1 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * several files: type canges to reduce the number of warnings and
4 to unify type hangling a bit. Still much to do.
6 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8 * lib/images/*: rename a bunch of icons to match Dekel converter
11 * src/buffer.C (SimpleLinuxDocOnePar): add a const qualifier to
14 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
16 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
18 * sigc++/handle.h: ditto for class Handle.
20 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
22 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
24 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
26 * src/intl.C (InitKeyMapper): Correct the value of n due to the
27 removal of the "default" language.
29 * src/combox.h (getline): Check that sel > 0
31 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
33 * lib/examples/docbook_example.lyx
34 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
36 * lib/layouts/docbook-book.layout: new docbook book layout.
38 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
40 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
42 * src/insets/figinset.C (DocBook):fixed small typo.
44 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
46 * src/insets/insetinclude.h: string include_label doesn't need to be
49 2000-09-29 Allan Rae <rae@lyx.org>
51 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
52 Allow derived type to control connection and disconnection from signals
53 of its choice if desired.
55 2000-09-28 Juergen Vigna <jug@sad.it>
57 * src/insets/insettabular.C (update): fixed cursor setting when
58 the_locking_inset changed.
59 (draw): made this a bit cleaner.
60 (InsetButtonPress): fixed!
62 * various files: added LyXText Parameter to fitCursor call.
64 * src/BufferView.C (fitCursor): added LyXText parameter.
66 * src/insets/insettabular.C (draw): small draw fix.
68 * src/tabular.C: right setting of left/right celllines.
70 * src/tabular.[Ch]: fixed various types in funcions and structures.
71 * src/insets/insettabular.C: ditto
72 * src/frontends/xforms/FormTabular.C: ditto
74 2000-09-28 Allan Rae <rae@lyx.org>
76 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
77 that the #ifdef's had been applied to part of what should have been
78 a complete condition. It's possible there are other tests that
79 were specific to tables that are also wrong now that InsetTabular is
80 being used. Now we need to fix the output of '\n' after a table in a
81 float for the same reason as the original condition:
82 "don't insert this if we would be adding it before or after a table
83 in a float. This little trick is needed in order to allow use of
84 tables in \subfigures or \subtables."
85 Juergen can you check this?
87 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
90 outputed to the ostream.
92 * several files: fixed types based on warnings from cxx
94 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
96 * src/frontends/kde/Makefile.am: fix rule for
97 formindexdialogdata_moc.C
99 * src/.cvsignore: add ext_l10n.h to ignore
101 * acconfig.h: stop messing with __STRICT_ANSI__
102 * config/gnome.m4: remove option to set -ansi
103 * config/kde.m4: remove option to set -ansi
104 * config/lyxinclude.m4: don't set -ansi
106 2000-09-27 Juergen Vigna <jug@sad.it>
108 * various files: remove "default" language check.
110 * src/insets/insetquotes.C: removed use of current_view.
112 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
113 the one should have red ears by now!
115 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
116 in more then one paragraph. Fixed cursor-movement/selection.
118 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
119 paragraphs inside a text inset.
121 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
122 text-inset if this owner is an inset.
124 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
126 * src/Bullet.h: changed type of font, character and size to int
128 * src/buffer.C (asciiParagraph): remove actcell and fname1.
130 * src/insets/inseturl.[Ch]:
131 * src/insets/insetref.[Ch]:
132 * src/insets/insetlabel.[Ch]: add linelen to Ascii
134 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
136 * src/buffer.C (readFile): block-if statement rearranged to minimise
137 bloat. Patch does not reverse Jean-Marc's change ;-)
139 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
140 Class rewritten to store pointers to hide/update signals directly,
141 rather than Dialogs *. Also defined an enum to ease use. All xforms
142 forms can now be derived from this class.
144 * src/frontends/xforms/FormCommand.[Ch]
145 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
147 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
150 * src/frontends/xforms/forms/form_citation.fd
151 * src/frontends/xforms/forms/form_copyright.fd
152 * src/frontends/xforms/forms/form_error.fd
153 * src/frontends/xforms/forms/form_index.fd
154 * src/frontends/xforms/forms/form_ref.fd
155 * src/frontends/xforms/forms/form_toc.fd
156 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
158 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
160 * src/insets/insetfoot.C: removed redundent using directive.
162 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
164 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
165 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
167 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
168 created in the constructors in different groups. Then set() just
169 have to show the groups as needed. This fixes the redraw problems
170 (and is how the old menu code worked).
172 * src/support/lyxlib.h: declare the methods as static when we do
175 2000-09-26 Juergen Vigna <jug@sad.it>
177 * src/buffer.C (asciiParagraph): new function.
178 (writeFileAscii): new function with parameter ostream.
179 (writeFileAscii): use now asciiParagraph.
181 * various inset files: added the linelen parameter to the Ascii-func.
183 * src/tabular.C (Write): fixed error in writing file introduced by
184 the last changes from Lars.
186 * lib/bind/menus.bind: removed not supported functions.
188 * src/insets/insettext.C (Ascii): implemented this function.
190 * src/insets/lyxinset.h (Ascii): added linelen parameter.
192 * src/tabular.C (write_attribute[int,string,bool]): new functions.
193 (Write): use of the write_attribute functions.
195 * src/bufferlist.C (close): fixed reasking question!
197 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
199 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
200 new files use the everwhere possible.
203 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
204 src/log_form.C src/lyx.C:
207 * src/buffer.C (runLaTeX): remove func
209 * src/PaperLayout.C: removed file
210 * src/ParagraphExtra.C: likewise
211 * src/bullet_forms.C: likewise
212 * src/bullet_forms.h: likewise
213 * src/bullet_forms_cb.C: likewise
215 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
216 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
219 * several files: remove all traces of the old fd_form_paragraph,
220 and functions belonging to that.
222 * several files: remove all traces of the old fd_form_document,
223 and functions belonging to that.
225 * several files: constify local variables were possible.
227 * several files: remove all code that was dead when NEW_EXPORT was
230 * several files: removed string::c_str in as many places as
233 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
234 (e): be a bit more outspoken when patching
235 (updatesrc): only move files if changed.
237 * forms/layout_forms.h.patch: regenerated
239 * forms/layout_forms.fd: remove form_document and form_paragraph
240 and form_quotes and form_paper and form_table_options and
243 * forms/form1.fd: remove form_table
245 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
246 the fdui->... rewrite. Update some comments to xforms 0.88
248 * forms/bullet_forms.C.patch: removed file
249 * forms/bullet_forms.fd: likewise
250 * forms/bullet_forms.h.patch: likewise
252 * development/Code_rules/Rules: added a section on switch
253 statements. Updated some comment to xforms 0.88.
255 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
257 * src/buffer.C (readFile): make sure that the whole version number
258 is read after \lyxformat (even when it contains a comma)
260 * lib/ui/default.ui: change shortcut of math menu to M-a.
262 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
264 * src/vspace.C (nextToken): use isStrDbl() to check for proper
267 * src/LyXView.C (updateWindowTitle): show the full files name in
268 window title, limited to 30 characters.
270 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
271 When a number of characters has been given, we should not assume
272 that the string is 0-terminated.
274 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
275 calls (fixes some memory leaks)
277 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
278 trans member on exit.
280 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
282 * src/converter.C (GetReachable): fix typo.
284 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
285 understand ',' instead of '.'.
286 (GetInteger): rewrite to use strToInt().
288 2000-09-26 Juergen Vigna <jug@sad.it>
290 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
291 better visibility and error-message on wrong VSpace input.
293 * src/language.C (initL): added english again.
295 2000-09-25 Juergen Vigna <jug@sad.it>
297 * src/frontends/kde/Dialogs.C (Dialogs):
298 * src/frontends/gnome/Dialogs.C (Dialogs):
299 * src/frontends/kde/Makefile.am:
300 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
302 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
304 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
306 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
308 * src/frontends/xforms/FormParagraph.C:
309 * src/frontends/xforms/FormParagraph.h:
310 * src/frontends/xforms/form_paragraph.C:
311 * src/frontends/xforms/form_paragraph.h:
312 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
315 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
317 * src/tabular.C (OldFormatRead): forgot to delete the temporary
318 Paragraph-Data after use.
320 * src/insets/insettext.C (LocalDispatch): don't set the layout on
321 non breakable paragraphs.
323 2000-09-25 Garst R. Reese <reese@isn.net>
325 * src/language.C (initL): added missing language_country codes.
327 2000-09-25 Juergen Vigna <jug@sad.it>
329 * src/insets/insettext.C (InsetText):
330 (deleteLyXText): remove the not released LyXText structure!
332 2000-09-24 Marko Vendelin <markov@ioc.ee>
334 * src/frontends/gnome/mainapp.C
335 * src/frontends/gnome/mainapp.h: added support for keyboard
338 * src/frontends/gnome/FormCitation.C
339 * src/frontends/gnome/FormCitation.h
340 * src/frontends/gnome/Makefile.am
341 * src/frontends/gnome/pixbutton.h: completed the rewrite of
342 FormCitation to use "action area" in mainapp window
344 * src/frontends/gnome/Menubar_pimpl.C
345 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
348 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
350 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
351 width/descent/ascent values if name is empty.
352 (mathed_string_height): Use std::max.
354 2000-09-25 Allan Rae <rae@lyx.org>
356 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
357 segfault. This will be completely redesigned soon.
359 * sigc++: updated libsigc++. Fixes struct timespec bug.
361 * development/tools/makeLyXsigc.sh: .cvsignore addition
363 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
365 * several files: removed almost all traces of the old table
368 * src/TableLayout.C: removed file
370 2000-09-22 Juergen Vigna <jug@sad.it>
372 * src/frontends/kde/Dialogs.C: added credits forms.
374 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
376 * src/frontends/gnome/Dialogs.C: added some forms.
378 * src/spellchecker.C (init_spell_checker): set language in pspell code
379 (RunSpellChecker): some modifications for setting language string.
381 * src/language.[Ch]: added language_country code.
383 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
385 * src/frontends/Dialogs.h: added new signal showError.
386 Rearranged existing signals in some sort of alphabetical order.
388 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
389 FormError.[Ch], form_error.[Ch]
390 * src/frontends/xforms/forms/makefile: added new file form_error.fd
391 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
393 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
394 dialogs. I think that this can be used as the base to all these
397 * src/frontends/xforms/FormError.[Ch]
398 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
399 implementation of InsetError dialog.
401 * src/insets/inseterror.[Ch]: rendered GUI-independent.
403 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
404 * src/frontends/kde/Makefile.am: ditto
406 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
408 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
409 macrobf. This fixes a bug of invisible text.
411 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
413 * lib/doc/LaTeXConfig.lyx.in: updated.
415 * src/language.C (initL): remove language "francais" and change a
416 bit the names of the two other french variations.
418 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
419 string that may not be 0-terminated.
421 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
423 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
425 2000-09-20 Marko Vendelin <markov@ioc.ee>
427 * src/frontends/gnome/FormCitation.C
428 * src/frontends/gnome/FormIndex.C
429 * src/frontends/gnome/FormToc.C
430 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
431 the variable initialization to shut up the warnings
433 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
435 * src/table.[Ch]: deleted files
437 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
440 2000-09-18 Juergen Vigna <jug@sad.it>
442 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
443 problems with selection. Inserted new LFUN_PASTESELECTION.
444 (InsetButtonPress): inserted handling of middle mouse-button paste.
446 * src/spellchecker.C: changed word to word.c_str().
448 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
450 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
451 included in the ``make dist'' tarball.
453 2000-09-15 Juergen Vigna <jug@sad.it>
455 * src/CutAndPaste.C (cutSelection): small fix return the right
456 end position after cut inside one paragraph only.
458 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
459 we are locked as otherwise we don't have a valid cursor position!
461 * src/insets/figinset.C (draw): small bugfix but why is this needed???
463 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
465 * src/frontends/kde/FormRef.C: added using directive.
466 * src/frontends/kde/FormToc.C: ditto
468 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
470 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
472 2000-09-19 Marko Vendelin <markov@ioc.ee>
474 * src/frontends/gnome/Menubar_pimpl.C
475 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
476 Toc, ViewFormats, UpdateFormats, and ExportFormats.
478 * src/frontends/gnome/mainapp.C
479 * src/frontends/gnome/mainapp.h: support for menu update used
482 * src/frontends/gnome/mainapp.C
483 * src/frontends/gnome/mainapp.h: support for "action" area in the
484 main window. This area is used by small simple dialogs, such as
487 * src/frontends/gnome/FormIndex.C
488 * src/frontends/gnome/FormIndex.h
489 * src/frontends/gnome/FormUrl.C
490 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
493 * src/frontends/gnome/FormCitation.C
494 * src/frontends/gnome/FormCitation.h: rewrite to use main window
495 action area. Only "Insert new citation" is implemented.
497 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
499 * src/buffer.C (Dispatch): fix call to Dispatch
500 * src/insets/insetref.C (Edit): likewise
501 * src/insets/insetparent.C (Edit): likewise
502 * src/insets/insetinclude.C (include_cb): likewise
503 * src/frontends/xforms/FormUrl.C (apply): likewise
504 * src/frontends/xforms/FormToc.C (apply): likewise
505 * src/frontends/xforms/FormRef.C (apply): likewise
506 * src/frontends/xforms/FormIndex.C (apply): likewise
507 * src/frontends/xforms/FormCitation.C (apply): likewise
508 * src/lyxserver.C (callback): likewise
509 * src/lyxfunc.C (processKeySym): likewise
512 * src/lyx_cb.C (LayoutsCB): likewise
514 * Makefile.am (sourcedoc): small change
516 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
518 * src/main.C (main): Don't make an empty GUIRunTime object. all
519 methods are static. constify a bit remove unneded using + headers.
521 * src/tabular.C: some more const to local vars move some loop vars
523 * src/spellchecker.C: added some c_str after some word for pspell
525 * src/frontends/GUIRunTime.h: add new static method setDefaults
526 * src/frontends/xforms/GUIRunTime.C (setDefaults):
527 * src/frontends/kde/GUIRunTime.C (setDefaults):
528 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
530 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
531 with strnew in arg, use correct emptystring when calling SetName.
533 * several files: remove all commented code with relation to
534 HAVE_SSTREAM beeing false. We now only support stringstream and
537 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
539 * src/lyxfunc.C: construct correctly the automatic new file
542 * src/text2.C (IsStringInText): change type of variable i to shut
545 * src/support/sstream.h: do not use namespaces if the compiler
546 does not support them.
548 2000-09-15 Marko Vendelin <markov@ioc.ee>
549 * src/frontends/gnome/FormCitation.C
550 * src/frontends/gnome/FormCitation.h
551 * src/frontends/gnome/diainsertcitation_interface.c
552 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
553 regexp support to FormCitation [Gnome].
555 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
558 * configure.in: remove unused KDE/GTKGUI define
560 * src/frontends/kde/FormRef.C
561 * src/frontends/kde/FormRef.h
562 * src/frontends/kde/formrefdialog.C
563 * src/frontends/kde/formrefdialog.h: double click will
564 go to reference, now it is possible to change a cross-ref
567 * src/frontends/kde/FormToc.C
568 * src/frontends/kde/FormToc.h
569 * src/frontends/kde/formtocdialog.C
570 * src/frontends/kde/formtocdialog.h: add a depth
573 * src/frontends/kde/Makefile.am: add QtLyXView.h
576 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
578 * src/frontends/kde/FormCitation.h: added some using directives.
580 * src/frontends/kde/FormToc.h: corrected definition of doTree.
582 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
585 * src/mathed/math_defs.h: redefine SetAlign to use string rather
588 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
590 * src/buffer.C (pop_tag): revert for the second time a change by
591 Lars, who seems to really hate having non-local loop variables :)
593 * src/Lsstream.h: add "using" statements.
595 * src/support/copy.C (copy): add a bunch of std:: qualifiers
596 * src/buffer.C (writeFile): ditto
598 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
600 * src/buffer.C (writeFile): try to fix the locale modified format
601 number to always be as we want it.
603 * src/WorkArea.C (work_area_handler): try to workaround the bugs
604 in XForms 0.89. C-space is now working again.
606 * src/Lsstream.h src/support/sstream.h: new files.
608 * also commented out all cases where strstream were used.
610 * src/Bullet.h (c_str): remove method.
612 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
614 * a lot of files: get rid of "char const *" and "char *" is as
615 many places as possible. We only want to use them in interaction
616 with system of other libraries, not inside lyx.
618 * a lot of files: return const object is not of pod type. This
619 helps ensure that temporary objects is not modified. And fits well
620 with "programming by contract".
622 * configure.in: check for the locale header too
624 * Makefile.am (sourcedoc): new tag for generation of doc++
627 2000-09-14 Juergen Vigna <jug@sad.it>
629 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
630 callback to check which combo called it and do the right action.
632 * src/combox.C (combo_cb): added combo * to the callbacks.
633 (Hide): moved call of callback after Ungrab of the pointer.
635 * src/intl.h: removed LCombo2 function.
637 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
638 function as this can now be handled in one function.
640 * src/combox.h: added Combox * to callback prototype.
642 * src/frontends/xforms/Toolbar_pimpl.C:
643 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
645 2000-09-14 Garst Reese <reese@isn.net>
647 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
648 moved usepackage{xxx}'s to beginning of file. Changed left margin
649 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
650 underlining from title. Thanks to John Culleton for useful suggestions.
652 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
654 * src/lyxlex_pimpl.C (setFile): change error message to debug
657 2000-09-13 Juergen Vigna <jug@sad.it>
659 * src/frontends/xforms/FormDocument.C: implemented choice_class
660 as combox and give callback to combo_language so OK/Apply is activated
663 * src/bufferlist.C (newFile): small fix so already named files
664 (via an open call) are not requested to be named again on the
667 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
669 * src/frontends/kde/Makefile.am
670 * src/frontends/kde/FormRef.C
671 * src/frontends/kde/FormRef.h
672 * src/frontends/kde/formrefdialog.C
673 * src/frontends/kde/formrefdialog.h: implement
676 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
678 * src/frontends/kde/formtocdialog.C
679 * src/frontends/kde/formtocdialog.h
680 * src/frontends/kde/FormToc.C
681 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
683 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
685 * src/frontends/kde/FormCitation.C: fix thinko
686 where we didn't always display the reference text
689 * src/frontends/kde/formurldialog.C
690 * src/frontends/kde/formurldialog.h
691 * src/frontends/kde/FormUrl.C
692 * src/frontends/kde/FormUrl.h: minor cleanups
694 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
696 * src/frontends/kde/Makefile.am
697 * src/frontends/kde/FormToc.C
698 * src/frontends/kde/FormToc.h
699 * src/frontends/kde/FormCitation.C
700 * src/frontends/kde/FormCitation.h
701 * src/frontends/kde/FormIndex.C
702 * src/frontends/kde/FormIndex.h
703 * src/frontends/kde/formtocdialog.C
704 * src/frontends/kde/formtocdialog.h
705 * src/frontends/kde/formcitationdialog.C
706 * src/frontends/kde/formcitationdialog.h
707 * src/frontends/kde/formindexdialog.C
708 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
710 2000-09-12 Juergen Vigna <jug@sad.it>
712 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
715 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
717 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
720 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
722 * src/converter.C (Add, Convert): Added support for converter flags:
723 needaux, resultdir, resultfile.
724 (Convert): Added new parameter view_file.
725 (dvips_options): Fixed letter paper option.
727 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
728 (Export, GetExportableFormats, GetViewableFormats): Added support
731 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
733 (easyParse): Fixed to work with new export code.
735 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
738 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
740 * lib/bind/*.bind: Replaced
741 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
742 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
744 2000-09-11 Juergen Vigna <jug@sad.it>
746 * src/lyx_gui.C (runTime): uses global guiruntime variable.
748 * src/main.C (main): now GUII defines global guiruntime!
750 * src/frontends/gnome/GUIRunTime.C (initApplication):
751 * src/frontends/kde/GUIRunTime.C (initApplication):
752 * src/frontends/xforms/GUIRunTime.C (initApplication):
753 * src/frontends/GUIRunTime.h: added new function initApplication.
755 * src/spellchecker.C (sc_accept_word): change to add_to_session.
757 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
759 2000-09-08 Juergen Vigna <jug@sad.it>
761 * src/lyx_gui.C (create_forms): don't display the "default" entry as
762 we have already "Reset".
764 * src/language.C (initL): inserted "default" language and made this
765 THE default language (and not american!)
767 * src/paragraph.C: inserted handling of "default" language!
769 * src/lyxfont.C: ditto
773 * src/paragraph.C: output the \\par only if we have a following
774 paragraph otherwise it's not needed.
776 2000-09-05 Juergen Vigna <jug@sad.it>
778 * config/pspell.m4: added entry to lyx-flags
780 * src/spellchecker.C: modified version from Kevin for using pspell
782 2000-09-01 Marko Vendelin <markov@ioc.ee>
783 * src/frontends/gnome/Makefile.am
784 * src/frontends/gnome/FormCitation.C
785 * src/frontends/gnome/FormCitation.h
786 * src/frontends/gnome/diainsertcitation_callbacks.c
787 * src/frontends/gnome/diainsertcitation_callbacks.h
788 * src/frontends/gnome/diainsertcitation_interface.c
789 * src/frontends/gnome/diainsertcitation_interface.h
790 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
791 dialog for Gnome frontend
793 * src/main.C: Gnome libraries require keeping application name
794 and its version as strings
796 * src/frontends/gnome/mainapp.C: Change the name of the main window
797 from GnomeLyX to PACKAGE
799 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
801 * src/frontends/Liason.C: add "using: declaration.
803 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
805 * src/mathed/math_macro.C (Metrics): Set the size of the template
807 * src/mathed/formulamacro.C (Latex): Fixed the returned value
809 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
811 * src/converter.C (add_options): New function.
812 (SetViewer): Change $$FName into '$$FName'.
813 (View): Add options when running xdvi
814 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
815 (Convert): The 3rd parameter is now the desired filename. Converts
816 calls to lyx::rename if necessary.
817 Add options when running dvips.
818 (dvi_papersize,dvips_options): New methods.
820 * src/exporter.C (Export): Use getLatexName() instead of fileName().
822 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
823 using a call to Converter::dvips_options.
824 Fixed to work with nex export code.
827 * src/support/rename.C: New files
829 * src/support/syscall.h
830 * src/support/syscall.C: Added Starttype SystemDontWait.
832 * lib/ui/default.ui: Changed to work with new export code
834 * lib/configure.m4: Changed to work with new export code
836 * src/encoding.C: Changed latex name for iso8859_7 encoding.
838 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
840 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
841 so that code compiles with DEC cxx.
843 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
844 to work correctly! Also now supports the additional elements
847 2000-09-01 Allan Rae <rae@lyx.org>
849 * src/frontends/ButtonPolicies.C: renamed all the references to
850 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
852 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
853 since it's a const not a type.
855 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
857 2000-08-31 Juergen Vigna <jug@sad.it>
859 * src/insets/figinset.C: Various changes to look if the filename has
860 an extension and if not add it for inline previewing.
862 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
864 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
865 make buttonStatus and isReadOnly be const methods. (also reflect
866 this in derived classes.)
868 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
869 (nextState): change to be static inline, pass the StateMachine as
871 (PreferencesPolicy): remove casts
872 (OkCancelPolicy): remvoe casts
873 (OkCancelReadOnlyPolicy): remove casts
874 (NoRepeatedApplyReadOnlyPolicy): remove casts
875 (OkApplyCancelReadOnlyPolicy): remove casts
876 (OkApplyCancelPolicy): remove casts
877 (NoRepeatedApplyPolicy): remove casts
879 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
881 * src/converter.C: added some using directives
883 * src/frontends/ButtonPolicies.C: changes to overcome
884 "need lvalue" error with DEC c++
886 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
887 to WMHideCB for DEC c++
889 * src/frontends/xforms/Menubar_pimpl.C: added using directive
891 * src/frontends/xforms/forms/form_document.C.patch: use C callback
892 to BulletBMTableCB for DEC c++
894 2000-08-31 Allan Rae <rae@lyx.org>
896 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
897 character dialog separately from old document dialogs combo_language.
900 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
902 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
903 Removed LFUN_REF_CREATE.
905 * src/MenuBackend.C: Added new tags: toc and references
907 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
908 (add_lastfiles, add_documents, add_formats): Removed the unused smn
910 (add_toc, add_references): New methods.
911 (create_submenu): Handle correctly the case when there is a
912 seperator after optional menu items.
914 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
915 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
916 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
918 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
920 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
922 * src/converter.[Ch]: New file for converting between different
925 * src/export.[Ch]: New file for exporting a LyX file to different
928 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
929 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
930 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
931 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
932 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
933 RunDocBook, MenuExport.
935 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
936 Exporter::Preview methods if NEW_EXPORT is defined.
938 * src/buffer.C (Dispatch): Use Exporter::Export.
940 * src/lyxrc.C: Added new tags: \converter and \viewer.
943 * src/LyXAction.C: Define new lyx-function: buffer-update.
944 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
945 when NEW_EXPORT is defined.
947 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
949 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
951 * lib/ui/default.ui: Added submenus "view" and "update" to the
954 * src/filetools.C (GetExtension): New function.
956 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
958 2000-08-29 Allan Rae <rae@lyx.org>
960 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
962 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
963 (EnableDocumentLayout): removed
964 (DisableDocumentLayout): removed
965 (build): make use of ButtonController's read-only handling to
966 de/activate various objects. Replaces both of the above functions.
968 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
969 (readOnly): was read_only
970 (refresh): fixed dumb mistakes with read_only_ handling
972 * src/frontends/xforms/forms/form_document.fd:
973 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
974 tabbed dialogs so the tabs look more like tabs and so its easier to
975 work out which is the current tab.
977 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
978 segfault with form_table
980 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
982 2000-08-28 Juergen Vigna <jug@sad.it>
984 * acconfig.h: added USE_PSPELL.
986 * src/config.h.in: added USE_PSPELL.
988 * autogen.sh: added pspell.m4
990 * config/pspell.m4: new file.
992 * src/spellchecker.C: implemented support for pspell libary.
994 2000-08-25 Juergen Vigna <jug@sad.it>
996 * src/LyXAction.C (init): renamed LFUN_TABLE to
997 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
999 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1001 * src/lyxscreen.h: add force_clear variable and fuction to force
1002 a clear area when redrawing in LyXText.
1004 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1006 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1008 * some whitespace and comment changes.
1010 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1012 * src/buffer.C: up te LYX_FORMAT to 2.17
1014 2000-08-23 Juergen Vigna <jug@sad.it>
1016 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1019 * src/insets/insettabular.C (pasteSelection): delete the insets
1020 LyXText as it is not valid anymore.
1021 (copySelection): new function.
1022 (pasteSelection): new function.
1023 (cutSelection): new function.
1024 (LocalDispatch): implemented cut/copy/paste of cell selections.
1026 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1027 don't have a LyXText.
1029 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1031 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1034 2000-08-22 Juergen Vigna <jug@sad.it>
1036 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1037 ifdef form_table out if NEW_TABULAR.
1039 2000-08-21 Juergen Vigna <jug@sad.it>
1041 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1042 (draw): fixed draw position so that the cursor is positioned in the
1044 (InsetMotionNotify): hide/show cursor so the position is updated.
1045 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1046 using cellstart() function where it should be used.
1048 * src/insets/insettext.C (draw): ditto.
1050 * src/tabular.C: fixed initialization of some missing variables and
1051 made BoxType into an enum.
