1 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/BufferView_pimpl.C (buffer): cleaned up a little.
5 * src/insets/figinset.[Ch]:
6 * src/insets/insetinclude.[Ch]:
7 * src/insets/insetinclude.[Ch]:
8 * src/insets/insetparent.[Ch]:
9 * src/insets/insetref.[Ch]:
10 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
13 * src/mathed/formula.[Ch]:
14 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
16 * src/buffer.C (parseSingleLyXformat2Token, readInset):
17 * src/lyx_cb.C (FigureApplyCB):
18 * src/lyxfunc.C (getStatus, Dispatch):
19 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
22 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
24 * src/converter.[Ch] (Formats::View):
25 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
27 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
28 *current_view->buffer(). This will change later, but this patch is way
31 2000-10-09 Juergen Vigna <jug@sad.it>
33 * src/text.C (GetRow): small fix.
35 * src/BufferView_pimpl.C (cursorPrevious):
36 (cursorNext): added LyXText parameter to function.
38 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
39 keypress depending on cursor position.
41 2000-10-06 Juergen Vigna <jug@sad.it>
43 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
44 (copySelection): redone this function and also copy ascii representa-
47 * src/tabular.C (Ascii):
51 (print_n_chars): new functions to realize the ascii export of tabulars.
53 2000-10-05 Juergen Vigna <jug@sad.it>
55 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
56 if we don't have a buffer.
58 2000-10-10 Allan Rae <rae@lyx.org>
60 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
61 with closing dialog. It seems that nested tabfolders require hiding
62 of inner tabfolders before hiding the dialog itself. Actually all I
63 did was hide the active outer folder.
65 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
66 unless there really is a buffer. hideBufferDependent is called
69 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
70 POTFILES.in stays in $(srcdir).
72 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
74 * lib/lyxrc.example: Few changes.
76 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
78 * src/BufferView_pimpl.C (buffer): only need one the
79 updateBufferDependent signal to be emitted once! Moved to the end of
80 the method to allow bv_->text to be updated first.
82 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
83 and hSignal_ with Dialogs * and BufferDependency variables.
84 New Buffer * parent_, initialised when the dialog is launched. Used to
85 check whether to update() or hide() dialog in the new, private
86 updateOrHide() method that is connected to the updateBufferDependent
87 signal. Daughter classes dictate what to do using the
88 ChangedBufferAction enum, passed to the c-tor.
90 * src/frontends/xforms/FormCitation.C:
91 * src/frontends/xforms/FormCommand.C:
92 * src/frontends/xforms/FormCopyright.C:
93 * src/frontends/xforms/FormDocument.C:
94 * src/frontends/xforms/FormError.C:
95 * src/frontends/xforms/FormIndex.C:
96 * src/frontends/xforms/FormPreferences.C:
97 * src/frontends/xforms/FormPrint.C:
98 * src/frontends/xforms/FormRef.C:
99 * src/frontends/xforms/FormToc.C:
100 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
103 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
104 ChangedBufferAction enum.
106 * src/frontends/xforms/FormParagraph.[Ch]
107 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
110 * src/frontends/xforms/FormToc.h (updateOrHide): override default
111 behaviour. Calls update() only.
113 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
115 * lib/bind/cua.bind: fix a bit.
116 * lib/bind/emacs.bind: ditto.
118 * lib/bind/menus.bind: remove real menu entries from there.
120 * src/spellchecker.C: make sure we only include strings.h when
123 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
125 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
126 function. It enlarges the maximum number of pup when needed.
127 (add_toc2): Open a new menu if maximum number of items per menu has
130 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
132 * src/frontends/kde/FormPrint.C: fix error reporting
134 * src/frontends/xforms/FormDocument.C: fix compiler
137 * lib/.cvsignore: add Literate.nw
139 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
142 * bufferview_funcs.[Ch]
145 * text2.C: Add support for numbers in RTL text.
147 2000-10-06 Allan Rae <rae@lyx.org>
149 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
150 to be gettext.m4 friendly again. ext_l10n.h is now
151 generated into $top_srcdir instead of $top_builddir
152 so that lyx.pot will be built correctly -- without
153 duplicate parsing of ext_l10n.h.
155 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
157 * src/frontends/kde/FormCitation.C: make the dialog
160 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
162 * config/kde.m4: fix consecutive ./configure runs,
163 look for qtarch, fix library order
165 * src/frontends/kde/Makefile.am: tidy up,
166 add Print dialog, add .dlg dependencies
168 * src/frontends/kde/FormPrint.C:
169 * src/frontends/kde/FormPrint.h:
170 * src/frontends/kde/formprintdialog.C:
171 * src/frontends/kde/formprintdialog.h:
172 * src/frontends/kde/formprintdialogdata.C:
173 * src/frontends/kde/formprintdialogdata.h:
174 * src/frontends/kde/dlg/formprintdialog.dlg: add
177 * src/frontends/kde/dlg/README: Added explanatory readme
179 * src/frontends/kde/dlg/checkinitorder.pl: small perl
180 script to double-check qtarch's output
182 * src/frontends/kde/formindexdialog.C:
183 * src/frontends/kde/formindexdialogdata.C:
184 * src/frontends/kde/formindexdialogdata.h:
185 * src/frontends/kde/dlg/formindexdialog.dlg: update
186 for qtarch, minor fixes
188 2000-10-05 Allan Rae <rae@lyx.org>
190 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
191 dialogs when switching buffers update them instead. It's up to each
192 dialog to decide if it should still be visible or not.
193 update() should return a bool to control visiblity within show().
194 Or perhaps better to set a member variable and use that to control
197 * lib/build-listerrors: create an empty "listerrors" file just to stop
198 make trying to regenerate it all the time if you don't have noweb
201 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
203 * po/Makefile.in.in (ext_l10n.h): added a rule to build
204 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
205 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
206 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
207 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
209 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
211 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
213 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
214 deleting buffer. Closes all buffer-dependent dialogs.
216 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
218 * src/frontends/xforms/FormCitation.[Ch]:
219 * src/frontends/xforms/FormPreferences.[Ch]:
220 * src/frontends/xforms/FormPrint.[Ch]:
221 * src/frontends/xforms/FormRef.[Ch]:
222 * src/frontends/xforms/FormUrl.[Ch]: ditto
224 * src/frontends/xforms/FormDocument.[Ch]:
225 * src/frontends/xforms/forms/form_document.C.patch:
226 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
227 pass through a single input() function.
229 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
231 * lib/build-listerrors: return status as OK
233 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
235 * lib/lyxrc.example: Updated to new export code
237 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
239 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
242 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
245 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
247 * lib/layouts/amsbook.layout: ditto.
249 * boost/Makefile.am: fix typo.
251 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
253 (add_lastfiles): removed.
254 (add_documents): removed.
255 (add_formats): removed.
257 * src/frontends/Menubar.C: remove useless "using" directive.
259 * src/MenuBackend.h: add a new MenuItem constructor.
261 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
264 2000-10-04 Allan Rae <rae@lyx.org>
266 * lib/Makefile.am (listerrors):
267 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
268 I haven't got notangle installed so Kayvan please test. The output
269 should end up in $builddir. This also allows people who don't have
270 noweb installed to complete the make process without error.
272 * src/frontends/xforms/FormCommand.[Ch] (showInset):
273 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
274 by JMarc's picky compiler.
276 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
279 * src/insets/insettabular.C (setPos): change for loop to not use
280 sequencing operator. Please check this Jürgen.
282 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
284 * src/insets/insetcite.C (getScreenLabel): ditto
285 * src/support/filetools.C (QuoteName): ditto
286 (ChangeExtension): ditto
288 * src/BufferView_pimpl.C (scrollCB): make heigt int
290 * src/BufferView2.C (insertInset): comment out unused arg
292 * boost/Makefile.am (EXTRADIST): new variable
294 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
296 * src/exporter.C (IsExportable): Fixed
298 * lib/configure.m4: Small fix
300 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
302 * src/insets/insetbutton.C (width): Changed to work with no GUI.
303 * src/insets/insetbib.C (bibitemWidest): ditto.
304 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
306 2000-10-03 Juergen Vigna <jug@sad.it>
308 * src/BufferView2.C (theLockingInset): removed const because of
309 Agnus's compile problems.
311 * src/insets/insettext.C (LocalDispatch): set the language of the
312 surronding paragraph on inserting the first character.
314 * various files: changed use of BufferView::the_locking_inset.
316 * src/BufferView2.C (theLockingInset):
317 (theLockingInset): new functions.
319 * src/BufferView.h: removed the_locking_inset.
321 * src/lyxtext.h: added the_locking_inset
323 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
325 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
327 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
329 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
330 * src/mathed/math_cursor.C (IsAlpha): ditto.
331 * src/mathed/math_inset.C (strnew): ditto.
332 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
333 (IMetrics): cxp set but never used; removed.
334 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
335 that the variable in question has been removed also!
338 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
339 using the Buffer * passed to Latex(), using the BufferView * passed to
340 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
342 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
343 Linuxdoc() and DocBook() rather than the stored Buffer * master.
345 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
346 * src/buffer.C (readInset): used new InsetBibtex c-tor
347 * (getBibkeyList): used new InsetBibtex::getKeys
349 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
352 * lib/build-listerrors
354 * src/exporter.C: Add literate programming support to the export code
357 * src/lyx_cb.C: Remove old literate code.
359 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
362 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
363 * src/converter.C (View, Convert): Use QuoteName.
365 * src/insets/figinset.C (Preview): Use Formats::View.
367 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
369 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
371 * src/lyxfunc.C (Dispatch): move declaration of text variable at
372 the top of the function, because compaq cxx complains that the
373 "goto exit_with_message" when the function is disabled bypasses
375 (MenuNew): try a better fix for the generation of new file names.
376 This time, I used AddName() instead of AddPath(), hoping Juergen
379 2000-10-03 Allan Rae <rae@lyx.org>
381 * src/frontends/xforms/forms/form_preferences.fd:
382 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
383 nested tabfolders has begun. The old "Miscellaneous" was renamed as
384 "Look and Feel"->"General" but will need to be split up further into
385 general output and general input tabs. Current plan is for four outer
386 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
387 stuff; "Inputs" for input and import configuration; "Outputs" for
388 output and export configuration; and one more whatever is left over
389 called "General". The leftovers at present look like being which
390 viewers to use, spellchecker, language support and might be better
391 named "Support". I've put "Paths" in "Inputs" for the moment as this
392 seems reasonable for now at least.
393 One problem remains: X error kills LyX when you close Preferences.
395 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
397 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
398 qualifier from form()
399 * src/frontends/xforms/FormCitation.[Ch]:
400 * src/frontends/xforms/FormCopyright.[Ch]:
401 * src/frontends/xforms/FormDocument.[Ch]:
402 * src/frontends/xforms/FormError.[Ch]:
403 * src/frontends/xforms/FormIndex.[Ch]:
404 * src/frontends/xforms/FormPreferences.[Ch]:
405 * src/frontends/xforms/FormPrint.[Ch]:
406 * src/frontends/xforms/FormRef.[Ch]:
407 * src/frontends/xforms/FormToc.[Ch]:
408 * src/frontends/xforms/FormUrl.[Ch]: ditto.
410 * src/frontends/xforms/FormCitation.[Ch]:
411 * src/frontends/xforms/FormIndex.[Ch]:
412 * src/frontends/xforms/FormRef.[Ch]:
413 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
414 with Allan's naming policy
416 * src/frontends/xforms/FormCitation.C: some static casts to remove
419 2000-10-02 Juergen Vigna <jug@sad.it>
421 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
422 now you can type or do stuff inside the table-cell also when in dummy
423 position, fixed visible cursor.
425 * src/insets/insettext.C (Edit): fixing cursor-view position.
427 * src/lyxfunc.C (Dispatch): use * text variable so that it can
428 be used for equal functions in lyxfunc and insettext.
430 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
432 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
434 * src/frontends/gnome/FormCitation.h:
435 * src/frontends/gnome/FormCopyright.h:
436 * src/frontends/gnome/FormIndex.h:
437 * src/frontends/gnome/FormPrint.h:
438 * src/frontends/gnome/FormToc.h:
439 * src/frontends/gnome/FormUrl.h:
440 * src/frontends/kde/FormCitation.h:
441 * src/frontends/kde/FormCopyright.h:
442 * src/frontends/kde/FormIndex.h:
443 * src/frontends/kde/FormRef.h:
444 * src/frontends/kde/FormToc.h:
445 * src/frontends/kde/FormUrl.h: fix remaining users of
448 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
450 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
452 (DocBookHandleCaption): ditto.
453 (DocBookHandleFootnote): ditto.
454 (SimpleDocBookOnePar): ditto.
456 * src/frontends/xforms/FormDocument.h (form): remove extra
457 FormDocument:: qualifier.
459 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
461 * sigc++/handle.h: ditto.
463 * src/lyx_gui_misc.C: add "using" directive.
465 * src/cheaders/cstddef: new file, needed by the boost library (for
468 2000-10-02 Juergen Vigna <jug@sad.it>
470 * src/insets/insettext.C (SetFont): better support.
472 * src/insets/insettabular.C (draw): fixed drawing of single cell.
474 * src/screen.C (DrawOneRow): some uint refixes!
476 2000-10-02 Allan Rae <rae@lyx.org>
478 * boost/.cvsignore: ignore Makefile as well
480 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
481 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
483 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
484 Left this one out by accident.
486 * src/frontends/xforms/FormBase.h (restore): default to calling
487 update() since that will restore the original/currently-applied values.
488 Any input() triggered error messages will require the derived classes
489 to redefine restore().
491 * src/frontends/xforms/FormDocument.C: initialize a few variables to
492 avoid a segfault. combo_doc_class is the main concern.
494 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
496 * Simplify build-listerrors in view of GUI-less export ability!
498 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
500 * src/lyx_main.C (easyParse): Disable gui when exporting
502 * src/insets/figinset.C:
506 * src/tabular.C: Changes to allow no-gui.
508 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
510 * src/support/utility.hpp: removed file
511 * src/support/block.h: removed file
513 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
516 * src/mathed/formula.C: add support/lyxlib.h
517 * src/mathed/formulamacro.C: ditto
519 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
520 * src/lyxparagraph.h: ditto
522 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
523 * src/frontends/Makefile.am (INCLUDES): ditto
524 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
525 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
526 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
527 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
528 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
529 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
531 * src/BufferView.h: use boost/utility.hpp
532 * src/LColor.h: ditto
534 * src/LyXAction.h: ditto
535 * src/LyXView.h: ditto
536 * src/bufferlist.h: ditto
537 * src/lastfiles.h: ditto
538 * src/layout.h: ditto
539 * src/lyx_gui.h: ditto
540 * src/lyx_main.h: ditto
541 * src/lyxlex.h: ditto
543 * src/frontends/ButtonPolicies.h: ditto
544 * src/frontends/Dialogs.h: ditto
545 * src/frontends/xforms/FormBase.h: ditto
546 * src/frontends/xforms/FormGraphics.h: ditto
547 * src/frontends/xforms/FormParagraph.h: ditto
548 * src/frontends/xforms/FormTabular.h: ditto
549 * src/graphics/GraphicsCache.h: ditto
550 * src/graphics/Renderer.h: ditto
551 * src/insets/ExternalTemplate.h: ditto
552 * src/insets/insetcommand.h: ditto
553 * src/support/path.h: ditto
555 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
556 and introduce clause for 2.97.
558 * boost/libs/README: new file
560 * boost/boost/utility.hpp: new file
562 * boost/boost/config.hpp: new file
564 * boost/boost/array.hpp: new file
566 * boost/Makefile.am: new file
568 * boost/.cvsignore: new file
570 * configure.in (AC_OUTPUT): add boost/Makefile
572 * Makefile.am (SUBDIRS): add boost
574 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
576 * src/support/lstrings.C (suffixIs): Fixed.
578 2000-10-01 Allan Rae <rae@lyx.org>
580 * src/PrinterParams.h: moved things around to avoid the "can't
581 inline call" warning.
583 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
584 into doc++ documentation.
586 * src/frontends/xforms/FormCommand.[Ch]: support button policy
588 * src/frontends/xforms/FormRef.C: make use of button controller
589 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
590 cleaned up button controller usage.
591 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
592 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
593 use the button controller
595 * src/frontends/xforms/forms/*.fd: and associated generated files
596 updated to reflect changes to FormBase. Some other FormXxxx files
597 also got minor updates to reflect changes to FormBase.
599 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
600 (hide): made virtual.
601 (input): return a bool. true == valid input
602 (RestoreCB, restore): new
603 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
604 Changes to allow derived dialogs to use a ButtonController and
605 make sense when doing so: OK button calls ok() and so on.
607 * src/frontends/xforms/ButtonController.h (class ButtonController):
608 Switch from template implementation to taking Policy parameter.
609 Allows FormBase to provide a ButtonController for any dialog.
611 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
612 Probably should rename connect and disconnect.
613 (apply): use the radio button groups
614 (form): needed by FormBase
615 (build): setup the radio button groups
617 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
619 * several files: type changes to reduce the number of warnings and
620 to unify type hangling a bit. Still much to do.
622 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
624 * lib/images/*: rename a bunch of icons to match Dekel converter
627 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
630 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
632 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
634 * sigc++/handle.h: ditto for class Handle.
636 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
638 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
640 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
642 * src/intl.C (InitKeyMapper): Correct the value of n due to the
643 removal of the "default" language.
645 * src/combox.h (getline): Check that sel > 0
647 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
649 * lib/examples/docbook_example.lyx
650 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
652 * lib/layouts/docbook-book.layout: new docbook book layout.
654 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
656 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
658 * src/insets/figinset.C (DocBook):fixed small typo.
660 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
662 * src/insets/insetinclude.h: string include_label doesn't need to be
665 2000-09-29 Allan Rae <rae@lyx.org>
667 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
668 Allow derived type to control connection and disconnection from signals
669 of its choice if desired.
671 2000-09-28 Juergen Vigna <jug@sad.it>
673 * src/insets/insettabular.C (update): fixed cursor setting when
674 the_locking_inset changed.
675 (draw): made this a bit cleaner.
676 (InsetButtonPress): fixed!
678 * various files: added LyXText Parameter to fitCursor call.
680 * src/BufferView.C (fitCursor): added LyXText parameter.
682 * src/insets/insettabular.C (draw): small draw fix.
684 * src/tabular.C: right setting of left/right celllines.
686 * src/tabular.[Ch]: fixed various types in funcions and structures.
687 * src/insets/insettabular.C: ditto
688 * src/frontends/xforms/FormTabular.C: ditto
690 2000-09-28 Allan Rae <rae@lyx.org>
692 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
693 that the #ifdef's had been applied to part of what should have been
694 a complete condition. It's possible there are other tests that
695 were specific to tables that are also wrong now that InsetTabular is
696 being used. Now we need to fix the output of '\n' after a table in a
697 float for the same reason as the original condition:
698 "don't insert this if we would be adding it before or after a table
699 in a float. This little trick is needed in order to allow use of
700 tables in \subfigures or \subtables."
701 Juergen can you check this?
703 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
705 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
706 outputed to the ostream.
708 * several files: fixed types based on warnings from cxx
710 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
712 * src/frontends/kde/Makefile.am: fix rule for
713 formindexdialogdata_moc.C
715 * src/.cvsignore: add ext_l10n.h to ignore
717 * acconfig.h: stop messing with __STRICT_ANSI__
718 * config/gnome.m4: remove option to set -ansi
719 * config/kde.m4: remove option to set -ansi
720 * config/lyxinclude.m4: don't set -ansi
722 2000-09-27 Juergen Vigna <jug@sad.it>
724 * various files: remove "default" language check.
726 * src/insets/insetquotes.C: removed use of current_view.
728 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
729 the one should have red ears by now!
731 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
732 in more then one paragraph. Fixed cursor-movement/selection.
734 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
735 paragraphs inside a text inset.
737 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
738 text-inset if this owner is an inset.
740 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
742 * src/Bullet.h: changed type of font, character and size to int
744 * src/buffer.C (asciiParagraph): remove actcell and fname1.
746 * src/insets/inseturl.[Ch]:
747 * src/insets/insetref.[Ch]:
748 * src/insets/insetlabel.[Ch]: add linelen to Ascii
750 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
752 * src/buffer.C (readFile): block-if statement rearranged to minimise
753 bloat. Patch does not reverse Jean-Marc's change ;-)
755 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
756 Class rewritten to store pointers to hide/update signals directly,
757 rather than Dialogs *. Also defined an enum to ease use. All xforms
758 forms can now be derived from this class.
760 * src/frontends/xforms/FormCommand.[Ch]
761 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
763 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
766 * src/frontends/xforms/forms/form_citation.fd
767 * src/frontends/xforms/forms/form_copyright.fd
768 * src/frontends/xforms/forms/form_error.fd
769 * src/frontends/xforms/forms/form_index.fd
770 * src/frontends/xforms/forms/form_ref.fd
771 * src/frontends/xforms/forms/form_toc.fd
772 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
774 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
776 * src/insets/insetfoot.C: removed redundent using directive.
778 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
780 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
781 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
783 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
784 created in the constructors in different groups. Then set() just
785 have to show the groups as needed. This fixes the redraw problems
786 (and is how the old menu code worked).
788 * src/support/lyxlib.h: declare the methods as static when we do
791 2000-09-26 Juergen Vigna <jug@sad.it>
793 * src/buffer.C (asciiParagraph): new function.
794 (writeFileAscii): new function with parameter ostream.
795 (writeFileAscii): use now asciiParagraph.
797 * various inset files: added the linelen parameter to the Ascii-func.
799 * src/tabular.C (Write): fixed error in writing file introduced by
800 the last changes from Lars.
802 * lib/bind/menus.bind: removed not supported functions.
804 * src/insets/insettext.C (Ascii): implemented this function.
806 * src/insets/lyxinset.h (Ascii): added linelen parameter.
808 * src/tabular.C (write_attribute[int,string,bool]): new functions.
809 (Write): use of the write_attribute functions.
811 * src/bufferlist.C (close): fixed reasking question!
813 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
815 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
816 new files use the everwhere possible.
819 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
820 src/log_form.C src/lyx.C:
823 * src/buffer.C (runLaTeX): remove func
825 * src/PaperLayout.C: removed file
826 * src/ParagraphExtra.C: likewise
827 * src/bullet_forms.C: likewise
828 * src/bullet_forms.h: likewise
829 * src/bullet_forms_cb.C: likewise
831 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
832 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
835 * several files: remove all traces of the old fd_form_paragraph,
836 and functions belonging to that.
838 * several files: remove all traces of the old fd_form_document,
839 and functions belonging to that.
841 * several files: constify local variables were possible.
843 * several files: remove all code that was dead when NEW_EXPORT was
846 * several files: removed string::c_str in as many places as
849 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
850 (e): be a bit more outspoken when patching
851 (updatesrc): only move files if changed.
853 * forms/layout_forms.h.patch: regenerated
855 * forms/layout_forms.fd: remove form_document and form_paragraph
856 and form_quotes and form_paper and form_table_options and
859 * forms/form1.fd: remove form_table
861 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
862 the fdui->... rewrite. Update some comments to xforms 0.88
864 * forms/bullet_forms.C.patch: removed file
865 * forms/bullet_forms.fd: likewise
866 * forms/bullet_forms.h.patch: likewise
868 * development/Code_rules/Rules: added a section on switch
869 statements. Updated some comment to xforms 0.88.
871 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
873 * src/buffer.C (readFile): make sure that the whole version number
874 is read after \lyxformat (even when it contains a comma)
876 * lib/ui/default.ui: change shortcut of math menu to M-a.
878 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
880 * src/vspace.C (nextToken): use isStrDbl() to check for proper
883 * src/LyXView.C (updateWindowTitle): show the full files name in
884 window title, limited to 30 characters.
886 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
887 When a number of characters has been given, we should not assume
888 that the string is 0-terminated.
890 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
891 calls (fixes some memory leaks)
893 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
894 trans member on exit.
896 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
898 * src/converter.C (GetReachable): fix typo.
900 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
901 understand ',' instead of '.'.
902 (GetInteger): rewrite to use strToInt().
904 2000-09-26 Juergen Vigna <jug@sad.it>
906 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
907 better visibility and error-message on wrong VSpace input.
909 * src/language.C (initL): added english again.
911 2000-09-25 Juergen Vigna <jug@sad.it>
913 * src/frontends/kde/Dialogs.C (Dialogs):
914 * src/frontends/gnome/Dialogs.C (Dialogs):
915 * src/frontends/kde/Makefile.am:
916 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
918 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
920 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
922 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
924 * src/frontends/xforms/FormParagraph.C:
925 * src/frontends/xforms/FormParagraph.h:
926 * src/frontends/xforms/form_paragraph.C:
927 * src/frontends/xforms/form_paragraph.h:
928 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
931 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
933 * src/tabular.C (OldFormatRead): forgot to delete the temporary
934 Paragraph-Data after use.
936 * src/insets/insettext.C (LocalDispatch): don't set the layout on
937 non breakable paragraphs.
939 2000-09-25 Garst R. Reese <reese@isn.net>
941 * src/language.C (initL): added missing language_country codes.
943 2000-09-25 Juergen Vigna <jug@sad.it>
945 * src/insets/insettext.C (InsetText):
946 (deleteLyXText): remove the not released LyXText structure!
948 2000-09-24 Marko Vendelin <markov@ioc.ee>
950 * src/frontends/gnome/mainapp.C
951 * src/frontends/gnome/mainapp.h: added support for keyboard
954 * src/frontends/gnome/FormCitation.C
955 * src/frontends/gnome/FormCitation.h
956 * src/frontends/gnome/Makefile.am
957 * src/frontends/gnome/pixbutton.h: completed the rewrite of
958 FormCitation to use "action area" in mainapp window
960 * src/frontends/gnome/Menubar_pimpl.C
961 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
964 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
966 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
967 width/descent/ascent values if name is empty.
968 (mathed_string_height): Use std::max.
970 2000-09-25 Allan Rae <rae@lyx.org>
972 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
973 segfault. This will be completely redesigned soon.
975 * sigc++: updated libsigc++. Fixes struct timespec bug.
977 * development/tools/makeLyXsigc.sh: .cvsignore addition
979 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
981 * several files: removed almost all traces of the old table
984 * src/TableLayout.C: removed file
986 2000-09-22 Juergen Vigna <jug@sad.it>
988 * src/frontends/kde/Dialogs.C: added credits forms.
990 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
992 * src/frontends/gnome/Dialogs.C: added some forms.
994 * src/spellchecker.C (init_spell_checker): set language in pspell code
995 (RunSpellChecker): some modifications for setting language string.
997 * src/language.[Ch]: added language_country code.
999 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1001 * src/frontends/Dialogs.h: added new signal showError.
1002 Rearranged existing signals in some sort of alphabetical order.
1004 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1005 FormError.[Ch], form_error.[Ch]
1006 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1007 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1009 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1010 dialogs. I think that this can be used as the base to all these
1013 * src/frontends/xforms/FormError.[Ch]
1014 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1015 implementation of InsetError dialog.
1017 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1019 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1020 * src/frontends/kde/Makefile.am: ditto
1022 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1024 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1025 macrobf. This fixes a bug of invisible text.
1027 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1029 * lib/doc/LaTeXConfig.lyx.in: updated.
1031 * src/language.C (initL): remove language "francais" and change a
1032 bit the names of the two other french variations.
1034 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1035 string that may not be 0-terminated.
1037 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1039 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1041 2000-09-20 Marko Vendelin <markov@ioc.ee>
1043 * src/frontends/gnome/FormCitation.C
1044 * src/frontends/gnome/FormIndex.C
1045 * src/frontends/gnome/FormToc.C
1046 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1047 the variable initialization to shut up the warnings
1049 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1051 * src/table.[Ch]: deleted files
1053 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1056 2000-09-18 Juergen Vigna <jug@sad.it>
1058 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1059 problems with selection. Inserted new LFUN_PASTESELECTION.
1060 (InsetButtonPress): inserted handling of middle mouse-button paste.
1062 * src/spellchecker.C: changed word to word.c_str().
1064 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1066 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1067 included in the ``make dist'' tarball.
1069 2000-09-15 Juergen Vigna <jug@sad.it>
1071 * src/CutAndPaste.C (cutSelection): small fix return the right
1072 end position after cut inside one paragraph only.
1074 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1075 we are locked as otherwise we don't have a valid cursor position!
1077 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1079 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1081 * src/frontends/kde/FormRef.C: added using directive.
1082 * src/frontends/kde/FormToc.C: ditto
1084 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1086 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1088 2000-09-19 Marko Vendelin <markov@ioc.ee>
1090 * src/frontends/gnome/Menubar_pimpl.C
1091 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1092 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1094 * src/frontends/gnome/mainapp.C
1095 * src/frontends/gnome/mainapp.h: support for menu update used
1098 * src/frontends/gnome/mainapp.C
1099 * src/frontends/gnome/mainapp.h: support for "action" area in the
1100 main window. This area is used by small simple dialogs, such as
1103 * src/frontends/gnome/FormIndex.C
1104 * src/frontends/gnome/FormIndex.h
1105 * src/frontends/gnome/FormUrl.C
1106 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1109 * src/frontends/gnome/FormCitation.C
1110 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1111 action area. Only "Insert new citation" is implemented.
1113 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1115 * src/buffer.C (Dispatch): fix call to Dispatch
1116 * src/insets/insetref.C (Edit): likewise
1117 * src/insets/insetparent.C (Edit): likewise
1118 * src/insets/insetinclude.C (include_cb): likewise
1119 * src/frontends/xforms/FormUrl.C (apply): likewise
1120 * src/frontends/xforms/FormToc.C (apply): likewise
1121 * src/frontends/xforms/FormRef.C (apply): likewise
1122 * src/frontends/xforms/FormIndex.C (apply): likewise
1123 * src/frontends/xforms/FormCitation.C (apply): likewise
1124 * src/lyxserver.C (callback): likewise
1125 * src/lyxfunc.C (processKeySym): likewise
1126 (Dispatch): likewise
1127 (Dispatch): likewise
1128 * src/lyx_cb.C (LayoutsCB): likewise
1130 * Makefile.am (sourcedoc): small change
1132 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1134 * src/main.C (main): Don't make an empty GUIRunTime object. all
1135 methods are static. constify a bit remove unneded using + headers.
1137 * src/tabular.C: some more const to local vars move some loop vars
1139 * src/spellchecker.C: added some c_str after some word for pspell
1141 * src/frontends/GUIRunTime.h: add new static method setDefaults
1142 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1143 * src/frontends/kde/GUIRunTime.C (setDefaults):
1144 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1146 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1147 with strnew in arg, use correct emptystring when calling SetName.
1149 * several files: remove all commented code with relation to
1150 HAVE_SSTREAM beeing false. We now only support stringstream and
1153 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1155 * src/lyxfunc.C: construct correctly the automatic new file
1158 * src/text2.C (IsStringInText): change type of variable i to shut
1161 * src/support/sstream.h: do not use namespaces if the compiler
1162 does not support them.
1164 2000-09-15 Marko Vendelin <markov@ioc.ee>
1165 * src/frontends/gnome/FormCitation.C
1166 * src/frontends/gnome/FormCitation.h
1167 * src/frontends/gnome/diainsertcitation_interface.c
1168 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1169 regexp support to FormCitation [Gnome].
1171 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1174 * configure.in: remove unused KDE/GTKGUI define
1176 * src/frontends/kde/FormRef.C
1177 * src/frontends/kde/FormRef.h
1178 * src/frontends/kde/formrefdialog.C
1179 * src/frontends/kde/formrefdialog.h: double click will
1180 go to reference, now it is possible to change a cross-ref
1183 * src/frontends/kde/FormToc.C
1184 * src/frontends/kde/FormToc.h
1185 * src/frontends/kde/formtocdialog.C
1186 * src/frontends/kde/formtocdialog.h: add a depth
1189 * src/frontends/kde/Makefile.am: add QtLyXView.h
1192 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1194 * src/frontends/kde/FormCitation.h: added some using directives.
1196 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1198 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1201 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1204 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1206 * src/buffer.C (pop_tag): revert for the second time a change by
1207 Lars, who seems to really hate having non-local loop variables :)
1209 * src/Lsstream.h: add "using" statements.
