1 2000-09-26 Juergen Vigna <jug@sad.it>
3 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
4 better visibility and error-message on wrong VSpace input.
6 * src/language.C (initL): added english again.
8 2000-09-25 Juergen Vigna <jug@sad.it>
10 * src/frontends/kde/Dialogs.C (Dialogs):
11 * src/frontends/gnome/Dialogs.C (Dialogs):
12 * src/frontends/kde/Makefile.am:
13 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
15 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
17 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
19 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
21 * src/frontends/xforms/FormParagraph.C:
22 * src/frontends/xforms/FormParagraph.h:
23 * src/frontends/xforms/form_paragraph.C:
24 * src/frontends/xforms/form_paragraph.h:
25 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
28 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
30 * src/tabular.C (OldFormatRead): forgot to delete the temporary
31 Paragraph-Data after use.
33 * src/insets/insettext.C (LocalDispatch): don't set the layout on
34 non breakable paragraphs.
36 2000-09-25 Garst R. Reese <reese@isn.net>
38 * src/language.C (initL): added missing language_country codes.
40 2000-09-25 Juergen Vigna <jug@sad.it>
42 * src/insets/insettext.C (InsetText):
43 (deleteLyXText): remove the not released LyXText structure!
45 2000-09-24 Marko Vendelin <markov@ioc.ee>
47 * src/frontends/gnome/mainapp.C
48 * src/frontends/gnome/mainapp.h: added support for keyboard
51 * src/frontends/gnome/FormCitation.C
52 * src/frontends/gnome/FormCitation.h
53 * src/frontends/gnome/Makefile.am
54 * src/frontends/gnome/pixbutton.h: completed the rewrite of
55 FormCitation to use "action area" in mainapp window
57 * src/frontends/gnome/Menubar_pimpl.C
58 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
61 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
63 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
64 width/descent/ascent values if name is empty.
65 (mathed_string_height): Use std::max.
67 2000-09-25 Allan Rae <rae@lyx.org>
69 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
70 segfault. This will be completely redesigned soon.
72 * sigc++: updated libsigc++. Fixes struct timespec bug.
74 * development/tools/makeLyXsigc.sh: .cvsignore addition
76 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
78 * several files: removed almost all traces of the old table
81 * src/TableLayout.C: removed file
83 2000-09-22 Juergen Vigna <jug@sad.it>
85 * src/frontends/kde/Dialogs.C: added credits forms.
87 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
89 * src/frontends/gnome/Dialogs.C: added some forms.
91 * src/spellchecker.C (init_spell_checker): set language in pspell code
92 (RunSpellChecker): some modifications for setting language string.
94 * src/language.[Ch]: added language_country code.
96 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
98 * src/frontends/Dialogs.h: added new signal showError.
99 Rearranged existing signals in some sort of alphabetical order.
101 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
102 FormError.[Ch], form_error.[Ch]
103 * src/frontends/xforms/forms/makefile: added new file form_error.fd
104 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
106 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
107 dialogs. I think that this can be used as the base to all these
110 * src/frontends/xforms/FormError.[Ch]
111 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
112 implementation of InsetError dialog.
114 * src/insets/inseterror.[Ch]: rendered GUI-independent.
116 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
117 * src/frontends/kde/Makefile.am: ditto
119 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
121 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
122 macrobf. This fixes a bug of invisible text.
124 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
126 * lib/doc/LaTeXConfig.lyx.in: updated.
128 * src/language.C (initL): remove language "francais" and change a
129 bit the names of the two other french variations.
131 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
132 string that may not be 0-terminated.
134 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
136 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
138 2000-09-20 Marko Vendelin <markov@ioc.ee>
140 * src/frontends/gnome/FormCitation.C
141 * src/frontends/gnome/FormIndex.C
142 * src/frontends/gnome/FormToc.C
143 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
144 the variable initialization to shut up the warnings
146 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
148 * src/table.[Ch]: deleted files
150 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
153 2000-09-18 Juergen Vigna <jug@sad.it>
155 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
156 problems with selection. Inserted new LFUN_PASTESELECTION.
157 (InsetButtonPress): inserted handling of middle mouse-button paste.
159 * src/spellchecker.C: changed word to word.c_str().
161 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
163 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
164 included in the ``make dist'' tarball.
166 2000-09-15 Juergen Vigna <jug@sad.it>
168 * src/CutAndPaste.C (cutSelection): small fix return the right
169 end position after cut inside one paragraph only.
171 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
172 we are locked as otherwise we don't have a valid cursor position!
174 * src/insets/figinset.C (draw): small bugfix but why is this needed???
176 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
178 * src/frontends/kde/FormRef.C: added using directive.
179 * src/frontends/kde/FormToc.C: ditto
181 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
183 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
186 2000-09-19 Marko Vendelin <markov@ioc.ee>
188 * src/frontends/gnome/Menubar_pimpl.C
189 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
190 Toc, ViewFormats, UpdateFormats, and ExportFormats.
192 * src/frontends/gnome/mainapp.C
193 * src/frontends/gnome/mainapp.h: support for menu update used
196 * src/frontends/gnome/mainapp.C
197 * src/frontends/gnome/mainapp.h: support for "action" area in the
198 main window. This area is used by small simple dialogs, such as
201 * src/frontends/gnome/FormIndex.C
202 * src/frontends/gnome/FormIndex.h
203 * src/frontends/gnome/FormUrl.C
204 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
207 * src/frontends/gnome/FormCitation.C
208 * src/frontends/gnome/FormCitation.h: rewrite to use main window
209 action area. Only "Insert new citation" is implemented.
213 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
215 * src/buffer.C (Dispatch): fix call to Dispatch
216 * src/insets/insetref.C (Edit): likewise
217 * src/insets/insetparent.C (Edit): likewise
218 * src/insets/insetinclude.C (include_cb): likewise
219 * src/frontends/xforms/FormUrl.C (apply): likewise
220 * src/frontends/xforms/FormToc.C (apply): likewise
221 * src/frontends/xforms/FormRef.C (apply): likewise
222 * src/frontends/xforms/FormIndex.C (apply): likewise
223 * src/frontends/xforms/FormCitation.C (apply): likewise
224 * src/lyxserver.C (callback): likewise
225 * src/lyxfunc.C (processKeySym): likewise
228 * src/lyx_cb.C (LayoutsCB): likewise
230 * Makefile.am (sourcedoc): small change
232 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
234 * src/main.C (main): Don't make an empty GUIRunTime object. all
235 methods are static. constify a bit remove unneded using + headers.
237 * src/tabular.C: some more const to local vars move some loop vars
239 * src/spellchecker.C: added some c_str after some word for pspell
241 * src/frontends/GUIRunTime.h: add new static method setDefaults
242 * src/frontends/xforms/GUIRunTime.C (setDefaults):
243 * src/frontends/kde/GUIRunTime.C (setDefaults):
244 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
246 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
247 with strnew in arg, use correct emptystring when calling SetName.
249 * several files: remove all commented code with relation to
250 HAVE_SSTREAM beeing false. We now only support stringstream and
253 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
255 * src/lyxfunc.C: construct correctly the automatic new file
258 * src/text2.C (IsStringInText): change type of variable i to shut
261 * src/support/sstream.h: do not use namespaces if the compiler
262 does not support them.
264 2000-09-15 Marko Vendelin <markov@ioc.ee>
265 * src/frontends/gnome/FormCitation.C
266 * src/frontends/gnome/FormCitation.h
267 * src/frontends/gnome/diainsertcitation_interface.c
268 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
269 regexp support to FormCitation [Gnome].
271 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
274 * configure.in: remove unused KDE/GTKGUI define
276 * src/frontends/kde/FormRef.C
277 * src/frontends/kde/FormRef.h
278 * src/frontends/kde/formrefdialog.C
279 * src/frontends/kde/formrefdialog.h: double click will
280 go to reference, now it is possible to change a cross-ref
283 * src/frontends/kde/FormToc.C
284 * src/frontends/kde/FormToc.h
285 * src/frontends/kde/formtocdialog.C
286 * src/frontends/kde/formtocdialog.h: add a depth
289 * src/frontends/kde/Makefile.am: add QtLyXView.h
292 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
294 * src/frontends/kde/FormCitation.h: added some using directives.
296 * src/frontends/kde/FormToc.h: corrected definition of doTree.
298 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
301 * src/mathed/math_defs.h: redefine SetAlign to use string rather
304 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
306 * src/buffer.C (pop_tag): revert for the second time a change by
307 Lars, who seems to really hate having non-local loop variables :)
309 * src/Lsstream.h: add "using" statements.
311 * src/support/copy.C (copy): add a bunch of std:: qualifiers
312 * src/buffer.C (writeFile): ditto
314 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
316 * src/buffer.C (writeFile): try to fix the locale modified format
317 number to always be as we want it.
319 * src/WorkArea.C (work_area_handler): try to workaround the bugs
320 in XForms 0.89. C-space is now working again.
322 * src/Lsstream.h src/support/sstream.h: new files.
324 * also commented out all cases where strstream were used.
326 * src/Bullet.h (c_str): remove method.
328 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
330 * a lot of files: get rid of "char const *" and "char *" is as
331 many places as possible. We only want to use them in interaction
332 with system of other libraries, not inside lyx.
334 * a lot of files: return const object is not of pod type. This
335 helps ensure that temporary objects is not modified. And fits well
336 with "programming by contract".
338 * configure.in: check for the locale header too
340 * Makefile.am (sourcedoc): new tag for generation of doc++
343 2000-09-14 Juergen Vigna <jug@sad.it>
345 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
346 callback to check which combo called it and do the right action.
348 * src/combox.C (combo_cb): added combo * to the callbacks.
349 (Hide): moved call of callback after Ungrab of the pointer.
351 * src/intl.h: removed LCombo2 function.
353 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
354 function as this can now be handled in one function.
356 * src/combox.h: added Combox * to callback prototype.
358 * src/frontends/xforms/Toolbar_pimpl.C:
359 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
361 2000-09-14 Garst Reese <reese@isn.net>
363 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
364 moved usepackage{xxx}'s to beginning of file. Changed left margin
365 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
366 underlining from title. Thanks to John Culleton for useful suggestions.
368 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
370 * src/lyxlex_pimpl.C (setFile): change error message to debug
373 2000-09-13 Juergen Vigna <jug@sad.it>
375 * src/frontends/xforms/FormDocument.C: implemented choice_class
376 as combox and give callback to combo_language so OK/Apply is activated
379 * src/bufferlist.C (newFile): small fix so already named files
380 (via an open call) are not requested to be named again on the
383 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
385 * src/frontends/kde/Makefile.am
386 * src/frontends/kde/FormRef.C
387 * src/frontends/kde/FormRef.h
388 * src/frontends/kde/formrefdialog.C
389 * src/frontends/kde/formrefdialog.h: implement
392 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
394 * src/frontends/kde/formtocdialog.C
395 * src/frontends/kde/formtocdialog.h
396 * src/frontends/kde/FormToc.C
397 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
399 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
401 * src/frontends/kde/FormCitation.C: fix thinko
402 where we didn't always display the reference text
405 * src/frontends/kde/formurldialog.C
406 * src/frontends/kde/formurldialog.h
407 * src/frontends/kde/FormUrl.C
408 * src/frontends/kde/FormUrl.h: minor cleanups
410 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
412 * src/frontends/kde/Makefile.am
413 * src/frontends/kde/FormToc.C
414 * src/frontends/kde/FormToc.h
415 * src/frontends/kde/FormCitation.C
416 * src/frontends/kde/FormCitation.h
417 * src/frontends/kde/FormIndex.C
418 * src/frontends/kde/FormIndex.h
419 * src/frontends/kde/formtocdialog.C
420 * src/frontends/kde/formtocdialog.h
421 * src/frontends/kde/formcitationdialog.C
422 * src/frontends/kde/formcitationdialog.h
423 * src/frontends/kde/formindexdialog.C
424 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
426 2000-09-12 Juergen Vigna <jug@sad.it>
428 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
431 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
433 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
436 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
438 * src/converter.C (Add, Convert): Added support for converter flags:
439 needaux, resultdir, resultfile.
440 (Convert): Added new parameter view_file.
441 (dvips_options): Fixed letter paper option.
443 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
444 (Export, GetExportableFormats, GetViewableFormats): Added support
447 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
449 (easyParse): Fixed to work with new export code.
451 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
454 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
456 * lib/bind/*.bind: Replaced
457 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
458 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
460 2000-09-11 Juergen Vigna <jug@sad.it>
462 * src/lyx_gui.C (runTime): uses global guiruntime variable.
464 * src/main.C (main): now GUII defines global guiruntime!
466 * src/frontends/gnome/GUIRunTime.C (initApplication):
467 * src/frontends/kde/GUIRunTime.C (initApplication):
468 * src/frontends/xforms/GUIRunTime.C (initApplication):
469 * src/frontends/GUIRunTime.h: added new function initApplication.
471 * src/spellchecker.C (sc_accept_word): change to add_to_session.
473 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
475 2000-09-08 Juergen Vigna <jug@sad.it>
477 * src/lyx_gui.C (create_forms): don't display the "default" entry as
478 we have already "Reset".
480 * src/language.C (initL): inserted "default" language and made this
481 THE default language (and not american!)
483 * src/paragraph.C: inserted handling of "default" language!
485 * src/lyxfont.C: ditto
489 * src/paragraph.C: output the \\par only if we have a following
490 paragraph otherwise it's not needed.
492 2000-09-05 Juergen Vigna <jug@sad.it>
494 * config/pspell.m4: added entry to lyx-flags
496 * src/spellchecker.C: modified version from Kevin for using pspell
498 2000-09-01 Marko Vendelin <markov@ioc.ee>
499 * src/frontends/gnome/Makefile.am
500 * src/frontends/gnome/FormCitation.C
501 * src/frontends/gnome/FormCitation.h
502 * src/frontends/gnome/diainsertcitation_callbacks.c
503 * src/frontends/gnome/diainsertcitation_callbacks.h
504 * src/frontends/gnome/diainsertcitation_interface.c
505 * src/frontends/gnome/diainsertcitation_interface.h
506 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
507 dialog for Gnome frontend
509 * src/main.C: Gnome libraries require keeping application name
510 and its version as strings
512 * src/frontends/gnome/mainapp.C: Change the name of the main window
513 from GnomeLyX to PACKAGE
515 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
517 * src/frontends/Liason.C: add "using: declaration.
519 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
521 * src/mathed/math_macro.C (Metrics): Set the size of the template
523 * src/mathed/formulamacro.C (Latex): Fixed the returned value
525 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
527 * src/converter.C (add_options): New function.
528 (SetViewer): Change $$FName into '$$FName'.
529 (View): Add options when running xdvi
530 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
531 (Convert): The 3rd parameter is now the desired filename. Converts
532 calls to lyx::rename if necessary.
533 Add options when running dvips.
534 (dvi_papersize,dvips_options): New methods.
536 * src/exporter.C (Export): Use getLatexName() instead of fileName().
538 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
539 using a call to Converter::dvips_options.
540 Fixed to work with nex export code.
543 * src/support/rename.C: New files
545 * src/support/syscall.h
546 * src/support/syscall.C: Added Starttype SystemDontWait.
548 * lib/ui/default.ui: Changed to work with new export code
550 * lib/configure.m4: Changed to work with new export code
552 * src/encoding.C: Changed latex name for iso8859_7 encoding.
554 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
556 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
557 so that code compiles with DEC cxx.
559 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
560 to work correctly! Also now supports the additional elements
563 2000-09-01 Allan Rae <rae@lyx.org>
565 * src/frontends/ButtonPolicies.C: renamed all the references to
566 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
568 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
569 since it's a const not a type.
571 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
573 2000-08-31 Juergen Vigna <jug@sad.it>
575 * src/insets/figinset.C: Various changes to look if the filename has
576 an extension and if not add it for inline previewing.
578 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
580 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
581 make buttonStatus and isReadOnly be const methods. (also reflect
582 this in derived classes.)
584 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
585 (nextState): change to be static inline, pass the StateMachine as
587 (PreferencesPolicy): remove casts
588 (OkCancelPolicy): remvoe casts
589 (OkCancelReadOnlyPolicy): remove casts
590 (NoRepeatedApplyReadOnlyPolicy): remove casts
591 (OkApplyCancelReadOnlyPolicy): remove casts
592 (OkApplyCancelPolicy): remove casts
593 (NoRepeatedApplyPolicy): remove casts
595 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
597 * src/converter.C: added some using directives
599 * src/frontends/ButtonPolicies.C: changes to overcome
600 "need lvalue" error with DEC c++
602 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
603 to WMHideCB for DEC c++
605 * src/frontends/xforms/Menubar_pimpl.C: added using directive
607 * src/frontends/xforms/forms/form_document.C.patch: use C callback
608 to BulletBMTableCB for DEC c++
610 2000-08-31 Allan Rae <rae@lyx.org>
612 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
613 character dialog separately from old document dialogs combo_language.
616 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
618 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
619 Removed LFUN_REF_CREATE.
621 * src/MenuBackend.C: Added new tags: toc and references
623 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
624 (add_lastfiles, add_documents, add_formats): Removed the unused smn
626 (add_toc, add_references): New methods.
627 (create_submenu): Handle correctly the case when there is a
628 seperator after optional menu items.
630 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
631 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
632 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
634 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
636 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
638 * src/converter.[Ch]: New file for converting between different
641 * src/export.[Ch]: New file for exporting a LyX file to different
644 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
645 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
646 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
647 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
648 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
649 RunDocBook, MenuExport.
651 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
652 Exporter::Preview methods if NEW_EXPORT is defined.
654 * src/buffer.C (Dispatch): Use Exporter::Export.
656 * src/lyxrc.C: Added new tags: \converter and \viewer.
659 * src/LyXAction.C: Define new lyx-function: buffer-update.
660 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
661 when NEW_EXPORT is defined.
663 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
665 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
667 * lib/ui/default.ui: Added submenus "view" and "update" to the
670 * src/filetools.C (GetExtension): New function.
672 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
674 2000-08-29 Allan Rae <rae@lyx.org>
676 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
678 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
679 (EnableDocumentLayout): removed
680 (DisableDocumentLayout): removed
681 (build): make use of ButtonController's read-only handling to
682 de/activate various objects. Replaces both of the above functions.
684 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
685 (readOnly): was read_only
686 (refresh): fixed dumb mistakes with read_only_ handling
688 * src/frontends/xforms/forms/form_document.fd:
689 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
690 tabbed dialogs so the tabs look more like tabs and so its easier to
691 work out which is the current tab.
693 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
694 segfault with form_table
696 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
698 2000-08-28 Juergen Vigna <jug@sad.it>
700 * acconfig.h: added USE_PSPELL.
702 * src/config.h.in: added USE_PSPELL.
704 * autogen.sh: added pspell.m4
706 * config/pspell.m4: new file.
708 * src/spellchecker.C: implemented support for pspell libary.
710 2000-08-25 Juergen Vigna <jug@sad.it>
712 * src/LyXAction.C (init): renamed LFUN_TABLE to
713 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
715 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
717 * src/lyxscreen.h: add force_clear variable and fuction to force
718 a clear area when redrawing in LyXText.
720 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
722 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
724 * some whitespace and comment changes.
726 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
728 * src/buffer.C: up te LYX_FORMAT to 2.17
730 2000-08-23 Juergen Vigna <jug@sad.it>
732 * src/BufferView_pimpl.C (tripleClick): disable this when in a
735 * src/insets/insettabular.C (pasteSelection): delete the insets
736 LyXText as it is not valid anymore.
737 (copySelection): new function.
738 (pasteSelection): new function.
739 (cutSelection): new function.
740 (LocalDispatch): implemented cut/copy/paste of cell selections.
742 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
743 don't have a LyXText.
745 * src/LyXAction.C (init): a NEW_TABULAR define too much.
747 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
750 2000-08-22 Juergen Vigna <jug@sad.it>
752 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
753 ifdef form_table out if NEW_TABULAR.
755 2000-08-21 Juergen Vigna <jug@sad.it>
757 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
758 (draw): fixed draw position so that the cursor is positioned in the
760 (InsetMotionNotify): hide/show cursor so the position is updated.
761 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
762 using cellstart() function where it should be used.
764 * src/insets/insettext.C (draw): ditto.
766 * src/tabular.C: fixed initialization of some missing variables and
767 made BoxType into an enum.
769 2000-08-22 Marko Vendelin <markov@ioc.ee>
770 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
771 stock menu item using action numerical value, not its string
775 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
777 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
778 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
780 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
782 * src/frontends/xforms/GUIRunTime.C: new file
784 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
785 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
787 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
789 * src/frontends/kde/GUIRunTime.C: new file
791 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
792 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
794 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
796 * src/frontends/gnome/GUIRunTime.C: new file
798 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
801 * src/frontends/GUIRunTime.h: removed constructor and destructor,
802 small change to documetentation.
804 * src/frontends/GUIRunTime.C: removed file
806 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
808 * src/lyxparagraph.h: enable NEW_TABULAR as default
810 * src/lyxfunc.C (processKeySym): remove some commented code
812 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
813 NEW_TABULAR around the fd_form_table_options.
815 * src/lyx_gui.C (runTime): call the static member function as
816 GUIRunTime::runTime().
818 2000-08-21 Allan Rae <rae@lyx.org>
820 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
823 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
825 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
827 2000-08-21 Allan Rae <rae@lyx.org>
829 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
831 * src/frontends/xforms/FormPreferences.C (build): use setOK
832 * src/frontends/xforms/FormDocument.C (build): use setOK
833 (FormDocument): use the appropriate policy.
835 2000-08-21 Allan Rae <rae@lyx.org>
837 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
838 automatic [de]activation of arbitrary objects when in a read-only state.
840 * src/frontends/ButtonPolicies.h: More documentation
841 (isReadOnly): added to support the above.
843 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
845 2000-08-18 Juergen Vigna <jug@sad.it>
847 * src/insets/insettabular.C (getStatus): changed to return func_status.
849 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
850 display toggle menu entries if they are.
852 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
853 new document layout now.
855 * src/lyxfunc.C: ditto
857 * src/lyx_gui_misc.C: ditto
859 * src/lyx_gui.C: ditto
861 * lib/ui/default.ui: removed paper and quotes layout as they are now
862 all in the document layout tabbed folder.
864 * src/frontends/xforms/forms/form_document.fd: added Restore
865 button and callbacks for all inputs for Allan's ButtonPolicy.
867 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
868 (CheckChoiceClass): added missing params setting on class change.
869 (UpdateLayoutDocument): added for updating the layout on params.
870 (build): forgot to RETURN_ALWAYS input_doc_spacing.
871 (FormDocument): Implemented Allan's ButtonPolicy with the
874 2000-08-17 Allan Rae <rae@lyx.org>
876 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
877 so we can at least see the credits again.
879 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
880 controller calls for the appropriate callbacks. Note that since Ok
881 calls apply followed by cancel, and apply isn't a valid input for the
882 APPLIED state, the bc_ calls have to be made in the static callback not
883 within each of the real callbacks.
885 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
886 (setOk): renamed from setOkay()
888 2000-08-17 Juergen Vigna <jug@sad.it>
890 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
891 in the implementation part.
892 (composeUIInfo): don't show optional menu-items.
894 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
896 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
898 * src/bufferview_funcs.C (CurrentState): fixed to show also the
899 text-state when in a text-inset.
901 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
903 2000-08-17 Marko Vendelin <markov@ioc.ee>
904 * src/frontends/gnome/FormIndex.C
905 * src/frontends/gnome/FormIndex.h
906 * src/frontends/gnome/FormToc.C
907 * src/frontends/gnome/FormToc.h
908 * src/frontends/gnome/dialogs
909 * src/frontends/gnome/diatoc_callbacks.c
910 * src/frontends/gnome/diatoc_callbacks.h
911 * src/frontends/gnome/diainsertindex_callbacks.h
912 * src/frontends/gnome/diainsertindex_callbacks.c
913 * src/frontends/gnome/diainsertindex_interface.c
914 * src/frontends/gnome/diainsertindex_interface.h
915 * src/frontends/gnome/diatoc_interface.h
916 * src/frontends/gnome/diatoc_interface.c
917 * src/frontends/gnome/Makefile.am: Table of Contents and
918 Insert Index dialogs implementation for Gnome frontend
920 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
922 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
924 * src/frontends/gnome/diainserturl_interface.c: make the dialog
927 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
929 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
930 destructor. Don't definde if you don't need it
931 (processEvents): made static, non-blocking events processing for
933 (runTime): static method. event loop for xforms
934 * similar as above for kde and gnome.
936 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
938 (runTime): new method calss the real frontends runtime func.
940 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
942 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
944 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
946 2000-08-16 Juergen Vigna <jug@sad.it>
948 * src/lyx_gui.C (runTime): added GUII RunTime support.
950 * src/frontends/Makefile.am:
951 * src/frontends/GUIRunTime.[Ch]:
952 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
953 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
954 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
956 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
958 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
959 as this is already set in ${FRONTEND_INCLUDE} if needed.
961 * configure.in (CPPFLAGS): setting the include dir for the frontend
962 directory and don't set FRONTEND=xforms for now as this is executed
965 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
967 * src/frontends/kde/Makefile.am:
968 * src/frontends/kde/FormUrl.C:
969 * src/frontends/kde/FormUrl.h:
970 * src/frontends/kde/formurldialog.h:
971 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
973 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
975 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
977 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
979 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
982 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
984 * src/WorkArea.C (work_area_handler): more work to get te
985 FL_KEYBOARD to work with xforms 0.88 too, please test.
987 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
989 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
991 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
994 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
996 * src/Timeout.h: remove Qt::emit hack.
998 * several files: changes to allo doc++ compilation
1000 * src/lyxfunc.C (processKeySym): new method
1001 (processKeyEvent): comment out if FL_REVISION < 89
1003 * src/WorkArea.C: change some debugging levels.
1004 (WorkArea): set wantkey to FL_KEY_ALL
1005 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1006 clearer code and the use of compose with XForms 0.89. Change to
1007 use signals instead of calling methods in bufferview directly.
1009 * src/Painter.C: change some debugging levels.
1011 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1014 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1015 (workAreaKeyPress): new method
1017 2000-08-14 Juergen Vigna <jug@sad.it>
1019 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1021 * config/kde.m4: addes some features
1023 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1024 include missing xforms dialogs.
1026 * src/Timeout.h: a hack to be able to compile with qt/kde.
1028 * sigc++/.cvsignore: added acinclude.m4
1030 * lib/.cvsignore: added listerros
1032 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1033 xforms tree as objects are needed for other frontends.
1035 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1036 linking with not yet implemented xforms objects.
1038 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1040 2000-08-14 Baruch Even <baruch.even@writeme.com>
1042 * src/frontends/xforms/FormGraphics.h:
1043 * src/frontends/xforms/FormGraphics.C:
1044 * src/frontends/xforms/RadioButtonGroup.h:
1045 * src/frontends/xforms/RadioButtonGroup.C:
1046 * src/insets/insetgraphics.h:
1047 * src/insets/insetgraphics.C:
1048 * src/insets/insetgraphicsParams.h:
1049 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1050 instead of spaces, and various other indentation issues to make the
1051 sources more consistent.
1053 2000-08-14 Marko Vendelin <markov@ioc.ee>
1055 * src/frontends/gnome/dialogs/diaprint.glade
1056 * src/frontends/gnome/FormPrint.C
1057 * src/frontends/gnome/FormPrint.h
1058 * src/frontends/gnome/diaprint_callbacks.c
1059 * src/frontends/gnome/diaprint_callbacks.h
1060 * src/frontends/gnome/diaprint_interface.c
1061 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1064 * src/frontends/gnome/dialogs/diainserturl.glade
1065 * src/frontends/gnome/FormUrl.C
1066 * src/frontends/gnome/FormUrl.h
1067 * src/frontends/gnome/diainserturl_callbacks.c
1068 * src/frontends/gnome/diainserturl_callbacks.h
1069 * src/frontends/gnome/diainserturl_interface.c
1070 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1071 Gnome implementation
1073 * src/frontends/gnome/Dialogs.C
1074 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1075 all other dialogs. Copy all unimplemented dialogs from Xforms
1078 * src/frontends/gnome/support.c
1079 * src/frontends/gnome/support.h: support files generated by Glade
1083 * config/gnome.m4: Gnome configuration scripts
1085 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1086 configure --help message
1088 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1089 only if there are no events pendling in Gnome/Gtk. This enhances
1090 the performance of menus.
1093 2000-08-14 Allan Rae <rae@lyx.org>
1095 * lib/Makefile.am: listerrors cleaning
1097 * lib/listerrors: removed -- generated file
1098 * acinclude.m4: ditto
1099 * sigc++/acinclude.m4: ditto
1101 * src/frontends/xforms/forms/form_citation.fd:
1102 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1105 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1106 `updatesrc` and now we have a `test` target that does what `updatesrc`
1107 used to do. I didn't like having an install target that wasn't related
1110 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1111 on all except FormGraphics. This may yet happen. Followed by a major
1112 cleanup including using FL_TRANSIENT for most of the dialogs. More
1113 changes to come when the ButtonController below is introduced.
1115 * src/frontends/xforms/ButtonController.h: New file for managing up to
1116 four buttons on a dialog according to an externally defined policy.