1053 2000-08-22 Marko Vendelin <markov@ioc.ee>
1054 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1055 stock menu item using action numerical value, not its string
1059 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1061 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1062 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1064 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1066 * src/frontends/xforms/GUIRunTime.C: new file
1068 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1069 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1071 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1073 * src/frontends/kde/GUIRunTime.C: new file
1075 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1076 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1078 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1080 * src/frontends/gnome/GUIRunTime.C: new file
1082 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1085 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1086 small change to documetentation.
1088 * src/frontends/GUIRunTime.C: removed file
1090 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1092 * src/lyxparagraph.h: enable NEW_TABULAR as default
1094 * src/lyxfunc.C (processKeySym): remove some commented code
1096 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1097 NEW_TABULAR around the fd_form_table_options.
1099 * src/lyx_gui.C (runTime): call the static member function as
1100 GUIRunTime::runTime().
1102 2000-08-21 Allan Rae <rae@lyx.org>
1104 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1107 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1109 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1111 2000-08-21 Allan Rae <rae@lyx.org>
1113 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1114 keep Garst happy ;-)
1115 * src/frontends/xforms/FormPreferences.C (build): use setOK
1116 * src/frontends/xforms/FormDocument.C (build): use setOK
1117 (FormDocument): use the appropriate policy.
1119 2000-08-21 Allan Rae <rae@lyx.org>
1121 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1122 automatic [de]activation of arbitrary objects when in a read-only state.
1124 * src/frontends/ButtonPolicies.h: More documentation
1125 (isReadOnly): added to support the above.
1127 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1129 2000-08-18 Juergen Vigna <jug@sad.it>
1131 * src/insets/insettabular.C (getStatus): changed to return func_status.
1133 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1134 display toggle menu entries if they are.
1136 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1137 new document layout now.
1139 * src/lyxfunc.C: ditto
1141 * src/lyx_gui_misc.C: ditto
1143 * src/lyx_gui.C: ditto
1145 * lib/ui/default.ui: removed paper and quotes layout as they are now
1146 all in the document layout tabbed folder.
1148 * src/frontends/xforms/forms/form_document.fd: added Restore
1149 button and callbacks for all inputs for Allan's ButtonPolicy.
1151 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1152 (CheckChoiceClass): added missing params setting on class change.
1153 (UpdateLayoutDocument): added for updating the layout on params.
1154 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1155 (FormDocument): Implemented Allan's ButtonPolicy with the
1158 2000-08-17 Allan Rae <rae@lyx.org>
1160 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1161 so we can at least see the credits again.
1163 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1164 controller calls for the appropriate callbacks. Note that since Ok
1165 calls apply followed by cancel, and apply isn't a valid input for the
1166 APPLIED state, the bc_ calls have to be made in the static callback not
1167 within each of the real callbacks.
1169 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1170 (setOk): renamed from setOkay()
1172 2000-08-17 Juergen Vigna <jug@sad.it>
1174 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1175 in the implementation part.
1176 (composeUIInfo): don't show optional menu-items.
1178 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1180 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1182 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1183 text-state when in a text-inset.
1185 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1187 2000-08-17 Marko Vendelin <markov@ioc.ee>
1188 * src/frontends/gnome/FormIndex.C
1189 * src/frontends/gnome/FormIndex.h
1190 * src/frontends/gnome/FormToc.C
1191 * src/frontends/gnome/FormToc.h
1192 * src/frontends/gnome/dialogs
1193 * src/frontends/gnome/diatoc_callbacks.c
1194 * src/frontends/gnome/diatoc_callbacks.h
1195 * src/frontends/gnome/diainsertindex_callbacks.h
1196 * src/frontends/gnome/diainsertindex_callbacks.c
1197 * src/frontends/gnome/diainsertindex_interface.c
1198 * src/frontends/gnome/diainsertindex_interface.h
1199 * src/frontends/gnome/diatoc_interface.h
1200 * src/frontends/gnome/diatoc_interface.c
1201 * src/frontends/gnome/Makefile.am: Table of Contents and
1202 Insert Index dialogs implementation for Gnome frontend
1204 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1206 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1208 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1211 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1213 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1214 destructor. Don't definde if you don't need it
1215 (processEvents): made static, non-blocking events processing for
1217 (runTime): static method. event loop for xforms
1218 * similar as above for kde and gnome.
1220 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1221 new Pimpl is correct
1222 (runTime): new method calss the real frontends runtime func.
1224 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1226 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1228 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1230 2000-08-16 Juergen Vigna <jug@sad.it>
1232 * src/lyx_gui.C (runTime): added GUII RunTime support.
1234 * src/frontends/Makefile.am:
1235 * src/frontends/GUIRunTime.[Ch]:
1236 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1237 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1238 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1240 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1242 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1243 as this is already set in ${FRONTEND_INCLUDE} if needed.
1245 * configure.in (CPPFLAGS): setting the include dir for the frontend
1246 directory and don't set FRONTEND=xforms for now as this is executed
1249 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1251 * src/frontends/kde/Makefile.am:
1252 * src/frontends/kde/FormUrl.C:
1253 * src/frontends/kde/FormUrl.h:
1254 * src/frontends/kde/formurldialog.h:
1255 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1257 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1259 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1261 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1263 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1266 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1268 * src/WorkArea.C (work_area_handler): more work to get te
1269 FL_KEYBOARD to work with xforms 0.88 too, please test.
1271 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1273 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1275 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1278 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1280 * src/Timeout.h: remove Qt::emit hack.
1282 * several files: changes to allo doc++ compilation
1284 * src/lyxfunc.C (processKeySym): new method
1285 (processKeyEvent): comment out if FL_REVISION < 89
1287 * src/WorkArea.C: change some debugging levels.
1288 (WorkArea): set wantkey to FL_KEY_ALL
1289 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1290 clearer code and the use of compose with XForms 0.89. Change to
1291 use signals instead of calling methods in bufferview directly.
1293 * src/Painter.C: change some debugging levels.
1295 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1298 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1299 (workAreaKeyPress): new method
1301 2000-08-14 Juergen Vigna <jug@sad.it>
1303 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1305 * config/kde.m4: addes some features
1307 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1308 include missing xforms dialogs.
1310 * src/Timeout.h: a hack to be able to compile with qt/kde.
1312 * sigc++/.cvsignore: added acinclude.m4
1314 * lib/.cvsignore: added listerros
1316 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1317 xforms tree as objects are needed for other frontends.
1319 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1320 linking with not yet implemented xforms objects.
1322 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1324 2000-08-14 Baruch Even <baruch.even@writeme.com>
1326 * src/frontends/xforms/FormGraphics.h:
1327 * src/frontends/xforms/FormGraphics.C:
1328 * src/frontends/xforms/RadioButtonGroup.h:
1329 * src/frontends/xforms/RadioButtonGroup.C:
1330 * src/insets/insetgraphics.h:
1331 * src/insets/insetgraphics.C:
1332 * src/insets/insetgraphicsParams.h:
1333 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1334 instead of spaces, and various other indentation issues to make the
1335 sources more consistent.
1337 2000-08-14 Marko Vendelin <markov@ioc.ee>
1339 * src/frontends/gnome/dialogs/diaprint.glade
1340 * src/frontends/gnome/FormPrint.C
1341 * src/frontends/gnome/FormPrint.h
1342 * src/frontends/gnome/diaprint_callbacks.c
1343 * src/frontends/gnome/diaprint_callbacks.h
1344 * src/frontends/gnome/diaprint_interface.c
1345 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1348 * src/frontends/gnome/dialogs/diainserturl.glade
1349 * src/frontends/gnome/FormUrl.C
1350 * src/frontends/gnome/FormUrl.h
1351 * src/frontends/gnome/diainserturl_callbacks.c
1352 * src/frontends/gnome/diainserturl_callbacks.h
1353 * src/frontends/gnome/diainserturl_interface.c
1354 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1355 Gnome implementation
1357 * src/frontends/gnome/Dialogs.C
1358 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1359 all other dialogs. Copy all unimplemented dialogs from Xforms
1362 * src/frontends/gnome/support.c
1363 * src/frontends/gnome/support.h: support files generated by Glade
1367 * config/gnome.m4: Gnome configuration scripts
1369 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1370 configure --help message
1372 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1373 only if there are no events pendling in Gnome/Gtk. This enhances
1374 the performance of menus.
1377 2000-08-14 Allan Rae <rae@lyx.org>
1379 * lib/Makefile.am: listerrors cleaning
1381 * lib/listerrors: removed -- generated file
1382 * acinclude.m4: ditto
1383 * sigc++/acinclude.m4: ditto
1385 * src/frontends/xforms/forms/form_citation.fd:
1386 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1389 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1390 `updatesrc` and now we have a `test` target that does what `updatesrc`
1391 used to do. I didn't like having an install target that wasn't related
1394 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1395 on all except FormGraphics. This may yet happen. Followed by a major
1396 cleanup including using FL_TRANSIENT for most of the dialogs. More
1397 changes to come when the ButtonController below is introduced.
1399 * src/frontends/xforms/ButtonController.h: New file for managing up to
1400 four buttons on a dialog according to an externally defined policy.
1401 * src/frontends/xforms/Makefile.am: added above
1403 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1404 Apply and Cancel/Close buttons and everything in between and beyond.
1405 * src/frontends/Makefile.am: added above.
1407 * src/frontends/xforms/forms/form_preferences.fd:
1408 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1409 and removed variable 'status' as a result. Fixed the set_minsize thing.
1410 Use the new screen-font-update after checking screen fonts were changed
1411 Added a "Restore" button to restore the original lyxrc values while
1412 editing. This restores everything not just the last input changed.
1413 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1415 * src/LyXAction.C: screen-font-update added for updating buffers after
1416 screen font settings have been changed.
1417 * src/commandtags.h: ditto
1418 * src/lyxfunc.C: ditto
1420 * forms/lyx.fd: removed screen fonts dialog.
1421 * src/lyx_gui.C: ditto
1422 * src/menus.[Ch]: ditto
1423 * src/lyx.[Ch]: ditto
1424 * src/lyx_cb.C: ditto + code from here moved to make
1425 screen-font-update. And people wonder why progress on GUII is
1426 slow. Look at how scattered this stuff was! It takes forever
1429 * forms/fdfix.sh: Fixup the spacing after commas.
1430 * forms/makefile: Remove date from generated files. Fewer clashes now.
1431 * forms/bullet_forms.C.patch: included someones handwritten changes
1433 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1434 once I've discovered why LyXRC was made noncopyable.
1435 * src/lyx_main.C: ditto
1437 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1439 * src/frontends/xforms/forms/fdfix.sh:
1440 * src/frontends/xforms/forms/fdfixh.sed:
1441 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1442 * src/frontends/xforms/Form*.[hC]:
1443 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1444 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1445 provide a destructor for the struct FD_form_xxxx. Another version of
1446 the set_[max|min]size workaround and a few other cleanups. Actually,
1447 Angus' patch from 20000809.
1449 2000-08-13 Baruch Even <baruch.even@writeme.com>
1451 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1454 2000-08-11 Juergen Vigna <jug@sad.it>
1456 * src/insets/insetgraphics.C (InsetGraphics): changing init
1457 order because of warnings.
1459 * src/frontends/xforms/forms/makefile: adding patching .C with
1462 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1463 from .C.patch to .c.patch
1465 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1466 order because of warning.
1468 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1470 * src/frontends/Liason.C (setMinibuffer): new helper function
1472 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1474 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1476 * lib/ui/default.ui: commented out PaperLayout entry
1478 * src/frontends/xforms/form_document.[Ch]: new added files
1480 * src/frontends/xforms/FormDocument.[Ch]: ditto
1482 * src/frontends/xforms/forms/form_document.fd: ditto
1484 * src/frontends/xforms/forms/form_document.C.patch: ditto
1486 2000-08-10 Juergen Vigna <jug@sad.it>
1488 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1489 (InsetGraphics): initialized cacheHandle to 0.
1490 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1492 2000-08-10 Baruch Even <baruch.even@writeme.com>
1494 * src/graphics/GraphicsCache.h:
1495 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1496 correctly as a cache.
1498 * src/graphics/GraphicsCacheItem.h:
1499 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1502 * src/graphics/GraphicsCacheItem_pimpl.h:
1503 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1506 * src/insets/insetgraphics.h:
1507 * src/insets/insetgraphics.C: Changed from using a signal notification
1508 to polling when image is not loaded.
1510 2000-08-10 Allan Rae <rae@lyx.org>
1512 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1513 that there are two functions that have to been taken out of line by
1514 hand and aren't taken care of in the script. (Just a reminder note)
1516 * sigc++/macros/*.h.m4: Updated as above.
1518 2000-08-09 Juergen Vigna <jug@sad.it>
1520 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1522 * src/insets/insettabular.C: make drawing of single cell smarter.
1524 2000-08-09 Marko Vendelin <markov@ioc.ee>
1525 * src/frontends/gnome/Menubar_pimpl.C
1526 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1527 implementation: new files
1529 * src/frontends/gnome/mainapp.C
1530 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1533 * src/main.C: create Gnome main window
1535 * src/frontends/xforms/Menubar_pimpl.h
1536 * src/frontends/Menubar.C
1537 * src/frontends/Menubar.h: added method Menubar::update that calls
1538 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1540 * src/LyXView.C: calls Menubar::update to update the state
1543 * src/frontends/gnome/Makefile.am: added new files
1545 * src/frontends/Makefile.am: added frontend compiler options
1547 2000-08-08 Juergen Vigna <jug@sad.it>
1549 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1551 * src/bufferlist.C (close):
1552 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1553 documents if exiting without saving.
1555 * src/buffer.C (save): use removeAutosaveFile()
1557 * src/support/filetools.C (removeAutosaveFile): new function.
1559 * src/lyx_cb.C (MenuWrite): returns a bool now.
1560 (MenuWriteAs): check if file could really be saved and revert to the
1562 (MenuWriteAs): removing old autosavefile if existant.
1564 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1565 before Goto toggle declaration, because of compiler warning.
1567 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1569 * src/lyxfunc.C (MenuNew): small fix.
1571 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1573 * src/bufferlist.C (newFile):
1574 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1576 * src/lyxrc.C: added new_ask_filename tag
1578 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/lyx.fd: removed code pertaining to form_ref
1581 * src/lyx.[Ch]: ditto
1582 * src/lyx_cb.C: ditto
1583 * src/lyx_gui.C: ditto
1584 * src/lyx_gui_misc.C: ditto
1586 * src/BufferView_pimpl.C (restorePosition): update buffer only
1589 * src/commandtags.h (LFUN_REFTOGGLE): removed
1590 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1591 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1592 (LFUN_REFBACK): renamed LFUN_REF_BACK
1594 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1595 * src/menus.C: ditto
1596 * src/lyxfunc.C (Dispatch): ditto.
1597 InsertRef dialog is now GUI-independent.
1599 * src/texrow.C: added using std::endl;
1601 * src/insets/insetref.[Ch]: strip out large amounts of code.
1602 The inset is now a container and this functionality is now
1603 managed by a new FormRef dialog
1605 * src/frontends/Dialogs.h (showRef, createRef): new signals
1607 * src/frontends/xforms/FormIndex.[Ch],
1608 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1609 when setting dialog's min/max size
1610 * src/frontends/xforms/FormIndex.[Ch]: ditto
1612 * src/frontends/xforms/FormRef.[Ch],
1613 src/frontends/xforms/forms/form_ref.fd: new xforms
1614 implementation of an InsetRef dialog
1616 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1619 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1620 ios::nocreate is not part of the standard. Removed.
1622 2000-08-07 Baruch Even <baruch.even@writeme.com>
1624 * src/graphics/Renderer.h:
1625 * src/graphics/Renderer.C: Added base class for rendering of different
1626 image formats into Pixmaps.
1628 * src/graphics/XPM_Renderer.h:
1629 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1630 in a different class.
1632 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1633 easily add support for other formats.
1635 * src/insets/figinset.C: plugged a leak of an X resource.
1637 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1639 * src/CutAndPaste.[Ch]: make all metods static.
1641 * development/Code_rules/Rules: more work, added section on
1642 Exceptions, and a References section.
1644 * a lot of header files: work to make doc++ able to generate the
1645 source documentation, some workarounds of doc++ problems. Doc++ is
1646 now able to generate the documentation.
1648 2000-08-07 Juergen Vigna <jug@sad.it>
1650 * src/insets/insettabular.C (recomputeTextInsets): removed function
1652 * src/tabular.C (SetWidthOfMulticolCell):
1654 (calculate_width_of_column_NMC): fixed return value so that it really
1655 only returns true if the column-width has changed (there where
1656 problems with muliticolumn-cells in this column).
1658 2000-08-04 Juergen Vigna <jug@sad.it>
1660 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1661 also on the scrollstatus of the inset.
1662 (workAreaMotionNotify): ditto.
1664 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1666 2000-08-01 Juergen Vigna <jug@sad.it>
1668 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1670 * src/commandtags.h:
1671 * src/LyXAction.C (init):
1672 * src/insets/inset.C (LocalDispatch): added support for
1675 * src/insets/inset.C (scroll): new functions.
1677 * src/insets/insettext.C (removeNewlines): new function.
1678 (SetAutoBreakRows): removes forced newlines in the text of the
1679 paragraph if autoBreakRows is set to false.
1681 * src/tabular.C (Latex): generates a parbox around the cell contents
1684 * src/frontends/xforms/FormTabular.C (local_update): removed
1685 the radio_useparbox button.
1687 * src/tabular.C (UseParbox): new function
1689 2000-08-06 Baruch Even <baruch.even@writeme.com>
1691 * src/graphics/GraphicsCache.h:
1692 * src/graphics/GraphicsCache.C:
1693 * src/graphics/GraphicsCacheItem.h:
1694 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1697 * src/insets/insetgraphics.h:
1698 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1699 drawing of the inline image.
1701 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1702 into the wrong position.
1704 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1707 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1709 * src/support/translator.h: move all typedefs to public section
1711 * src/support/filetools.C (MakeLatexName): return string const
1713 (TmpFileName): ditto
1714 (FileOpenSearch): ditto
1716 (LibFileSearch): ditto
1717 (i18nLibFileSearch): ditto
1720 (CreateTmpDir): ditto
1721 (CreateBufferTmpDir): ditto
1722 (CreateLyXTmpDir): ditto
1725 (MakeAbsPath): ditto
1727 (OnlyFilename): ditto
1729 (NormalizePath): ditto
1730 (CleanupPath): ditto
1731 (GetFileContents): ditto
1732 (ReplaceEnvironmentPath): ditto
1733 (MakeRelPath): ditto
1735 (ChangeExtension): ditto
1736 (MakeDisplayPath): ditto
1737 (do_popen): return cmdret const
1738 (findtexfile): return string const
1740 * src/support/DebugStream.h: add some /// to please doc++
1742 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1744 * src/texrow.C (same_rownumber): functor to use with find_if
1745 (getIdFromRow): rewritten to use find_if and to not update the
1746 positions. return true if row is found
1747 (increasePos): new method, use to update positions
1749 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1751 * src/lyxlex_pimpl.C (verifyTable): new method
1754 (GetString): return string const
1755 (pushTable): rewrite to use std::stack
1757 (setFile): better check
1760 * src/lyxlex.h: make LyXLex noncopyable
1762 * src/lyxlex.C (text): return char const * const
1763 (GetString): return string const
1764 (getLongString): return string const
1766 * src/lyx_gui_misc.C (askForText): return pair<...> const
1768 * src/lastfiles.[Ch] (operator): return string const
1770 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1771 istringstream not char const *.
1772 move token.end() out of loop.
1773 (readFile): move initializaton of token
1775 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1776 getIdFromRow is successful.
1778 * lib/bind/emacs.bind: don't include menus bind
1780 * development/Code_rules/Rules: the beginnings of making this
1781 better and covering more of the unwritten rules that we have.
1783 * development/Code_rules/Recommendations: a couple of wording
1786 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1788 * src/support/strerror.c: remove C++ comment.
1790 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1792 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1793 LFUN_INDEX_INSERT_LAST
1795 * src/texrow.C (getIdFromRow): changed from const_iterator to
1796 iterator, allowing code to compile with DEC cxx
1798 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1799 stores part of the class, as suggested by Allan. Will allow
1801 (apply): test to apply uses InsetCommandParams operator!=
1803 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1804 (apply): test to apply uses InsetCommandParams operator!=
1806 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1807 stores part of the class.
1808 (update): removed limits on min/max size.
1810 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1811 (apply): test to apply uses InsetCommandParams operator!=
1813 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1814 (Read, Write, scanCommand, getCommand): moved functionality
1815 into InsetCommandParams.
1817 (getScreenLabel): made pure virtual
1818 new InsetCommandParams operators== and !=
1820 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1821 c-tors based on InsetCommandParams. Removed others.
1822 * src/insets/insetinclude.[Ch]: ditto
1823 * src/insets/insetlabel.[Ch]: ditto
1824 * src/insets/insetparent.[Ch]: ditto
1825 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1827 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1828 insets derived from InsetCommand created using similar c-tors
1829 based on InsetCommandParams
1830 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1831 * src/menus.C (ShowRefsMenu): ditto
1832 * src/paragraph.C (Clone): ditto
1833 * src/text2.C (SetCounter): ditto
1834 * src/lyxfunc.C (Dispatch) ditto
1835 Also recreated old InsetIndex behaviour exactly. Can now
1836 index-insert at the start of a paragraph and index-insert-last
1837 without launching the pop-up.
1839 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1841 * lib/lyxrc.example: mark te pdf options as non functional.
1843 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1844 (isStrDbl): move tmpstr.end() out of loop.
1845 (strToDbl): move intialization of tmpstr
1846 (lowercase): return string const and move tmp.end() out of loop.
1847 (uppercase): return string const and move tmp.edn() out of loop.
1848 (prefixIs): add assertion
1853 (containsOnly): ditto
1854 (containsOnly): ditto
1855 (containsOnly): ditto
1856 (countChar): make last arg char not char const
1857 (token): return string const
1858 (subst): return string const, move tmp.end() out of loop.
1859 (subst): return string const, add assertion
1860 (strip): return string const
1861 (frontStrip): return string const, add assertion
1862 (frontStrip): return string const
1867 * src/support/lstrings.C: add inclde "LAssert.h"
1868 (isStrInt): move tmpstr.end() out of loop.
1870 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1871 toollist.end() out of loop.
1872 (deactivate): move toollist.end() out of loop.
1873 (update): move toollist.end() out of loop.
1874 (updateLayoutList): move tc.end() out of loop.
1875 (add): move toollist.end() out of loop.
1877 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1878 md.end() out of loop.
1880 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1882 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1885 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1886 (Erase): move insetlist.end() out of loop.
1888 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1889 ref to const string as first arg. Move initialization of some
1890 variables, whitespace changes.
1892 * src/kbmap.C (defkey): move table.end() out of loop.
1893 (kb_keymap): move table.end() out of loop.
1894 (findbinding): move table.end() out of loop.
1896 * src/MenuBackend.C (hasMenu): move end() out of loop.
1897 (getMenu): move end() out of loop.
1898 (getMenu): move menulist_.end() out of loop.
1900 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1902 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1905 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1906 (getFromLyXName): move infotab.end() out of loop.
1908 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1909 -fvtable-thunks -ffunction-sections -fdata-sections
1911 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1913 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1916 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1918 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1920 * src/frontends/xforms/FormCitation.[Ch],
1921 src/frontends/xforms/FormIndex.[Ch],
1922 src/frontends/xforms/FormToc.[Ch],
1923 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1925 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1927 * src/commandtags.h: renamed, created some flags for citation
1930 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1932 * src/lyxfunc.C (dispatch): use signals to insert index entry
1934 * src/frontends/Dialogs.h: new signal createIndex
1936 * src/frontends/xforms/FormCommand.[Ch],
1937 src/frontends/xforms/FormCitation.[Ch],
1938 src/frontends/xforms/FormToc.[Ch],
1939 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1941 * src/insets/insetindex.[Ch]: GUI-independent
1943 * src/frontends/xforms/FormIndex.[Ch],
1944 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1947 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1949 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1950 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1952 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1954 * src/insets/insetref.C (Latex): rewrite so that there is now
1955 question that a initialization is requested.
1957 * src/insets/insetcommand.h: reenable the hide signal
1959 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1961 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1962 fix handling of shortcuts (many bugs :)
1963 (add_lastfiles): ditto.
1965 * lib/ui/default.ui: fix a few shortcuts.
1967 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1969 * Makefile.am: Fix ``rpmdist'' target to return the exit
1970 status of the ``rpm'' command, instead of the last command in
1971 the chain (the ``rm lyx.xpm'' command, which always returns
1974 2000-08-02 Allan Rae <rae@lyx.org>
1976 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1977 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1978 * src/frontends/xforms/FormToc.C (FormToc): ditto
1980 * src/frontends/xforms/Makefile.am: A few forgotten files
1982 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1983 Signals-not-copyable-problem Lars' started commenting out.
1985 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1987 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1989 * src/insets/insetcommand.h: Signals is not copyable so anoter
1990 scheme for automatic hiding of forms must be used.
1992 * src/frontends/xforms/FormCitation.h: don't inerit from
1993 noncopyable, FormCommand already does that.
1994 * src/frontends/xforms/FormToc.h: ditto
1995 * src/frontends/xforms/FormUrl.h: ditto
1997 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1999 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2001 * src/insets/insetcommand.h (hide): new SigC::Signal0
2002 (d-tor) new virtual destructor emits hide signal
2004 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2005 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2007 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2008 LOF and LOT. Inset is now GUI-independent
2010 * src/insets/insetloa.[Ch]: redundant
2011 * src/insets/insetlof.[Ch]: ditto
2012 * src/insets/insetlot.[Ch]: ditto
2014 * src/frontends/xforms/forms/form_url.fd: tweaked!
2015 * src/frontends/xforms/forms/form_citation.fd: ditto
2017 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2018 dialogs dealing with InsetCommand insets
2020 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2021 FormCommand base class
2022 * src/frontends/xforms/FormUrl.[Ch]: ditto
2024 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2026 * src/frontends/xforms/FormToc.[Ch]: ditto
2028 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2029 passed a generic InsetCommand pointer
2030 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2032 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2033 and modified InsetTOC class
2034 * src/buffer.C: ditto
2036 * forms/lyx.fd: strip out old FD_form_toc code
2037 * src/lyx_gui_misc.C: ditto
2038 * src/lyx_gui.C: ditto
2039 * src/lyx_cb.C: ditto
2040 * src/lyx.[Ch]: ditto
2042 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2044 * src/support/utility.hpp: tr -d '\r'
2046 2000-08-01 Juergen Vigna <jug@sad.it>
2048 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2050 * src/commandtags.h:
2051 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2052 LFUN_TABULAR_FEATURES.
2054 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2055 LFUN_LAYOUT_TABULAR.
2057 * src/insets/insettabular.C (getStatus): implemented helper function.
2059 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2061 2000-07-31 Juergen Vigna <jug@sad.it>
2063 * src/text.C (draw): fixed screen update problem for text-insets.
2065 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2066 something changed probably this has to be added in various other
2069 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2071 2000-07-31 Baruch Even <baruch.even@writeme.com>
2073 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2074 templates to satisfy compaq cxx.
2077 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2079 * src/support/translator.h (equal_1st_in_pair::operator()): take
2080 const ref pair_type as arg.
2081 (equal_2nd_in_pair::operator()): ditto
2082 (Translator::~Translator): remove empty d-tor.
2084 * src/graphics/GraphicsCache.C: move include config.h to top, also
2085 put initialization of GraphicsCache::singleton here.