1211 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1212 * src/buffer.C (writeFile): ditto
1214 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1216 * src/buffer.C (writeFile): try to fix the locale modified format
1217 number to always be as we want it.
1219 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1220 in XForms 0.89. C-space is now working again.
1222 * src/Lsstream.h src/support/sstream.h: new files.
1224 * also commented out all cases where strstream were used.
1226 * src/Bullet.h (c_str): remove method.
1228 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1230 * a lot of files: get rid of "char const *" and "char *" is as
1231 many places as possible. We only want to use them in interaction
1232 with system of other libraries, not inside lyx.
1234 * a lot of files: return const object is not of pod type. This
1235 helps ensure that temporary objects is not modified. And fits well
1236 with "programming by contract".
1238 * configure.in: check for the locale header too
1240 * Makefile.am (sourcedoc): new tag for generation of doc++
1243 2000-09-14 Juergen Vigna <jug@sad.it>
1245 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1246 callback to check which combo called it and do the right action.
1248 * src/combox.C (combo_cb): added combo * to the callbacks.
1249 (Hide): moved call of callback after Ungrab of the pointer.
1251 * src/intl.h: removed LCombo2 function.
1253 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1254 function as this can now be handled in one function.
1256 * src/combox.h: added Combox * to callback prototype.
1258 * src/frontends/xforms/Toolbar_pimpl.C:
1259 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1261 2000-09-14 Garst Reese <reese@isn.net>
1263 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1264 moved usepackage{xxx}'s to beginning of file. Changed left margin
1265 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1266 underlining from title. Thanks to John Culleton for useful suggestions.
1268 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1270 * src/lyxlex_pimpl.C (setFile): change error message to debug
1273 2000-09-13 Juergen Vigna <jug@sad.it>
1275 * src/frontends/xforms/FormDocument.C: implemented choice_class
1276 as combox and give callback to combo_language so OK/Apply is activated
1279 * src/bufferlist.C (newFile): small fix so already named files
1280 (via an open call) are not requested to be named again on the
1283 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1285 * src/frontends/kde/Makefile.am
1286 * src/frontends/kde/FormRef.C
1287 * src/frontends/kde/FormRef.h
1288 * src/frontends/kde/formrefdialog.C
1289 * src/frontends/kde/formrefdialog.h: implement
1292 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1294 * src/frontends/kde/formtocdialog.C
1295 * src/frontends/kde/formtocdialog.h
1296 * src/frontends/kde/FormToc.C
1297 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1299 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1301 * src/frontends/kde/FormCitation.C: fix thinko
1302 where we didn't always display the reference text
1305 * src/frontends/kde/formurldialog.C
1306 * src/frontends/kde/formurldialog.h
1307 * src/frontends/kde/FormUrl.C
1308 * src/frontends/kde/FormUrl.h: minor cleanups
1310 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1312 * src/frontends/kde/Makefile.am
1313 * src/frontends/kde/FormToc.C
1314 * src/frontends/kde/FormToc.h
1315 * src/frontends/kde/FormCitation.C
1316 * src/frontends/kde/FormCitation.h
1317 * src/frontends/kde/FormIndex.C
1318 * src/frontends/kde/FormIndex.h
1319 * src/frontends/kde/formtocdialog.C
1320 * src/frontends/kde/formtocdialog.h
1321 * src/frontends/kde/formcitationdialog.C
1322 * src/frontends/kde/formcitationdialog.h
1323 * src/frontends/kde/formindexdialog.C
1324 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1326 2000-09-12 Juergen Vigna <jug@sad.it>
1328 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1331 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1333 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1336 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1338 * src/converter.C (Add, Convert): Added support for converter flags:
1339 needaux, resultdir, resultfile.
1340 (Convert): Added new parameter view_file.
1341 (dvips_options): Fixed letter paper option.
1343 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1344 (Export, GetExportableFormats, GetViewableFormats): Added support
1347 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1349 (easyParse): Fixed to work with new export code.
1351 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1354 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1356 * lib/bind/*.bind: Replaced
1357 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1358 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1360 2000-09-11 Juergen Vigna <jug@sad.it>
1362 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1364 * src/main.C (main): now GUII defines global guiruntime!
1366 * src/frontends/gnome/GUIRunTime.C (initApplication):
1367 * src/frontends/kde/GUIRunTime.C (initApplication):
1368 * src/frontends/xforms/GUIRunTime.C (initApplication):
1369 * src/frontends/GUIRunTime.h: added new function initApplication.
1371 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1373 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1375 2000-09-08 Juergen Vigna <jug@sad.it>
1377 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1378 we have already "Reset".
1380 * src/language.C (initL): inserted "default" language and made this
1381 THE default language (and not american!)
1383 * src/paragraph.C: inserted handling of "default" language!
1385 * src/lyxfont.C: ditto
1389 * src/paragraph.C: output the \\par only if we have a following
1390 paragraph otherwise it's not needed.
1392 2000-09-05 Juergen Vigna <jug@sad.it>
1394 * config/pspell.m4: added entry to lyx-flags
1396 * src/spellchecker.C: modified version from Kevin for using pspell
1398 2000-09-01 Marko Vendelin <markov@ioc.ee>
1399 * src/frontends/gnome/Makefile.am
1400 * src/frontends/gnome/FormCitation.C
1401 * src/frontends/gnome/FormCitation.h
1402 * src/frontends/gnome/diainsertcitation_callbacks.c
1403 * src/frontends/gnome/diainsertcitation_callbacks.h
1404 * src/frontends/gnome/diainsertcitation_interface.c
1405 * src/frontends/gnome/diainsertcitation_interface.h
1406 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1407 dialog for Gnome frontend
1409 * src/main.C: Gnome libraries require keeping application name
1410 and its version as strings
1412 * src/frontends/gnome/mainapp.C: Change the name of the main window
1413 from GnomeLyX to PACKAGE
1415 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1417 * src/frontends/Liason.C: add "using: declaration.
1419 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1421 * src/mathed/math_macro.C (Metrics): Set the size of the template
1423 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1425 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1427 * src/converter.C (add_options): New function.
1428 (SetViewer): Change $$FName into '$$FName'.
1429 (View): Add options when running xdvi
1430 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1431 (Convert): The 3rd parameter is now the desired filename. Converts
1432 calls to lyx::rename if necessary.
1433 Add options when running dvips.
1434 (dvi_papersize,dvips_options): New methods.
1436 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1438 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1439 using a call to Converter::dvips_options.
1440 Fixed to work with nex export code.
1442 * src/support/copy.C
1443 * src/support/rename.C: New files
1445 * src/support/syscall.h
1446 * src/support/syscall.C: Added Starttype SystemDontWait.
1448 * lib/ui/default.ui: Changed to work with new export code
1450 * lib/configure.m4: Changed to work with new export code
1452 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1454 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1456 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1457 so that code compiles with DEC cxx.
1459 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1460 to work correctly! Also now supports the additional elements
1463 2000-09-01 Allan Rae <rae@lyx.org>
1465 * src/frontends/ButtonPolicies.C: renamed all the references to
1466 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1468 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1469 since it's a const not a type.
1471 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1473 2000-08-31 Juergen Vigna <jug@sad.it>
1475 * src/insets/figinset.C: Various changes to look if the filename has
1476 an extension and if not add it for inline previewing.
1478 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1480 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1481 make buttonStatus and isReadOnly be const methods. (also reflect
1482 this in derived classes.)
1484 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1485 (nextState): change to be static inline, pass the StateMachine as
1487 (PreferencesPolicy): remove casts
1488 (OkCancelPolicy): remvoe casts
1489 (OkCancelReadOnlyPolicy): remove casts
1490 (NoRepeatedApplyReadOnlyPolicy): remove casts
1491 (OkApplyCancelReadOnlyPolicy): remove casts
1492 (OkApplyCancelPolicy): remove casts
1493 (NoRepeatedApplyPolicy): remove casts
1495 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1497 * src/converter.C: added some using directives
1499 * src/frontends/ButtonPolicies.C: changes to overcome
1500 "need lvalue" error with DEC c++
1502 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1503 to WMHideCB for DEC c++
1505 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1507 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1508 to BulletBMTableCB for DEC c++
1510 2000-08-31 Allan Rae <rae@lyx.org>
1512 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1513 character dialog separately from old document dialogs combo_language.
1516 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1518 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1519 Removed LFUN_REF_CREATE.
1521 * src/MenuBackend.C: Added new tags: toc and references
1523 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1524 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1526 (add_toc, add_references): New methods.
1527 (create_submenu): Handle correctly the case when there is a
1528 seperator after optional menu items.
1530 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1531 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1532 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1534 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1536 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1538 * src/converter.[Ch]: New file for converting between different
1541 * src/export.[Ch]: New file for exporting a LyX file to different
1544 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1545 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1546 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1547 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1548 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1549 RunDocBook, MenuExport.
1551 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1552 Exporter::Preview methods if NEW_EXPORT is defined.
1554 * src/buffer.C (Dispatch): Use Exporter::Export.
1556 * src/lyxrc.C: Added new tags: \converter and \viewer.
1559 * src/LyXAction.C: Define new lyx-function: buffer-update.
1560 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1561 when NEW_EXPORT is defined.
1563 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1565 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1567 * lib/ui/default.ui: Added submenus "view" and "update" to the
1570 * src/filetools.C (GetExtension): New function.
1572 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1574 2000-08-29 Allan Rae <rae@lyx.org>
1576 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1578 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1579 (EnableDocumentLayout): removed
1580 (DisableDocumentLayout): removed
1581 (build): make use of ButtonController's read-only handling to
1582 de/activate various objects. Replaces both of the above functions.
1584 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1585 (readOnly): was read_only
1586 (refresh): fixed dumb mistakes with read_only_ handling
1588 * src/frontends/xforms/forms/form_document.fd:
1589 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1590 tabbed dialogs so the tabs look more like tabs and so its easier to
1591 work out which is the current tab.
1593 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1594 segfault with form_table
1596 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1598 2000-08-28 Juergen Vigna <jug@sad.it>
1600 * acconfig.h: added USE_PSPELL.
1602 * src/config.h.in: added USE_PSPELL.
1604 * autogen.sh: added pspell.m4
1606 * config/pspell.m4: new file.
1608 * src/spellchecker.C: implemented support for pspell libary.
1610 2000-08-25 Juergen Vigna <jug@sad.it>
1612 * src/LyXAction.C (init): renamed LFUN_TABLE to
1613 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1615 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1617 * src/lyxscreen.h: add force_clear variable and fuction to force
1618 a clear area when redrawing in LyXText.
1620 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1622 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1624 * some whitespace and comment changes.
1626 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1628 * src/buffer.C: up te LYX_FORMAT to 2.17
1630 2000-08-23 Juergen Vigna <jug@sad.it>
1632 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1635 * src/insets/insettabular.C (pasteSelection): delete the insets
1636 LyXText as it is not valid anymore.
1637 (copySelection): new function.
1638 (pasteSelection): new function.
1639 (cutSelection): new function.
1640 (LocalDispatch): implemented cut/copy/paste of cell selections.
1642 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1643 don't have a LyXText.
1645 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1647 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1650 2000-08-22 Juergen Vigna <jug@sad.it>
1652 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1653 ifdef form_table out if NEW_TABULAR.
1655 2000-08-21 Juergen Vigna <jug@sad.it>
1657 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1658 (draw): fixed draw position so that the cursor is positioned in the
1660 (InsetMotionNotify): hide/show cursor so the position is updated.
1661 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1662 using cellstart() function where it should be used.
1664 * src/insets/insettext.C (draw): ditto.
1666 * src/tabular.C: fixed initialization of some missing variables and
1667 made BoxType into an enum.
1669 2000-08-22 Marko Vendelin <markov@ioc.ee>
1670 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1671 stock menu item using action numerical value, not its string
1675 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1677 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1678 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1680 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1682 * src/frontends/xforms/GUIRunTime.C: new file
1684 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1685 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1687 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1689 * src/frontends/kde/GUIRunTime.C: new file
1691 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1692 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1694 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1696 * src/frontends/gnome/GUIRunTime.C: new file
1698 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1701 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1702 small change to documetentation.
1704 * src/frontends/GUIRunTime.C: removed file
1706 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1708 * src/lyxparagraph.h: enable NEW_TABULAR as default
1710 * src/lyxfunc.C (processKeySym): remove some commented code
1712 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1713 NEW_TABULAR around the fd_form_table_options.
1715 * src/lyx_gui.C (runTime): call the static member function as
1716 GUIRunTime::runTime().
1718 2000-08-21 Allan Rae <rae@lyx.org>
1720 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1723 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1725 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1727 2000-08-21 Allan Rae <rae@lyx.org>
1729 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1730 keep Garst happy ;-)
1731 * src/frontends/xforms/FormPreferences.C (build): use setOK
1732 * src/frontends/xforms/FormDocument.C (build): use setOK
1733 (FormDocument): use the appropriate policy.
1735 2000-08-21 Allan Rae <rae@lyx.org>
1737 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1738 automatic [de]activation of arbitrary objects when in a read-only state.
1740 * src/frontends/ButtonPolicies.h: More documentation
1741 (isReadOnly): added to support the above.
1743 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1745 2000-08-18 Juergen Vigna <jug@sad.it>
1747 * src/insets/insettabular.C (getStatus): changed to return func_status.
1749 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1750 display toggle menu entries if they are.
1752 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1753 new document layout now.
1755 * src/lyxfunc.C: ditto
1757 * src/lyx_gui_misc.C: ditto
1759 * src/lyx_gui.C: ditto
1761 * lib/ui/default.ui: removed paper and quotes layout as they are now
1762 all in the document layout tabbed folder.
1764 * src/frontends/xforms/forms/form_document.fd: added Restore
1765 button and callbacks for all inputs for Allan's ButtonPolicy.
1767 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1768 (CheckChoiceClass): added missing params setting on class change.
1769 (UpdateLayoutDocument): added for updating the layout on params.
1770 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1771 (FormDocument): Implemented Allan's ButtonPolicy with the
1774 2000-08-17 Allan Rae <rae@lyx.org>
1776 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1777 so we can at least see the credits again.
1779 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1780 controller calls for the appropriate callbacks. Note that since Ok
1781 calls apply followed by cancel, and apply isn't a valid input for the
1782 APPLIED state, the bc_ calls have to be made in the static callback not
1783 within each of the real callbacks.
1785 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1786 (setOk): renamed from setOkay()
1788 2000-08-17 Juergen Vigna <jug@sad.it>
1790 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1791 in the implementation part.
1792 (composeUIInfo): don't show optional menu-items.
1794 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1796 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1798 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1799 text-state when in a text-inset.
1801 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1803 2000-08-17 Marko Vendelin <markov@ioc.ee>
1804 * src/frontends/gnome/FormIndex.C
1805 * src/frontends/gnome/FormIndex.h
1806 * src/frontends/gnome/FormToc.C
1807 * src/frontends/gnome/FormToc.h
1808 * src/frontends/gnome/dialogs
1809 * src/frontends/gnome/diatoc_callbacks.c
1810 * src/frontends/gnome/diatoc_callbacks.h
1811 * src/frontends/gnome/diainsertindex_callbacks.h
1812 * src/frontends/gnome/diainsertindex_callbacks.c
1813 * src/frontends/gnome/diainsertindex_interface.c
1814 * src/frontends/gnome/diainsertindex_interface.h
1815 * src/frontends/gnome/diatoc_interface.h
1816 * src/frontends/gnome/diatoc_interface.c
1817 * src/frontends/gnome/Makefile.am: Table of Contents and
1818 Insert Index dialogs implementation for Gnome frontend
1820 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1822 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1824 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1827 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1829 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1830 destructor. Don't definde if you don't need it
1831 (processEvents): made static, non-blocking events processing for
1833 (runTime): static method. event loop for xforms
1834 * similar as above for kde and gnome.
1836 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1837 new Pimpl is correct
1838 (runTime): new method calss the real frontends runtime func.
1840 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1842 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1844 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1846 2000-08-16 Juergen Vigna <jug@sad.it>
1848 * src/lyx_gui.C (runTime): added GUII RunTime support.
1850 * src/frontends/Makefile.am:
1851 * src/frontends/GUIRunTime.[Ch]:
1852 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1853 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1854 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1856 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1858 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1859 as this is already set in ${FRONTEND_INCLUDE} if needed.
1861 * configure.in (CPPFLAGS): setting the include dir for the frontend
1862 directory and don't set FRONTEND=xforms for now as this is executed
1865 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1867 * src/frontends/kde/Makefile.am:
1868 * src/frontends/kde/FormUrl.C:
1869 * src/frontends/kde/FormUrl.h:
1870 * src/frontends/kde/formurldialog.h:
1871 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1873 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1875 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1877 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1879 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1882 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1884 * src/WorkArea.C (work_area_handler): more work to get te
1885 FL_KEYBOARD to work with xforms 0.88 too, please test.
1887 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1889 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1891 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1894 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1896 * src/Timeout.h: remove Qt::emit hack.
1898 * several files: changes to allo doc++ compilation
1900 * src/lyxfunc.C (processKeySym): new method
1901 (processKeyEvent): comment out if FL_REVISION < 89
1903 * src/WorkArea.C: change some debugging levels.
1904 (WorkArea): set wantkey to FL_KEY_ALL
1905 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1906 clearer code and the use of compose with XForms 0.89. Change to
1907 use signals instead of calling methods in bufferview directly.
1909 * src/Painter.C: change some debugging levels.
1911 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1914 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1915 (workAreaKeyPress): new method
1917 2000-08-14 Juergen Vigna <jug@sad.it>
1919 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1921 * config/kde.m4: addes some features
1923 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1924 include missing xforms dialogs.
1926 * src/Timeout.h: a hack to be able to compile with qt/kde.
1928 * sigc++/.cvsignore: added acinclude.m4
1930 * lib/.cvsignore: added listerros
1932 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1933 xforms tree as objects are needed for other frontends.
1935 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1936 linking with not yet implemented xforms objects.
1938 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1940 2000-08-14 Baruch Even <baruch.even@writeme.com>
1942 * src/frontends/xforms/FormGraphics.h:
1943 * src/frontends/xforms/FormGraphics.C:
1944 * src/frontends/xforms/RadioButtonGroup.h:
1945 * src/frontends/xforms/RadioButtonGroup.C:
1946 * src/insets/insetgraphics.h:
1947 * src/insets/insetgraphics.C:
1948 * src/insets/insetgraphicsParams.h:
1949 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1950 instead of spaces, and various other indentation issues to make the
1951 sources more consistent.
1953 2000-08-14 Marko Vendelin <markov@ioc.ee>
1955 * src/frontends/gnome/dialogs/diaprint.glade
1956 * src/frontends/gnome/FormPrint.C
1957 * src/frontends/gnome/FormPrint.h
1958 * src/frontends/gnome/diaprint_callbacks.c
1959 * src/frontends/gnome/diaprint_callbacks.h
1960 * src/frontends/gnome/diaprint_interface.c
1961 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1964 * src/frontends/gnome/dialogs/diainserturl.glade
1965 * src/frontends/gnome/FormUrl.C
1966 * src/frontends/gnome/FormUrl.h
1967 * src/frontends/gnome/diainserturl_callbacks.c
1968 * src/frontends/gnome/diainserturl_callbacks.h
1969 * src/frontends/gnome/diainserturl_interface.c
1970 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1971 Gnome implementation
1973 * src/frontends/gnome/Dialogs.C
1974 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1975 all other dialogs. Copy all unimplemented dialogs from Xforms
1978 * src/frontends/gnome/support.c
1979 * src/frontends/gnome/support.h: support files generated by Glade
1983 * config/gnome.m4: Gnome configuration scripts
1985 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1986 configure --help message
1988 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1989 only if there are no events pendling in Gnome/Gtk. This enhances
1990 the performance of menus.
1993 2000-08-14 Allan Rae <rae@lyx.org>
1995 * lib/Makefile.am: listerrors cleaning
1997 * lib/listerrors: removed -- generated file
1998 * acinclude.m4: ditto
1999 * sigc++/acinclude.m4: ditto
2001 * src/frontends/xforms/forms/form_citation.fd:
2002 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2005 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2006 `updatesrc` and now we have a `test` target that does what `updatesrc`
2007 used to do. I didn't like having an install target that wasn't related
2010 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2011 on all except FormGraphics. This may yet happen. Followed by a major
2012 cleanup including using FL_TRANSIENT for most of the dialogs. More
2013 changes to come when the ButtonController below is introduced.
2015 * src/frontends/xforms/ButtonController.h: New file for managing up to
2016 four buttons on a dialog according to an externally defined policy.
2017 * src/frontends/xforms/Makefile.am: added above
2019 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2020 Apply and Cancel/Close buttons and everything in between and beyond.
2021 * src/frontends/Makefile.am: added above.
2023 * src/frontends/xforms/forms/form_preferences.fd:
2024 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2025 and removed variable 'status' as a result. Fixed the set_minsize thing.
2026 Use the new screen-font-update after checking screen fonts were changed
2027 Added a "Restore" button to restore the original lyxrc values while
2028 editing. This restores everything not just the last input changed.
2029 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2031 * src/LyXAction.C: screen-font-update added for updating buffers after
2032 screen font settings have been changed.
2033 * src/commandtags.h: ditto
2034 * src/lyxfunc.C: ditto
2036 * forms/lyx.fd: removed screen fonts dialog.
2037 * src/lyx_gui.C: ditto
2038 * src/menus.[Ch]: ditto
2039 * src/lyx.[Ch]: ditto
2040 * src/lyx_cb.C: ditto + code from here moved to make
2041 screen-font-update. And people wonder why progress on GUII is
2042 slow. Look at how scattered this stuff was! It takes forever
2045 * forms/fdfix.sh: Fixup the spacing after commas.
2046 * forms/makefile: Remove date from generated files. Fewer clashes now.
2047 * forms/bullet_forms.C.patch: included someones handwritten changes
2049 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2050 once I've discovered why LyXRC was made noncopyable.
2051 * src/lyx_main.C: ditto
2053 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2055 * src/frontends/xforms/forms/fdfix.sh:
2056 * src/frontends/xforms/forms/fdfixh.sed:
2057 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2058 * src/frontends/xforms/Form*.[hC]:
2059 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2060 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2061 provide a destructor for the struct FD_form_xxxx. Another version of
2062 the set_[max|min]size workaround and a few other cleanups. Actually,
2063 Angus' patch from 20000809.
2065 2000-08-13 Baruch Even <baruch.even@writeme.com>
2067 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2070 2000-08-11 Juergen Vigna <jug@sad.it>
2072 * src/insets/insetgraphics.C (InsetGraphics): changing init
2073 order because of warnings.
2075 * src/frontends/xforms/forms/makefile: adding patching .C with
2078 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2079 from .C.patch to .c.patch
2081 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2082 order because of warning.
2084 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2086 * src/frontends/Liason.C (setMinibuffer): new helper function
2088 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2090 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2092 * lib/ui/default.ui: commented out PaperLayout entry
2094 * src/frontends/xforms/form_document.[Ch]: new added files
2096 * src/frontends/xforms/FormDocument.[Ch]: ditto
2098 * src/frontends/xforms/forms/form_document.fd: ditto
2100 * src/frontends/xforms/forms/form_document.C.patch: ditto
2102 2000-08-10 Juergen Vigna <jug@sad.it>
2104 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2105 (InsetGraphics): initialized cacheHandle to 0.
2106 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2108 2000-08-10 Baruch Even <baruch.even@writeme.com>
2110 * src/graphics/GraphicsCache.h:
2111 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2112 correctly as a cache.
2114 * src/graphics/GraphicsCacheItem.h:
2115 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2118 * src/graphics/GraphicsCacheItem_pimpl.h:
2119 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2122 * src/insets/insetgraphics.h:
2123 * src/insets/insetgraphics.C: Changed from using a signal notification
2124 to polling when image is not loaded.
2126 2000-08-10 Allan Rae <rae@lyx.org>
2128 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2129 that there are two functions that have to been taken out of line by
2130 hand and aren't taken care of in the script. (Just a reminder note)
2132 * sigc++/macros/*.h.m4: Updated as above.
2134 2000-08-09 Juergen Vigna <jug@sad.it>
2136 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2138 * src/insets/insettabular.C: make drawing of single cell smarter.
2140 2000-08-09 Marko Vendelin <markov@ioc.ee>
2141 * src/frontends/gnome/Menubar_pimpl.C
2142 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2143 implementation: new files
2145 * src/frontends/gnome/mainapp.C
2146 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2149 * src/main.C: create Gnome main window
2151 * src/frontends/xforms/Menubar_pimpl.h
2152 * src/frontends/Menubar.C
2153 * src/frontends/Menubar.h: added method Menubar::update that calls
2154 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2156 * src/LyXView.C: calls Menubar::update to update the state
2159 * src/frontends/gnome/Makefile.am: added new files
2161 * src/frontends/Makefile.am: added frontend compiler options
2163 2000-08-08 Juergen Vigna <jug@sad.it>
2165 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2167 * src/bufferlist.C (close):
2168 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2169 documents if exiting without saving.
2171 * src/buffer.C (save): use removeAutosaveFile()
2173 * src/support/filetools.C (removeAutosaveFile): new function.
2175 * src/lyx_cb.C (MenuWrite): returns a bool now.
2176 (MenuWriteAs): check if file could really be saved and revert to the
2178 (MenuWriteAs): removing old autosavefile if existant.
2180 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2181 before Goto toggle declaration, because of compiler warning.
2183 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2185 * src/lyxfunc.C (MenuNew): small fix.
2187 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2189 * src/bufferlist.C (newFile):
2190 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2192 * src/lyxrc.C: added new_ask_filename tag
2194 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2196 * src/lyx.fd: removed code pertaining to form_ref
2197 * src/lyx.[Ch]: ditto
2198 * src/lyx_cb.C: ditto
2199 * src/lyx_gui.C: ditto
2200 * src/lyx_gui_misc.C: ditto
2202 * src/BufferView_pimpl.C (restorePosition): update buffer only
2205 * src/commandtags.h (LFUN_REFTOGGLE): removed
2206 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2207 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2208 (LFUN_REFBACK): renamed LFUN_REF_BACK
2210 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2211 * src/menus.C: ditto
2212 * src/lyxfunc.C (Dispatch): ditto.
2213 InsertRef dialog is now GUI-independent.
2215 * src/texrow.C: added using std::endl;
2217 * src/insets/insetref.[Ch]: strip out large amounts of code.
2218 The inset is now a container and this functionality is now
2219 managed by a new FormRef dialog
2221 * src/frontends/Dialogs.h (showRef, createRef): new signals
2223 * src/frontends/xforms/FormIndex.[Ch],
2224 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2225 when setting dialog's min/max size
2226 * src/frontends/xforms/FormIndex.[Ch]: ditto
2228 * src/frontends/xforms/FormRef.[Ch],
2229 src/frontends/xforms/forms/form_ref.fd: new xforms
2230 implementation of an InsetRef dialog
2232 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2235 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2236 ios::nocreate is not part of the standard. Removed.
2238 2000-08-07 Baruch Even <baruch.even@writeme.com>
2240 * src/graphics/Renderer.h:
2241 * src/graphics/Renderer.C: Added base class for rendering of different
2242 image formats into Pixmaps.
2244 * src/graphics/XPM_Renderer.h:
2245 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2246 in a different class.
2248 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2249 easily add support for other formats.
2251 * src/insets/figinset.C: plugged a leak of an X resource.
2253 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2255 * src/CutAndPaste.[Ch]: make all metods static.
2257 * development/Code_rules/Rules: more work, added section on
2258 Exceptions, and a References section.
2260 * a lot of header files: work to make doc++ able to generate the
2261 source documentation, some workarounds of doc++ problems. Doc++ is
2262 now able to generate the documentation.
2264 2000-08-07 Juergen Vigna <jug@sad.it>
2266 * src/insets/insettabular.C (recomputeTextInsets): removed function
2268 * src/tabular.C (SetWidthOfMulticolCell):
2270 (calculate_width_of_column_NMC): fixed return value so that it really
2271 only returns true if the column-width has changed (there where
2272 problems with muliticolumn-cells in this column).
2274 2000-08-04 Juergen Vigna <jug@sad.it>
2276 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2277 also on the scrollstatus of the inset.
2278 (workAreaMotionNotify): ditto.
2280 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2282 2000-08-01 Juergen Vigna <jug@sad.it>
2284 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2286 * src/commandtags.h:
2287 * src/LyXAction.C (init):
2288 * src/insets/inset.C (LocalDispatch): added support for
2291 * src/insets/inset.C (scroll): new functions.
2293 * src/insets/insettext.C (removeNewlines): new function.
2294 (SetAutoBreakRows): removes forced newlines in the text of the
2295 paragraph if autoBreakRows is set to false.
2297 * src/tabular.C (Latex): generates a parbox around the cell contents
2300 * src/frontends/xforms/FormTabular.C (local_update): removed
2301 the radio_useparbox button.
2303 * src/tabular.C (UseParbox): new function
2305 2000-08-06 Baruch Even <baruch.even@writeme.com>
2307 * src/graphics/GraphicsCache.h:
2308 * src/graphics/GraphicsCache.C:
2309 * src/graphics/GraphicsCacheItem.h:
2310 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2313 * src/insets/insetgraphics.h:
2314 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2315 drawing of the inline image.
2317 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2318 into the wrong position.
2320 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2323 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2325 * src/support/translator.h: move all typedefs to public section
2327 * src/support/filetools.C (MakeLatexName): return string const
2329 (TmpFileName): ditto
2330 (FileOpenSearch): ditto
2332 (LibFileSearch): ditto
2333 (i18nLibFileSearch): ditto
2336 (CreateTmpDir): ditto
2337 (CreateBufferTmpDir): ditto
2338 (CreateLyXTmpDir): ditto
2341 (MakeAbsPath): ditto
2343 (OnlyFilename): ditto
2345 (NormalizePath): ditto
2346 (CleanupPath): ditto
2347 (GetFileContents): ditto
2348 (ReplaceEnvironmentPath): ditto
2349 (MakeRelPath): ditto
2351 (ChangeExtension): ditto
2352 (MakeDisplayPath): ditto
2353 (do_popen): return cmdret const
2354 (findtexfile): return string const
2356 * src/support/DebugStream.h: add some /// to please doc++
2358 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2360 * src/texrow.C (same_rownumber): functor to use with find_if
2361 (getIdFromRow): rewritten to use find_if and to not update the
2362 positions. return true if row is found
2363 (increasePos): new method, use to update positions
2365 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2367 * src/lyxlex_pimpl.C (verifyTable): new method
2370 (GetString): return string const
2371 (pushTable): rewrite to use std::stack
2373 (setFile): better check
2376 * src/lyxlex.h: make LyXLex noncopyable
2378 * src/lyxlex.C (text): return char const * const
2379 (GetString): return string const
2380 (getLongString): return string const
2382 * src/lyx_gui_misc.C (askForText): return pair<...> const
2384 * src/lastfiles.[Ch] (operator): return string const
2386 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2387 istringstream not char const *.
2388 move token.end() out of loop.
2389 (readFile): move initializaton of token
2391 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2392 getIdFromRow is successful.
2394 * lib/bind/emacs.bind: don't include menus bind
2396 * development/Code_rules/Rules: the beginnings of making this
2397 better and covering more of the unwritten rules that we have.
2399 * development/Code_rules/Recommendations: a couple of wording
2402 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2404 * src/support/strerror.c: remove C++ comment.
2406 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2408 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2409 LFUN_INDEX_INSERT_LAST
2411 * src/texrow.C (getIdFromRow): changed from const_iterator to
2412 iterator, allowing code to compile with DEC cxx
2414 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2415 stores part of the class, as suggested by Allan. Will allow
2417 (apply): test to apply uses InsetCommandParams operator!=
2419 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2420 (apply): test to apply uses InsetCommandParams operator!=
2422 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2423 stores part of the class.
2424 (update): removed limits on min/max size.
2426 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2427 (apply): test to apply uses InsetCommandParams operator!=
2429 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2430 (Read, Write, scanCommand, getCommand): moved functionality
2431 into InsetCommandParams.
2433 (getScreenLabel): made pure virtual
2434 new InsetCommandParams operators== and !=
2436 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2437 c-tors based on InsetCommandParams. Removed others.