1117 * src/frontends/xforms/Makefile.am: added above
1119 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1120 Apply and Cancel/Close buttons and everything in between and beyond.
1121 * src/frontends/Makefile.am: added above.
1123 * src/frontends/xforms/forms/form_preferences.fd:
1124 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1125 and removed variable 'status' as a result. Fixed the set_minsize thing.
1126 Use the new screen-font-update after checking screen fonts were changed
1127 Added a "Restore" button to restore the original lyxrc values while
1128 editing. This restores everything not just the last input changed.
1129 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1131 * src/LyXAction.C: screen-font-update added for updating buffers after
1132 screen font settings have been changed.
1133 * src/commandtags.h: ditto
1134 * src/lyxfunc.C: ditto
1136 * forms/lyx.fd: removed screen fonts dialog.
1137 * src/lyx_gui.C: ditto
1138 * src/menus.[Ch]: ditto
1139 * src/lyx.[Ch]: ditto
1140 * src/lyx_cb.C: ditto + code from here moved to make
1141 screen-font-update. And people wonder why progress on GUII is
1142 slow. Look at how scattered this stuff was! It takes forever
1145 * forms/fdfix.sh: Fixup the spacing after commas.
1146 * forms/makefile: Remove date from generated files. Fewer clashes now.
1147 * forms/bullet_forms.C.patch: included someones handwritten changes
1149 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1150 once I've discovered why LyXRC was made noncopyable.
1151 * src/lyx_main.C: ditto
1153 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1155 * src/frontends/xforms/forms/fdfix.sh:
1156 * src/frontends/xforms/forms/fdfixh.sed:
1157 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1158 * src/frontends/xforms/Form*.[hC]:
1159 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1160 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1161 provide a destructor for the struct FD_form_xxxx. Another version of
1162 the set_[max|min]size workaround and a few other cleanups. Actually,
1163 Angus' patch from 20000809.
1165 2000-08-13 Baruch Even <baruch.even@writeme.com>
1167 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1170 2000-08-11 Juergen Vigna <jug@sad.it>
1172 * src/insets/insetgraphics.C (InsetGraphics): changing init
1173 order because of warnings.
1175 * src/frontends/xforms/forms/makefile: adding patching .C with
1178 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1179 from .C.patch to .c.patch
1181 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1182 order because of warning.
1184 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1186 * src/frontends/Liason.C (setMinibuffer): new helper function
1188 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1190 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1192 * lib/ui/default.ui: commented out PaperLayout entry
1194 * src/frontends/xforms/form_document.[Ch]: new added files
1196 * src/frontends/xforms/FormDocument.[Ch]: ditto
1198 * src/frontends/xforms/forms/form_document.fd: ditto
1200 * src/frontends/xforms/forms/form_document.C.patch: ditto
1202 2000-08-10 Juergen Vigna <jug@sad.it>
1204 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1205 (InsetGraphics): initialized cacheHandle to 0.
1206 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1208 2000-08-10 Baruch Even <baruch.even@writeme.com>
1210 * src/graphics/GraphicsCache.h:
1211 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1212 correctly as a cache.
1214 * src/graphics/GraphicsCacheItem.h:
1215 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1218 * src/graphics/GraphicsCacheItem_pimpl.h:
1219 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1222 * src/insets/insetgraphics.h:
1223 * src/insets/insetgraphics.C: Changed from using a signal notification
1224 to polling when image is not loaded.
1226 2000-08-10 Allan Rae <rae@lyx.org>
1228 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1229 that there are two functions that have to been taken out of line by
1230 hand and aren't taken care of in the script. (Just a reminder note)
1232 * sigc++/macros/*.h.m4: Updated as above.
1234 2000-08-09 Juergen Vigna <jug@sad.it>
1236 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1238 * src/insets/insettabular.C: make drawing of single cell smarter.
1240 2000-08-09 Marko Vendelin <markov@ioc.ee>
1241 * src/frontends/gnome/Menubar_pimpl.C
1242 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1243 implementation: new files
1245 * src/frontends/gnome/mainapp.C
1246 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1249 * src/main.C: create Gnome main window
1251 * src/frontends/xforms/Menubar_pimpl.h
1252 * src/frontends/Menubar.C
1253 * src/frontends/Menubar.h: added method Menubar::update that calls
1254 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1256 * src/LyXView.C: calls Menubar::update to update the state
1259 * src/frontends/gnome/Makefile.am: added new files
1261 * src/frontends/Makefile.am: added frontend compiler options
1263 2000-08-08 Juergen Vigna <jug@sad.it>
1265 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1267 * src/bufferlist.C (close):
1268 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1269 documents if exiting without saving.
1271 * src/buffer.C (save): use removeAutosaveFile()
1273 * src/support/filetools.C (removeAutosaveFile): new function.
1275 * src/lyx_cb.C (MenuWrite): returns a bool now.
1276 (MenuWriteAs): check if file could really be saved and revert to the
1278 (MenuWriteAs): removing old autosavefile if existant.
1280 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1281 before Goto toggle declaration, because of compiler warning.
1283 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1285 * src/lyxfunc.C (MenuNew): small fix.
1287 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1289 * src/bufferlist.C (newFile):
1290 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1292 * src/lyxrc.C: added new_ask_filename tag
1294 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1296 * src/lyx.fd: removed code pertaining to form_ref
1297 * src/lyx.[Ch]: ditto
1298 * src/lyx_cb.C: ditto
1299 * src/lyx_gui.C: ditto
1300 * src/lyx_gui_misc.C: ditto
1302 * src/BufferView_pimpl.C (restorePosition): update buffer only
1305 * src/commandtags.h (LFUN_REFTOGGLE): removed
1306 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1307 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1308 (LFUN_REFBACK): renamed LFUN_REF_BACK
1310 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1311 * src/menus.C: ditto
1312 * src/lyxfunc.C (Dispatch): ditto.
1313 InsertRef dialog is now GUI-independent.
1315 * src/texrow.C: added using std::endl;
1317 * src/insets/insetref.[Ch]: strip out large amounts of code.
1318 The inset is now a container and this functionality is now
1319 managed by a new FormRef dialog
1321 * src/frontends/Dialogs.h (showRef, createRef): new signals
1323 * src/frontends/xforms/FormIndex.[Ch],
1324 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1325 when setting dialog's min/max size
1326 * src/frontends/xforms/FormIndex.[Ch]: ditto
1328 * src/frontends/xforms/FormRef.[Ch],
1329 src/frontends/xforms/forms/form_ref.fd: new xforms
1330 implementation of an InsetRef dialog
1332 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1335 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1336 ios::nocreate is not part of the standard. Removed.
1338 2000-08-07 Baruch Even <baruch.even@writeme.com>
1340 * src/graphics/Renderer.h:
1341 * src/graphics/Renderer.C: Added base class for rendering of different
1342 image formats into Pixmaps.
1344 * src/graphics/XPM_Renderer.h:
1345 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1346 in a different class.
1348 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1349 easily add support for other formats.
1351 * src/insets/figinset.C: plugged a leak of an X resource.
1353 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1355 * src/CutAndPaste.[Ch]: make all metods static.
1357 * development/Code_rules/Rules: more work, added section on
1358 Exceptions, and a References section.
1360 * a lot of header files: work to make doc++ able to generate the
1361 source documentation, some workarounds of doc++ problems. Doc++ is
1362 now able to generate the documentation.
1364 2000-08-07 Juergen Vigna <jug@sad.it>
1366 * src/insets/insettabular.C (recomputeTextInsets): removed function
1368 * src/tabular.C (SetWidthOfMulticolCell):
1370 (calculate_width_of_column_NMC): fixed return value so that it really
1371 only returns true if the column-width has changed (there where
1372 problems with muliticolumn-cells in this column).
1374 2000-08-04 Juergen Vigna <jug@sad.it>
1376 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1377 also on the scrollstatus of the inset.
1378 (workAreaMotionNotify): ditto.
1380 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1382 2000-08-01 Juergen Vigna <jug@sad.it>
1384 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1386 * src/commandtags.h:
1387 * src/LyXAction.C (init):
1388 * src/insets/inset.C (LocalDispatch): added support for
1391 * src/insets/inset.C (scroll): new functions.
1393 * src/insets/insettext.C (removeNewlines): new function.
1394 (SetAutoBreakRows): removes forced newlines in the text of the
1395 paragraph if autoBreakRows is set to false.
1397 * src/tabular.C (Latex): generates a parbox around the cell contents
1400 * src/frontends/xforms/FormTabular.C (local_update): removed
1401 the radio_useparbox button.
1403 * src/tabular.C (UseParbox): new function
1405 2000-08-06 Baruch Even <baruch.even@writeme.com>
1407 * src/graphics/GraphicsCache.h:
1408 * src/graphics/GraphicsCache.C:
1409 * src/graphics/GraphicsCacheItem.h:
1410 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1413 * src/insets/insetgraphics.h:
1414 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1415 drawing of the inline image.
1417 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1418 into the wrong position.
1420 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1423 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1425 * src/support/translator.h: move all typedefs to public section
1427 * src/support/filetools.C (MakeLatexName): return string const
1429 (TmpFileName): ditto
1430 (FileOpenSearch): ditto
1432 (LibFileSearch): ditto
1433 (i18nLibFileSearch): ditto
1436 (CreateTmpDir): ditto
1437 (CreateBufferTmpDir): ditto
1438 (CreateLyXTmpDir): ditto
1441 (MakeAbsPath): ditto
1443 (OnlyFilename): ditto
1445 (NormalizePath): ditto
1446 (CleanupPath): ditto
1447 (GetFileContents): ditto
1448 (ReplaceEnvironmentPath): ditto
1449 (MakeRelPath): ditto
1451 (ChangeExtension): ditto
1452 (MakeDisplayPath): ditto
1453 (do_popen): return cmdret const
1454 (findtexfile): return string const
1456 * src/support/DebugStream.h: add some /// to please doc++
1458 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1460 * src/texrow.C (same_rownumber): functor to use with find_if
1461 (getIdFromRow): rewritten to use find_if and to not update the
1462 positions. return true if row is found
1463 (increasePos): new method, use to update positions
1465 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1467 * src/lyxlex_pimpl.C (verifyTable): new method
1470 (GetString): return string const
1471 (pushTable): rewrite to use std::stack
1473 (setFile): better check
1476 * src/lyxlex.h: make LyXLex noncopyable
1478 * src/lyxlex.C (text): return char const * const
1479 (GetString): return string const
1480 (getLongString): return string const
1482 * src/lyx_gui_misc.C (askForText): return pair<...> const
1484 * src/lastfiles.[Ch] (operator): return string const
1486 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1487 istringstream not char const *.
1488 move token.end() out of loop.
1489 (readFile): move initializaton of token
1491 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1492 getIdFromRow is successful.
1494 * lib/bind/emacs.bind: don't include menus bind
1496 * development/Code_rules/Rules: the beginnings of making this
1497 better and covering more of the unwritten rules that we have.
1499 * development/Code_rules/Recommendations: a couple of wording
1502 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1504 * src/support/strerror.c: remove C++ comment.
1506 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1508 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1509 LFUN_INDEX_INSERT_LAST
1511 * src/texrow.C (getIdFromRow): changed from const_iterator to
1512 iterator, allowing code to compile with DEC cxx
1514 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1515 stores part of the class, as suggested by Allan. Will allow
1517 (apply): test to apply uses InsetCommandParams operator!=
1519 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1520 (apply): test to apply uses InsetCommandParams operator!=
1522 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1523 stores part of the class.
1524 (update): removed limits on min/max size.
1526 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1527 (apply): test to apply uses InsetCommandParams operator!=
1529 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1530 (Read, Write, scanCommand, getCommand): moved functionality
1531 into InsetCommandParams.
1533 (getScreenLabel): made pure virtual
1534 new InsetCommandParams operators== and !=
1536 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1537 c-tors based on InsetCommandParams. Removed others.
1538 * src/insets/insetinclude.[Ch]: ditto
1539 * src/insets/insetlabel.[Ch]: ditto
1540 * src/insets/insetparent.[Ch]: ditto
1541 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1543 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1544 insets derived from InsetCommand created using similar c-tors
1545 based on InsetCommandParams
1546 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1547 * src/menus.C (ShowRefsMenu): ditto
1548 * src/paragraph.C (Clone): ditto
1549 * src/text2.C (SetCounter): ditto
1550 * src/lyxfunc.C (Dispatch) ditto
1551 Also recreated old InsetIndex behaviour exactly. Can now
1552 index-insert at the start of a paragraph and index-insert-last
1553 without launching the pop-up.
1555 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1557 * lib/lyxrc.example: mark te pdf options as non functional.
1559 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1560 (isStrDbl): move tmpstr.end() out of loop.
1561 (strToDbl): move intialization of tmpstr
1562 (lowercase): return string const and move tmp.end() out of loop.
1563 (uppercase): return string const and move tmp.edn() out of loop.
1564 (prefixIs): add assertion
1569 (containsOnly): ditto
1570 (containsOnly): ditto
1571 (containsOnly): ditto
1572 (countChar): make last arg char not char const
1573 (token): return string const
1574 (subst): return string const, move tmp.end() out of loop.
1575 (subst): return string const, add assertion
1576 (strip): return string const
1577 (frontStrip): return string const, add assertion
1578 (frontStrip): return string const
1583 * src/support/lstrings.C: add inclde "LAssert.h"
1584 (isStrInt): move tmpstr.end() out of loop.
1586 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1587 toollist.end() out of loop.
1588 (deactivate): move toollist.end() out of loop.
1589 (update): move toollist.end() out of loop.
1590 (updateLayoutList): move tc.end() out of loop.
1591 (add): move toollist.end() out of loop.
1593 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1594 md.end() out of loop.
1596 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1598 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1601 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1602 (Erase): move insetlist.end() out of loop.
1604 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1605 ref to const string as first arg. Move initialization of some
1606 variables, whitespace changes.
1608 * src/kbmap.C (defkey): move table.end() out of loop.
1609 (kb_keymap): move table.end() out of loop.
1610 (findbinding): move table.end() out of loop.
1612 * src/MenuBackend.C (hasMenu): move end() out of loop.
1613 (getMenu): move end() out of loop.
1614 (getMenu): move menulist_.end() out of loop.
1616 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1618 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1621 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1622 (getFromLyXName): move infotab.end() out of loop.
1624 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1625 -fvtable-thunks -ffunction-sections -fdata-sections
1627 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1629 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1632 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1634 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1636 * src/frontends/xforms/FormCitation.[Ch],
1637 src/frontends/xforms/FormIndex.[Ch],
1638 src/frontends/xforms/FormToc.[Ch],
1639 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1641 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1643 * src/commandtags.h: renamed, created some flags for citation
1646 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1648 * src/lyxfunc.C (dispatch): use signals to insert index entry
1650 * src/frontends/Dialogs.h: new signal createIndex
1652 * src/frontends/xforms/FormCommand.[Ch],
1653 src/frontends/xforms/FormCitation.[Ch],
1654 src/frontends/xforms/FormToc.[Ch],
1655 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1657 * src/insets/insetindex.[Ch]: GUI-independent
1659 * src/frontends/xforms/FormIndex.[Ch],
1660 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1663 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1665 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1666 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1668 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1670 * src/insets/insetref.C (Latex): rewrite so that there is now
1671 question that a initialization is requested.
1673 * src/insets/insetcommand.h: reenable the hide signal
1675 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1677 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1678 fix handling of shortcuts (many bugs :)
1679 (add_lastfiles): ditto.
1681 * lib/ui/default.ui: fix a few shortcuts.
1683 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1685 * Makefile.am: Fix ``rpmdist'' target to return the exit
1686 status of the ``rpm'' command, instead of the last command in
1687 the chain (the ``rm lyx.xpm'' command, which always returns
1690 2000-08-02 Allan Rae <rae@lyx.org>
1692 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1693 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1694 * src/frontends/xforms/FormToc.C (FormToc): ditto
1696 * src/frontends/xforms/Makefile.am: A few forgotten files
1698 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1699 Signals-not-copyable-problem Lars' started commenting out.
1701 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1703 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1705 * src/insets/insetcommand.h: Signals is not copyable so anoter
1706 scheme for automatic hiding of forms must be used.
1708 * src/frontends/xforms/FormCitation.h: don't inerit from
1709 noncopyable, FormCommand already does that.
1710 * src/frontends/xforms/FormToc.h: ditto
1711 * src/frontends/xforms/FormUrl.h: ditto
1713 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1715 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1717 * src/insets/insetcommand.h (hide): new SigC::Signal0
1718 (d-tor) new virtual destructor emits hide signal
1720 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1721 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1723 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1724 LOF and LOT. Inset is now GUI-independent
1726 * src/insets/insetloa.[Ch]: redundant
1727 * src/insets/insetlof.[Ch]: ditto
1728 * src/insets/insetlot.[Ch]: ditto
1730 * src/frontends/xforms/forms/form_url.fd: tweaked!
1731 * src/frontends/xforms/forms/form_citation.fd: ditto
1733 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1734 dialogs dealing with InsetCommand insets
1736 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1737 FormCommand base class
1738 * src/frontends/xforms/FormUrl.[Ch]: ditto
1740 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1742 * src/frontends/xforms/FormToc.[Ch]: ditto
1744 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1745 passed a generic InsetCommand pointer
1746 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1748 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1749 and modified InsetTOC class
1750 * src/buffer.C: ditto
1752 * forms/lyx.fd: strip out old FD_form_toc code
1753 * src/lyx_gui_misc.C: ditto
1754 * src/lyx_gui.C: ditto
1755 * src/lyx_cb.C: ditto
1756 * src/lyx.[Ch]: ditto
1758 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1760 * src/support/utility.hpp: tr -d '\r'
1762 2000-08-01 Juergen Vigna <jug@sad.it>
1764 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1766 * src/commandtags.h:
1767 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1768 LFUN_TABULAR_FEATURES.
1770 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1771 LFUN_LAYOUT_TABULAR.
1773 * src/insets/insettabular.C (getStatus): implemented helper function.
1775 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1777 2000-07-31 Juergen Vigna <jug@sad.it>
1779 * src/text.C (draw): fixed screen update problem for text-insets.
1781 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1782 something changed probably this has to be added in various other
1785 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1787 2000-07-31 Baruch Even <baruch.even@writeme.com>
1789 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1790 templates to satisfy compaq cxx.
1793 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1795 * src/support/translator.h (equal_1st_in_pair::operator()): take
1796 const ref pair_type as arg.
1797 (equal_2nd_in_pair::operator()): ditto
1798 (Translator::~Translator): remove empty d-tor.
1800 * src/graphics/GraphicsCache.C: move include config.h to top, also
1801 put initialization of GraphicsCache::singleton here.
1802 (~GraphicsCache): move here
1803 (addFile): take const ref as arg
1806 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1808 * src/BufferView2.C (insertLyXFile): change te with/without header
1811 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1813 * src/frontends/xforms/FormGraphics.C (apply): add some
1814 static_cast. Not very nice, but required by compaq cxx.
1816 * src/frontends/xforms/RadioButtonGroup.h: include header
1817 <utility> instead of <pair.h>
1819 * src/insets/insetgraphicsParams.C: add using directive.
1820 (readResize): change return type to void.
1821 (readOrigin): ditto.
1823 * src/lyxfunc.C (getStatus): add missing break for build-program
1824 function; add test for Literate for export functions.
1826 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1827 entries in Options menu.
1829 2000-07-31 Baruch Even <baruch.even@writeme.com>
1831 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1832 protect against auto-allocation; release icon when needed.
1834 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1836 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1837 on usual typewriter.
1839 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1840 earlier czech.kmap), useful only for programming.
1842 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1844 * src/frontends/xforms/FormCitation.h: fix conditioning around
1847 2000-07-31 Juergen Vigna <jug@sad.it>
1849 * src/frontends/xforms/FormTabular.C (local_update): changed
1850 radio_linebreaks to radio_useparbox and added radio_useminipage.
1852 * src/tabular.C: made support for using minipages/parboxes.
1854 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1856 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1858 (descent): so the cursor is in the middle.
1859 (width): bit smaller box.
1861 * src/insets/insetgraphics.h: added display() function.
1863 2000-07-31 Baruch Even <baruch.even@writeme.com>
1865 * src/frontends/Dialogs.h: Added showGraphics signals.
1867 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1868 xforms form definition of the graphics dialog.
1870 * src/frontends/xforms/FormGraphics.h:
1871 * src/frontends/xforms/FormGraphics.C: Added files, the
1872 GUIndependent code of InsetGraphics
1874 * src/insets/insetgraphics.h:
1875 * src/insets/insetgraphics.C: Major writing to make it work.
1877 * src/insets/insetgraphicsParams.h:
1878 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1879 struct between InsetGraphics and GUI.
1881 * src/LaTeXFeatures.h:
1882 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1883 support for graphicx package.
1885 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1886 for the graphics inset.
1888 * src/support/translator.h: Added file, used in
1889 InsetGraphicsParams. this is a template to translate between two
1892 * src/frontends/xforms/RadioButtonGroup.h:
1893 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1894 way to easily control a radio button group.
1896 2000-07-28 Juergen Vigna <jug@sad.it>
1898 * src/insets/insettabular.C (LocalDispatch):
1899 (TabularFeatures): added support for lyx-functions of tabular features.
1900 (cellstart): refixed this function after someone wrongly changed it.
1902 * src/commandtags.h:
1903 * src/LyXAction.C (init): added support for tabular-features
1905 2000-07-28 Allan Rae <rae@lyx.org>
1907 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1908 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1909 triggers the callback for input checking. As a result we sometimes get
1910 "LyX: This shouldn't happen..." printed to cerr.
1911 (input): Started using status variable since I only free() on
1912 destruction. Some input checking for paths and font sizes.
1914 * src/frontends/xforms/FormPreferences.h: Use status to control
1915 activation of Ok and Apply
1917 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1918 callback. Also resized to stop segfaults with 0.88. The problem is
1919 that xforms-0.88 requires the folder to be wide enough to fit all the
1920 tabs. If it isn't it causes all sorts of problems.
1922 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1924 * src/frontends/xforms/forms/README: Reflect reality.
1926 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1927 * src/frontends/xforms/forms/makefile: ditto.
1929 * src/commandtags.h: Get access to new Preferences dialog
1930 * src/LyXAction.C: ditto
1931 * src/lyxfunc.C: ditto
1932 * lib/ui/default.ui: ditto
1934 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1936 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1938 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1941 * src/frontends/xforms/form_url.[Ch]: added.
1943 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1945 * src/insets/insetbib.h: fixed bug in previous commit
1947 * src/frontends/xforms/FormUrl.h: ditto
1949 * src/frontends/xforms/FormPrint.h: ditto
1951 * src/frontends/xforms/FormPreferences.h: ditto
1953 * src/frontends/xforms/FormCopyright.h: ditto
1955 * src/frontends/xforms/FormCitation.C: ditto
1957 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1958 private copyconstructor and private default contructor
1960 * src/support/Makefile.am: add utility.hpp
1962 * src/support/utility.hpp: new file from boost
1964 * src/insets/insetbib.h: set owner in clone
1966 * src/frontends/xforms/FormCitation.C: added missing include
1969 * src/insets/form_url.[Ch]: removed
1971 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1973 * development/lyx.spec.in
1974 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1975 file/directory re-organization.
1977 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1979 * src/insets/insetcommand.[Ch]: moved the string data and
1980 associated manipulation methods into a new stand-alone class
1981 InsetCommandParams. This class has two additional methods
1982 getAsString() and setFromString() allowing the contents to be
1983 moved around as a single string.
1984 (addContents) method removed.
1985 (setContents) method no longer virtual.
1987 * src/buffer.C (readInset): made use of new InsetCitation,
1988 InsetUrl constructors based on InsetCommandParams.
1990 * src/commandtags.h: add LFUN_INSERT_URL
1992 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1993 independent InsetUrl and use InsetCommandParams to extract
1994 string info and create new Insets.
1996 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1998 * src/frontends/xforms/FormCitation.C (apply): uses
2001 * src/frontends/xforms/form_url.C
2002 * src/frontends/xforms/form_url.h
2003 * src/frontends/xforms/FormUrl.h
2004 * src/frontends/xforms/FormUrl.C
2005 * src/frontends/xforms/forms/form_url.fd: new files
2007 * src/insets/insetcite.[Ch]: removed unused constructors.
2009 * src/insets/insetinclude.[Ch]: no longer store filename
2011 * src/insets/inseturl.[Ch]: GUI-independent.
2013 2000-07-26 Juergen Vigna <jug@sad.it>
2014 * renamed frontend from gtk to gnome as it is that what is realized
2015 and did the necessary changes in the files.
2017 2000-07-26 Marko Vendelin <markov@ioc.ee>
2019 * configure.in: cleaning up gnome configuration scripts
2021 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2023 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2024 shortcuts syndrom by redrawing them explicitely (a better solution
2025 would be appreciated).
2027 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2029 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2032 * src/lyx_cb.C (MenuExport): change html export to do the right
2033 thing depending of the document type (instead of having
2034 html-linuxdoc and html-docbook).
2035 * src/lyxfunc.C (getStatus): update for html
2036 * lib/ui/default.ui: simplify due to the above change.
2037 * src/menus.C (ShowFileMenu): update too (in case we need it).
2039 * src/MenuBackend.C (read): if a menu is defined twice, add the
2040 new entries to the exiting one.
2042 2000-07-26 Juergen Vigna <jug@sad.it>
2044 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2046 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2047 and return a bool if it did actual save the file.
2048 (AutoSave): don't autosave a unnamed doc.
2050 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2051 check if this is an UNNAMED new file and react to it.
2052 (newFile): set buffer to unnamed and change to not mark a new
2053 buffer dirty if I didn't do anything with it.
2055 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2057 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2059 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2060 friend as per Angus's patch posted to lyx-devel.
2062 * src/ext_l10n.h: updated
2064 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2065 gettext on the style string right before inserting them into the
2068 * autogen.sh: add code to extract style strings form layout files,
2069 not good enough yet.
2071 * src/frontends/gtk/.cvsignore: add MAKEFILE
2073 * src/MenuBackend.C (read): run the label strings through gettext
2074 before storing them in the containers.
2076 * src/ext_l10n.h: new file
2078 * autogen.sh : generate the ext_l10n.h file here
2080 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2082 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2085 * lib/ui/default.ui: fix a couple of typos.
2087 * config/gnome/gtk.m4: added (and added to the list of files in
2090 * src/insets/insetinclude.C (unique_id): fix when we are using
2091 lyxstring instead of basic_string<>.
2092 * src/insets/insettext.C (LocalDispatch): ditto.
2093 * src/support/filetools.C: ditto.
2095 * lib/configure.m4: create the ui/ directory if necessary.
2097 * src/LyXView.[Ch] (updateToolbar): new method.
2099 * src/BufferView_pimpl.C (buffer): update the toolbar when
2100 opening/closing buffer.
2102 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2104 * src/LyXAction.C (getActionName): enhance to return also the name
2105 and options of pseudo-actions.
2106 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2108 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2109 as an example of what is possible). Used in File->Build too (more
2110 useful) and in the import/export menus (to mimick the complicated
2111 handling of linuxdoc and friends). Try to update all the entries.
2113 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2116 * src/MenuBackend.C (read): Parse the new OptItem tag.
2118 * src/MenuBackend.h: Add a new optional_ data member (used if the
2119 entry should be omitted when the lyxfunc is disabled).
2121 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2122 function, used as a shortcut.
2123 (create_submenu): align correctly the shortcuts on the widest
2126 * src/MenuBackend.h: MenuItem.label() only returns the label of
2127 the menu without shortcut; new method shortcut().
2129 2000-07-14 Marko Vendelin <markov@ioc.ee>
2131 * src/frontends/gtk/Dialogs.C:
2132 * src/frontends/gtk/FormCopyright.C:
2133 * src/frontends/gtk/FormCopyright.h:
2134 * src/frontends/gtk/Makefile.am: added these source-files for the
2135 Gtk/Gnome support of the Copyright-Dialog.
2137 * src/main.C: added Gnome::Main initialization if using
2138 Gtk/Gnome frontend-GUI.
2140 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2142 * config/gnome/aclocal-include.m4
2143 * config/gnome/compiler-flags.m4
2144 * config/gnome/curses.m4
2145 * config/gnome/gnome--.m4
2146 * config/gnome/gnome-bonobo-check.m4
2147 * config/gnome/gnome-common.m4
2148 * config/gnome/gnome-fileutils.m4
2149 * config/gnome/gnome-ghttp-check.m4
2150 * config/gnome/gnome-gnorba-check.m4
2151 * config/gnome/gnome-guile-checks.m4
2152 * config/gnome/gnome-libgtop-check.m4
2153 * config/gnome/gnome-objc-checks.m4
2154 * config/gnome/gnome-orbit-check.m4
2155 * config/gnome/gnome-print-check.m4
2156 * config/gnome/gnome-pthread-check.m4
2157 * config/gnome/gnome-support.m4
2158 * config/gnome/gnome-undelfs.m4
2159 * config/gnome/gnome-vfs.m4
2160 * config/gnome/gnome-x-checks.m4
2161 * config/gnome/gnome-xml-check.m4
2162 * config/gnome/gnome.m4
2163 * config/gnome/gperf-check.m4
2164 * config/gnome/gtk--.m4
2165 * config/gnome/linger.m4
2166 * config/gnome/need-declaration.m4: added configuration scripts
2167 for Gtk/Gnome frontend-GUI
2169 * configure.in: added support for the --with-frontend=gtk option
2171 * autogen.sh: added config/gnome/* to list of config-files
2173 * acconfig.h: added define for GTKGUI-support
2175 * config/lyxinclude.m4: added --with-frontend[=value] option value
2176 for Gtk/Gnome frontend-GUI support.