2086 (~GraphicsCache): move here
2087 (addFile): take const ref as arg
2090 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2092 * src/BufferView2.C (insertLyXFile): change te with/without header
2095 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2097 * src/frontends/xforms/FormGraphics.C (apply): add some
2098 static_cast. Not very nice, but required by compaq cxx.
2100 * src/frontends/xforms/RadioButtonGroup.h: include header
2101 <utility> instead of <pair.h>
2103 * src/insets/insetgraphicsParams.C: add using directive.
2104 (readResize): change return type to void.
2105 (readOrigin): ditto.
2107 * src/lyxfunc.C (getStatus): add missing break for build-program
2108 function; add test for Literate for export functions.
2110 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2111 entries in Options menu.
2113 2000-07-31 Baruch Even <baruch.even@writeme.com>
2115 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2116 protect against auto-allocation; release icon when needed.
2118 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2120 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2121 on usual typewriter.
2123 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2124 earlier czech.kmap), useful only for programming.
2126 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2128 * src/frontends/xforms/FormCitation.h: fix conditioning around
2131 2000-07-31 Juergen Vigna <jug@sad.it>
2133 * src/frontends/xforms/FormTabular.C (local_update): changed
2134 radio_linebreaks to radio_useparbox and added radio_useminipage.
2136 * src/tabular.C: made support for using minipages/parboxes.
2138 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2140 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2142 (descent): so the cursor is in the middle.
2143 (width): bit smaller box.
2145 * src/insets/insetgraphics.h: added display() function.
2147 2000-07-31 Baruch Even <baruch.even@writeme.com>
2149 * src/frontends/Dialogs.h: Added showGraphics signals.
2151 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2152 xforms form definition of the graphics dialog.
2154 * src/frontends/xforms/FormGraphics.h:
2155 * src/frontends/xforms/FormGraphics.C: Added files, the
2156 GUIndependent code of InsetGraphics
2158 * src/insets/insetgraphics.h:
2159 * src/insets/insetgraphics.C: Major writing to make it work.
2161 * src/insets/insetgraphicsParams.h:
2162 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2163 struct between InsetGraphics and GUI.
2165 * src/LaTeXFeatures.h:
2166 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2167 support for graphicx package.
2169 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2170 for the graphics inset.
2172 * src/support/translator.h: Added file, used in
2173 InsetGraphicsParams. this is a template to translate between two
2176 * src/frontends/xforms/RadioButtonGroup.h:
2177 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2178 way to easily control a radio button group.
2180 2000-07-28 Juergen Vigna <jug@sad.it>
2182 * src/insets/insettabular.C (LocalDispatch):
2183 (TabularFeatures): added support for lyx-functions of tabular features.
2184 (cellstart): refixed this function after someone wrongly changed it.
2186 * src/commandtags.h:
2187 * src/LyXAction.C (init): added support for tabular-features
2189 2000-07-28 Allan Rae <rae@lyx.org>
2191 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2192 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2193 triggers the callback for input checking. As a result we sometimes get
2194 "LyX: This shouldn't happen..." printed to cerr.
2195 (input): Started using status variable since I only free() on
2196 destruction. Some input checking for paths and font sizes.
2198 * src/frontends/xforms/FormPreferences.h: Use status to control
2199 activation of Ok and Apply
2201 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2202 callback. Also resized to stop segfaults with 0.88. The problem is
2203 that xforms-0.88 requires the folder to be wide enough to fit all the
2204 tabs. If it isn't it causes all sorts of problems.
2206 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2208 * src/frontends/xforms/forms/README: Reflect reality.
2210 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2211 * src/frontends/xforms/forms/makefile: ditto.
2213 * src/commandtags.h: Get access to new Preferences dialog
2214 * src/LyXAction.C: ditto
2215 * src/lyxfunc.C: ditto
2216 * lib/ui/default.ui: ditto
2218 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2220 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2222 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2225 * src/frontends/xforms/form_url.[Ch]: added.
2227 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2229 * src/insets/insetbib.h: fixed bug in previous commit
2231 * src/frontends/xforms/FormUrl.h: ditto
2233 * src/frontends/xforms/FormPrint.h: ditto
2235 * src/frontends/xforms/FormPreferences.h: ditto
2237 * src/frontends/xforms/FormCopyright.h: ditto
2239 * src/frontends/xforms/FormCitation.C: ditto
2241 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2242 private copyconstructor and private default contructor
2244 * src/support/Makefile.am: add utility.hpp
2246 * src/support/utility.hpp: new file from boost
2248 * src/insets/insetbib.h: set owner in clone
2250 * src/frontends/xforms/FormCitation.C: added missing include
2253 * src/insets/form_url.[Ch]: removed
2255 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2257 * development/lyx.spec.in
2258 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2259 file/directory re-organization.
2261 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2263 * src/insets/insetcommand.[Ch]: moved the string data and
2264 associated manipulation methods into a new stand-alone class
2265 InsetCommandParams. This class has two additional methods
2266 getAsString() and setFromString() allowing the contents to be
2267 moved around as a single string.
2268 (addContents) method removed.
2269 (setContents) method no longer virtual.
2271 * src/buffer.C (readInset): made use of new InsetCitation,
2272 InsetUrl constructors based on InsetCommandParams.
2274 * src/commandtags.h: add LFUN_INSERT_URL
2276 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2277 independent InsetUrl and use InsetCommandParams to extract
2278 string info and create new Insets.
2280 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2282 * src/frontends/xforms/FormCitation.C (apply): uses
2285 * src/frontends/xforms/form_url.C
2286 * src/frontends/xforms/form_url.h
2287 * src/frontends/xforms/FormUrl.h
2288 * src/frontends/xforms/FormUrl.C
2289 * src/frontends/xforms/forms/form_url.fd: new files
2291 * src/insets/insetcite.[Ch]: removed unused constructors.
2293 * src/insets/insetinclude.[Ch]: no longer store filename
2295 * src/insets/inseturl.[Ch]: GUI-independent.
2297 2000-07-26 Juergen Vigna <jug@sad.it>
2298 * renamed frontend from gtk to gnome as it is that what is realized
2299 and did the necessary changes in the files.
2301 2000-07-26 Marko Vendelin <markov@ioc.ee>
2303 * configure.in: cleaning up gnome configuration scripts
2305 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2307 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2308 shortcuts syndrom by redrawing them explicitely (a better solution
2309 would be appreciated).
2311 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2313 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2316 * src/lyx_cb.C (MenuExport): change html export to do the right
2317 thing depending of the document type (instead of having
2318 html-linuxdoc and html-docbook).
2319 * src/lyxfunc.C (getStatus): update for html
2320 * lib/ui/default.ui: simplify due to the above change.
2321 * src/menus.C (ShowFileMenu): update too (in case we need it).
2323 * src/MenuBackend.C (read): if a menu is defined twice, add the
2324 new entries to the exiting one.
2326 2000-07-26 Juergen Vigna <jug@sad.it>
2328 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2330 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2331 and return a bool if it did actual save the file.
2332 (AutoSave): don't autosave a unnamed doc.
2334 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2335 check if this is an UNNAMED new file and react to it.
2336 (newFile): set buffer to unnamed and change to not mark a new
2337 buffer dirty if I didn't do anything with it.
2339 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2341 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2343 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2344 friend as per Angus's patch posted to lyx-devel.
2346 * src/ext_l10n.h: updated
2348 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2349 gettext on the style string right before inserting them into the
2352 * autogen.sh: add code to extract style strings form layout files,
2353 not good enough yet.
2355 * src/frontends/gtk/.cvsignore: add MAKEFILE
2357 * src/MenuBackend.C (read): run the label strings through gettext
2358 before storing them in the containers.
2360 * src/ext_l10n.h: new file
2362 * autogen.sh : generate the ext_l10n.h file here
2364 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2366 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2369 * lib/ui/default.ui: fix a couple of typos.
2371 * config/gnome/gtk.m4: added (and added to the list of files in
2374 * src/insets/insetinclude.C (unique_id): fix when we are using
2375 lyxstring instead of basic_string<>.
2376 * src/insets/insettext.C (LocalDispatch): ditto.
2377 * src/support/filetools.C: ditto.
2379 * lib/configure.m4: create the ui/ directory if necessary.
2381 * src/LyXView.[Ch] (updateToolbar): new method.
2383 * src/BufferView_pimpl.C (buffer): update the toolbar when
2384 opening/closing buffer.
2386 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2388 * src/LyXAction.C (getActionName): enhance to return also the name
2389 and options of pseudo-actions.
2390 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2392 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2393 as an example of what is possible). Used in File->Build too (more
2394 useful) and in the import/export menus (to mimick the complicated
2395 handling of linuxdoc and friends). Try to update all the entries.
2397 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2400 * src/MenuBackend.C (read): Parse the new OptItem tag.
2402 * src/MenuBackend.h: Add a new optional_ data member (used if the
2403 entry should be omitted when the lyxfunc is disabled).
2405 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2406 function, used as a shortcut.
2407 (create_submenu): align correctly the shortcuts on the widest
2410 * src/MenuBackend.h: MenuItem.label() only returns the label of
2411 the menu without shortcut; new method shortcut().
2413 2000-07-14 Marko Vendelin <markov@ioc.ee>
2415 * src/frontends/gtk/Dialogs.C:
2416 * src/frontends/gtk/FormCopyright.C:
2417 * src/frontends/gtk/FormCopyright.h:
2418 * src/frontends/gtk/Makefile.am: added these source-files for the
2419 Gtk/Gnome support of the Copyright-Dialog.
2421 * src/main.C: added Gnome::Main initialization if using
2422 Gtk/Gnome frontend-GUI.
2424 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2426 * config/gnome/aclocal-include.m4
2427 * config/gnome/compiler-flags.m4
2428 * config/gnome/curses.m4
2429 * config/gnome/gnome--.m4
2430 * config/gnome/gnome-bonobo-check.m4
2431 * config/gnome/gnome-common.m4
2432 * config/gnome/gnome-fileutils.m4
2433 * config/gnome/gnome-ghttp-check.m4
2434 * config/gnome/gnome-gnorba-check.m4
2435 * config/gnome/gnome-guile-checks.m4
2436 * config/gnome/gnome-libgtop-check.m4
2437 * config/gnome/gnome-objc-checks.m4
2438 * config/gnome/gnome-orbit-check.m4
2439 * config/gnome/gnome-print-check.m4
2440 * config/gnome/gnome-pthread-check.m4
2441 * config/gnome/gnome-support.m4
2442 * config/gnome/gnome-undelfs.m4
2443 * config/gnome/gnome-vfs.m4
2444 * config/gnome/gnome-x-checks.m4
2445 * config/gnome/gnome-xml-check.m4
2446 * config/gnome/gnome.m4
2447 * config/gnome/gperf-check.m4
2448 * config/gnome/gtk--.m4
2449 * config/gnome/linger.m4
2450 * config/gnome/need-declaration.m4: added configuration scripts
2451 for Gtk/Gnome frontend-GUI
2453 * configure.in: added support for the --with-frontend=gtk option
2455 * autogen.sh: added config/gnome/* to list of config-files
2457 * acconfig.h: added define for GTKGUI-support
2459 * config/lyxinclude.m4: added --with-frontend[=value] option value
2460 for Gtk/Gnome frontend-GUI support.
2462 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2464 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2468 * src/paragraph.C (GetChar): remove non-const version
2470 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2471 (search_kw): use it.
2473 * src/lyx_main.C (init): if "preferences" exist, read that instead
2475 (ReadRcFile): return bool if the file could be read ok.
2476 (ReadUIFile): add a check to see if lex file is set ok.
2478 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2479 bastring can be used instead of lyxstring (still uses the old code
2480 if std::string is good enough or if lyxstring is used.)
2482 * src/encoding.C: make the arrays static, move ininle functions
2484 * src/encoding.h: from here.
2486 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2487 (parseSingleLyXformat2Token): move inset parsing to separate method
2488 (readInset): new private method
2490 * src/Variables.h: remove virtual from get().
2492 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2493 access to NEW_INSETS and NEW_TABULAR
2495 * src/MenuBackend.h: remove superfluous forward declaration of
2496 MenuItem. Add documentations tags "///", remove empty MenuItem
2497 destructor, remove private default contructor.
2499 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2501 (read): more string mlabel and mname to where they are used
2502 (read): remove unused variables mlabel and mname
2503 (defaults): unconditional clear, make menusetup take advantage of
2504 add returning Menu &.
2506 * src/LyXView.h: define NEW_MENUBAR as default
2508 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2509 to NEW_INSETS and NEW_TABULAR.
2510 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2511 defined. Change some of the "xxxx-inset-insert" functions names to
2514 * several files: more enahncements to NEW_INSETS and the resulting
2517 * lib/lyxrc.example (\date_insert_format): move to misc section
2519 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2520 bastring and use AC_CACHE_CHECK.
2521 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2522 the system have the newest methods. uses AC_CACHE_CHECK
2523 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2524 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2525 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2527 * configure.in: add LYX_CXX_GOOD_STD_STRING
2529 * acinclude.m4: recreated
2531 2000-07-24 Amir Karger
2533 * README: add Hebrew, Arabic kmaps
2536 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2538 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2541 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2543 * Lot of files: add pragma interface/implementation.
2545 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2547 * lib/ui/default.ui: new file (ans new directory). Contains the
2548 default menu and toolbar.
2550 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2551 global space. Toolbars are now read (as menus) in ui files.
2553 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2555 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2556 is disabled because the document is read-only. We want to have the
2557 toggle state of the function anyway.
2558 (getStatus): add code for LFUN_VC* functions (mimicking what is
2559 done in old-style menus)
2561 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2562 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2564 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2565 * src/BufferView_pimpl.C: ditto.
2566 * src/lyxfunc.C: ditto.
2568 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2569 default). This replaces old-style menus by new ones.
2571 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2572 MenuItem. Contain the data structure of a menu.
2574 * src/insets/insettext.C: use LyXView::setLayout instead of
2575 accessing directly the toolbar combox.
2576 * src/lyxfunc.C (Dispatch): ditto.
2578 * src/LyXView.C (setLayout): new method, which just calls
2579 Toolbar::setLayout().
2580 (updateLayoutChoice): move part of this method in Toolbar.
2582 * src/toolbar.[Ch]: removed.
2584 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2585 implementation the toolbar.
2587 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2588 the toolbar. It might make sense to merge it with ToolbarDefaults
2590 (setLayout): new function.
2591 (updateLayoutList): ditto.
2592 (openLayoutList): ditto.
2594 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2595 xforms implementation of the toolbar.
2596 (get_toolbar_func): comment out, since I do not
2597 know what it is good for.
2599 * src/ToolbarDefaults.h: Add the ItemType enum.
2601 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2602 for a list of allocated C strings. Used in Menubar xforms
2603 implementation to avoid memory leaks.
2605 * src/support/lstrings.[Ch] (uppercase): new version taking and
2609 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2610 * lib/bind/emacs.bind: ditto.
2612 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2614 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2615 forward decl of LyXView.
2617 * src/toolbar.C (toolbarItem): moved from toolbar.h
2618 (toolbarItem::clean): ditto
2619 (toolbarItem::~toolbarItem): ditto
2620 (toolbarItem::operator): ditto
2622 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2624 * src/paragraph.h: control the NEW_TABULAR define from here
2626 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2627 USE_TABULAR_INSETS to NEW_TABULAR
2629 * src/ToolbarDefaults.C: add include "lyxlex.h"
2631 * files using the old table/tabular: use NEW_TABULAR to control
2632 compilation of old tabular stuff.
2634 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2637 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2638 planemet in reading of old style floats, fix the \end_deeper
2639 problem when reading old style floats.
2641 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2643 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2645 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2647 * lib/bind/sciword.bind: updated.
2649 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2651 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2652 layout write problem
2654 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2656 * src/Makefile.am (INCLUDES): remove image directory from include
2659 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2660 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2662 * src/LyXView.C (create_form_form_main): read the application icon
2665 * lib/images/*.xpm: change the icons to use transparent color for
2668 * src/toolbar.C (update): change the color of the button when it
2671 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2673 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2674 setting explicitely the minibuffer.
2675 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2677 * src/LyXView.C (showState): new function. Shows font information
2678 in minibuffer and update toolbar state.
2679 (LyXView): call Toolbar::update after creating the
2682 * src/toolbar.C: change toollist to be a vector instead of a
2684 (BubbleTimerCB): get help string directly from the callback
2685 argument of the corresponding icon (which is the action)
2686 (set): remove unnecessary ugliness.
2687 (update): new function. update the icons (depressed, disabled)
2688 depending of the status of the corresponding action.
2690 * src/toolbar.h: remove help in toolbarItem
2692 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2694 * src/Painter.C (text): Added code for using symbol glyphs from
2695 iso10646 fonts. Currently diabled.
2697 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2700 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2701 magyar,turkish and usorbian.
2703 * src/paragraph.C (isMultiLingual): Made more efficient.
2705 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2708 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2709 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2710 Also changed the prototype to "bool math_insert_greek(char)".
2712 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2714 * lots of files: apply the NEW_INSETS on all code that will not be
2715 needed when we move to use the new insets. Enable the define in
2716 lyxparagrah.h to try it.
2718 * src/insets/insettabular.C (cellstart): change to be a static
2720 (InsetTabular): initialize buffer in the initializer list.
2722 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2724 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2725 form_print.h out of the header file. Replaced with forward
2726 declarations of the relevant struct.
2728 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2731 * src/commandtags.h: do not include "debug.h" which does not
2732 belong there. #include it in some other places because of this
2735 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2737 * src/insets/insetcaption.C: add a couple "using" directives.
2739 * src/toolbar.C (add): get the help text directly from lyxaction.
2741 (setPixmap): new function. Loads from disk and sets a pixmap on a
2742 botton; the name of the pixmap file is derived from the command
2745 * src/toolbar.h: remove members isBitmap and pixmap from
2748 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2749 * lib/images/: move many files from images/banner.xpm.
2751 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2753 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2754 * src/toolbar.C: ditto.
2755 * configure.in: ditto.
2756 * INSTALL: document.
2758 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2759 the spellchecker popup is closed from the WM.
2761 2000-07-19 Juergen Vigna <jug@sad.it>
2763 * src/insets/insetfloat.C (Write): small fix because we use the
2764 insetname for the type now!
2766 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2768 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2771 * src/frontends/Dialogs.h: removed hideCitation signal
2773 * src/insets/insetcite.h: added hide signal
2775 * src/insets/insetcite.C (~InsetCitation): emits new signal
2776 (getScreenLabel): "intelligent" label should now fit on the screen!
2778 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2780 * src/frontends/xforms/FormCitation.C (showInset): connects
2781 hide() to the inset's hide signal
2782 (show): modified to use fl_set_object_position rather than
2783 fl_set_object_geometry wherever possible
2785 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2787 * src/insets/lyxinset.h: add caption code
2789 * src/insets/insetfloat.C (type): new method
2791 * src/insets/insetcaption.C (Write): new method
2793 (LyxCode): new method
2795 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2796 to get it right together with using the FloatList.
2798 * src/commandtags.h: add LFUN_INSET_CAPTION
2799 * src/lyxfunc.C (Dispatch): handle it
2801 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2804 * src/Variables.[Ch]: make expand take a const reference, remove
2805 the destructor, some whitespace changes.
2807 * src/LyXAction.C (init): add caption-inset-insert
2809 * src/FloatList.C (FloatList): update the default floats a bit.
2811 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2813 * src/Variables.[Ch]: new files. Intended to be used for language
2814 specific strings (like \chaptername) and filename substitution in
2817 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2819 * lib/kbd/american.kmap: update
2821 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2823 * src/bufferparams.[Ch]: remove member allowAccents.
2825 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2827 * src/LaTeXLog.C: use the log_form.h header.
2828 * src/lyx_gui.C: ditto.
2829 * src/lyx_gui_misc.C: ditto.
2830 * src/lyxvc.h: ditto.
2832 * forms/log_form.fd: new file, created from latexoptions.fd. I
2833 kept the log popup and nuked the options form.
2835 * src/{la,}texoptions.[Ch]: removed.
2836 * src/lyx_cb.C (LaTeXOptions): ditto
2838 * src/lyx_gui.C (create_forms): do not handle the
2839 fd_latex_options form.
2841 2000-07-18 Juergen Vigna <jug@sad.it>
2843 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2844 name of the inset so that it can be requested outside (text2.C).
2846 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2849 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2851 * src/mathed/formula.h (ConvertFont): constify
2853 * src/mathed/formula.C (Read): add warning if \end_inset is not
2854 found on expected place.
2856 * src/insets/lyxinset.h (ConvertFont): consify
2858 * src/insets/insetquotes.C (ConvertFont): constify
2859 * src/insets/insetquotes.h: ditto
2861 * src/insets/insetinfo.h: add labelfont
2863 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2864 (ascent): use labelfont
2868 (Write): make .lyx file a bit nicer
2870 * src/insets/insetfloat.C (Write): simplify somewhat...
2871 (Read): add warning if arg is not found
2873 * src/insets/insetcollapsable.C: add using std::max
2874 (Read): move string token and add warning in arg is not found
2875 (draw): use std::max to get the right ty
2876 (getMaxWidth): simplify by using std::max
2878 * src/insets/insetsection.h: new file
2879 * src/insets/insetsection.C: new file
2880 * src/insets/insetcaption.h: new file
2881 * src/insets/insetcaption.C: new file
2883 * src/insets/inset.C (ConvertFont): constify signature
2885 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2886 insetcaption.[Ch] and insetsection.[Ch]
2888 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2889 uses to use LABEL_COUNTER_CHAPTER instead.
2890 * src/text2.C (SetCounter): here
2892 * src/counters.h: new file
2893 * src/counters.C: new file
2894 * src/Sectioning.h: new file
2895 * src/Sectioning.C: new file
2897 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2899 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2901 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2904 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2907 2000-07-17 Juergen Vigna <jug@sad.it>
2909 * src/tabular.C (Validate): check if array-package is needed.
2910 (SetVAlignment): added support for vertical alignment.
2911 (SetLTFoot): better support for longtable header/footers
2912 (Latex): modified to support added features.
2914 * src/LaTeXFeatures.[Ch]: added array-package.
2916 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2918 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2921 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2923 * configure.in: do not forget to put a space after -isystem.
2925 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2927 * lib/kbd/arabic.kmap: a few fixes.
2929 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2931 * some whitespace chagnes to a number of files.
2933 * src/support/DebugStream.h: change to make it easier for
2934 doc++ to parse correctly.
2935 * src/support/lyxstring.h: ditto
2937 * src/mathed/math_utils.C (compara): change to have only one
2939 (MathedLookupBOP): change because of the above.
2941 * src/mathed/math_delim.C (math_deco_compare): change to have only
2943 (search_deco): change becasue of the above.
2945 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2946 instead of manually coded one.
2948 * src/insets/insetquotes.C (Read): read the \end_inset too
2950 * src/insets/insetlatex.h: remove file
2951 * src/insets/insetlatex.C: remove file
2953 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2955 (InsetPrintIndex): remove destructor
2957 * src/insets/insetinclude.h: remove default constructor
2959 * src/insets/insetfloat.C: work to make it work better
2961 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2963 * src/insets/insetcite.h (InsetCitation): remove default constructor
2965 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2967 * src/text.C (GetColumnNearX): comment out some currently unused code.
2969 * src/paragraph.C (writeFile): move some initializations closer to
2971 (CutIntoMinibuffer): small change to use new matchIT operator
2975 (InsertInset): ditto
2978 (InsetIterator): ditto
2979 (Erase): small change to use new matchFT operator
2981 (GetFontSettings): ditto
2982 (HighestFontInRange): ditto
2985 * src/lyxparagraph.h: some chars changed to value_type
2986 (matchIT): because of some stronger checking (perhaps too strong)
2987 in SGI STL, the two operator() unified to one.
2990 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2992 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2993 the last inset read added
2994 (parseSingleLyXformat2Token): some more (future) compability code added
2995 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2996 (parseSingleLyXformat2Token): set last_inset_read
2997 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2998 (parseSingleLyXformat2Token): don't double intializw string next_token
3000 * src/TextCache.C (text_fits::operator()): add const's to the signature
3001 (has_buffer::operator()): ditto
3003 * src/Floating.h: add some comments on the class
3005 * src/FloatList.[Ch] (typeExist): new method
3008 * src/BackStack.h: added default constructor, wanted by Gcc.
3010 2000-07-14 Juergen Vigna <jug@sad.it>
3012 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3014 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3016 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3017 do a redraw when the window is resized!
3018 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3020 * src/insets/insettext.C (resizeLyXText): added function to correctly
3021 being able to resize the LyXWindow.
3023 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3025 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3027 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3028 crashes when closing dialog to a deleted inset.
3030 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3031 method! Now similar to other insets.
3033 2000-07-13 Juergen Vigna <jug@sad.it>
3035 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3037 * lib/examples/Literate.lyx: small patch!
3039 * src/insets/insetbib.C (Read): added this function because of wrong
3040 Write (without [begin|end]_inset).
3042 2000-07-11 Juergen Vigna <jug@sad.it>
3044 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3045 as the insertInset could not be good!
3047 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3048 the bool param should not be last.
3050 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3052 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3053 did submit that to Karl).
3055 * configure.in: use -isystem instead of -I for X headers. This
3056 fixes a problem on solaris with a recent gcc;
3057 put the front-end code after the X detection code;
3058 configure in sigc++ before lib/
3060 * src/lyx_main.C (commandLineHelp): remove -display from command
3063 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3065 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3066 Also put in Makefile rules for building the ``listerrors''
3067 program for parsing errors from literate programs written in LyX.
3069 * lib/build-listerrors: Added small shell script as part of compile
3070 process. This builds a working ``listerrors'' binary if noweb is
3071 installed and either 1) the VNC X server is installed on the machine,
3072 or 2) the user is compiling from within a GUI. The existence of a GUI
3073 is necessary to use the ``lyx --export'' feature for now. This
3074 hack can be removed once ``lyx --export'' no longer requires a GUI to
3077 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3079 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3080 now passed back correctly from gcc and placed "under" error
3081 buttons in a Literate LyX source.
3083 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3085 * src/text.C (GetColumnNearX): Better behavior when a RTL
3086 paragraph is ended by LTR text.
3088 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3091 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3093 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3094 true when clipboard is empty.
3096 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3098 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3099 row of the paragraph.
3100 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3101 to prevent calculation of bidi tables
3103 2000-07-07 Juergen Vigna <jug@sad.it>
3105 * src/screen.C (ToggleSelection): added y_offset and x_offset
3108 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3111 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3113 * src/insets/insettext.C: fixed Layout-Display!
3115 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3117 * configure.in: add check for strings.h header.
3119 * src/spellchecker.C: include <strings.h> in order to have a
3120 definition for bzero().
3122 2000-07-07 Juergen Vigna <jug@sad.it>
3124 * src/insets/insettext.C (draw): set the status of the bv->text to
3125 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3127 * src/screen.C (DrawOneRow):
3128 (DrawFromTo): redraw the actual row if something has changed in it
3131 * src/text.C (draw): call an update of the toplevel-inset if something
3132 has changed inside while drawing.
3134 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3136 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3138 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3139 processing inside class.
3141 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3142 processing inside class.
3144 * src/insets/insetindex.h new struct Holder, consistent with other
3147 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3148 citation dialog from main code and placed it in src/frontends/xforms.
3149 Dialog launched through signals instead of callbacks
3151 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3153 * lyx.man: update the options description.