2438 * src/insets/insetinclude.[Ch]: ditto
2439 * src/insets/insetlabel.[Ch]: ditto
2440 * src/insets/insetparent.[Ch]: ditto
2441 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2443 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2444 insets derived from InsetCommand created using similar c-tors
2445 based on InsetCommandParams
2446 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2447 * src/menus.C (ShowRefsMenu): ditto
2448 * src/paragraph.C (Clone): ditto
2449 * src/text2.C (SetCounter): ditto
2450 * src/lyxfunc.C (Dispatch) ditto
2451 Also recreated old InsetIndex behaviour exactly. Can now
2452 index-insert at the start of a paragraph and index-insert-last
2453 without launching the pop-up.
2455 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2457 * lib/lyxrc.example: mark te pdf options as non functional.
2459 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2460 (isStrDbl): move tmpstr.end() out of loop.
2461 (strToDbl): move intialization of tmpstr
2462 (lowercase): return string const and move tmp.end() out of loop.
2463 (uppercase): return string const and move tmp.edn() out of loop.
2464 (prefixIs): add assertion
2469 (containsOnly): ditto
2470 (containsOnly): ditto
2471 (containsOnly): ditto
2472 (countChar): make last arg char not char const
2473 (token): return string const
2474 (subst): return string const, move tmp.end() out of loop.
2475 (subst): return string const, add assertion
2476 (strip): return string const
2477 (frontStrip): return string const, add assertion
2478 (frontStrip): return string const
2483 * src/support/lstrings.C: add inclde "LAssert.h"
2484 (isStrInt): move tmpstr.end() out of loop.
2486 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2487 toollist.end() out of loop.
2488 (deactivate): move toollist.end() out of loop.
2489 (update): move toollist.end() out of loop.
2490 (updateLayoutList): move tc.end() out of loop.
2491 (add): move toollist.end() out of loop.
2493 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2494 md.end() out of loop.
2496 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2498 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2501 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2502 (Erase): move insetlist.end() out of loop.
2504 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2505 ref to const string as first arg. Move initialization of some
2506 variables, whitespace changes.
2508 * src/kbmap.C (defkey): move table.end() out of loop.
2509 (kb_keymap): move table.end() out of loop.
2510 (findbinding): move table.end() out of loop.
2512 * src/MenuBackend.C (hasMenu): move end() out of loop.
2513 (getMenu): move end() out of loop.
2514 (getMenu): move menulist_.end() out of loop.
2516 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2518 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2521 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2522 (getFromLyXName): move infotab.end() out of loop.
2524 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2525 -fvtable-thunks -ffunction-sections -fdata-sections
2527 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2529 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2532 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2534 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2536 * src/frontends/xforms/FormCitation.[Ch],
2537 src/frontends/xforms/FormIndex.[Ch],
2538 src/frontends/xforms/FormToc.[Ch],
2539 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2541 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2543 * src/commandtags.h: renamed, created some flags for citation
2546 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2548 * src/lyxfunc.C (dispatch): use signals to insert index entry
2550 * src/frontends/Dialogs.h: new signal createIndex
2552 * src/frontends/xforms/FormCommand.[Ch],
2553 src/frontends/xforms/FormCitation.[Ch],
2554 src/frontends/xforms/FormToc.[Ch],
2555 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2557 * src/insets/insetindex.[Ch]: GUI-independent
2559 * src/frontends/xforms/FormIndex.[Ch],
2560 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2563 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2565 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2566 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2568 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2570 * src/insets/insetref.C (Latex): rewrite so that there is now
2571 question that a initialization is requested.
2573 * src/insets/insetcommand.h: reenable the hide signal
2575 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2577 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2578 fix handling of shortcuts (many bugs :)
2579 (add_lastfiles): ditto.
2581 * lib/ui/default.ui: fix a few shortcuts.
2583 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2585 * Makefile.am: Fix ``rpmdist'' target to return the exit
2586 status of the ``rpm'' command, instead of the last command in
2587 the chain (the ``rm lyx.xpm'' command, which always returns
2590 2000-08-02 Allan Rae <rae@lyx.org>
2592 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2593 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2594 * src/frontends/xforms/FormToc.C (FormToc): ditto
2596 * src/frontends/xforms/Makefile.am: A few forgotten files
2598 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2599 Signals-not-copyable-problem Lars' started commenting out.
2601 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2603 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2605 * src/insets/insetcommand.h: Signals is not copyable so anoter
2606 scheme for automatic hiding of forms must be used.
2608 * src/frontends/xforms/FormCitation.h: don't inerit from
2609 noncopyable, FormCommand already does that.
2610 * src/frontends/xforms/FormToc.h: ditto
2611 * src/frontends/xforms/FormUrl.h: ditto
2613 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2615 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2617 * src/insets/insetcommand.h (hide): new SigC::Signal0
2618 (d-tor) new virtual destructor emits hide signal
2620 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2621 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2623 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2624 LOF and LOT. Inset is now GUI-independent
2626 * src/insets/insetloa.[Ch]: redundant
2627 * src/insets/insetlof.[Ch]: ditto
2628 * src/insets/insetlot.[Ch]: ditto
2630 * src/frontends/xforms/forms/form_url.fd: tweaked!
2631 * src/frontends/xforms/forms/form_citation.fd: ditto
2633 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2634 dialogs dealing with InsetCommand insets
2636 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2637 FormCommand base class
2638 * src/frontends/xforms/FormUrl.[Ch]: ditto
2640 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2642 * src/frontends/xforms/FormToc.[Ch]: ditto
2644 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2645 passed a generic InsetCommand pointer
2646 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2648 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2649 and modified InsetTOC class
2650 * src/buffer.C: ditto
2652 * forms/lyx.fd: strip out old FD_form_toc code
2653 * src/lyx_gui_misc.C: ditto
2654 * src/lyx_gui.C: ditto
2655 * src/lyx_cb.C: ditto
2656 * src/lyx.[Ch]: ditto
2658 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2660 * src/support/utility.hpp: tr -d '\r'
2662 2000-08-01 Juergen Vigna <jug@sad.it>
2664 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2666 * src/commandtags.h:
2667 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2668 LFUN_TABULAR_FEATURES.
2670 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2671 LFUN_LAYOUT_TABULAR.
2673 * src/insets/insettabular.C (getStatus): implemented helper function.
2675 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2677 2000-07-31 Juergen Vigna <jug@sad.it>
2679 * src/text.C (draw): fixed screen update problem for text-insets.
2681 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2682 something changed probably this has to be added in various other
2685 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2687 2000-07-31 Baruch Even <baruch.even@writeme.com>
2689 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2690 templates to satisfy compaq cxx.
2693 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2695 * src/support/translator.h (equal_1st_in_pair::operator()): take
2696 const ref pair_type as arg.
2697 (equal_2nd_in_pair::operator()): ditto
2698 (Translator::~Translator): remove empty d-tor.
2700 * src/graphics/GraphicsCache.C: move include config.h to top, also
2701 put initialization of GraphicsCache::singleton here.
2702 (~GraphicsCache): move here
2703 (addFile): take const ref as arg
2706 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2708 * src/BufferView2.C (insertLyXFile): change te with/without header
2711 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2713 * src/frontends/xforms/FormGraphics.C (apply): add some
2714 static_cast. Not very nice, but required by compaq cxx.
2716 * src/frontends/xforms/RadioButtonGroup.h: include header
2717 <utility> instead of <pair.h>
2719 * src/insets/insetgraphicsParams.C: add using directive.
2720 (readResize): change return type to void.
2721 (readOrigin): ditto.
2723 * src/lyxfunc.C (getStatus): add missing break for build-program
2724 function; add test for Literate for export functions.
2726 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2727 entries in Options menu.
2729 2000-07-31 Baruch Even <baruch.even@writeme.com>
2731 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2732 protect against auto-allocation; release icon when needed.
2734 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2736 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2737 on usual typewriter.
2739 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2740 earlier czech.kmap), useful only for programming.
2742 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2744 * src/frontends/xforms/FormCitation.h: fix conditioning around
2747 2000-07-31 Juergen Vigna <jug@sad.it>
2749 * src/frontends/xforms/FormTabular.C (local_update): changed
2750 radio_linebreaks to radio_useparbox and added radio_useminipage.
2752 * src/tabular.C: made support for using minipages/parboxes.
2754 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2756 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2758 (descent): so the cursor is in the middle.
2759 (width): bit smaller box.
2761 * src/insets/insetgraphics.h: added display() function.
2763 2000-07-31 Baruch Even <baruch.even@writeme.com>
2765 * src/frontends/Dialogs.h: Added showGraphics signals.
2767 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2768 xforms form definition of the graphics dialog.
2770 * src/frontends/xforms/FormGraphics.h:
2771 * src/frontends/xforms/FormGraphics.C: Added files, the
2772 GUIndependent code of InsetGraphics
2774 * src/insets/insetgraphics.h:
2775 * src/insets/insetgraphics.C: Major writing to make it work.
2777 * src/insets/insetgraphicsParams.h:
2778 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2779 struct between InsetGraphics and GUI.
2781 * src/LaTeXFeatures.h:
2782 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2783 support for graphicx package.
2785 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2786 for the graphics inset.
2788 * src/support/translator.h: Added file, used in
2789 InsetGraphicsParams. this is a template to translate between two
2792 * src/frontends/xforms/RadioButtonGroup.h:
2793 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2794 way to easily control a radio button group.
2796 2000-07-28 Juergen Vigna <jug@sad.it>
2798 * src/insets/insettabular.C (LocalDispatch):
2799 (TabularFeatures): added support for lyx-functions of tabular features.
2800 (cellstart): refixed this function after someone wrongly changed it.
2802 * src/commandtags.h:
2803 * src/LyXAction.C (init): added support for tabular-features
2805 2000-07-28 Allan Rae <rae@lyx.org>
2807 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2808 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2809 triggers the callback for input checking. As a result we sometimes get
2810 "LyX: This shouldn't happen..." printed to cerr.
2811 (input): Started using status variable since I only free() on
2812 destruction. Some input checking for paths and font sizes.
2814 * src/frontends/xforms/FormPreferences.h: Use status to control
2815 activation of Ok and Apply
2817 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2818 callback. Also resized to stop segfaults with 0.88. The problem is
2819 that xforms-0.88 requires the folder to be wide enough to fit all the
2820 tabs. If it isn't it causes all sorts of problems.
2822 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2824 * src/frontends/xforms/forms/README: Reflect reality.
2826 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2827 * src/frontends/xforms/forms/makefile: ditto.
2829 * src/commandtags.h: Get access to new Preferences dialog
2830 * src/LyXAction.C: ditto
2831 * src/lyxfunc.C: ditto
2832 * lib/ui/default.ui: ditto
2834 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2836 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2838 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2841 * src/frontends/xforms/form_url.[Ch]: added.
2843 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2845 * src/insets/insetbib.h: fixed bug in previous commit
2847 * src/frontends/xforms/FormUrl.h: ditto
2849 * src/frontends/xforms/FormPrint.h: ditto
2851 * src/frontends/xforms/FormPreferences.h: ditto
2853 * src/frontends/xforms/FormCopyright.h: ditto
2855 * src/frontends/xforms/FormCitation.C: ditto
2857 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2858 private copyconstructor and private default contructor
2860 * src/support/Makefile.am: add utility.hpp
2862 * src/support/utility.hpp: new file from boost
2864 * src/insets/insetbib.h: set owner in clone
2866 * src/frontends/xforms/FormCitation.C: added missing include
2869 * src/insets/form_url.[Ch]: removed
2871 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2873 * development/lyx.spec.in
2874 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2875 file/directory re-organization.
2877 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2879 * src/insets/insetcommand.[Ch]: moved the string data and
2880 associated manipulation methods into a new stand-alone class
2881 InsetCommandParams. This class has two additional methods
2882 getAsString() and setFromString() allowing the contents to be
2883 moved around as a single string.
2884 (addContents) method removed.
2885 (setContents) method no longer virtual.
2887 * src/buffer.C (readInset): made use of new InsetCitation,
2888 InsetUrl constructors based on InsetCommandParams.
2890 * src/commandtags.h: add LFUN_INSERT_URL
2892 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2893 independent InsetUrl and use InsetCommandParams to extract
2894 string info and create new Insets.
2896 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2898 * src/frontends/xforms/FormCitation.C (apply): uses
2901 * src/frontends/xforms/form_url.C
2902 * src/frontends/xforms/form_url.h
2903 * src/frontends/xforms/FormUrl.h
2904 * src/frontends/xforms/FormUrl.C
2905 * src/frontends/xforms/forms/form_url.fd: new files
2907 * src/insets/insetcite.[Ch]: removed unused constructors.
2909 * src/insets/insetinclude.[Ch]: no longer store filename
2911 * src/insets/inseturl.[Ch]: GUI-independent.
2913 2000-07-26 Juergen Vigna <jug@sad.it>
2914 * renamed frontend from gtk to gnome as it is that what is realized
2915 and did the necessary changes in the files.
2917 2000-07-26 Marko Vendelin <markov@ioc.ee>
2919 * configure.in: cleaning up gnome configuration scripts
2921 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2923 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2924 shortcuts syndrom by redrawing them explicitely (a better solution
2925 would be appreciated).
2927 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2929 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2932 * src/lyx_cb.C (MenuExport): change html export to do the right
2933 thing depending of the document type (instead of having
2934 html-linuxdoc and html-docbook).
2935 * src/lyxfunc.C (getStatus): update for html
2936 * lib/ui/default.ui: simplify due to the above change.
2937 * src/menus.C (ShowFileMenu): update too (in case we need it).
2939 * src/MenuBackend.C (read): if a menu is defined twice, add the
2940 new entries to the exiting one.
2942 2000-07-26 Juergen Vigna <jug@sad.it>
2944 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2946 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2947 and return a bool if it did actual save the file.
2948 (AutoSave): don't autosave a unnamed doc.
2950 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2951 check if this is an UNNAMED new file and react to it.
2952 (newFile): set buffer to unnamed and change to not mark a new
2953 buffer dirty if I didn't do anything with it.
2955 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2957 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2959 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2960 friend as per Angus's patch posted to lyx-devel.
2962 * src/ext_l10n.h: updated
2964 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2965 gettext on the style string right before inserting them into the
2968 * autogen.sh: add code to extract style strings form layout files,
2969 not good enough yet.
2971 * src/frontends/gtk/.cvsignore: add MAKEFILE
2973 * src/MenuBackend.C (read): run the label strings through gettext
2974 before storing them in the containers.
2976 * src/ext_l10n.h: new file
2978 * autogen.sh : generate the ext_l10n.h file here
2980 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2982 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2985 * lib/ui/default.ui: fix a couple of typos.
2987 * config/gnome/gtk.m4: added (and added to the list of files in
2990 * src/insets/insetinclude.C (unique_id): fix when we are using
2991 lyxstring instead of basic_string<>.
2992 * src/insets/insettext.C (LocalDispatch): ditto.
2993 * src/support/filetools.C: ditto.
2995 * lib/configure.m4: create the ui/ directory if necessary.
2997 * src/LyXView.[Ch] (updateToolbar): new method.
2999 * src/BufferView_pimpl.C (buffer): update the toolbar when
3000 opening/closing buffer.
3002 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3004 * src/LyXAction.C (getActionName): enhance to return also the name
3005 and options of pseudo-actions.
3006 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3008 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3009 as an example of what is possible). Used in File->Build too (more
3010 useful) and in the import/export menus (to mimick the complicated
3011 handling of linuxdoc and friends). Try to update all the entries.
3013 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3016 * src/MenuBackend.C (read): Parse the new OptItem tag.
3018 * src/MenuBackend.h: Add a new optional_ data member (used if the
3019 entry should be omitted when the lyxfunc is disabled).
3021 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3022 function, used as a shortcut.
3023 (create_submenu): align correctly the shortcuts on the widest
3026 * src/MenuBackend.h: MenuItem.label() only returns the label of
3027 the menu without shortcut; new method shortcut().
3029 2000-07-14 Marko Vendelin <markov@ioc.ee>
3031 * src/frontends/gtk/Dialogs.C:
3032 * src/frontends/gtk/FormCopyright.C:
3033 * src/frontends/gtk/FormCopyright.h:
3034 * src/frontends/gtk/Makefile.am: added these source-files for the
3035 Gtk/Gnome support of the Copyright-Dialog.
3037 * src/main.C: added Gnome::Main initialization if using
3038 Gtk/Gnome frontend-GUI.
3040 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3042 * config/gnome/aclocal-include.m4
3043 * config/gnome/compiler-flags.m4
3044 * config/gnome/curses.m4
3045 * config/gnome/gnome--.m4
3046 * config/gnome/gnome-bonobo-check.m4
3047 * config/gnome/gnome-common.m4
3048 * config/gnome/gnome-fileutils.m4
3049 * config/gnome/gnome-ghttp-check.m4
3050 * config/gnome/gnome-gnorba-check.m4
3051 * config/gnome/gnome-guile-checks.m4
3052 * config/gnome/gnome-libgtop-check.m4
3053 * config/gnome/gnome-objc-checks.m4
3054 * config/gnome/gnome-orbit-check.m4
3055 * config/gnome/gnome-print-check.m4
3056 * config/gnome/gnome-pthread-check.m4
3057 * config/gnome/gnome-support.m4
3058 * config/gnome/gnome-undelfs.m4
3059 * config/gnome/gnome-vfs.m4
3060 * config/gnome/gnome-x-checks.m4
3061 * config/gnome/gnome-xml-check.m4
3062 * config/gnome/gnome.m4
3063 * config/gnome/gperf-check.m4
3064 * config/gnome/gtk--.m4
3065 * config/gnome/linger.m4
3066 * config/gnome/need-declaration.m4: added configuration scripts
3067 for Gtk/Gnome frontend-GUI
3069 * configure.in: added support for the --with-frontend=gtk option
3071 * autogen.sh: added config/gnome/* to list of config-files
3073 * acconfig.h: added define for GTKGUI-support
3075 * config/lyxinclude.m4: added --with-frontend[=value] option value
3076 for Gtk/Gnome frontend-GUI support.
3078 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3080 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3084 * src/paragraph.C (GetChar): remove non-const version
3086 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3087 (search_kw): use it.
3089 * src/lyx_main.C (init): if "preferences" exist, read that instead
3091 (ReadRcFile): return bool if the file could be read ok.
3092 (ReadUIFile): add a check to see if lex file is set ok.
3094 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3095 bastring can be used instead of lyxstring (still uses the old code
3096 if std::string is good enough or if lyxstring is used.)
3098 * src/encoding.C: make the arrays static, move ininle functions
3100 * src/encoding.h: from here.
3102 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3103 (parseSingleLyXformat2Token): move inset parsing to separate method
3104 (readInset): new private method
3106 * src/Variables.h: remove virtual from get().
3108 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3109 access to NEW_INSETS and NEW_TABULAR
3111 * src/MenuBackend.h: remove superfluous forward declaration of
3112 MenuItem. Add documentations tags "///", remove empty MenuItem
3113 destructor, remove private default contructor.
3115 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3117 (read): more string mlabel and mname to where they are used
3118 (read): remove unused variables mlabel and mname
3119 (defaults): unconditional clear, make menusetup take advantage of
3120 add returning Menu &.
3122 * src/LyXView.h: define NEW_MENUBAR as default
3124 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3125 to NEW_INSETS and NEW_TABULAR.
3126 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3127 defined. Change some of the "xxxx-inset-insert" functions names to
3130 * several files: more enahncements to NEW_INSETS and the resulting
3133 * lib/lyxrc.example (\date_insert_format): move to misc section
3135 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3136 bastring and use AC_CACHE_CHECK.
3137 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3138 the system have the newest methods. uses AC_CACHE_CHECK
3139 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3140 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3141 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3143 * configure.in: add LYX_CXX_GOOD_STD_STRING
3145 * acinclude.m4: recreated
3147 2000-07-24 Amir Karger
3149 * README: add Hebrew, Arabic kmaps
3152 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3154 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3157 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3159 * Lot of files: add pragma interface/implementation.
3161 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3163 * lib/ui/default.ui: new file (ans new directory). Contains the
3164 default menu and toolbar.
3166 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3167 global space. Toolbars are now read (as menus) in ui files.
3169 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3171 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3172 is disabled because the document is read-only. We want to have the
3173 toggle state of the function anyway.
3174 (getStatus): add code for LFUN_VC* functions (mimicking what is
3175 done in old-style menus)
3177 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3178 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3180 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3181 * src/BufferView_pimpl.C: ditto.
3182 * src/lyxfunc.C: ditto.
3184 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3185 default). This replaces old-style menus by new ones.
3187 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3188 MenuItem. Contain the data structure of a menu.
3190 * src/insets/insettext.C: use LyXView::setLayout instead of
3191 accessing directly the toolbar combox.
3192 * src/lyxfunc.C (Dispatch): ditto.
3194 * src/LyXView.C (setLayout): new method, which just calls
3195 Toolbar::setLayout().
3196 (updateLayoutChoice): move part of this method in Toolbar.
3198 * src/toolbar.[Ch]: removed.
3200 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3201 implementation the toolbar.
3203 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3204 the toolbar. It might make sense to merge it with ToolbarDefaults
3206 (setLayout): new function.
3207 (updateLayoutList): ditto.
3208 (openLayoutList): ditto.
3210 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3211 xforms implementation of the toolbar.
3212 (get_toolbar_func): comment out, since I do not
3213 know what it is good for.
3215 * src/ToolbarDefaults.h: Add the ItemType enum.
3217 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3218 for a list of allocated C strings. Used in Menubar xforms
3219 implementation to avoid memory leaks.
3221 * src/support/lstrings.[Ch] (uppercase): new version taking and
3225 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3226 * lib/bind/emacs.bind: ditto.
3228 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3230 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3231 forward decl of LyXView.
3233 * src/toolbar.C (toolbarItem): moved from toolbar.h
3234 (toolbarItem::clean): ditto
3235 (toolbarItem::~toolbarItem): ditto
3236 (toolbarItem::operator): ditto
3238 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3240 * src/paragraph.h: control the NEW_TABULAR define from here
3242 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3243 USE_TABULAR_INSETS to NEW_TABULAR
3245 * src/ToolbarDefaults.C: add include "lyxlex.h"
3247 * files using the old table/tabular: use NEW_TABULAR to control
3248 compilation of old tabular stuff.
3250 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3253 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3254 planemet in reading of old style floats, fix the \end_deeper
3255 problem when reading old style floats.
3257 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3259 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3261 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3263 * lib/bind/sciword.bind: updated.
3265 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3267 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3268 layout write problem
3270 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3272 * src/Makefile.am (INCLUDES): remove image directory from include
3275 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3276 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3278 * src/LyXView.C (create_form_form_main): read the application icon
3281 * lib/images/*.xpm: change the icons to use transparent color for
3284 * src/toolbar.C (update): change the color of the button when it
3287 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3289 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3290 setting explicitely the minibuffer.
3291 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3293 * src/LyXView.C (showState): new function. Shows font information
3294 in minibuffer and update toolbar state.
3295 (LyXView): call Toolbar::update after creating the
3298 * src/toolbar.C: change toollist to be a vector instead of a
3300 (BubbleTimerCB): get help string directly from the callback
3301 argument of the corresponding icon (which is the action)
3302 (set): remove unnecessary ugliness.
3303 (update): new function. update the icons (depressed, disabled)
3304 depending of the status of the corresponding action.
3306 * src/toolbar.h: remove help in toolbarItem
3308 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3310 * src/Painter.C (text): Added code for using symbol glyphs from
3311 iso10646 fonts. Currently diabled.
3313 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3316 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3317 magyar,turkish and usorbian.
3319 * src/paragraph.C (isMultiLingual): Made more efficient.
3321 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3324 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3325 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3326 Also changed the prototype to "bool math_insert_greek(char)".
3328 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3330 * lots of files: apply the NEW_INSETS on all code that will not be
3331 needed when we move to use the new insets. Enable the define in
3332 lyxparagrah.h to try it.
3334 * src/insets/insettabular.C (cellstart): change to be a static
3336 (InsetTabular): initialize buffer in the initializer list.
3338 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3340 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3341 form_print.h out of the header file. Replaced with forward
3342 declarations of the relevant struct.
3344 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3347 * src/commandtags.h: do not include "debug.h" which does not
3348 belong there. #include it in some other places because of this
3351 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3353 * src/insets/insetcaption.C: add a couple "using" directives.
3355 * src/toolbar.C (add): get the help text directly from lyxaction.
3357 (setPixmap): new function. Loads from disk and sets a pixmap on a
3358 botton; the name of the pixmap file is derived from the command
3361 * src/toolbar.h: remove members isBitmap and pixmap from
3364 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3365 * lib/images/: move many files from images/banner.xpm.
3367 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3369 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3370 * src/toolbar.C: ditto.
3371 * configure.in: ditto.
3372 * INSTALL: document.
3374 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3375 the spellchecker popup is closed from the WM.
3377 2000-07-19 Juergen Vigna <jug@sad.it>
3379 * src/insets/insetfloat.C (Write): small fix because we use the
3380 insetname for the type now!
3382 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3384 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3387 * src/frontends/Dialogs.h: removed hideCitation signal
3389 * src/insets/insetcite.h: added hide signal
3391 * src/insets/insetcite.C (~InsetCitation): emits new signal
3392 (getScreenLabel): "intelligent" label should now fit on the screen!
3394 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3396 * src/frontends/xforms/FormCitation.C (showInset): connects
3397 hide() to the inset's hide signal
3398 (show): modified to use fl_set_object_position rather than
3399 fl_set_object_geometry wherever possible
3401 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3403 * src/insets/lyxinset.h: add caption code
3405 * src/insets/insetfloat.C (type): new method
3407 * src/insets/insetcaption.C (Write): new method
3409 (LyxCode): new method
3411 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3412 to get it right together with using the FloatList.
3414 * src/commandtags.h: add LFUN_INSET_CAPTION
3415 * src/lyxfunc.C (Dispatch): handle it
3417 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3420 * src/Variables.[Ch]: make expand take a const reference, remove
3421 the destructor, some whitespace changes.
3423 * src/LyXAction.C (init): add caption-inset-insert
3425 * src/FloatList.C (FloatList): update the default floats a bit.
3427 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3429 * src/Variables.[Ch]: new files. Intended to be used for language
3430 specific strings (like \chaptername) and filename substitution in
3433 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3435 * lib/kbd/american.kmap: update
3437 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3439 * src/bufferparams.[Ch]: remove member allowAccents.
3441 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3443 * src/LaTeXLog.C: use the log_form.h header.
3444 * src/lyx_gui.C: ditto.
3445 * src/lyx_gui_misc.C: ditto.
3446 * src/lyxvc.h: ditto.
3448 * forms/log_form.fd: new file, created from latexoptions.fd. I
3449 kept the log popup and nuked the options form.
3451 * src/{la,}texoptions.[Ch]: removed.
3452 * src/lyx_cb.C (LaTeXOptions): ditto
3454 * src/lyx_gui.C (create_forms): do not handle the
3455 fd_latex_options form.
3457 2000-07-18 Juergen Vigna <jug@sad.it>
3459 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3460 name of the inset so that it can be requested outside (text2.C).
3462 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3465 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3467 * src/mathed/formula.h (ConvertFont): constify
3469 * src/mathed/formula.C (Read): add warning if \end_inset is not
3470 found on expected place.
3472 * src/insets/lyxinset.h (ConvertFont): consify
3474 * src/insets/insetquotes.C (ConvertFont): constify
3475 * src/insets/insetquotes.h: ditto
3477 * src/insets/insetinfo.h: add labelfont
3479 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3480 (ascent): use labelfont
3484 (Write): make .lyx file a bit nicer
3486 * src/insets/insetfloat.C (Write): simplify somewhat...
3487 (Read): add warning if arg is not found
3489 * src/insets/insetcollapsable.C: add using std::max
3490 (Read): move string token and add warning in arg is not found
3491 (draw): use std::max to get the right ty
3492 (getMaxWidth): simplify by using std::max
3494 * src/insets/insetsection.h: new file
3495 * src/insets/insetsection.C: new file
3496 * src/insets/insetcaption.h: new file
3497 * src/insets/insetcaption.C: new file
3499 * src/insets/inset.C (ConvertFont): constify signature
3501 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3502 insetcaption.[Ch] and insetsection.[Ch]
3504 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3505 uses to use LABEL_COUNTER_CHAPTER instead.
3506 * src/text2.C (SetCounter): here
3508 * src/counters.h: new file
3509 * src/counters.C: new file
3510 * src/Sectioning.h: new file
3511 * src/Sectioning.C: new file
3513 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3515 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3517 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3520 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3523 2000-07-17 Juergen Vigna <jug@sad.it>
3525 * src/tabular.C (Validate): check if array-package is needed.
3526 (SetVAlignment): added support for vertical alignment.
3527 (SetLTFoot): better support for longtable header/footers
3528 (Latex): modified to support added features.
3530 * src/LaTeXFeatures.[Ch]: added array-package.
3532 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3534 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3537 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3539 * configure.in: do not forget to put a space after -isystem.
3541 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3543 * lib/kbd/arabic.kmap: a few fixes.
3545 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3547 * some whitespace chagnes to a number of files.
3549 * src/support/DebugStream.h: change to make it easier for
3550 doc++ to parse correctly.
3551 * src/support/lyxstring.h: ditto
3553 * src/mathed/math_utils.C (compara): change to have only one
3555 (MathedLookupBOP): change because of the above.
3557 * src/mathed/math_delim.C (math_deco_compare): change to have only
3559 (search_deco): change becasue of the above.
3561 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3562 instead of manually coded one.
3564 * src/insets/insetquotes.C (Read): read the \end_inset too
3566 * src/insets/insetlatex.h: remove file
3567 * src/insets/insetlatex.C: remove file
3569 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3571 (InsetPrintIndex): remove destructor
3573 * src/insets/insetinclude.h: remove default constructor
3575 * src/insets/insetfloat.C: work to make it work better
3577 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3579 * src/insets/insetcite.h (InsetCitation): remove default constructor
3581 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3583 * src/text.C (GetColumnNearX): comment out some currently unused code.
3585 * src/paragraph.C (writeFile): move some initializations closer to
3587 (CutIntoMinibuffer): small change to use new matchIT operator
3591 (InsertInset): ditto
3594 (InsetIterator): ditto
3595 (Erase): small change to use new matchFT operator
3597 (GetFontSettings): ditto
3598 (HighestFontInRange): ditto
3601 * src/lyxparagraph.h: some chars changed to value_type
3602 (matchIT): because of some stronger checking (perhaps too strong)
3603 in SGI STL, the two operator() unified to one.
3606 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3608 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3609 the last inset read added
3610 (parseSingleLyXformat2Token): some more (future) compability code added
3611 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3612 (parseSingleLyXformat2Token): set last_inset_read
3613 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3614 (parseSingleLyXformat2Token): don't double intializw string next_token
3616 * src/TextCache.C (text_fits::operator()): add const's to the signature
3617 (has_buffer::operator()): ditto
3619 * src/Floating.h: add some comments on the class
3621 * src/FloatList.[Ch] (typeExist): new method
3624 * src/BackStack.h: added default constructor, wanted by Gcc.
3626 2000-07-14 Juergen Vigna <jug@sad.it>
3628 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3630 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3632 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3633 do a redraw when the window is resized!
3634 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3636 * src/insets/insettext.C (resizeLyXText): added function to correctly
3637 being able to resize the LyXWindow.
3639 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3641 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3643 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3644 crashes when closing dialog to a deleted inset.
3646 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3647 method! Now similar to other insets.
3649 2000-07-13 Juergen Vigna <jug@sad.it>
3651 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3653 * lib/examples/Literate.lyx: small patch!
3655 * src/insets/insetbib.C (Read): added this function because of wrong
3656 Write (without [begin|end]_inset).
3658 2000-07-11 Juergen Vigna <jug@sad.it>
3660 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3661 as the insertInset could not be good!
3663 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3664 the bool param should not be last.
3666 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3668 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3669 did submit that to Karl).