2178 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2180 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2184 * src/paragraph.C (GetChar): remove non-const version
2186 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2187 (search_kw): use it.
2189 * src/lyx_main.C (init): if "preferences" exist, read that instead
2191 (ReadRcFile): return bool if the file could be read ok.
2192 (ReadUIFile): add a check to see if lex file is set ok.
2194 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2195 bastring can be used instead of lyxstring (still uses the old code
2196 if std::string is good enough or if lyxstring is used.)
2198 * src/encoding.C: make the arrays static, move ininle functions
2200 * src/encoding.h: from here.
2202 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2203 (parseSingleLyXformat2Token): move inset parsing to separate method
2204 (readInset): new private method
2206 * src/Variables.h: remove virtual from get().
2208 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2209 access to NEW_INSETS and NEW_TABULAR
2211 * src/MenuBackend.h: remove superfluous forward declaration of
2212 MenuItem. Add documentations tags "///", remove empty MenuItem
2213 destructor, remove private default contructor.
2215 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2217 (read): more string mlabel and mname to where they are used
2218 (read): remove unused variables mlabel and mname
2219 (defaults): unconditional clear, make menusetup take advantage of
2220 add returning Menu &.
2222 * src/LyXView.h: define NEW_MENUBAR as default
2224 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2225 to NEW_INSETS and NEW_TABULAR.
2226 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2227 defined. Change some of the "xxxx-inset-insert" functions names to
2230 * several files: more enahncements to NEW_INSETS and the resulting
2233 * lib/lyxrc.example (\date_insert_format): move to misc section
2235 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2236 bastring and use AC_CACHE_CHECK.
2237 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2238 the system have the newest methods. uses AC_CACHE_CHECK
2239 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2240 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2241 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2243 * configure.in: add LYX_CXX_GOOD_STD_STRING
2245 * acinclude.m4: recreated
2247 2000-07-24 Amir Karger
2249 * README: add Hebrew, Arabic kmaps
2252 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2254 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2257 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2259 * Lot of files: add pragma interface/implementation.
2261 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2263 * lib/ui/default.ui: new file (ans new directory). Contains the
2264 default menu and toolbar.
2266 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2267 global space. Toolbars are now read (as menus) in ui files.
2269 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2271 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2272 is disabled because the document is read-only. We want to have the
2273 toggle state of the function anyway.
2274 (getStatus): add code for LFUN_VC* functions (mimicking what is
2275 done in old-style menus)
2277 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2278 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2280 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2281 * src/BufferView_pimpl.C: ditto.
2282 * src/lyxfunc.C: ditto.
2284 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2285 default). This replaces old-style menus by new ones.
2287 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2288 MenuItem. Contain the data structure of a menu.
2290 * src/insets/insettext.C: use LyXView::setLayout instead of
2291 accessing directly the toolbar combox.
2292 * src/lyxfunc.C (Dispatch): ditto.
2294 * src/LyXView.C (setLayout): new method, which just calls
2295 Toolbar::setLayout().
2296 (updateLayoutChoice): move part of this method in Toolbar.
2298 * src/toolbar.[Ch]: removed.
2300 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2301 implementation the toolbar.
2303 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2304 the toolbar. It might make sense to merge it with ToolbarDefaults
2306 (setLayout): new function.
2307 (updateLayoutList): ditto.
2308 (openLayoutList): ditto.
2310 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2311 xforms implementation of the toolbar.
2312 (get_toolbar_func): comment out, since I do not
2313 know what it is good for.
2315 * src/ToolbarDefaults.h: Add the ItemType enum.
2317 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2318 for a list of allocated C strings. Used in Menubar xforms
2319 implementation to avoid memory leaks.
2321 * src/support/lstrings.[Ch] (uppercase): new version taking and
2325 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2326 * lib/bind/emacs.bind: ditto.
2328 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2330 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2331 forward decl of LyXView.
2333 * src/toolbar.C (toolbarItem): moved from toolbar.h
2334 (toolbarItem::clean): ditto
2335 (toolbarItem::~toolbarItem): ditto
2336 (toolbarItem::operator): ditto
2338 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2340 * src/paragraph.h: control the NEW_TABULAR define from here
2342 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2343 USE_TABULAR_INSETS to NEW_TABULAR
2345 * src/ToolbarDefaults.C: add include "lyxlex.h"
2347 * files using the old table/tabular: use NEW_TABULAR to control
2348 compilation of old tabular stuff.
2350 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2353 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2354 planemet in reading of old style floats, fix the \end_deeper
2355 problem when reading old style floats.
2357 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2359 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2361 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2363 * lib/bind/sciword.bind: updated.
2365 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2367 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2368 layout write problem
2370 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2372 * src/Makefile.am (INCLUDES): remove image directory from include
2375 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2376 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2378 * src/LyXView.C (create_form_form_main): read the application icon
2381 * lib/images/*.xpm: change the icons to use transparent color for
2384 * src/toolbar.C (update): change the color of the button when it
2387 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2389 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2390 setting explicitely the minibuffer.
2391 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2393 * src/LyXView.C (showState): new function. Shows font information
2394 in minibuffer and update toolbar state.
2395 (LyXView): call Toolbar::update after creating the
2398 * src/toolbar.C: change toollist to be a vector instead of a
2400 (BubbleTimerCB): get help string directly from the callback
2401 argument of the corresponding icon (which is the action)
2402 (set): remove unnecessary ugliness.
2403 (update): new function. update the icons (depressed, disabled)
2404 depending of the status of the corresponding action.
2406 * src/toolbar.h: remove help in toolbarItem
2408 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2410 * src/Painter.C (text): Added code for using symbol glyphs from
2411 iso10646 fonts. Currently diabled.
2413 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2416 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2417 magyar,turkish and usorbian.
2419 * src/paragraph.C (isMultiLingual): Made more efficient.
2421 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2424 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2425 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2426 Also changed the prototype to "bool math_insert_greek(char)".
2428 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2430 * lots of files: apply the NEW_INSETS on all code that will not be
2431 needed when we move to use the new insets. Enable the define in
2432 lyxparagrah.h to try it.
2434 * src/insets/insettabular.C (cellstart): change to be a static
2436 (InsetTabular): initialize buffer in the initializer list.
2438 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2440 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2441 form_print.h out of the header file. Replaced with forward
2442 declarations of the relevant struct.
2444 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2447 * src/commandtags.h: do not include "debug.h" which does not
2448 belong there. #include it in some other places because of this
2451 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2453 * src/insets/insetcaption.C: add a couple "using" directives.
2455 * src/toolbar.C (add): get the help text directly from lyxaction.
2457 (setPixmap): new function. Loads from disk and sets a pixmap on a
2458 botton; the name of the pixmap file is derived from the command
2461 * src/toolbar.h: remove members isBitmap and pixmap from
2464 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2465 * lib/images/: move many files from images/banner.xpm.
2467 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2469 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2470 * src/toolbar.C: ditto.
2471 * configure.in: ditto.
2472 * INSTALL: document.
2474 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2475 the spellchecker popup is closed from the WM.
2477 2000-07-19 Juergen Vigna <jug@sad.it>
2479 * src/insets/insetfloat.C (Write): small fix because we use the
2480 insetname for the type now!
2482 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2484 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2487 * src/frontends/Dialogs.h: removed hideCitation signal
2489 * src/insets/insetcite.h: added hide signal
2491 * src/insets/insetcite.C (~InsetCitation): emits new signal
2492 (getScreenLabel): "intelligent" label should now fit on the screen!
2494 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2496 * src/frontends/xforms/FormCitation.C (showInset): connects
2497 hide() to the inset's hide signal
2498 (show): modified to use fl_set_object_position rather than
2499 fl_set_object_geometry wherever possible
2501 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2503 * src/insets/lyxinset.h: add caption code
2505 * src/insets/insetfloat.C (type): new method
2507 * src/insets/insetcaption.C (Write): new method
2509 (LyxCode): new method
2511 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2512 to get it right together with using the FloatList.
2514 * src/commandtags.h: add LFUN_INSET_CAPTION
2515 * src/lyxfunc.C (Dispatch): handle it
2517 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2520 * src/Variables.[Ch]: make expand take a const reference, remove
2521 the destructor, some whitespace changes.
2523 * src/LyXAction.C (init): add caption-inset-insert
2525 * src/FloatList.C (FloatList): update the default floats a bit.
2527 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2529 * src/Variables.[Ch]: new files. Intended to be used for language
2530 specific strings (like \chaptername) and filename substitution in
2533 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2535 * lib/kbd/american.kmap: update
2537 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2539 * src/bufferparams.[Ch]: remove member allowAccents.
2541 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2543 * src/LaTeXLog.C: use the log_form.h header.
2544 * src/lyx_gui.C: ditto.
2545 * src/lyx_gui_misc.C: ditto.
2546 * src/lyxvc.h: ditto.
2548 * forms/log_form.fd: new file, created from latexoptions.fd. I
2549 kept the log popup and nuked the options form.
2551 * src/{la,}texoptions.[Ch]: removed.
2552 * src/lyx_cb.C (LaTeXOptions): ditto
2554 * src/lyx_gui.C (create_forms): do not handle the
2555 fd_latex_options form.
2557 2000-07-18 Juergen Vigna <jug@sad.it>
2559 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2560 name of the inset so that it can be requested outside (text2.C).
2562 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2565 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2567 * src/mathed/formula.h (ConvertFont): constify
2569 * src/mathed/formula.C (Read): add warning if \end_inset is not
2570 found on expected place.
2572 * src/insets/lyxinset.h (ConvertFont): consify
2574 * src/insets/insetquotes.C (ConvertFont): constify
2575 * src/insets/insetquotes.h: ditto
2577 * src/insets/insetinfo.h: add labelfont
2579 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2580 (ascent): use labelfont
2584 (Write): make .lyx file a bit nicer
2586 * src/insets/insetfloat.C (Write): simplify somewhat...
2587 (Read): add warning if arg is not found
2589 * src/insets/insetcollapsable.C: add using std::max
2590 (Read): move string token and add warning in arg is not found
2591 (draw): use std::max to get the right ty
2592 (getMaxWidth): simplify by using std::max
2594 * src/insets/insetsection.h: new file
2595 * src/insets/insetsection.C: new file
2596 * src/insets/insetcaption.h: new file
2597 * src/insets/insetcaption.C: new file
2599 * src/insets/inset.C (ConvertFont): constify signature
2601 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2602 insetcaption.[Ch] and insetsection.[Ch]
2604 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2605 uses to use LABEL_COUNTER_CHAPTER instead.
2606 * src/text2.C (SetCounter): here
2608 * src/counters.h: new file
2609 * src/counters.C: new file
2610 * src/Sectioning.h: new file
2611 * src/Sectioning.C: new file
2613 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2615 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2617 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2620 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2623 2000-07-17 Juergen Vigna <jug@sad.it>
2625 * src/tabular.C (Validate): check if array-package is needed.
2626 (SetVAlignment): added support for vertical alignment.
2627 (SetLTFoot): better support for longtable header/footers
2628 (Latex): modified to support added features.
2630 * src/LaTeXFeatures.[Ch]: added array-package.
2632 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2634 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2637 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2639 * configure.in: do not forget to put a space after -isystem.
2641 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2643 * lib/kbd/arabic.kmap: a few fixes.
2645 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2647 * some whitespace chagnes to a number of files.
2649 * src/support/DebugStream.h: change to make it easier for
2650 doc++ to parse correctly.
2651 * src/support/lyxstring.h: ditto
2653 * src/mathed/math_utils.C (compara): change to have only one
2655 (MathedLookupBOP): change because of the above.
2657 * src/mathed/math_delim.C (math_deco_compare): change to have only
2659 (search_deco): change becasue of the above.
2661 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2662 instead of manually coded one.
2664 * src/insets/insetquotes.C (Read): read the \end_inset too
2666 * src/insets/insetlatex.h: remove file
2667 * src/insets/insetlatex.C: remove file
2669 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2671 (InsetPrintIndex): remove destructor
2673 * src/insets/insetinclude.h: remove default constructor
2675 * src/insets/insetfloat.C: work to make it work better
2677 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2679 * src/insets/insetcite.h (InsetCitation): remove default constructor
2681 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2683 * src/text.C (GetColumnNearX): comment out some currently unused code.
2685 * src/paragraph.C (writeFile): move some initializations closer to
2687 (CutIntoMinibuffer): small change to use new matchIT operator
2691 (InsertInset): ditto
2694 (InsetIterator): ditto
2695 (Erase): small change to use new matchFT operator
2697 (GetFontSettings): ditto
2698 (HighestFontInRange): ditto
2701 * src/lyxparagraph.h: some chars changed to value_type
2702 (matchIT): because of some stronger checking (perhaps too strong)
2703 in SGI STL, the two operator() unified to one.
2706 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2708 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2709 the last inset read added
2710 (parseSingleLyXformat2Token): some more (future) compability code added
2711 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2712 (parseSingleLyXformat2Token): set last_inset_read
2713 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2714 (parseSingleLyXformat2Token): don't double intializw string next_token
2716 * src/TextCache.C (text_fits::operator()): add const's to the signature
2717 (has_buffer::operator()): ditto
2719 * src/Floating.h: add some comments on the class
2721 * src/FloatList.[Ch] (typeExist): new method
2724 * src/BackStack.h: added default constructor, wanted by Gcc.
2726 2000-07-14 Juergen Vigna <jug@sad.it>
2728 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2730 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2732 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2733 do a redraw when the window is resized!
2734 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2736 * src/insets/insettext.C (resizeLyXText): added function to correctly
2737 being able to resize the LyXWindow.
2739 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2741 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2743 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2744 crashes when closing dialog to a deleted inset.
2746 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2747 method! Now similar to other insets.
2749 2000-07-13 Juergen Vigna <jug@sad.it>
2751 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2753 * lib/examples/Literate.lyx: small patch!
2755 * src/insets/insetbib.C (Read): added this function because of wrong
2756 Write (without [begin|end]_inset).
2758 2000-07-11 Juergen Vigna <jug@sad.it>
2760 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2761 as the insertInset could not be good!
2763 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2764 the bool param should not be last.
2766 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2768 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2769 did submit that to Karl).
2771 * configure.in: use -isystem instead of -I for X headers. This
2772 fixes a problem on solaris with a recent gcc;
2773 put the front-end code after the X detection code;
2774 configure in sigc++ before lib/
2776 * src/lyx_main.C (commandLineHelp): remove -display from command
2779 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2781 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2782 Also put in Makefile rules for building the ``listerrors''
2783 program for parsing errors from literate programs written in LyX.
2785 * lib/build-listerrors: Added small shell script as part of compile
2786 process. This builds a working ``listerrors'' binary if noweb is
2787 installed and either 1) the VNC X server is installed on the machine,
2788 or 2) the user is compiling from within a GUI. The existence of a GUI
2789 is necessary to use the ``lyx --export'' feature for now. This
2790 hack can be removed once ``lyx --export'' no longer requires a GUI to
2793 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2795 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2796 now passed back correctly from gcc and placed "under" error
2797 buttons in a Literate LyX source.
2799 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2801 * src/text.C (GetColumnNearX): Better behavior when a RTL
2802 paragraph is ended by LTR text.
2804 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2807 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2809 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2810 true when clipboard is empty.
2812 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2814 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2815 row of the paragraph.
2816 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2817 to prevent calculation of bidi tables
2819 2000-07-07 Juergen Vigna <jug@sad.it>
2821 * src/screen.C (ToggleSelection): added y_offset and x_offset
2824 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2827 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2829 * src/insets/insettext.C: fixed Layout-Display!
2831 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2833 * configure.in: add check for strings.h header.
2835 * src/spellchecker.C: include <strings.h> in order to have a
2836 definition for bzero().
2838 2000-07-07 Juergen Vigna <jug@sad.it>
2840 * src/insets/insettext.C (draw): set the status of the bv->text to
2841 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2843 * src/screen.C (DrawOneRow):
2844 (DrawFromTo): redraw the actual row if something has changed in it
2847 * src/text.C (draw): call an update of the toplevel-inset if something
2848 has changed inside while drawing.
2850 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2852 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2854 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2855 processing inside class.
2857 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2858 processing inside class.
2860 * src/insets/insetindex.h new struct Holder, consistent with other
2863 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2864 citation dialog from main code and placed it in src/frontends/xforms.
2865 Dialog launched through signals instead of callbacks
2867 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2869 * lyx.man: update the options description.
2871 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2873 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2874 handle neg values, set min width to 590, add doc about -display
2876 2000-07-05 Juergen Vigna <jug@sad.it>
2878 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2879 calls to BufferView *.
2881 * src/insets/insettext.C (checkAndActivateInset): small fix non
2882 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2884 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2885 their \end_inset token!
2887 2000-07-04 edscott <edscott@imp.mx>
2889 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2890 lib/lyxrc.example: added option \wheel_jump
2892 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2894 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2895 remove support for -width,-height,-xpos and -ypos.
2897 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2899 * src/encoding.[Ch]: New files.
2901 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2902 (text): Call to the underline() method only when needed.
2904 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2906 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2907 encoding(s) for the document.
2909 * src/bufferparams.C (BufferParams): Changed default value of
2912 * src/language.C (newLang): Removed.
2913 (items[]): Added encoding information for all defined languages.
2915 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2916 encoding choice button.
2918 * src/lyxrc.h (font_norm_type): New member variable.
2919 (set_font_norm_type): New method.
2921 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2922 paragraphs with different encodings.
2924 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2925 (TransformChar): Changed to work correctly with Arabic points.
2926 (draw): Added support for drawing Arabic points.
2927 (draw): Removed code for drawing underbars (this is done by
2930 * src/support/textutils.h (IsPrintableNonspace): New function.
2932 * src/BufferView_pimpl.h: Added "using SigC::Object".
2933 * src/LyXView.h: ditto.
2935 * src/insets/insetinclude.h (include_label): Changed to mutable.
2937 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2939 * src/mathed/math_iter.h: remove empty destructor
2941 * src/mathed/math_cursor.h: remove empty destructor
2943 * src/insets/lyxinset.h: add THEOREM_CODE
2945 * src/insets/insettheorem.[Ch]: new files
2947 * src/insets/insetminipage.C: (InsertInset): remove
2949 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2951 (InsertInset): remove
2953 * src/insets/insetlist.C: (InsertList): remove
2955 * src/insets/insetfootlike.[Ch]: new files
2957 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2960 (InsertInset): ditto
2962 * src/insets/insetert.C: remove include Painter.h, reindent
2963 (InsertInset): move to header
2965 * src/insets/insetcollapsable.h: remove explicit from default
2966 contructor, remove empty destructor, add InsertInset
2968 * src/insets/insetcollapsable.C (InsertInset): new func
2970 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2972 * src/vspace.h: add explicit to constructor
2974 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2975 \textcompwordmark, please test this.
2977 * src/lyxrc.C: set ascii_linelen to 65 by default
2979 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2981 * src/commandtags.h: add LFUN_INSET_THEOREM
2983 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2984 (makeLinuxDocFile): remove _some_ of the nice logic
2985 (makeDocBookFile): ditto
2987 * src/Painter.[Ch]: (~Painter): removed
2989 * src/LyXAction.C (init): entry for insettheorem added
2991 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2993 (deplog): code to detect files generated by LaTeX, needs testing
2996 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2998 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3000 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3002 * src/LaTeX.C (deplog): Add a check for files that are going to be
3003 created by the first latex run, part of the project to remove the
3006 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3007 contents to the extension list.
3009 2000-07-04 Juergen Vigna <jug@sad.it>
3011 * src/text.C (NextBreakPoint): added support for needFullRow()
3013 * src/insets/lyxinset.h: added needFullRow()
3015 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3018 * src/insets/insettext.C: lots of changes for update!
3020 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3022 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3024 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3026 * src/insets/insetinclude.C (InsetInclude): fixed
3027 initialization of include_label.
3028 (unique_id): now returns a string.
3030 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3032 * src/LaTeXFeatures.h: new member IncludedFiles, for
3033 a map of key, included file name.
3035 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3036 with the included files for inclusion in SGML preamble,
3037 i. e., linuxdoc and docbook.
3040 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3041 nice (is the generated linuxdoc code to be exported?), that
3042 allows to remove column, and only_body that will be true for
3043 slave documents. Insets are allowed inside SGML font type.
3044 New handling of the SGML preamble for included files.
3045 (makeDocBookFile): the same for docbook.
3047 * src/insets/insetinclude.h:
3048 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3050 (DocBook): new export methods.
3052 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3053 and makeDocBookFile.
3055 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3056 formats to export with command line argument -x.
3058 2000-06-29 Juergen Vigna <jug@sad.it>
3060 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3061 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3063 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3064 region could already been cleared by an inset!
3066 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3068 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3071 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3073 (cursorToggle): remove special handling of lyx focus.
3075 2000-06-28 Juergen Vigna <jug@sad.it>
3077 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3080 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3082 * src/insets/insetindex.C (Edit): add a callback when popup is
3085 * src/insets/insettext.C (LocalDispatch):
3086 * src/insets/insetmarginal.h:
3087 * src/insets/insetlist.h:
3088 * src/insets/insetfoot.h:
3089 * src/insets/insetfloat.h:
3090 * src/insets/insetert.h: add a missing std:: qualifier.
3092 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3094 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3097 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3099 * src/insets/insettext.C (Read): remove tmptok unused variable
3100 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3101 (InsertInset): change for new InsetInset code
3103 * src/insets/insettext.h: add TEXT inline method
3105 * src/insets/insettext.C: remove TEXT macro
3107 * src/insets/insetmarginal.C (Write): new method
3108 (Latex): change output slightly
3110 * src/insets/insetfoot.C (Write): new method
3111 (Latex): change output slightly (don't use endl when no need)
3113 * src/insets/insetert.C (Write): new method
3115 * src/insets/insetcollapsable.h: make button_length, button_top_y
3116 and button_bottm_y protected.
3118 * src/insets/insetcollapsable.C (Write): simplify code by using
3119 tostr. Also do not output the float name, the children class
3120 should to that to get control over own arguments
3122 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3123 src/insets/insetminipage.[Ch]:
3126 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3128 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3130 * src/Makefile.am (lyx_SOURCES): add the new files
3132 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3133 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3134 * src/commandtags.h: ditto
3136 * src/LaTeXFeatures.h: add a std::set of used floattypes
3138 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3140 * src/FloatList.[Ch] src/Floating.h: new files
3142 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3144 * src/lyx_cb.C (TableApplyCB): ditto
3146 * src/text2.C: ditto
3147 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3148 (parseSingleLyXformat2Token): ditto + add code for
3149 backwards compability for old float styles + add code for new insets
3151 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3153 (InsertInset(size_type, Inset *, LyXFont)): new method
3154 (InsetChar(size_type, char)): changed to use the other InsetChar
3155 with a LyXFont(ALL_INHERIT).
3156 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3157 insert the META_INSET.
3159 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3161 * sigc++/thread.h (Threads): from here
3163 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3164 definition out of line
3165 * sigc++/scope.h: from here
3167 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3169 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3170 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3172 * Makefile.am (bindist): new target.
3174 * INSTALL: add instructions for doing a binary distribution.
3176 * development/tools/README.bin.example: update a bit.
3178 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3181 * lib/lyxrc.example: new lyxrc tag \set_color.
3183 * src/lyxfunc.C (Dispatch):
3184 * src/commandtags.h:
3185 * src/LyXAction.C: new lyxfunc "set-color".
3187 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3188 and an x11name given as strings.
3190 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3191 cache when a color is changed.
3193 2000-06-26 Juergen Vigna <jug@sad.it>
3195 * src/lyxrow.C (width): added this functions and variable.
3197 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3200 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3202 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3204 * images/undo_bw.xpm: new icon.
3205 * images/redo_bw.xpm: ditto.
3207 * configure.in (INSTALL_SCRIPT): change value to
3208 ${INSTALL} to avoid failures of install-script target.
3209 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3211 * src/BufferView.h: add a magic "friend" declaration to please
3214 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3216 * forms/cite.fd: modified to allow resizing without messing
3219 * src/insetcite.C: Uses code from cite.fd almost without
3221 User can now resize dialog in the x-direction.
3222 Resizing the dialog in the y-direction is prevented, as the
3223 code does this intelligently already.
3225 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3227 * INSTALL: remove obsolete entry in "problems" section.
3229 * lib/examples/sl_*.lyx: update of the slovenian examples.
3231 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3233 2000-06-23 Juergen Vigna <jug@sad.it>
3235 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3237 * src/buffer.C (resize): delete the LyXText of textinsets.
3239 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3241 * src/insets/lyxinset.h: added another parameter 'cleared' to
3242 the draw() function.
3244 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3245 unlocking inset in inset.
3247 2000-06-22 Juergen Vigna <jug@sad.it>
3249 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3250 of insets and moved first to LyXText.
3252 * src/mathed/formulamacro.[Ch]:
3253 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3255 2000-06-21 Juergen Vigna <jug@sad.it>
3257 * src/text.C (GetVisibleRow): look if I should clear the area or not
3258 using Inset::doClearArea() function.
3260 * src/insets/lyxinset.h: added doClearArea() function and
3261 modified draw(Painter &, ...) to draw(BufferView *, ...)
3263 * src/text2.C (UpdateInset): return bool insted of int
3265 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3267 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3268 combox in the character popup
3270 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3271 BufferParams const & params
3273 2000-06-20 Juergen Vigna <jug@sad.it>
3275 * src/insets/insettext.C (SetParagraphData): set insetowner on
3278 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3280 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3281 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3283 (form_main_): remove
3285 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3286 (create_form_form_main): remove FD_form_main stuff, connect to
3287 autosave_timeout signal
3289 * src/LyXView.[Ch] (getMainForm): remove
3290 (UpdateTimerCB): remove
3291 * src/BufferView_pimpl.h: inherit from SigC::Object
3293 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3294 signal instead of callback
3296 * src/BufferView.[Ch] (cursorToggleCB): remove
3298 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3300 * src/BufferView_pimpl.C: changes because of the one below
3302 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3303 instead of storing a pointer to a LyXText.
3305 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3307 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3309 * src/lyxparagraph.h
3311 * src/paragraph.C: Changed fontlist to a sorted vector.
3313 2000-06-19 Juergen Vigna <jug@sad.it>
3315 * src/BufferView.h: added screen() function.
3317 * src/insets/insettext.C (LocalDispatch): some selection code
3320 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3322 * src/insets/insettext.C (SetParagraphData):
3324 (InsetText): fixes for multiple paragraphs.
3326 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3328 * development/lyx.spec.in: Call configure with ``--without-warnings''
3329 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3330 This should be fine, however, since we generally don't want to be
3331 verbose when making an RPM.
3333 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3335 * lib/scripts/fig2pstex.py: New file
3337 2000-06-16 Juergen Vigna <jug@sad.it>
3339 * src/insets/insettabular.C (UpdateLocal):
3340 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3341 (LocalDispatch): Changed all functions to use LyXText.
3343 2000-06-15 Juergen Vigna <jug@sad.it>
3345 * src/text.C (SetHeightOfRow): call inset::update before requesting
3348 * src/insets/insettext.C (update):
3349 * src/insets/insettabular.C (update): added implementation
3351 * src/insets/lyxinset.h: added update function
3353 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3355 * src/text.C (SelectNextWord): protect against null pointers with
3356 old-style string streams. (fix from Paul Theo Gonciari
3359 * src/cite.[Ch]: remove erroneous files.
3361 * lib/configure.m4: update the list of created directories.
3363 * src/lyxrow.C: include <config.h>
3364 * src/lyxcursor.C: ditto.
3366 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3368 * lib/examples/decimal.lyx: new example file from Mike.
3370 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3371 to find template definitions (from Dekel)
3373 * src/frontends/.cvsignore: add a few things.
3375 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3377 * src/Timeout.C (TimeOut): remove default argument.
3379 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3382 * src/insets/ExternalTemplate.C: add a "using" directive.
3384 * src/lyx_main.h: remove the act_ struct, which seems unused
3387 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3389 * LyX Developers Meeting: All files changed, due to random C++ (by
3390 coincidence) code generator script.
3392 - external inset (cool!)
3393 - initial online editing of preferences
3394 - insettabular breaks insettext(s contents)
3396 - some DocBook fixes
3397 - example files update
3398 - other cool stuff, create a diff and look for yourself.
3400 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3402 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3403 -1 this is a non-line-breaking textinset.
3405 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3406 if there is no width set.
3408 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3410 * Lots of files: Merged the dialogbase branch.
3412 2000-06-09 Allan Rae <rae@lyx.org>
3414 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3415 and the Dispatch methods that used it.
3417 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3418 access to functions formerly kept in Dispatch.
3420 2000-05-19 Allan Rae <rae@lyx.org>
3422 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3423 made to_page and count_copies integers again. from_page remains a
3424 string however because I want to allow entry of a print range like
3425 "1,4,22-25" using this field.