3155 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3157 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3158 handle neg values, set min width to 590, add doc about -display
3160 2000-07-05 Juergen Vigna <jug@sad.it>
3162 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3163 calls to BufferView *.
3165 * src/insets/insettext.C (checkAndActivateInset): small fix non
3166 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3168 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3169 their \end_inset token!
3171 2000-07-04 edscott <edscott@imp.mx>
3173 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3174 lib/lyxrc.example: added option \wheel_jump
3176 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3178 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3179 remove support for -width,-height,-xpos and -ypos.
3181 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3183 * src/encoding.[Ch]: New files.
3185 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3186 (text): Call to the underline() method only when needed.
3188 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3190 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3191 encoding(s) for the document.
3193 * src/bufferparams.C (BufferParams): Changed default value of
3196 * src/language.C (newLang): Removed.
3197 (items[]): Added encoding information for all defined languages.
3199 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3200 encoding choice button.
3202 * src/lyxrc.h (font_norm_type): New member variable.
3203 (set_font_norm_type): New method.
3205 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3206 paragraphs with different encodings.
3208 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3209 (TransformChar): Changed to work correctly with Arabic points.
3210 (draw): Added support for drawing Arabic points.
3211 (draw): Removed code for drawing underbars (this is done by
3214 * src/support/textutils.h (IsPrintableNonspace): New function.
3216 * src/BufferView_pimpl.h: Added "using SigC::Object".
3217 * src/LyXView.h: ditto.
3219 * src/insets/insetinclude.h (include_label): Changed to mutable.
3221 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3223 * src/mathed/math_iter.h: remove empty destructor
3225 * src/mathed/math_cursor.h: remove empty destructor
3227 * src/insets/lyxinset.h: add THEOREM_CODE
3229 * src/insets/insettheorem.[Ch]: new files
3231 * src/insets/insetminipage.C: (InsertInset): remove
3233 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3235 (InsertInset): remove
3237 * src/insets/insetlist.C: (InsertList): remove
3239 * src/insets/insetfootlike.[Ch]: new files
3241 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3244 (InsertInset): ditto
3246 * src/insets/insetert.C: remove include Painter.h, reindent
3247 (InsertInset): move to header
3249 * src/insets/insetcollapsable.h: remove explicit from default
3250 contructor, remove empty destructor, add InsertInset
3252 * src/insets/insetcollapsable.C (InsertInset): new func
3254 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3256 * src/vspace.h: add explicit to constructor
3258 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3259 \textcompwordmark, please test this.
3261 * src/lyxrc.C: set ascii_linelen to 65 by default
3263 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3265 * src/commandtags.h: add LFUN_INSET_THEOREM
3267 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3268 (makeLinuxDocFile): remove _some_ of the nice logic
3269 (makeDocBookFile): ditto
3271 * src/Painter.[Ch]: (~Painter): removed
3273 * src/LyXAction.C (init): entry for insettheorem added
3275 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3277 (deplog): code to detect files generated by LaTeX, needs testing
3280 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3282 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3284 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3286 * src/LaTeX.C (deplog): Add a check for files that are going to be
3287 created by the first latex run, part of the project to remove the
3290 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3291 contents to the extension list.
3293 2000-07-04 Juergen Vigna <jug@sad.it>
3295 * src/text.C (NextBreakPoint): added support for needFullRow()
3297 * src/insets/lyxinset.h: added needFullRow()
3299 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3302 * src/insets/insettext.C: lots of changes for update!
3304 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3306 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3308 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3310 * src/insets/insetinclude.C (InsetInclude): fixed
3311 initialization of include_label.
3312 (unique_id): now returns a string.
3314 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3316 * src/LaTeXFeatures.h: new member IncludedFiles, for
3317 a map of key, included file name.
3319 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3320 with the included files for inclusion in SGML preamble,
3321 i. e., linuxdoc and docbook.
3324 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3325 nice (is the generated linuxdoc code to be exported?), that
3326 allows to remove column, and only_body that will be true for
3327 slave documents. Insets are allowed inside SGML font type.
3328 New handling of the SGML preamble for included files.
3329 (makeDocBookFile): the same for docbook.
3331 * src/insets/insetinclude.h:
3332 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3334 (DocBook): new export methods.
3336 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3337 and makeDocBookFile.
3339 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3340 formats to export with command line argument -x.
3342 2000-06-29 Juergen Vigna <jug@sad.it>
3344 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3345 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3347 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3348 region could already been cleared by an inset!
3350 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3352 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3355 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3357 (cursorToggle): remove special handling of lyx focus.
3359 2000-06-28 Juergen Vigna <jug@sad.it>
3361 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3364 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3366 * src/insets/insetindex.C (Edit): add a callback when popup is
3369 * src/insets/insettext.C (LocalDispatch):
3370 * src/insets/insetmarginal.h:
3371 * src/insets/insetlist.h:
3372 * src/insets/insetfoot.h:
3373 * src/insets/insetfloat.h:
3374 * src/insets/insetert.h: add a missing std:: qualifier.
3376 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3378 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3381 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3383 * src/insets/insettext.C (Read): remove tmptok unused variable
3384 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3385 (InsertInset): change for new InsetInset code
3387 * src/insets/insettext.h: add TEXT inline method
3389 * src/insets/insettext.C: remove TEXT macro
3391 * src/insets/insetmarginal.C (Write): new method
3392 (Latex): change output slightly
3394 * src/insets/insetfoot.C (Write): new method
3395 (Latex): change output slightly (don't use endl when no need)
3397 * src/insets/insetert.C (Write): new method
3399 * src/insets/insetcollapsable.h: make button_length, button_top_y
3400 and button_bottm_y protected.
3402 * src/insets/insetcollapsable.C (Write): simplify code by using
3403 tostr. Also do not output the float name, the children class
3404 should to that to get control over own arguments
3406 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3407 src/insets/insetminipage.[Ch]:
3410 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3412 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3414 * src/Makefile.am (lyx_SOURCES): add the new files
3416 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3417 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3418 * src/commandtags.h: ditto
3420 * src/LaTeXFeatures.h: add a std::set of used floattypes
3422 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3424 * src/FloatList.[Ch] src/Floating.h: new files
3426 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3428 * src/lyx_cb.C (TableApplyCB): ditto
3430 * src/text2.C: ditto
3431 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3432 (parseSingleLyXformat2Token): ditto + add code for
3433 backwards compability for old float styles + add code for new insets
3435 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3437 (InsertInset(size_type, Inset *, LyXFont)): new method
3438 (InsetChar(size_type, char)): changed to use the other InsetChar
3439 with a LyXFont(ALL_INHERIT).
3440 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3441 insert the META_INSET.
3443 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3445 * sigc++/thread.h (Threads): from here
3447 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3448 definition out of line
3449 * sigc++/scope.h: from here
3451 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3453 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3454 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3456 * Makefile.am (bindist): new target.
3458 * INSTALL: add instructions for doing a binary distribution.
3460 * development/tools/README.bin.example: update a bit.
3462 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3465 * lib/lyxrc.example: new lyxrc tag \set_color.
3467 * src/lyxfunc.C (Dispatch):
3468 * src/commandtags.h:
3469 * src/LyXAction.C: new lyxfunc "set-color".
3471 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3472 and an x11name given as strings.
3474 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3475 cache when a color is changed.
3477 2000-06-26 Juergen Vigna <jug@sad.it>
3479 * src/lyxrow.C (width): added this functions and variable.
3481 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3484 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3486 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3488 * images/undo_bw.xpm: new icon.
3489 * images/redo_bw.xpm: ditto.
3491 * configure.in (INSTALL_SCRIPT): change value to
3492 ${INSTALL} to avoid failures of install-script target.
3493 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3495 * src/BufferView.h: add a magic "friend" declaration to please
3498 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3500 * forms/cite.fd: modified to allow resizing without messing
3503 * src/insetcite.C: Uses code from cite.fd almost without
3505 User can now resize dialog in the x-direction.
3506 Resizing the dialog in the y-direction is prevented, as the
3507 code does this intelligently already.
3509 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3511 * INSTALL: remove obsolete entry in "problems" section.
3513 * lib/examples/sl_*.lyx: update of the slovenian examples.
3515 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3517 2000-06-23 Juergen Vigna <jug@sad.it>
3519 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3521 * src/buffer.C (resize): delete the LyXText of textinsets.
3523 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3525 * src/insets/lyxinset.h: added another parameter 'cleared' to
3526 the draw() function.
3528 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3529 unlocking inset in inset.
3531 2000-06-22 Juergen Vigna <jug@sad.it>
3533 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3534 of insets and moved first to LyXText.
3536 * src/mathed/formulamacro.[Ch]:
3537 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3539 2000-06-21 Juergen Vigna <jug@sad.it>
3541 * src/text.C (GetVisibleRow): look if I should clear the area or not
3542 using Inset::doClearArea() function.
3544 * src/insets/lyxinset.h: added doClearArea() function and
3545 modified draw(Painter &, ...) to draw(BufferView *, ...)
3547 * src/text2.C (UpdateInset): return bool insted of int
3549 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3551 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3552 combox in the character popup
3554 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3555 BufferParams const & params
3557 2000-06-20 Juergen Vigna <jug@sad.it>
3559 * src/insets/insettext.C (SetParagraphData): set insetowner on
3562 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3564 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3565 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3567 (form_main_): remove
3569 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3570 (create_form_form_main): remove FD_form_main stuff, connect to
3571 autosave_timeout signal
3573 * src/LyXView.[Ch] (getMainForm): remove
3574 (UpdateTimerCB): remove
3575 * src/BufferView_pimpl.h: inherit from SigC::Object
3577 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3578 signal instead of callback
3580 * src/BufferView.[Ch] (cursorToggleCB): remove
3582 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3584 * src/BufferView_pimpl.C: changes because of the one below
3586 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3587 instead of storing a pointer to a LyXText.
3589 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3591 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3593 * src/lyxparagraph.h
3595 * src/paragraph.C: Changed fontlist to a sorted vector.
3597 2000-06-19 Juergen Vigna <jug@sad.it>
3599 * src/BufferView.h: added screen() function.
3601 * src/insets/insettext.C (LocalDispatch): some selection code
3604 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3606 * src/insets/insettext.C (SetParagraphData):
3608 (InsetText): fixes for multiple paragraphs.
3610 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3612 * development/lyx.spec.in: Call configure with ``--without-warnings''
3613 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3614 This should be fine, however, since we generally don't want to be
3615 verbose when making an RPM.
3617 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3619 * lib/scripts/fig2pstex.py: New file
3621 2000-06-16 Juergen Vigna <jug@sad.it>
3623 * src/insets/insettabular.C (UpdateLocal):
3624 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3625 (LocalDispatch): Changed all functions to use LyXText.
3627 2000-06-15 Juergen Vigna <jug@sad.it>
3629 * src/text.C (SetHeightOfRow): call inset::update before requesting
3632 * src/insets/insettext.C (update):
3633 * src/insets/insettabular.C (update): added implementation
3635 * src/insets/lyxinset.h: added update function
3637 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3639 * src/text.C (SelectNextWord): protect against null pointers with
3640 old-style string streams. (fix from Paul Theo Gonciari
3643 * src/cite.[Ch]: remove erroneous files.
3645 * lib/configure.m4: update the list of created directories.
3647 * src/lyxrow.C: include <config.h>
3648 * src/lyxcursor.C: ditto.
3650 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3652 * lib/examples/decimal.lyx: new example file from Mike.
3654 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3655 to find template definitions (from Dekel)
3657 * src/frontends/.cvsignore: add a few things.
3659 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3661 * src/Timeout.C (TimeOut): remove default argument.
3663 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3666 * src/insets/ExternalTemplate.C: add a "using" directive.
3668 * src/lyx_main.h: remove the act_ struct, which seems unused
3671 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3673 * LyX Developers Meeting: All files changed, due to random C++ (by
3674 coincidence) code generator script.
3676 - external inset (cool!)
3677 - initial online editing of preferences
3678 - insettabular breaks insettext(s contents)
3680 - some DocBook fixes
3681 - example files update
3682 - other cool stuff, create a diff and look for yourself.
3684 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3686 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3687 -1 this is a non-line-breaking textinset.
3689 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3690 if there is no width set.
3692 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3694 * Lots of files: Merged the dialogbase branch.
3696 2000-06-09 Allan Rae <rae@lyx.org>
3698 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3699 and the Dispatch methods that used it.
3701 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3702 access to functions formerly kept in Dispatch.
3704 2000-05-19 Allan Rae <rae@lyx.org>
3706 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3707 made to_page and count_copies integers again. from_page remains a
3708 string however because I want to allow entry of a print range like
3709 "1,4,22-25" using this field.
3711 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3712 and printer-params-get. These aren't useful from the minibuffer but
3713 could be used by a script/LyXServer app provided it passes a suitable
3714 auto_mem_buffer. I guess I should take a look at how the LyXServer
3715 works and make it support xtl buffers.
3717 * sigc++/: updated to libsigc++-1.0.1
3719 * src/xtl/: updated to xtl-1.3.pl.11
3721 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3722 those changes done to the files in src/ are actually recreated when
3723 they get regenerated. Please don't ever accept a patch that changes a
3724 dialog unless that patch includes the changes to the corresponding *.fd
3727 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3728 stringOnlyContains, renamed it and generalised it.
3730 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3731 branch. Removed the remaining old form_print code.
3733 2000-04-26 Allan Rae <rae@lyx.org>
3735 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3736 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3738 2000-04-25 Allan Rae <rae@lyx.org>
3740 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3741 against a base of xtl-1.3.pl.4
3743 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3744 filter the Id: entries so they still show the xtl version number
3747 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3748 into the src/xtl code. Patch still pending with José (XTL)
3750 2000-04-24 Allan Rae <rae@lyx.org>
3752 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3753 both more generic and much safer. Use the new template functions.
3754 * src/buffer.[Ch] (Dispatch): ditto.
3756 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3757 and mem buffer more intelligently. Also a little general cleanup.
3760 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3761 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3762 * src/xtl/Makefile.am: ditto.
3763 * src/xtl/.cvsignore: ditto.
3764 * src/Makefile.am: ditto.
3766 * src/PrinterParams.h: Removed the macros member functions. Added a
3767 testInvariant member function. A bit of tidying up and commenting.
3768 Included Angus's idea for fixing operation with egcs-1.1.2.
3770 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3771 cool expansion of XTL's mem_buffer to support automatic memory
3772 management within the buffer itself. Removed the various macros and
3773 replaced them with template functions that use either auto_mem_buffer
3774 or mem_buffer depending on a #define. The mem_buffer support will
3775 disappear as soon as the auto_mem_buffer is confirmed to be good on
3776 other platforms/compilers. That is, it's there so you've got something
3779 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3780 effectively forked XTL. However I expect José will include my code
3781 into the next major release. Also fixed a memory leak.
3782 * src/xtl/text.h: ditto.
3783 * src/xtl/xdr.h: ditto.
3784 * src/xtl/giop.h: ditto.
3786 2000-04-16 Allan Rae <rae@lyx.org>
3788 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3789 by autogen.sh and removed by maintainer-clean anyway.
3790 * .cvsignore, sigc++/.cvsignore: Support the above.
3792 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3794 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3796 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3797 macros, renamed static callback-target member functions to suit new
3798 scheme and made them public.
3799 * src/frontends/xforms/forms/form_print.fd: ditto.
3800 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3802 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3805 * src/xtl/: New directory containing a minimal distribution of XTL.
3806 This is XTL-1.3.pl.4.
3808 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3810 2000-04-15 Allan Rae <rae@lyx.org>
3812 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3814 * sigc++/: Updated to libsigc++-1.0.0
3816 2000-04-14 Allan Rae <rae@lyx.org>
3818 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3819 use the generic ones in future. I'll modify my conversion script.
3821 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3823 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3824 (CloseAllBufferRelatedDialogs): Renamed.
3825 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3827 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3828 of the generic ones. These are the same ones my conversion script
3831 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3832 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3833 * src/buffer.C (Dispatch): ditto
3835 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3836 functions for updating and hiding buffer dependent dialogs.
3837 * src/BufferView.C (buffer): ditto
3838 * src/buffer.C (setReadonly): ditto
3839 * src/lyxfunc.C (CloseBuffer): ditto
3841 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3842 Dialogs.h, and hence all the SigC stuff, into every file that includes
3843 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3845 * src/BufferView2.C: reduce the number of headers included by buffer.h
3847 2000-04-11 Allan Rae <rae@lyx.org>
3849 * src/frontends/xforms/xform_macros.h: A small collection of macros
3850 for building C callbacks.
3852 * src/frontends/xforms/Makefile.am: Added above file.
3854 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3855 scheme again. This time it should work for JMarc. If this is
3856 successful I'll revise my conversion script to automate some of this.
3857 The static member functions in the class also have to be public for
3858 this scheme will work. If the scheme works (it's almost identical to
3859 the way BufferView::cursorToggleCB is handled so it should work) then
3860 FormCopyright and FormPrint will be ready for inclusion into the main
3861 trunk immediately after 1.1.5 is released -- provided we're prepared
3862 for complaints about lame compilers not handling XTL.
3864 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3866 2000-04-07 Allan Rae <rae@lyx.org>
3868 * config/lyxinclude.m4: A bit more tidying up (Angus)
3870 * src/LString.h: JMarc's <string> header fix
3872 * src/PrinterParams.h: Used string for most data to remove some
3873 ugly code in the Print dialog and avoid even uglier code when
3874 appending the ints to a string for output.
3876 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3877 and moved "default:" back to the end of switch statement. Cleaned
3878 up the printing so it uses the right function calls and so the
3879 "print to file" option actually puts the file in the right directory.
3881 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3883 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3884 and Ok+Apply button control into a separate method: input (Angus).
3885 (input) Cleaned it up and improved it to be very thorough now.
3886 (All CB) static_cast used instead of C style cast (Angus). This will
3887 probably change again once we've worked out how to keep gcc-2.8.1 happy
3888 with real C callbacks.
3889 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3890 ignore some of the bool settings and has random numbers instead. Needs
3891 some more investigation. Added other input length checks and checking
3892 of file and printer names.
3894 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3895 would link (Angus). Seems the old code doesn't compile with the pragma
3896 statement either. Separated callback entries from internal methods.
3898 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3900 2000-03-17 Allan Rae <rae@lyx.org>
3902 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3903 need it? Maybe it could go in Dialogs instead? I could make it a
3904 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3905 values to get the bool return value.
3906 (Dispatch): New overloaded method for xtl support.
3908 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3909 extern "C" callback instead of static member functions. Hopefully,
3910 JMarc will be able to compile this. I haven't changed
3911 forms/form_copyright.fd yet. Breaking one of my own rules already.
3913 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3914 because they aren't useful from the minibuffer. Maybe a LyXServer
3915 might want a help message though?
3917 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3919 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3920 xtl which needs both rtti and exceptions.
3922 * src/support/Makefile.am:
3923 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3925 * src/frontends/xforms/input_validators.[ch]: input filters and
3926 validators. These conrol what keys are valid in input boxes.
3927 Use them and write some more. Much better idea than waiting till
3928 after the user has pressed Ok to say that the input fields don't make
3931 * src/frontends/xforms/Makefile.am:
3932 * src/frontends/xforms/forms/form_print.fd:
3933 * src/frontends/xforms/forms/makefile:
3934 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3935 new scheme. Still have to make sure I haven't missed anything from
3936 the current implementation.
3938 * src/Makefile.am, src/PrinterParams.h: New data store.
3940 * other files: Added a couple of copyright notices.
3942 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3944 * src/insets/insetbib.h: move Holder struct in public space.
3946 * src/frontends/include/DialogBase.h: use SigC:: only when
3947 SIGC_CXX_NAMESPACES is defined.
3948 * src/frontends/include/Dialogs.h: ditto.
3950 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3952 * src/frontends/xforms/FormCopyright.[Ch]: do not
3953 mention SigC:: explicitely.
3955 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3957 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3958 deals with testing KDE in main configure.in
3959 * configure.in: ditto.
3961 2000-02-22 Allan Rae <rae@lyx.org>
3963 * Lots of files: Merged from HEAD
3965 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3966 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3968 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3970 * sigc++/: new minidist.
3972 2000-02-14 Allan Rae <rae@lyx.org>
3974 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3976 2000-02-08 Juergen Vigna <jug@sad.it>
3978 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3979 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3981 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3982 for this port and so it is much easier for other people to port
3983 dialogs in a common development environment.
3985 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3986 the QT/KDE implementation.
3988 * src/frontends/kde/Dialogs.C:
3989 * src/frontends/kde/FormCopyright.C:
3990 * src/frontends/kde/FormCopyright.h:
3991 * src/frontends/kde/Makefile.am:
3992 * src/frontends/kde/formcopyrightdialog.C:
3993 * src/frontends/kde/formcopyrightdialog.h:
3994 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3995 for the kde support of the Copyright-Dialog.
3997 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3998 subdir-substitution instead of hardcoded 'xforms' as we now have also
4001 * src/frontends/include/DialogBase.h (Object): just commented the
4002 label after #endif (nasty warning and I don't like warnings ;)
4004 * src/main.C (main): added KApplication initialization if using
4007 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4008 For now only the KDE event-loop is added if frontend==kde.
4010 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4012 * configure.in: added support for the --with-frontend[=value] option
4014 * autogen.sh: added kde.m4 file to list of config-files
4016 * acconfig.h: added define for KDEGUI-support
4018 * config/kde.m4: added configuration functions for KDE-port
4020 * config/lyxinclude.m4: added --with-frontend[=value] option with
4021 support for xforms and KDE.
4023 2000-02-08 Allan Rae <rae@lyx.org>
4025 * all Makefile.am: Fixed up so the make targets dist, distclean,
4026 install and uninstall all work even if builddir != srcdir. Still
4027 have a new sigc++ minidist update to come.
4029 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4031 2000-02-01 Allan Rae <rae@lyx.org>
4033 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4034 Many mods to get builddir != srcdir working.
4036 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4037 for building on NT and so we can do the builddir != srcdir stuff.
4039 2000-01-30 Allan Rae <rae@lyx.org>
4041 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4042 This will stay in "rae" branch. We probably don't really need it in
4043 the main trunk as anyone who wants to help programming it should get
4044 a full library installed also. So they can check both included and
4045 system supplied library compilation.
4047 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4048 Added a 'mini' distribution of libsigc++. If you feel the urge to
4049 change something in these directories - Resist it. If you can't
4050 resist the urge then you should modify the following script and rebuild
4051 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4052 all happen. Still uses a hacked version of libsigc++'s configure.in.
4053 I'm quite happy with the results. I'm not sure the extra work to turn
4054 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4055 worth the trouble and would probably lead to extra maintenance
4057 I haven't tested the following important make targets: install, dist.
4058 Not ready for prime time but very close. Maybe 1.1.5.
4060 * development/tools/makeLyXsigc.sh: A shell script to automatically
4061 generate our mini-dist of libsigc++. It can only be used with a CVS
4062 checkout of libsigc++ not a tarball distribution. It's well commented.
4063 This will end up as part of the libsigc++ distribution so other apps
4064 can easily have an included mini-dist. If someone makes mods to the
4065 sigc++ subpackage without modifying this script to generate those
4066 changes I'll be very upset!
4068 * src/frontends/: Started the gui/system indep structure.
4070 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4071 to access the gui-indep dialogs are in this class. Much improved
4072 design compared to previous revision. Lars, please refrain from
4073 moving this header into src/ like you did with Popups.h last time.
4075 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4077 * src/frontends/xforms/: Started the gui-indep system with a single
4078 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4081 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4082 Here you'll find a very useful makefile and automated fdfix.sh that
4083 makes updating dailogs a no-brainer -- provided you follow the rules
4084 set out in the README. I'm thinking about adding another script to
4085 automatically generate skeleton code for a new dialog given just the
4088 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4089 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4090 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4092 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4094 * src/support/LSubstring.C (operator): simplify
4096 * src/lyxtext.h: removed bparams, use buffer_->params instead
4098 * src/lyxrow.h: make Row a real class, move all variables to
4099 private and use accessors.
4101 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4103 (isRightToLeftPar): ditto
4104 (ChangeLanguage): ditto
4105 (isMultiLingual): ditto
4108 (SimpleTeXOnePar): ditto
4109 (TeXEnvironment): ditto
4110 (GetEndLabel): ditto
4112 (SetOnlyLayout): ditto
4113 (BreakParagraph): ditto
4114 (BreakParagraphConservative): ditto
4115 (GetFontSettings): ditto
4117 (CopyIntoMinibuffer): ditto
4118 (CutIntoMinibuffer): ditto
4119 (PasteParagraph): ditto
4120 (SetPExtraType): ditto
4121 (UnsetPExtraType): ditto
4122 (DocBookContTableRows): ditto
4123 (SimpleDocBookOneTablePar): ditto
4125 (TeXFootnote): ditto
4126 (SimpleTeXOneTablePar): ditto
4127 (TeXContTableRows): ditto
4128 (SimpleTeXSpecialChars): ditto
4131 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4132 to private and use accessors.
4134 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4135 this, we did not use it anymore and has not been for ages. Just a
4136 waste of cpu cycles.
4138 * src/language.h: make Language a real class, move all variables
4139 to private and use accessors.
4141 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4142 (create_view): remove
4143 (update): some changes for new timer
4144 (cursorToggle): use new timer
4145 (beforeChange): change for new timer
4147 * src/BufferView.h (cursorToggleCB): removed last paramter because
4150 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4151 (cursorToggleCB): change because of new timer code
4153 * lib/CREDITS: updated own mailaddress
4155 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4157 * src/support/filetools.C (PutEnv): fix the code in case neither
4158 putenv() nor setenv() have been found.
4160 * INSTALL: mention the install-strip Makefile target.
4162 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4163 read-only documents.
4165 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4167 * lib/reLyX/configure.in (VERSION): avoid using a previously
4168 generated reLyX wrapper to find out $prefix.
4170 * lib/examples/eu_adibide_lyx-atua.lyx:
4171 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4172 translation of the Tutorial (Dooteo)
4174 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4176 * forms/cite.fd: new citation dialog
4178 * src/insetcite.[Ch]: the new citation dialog is moved into
4181 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4184 * src/insets/insetcommand.h: data members made private.
4186 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4188 * LyX 1.1.5 released
4190 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4192 * src/version.h (LYX_RELEASE): to 1.1.5
4194 * src/spellchecker.C (RunSpellChecker): return false if the
4195 spellchecker dies upon creation.
4197 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4199 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4200 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4204 * lib/CREDITS: update entry for Martin Vermeer.
4206 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4208 * src/text.C (draw): Draw foreign language bars at the bottom of
4209 the row instead of at the baseline.
4211 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4213 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4215 * lib/bind/de_menus.bind: updated
4217 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4219 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4221 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4223 * src/menus.C (Limit_string_length): New function
4224 (ShowTocMenu): Limit the number of items/length of items in the
4227 * src/paragraph.C (String): Correct result for a paragraph inside
4230 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4232 * src/bufferlist.C (close): test of buf->getuser() == NULL
4234 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4236 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4237 Do not call to SetCursor when the paragraph is a closed footnote!
4239 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4241 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4244 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4246 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4249 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4250 reference popup, that activates the reference-back action
4252 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4254 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4255 the menus. Also fixed a bug.
4257 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4258 the math panels when switching buffers (unless new buffer is readonly).
4260 * src/BufferView.C (NoSavedPositions)
4261 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4263 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4265 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4266 less of dvi dirty or not.