3671 * configure.in: use -isystem instead of -I for X headers. This
3672 fixes a problem on solaris with a recent gcc;
3673 put the front-end code after the X detection code;
3674 configure in sigc++ before lib/
3676 * src/lyx_main.C (commandLineHelp): remove -display from command
3679 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3681 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3682 Also put in Makefile rules for building the ``listerrors''
3683 program for parsing errors from literate programs written in LyX.
3685 * lib/build-listerrors: Added small shell script as part of compile
3686 process. This builds a working ``listerrors'' binary if noweb is
3687 installed and either 1) the VNC X server is installed on the machine,
3688 or 2) the user is compiling from within a GUI. The existence of a GUI
3689 is necessary to use the ``lyx --export'' feature for now. This
3690 hack can be removed once ``lyx --export'' no longer requires a GUI to
3693 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3695 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3696 now passed back correctly from gcc and placed "under" error
3697 buttons in a Literate LyX source.
3699 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3701 * src/text.C (GetColumnNearX): Better behavior when a RTL
3702 paragraph is ended by LTR text.
3704 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3707 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3709 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3710 true when clipboard is empty.
3712 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3714 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3715 row of the paragraph.
3716 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3717 to prevent calculation of bidi tables
3719 2000-07-07 Juergen Vigna <jug@sad.it>
3721 * src/screen.C (ToggleSelection): added y_offset and x_offset
3724 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3727 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3729 * src/insets/insettext.C: fixed Layout-Display!
3731 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3733 * configure.in: add check for strings.h header.
3735 * src/spellchecker.C: include <strings.h> in order to have a
3736 definition for bzero().
3738 2000-07-07 Juergen Vigna <jug@sad.it>
3740 * src/insets/insettext.C (draw): set the status of the bv->text to
3741 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3743 * src/screen.C (DrawOneRow):
3744 (DrawFromTo): redraw the actual row if something has changed in it
3747 * src/text.C (draw): call an update of the toplevel-inset if something
3748 has changed inside while drawing.
3750 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3752 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3754 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3755 processing inside class.
3757 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3758 processing inside class.
3760 * src/insets/insetindex.h new struct Holder, consistent with other
3763 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3764 citation dialog from main code and placed it in src/frontends/xforms.
3765 Dialog launched through signals instead of callbacks
3767 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3769 * lyx.man: update the options description.
3771 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3773 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3774 handle neg values, set min width to 590, add doc about -display
3776 2000-07-05 Juergen Vigna <jug@sad.it>
3778 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3779 calls to BufferView *.
3781 * src/insets/insettext.C (checkAndActivateInset): small fix non
3782 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3784 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3785 their \end_inset token!
3787 2000-07-04 edscott <edscott@imp.mx>
3789 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3790 lib/lyxrc.example: added option \wheel_jump
3792 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3794 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3795 remove support for -width,-height,-xpos and -ypos.
3797 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3799 * src/encoding.[Ch]: New files.
3801 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3802 (text): Call to the underline() method only when needed.
3804 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3806 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3807 encoding(s) for the document.
3809 * src/bufferparams.C (BufferParams): Changed default value of
3812 * src/language.C (newLang): Removed.
3813 (items[]): Added encoding information for all defined languages.
3815 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3816 encoding choice button.
3818 * src/lyxrc.h (font_norm_type): New member variable.
3819 (set_font_norm_type): New method.
3821 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3822 paragraphs with different encodings.
3824 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3825 (TransformChar): Changed to work correctly with Arabic points.
3826 (draw): Added support for drawing Arabic points.
3827 (draw): Removed code for drawing underbars (this is done by
3830 * src/support/textutils.h (IsPrintableNonspace): New function.
3832 * src/BufferView_pimpl.h: Added "using SigC::Object".
3833 * src/LyXView.h: ditto.
3835 * src/insets/insetinclude.h (include_label): Changed to mutable.
3837 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3839 * src/mathed/math_iter.h: remove empty destructor
3841 * src/mathed/math_cursor.h: remove empty destructor
3843 * src/insets/lyxinset.h: add THEOREM_CODE
3845 * src/insets/insettheorem.[Ch]: new files
3847 * src/insets/insetminipage.C: (InsertInset): remove
3849 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3851 (InsertInset): remove
3853 * src/insets/insetlist.C: (InsertList): remove
3855 * src/insets/insetfootlike.[Ch]: new files
3857 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3860 (InsertInset): ditto
3862 * src/insets/insetert.C: remove include Painter.h, reindent
3863 (InsertInset): move to header
3865 * src/insets/insetcollapsable.h: remove explicit from default
3866 contructor, remove empty destructor, add InsertInset
3868 * src/insets/insetcollapsable.C (InsertInset): new func
3870 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3872 * src/vspace.h: add explicit to constructor
3874 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3875 \textcompwordmark, please test this.
3877 * src/lyxrc.C: set ascii_linelen to 65 by default
3879 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3881 * src/commandtags.h: add LFUN_INSET_THEOREM
3883 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3884 (makeLinuxDocFile): remove _some_ of the nice logic
3885 (makeDocBookFile): ditto
3887 * src/Painter.[Ch]: (~Painter): removed
3889 * src/LyXAction.C (init): entry for insettheorem added
3891 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3893 (deplog): code to detect files generated by LaTeX, needs testing
3896 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3898 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3900 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3902 * src/LaTeX.C (deplog): Add a check for files that are going to be
3903 created by the first latex run, part of the project to remove the
3906 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3907 contents to the extension list.
3909 2000-07-04 Juergen Vigna <jug@sad.it>
3911 * src/text.C (NextBreakPoint): added support for needFullRow()
3913 * src/insets/lyxinset.h: added needFullRow()
3915 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3918 * src/insets/insettext.C: lots of changes for update!
3920 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3922 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3924 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3926 * src/insets/insetinclude.C (InsetInclude): fixed
3927 initialization of include_label.
3928 (unique_id): now returns a string.
3930 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3932 * src/LaTeXFeatures.h: new member IncludedFiles, for
3933 a map of key, included file name.
3935 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3936 with the included files for inclusion in SGML preamble,
3937 i. e., linuxdoc and docbook.
3940 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3941 nice (is the generated linuxdoc code to be exported?), that
3942 allows to remove column, and only_body that will be true for
3943 slave documents. Insets are allowed inside SGML font type.
3944 New handling of the SGML preamble for included files.
3945 (makeDocBookFile): the same for docbook.
3947 * src/insets/insetinclude.h:
3948 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3950 (DocBook): new export methods.
3952 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3953 and makeDocBookFile.
3955 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3956 formats to export with command line argument -x.
3958 2000-06-29 Juergen Vigna <jug@sad.it>
3960 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3961 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3963 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3964 region could already been cleared by an inset!
3966 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3968 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3971 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3973 (cursorToggle): remove special handling of lyx focus.
3975 2000-06-28 Juergen Vigna <jug@sad.it>
3977 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3980 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3982 * src/insets/insetindex.C (Edit): add a callback when popup is
3985 * src/insets/insettext.C (LocalDispatch):
3986 * src/insets/insetmarginal.h:
3987 * src/insets/insetlist.h:
3988 * src/insets/insetfoot.h:
3989 * src/insets/insetfloat.h:
3990 * src/insets/insetert.h: add a missing std:: qualifier.
3992 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3994 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3997 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3999 * src/insets/insettext.C (Read): remove tmptok unused variable
4000 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4001 (InsertInset): change for new InsetInset code
4003 * src/insets/insettext.h: add TEXT inline method
4005 * src/insets/insettext.C: remove TEXT macro
4007 * src/insets/insetmarginal.C (Write): new method
4008 (Latex): change output slightly
4010 * src/insets/insetfoot.C (Write): new method
4011 (Latex): change output slightly (don't use endl when no need)
4013 * src/insets/insetert.C (Write): new method
4015 * src/insets/insetcollapsable.h: make button_length, button_top_y
4016 and button_bottm_y protected.
4018 * src/insets/insetcollapsable.C (Write): simplify code by using
4019 tostr. Also do not output the float name, the children class
4020 should to that to get control over own arguments
4022 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4023 src/insets/insetminipage.[Ch]:
4026 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4028 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4030 * src/Makefile.am (lyx_SOURCES): add the new files
4032 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4033 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4034 * src/commandtags.h: ditto
4036 * src/LaTeXFeatures.h: add a std::set of used floattypes
4038 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4040 * src/FloatList.[Ch] src/Floating.h: new files
4042 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4044 * src/lyx_cb.C (TableApplyCB): ditto
4046 * src/text2.C: ditto
4047 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4048 (parseSingleLyXformat2Token): ditto + add code for
4049 backwards compability for old float styles + add code for new insets
4051 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4053 (InsertInset(size_type, Inset *, LyXFont)): new method
4054 (InsetChar(size_type, char)): changed to use the other InsetChar
4055 with a LyXFont(ALL_INHERIT).
4056 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4057 insert the META_INSET.
4059 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4061 * sigc++/thread.h (Threads): from here
4063 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4064 definition out of line
4065 * sigc++/scope.h: from here
4067 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4069 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4070 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4072 * Makefile.am (bindist): new target.
4074 * INSTALL: add instructions for doing a binary distribution.
4076 * development/tools/README.bin.example: update a bit.
4078 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4081 * lib/lyxrc.example: new lyxrc tag \set_color.
4083 * src/lyxfunc.C (Dispatch):
4084 * src/commandtags.h:
4085 * src/LyXAction.C: new lyxfunc "set-color".
4087 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4088 and an x11name given as strings.
4090 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4091 cache when a color is changed.
4093 2000-06-26 Juergen Vigna <jug@sad.it>
4095 * src/lyxrow.C (width): added this functions and variable.
4097 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4100 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4102 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4104 * images/undo_bw.xpm: new icon.
4105 * images/redo_bw.xpm: ditto.
4107 * configure.in (INSTALL_SCRIPT): change value to
4108 ${INSTALL} to avoid failures of install-script target.
4109 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4111 * src/BufferView.h: add a magic "friend" declaration to please
4114 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4116 * forms/cite.fd: modified to allow resizing without messing
4119 * src/insetcite.C: Uses code from cite.fd almost without
4121 User can now resize dialog in the x-direction.
4122 Resizing the dialog in the y-direction is prevented, as the
4123 code does this intelligently already.
4125 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4127 * INSTALL: remove obsolete entry in "problems" section.
4129 * lib/examples/sl_*.lyx: update of the slovenian examples.
4131 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4133 2000-06-23 Juergen Vigna <jug@sad.it>
4135 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4137 * src/buffer.C (resize): delete the LyXText of textinsets.
4139 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4141 * src/insets/lyxinset.h: added another parameter 'cleared' to
4142 the draw() function.
4144 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4145 unlocking inset in inset.
4147 2000-06-22 Juergen Vigna <jug@sad.it>
4149 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4150 of insets and moved first to LyXText.
4152 * src/mathed/formulamacro.[Ch]:
4153 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4155 2000-06-21 Juergen Vigna <jug@sad.it>
4157 * src/text.C (GetVisibleRow): look if I should clear the area or not
4158 using Inset::doClearArea() function.
4160 * src/insets/lyxinset.h: added doClearArea() function and
4161 modified draw(Painter &, ...) to draw(BufferView *, ...)
4163 * src/text2.C (UpdateInset): return bool insted of int
4165 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4167 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4168 combox in the character popup
4170 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4171 BufferParams const & params
4173 2000-06-20 Juergen Vigna <jug@sad.it>
4175 * src/insets/insettext.C (SetParagraphData): set insetowner on
4178 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4180 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4181 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4183 (form_main_): remove
4185 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4186 (create_form_form_main): remove FD_form_main stuff, connect to
4187 autosave_timeout signal
4189 * src/LyXView.[Ch] (getMainForm): remove
4190 (UpdateTimerCB): remove
4191 * src/BufferView_pimpl.h: inherit from SigC::Object
4193 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4194 signal instead of callback
4196 * src/BufferView.[Ch] (cursorToggleCB): remove
4198 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4200 * src/BufferView_pimpl.C: changes because of the one below
4202 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4203 instead of storing a pointer to a LyXText.
4205 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4207 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4209 * src/lyxparagraph.h
4211 * src/paragraph.C: Changed fontlist to a sorted vector.
4213 2000-06-19 Juergen Vigna <jug@sad.it>
4215 * src/BufferView.h: added screen() function.
4217 * src/insets/insettext.C (LocalDispatch): some selection code
4220 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4222 * src/insets/insettext.C (SetParagraphData):
4224 (InsetText): fixes for multiple paragraphs.
4226 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4228 * development/lyx.spec.in: Call configure with ``--without-warnings''
4229 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4230 This should be fine, however, since we generally don't want to be
4231 verbose when making an RPM.
4233 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4235 * lib/scripts/fig2pstex.py: New file
4237 2000-06-16 Juergen Vigna <jug@sad.it>
4239 * src/insets/insettabular.C (UpdateLocal):
4240 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4241 (LocalDispatch): Changed all functions to use LyXText.
4243 2000-06-15 Juergen Vigna <jug@sad.it>
4245 * src/text.C (SetHeightOfRow): call inset::update before requesting
4248 * src/insets/insettext.C (update):
4249 * src/insets/insettabular.C (update): added implementation
4251 * src/insets/lyxinset.h: added update function
4253 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4255 * src/text.C (SelectNextWord): protect against null pointers with
4256 old-style string streams. (fix from Paul Theo Gonciari
4259 * src/cite.[Ch]: remove erroneous files.
4261 * lib/configure.m4: update the list of created directories.
4263 * src/lyxrow.C: include <config.h>
4264 * src/lyxcursor.C: ditto.
4266 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4268 * lib/examples/decimal.lyx: new example file from Mike.
4270 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4271 to find template definitions (from Dekel)
4273 * src/frontends/.cvsignore: add a few things.
4275 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4277 * src/Timeout.C (TimeOut): remove default argument.
4279 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4282 * src/insets/ExternalTemplate.C: add a "using" directive.
4284 * src/lyx_main.h: remove the act_ struct, which seems unused
4287 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4289 * LyX Developers Meeting: All files changed, due to random C++ (by
4290 coincidence) code generator script.
4292 - external inset (cool!)
4293 - initial online editing of preferences
4294 - insettabular breaks insettext(s contents)
4296 - some DocBook fixes
4297 - example files update
4298 - other cool stuff, create a diff and look for yourself.
4300 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4302 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4303 -1 this is a non-line-breaking textinset.
4305 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4306 if there is no width set.
4308 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4310 * Lots of files: Merged the dialogbase branch.
4312 2000-06-09 Allan Rae <rae@lyx.org>
4314 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4315 and the Dispatch methods that used it.
4317 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4318 access to functions formerly kept in Dispatch.
4320 2000-05-19 Allan Rae <rae@lyx.org>
4322 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4323 made to_page and count_copies integers again. from_page remains a
4324 string however because I want to allow entry of a print range like
4325 "1,4,22-25" using this field.
4327 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4328 and printer-params-get. These aren't useful from the minibuffer but
4329 could be used by a script/LyXServer app provided it passes a suitable
4330 auto_mem_buffer. I guess I should take a look at how the LyXServer
4331 works and make it support xtl buffers.
4333 * sigc++/: updated to libsigc++-1.0.1
4335 * src/xtl/: updated to xtl-1.3.pl.11
4337 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4338 those changes done to the files in src/ are actually recreated when
4339 they get regenerated. Please don't ever accept a patch that changes a
4340 dialog unless that patch includes the changes to the corresponding *.fd
4343 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4344 stringOnlyContains, renamed it and generalised it.
4346 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4347 branch. Removed the remaining old form_print code.
4349 2000-04-26 Allan Rae <rae@lyx.org>
4351 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4352 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4354 2000-04-25 Allan Rae <rae@lyx.org>
4356 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4357 against a base of xtl-1.3.pl.4
4359 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4360 filter the Id: entries so they still show the xtl version number
4363 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4364 into the src/xtl code. Patch still pending with José (XTL)
4366 2000-04-24 Allan Rae <rae@lyx.org>
4368 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4369 both more generic and much safer. Use the new template functions.
4370 * src/buffer.[Ch] (Dispatch): ditto.
4372 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4373 and mem buffer more intelligently. Also a little general cleanup.
4376 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4377 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4378 * src/xtl/Makefile.am: ditto.
4379 * src/xtl/.cvsignore: ditto.
4380 * src/Makefile.am: ditto.
4382 * src/PrinterParams.h: Removed the macros member functions. Added a
4383 testInvariant member function. A bit of tidying up and commenting.
4384 Included Angus's idea for fixing operation with egcs-1.1.2.
4386 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4387 cool expansion of XTL's mem_buffer to support automatic memory
4388 management within the buffer itself. Removed the various macros and
4389 replaced them with template functions that use either auto_mem_buffer
4390 or mem_buffer depending on a #define. The mem_buffer support will
4391 disappear as soon as the auto_mem_buffer is confirmed to be good on
4392 other platforms/compilers. That is, it's there so you've got something
4395 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4396 effectively forked XTL. However I expect José will include my code
4397 into the next major release. Also fixed a memory leak.
4398 * src/xtl/text.h: ditto.
4399 * src/xtl/xdr.h: ditto.
4400 * src/xtl/giop.h: ditto.
4402 2000-04-16 Allan Rae <rae@lyx.org>
4404 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4405 by autogen.sh and removed by maintainer-clean anyway.
4406 * .cvsignore, sigc++/.cvsignore: Support the above.
4408 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4410 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4412 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4413 macros, renamed static callback-target member functions to suit new
4414 scheme and made them public.
4415 * src/frontends/xforms/forms/form_print.fd: ditto.
4416 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4418 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4421 * src/xtl/: New directory containing a minimal distribution of XTL.
4422 This is XTL-1.3.pl.4.
4424 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4426 2000-04-15 Allan Rae <rae@lyx.org>
4428 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4430 * sigc++/: Updated to libsigc++-1.0.0
4432 2000-04-14 Allan Rae <rae@lyx.org>
4434 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4435 use the generic ones in future. I'll modify my conversion script.
4437 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4439 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4440 (CloseAllBufferRelatedDialogs): Renamed.
4441 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4443 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4444 of the generic ones. These are the same ones my conversion script
4447 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4448 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4449 * src/buffer.C (Dispatch): ditto
4451 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4452 functions for updating and hiding buffer dependent dialogs.
4453 * src/BufferView.C (buffer): ditto
4454 * src/buffer.C (setReadonly): ditto
4455 * src/lyxfunc.C (CloseBuffer): ditto
4457 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4458 Dialogs.h, and hence all the SigC stuff, into every file that includes
4459 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4461 * src/BufferView2.C: reduce the number of headers included by buffer.h
4463 2000-04-11 Allan Rae <rae@lyx.org>
4465 * src/frontends/xforms/xform_macros.h: A small collection of macros
4466 for building C callbacks.
4468 * src/frontends/xforms/Makefile.am: Added above file.
4470 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4471 scheme again. This time it should work for JMarc. If this is
4472 successful I'll revise my conversion script to automate some of this.
4473 The static member functions in the class also have to be public for
4474 this scheme will work. If the scheme works (it's almost identical to
4475 the way BufferView::cursorToggleCB is handled so it should work) then
4476 FormCopyright and FormPrint will be ready for inclusion into the main
4477 trunk immediately after 1.1.5 is released -- provided we're prepared
4478 for complaints about lame compilers not handling XTL.
4480 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4482 2000-04-07 Allan Rae <rae@lyx.org>
4484 * config/lyxinclude.m4: A bit more tidying up (Angus)
4486 * src/LString.h: JMarc's <string> header fix
4488 * src/PrinterParams.h: Used string for most data to remove some
4489 ugly code in the Print dialog and avoid even uglier code when
4490 appending the ints to a string for output.
4492 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4493 and moved "default:" back to the end of switch statement. Cleaned
4494 up the printing so it uses the right function calls and so the
4495 "print to file" option actually puts the file in the right directory.
4497 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4499 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4500 and Ok+Apply button control into a separate method: input (Angus).
4501 (input) Cleaned it up and improved it to be very thorough now.
4502 (All CB) static_cast used instead of C style cast (Angus). This will
4503 probably change again once we've worked out how to keep gcc-2.8.1 happy
4504 with real C callbacks.
4505 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4506 ignore some of the bool settings and has random numbers instead. Needs
4507 some more investigation. Added other input length checks and checking
4508 of file and printer names.
4510 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4511 would link (Angus). Seems the old code doesn't compile with the pragma
4512 statement either. Separated callback entries from internal methods.
4514 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4516 2000-03-17 Allan Rae <rae@lyx.org>
4518 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4519 need it? Maybe it could go in Dialogs instead? I could make it a
4520 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4521 values to get the bool return value.
4522 (Dispatch): New overloaded method for xtl support.
4524 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4525 extern "C" callback instead of static member functions. Hopefully,
4526 JMarc will be able to compile this. I haven't changed
4527 forms/form_copyright.fd yet. Breaking one of my own rules already.
4529 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4530 because they aren't useful from the minibuffer. Maybe a LyXServer
4531 might want a help message though?
4533 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4535 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4536 xtl which needs both rtti and exceptions.
4538 * src/support/Makefile.am:
4539 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4541 * src/frontends/xforms/input_validators.[ch]: input filters and
4542 validators. These conrol what keys are valid in input boxes.
4543 Use them and write some more. Much better idea than waiting till
4544 after the user has pressed Ok to say that the input fields don't make
4547 * src/frontends/xforms/Makefile.am:
4548 * src/frontends/xforms/forms/form_print.fd:
4549 * src/frontends/xforms/forms/makefile:
4550 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4551 new scheme. Still have to make sure I haven't missed anything from
4552 the current implementation.
4554 * src/Makefile.am, src/PrinterParams.h: New data store.
4556 * other files: Added a couple of copyright notices.
4558 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4560 * src/insets/insetbib.h: move Holder struct in public space.
4562 * src/frontends/include/DialogBase.h: use SigC:: only when
4563 SIGC_CXX_NAMESPACES is defined.
4564 * src/frontends/include/Dialogs.h: ditto.
4566 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4568 * src/frontends/xforms/FormCopyright.[Ch]: do not
4569 mention SigC:: explicitely.
4571 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4573 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4574 deals with testing KDE in main configure.in
4575 * configure.in: ditto.
4577 2000-02-22 Allan Rae <rae@lyx.org>
4579 * Lots of files: Merged from HEAD
4581 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4582 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4584 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4586 * sigc++/: new minidist.
4588 2000-02-14 Allan Rae <rae@lyx.org>
4590 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4592 2000-02-08 Juergen Vigna <jug@sad.it>
4594 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4595 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4597 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4598 for this port and so it is much easier for other people to port
4599 dialogs in a common development environment.
4601 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4602 the QT/KDE implementation.
4604 * src/frontends/kde/Dialogs.C:
4605 * src/frontends/kde/FormCopyright.C:
4606 * src/frontends/kde/FormCopyright.h:
4607 * src/frontends/kde/Makefile.am:
4608 * src/frontends/kde/formcopyrightdialog.C:
4609 * src/frontends/kde/formcopyrightdialog.h:
4610 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4611 for the kde support of the Copyright-Dialog.
4613 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4614 subdir-substitution instead of hardcoded 'xforms' as we now have also
4617 * src/frontends/include/DialogBase.h (Object): just commented the
4618 label after #endif (nasty warning and I don't like warnings ;)
4620 * src/main.C (main): added KApplication initialization if using
4623 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4624 For now only the KDE event-loop is added if frontend==kde.
4626 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4628 * configure.in: added support for the --with-frontend[=value] option
4630 * autogen.sh: added kde.m4 file to list of config-files
4632 * acconfig.h: added define for KDEGUI-support
4634 * config/kde.m4: added configuration functions for KDE-port
4636 * config/lyxinclude.m4: added --with-frontend[=value] option with
4637 support for xforms and KDE.
4639 2000-02-08 Allan Rae <rae@lyx.org>
4641 * all Makefile.am: Fixed up so the make targets dist, distclean,
4642 install and uninstall all work even if builddir != srcdir. Still
4643 have a new sigc++ minidist update to come.
4645 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4647 2000-02-01 Allan Rae <rae@lyx.org>
4649 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4650 Many mods to get builddir != srcdir working.
4652 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4653 for building on NT and so we can do the builddir != srcdir stuff.
4655 2000-01-30 Allan Rae <rae@lyx.org>
4657 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4658 This will stay in "rae" branch. We probably don't really need it in
4659 the main trunk as anyone who wants to help programming it should get
4660 a full library installed also. So they can check both included and
4661 system supplied library compilation.
4663 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4664 Added a 'mini' distribution of libsigc++. If you feel the urge to
4665 change something in these directories - Resist it. If you can't
4666 resist the urge then you should modify the following script and rebuild
4667 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4668 all happen. Still uses a hacked version of libsigc++'s configure.in.
4669 I'm quite happy with the results. I'm not sure the extra work to turn
4670 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4671 worth the trouble and would probably lead to extra maintenance
4673 I haven't tested the following important make targets: install, dist.
4674 Not ready for prime time but very close. Maybe 1.1.5.
4676 * development/tools/makeLyXsigc.sh: A shell script to automatically
4677 generate our mini-dist of libsigc++. It can only be used with a CVS
4678 checkout of libsigc++ not a tarball distribution. It's well commented.
4679 This will end up as part of the libsigc++ distribution so other apps
4680 can easily have an included mini-dist. If someone makes mods to the
4681 sigc++ subpackage without modifying this script to generate those
4682 changes I'll be very upset!
4684 * src/frontends/: Started the gui/system indep structure.
4686 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4687 to access the gui-indep dialogs are in this class. Much improved
4688 design compared to previous revision. Lars, please refrain from
4689 moving this header into src/ like you did with Popups.h last time.
4691 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4693 * src/frontends/xforms/: Started the gui-indep system with a single
4694 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4697 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4698 Here you'll find a very useful makefile and automated fdfix.sh that
4699 makes updating dailogs a no-brainer -- provided you follow the rules
4700 set out in the README. I'm thinking about adding another script to
4701 automatically generate skeleton code for a new dialog given just the
4704 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4705 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4706 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4708 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4710 * src/support/LSubstring.C (operator): simplify
4712 * src/lyxtext.h: removed bparams, use buffer_->params instead
4714 * src/lyxrow.h: make Row a real class, move all variables to
4715 private and use accessors.
4717 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4719 (isRightToLeftPar): ditto
4720 (ChangeLanguage): ditto
4721 (isMultiLingual): ditto
4724 (SimpleTeXOnePar): ditto
4725 (TeXEnvironment): ditto
4726 (GetEndLabel): ditto
4728 (SetOnlyLayout): ditto
4729 (BreakParagraph): ditto
4730 (BreakParagraphConservative): ditto
4731 (GetFontSettings): ditto
4733 (CopyIntoMinibuffer): ditto
4734 (CutIntoMinibuffer): ditto
4735 (PasteParagraph): ditto
4736 (SetPExtraType): ditto
4737 (UnsetPExtraType): ditto
4738 (DocBookContTableRows): ditto
4739 (SimpleDocBookOneTablePar): ditto
4741 (TeXFootnote): ditto
4742 (SimpleTeXOneTablePar): ditto
4743 (TeXContTableRows): ditto
4744 (SimpleTeXSpecialChars): ditto
4747 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4748 to private and use accessors.
4750 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4751 this, we did not use it anymore and has not been for ages. Just a
4752 waste of cpu cycles.
4754 * src/language.h: make Language a real class, move all variables
4755 to private and use accessors.
4757 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4758 (create_view): remove
4759 (update): some changes for new timer
4760 (cursorToggle): use new timer
4761 (beforeChange): change for new timer
4763 * src/BufferView.h (cursorToggleCB): removed last paramter because
4766 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4767 (cursorToggleCB): change because of new timer code
4769 * lib/CREDITS: updated own mailaddress
4771 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4773 * src/support/filetools.C (PutEnv): fix the code in case neither
4774 putenv() nor setenv() have been found.
4776 * INSTALL: mention the install-strip Makefile target.
4778 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4779 read-only documents.
4781 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4783 * lib/reLyX/configure.in (VERSION): avoid using a previously
4784 generated reLyX wrapper to find out $prefix.
4786 * lib/examples/eu_adibide_lyx-atua.lyx:
4787 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4788 translation of the Tutorial (Dooteo)
4790 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4792 * forms/cite.fd: new citation dialog
4794 * src/insetcite.[Ch]: the new citation dialog is moved into
4797 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4800 * src/insets/insetcommand.h: data members made private.
4802 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4804 * LyX 1.1.5 released
4806 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4808 * src/version.h (LYX_RELEASE): to 1.1.5
4810 * src/spellchecker.C (RunSpellChecker): return false if the
4811 spellchecker dies upon creation.
4813 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4815 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4816 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4820 * lib/CREDITS: update entry for Martin Vermeer.
4822 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4824 * src/text.C (draw): Draw foreign language bars at the bottom of
4825 the row instead of at the baseline.
4827 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4829 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4831 * lib/bind/de_menus.bind: updated
4833 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4835 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4837 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4839 * src/menus.C (Limit_string_length): New function
4840 (ShowTocMenu): Limit the number of items/length of items in the
4843 * src/paragraph.C (String): Correct result for a paragraph inside
4846 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4848 * src/bufferlist.C (close): test of buf->getuser() == NULL
4850 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4852 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4853 Do not call to SetCursor when the paragraph is a closed footnote!
4855 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4857 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4860 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4862 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4865 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4866 reference popup, that activates the reference-back action
4868 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4870 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4871 the menus. Also fixed a bug.
4873 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4874 the math panels when switching buffers (unless new buffer is readonly).
4876 * src/BufferView.C (NoSavedPositions)
4877 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4879 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4881 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4882 less of dvi dirty or not.
4884 * src/trans_mgr.[Ch] (insert): change first parameter to string
4887 * src/chset.[Ch] (encodeString): add const to first parameter
4889 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4891 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4895 * src/LaTeX.C (deplog): better searching for dependency files in
4896 the latex log. Uses now regexps.
4898 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4899 instead of the box hack or \hfill.
4901 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4903 * src/lyxfunc.C (doImportHelper): do not create the file before
4904 doing the actual import.
4905 (doImportASCIIasLines): create a new file before doing the insert.
4906 (doImportASCIIasParagraphs): ditto.
4908 * lib/lyxrc.example: remove mention of non-existing commands
4910 * lyx.man: remove mention of color-related switches.
4912 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4914 * src/lyx_gui.C: remove all the color-related ressources, which
4915 are not used anymore.
4917 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4920 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4922 * src/lyxrc.C (read): Add a missing break in the switch
4924 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4926 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4928 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4931 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4933 * src/text.C (draw): draw bars under foreign language words.
4935 * src/LColor.[Ch]: add LColor::language
4937 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4939 * src/lyxcursor.h (boundary): New member variable
4941 * src/text.C (IsBoundary): New methods
4943 * src/text.C: Use the above for currect cursor movement when there
4944 is both RTL & LTR text.
4946 * src/text2.C: ditto
4948 * src/bufferview_funcs.C (ToggleAndShow): ditto
4950 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4952 * src/text.C (DeleteLineForward): set selection to true to avoid
4953 that DeleteEmptyParagraphMechanism does some magic. This is how it
4954 is done in all other functions, and seems reasonable.
4955 (DeleteWordForward): do not jump over non-word stuff, since
4956 CursorRightOneWord() already does it.
4958 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4959 DeleteWordBackward, since they seem safe to me (since selection is
4960 set to "true") DeleteEmptyParagraphMechanism does nothing.
4962 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4964 * src/lyx_main.C (easyParse): simplify the code by factoring the
4965 part that removes parameters from the command line.
4966 (LyX): check wether wrong command line options have been given.
4968 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4970 * src/lyx_main.C : add support for specifying user LyX
4971 directory via command line option -userdir.
4973 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4975 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4976 the number of items per popup.
4977 (Add_to_refs_menu): Ditto.
4979 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4981 * src/lyxparagraph.h: renamed ClearParagraph() to
4982 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4983 textclass as parameter, and do nothing if free_spacing is
4984 true. This fixes part of the line-delete-forward problems.
4986 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4987 (pasteSelection): ditto.
4988 (SwitchLayoutsBetweenClasses): more translatable strings.
4990 * src/text2.C (CutSelection): use StripLeadingSpaces.
4991 (PasteSelection): ditto.
4992 (DeleteEmptyParagraphMechanism): ditto.