3427 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3428 and printer-params-get. These aren't useful from the minibuffer but
3429 could be used by a script/LyXServer app provided it passes a suitable
3430 auto_mem_buffer. I guess I should take a look at how the LyXServer
3431 works and make it support xtl buffers.
3433 * sigc++/: updated to libsigc++-1.0.1
3435 * src/xtl/: updated to xtl-1.3.pl.11
3437 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3438 those changes done to the files in src/ are actually recreated when
3439 they get regenerated. Please don't ever accept a patch that changes a
3440 dialog unless that patch includes the changes to the corresponding *.fd
3443 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3444 stringOnlyContains, renamed it and generalised it.
3446 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3447 branch. Removed the remaining old form_print code.
3449 2000-04-26 Allan Rae <rae@lyx.org>
3451 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3452 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3454 2000-04-25 Allan Rae <rae@lyx.org>
3456 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3457 against a base of xtl-1.3.pl.4
3459 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3460 filter the Id: entries so they still show the xtl version number
3463 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3464 into the src/xtl code. Patch still pending with José (XTL)
3466 2000-04-24 Allan Rae <rae@lyx.org>
3468 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3469 both more generic and much safer. Use the new template functions.
3470 * src/buffer.[Ch] (Dispatch): ditto.
3472 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3473 and mem buffer more intelligently. Also a little general cleanup.
3476 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3477 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3478 * src/xtl/Makefile.am: ditto.
3479 * src/xtl/.cvsignore: ditto.
3480 * src/Makefile.am: ditto.
3482 * src/PrinterParams.h: Removed the macros member functions. Added a
3483 testInvariant member function. A bit of tidying up and commenting.
3484 Included Angus's idea for fixing operation with egcs-1.1.2.
3486 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3487 cool expansion of XTL's mem_buffer to support automatic memory
3488 management within the buffer itself. Removed the various macros and
3489 replaced them with template functions that use either auto_mem_buffer
3490 or mem_buffer depending on a #define. The mem_buffer support will
3491 disappear as soon as the auto_mem_buffer is confirmed to be good on
3492 other platforms/compilers. That is, it's there so you've got something
3495 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3496 effectively forked XTL. However I expect José will include my code
3497 into the next major release. Also fixed a memory leak.
3498 * src/xtl/text.h: ditto.
3499 * src/xtl/xdr.h: ditto.
3500 * src/xtl/giop.h: ditto.
3502 2000-04-16 Allan Rae <rae@lyx.org>
3504 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3505 by autogen.sh and removed by maintainer-clean anyway.
3506 * .cvsignore, sigc++/.cvsignore: Support the above.
3508 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3510 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3512 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3513 macros, renamed static callback-target member functions to suit new
3514 scheme and made them public.
3515 * src/frontends/xforms/forms/form_print.fd: ditto.
3516 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3518 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3521 * src/xtl/: New directory containing a minimal distribution of XTL.
3522 This is XTL-1.3.pl.4.
3524 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3526 2000-04-15 Allan Rae <rae@lyx.org>
3528 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3530 * sigc++/: Updated to libsigc++-1.0.0
3532 2000-04-14 Allan Rae <rae@lyx.org>
3534 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3535 use the generic ones in future. I'll modify my conversion script.
3537 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3539 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3540 (CloseAllBufferRelatedDialogs): Renamed.
3541 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3543 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3544 of the generic ones. These are the same ones my conversion script
3547 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3548 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3549 * src/buffer.C (Dispatch): ditto
3551 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3552 functions for updating and hiding buffer dependent dialogs.
3553 * src/BufferView.C (buffer): ditto
3554 * src/buffer.C (setReadonly): ditto
3555 * src/lyxfunc.C (CloseBuffer): ditto
3557 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3558 Dialogs.h, and hence all the SigC stuff, into every file that includes
3559 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3561 * src/BufferView2.C: reduce the number of headers included by buffer.h
3563 2000-04-11 Allan Rae <rae@lyx.org>
3565 * src/frontends/xforms/xform_macros.h: A small collection of macros
3566 for building C callbacks.
3568 * src/frontends/xforms/Makefile.am: Added above file.
3570 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3571 scheme again. This time it should work for JMarc. If this is
3572 successful I'll revise my conversion script to automate some of this.
3573 The static member functions in the class also have to be public for
3574 this scheme will work. If the scheme works (it's almost identical to
3575 the way BufferView::cursorToggleCB is handled so it should work) then
3576 FormCopyright and FormPrint will be ready for inclusion into the main
3577 trunk immediately after 1.1.5 is released -- provided we're prepared
3578 for complaints about lame compilers not handling XTL.
3580 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3582 2000-04-07 Allan Rae <rae@lyx.org>
3584 * config/lyxinclude.m4: A bit more tidying up (Angus)
3586 * src/LString.h: JMarc's <string> header fix
3588 * src/PrinterParams.h: Used string for most data to remove some
3589 ugly code in the Print dialog and avoid even uglier code when
3590 appending the ints to a string for output.
3592 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3593 and moved "default:" back to the end of switch statement. Cleaned
3594 up the printing so it uses the right function calls and so the
3595 "print to file" option actually puts the file in the right directory.
3597 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3599 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3600 and Ok+Apply button control into a separate method: input (Angus).
3601 (input) Cleaned it up and improved it to be very thorough now.
3602 (All CB) static_cast used instead of C style cast (Angus). This will
3603 probably change again once we've worked out how to keep gcc-2.8.1 happy
3604 with real C callbacks.
3605 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3606 ignore some of the bool settings and has random numbers instead. Needs
3607 some more investigation. Added other input length checks and checking
3608 of file and printer names.
3610 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3611 would link (Angus). Seems the old code doesn't compile with the pragma
3612 statement either. Separated callback entries from internal methods.
3614 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3616 2000-03-17 Allan Rae <rae@lyx.org>
3618 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3619 need it? Maybe it could go in Dialogs instead? I could make it a
3620 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3621 values to get the bool return value.
3622 (Dispatch): New overloaded method for xtl support.
3624 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3625 extern "C" callback instead of static member functions. Hopefully,
3626 JMarc will be able to compile this. I haven't changed
3627 forms/form_copyright.fd yet. Breaking one of my own rules already.
3629 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3630 because they aren't useful from the minibuffer. Maybe a LyXServer
3631 might want a help message though?
3633 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3635 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3636 xtl which needs both rtti and exceptions.
3638 * src/support/Makefile.am:
3639 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3641 * src/frontends/xforms/input_validators.[ch]: input filters and
3642 validators. These conrol what keys are valid in input boxes.
3643 Use them and write some more. Much better idea than waiting till
3644 after the user has pressed Ok to say that the input fields don't make
3647 * src/frontends/xforms/Makefile.am:
3648 * src/frontends/xforms/forms/form_print.fd:
3649 * src/frontends/xforms/forms/makefile:
3650 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3651 new scheme. Still have to make sure I haven't missed anything from
3652 the current implementation.
3654 * src/Makefile.am, src/PrinterParams.h: New data store.
3656 * other files: Added a couple of copyright notices.
3658 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3660 * src/insets/insetbib.h: move Holder struct in public space.
3662 * src/frontends/include/DialogBase.h: use SigC:: only when
3663 SIGC_CXX_NAMESPACES is defined.
3664 * src/frontends/include/Dialogs.h: ditto.
3666 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3668 * src/frontends/xforms/FormCopyright.[Ch]: do not
3669 mention SigC:: explicitely.
3671 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3673 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3674 deals with testing KDE in main configure.in
3675 * configure.in: ditto.
3677 2000-02-22 Allan Rae <rae@lyx.org>
3679 * Lots of files: Merged from HEAD
3681 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3682 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3684 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3686 * sigc++/: new minidist.
3688 2000-02-14 Allan Rae <rae@lyx.org>
3690 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3692 2000-02-08 Juergen Vigna <jug@sad.it>
3694 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3695 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3697 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3698 for this port and so it is much easier for other people to port
3699 dialogs in a common development environment.
3701 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3702 the QT/KDE implementation.
3704 * src/frontends/kde/Dialogs.C:
3705 * src/frontends/kde/FormCopyright.C:
3706 * src/frontends/kde/FormCopyright.h:
3707 * src/frontends/kde/Makefile.am:
3708 * src/frontends/kde/formcopyrightdialog.C:
3709 * src/frontends/kde/formcopyrightdialog.h:
3710 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3711 for the kde support of the Copyright-Dialog.
3713 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3714 subdir-substitution instead of hardcoded 'xforms' as we now have also
3717 * src/frontends/include/DialogBase.h (Object): just commented the
3718 label after #endif (nasty warning and I don't like warnings ;)
3720 * src/main.C (main): added KApplication initialization if using
3723 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3724 For now only the KDE event-loop is added if frontend==kde.
3726 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3728 * configure.in: added support for the --with-frontend[=value] option
3730 * autogen.sh: added kde.m4 file to list of config-files
3732 * acconfig.h: added define for KDEGUI-support
3734 * config/kde.m4: added configuration functions for KDE-port
3736 * config/lyxinclude.m4: added --with-frontend[=value] option with
3737 support for xforms and KDE.
3739 2000-02-08 Allan Rae <rae@lyx.org>
3741 * all Makefile.am: Fixed up so the make targets dist, distclean,
3742 install and uninstall all work even if builddir != srcdir. Still
3743 have a new sigc++ minidist update to come.
3745 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3747 2000-02-01 Allan Rae <rae@lyx.org>
3749 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3750 Many mods to get builddir != srcdir working.
3752 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3753 for building on NT and so we can do the builddir != srcdir stuff.
3755 2000-01-30 Allan Rae <rae@lyx.org>
3757 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3758 This will stay in "rae" branch. We probably don't really need it in
3759 the main trunk as anyone who wants to help programming it should get
3760 a full library installed also. So they can check both included and
3761 system supplied library compilation.
3763 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3764 Added a 'mini' distribution of libsigc++. If you feel the urge to
3765 change something in these directories - Resist it. If you can't
3766 resist the urge then you should modify the following script and rebuild
3767 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3768 all happen. Still uses a hacked version of libsigc++'s configure.in.
3769 I'm quite happy with the results. I'm not sure the extra work to turn
3770 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3771 worth the trouble and would probably lead to extra maintenance
3773 I haven't tested the following important make targets: install, dist.
3774 Not ready for prime time but very close. Maybe 1.1.5.
3776 * development/tools/makeLyXsigc.sh: A shell script to automatically
3777 generate our mini-dist of libsigc++. It can only be used with a CVS
3778 checkout of libsigc++ not a tarball distribution. It's well commented.
3779 This will end up as part of the libsigc++ distribution so other apps
3780 can easily have an included mini-dist. If someone makes mods to the
3781 sigc++ subpackage without modifying this script to generate those
3782 changes I'll be very upset!
3784 * src/frontends/: Started the gui/system indep structure.
3786 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3787 to access the gui-indep dialogs are in this class. Much improved
3788 design compared to previous revision. Lars, please refrain from
3789 moving this header into src/ like you did with Popups.h last time.
3791 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3793 * src/frontends/xforms/: Started the gui-indep system with a single
3794 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3797 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3798 Here you'll find a very useful makefile and automated fdfix.sh that
3799 makes updating dailogs a no-brainer -- provided you follow the rules
3800 set out in the README. I'm thinking about adding another script to
3801 automatically generate skeleton code for a new dialog given just the
3804 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3805 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3806 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3808 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3810 * src/support/LSubstring.C (operator): simplify
3812 * src/lyxtext.h: removed bparams, use buffer_->params instead
3814 * src/lyxrow.h: make Row a real class, move all variables to
3815 private and use accessors.
3817 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3819 (isRightToLeftPar): ditto
3820 (ChangeLanguage): ditto
3821 (isMultiLingual): ditto
3824 (SimpleTeXOnePar): ditto
3825 (TeXEnvironment): ditto
3826 (GetEndLabel): ditto
3828 (SetOnlyLayout): ditto
3829 (BreakParagraph): ditto
3830 (BreakParagraphConservative): ditto
3831 (GetFontSettings): ditto
3833 (CopyIntoMinibuffer): ditto
3834 (CutIntoMinibuffer): ditto
3835 (PasteParagraph): ditto
3836 (SetPExtraType): ditto
3837 (UnsetPExtraType): ditto
3838 (DocBookContTableRows): ditto
3839 (SimpleDocBookOneTablePar): ditto
3841 (TeXFootnote): ditto
3842 (SimpleTeXOneTablePar): ditto
3843 (TeXContTableRows): ditto
3844 (SimpleTeXSpecialChars): ditto
3847 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3848 to private and use accessors.
3850 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3851 this, we did not use it anymore and has not been for ages. Just a
3852 waste of cpu cycles.
3854 * src/language.h: make Language a real class, move all variables
3855 to private and use accessors.
3857 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3858 (create_view): remove
3859 (update): some changes for new timer
3860 (cursorToggle): use new timer
3861 (beforeChange): change for new timer
3863 * src/BufferView.h (cursorToggleCB): removed last paramter because
3866 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3867 (cursorToggleCB): change because of new timer code
3869 * lib/CREDITS: updated own mailaddress
3871 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3873 * src/support/filetools.C (PutEnv): fix the code in case neither
3874 putenv() nor setenv() have been found.
3876 * INSTALL: mention the install-strip Makefile target.
3878 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3879 read-only documents.
3881 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3883 * lib/reLyX/configure.in (VERSION): avoid using a previously
3884 generated reLyX wrapper to find out $prefix.
3886 * lib/examples/eu_adibide_lyx-atua.lyx:
3887 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3888 translation of the Tutorial (Dooteo)
3890 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3892 * forms/cite.fd: new citation dialog
3894 * src/insetcite.[Ch]: the new citation dialog is moved into
3897 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3900 * src/insets/insetcommand.h: data members made private.
3902 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3904 * LyX 1.1.5 released
3906 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3908 * src/version.h (LYX_RELEASE): to 1.1.5
3910 * src/spellchecker.C (RunSpellChecker): return false if the
3911 spellchecker dies upon creation.
3913 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3915 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3916 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3920 * lib/CREDITS: update entry for Martin Vermeer.
3922 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3924 * src/text.C (draw): Draw foreign language bars at the bottom of
3925 the row instead of at the baseline.
3927 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3929 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3931 * lib/bind/de_menus.bind: updated
3933 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3935 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3937 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3939 * src/menus.C (Limit_string_length): New function
3940 (ShowTocMenu): Limit the number of items/length of items in the
3943 * src/paragraph.C (String): Correct result for a paragraph inside
3946 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3948 * src/bufferlist.C (close): test of buf->getuser() == NULL
3950 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3952 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3953 Do not call to SetCursor when the paragraph is a closed footnote!
3955 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3957 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3960 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3962 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3965 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3966 reference popup, that activates the reference-back action
3968 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3970 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3971 the menus. Also fixed a bug.
3973 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3974 the math panels when switching buffers (unless new buffer is readonly).
3976 * src/BufferView.C (NoSavedPositions)
3977 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3979 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3981 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3982 less of dvi dirty or not.
3984 * src/trans_mgr.[Ch] (insert): change first parameter to string
3987 * src/chset.[Ch] (encodeString): add const to first parameter
3989 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3991 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3995 * src/LaTeX.C (deplog): better searching for dependency files in
3996 the latex log. Uses now regexps.
3998 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3999 instead of the box hack or \hfill.
4001 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4003 * src/lyxfunc.C (doImportHelper): do not create the file before
4004 doing the actual import.
4005 (doImportASCIIasLines): create a new file before doing the insert.
4006 (doImportASCIIasParagraphs): ditto.
4008 * lib/lyxrc.example: remove mention of non-existing commands
4010 * lyx.man: remove mention of color-related switches.
4012 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4014 * src/lyx_gui.C: remove all the color-related ressources, which
4015 are not used anymore.
4017 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4020 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4022 * src/lyxrc.C (read): Add a missing break in the switch
4024 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4026 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4028 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4031 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4033 * src/text.C (draw): draw bars under foreign language words.
4035 * src/LColor.[Ch]: add LColor::language
4037 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4039 * src/lyxcursor.h (boundary): New member variable
4041 * src/text.C (IsBoundary): New methods
4043 * src/text.C: Use the above for currect cursor movement when there
4044 is both RTL & LTR text.
4046 * src/text2.C: ditto
4048 * src/bufferview_funcs.C (ToggleAndShow): ditto
4050 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4052 * src/text.C (DeleteLineForward): set selection to true to avoid
4053 that DeleteEmptyParagraphMechanism does some magic. This is how it
4054 is done in all other functions, and seems reasonable.
4055 (DeleteWordForward): do not jump over non-word stuff, since
4056 CursorRightOneWord() already does it.
4058 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4059 DeleteWordBackward, since they seem safe to me (since selection is
4060 set to "true") DeleteEmptyParagraphMechanism does nothing.
4062 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4064 * src/lyx_main.C (easyParse): simplify the code by factoring the
4065 part that removes parameters from the command line.
4066 (LyX): check wether wrong command line options have been given.
4068 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4070 * src/lyx_main.C : add support for specifying user LyX
4071 directory via command line option -userdir.
4073 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4075 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4076 the number of items per popup.
4077 (Add_to_refs_menu): Ditto.
4079 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4081 * src/lyxparagraph.h: renamed ClearParagraph() to
4082 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4083 textclass as parameter, and do nothing if free_spacing is
4084 true. This fixes part of the line-delete-forward problems.
4086 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4087 (pasteSelection): ditto.
4088 (SwitchLayoutsBetweenClasses): more translatable strings.
4090 * src/text2.C (CutSelection): use StripLeadingSpaces.
4091 (PasteSelection): ditto.
4092 (DeleteEmptyParagraphMechanism): ditto.
4094 2000-05-26 Juergen Vigna <jug@sad.it>
4096 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4097 is not needed in tabular insets.
4099 * src/insets/insettabular.C (TabularFeatures): added missing features.
4101 * src/tabular.C (DeleteColumn):
4103 (AppendRow): implemented this functions
4104 (cellsturct::operator=): clone the inset too;
4106 2000-05-23 Juergen Vigna <jug@sad.it>
4108 * src/insets/insettabular.C (LocalDispatch): better selection support
4109 when having multicolumn-cells.
4111 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4113 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4115 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4117 * src/ColorHandler.C (getGCForeground): put more test into _()
4119 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4122 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4125 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4127 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4128 there are no labels, or when buffer is readonly.
4130 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4131 there are no labels, buffer is SGML, or when buffer is readonly.
4133 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4135 * src/LColor.C (LColor): change a couple of grey40 to grey60
4136 (LColor): rewore initalization to make compiles go some magnitude
4138 (getGUIName): don't use gettext until we need the string.
4140 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4142 * src/Bullet.[Ch]: Fixed a small bug.
4144 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4146 * src/paragraph.C (String): Several fixes/improvements
4148 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4150 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4152 * src/paragraph.C (String): give more correct output.
4154 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4156 * src/lyxfont.C (stateText) Do not output the language if it is
4157 eqaul to the language of the document.
4159 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4160 between two paragraphs with the same language.
4162 * src/paragraph.C (getParLanguage) Return a correct answer for an
4163 empty dummy paragraph.
4165 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4168 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4171 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4172 the menus/popup, if requested fonts are unavailable.
4174 2000-05-22 Juergen Vigna <jug@sad.it>
4176 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4177 movement support (Up/Down/Tab/Shift-Tab).
4178 (LocalDispatch): added also preliminari cursor-selection.
4180 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4182 * src/paragraph.C (PasteParagraph): Hopefully now right!
4184 2000-05-22 Garst R. Reese <reese@isn.net>
4186 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4187 of list, change all references to Environment to Command
4188 * tex/hollywood.cls : rewrite environments as commands, add
4189 \uppercase to interiorshot and exteriorshot to force uppecase.
4190 * tex/broadway.cls : rewrite environments as commands. Tweak
4193 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4195 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4196 size of items: use a constant intead of the hardcoded 40, and more
4197 importantly do not remove the %m and %x tags added at the end.
4198 (Add_to_refs_menu): use vector::size_type instead of
4199 unsigned int as basic types for the variables. _Please_ do not
4200 assume that size_t is equal to unsigned int. On an alpha, this is
4201 unsigned long, which is _not_ the same.
4203 * src/language.C (initL): remove language "hungarian", since it
4204 seems that "magyar" is better.
4206 2000-05-22 Juergen Vigna <jug@sad.it>
4208 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4210 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4213 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4214 next was deleted but not set to 0.
4216 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4218 * src/language.C (initL): change the initialization of languages
4219 so that compiles goes _fast_.
4221 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4224 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4226 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4230 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4232 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4234 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4238 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4241 * src/insets/insetlo*.[Ch]: Made editable
4243 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4245 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4246 the current selection.
4248 * src/BufferView_pimpl.C (stuffClipboard): new method
4250 * src/BufferView.C (stuffClipboard): new method
4252 * src/paragraph.C (String): new method
4254 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4255 LColor::ignore when lyxname is not found.
4257 * src/BufferView.C (pasteSelection): new method
4259 * src/BufferView_pimpl.C (pasteSelection): new method
4261 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4263 * src/WorkArea.C (request_clipboard_cb): new static function
4264 (getClipboard): new method
4265 (putClipboard): new method
4267 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4269 * LyX 1.1.5pre2 released
4271 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4273 * src/vspace.C (operator=): removed
4274 (operator=): removed
4276 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4278 * src/layout.C (NumberOfClass): manually set the type in make_pair
4279 (NumberOfLayout): ditto
4281 * src/language.C: use the Language constructor for ignore_lang
4283 * src/language.h: add constructors to struct Language
4285 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4287 * src/text2.C (SetCursorIntern): comment out #warning
4289 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4291 * src/mathed/math_iter.h: initialize sx and sw to 0
4293 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4295 * forms/lyx.fd: Redesign of form_ref
4297 * src/LaTeXFeatures.[Ch]
4301 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4304 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4305 and Buffer::inset_iterator.
4307 * src/menus.C: Added new menus: TOC and Refs.
4309 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4311 * src/buffer.C (getTocList): New method.
4313 * src/BufferView2.C (ChangeRefs): New method.
4315 * src/buffer.C (getLabelList): New method. It replaces the old
4316 getReferenceList. The return type is vector<string> instead of
4319 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4320 the old getLabel() and GetNumberOfLabels() methods.
4321 * src/insets/insetlabel.C (getLabelList): ditto
4322 * src/mathed/formula.C (getLabelList): ditto
4324 * src/paragraph.C (String): New method.
4326 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4327 Uses the new getTocList() method.
4328 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4329 which automatically updates the contents of the browser.
4330 (RefUpdateCB): Use the new getLabelList method.
4332 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4334 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4336 * src/spellchecker.C: Added using std::reverse;
4338 2000-05-19 Juergen Vigna <jug@sad.it>
4340 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4342 * src/insets/insettext.C (computeTextRows): small fix for display of
4343 1 character after a newline.
4345 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4348 2000-05-18 Juergen Vigna <jug@sad.it>
4350 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4351 when changing width of column.
4353 * src/tabular.C (set_row_column_number_info): setting of
4354 autobreak rows if necessary.
4356 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4358 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4360 * src/vc-backend.*: renamed stat() to status() and vcstat to
4361 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4362 compilation broke. The new name seems more relevant, anyway.
4364 2000-05-17 Juergen Vigna <jug@sad.it>
4366 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4367 which was wrong if the removing caused removing of rows!
4369 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4370 (pushToken): new function.
4372 * src/text2.C (CutSelection): fix problem discovered with purify
4374 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4376 * src/debug.C (showTags): enlarge the first column, now that we
4377 have 6-digits debug codes.
4379 * lib/layouts/hollywood.layout:
4380 * lib/tex/hollywood.cls:
4381 * lib/tex/brodway.cls:
4382 * lib/layouts/brodway.layout: more commands and fewer
4383 environments. Preambles moved in the .cls files. Broadway now has
4384 more options on scene numbering and less whitespace (from Garst)
4386 * src/insets/insetbib.C (getKeys): make sure that we are in the
4387 document directory, in case the bib file is there.
4389 * src/insets/insetbib.C (Latex): revert bogus change.
4391 2000-05-16 Juergen Vigna <jug@sad.it>
4393 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4394 the TabularLayout on cursor move.
4396 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4398 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4401 (draw): fixed cursor position and drawing so that the cursor is
4402 visible when before the tabular-inset.
4404 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4405 when creating from old insettext.
4407 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4409 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4411 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4412 * lib/tex/brodway.cls: ditto
4414 * lib/layouts/brodway.layout: change alignment of parenthical
4417 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4419 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4420 versions 0.88 and 0.89 are supported.
4422 2000-05-15 Juergen Vigna <jug@sad.it>
4424 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4427 * src/insets/insettext.C (computeTextRows): redone completely this
4428 function in a much cleaner way, because of problems when having a
4430 (draw): added a frame border when the inset is locked.
4431 (SetDrawLockedFrame): this sets if we draw the border or not.
4432 (SetFrameColor): this sets the frame color (default=insetframe).
4434 * src/insets/lyxinset.h: added x() and y() functions which return
4435 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4436 function which is needed to see if we have a locking inset of some
4437 type in this inset (needed for now in insettabular).
4439 * src/vspace.C (inPixels): the same function also without a BufferView
4440 parameter as so it is easier to use it in some ocasions.
4442 * src/lyxfunc.C: changed all places where insertInset was used so
4443 that now if it couldn't be inserted it is deleted!
4445 * src/TabularLayout.C:
4446 * src/TableLayout.C: added support for new tabular-inset!
4448 * src/BufferView2.C (insertInset): this now returns a bool if the
4449 inset was really inserted!!!
4451 * src/tabular.C (GetLastCellInRow):
4452 (GetFirstCellInRow): new helper functions.
4453 (Latex): implemented for new tabular class.
4457 (TeXTopHLine): new Latex() helper functions.
4459 2000-05-12 Juergen Vigna <jug@sad.it>
4461 * src/mathed/formulamacro.C (Read):
4462 * src/mathed/formula.C (Read): read also the \end_inset here!
4464 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4466 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4467 crush when saving formulae with unbalanced parenthesis.
4469 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4471 * src/layout.C: Add new keyword "endlabelstring" to layout file
4473 * src/text.C (GetVisibleRow): Draw endlabel string.
4475 * lib/layouts/broadway.layout
4476 * lib/layouts/hollywood.layout: Added endlabel for the
4477 Parenthetical layout.
4479 * lib/layouts/heb-article.layout: Do not use slanted font shape
4480 for Theorem like environments.
4482 * src/buffer.C (makeLaTeXFile): Always add "american" to
4483 the UsedLanguages list if document language is RTL.
4485 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4487 * add addendum to README.OS2 and small patch (from SMiyata)
4489 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4491 * many files: correct the calls to ChangeExtension().
4493 * src/support/filetools.C (ChangeExtension): remove the no_path
4494 argument, which does not belong there. Use OnlyFileName() instead.
4496 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4497 files when LaTeXing a non-nice latex file.
4499 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4500 a chain of "if". Return false when deadkeys are not handled.
4502 * src/lyx_main.C (LyX): adapted the code for default bindings.
4504 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4505 bindings for basic functionality (except deadkeys).
4506 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4508 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4509 several methods: handle override_x_deadkeys.
4511 * src/lyxrc.h: remove the "bindings" map, which did not make much
4512 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4514 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4516 * src/lyxfont.C (stateText): use a saner method to determine
4517 whether the font is "default". Seems to fix the crash with DEC
4520 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4522 2000-05-08 Juergen Vigna <jug@sad.it>
4524 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4525 TabularLayoutMenu with mouse-button-3
4526 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4528 * src/TabularLayout.C: added this file for having a Layout for
4531 2000-05-05 Juergen Vigna <jug@sad.it>
4533 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4534 recalculating inset-widths.
4535 (TabularFeatures): activated this function so that I can change
4536 tabular-features via menu.
4538 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4539 that I can test some functions with the Table menu.
4541 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4543 * src/lyxfont.C (stateText): guard against stupid c++libs.
4545 * src/tabular.C: add using std::vector
4546 some whitespace changes, + removed som autogenerated code.
4548 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4550 2000-05-05 Juergen Vigna <jug@sad.it>
4552 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4553 row, columns and cellstructures.
4555 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4557 * lib/lyxrc.example: remove obsolete entries.
4559 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4560 reading of protected_separator for free_spacing.
4562 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4564 * src/text.C (draw): do not display an exclamation mark in the
4565 margin for margin notes. This is confusing, ugly and
4568 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4569 AMS math' is checked.
4571 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4572 name to see whether including the amsmath package is needed.
4574 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4576 * src/paragraph.C (validate): Compute UsedLanguages correctly
4577 (don't insert the american language if it doesn't appear in the
4580 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4581 The argument of \thanks{} command is considered moving argument
4583 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4586 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4588 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4589 for appendix/minipage/depth. The lines can be now both in the footnote
4590 frame, and outside the frame.
4592 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4595 2000-05-05 Juergen Vigna <jug@sad.it>
4597 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4598 neede only in tabular.[Ch].
4600 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4602 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4604 (Write): write '~' for PROTECTED_SEPARATOR
4606 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4611 * src/mathed/formula.C (drawStr): rename size to siz.