4268 * src/trans_mgr.[Ch] (insert): change first parameter to string
4271 * src/chset.[Ch] (encodeString): add const to first parameter
4273 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4275 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4279 * src/LaTeX.C (deplog): better searching for dependency files in
4280 the latex log. Uses now regexps.
4282 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4283 instead of the box hack or \hfill.
4285 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4287 * src/lyxfunc.C (doImportHelper): do not create the file before
4288 doing the actual import.
4289 (doImportASCIIasLines): create a new file before doing the insert.
4290 (doImportASCIIasParagraphs): ditto.
4292 * lib/lyxrc.example: remove mention of non-existing commands
4294 * lyx.man: remove mention of color-related switches.
4296 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4298 * src/lyx_gui.C: remove all the color-related ressources, which
4299 are not used anymore.
4301 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4304 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4306 * src/lyxrc.C (read): Add a missing break in the switch
4308 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4310 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4312 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4315 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4317 * src/text.C (draw): draw bars under foreign language words.
4319 * src/LColor.[Ch]: add LColor::language
4321 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4323 * src/lyxcursor.h (boundary): New member variable
4325 * src/text.C (IsBoundary): New methods
4327 * src/text.C: Use the above for currect cursor movement when there
4328 is both RTL & LTR text.
4330 * src/text2.C: ditto
4332 * src/bufferview_funcs.C (ToggleAndShow): ditto
4334 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4336 * src/text.C (DeleteLineForward): set selection to true to avoid
4337 that DeleteEmptyParagraphMechanism does some magic. This is how it
4338 is done in all other functions, and seems reasonable.
4339 (DeleteWordForward): do not jump over non-word stuff, since
4340 CursorRightOneWord() already does it.
4342 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4343 DeleteWordBackward, since they seem safe to me (since selection is
4344 set to "true") DeleteEmptyParagraphMechanism does nothing.
4346 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4348 * src/lyx_main.C (easyParse): simplify the code by factoring the
4349 part that removes parameters from the command line.
4350 (LyX): check wether wrong command line options have been given.
4352 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4354 * src/lyx_main.C : add support for specifying user LyX
4355 directory via command line option -userdir.
4357 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4359 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4360 the number of items per popup.
4361 (Add_to_refs_menu): Ditto.
4363 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4365 * src/lyxparagraph.h: renamed ClearParagraph() to
4366 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4367 textclass as parameter, and do nothing if free_spacing is
4368 true. This fixes part of the line-delete-forward problems.
4370 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4371 (pasteSelection): ditto.
4372 (SwitchLayoutsBetweenClasses): more translatable strings.
4374 * src/text2.C (CutSelection): use StripLeadingSpaces.
4375 (PasteSelection): ditto.
4376 (DeleteEmptyParagraphMechanism): ditto.
4378 2000-05-26 Juergen Vigna <jug@sad.it>
4380 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4381 is not needed in tabular insets.
4383 * src/insets/insettabular.C (TabularFeatures): added missing features.
4385 * src/tabular.C (DeleteColumn):
4387 (AppendRow): implemented this functions
4388 (cellsturct::operator=): clone the inset too;
4390 2000-05-23 Juergen Vigna <jug@sad.it>
4392 * src/insets/insettabular.C (LocalDispatch): better selection support
4393 when having multicolumn-cells.
4395 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4397 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4399 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4401 * src/ColorHandler.C (getGCForeground): put more test into _()
4403 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4406 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4409 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4411 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4412 there are no labels, or when buffer is readonly.
4414 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4415 there are no labels, buffer is SGML, or when buffer is readonly.
4417 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4419 * src/LColor.C (LColor): change a couple of grey40 to grey60
4420 (LColor): rewore initalization to make compiles go some magnitude
4422 (getGUIName): don't use gettext until we need the string.
4424 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4426 * src/Bullet.[Ch]: Fixed a small bug.
4428 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4430 * src/paragraph.C (String): Several fixes/improvements
4432 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4434 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * src/paragraph.C (String): give more correct output.
4438 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4440 * src/lyxfont.C (stateText) Do not output the language if it is
4441 eqaul to the language of the document.
4443 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4444 between two paragraphs with the same language.
4446 * src/paragraph.C (getParLanguage) Return a correct answer for an
4447 empty dummy paragraph.
4449 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4452 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4455 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4456 the menus/popup, if requested fonts are unavailable.
4458 2000-05-22 Juergen Vigna <jug@sad.it>
4460 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4461 movement support (Up/Down/Tab/Shift-Tab).
4462 (LocalDispatch): added also preliminari cursor-selection.
4464 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4466 * src/paragraph.C (PasteParagraph): Hopefully now right!
4468 2000-05-22 Garst R. Reese <reese@isn.net>
4470 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4471 of list, change all references to Environment to Command
4472 * tex/hollywood.cls : rewrite environments as commands, add
4473 \uppercase to interiorshot and exteriorshot to force uppecase.
4474 * tex/broadway.cls : rewrite environments as commands. Tweak
4477 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4479 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4480 size of items: use a constant intead of the hardcoded 40, and more
4481 importantly do not remove the %m and %x tags added at the end.
4482 (Add_to_refs_menu): use vector::size_type instead of
4483 unsigned int as basic types for the variables. _Please_ do not
4484 assume that size_t is equal to unsigned int. On an alpha, this is
4485 unsigned long, which is _not_ the same.
4487 * src/language.C (initL): remove language "hungarian", since it
4488 seems that "magyar" is better.
4490 2000-05-22 Juergen Vigna <jug@sad.it>
4492 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4494 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4497 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4498 next was deleted but not set to 0.
4500 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4502 * src/language.C (initL): change the initialization of languages
4503 so that compiles goes _fast_.
4505 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4508 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4510 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4514 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4516 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4518 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4522 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4525 * src/insets/insetlo*.[Ch]: Made editable
4527 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4529 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4530 the current selection.
4532 * src/BufferView_pimpl.C (stuffClipboard): new method
4534 * src/BufferView.C (stuffClipboard): new method
4536 * src/paragraph.C (String): new method
4538 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4539 LColor::ignore when lyxname is not found.
4541 * src/BufferView.C (pasteSelection): new method
4543 * src/BufferView_pimpl.C (pasteSelection): new method
4545 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4547 * src/WorkArea.C (request_clipboard_cb): new static function
4548 (getClipboard): new method
4549 (putClipboard): new method
4551 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4553 * LyX 1.1.5pre2 released
4555 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4557 * src/vspace.C (operator=): removed
4558 (operator=): removed
4560 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4562 * src/layout.C (NumberOfClass): manually set the type in make_pair
4563 (NumberOfLayout): ditto
4565 * src/language.C: use the Language constructor for ignore_lang
4567 * src/language.h: add constructors to struct Language
4569 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4571 * src/text2.C (SetCursorIntern): comment out #warning
4573 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4575 * src/mathed/math_iter.h: initialize sx and sw to 0
4577 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4579 * forms/lyx.fd: Redesign of form_ref
4581 * src/LaTeXFeatures.[Ch]
4585 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4588 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4589 and Buffer::inset_iterator.
4591 * src/menus.C: Added new menus: TOC and Refs.
4593 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4595 * src/buffer.C (getTocList): New method.
4597 * src/BufferView2.C (ChangeRefs): New method.
4599 * src/buffer.C (getLabelList): New method. It replaces the old
4600 getReferenceList. The return type is vector<string> instead of
4603 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4604 the old getLabel() and GetNumberOfLabels() methods.
4605 * src/insets/insetlabel.C (getLabelList): ditto
4606 * src/mathed/formula.C (getLabelList): ditto
4608 * src/paragraph.C (String): New method.
4610 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4611 Uses the new getTocList() method.
4612 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4613 which automatically updates the contents of the browser.
4614 (RefUpdateCB): Use the new getLabelList method.
4616 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4618 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4620 * src/spellchecker.C: Added using std::reverse;
4622 2000-05-19 Juergen Vigna <jug@sad.it>
4624 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4626 * src/insets/insettext.C (computeTextRows): small fix for display of
4627 1 character after a newline.
4629 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4632 2000-05-18 Juergen Vigna <jug@sad.it>
4634 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4635 when changing width of column.
4637 * src/tabular.C (set_row_column_number_info): setting of
4638 autobreak rows if necessary.
4640 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4642 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4644 * src/vc-backend.*: renamed stat() to status() and vcstat to
4645 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4646 compilation broke. The new name seems more relevant, anyway.
4648 2000-05-17 Juergen Vigna <jug@sad.it>
4650 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4651 which was wrong if the removing caused removing of rows!
4653 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4654 (pushToken): new function.
4656 * src/text2.C (CutSelection): fix problem discovered with purify
4658 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4660 * src/debug.C (showTags): enlarge the first column, now that we
4661 have 6-digits debug codes.
4663 * lib/layouts/hollywood.layout:
4664 * lib/tex/hollywood.cls:
4665 * lib/tex/brodway.cls:
4666 * lib/layouts/brodway.layout: more commands and fewer
4667 environments. Preambles moved in the .cls files. Broadway now has
4668 more options on scene numbering and less whitespace (from Garst)
4670 * src/insets/insetbib.C (getKeys): make sure that we are in the
4671 document directory, in case the bib file is there.
4673 * src/insets/insetbib.C (Latex): revert bogus change.
4675 2000-05-16 Juergen Vigna <jug@sad.it>
4677 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4678 the TabularLayout on cursor move.
4680 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4682 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4685 (draw): fixed cursor position and drawing so that the cursor is
4686 visible when before the tabular-inset.
4688 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4689 when creating from old insettext.
4691 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4693 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4695 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4696 * lib/tex/brodway.cls: ditto
4698 * lib/layouts/brodway.layout: change alignment of parenthical
4701 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4703 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4704 versions 0.88 and 0.89 are supported.
4706 2000-05-15 Juergen Vigna <jug@sad.it>
4708 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4711 * src/insets/insettext.C (computeTextRows): redone completely this
4712 function in a much cleaner way, because of problems when having a
4714 (draw): added a frame border when the inset is locked.
4715 (SetDrawLockedFrame): this sets if we draw the border or not.
4716 (SetFrameColor): this sets the frame color (default=insetframe).
4718 * src/insets/lyxinset.h: added x() and y() functions which return
4719 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4720 function which is needed to see if we have a locking inset of some
4721 type in this inset (needed for now in insettabular).
4723 * src/vspace.C (inPixels): the same function also without a BufferView
4724 parameter as so it is easier to use it in some ocasions.
4726 * src/lyxfunc.C: changed all places where insertInset was used so
4727 that now if it couldn't be inserted it is deleted!
4729 * src/TabularLayout.C:
4730 * src/TableLayout.C: added support for new tabular-inset!
4732 * src/BufferView2.C (insertInset): this now returns a bool if the
4733 inset was really inserted!!!
4735 * src/tabular.C (GetLastCellInRow):
4736 (GetFirstCellInRow): new helper functions.
4737 (Latex): implemented for new tabular class.
4741 (TeXTopHLine): new Latex() helper functions.
4743 2000-05-12 Juergen Vigna <jug@sad.it>
4745 * src/mathed/formulamacro.C (Read):
4746 * src/mathed/formula.C (Read): read also the \end_inset here!
4748 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4750 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4751 crush when saving formulae with unbalanced parenthesis.
4753 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4755 * src/layout.C: Add new keyword "endlabelstring" to layout file
4757 * src/text.C (GetVisibleRow): Draw endlabel string.
4759 * lib/layouts/broadway.layout
4760 * lib/layouts/hollywood.layout: Added endlabel for the
4761 Parenthetical layout.
4763 * lib/layouts/heb-article.layout: Do not use slanted font shape
4764 for Theorem like environments.
4766 * src/buffer.C (makeLaTeXFile): Always add "american" to
4767 the UsedLanguages list if document language is RTL.
4769 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4771 * add addendum to README.OS2 and small patch (from SMiyata)
4773 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4775 * many files: correct the calls to ChangeExtension().
4777 * src/support/filetools.C (ChangeExtension): remove the no_path
4778 argument, which does not belong there. Use OnlyFileName() instead.
4780 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4781 files when LaTeXing a non-nice latex file.
4783 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4784 a chain of "if". Return false when deadkeys are not handled.
4786 * src/lyx_main.C (LyX): adapted the code for default bindings.
4788 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4789 bindings for basic functionality (except deadkeys).
4790 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4792 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4793 several methods: handle override_x_deadkeys.
4795 * src/lyxrc.h: remove the "bindings" map, which did not make much
4796 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4798 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4800 * src/lyxfont.C (stateText): use a saner method to determine
4801 whether the font is "default". Seems to fix the crash with DEC
4804 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4806 2000-05-08 Juergen Vigna <jug@sad.it>
4808 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4809 TabularLayoutMenu with mouse-button-3
4810 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4812 * src/TabularLayout.C: added this file for having a Layout for
4815 2000-05-05 Juergen Vigna <jug@sad.it>
4817 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4818 recalculating inset-widths.
4819 (TabularFeatures): activated this function so that I can change
4820 tabular-features via menu.
4822 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4823 that I can test some functions with the Table menu.
4825 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4827 * src/lyxfont.C (stateText): guard against stupid c++libs.
4829 * src/tabular.C: add using std::vector
4830 some whitespace changes, + removed som autogenerated code.
4832 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4834 2000-05-05 Juergen Vigna <jug@sad.it>
4836 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4837 row, columns and cellstructures.
4839 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4841 * lib/lyxrc.example: remove obsolete entries.
4843 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4844 reading of protected_separator for free_spacing.
4846 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4848 * src/text.C (draw): do not display an exclamation mark in the
4849 margin for margin notes. This is confusing, ugly and
4852 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4853 AMS math' is checked.
4855 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4856 name to see whether including the amsmath package is needed.
4858 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4860 * src/paragraph.C (validate): Compute UsedLanguages correctly
4861 (don't insert the american language if it doesn't appear in the
4864 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4865 The argument of \thanks{} command is considered moving argument
4867 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4870 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4872 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4873 for appendix/minipage/depth. The lines can be now both in the footnote
4874 frame, and outside the frame.
4876 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4879 2000-05-05 Juergen Vigna <jug@sad.it>
4881 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4882 neede only in tabular.[Ch].
4884 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4886 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4888 (Write): write '~' for PROTECTED_SEPARATOR
4890 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4892 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4895 * src/mathed/formula.C (drawStr): rename size to siz.
4897 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4898 possibly fix a bug by not changing the pflags = flags to piflags =
4901 2000-05-05 Juergen Vigna <jug@sad.it>
4903 * src/insets/insetbib.C: moved using directive
4905 * src/ImportNoweb.C: small fix for being able to compile (missing
4908 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4910 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4911 to use clear, since we don't depend on this in the code. Add test
4914 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4916 * (various *.C files): add using std::foo directives to please dec
4919 * replace calls to string::clear() to string::erase() (Angus)
4921 * src/cheaders/cmath: modified to provide std::abs.
4923 2000-05-04 Juergen Vigna <jug@sad.it>
4925 * src/insets/insettext.C: Prepared all for inserting of multiple
4926 paragraphs. Still display stuff to do (alignment and other things),
4927 but I would like to use LyXText to do this when we cleaned out the
4928 table-support stuff.
4930 * src/insets/insettabular.C: Changed lot of stuff and added lots
4931 of functionality still a lot to do.
4933 * src/tabular.C: Various functions changed name and moved to be
4934 const functions. Added new Read and Write functions and changed
4935 lots of things so it works good with tabular-insets (also removed
4936 some stuff which is not needed anymore * hacks *).
4938 * src/lyxcursor.h: added operators == and != which just look if
4939 par and pos are (not) equal.
4941 * src/buffer.C (latexParagraphs): inserted this function to latex
4942 all paragraphs form par to endpar as then I can use this too for
4945 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4946 so that I can call this to from text insets with their own cursor.
4948 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4949 output off all paragraphs (because of the fix below)!
4951 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4952 the very last paragraph (this could be also the last paragraph of an
4955 * src/texrow.h: added rows() call which returns the count-variable.
4957 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4959 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4961 * lib/configure.m4: better autodetection of DocBook tools.
4963 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4965 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4967 * src/lyx_cb.C: add using std::reverse;
4969 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4972 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4973 selected files. Should fix repeated errors from generated files.
4975 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4977 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4979 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4980 the spellchecker popup.
4982 * lib/lyxrc.example: Removed the \number_inset section
4984 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4986 * src/insets/figinset.C (various): Use IsFileReadable() to make
4987 sure that the file actually exist. Relying on ghostscripts errors
4988 is a bad idea since they can lead to X server crashes.
4990 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4992 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4995 * lib/lyxrc.example: smallish typo in description of
4996 \view_dvi_paper_option
4998 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5001 * src/lyxfunc.C: doImportHelper to factor out common code of the
5002 various import methods. New functions doImportASCIIasLines,
5003 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5004 doImportLinuxDoc for the format specific parts.
5007 * buffer.C: Dispatch returns now a bool to indicate success
5010 * lyx_gui.C: Add getLyXView() for member access
5012 * lyx_main.C: Change logic for batch commands: First try
5013 Buffer::Dispatch (possibly without GUI), if that fails, use
5016 * lyx_main.C: Add support for --import command line switch.
5017 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5018 Available Formats: Everything accepted by 'buffer-import <format>'
5020 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5022 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5025 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5026 documents will be reformatted upon reentry.
5028 2000-04-27 Juergen Vigna <jug@sad.it>
5030 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5031 correctly only last pos this was a bug.
5033 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5035 * release of lyx-1.1.5pre1
5037 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5039 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5041 * src/menus.C: revert the change of naming (Figure->Graphic...)
5042 from 2000-04-11. It was incomplete and bad.
5044 * src/LColor.[Ch]: add LColor::depthbar.
5045 * src/text.C (GetVisibleRow): use it.
5047 * README: update the languages list.
5049 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5051 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5054 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5056 * README: remove sections that were just wrong.
5058 * src/text2.C (GetRowNearY): remove currentrow code
5060 * src/text.C (GetRow): remove currentrow code
5062 * src/screen.C (Update): rewritten a bit.
5063 (SmallUpdate): removed func
5065 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5067 (FullRebreak): return bool
5068 (currentrow): remove var
5069 (currentrow_y): ditto
5071 * src/lyxscreen.h (Draw): change arg to unsigned long
5072 (FitCursor): return bool
5073 (FitManualCursor): ditto
5074 (Smallpdate): remove func
5075 (first): change to unsigned long
5076 (DrawOneRow): change second arg to long (from long &)
5077 (screen_refresh_y): remove var
5078 (scree_refresh_row): ditto
5080 * src/lyxrow.h: change baseline to usigned int from unsigned
5081 short, this brings some implicit/unsigned issues out in the open.
5083 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5085 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5086 instead of smallUpdate.
5088 * src/lyxcursor.h: change y to unsigned long
5090 * src/buffer.h: don't call updateScrollbar after fitcursor
5092 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5093 where they are used. Removed "\\direction", this was not present
5094 in 1.1.4 and is already obsolete. Commented out some code that I
5095 believe to never be called.
5096 (runLiterate): don't call updateScrollbar after fitCursor
5098 (buildProgram): ditto
5101 * src/WorkArea.h (workWidth): change return val to unsigned
5104 (redraw): remove the button redraws
5105 (setScrollbarValue): change for scrollbar
5106 (getScrollbarValue): change for scrollbar
5107 (getScrollbarBounds): change for scrollbar
5109 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5110 (C_WorkArea_down_cb): removed func
5111 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5112 (resize): change for scrollbar
5113 (setScrollbar): ditto
5114 (setScrollbarBounds): ditto
5115 (setScrollbarIncrements): ditto
5116 (up_cb): removed func
5117 (down_cb): removed func
5118 (scroll_cb): change for scrollbar
5119 (work_area_handler): ditto
5121 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5122 when FitCursor did something.
5123 (updateScrollbar): some unsigned changes
5124 (downCB): removed func
5125 (scrollUpOnePage): removed func
5126 (scrollDownOnePage): remvoed func
5127 (workAreaMotionNotify): don't call screen->FitCursor but use
5128 fitCursor instead. and bool return val
5129 (workAreaButtonPress): ditto
5130 (workAreaButtonRelease): some unsigned changes
5131 (checkInsetHit): ditto
5132 (workAreaExpose): ditto
5133 (update): parts rewritten, comments about the signed char arg added
5134 (smallUpdate): removed func
5135 (cursorPrevious): call needed updateScrollbar
5138 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5141 * src/BufferView.[Ch] (upCB): removed func
5142 (downCB): removed func
5143 (smallUpdate): removed func
5145 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5147 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5148 currentrow, currentrow_y optimization. This did not help a lot and
5149 if we want to do this kind of optimization we should rather use
5150 cursor.row instead of the currentrow.
5152 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5153 buffer spacing and klyx spacing support.
5155 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5157 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5160 2000-04-26 Juergen Vigna <jug@sad.it>
5162 * src/insets/figinset.C: fixes to Lars sstream changes!
5164 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5166 * A lot of files: Added Ascii(ostream &) methods to all inset
5167 classes. Used when exporting to ASCII.
5169 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5170 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5173 * src/text2.C (ToggleFree): Disabled implicit word selection when
5174 there is a change in the language
5176 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5177 no output was generated for end-of-sentence inset.
5179 * src/insets/lyxinset.h
5182 * src/paragraph.C: Removed the insetnumber code
5184 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5186 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5188 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5189 no_babel and no_epsfig completely from the file.
5190 (parseSingleLyXformat2Token): add handling for per-paragraph
5191 spacing as written by klyx.
5193 * src/insets/figinset.C: applied patch by Andre. Made it work with
5196 2000-04-20 Juergen Vigna <jug@sad.it>
5198 * src/insets/insettext.C (cutSelection):
5199 (copySelection): Fixed with selection from right to left.
5200 (draw): now the rows are not recalculated at every draw.
5201 (computeTextRows): for now reset the inset-owner here (this is
5202 important for an undo or copy where the inset-owner is not set
5205 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5206 motion to the_locking_inset screen->first was forgotten, this was
5207 not important till we got multiline insets.
5209 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5211 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5212 code seems to be alright (it is code changed by Dekel, and the
5213 intent is indeed that all macros should be defined \protect'ed)
5215 * NEWS: a bit of reorganisation of the new user-visible features.
5217 2000-04-19 Juergen Vigna <jug@sad.it>
5219 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5220 position. Set the inset_owner of the used paragraph so that it knows
5221 that it is inside an inset. Fixed cursor handling with mouse and
5222 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5223 and cleanups to make TextInsets work better.
5225 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5226 Changed parameters of various functions and added LockInsetInInset().
5228 * src/insets/insettext.C:
5230 * src/insets/insetcollapsable.h:
5231 * src/insets/insetcollapsable.C:
5232 * src/insets/insetfoot.h:
5233 * src/insets/insetfoot.C:
5234 * src/insets/insetert.h:
5235 * src/insets/insetert.C: cleaned up the code so that it works now
5236 correctly with insettext.
5238 * src/insets/inset.C:
5239 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5240 that insets in insets are supported right.
5243 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5245 * src/paragraph.C: some small fixes
5247 * src/debug.h: inserted INSETS debug info
5249 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5250 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5252 * src/commandtags.h:
5253 * src/LyXAction.C: insert code for InsetTabular.
5255 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5256 not Button1MotionMask.
5257 (workAreaButtonRelease): send always a InsetButtonRelease event to
5259 (checkInsetHit): some setCursor fixes (always with insets).
5261 * src/BufferView2.C (lockInset): returns a bool now and extended for
5262 locking insets inside insets.
5263 (showLockedInsetCursor): it is important to have the cursor always
5264 before the locked inset.
5265 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5267 * src/BufferView.h: made lockInset return a bool.
5269 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5271 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5272 that is used also internally but can be called as public to have back
5273 a cursor pos which is not set internally.
5274 (SetCursorIntern): Changed to use above function.
5276 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5278 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5283 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5284 patches for things that should be in or should be changed.
5286 * src/* [insetfiles]: change "usigned char fragile" to bool
5287 fragile. There was only one point that could that be questioned
5288 and that is commented in formulamacro.C. Grep for "CHECK".
5290 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5291 (DeleteBuffer): take it out of CutAndPaste and make it static.
5293 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5296 output the spacing envir commands. Also the new commands used in
5297 the LaTeX output makes the result better.
5299 * src/Spacing.C (writeEnvirBegin): new method
5300 (writeEnvirEnd): new method
5302 2000-04-18 Juergen Vigna <jug@sad.it>
5304 * src/CutAndPaste.C: made textclass a static member of the class
5305 as otherwise it is not accesed right!!!
5307 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5309 * forms/layout_forms.fd
5310 * src/layout_forms.h
5311 * src/layout_forms.C (create_form_form_character)
5312 * src/lyx_cb.C (UserFreeFont)
5313 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5314 documents (in the layout->character popup).
5316 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5318 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5319 \spell_command was in fact not honored (from Kevin Atkinson).
5321 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5324 * src/lyx_gui.h: make lyxViews private (Angus)
5326 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5328 * src/mathed/math_write.C
5329 (MathMatrixInset::Write) Put \protect before \begin{array} and
5330 \end{array} if fragile
5331 (MathParInset::Write): Put \protect before \\ if fragile
5333 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5335 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5336 initialization if the LyXColorHandler must be done after the
5337 connections to the XServer has been established.
5339 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5340 get the background pixel from the lyxColorhandler so that the
5341 figures are rendered with the correct background color.
5342 (NextToken): removed functions.
5343 (GetPSSizes): use ifs >> string instead of NextToken.
5345 * src/Painter.[Ch]: the color cache moved out of this file.
5347 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5350 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5352 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5353 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5355 * src/BufferView.C (enterView): new func
5356 (leaveView): new func
5358 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5360 (leaveView): new func, undefines xterm cursor when approp.
5362 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5363 (AllowInput): delete the Workarea cursor handling from this func.
5365 * src/Painter.C (underline): draw a slimer underline in most cases.
5367 * src/lyx_main.C (error_handler): use extern "C"
5369 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5371 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5372 sent directly to me.
5374 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5375 to the list by Dekel.
5377 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5380 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5381 methods from lyx_cb.here.
5383 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5386 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5388 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5389 instead of using current_view directly.
5391 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5393 * src/LyXAction.C (init): add the paragraph-spacing command.
5395 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5397 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5399 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5400 different from the documents.
5402 * src/text.C (SetHeightOfRow): take paragraph spacing into
5403 account, paragraph spacing takes precedence over buffer spacing
5404 (GetVisibleRow): ditto
5406 * src/paragraph.C (writeFile): output the spacing parameter too.
5407 (validate): set the correct features if spacing is used in the
5409 (Clear): set spacing to default
5410 (MakeSameLayout): spacing too
5411 (HasSameLayout): spacing too
5412 (SetLayout): spacing too
5413 (TeXOnePar): output the spacing commands
5415 * src/lyxparagraph.h: added a spacing variable for use with
5416 per-paragraph spacing.
5418 * src/Spacing.h: add a Default spacing and a method to check if
5419 the current spacing is default. also added an operator==
5421 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5424 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5426 * src/lyxserver.C (callback): fix dispatch of functions
5428 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5429 printf() into lyxerr call.
5431 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5434 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5435 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5436 the "Float" from each of the subitems.
5437 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5439 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5440 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5441 documented the change so that the workaround can be nuked later.
5443 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5446 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5448 * src/buffer.C (getLatexName): ditto
5449 (setReadonly): ditto
5451 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5453 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5454 avoid some uses of current_view. Added also a bufferParams()
5455 method to get at this.