4994 2000-05-26 Juergen Vigna <jug@sad.it>
4996 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4997 is not needed in tabular insets.
4999 * src/insets/insettabular.C (TabularFeatures): added missing features.
5001 * src/tabular.C (DeleteColumn):
5003 (AppendRow): implemented this functions
5004 (cellsturct::operator=): clone the inset too;
5006 2000-05-23 Juergen Vigna <jug@sad.it>
5008 * src/insets/insettabular.C (LocalDispatch): better selection support
5009 when having multicolumn-cells.
5011 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5013 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5015 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5017 * src/ColorHandler.C (getGCForeground): put more test into _()
5019 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5022 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5025 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5027 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5028 there are no labels, or when buffer is readonly.
5030 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5031 there are no labels, buffer is SGML, or when buffer is readonly.
5033 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5035 * src/LColor.C (LColor): change a couple of grey40 to grey60
5036 (LColor): rewore initalization to make compiles go some magnitude
5038 (getGUIName): don't use gettext until we need the string.
5040 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5042 * src/Bullet.[Ch]: Fixed a small bug.
5044 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5046 * src/paragraph.C (String): Several fixes/improvements
5048 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5050 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5052 * src/paragraph.C (String): give more correct output.
5054 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5056 * src/lyxfont.C (stateText) Do not output the language if it is
5057 eqaul to the language of the document.
5059 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5060 between two paragraphs with the same language.
5062 * src/paragraph.C (getParLanguage) Return a correct answer for an
5063 empty dummy paragraph.
5065 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5068 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5071 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5072 the menus/popup, if requested fonts are unavailable.
5074 2000-05-22 Juergen Vigna <jug@sad.it>
5076 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5077 movement support (Up/Down/Tab/Shift-Tab).
5078 (LocalDispatch): added also preliminari cursor-selection.
5080 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5082 * src/paragraph.C (PasteParagraph): Hopefully now right!
5084 2000-05-22 Garst R. Reese <reese@isn.net>
5086 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5087 of list, change all references to Environment to Command
5088 * tex/hollywood.cls : rewrite environments as commands, add
5089 \uppercase to interiorshot and exteriorshot to force uppecase.
5090 * tex/broadway.cls : rewrite environments as commands. Tweak
5093 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5095 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5096 size of items: use a constant intead of the hardcoded 40, and more
5097 importantly do not remove the %m and %x tags added at the end.
5098 (Add_to_refs_menu): use vector::size_type instead of
5099 unsigned int as basic types for the variables. _Please_ do not
5100 assume that size_t is equal to unsigned int. On an alpha, this is
5101 unsigned long, which is _not_ the same.
5103 * src/language.C (initL): remove language "hungarian", since it
5104 seems that "magyar" is better.
5106 2000-05-22 Juergen Vigna <jug@sad.it>
5108 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5110 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5113 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5114 next was deleted but not set to 0.
5116 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5118 * src/language.C (initL): change the initialization of languages
5119 so that compiles goes _fast_.
5121 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5124 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5126 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5130 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5132 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5134 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5138 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5141 * src/insets/insetlo*.[Ch]: Made editable
5143 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5145 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5146 the current selection.
5148 * src/BufferView_pimpl.C (stuffClipboard): new method
5150 * src/BufferView.C (stuffClipboard): new method
5152 * src/paragraph.C (String): new method
5154 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5155 LColor::ignore when lyxname is not found.
5157 * src/BufferView.C (pasteSelection): new method
5159 * src/BufferView_pimpl.C (pasteSelection): new method
5161 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5163 * src/WorkArea.C (request_clipboard_cb): new static function
5164 (getClipboard): new method
5165 (putClipboard): new method
5167 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5169 * LyX 1.1.5pre2 released
5171 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5173 * src/vspace.C (operator=): removed
5174 (operator=): removed
5176 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5178 * src/layout.C (NumberOfClass): manually set the type in make_pair
5179 (NumberOfLayout): ditto
5181 * src/language.C: use the Language constructor for ignore_lang
5183 * src/language.h: add constructors to struct Language
5185 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5187 * src/text2.C (SetCursorIntern): comment out #warning
5189 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5191 * src/mathed/math_iter.h: initialize sx and sw to 0
5193 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5195 * forms/lyx.fd: Redesign of form_ref
5197 * src/LaTeXFeatures.[Ch]
5201 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5204 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5205 and Buffer::inset_iterator.
5207 * src/menus.C: Added new menus: TOC and Refs.
5209 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5211 * src/buffer.C (getTocList): New method.
5213 * src/BufferView2.C (ChangeRefs): New method.
5215 * src/buffer.C (getLabelList): New method. It replaces the old
5216 getReferenceList. The return type is vector<string> instead of
5219 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5220 the old getLabel() and GetNumberOfLabels() methods.
5221 * src/insets/insetlabel.C (getLabelList): ditto
5222 * src/mathed/formula.C (getLabelList): ditto
5224 * src/paragraph.C (String): New method.
5226 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5227 Uses the new getTocList() method.
5228 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5229 which automatically updates the contents of the browser.
5230 (RefUpdateCB): Use the new getLabelList method.
5232 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5234 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5236 * src/spellchecker.C: Added using std::reverse;
5238 2000-05-19 Juergen Vigna <jug@sad.it>
5240 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5242 * src/insets/insettext.C (computeTextRows): small fix for display of
5243 1 character after a newline.
5245 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5248 2000-05-18 Juergen Vigna <jug@sad.it>
5250 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5251 when changing width of column.
5253 * src/tabular.C (set_row_column_number_info): setting of
5254 autobreak rows if necessary.
5256 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5258 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5260 * src/vc-backend.*: renamed stat() to status() and vcstat to
5261 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5262 compilation broke. The new name seems more relevant, anyway.
5264 2000-05-17 Juergen Vigna <jug@sad.it>
5266 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5267 which was wrong if the removing caused removing of rows!
5269 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5270 (pushToken): new function.
5272 * src/text2.C (CutSelection): fix problem discovered with purify
5274 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5276 * src/debug.C (showTags): enlarge the first column, now that we
5277 have 6-digits debug codes.
5279 * lib/layouts/hollywood.layout:
5280 * lib/tex/hollywood.cls:
5281 * lib/tex/brodway.cls:
5282 * lib/layouts/brodway.layout: more commands and fewer
5283 environments. Preambles moved in the .cls files. Broadway now has
5284 more options on scene numbering and less whitespace (from Garst)
5286 * src/insets/insetbib.C (getKeys): make sure that we are in the
5287 document directory, in case the bib file is there.
5289 * src/insets/insetbib.C (Latex): revert bogus change.
5291 2000-05-16 Juergen Vigna <jug@sad.it>
5293 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5294 the TabularLayout on cursor move.
5296 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5298 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5301 (draw): fixed cursor position and drawing so that the cursor is
5302 visible when before the tabular-inset.
5304 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5305 when creating from old insettext.
5307 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5309 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5311 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5312 * lib/tex/brodway.cls: ditto
5314 * lib/layouts/brodway.layout: change alignment of parenthical
5317 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5319 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5320 versions 0.88 and 0.89 are supported.
5322 2000-05-15 Juergen Vigna <jug@sad.it>
5324 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5327 * src/insets/insettext.C (computeTextRows): redone completely this
5328 function in a much cleaner way, because of problems when having a
5330 (draw): added a frame border when the inset is locked.
5331 (SetDrawLockedFrame): this sets if we draw the border or not.
5332 (SetFrameColor): this sets the frame color (default=insetframe).
5334 * src/insets/lyxinset.h: added x() and y() functions which return
5335 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5336 function which is needed to see if we have a locking inset of some
5337 type in this inset (needed for now in insettabular).
5339 * src/vspace.C (inPixels): the same function also without a BufferView
5340 parameter as so it is easier to use it in some ocasions.
5342 * src/lyxfunc.C: changed all places where insertInset was used so
5343 that now if it couldn't be inserted it is deleted!
5345 * src/TabularLayout.C:
5346 * src/TableLayout.C: added support for new tabular-inset!
5348 * src/BufferView2.C (insertInset): this now returns a bool if the
5349 inset was really inserted!!!
5351 * src/tabular.C (GetLastCellInRow):
5352 (GetFirstCellInRow): new helper functions.
5353 (Latex): implemented for new tabular class.
5357 (TeXTopHLine): new Latex() helper functions.
5359 2000-05-12 Juergen Vigna <jug@sad.it>
5361 * src/mathed/formulamacro.C (Read):
5362 * src/mathed/formula.C (Read): read also the \end_inset here!
5364 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5366 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5367 crush when saving formulae with unbalanced parenthesis.
5369 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5371 * src/layout.C: Add new keyword "endlabelstring" to layout file
5373 * src/text.C (GetVisibleRow): Draw endlabel string.
5375 * lib/layouts/broadway.layout
5376 * lib/layouts/hollywood.layout: Added endlabel for the
5377 Parenthetical layout.
5379 * lib/layouts/heb-article.layout: Do not use slanted font shape
5380 for Theorem like environments.
5382 * src/buffer.C (makeLaTeXFile): Always add "american" to
5383 the UsedLanguages list if document language is RTL.
5385 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5387 * add addendum to README.OS2 and small patch (from SMiyata)
5389 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5391 * many files: correct the calls to ChangeExtension().
5393 * src/support/filetools.C (ChangeExtension): remove the no_path
5394 argument, which does not belong there. Use OnlyFileName() instead.
5396 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5397 files when LaTeXing a non-nice latex file.
5399 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5400 a chain of "if". Return false when deadkeys are not handled.
5402 * src/lyx_main.C (LyX): adapted the code for default bindings.
5404 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5405 bindings for basic functionality (except deadkeys).
5406 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5408 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5409 several methods: handle override_x_deadkeys.
5411 * src/lyxrc.h: remove the "bindings" map, which did not make much
5412 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5414 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5416 * src/lyxfont.C (stateText): use a saner method to determine
5417 whether the font is "default". Seems to fix the crash with DEC
5420 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5422 2000-05-08 Juergen Vigna <jug@sad.it>
5424 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5425 TabularLayoutMenu with mouse-button-3
5426 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5428 * src/TabularLayout.C: added this file for having a Layout for
5431 2000-05-05 Juergen Vigna <jug@sad.it>
5433 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5434 recalculating inset-widths.
5435 (TabularFeatures): activated this function so that I can change
5436 tabular-features via menu.
5438 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5439 that I can test some functions with the Table menu.
5441 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * src/lyxfont.C (stateText): guard against stupid c++libs.
5445 * src/tabular.C: add using std::vector
5446 some whitespace changes, + removed som autogenerated code.
5448 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5450 2000-05-05 Juergen Vigna <jug@sad.it>
5452 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5453 row, columns and cellstructures.
5455 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5457 * lib/lyxrc.example: remove obsolete entries.
5459 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5460 reading of protected_separator for free_spacing.
5462 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5464 * src/text.C (draw): do not display an exclamation mark in the
5465 margin for margin notes. This is confusing, ugly and
5468 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5469 AMS math' is checked.
5471 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5472 name to see whether including the amsmath package is needed.
5474 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5476 * src/paragraph.C (validate): Compute UsedLanguages correctly
5477 (don't insert the american language if it doesn't appear in the
5480 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5481 The argument of \thanks{} command is considered moving argument
5483 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5486 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5488 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5489 for appendix/minipage/depth. The lines can be now both in the footnote
5490 frame, and outside the frame.
5492 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5495 2000-05-05 Juergen Vigna <jug@sad.it>
5497 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5498 neede only in tabular.[Ch].
5500 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5502 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5504 (Write): write '~' for PROTECTED_SEPARATOR
5506 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5508 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5511 * src/mathed/formula.C (drawStr): rename size to siz.
5513 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5514 possibly fix a bug by not changing the pflags = flags to piflags =
5517 2000-05-05 Juergen Vigna <jug@sad.it>
5519 * src/insets/insetbib.C: moved using directive
5521 * src/ImportNoweb.C: small fix for being able to compile (missing
5524 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5526 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5527 to use clear, since we don't depend on this in the code. Add test
5530 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5532 * (various *.C files): add using std::foo directives to please dec
5535 * replace calls to string::clear() to string::erase() (Angus)
5537 * src/cheaders/cmath: modified to provide std::abs.
5539 2000-05-04 Juergen Vigna <jug@sad.it>
5541 * src/insets/insettext.C: Prepared all for inserting of multiple
5542 paragraphs. Still display stuff to do (alignment and other things),
5543 but I would like to use LyXText to do this when we cleaned out the
5544 table-support stuff.
5546 * src/insets/insettabular.C: Changed lot of stuff and added lots
5547 of functionality still a lot to do.
5549 * src/tabular.C: Various functions changed name and moved to be
5550 const functions. Added new Read and Write functions and changed
5551 lots of things so it works good with tabular-insets (also removed
5552 some stuff which is not needed anymore * hacks *).
5554 * src/lyxcursor.h: added operators == and != which just look if
5555 par and pos are (not) equal.
5557 * src/buffer.C (latexParagraphs): inserted this function to latex
5558 all paragraphs form par to endpar as then I can use this too for
5561 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5562 so that I can call this to from text insets with their own cursor.
5564 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5565 output off all paragraphs (because of the fix below)!
5567 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5568 the very last paragraph (this could be also the last paragraph of an
5571 * src/texrow.h: added rows() call which returns the count-variable.
5573 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5575 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5577 * lib/configure.m4: better autodetection of DocBook tools.
5579 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5581 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5583 * src/lyx_cb.C: add using std::reverse;
5585 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5588 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5589 selected files. Should fix repeated errors from generated files.
5591 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5593 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5595 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5596 the spellchecker popup.
5598 * lib/lyxrc.example: Removed the \number_inset section
5600 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5602 * src/insets/figinset.C (various): Use IsFileReadable() to make
5603 sure that the file actually exist. Relying on ghostscripts errors
5604 is a bad idea since they can lead to X server crashes.
5606 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5608 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5611 * lib/lyxrc.example: smallish typo in description of
5612 \view_dvi_paper_option
5614 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5617 * src/lyxfunc.C: doImportHelper to factor out common code of the
5618 various import methods. New functions doImportASCIIasLines,
5619 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5620 doImportLinuxDoc for the format specific parts.
5623 * buffer.C: Dispatch returns now a bool to indicate success
5626 * lyx_gui.C: Add getLyXView() for member access
5628 * lyx_main.C: Change logic for batch commands: First try
5629 Buffer::Dispatch (possibly without GUI), if that fails, use
5632 * lyx_main.C: Add support for --import command line switch.
5633 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5634 Available Formats: Everything accepted by 'buffer-import <format>'
5636 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5638 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5641 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5642 documents will be reformatted upon reentry.
5644 2000-04-27 Juergen Vigna <jug@sad.it>
5646 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5647 correctly only last pos this was a bug.
5649 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5651 * release of lyx-1.1.5pre1
5653 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5655 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5657 * src/menus.C: revert the change of naming (Figure->Graphic...)
5658 from 2000-04-11. It was incomplete and bad.
5660 * src/LColor.[Ch]: add LColor::depthbar.
5661 * src/text.C (GetVisibleRow): use it.
5663 * README: update the languages list.
5665 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5667 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5670 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5672 * README: remove sections that were just wrong.
5674 * src/text2.C (GetRowNearY): remove currentrow code
5676 * src/text.C (GetRow): remove currentrow code
5678 * src/screen.C (Update): rewritten a bit.
5679 (SmallUpdate): removed func
5681 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5683 (FullRebreak): return bool
5684 (currentrow): remove var
5685 (currentrow_y): ditto
5687 * src/lyxscreen.h (Draw): change arg to unsigned long
5688 (FitCursor): return bool
5689 (FitManualCursor): ditto
5690 (Smallpdate): remove func
5691 (first): change to unsigned long
5692 (DrawOneRow): change second arg to long (from long &)
5693 (screen_refresh_y): remove var
5694 (scree_refresh_row): ditto
5696 * src/lyxrow.h: change baseline to usigned int from unsigned
5697 short, this brings some implicit/unsigned issues out in the open.
5699 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5701 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5702 instead of smallUpdate.
5704 * src/lyxcursor.h: change y to unsigned long
5706 * src/buffer.h: don't call updateScrollbar after fitcursor
5708 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5709 where they are used. Removed "\\direction", this was not present
5710 in 1.1.4 and is already obsolete. Commented out some code that I
5711 believe to never be called.
5712 (runLiterate): don't call updateScrollbar after fitCursor
5714 (buildProgram): ditto
5717 * src/WorkArea.h (workWidth): change return val to unsigned
5720 (redraw): remove the button redraws
5721 (setScrollbarValue): change for scrollbar
5722 (getScrollbarValue): change for scrollbar
5723 (getScrollbarBounds): change for scrollbar
5725 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5726 (C_WorkArea_down_cb): removed func
5727 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5728 (resize): change for scrollbar
5729 (setScrollbar): ditto
5730 (setScrollbarBounds): ditto
5731 (setScrollbarIncrements): ditto
5732 (up_cb): removed func
5733 (down_cb): removed func
5734 (scroll_cb): change for scrollbar
5735 (work_area_handler): ditto
5737 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5738 when FitCursor did something.
5739 (updateScrollbar): some unsigned changes
5740 (downCB): removed func
5741 (scrollUpOnePage): removed func
5742 (scrollDownOnePage): remvoed func
5743 (workAreaMotionNotify): don't call screen->FitCursor but use
5744 fitCursor instead. and bool return val
5745 (workAreaButtonPress): ditto
5746 (workAreaButtonRelease): some unsigned changes
5747 (checkInsetHit): ditto
5748 (workAreaExpose): ditto
5749 (update): parts rewritten, comments about the signed char arg added
5750 (smallUpdate): removed func
5751 (cursorPrevious): call needed updateScrollbar
5754 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5757 * src/BufferView.[Ch] (upCB): removed func
5758 (downCB): removed func
5759 (smallUpdate): removed func
5761 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5763 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5764 currentrow, currentrow_y optimization. This did not help a lot and
5765 if we want to do this kind of optimization we should rather use
5766 cursor.row instead of the currentrow.
5768 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5769 buffer spacing and klyx spacing support.
5771 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5773 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5776 2000-04-26 Juergen Vigna <jug@sad.it>
5778 * src/insets/figinset.C: fixes to Lars sstream changes!
5780 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5782 * A lot of files: Added Ascii(ostream &) methods to all inset
5783 classes. Used when exporting to ASCII.
5785 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5786 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5789 * src/text2.C (ToggleFree): Disabled implicit word selection when
5790 there is a change in the language
5792 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5793 no output was generated for end-of-sentence inset.
5795 * src/insets/lyxinset.h
5798 * src/paragraph.C: Removed the insetnumber code
5800 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5802 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5804 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5805 no_babel and no_epsfig completely from the file.
5806 (parseSingleLyXformat2Token): add handling for per-paragraph
5807 spacing as written by klyx.
5809 * src/insets/figinset.C: applied patch by Andre. Made it work with
5812 2000-04-20 Juergen Vigna <jug@sad.it>
5814 * src/insets/insettext.C (cutSelection):
5815 (copySelection): Fixed with selection from right to left.
5816 (draw): now the rows are not recalculated at every draw.
5817 (computeTextRows): for now reset the inset-owner here (this is
5818 important for an undo or copy where the inset-owner is not set
5821 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5822 motion to the_locking_inset screen->first was forgotten, this was
5823 not important till we got multiline insets.
5825 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5827 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5828 code seems to be alright (it is code changed by Dekel, and the
5829 intent is indeed that all macros should be defined \protect'ed)
5831 * NEWS: a bit of reorganisation of the new user-visible features.
5833 2000-04-19 Juergen Vigna <jug@sad.it>
5835 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5836 position. Set the inset_owner of the used paragraph so that it knows
5837 that it is inside an inset. Fixed cursor handling with mouse and
5838 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5839 and cleanups to make TextInsets work better.
5841 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5842 Changed parameters of various functions and added LockInsetInInset().
5844 * src/insets/insettext.C:
5846 * src/insets/insetcollapsable.h:
5847 * src/insets/insetcollapsable.C:
5848 * src/insets/insetfoot.h:
5849 * src/insets/insetfoot.C:
5850 * src/insets/insetert.h:
5851 * src/insets/insetert.C: cleaned up the code so that it works now
5852 correctly with insettext.
5854 * src/insets/inset.C:
5855 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5856 that insets in insets are supported right.
5859 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5861 * src/paragraph.C: some small fixes
5863 * src/debug.h: inserted INSETS debug info
5865 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5866 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5868 * src/commandtags.h:
5869 * src/LyXAction.C: insert code for InsetTabular.
5871 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5872 not Button1MotionMask.
5873 (workAreaButtonRelease): send always a InsetButtonRelease event to
5875 (checkInsetHit): some setCursor fixes (always with insets).
5877 * src/BufferView2.C (lockInset): returns a bool now and extended for
5878 locking insets inside insets.
5879 (showLockedInsetCursor): it is important to have the cursor always
5880 before the locked inset.
5881 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5883 * src/BufferView.h: made lockInset return a bool.
5885 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5887 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5888 that is used also internally but can be called as public to have back
5889 a cursor pos which is not set internally.
5890 (SetCursorIntern): Changed to use above function.
5892 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5894 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5899 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5900 patches for things that should be in or should be changed.
5902 * src/* [insetfiles]: change "usigned char fragile" to bool
5903 fragile. There was only one point that could that be questioned
5904 and that is commented in formulamacro.C. Grep for "CHECK".
5906 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5907 (DeleteBuffer): take it out of CutAndPaste and make it static.
5909 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5911 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5912 output the spacing envir commands. Also the new commands used in
5913 the LaTeX output makes the result better.
5915 * src/Spacing.C (writeEnvirBegin): new method
5916 (writeEnvirEnd): new method
5918 2000-04-18 Juergen Vigna <jug@sad.it>
5920 * src/CutAndPaste.C: made textclass a static member of the class
5921 as otherwise it is not accesed right!!!
5923 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5925 * forms/layout_forms.fd
5926 * src/layout_forms.h
5927 * src/layout_forms.C (create_form_form_character)
5928 * src/lyx_cb.C (UserFreeFont)
5929 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5930 documents (in the layout->character popup).
5932 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5934 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5935 \spell_command was in fact not honored (from Kevin Atkinson).
5937 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5940 * src/lyx_gui.h: make lyxViews private (Angus)
5942 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5944 * src/mathed/math_write.C
5945 (MathMatrixInset::Write) Put \protect before \begin{array} and
5946 \end{array} if fragile
5947 (MathParInset::Write): Put \protect before \\ if fragile
5949 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5951 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5952 initialization if the LyXColorHandler must be done after the
5953 connections to the XServer has been established.
5955 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5956 get the background pixel from the lyxColorhandler so that the
5957 figures are rendered with the correct background color.
5958 (NextToken): removed functions.
5959 (GetPSSizes): use ifs >> string instead of NextToken.
5961 * src/Painter.[Ch]: the color cache moved out of this file.
5963 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5966 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5969 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5971 * src/BufferView.C (enterView): new func
5972 (leaveView): new func
5974 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5976 (leaveView): new func, undefines xterm cursor when approp.
5978 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5979 (AllowInput): delete the Workarea cursor handling from this func.
5981 * src/Painter.C (underline): draw a slimer underline in most cases.
5983 * src/lyx_main.C (error_handler): use extern "C"
5985 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5987 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5988 sent directly to me.
5990 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5991 to the list by Dekel.
5993 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5996 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5997 methods from lyx_cb.here.
5999 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6002 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6004 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6005 instead of using current_view directly.
6007 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6009 * src/LyXAction.C (init): add the paragraph-spacing command.
6011 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6013 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6015 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6016 different from the documents.
6018 * src/text.C (SetHeightOfRow): take paragraph spacing into
6019 account, paragraph spacing takes precedence over buffer spacing
6020 (GetVisibleRow): ditto
6022 * src/paragraph.C (writeFile): output the spacing parameter too.
6023 (validate): set the correct features if spacing is used in the
6025 (Clear): set spacing to default
6026 (MakeSameLayout): spacing too
6027 (HasSameLayout): spacing too
6028 (SetLayout): spacing too
6029 (TeXOnePar): output the spacing commands
6031 * src/lyxparagraph.h: added a spacing variable for use with
6032 per-paragraph spacing.
6034 * src/Spacing.h: add a Default spacing and a method to check if
6035 the current spacing is default. also added an operator==
6037 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6040 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6042 * src/lyxserver.C (callback): fix dispatch of functions
6044 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6045 printf() into lyxerr call.
6047 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6050 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6051 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6052 the "Float" from each of the subitems.
6053 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6055 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6056 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6057 documented the change so that the workaround can be nuked later.
6059 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6062 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6064 * src/buffer.C (getLatexName): ditto
6065 (setReadonly): ditto
6067 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6069 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6070 avoid some uses of current_view. Added also a bufferParams()
6071 method to get at this.
6073 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6075 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/lyxparagraph.[Ch]: removed
6078 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6079 with operators used by lower_bound and
6080 upper_bound in InsetTable's
6081 Make struct InsetTable private again. Used matchpos.
6083 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6085 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6086 document, the language of existing text is changed (unless the
6087 document is multi-lingual)
6089 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6091 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6093 * A lot of files: A rewrite of the Right-to-Left support.
6095 2000-04-10 Juergen Vigna <jug@sad.it>
6097 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6098 misplaced cursor when inset in inset is locked.
6100 * src/insets/insettext.C (LocalDispatch): small fix so that a
6101 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6103 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6104 footnote font should be decreased in size twice when displaying.
6106 * src/insets/insettext.C (GetDrawFont): inserted this function as
6107 the drawing-font may differ from the real paragraph font.
6109 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6110 insets (inset in inset!).
6112 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6113 function here because we don't want footnotes inside footnotes.
6115 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6117 (init): now set the inset_owner in paragraph.C
6118 (LocalDispatch): added some resetPos() in the right position
6121 (pasteSelection): changed to use the new CutAndPaste-Class.
6123 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6124 which tells if it is allowed to insert another inset inside this one.
6126 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6127 SwitchLayoutsBetweenClasses.
6129 * src/text2.C (InsertInset): checking of the new paragraph-function
6131 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6132 is not needed anymore here!
6135 (PasteSelection): redone (also with #ifdef) so that now this uses
6136 the CutAndPaste-Class.
6137 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6140 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6141 from/to text/insets.
6143 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6144 so that the paragraph knows if it is inside an (text)-inset.
6145 (InsertFromMinibuffer): changed return-value to bool as now it
6146 may happen that an inset is not inserted in the paragraph.
6147 (InsertInsetAllowed): this checks if it is allowed to insert an
6148 inset in this paragraph.
6150 (BreakParagraphConservative):
6151 (BreakParagraph) : small change for the above change of the return
6152 value of InsertFromMinibuffer.
6154 * src/lyxparagraph.h: added inset_owner and the functions to handle
6155 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6157 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6159 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6160 functions from BufferView to BufferView::Pimpl to ease maintence.
6162 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6163 correctly. Also use SetCursorIntern instead of SetCursor.
6165 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6168 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6170 * src/WorkArea.C (belowMouse): manually implement below mouse.
6172 * src/*: Add "explicit" on several constructors, I added probably
6173 some unneeded ones. A couple of changes to code because of this.
6175 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6176 implementation and private parts from the users of BufferView. Not
6179 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6180 implementation and private parts from the users of LyXLex. Not
6183 * src/BufferView_pimpl.[Ch]: new files
6185 * src/lyxlex_pimpl.[Ch]: new files
6187 * src/LyXView.[Ch]: some inline functions move out-of-line
6189 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * src/lyxparagraph.h: make struct InsetTable public.
6193 * src/support/lyxstring.h: change lyxstring::difference_type to be
6194 ptrdiff_t. Add std:: modifiers to streams.
6196 * src/font.C: include the <cctype> header, for islower() and
6199 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6201 * src/font.[Ch]: new files. Contains the metric functions for
6202 fonts, takes a LyXFont as parameter. Better separation of concepts.
6204 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6205 changes because of this.
6207 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6209 * src/*: compile with -Winline and move functions that don't
6212 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6215 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6217 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6218 (various files changed because of this)
6220 * src/Painter.C (text): fixed the drawing of smallcaps.
6222 * src/lyxfont.[Ch] (drawText): removed unused member func.
6225 * src/*.C: added needed "using" statements and "std::" qualifiers.
6227 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/*.h: removed all use of "using" from header files use
6230 qualifier std:: instead.
6232 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6234 * src/text.C (Backspace): some additional cleanups (we already
6235 know whether cursor.pos is 0 or not).
6237 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6238 automake does not provide one).
6240 * src/bmtable.h: replace C++ comments with C comments.
6242 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6244 * src/screen.C (ShowCursor): Change the shape of the cursor if
6245 the current language is not equal to the language of the document.
6246 (If the cursor change its shape unexpectedly, then you've found a bug)
6248 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6251 * src/insets/insetnumber.[Ch]: New files.
6253 * src/LyXAction.C (init)
6254 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6257 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6259 * src/lyxparagraph.h
6260 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6261 (the vector is kept sorted).
6263 * src/text.C (GetVisibleRow): Draw selection correctly when there
6264 is both LTR and RTL text.
6266 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6267 which is much faster.
6269 * src/text.C (GetVisibleRow and other): Do not draw the last space
6270 in a row if the direction of the last letter is not equal to the
6271 direction of the paragraph.
6273 * src/lyxfont.C (latexWriteStartChanges):
6274 Check that font language is not equal to basefont language.
6275 (latexWriteEndChanges): ditto
6277 * src/lyx_cb.C (StyleReset): Don't change the language while using
6278 the font-default command.
6280 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6281 empty paragraph before a footnote.
6283 * src/insets/insetcommand.C (draw): Increase x correctly.
6285 * src/screen.C (ShowCursor): Change cursor shape if
6286 current language != document language.
6288 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6290 2000-03-31 Juergen Vigna <jug@sad.it>
6292 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6293 (Clone): changed mode how the paragraph-data is copied to the
6294 new clone-paragraph.
6296 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6297 GetInset(pos) with no inset anymore there (in inset UNDO)
6299 * src/insets/insetcommand.C (draw): small fix as here x is
6300 incremented not as much as width() returns (2 before, 2 behind = 4)
6302 2000-03-30 Juergen Vigna <jug@sad.it>
6304 * src/insets/insettext.C (InsetText): small fix in initialize
6305 widthOffset (should not be done in the init() function)
6307 2000-03-29 Amir Karger <karger@lyx.org>
6309 * lib/examples/it_ItemizeBullets.lyx: translation by
6312 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6314 2000-03-29 Juergen Vigna <jug@sad.it>
6316 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6318 * src/insets/insetfoot.C (Clone): small change as for the below
6319 new init function in the text-inset
6321 * src/insets/insettext.C (init): new function as I've seen that
6322 clone did not copy the Paragraph-Data!
6323 (LocalDispatch): Added code so that now we have some sort of Undo
6324 functionality (well actually we HAVE Undo ;)
6326 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6328 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6330 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6333 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6335 * src/main.C: added a runtime check that verifies that the xforms
6336 header used when building LyX and the library used when running
6337 LyX match. Exit with a message if they don't match. This is a
6338 version number check only.
6340 * src/buffer.C (save): Don't allocate memory on the heap for
6341 struct utimbuf times.
6343 * *: some using changes, use iosfwd instead of the real headers.
6345 * src/lyxfont.C use char const * instead of string for the static
6346 strings. Rewrite some functions to use sstream.
6348 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6353 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6355 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6356 of Geodesy (from Martin Vermeer)
6358 * lib/layouts/svjour.inc: include file for the Springer svjour
6359 class. It can be used to support journals other than JoG.
6361 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6362 Miskiewicz <misiek@pld.org.pl>)
6363 * lib/reLyX/Makefile.am: ditto.
6365 2000-03-27 Juergen Vigna <jug@sad.it>
6367 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6368 also some modifications with operations on selected text.
6370 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6371 problems with clicking on insets (last famous words ;)
6373 * src/insets/insetcommand.C (draw):
6374 (width): Changed to have a bit of space before and after the inset so
6375 that the blinking cursor can be seen (otherwise it was hidden)
6377 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6379 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6380 would not be added to the link list when an installed gettext (not
6381 part of libc) is found.