4613 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4614 possibly fix a bug by not changing the pflags = flags to piflags =
4617 2000-05-05 Juergen Vigna <jug@sad.it>
4619 * src/insets/insetbib.C: moved using directive
4621 * src/ImportNoweb.C: small fix for being able to compile (missing
4624 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4626 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4627 to use clear, since we don't depend on this in the code. Add test
4630 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4632 * (various *.C files): add using std::foo directives to please dec
4635 * replace calls to string::clear() to string::erase() (Angus)
4637 * src/cheaders/cmath: modified to provide std::abs.
4639 2000-05-04 Juergen Vigna <jug@sad.it>
4641 * src/insets/insettext.C: Prepared all for inserting of multiple
4642 paragraphs. Still display stuff to do (alignment and other things),
4643 but I would like to use LyXText to do this when we cleaned out the
4644 table-support stuff.
4646 * src/insets/insettabular.C: Changed lot of stuff and added lots
4647 of functionality still a lot to do.
4649 * src/tabular.C: Various functions changed name and moved to be
4650 const functions. Added new Read and Write functions and changed
4651 lots of things so it works good with tabular-insets (also removed
4652 some stuff which is not needed anymore * hacks *).
4654 * src/lyxcursor.h: added operators == and != which just look if
4655 par and pos are (not) equal.
4657 * src/buffer.C (latexParagraphs): inserted this function to latex
4658 all paragraphs form par to endpar as then I can use this too for
4661 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4662 so that I can call this to from text insets with their own cursor.
4664 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4665 output off all paragraphs (because of the fix below)!
4667 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4668 the very last paragraph (this could be also the last paragraph of an
4671 * src/texrow.h: added rows() call which returns the count-variable.
4673 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4675 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4677 * lib/configure.m4: better autodetection of DocBook tools.
4679 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4681 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4683 * src/lyx_cb.C: add using std::reverse;
4685 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4688 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4689 selected files. Should fix repeated errors from generated files.
4691 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4693 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4695 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4696 the spellchecker popup.
4698 * lib/lyxrc.example: Removed the \number_inset section
4700 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4702 * src/insets/figinset.C (various): Use IsFileReadable() to make
4703 sure that the file actually exist. Relying on ghostscripts errors
4704 is a bad idea since they can lead to X server crashes.
4706 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4708 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4711 * lib/lyxrc.example: smallish typo in description of
4712 \view_dvi_paper_option
4714 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4717 * src/lyxfunc.C: doImportHelper to factor out common code of the
4718 various import methods. New functions doImportASCIIasLines,
4719 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4720 doImportLinuxDoc for the format specific parts.
4723 * buffer.C: Dispatch returns now a bool to indicate success
4726 * lyx_gui.C: Add getLyXView() for member access
4728 * lyx_main.C: Change logic for batch commands: First try
4729 Buffer::Dispatch (possibly without GUI), if that fails, use
4732 * lyx_main.C: Add support for --import command line switch.
4733 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4734 Available Formats: Everything accepted by 'buffer-import <format>'
4736 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4738 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4741 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4742 documents will be reformatted upon reentry.
4744 2000-04-27 Juergen Vigna <jug@sad.it>
4746 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4747 correctly only last pos this was a bug.
4749 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4751 * release of lyx-1.1.5pre1
4753 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4755 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4757 * src/menus.C: revert the change of naming (Figure->Graphic...)
4758 from 2000-04-11. It was incomplete and bad.
4760 * src/LColor.[Ch]: add LColor::depthbar.
4761 * src/text.C (GetVisibleRow): use it.
4763 * README: update the languages list.
4765 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4767 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4770 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * README: remove sections that were just wrong.
4774 * src/text2.C (GetRowNearY): remove currentrow code
4776 * src/text.C (GetRow): remove currentrow code
4778 * src/screen.C (Update): rewritten a bit.
4779 (SmallUpdate): removed func
4781 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4783 (FullRebreak): return bool
4784 (currentrow): remove var
4785 (currentrow_y): ditto
4787 * src/lyxscreen.h (Draw): change arg to unsigned long
4788 (FitCursor): return bool
4789 (FitManualCursor): ditto
4790 (Smallpdate): remove func
4791 (first): change to unsigned long
4792 (DrawOneRow): change second arg to long (from long &)
4793 (screen_refresh_y): remove var
4794 (scree_refresh_row): ditto
4796 * src/lyxrow.h: change baseline to usigned int from unsigned
4797 short, this brings some implicit/unsigned issues out in the open.
4799 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4801 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4802 instead of smallUpdate.
4804 * src/lyxcursor.h: change y to unsigned long
4806 * src/buffer.h: don't call updateScrollbar after fitcursor
4808 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4809 where they are used. Removed "\\direction", this was not present
4810 in 1.1.4 and is already obsolete. Commented out some code that I
4811 believe to never be called.
4812 (runLiterate): don't call updateScrollbar after fitCursor
4814 (buildProgram): ditto
4817 * src/WorkArea.h (workWidth): change return val to unsigned
4820 (redraw): remove the button redraws
4821 (setScrollbarValue): change for scrollbar
4822 (getScrollbarValue): change for scrollbar
4823 (getScrollbarBounds): change for scrollbar
4825 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4826 (C_WorkArea_down_cb): removed func
4827 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4828 (resize): change for scrollbar
4829 (setScrollbar): ditto
4830 (setScrollbarBounds): ditto
4831 (setScrollbarIncrements): ditto
4832 (up_cb): removed func
4833 (down_cb): removed func
4834 (scroll_cb): change for scrollbar
4835 (work_area_handler): ditto
4837 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4838 when FitCursor did something.
4839 (updateScrollbar): some unsigned changes
4840 (downCB): removed func
4841 (scrollUpOnePage): removed func
4842 (scrollDownOnePage): remvoed func
4843 (workAreaMotionNotify): don't call screen->FitCursor but use
4844 fitCursor instead. and bool return val
4845 (workAreaButtonPress): ditto
4846 (workAreaButtonRelease): some unsigned changes
4847 (checkInsetHit): ditto
4848 (workAreaExpose): ditto
4849 (update): parts rewritten, comments about the signed char arg added
4850 (smallUpdate): removed func
4851 (cursorPrevious): call needed updateScrollbar
4854 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4857 * src/BufferView.[Ch] (upCB): removed func
4858 (downCB): removed func
4859 (smallUpdate): removed func
4861 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4863 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4864 currentrow, currentrow_y optimization. This did not help a lot and
4865 if we want to do this kind of optimization we should rather use
4866 cursor.row instead of the currentrow.
4868 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4869 buffer spacing and klyx spacing support.
4871 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4873 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4876 2000-04-26 Juergen Vigna <jug@sad.it>
4878 * src/insets/figinset.C: fixes to Lars sstream changes!
4880 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4882 * A lot of files: Added Ascii(ostream &) methods to all inset
4883 classes. Used when exporting to ASCII.
4885 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4886 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4889 * src/text2.C (ToggleFree): Disabled implicit word selection when
4890 there is a change in the language
4892 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4893 no output was generated for end-of-sentence inset.
4895 * src/insets/lyxinset.h
4898 * src/paragraph.C: Removed the insetnumber code
4900 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4902 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4904 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4905 no_babel and no_epsfig completely from the file.
4906 (parseSingleLyXformat2Token): add handling for per-paragraph
4907 spacing as written by klyx.
4909 * src/insets/figinset.C: applied patch by Andre. Made it work with
4912 2000-04-20 Juergen Vigna <jug@sad.it>
4914 * src/insets/insettext.C (cutSelection):
4915 (copySelection): Fixed with selection from right to left.
4916 (draw): now the rows are not recalculated at every draw.
4917 (computeTextRows): for now reset the inset-owner here (this is
4918 important for an undo or copy where the inset-owner is not set
4921 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4922 motion to the_locking_inset screen->first was forgotten, this was
4923 not important till we got multiline insets.
4925 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4927 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4928 code seems to be alright (it is code changed by Dekel, and the
4929 intent is indeed that all macros should be defined \protect'ed)
4931 * NEWS: a bit of reorganisation of the new user-visible features.
4933 2000-04-19 Juergen Vigna <jug@sad.it>
4935 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4936 position. Set the inset_owner of the used paragraph so that it knows
4937 that it is inside an inset. Fixed cursor handling with mouse and
4938 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4939 and cleanups to make TextInsets work better.
4941 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4942 Changed parameters of various functions and added LockInsetInInset().
4944 * src/insets/insettext.C:
4946 * src/insets/insetcollapsable.h:
4947 * src/insets/insetcollapsable.C:
4948 * src/insets/insetfoot.h:
4949 * src/insets/insetfoot.C:
4950 * src/insets/insetert.h:
4951 * src/insets/insetert.C: cleaned up the code so that it works now
4952 correctly with insettext.
4954 * src/insets/inset.C:
4955 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4956 that insets in insets are supported right.
4959 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4961 * src/paragraph.C: some small fixes
4963 * src/debug.h: inserted INSETS debug info
4965 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4966 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4968 * src/commandtags.h:
4969 * src/LyXAction.C: insert code for InsetTabular.
4971 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4972 not Button1MotionMask.
4973 (workAreaButtonRelease): send always a InsetButtonRelease event to
4975 (checkInsetHit): some setCursor fixes (always with insets).
4977 * src/BufferView2.C (lockInset): returns a bool now and extended for
4978 locking insets inside insets.
4979 (showLockedInsetCursor): it is important to have the cursor always
4980 before the locked inset.
4981 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4983 * src/BufferView.h: made lockInset return a bool.
4985 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4987 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4988 that is used also internally but can be called as public to have back
4989 a cursor pos which is not set internally.
4990 (SetCursorIntern): Changed to use above function.
4992 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4994 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4999 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5000 patches for things that should be in or should be changed.
5002 * src/* [insetfiles]: change "usigned char fragile" to bool
5003 fragile. There was only one point that could that be questioned
5004 and that is commented in formulamacro.C. Grep for "CHECK".
5006 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5007 (DeleteBuffer): take it out of CutAndPaste and make it static.
5009 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5011 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5012 output the spacing envir commands. Also the new commands used in
5013 the LaTeX output makes the result better.
5015 * src/Spacing.C (writeEnvirBegin): new method
5016 (writeEnvirEnd): new method
5018 2000-04-18 Juergen Vigna <jug@sad.it>
5020 * src/CutAndPaste.C: made textclass a static member of the class
5021 as otherwise it is not accesed right!!!
5023 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5025 * forms/layout_forms.fd
5026 * src/layout_forms.h
5027 * src/layout_forms.C (create_form_form_character)
5028 * src/lyx_cb.C (UserFreeFont)
5029 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5030 documents (in the layout->character popup).
5032 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5034 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5035 \spell_command was in fact not honored (from Kevin Atkinson).
5037 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5040 * src/lyx_gui.h: make lyxViews private (Angus)
5042 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5044 * src/mathed/math_write.C
5045 (MathMatrixInset::Write) Put \protect before \begin{array} and
5046 \end{array} if fragile
5047 (MathParInset::Write): Put \protect before \\ if fragile
5049 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5051 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5052 initialization if the LyXColorHandler must be done after the
5053 connections to the XServer has been established.
5055 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5056 get the background pixel from the lyxColorhandler so that the
5057 figures are rendered with the correct background color.
5058 (NextToken): removed functions.
5059 (GetPSSizes): use ifs >> string instead of NextToken.
5061 * src/Painter.[Ch]: the color cache moved out of this file.
5063 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5066 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5068 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5069 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5071 * src/BufferView.C (enterView): new func
5072 (leaveView): new func
5074 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5076 (leaveView): new func, undefines xterm cursor when approp.
5078 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5079 (AllowInput): delete the Workarea cursor handling from this func.
5081 * src/Painter.C (underline): draw a slimer underline in most cases.
5083 * src/lyx_main.C (error_handler): use extern "C"
5085 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5087 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5088 sent directly to me.
5090 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5091 to the list by Dekel.
5093 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5096 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5097 methods from lyx_cb.here.
5099 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5102 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5104 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5105 instead of using current_view directly.
5107 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5109 * src/LyXAction.C (init): add the paragraph-spacing command.
5111 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5113 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5115 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5116 different from the documents.
5118 * src/text.C (SetHeightOfRow): take paragraph spacing into
5119 account, paragraph spacing takes precedence over buffer spacing
5120 (GetVisibleRow): ditto
5122 * src/paragraph.C (writeFile): output the spacing parameter too.
5123 (validate): set the correct features if spacing is used in the
5125 (Clear): set spacing to default
5126 (MakeSameLayout): spacing too
5127 (HasSameLayout): spacing too
5128 (SetLayout): spacing too
5129 (TeXOnePar): output the spacing commands
5131 * src/lyxparagraph.h: added a spacing variable for use with
5132 per-paragraph spacing.
5134 * src/Spacing.h: add a Default spacing and a method to check if
5135 the current spacing is default. also added an operator==
5137 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5140 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5142 * src/lyxserver.C (callback): fix dispatch of functions
5144 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5145 printf() into lyxerr call.
5147 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5150 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5151 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5152 the "Float" from each of the subitems.
5153 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5155 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5156 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5157 documented the change so that the workaround can be nuked later.
5159 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5162 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5164 * src/buffer.C (getLatexName): ditto
5165 (setReadonly): ditto
5167 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5169 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5170 avoid some uses of current_view. Added also a bufferParams()
5171 method to get at this.
5173 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5175 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/lyxparagraph.[Ch]: removed
5178 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5179 with operators used by lower_bound and
5180 upper_bound in InsetTable's
5181 Make struct InsetTable private again. Used matchpos.
5183 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5185 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5186 document, the language of existing text is changed (unless the
5187 document is multi-lingual)
5189 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5191 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5193 * A lot of files: A rewrite of the Right-to-Left support.
5195 2000-04-10 Juergen Vigna <jug@sad.it>
5197 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5198 misplaced cursor when inset in inset is locked.
5200 * src/insets/insettext.C (LocalDispatch): small fix so that a
5201 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5203 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5204 footnote font should be decreased in size twice when displaying.
5206 * src/insets/insettext.C (GetDrawFont): inserted this function as
5207 the drawing-font may differ from the real paragraph font.
5209 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5210 insets (inset in inset!).
5212 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5213 function here because we don't want footnotes inside footnotes.
5215 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5217 (init): now set the inset_owner in paragraph.C
5218 (LocalDispatch): added some resetPos() in the right position
5221 (pasteSelection): changed to use the new CutAndPaste-Class.
5223 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5224 which tells if it is allowed to insert another inset inside this one.
5226 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5227 SwitchLayoutsBetweenClasses.
5229 * src/text2.C (InsertInset): checking of the new paragraph-function
5231 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5232 is not needed anymore here!
5235 (PasteSelection): redone (also with #ifdef) so that now this uses
5236 the CutAndPaste-Class.
5237 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5240 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5241 from/to text/insets.
5243 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5244 so that the paragraph knows if it is inside an (text)-inset.
5245 (InsertFromMinibuffer): changed return-value to bool as now it
5246 may happen that an inset is not inserted in the paragraph.
5247 (InsertInsetAllowed): this checks if it is allowed to insert an
5248 inset in this paragraph.
5250 (BreakParagraphConservative):
5251 (BreakParagraph) : small change for the above change of the return
5252 value of InsertFromMinibuffer.
5254 * src/lyxparagraph.h: added inset_owner and the functions to handle
5255 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5257 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5259 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5260 functions from BufferView to BufferView::Pimpl to ease maintence.
5262 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5263 correctly. Also use SetCursorIntern instead of SetCursor.
5265 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5268 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5270 * src/WorkArea.C (belowMouse): manually implement below mouse.
5272 * src/*: Add "explicit" on several constructors, I added probably
5273 some unneeded ones. A couple of changes to code because of this.
5275 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5276 implementation and private parts from the users of BufferView. Not
5279 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5280 implementation and private parts from the users of LyXLex. Not
5283 * src/BufferView_pimpl.[Ch]: new files
5285 * src/lyxlex_pimpl.[Ch]: new files
5287 * src/LyXView.[Ch]: some inline functions move out-of-line
5289 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5291 * src/lyxparagraph.h: make struct InsetTable public.
5293 * src/support/lyxstring.h: change lyxstring::difference_type to be
5294 ptrdiff_t. Add std:: modifiers to streams.
5296 * src/font.C: include the <cctype> header, for islower() and
5299 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5301 * src/font.[Ch]: new files. Contains the metric functions for
5302 fonts, takes a LyXFont as parameter. Better separation of concepts.
5304 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5305 changes because of this.
5307 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5309 * src/*: compile with -Winline and move functions that don't
5312 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5315 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5317 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5318 (various files changed because of this)
5320 * src/Painter.C (text): fixed the drawing of smallcaps.
5322 * src/lyxfont.[Ch] (drawText): removed unused member func.
5325 * src/*.C: added needed "using" statements and "std::" qualifiers.
5327 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5329 * src/*.h: removed all use of "using" from header files use
5330 qualifier std:: instead.
5332 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5334 * src/text.C (Backspace): some additional cleanups (we already
5335 know whether cursor.pos is 0 or not).
5337 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5338 automake does not provide one).
5340 * src/bmtable.h: replace C++ comments with C comments.
5342 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5344 * src/screen.C (ShowCursor): Change the shape of the cursor if
5345 the current language is not equal to the language of the document.
5346 (If the cursor change its shape unexpectedly, then you've found a bug)
5348 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5351 * src/insets/insetnumber.[Ch]: New files.
5353 * src/LyXAction.C (init)
5354 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5357 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5359 * src/lyxparagraph.h
5360 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5361 (the vector is kept sorted).
5363 * src/text.C (GetVisibleRow): Draw selection correctly when there
5364 is both LTR and RTL text.
5366 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5367 which is much faster.
5369 * src/text.C (GetVisibleRow and other): Do not draw the last space
5370 in a row if the direction of the last letter is not equal to the
5371 direction of the paragraph.
5373 * src/lyxfont.C (latexWriteStartChanges):
5374 Check that font language is not equal to basefont language.
5375 (latexWriteEndChanges): ditto
5377 * src/lyx_cb.C (StyleReset): Don't change the language while using
5378 the font-default command.
5380 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5381 empty paragraph before a footnote.
5383 * src/insets/insetcommand.C (draw): Increase x correctly.
5385 * src/screen.C (ShowCursor): Change cursor shape if
5386 current language != document language.
5388 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5390 2000-03-31 Juergen Vigna <jug@sad.it>
5392 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5393 (Clone): changed mode how the paragraph-data is copied to the
5394 new clone-paragraph.
5396 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5397 GetInset(pos) with no inset anymore there (in inset UNDO)
5399 * src/insets/insetcommand.C (draw): small fix as here x is
5400 incremented not as much as width() returns (2 before, 2 behind = 4)
5402 2000-03-30 Juergen Vigna <jug@sad.it>
5404 * src/insets/insettext.C (InsetText): small fix in initialize
5405 widthOffset (should not be done in the init() function)
5407 2000-03-29 Amir Karger <karger@lyx.org>
5409 * lib/examples/it_ItemizeBullets.lyx: translation by
5412 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5414 2000-03-29 Juergen Vigna <jug@sad.it>
5416 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5418 * src/insets/insetfoot.C (Clone): small change as for the below
5419 new init function in the text-inset
5421 * src/insets/insettext.C (init): new function as I've seen that
5422 clone did not copy the Paragraph-Data!
5423 (LocalDispatch): Added code so that now we have some sort of Undo
5424 functionality (well actually we HAVE Undo ;)
5426 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5428 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5430 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5433 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5435 * src/main.C: added a runtime check that verifies that the xforms
5436 header used when building LyX and the library used when running
5437 LyX match. Exit with a message if they don't match. This is a
5438 version number check only.
5440 * src/buffer.C (save): Don't allocate memory on the heap for
5441 struct utimbuf times.
5443 * *: some using changes, use iosfwd instead of the real headers.
5445 * src/lyxfont.C use char const * instead of string for the static
5446 strings. Rewrite some functions to use sstream.
5448 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5450 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5453 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5455 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5456 of Geodesy (from Martin Vermeer)
5458 * lib/layouts/svjour.inc: include file for the Springer svjour
5459 class. It can be used to support journals other than JoG.
5461 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5462 Miskiewicz <misiek@pld.org.pl>)
5463 * lib/reLyX/Makefile.am: ditto.
5465 2000-03-27 Juergen Vigna <jug@sad.it>
5467 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5468 also some modifications with operations on selected text.
5470 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5471 problems with clicking on insets (last famous words ;)
5473 * src/insets/insetcommand.C (draw):
5474 (width): Changed to have a bit of space before and after the inset so
5475 that the blinking cursor can be seen (otherwise it was hidden)
5477 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5479 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5480 would not be added to the link list when an installed gettext (not
5481 part of libc) is found.
5483 2000-03-24 Juergen Vigna <jug@sad.it>
5485 * src/insets/insetcollapsable.C (Edit):
5486 * src/mathed/formula.C (InsetButtonRelease):
5487 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5490 * src/BufferView.C (workAreaButtonPress):
5491 (workAreaButtonRelease):
5492 (checkInsetHit): Finally fixed the clicking on insets be handled
5495 * src/insets/insetert.C (Edit): inserted this call so that ERT
5496 insets work always with LaTeX-font
5498 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5500 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5501 caused lyx to startup with no GUI in place, causing in a crash
5502 upon startup when called with arguments.
5504 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5506 * src/FontLoader.C: better initialization of dummyXFontStruct.
5508 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5510 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5511 for linuxdoc and docbook import and export format options.
5513 * lib/lyxrc.example Example of default values for the previous flags.
5515 * src/lyx_cb.C Use those flags instead of the hardwired values for
5516 linuxdoc and docbook export.
5518 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5521 * src/menus.C Added menus entries for the new import/exports formats.
5523 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5525 * src/lyxrc.*: Added support for running without Gui
5528 * src/FontLoader.C: sensible defaults if no fonts are needed
5530 * src/lyx_cb.C: New function ShowMessage (writes either to the
5531 minibuffer or cout in case of no gui
5532 New function AskOverwrite for common stuff
5533 Consequently various changes to call these functions
5535 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5536 wild guess at sensible screen resolution when having no gui
5538 * src/lyxfont.C: no gui, no fonts... set some defaults
5540 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5542 * src/LColor.C: made the command inset background a bit lighter.
5544 2000-03-20 Hartmut Goebel <goebel@noris.net>
5546 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5547 stdstruct.inc. Koma-Script added some title elements which
5548 otherwise have been listed below "bibliography". This split allows
5549 adding title elements to where they belong.
5551 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5552 define the additional tilte elements and then include
5555 * many other layout files: changed to include stdtitle.inc just
5556 before stdstruct.inc.
5558 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5560 * src/buffer.C: (save) Added the option to store all backup files
5561 in a single directory
5563 * src/lyxrc.[Ch]: Added variable \backupdir_path
5565 * lib/lyxrc.example: Added descriptions of recently added variables
5567 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5568 bibtex inset, not closing the bibtex popup when deleting the inset)
5570 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5572 * src/lyx_cb.C: add a couple using directives.
5574 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5575 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5576 import based on the filename.
5578 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5579 file would be imported at start, if the filename where of a sgml file.
5581 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5583 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5585 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5586 * src/lyxfont.h Replaced the member variable bits.direction by the
5587 member variable lang. Made many changes in other files.
5588 This allows having a multi-lingual document
5590 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5591 that change the current language to <l>.
5592 Removed the command "font-rtl"
5594 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5595 format for Hebrew documents)
5597 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5598 When auto_mathmode is "true", pressing a digit key in normal mode
5599 will cause entering into mathmode.
5600 If auto_mathmode is "rtl" then this behavior will be active only
5601 when writing right-to-left text.
5603 * src/text2.C (InsertStringA) The string is inserted using the
5606 * src/paragraph.C (GetEndLabel) Gives a correct result for
5607 footnote paragraphs.
5609 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5611 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5613 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5614 front of PasteParagraph. Never insert a ' '. This should at least
5615 fix some cause for the segfaults that we have been experiencing,
5616 it also fixes backspace behaviour slightly. (Phu!)
5618 * src/support/lstrings.C (compare_no_case): some change to make it
5619 compile with gcc 2.95.2 and stdlibc++-v3
5621 * src/text2.C (MeltFootnoteEnvironment): change type o
5622 first_footnote_par_is_not_empty to bool.
5624 * src/lyxparagraph.h: make text private. Changes in other files
5626 (fitToSize): new function
5627 (setContentsFromPar): new function
5628 (clearContents): new function
5629 (SetChar): new function
5631 * src/paragraph.C (readSimpleWholeFile): deleted.
5633 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5634 the file, just use a simple string instead. Also read the file in
5635 a more maintainable manner.
5637 * src/text2.C (InsertStringA): deleted.
5638 (InsertStringB): deleted.
5640 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5642 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5643 RedoParagraphs from the doublespace handling part, just set status
5644 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5645 done, but perhaps not like this.)
5647 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5649 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5650 character when inserting an inset.
5652 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5654 * src/bufferparams.C (readLanguage): now takes "default" into
5657 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5658 also initialize the toplevel_keymap with the default bindings from
5661 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5663 * all files using lyxrc: have lyxrc as a real variable and not a
5664 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5667 * src/lyxrc.C: remove double call to defaultKeyBindings
5669 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5670 toolbar defauls using lyxlex. Remove enums, structs, functions
5673 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5674 toolbar defaults. Also store default keybindings in a map.
5676 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5677 storing the toolbar defaults without any xforms dependencies.
5679 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5680 applied. Changed to use iterators.
5682 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5684 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5685 systems that don't have LINGUAS set to begin with.
5687 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5689 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5690 the list by Dekel Tsur.
5692 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5694 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5695 * src/insets/form_graphics.C: ditto.
5697 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5699 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5701 * src/bufferparams.C (readLanguage): use the new language map
5703 * src/intl.C (InitKeyMapper): use the new language map
5705 * src/lyx_gui.C (create_forms): use the new language map
5707 * src/language.[Ch]: New files. Used for holding the information
5708 about each language. Now! Use this new language map enhance it and
5709 make it really usable for our needs.
5711 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5713 * screen.C (ShowCursor): Removed duplicate code.
5714 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5715 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5717 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5720 * src/text.C Added TransformChar method. Used for rendering Arabic
5721 text correctly (change the glyphs of the letter according to the
5722 position in the word)
5727 * src/lyxrc.C Added lyxrc command {language_command_begin,
5728 language_command_end,language_command_ltr,language_command_rtl,
5729 language_package} which allows the use of either arabtex or Omega
5732 * src/lyx_gui.C (init)
5734 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5735 to use encoding for menu fonts which is different than the encoding
5738 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5739 do not load the babel package.
5740 To write an English document with Hebrew/Arabic, change the document
5741 language to "english".
5743 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5744 (alphaCounter): changed to return char
5745 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5747 * lib/lyxrc.example Added examples for Hebrew/Arabic
5750 * src/layout.C Added layout command endlabeltype
5752 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5754 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5756 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5758 * src/mathed/math_delim.C (search_deco): return a
5759 math_deco_struct* instead of index.
5761 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5763 * All files with a USE_OSTREAM_ONLY within: removed all code that
5764 was unused when USE_OSTREAM_ONLY is defined.
5766 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5767 of any less. Removed header and using.
5769 * src/text.C (GetVisibleRow): draw the string "Page Break
5770 (top/bottom)" on screen when drawing a pagebreak line.
5772 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5774 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5776 * src/mathed/math_macro.C (draw): do some cast magic.
5779 * src/mathed/math_defs.h: change byte* argument to byte const*.
5781 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5783 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5784 know it is right to return InsetFoot* too, but cxx does not like
5787 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5789 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5791 * src/mathed/math_delim.C: change == to proper assignment.
5793 2000-03-09 Juergen Vigna <jug@sad.it>
5795 * src/insets/insettext.C (setPos): fixed various cursor positioning
5796 problems (via mouse and cursor-keys)
5797 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5798 inset (still a small display problem but it works ;)
5800 * src/insets/insetcollapsable.C (draw): added button_top_y and
5801 button_bottom_y to have correct values for clicking on the inset.
5803 * src/support/lyxalgo.h: commented out 'using std::less'
5805 2000-03-08 Juergen Vigna <jug@sad.it>
5807 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5808 Button-Release event closes as it is alos the Release-Event
5811 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5813 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5815 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5816 can add multiple spaces in Scrap (literate programming) styles...
5817 which, by the way, is how I got hooked on LyX to begin with.
5819 * src/mathed/formula.C (Write): Added dummy variable to an
5820 inset::Latex() call.
5821 (Latex): Add free_spacing boolean to inset::Latex()
5823 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5825 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5826 virtual function to include the free_spacing boolean from
5827 the containing paragraph's style.
5829 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5830 Added free_spacing boolean arg to match inset.h
5832 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5833 Added free_spacing boolean arg to match inset.h
5835 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5836 Added free_spacing boolean and made sure that if in a free_spacing
5837 paragraph, that we output normal space if there is a protected space.