5457 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5459 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5461 * src/lyxparagraph.[Ch]: removed
5462 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5463 with operators used by lower_bound and
5464 upper_bound in InsetTable's
5465 Make struct InsetTable private again. Used matchpos.
5467 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5469 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5470 document, the language of existing text is changed (unless the
5471 document is multi-lingual)
5473 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5475 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5477 * A lot of files: A rewrite of the Right-to-Left support.
5479 2000-04-10 Juergen Vigna <jug@sad.it>
5481 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5482 misplaced cursor when inset in inset is locked.
5484 * src/insets/insettext.C (LocalDispatch): small fix so that a
5485 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5487 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5488 footnote font should be decreased in size twice when displaying.
5490 * src/insets/insettext.C (GetDrawFont): inserted this function as
5491 the drawing-font may differ from the real paragraph font.
5493 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5494 insets (inset in inset!).
5496 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5497 function here because we don't want footnotes inside footnotes.
5499 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5501 (init): now set the inset_owner in paragraph.C
5502 (LocalDispatch): added some resetPos() in the right position
5505 (pasteSelection): changed to use the new CutAndPaste-Class.
5507 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5508 which tells if it is allowed to insert another inset inside this one.
5510 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5511 SwitchLayoutsBetweenClasses.
5513 * src/text2.C (InsertInset): checking of the new paragraph-function
5515 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5516 is not needed anymore here!
5519 (PasteSelection): redone (also with #ifdef) so that now this uses
5520 the CutAndPaste-Class.
5521 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5524 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5525 from/to text/insets.
5527 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5528 so that the paragraph knows if it is inside an (text)-inset.
5529 (InsertFromMinibuffer): changed return-value to bool as now it
5530 may happen that an inset is not inserted in the paragraph.
5531 (InsertInsetAllowed): this checks if it is allowed to insert an
5532 inset in this paragraph.
5534 (BreakParagraphConservative):
5535 (BreakParagraph) : small change for the above change of the return
5536 value of InsertFromMinibuffer.
5538 * src/lyxparagraph.h: added inset_owner and the functions to handle
5539 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5541 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5543 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5544 functions from BufferView to BufferView::Pimpl to ease maintence.
5546 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5547 correctly. Also use SetCursorIntern instead of SetCursor.
5549 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5552 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5554 * src/WorkArea.C (belowMouse): manually implement below mouse.
5556 * src/*: Add "explicit" on several constructors, I added probably
5557 some unneeded ones. A couple of changes to code because of this.
5559 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5560 implementation and private parts from the users of BufferView. Not
5563 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5564 implementation and private parts from the users of LyXLex. Not
5567 * src/BufferView_pimpl.[Ch]: new files
5569 * src/lyxlex_pimpl.[Ch]: new files
5571 * src/LyXView.[Ch]: some inline functions move out-of-line
5573 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5575 * src/lyxparagraph.h: make struct InsetTable public.
5577 * src/support/lyxstring.h: change lyxstring::difference_type to be
5578 ptrdiff_t. Add std:: modifiers to streams.
5580 * src/font.C: include the <cctype> header, for islower() and
5583 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5585 * src/font.[Ch]: new files. Contains the metric functions for
5586 fonts, takes a LyXFont as parameter. Better separation of concepts.
5588 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5589 changes because of this.
5591 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5593 * src/*: compile with -Winline and move functions that don't
5596 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5599 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5601 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5602 (various files changed because of this)
5604 * src/Painter.C (text): fixed the drawing of smallcaps.
5606 * src/lyxfont.[Ch] (drawText): removed unused member func.
5609 * src/*.C: added needed "using" statements and "std::" qualifiers.
5611 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5613 * src/*.h: removed all use of "using" from header files use
5614 qualifier std:: instead.
5616 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5618 * src/text.C (Backspace): some additional cleanups (we already
5619 know whether cursor.pos is 0 or not).
5621 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5622 automake does not provide one).
5624 * src/bmtable.h: replace C++ comments with C comments.
5626 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5628 * src/screen.C (ShowCursor): Change the shape of the cursor if
5629 the current language is not equal to the language of the document.
5630 (If the cursor change its shape unexpectedly, then you've found a bug)
5632 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5635 * src/insets/insetnumber.[Ch]: New files.
5637 * src/LyXAction.C (init)
5638 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5641 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5643 * src/lyxparagraph.h
5644 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5645 (the vector is kept sorted).
5647 * src/text.C (GetVisibleRow): Draw selection correctly when there
5648 is both LTR and RTL text.
5650 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5651 which is much faster.
5653 * src/text.C (GetVisibleRow and other): Do not draw the last space
5654 in a row if the direction of the last letter is not equal to the
5655 direction of the paragraph.
5657 * src/lyxfont.C (latexWriteStartChanges):
5658 Check that font language is not equal to basefont language.
5659 (latexWriteEndChanges): ditto
5661 * src/lyx_cb.C (StyleReset): Don't change the language while using
5662 the font-default command.
5664 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5665 empty paragraph before a footnote.
5667 * src/insets/insetcommand.C (draw): Increase x correctly.
5669 * src/screen.C (ShowCursor): Change cursor shape if
5670 current language != document language.
5672 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5674 2000-03-31 Juergen Vigna <jug@sad.it>
5676 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5677 (Clone): changed mode how the paragraph-data is copied to the
5678 new clone-paragraph.
5680 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5681 GetInset(pos) with no inset anymore there (in inset UNDO)
5683 * src/insets/insetcommand.C (draw): small fix as here x is
5684 incremented not as much as width() returns (2 before, 2 behind = 4)
5686 2000-03-30 Juergen Vigna <jug@sad.it>
5688 * src/insets/insettext.C (InsetText): small fix in initialize
5689 widthOffset (should not be done in the init() function)
5691 2000-03-29 Amir Karger <karger@lyx.org>
5693 * lib/examples/it_ItemizeBullets.lyx: translation by
5696 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5698 2000-03-29 Juergen Vigna <jug@sad.it>
5700 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5702 * src/insets/insetfoot.C (Clone): small change as for the below
5703 new init function in the text-inset
5705 * src/insets/insettext.C (init): new function as I've seen that
5706 clone did not copy the Paragraph-Data!
5707 (LocalDispatch): Added code so that now we have some sort of Undo
5708 functionality (well actually we HAVE Undo ;)
5710 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5712 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5714 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5717 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5719 * src/main.C: added a runtime check that verifies that the xforms
5720 header used when building LyX and the library used when running
5721 LyX match. Exit with a message if they don't match. This is a
5722 version number check only.
5724 * src/buffer.C (save): Don't allocate memory on the heap for
5725 struct utimbuf times.
5727 * *: some using changes, use iosfwd instead of the real headers.
5729 * src/lyxfont.C use char const * instead of string for the static
5730 strings. Rewrite some functions to use sstream.
5732 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5734 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5737 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5739 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5740 of Geodesy (from Martin Vermeer)
5742 * lib/layouts/svjour.inc: include file for the Springer svjour
5743 class. It can be used to support journals other than JoG.
5745 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5746 Miskiewicz <misiek@pld.org.pl>)
5747 * lib/reLyX/Makefile.am: ditto.
5749 2000-03-27 Juergen Vigna <jug@sad.it>
5751 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5752 also some modifications with operations on selected text.
5754 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5755 problems with clicking on insets (last famous words ;)
5757 * src/insets/insetcommand.C (draw):
5758 (width): Changed to have a bit of space before and after the inset so
5759 that the blinking cursor can be seen (otherwise it was hidden)
5761 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5763 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5764 would not be added to the link list when an installed gettext (not
5765 part of libc) is found.
5767 2000-03-24 Juergen Vigna <jug@sad.it>
5769 * src/insets/insetcollapsable.C (Edit):
5770 * src/mathed/formula.C (InsetButtonRelease):
5771 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5774 * src/BufferView.C (workAreaButtonPress):
5775 (workAreaButtonRelease):
5776 (checkInsetHit): Finally fixed the clicking on insets be handled
5779 * src/insets/insetert.C (Edit): inserted this call so that ERT
5780 insets work always with LaTeX-font
5782 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5784 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5785 caused lyx to startup with no GUI in place, causing in a crash
5786 upon startup when called with arguments.
5788 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5790 * src/FontLoader.C: better initialization of dummyXFontStruct.
5792 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5794 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5795 for linuxdoc and docbook import and export format options.
5797 * lib/lyxrc.example Example of default values for the previous flags.
5799 * src/lyx_cb.C Use those flags instead of the hardwired values for
5800 linuxdoc and docbook export.
5802 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5805 * src/menus.C Added menus entries for the new import/exports formats.
5807 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5809 * src/lyxrc.*: Added support for running without Gui
5812 * src/FontLoader.C: sensible defaults if no fonts are needed
5814 * src/lyx_cb.C: New function ShowMessage (writes either to the
5815 minibuffer or cout in case of no gui
5816 New function AskOverwrite for common stuff
5817 Consequently various changes to call these functions
5819 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5820 wild guess at sensible screen resolution when having no gui
5822 * src/lyxfont.C: no gui, no fonts... set some defaults
5824 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5826 * src/LColor.C: made the command inset background a bit lighter.
5828 2000-03-20 Hartmut Goebel <goebel@noris.net>
5830 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5831 stdstruct.inc. Koma-Script added some title elements which
5832 otherwise have been listed below "bibliography". This split allows
5833 adding title elements to where they belong.
5835 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5836 define the additional tilte elements and then include
5839 * many other layout files: changed to include stdtitle.inc just
5840 before stdstruct.inc.
5842 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5844 * src/buffer.C: (save) Added the option to store all backup files
5845 in a single directory
5847 * src/lyxrc.[Ch]: Added variable \backupdir_path
5849 * lib/lyxrc.example: Added descriptions of recently added variables
5851 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5852 bibtex inset, not closing the bibtex popup when deleting the inset)
5854 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5856 * src/lyx_cb.C: add a couple using directives.
5858 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5859 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5860 import based on the filename.
5862 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5863 file would be imported at start, if the filename where of a sgml file.
5865 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5867 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5869 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5870 * src/lyxfont.h Replaced the member variable bits.direction by the
5871 member variable lang. Made many changes in other files.
5872 This allows having a multi-lingual document
5874 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5875 that change the current language to <l>.
5876 Removed the command "font-rtl"
5878 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5879 format for Hebrew documents)
5881 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5882 When auto_mathmode is "true", pressing a digit key in normal mode
5883 will cause entering into mathmode.
5884 If auto_mathmode is "rtl" then this behavior will be active only
5885 when writing right-to-left text.
5887 * src/text2.C (InsertStringA) The string is inserted using the
5890 * src/paragraph.C (GetEndLabel) Gives a correct result for
5891 footnote paragraphs.
5893 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5895 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5897 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5898 front of PasteParagraph. Never insert a ' '. This should at least
5899 fix some cause for the segfaults that we have been experiencing,
5900 it also fixes backspace behaviour slightly. (Phu!)
5902 * src/support/lstrings.C (compare_no_case): some change to make it
5903 compile with gcc 2.95.2 and stdlibc++-v3
5905 * src/text2.C (MeltFootnoteEnvironment): change type o
5906 first_footnote_par_is_not_empty to bool.
5908 * src/lyxparagraph.h: make text private. Changes in other files
5910 (fitToSize): new function
5911 (setContentsFromPar): new function
5912 (clearContents): new function
5913 (SetChar): new function
5915 * src/paragraph.C (readSimpleWholeFile): deleted.
5917 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5918 the file, just use a simple string instead. Also read the file in
5919 a more maintainable manner.
5921 * src/text2.C (InsertStringA): deleted.
5922 (InsertStringB): deleted.
5924 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5926 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5927 RedoParagraphs from the doublespace handling part, just set status
5928 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5929 done, but perhaps not like this.)
5931 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5933 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5934 character when inserting an inset.
5936 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5938 * src/bufferparams.C (readLanguage): now takes "default" into
5941 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5942 also initialize the toplevel_keymap with the default bindings from
5945 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5947 * all files using lyxrc: have lyxrc as a real variable and not a
5948 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5951 * src/lyxrc.C: remove double call to defaultKeyBindings
5953 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5954 toolbar defauls using lyxlex. Remove enums, structs, functions
5957 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5958 toolbar defaults. Also store default keybindings in a map.
5960 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5961 storing the toolbar defaults without any xforms dependencies.
5963 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5964 applied. Changed to use iterators.
5966 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5968 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5969 systems that don't have LINGUAS set to begin with.
5971 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5973 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5974 the list by Dekel Tsur.
5976 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5978 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5979 * src/insets/form_graphics.C: ditto.
5981 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5983 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5985 * src/bufferparams.C (readLanguage): use the new language map
5987 * src/intl.C (InitKeyMapper): use the new language map
5989 * src/lyx_gui.C (create_forms): use the new language map
5991 * src/language.[Ch]: New files. Used for holding the information
5992 about each language. Now! Use this new language map enhance it and
5993 make it really usable for our needs.
5995 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5997 * screen.C (ShowCursor): Removed duplicate code.
5998 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5999 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6001 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6004 * src/text.C Added TransformChar method. Used for rendering Arabic
6005 text correctly (change the glyphs of the letter according to the
6006 position in the word)
6011 * src/lyxrc.C Added lyxrc command {language_command_begin,
6012 language_command_end,language_command_ltr,language_command_rtl,
6013 language_package} which allows the use of either arabtex or Omega
6016 * src/lyx_gui.C (init)
6018 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6019 to use encoding for menu fonts which is different than the encoding
6022 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6023 do not load the babel package.
6024 To write an English document with Hebrew/Arabic, change the document
6025 language to "english".
6027 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6028 (alphaCounter): changed to return char
6029 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6031 * lib/lyxrc.example Added examples for Hebrew/Arabic
6034 * src/layout.C Added layout command endlabeltype
6036 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6038 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6040 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6042 * src/mathed/math_delim.C (search_deco): return a
6043 math_deco_struct* instead of index.
6045 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * All files with a USE_OSTREAM_ONLY within: removed all code that
6048 was unused when USE_OSTREAM_ONLY is defined.
6050 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6051 of any less. Removed header and using.
6053 * src/text.C (GetVisibleRow): draw the string "Page Break
6054 (top/bottom)" on screen when drawing a pagebreak line.
6056 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6058 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6060 * src/mathed/math_macro.C (draw): do some cast magic.
6063 * src/mathed/math_defs.h: change byte* argument to byte const*.
6065 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6067 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6068 know it is right to return InsetFoot* too, but cxx does not like
6071 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6073 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6075 * src/mathed/math_delim.C: change == to proper assignment.
6077 2000-03-09 Juergen Vigna <jug@sad.it>
6079 * src/insets/insettext.C (setPos): fixed various cursor positioning
6080 problems (via mouse and cursor-keys)
6081 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6082 inset (still a small display problem but it works ;)
6084 * src/insets/insetcollapsable.C (draw): added button_top_y and
6085 button_bottom_y to have correct values for clicking on the inset.
6087 * src/support/lyxalgo.h: commented out 'using std::less'
6089 2000-03-08 Juergen Vigna <jug@sad.it>
6091 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6092 Button-Release event closes as it is alos the Release-Event
6095 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6097 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6099 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6100 can add multiple spaces in Scrap (literate programming) styles...
6101 which, by the way, is how I got hooked on LyX to begin with.
6103 * src/mathed/formula.C (Write): Added dummy variable to an
6104 inset::Latex() call.
6105 (Latex): Add free_spacing boolean to inset::Latex()
6107 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6109 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6110 virtual function to include the free_spacing boolean from
6111 the containing paragraph's style.
6113 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6114 Added free_spacing boolean arg to match inset.h
6116 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6117 Added free_spacing boolean arg to match inset.h
6119 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6120 Added free_spacing boolean and made sure that if in a free_spacing
6121 paragraph, that we output normal space if there is a protected space.
6123 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6124 Added free_spacing boolean arg to match inset.h
6126 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6127 Added free_spacing boolean arg to match inset.h
6129 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6130 Added free_spacing boolean arg to match inset.h
6132 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6133 Added free_spacing boolean arg to match inset.h
6135 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6136 Added free_spacing boolean arg to match inset.h
6138 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6139 free_spacing boolean arg to match inset.h
6141 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6142 Added free_spacing boolean arg to match inset.h
6144 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6145 Added free_spacing boolean arg to match inset.h
6147 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6148 Added free_spacing boolean arg to match inset.h
6150 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6151 Added free_spacing boolean arg to match inset.h
6153 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6154 Added free_spacing boolean arg to match inset.h
6156 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6157 free_spacing boolean arg to match inset.h
6159 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6160 free_spacing boolean arg to match inset.h
6162 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6163 ignore free_spacing paragraphs. The user's spaces are left
6166 * src/text.C (InsertChar): Fixed the free_spacing layout
6167 attribute behavior. Now, if free_spacing is set, you can
6168 add multiple spaces in a paragraph with impunity (and they
6169 get output verbatim).
6170 (SelectSelectedWord): Added dummy argument to inset::Latex()
6173 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6176 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6177 paragraph layouts now only input a simple space instead.
6178 Special character insets don't make any sense in free-spacing
6181 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6182 hard-spaces in the *input* file to simple spaces if the layout
6183 is free-spacing. This converts old files which had to have
6184 hard-spaces in free-spacing layouts where a simple space was
6186 (writeFileAscii): Added free_spacing check to pass to the newly
6187 reworked inset::Latex(...) methods. The inset::Latex() code
6188 ensures that hard-spaces in free-spacing paragraphs get output
6189 as spaces (rather than "~").
6191 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6193 * src/mathed/math_delim.C (draw): draw the empty placeholder
6194 delims with a onoffdash line.
6195 (struct math_deco_compare): struct that holds the "functors" used
6196 for the sort and the binary search in math_deco_table.
6197 (class init_deco_table): class used for initial sort of the
6199 (search_deco): use lower_bound to do a binary search in the
6202 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6204 * src/lyxrc.C: a small secret thingie...
6206 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6207 and to not flush the stream as often as it used to.
6209 * src/support/lyxalgo.h: new file
6210 (sorted): template function used for checking if a sequence is
6211 sorted or not. Two versions with and without user supplied
6212 compare. Uses same compare as std::sort.
6214 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6215 it and give warning on lyxerr.
6217 (struct compare_tags): struct with function operators used for
6218 checking if sorted, sorting and lower_bound.
6219 (search_kw): use lower_bound instead of manually implemented
6222 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6224 * src/insets/insetcollapsable.h: fix Clone() declaration.
6225 * src/insets/insetfoot.h: ditto.
6227 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6229 2000-03-08 Juergen Vigna <jug@sad.it>
6231 * src/insets/lyxinset.h: added owner call which tells us if
6232 this inset is inside another inset. Changed also the return-type
6233 of Editable to an enum so it tells clearer what the return-value is.
6235 * src/insets/insettext.C (computeTextRows): fixed computing of
6236 textinsets which split automatically on more rows.
6238 * src/insets/insetert.[Ch]: changed this to be of BaseType
6241 * src/insets/insetfoot.[Ch]: added footnote inset
6243 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6244 collapsable insets (like footnote, ert, ...)
6246 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6248 * src/lyxdraw.h: remvoe file
6250 * src/lyxdraw.C: remove file
6252 * src/insets/insettext.C: added <algorithm>.
6254 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6256 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6257 (matrix_cb): case MM_OK use string stream
6259 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6262 * src/mathed/math_macro.C (draw): use string stream
6263 (Metrics): use string stream
6265 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6266 directly to the ostream.
6268 * src/vspace.C (asString): use string stream.
6269 (asString): use string stream
6270 (asLatexString): use string stream
6272 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6273 setting Spacing::Other.
6275 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6276 sprintf when creating the stretch vale.
6278 * src/text2.C (alphaCounter): changed to return a string and to
6279 not use a static variable internally. Also fixed a one-off bug.
6280 (SetCounter): changed the drawing of the labels to use string
6281 streams instead of sprintf.
6283 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6284 manipulator to use a scheme that does not require library support.
6285 This is also the way it is done in the new GNU libstdc++. Should
6286 work with DEC cxx now.
6288 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6290 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6291 end. This fixes a bug.
6293 * src/mathed (all files concerned with file writing): apply the
6294 USE_OSTREAM_ONLY changes to mathed too.
6296 * src/support/DebugStream.h: make the constructor explicit.
6298 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6299 count and ostream squashed.
6301 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6303 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6305 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6306 ostringstream uses STL strings, and we might not.
6308 * src/insets/insetspecialchar.C: add using directive.
6309 * src/insets/insettext.C: ditto.
6311 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6313 * lib/layouts/seminar.layout: feeble attempt at a layout for
6314 seminar.cls, far from completet and could really use some looking
6315 at from people used to write layout files.
6317 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6318 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6319 a lot nicer and works nicely with ostreams.
6321 * src/mathed/formula.C (draw): a slightly different solution that
6322 the one posted to the list, but I think this one works too. (font
6323 size wrong in headers.)
6325 * src/insets/insettext.C (computeTextRows): some fiddling on
6326 Jürgens turf, added some comments that he should read.
6328 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6329 used and it gave compiler warnings.
6330 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6333 * src/lyx_gui.C (create_forms): do the right thing when
6334 show_banner is true/false.
6336 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6337 show_banner is false.
6339 * most file writing files: Now use iostreams to do almost all of
6340 the writing. Also instead of passing string &, we now use
6341 stringstreams. mathed output is still not adapted to iostreams.
6342 This change can be turned off by commenting out all the occurences
6343 of the "#define USE_OSTREAM_ONLY 1" lines.
6345 * src/WorkArea.C (createPixmap): don't output debug messages.
6346 (WorkArea): don't output debug messages.
6348 * lib/lyxrc.example: added a comment about the new variable
6351 * development/Code_rules/Rules: Added some more commente about how
6352 to build class interfaces and on how better encapsulation can be
6355 2000-03-03 Juergen Vigna <jug@sad.it>
6357 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6358 automatically with the width of the LyX-Window
6360 * src/insets/insettext.C (computeTextRows): fixed update bug in
6361 displaying text-insets (scrollvalues where not initialized!)
6363 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6365 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6366 id in the check of the result from lower_bound is not enough since
6367 lower_bound can return last too, and then res->id will not be a
6370 * all insets and some code that use them: I have conditionalized
6371 removed the Latex(string & out, ...) this means that only the
6372 Latex(ostream &, ...) will be used. This is a work in progress to
6373 move towards using streams for all output of files.
6375 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6378 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6380 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6381 routine (this fixes bug where greek letters were surrounded by too
6384 * src/support/filetools.C (findtexfile): change a bit the search
6385 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6386 no longer passed to kpsewhich, we may have to change that later.
6388 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6389 warning options to avoid problems with X header files (from Angus
6391 * acinclude.m4: regenerated.
6393 2000-03-02 Juergen Vigna <jug@sad.it>
6395 * src/insets/insettext.C (WriteParagraphData): Using the
6396 par->writeFile() function for writing paragraph-data.
6397 (Read): Using buffer->parseSingleLyXformat2Token()-function
6398 for parsing paragraph data!
6400 * src/buffer.C (readLyXformat2): removed all parse data and using
6401 the new parseSingleLyXformat2Token()-function.
6402 (parseSingleLyXformat2Token): added this function to parse (read)
6403 lyx-file-format (this is called also from text-insets now!)
6405 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6407 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6410 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6411 directly instead of going through a func. One very bad thing: a
6412 static LyXFindReplace, but I don't know where to place it.
6414 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6415 string instead of char[]. Also changed to static.
6416 (GetSelectionOrWordAtCursor): changed to static inline
6417 (SetSelectionOverLenChars): ditto.
6419 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6420 current_view and global variables. both classes has changed names
6421 and LyXFindReplace is not inherited from SearchForm.
6423 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6424 fl_form_search form.
6426 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6428 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6430 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6431 bound (from Kayvan).
6433 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6435 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6437 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6439 * some things that I should comment but the local pub says head to
6442 * comment out all code that belongs to the Roff code for Ascii
6443 export of tables. (this is unused)
6445 * src/LyXView.C: use correct type for global variable
6446 current_layout. (LyXTextClass::size_type)
6448 * some code to get the new insetgraphics closer to working I'd be
6449 grateful for any help.
6451 * src/BufferView2.C (insertInset): use the return type of
6452 NumberOfLayout properly. (also changes in other files)
6454 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6455 this as a test. I want to know what breaks because of this.
6457 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6459 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6462 to use a \makebox in the label, this allows proper justification
6463 with out using protected spaces or multiple hfills. Now it is
6464 "label" for left justified, "\hfill label\hfill" for center, and
6465 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6466 should be changed accordingly.
6468 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6470 * src/lyxtext.h: change SetLayout() to take a
6471 LyXTextClass::size_type instead of a char (when there is more than
6472 127 layouts in a class); also change type of copylayouttype.
6473 * src/text2.C (SetLayout): ditto.
6474 * src/LyXView.C (updateLayoutChoice): ditto.
6476 * src/LaTeX.C (scanLogFile): errors where the line number was not
6477 given just after the '!'-line were ignored (from Dekel Tsur).
6479 * lib/lyxrc.example: fix description of \date_insert_format
6481 * lib/layouts/llncs.layout: new layout, contributed by Martin
6484 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6486 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6487 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6488 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6489 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6490 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6491 paragraph.C, text.C, text2.C)
6493 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6495 * src/insets/insettext.C (LocalDispatch): remove extra break
6498 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6499 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6501 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6502 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6504 * src/insets/insetbib.h: move InsetBibkey::Holder and
6505 InsetCitation::Holder in public space.
6507 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6509 * src/insets/insettext.h: small change to get the new files from
6510 Juergen to compile (use "string", not "class string").
6512 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6513 const & as parameter to LocalDispatch, use LyXFont const & as
6514 paramter to some other func. This also had impacto on lyxinsets.h
6515 and the two mathed insets.
6517 2000-02-24 Juergen Vigna <jug@sad.it>
6520 * src/commandtags.h:
6522 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6526 * src/BufferView2.C: added/updated code for various inset-functions
6528 * src/insets/insetert.[Ch]: added implementation of InsetERT
6530 * src/insets/insettext.[Ch]: added implementation of InsetText
6532 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6533 (draw): added preliminary code for inset scrolling not finshed yet
6535 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6536 as it is in lyxfunc.C now
6538 * src/insets/lyxinset.h: Added functions for text-insets
6540 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6542 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6543 BufferView and reimplement the list as a queue put inside its own
6546 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6548 * several files: use the new interface to the "updateinsetlist"
6550 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6552 (work_area_handler): call BufferView::trippleClick on trippleclick.
6554 * src/BufferView.C (doubleClick): new function, selects word on
6556 (trippleClick): new function, selects line on trippleclick.
6558 2000-02-22 Allan Rae <rae@lyx.org>
6560 * lib/bind/xemacs.bind: buffer-previous not supported
6562 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6567 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6569 * src/bufferlist.C: get rid of current_view from this file
6571 * src/spellchecker.C: get rid of current_view from this file
6573 * src/vspace.C: get rid of current_view from this file
6574 (inPixels): added BufferView parameter for this func
6575 (asLatexCommand): added a BufferParams for this func
6577 * src/text.C src/text2.C: get rid of current_view from these
6580 * src/lyxfont.C (getFontDirection): move this function here from
6583 * src/bufferparams.C (getDocumentDirection): move this function
6586 * src/paragraph.C (getParDirection): move this function here from
6588 (getLetterDirection): ditto
6590 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6592 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6593 resize due to wrong pixmap beeing used. Also took the opurtunity
6594 to make the LyXScreen stateless on regard to WorkArea and some
6595 general cleanup in the same files.