6383 2000-03-24 Juergen Vigna <jug@sad.it>
6385 * src/insets/insetcollapsable.C (Edit):
6386 * src/mathed/formula.C (InsetButtonRelease):
6387 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6390 * src/BufferView.C (workAreaButtonPress):
6391 (workAreaButtonRelease):
6392 (checkInsetHit): Finally fixed the clicking on insets be handled
6395 * src/insets/insetert.C (Edit): inserted this call so that ERT
6396 insets work always with LaTeX-font
6398 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6400 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6401 caused lyx to startup with no GUI in place, causing in a crash
6402 upon startup when called with arguments.
6404 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6406 * src/FontLoader.C: better initialization of dummyXFontStruct.
6408 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6410 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6411 for linuxdoc and docbook import and export format options.
6413 * lib/lyxrc.example Example of default values for the previous flags.
6415 * src/lyx_cb.C Use those flags instead of the hardwired values for
6416 linuxdoc and docbook export.
6418 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6421 * src/menus.C Added menus entries for the new import/exports formats.
6423 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6425 * src/lyxrc.*: Added support for running without Gui
6428 * src/FontLoader.C: sensible defaults if no fonts are needed
6430 * src/lyx_cb.C: New function ShowMessage (writes either to the
6431 minibuffer or cout in case of no gui
6432 New function AskOverwrite for common stuff
6433 Consequently various changes to call these functions
6435 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6436 wild guess at sensible screen resolution when having no gui
6438 * src/lyxfont.C: no gui, no fonts... set some defaults
6440 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6442 * src/LColor.C: made the command inset background a bit lighter.
6444 2000-03-20 Hartmut Goebel <goebel@noris.net>
6446 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6447 stdstruct.inc. Koma-Script added some title elements which
6448 otherwise have been listed below "bibliography". This split allows
6449 adding title elements to where they belong.
6451 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6452 define the additional tilte elements and then include
6455 * many other layout files: changed to include stdtitle.inc just
6456 before stdstruct.inc.
6458 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6460 * src/buffer.C: (save) Added the option to store all backup files
6461 in a single directory
6463 * src/lyxrc.[Ch]: Added variable \backupdir_path
6465 * lib/lyxrc.example: Added descriptions of recently added variables
6467 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6468 bibtex inset, not closing the bibtex popup when deleting the inset)
6470 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6472 * src/lyx_cb.C: add a couple using directives.
6474 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6475 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6476 import based on the filename.
6478 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6479 file would be imported at start, if the filename where of a sgml file.
6481 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6483 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6485 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6486 * src/lyxfont.h Replaced the member variable bits.direction by the
6487 member variable lang. Made many changes in other files.
6488 This allows having a multi-lingual document
6490 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6491 that change the current language to <l>.
6492 Removed the command "font-rtl"
6494 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6495 format for Hebrew documents)
6497 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6498 When auto_mathmode is "true", pressing a digit key in normal mode
6499 will cause entering into mathmode.
6500 If auto_mathmode is "rtl" then this behavior will be active only
6501 when writing right-to-left text.
6503 * src/text2.C (InsertStringA) The string is inserted using the
6506 * src/paragraph.C (GetEndLabel) Gives a correct result for
6507 footnote paragraphs.
6509 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6511 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6513 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6514 front of PasteParagraph. Never insert a ' '. This should at least
6515 fix some cause for the segfaults that we have been experiencing,
6516 it also fixes backspace behaviour slightly. (Phu!)
6518 * src/support/lstrings.C (compare_no_case): some change to make it
6519 compile with gcc 2.95.2 and stdlibc++-v3
6521 * src/text2.C (MeltFootnoteEnvironment): change type o
6522 first_footnote_par_is_not_empty to bool.
6524 * src/lyxparagraph.h: make text private. Changes in other files
6526 (fitToSize): new function
6527 (setContentsFromPar): new function
6528 (clearContents): new function
6529 (SetChar): new function
6531 * src/paragraph.C (readSimpleWholeFile): deleted.
6533 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6534 the file, just use a simple string instead. Also read the file in
6535 a more maintainable manner.
6537 * src/text2.C (InsertStringA): deleted.
6538 (InsertStringB): deleted.
6540 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6542 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6543 RedoParagraphs from the doublespace handling part, just set status
6544 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6545 done, but perhaps not like this.)
6547 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6549 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6550 character when inserting an inset.
6552 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6554 * src/bufferparams.C (readLanguage): now takes "default" into
6557 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6558 also initialize the toplevel_keymap with the default bindings from
6561 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6563 * all files using lyxrc: have lyxrc as a real variable and not a
6564 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6567 * src/lyxrc.C: remove double call to defaultKeyBindings
6569 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6570 toolbar defauls using lyxlex. Remove enums, structs, functions
6573 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6574 toolbar defaults. Also store default keybindings in a map.
6576 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6577 storing the toolbar defaults without any xforms dependencies.
6579 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6580 applied. Changed to use iterators.
6582 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6584 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6585 systems that don't have LINGUAS set to begin with.
6587 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6589 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6590 the list by Dekel Tsur.
6592 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6594 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6595 * src/insets/form_graphics.C: ditto.
6597 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6599 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * src/bufferparams.C (readLanguage): use the new language map
6603 * src/intl.C (InitKeyMapper): use the new language map
6605 * src/lyx_gui.C (create_forms): use the new language map
6607 * src/language.[Ch]: New files. Used for holding the information
6608 about each language. Now! Use this new language map enhance it and
6609 make it really usable for our needs.
6611 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6613 * screen.C (ShowCursor): Removed duplicate code.
6614 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6615 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6617 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6620 * src/text.C Added TransformChar method. Used for rendering Arabic
6621 text correctly (change the glyphs of the letter according to the
6622 position in the word)
6627 * src/lyxrc.C Added lyxrc command {language_command_begin,
6628 language_command_end,language_command_ltr,language_command_rtl,
6629 language_package} which allows the use of either arabtex or Omega
6632 * src/lyx_gui.C (init)
6634 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6635 to use encoding for menu fonts which is different than the encoding
6638 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6639 do not load the babel package.
6640 To write an English document with Hebrew/Arabic, change the document
6641 language to "english".
6643 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6644 (alphaCounter): changed to return char
6645 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6647 * lib/lyxrc.example Added examples for Hebrew/Arabic
6650 * src/layout.C Added layout command endlabeltype
6652 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6654 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6656 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6658 * src/mathed/math_delim.C (search_deco): return a
6659 math_deco_struct* instead of index.
6661 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6663 * All files with a USE_OSTREAM_ONLY within: removed all code that
6664 was unused when USE_OSTREAM_ONLY is defined.
6666 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6667 of any less. Removed header and using.
6669 * src/text.C (GetVisibleRow): draw the string "Page Break
6670 (top/bottom)" on screen when drawing a pagebreak line.
6672 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6674 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6676 * src/mathed/math_macro.C (draw): do some cast magic.
6679 * src/mathed/math_defs.h: change byte* argument to byte const*.
6681 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6683 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6684 know it is right to return InsetFoot* too, but cxx does not like
6687 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6689 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6691 * src/mathed/math_delim.C: change == to proper assignment.
6693 2000-03-09 Juergen Vigna <jug@sad.it>
6695 * src/insets/insettext.C (setPos): fixed various cursor positioning
6696 problems (via mouse and cursor-keys)
6697 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6698 inset (still a small display problem but it works ;)
6700 * src/insets/insetcollapsable.C (draw): added button_top_y and
6701 button_bottom_y to have correct values for clicking on the inset.
6703 * src/support/lyxalgo.h: commented out 'using std::less'
6705 2000-03-08 Juergen Vigna <jug@sad.it>
6707 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6708 Button-Release event closes as it is alos the Release-Event
6711 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6713 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6715 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6716 can add multiple spaces in Scrap (literate programming) styles...
6717 which, by the way, is how I got hooked on LyX to begin with.
6719 * src/mathed/formula.C (Write): Added dummy variable to an
6720 inset::Latex() call.
6721 (Latex): Add free_spacing boolean to inset::Latex()
6723 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6725 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6726 virtual function to include the free_spacing boolean from
6727 the containing paragraph's style.
6729 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6730 Added free_spacing boolean arg to match inset.h
6732 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6733 Added free_spacing boolean arg to match inset.h
6735 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6736 Added free_spacing boolean and made sure that if in a free_spacing
6737 paragraph, that we output normal space if there is a protected space.
6739 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6740 Added free_spacing boolean arg to match inset.h
6742 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6743 Added free_spacing boolean arg to match inset.h
6745 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6746 Added free_spacing boolean arg to match inset.h
6748 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6749 Added free_spacing boolean arg to match inset.h
6751 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6752 Added free_spacing boolean arg to match inset.h
6754 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6755 free_spacing boolean arg to match inset.h
6757 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6758 Added free_spacing boolean arg to match inset.h
6760 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6761 Added free_spacing boolean arg to match inset.h
6763 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6764 Added free_spacing boolean arg to match inset.h
6766 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6767 Added free_spacing boolean arg to match inset.h
6769 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6770 Added free_spacing boolean arg to match inset.h
6772 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6773 free_spacing boolean arg to match inset.h
6775 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6776 free_spacing boolean arg to match inset.h
6778 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6779 ignore free_spacing paragraphs. The user's spaces are left
6782 * src/text.C (InsertChar): Fixed the free_spacing layout
6783 attribute behavior. Now, if free_spacing is set, you can
6784 add multiple spaces in a paragraph with impunity (and they
6785 get output verbatim).
6786 (SelectSelectedWord): Added dummy argument to inset::Latex()
6789 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6792 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6793 paragraph layouts now only input a simple space instead.
6794 Special character insets don't make any sense in free-spacing
6797 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6798 hard-spaces in the *input* file to simple spaces if the layout
6799 is free-spacing. This converts old files which had to have
6800 hard-spaces in free-spacing layouts where a simple space was
6802 (writeFileAscii): Added free_spacing check to pass to the newly
6803 reworked inset::Latex(...) methods. The inset::Latex() code
6804 ensures that hard-spaces in free-spacing paragraphs get output
6805 as spaces (rather than "~").
6807 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6809 * src/mathed/math_delim.C (draw): draw the empty placeholder
6810 delims with a onoffdash line.
6811 (struct math_deco_compare): struct that holds the "functors" used
6812 for the sort and the binary search in math_deco_table.
6813 (class init_deco_table): class used for initial sort of the
6815 (search_deco): use lower_bound to do a binary search in the
6818 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6820 * src/lyxrc.C: a small secret thingie...
6822 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6823 and to not flush the stream as often as it used to.
6825 * src/support/lyxalgo.h: new file
6826 (sorted): template function used for checking if a sequence is
6827 sorted or not. Two versions with and without user supplied
6828 compare. Uses same compare as std::sort.
6830 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6831 it and give warning on lyxerr.
6833 (struct compare_tags): struct with function operators used for
6834 checking if sorted, sorting and lower_bound.
6835 (search_kw): use lower_bound instead of manually implemented
6838 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6840 * src/insets/insetcollapsable.h: fix Clone() declaration.
6841 * src/insets/insetfoot.h: ditto.
6843 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6845 2000-03-08 Juergen Vigna <jug@sad.it>
6847 * src/insets/lyxinset.h: added owner call which tells us if
6848 this inset is inside another inset. Changed also the return-type
6849 of Editable to an enum so it tells clearer what the return-value is.
6851 * src/insets/insettext.C (computeTextRows): fixed computing of
6852 textinsets which split automatically on more rows.
6854 * src/insets/insetert.[Ch]: changed this to be of BaseType
6857 * src/insets/insetfoot.[Ch]: added footnote inset
6859 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6860 collapsable insets (like footnote, ert, ...)
6862 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * src/lyxdraw.h: remvoe file
6866 * src/lyxdraw.C: remove file
6868 * src/insets/insettext.C: added <algorithm>.
6870 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6872 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6873 (matrix_cb): case MM_OK use string stream
6875 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6878 * src/mathed/math_macro.C (draw): use string stream
6879 (Metrics): use string stream
6881 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6882 directly to the ostream.
6884 * src/vspace.C (asString): use string stream.
6885 (asString): use string stream
6886 (asLatexString): use string stream
6888 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6889 setting Spacing::Other.
6891 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6892 sprintf when creating the stretch vale.
6894 * src/text2.C (alphaCounter): changed to return a string and to
6895 not use a static variable internally. Also fixed a one-off bug.
6896 (SetCounter): changed the drawing of the labels to use string
6897 streams instead of sprintf.
6899 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6900 manipulator to use a scheme that does not require library support.
6901 This is also the way it is done in the new GNU libstdc++. Should
6902 work with DEC cxx now.
6904 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6906 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6907 end. This fixes a bug.
6909 * src/mathed (all files concerned with file writing): apply the
6910 USE_OSTREAM_ONLY changes to mathed too.
6912 * src/support/DebugStream.h: make the constructor explicit.
6914 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6915 count and ostream squashed.
6917 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6919 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6921 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6922 ostringstream uses STL strings, and we might not.
6924 * src/insets/insetspecialchar.C: add using directive.
6925 * src/insets/insettext.C: ditto.
6927 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6929 * lib/layouts/seminar.layout: feeble attempt at a layout for
6930 seminar.cls, far from completet and could really use some looking
6931 at from people used to write layout files.
6933 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6934 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6935 a lot nicer and works nicely with ostreams.
6937 * src/mathed/formula.C (draw): a slightly different solution that
6938 the one posted to the list, but I think this one works too. (font
6939 size wrong in headers.)
6941 * src/insets/insettext.C (computeTextRows): some fiddling on
6942 Jürgens turf, added some comments that he should read.
6944 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6945 used and it gave compiler warnings.
6946 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6949 * src/lyx_gui.C (create_forms): do the right thing when
6950 show_banner is true/false.
6952 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6953 show_banner is false.
6955 * most file writing files: Now use iostreams to do almost all of
6956 the writing. Also instead of passing string &, we now use
6957 stringstreams. mathed output is still not adapted to iostreams.
6958 This change can be turned off by commenting out all the occurences
6959 of the "#define USE_OSTREAM_ONLY 1" lines.
6961 * src/WorkArea.C (createPixmap): don't output debug messages.
6962 (WorkArea): don't output debug messages.
6964 * lib/lyxrc.example: added a comment about the new variable
6967 * development/Code_rules/Rules: Added some more commente about how
6968 to build class interfaces and on how better encapsulation can be
6971 2000-03-03 Juergen Vigna <jug@sad.it>
6973 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6974 automatically with the width of the LyX-Window
6976 * src/insets/insettext.C (computeTextRows): fixed update bug in
6977 displaying text-insets (scrollvalues where not initialized!)
6979 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6981 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6982 id in the check of the result from lower_bound is not enough since
6983 lower_bound can return last too, and then res->id will not be a
6986 * all insets and some code that use them: I have conditionalized
6987 removed the Latex(string & out, ...) this means that only the
6988 Latex(ostream &, ...) will be used. This is a work in progress to
6989 move towards using streams for all output of files.
6991 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6994 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6996 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6997 routine (this fixes bug where greek letters were surrounded by too
7000 * src/support/filetools.C (findtexfile): change a bit the search
7001 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7002 no longer passed to kpsewhich, we may have to change that later.
7004 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7005 warning options to avoid problems with X header files (from Angus
7007 * acinclude.m4: regenerated.
7009 2000-03-02 Juergen Vigna <jug@sad.it>
7011 * src/insets/insettext.C (WriteParagraphData): Using the
7012 par->writeFile() function for writing paragraph-data.
7013 (Read): Using buffer->parseSingleLyXformat2Token()-function
7014 for parsing paragraph data!
7016 * src/buffer.C (readLyXformat2): removed all parse data and using
7017 the new parseSingleLyXformat2Token()-function.
7018 (parseSingleLyXformat2Token): added this function to parse (read)
7019 lyx-file-format (this is called also from text-insets now!)
7021 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7023 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7026 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7027 directly instead of going through a func. One very bad thing: a
7028 static LyXFindReplace, but I don't know where to place it.
7030 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7031 string instead of char[]. Also changed to static.
7032 (GetSelectionOrWordAtCursor): changed to static inline
7033 (SetSelectionOverLenChars): ditto.
7035 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7036 current_view and global variables. both classes has changed names
7037 and LyXFindReplace is not inherited from SearchForm.
7039 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7040 fl_form_search form.
7042 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7044 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7046 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7047 bound (from Kayvan).
7049 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7051 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7053 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7055 * some things that I should comment but the local pub says head to
7058 * comment out all code that belongs to the Roff code for Ascii
7059 export of tables. (this is unused)
7061 * src/LyXView.C: use correct type for global variable
7062 current_layout. (LyXTextClass::size_type)
7064 * some code to get the new insetgraphics closer to working I'd be
7065 grateful for any help.
7067 * src/BufferView2.C (insertInset): use the return type of
7068 NumberOfLayout properly. (also changes in other files)
7070 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7071 this as a test. I want to know what breaks because of this.
7073 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7075 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7077 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7078 to use a \makebox in the label, this allows proper justification
7079 with out using protected spaces or multiple hfills. Now it is
7080 "label" for left justified, "\hfill label\hfill" for center, and
7081 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7082 should be changed accordingly.
7084 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7086 * src/lyxtext.h: change SetLayout() to take a
7087 LyXTextClass::size_type instead of a char (when there is more than
7088 127 layouts in a class); also change type of copylayouttype.
7089 * src/text2.C (SetLayout): ditto.
7090 * src/LyXView.C (updateLayoutChoice): ditto.
7092 * src/LaTeX.C (scanLogFile): errors where the line number was not
7093 given just after the '!'-line were ignored (from Dekel Tsur).
7095 * lib/lyxrc.example: fix description of \date_insert_format
7097 * lib/layouts/llncs.layout: new layout, contributed by Martin
7100 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7102 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7103 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7104 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7105 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7106 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7107 paragraph.C, text.C, text2.C)
7109 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * src/insets/insettext.C (LocalDispatch): remove extra break
7114 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7115 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7117 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7118 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7120 * src/insets/insetbib.h: move InsetBibkey::Holder and
7121 InsetCitation::Holder in public space.
7123 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7125 * src/insets/insettext.h: small change to get the new files from
7126 Juergen to compile (use "string", not "class string").
7128 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7129 const & as parameter to LocalDispatch, use LyXFont const & as
7130 paramter to some other func. This also had impacto on lyxinsets.h
7131 and the two mathed insets.
7133 2000-02-24 Juergen Vigna <jug@sad.it>
7136 * src/commandtags.h:
7138 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7142 * src/BufferView2.C: added/updated code for various inset-functions
7144 * src/insets/insetert.[Ch]: added implementation of InsetERT
7146 * src/insets/insettext.[Ch]: added implementation of InsetText
7148 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7149 (draw): added preliminary code for inset scrolling not finshed yet
7151 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7152 as it is in lyxfunc.C now
7154 * src/insets/lyxinset.h: Added functions for text-insets
7156 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7158 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7159 BufferView and reimplement the list as a queue put inside its own
7162 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7164 * several files: use the new interface to the "updateinsetlist"
7166 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7168 (work_area_handler): call BufferView::trippleClick on trippleclick.
7170 * src/BufferView.C (doubleClick): new function, selects word on
7172 (trippleClick): new function, selects line on trippleclick.
7174 2000-02-22 Allan Rae <rae@lyx.org>
7176 * lib/bind/xemacs.bind: buffer-previous not supported
7178 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7180 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7183 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * src/bufferlist.C: get rid of current_view from this file
7187 * src/spellchecker.C: get rid of current_view from this file
7189 * src/vspace.C: get rid of current_view from this file
7190 (inPixels): added BufferView parameter for this func
7191 (asLatexCommand): added a BufferParams for this func
7193 * src/text.C src/text2.C: get rid of current_view from these
7196 * src/lyxfont.C (getFontDirection): move this function here from
7199 * src/bufferparams.C (getDocumentDirection): move this function
7202 * src/paragraph.C (getParDirection): move this function here from
7204 (getLetterDirection): ditto
7206 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7208 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7209 resize due to wrong pixmap beeing used. Also took the opurtunity
7210 to make the LyXScreen stateless on regard to WorkArea and some
7211 general cleanup in the same files.
7213 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7215 * src/Makefile.am: add missing direction.h
7217 * src/PainterBase.h: made the width functions const.
7219 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7222 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7224 * src/insets/insetlatexaccent.C (draw): make the accents draw
7225 better, at present this will only work well with iso8859-1.
7227 * several files: remove the old drawing code, now we use the new
7230 * several files: remove support for mono_video, reverse_video and
7233 2000-02-17 Juergen Vigna <jug@sad.it>
7235 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7236 int ** as we have to return the pointer, otherwise we have only
7237 NULL pointers in the returning function.
7239 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7241 * src/LaTeX.C (operator()): quote file name when running latex.
7243 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7245 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7246 (bubble tip), this removes our special handling of this.
7248 * Remove all code that is unused now that we have the new
7249 workarea. (Code that are not active when NEW_WA is defined.)
7251 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7253 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7255 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7256 nonexisting layout; correctly redirect obsoleted layouts.
7258 * lib/lyxrc.example: document \view_dvi_paper_option
7260 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7263 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7264 (PreviewDVI): handle the view_dvi_paper_option variable.
7265 [Both from Roland Krause]
7267 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7269 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7270 char const *, int, LyXFont)
7271 (text(int, int, string, LyXFont)): ditto
7273 * src/text.C (InsertCharInTable): attempt to fix the double-space
7274 feature in tables too.
7275 (BackspaceInTable): ditto.
7276 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7278 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7280 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7282 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7283 newly found text in textcache to this.
7284 (buffer): set the owner of the text put into the textcache to 0
7286 * src/insets/figinset.C (draw): fixed the drawing of figures with
7289 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7290 drawing of mathframe, hfills, protected space, table lines. I have
7291 now no outstanding drawing problems with the new Painter code.
7293 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7295 * src/PainterBase.C (ellipse, circle): do not specify the default
7298 * src/LColor.h: add using directive.
7300 * src/Painter.[Ch]: change return type of methods from Painter& to
7301 PainterBase&. Add a using directive.
7303 * src/WorkArea.C: wrap xforms callbacks in C functions
7306 * lib/layouts/foils.layout: font fix and simplifications from Carl
7309 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * a lot of files: The Painter, LColor and WorkArea from the old
7312 devel branch has been ported to lyx-devel. Some new files and a
7313 lot of #ifdeffed code. The new workarea is enabled by default, but
7314 if you want to test the new Painter and LColor you have to compile
7315 with USE_PAINTER defined (do this in config.h f.ex.) There are
7316 still some rought edges, and I'd like some help to clear those
7317 out. It looks stable (loads and displays the Userguide very well).
7320 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7322 * src/buffer.C (pop_tag): revert to the previous implementation
7323 (use a global variable for both loops).
7325 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7327 * src/lyxrc.C (LyXRC): change slightly default date format.
7329 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7330 there is an English text with a footnote that starts with a Hebrew
7331 paragraph, or vice versa.
7332 (TeXFootnote): ditto.
7334 * src/text.C (LeftMargin): allow for negative values for
7335 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7338 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7339 for input encoding (cyrillic)
7341 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7343 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7346 * src/toolbar.C (set): ditto
7347 * src/insets/insetbib.C (create_form_citation_form): ditto
7349 * lib/CREDITS: added Dekel Tsur.
7351 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7352 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7353 hebrew supports files from Dekel Tsur.
7355 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7356 <tzafrir@technion.ac.il>
7358 * src/lyxrc.C: put \date_insert_format at the right place.
7360 * src/buffer.C (makeLaTeXFile): fix the handling of
7361 BufferParams::sides when writing out latex files.
7363 * src/BufferView2.C: add a "using" directive.
7365 * src/support/lyxsum.C (sum): when we use lyxstring,
7366 ostringstream::str needs an additional .c_str().
7368 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7370 * src/support/filetools.C (ChangeExtension): patch from Etienne
7373 * src/TextCache.C (show): remove const_cast and make second
7374 parameter non-const LyXText *.
7376 * src/TextCache.h: use non const LyXText in show.
7378 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7381 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/support/lyxsum.C: rework to be more flexible.
7385 * several places: don't check if a pointer is 0 if you are going
7388 * src/text.C: remove some dead code.
7390 * src/insets/figinset.C: remove some dead code
7392 * src/buffer.C: move the BufferView funcs to BufferView2.C
7393 remove all support for insetlatexdel
7394 remove support for oldpapersize stuff
7395 made some member funcs const
7397 * src/kbmap.C: use a std::list to store the bindings in.
7399 * src/BufferView2.C: new file
7401 * src/kbsequence.[Ch]: new files
7403 * src/LyXAction.C + others: remove all trace of buffer-previous
7405 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7406 only have one copy in the binary of this table.
7408 * hebrew patch: moved some functions from LyXText to more
7409 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7411 * several files: remove support for XForms older than 0.88
7413 remove some #if 0 #endif code
7415 * src/TextCache.[Ch]: new file. Holds the textcache.
7417 * src/BufferView.C: changes to use the new TextCache interface.
7418 (waitForX): remove the now unused code.
7420 * src/BackStack.h: remove some commented code
7422 * lib/bind/emacs.bind: remove binding for buffer-previous
7424 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7426 * applied the hebrew patch.
7428 * src/lyxrow.h: make sure that all Row variables are initialized.
7430 * src/text2.C (TextHandleUndo): comment out a delete, this might
7431 introduce a memory leak, but should also help us to not try to
7432 read freed memory. We need to look at this one.
7434 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7435 (LyXParagraph): initalize footnotekind.
7437 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7438 forgot this when applying the patch. Please heed the warnings.
7440 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7441 (aka. reformat problem)
7443 * src/bufferlist.C (exists): made const, and use const_iterator
7444 (isLoaded): new func.
7445 (release): use std::find to find the correct buffer.
7447 * src/bufferlist.h: made getState a const func.
7448 made empty a const func.
7449 made exists a const func.
7452 2000-02-01 Juergen Vigna <jug@sad.it>
7454 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7456 * po/it.po: updated a bit the italian po file and also changed the
7457 'file nuovo' for newfile to 'filenuovo' without a space, this did
7460 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7461 for the new insert_date command.
7463 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7464 from jdblair, to insert a date into the current text conforming to
7465 a strftime format (for now only considering the locale-set and not
7466 the document-language).
7468 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7470 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7471 Bounds Read error seen by purify. The problem was that islower is
7472 a macros which takes an unsigned char and uses it as an index for
7473 in array of characters properties (and is thus subject to the
7477 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7478 correctly the paper sides radio buttons.
7479 (UpdateDocumentButtons): ditto.
7481 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7483 * src/kbmap.C (getsym + others): change to return unsigned int,
7484 returning a long can give problems on 64 bit systems. (I assume
7485 that int is 32bit on 64bit systems)
7487 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7489 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7490 LyXLookupString to be zero-terminated. Really fixes problems seen
7493 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7495 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7496 write a (char*)0 to the lyxerr stream.
7498 * src/lastfiles.C: move algorithm before the using statemets.
7500 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7502 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7503 complains otherwise).
7504 * src/table.C: ditto
7506 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7509 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7510 that I removed earlier... It is really needed.
7512 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7514 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7516 * INSTALL: update xforms home page URL.
7518 * lib/configure.m4: fix a bug with unreadable layout files.
7520 * src/table.C (calculate_width_of_column): add "using std::max"
7523 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * several files: marked several lines with "DEL LINE", this is
7526 lines that can be deleted without changing anything.
7527 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7528 checks this anyway */
7531 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7533 * src/DepTable.C (update): add a "+" at the end when the checksum
7534 is different. (debugging string only)
7536 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7537 the next inset to not be displayed. This should also fix the list
7538 of labels in the "Insert Crossreference" dialog.
7540 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7542 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7543 when regex was not found.
7545 * src/support/lstrings.C (lowercase): use handcoded transform always.
7548 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7549 old_cursor.par->prev could be 0.
7551 * several files: changed post inc/dec to pre inc/dec
7553 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7554 write the lastfiles to file.
7556 * src/BufferView.C (buffer): only show TextCache info when debugging
7558 (resizeCurrentBuffer): ditto
7559 (workAreaExpose): ditto
7561 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7563 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7565 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7566 a bit better by removing the special case for \i and \j.
7568 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7570 * src/lyx_main.C (easyParse): remove test for bad comand line
7571 options, since this broke all xforms-related parsing.
7573 * src/kbmap.C (getsym): set return type to unsigned long, as
7574 declared in header. On an alpha, long is _not_ the same as int.
7576 * src/support/LOstream.h: add a "using std::flush;"
7578 * src/insets/figinset.C: ditto.
7580 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7582 * src/bufferlist.C (write): use blinding fast file copy instead of
7583 "a char at a time", now we are doing it the C++ way.
7585 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7586 std::list<int> instead.
7587 (addpidwait): reflect move to std::list<int>
7588 (sigchldchecker): ditto
7590 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7593 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7594 that obviously was wrong...
7596 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7597 c, this avoids warnings with purify and islower.
7599 * src/insets/figinset.C: rename struct queue to struct
7600 queue_element and rewrite to use a std::queue. gsqueue is now a
7601 std::queue<queue_element>
7602 (runqueue): reflect move to std::queue
7605 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7606 we would get "1" "0" instead of "true" "false. Also make the tostr
7609 2000-01-21 Juergen Vigna <jug@sad.it>
7611 * src/buffer.C (writeFileAscii): Disabled code for special groff
7612 handling of tabulars till I fix this in table.C
7614 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7616 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7618 * src/support/lyxlib.h: ditto.
7620 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7622 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7623 and 'j' look better. This might fix the "macron" bug that has been
7626 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7627 functions as one template function. Delete the old versions.
7629 * src/support/lyxsum.C: move using std::ifstream inside
7632 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7635 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7637 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7639 * src/insets/figinset.C (InitFigures): use new instead of malloc
7640 to allocate memory for figures and bitmaps.
7641 (DoneFigures): use delete[] instead of free to deallocate memory
7642 for figures and bitmaps.
7643 (runqueue): use new to allocate
7644 (getfigdata): use new/delete[] instead of malloc/free
7645 (RegisterFigure): ditto
7647 * some files: moved some declarations closer to first use, small
7648 whitespace changes use preincrement instead of postincrement where
7649 it does not make a difference.
7651 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7652 step on the way to use stl::containers for key maps.
7654 * src/bufferlist.h: add a typedef for const_iterator and const
7655 versions of begin and end.
7657 * src/bufferlist.[Ch]: change name of member variable _state to
7658 state_. (avoid reserved names)
7660 (getFileNames): returns the filenames of the buffers in a vector.
7662 * configure.in (ALL_LINGUAS): added ro
7664 * src/support/putenv.C: new file
7666 * src/support/mkdir.C: new file
7668 2000-01-20 Allan Rae <rae@lyx.org>
7670 * lib/layouts/IEEEtran.layout: Added several theorem environments
7672 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7673 couple of minor additions.
7675 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7676 (except for those in footnotes of course)
7678 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7680 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7682 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7683 std::sort and std::lower_bound instead of qsort and handwritten
7685 (struct compara): struct that holds the functors used by std::sort
7686 and std::lower_bound in MathedLookupBOP.
7688 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7690 * src/support/LAssert.h: do not do partial specialization. We do
7693 * src/support/lyxlib.h: note that lyx::getUserName() and
7694 lyx::date() are not in use right now. Should these be suppressed?
7696 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7697 (makeLinuxDocFile): do not put date and user name in linuxdoc
7700 * src/support/lyxlib.h (kill): change first argument to long int,
7701 since that's what solaris uses.
7703 * src/support/kill.C (kill): fix declaration to match prototype.
7705 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7706 actually check whether namespaces are supported. This is not what
7709 * src/support/lyxsum.C: add a using directive.
7711 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7713 * src/support/kill.C: if we have namespace support we don't have
7714 to include lyxlib.h.
7716 * src/support/lyxlib.h: use namespace lyx if supported.
7718 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7720 * src/support/date.C: new file
7722 * src/support/chdir.C: new file
7724 * src/support/getUserName.C: new file
7726 * src/support/getcwd.C: new file
7728 * src/support/abort.C: new file
7730 * src/support/kill.C: new file
7732 * src/support/lyxlib.h: moved all the functions in this file
7733 insede struct lyx. Added also kill and abort to this struct. This
7734 is a way to avoid the "kill is not defined in <csignal>", we make
7735 C++ wrappers for functions that are not ANSI C or ANSI C++.
7737 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7738 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7739 lyx it has been renamed to sum.