5839 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5840 Added free_spacing boolean arg to match inset.h
5842 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5843 Added free_spacing boolean arg to match inset.h
5845 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5846 Added free_spacing boolean arg to match inset.h
5848 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5849 Added free_spacing boolean arg to match inset.h
5851 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5852 Added free_spacing boolean arg to match inset.h
5854 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5855 free_spacing boolean arg to match inset.h
5857 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5858 Added free_spacing boolean arg to match inset.h
5860 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5861 Added free_spacing boolean arg to match inset.h
5863 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5864 Added free_spacing boolean arg to match inset.h
5866 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5867 Added free_spacing boolean arg to match inset.h
5869 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5870 Added free_spacing boolean arg to match inset.h
5872 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5873 free_spacing boolean arg to match inset.h
5875 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5876 free_spacing boolean arg to match inset.h
5878 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5879 ignore free_spacing paragraphs. The user's spaces are left
5882 * src/text.C (InsertChar): Fixed the free_spacing layout
5883 attribute behavior. Now, if free_spacing is set, you can
5884 add multiple spaces in a paragraph with impunity (and they
5885 get output verbatim).
5886 (SelectSelectedWord): Added dummy argument to inset::Latex()
5889 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5892 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5893 paragraph layouts now only input a simple space instead.
5894 Special character insets don't make any sense in free-spacing
5897 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5898 hard-spaces in the *input* file to simple spaces if the layout
5899 is free-spacing. This converts old files which had to have
5900 hard-spaces in free-spacing layouts where a simple space was
5902 (writeFileAscii): Added free_spacing check to pass to the newly
5903 reworked inset::Latex(...) methods. The inset::Latex() code
5904 ensures that hard-spaces in free-spacing paragraphs get output
5905 as spaces (rather than "~").
5907 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5909 * src/mathed/math_delim.C (draw): draw the empty placeholder
5910 delims with a onoffdash line.
5911 (struct math_deco_compare): struct that holds the "functors" used
5912 for the sort and the binary search in math_deco_table.
5913 (class init_deco_table): class used for initial sort of the
5915 (search_deco): use lower_bound to do a binary search in the
5918 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5920 * src/lyxrc.C: a small secret thingie...
5922 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5923 and to not flush the stream as often as it used to.
5925 * src/support/lyxalgo.h: new file
5926 (sorted): template function used for checking if a sequence is
5927 sorted or not. Two versions with and without user supplied
5928 compare. Uses same compare as std::sort.
5930 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5931 it and give warning on lyxerr.
5933 (struct compare_tags): struct with function operators used for
5934 checking if sorted, sorting and lower_bound.
5935 (search_kw): use lower_bound instead of manually implemented
5938 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5940 * src/insets/insetcollapsable.h: fix Clone() declaration.
5941 * src/insets/insetfoot.h: ditto.
5943 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5945 2000-03-08 Juergen Vigna <jug@sad.it>
5947 * src/insets/lyxinset.h: added owner call which tells us if
5948 this inset is inside another inset. Changed also the return-type
5949 of Editable to an enum so it tells clearer what the return-value is.
5951 * src/insets/insettext.C (computeTextRows): fixed computing of
5952 textinsets which split automatically on more rows.
5954 * src/insets/insetert.[Ch]: changed this to be of BaseType
5957 * src/insets/insetfoot.[Ch]: added footnote inset
5959 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5960 collapsable insets (like footnote, ert, ...)
5962 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5964 * src/lyxdraw.h: remvoe file
5966 * src/lyxdraw.C: remove file
5968 * src/insets/insettext.C: added <algorithm>.
5970 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5972 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5973 (matrix_cb): case MM_OK use string stream
5975 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5978 * src/mathed/math_macro.C (draw): use string stream
5979 (Metrics): use string stream
5981 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5982 directly to the ostream.
5984 * src/vspace.C (asString): use string stream.
5985 (asString): use string stream
5986 (asLatexString): use string stream
5988 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5989 setting Spacing::Other.
5991 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5992 sprintf when creating the stretch vale.
5994 * src/text2.C (alphaCounter): changed to return a string and to
5995 not use a static variable internally. Also fixed a one-off bug.
5996 (SetCounter): changed the drawing of the labels to use string
5997 streams instead of sprintf.
5999 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6000 manipulator to use a scheme that does not require library support.
6001 This is also the way it is done in the new GNU libstdc++. Should
6002 work with DEC cxx now.
6004 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6007 end. This fixes a bug.
6009 * src/mathed (all files concerned with file writing): apply the
6010 USE_OSTREAM_ONLY changes to mathed too.
6012 * src/support/DebugStream.h: make the constructor explicit.
6014 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6015 count and ostream squashed.
6017 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6019 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6021 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6022 ostringstream uses STL strings, and we might not.
6024 * src/insets/insetspecialchar.C: add using directive.
6025 * src/insets/insettext.C: ditto.
6027 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6029 * lib/layouts/seminar.layout: feeble attempt at a layout for
6030 seminar.cls, far from completet and could really use some looking
6031 at from people used to write layout files.
6033 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6034 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6035 a lot nicer and works nicely with ostreams.
6037 * src/mathed/formula.C (draw): a slightly different solution that
6038 the one posted to the list, but I think this one works too. (font
6039 size wrong in headers.)
6041 * src/insets/insettext.C (computeTextRows): some fiddling on
6042 Jürgens turf, added some comments that he should read.
6044 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6045 used and it gave compiler warnings.
6046 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6049 * src/lyx_gui.C (create_forms): do the right thing when
6050 show_banner is true/false.
6052 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6053 show_banner is false.
6055 * most file writing files: Now use iostreams to do almost all of
6056 the writing. Also instead of passing string &, we now use
6057 stringstreams. mathed output is still not adapted to iostreams.
6058 This change can be turned off by commenting out all the occurences
6059 of the "#define USE_OSTREAM_ONLY 1" lines.
6061 * src/WorkArea.C (createPixmap): don't output debug messages.
6062 (WorkArea): don't output debug messages.
6064 * lib/lyxrc.example: added a comment about the new variable
6067 * development/Code_rules/Rules: Added some more commente about how
6068 to build class interfaces and on how better encapsulation can be
6071 2000-03-03 Juergen Vigna <jug@sad.it>
6073 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6074 automatically with the width of the LyX-Window
6076 * src/insets/insettext.C (computeTextRows): fixed update bug in
6077 displaying text-insets (scrollvalues where not initialized!)
6079 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6081 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6082 id in the check of the result from lower_bound is not enough since
6083 lower_bound can return last too, and then res->id will not be a
6086 * all insets and some code that use them: I have conditionalized
6087 removed the Latex(string & out, ...) this means that only the
6088 Latex(ostream &, ...) will be used. This is a work in progress to
6089 move towards using streams for all output of files.
6091 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6094 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6096 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6097 routine (this fixes bug where greek letters were surrounded by too
6100 * src/support/filetools.C (findtexfile): change a bit the search
6101 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6102 no longer passed to kpsewhich, we may have to change that later.
6104 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6105 warning options to avoid problems with X header files (from Angus
6107 * acinclude.m4: regenerated.
6109 2000-03-02 Juergen Vigna <jug@sad.it>
6111 * src/insets/insettext.C (WriteParagraphData): Using the
6112 par->writeFile() function for writing paragraph-data.
6113 (Read): Using buffer->parseSingleLyXformat2Token()-function
6114 for parsing paragraph data!
6116 * src/buffer.C (readLyXformat2): removed all parse data and using
6117 the new parseSingleLyXformat2Token()-function.
6118 (parseSingleLyXformat2Token): added this function to parse (read)
6119 lyx-file-format (this is called also from text-insets now!)
6121 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6123 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6126 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6127 directly instead of going through a func. One very bad thing: a
6128 static LyXFindReplace, but I don't know where to place it.
6130 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6131 string instead of char[]. Also changed to static.
6132 (GetSelectionOrWordAtCursor): changed to static inline
6133 (SetSelectionOverLenChars): ditto.
6135 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6136 current_view and global variables. both classes has changed names
6137 and LyXFindReplace is not inherited from SearchForm.
6139 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6140 fl_form_search form.
6142 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6144 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6146 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6147 bound (from Kayvan).
6149 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6151 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6153 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6155 * some things that I should comment but the local pub says head to
6158 * comment out all code that belongs to the Roff code for Ascii
6159 export of tables. (this is unused)
6161 * src/LyXView.C: use correct type for global variable
6162 current_layout. (LyXTextClass::size_type)
6164 * some code to get the new insetgraphics closer to working I'd be
6165 grateful for any help.
6167 * src/BufferView2.C (insertInset): use the return type of
6168 NumberOfLayout properly. (also changes in other files)
6170 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6171 this as a test. I want to know what breaks because of this.
6173 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6175 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6177 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6178 to use a \makebox in the label, this allows proper justification
6179 with out using protected spaces or multiple hfills. Now it is
6180 "label" for left justified, "\hfill label\hfill" for center, and
6181 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6182 should be changed accordingly.
6184 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6186 * src/lyxtext.h: change SetLayout() to take a
6187 LyXTextClass::size_type instead of a char (when there is more than
6188 127 layouts in a class); also change type of copylayouttype.
6189 * src/text2.C (SetLayout): ditto.
6190 * src/LyXView.C (updateLayoutChoice): ditto.
6192 * src/LaTeX.C (scanLogFile): errors where the line number was not
6193 given just after the '!'-line were ignored (from Dekel Tsur).
6195 * lib/lyxrc.example: fix description of \date_insert_format
6197 * lib/layouts/llncs.layout: new layout, contributed by Martin
6200 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6202 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6203 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6204 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6205 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6206 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6207 paragraph.C, text.C, text2.C)
6209 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/insets/insettext.C (LocalDispatch): remove extra break
6214 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6215 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6217 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6218 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6220 * src/insets/insetbib.h: move InsetBibkey::Holder and
6221 InsetCitation::Holder in public space.
6223 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6225 * src/insets/insettext.h: small change to get the new files from
6226 Juergen to compile (use "string", not "class string").
6228 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6229 const & as parameter to LocalDispatch, use LyXFont const & as
6230 paramter to some other func. This also had impacto on lyxinsets.h
6231 and the two mathed insets.
6233 2000-02-24 Juergen Vigna <jug@sad.it>
6236 * src/commandtags.h:
6238 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6242 * src/BufferView2.C: added/updated code for various inset-functions
6244 * src/insets/insetert.[Ch]: added implementation of InsetERT
6246 * src/insets/insettext.[Ch]: added implementation of InsetText
6248 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6249 (draw): added preliminary code for inset scrolling not finshed yet
6251 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6252 as it is in lyxfunc.C now
6254 * src/insets/lyxinset.h: Added functions for text-insets
6256 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6259 BufferView and reimplement the list as a queue put inside its own
6262 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6264 * several files: use the new interface to the "updateinsetlist"
6266 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6268 (work_area_handler): call BufferView::trippleClick on trippleclick.
6270 * src/BufferView.C (doubleClick): new function, selects word on
6272 (trippleClick): new function, selects line on trippleclick.
6274 2000-02-22 Allan Rae <rae@lyx.org>
6276 * lib/bind/xemacs.bind: buffer-previous not supported
6278 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6280 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6283 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/bufferlist.C: get rid of current_view from this file
6287 * src/spellchecker.C: get rid of current_view from this file
6289 * src/vspace.C: get rid of current_view from this file
6290 (inPixels): added BufferView parameter for this func
6291 (asLatexCommand): added a BufferParams for this func
6293 * src/text.C src/text2.C: get rid of current_view from these
6296 * src/lyxfont.C (getFontDirection): move this function here from
6299 * src/bufferparams.C (getDocumentDirection): move this function
6302 * src/paragraph.C (getParDirection): move this function here from
6304 (getLetterDirection): ditto
6306 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6308 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6309 resize due to wrong pixmap beeing used. Also took the opurtunity
6310 to make the LyXScreen stateless on regard to WorkArea and some
6311 general cleanup in the same files.
6313 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6315 * src/Makefile.am: add missing direction.h
6317 * src/PainterBase.h: made the width functions const.
6319 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6322 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6324 * src/insets/insetlatexaccent.C (draw): make the accents draw
6325 better, at present this will only work well with iso8859-1.
6327 * several files: remove the old drawing code, now we use the new
6330 * several files: remove support for mono_video, reverse_video and
6333 2000-02-17 Juergen Vigna <jug@sad.it>
6335 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6336 int ** as we have to return the pointer, otherwise we have only
6337 NULL pointers in the returning function.
6339 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6341 * src/LaTeX.C (operator()): quote file name when running latex.
6343 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6345 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6346 (bubble tip), this removes our special handling of this.
6348 * Remove all code that is unused now that we have the new
6349 workarea. (Code that are not active when NEW_WA is defined.)
6351 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6353 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6355 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6356 nonexisting layout; correctly redirect obsoleted layouts.
6358 * lib/lyxrc.example: document \view_dvi_paper_option
6360 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6363 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6364 (PreviewDVI): handle the view_dvi_paper_option variable.
6365 [Both from Roland Krause]
6367 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6369 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6370 char const *, int, LyXFont)
6371 (text(int, int, string, LyXFont)): ditto
6373 * src/text.C (InsertCharInTable): attempt to fix the double-space
6374 feature in tables too.
6375 (BackspaceInTable): ditto.
6376 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6378 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6380 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6382 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6383 newly found text in textcache to this.
6384 (buffer): set the owner of the text put into the textcache to 0
6386 * src/insets/figinset.C (draw): fixed the drawing of figures with
6389 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6390 drawing of mathframe, hfills, protected space, table lines. I have
6391 now no outstanding drawing problems with the new Painter code.
6393 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6395 * src/PainterBase.C (ellipse, circle): do not specify the default
6398 * src/LColor.h: add using directive.
6400 * src/Painter.[Ch]: change return type of methods from Painter& to
6401 PainterBase&. Add a using directive.
6403 * src/WorkArea.C: wrap xforms callbacks in C functions
6406 * lib/layouts/foils.layout: font fix and simplifications from Carl
6409 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6411 * a lot of files: The Painter, LColor and WorkArea from the old
6412 devel branch has been ported to lyx-devel. Some new files and a
6413 lot of #ifdeffed code. The new workarea is enabled by default, but
6414 if you want to test the new Painter and LColor you have to compile
6415 with USE_PAINTER defined (do this in config.h f.ex.) There are
6416 still some rought edges, and I'd like some help to clear those
6417 out. It looks stable (loads and displays the Userguide very well).
6420 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6422 * src/buffer.C (pop_tag): revert to the previous implementation
6423 (use a global variable for both loops).
6425 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6427 * src/lyxrc.C (LyXRC): change slightly default date format.
6429 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6430 there is an English text with a footnote that starts with a Hebrew
6431 paragraph, or vice versa.
6432 (TeXFootnote): ditto.
6434 * src/text.C (LeftMargin): allow for negative values for
6435 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6438 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6439 for input encoding (cyrillic)
6441 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6443 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6446 * src/toolbar.C (set): ditto
6447 * src/insets/insetbib.C (create_form_citation_form): ditto
6449 * lib/CREDITS: added Dekel Tsur.
6451 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6452 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6453 hebrew supports files from Dekel Tsur.
6455 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6456 <tzafrir@technion.ac.il>
6458 * src/lyxrc.C: put \date_insert_format at the right place.
6460 * src/buffer.C (makeLaTeXFile): fix the handling of
6461 BufferParams::sides when writing out latex files.
6463 * src/BufferView2.C: add a "using" directive.
6465 * src/support/lyxsum.C (sum): when we use lyxstring,
6466 ostringstream::str needs an additional .c_str().
6468 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6470 * src/support/filetools.C (ChangeExtension): patch from Etienne
6473 * src/TextCache.C (show): remove const_cast and make second
6474 parameter non-const LyXText *.
6476 * src/TextCache.h: use non const LyXText in show.
6478 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6481 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6483 * src/support/lyxsum.C: rework to be more flexible.
6485 * several places: don't check if a pointer is 0 if you are going
6488 * src/text.C: remove some dead code.
6490 * src/insets/figinset.C: remove some dead code
6492 * src/buffer.C: move the BufferView funcs to BufferView2.C
6493 remove all support for insetlatexdel
6494 remove support for oldpapersize stuff
6495 made some member funcs const
6497 * src/kbmap.C: use a std::list to store the bindings in.
6499 * src/BufferView2.C: new file
6501 * src/kbsequence.[Ch]: new files
6503 * src/LyXAction.C + others: remove all trace of buffer-previous
6505 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6506 only have one copy in the binary of this table.
6508 * hebrew patch: moved some functions from LyXText to more
6509 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6511 * several files: remove support for XForms older than 0.88
6513 remove some #if 0 #endif code
6515 * src/TextCache.[Ch]: new file. Holds the textcache.
6517 * src/BufferView.C: changes to use the new TextCache interface.
6518 (waitForX): remove the now unused code.
6520 * src/BackStack.h: remove some commented code
6522 * lib/bind/emacs.bind: remove binding for buffer-previous
6524 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6526 * applied the hebrew patch.
6528 * src/lyxrow.h: make sure that all Row variables are initialized.
6530 * src/text2.C (TextHandleUndo): comment out a delete, this might
6531 introduce a memory leak, but should also help us to not try to
6532 read freed memory. We need to look at this one.
6534 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6535 (LyXParagraph): initalize footnotekind.
6537 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6538 forgot this when applying the patch. Please heed the warnings.
6540 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6541 (aka. reformat problem)
6543 * src/bufferlist.C (exists): made const, and use const_iterator
6544 (isLoaded): new func.
6545 (release): use std::find to find the correct buffer.
6547 * src/bufferlist.h: made getState a const func.
6548 made empty a const func.
6549 made exists a const func.
6552 2000-02-01 Juergen Vigna <jug@sad.it>
6554 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6556 * po/it.po: updated a bit the italian po file and also changed the
6557 'file nuovo' for newfile to 'filenuovo' without a space, this did
6560 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6561 for the new insert_date command.
6563 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6564 from jdblair, to insert a date into the current text conforming to
6565 a strftime format (for now only considering the locale-set and not
6566 the document-language).
6568 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6570 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6571 Bounds Read error seen by purify. The problem was that islower is
6572 a macros which takes an unsigned char and uses it as an index for
6573 in array of characters properties (and is thus subject to the
6577 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6578 correctly the paper sides radio buttons.
6579 (UpdateDocumentButtons): ditto.
6581 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6583 * src/kbmap.C (getsym + others): change to return unsigned int,
6584 returning a long can give problems on 64 bit systems. (I assume
6585 that int is 32bit on 64bit systems)
6587 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6590 LyXLookupString to be zero-terminated. Really fixes problems seen
6593 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6595 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6596 write a (char*)0 to the lyxerr stream.
6598 * src/lastfiles.C: move algorithm before the using statemets.
6600 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6602 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6603 complains otherwise).
6604 * src/table.C: ditto
6606 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6609 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6610 that I removed earlier... It is really needed.
6612 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6614 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6616 * INSTALL: update xforms home page URL.
6618 * lib/configure.m4: fix a bug with unreadable layout files.
6620 * src/table.C (calculate_width_of_column): add "using std::max"
6623 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6625 * several files: marked several lines with "DEL LINE", this is
6626 lines that can be deleted without changing anything.
6627 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6628 checks this anyway */
6631 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6633 * src/DepTable.C (update): add a "+" at the end when the checksum
6634 is different. (debugging string only)
6636 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6637 the next inset to not be displayed. This should also fix the list
6638 of labels in the "Insert Crossreference" dialog.
6640 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6642 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6643 when regex was not found.
6645 * src/support/lstrings.C (lowercase): use handcoded transform always.
6648 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6649 old_cursor.par->prev could be 0.
6651 * several files: changed post inc/dec to pre inc/dec
6653 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6654 write the lastfiles to file.
6656 * src/BufferView.C (buffer): only show TextCache info when debugging
6658 (resizeCurrentBuffer): ditto
6659 (workAreaExpose): ditto
6661 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6663 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6665 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6666 a bit better by removing the special case for \i and \j.
6668 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6670 * src/lyx_main.C (easyParse): remove test for bad comand line
6671 options, since this broke all xforms-related parsing.
6673 * src/kbmap.C (getsym): set return type to unsigned long, as
6674 declared in header. On an alpha, long is _not_ the same as int.
6676 * src/support/LOstream.h: add a "using std::flush;"
6678 * src/insets/figinset.C: ditto.
6680 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6682 * src/bufferlist.C (write): use blinding fast file copy instead of
6683 "a char at a time", now we are doing it the C++ way.
6685 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6686 std::list<int> instead.
6687 (addpidwait): reflect move to std::list<int>
6688 (sigchldchecker): ditto
6690 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6693 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6694 that obviously was wrong...
6696 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6697 c, this avoids warnings with purify and islower.
6699 * src/insets/figinset.C: rename struct queue to struct
6700 queue_element and rewrite to use a std::queue. gsqueue is now a
6701 std::queue<queue_element>
6702 (runqueue): reflect move to std::queue
6705 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6706 we would get "1" "0" instead of "true" "false. Also make the tostr
6709 2000-01-21 Juergen Vigna <jug@sad.it>
6711 * src/buffer.C (writeFileAscii): Disabled code for special groff
6712 handling of tabulars till I fix this in table.C
6714 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6716 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6718 * src/support/lyxlib.h: ditto.
6720 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6723 and 'j' look better. This might fix the "macron" bug that has been
6726 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6727 functions as one template function. Delete the old versions.
6729 * src/support/lyxsum.C: move using std::ifstream inside
6732 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6735 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6737 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6739 * src/insets/figinset.C (InitFigures): use new instead of malloc
6740 to allocate memory for figures and bitmaps.
6741 (DoneFigures): use delete[] instead of free to deallocate memory
6742 for figures and bitmaps.
6743 (runqueue): use new to allocate
6744 (getfigdata): use new/delete[] instead of malloc/free
6745 (RegisterFigure): ditto
6747 * some files: moved some declarations closer to first use, small
6748 whitespace changes use preincrement instead of postincrement where
6749 it does not make a difference.
6751 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6752 step on the way to use stl::containers for key maps.
6754 * src/bufferlist.h: add a typedef for const_iterator and const
6755 versions of begin and end.
6757 * src/bufferlist.[Ch]: change name of member variable _state to
6758 state_. (avoid reserved names)
6760 (getFileNames): returns the filenames of the buffers in a vector.
6762 * configure.in (ALL_LINGUAS): added ro
6764 * src/support/putenv.C: new file
6766 * src/support/mkdir.C: new file
6768 2000-01-20 Allan Rae <rae@lyx.org>
6770 * lib/layouts/IEEEtran.layout: Added several theorem environments
6772 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6773 couple of minor additions.
6775 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6776 (except for those in footnotes of course)
6778 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6782 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6783 std::sort and std::lower_bound instead of qsort and handwritten
6785 (struct compara): struct that holds the functors used by std::sort
6786 and std::lower_bound in MathedLookupBOP.
6788 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6790 * src/support/LAssert.h: do not do partial specialization. We do
6793 * src/support/lyxlib.h: note that lyx::getUserName() and
6794 lyx::date() are not in use right now. Should these be suppressed?
6796 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6797 (makeLinuxDocFile): do not put date and user name in linuxdoc
6800 * src/support/lyxlib.h (kill): change first argument to long int,
6801 since that's what solaris uses.
6803 * src/support/kill.C (kill): fix declaration to match prototype.
6805 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6806 actually check whether namespaces are supported. This is not what
6809 * src/support/lyxsum.C: add a using directive.
6811 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/support/kill.C: if we have namespace support we don't have
6814 to include lyxlib.h.
6816 * src/support/lyxlib.h: use namespace lyx if supported.
6818 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6820 * src/support/date.C: new file
6822 * src/support/chdir.C: new file
6824 * src/support/getUserName.C: new file
6826 * src/support/getcwd.C: new file
6828 * src/support/abort.C: new file
6830 * src/support/kill.C: new file
6832 * src/support/lyxlib.h: moved all the functions in this file
6833 insede struct lyx. Added also kill and abort to this struct. This
6834 is a way to avoid the "kill is not defined in <csignal>", we make
6835 C++ wrappers for functions that are not ANSI C or ANSI C++.
6837 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6838 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6839 lyx it has been renamed to sum.
6841 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6843 * src/text.C: add using directives for std::min and std::max.
6845 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6847 * src/texrow.C (getIdFromRow): actually return something useful in
6848 id and pos. Hopefully fixes the bug with positionning of errorbox
6851 * src/lyx_main.C (easyParse): output an error and exit if an
6852 incorrect command line option has been given.
6854 * src/spellchecker.C (ispell_check_word): document a memory leak.
6856 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6857 where a "struct utimbuf" is allocated with "new" and deleted with
6860 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6862 * src/text2.C (CutSelection): don't delete double spaces.
6863 (PasteSelection): ditto
6864 (CopySelection): ditto
6866 * src/text.C (Backspace): don't delete double spaces.
6868 * src/lyxlex.C (next): fix a bug that were only present with
6869 conformant std::istream::get to read comment lines, use
6870 std::istream::getline instead. This seems to fix the problem.
6872 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6874 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6875 allowed to insert space before space" editing problem. Please read
6876 commends at the beginning of the function. Comments about usage
6879 * src/text.C (InsertChar): fix for the "not allowed to insert
6880 space before space" editing problem.
6882 * src/text2.C (DeleteEmptyParagraphMechanism): when
6883 IsEmptyTableRow can only return false this last "else if" will
6884 always be a no-op. Commented out.
6886 * src/text.C (RedoParagraph): As far as I can understand tmp
6887 cursor is not really needed.
6889 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6890 present it could only return false anyway.
6891 (several functions): Did something not so smart...added a const
6892 specifier on a lot of methods.
6894 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6895 and add a tmp->text.resize. The LyXParagraph constructor does the
6897 (BreakParagraphConservative): ditto
6899 * src/support/path.h (Path): add a define so that the wrong usage
6900 "Path("/tmp") will be flagged as a compilation error:
6901 "`unnamed_Path' undeclared (first use this function)"
6903 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6905 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6906 which was bogus for several reasons.
6908 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6912 * autogen.sh: do not use "type -path" (what's that anyway?).
6914 * src/support/filetools.C (findtexfile): remove extraneous space
6915 which caused a kpsewhich warning (at least with kpathsea version
6918 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6920 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6922 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6924 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6926 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6928 * src/paragraph.C (BreakParagraph): do not reserve space on text
6929 if we don't need to (otherwise, if pos_end < pos, we end up
6930 reserving huge amounts of memory due to bad unsigned karma).
6931 (BreakParagraphConservative): ditto, although I have not seen
6932 evidence the bug can happen here.
6934 * src/lyxparagraph.h: add a using std::list.
6936 2000-01-11 Juergen Vigna <jug@sad.it>
6938 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6941 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/vc-backend.C (doVCCommand): change to be static and take one
6944 more parameter: the path to chdir too be fore executing the command.
6945 (retrive): new function equiv to "co -r"
6947 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6948 file_not_found_hook is true.
6950 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6952 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6953 if a file is readwrite,readonly...anything else.
6955 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6957 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6958 (CreatePostscript): name change from MenuRunDVIPS (or something)
6959 (PreviewPostscript): name change from MenuPreviewPS
6960 (PreviewDVI): name change from MenuPreviewDVI
6962 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6963 \view_pdf_command., \pdf_to_ps_command
6965 * lib/configure.m4: added search for PDF viewer, and search for
6966 PDF to PS converter.
6967 (lyxrc.defaults output): add \pdflatex_command,
6968 \view_pdf_command and \pdf_to_ps_command.
6970 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6972 * src/bufferlist.C (write): we don't use blocksize for anything so
6975 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6977 * src/support/block.h: disable operator T* (), since it causes
6978 problems with both compilers I tried. See comments in the file.
6980 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6983 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6984 variable LYX_DIR_10x to LYX_DIR_11x.
6986 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6988 * INSTALL: document --with-lyxname.
6991 * configure.in: new configure flag --with-lyxname which allows to
6992 choose the name under which lyx is installed. Default is "lyx", of
6993 course. It used to be possible to do this with --program-suffix,
6994 but the later has in fact a different meaning for autoconf.
6996 * src/support/lstrings.h (lstrchr): reformat a bit.
6998 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6999 * src/mathed/math_defs.h: ditto.
7001 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7003 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7004 true, decides if we create a backup file or not when saving. New
7005 tag and variable \pdf_mode, defaults to false. New tag and
7006 variable \pdflatex_command, defaults to pdflatex. New tag and
7007 variable \view_pdf_command, defaults to xpdf. New tag and variable
7008 \pdf_to_ps_command, defaults to pdf2ps.
7010 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7012 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7013 does not have a BufferView.
7014 (unlockInset): ditto + don't access the_locking_inset if the
7015 buffer does not have a BufferView.
7017 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7018 certain circumstances so that we don't continue a keyboard
7019 operation long after the key was released. Try f.ex. to load a
7020 large document, press PageDown for some seconds and then release
7021 it. Before this change the document would contine to scroll for
7022 some time, with this change it stops imidiatly.
7024 * src/support/block.h: don't allocate more space than needed. As
7025 long as we don't try to write to the arr[x] in a array_type arr[x]
7026 it is perfectly ok. (if you write to it you might segfault).
7027 added operator value_type*() so that is possible to pass the array
7028 to functions expecting a C-pointer.
7030 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7033 * intl/*: updated to gettext 0.10.35, tried to add our own
7034 required modifications. Please verify.
7036 * po/*: updated to gettext 0.10.35, tried to add our own required
7037 modifications. Please verify.