6597 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6599 * src/Makefile.am: add missing direction.h
6601 * src/PainterBase.h: made the width functions const.
6603 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6606 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6608 * src/insets/insetlatexaccent.C (draw): make the accents draw
6609 better, at present this will only work well with iso8859-1.
6611 * several files: remove the old drawing code, now we use the new
6614 * several files: remove support for mono_video, reverse_video and
6617 2000-02-17 Juergen Vigna <jug@sad.it>
6619 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6620 int ** as we have to return the pointer, otherwise we have only
6621 NULL pointers in the returning function.
6623 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6625 * src/LaTeX.C (operator()): quote file name when running latex.
6627 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6629 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6630 (bubble tip), this removes our special handling of this.
6632 * Remove all code that is unused now that we have the new
6633 workarea. (Code that are not active when NEW_WA is defined.)
6635 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6637 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6639 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6640 nonexisting layout; correctly redirect obsoleted layouts.
6642 * lib/lyxrc.example: document \view_dvi_paper_option
6644 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6647 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6648 (PreviewDVI): handle the view_dvi_paper_option variable.
6649 [Both from Roland Krause]
6651 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6653 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6654 char const *, int, LyXFont)
6655 (text(int, int, string, LyXFont)): ditto
6657 * src/text.C (InsertCharInTable): attempt to fix the double-space
6658 feature in tables too.
6659 (BackspaceInTable): ditto.
6660 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6662 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6664 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6666 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6667 newly found text in textcache to this.
6668 (buffer): set the owner of the text put into the textcache to 0
6670 * src/insets/figinset.C (draw): fixed the drawing of figures with
6673 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6674 drawing of mathframe, hfills, protected space, table lines. I have
6675 now no outstanding drawing problems with the new Painter code.
6677 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6679 * src/PainterBase.C (ellipse, circle): do not specify the default
6682 * src/LColor.h: add using directive.
6684 * src/Painter.[Ch]: change return type of methods from Painter& to
6685 PainterBase&. Add a using directive.
6687 * src/WorkArea.C: wrap xforms callbacks in C functions
6690 * lib/layouts/foils.layout: font fix and simplifications from Carl
6693 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6695 * a lot of files: The Painter, LColor and WorkArea from the old
6696 devel branch has been ported to lyx-devel. Some new files and a
6697 lot of #ifdeffed code. The new workarea is enabled by default, but
6698 if you want to test the new Painter and LColor you have to compile
6699 with USE_PAINTER defined (do this in config.h f.ex.) There are
6700 still some rought edges, and I'd like some help to clear those
6701 out. It looks stable (loads and displays the Userguide very well).
6704 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6706 * src/buffer.C (pop_tag): revert to the previous implementation
6707 (use a global variable for both loops).
6709 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6711 * src/lyxrc.C (LyXRC): change slightly default date format.
6713 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6714 there is an English text with a footnote that starts with a Hebrew
6715 paragraph, or vice versa.
6716 (TeXFootnote): ditto.
6718 * src/text.C (LeftMargin): allow for negative values for
6719 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6722 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6723 for input encoding (cyrillic)
6725 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6727 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6730 * src/toolbar.C (set): ditto
6731 * src/insets/insetbib.C (create_form_citation_form): ditto
6733 * lib/CREDITS: added Dekel Tsur.
6735 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6736 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6737 hebrew supports files from Dekel Tsur.
6739 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6740 <tzafrir@technion.ac.il>
6742 * src/lyxrc.C: put \date_insert_format at the right place.
6744 * src/buffer.C (makeLaTeXFile): fix the handling of
6745 BufferParams::sides when writing out latex files.
6747 * src/BufferView2.C: add a "using" directive.
6749 * src/support/lyxsum.C (sum): when we use lyxstring,
6750 ostringstream::str needs an additional .c_str().
6752 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6754 * src/support/filetools.C (ChangeExtension): patch from Etienne
6757 * src/TextCache.C (show): remove const_cast and make second
6758 parameter non-const LyXText *.
6760 * src/TextCache.h: use non const LyXText in show.
6762 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6765 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6767 * src/support/lyxsum.C: rework to be more flexible.
6769 * several places: don't check if a pointer is 0 if you are going
6772 * src/text.C: remove some dead code.
6774 * src/insets/figinset.C: remove some dead code
6776 * src/buffer.C: move the BufferView funcs to BufferView2.C
6777 remove all support for insetlatexdel
6778 remove support for oldpapersize stuff
6779 made some member funcs const
6781 * src/kbmap.C: use a std::list to store the bindings in.
6783 * src/BufferView2.C: new file
6785 * src/kbsequence.[Ch]: new files
6787 * src/LyXAction.C + others: remove all trace of buffer-previous
6789 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6790 only have one copy in the binary of this table.
6792 * hebrew patch: moved some functions from LyXText to more
6793 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6795 * several files: remove support for XForms older than 0.88
6797 remove some #if 0 #endif code
6799 * src/TextCache.[Ch]: new file. Holds the textcache.
6801 * src/BufferView.C: changes to use the new TextCache interface.
6802 (waitForX): remove the now unused code.
6804 * src/BackStack.h: remove some commented code
6806 * lib/bind/emacs.bind: remove binding for buffer-previous
6808 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * applied the hebrew patch.
6812 * src/lyxrow.h: make sure that all Row variables are initialized.
6814 * src/text2.C (TextHandleUndo): comment out a delete, this might
6815 introduce a memory leak, but should also help us to not try to
6816 read freed memory. We need to look at this one.
6818 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6819 (LyXParagraph): initalize footnotekind.
6821 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6822 forgot this when applying the patch. Please heed the warnings.
6824 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6825 (aka. reformat problem)
6827 * src/bufferlist.C (exists): made const, and use const_iterator
6828 (isLoaded): new func.
6829 (release): use std::find to find the correct buffer.
6831 * src/bufferlist.h: made getState a const func.
6832 made empty a const func.
6833 made exists a const func.
6836 2000-02-01 Juergen Vigna <jug@sad.it>
6838 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6840 * po/it.po: updated a bit the italian po file and also changed the
6841 'file nuovo' for newfile to 'filenuovo' without a space, this did
6844 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6845 for the new insert_date command.
6847 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6848 from jdblair, to insert a date into the current text conforming to
6849 a strftime format (for now only considering the locale-set and not
6850 the document-language).
6852 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6854 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6855 Bounds Read error seen by purify. The problem was that islower is
6856 a macros which takes an unsigned char and uses it as an index for
6857 in array of characters properties (and is thus subject to the
6861 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6862 correctly the paper sides radio buttons.
6863 (UpdateDocumentButtons): ditto.
6865 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * src/kbmap.C (getsym + others): change to return unsigned int,
6868 returning a long can give problems on 64 bit systems. (I assume
6869 that int is 32bit on 64bit systems)
6871 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6873 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6874 LyXLookupString to be zero-terminated. Really fixes problems seen
6877 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6879 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6880 write a (char*)0 to the lyxerr stream.
6882 * src/lastfiles.C: move algorithm before the using statemets.
6884 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6886 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6887 complains otherwise).
6888 * src/table.C: ditto
6890 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6893 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6894 that I removed earlier... It is really needed.
6896 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6898 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6900 * INSTALL: update xforms home page URL.
6902 * lib/configure.m4: fix a bug with unreadable layout files.
6904 * src/table.C (calculate_width_of_column): add "using std::max"
6907 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6909 * several files: marked several lines with "DEL LINE", this is
6910 lines that can be deleted without changing anything.
6911 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6912 checks this anyway */
6915 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6917 * src/DepTable.C (update): add a "+" at the end when the checksum
6918 is different. (debugging string only)
6920 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6921 the next inset to not be displayed. This should also fix the list
6922 of labels in the "Insert Crossreference" dialog.
6924 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6926 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6927 when regex was not found.
6929 * src/support/lstrings.C (lowercase): use handcoded transform always.
6932 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6933 old_cursor.par->prev could be 0.
6935 * several files: changed post inc/dec to pre inc/dec
6937 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6938 write the lastfiles to file.
6940 * src/BufferView.C (buffer): only show TextCache info when debugging
6942 (resizeCurrentBuffer): ditto
6943 (workAreaExpose): ditto
6945 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6947 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6949 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6950 a bit better by removing the special case for \i and \j.
6952 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6954 * src/lyx_main.C (easyParse): remove test for bad comand line
6955 options, since this broke all xforms-related parsing.
6957 * src/kbmap.C (getsym): set return type to unsigned long, as
6958 declared in header. On an alpha, long is _not_ the same as int.
6960 * src/support/LOstream.h: add a "using std::flush;"
6962 * src/insets/figinset.C: ditto.
6964 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6966 * src/bufferlist.C (write): use blinding fast file copy instead of
6967 "a char at a time", now we are doing it the C++ way.
6969 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6970 std::list<int> instead.
6971 (addpidwait): reflect move to std::list<int>
6972 (sigchldchecker): ditto
6974 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6977 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6978 that obviously was wrong...
6980 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6981 c, this avoids warnings with purify and islower.
6983 * src/insets/figinset.C: rename struct queue to struct
6984 queue_element and rewrite to use a std::queue. gsqueue is now a
6985 std::queue<queue_element>
6986 (runqueue): reflect move to std::queue
6989 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6990 we would get "1" "0" instead of "true" "false. Also make the tostr
6993 2000-01-21 Juergen Vigna <jug@sad.it>
6995 * src/buffer.C (writeFileAscii): Disabled code for special groff
6996 handling of tabulars till I fix this in table.C
6998 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7000 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7002 * src/support/lyxlib.h: ditto.
7004 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7006 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7007 and 'j' look better. This might fix the "macron" bug that has been
7010 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7011 functions as one template function. Delete the old versions.
7013 * src/support/lyxsum.C: move using std::ifstream inside
7016 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7019 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7021 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7023 * src/insets/figinset.C (InitFigures): use new instead of malloc
7024 to allocate memory for figures and bitmaps.
7025 (DoneFigures): use delete[] instead of free to deallocate memory
7026 for figures and bitmaps.
7027 (runqueue): use new to allocate
7028 (getfigdata): use new/delete[] instead of malloc/free
7029 (RegisterFigure): ditto
7031 * some files: moved some declarations closer to first use, small
7032 whitespace changes use preincrement instead of postincrement where
7033 it does not make a difference.
7035 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7036 step on the way to use stl::containers for key maps.
7038 * src/bufferlist.h: add a typedef for const_iterator and const
7039 versions of begin and end.
7041 * src/bufferlist.[Ch]: change name of member variable _state to
7042 state_. (avoid reserved names)
7044 (getFileNames): returns the filenames of the buffers in a vector.
7046 * configure.in (ALL_LINGUAS): added ro
7048 * src/support/putenv.C: new file
7050 * src/support/mkdir.C: new file
7052 2000-01-20 Allan Rae <rae@lyx.org>
7054 * lib/layouts/IEEEtran.layout: Added several theorem environments
7056 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7057 couple of minor additions.
7059 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7060 (except for those in footnotes of course)
7062 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7064 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7066 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7067 std::sort and std::lower_bound instead of qsort and handwritten
7069 (struct compara): struct that holds the functors used by std::sort
7070 and std::lower_bound in MathedLookupBOP.
7072 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7074 * src/support/LAssert.h: do not do partial specialization. We do
7077 * src/support/lyxlib.h: note that lyx::getUserName() and
7078 lyx::date() are not in use right now. Should these be suppressed?
7080 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7081 (makeLinuxDocFile): do not put date and user name in linuxdoc
7084 * src/support/lyxlib.h (kill): change first argument to long int,
7085 since that's what solaris uses.
7087 * src/support/kill.C (kill): fix declaration to match prototype.
7089 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7090 actually check whether namespaces are supported. This is not what
7093 * src/support/lyxsum.C: add a using directive.
7095 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * src/support/kill.C: if we have namespace support we don't have
7098 to include lyxlib.h.
7100 * src/support/lyxlib.h: use namespace lyx if supported.
7102 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7104 * src/support/date.C: new file
7106 * src/support/chdir.C: new file
7108 * src/support/getUserName.C: new file
7110 * src/support/getcwd.C: new file
7112 * src/support/abort.C: new file
7114 * src/support/kill.C: new file
7116 * src/support/lyxlib.h: moved all the functions in this file
7117 insede struct lyx. Added also kill and abort to this struct. This
7118 is a way to avoid the "kill is not defined in <csignal>", we make
7119 C++ wrappers for functions that are not ANSI C or ANSI C++.
7121 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7122 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7123 lyx it has been renamed to sum.
7125 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7127 * src/text.C: add using directives for std::min and std::max.
7129 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7131 * src/texrow.C (getIdFromRow): actually return something useful in
7132 id and pos. Hopefully fixes the bug with positionning of errorbox
7135 * src/lyx_main.C (easyParse): output an error and exit if an
7136 incorrect command line option has been given.
7138 * src/spellchecker.C (ispell_check_word): document a memory leak.
7140 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7141 where a "struct utimbuf" is allocated with "new" and deleted with
7144 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7146 * src/text2.C (CutSelection): don't delete double spaces.
7147 (PasteSelection): ditto
7148 (CopySelection): ditto
7150 * src/text.C (Backspace): don't delete double spaces.
7152 * src/lyxlex.C (next): fix a bug that were only present with
7153 conformant std::istream::get to read comment lines, use
7154 std::istream::getline instead. This seems to fix the problem.
7156 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7158 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7159 allowed to insert space before space" editing problem. Please read
7160 commends at the beginning of the function. Comments about usage
7163 * src/text.C (InsertChar): fix for the "not allowed to insert
7164 space before space" editing problem.
7166 * src/text2.C (DeleteEmptyParagraphMechanism): when
7167 IsEmptyTableRow can only return false this last "else if" will
7168 always be a no-op. Commented out.
7170 * src/text.C (RedoParagraph): As far as I can understand tmp
7171 cursor is not really needed.
7173 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7174 present it could only return false anyway.
7175 (several functions): Did something not so smart...added a const
7176 specifier on a lot of methods.
7178 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7179 and add a tmp->text.resize. The LyXParagraph constructor does the
7181 (BreakParagraphConservative): ditto
7183 * src/support/path.h (Path): add a define so that the wrong usage
7184 "Path("/tmp") will be flagged as a compilation error:
7185 "`unnamed_Path' undeclared (first use this function)"
7187 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7189 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7190 which was bogus for several reasons.
7192 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7196 * autogen.sh: do not use "type -path" (what's that anyway?).
7198 * src/support/filetools.C (findtexfile): remove extraneous space
7199 which caused a kpsewhich warning (at least with kpathsea version
7202 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7206 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7208 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7210 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7212 * src/paragraph.C (BreakParagraph): do not reserve space on text
7213 if we don't need to (otherwise, if pos_end < pos, we end up
7214 reserving huge amounts of memory due to bad unsigned karma).
7215 (BreakParagraphConservative): ditto, although I have not seen
7216 evidence the bug can happen here.
7218 * src/lyxparagraph.h: add a using std::list.
7220 2000-01-11 Juergen Vigna <jug@sad.it>
7222 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7225 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7227 * src/vc-backend.C (doVCCommand): change to be static and take one
7228 more parameter: the path to chdir too be fore executing the command.
7229 (retrive): new function equiv to "co -r"
7231 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7232 file_not_found_hook is true.
7234 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7236 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7237 if a file is readwrite,readonly...anything else.
7239 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7242 (CreatePostscript): name change from MenuRunDVIPS (or something)
7243 (PreviewPostscript): name change from MenuPreviewPS
7244 (PreviewDVI): name change from MenuPreviewDVI
7246 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7247 \view_pdf_command., \pdf_to_ps_command
7249 * lib/configure.m4: added search for PDF viewer, and search for
7250 PDF to PS converter.
7251 (lyxrc.defaults output): add \pdflatex_command,
7252 \view_pdf_command and \pdf_to_ps_command.
7254 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7256 * src/bufferlist.C (write): we don't use blocksize for anything so
7259 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7261 * src/support/block.h: disable operator T* (), since it causes
7262 problems with both compilers I tried. See comments in the file.
7264 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7267 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7268 variable LYX_DIR_10x to LYX_DIR_11x.
7270 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7272 * INSTALL: document --with-lyxname.
7275 * configure.in: new configure flag --with-lyxname which allows to
7276 choose the name under which lyx is installed. Default is "lyx", of
7277 course. It used to be possible to do this with --program-suffix,
7278 but the later has in fact a different meaning for autoconf.
7280 * src/support/lstrings.h (lstrchr): reformat a bit.
7282 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7283 * src/mathed/math_defs.h: ditto.
7285 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7287 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7288 true, decides if we create a backup file or not when saving. New
7289 tag and variable \pdf_mode, defaults to false. New tag and
7290 variable \pdflatex_command, defaults to pdflatex. New tag and
7291 variable \view_pdf_command, defaults to xpdf. New tag and variable
7292 \pdf_to_ps_command, defaults to pdf2ps.
7294 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7296 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7297 does not have a BufferView.
7298 (unlockInset): ditto + don't access the_locking_inset if the
7299 buffer does not have a BufferView.
7301 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7302 certain circumstances so that we don't continue a keyboard
7303 operation long after the key was released. Try f.ex. to load a
7304 large document, press PageDown for some seconds and then release
7305 it. Before this change the document would contine to scroll for
7306 some time, with this change it stops imidiatly.
7308 * src/support/block.h: don't allocate more space than needed. As
7309 long as we don't try to write to the arr[x] in a array_type arr[x]
7310 it is perfectly ok. (if you write to it you might segfault).
7311 added operator value_type*() so that is possible to pass the array
7312 to functions expecting a C-pointer.
7314 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7317 * intl/*: updated to gettext 0.10.35, tried to add our own
7318 required modifications. Please verify.
7320 * po/*: updated to gettext 0.10.35, tried to add our own required
7321 modifications. Please verify.
7323 * src/support/lstrings.C (tostr): go at fixing the problem with
7324 cxx and stringstream. When stringstream is used return
7325 oss.str().c_str() so that problems with lyxstring and basic_string
7326 are avoided. Note that the best solution would be for cxx to use
7327 basic_string all the way, but it is not conformant yet. (it seems)
7329 * src/lyx_cb.C + other files: moved several global functions to
7330 class BufferView, some have been moved to BufferView.[Ch] others
7331 are still located in lyx_cb.C. Code changes because of this. (part
7332 of "get rid of current_view project".)
7334 * src/buffer.C + other files: moved several Buffer functions to
7335 class BufferView, the functions are still present in buffer.C.
7336 Code changes because of this.
7338 * config/lcmessage.m4: updated to most recent. used when creating
7341 * config/progtest.m4: updated to most recent. used when creating
7344 * config/gettext.m4: updated to most recent. applied patch for
7347 * config/gettext.m4.patch: new file that shows what changes we
7348 have done to the local copy of gettext.m4.
7350 * config/libtool.m4: new file, used in creation of acinclude.m4
7352 * config/lyxinclude.m4: new file, this is the lyx created m4
7353 macros, used in making acinclude.m4.
7355 * autogen.sh: GNU m4 discovered as a separate task not as part of
7356 the lib/configure creation.
7357 Generate acinlucde from files in config. Actually cat
7358 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7359 easier to upgrade .m4 files that really are external.
7361 * src/Spacing.h: moved using std::istringstream to right after
7362 <sstream>. This should fix the problem seen with some compilers.
7364 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 * src/lyx_cb.C: began some work to remove the dependency a lot of
7367 functions have on BufferView::text, even if not really needed.
7368 (GetCurrentTextClass): removed this func, it only hid the
7371 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7372 forgot this in last commit.
7374 * src/Bullet.C (bulletEntry): use static char const *[] for the
7375 tables, becuase of this the return arg had to change to string.
7377 (~Bullet): removed unneeded destructor
7379 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7380 (insetSleep): moved from Buffer
7381 (insetWakeup): moved from Buffer
7382 (insetUnlock): moved from Buffer
7384 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7385 from Buffer to BufferView.
7387 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7389 * config/ltmain.sh: updated to version 1.3.4 of libtool
7391 * config/ltconfig: updated to version 1.3.4 of libtool
7393 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7396 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7397 Did I get that right?
7399 * src/lyxlex.h: add a "using" directive or two.
7400 * src/Spacing.h: ditto.
7401 * src/insets/figinset.C: ditto.
7402 * src/support/filetools.C: ditto.
7403 * src/support/lstrings.C: ditto.
7404 * src/BufferView.C: ditto.
7405 * src/bufferlist.C: ditto.
7406 * src/lyx_cb.C: ditto.
7407 * src/lyxlex.C: ditto.
7409 * NEWS: add some changes for 1.1.4.
7411 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7413 * src/BufferView.C: first go at a TextCache to speed up switching
7416 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7418 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7419 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7420 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7421 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7424 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7425 members of the struct are correctly initialized to 0 (detected by
7427 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7428 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7430 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7431 pidwait, since it was allocated with "new". This was potentially
7432 very bad. Thanks to Michael Schmitt for running purify for us.
7435 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7437 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7439 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7441 1999-12-30 Allan Rae <rae@lyx.org>
7443 * lib/templates/IEEEtran.lyx: minor change
7445 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7446 src/mathed/formula.C (LocalDispatch): askForText changes
7448 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7449 know when a user has cancelled input. Fixes annoying problems with
7450 inserting labels and version control.
7452 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7454 * src/support/lstrings.C (tostr): rewritten to use strstream and
7457 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7459 * src/support/filetools.C (IsFileWriteable): use fstream to check
7460 (IsDirWriteable): use fileinfo to check
7462 * src/support/filetools.h (FilePtr): whole class deleted
7464 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7466 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7468 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7470 * src/bufferlist.C (write): use ifstream and ofstream instead of
7473 * src/Spacing.h: use istrstream instead of sscanf
7475 * src/mathed/math_defs.h: change first arg to istream from FILE*
7477 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7479 * src/mathed/math_parser.C: have yyis to be an istream
7480 (LexGetArg): use istream (yyis)
7482 (mathed_parse): ditto
7483 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7485 * src/mathed/formula.C (Read): rewritten to use istream
7487 * src/mathed/formulamacro.C (Read): rewritten to use istream
7489 * src/lyxlex.h (~LyXLex): deleted desturctor
7490 (getStream): new function, returns an istream
7491 (getFile): deleted funtion
7492 (IsOK): return is.good();
7494 * src/lyxlex.C (LyXLex): delete file and owns_file
7495 (setFile): open an filebuf and assign that to a istream instead of
7497 (setStream): new function, takes an istream as arg.
7498 (setFile): deleted function
7499 (EatLine): rewritten us use istream instead of FILE*
7503 * src/table.C (LyXTable): use istream instead of FILE*
7504 (Read): rewritten to take an istream instead of FILE*
7506 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7508 * src/buffer.C (Dispatch): remove an extraneous break statement.
7510 * src/support/filetools.C (QuoteName): change to do simple
7511 'quoting'. More work is necessary. Also changed to do nothing
7512 under emx (needs fix too).
7513 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7515 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7516 config.h.in to the AC_DEFINE_UNQUOTED() call.
7517 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7518 needs char * as argument (because Solaris 7 declares it like
7521 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7522 remove definition of BZERO.
7524 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7526 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7527 defined, "lyxregex.h" if not.
7529 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7531 (REGEX): new variable that is set to regex.c lyxregex.h when
7532 AM_CONDITIONAL USE_REGEX is set.
7533 (libsupport_la_SOURCES): add $(REGEX)
7535 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7538 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7541 * configure.in: add call to LYX_REGEX
7543 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7544 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7546 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7548 * lib/bind/fi_menus.bind: new file, from
7549 pauli.virtanen@saunalahti.fi.
7551 * src/buffer.C (getBibkeyList): pass the parameter delim to
7552 InsetInclude::getKeys and InsetBibtex::getKeys.
7554 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7555 is passed to Buffer::getBibkeyList
7557 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7558 instead of the hardcoded comma.
7560 * src/insets/insetbib.C (getKeys): make sure that there are not
7561 leading blanks in bibtex keys. Normal latex does not care, but
7562 harvard.sty seems to dislike blanks at the beginning of citation
7563 keys. In particular, the retturn value of the function is
7565 * INSTALL: make it clear that libstdc++ is needed and that gcc
7566 2.7.x probably does not work.
7568 * src/support/filetools.C (findtexfile): make debug message go to
7570 * src/insets/insetbib.C (getKeys): ditto
7572 * src/debug.C (showTags): make sure that the output is correctly
7575 * configure.in: add a comment for TWO_COLOR_ICON define.
7577 * acconfig.h: remove all the entries that already defined in
7578 configure.in or acinclude.m4.
7580 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7581 to avoid user name, date and copyright.
7583 1999-12-21 Juergen Vigna <jug@sad.it>
7585 * src/table.C (Read): Now read bogus row format informations
7586 if the format is < 5 so that afterwards the table can
7587 be read by lyx but without any format-info. Fixed the
7588 crash we experienced when not doing this.
7590 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7592 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7593 (RedoDrawingOfParagraph): ditto
7594 (RedoParagraphs): ditto
7595 (RemoveTableRow): ditto
7597 * src/text.C (Fill): rename arg paperwidth -> paper_width
7599 * src/buffer.C (insertLyXFile): rename var filename -> fname
7600 (writeFile): rename arg filename -> fname
7601 (writeFileAscii): ditto
7602 (makeLaTeXFile): ditto
7603 (makeLinuxDocFile): ditto
7604 (makeDocBookFile): ditto
7606 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7609 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7611 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7614 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7615 compiled by a C compiler not C++.
7617 * src/layout.h (LyXTextClass): added typedef for const_iterator
7618 (LyXTextClassList): added typedef for const_iterator + member
7619 functions begin and end.
7621 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7622 iterators to fill the choice_class.
7623 (updateLayoutChoice): rewritten to use iterators to fill the
7624 layoutlist in the toolbar.
7626 * src/BufferView.h (BufferView::work_area_width): removed unused
7629 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7631 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7632 (sgmlCloseTag): ditto
7634 * src/support/lstrings.h: return type of countChar changed to
7637 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7638 what version of this func to use. Also made to return unsigned int.
7640 * configure.in: call LYX_STD_COUNT
7642 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7643 conforming std::count.
7645 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7647 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7648 and a subscript would give bad display (patch from Dekel Tsur
7649 <dekel@math.tau.ac.il>).
7651 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7653 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7656 * src/chset.h: add a few 'using' directives
7658 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7659 triggered when no buffer is active
7661 * src/layout.C: removed `break' after `return' in switch(), since
7664 * src/lyx_main.C (init): make sure LyX can be ran in place even
7665 when libtool has done its magic with shared libraries. Fix the
7666 test for the case when the system directory has not been found.
7668 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7669 name for the latex file.
7670 (MenuMakeHTML): ditto
7672 * src/buffer.h: add an optional boolean argument, which is passed
7675 1999-12-20 Allan Rae <rae@lyx.org>
7677 * lib/templates/IEEEtran.lyx: small correction and update.
7679 * configure.in: Attempted to use LYX_PATH_HEADER
7681 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7683 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7684 input from JMarc. Now use preprocessor to find the header.
7685 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7686 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7687 LYX_STL_STRING_FWD. See comments in file.
7689 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7691 * The global MiniBuffer * minibuffer variable is dead.
7693 * The global FD_form_main * fd_form_main variable is dead.
7695 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7697 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7699 * src/table.h: add the LOstream.h header
7700 * src/debug.h: ditto
7702 * src/LyXAction.h: change the explaination of the ReadOnly
7703 attribute: is indicates that the function _can_ be used.
