 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11415 * autogen.sh (AUTOCONF): let the autogen script create the
11416 POTFILES.in file too. POTFILES.in should perhaps now not be
11417 included in the cvs module.
11419 * some more files changed to use C++ includes instead of C ones.
11421 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11423 (Reread): added tostr to nlink. buggy output otherwise.
11424 (Reread): added a string() around szMode when assigning to Buffer,
11425 without this I got a log of garbled info strings.
11427 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11430 * I have added several ostream & operator<<(ostream &, some_type)
11431 functions. This has been done to avoid casting and warnings when
11432 outputting enums to lyxerr. This as thus eliminated a lot of
11433 explicit casts and has made the code clearer. Among the enums
11434 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11435 mathed enums, some font enum the Debug::type enum.
11437 * src/support/lyxstring.h (clear): missing method. equivalent of
11440 * all files that contained "stderr": rewrote constructs that used
11441 stderr to use lyxerr instead. (except bmtable)
11443 * src/support/DebugStream.h (level): and the passed t with
11444 Debug::ANY to avoid spurious bits set.
11446 * src/debug.h (Debug::type value): made it accept strings of the
11447 type INFO,INIT,KEY.
11449 * configure.in (Check for programs): Added a check for kpsewhich,
11450 the latex generation will use this later to better the dicovery of
11453 * src/BufferView.C (create_view): we don't need to cast this to
11454 (void*) that is done automatically.
11455 (WorkAreaButtonPress): removed some dead code.
11457 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11459 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11460 is not overwritten when translated (David Sua'rez de Lis).
11462 * lib/CREDITS: Added David Sua'rez de Lis
11464 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11466 * src/bufferparams.C (BufferParams): default input encoding is now
11469 * acinclude.m4 (cross_compiling): comment out macro
11470 LYX_GXX_STRENGTH_REDUCE.
11472 * acconfig.h: make sure that const is not defined (to empty) when
11473 we are compiling C++. Remove commented out code using SIZEOF_xx
11476 * configure.in : move the test for const and inline as late as
11477 possible so that these C tests do not interefere with C++ ones.
11478 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11479 has not been proven.
11481 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11483 * src/table.C (getDocBookAlign): remove bad default value for
11484 isColumn parameter.
11486 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11488 (ShowFileMenu2): ditto.
11490 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11491 of files to ignore.
11493 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11495 * Most files: finished the change from the old error code to use
11496 DebugStream for all lyxerr debugging. Only minor changes remain
11497 (e.g. the setting of debug levels using strings instead of number)
11499 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11501 * src/layout.C (Add): Changed to use compare_no_case instead of
11504 * src/FontInfo.C: changed loop variable type too string::size_type.
11506 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11508 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11509 set ETAGS_ARGS to --c++
11511 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11513 * src/table.C (DocBookEndOfCell): commented out two unused variables
11515 * src/paragraph.C: commented out four unused variables.
11517 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11518 insed a if clause with type string::size_type.
11520 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11523 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11525 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11526 variable, also changed loop to go from 0 to lenght + 1, instead of
11527 -1 to length. This should be correct.
11529 * src/LaTeX.C (scanError): use string::size_type as loop variable
11532 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11533 (l.896) since y_tmp and row was not used anyway.
11535 * src/insets/insetref.C (escape): use string::size_type as loop
11538 * src/insets/insetquotes.C (Width): use string::size_type as loop
11540 (Draw): use string::size_type as loop variable type.
11542 * src/insets/insetlatexaccent.C (checkContents): use
11543 string::size_type as loop variable type.
11545 * src/insets/insetlabel.C (escape): use string::size_type as loop
11548 * src/insets/insetinfo.C: added an extern for current_view.
11550 * src/insets/insetcommand.C (scanCommand): use string::size_type
11551 as loop variable type.
11553 * most files: removed the RCS tags. With them we had to recompile
11554 a lot of files after a simple cvs commit. Also we have never used
11555 them for anything meaningful.
11557 * most files: tags-query-replace NULL 0. As adviced several plases
11558 we now use "0" instead of "NULL" in our code.
11560 * src/support/filetools.C (SpaceLess): use string::size_type as
11561 loop variable type.
11563 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11565 * src/paragraph.C: fixed up some more string stuff.
11567 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11569 * src/support/filetools.h: make modestr a std::string.
11571 * src/filetools.C (GetEnv): made ch really const.
11573 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11574 made code that used these use max/min from <algorithm> instead.
11576 * changed several c library include files to their equivalent c++
11577 library include files. All is not changed yet.
11579 * created a support subdir in src, put lyxstring and lstrings
11580 there + the extra files atexit, fileblock, strerror. Created
11581 Makefile.am. edited configure.in and src/Makefile.am to use this
11582 new subdir. More files moved to support.
11584 * imported som of the functions from repository lyx, filetools
11586 * ran tags-query-replace on LString -> string, corrected the bogus
11587 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11588 is still some errors in there. This is errors where too much or
11589 too litle get deleted from strings (string::erase, string::substr,
11590 string::replace), there can also be some off by one errors, or
11591 just plain wrong use of functions from lstrings. Viewing of quotes
11594 * LyX is now running fairly well with string, but there are
11595 certainly some bugs yet (see above) also string is quite different
11596 from LString among others in that it does not allow null pointers
11597 passed in and will abort if it gets any.
11599 * Added the revtex4 files I forgot when setting up the repository.
11601 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11603 * All over: Tried to clean everything up so that only the files
11604 that we really need are included in the cvs repository.
11605 * Switched to use automake.
11606 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11607 * Install has not been checked.
11609 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11611 * po/pt.po: Three errors:
11612 l.533 and l.538 format specification error
11613 l. 402 duplicate entry, I just deleted it.