7039 * src/support/lstrings.C (tostr): go at fixing the problem with
7040 cxx and stringstream. When stringstream is used return
7041 oss.str().c_str() so that problems with lyxstring and basic_string
7042 are avoided. Note that the best solution would be for cxx to use
7043 basic_string all the way, but it is not conformant yet. (it seems)
7045 * src/lyx_cb.C + other files: moved several global functions to
7046 class BufferView, some have been moved to BufferView.[Ch] others
7047 are still located in lyx_cb.C. Code changes because of this. (part
7048 of "get rid of current_view project".)
7050 * src/buffer.C + other files: moved several Buffer functions to
7051 class BufferView, the functions are still present in buffer.C.
7052 Code changes because of this.
7054 * config/lcmessage.m4: updated to most recent. used when creating
7057 * config/progtest.m4: updated to most recent. used when creating
7060 * config/gettext.m4: updated to most recent. applied patch for
7063 * config/gettext.m4.patch: new file that shows what changes we
7064 have done to the local copy of gettext.m4.
7066 * config/libtool.m4: new file, used in creation of acinclude.m4
7068 * config/lyxinclude.m4: new file, this is the lyx created m4
7069 macros, used in making acinclude.m4.
7071 * autogen.sh: GNU m4 discovered as a separate task not as part of
7072 the lib/configure creation.
7073 Generate acinlucde from files in config. Actually cat
7074 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7075 easier to upgrade .m4 files that really are external.
7077 * src/Spacing.h: moved using std::istringstream to right after
7078 <sstream>. This should fix the problem seen with some compilers.
7080 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7082 * src/lyx_cb.C: began some work to remove the dependency a lot of
7083 functions have on BufferView::text, even if not really needed.
7084 (GetCurrentTextClass): removed this func, it only hid the
7087 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7088 forgot this in last commit.
7090 * src/Bullet.C (bulletEntry): use static char const *[] for the
7091 tables, becuase of this the return arg had to change to string.
7093 (~Bullet): removed unneeded destructor
7095 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7096 (insetSleep): moved from Buffer
7097 (insetWakeup): moved from Buffer
7098 (insetUnlock): moved from Buffer
7100 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7101 from Buffer to BufferView.
7103 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7105 * config/ltmain.sh: updated to version 1.3.4 of libtool
7107 * config/ltconfig: updated to version 1.3.4 of libtool
7109 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7112 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7113 Did I get that right?
7115 * src/lyxlex.h: add a "using" directive or two.
7116 * src/Spacing.h: ditto.
7117 * src/insets/figinset.C: ditto.
7118 * src/support/filetools.C: ditto.
7119 * src/support/lstrings.C: ditto.
7120 * src/BufferView.C: ditto.
7121 * src/bufferlist.C: ditto.
7122 * src/lyx_cb.C: ditto.
7123 * src/lyxlex.C: ditto.
7125 * NEWS: add some changes for 1.1.4.
7127 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7129 * src/BufferView.C: first go at a TextCache to speed up switching
7132 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7134 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7135 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7136 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7137 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7140 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7141 members of the struct are correctly initialized to 0 (detected by
7143 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7144 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7146 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7147 pidwait, since it was allocated with "new". This was potentially
7148 very bad. Thanks to Michael Schmitt for running purify for us.
7151 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7153 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7155 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7157 1999-12-30 Allan Rae <rae@lyx.org>
7159 * lib/templates/IEEEtran.lyx: minor change
7161 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7162 src/mathed/formula.C (LocalDispatch): askForText changes
7164 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7165 know when a user has cancelled input. Fixes annoying problems with
7166 inserting labels and version control.
7168 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7170 * src/support/lstrings.C (tostr): rewritten to use strstream and
7173 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7175 * src/support/filetools.C (IsFileWriteable): use fstream to check
7176 (IsDirWriteable): use fileinfo to check
7178 * src/support/filetools.h (FilePtr): whole class deleted
7180 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7182 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7184 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7186 * src/bufferlist.C (write): use ifstream and ofstream instead of
7189 * src/Spacing.h: use istrstream instead of sscanf
7191 * src/mathed/math_defs.h: change first arg to istream from FILE*
7193 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7195 * src/mathed/math_parser.C: have yyis to be an istream
7196 (LexGetArg): use istream (yyis)
7198 (mathed_parse): ditto
7199 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7201 * src/mathed/formula.C (Read): rewritten to use istream
7203 * src/mathed/formulamacro.C (Read): rewritten to use istream
7205 * src/lyxlex.h (~LyXLex): deleted desturctor
7206 (getStream): new function, returns an istream
7207 (getFile): deleted funtion
7208 (IsOK): return is.good();
7210 * src/lyxlex.C (LyXLex): delete file and owns_file
7211 (setFile): open an filebuf and assign that to a istream instead of
7213 (setStream): new function, takes an istream as arg.
7214 (setFile): deleted function
7215 (EatLine): rewritten us use istream instead of FILE*
7219 * src/table.C (LyXTable): use istream instead of FILE*
7220 (Read): rewritten to take an istream instead of FILE*
7222 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7224 * src/buffer.C (Dispatch): remove an extraneous break statement.
7226 * src/support/filetools.C (QuoteName): change to do simple
7227 'quoting'. More work is necessary. Also changed to do nothing
7228 under emx (needs fix too).
7229 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7231 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7232 config.h.in to the AC_DEFINE_UNQUOTED() call.
7233 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7234 needs char * as argument (because Solaris 7 declares it like
7237 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7238 remove definition of BZERO.
7240 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7243 defined, "lyxregex.h" if not.
7245 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7247 (REGEX): new variable that is set to regex.c lyxregex.h when
7248 AM_CONDITIONAL USE_REGEX is set.
7249 (libsupport_la_SOURCES): add $(REGEX)
7251 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7254 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7257 * configure.in: add call to LYX_REGEX
7259 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7260 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7262 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7264 * lib/bind/fi_menus.bind: new file, from
7265 pauli.virtanen@saunalahti.fi.
7267 * src/buffer.C (getBibkeyList): pass the parameter delim to
7268 InsetInclude::getKeys and InsetBibtex::getKeys.
7270 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7271 is passed to Buffer::getBibkeyList
7273 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7274 instead of the hardcoded comma.
7276 * src/insets/insetbib.C (getKeys): make sure that there are not
7277 leading blanks in bibtex keys. Normal latex does not care, but
7278 harvard.sty seems to dislike blanks at the beginning of citation
7279 keys. In particular, the retturn value of the function is
7281 * INSTALL: make it clear that libstdc++ is needed and that gcc
7282 2.7.x probably does not work.
7284 * src/support/filetools.C (findtexfile): make debug message go to
7286 * src/insets/insetbib.C (getKeys): ditto
7288 * src/debug.C (showTags): make sure that the output is correctly
7291 * configure.in: add a comment for TWO_COLOR_ICON define.
7293 * acconfig.h: remove all the entries that already defined in
7294 configure.in or acinclude.m4.
7296 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7297 to avoid user name, date and copyright.
7299 1999-12-21 Juergen Vigna <jug@sad.it>
7301 * src/table.C (Read): Now read bogus row format informations
7302 if the format is < 5 so that afterwards the table can
7303 be read by lyx but without any format-info. Fixed the
7304 crash we experienced when not doing this.
7306 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7309 (RedoDrawingOfParagraph): ditto
7310 (RedoParagraphs): ditto
7311 (RemoveTableRow): ditto
7313 * src/text.C (Fill): rename arg paperwidth -> paper_width
7315 * src/buffer.C (insertLyXFile): rename var filename -> fname
7316 (writeFile): rename arg filename -> fname
7317 (writeFileAscii): ditto
7318 (makeLaTeXFile): ditto
7319 (makeLinuxDocFile): ditto
7320 (makeDocBookFile): ditto
7322 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7325 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7327 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7330 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7331 compiled by a C compiler not C++.
7333 * src/layout.h (LyXTextClass): added typedef for const_iterator
7334 (LyXTextClassList): added typedef for const_iterator + member
7335 functions begin and end.
7337 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7338 iterators to fill the choice_class.
7339 (updateLayoutChoice): rewritten to use iterators to fill the
7340 layoutlist in the toolbar.
7342 * src/BufferView.h (BufferView::work_area_width): removed unused
7345 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7347 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7348 (sgmlCloseTag): ditto
7350 * src/support/lstrings.h: return type of countChar changed to
7353 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7354 what version of this func to use. Also made to return unsigned int.
7356 * configure.in: call LYX_STD_COUNT
7358 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7359 conforming std::count.
7361 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7363 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7364 and a subscript would give bad display (patch from Dekel Tsur
7365 <dekel@math.tau.ac.il>).
7367 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7369 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7372 * src/chset.h: add a few 'using' directives
7374 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7375 triggered when no buffer is active
7377 * src/layout.C: removed `break' after `return' in switch(), since
7380 * src/lyx_main.C (init): make sure LyX can be ran in place even
7381 when libtool has done its magic with shared libraries. Fix the
7382 test for the case when the system directory has not been found.
7384 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7385 name for the latex file.
7386 (MenuMakeHTML): ditto
7388 * src/buffer.h: add an optional boolean argument, which is passed
7391 1999-12-20 Allan Rae <rae@lyx.org>
7393 * lib/templates/IEEEtran.lyx: small correction and update.
7395 * configure.in: Attempted to use LYX_PATH_HEADER
7397 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7399 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7400 input from JMarc. Now use preprocessor to find the header.
7401 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7402 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7403 LYX_STL_STRING_FWD. See comments in file.
7405 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7407 * The global MiniBuffer * minibuffer variable is dead.
7409 * The global FD_form_main * fd_form_main variable is dead.
7411 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7413 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7415 * src/table.h: add the LOstream.h header
7416 * src/debug.h: ditto
7418 * src/LyXAction.h: change the explaination of the ReadOnly
7419 attribute: is indicates that the function _can_ be used.
7421 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7424 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7426 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7432 * src/paragraph.C (GetWord): assert on pos>=0
7435 * src/support/lyxstring.C: condition the use of an invariant on
7437 * src/support/lyxstring.h: ditto
7439 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7440 Use LAssert.h instead of plain assert().
7442 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7444 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7445 * src/support/filetools.C: ditto
7447 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7450 * INSTALL: document the new configure flags
7452 * configure.in: suppress --with-debug; add --enable-assertions
7454 * acinclude.m4: various changes in alignment of help strings.
7456 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7458 * src/kbmap.C: commented out the use of the hash map in kb_map,
7459 beginning of movement to a stl::container.
7461 * several files: removed code that was not in effect when
7462 MOVE_TEXT was defined.
7464 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7465 for escaping should not be used. We can discuss if the string
7466 should be enclosed in f.ex. [] instead of "".
7468 * src/trans_mgr.C (insert): use the new returned value from
7469 encodeString to get deadkeys and keymaps done correctly.
7471 * src/chset.C (encodeString): changed to return a pair, to tell
7472 what to use if we know the string.
7474 * src/lyxscreen.h (fillArc): new function.
7476 * src/FontInfo.C (resize): rewritten to use more std::string like
7477 structore, especially string::replace.
7479 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7482 * configure.in (chmod +x some scripts): remove config/gcc-hack
7484 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7486 * src/buffer.C (writeFile): change once again the top comment in a
7487 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7488 instead of an hardcoded version number.
7489 (makeDocBookFile): ditto
7491 * src/version.h: add new define LYX_DOCVERSION
7493 * po/de.po: update from Pit Sütterlin
7494 * lib/bind/de_menus.bind: ditto.
7496 * src/lyxfunc.C (Dispatch): call MenuExport()
7497 * src/buffer.C (Dispatch): ditto
7499 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7500 LyXFunc::Dispatch().
7501 (MenuExport): new function, moved from
7502 LyXFunc::Dispatch().
7504 * src/trans_mgr.C (insert): small cleanup
7505 * src/chset.C (loadFile): ditto
7507 * lib/kbd/iso8859-1.cdef: add missing backslashes
7509 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7511 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7512 help with placing the manually drawn accents better.
7514 (Draw): x2 and hg changed to float to minimize rounding errors and
7515 help place the accents better.
7517 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7518 unsigned short to char is just wrong...cast the char to unsigned
7519 char instead so that the two values can compare sanely. This
7520 should also make the display of insetlatexaccents better and
7521 perhaps also some other insets.
7523 (lbearing): new function
7526 1999-12-15 Allan Rae <rae@lyx.org>
7528 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7529 header that provides a wrapper around the very annoying SGI STL header
7532 * src/support/lyxstring.C, src/LString.h:
7533 removed old SGI-STL-compatability attempts.
7535 * configure.in: Use LYX_STL_STRING_FWD.
7537 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7538 stl_string_fwd.h is around and try to determine it's location.
7539 Major improvement over previous SGI STL 3.2 compatability.
7540 Three small problems remain with this function due to my zero
7541 knowledge of autoconf. JMarc and lgb see the comments in the code.
7543 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7545 * src/broken_const.h, config/hack-gcc, config/README: removed
7547 * configure.in: remove --with-gcc-hack option; do not call
7550 * INSTALL: remove documentation of --with-broken-const and
7553 * acconfig.h: remove all trace of BROKEN_CONST define
7555 * src/buffer.C (makeDocBookFile): update version number in output
7557 (SimpleDocBookOnePar): fix an assert when trying to a character
7558 access beyond string length
7561 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7563 * po/de.po: fix the Export menu
7565 * lyx.man: update the description of -dbg
7567 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7568 (commandLineHelp): updated
7569 (easyParse): show list of available debug levels if -dbg is passed
7572 * src/Makefile.am: add debug.C
7574 * src/debug.h: moved some code to debug.C
7576 * src/debug.C: new file. Contains code to set and show debug
7579 * src/layout.C: remove 'break' after 'continue' in switch
7580 statements, since these cannot be reached.
7582 1999-12-13 Allan Rae <rae@lyx.org>
7584 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7585 (in_word_set): hash() -> math_hash()
7587 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7589 * acconfig.h: Added a test for whether we are using exceptions in the
7590 current compilation run. If so USING_EXCEPTIONS is defined.
7592 * config.in: Check for existance of stl_string_fwd.h
7593 * src/LString.h: If compiling --with-included-string and SGI's
7594 STL version 3.2 is present (see above test) we need to block their
7595 forward declaration of string and supply a __get_c_string().
7596 However, it turns out this is only necessary if compiling with
7597 exceptions enabled so I've a bit more to add yet.
7599 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7600 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7601 src/support/LRegex.h, src/undo.h:
7602 Shuffle the order of the included files a little to ensure that
7603 LString.h gets included before anything that includes stl_string_fwd.h
7605 * src/support/lyxstring.C: We need to #include LString.h instead of
7606 lyxstring.h to get the necessary definition of __get_c_string.
7607 (__get_c_string): New function. This is defined static just like SGI's
7608 although why they need to do this I'm not sure. Perhaps it should be
7609 in lstrings.C instead.
7611 * lib/templates/IEEEtran.lyx: New template file.
7613 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7615 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7616 * intl/Makefile.in (MKINSTALLDIRS): ditto
7618 * src/LyXAction.C (init): changed to hold the LFUN data in a
7619 automatic array in stead of in callso to newFunc, this speeds up
7620 compilation a lot. Also all the memory used by the array is
7621 returned when the init is completed.
7623 * a lot of files: compiled with -Wold-style-cast, changed most of
7624 the reported offenders to C++ style casts. Did not change the
7625 offenders in C files.
7627 * src/trans.h (Match): change argument type to unsigned int.
7629 * src/support/DebugStream.C: fix some types on the streambufs so
7630 that it works on a conforming implementation.
7632 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7634 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7636 * src/support/lyxstring.C: remove the inline added earlier since
7637 they cause a bunch of unsatisfied symbols when linking with dec
7638 cxx. Cxx likes to have the body of inlines at the place where they
7641 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7642 accessing negative bounds in array. This fixes the crash when
7643 inserting accented characters.
7644 * src/trans.h (Match): ditto
7646 * src/buffer.C (Dispatch): since this is a void, it should not try
7647 to return anything...
7649 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7651 * src/buffer.h: removed the two friends from Buffer. Some changes
7652 because of this. Buffer::getFileName and Buffer::setFileName
7653 renamed to Buffer::fileName() and Buffer::fileName(...).
7655 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7657 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7658 and Buffer::update(short) to BufferView. This move is currently
7659 controlled by a define MOVE_TEXT, this will be removed when all
7660 shows to be ok. This move paves the way for better separation
7661 between buffer contents and buffer view. One side effect is that
7662 the BufferView needs a rebreak when swiching buffers, if we want
7663 to avoid this we can add a cache that holds pointers to LyXText's
7664 that is not currently in use.
7666 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7669 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7671 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7673 * lyx_main.C: new command line option -x (or --execute) and
7674 -e (or --export). Now direct conversion from .lyx to .tex
7675 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7676 Unfortunately, X is still needed and the GUI pops up during the
7679 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7681 * src/Spacing.C: add a using directive to bring stream stuff into
7683 * src/paragraph.C: ditto
7684 * src/buffer.C: ditto
7686 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7687 from Lars' announcement).
7689 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7690 example files from Tino Meinen.
7692 1999-12-06 Allan Rae <rae@lyx.org>
7694 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7696 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7698 * src/support/lyxstring.C: added a lot of inline for no good
7701 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7702 latexWriteEndChanges, they were not used.
7704 * src/layout.h (operator<<): output operator for PageSides
7706 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7708 * some example files: loaded in LyX 1.0.4 and saved again to update
7709 certain constructs (table format)
7711 * a lot of files: did the change to use fstream/iostream for all
7712 writing of files. Done with a close look at Andre Poenitz's patch.
7714 * some files: whitespace changes.
7716 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7718 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7719 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7720 architecture, we provide our own. It is used unconditionnally, but
7721 I do not think this is a performance problem. Thanks to Angus
7722 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7723 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7725 (GetInset): use my_memcpy.
7729 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7730 it is easier to understand, but it uses less TeX-only constructs now.
7732 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7733 elements contain spaces
7735 * lib/configure: regenerated
7737 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7738 elements contain spaces; display the list of programs that are
7741 * autogen.sh: make sure lib/configure is executable
7743 * lib/examples/*: rename the tutorial examples to begin with the
7744 two-letters language code.
7746 * src/lyxfunc.C (getStatus): do not query current font if no
7749 * src/lyx_cb.C (RunScript): use QuoteName
7750 (MenuRunDvips): ditto
7751 (PrintApplyCB): ditto
7753 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7754 around argument, so that it works well with the current shell.
7755 Does not work properly with OS/2 shells currently.
7757 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7758 * src/LyXSendto.C (SendtoApplyCB): ditto
7759 * src/lyxfunc.C (Dispatch): ditto
7760 * src/buffer.C (runLaTeX): ditto
7761 (runLiterate): ditto
7762 (buildProgram): ditto
7764 * src/lyx_cb.C (RunScript): ditto
7765 (MenuMakeLaTeX): ditto
7767 * src/buffer.h (getLatexName): new method
7769 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7771 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7773 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7774 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7775 (create_math_panel): ditto
7777 * src/lyxfunc.C (getStatus): re-activate the code which gets
7778 current font and cursor; add test for export to html.
7780 * src/lyxrc.C (read): remove unreachable break statements; add a
7783 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7785 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7787 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7788 introduced by faulty regex.
7789 * src/buffer.C: ditto
7790 * src/lastfiles.C: ditto
7791 * src/paragraph.C: ditto
7792 * src/table.C: ditto
7793 * src/vspace.C: ditto
7794 * src/insets/figinset.C: ditto
7795 Note: most of these is absolutely harmless, except the one in
7796 src/mathed formula.C.
7798 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7800 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7801 operation, yielding correct results for the reLyX command.
7803 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7805 * src/support/filetools.C (ExpandPath): removed an over eager
7807 (ReplaceEnvironmentPath): ditto
7809 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7810 shows that we are doing something fishy in our code...
7814 * src/lyxrc.C (read): use a double switch trick to get more help
7815 from the compiler. (the same trick is used in layout.C)
7816 (write): new function. opens a ofstream and pass that to output
7817 (output): new function, takes a ostream and writes the lyxrc
7818 elemts to it. uses a dummy switch to make sure no elements are
7821 * src/lyxlex.h: added a struct pushpophelper for use in functions
7822 with more than one exit point.
7824 * src/lyxlex.[Ch] (GetInteger): made it const
7828 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7830 * src/layout.[hC] : LayoutTags splitted into several enums, new
7831 methods created, better error handling cleaner use of lyxlex. Read
7834 * src/bmtable.[Ch]: change some member prototypes because of the
7835 image const changes.
7837 * commandtags.h, src/LyXAction.C (init): new function:
7838 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7839 This file is not read automatically but you can add \input
7840 preferences to your lyxrc if you want to. We need to discuss how
7843 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7844 in .aux, also remove .bib and .bst files from dependencies when
7847 * src/BufferView.C, src/LyXView.C: add const_cast several places
7848 because of changes to images.
7850 * lib/images/*: same change as for images/*
7852 * lib/lyxrc.example: Default for accept_compound is false not no.
7854 * images/*: changed to be const, however I have som misgivings
7855 about this change so it might be changed back.
7857 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7859 * lib/configure, po/POTFILES.in: regenerated
7861 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7863 * config/lib_configure.m4: removed
7865 * lib/configure.m4: new file (was config/lib_configure.m4)
7867 * configure.in: do not test for rtti, since we do not use it.
7869 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7871 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7872 doubling of allocated space scheme. This makes it faster for large
7873 strings end to use less memory for small strings. xtra rememoved.
7875 * src/insets/figinset.C (waitalarm): commented out.
7876 (GhostscriptMsg): use static_cast
7877 (GhostscriptMsg): use new instead of malloc to allocate memory for
7878 cmap. also delete the memory after use.
7880 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7882 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7883 for changes in bibtex database or style.
7884 (runBibTeX): remove all .bib and .bst files from dep before we
7886 (run): use scanAuc in when dep file already exist.
7888 * src/DepTable.C (remove_files_with_extension): new method
7891 * src/DepTable.[Ch]: made many of the methods const.
7893 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7895 * src/bufferparams.C: make sure that the default textclass is
7896 "article". It used to be the first one by description order, but
7897 now the first one is "docbook".
7899 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7900 string; call Debug::value.
7901 (easyParse): pass complete argument to setDebuggingLevel().
7903 * src/debug.h (value): fix the code that parses debug levels.
7905 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7908 * src/LyXAction.C: use Debug::ACTION as debug channel.
7910 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7912 * NEWS: updated for the future 1.1.3 release.
7914 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7915 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7916 it should. This is of course a controversial change (since many
7917 people will find that their lyx workscreen is suddenly full of
7918 red), but done for the sake of correctness.
7920 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7921 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7923 * src/insets/inseterror.h, src/insets/inseturl.h,
7924 src/insets/insetinfo.h, src/insets/figinset.h,
7925 src/mathed/formulamacro.h, src/mathed/math_macro.h
7926 (EditMessage): add a missing const and add _() to make sure that
7929 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7930 src/insets/insetbib.C, src/support/filetools.C: add `using'
7933 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7934 doing 'Insert index of last word' at the beginning of a paragraph.
7936 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * several files: white-space changes.
7940 * src/mathed/formula.C: removed IsAlpha and IsDigit
7942 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7943 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7946 * src/insets/figinset.C (GetPSSizes): don't break when
7947 "EndComments" is seen. But break when a boundingbox is read.
7949 * all classes inherited from Inset: return value of Clone
7950 changed back to Inset *.
7952 * all classes inherited form MathInset: return value of Clone
7953 changed back to MathedInset *.
7955 * src/insets/figinset.C (runqueue): use a ofstream to output the
7956 gs/ps file. Might need some setpresicion or setw. However I can
7957 see no problem with the current code.
7958 (runqueue): use sleep instead of the alarm/signal code. I just
7959 can't see the difference.
7961 * src/paragraph.C (LyXParagraph): reserve space in the new
7962 paragraph and resize the inserted paragraph to just fit.
7964 * src/lyxfunc.h (operator|=): added operator for func_status.
7966 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7967 check for readable file.
7969 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7970 check for readable file.
7971 (MenuMakeLinuxDoc): ditto
7972 (MenuMakeDocBook): ditto
7973 (MenuMakeAscii): ditto
7974 (InsertAsciiFile): split the test for openable and readable
7976 * src/bmtable.C (draw_bitmaptable): use
7977 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7979 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7980 findtexfile from LaTeX to filetools.
7982 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7983 instead of FilePtr. Needs to be verified by a literate user.
7985 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7987 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7988 (EditMessage): likewise.
7990 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7991 respectively as \textasciitilde and \textasciicircum.
7993 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7995 * src/support/lyxstring.h: made the methods that take iterators
7998 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7999 (regexMatch): made is use the real regex class.
8001 * src/support/Makefile.am: changed to use libtool
8003 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8005 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8007 (MathIsInset ++): changed several macros to be inline functions
8010 * src/mathed/Makefile.am: changed to use libtool
8012 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8014 * src/insets/inset* : Clone changed to const and return type is
8015 the true insettype not just Inset*.
8017 * src/insets/Makefile.am: changed to use libtool
8019 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8021 * src/undo.[Ch] : added empty() and changed some of the method
8024 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8026 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8027 setID use block<> for the bullets array, added const several places.
8029 * src/lyxfunc.C (getStatus): new function
8031 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8032 LyXAction, added const to several funtions.
8034 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8035 a std::map, and to store the dir items in a vector.
8037 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8040 * src/LyXView.[Ch] + other files : changed currentView to view.
8042 * src/LyXAction.[Ch] : ported from the old devel branch.
8044 * src/.cvsignore: added .libs and a.out
8046 * configure.in : changes to use libtool.
8048 * acinclude.m4 : inserted libtool.m4
8050 * .cvsignore: added libtool
8052 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8054 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8055 file name in insets and mathed directories (otherwise the
8056 dependency is not taken in account under cygwin).
8058 * src/text2.C (InsertString[AB]): make sure that we do not try to
8059 read characters past the string length.
8061 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8063 * lib/doc/LaTeXConfig.lyx.in,
8064 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8066 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8067 file saying who created them and when this heppened; this is
8068 useless and annoys tools like cvs.
8070 * lib/layouts/g-brief-{en,de}.layout,
8071 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8072 from Thomas Hartkens <thomas@hartkens.de>.
8074 * src/{insets,mathed}/Makefile.am: do not declare an empty
8075 LDFLAGS, so that it can be set at configure time (useful on Irix
8078 * lib/reLyX/configure.in: make sure that the prefix is set
8079 correctly in LYX_DIR.
8081 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8083 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8084 be used by 'command-sequence' this allows to bind a key to a
8085 sequence of LyX-commands
8086 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8088 * src/LyXAction.C: add "command-sequence"
8090 * src/LyXFunction.C: handling of "command-sequence"
8092 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8093 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8095 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8097 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8099 * src/buffer.C (writeFile): Do not output a comment giving user
8100 and date at the beginning of a .lyx file. This is useless and
8101 annoys cvs anyway; update version number to 1.1.
8103 * src/Makefile.am (LYX_DIR): add this definition, so that a
8104 default path is hardcoded in LyX.
8106 * configure.in: Use LYX_GNU_GETTEXT.
8108 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8109 AM_GNU_GETTEXT with a bug fixed.
8111 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8113 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8115 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8116 which is used to point to LyX data is now LYX_DIR_11x.
8118 * lyx.man: convert to a unix text file; small updates.
8120 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8122 * src/support/LSubstring.[Ch]: made the second arg of most of the
8123 constructors be a const reference.
8125 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8128 * src/support/lyxstring.[Ch] (swap): added missing member function
8129 and specialization of swap(str, str);
8131 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8133 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8134 trace of the old one.
8136 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8137 put the member definitions in undo.C.
8139 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8140 NEW_TEXT and have now only code that was included when this was
8143 * src/intl.C (LCombo): use static_cast
8145 (DispatchCallback): ditto
8147 * src/definitions.h: removed whole file
8149 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8151 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8152 parsing and stores in a std:map. a regex defines the file format.
8153 removed unneeded members.
8155 * src/bufferparams.h: added several enums from definitions.h here.
8156 Removed unsused destructor. Changed some types to use proper enum
8157 types. use block to have the temp_bullets and user_defined_bullets
8158 and to make the whole class assignable.
8160 * src/bufferparams.C (Copy): removed this functions, use a default
8163 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8166 * src/buffer.C (readLyXformat2): commend out all that have with
8167 oldpapersize to do. also comment out all that hve to do with
8168 insetlatex and insetlatexdel.
8169 (setOldPaperStuff): commented out
8171 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8173 * src/LyXAction.C: remove use of inset-latex-insert
8175 * src/mathed/math_panel.C (button_cb): use static_cast
8177 * src/insets/Makefile.am (insets_o_SOURCES): removed
8180 * src/support/lyxstring.C (helper): use the unsigned long
8181 specifier, UL, instead of a static_cast.
8183 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8185 * src/support/block.h: new file. to be used as a c-style array in
8186 classes, so that the class can be assignable.
8188 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8190 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8191 NULL, make sure to return an empty string (it is not possible to
8192 set a string to NULL).
8194 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8196 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8198 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8200 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8201 link line, so that Irix users (for example) can set it explicitely to
8204 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8205 it can be overidden at make time (static or dynamic link, for
8208 * src/vc-backend.C, src/LaTeXFeatures.h,
8209 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8210 statements to bring templates to global namespace.