7741 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7743 * src/text.C: add using directives for std::min and std::max.
7745 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7747 * src/texrow.C (getIdFromRow): actually return something useful in
7748 id and pos. Hopefully fixes the bug with positionning of errorbox
7751 * src/lyx_main.C (easyParse): output an error and exit if an
7752 incorrect command line option has been given.
7754 * src/spellchecker.C (ispell_check_word): document a memory leak.
7756 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7757 where a "struct utimbuf" is allocated with "new" and deleted with
7760 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7762 * src/text2.C (CutSelection): don't delete double spaces.
7763 (PasteSelection): ditto
7764 (CopySelection): ditto
7766 * src/text.C (Backspace): don't delete double spaces.
7768 * src/lyxlex.C (next): fix a bug that were only present with
7769 conformant std::istream::get to read comment lines, use
7770 std::istream::getline instead. This seems to fix the problem.
7772 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7774 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7775 allowed to insert space before space" editing problem. Please read
7776 commends at the beginning of the function. Comments about usage
7779 * src/text.C (InsertChar): fix for the "not allowed to insert
7780 space before space" editing problem.
7782 * src/text2.C (DeleteEmptyParagraphMechanism): when
7783 IsEmptyTableRow can only return false this last "else if" will
7784 always be a no-op. Commented out.
7786 * src/text.C (RedoParagraph): As far as I can understand tmp
7787 cursor is not really needed.
7789 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7790 present it could only return false anyway.
7791 (several functions): Did something not so smart...added a const
7792 specifier on a lot of methods.
7794 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7795 and add a tmp->text.resize. The LyXParagraph constructor does the
7797 (BreakParagraphConservative): ditto
7799 * src/support/path.h (Path): add a define so that the wrong usage
7800 "Path("/tmp") will be flagged as a compilation error:
7801 "`unnamed_Path' undeclared (first use this function)"
7803 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7805 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7806 which was bogus for several reasons.
7808 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7812 * autogen.sh: do not use "type -path" (what's that anyway?).
7814 * src/support/filetools.C (findtexfile): remove extraneous space
7815 which caused a kpsewhich warning (at least with kpathsea version
7818 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7820 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7822 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7824 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7826 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7828 * src/paragraph.C (BreakParagraph): do not reserve space on text
7829 if we don't need to (otherwise, if pos_end < pos, we end up
7830 reserving huge amounts of memory due to bad unsigned karma).
7831 (BreakParagraphConservative): ditto, although I have not seen
7832 evidence the bug can happen here.
7834 * src/lyxparagraph.h: add a using std::list.
7836 2000-01-11 Juergen Vigna <jug@sad.it>
7838 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7841 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/vc-backend.C (doVCCommand): change to be static and take one
7844 more parameter: the path to chdir too be fore executing the command.
7845 (retrive): new function equiv to "co -r"
7847 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7848 file_not_found_hook is true.
7850 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7852 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7853 if a file is readwrite,readonly...anything else.
7855 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7857 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7858 (CreatePostscript): name change from MenuRunDVIPS (or something)
7859 (PreviewPostscript): name change from MenuPreviewPS
7860 (PreviewDVI): name change from MenuPreviewDVI
7862 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7863 \view_pdf_command., \pdf_to_ps_command
7865 * lib/configure.m4: added search for PDF viewer, and search for
7866 PDF to PS converter.
7867 (lyxrc.defaults output): add \pdflatex_command,
7868 \view_pdf_command and \pdf_to_ps_command.
7870 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7872 * src/bufferlist.C (write): we don't use blocksize for anything so
7875 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7877 * src/support/block.h: disable operator T* (), since it causes
7878 problems with both compilers I tried. See comments in the file.
7880 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7883 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7884 variable LYX_DIR_10x to LYX_DIR_11x.
7886 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7888 * INSTALL: document --with-lyxname.
7891 * configure.in: new configure flag --with-lyxname which allows to
7892 choose the name under which lyx is installed. Default is "lyx", of
7893 course. It used to be possible to do this with --program-suffix,
7894 but the later has in fact a different meaning for autoconf.
7896 * src/support/lstrings.h (lstrchr): reformat a bit.
7898 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7899 * src/mathed/math_defs.h: ditto.
7901 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7903 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7904 true, decides if we create a backup file or not when saving. New
7905 tag and variable \pdf_mode, defaults to false. New tag and
7906 variable \pdflatex_command, defaults to pdflatex. New tag and
7907 variable \view_pdf_command, defaults to xpdf. New tag and variable
7908 \pdf_to_ps_command, defaults to pdf2ps.
7910 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7912 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7913 does not have a BufferView.
7914 (unlockInset): ditto + don't access the_locking_inset if the
7915 buffer does not have a BufferView.
7917 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7918 certain circumstances so that we don't continue a keyboard
7919 operation long after the key was released. Try f.ex. to load a
7920 large document, press PageDown for some seconds and then release
7921 it. Before this change the document would contine to scroll for
7922 some time, with this change it stops imidiatly.
7924 * src/support/block.h: don't allocate more space than needed. As
7925 long as we don't try to write to the arr[x] in a array_type arr[x]
7926 it is perfectly ok. (if you write to it you might segfault).
7927 added operator value_type*() so that is possible to pass the array
7928 to functions expecting a C-pointer.
7930 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7933 * intl/*: updated to gettext 0.10.35, tried to add our own
7934 required modifications. Please verify.
7936 * po/*: updated to gettext 0.10.35, tried to add our own required
7937 modifications. Please verify.
7939 * src/support/lstrings.C (tostr): go at fixing the problem with
7940 cxx and stringstream. When stringstream is used return
7941 oss.str().c_str() so that problems with lyxstring and basic_string
7942 are avoided. Note that the best solution would be for cxx to use
7943 basic_string all the way, but it is not conformant yet. (it seems)
7945 * src/lyx_cb.C + other files: moved several global functions to
7946 class BufferView, some have been moved to BufferView.[Ch] others
7947 are still located in lyx_cb.C. Code changes because of this. (part
7948 of "get rid of current_view project".)
7950 * src/buffer.C + other files: moved several Buffer functions to
7951 class BufferView, the functions are still present in buffer.C.
7952 Code changes because of this.
7954 * config/lcmessage.m4: updated to most recent. used when creating
7957 * config/progtest.m4: updated to most recent. used when creating
7960 * config/gettext.m4: updated to most recent. applied patch for
7963 * config/gettext.m4.patch: new file that shows what changes we
7964 have done to the local copy of gettext.m4.
7966 * config/libtool.m4: new file, used in creation of acinclude.m4
7968 * config/lyxinclude.m4: new file, this is the lyx created m4
7969 macros, used in making acinclude.m4.
7971 * autogen.sh: GNU m4 discovered as a separate task not as part of
7972 the lib/configure creation.
7973 Generate acinlucde from files in config. Actually cat
7974 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7975 easier to upgrade .m4 files that really are external.
7977 * src/Spacing.h: moved using std::istringstream to right after
7978 <sstream>. This should fix the problem seen with some compilers.
7980 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7982 * src/lyx_cb.C: began some work to remove the dependency a lot of
7983 functions have on BufferView::text, even if not really needed.
7984 (GetCurrentTextClass): removed this func, it only hid the
7987 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7988 forgot this in last commit.
7990 * src/Bullet.C (bulletEntry): use static char const *[] for the
7991 tables, becuase of this the return arg had to change to string.
7993 (~Bullet): removed unneeded destructor
7995 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7996 (insetSleep): moved from Buffer
7997 (insetWakeup): moved from Buffer
7998 (insetUnlock): moved from Buffer
8000 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8001 from Buffer to BufferView.
8003 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8005 * config/ltmain.sh: updated to version 1.3.4 of libtool
8007 * config/ltconfig: updated to version 1.3.4 of libtool
8009 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8012 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8013 Did I get that right?
8015 * src/lyxlex.h: add a "using" directive or two.
8016 * src/Spacing.h: ditto.
8017 * src/insets/figinset.C: ditto.
8018 * src/support/filetools.C: ditto.
8019 * src/support/lstrings.C: ditto.
8020 * src/BufferView.C: ditto.
8021 * src/bufferlist.C: ditto.
8022 * src/lyx_cb.C: ditto.
8023 * src/lyxlex.C: ditto.
8025 * NEWS: add some changes for 1.1.4.
8027 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8029 * src/BufferView.C: first go at a TextCache to speed up switching
8032 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8034 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8035 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8036 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8037 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8040 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8041 members of the struct are correctly initialized to 0 (detected by
8043 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8044 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8046 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8047 pidwait, since it was allocated with "new". This was potentially
8048 very bad. Thanks to Michael Schmitt for running purify for us.
8051 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8053 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8055 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8057 1999-12-30 Allan Rae <rae@lyx.org>
8059 * lib/templates/IEEEtran.lyx: minor change
8061 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8062 src/mathed/formula.C (LocalDispatch): askForText changes
8064 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8065 know when a user has cancelled input. Fixes annoying problems with
8066 inserting labels and version control.
8068 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * src/support/lstrings.C (tostr): rewritten to use strstream and
8073 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8075 * src/support/filetools.C (IsFileWriteable): use fstream to check
8076 (IsDirWriteable): use fileinfo to check
8078 * src/support/filetools.h (FilePtr): whole class deleted
8080 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8082 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8084 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8086 * src/bufferlist.C (write): use ifstream and ofstream instead of
8089 * src/Spacing.h: use istrstream instead of sscanf
8091 * src/mathed/math_defs.h: change first arg to istream from FILE*
8093 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8095 * src/mathed/math_parser.C: have yyis to be an istream
8096 (LexGetArg): use istream (yyis)
8098 (mathed_parse): ditto
8099 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8101 * src/mathed/formula.C (Read): rewritten to use istream
8103 * src/mathed/formulamacro.C (Read): rewritten to use istream
8105 * src/lyxlex.h (~LyXLex): deleted desturctor
8106 (getStream): new function, returns an istream
8107 (getFile): deleted funtion
8108 (IsOK): return is.good();
8110 * src/lyxlex.C (LyXLex): delete file and owns_file
8111 (setFile): open an filebuf and assign that to a istream instead of
8113 (setStream): new function, takes an istream as arg.
8114 (setFile): deleted function
8115 (EatLine): rewritten us use istream instead of FILE*
8119 * src/table.C (LyXTable): use istream instead of FILE*
8120 (Read): rewritten to take an istream instead of FILE*
8122 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * src/buffer.C (Dispatch): remove an extraneous break statement.
8126 * src/support/filetools.C (QuoteName): change to do simple
8127 'quoting'. More work is necessary. Also changed to do nothing
8128 under emx (needs fix too).
8129 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8131 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8132 config.h.in to the AC_DEFINE_UNQUOTED() call.
8133 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8134 needs char * as argument (because Solaris 7 declares it like
8137 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8138 remove definition of BZERO.
8140 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8143 defined, "lyxregex.h" if not.
8145 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8147 (REGEX): new variable that is set to regex.c lyxregex.h when
8148 AM_CONDITIONAL USE_REGEX is set.
8149 (libsupport_la_SOURCES): add $(REGEX)
8151 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8154 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8157 * configure.in: add call to LYX_REGEX
8159 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8160 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8162 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8164 * lib/bind/fi_menus.bind: new file, from
8165 pauli.virtanen@saunalahti.fi.
8167 * src/buffer.C (getBibkeyList): pass the parameter delim to
8168 InsetInclude::getKeys and InsetBibtex::getKeys.
8170 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8171 is passed to Buffer::getBibkeyList
8173 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8174 instead of the hardcoded comma.
8176 * src/insets/insetbib.C (getKeys): make sure that there are not
8177 leading blanks in bibtex keys. Normal latex does not care, but
8178 harvard.sty seems to dislike blanks at the beginning of citation
8179 keys. In particular, the retturn value of the function is
8181 * INSTALL: make it clear that libstdc++ is needed and that gcc
8182 2.7.x probably does not work.
8184 * src/support/filetools.C (findtexfile): make debug message go to
8186 * src/insets/insetbib.C (getKeys): ditto
8188 * src/debug.C (showTags): make sure that the output is correctly
8191 * configure.in: add a comment for TWO_COLOR_ICON define.
8193 * acconfig.h: remove all the entries that already defined in
8194 configure.in or acinclude.m4.
8196 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8197 to avoid user name, date and copyright.
8199 1999-12-21 Juergen Vigna <jug@sad.it>
8201 * src/table.C (Read): Now read bogus row format informations
8202 if the format is < 5 so that afterwards the table can
8203 be read by lyx but without any format-info. Fixed the
8204 crash we experienced when not doing this.
8206 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8208 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8209 (RedoDrawingOfParagraph): ditto
8210 (RedoParagraphs): ditto
8211 (RemoveTableRow): ditto
8213 * src/text.C (Fill): rename arg paperwidth -> paper_width
8215 * src/buffer.C (insertLyXFile): rename var filename -> fname
8216 (writeFile): rename arg filename -> fname
8217 (writeFileAscii): ditto
8218 (makeLaTeXFile): ditto
8219 (makeLinuxDocFile): ditto
8220 (makeDocBookFile): ditto
8222 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8225 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8227 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8230 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8231 compiled by a C compiler not C++.
8233 * src/layout.h (LyXTextClass): added typedef for const_iterator
8234 (LyXTextClassList): added typedef for const_iterator + member
8235 functions begin and end.
8237 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8238 iterators to fill the choice_class.
8239 (updateLayoutChoice): rewritten to use iterators to fill the
8240 layoutlist in the toolbar.
8242 * src/BufferView.h (BufferView::work_area_width): removed unused
8245 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8247 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8248 (sgmlCloseTag): ditto
8250 * src/support/lstrings.h: return type of countChar changed to
8253 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8254 what version of this func to use. Also made to return unsigned int.
8256 * configure.in: call LYX_STD_COUNT
8258 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8259 conforming std::count.
8261 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8263 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8264 and a subscript would give bad display (patch from Dekel Tsur
8265 <dekel@math.tau.ac.il>).
8267 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8269 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8272 * src/chset.h: add a few 'using' directives
8274 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8275 triggered when no buffer is active
8277 * src/layout.C: removed `break' after `return' in switch(), since
8280 * src/lyx_main.C (init): make sure LyX can be ran in place even
8281 when libtool has done its magic with shared libraries. Fix the
8282 test for the case when the system directory has not been found.
8284 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8285 name for the latex file.
8286 (MenuMakeHTML): ditto
8288 * src/buffer.h: add an optional boolean argument, which is passed
8291 1999-12-20 Allan Rae <rae@lyx.org>
8293 * lib/templates/IEEEtran.lyx: small correction and update.
8295 * configure.in: Attempted to use LYX_PATH_HEADER
8297 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8299 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8300 input from JMarc. Now use preprocessor to find the header.
8301 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8302 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8303 LYX_STL_STRING_FWD. See comments in file.
8305 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8307 * The global MiniBuffer * minibuffer variable is dead.
8309 * The global FD_form_main * fd_form_main variable is dead.
8311 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8313 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8315 * src/table.h: add the LOstream.h header
8316 * src/debug.h: ditto
8318 * src/LyXAction.h: change the explaination of the ReadOnly
8319 attribute: is indicates that the function _can_ be used.
8321 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8324 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8332 * src/paragraph.C (GetWord): assert on pos>=0
8335 * src/support/lyxstring.C: condition the use of an invariant on
8337 * src/support/lyxstring.h: ditto
8339 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8340 Use LAssert.h instead of plain assert().
8342 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8344 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8345 * src/support/filetools.C: ditto
8347 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8350 * INSTALL: document the new configure flags
8352 * configure.in: suppress --with-debug; add --enable-assertions
8354 * acinclude.m4: various changes in alignment of help strings.
8356 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8358 * src/kbmap.C: commented out the use of the hash map in kb_map,
8359 beginning of movement to a stl::container.
8361 * several files: removed code that was not in effect when
8362 MOVE_TEXT was defined.
8364 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8365 for escaping should not be used. We can discuss if the string
8366 should be enclosed in f.ex. [] instead of "".
8368 * src/trans_mgr.C (insert): use the new returned value from
8369 encodeString to get deadkeys and keymaps done correctly.
8371 * src/chset.C (encodeString): changed to return a pair, to tell
8372 what to use if we know the string.
8374 * src/lyxscreen.h (fillArc): new function.
8376 * src/FontInfo.C (resize): rewritten to use more std::string like
8377 structore, especially string::replace.
8379 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8382 * configure.in (chmod +x some scripts): remove config/gcc-hack
8384 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8386 * src/buffer.C (writeFile): change once again the top comment in a
8387 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8388 instead of an hardcoded version number.
8389 (makeDocBookFile): ditto
8391 * src/version.h: add new define LYX_DOCVERSION
8393 * po/de.po: update from Pit Sütterlin
8394 * lib/bind/de_menus.bind: ditto.
8396 * src/lyxfunc.C (Dispatch): call MenuExport()
8397 * src/buffer.C (Dispatch): ditto
8399 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8400 LyXFunc::Dispatch().
8401 (MenuExport): new function, moved from
8402 LyXFunc::Dispatch().
8404 * src/trans_mgr.C (insert): small cleanup
8405 * src/chset.C (loadFile): ditto
8407 * lib/kbd/iso8859-1.cdef: add missing backslashes
8409 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8411 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8412 help with placing the manually drawn accents better.
8414 (Draw): x2 and hg changed to float to minimize rounding errors and
8415 help place the accents better.
8417 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8418 unsigned short to char is just wrong...cast the char to unsigned
8419 char instead so that the two values can compare sanely. This
8420 should also make the display of insetlatexaccents better and
8421 perhaps also some other insets.
8423 (lbearing): new function
8426 1999-12-15 Allan Rae <rae@lyx.org>
8428 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8429 header that provides a wrapper around the very annoying SGI STL header
8432 * src/support/lyxstring.C, src/LString.h:
8433 removed old SGI-STL-compatability attempts.
8435 * configure.in: Use LYX_STL_STRING_FWD.
8437 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8438 stl_string_fwd.h is around and try to determine it's location.
8439 Major improvement over previous SGI STL 3.2 compatability.
8440 Three small problems remain with this function due to my zero
8441 knowledge of autoconf. JMarc and lgb see the comments in the code.
8443 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8445 * src/broken_const.h, config/hack-gcc, config/README: removed
8447 * configure.in: remove --with-gcc-hack option; do not call
8450 * INSTALL: remove documentation of --with-broken-const and
8453 * acconfig.h: remove all trace of BROKEN_CONST define
8455 * src/buffer.C (makeDocBookFile): update version number in output
8457 (SimpleDocBookOnePar): fix an assert when trying to a character
8458 access beyond string length
8461 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8463 * po/de.po: fix the Export menu
8465 * lyx.man: update the description of -dbg
8467 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8468 (commandLineHelp): updated
8469 (easyParse): show list of available debug levels if -dbg is passed
8472 * src/Makefile.am: add debug.C
8474 * src/debug.h: moved some code to debug.C
8476 * src/debug.C: new file. Contains code to set and show debug
8479 * src/layout.C: remove 'break' after 'continue' in switch
8480 statements, since these cannot be reached.
8482 1999-12-13 Allan Rae <rae@lyx.org>
8484 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8485 (in_word_set): hash() -> math_hash()
8487 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8489 * acconfig.h: Added a test for whether we are using exceptions in the
8490 current compilation run. If so USING_EXCEPTIONS is defined.
8492 * config.in: Check for existance of stl_string_fwd.h
8493 * src/LString.h: If compiling --with-included-string and SGI's
8494 STL version 3.2 is present (see above test) we need to block their
8495 forward declaration of string and supply a __get_c_string().
8496 However, it turns out this is only necessary if compiling with
8497 exceptions enabled so I've a bit more to add yet.
8499 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8500 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8501 src/support/LRegex.h, src/undo.h:
8502 Shuffle the order of the included files a little to ensure that
8503 LString.h gets included before anything that includes stl_string_fwd.h
8505 * src/support/lyxstring.C: We need to #include LString.h instead of
8506 lyxstring.h to get the necessary definition of __get_c_string.
8507 (__get_c_string): New function. This is defined static just like SGI's
8508 although why they need to do this I'm not sure. Perhaps it should be
8509 in lstrings.C instead.
8511 * lib/templates/IEEEtran.lyx: New template file.
8513 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8516 * intl/Makefile.in (MKINSTALLDIRS): ditto
8518 * src/LyXAction.C (init): changed to hold the LFUN data in a
8519 automatic array in stead of in callso to newFunc, this speeds up
8520 compilation a lot. Also all the memory used by the array is
8521 returned when the init is completed.
8523 * a lot of files: compiled with -Wold-style-cast, changed most of
8524 the reported offenders to C++ style casts. Did not change the
8525 offenders in C files.
8527 * src/trans.h (Match): change argument type to unsigned int.
8529 * src/support/DebugStream.C: fix some types on the streambufs so
8530 that it works on a conforming implementation.
8532 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8534 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8536 * src/support/lyxstring.C: remove the inline added earlier since
8537 they cause a bunch of unsatisfied symbols when linking with dec
8538 cxx. Cxx likes to have the body of inlines at the place where they
8541 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8542 accessing negative bounds in array. This fixes the crash when
8543 inserting accented characters.
8544 * src/trans.h (Match): ditto
8546 * src/buffer.C (Dispatch): since this is a void, it should not try
8547 to return anything...
8549 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8551 * src/buffer.h: removed the two friends from Buffer. Some changes
8552 because of this. Buffer::getFileName and Buffer::setFileName
8553 renamed to Buffer::fileName() and Buffer::fileName(...).
8555 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8558 and Buffer::update(short) to BufferView. This move is currently
8559 controlled by a define MOVE_TEXT, this will be removed when all
8560 shows to be ok. This move paves the way for better separation
8561 between buffer contents and buffer view. One side effect is that
8562 the BufferView needs a rebreak when swiching buffers, if we want
8563 to avoid this we can add a cache that holds pointers to LyXText's
8564 that is not currently in use.
8566 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8569 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8571 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8573 * lyx_main.C: new command line option -x (or --execute) and
8574 -e (or --export). Now direct conversion from .lyx to .tex
8575 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8576 Unfortunately, X is still needed and the GUI pops up during the
8579 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8581 * src/Spacing.C: add a using directive to bring stream stuff into
8583 * src/paragraph.C: ditto
8584 * src/buffer.C: ditto
8586 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8587 from Lars' announcement).
8589 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8590 example files from Tino Meinen.
8592 1999-12-06 Allan Rae <rae@lyx.org>
8594 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8596 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8598 * src/support/lyxstring.C: added a lot of inline for no good
8601 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8602 latexWriteEndChanges, they were not used.
8604 * src/layout.h (operator<<): output operator for PageSides
8606 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8608 * some example files: loaded in LyX 1.0.4 and saved again to update
8609 certain constructs (table format)
8611 * a lot of files: did the change to use fstream/iostream for all
8612 writing of files. Done with a close look at Andre Poenitz's patch.
8614 * some files: whitespace changes.
8616 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8618 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8619 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8620 architecture, we provide our own. It is used unconditionnally, but
8621 I do not think this is a performance problem. Thanks to Angus
8622 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8623 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8625 (GetInset): use my_memcpy.
8629 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8630 it is easier to understand, but it uses less TeX-only constructs now.
8632 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8633 elements contain spaces
8635 * lib/configure: regenerated
8637 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8638 elements contain spaces; display the list of programs that are
8641 * autogen.sh: make sure lib/configure is executable
8643 * lib/examples/*: rename the tutorial examples to begin with the
8644 two-letters language code.
8646 * src/lyxfunc.C (getStatus): do not query current font if no
8649 * src/lyx_cb.C (RunScript): use QuoteName
8650 (MenuRunDvips): ditto
8651 (PrintApplyCB): ditto
8653 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8654 around argument, so that it works well with the current shell.
8655 Does not work properly with OS/2 shells currently.
8657 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8658 * src/LyXSendto.C (SendtoApplyCB): ditto
8659 * src/lyxfunc.C (Dispatch): ditto
8660 * src/buffer.C (runLaTeX): ditto
8661 (runLiterate): ditto
8662 (buildProgram): ditto
8664 * src/lyx_cb.C (RunScript): ditto
8665 (MenuMakeLaTeX): ditto
8667 * src/buffer.h (getLatexName): new method
8669 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8671 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8673 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8674 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8675 (create_math_panel): ditto
8677 * src/lyxfunc.C (getStatus): re-activate the code which gets
8678 current font and cursor; add test for export to html.
8680 * src/lyxrc.C (read): remove unreachable break statements; add a
8683 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8685 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8687 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8688 introduced by faulty regex.
8689 * src/buffer.C: ditto
8690 * src/lastfiles.C: ditto
8691 * src/paragraph.C: ditto
8692 * src/table.C: ditto
8693 * src/vspace.C: ditto
8694 * src/insets/figinset.C: ditto
8695 Note: most of these is absolutely harmless, except the one in
8696 src/mathed formula.C.
8698 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8700 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8701 operation, yielding correct results for the reLyX command.
8703 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/support/filetools.C (ExpandPath): removed an over eager
8707 (ReplaceEnvironmentPath): ditto
8709 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8710 shows that we are doing something fishy in our code...
8714 * src/lyxrc.C (read): use a double switch trick to get more help
8715 from the compiler. (the same trick is used in layout.C)
8716 (write): new function. opens a ofstream and pass that to output
8717 (output): new function, takes a ostream and writes the lyxrc
8718 elemts to it. uses a dummy switch to make sure no elements are
8721 * src/lyxlex.h: added a struct pushpophelper for use in functions
8722 with more than one exit point.
8724 * src/lyxlex.[Ch] (GetInteger): made it const
8728 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8730 * src/layout.[hC] : LayoutTags splitted into several enums, new
8731 methods created, better error handling cleaner use of lyxlex. Read
8734 * src/bmtable.[Ch]: change some member prototypes because of the
8735 image const changes.
8737 * commandtags.h, src/LyXAction.C (init): new function:
8738 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8739 This file is not read automatically but you can add \input
8740 preferences to your lyxrc if you want to. We need to discuss how
8743 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8744 in .aux, also remove .bib and .bst files from dependencies when
8747 * src/BufferView.C, src/LyXView.C: add const_cast several places
8748 because of changes to images.
8750 * lib/images/*: same change as for images/*
8752 * lib/lyxrc.example: Default for accept_compound is false not no.
8754 * images/*: changed to be const, however I have som misgivings
8755 about this change so it might be changed back.
8757 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8759 * lib/configure, po/POTFILES.in: regenerated
8761 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8763 * config/lib_configure.m4: removed
8765 * lib/configure.m4: new file (was config/lib_configure.m4)
8767 * configure.in: do not test for rtti, since we do not use it.
8769 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8771 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8772 doubling of allocated space scheme. This makes it faster for large
8773 strings end to use less memory for small strings. xtra rememoved.
8775 * src/insets/figinset.C (waitalarm): commented out.
8776 (GhostscriptMsg): use static_cast
8777 (GhostscriptMsg): use new instead of malloc to allocate memory for
8778 cmap. also delete the memory after use.
8780 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8782 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8783 for changes in bibtex database or style.
8784 (runBibTeX): remove all .bib and .bst files from dep before we
8786 (run): use scanAuc in when dep file already exist.
8788 * src/DepTable.C (remove_files_with_extension): new method
8791 * src/DepTable.[Ch]: made many of the methods const.
8793 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8795 * src/bufferparams.C: make sure that the default textclass is
8796 "article". It used to be the first one by description order, but
8797 now the first one is "docbook".
8799 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8800 string; call Debug::value.
8801 (easyParse): pass complete argument to setDebuggingLevel().
8803 * src/debug.h (value): fix the code that parses debug levels.
8805 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8808 * src/LyXAction.C: use Debug::ACTION as debug channel.
8810 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8812 * NEWS: updated for the future 1.1.3 release.
8814 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8815 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8816 it should. This is of course a controversial change (since many
8817 people will find that their lyx workscreen is suddenly full of
8818 red), but done for the sake of correctness.
8820 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8821 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8823 * src/insets/inseterror.h, src/insets/inseturl.h,
8824 src/insets/insetinfo.h, src/insets/figinset.h,
8825 src/mathed/formulamacro.h, src/mathed/math_macro.h
8826 (EditMessage): add a missing const and add _() to make sure that
8829 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8830 src/insets/insetbib.C, src/support/filetools.C: add `using'
8833 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8834 doing 'Insert index of last word' at the beginning of a paragraph.
8836 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8838 * several files: white-space changes.
8840 * src/mathed/formula.C: removed IsAlpha and IsDigit
8842 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8843 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8846 * src/insets/figinset.C (GetPSSizes): don't break when
8847 "EndComments" is seen. But break when a boundingbox is read.
8849 * all classes inherited from Inset: return value of Clone
8850 changed back to Inset *.
8852 * all classes inherited form MathInset: return value of Clone
8853 changed back to MathedInset *.
8855 * src/insets/figinset.C (runqueue): use a ofstream to output the
8856 gs/ps file. Might need some setpresicion or setw. However I can
8857 see no problem with the current code.
8858 (runqueue): use sleep instead of the alarm/signal code. I just
8859 can't see the difference.
8861 * src/paragraph.C (LyXParagraph): reserve space in the new
8862 paragraph and resize the inserted paragraph to just fit.
8864 * src/lyxfunc.h (operator|=): added operator for func_status.
8866 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8867 check for readable file.
8869 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8870 check for readable file.
8871 (MenuMakeLinuxDoc): ditto
8872 (MenuMakeDocBook): ditto
8873 (MenuMakeAscii): ditto
8874 (InsertAsciiFile): split the test for openable and readable
8876 * src/bmtable.C (draw_bitmaptable): use
8877 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8879 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8880 findtexfile from LaTeX to filetools.
8882 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8883 instead of FilePtr. Needs to be verified by a literate user.
8885 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8887 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8888 (EditMessage): likewise.
8890 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8891 respectively as \textasciitilde and \textasciicircum.
8893 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8895 * src/support/lyxstring.h: made the methods that take iterators
8898 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8899 (regexMatch): made is use the real regex class.
8901 * src/support/Makefile.am: changed to use libtool
8903 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8905 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8907 (MathIsInset ++): changed several macros to be inline functions
8910 * src/mathed/Makefile.am: changed to use libtool
8912 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8914 * src/insets/inset* : Clone changed to const and return type is
8915 the true insettype not just Inset*.
8917 * src/insets/Makefile.am: changed to use libtool
8919 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8921 * src/undo.[Ch] : added empty() and changed some of the method
8924 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8926 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8927 setID use block<> for the bullets array, added const several places.
8929 * src/lyxfunc.C (getStatus): new function
8931 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8932 LyXAction, added const to several funtions.
8934 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8935 a std::map, and to store the dir items in a vector.
8937 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8940 * src/LyXView.[Ch] + other files : changed currentView to view.
8942 * src/LyXAction.[Ch] : ported from the old devel branch.
8944 * src/.cvsignore: added .libs and a.out
8946 * configure.in : changes to use libtool.
8948 * acinclude.m4 : inserted libtool.m4
8950 * .cvsignore: added libtool
8952 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8954 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8955 file name in insets and mathed directories (otherwise the
8956 dependency is not taken in account under cygwin).
8958 * src/text2.C (InsertString[AB]): make sure that we do not try to
8959 read characters past the string length.
8961 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8963 * lib/doc/LaTeXConfig.lyx.in,
8964 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8966 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8967 file saying who created them and when this heppened; this is
8968 useless and annoys tools like cvs.
8970 * lib/layouts/g-brief-{en,de}.layout,
8971 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8972 from Thomas Hartkens <thomas@hartkens.de>.
8974 * src/{insets,mathed}/Makefile.am: do not declare an empty
8975 LDFLAGS, so that it can be set at configure time (useful on Irix
8978 * lib/reLyX/configure.in: make sure that the prefix is set
8979 correctly in LYX_DIR.
8981 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8983 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8984 be used by 'command-sequence' this allows to bind a key to a
8985 sequence of LyX-commands
8986 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8988 * src/LyXAction.C: add "command-sequence"
8990 * src/LyXFunction.C: handling of "command-sequence"
8992 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8993 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8995 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8997 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * src/buffer.C (writeFile): Do not output a comment giving user
9000 and date at the beginning of a .lyx file. This is useless and
9001 annoys cvs anyway; update version number to 1.1.
9003 * src/Makefile.am (LYX_DIR): add this definition, so that a
9004 default path is hardcoded in LyX.
9006 * configure.in: Use LYX_GNU_GETTEXT.
9008 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9009 AM_GNU_GETTEXT with a bug fixed.
9011 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9013 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9015 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9016 which is used to point to LyX data is now LYX_DIR_11x.
9018 * lyx.man: convert to a unix text file; small updates.
9020 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9022 * src/support/LSubstring.[Ch]: made the second arg of most of the
9023 constructors be a const reference.
9025 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9028 * src/support/lyxstring.[Ch] (swap): added missing member function
9029 and specialization of swap(str, str);
9031 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9033 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9034 trace of the old one.
9036 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9037 put the member definitions in undo.C.
9039 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9040 NEW_TEXT and have now only code that was included when this was
9043 * src/intl.C (LCombo): use static_cast
9045 (DispatchCallback): ditto
9047 * src/definitions.h: removed whole file
9049 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9051 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9052 parsing and stores in a std:map. a regex defines the file format.
9053 removed unneeded members.
9055 * src/bufferparams.h: added several enums from definitions.h here.
9056 Removed unsused destructor. Changed some types to use proper enum
9057 types. use block to have the temp_bullets and user_defined_bullets
9058 and to make the whole class assignable.
9060 * src/bufferparams.C (Copy): removed this functions, use a default
9063 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9066 * src/buffer.C (readLyXformat2): commend out all that have with
9067 oldpapersize to do. also comment out all that hve to do with
9068 insetlatex and insetlatexdel.
9069 (setOldPaperStuff): commented out
9071 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9073 * src/LyXAction.C: remove use of inset-latex-insert
9075 * src/mathed/math_panel.C (button_cb): use static_cast
9077 * src/insets/Makefile.am (insets_o_SOURCES): removed
9080 * src/support/lyxstring.C (helper): use the unsigned long
9081 specifier, UL, instead of a static_cast.
9083 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9085 * src/support/block.h: new file. to be used as a c-style array in
9086 classes, so that the class can be assignable.
9088 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9090 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9091 NULL, make sure to return an empty string (it is not possible to
9092 set a string to NULL).
9094 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9096 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9098 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9100 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9101 link line, so that Irix users (for example) can set it explicitely to
9104 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9105 it can be overidden at make time (static or dynamic link, for
9108 * src/vc-backend.C, src/LaTeXFeatures.h,
9109 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9110 statements to bring templates to global namespace.
9112 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/support/lyxstring.C (operator[] const): make it standard
9117 * src/minibuffer.C (Init): changed to reflect that more
9118 information is given from the lyxvc and need not be provided here.
9120 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9122 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9124 * src/LyXView.C (UpdateTimerCB): use static_cast
9125 (KeyPressMask_raw_callback): ditto
9127 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9128 buffer_, a lot of changes because of this. currentBuffer() ->
9129 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9130 also changes to other files because of this.
9132 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9134 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9135 have no support for RCS and partial support for CVS, will be
9138 * src/insets/ several files: changes because of function name
9139 changes in Bufferview and LyXView.
9141 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9143 * src/support/LSubstring.[Ch]: new files. These implement a
9144 Substring that can be very convenient to use. i.e. is this
9146 string a = "Mary had a little sheep";
9147 Substring(a, "sheep") = "lamb";
9148 a is now "Mary has a little lamb".
9150 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9151 out patterns and subpatterns of strings. It is used by LSubstring
9152 and also by vc-backend.C
9154 * src/support/lyxstring.C: went over all the assertions used and
9155 tried to correct the wrong ones and flag which of them is required
9156 by the standard. some bugs found because of this. Also removed a
9157 couple of assertions.
9159 * src/support/Makefile.am (libsupport_a_SOURCES): added
9160 LSubstring.[Ch] and LRegex.[Ch]
9162 * src/support/FileInfo.h: have struct stat buf as an object and
9163 not a pointer to one, some changes because of this.
9165 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9166 information in layout when adding the layouts preamble to the
9169 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9172 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9173 because of bug in OS/2.
9175 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9177 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9178 \verbatim@font instead of \ttfamily, so that it can be redefined.
9180 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9181 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9182 src/layout.h, src/text2.C: add 'using' directive to bring the
9183 STL templates we need from the std:: namespace to the global one.
9184 Needed by DEC cxx in strict ansi mode.
9186 * src/support/LIstream.h,src/support/LOstream.h,
9187 src/support/lyxstring.h,src/table.h,
9188 src/lyxlookup.h: do not include <config.h> in header
9189 files. This should be done in the .C files only.
9191 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9195 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9197 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9198 from Kayvan to fix the tth invokation.
9200 * development/lyx.spec.in: updates from Kayvan to reflect the
9201 changes of file names.
9203 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9205 * src/text2.C (InsertStringB): use std::copy
9206 (InsertStringA): use std::copy
9208 * src/bufferlist.C: use a vector to store the buffers in. This is
9209 an internal change and should not affect any other thing.
9211 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9214 * src/text.C (Fill): fix potential bug, one off bug.
9216 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9218 * src/Makefile.am (lyx_main.o): add more files it depends on.
9220 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9222 * src/support/lyxstring.C: use size_t for the reference count,
9223 size, reserved memory and xtra.
9224 (internal_compare): new private member function. Now the compare
9225 functions should work for std::strings that have embedded '\0'
9227 (compare): all compare functions rewritten to use
9230 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9232 * src/support/lyxstring.C (compare): pass c_str()
9233 (compare): pass c_str
9234 (compare): pass c_str
9236 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9238 * src/support/DebugStream.C: <config.h> was not included correctly.
9240 * lib/configure: forgot to re-generate it :( I'll make this file
9241 auto generated soon.
9243 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9245 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9248 * src/support/lyxstring.C: some changes from length() to rep->sz.
9249 avoids a function call.
9251 * src/support/filetools.C (SpaceLess): yet another version of the
9252 algorithm...now per Jean-Marc's suggestions.
9254 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9256 * src/layout.C (less_textclass_desc): functor for use in sorting
9258 (LyXTextClass::Read): sort the textclasses after reading.
9260 * src/support/filetools.C (SpaceLess): new version of the
9261 SpaceLess functions. What problems does this one give? Please
9264 * images/banner_bw.xbm: made the arrays unsigned char *
9266 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9268 * src/support/lyxstring.C (find): remove bogus assertion in the
9269 two versions of find where this has not been done yet.
9271 * src/support/lyxlib.h: add missing int return type to
9274 * src/menus.C (ShowFileMenu): disable exporting to html if no
9275 html export command is present.
9277 * config/lib_configure.m4: add a test for an HTML converter. The
9278 programs checked for are, in this order: tth, latex2html and
9281 * lib/configure: generated from config/lib_configure.m4.
9283 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9284 html converter. The parameters are now passed through $$FName and
9285 $$OutName, instead of standard input/output.
9287 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9289 * lib/lyxrc.example: update description of \html_command.
9290 add "quotes" around \screen_font_xxx font setting examples to help
9291 people who use fonts with spaces in their names.
9293 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9295 * Distribution files: updates for v1.1.2
9297 * src/support/lyxstring.C (find): remove bogus assert and return
9298 npos for the same condition.
9300 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9302 * added patch for OS/2 from SMiyata.
9304 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9306 * src/text2.C (CutSelection): make space_wrapped a bool
9307 (CutSelection): dont declare int i until we have to.
9308 (alphaCounter): return a char const *.
9310 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9312 * src/support/syscall.C (Systemcalls::kill):
9313 src/support/filetools.C (PutEnv, PutEnvPath):
9314 src/lyx_cb.C (addNewlineAndDepth):
9315 src/FontInfo.C (FontInfo::resize): condition some #warning
9316 directives with WITH_WARNINGS.
9319 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9321 * src/layout.[Ch] + several files: access to class variables
9322 limited and made accessor functions instead a lot of code changed
9323 becuase of this. Also instead of returning pointers often a const
9324 reference is returned instead.
9326 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9328 * src/Makefile.am (dist-hook): added used to remove the CVS from
9329 cheaders upon creating a dist
9330 (EXTRA_DIST): added cheaders
9332 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9333 a character not as a small integer.
9335 * src/support/lyxstring.C (find): removed Assert and added i >=
9336 rep->sz to the first if.
9338 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9340 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9341 src/LyXView.C src/buffer.C src/bufferparams.C
9342 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9343 src/text2.C src/insets/insetinclude.C:
9344 lyxlayout renamed to textclasslist.
9346 * src/layout.C: some lyxerr changes.
9348 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9349 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9350 (LyXLayoutList): removed all traces of this class.
9351 (LyXTextClass::Read): rewrote LT_STYLE
9352 (LyXTextClass::hasLayout): new function
9353 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9354 both const and nonconst version.
9355 (LyXTextClass::delete_layout): new function.
9356 (LyXTextClassList::Style): bug fix. do the right thing if layout
9358 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9359 (LyXTextClassList::NameOfLayout): ditto
9360 (LyXTextClassList::Load): ditto
9362 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9364 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9366 * src/LyXAction.C (LookupFunc): added a workaround for sun
9367 compiler, on the other hand...we don't know if the current code
9368 compiles on sun at all...
9370 * src/support/filetools.C (CleanupPath): subst fix
9372 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9375 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9376 complained about this one?
9378 * src/insets/insetinclude.C (Latex): subst fix
9380 * src/insets/insetbib.C (getKeys): subst fix
9382 * src/LyXSendto.C (SendtoApplyCB): subst fix
9384 * src/lyx_main.C (init): subst fix
9386 * src/layout.C (Read): subst fix
9388 * src/lyx_sendfax_main.C (button_send): subst fix
9390 * src/buffer.C (RoffAsciiTable): subst fix
9392 * src/lyx_cb.C (MenuFax): subst fix
9393 (PrintApplyCB): subst fix
9395 1999-10-26 Juergen Vigna <jug@sad.it>
9397 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9399 (Read): Cleaned up this code so now we read only format vestion >= 5
9401 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9403 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9404 come nobody has complained about this one?
9406 * src/insets/insetinclude.C (Latex): subst fix
9408 * src/insets/insetbib.C (getKeys): subst fix
9410 * src/lyx_main.C (init): subst fix
9412 * src/layout.C (Read): subst fix
9414 * src/buffer.C (RoffAsciiTable): subst fix
9416 * src/lyx_cb.C (MenuFax): subst fix.
9418 * src/layout.[hC] + some other files: rewrote to use
9419 std::container to store textclasses and layouts in.
9420 Simplified, removed a lot of code. Make all classes
9421 assignable. Further simplifications and review of type
9422 use still to be one.
9424 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9425 lastfiles to create the lastfiles partr of the menu.
9427 * src/lastfiles.[Ch]: rewritten to use deque to store the
9428 lastfiles in. Uses fstream for reading and writing. Simplifies
9431 * src/support/syscall.C: remove explicit cast.
9433 * src/BufferView.C (CursorToggleCB): removed code snippets that
9435 use explicat C++ style casts instead of C style casts. also use
9436 u_vdata instea of passing pointers in longs.
9438 * src/PaperLayout.C: removed code snippets that were commented out.
9440 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9442 * src/lyx_main.C: removed code snippets that wer commented out.
9444 * src/paragraph.C: removed code snippets that were commented out.
9446 * src/lyxvc.C (logClose): use static_cast
9448 (viewLog): remove explicit cast to void*
9449 (showLog): removed old commented code
9451 * src/menus.C: use static_cast instead of C style casts. use
9452 u_vdata instead of u_ldata. remove explicit cast to (long) for
9453 pointers. Removed old code that was commented out.
9455 * src/insets/inset.C: removed old commented func
9457 * src/insets/insetref.C (InsetRef): removed old code that had been
9458 commented out for a long time.
9460 (escape): removed C style cast
9462 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9464 * src/insets/insetlatex.C (Draw): removed old commented code
9465 (Read): rewritten to use string
9467 * src/insets/insetlabel.C (escape): removed C style cast
9469 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9471 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9474 * src/insets/insetinclude.h: removed a couple of stupid bools
9476 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9477 (Clone): remove C style cast
9478 (getKeys): changed list to lst because of std::list
9480 * src/insets/inseterror.C (Draw): removed som old commented code.
9482 * src/insets/insetcommand.C (Draw): removed some old commented code.
9484 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9485 commented out forever.
9486 (bibitem_cb): use static_cast instead of C style cast
9487 use of vdata changed to u_vdata.
9489 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9491 (CloseUrlCB): use static_cast instead of C style cast.
9492 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9494 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9495 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9496 (CloseInfoCB): static_cast from ob->u_vdata instead.
9497 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9500 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9501 (C_InsetError_CloseErrorCB): forward the ob parameter
9502 (CloseErrorCB): static_cast from ob->u_vdata instead.
9504 * src/vspace.h: include LString.h since we use string in this class.
9506 * src/vspace.C (lyx_advance): changed name from advance because of
9507 nameclash with stl. And since we cannot use namespaces yet...I
9508 used a lyx_ prefix instead. Expect this to change when we begin
9511 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9513 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9514 and removed now defunct constructor and deconstructor.
9516 * src/BufferView.h: have backstack as a object not as a pointer.
9517 removed initialization from constructor. added include for BackStack
9519 * development/lyx.spec.in (%build): add CFLAGS also.
9521 * src/screen.C (drawFrame): removed another warning.
9523 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9525 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9526 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9527 README and ANNOUNCE a bit for the next release. More work is
9530 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9531 unbreakable if we are in freespacing mode (LyX-Code), but not in
9534 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9536 * src/BackStack.h: fixed initialization order in constructor
9538 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9540 * acinclude.m4 (VERSION): new rules for when a version is
9541 development, added also a variable for prerelease.
9542 (warnings): we set with_warnings=yes for prereleases
9543 (lyx_opt): prereleases compile with same optimization as development
9544 (CXXFLAGS): only use pedantic if we are a development version
9546 * src/BufferView.C (restorePosition): don't do anything if the
9549 * src/BackStack.h: added member empty, use this to test if there
9550 is anything to pop...
9552 1999-10-25 Juergen Vigna <jug@sad.it>
9555 * forms/layout_forms.fd +
9556 * forms/latexoptions.fd +
9557 * lyx.fd: changed for various form resize issues
9559 * src/mathed/math_panel.C +
9560 * src/insets/inseterror.C +
9561 * src/insets/insetinfo.C +
9562 * src/insets/inseturl.C +
9563 * src/insets/inseturl.h +
9566 * src/PaperLayout.C +
9567 * src/ParagraphExtra.C +
9568 * src/TableLayout.C +
9570 * src/layout_forms.C +
9577 * src/menus.C: fixed various resize issues. So now forms can be
9578 resized savely or not be resized at all.
9580 * forms/form_url.fd +
9581 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9584 * src/insets/Makefile.am: added files form_url.[Ch]
9586 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9588 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9589 (and presumably 6.2).
9591 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9592 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9593 remaining static member callbacks.
9595 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9598 * src/support/lyxstring.h: declare struct Srep as friend of
9599 lyxstring, since DEC cxx complains otherwise.
9601 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9603 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/LaTeX.C (run): made run_bibtex also depend on files with
9607 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9608 are put into the dependency file.
9610 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9611 the code has shown itself to work
9612 (create_ispell_pipe): removed another warning, added a comment
9615 * src/minibuffer.C (ExecutingCB): removed code that has been
9616 commented out a long time
9618 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9619 out code + a warning.
9621 * src/support/lyxstring.h: comment out the three private
9622 operators, when compiling with string ansi conforming compilers
9625 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9627 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9628 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9631 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9634 * src/mathed/math_panel.C (create_math_panel): remove explicit
9637 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9640 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9641 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9642 to XCreatePixmapFromBitmapData
9643 (fl_set_bmtable_data): change the last argument to be unsigned
9645 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9646 and bh to be unsigned int, remove explicit casts in call to
9647 XReadBitmapFileData.
9649 * images/arrows.xbm: made the arrays unsigned char *
9650 * images/varsz.xbm: ditto
9651 * images/misc.xbm: ditto
9652 * images/greek.xbm: ditto
9653 * images/dots.xbm: ditto
9654 * images/brel.xbm: ditto
9655 * images/bop.xbm: ditto
9657 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9659 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9660 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9661 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9663 (LYX_CXX_CHEADERS): added <clocale> to the test.
9665 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9667 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9669 * src/support/lyxstring.C (append): fixed something that must be a
9670 bug, rep->assign was used instead of rep->append.
9672 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9675 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9676 lyx insert double chars. Fix spotted by Kayvan.
9678 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9680 * Fixed the tth support. I messed up with the Emacs patch apply feature
9681 and omitted the changes in lyxrc.C.
9683 1999-10-22 Juergen Vigna <jug@sad.it>
9685 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9687 * src/lyx_cb.C (MenuInsertRef) +
9688 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9689 the form cannot be resized under it limits (fixes a segfault)
9691 * src/lyx.C (create_form_form_ref) +
9692 * forms/lyx.fd: Changed Gravity on name input field so that it is
9695 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9697 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9698 <ostream> and <istream>.
9700 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9701 whether <fstream> provides the latest standard features, or if we
9702 have an oldstyle library (like in egcs).
9703 (LYX_CXX_STL_STRING): fix the test.
9705 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9706 code on MODERN_STL_STREAM.
9708 * src/support/lyxstring.h: use L{I,O}stream.h.
9710 * src/support/L{I,O}stream.h: new files, designed to setup
9711 correctly streams for our use
9712 - includes the right header depending on STL capabilities
9713 - puts std::ostream and std::endl (for LOStream.h) or
9714 std::istream (LIStream.h) in toplevel namespace.
9716 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9718 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9719 was a bib file that had been changed we ensure that bibtex is run.
9720 (runBibTeX): enhanced to extract the names of the bib files and
9721 getting their absolute path and enter them into the dep file.
9722 (findtexfile): static func that is used to look for tex-files,
9723 checks for absolute patchs and tries also with kpsewhich.
9724 Alternative ways of finding the correct files are wanted. Will
9726 (do_popen): function that runs a command using popen and returns
9727 the whole output of that command in a string. Should be moved to
9730 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9731 file with extension ext has changed.
9733 * src/insets/figinset.C: added ifdef guards around the fl_free
9734 code that jug commented out. Now it is commented out when
9735 compiling with XForms == 0.89.
9737 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9738 to lyxstring.C, and only keep a forward declaration in
9739 lyxstring.h. Simplifies the header file a bit and should help a
9740 bit on compile time too. Also changes to Srep will not mandate a
9741 recompile of code just using string.
9742 (~lyxstring): definition moved here since it uses srep.
9743 (size): definition moved here since it uses srep.
9745 * src/support/lyxstring.h: removed a couple of "inline" that should
9748 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9750 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9753 1999-10-21 Juergen Vigna <jug@sad.it>
9755 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9756 set to left if I just remove the width entry (or it is empty).
9758 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9759 paragraph when having dummy paragraphs.
9761 1999-10-20 Juergen Vigna <jug@sad.it>
9763 * src/insets/figinset.C: just commented some fl_free_form calls
9764 and added warnings so that this calls should be activated later
9765 again. This avoids for now a segfault, but we have a memory leak!
9767 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9768 'const char * argument' to 'string argument', this should
9769 fix some Asserts() in lyxstring.C.
9771 * src/lyxfunc.h: Removed the function argAsString(const char *)
9772 as it is not used anymore.
9774 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9776 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9779 * src/Literate.h: some funcs moved from public to private to make
9780 interface clearer. Unneeded args removed.
9782 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9784 (scanBuildLogFile): ditto
9786 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9787 normal TeX Error. Still room for improvement.
9789 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9791 * src/buffer.C (insertErrors): changes to make the error
9792 desctription show properly.
9794 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9797 * src/support/lyxstring.C (helper): changed to use
9798 sizeof(object->rep->ref).
9799 (operator>>): changed to use a pointer instead.
9801 * src/support/lyxstring.h: changed const reference & to value_type
9802 const & lets see if that helps.
9804 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9806 * Makefile.am (rpmdist): fixed to have non static package and
9809 * src/support/lyxstring.C: removed the compilation guards
9811 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9814 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9815 conditional compile of lyxstring.Ch
9817 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9818 stupid check, but it is a lot better than the bastring hack.
9819 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9821 * several files: changed string::erase into string::clear. Not
9824 * src/chset.C (encodeString): use a char temporary instead
9826 * src/table.C (TexEndOfCell): added tostr around
9827 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9828 (TexEndOfCell): ditto
9829 (TexEndOfCell): ditto
9830 (TexEndOfCell): ditto
9831 (DocBookEndOfCell): ditto
9832 (DocBookEndOfCell): ditto
9833 (DocBookEndOfCell): ditto
9834 (DocBookEndOfCell): ditto
9836 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9838 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9840 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9841 (MenuBuildProg): added tostr around ret
9842 (MenuRunChktex): added tostr around ret
9843 (DocumentApplyCB): added tostr around ret
9845 * src/chset.C (encodeString): added tostr around t->ic
9847 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9848 (makeLaTeXFile): added tostr around tocdepth
9849 (makeLaTeXFile): added tostr around ftcound - 1
9851 * src/insets/insetbib.C (setCounter): added tostr around counter.
9853 * src/support/lyxstring.h: added an operator+=(int) to catch more
9856 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9857 (lyxstring): We DON'T allow NULL pointers.
9859 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9861 * src/mathed/math_macro.C (MathMacroArgument::Write,
9862 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9863 when writing them out.
9865 * src/LString.C: remove, since it is not used anymore.
9867 * src/support/lyxstring.C: condition the content to
9868 USE_INCLUDED_STRING macro.
9870 * src/mathed/math_symbols.C, src/support/lstrings.C,
9871 src/support/lyxstring.C: add `using' directive to specify what
9872 we need in <algorithm>. I do not think that we need to
9873 conditionalize this, but any thought is appreciated.
9875 * many files: change all callback functions to "C" linkage
9876 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9877 strict_ansi. Those who were static are now global.
9878 The case of callbacks which are static class members is
9879 trickier, since we have to make C wrappers around them (see
9880 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9881 did not finish this yet, since it defeats the purpose of
9882 encapsulation, and I am not sure what the best route is.
9884 1999-10-19 Juergen Vigna <jug@sad.it>
9886 * src/support/lyxstring.C (lyxstring): we permit to have a null
9887 pointer as assignment value and just don't assign it.
9889 * src/vspace.C (nextToken): corrected this function substituting
9890 find_first(_not)_of with find_last_of.
9892 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9893 (TableOptCloseCB) (TableSpeCloseCB):
9894 inserted fl_set_focus call for problem with fl_hide_form() in
9897 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9899 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9902 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9904 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9905 LyXLex::next() and not eatline() to get its argument.
9907 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9909 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9910 instead, use fstreams for io of the depfile, removed unneeded
9911 functions and variables.
9913 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9914 vector instead, removed all functions and variables that is not in
9917 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * src/buffer.C (insertErrors): use new interface to TeXError
9921 * Makefile.am (rpmdist): added a rpmdist target
9923 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9924 per Kayvan's instructions.
9926 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9928 * src/Makefile.am: add a definition for localedir, so that locales
9929 are found after installation (Kayvan)
9931 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9933 * development/.cvsignore: new file.
9935 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9937 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9938 C++ compiler provides wrappers for C headers and use our alternate
9941 * configure.in: use LYX_CXX_CHEADERS.
9943 * src/cheader/: new directory, populated with cname headers from
9944 libstdc++-2.8.1. They are a bit old, but probably good enough for
9945 what we want (support compilers who lack them).
9947 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9948 from includes. It turns out is was stupid.
9950 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9952 * lib/Makefile.am (install-data-local): forgot a ';'
9953 (install-data-local): forgot a '\'
9954 (libinstalldirs): needed after all. reintroduced.
9956 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * configure.in (AC_OUTPUT): added lyx.spec
9960 * development/lyx.spec: removed file
9962 * development/lyx.spec.in: new file
9964 * po/*.po: merged with lyx.pot becuase of make distcheck
9966 * lib/Makefile.am (dist-hook): added dist-hook so that
9967 documentation files will be included when doing a make
9968 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9969 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9971 more: tried to make install do the right thing, exclude CVS dirs
9974 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9975 Path would fit in more nicely.
9977 * all files that used to use pathstack: uses now Path instead.
9978 This change was a lot easier than expected.
9980 * src/support/path.h: new file
9982 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9984 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9986 * src/support/lyxstring.C (getline): Default arg was given for
9989 * Configure.cmd: removed file
9991 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9993 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9994 streams classes and types, add the proper 'using' statements when
9995 MODERN_STL is defined.
9997 * src/debug.h: move the << operator definition after the inclusion
10000 * src/support/filetools.C: include "LAssert.h", which is needed
10003 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10006 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10007 include "debug.h" to define a proper ostream.
10009 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10011 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10012 method to the SystemCall class which can kill a process, but it's
10013 not fully implemented yet.
10015 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10017 * src/support/FileInfo.h: Better documentation
10019 * src/lyxfunc.C: Added support for buffer-export html
10021 * src/menus.C: Added Export->As HTML...
10023 * lib/bind/*.bind: Added short-cut for buffer-export html
10025 * src/lyxrc.*: Added support for new \tth_command
10027 * lib/lyxrc.example: Added stuff for new \tth_command
10029 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10031 * lib/Makefile.am (IMAGES): removed images/README
10032 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10033 installes in correct place. Check permisions is installed
10036 * src/LaTeX.C: some no-op changes moved declaration of some
10039 * src/LaTeX.h (LATEX_H): changed include guard name
10041 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10043 * lib/reLyX/Makefile.am: install noweb2lyx.
10045 * lib/Makefile.am: install configure.
10047 * lib/reLyX/configure.in: declare a config aux dir; set package
10048 name to lyx (not sure what the best solution is); generate noweb2lyx.
10050 * lib/layouts/egs.layout: fix the bibliography layout.
10052 1999-10-08 Jürgen Vigna <jug@sad.it>
10054 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10055 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10056 it returned without continuing to search the path.
10058 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10060 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10061 also fixes a bug. It is not allowed to do tricks with std::strings
10062 like: string a("hei"); &a[e]; this will not give what you
10063 think... Any reason for the complexity in this func?
10065 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10067 * Updated README and INSTALL a bit, mostly to check that my
10068 CVS rights are correctly set up.
10070 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10072 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10073 does not allow '\0' chars but lyxstring and std::string does.
10075 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10077 * autogen.sh (AUTOCONF): let the autogen script create the
10078 POTFILES.in file too. POTFILES.in should perhaps now not be
10079 included in the cvs module.
10081 * some more files changed to use C++ includes instead of C ones.
10083 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10085 (Reread): added tostr to nlink. buggy output otherwise.
10086 (Reread): added a string() around szMode when assigning to Buffer,
10087 without this I got a log of garbled info strings.
10089 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10092 * I have added several ostream & operator<<(ostream &, some_type)
10093 functions. This has been done to avoid casting and warnings when
10094 outputting enums to lyxerr. This as thus eliminated a lot of
10095 explicit casts and has made the code clearer. Among the enums
10096 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10097 mathed enums, some font enum the Debug::type enum.
10099 * src/support/lyxstring.h (clear): missing method. equivalent of
10102 * all files that contained "stderr": rewrote constructs that used
10103 stderr to use lyxerr instead. (except bmtable)
10105 * src/support/DebugStream.h (level): and the passed t with
10106 Debug::ANY to avoid spurious bits set.
10108 * src/debug.h (Debug::type value): made it accept strings of the
10109 type INFO,INIT,KEY.
10111 * configure.in (Check for programs): Added a check for kpsewhich,
10112 the latex generation will use this later to better the dicovery of
10115 * src/BufferView.C (create_view): we don't need to cast this to
10116 (void*) that is done automatically.
10117 (WorkAreaButtonPress): removed some dead code.
10119 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10121 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10122 is not overwritten when translated (David Sua'rez de Lis).
10124 * lib/CREDITS: Added David Sua'rez de Lis
10126 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10128 * src/bufferparams.C (BufferParams): default input encoding is now
10131 * acinclude.m4 (cross_compiling): comment out macro
10132 LYX_GXX_STRENGTH_REDUCE.
10134 * acconfig.h: make sure that const is not defined (to empty) when
10135 we are compiling C++. Remove commented out code using SIZEOF_xx
10138 * configure.in : move the test for const and inline as late as
10139 possible so that these C tests do not interefere with C++ ones.
10140 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10141 has not been proven.
10143 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10145 * src/table.C (getDocBookAlign): remove bad default value for
10146 isColumn parameter.
10148 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10150 (ShowFileMenu2): ditto.
10152 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10153 of files to ignore.
10155 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10157 * Most files: finished the change from the old error code to use
10158 DebugStream for all lyxerr debugging. Only minor changes remain
10159 (e.g. the setting of debug levels using strings instead of number)
10161 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10163 * src/layout.C (Add): Changed to use compare_no_case instead of
10166 * src/FontInfo.C: changed loop variable type too string::size_type.
10168 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10170 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10171 set ETAGS_ARGS to --c++
10173 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10175 * src/table.C (DocBookEndOfCell): commented out two unused variables
10177 * src/paragraph.C: commented out four unused variables.
10179 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10180 insed a if clause with type string::size_type.
10182 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10185 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10187 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10188 variable, also changed loop to go from 0 to lenght + 1, instead of
10189 -1 to length. This should be correct.
10191 * src/LaTeX.C (scanError): use string::size_type as loop variable
10194 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10195 (l.896) since y_tmp and row was not used anyway.
10197 * src/insets/insetref.C (escape): use string::size_type as loop
10200 * src/insets/insetquotes.C (Width): use string::size_type as loop
10202 (Draw): use string::size_type as loop variable type.
10204 * src/insets/insetlatexaccent.C (checkContents): use
10205 string::size_type as loop variable type.
10207 * src/insets/insetlabel.C (escape): use string::size_type as loop
10210 * src/insets/insetinfo.C: added an extern for current_view.
10212 * src/insets/insetcommand.C (scanCommand): use string::size_type
10213 as loop variable type.
10215 * most files: removed the RCS tags. With them we had to recompile
10216 a lot of files after a simple cvs commit. Also we have never used
10217 them for anything meaningful.
10219 * most files: tags-query-replace NULL 0. As adviced several plases
10220 we now use "0" instead of "NULL" in our code.
10222 * src/support/filetools.C (SpaceLess): use string::size_type as
10223 loop variable type.
10225 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10227 * src/paragraph.C: fixed up some more string stuff.
10229 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10231 * src/support/filetools.h: make modestr a std::string.
10233 * src/filetools.C (GetEnv): made ch really const.
10235 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10236 made code that used these use max/min from <algorithm> instead.
10238 * changed several c library include files to their equivalent c++
10239 library include files. All is not changed yet.
10241 * created a support subdir in src, put lyxstring and lstrings
10242 there + the extra files atexit, fileblock, strerror. Created
10243 Makefile.am. edited configure.in and src/Makefile.am to use this
10244 new subdir. More files moved to support.
10246 * imported som of the functions from repository lyx, filetools
10248 * ran tags-query-replace on LString -> string, corrected the bogus
10249 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10250 is still some errors in there. This is errors where too much or
10251 too litle get deleted from strings (string::erase, string::substr,
10252 string::replace), there can also be some off by one errors, or
10253 just plain wrong use of functions from lstrings. Viewing of quotes
10256 * LyX is now running fairly well with string, but there are
10257 certainly some bugs yet (see above) also string is quite different
10258 from LString among others in that it does not allow null pointers
10259 passed in and will abort if it gets any.
10261 * Added the revtex4 files I forgot when setting up the repository.
10263 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10265 * All over: Tried to clean everything up so that only the files
10266 that we really need are included in the cvs repository.
10267 * Switched to use automake.
10268 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10269 * Install has not been checked.
10271 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10273 * po/pt.po: Three errors:
10274 l.533 and l.538 format specification error
10275 l. 402 duplicate entry, I just deleted it.