8212 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8214 * src/support/lyxstring.C (operator[] const): make it standard
8217 * src/minibuffer.C (Init): changed to reflect that more
8218 information is given from the lyxvc and need not be provided here.
8220 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8222 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8224 * src/LyXView.C (UpdateTimerCB): use static_cast
8225 (KeyPressMask_raw_callback): ditto
8227 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8228 buffer_, a lot of changes because of this. currentBuffer() ->
8229 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8230 also changes to other files because of this.
8232 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8234 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8235 have no support for RCS and partial support for CVS, will be
8238 * src/insets/ several files: changes because of function name
8239 changes in Bufferview and LyXView.
8241 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8243 * src/support/LSubstring.[Ch]: new files. These implement a
8244 Substring that can be very convenient to use. i.e. is this
8246 string a = "Mary had a little sheep";
8247 Substring(a, "sheep") = "lamb";
8248 a is now "Mary has a little lamb".
8250 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8251 out patterns and subpatterns of strings. It is used by LSubstring
8252 and also by vc-backend.C
8254 * src/support/lyxstring.C: went over all the assertions used and
8255 tried to correct the wrong ones and flag which of them is required
8256 by the standard. some bugs found because of this. Also removed a
8257 couple of assertions.
8259 * src/support/Makefile.am (libsupport_a_SOURCES): added
8260 LSubstring.[Ch] and LRegex.[Ch]
8262 * src/support/FileInfo.h: have struct stat buf as an object and
8263 not a pointer to one, some changes because of this.
8265 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8266 information in layout when adding the layouts preamble to the
8269 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8272 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8273 because of bug in OS/2.
8275 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8277 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8278 \verbatim@font instead of \ttfamily, so that it can be redefined.
8280 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8281 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8282 src/layout.h, src/text2.C: add 'using' directive to bring the
8283 STL templates we need from the std:: namespace to the global one.
8284 Needed by DEC cxx in strict ansi mode.
8286 * src/support/LIstream.h,src/support/LOstream.h,
8287 src/support/lyxstring.h,src/table.h,
8288 src/lyxlookup.h: do not include <config.h> in header
8289 files. This should be done in the .C files only.
8291 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8295 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8297 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8298 from Kayvan to fix the tth invokation.
8300 * development/lyx.spec.in: updates from Kayvan to reflect the
8301 changes of file names.
8303 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/text2.C (InsertStringB): use std::copy
8306 (InsertStringA): use std::copy
8308 * src/bufferlist.C: use a vector to store the buffers in. This is
8309 an internal change and should not affect any other thing.
8311 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8314 * src/text.C (Fill): fix potential bug, one off bug.
8316 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/Makefile.am (lyx_main.o): add more files it depends on.
8320 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8322 * src/support/lyxstring.C: use size_t for the reference count,
8323 size, reserved memory and xtra.
8324 (internal_compare): new private member function. Now the compare
8325 functions should work for std::strings that have embedded '\0'
8327 (compare): all compare functions rewritten to use
8330 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8332 * src/support/lyxstring.C (compare): pass c_str()
8333 (compare): pass c_str
8334 (compare): pass c_str
8336 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8338 * src/support/DebugStream.C: <config.h> was not included correctly.
8340 * lib/configure: forgot to re-generate it :( I'll make this file
8341 auto generated soon.
8343 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8345 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8348 * src/support/lyxstring.C: some changes from length() to rep->sz.
8349 avoids a function call.
8351 * src/support/filetools.C (SpaceLess): yet another version of the
8352 algorithm...now per Jean-Marc's suggestions.
8354 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8356 * src/layout.C (less_textclass_desc): functor for use in sorting
8358 (LyXTextClass::Read): sort the textclasses after reading.
8360 * src/support/filetools.C (SpaceLess): new version of the
8361 SpaceLess functions. What problems does this one give? Please
8364 * images/banner_bw.xbm: made the arrays unsigned char *
8366 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8368 * src/support/lyxstring.C (find): remove bogus assertion in the
8369 two versions of find where this has not been done yet.
8371 * src/support/lyxlib.h: add missing int return type to
8374 * src/menus.C (ShowFileMenu): disable exporting to html if no
8375 html export command is present.
8377 * config/lib_configure.m4: add a test for an HTML converter. The
8378 programs checked for are, in this order: tth, latex2html and
8381 * lib/configure: generated from config/lib_configure.m4.
8383 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8384 html converter. The parameters are now passed through $$FName and
8385 $$OutName, instead of standard input/output.
8387 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8389 * lib/lyxrc.example: update description of \html_command.
8390 add "quotes" around \screen_font_xxx font setting examples to help
8391 people who use fonts with spaces in their names.
8393 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8395 * Distribution files: updates for v1.1.2
8397 * src/support/lyxstring.C (find): remove bogus assert and return
8398 npos for the same condition.
8400 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * added patch for OS/2 from SMiyata.
8404 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8406 * src/text2.C (CutSelection): make space_wrapped a bool
8407 (CutSelection): dont declare int i until we have to.
8408 (alphaCounter): return a char const *.
8410 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8412 * src/support/syscall.C (Systemcalls::kill):
8413 src/support/filetools.C (PutEnv, PutEnvPath):
8414 src/lyx_cb.C (addNewlineAndDepth):
8415 src/FontInfo.C (FontInfo::resize): condition some #warning
8416 directives with WITH_WARNINGS.
8419 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8421 * src/layout.[Ch] + several files: access to class variables
8422 limited and made accessor functions instead a lot of code changed
8423 becuase of this. Also instead of returning pointers often a const
8424 reference is returned instead.
8426 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8428 * src/Makefile.am (dist-hook): added used to remove the CVS from
8429 cheaders upon creating a dist
8430 (EXTRA_DIST): added cheaders
8432 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8433 a character not as a small integer.
8435 * src/support/lyxstring.C (find): removed Assert and added i >=
8436 rep->sz to the first if.
8438 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8440 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8441 src/LyXView.C src/buffer.C src/bufferparams.C
8442 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8443 src/text2.C src/insets/insetinclude.C:
8444 lyxlayout renamed to textclasslist.
8446 * src/layout.C: some lyxerr changes.
8448 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8449 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8450 (LyXLayoutList): removed all traces of this class.
8451 (LyXTextClass::Read): rewrote LT_STYLE
8452 (LyXTextClass::hasLayout): new function
8453 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8454 both const and nonconst version.
8455 (LyXTextClass::delete_layout): new function.
8456 (LyXTextClassList::Style): bug fix. do the right thing if layout
8458 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8459 (LyXTextClassList::NameOfLayout): ditto
8460 (LyXTextClassList::Load): ditto
8462 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8464 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8466 * src/LyXAction.C (LookupFunc): added a workaround for sun
8467 compiler, on the other hand...we don't know if the current code
8468 compiles on sun at all...
8470 * src/support/filetools.C (CleanupPath): subst fix
8472 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8475 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8476 complained about this one?
8478 * src/insets/insetinclude.C (Latex): subst fix
8480 * src/insets/insetbib.C (getKeys): subst fix
8482 * src/LyXSendto.C (SendtoApplyCB): subst fix
8484 * src/lyx_main.C (init): subst fix
8486 * src/layout.C (Read): subst fix
8488 * src/lyx_sendfax_main.C (button_send): subst fix
8490 * src/buffer.C (RoffAsciiTable): subst fix
8492 * src/lyx_cb.C (MenuFax): subst fix
8493 (PrintApplyCB): subst fix
8495 1999-10-26 Juergen Vigna <jug@sad.it>
8497 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8499 (Read): Cleaned up this code so now we read only format vestion >= 5
8501 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8504 come nobody has complained about this one?
8506 * src/insets/insetinclude.C (Latex): subst fix
8508 * src/insets/insetbib.C (getKeys): subst fix
8510 * src/lyx_main.C (init): subst fix
8512 * src/layout.C (Read): subst fix
8514 * src/buffer.C (RoffAsciiTable): subst fix
8516 * src/lyx_cb.C (MenuFax): subst fix.
8518 * src/layout.[hC] + some other files: rewrote to use
8519 std::container to store textclasses and layouts in.
8520 Simplified, removed a lot of code. Make all classes
8521 assignable. Further simplifications and review of type
8522 use still to be one.
8524 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8525 lastfiles to create the lastfiles partr of the menu.
8527 * src/lastfiles.[Ch]: rewritten to use deque to store the
8528 lastfiles in. Uses fstream for reading and writing. Simplifies
8531 * src/support/syscall.C: remove explicit cast.
8533 * src/BufferView.C (CursorToggleCB): removed code snippets that
8535 use explicat C++ style casts instead of C style casts. also use
8536 u_vdata instea of passing pointers in longs.
8538 * src/PaperLayout.C: removed code snippets that were commented out.
8540 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8542 * src/lyx_main.C: removed code snippets that wer commented out.
8544 * src/paragraph.C: removed code snippets that were commented out.
8546 * src/lyxvc.C (logClose): use static_cast
8548 (viewLog): remove explicit cast to void*
8549 (showLog): removed old commented code
8551 * src/menus.C: use static_cast instead of C style casts. use
8552 u_vdata instead of u_ldata. remove explicit cast to (long) for
8553 pointers. Removed old code that was commented out.
8555 * src/insets/inset.C: removed old commented func
8557 * src/insets/insetref.C (InsetRef): removed old code that had been
8558 commented out for a long time.
8560 (escape): removed C style cast
8562 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8564 * src/insets/insetlatex.C (Draw): removed old commented code
8565 (Read): rewritten to use string
8567 * src/insets/insetlabel.C (escape): removed C style cast
8569 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8571 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8574 * src/insets/insetinclude.h: removed a couple of stupid bools
8576 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8577 (Clone): remove C style cast
8578 (getKeys): changed list to lst because of std::list
8580 * src/insets/inseterror.C (Draw): removed som old commented code.
8582 * src/insets/insetcommand.C (Draw): removed some old commented code.
8584 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8585 commented out forever.
8586 (bibitem_cb): use static_cast instead of C style cast
8587 use of vdata changed to u_vdata.
8589 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8591 (CloseUrlCB): use static_cast instead of C style cast.
8592 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8594 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8595 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8596 (CloseInfoCB): static_cast from ob->u_vdata instead.
8597 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8600 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8601 (C_InsetError_CloseErrorCB): forward the ob parameter
8602 (CloseErrorCB): static_cast from ob->u_vdata instead.
8604 * src/vspace.h: include LString.h since we use string in this class.
8606 * src/vspace.C (lyx_advance): changed name from advance because of
8607 nameclash with stl. And since we cannot use namespaces yet...I
8608 used a lyx_ prefix instead. Expect this to change when we begin
8611 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8613 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8614 and removed now defunct constructor and deconstructor.
8616 * src/BufferView.h: have backstack as a object not as a pointer.
8617 removed initialization from constructor. added include for BackStack
8619 * development/lyx.spec.in (%build): add CFLAGS also.
8621 * src/screen.C (drawFrame): removed another warning.
8623 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8625 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8626 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8627 README and ANNOUNCE a bit for the next release. More work is
8630 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8631 unbreakable if we are in freespacing mode (LyX-Code), but not in
8634 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8636 * src/BackStack.h: fixed initialization order in constructor
8638 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8640 * acinclude.m4 (VERSION): new rules for when a version is
8641 development, added also a variable for prerelease.
8642 (warnings): we set with_warnings=yes for prereleases
8643 (lyx_opt): prereleases compile with same optimization as development
8644 (CXXFLAGS): only use pedantic if we are a development version
8646 * src/BufferView.C (restorePosition): don't do anything if the
8649 * src/BackStack.h: added member empty, use this to test if there
8650 is anything to pop...
8652 1999-10-25 Juergen Vigna <jug@sad.it>
8655 * forms/layout_forms.fd +
8656 * forms/latexoptions.fd +
8657 * lyx.fd: changed for various form resize issues
8659 * src/mathed/math_panel.C +
8660 * src/insets/inseterror.C +
8661 * src/insets/insetinfo.C +
8662 * src/insets/inseturl.C +
8663 * src/insets/inseturl.h +
8666 * src/PaperLayout.C +
8667 * src/ParagraphExtra.C +
8668 * src/TableLayout.C +
8670 * src/layout_forms.C +
8677 * src/menus.C: fixed various resize issues. So now forms can be
8678 resized savely or not be resized at all.
8680 * forms/form_url.fd +
8681 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8684 * src/insets/Makefile.am: added files form_url.[Ch]
8686 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8688 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8689 (and presumably 6.2).
8691 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8692 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8693 remaining static member callbacks.
8695 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8698 * src/support/lyxstring.h: declare struct Srep as friend of
8699 lyxstring, since DEC cxx complains otherwise.
8701 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8703 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/LaTeX.C (run): made run_bibtex also depend on files with
8707 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8708 are put into the dependency file.
8710 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8711 the code has shown itself to work
8712 (create_ispell_pipe): removed another warning, added a comment
8715 * src/minibuffer.C (ExecutingCB): removed code that has been
8716 commented out a long time
8718 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8719 out code + a warning.
8721 * src/support/lyxstring.h: comment out the three private
8722 operators, when compiling with string ansi conforming compilers
8725 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8727 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8728 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8731 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8734 * src/mathed/math_panel.C (create_math_panel): remove explicit
8737 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8740 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8741 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8742 to XCreatePixmapFromBitmapData
8743 (fl_set_bmtable_data): change the last argument to be unsigned
8745 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8746 and bh to be unsigned int, remove explicit casts in call to
8747 XReadBitmapFileData.
8749 * images/arrows.xbm: made the arrays unsigned char *
8750 * images/varsz.xbm: ditto
8751 * images/misc.xbm: ditto
8752 * images/greek.xbm: ditto
8753 * images/dots.xbm: ditto
8754 * images/brel.xbm: ditto
8755 * images/bop.xbm: ditto
8757 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8759 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8760 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8761 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8763 (LYX_CXX_CHEADERS): added <clocale> to the test.
8765 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8767 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8769 * src/support/lyxstring.C (append): fixed something that must be a
8770 bug, rep->assign was used instead of rep->append.
8772 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8775 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8776 lyx insert double chars. Fix spotted by Kayvan.
8778 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8780 * Fixed the tth support. I messed up with the Emacs patch apply feature
8781 and omitted the changes in lyxrc.C.
8783 1999-10-22 Juergen Vigna <jug@sad.it>
8785 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8787 * src/lyx_cb.C (MenuInsertRef) +
8788 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8789 the form cannot be resized under it limits (fixes a segfault)
8791 * src/lyx.C (create_form_form_ref) +
8792 * forms/lyx.fd: Changed Gravity on name input field so that it is
8795 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8797 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8798 <ostream> and <istream>.
8800 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8801 whether <fstream> provides the latest standard features, or if we
8802 have an oldstyle library (like in egcs).
8803 (LYX_CXX_STL_STRING): fix the test.
8805 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8806 code on MODERN_STL_STREAM.
8808 * src/support/lyxstring.h: use L{I,O}stream.h.
8810 * src/support/L{I,O}stream.h: new files, designed to setup
8811 correctly streams for our use
8812 - includes the right header depending on STL capabilities
8813 - puts std::ostream and std::endl (for LOStream.h) or
8814 std::istream (LIStream.h) in toplevel namespace.
8816 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8819 was a bib file that had been changed we ensure that bibtex is run.
8820 (runBibTeX): enhanced to extract the names of the bib files and
8821 getting their absolute path and enter them into the dep file.
8822 (findtexfile): static func that is used to look for tex-files,
8823 checks for absolute patchs and tries also with kpsewhich.
8824 Alternative ways of finding the correct files are wanted. Will
8826 (do_popen): function that runs a command using popen and returns
8827 the whole output of that command in a string. Should be moved to
8830 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8831 file with extension ext has changed.
8833 * src/insets/figinset.C: added ifdef guards around the fl_free
8834 code that jug commented out. Now it is commented out when
8835 compiling with XForms == 0.89.
8837 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8838 to lyxstring.C, and only keep a forward declaration in
8839 lyxstring.h. Simplifies the header file a bit and should help a
8840 bit on compile time too. Also changes to Srep will not mandate a
8841 recompile of code just using string.
8842 (~lyxstring): definition moved here since it uses srep.
8843 (size): definition moved here since it uses srep.
8845 * src/support/lyxstring.h: removed a couple of "inline" that should
8848 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8850 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8853 1999-10-21 Juergen Vigna <jug@sad.it>
8855 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8856 set to left if I just remove the width entry (or it is empty).
8858 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8859 paragraph when having dummy paragraphs.
8861 1999-10-20 Juergen Vigna <jug@sad.it>
8863 * src/insets/figinset.C: just commented some fl_free_form calls
8864 and added warnings so that this calls should be activated later
8865 again. This avoids for now a segfault, but we have a memory leak!
8867 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8868 'const char * argument' to 'string argument', this should
8869 fix some Asserts() in lyxstring.C.
8871 * src/lyxfunc.h: Removed the function argAsString(const char *)
8872 as it is not used anymore.
8874 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8876 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8879 * src/Literate.h: some funcs moved from public to private to make
8880 interface clearer. Unneeded args removed.
8882 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8884 (scanBuildLogFile): ditto
8886 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8887 normal TeX Error. Still room for improvement.
8889 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8891 * src/buffer.C (insertErrors): changes to make the error
8892 desctription show properly.
8894 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8897 * src/support/lyxstring.C (helper): changed to use
8898 sizeof(object->rep->ref).
8899 (operator>>): changed to use a pointer instead.
8901 * src/support/lyxstring.h: changed const reference & to value_type
8902 const & lets see if that helps.
8904 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8906 * Makefile.am (rpmdist): fixed to have non static package and
8909 * src/support/lyxstring.C: removed the compilation guards
8911 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8914 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8915 conditional compile of lyxstring.Ch
8917 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8918 stupid check, but it is a lot better than the bastring hack.
8919 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8921 * several files: changed string::erase into string::clear. Not
8924 * src/chset.C (encodeString): use a char temporary instead
8926 * src/table.C (TexEndOfCell): added tostr around
8927 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8928 (TexEndOfCell): ditto
8929 (TexEndOfCell): ditto
8930 (TexEndOfCell): ditto
8931 (DocBookEndOfCell): ditto
8932 (DocBookEndOfCell): ditto
8933 (DocBookEndOfCell): ditto
8934 (DocBookEndOfCell): ditto
8936 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8938 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8940 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8941 (MenuBuildProg): added tostr around ret
8942 (MenuRunChktex): added tostr around ret
8943 (DocumentApplyCB): added tostr around ret
8945 * src/chset.C (encodeString): added tostr around t->ic
8947 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8948 (makeLaTeXFile): added tostr around tocdepth
8949 (makeLaTeXFile): added tostr around ftcound - 1
8951 * src/insets/insetbib.C (setCounter): added tostr around counter.
8953 * src/support/lyxstring.h: added an operator+=(int) to catch more
8956 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8957 (lyxstring): We DON'T allow NULL pointers.
8959 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8961 * src/mathed/math_macro.C (MathMacroArgument::Write,
8962 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8963 when writing them out.
8965 * src/LString.C: remove, since it is not used anymore.
8967 * src/support/lyxstring.C: condition the content to
8968 USE_INCLUDED_STRING macro.
8970 * src/mathed/math_symbols.C, src/support/lstrings.C,
8971 src/support/lyxstring.C: add `using' directive to specify what
8972 we need in <algorithm>. I do not think that we need to
8973 conditionalize this, but any thought is appreciated.
8975 * many files: change all callback functions to "C" linkage
8976 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8977 strict_ansi. Those who were static are now global.
8978 The case of callbacks which are static class members is
8979 trickier, since we have to make C wrappers around them (see
8980 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8981 did not finish this yet, since it defeats the purpose of
8982 encapsulation, and I am not sure what the best route is.
8984 1999-10-19 Juergen Vigna <jug@sad.it>
8986 * src/support/lyxstring.C (lyxstring): we permit to have a null
8987 pointer as assignment value and just don't assign it.
8989 * src/vspace.C (nextToken): corrected this function substituting
8990 find_first(_not)_of with find_last_of.
8992 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8993 (TableOptCloseCB) (TableSpeCloseCB):
8994 inserted fl_set_focus call for problem with fl_hide_form() in
8997 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9002 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9004 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9005 LyXLex::next() and not eatline() to get its argument.
9007 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9009 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9010 instead, use fstreams for io of the depfile, removed unneeded
9011 functions and variables.
9013 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9014 vector instead, removed all functions and variables that is not in
9017 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9019 * src/buffer.C (insertErrors): use new interface to TeXError
9021 * Makefile.am (rpmdist): added a rpmdist target
9023 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9024 per Kayvan's instructions.
9026 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9028 * src/Makefile.am: add a definition for localedir, so that locales
9029 are found after installation (Kayvan)
9031 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9033 * development/.cvsignore: new file.
9035 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9037 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9038 C++ compiler provides wrappers for C headers and use our alternate
9041 * configure.in: use LYX_CXX_CHEADERS.
9043 * src/cheader/: new directory, populated with cname headers from
9044 libstdc++-2.8.1. They are a bit old, but probably good enough for
9045 what we want (support compilers who lack them).
9047 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9048 from includes. It turns out is was stupid.
9050 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9052 * lib/Makefile.am (install-data-local): forgot a ';'
9053 (install-data-local): forgot a '\'
9054 (libinstalldirs): needed after all. reintroduced.
9056 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9058 * configure.in (AC_OUTPUT): added lyx.spec
9060 * development/lyx.spec: removed file
9062 * development/lyx.spec.in: new file
9064 * po/*.po: merged with lyx.pot becuase of make distcheck
9066 * lib/Makefile.am (dist-hook): added dist-hook so that
9067 documentation files will be included when doing a make
9068 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9069 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9071 more: tried to make install do the right thing, exclude CVS dirs
9074 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9075 Path would fit in more nicely.
9077 * all files that used to use pathstack: uses now Path instead.
9078 This change was a lot easier than expected.
9080 * src/support/path.h: new file
9082 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9084 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9086 * src/support/lyxstring.C (getline): Default arg was given for
9089 * Configure.cmd: removed file
9091 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9093 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9094 streams classes and types, add the proper 'using' statements when
9095 MODERN_STL is defined.
9097 * src/debug.h: move the << operator definition after the inclusion
9100 * src/support/filetools.C: include "LAssert.h", which is needed
9103 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9106 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9107 include "debug.h" to define a proper ostream.
9109 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9111 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9112 method to the SystemCall class which can kill a process, but it's
9113 not fully implemented yet.
9115 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9117 * src/support/FileInfo.h: Better documentation
9119 * src/lyxfunc.C: Added support for buffer-export html
9121 * src/menus.C: Added Export->As HTML...
9123 * lib/bind/*.bind: Added short-cut for buffer-export html
9125 * src/lyxrc.*: Added support for new \tth_command
9127 * lib/lyxrc.example: Added stuff for new \tth_command
9129 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9131 * lib/Makefile.am (IMAGES): removed images/README
9132 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9133 installes in correct place. Check permisions is installed
9136 * src/LaTeX.C: some no-op changes moved declaration of some
9139 * src/LaTeX.h (LATEX_H): changed include guard name
9141 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9143 * lib/reLyX/Makefile.am: install noweb2lyx.
9145 * lib/Makefile.am: install configure.
9147 * lib/reLyX/configure.in: declare a config aux dir; set package
9148 name to lyx (not sure what the best solution is); generate noweb2lyx.
9150 * lib/layouts/egs.layout: fix the bibliography layout.
9152 1999-10-08 Jürgen Vigna <jug@sad.it>
9154 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9155 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9156 it returned without continuing to search the path.
9158 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9160 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9161 also fixes a bug. It is not allowed to do tricks with std::strings
9162 like: string a("hei"); &a[e]; this will not give what you
9163 think... Any reason for the complexity in this func?
9165 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9167 * Updated README and INSTALL a bit, mostly to check that my
9168 CVS rights are correctly set up.
9170 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9172 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9173 does not allow '\0' chars but lyxstring and std::string does.
9175 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9177 * autogen.sh (AUTOCONF): let the autogen script create the
9178 POTFILES.in file too. POTFILES.in should perhaps now not be
9179 included in the cvs module.
9181 * some more files changed to use C++ includes instead of C ones.
9183 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9185 (Reread): added tostr to nlink. buggy output otherwise.
9186 (Reread): added a string() around szMode when assigning to Buffer,
9187 without this I got a log of garbled info strings.
9189 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9192 * I have added several ostream & operator<<(ostream &, some_type)
9193 functions. This has been done to avoid casting and warnings when
9194 outputting enums to lyxerr. This as thus eliminated a lot of
9195 explicit casts and has made the code clearer. Among the enums
9196 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9197 mathed enums, some font enum the Debug::type enum.
9199 * src/support/lyxstring.h (clear): missing method. equivalent of
9202 * all files that contained "stderr": rewrote constructs that used
9203 stderr to use lyxerr instead. (except bmtable)
9205 * src/support/DebugStream.h (level): and the passed t with
9206 Debug::ANY to avoid spurious bits set.
9208 * src/debug.h (Debug::type value): made it accept strings of the
9211 * configure.in (Check for programs): Added a check for kpsewhich,
9212 the latex generation will use this later to better the dicovery of
9215 * src/BufferView.C (create_view): we don't need to cast this to
9216 (void*) that is done automatically.
9217 (WorkAreaButtonPress): removed some dead code.
9219 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9221 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9222 is not overwritten when translated (David Sua'rez de Lis).
9224 * lib/CREDITS: Added David Sua'rez de Lis
9226 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9228 * src/bufferparams.C (BufferParams): default input encoding is now
9231 * acinclude.m4 (cross_compiling): comment out macro
9232 LYX_GXX_STRENGTH_REDUCE.
9234 * acconfig.h: make sure that const is not defined (to empty) when
9235 we are compiling C++. Remove commented out code using SIZEOF_xx
9238 * configure.in : move the test for const and inline as late as
9239 possible so that these C tests do not interefere with C++ ones.
9240 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9241 has not been proven.
9243 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9245 * src/table.C (getDocBookAlign): remove bad default value for
9248 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9250 (ShowFileMenu2): ditto.
9252 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9255 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9257 * Most files: finished the change from the old error code to use
9258 DebugStream for all lyxerr debugging. Only minor changes remain
9259 (e.g. the setting of debug levels using strings instead of number)
9261 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9263 * src/layout.C (Add): Changed to use compare_no_case instead of
9266 * src/FontInfo.C: changed loop variable type too string::size_type.
9268 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9270 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9271 set ETAGS_ARGS to --c++
9273 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9275 * src/table.C (DocBookEndOfCell): commented out two unused variables
9277 * src/paragraph.C: commented out four unused variables.
9279 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9280 insed a if clause with type string::size_type.
9282 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9285 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9287 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9288 variable, also changed loop to go from 0 to lenght + 1, instead of
9289 -1 to length. This should be correct.
9291 * src/LaTeX.C (scanError): use string::size_type as loop variable
9294 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9295 (l.896) since y_tmp and row was not used anyway.
9297 * src/insets/insetref.C (escape): use string::size_type as loop
9300 * src/insets/insetquotes.C (Width): use string::size_type as loop
9302 (Draw): use string::size_type as loop variable type.
9304 * src/insets/insetlatexaccent.C (checkContents): use
9305 string::size_type as loop variable type.
9307 * src/insets/insetlabel.C (escape): use string::size_type as loop
9310 * src/insets/insetinfo.C: added an extern for current_view.
9312 * src/insets/insetcommand.C (scanCommand): use string::size_type
9313 as loop variable type.
9315 * most files: removed the RCS tags. With them we had to recompile
9316 a lot of files after a simple cvs commit. Also we have never used
9317 them for anything meaningful.
9319 * most files: tags-query-replace NULL 0. As adviced several plases
9320 we now use "0" instead of "NULL" in our code.
9322 * src/support/filetools.C (SpaceLess): use string::size_type as
9325 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9327 * src/paragraph.C: fixed up some more string stuff.
9329 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9331 * src/support/filetools.h: make modestr a std::string.
9333 * src/filetools.C (GetEnv): made ch really const.
9335 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9336 made code that used these use max/min from <algorithm> instead.
9338 * changed several c library include files to their equivalent c++
9339 library include files. All is not changed yet.
9341 * created a support subdir in src, put lyxstring and lstrings
9342 there + the extra files atexit, fileblock, strerror. Created
9343 Makefile.am. edited configure.in and src/Makefile.am to use this
9344 new subdir. More files moved to support.
9346 * imported som of the functions from repository lyx, filetools
9348 * ran tags-query-replace on LString -> string, corrected the bogus
9349 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9350 is still some errors in there. This is errors where too much or
9351 too litle get deleted from strings (string::erase, string::substr,
9352 string::replace), there can also be some off by one errors, or
9353 just plain wrong use of functions from lstrings. Viewing of quotes
9356 * LyX is now running fairly well with string, but there are
9357 certainly some bugs yet (see above) also string is quite different
9358 from LString among others in that it does not allow null pointers
9359 passed in and will abort if it gets any.
9361 * Added the revtex4 files I forgot when setting up the repository.
9363 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9365 * All over: Tried to clean everything up so that only the files
9366 that we really need are included in the cvs repository.
9367 * Switched to use automake.
9368 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9369 * Install has not been checked.
9371 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9373 * po/pt.po: Three errors:
9374 l.533 and l.538 format specification error
9375 l. 402 duplicate entry, I just deleted it.