7705 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7708 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7710 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7716 * src/paragraph.C (GetWord): assert on pos>=0
7719 * src/support/lyxstring.C: condition the use of an invariant on
7721 * src/support/lyxstring.h: ditto
7723 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7724 Use LAssert.h instead of plain assert().
7726 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7728 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7729 * src/support/filetools.C: ditto
7731 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7734 * INSTALL: document the new configure flags
7736 * configure.in: suppress --with-debug; add --enable-assertions
7738 * acinclude.m4: various changes in alignment of help strings.
7740 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7742 * src/kbmap.C: commented out the use of the hash map in kb_map,
7743 beginning of movement to a stl::container.
7745 * several files: removed code that was not in effect when
7746 MOVE_TEXT was defined.
7748 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7749 for escaping should not be used. We can discuss if the string
7750 should be enclosed in f.ex. [] instead of "".
7752 * src/trans_mgr.C (insert): use the new returned value from
7753 encodeString to get deadkeys and keymaps done correctly.
7755 * src/chset.C (encodeString): changed to return a pair, to tell
7756 what to use if we know the string.
7758 * src/lyxscreen.h (fillArc): new function.
7760 * src/FontInfo.C (resize): rewritten to use more std::string like
7761 structore, especially string::replace.
7763 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7766 * configure.in (chmod +x some scripts): remove config/gcc-hack
7768 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7770 * src/buffer.C (writeFile): change once again the top comment in a
7771 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7772 instead of an hardcoded version number.
7773 (makeDocBookFile): ditto
7775 * src/version.h: add new define LYX_DOCVERSION
7777 * po/de.po: update from Pit Sütterlin
7778 * lib/bind/de_menus.bind: ditto.
7780 * src/lyxfunc.C (Dispatch): call MenuExport()
7781 * src/buffer.C (Dispatch): ditto
7783 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7784 LyXFunc::Dispatch().
7785 (MenuExport): new function, moved from
7786 LyXFunc::Dispatch().
7788 * src/trans_mgr.C (insert): small cleanup
7789 * src/chset.C (loadFile): ditto
7791 * lib/kbd/iso8859-1.cdef: add missing backslashes
7793 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7795 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7796 help with placing the manually drawn accents better.
7798 (Draw): x2 and hg changed to float to minimize rounding errors and
7799 help place the accents better.
7801 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7802 unsigned short to char is just wrong...cast the char to unsigned
7803 char instead so that the two values can compare sanely. This
7804 should also make the display of insetlatexaccents better and
7805 perhaps also some other insets.
7807 (lbearing): new function
7810 1999-12-15 Allan Rae <rae@lyx.org>
7812 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7813 header that provides a wrapper around the very annoying SGI STL header
7816 * src/support/lyxstring.C, src/LString.h:
7817 removed old SGI-STL-compatability attempts.
7819 * configure.in: Use LYX_STL_STRING_FWD.
7821 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7822 stl_string_fwd.h is around and try to determine it's location.
7823 Major improvement over previous SGI STL 3.2 compatability.
7824 Three small problems remain with this function due to my zero
7825 knowledge of autoconf. JMarc and lgb see the comments in the code.
7827 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7829 * src/broken_const.h, config/hack-gcc, config/README: removed
7831 * configure.in: remove --with-gcc-hack option; do not call
7834 * INSTALL: remove documentation of --with-broken-const and
7837 * acconfig.h: remove all trace of BROKEN_CONST define
7839 * src/buffer.C (makeDocBookFile): update version number in output
7841 (SimpleDocBookOnePar): fix an assert when trying to a character
7842 access beyond string length
7845 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7847 * po/de.po: fix the Export menu
7849 * lyx.man: update the description of -dbg
7851 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7852 (commandLineHelp): updated
7853 (easyParse): show list of available debug levels if -dbg is passed
7856 * src/Makefile.am: add debug.C
7858 * src/debug.h: moved some code to debug.C
7860 * src/debug.C: new file. Contains code to set and show debug
7863 * src/layout.C: remove 'break' after 'continue' in switch
7864 statements, since these cannot be reached.
7866 1999-12-13 Allan Rae <rae@lyx.org>
7868 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7869 (in_word_set): hash() -> math_hash()
7871 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7873 * acconfig.h: Added a test for whether we are using exceptions in the
7874 current compilation run. If so USING_EXCEPTIONS is defined.
7876 * config.in: Check for existance of stl_string_fwd.h
7877 * src/LString.h: If compiling --with-included-string and SGI's
7878 STL version 3.2 is present (see above test) we need to block their
7879 forward declaration of string and supply a __get_c_string().
7880 However, it turns out this is only necessary if compiling with
7881 exceptions enabled so I've a bit more to add yet.
7883 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7884 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7885 src/support/LRegex.h, src/undo.h:
7886 Shuffle the order of the included files a little to ensure that
7887 LString.h gets included before anything that includes stl_string_fwd.h
7889 * src/support/lyxstring.C: We need to #include LString.h instead of
7890 lyxstring.h to get the necessary definition of __get_c_string.
7891 (__get_c_string): New function. This is defined static just like SGI's
7892 although why they need to do this I'm not sure. Perhaps it should be
7893 in lstrings.C instead.
7895 * lib/templates/IEEEtran.lyx: New template file.
7897 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7899 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7900 * intl/Makefile.in (MKINSTALLDIRS): ditto
7902 * src/LyXAction.C (init): changed to hold the LFUN data in a
7903 automatic array in stead of in callso to newFunc, this speeds up
7904 compilation a lot. Also all the memory used by the array is
7905 returned when the init is completed.
7907 * a lot of files: compiled with -Wold-style-cast, changed most of
7908 the reported offenders to C++ style casts. Did not change the
7909 offenders in C files.
7911 * src/trans.h (Match): change argument type to unsigned int.
7913 * src/support/DebugStream.C: fix some types on the streambufs so
7914 that it works on a conforming implementation.
7916 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7918 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7920 * src/support/lyxstring.C: remove the inline added earlier since
7921 they cause a bunch of unsatisfied symbols when linking with dec
7922 cxx. Cxx likes to have the body of inlines at the place where they
7925 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7926 accessing negative bounds in array. This fixes the crash when
7927 inserting accented characters.
7928 * src/trans.h (Match): ditto
7930 * src/buffer.C (Dispatch): since this is a void, it should not try
7931 to return anything...
7933 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7935 * src/buffer.h: removed the two friends from Buffer. Some changes
7936 because of this. Buffer::getFileName and Buffer::setFileName
7937 renamed to Buffer::fileName() and Buffer::fileName(...).
7939 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7942 and Buffer::update(short) to BufferView. This move is currently
7943 controlled by a define MOVE_TEXT, this will be removed when all
7944 shows to be ok. This move paves the way for better separation
7945 between buffer contents and buffer view. One side effect is that
7946 the BufferView needs a rebreak when swiching buffers, if we want
7947 to avoid this we can add a cache that holds pointers to LyXText's
7948 that is not currently in use.
7950 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7953 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7955 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7957 * lyx_main.C: new command line option -x (or --execute) and
7958 -e (or --export). Now direct conversion from .lyx to .tex
7959 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7960 Unfortunately, X is still needed and the GUI pops up during the
7963 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7965 * src/Spacing.C: add a using directive to bring stream stuff into
7967 * src/paragraph.C: ditto
7968 * src/buffer.C: ditto
7970 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7971 from Lars' announcement).
7973 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7974 example files from Tino Meinen.
7976 1999-12-06 Allan Rae <rae@lyx.org>
7978 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7980 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7982 * src/support/lyxstring.C: added a lot of inline for no good
7985 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7986 latexWriteEndChanges, they were not used.
7988 * src/layout.h (operator<<): output operator for PageSides
7990 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7992 * some example files: loaded in LyX 1.0.4 and saved again to update
7993 certain constructs (table format)
7995 * a lot of files: did the change to use fstream/iostream for all
7996 writing of files. Done with a close look at Andre Poenitz's patch.
7998 * some files: whitespace changes.
8000 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8002 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8003 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8004 architecture, we provide our own. It is used unconditionnally, but
8005 I do not think this is a performance problem. Thanks to Angus
8006 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8007 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8009 (GetInset): use my_memcpy.
8013 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8014 it is easier to understand, but it uses less TeX-only constructs now.
8016 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8017 elements contain spaces
8019 * lib/configure: regenerated
8021 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8022 elements contain spaces; display the list of programs that are
8025 * autogen.sh: make sure lib/configure is executable
8027 * lib/examples/*: rename the tutorial examples to begin with the
8028 two-letters language code.
8030 * src/lyxfunc.C (getStatus): do not query current font if no
8033 * src/lyx_cb.C (RunScript): use QuoteName
8034 (MenuRunDvips): ditto
8035 (PrintApplyCB): ditto
8037 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8038 around argument, so that it works well with the current shell.
8039 Does not work properly with OS/2 shells currently.
8041 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8042 * src/LyXSendto.C (SendtoApplyCB): ditto
8043 * src/lyxfunc.C (Dispatch): ditto
8044 * src/buffer.C (runLaTeX): ditto
8045 (runLiterate): ditto
8046 (buildProgram): ditto
8048 * src/lyx_cb.C (RunScript): ditto
8049 (MenuMakeLaTeX): ditto
8051 * src/buffer.h (getLatexName): new method
8053 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8055 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8057 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8058 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8059 (create_math_panel): ditto
8061 * src/lyxfunc.C (getStatus): re-activate the code which gets
8062 current font and cursor; add test for export to html.
8064 * src/lyxrc.C (read): remove unreachable break statements; add a
8067 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8069 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8071 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8072 introduced by faulty regex.
8073 * src/buffer.C: ditto
8074 * src/lastfiles.C: ditto
8075 * src/paragraph.C: ditto
8076 * src/table.C: ditto
8077 * src/vspace.C: ditto
8078 * src/insets/figinset.C: ditto
8079 Note: most of these is absolutely harmless, except the one in
8080 src/mathed formula.C.
8082 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8084 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8085 operation, yielding correct results for the reLyX command.
8087 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * src/support/filetools.C (ExpandPath): removed an over eager
8091 (ReplaceEnvironmentPath): ditto
8093 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8094 shows that we are doing something fishy in our code...
8098 * src/lyxrc.C (read): use a double switch trick to get more help
8099 from the compiler. (the same trick is used in layout.C)
8100 (write): new function. opens a ofstream and pass that to output
8101 (output): new function, takes a ostream and writes the lyxrc
8102 elemts to it. uses a dummy switch to make sure no elements are
8105 * src/lyxlex.h: added a struct pushpophelper for use in functions
8106 with more than one exit point.
8108 * src/lyxlex.[Ch] (GetInteger): made it const
8112 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8114 * src/layout.[hC] : LayoutTags splitted into several enums, new
8115 methods created, better error handling cleaner use of lyxlex. Read
8118 * src/bmtable.[Ch]: change some member prototypes because of the
8119 image const changes.
8121 * commandtags.h, src/LyXAction.C (init): new function:
8122 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8123 This file is not read automatically but you can add \input
8124 preferences to your lyxrc if you want to. We need to discuss how
8127 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8128 in .aux, also remove .bib and .bst files from dependencies when
8131 * src/BufferView.C, src/LyXView.C: add const_cast several places
8132 because of changes to images.
8134 * lib/images/*: same change as for images/*
8136 * lib/lyxrc.example: Default for accept_compound is false not no.
8138 * images/*: changed to be const, however I have som misgivings
8139 about this change so it might be changed back.
8141 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8143 * lib/configure, po/POTFILES.in: regenerated
8145 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8147 * config/lib_configure.m4: removed
8149 * lib/configure.m4: new file (was config/lib_configure.m4)
8151 * configure.in: do not test for rtti, since we do not use it.
8153 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8155 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8156 doubling of allocated space scheme. This makes it faster for large
8157 strings end to use less memory for small strings. xtra rememoved.
8159 * src/insets/figinset.C (waitalarm): commented out.
8160 (GhostscriptMsg): use static_cast
8161 (GhostscriptMsg): use new instead of malloc to allocate memory for
8162 cmap. also delete the memory after use.
8164 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8166 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8167 for changes in bibtex database or style.
8168 (runBibTeX): remove all .bib and .bst files from dep before we
8170 (run): use scanAuc in when dep file already exist.
8172 * src/DepTable.C (remove_files_with_extension): new method
8175 * src/DepTable.[Ch]: made many of the methods const.
8177 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8179 * src/bufferparams.C: make sure that the default textclass is
8180 "article". It used to be the first one by description order, but
8181 now the first one is "docbook".
8183 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8184 string; call Debug::value.
8185 (easyParse): pass complete argument to setDebuggingLevel().
8187 * src/debug.h (value): fix the code that parses debug levels.
8189 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8192 * src/LyXAction.C: use Debug::ACTION as debug channel.
8194 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8196 * NEWS: updated for the future 1.1.3 release.
8198 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8199 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8200 it should. This is of course a controversial change (since many
8201 people will find that their lyx workscreen is suddenly full of
8202 red), but done for the sake of correctness.
8204 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8205 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8207 * src/insets/inseterror.h, src/insets/inseturl.h,
8208 src/insets/insetinfo.h, src/insets/figinset.h,
8209 src/mathed/formulamacro.h, src/mathed/math_macro.h
8210 (EditMessage): add a missing const and add _() to make sure that
8213 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8214 src/insets/insetbib.C, src/support/filetools.C: add `using'
8217 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8218 doing 'Insert index of last word' at the beginning of a paragraph.
8220 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8222 * several files: white-space changes.
8224 * src/mathed/formula.C: removed IsAlpha and IsDigit
8226 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8227 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8230 * src/insets/figinset.C (GetPSSizes): don't break when
8231 "EndComments" is seen. But break when a boundingbox is read.
8233 * all classes inherited from Inset: return value of Clone
8234 changed back to Inset *.
8236 * all classes inherited form MathInset: return value of Clone
8237 changed back to MathedInset *.
8239 * src/insets/figinset.C (runqueue): use a ofstream to output the
8240 gs/ps file. Might need some setpresicion or setw. However I can
8241 see no problem with the current code.
8242 (runqueue): use sleep instead of the alarm/signal code. I just
8243 can't see the difference.
8245 * src/paragraph.C (LyXParagraph): reserve space in the new
8246 paragraph and resize the inserted paragraph to just fit.
8248 * src/lyxfunc.h (operator|=): added operator for func_status.
8250 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8251 check for readable file.
8253 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8254 check for readable file.
8255 (MenuMakeLinuxDoc): ditto
8256 (MenuMakeDocBook): ditto
8257 (MenuMakeAscii): ditto
8258 (InsertAsciiFile): split the test for openable and readable
8260 * src/bmtable.C (draw_bitmaptable): use
8261 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8263 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8264 findtexfile from LaTeX to filetools.
8266 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8267 instead of FilePtr. Needs to be verified by a literate user.
8269 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8271 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8272 (EditMessage): likewise.
8274 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8275 respectively as \textasciitilde and \textasciicircum.
8277 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * src/support/lyxstring.h: made the methods that take iterators
8282 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8283 (regexMatch): made is use the real regex class.
8285 * src/support/Makefile.am: changed to use libtool
8287 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8289 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8291 (MathIsInset ++): changed several macros to be inline functions
8294 * src/mathed/Makefile.am: changed to use libtool
8296 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8298 * src/insets/inset* : Clone changed to const and return type is
8299 the true insettype not just Inset*.
8301 * src/insets/Makefile.am: changed to use libtool
8303 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8305 * src/undo.[Ch] : added empty() and changed some of the method
8308 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8310 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8311 setID use block<> for the bullets array, added const several places.
8313 * src/lyxfunc.C (getStatus): new function
8315 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8316 LyXAction, added const to several funtions.
8318 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8319 a std::map, and to store the dir items in a vector.
8321 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8324 * src/LyXView.[Ch] + other files : changed currentView to view.
8326 * src/LyXAction.[Ch] : ported from the old devel branch.
8328 * src/.cvsignore: added .libs and a.out
8330 * configure.in : changes to use libtool.
8332 * acinclude.m4 : inserted libtool.m4
8334 * .cvsignore: added libtool
8336 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8338 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8339 file name in insets and mathed directories (otherwise the
8340 dependency is not taken in account under cygwin).
8342 * src/text2.C (InsertString[AB]): make sure that we do not try to
8343 read characters past the string length.
8345 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8347 * lib/doc/LaTeXConfig.lyx.in,
8348 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8350 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8351 file saying who created them and when this heppened; this is
8352 useless and annoys tools like cvs.
8354 * lib/layouts/g-brief-{en,de}.layout,
8355 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8356 from Thomas Hartkens <thomas@hartkens.de>.
8358 * src/{insets,mathed}/Makefile.am: do not declare an empty
8359 LDFLAGS, so that it can be set at configure time (useful on Irix
8362 * lib/reLyX/configure.in: make sure that the prefix is set
8363 correctly in LYX_DIR.
8365 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8367 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8368 be used by 'command-sequence' this allows to bind a key to a
8369 sequence of LyX-commands
8370 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8372 * src/LyXAction.C: add "command-sequence"
8374 * src/LyXFunction.C: handling of "command-sequence"
8376 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8377 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8379 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8381 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8383 * src/buffer.C (writeFile): Do not output a comment giving user
8384 and date at the beginning of a .lyx file. This is useless and
8385 annoys cvs anyway; update version number to 1.1.
8387 * src/Makefile.am (LYX_DIR): add this definition, so that a
8388 default path is hardcoded in LyX.
8390 * configure.in: Use LYX_GNU_GETTEXT.
8392 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8393 AM_GNU_GETTEXT with a bug fixed.
8395 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8397 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8399 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8400 which is used to point to LyX data is now LYX_DIR_11x.
8402 * lyx.man: convert to a unix text file; small updates.
8404 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8406 * src/support/LSubstring.[Ch]: made the second arg of most of the
8407 constructors be a const reference.
8409 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8412 * src/support/lyxstring.[Ch] (swap): added missing member function
8413 and specialization of swap(str, str);
8415 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8417 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8418 trace of the old one.
8420 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8421 put the member definitions in undo.C.
8423 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8424 NEW_TEXT and have now only code that was included when this was
8427 * src/intl.C (LCombo): use static_cast
8429 (DispatchCallback): ditto
8431 * src/definitions.h: removed whole file
8433 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8435 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8436 parsing and stores in a std:map. a regex defines the file format.
8437 removed unneeded members.
8439 * src/bufferparams.h: added several enums from definitions.h here.
8440 Removed unsused destructor. Changed some types to use proper enum
8441 types. use block to have the temp_bullets and user_defined_bullets
8442 and to make the whole class assignable.
8444 * src/bufferparams.C (Copy): removed this functions, use a default
8447 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8450 * src/buffer.C (readLyXformat2): commend out all that have with
8451 oldpapersize to do. also comment out all that hve to do with
8452 insetlatex and insetlatexdel.
8453 (setOldPaperStuff): commented out
8455 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8457 * src/LyXAction.C: remove use of inset-latex-insert
8459 * src/mathed/math_panel.C (button_cb): use static_cast
8461 * src/insets/Makefile.am (insets_o_SOURCES): removed
8464 * src/support/lyxstring.C (helper): use the unsigned long
8465 specifier, UL, instead of a static_cast.
8467 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8469 * src/support/block.h: new file. to be used as a c-style array in
8470 classes, so that the class can be assignable.
8472 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8474 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8475 NULL, make sure to return an empty string (it is not possible to
8476 set a string to NULL).
8478 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8480 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8482 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8484 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8485 link line, so that Irix users (for example) can set it explicitely to
8488 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8489 it can be overidden at make time (static or dynamic link, for
8492 * src/vc-backend.C, src/LaTeXFeatures.h,
8493 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8494 statements to bring templates to global namespace.
8496 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8498 * src/support/lyxstring.C (operator[] const): make it standard
8501 * src/minibuffer.C (Init): changed to reflect that more
8502 information is given from the lyxvc and need not be provided here.
8504 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8506 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8508 * src/LyXView.C (UpdateTimerCB): use static_cast
8509 (KeyPressMask_raw_callback): ditto
8511 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8512 buffer_, a lot of changes because of this. currentBuffer() ->
8513 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8514 also changes to other files because of this.
8516 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8519 have no support for RCS and partial support for CVS, will be
8522 * src/insets/ several files: changes because of function name
8523 changes in Bufferview and LyXView.
8525 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8527 * src/support/LSubstring.[Ch]: new files. These implement a
8528 Substring that can be very convenient to use. i.e. is this
8530 string a = "Mary had a little sheep";
8531 Substring(a, "sheep") = "lamb";
8532 a is now "Mary has a little lamb".
8534 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8535 out patterns and subpatterns of strings. It is used by LSubstring
8536 and also by vc-backend.C
8538 * src/support/lyxstring.C: went over all the assertions used and
8539 tried to correct the wrong ones and flag which of them is required
8540 by the standard. some bugs found because of this. Also removed a
8541 couple of assertions.
8543 * src/support/Makefile.am (libsupport_a_SOURCES): added
8544 LSubstring.[Ch] and LRegex.[Ch]
8546 * src/support/FileInfo.h: have struct stat buf as an object and
8547 not a pointer to one, some changes because of this.
8549 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8550 information in layout when adding the layouts preamble to the
8553 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8556 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8557 because of bug in OS/2.
8559 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8562 \verbatim@font instead of \ttfamily, so that it can be redefined.
8564 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8565 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8566 src/layout.h, src/text2.C: add 'using' directive to bring the
8567 STL templates we need from the std:: namespace to the global one.
8568 Needed by DEC cxx in strict ansi mode.
8570 * src/support/LIstream.h,src/support/LOstream.h,
8571 src/support/lyxstring.h,src/table.h,
8572 src/lyxlookup.h: do not include <config.h> in header
8573 files. This should be done in the .C files only.
8575 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8579 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8581 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8582 from Kayvan to fix the tth invokation.
8584 * development/lyx.spec.in: updates from Kayvan to reflect the
8585 changes of file names.
8587 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8589 * src/text2.C (InsertStringB): use std::copy
8590 (InsertStringA): use std::copy
8592 * src/bufferlist.C: use a vector to store the buffers in. This is
8593 an internal change and should not affect any other thing.
8595 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8598 * src/text.C (Fill): fix potential bug, one off bug.
8600 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8602 * src/Makefile.am (lyx_main.o): add more files it depends on.
8604 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8606 * src/support/lyxstring.C: use size_t for the reference count,
8607 size, reserved memory and xtra.
8608 (internal_compare): new private member function. Now the compare
8609 functions should work for std::strings that have embedded '\0'
8611 (compare): all compare functions rewritten to use
8614 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8616 * src/support/lyxstring.C (compare): pass c_str()
8617 (compare): pass c_str
8618 (compare): pass c_str
8620 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8622 * src/support/DebugStream.C: <config.h> was not included correctly.
8624 * lib/configure: forgot to re-generate it :( I'll make this file
8625 auto generated soon.
8627 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8629 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8632 * src/support/lyxstring.C: some changes from length() to rep->sz.
8633 avoids a function call.
8635 * src/support/filetools.C (SpaceLess): yet another version of the
8636 algorithm...now per Jean-Marc's suggestions.
8638 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8640 * src/layout.C (less_textclass_desc): functor for use in sorting
8642 (LyXTextClass::Read): sort the textclasses after reading.
8644 * src/support/filetools.C (SpaceLess): new version of the
8645 SpaceLess functions. What problems does this one give? Please
8648 * images/banner_bw.xbm: made the arrays unsigned char *
8650 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8652 * src/support/lyxstring.C (find): remove bogus assertion in the
8653 two versions of find where this has not been done yet.
8655 * src/support/lyxlib.h: add missing int return type to
8658 * src/menus.C (ShowFileMenu): disable exporting to html if no
8659 html export command is present.
8661 * config/lib_configure.m4: add a test for an HTML converter. The
8662 programs checked for are, in this order: tth, latex2html and
8665 * lib/configure: generated from config/lib_configure.m4.
8667 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8668 html converter. The parameters are now passed through $$FName and
8669 $$OutName, instead of standard input/output.
8671 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8673 * lib/lyxrc.example: update description of \html_command.
8674 add "quotes" around \screen_font_xxx font setting examples to help
8675 people who use fonts with spaces in their names.
8677 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8679 * Distribution files: updates for v1.1.2
8681 * src/support/lyxstring.C (find): remove bogus assert and return
8682 npos for the same condition.
8684 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * added patch for OS/2 from SMiyata.
8688 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8690 * src/text2.C (CutSelection): make space_wrapped a bool
8691 (CutSelection): dont declare int i until we have to.
8692 (alphaCounter): return a char const *.
8694 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8696 * src/support/syscall.C (Systemcalls::kill):
8697 src/support/filetools.C (PutEnv, PutEnvPath):
8698 src/lyx_cb.C (addNewlineAndDepth):
8699 src/FontInfo.C (FontInfo::resize): condition some #warning
8700 directives with WITH_WARNINGS.
8703 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/layout.[Ch] + several files: access to class variables
8706 limited and made accessor functions instead a lot of code changed
8707 becuase of this. Also instead of returning pointers often a const
8708 reference is returned instead.
8710 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8712 * src/Makefile.am (dist-hook): added used to remove the CVS from
8713 cheaders upon creating a dist
8714 (EXTRA_DIST): added cheaders
8716 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8717 a character not as a small integer.
8719 * src/support/lyxstring.C (find): removed Assert and added i >=
8720 rep->sz to the first if.
8722 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8724 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8725 src/LyXView.C src/buffer.C src/bufferparams.C
8726 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8727 src/text2.C src/insets/insetinclude.C:
8728 lyxlayout renamed to textclasslist.
8730 * src/layout.C: some lyxerr changes.
8732 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8733 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8734 (LyXLayoutList): removed all traces of this class.
8735 (LyXTextClass::Read): rewrote LT_STYLE
8736 (LyXTextClass::hasLayout): new function
8737 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8738 both const and nonconst version.
8739 (LyXTextClass::delete_layout): new function.
8740 (LyXTextClassList::Style): bug fix. do the right thing if layout
8742 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8743 (LyXTextClassList::NameOfLayout): ditto
8744 (LyXTextClassList::Load): ditto
8746 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8748 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8750 * src/LyXAction.C (LookupFunc): added a workaround for sun
8751 compiler, on the other hand...we don't know if the current code
8752 compiles on sun at all...
8754 * src/support/filetools.C (CleanupPath): subst fix
8756 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8759 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8760 complained about this one?
8762 * src/insets/insetinclude.C (Latex): subst fix
8764 * src/insets/insetbib.C (getKeys): subst fix
8766 * src/LyXSendto.C (SendtoApplyCB): subst fix
8768 * src/lyx_main.C (init): subst fix
8770 * src/layout.C (Read): subst fix
8772 * src/lyx_sendfax_main.C (button_send): subst fix
8774 * src/buffer.C (RoffAsciiTable): subst fix
8776 * src/lyx_cb.C (MenuFax): subst fix
8777 (PrintApplyCB): subst fix
8779 1999-10-26 Juergen Vigna <jug@sad.it>
8781 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8783 (Read): Cleaned up this code so now we read only format vestion >= 5
8785 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8787 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8788 come nobody has complained about this one?
8790 * src/insets/insetinclude.C (Latex): subst fix
8792 * src/insets/insetbib.C (getKeys): subst fix
8794 * src/lyx_main.C (init): subst fix
8796 * src/layout.C (Read): subst fix
8798 * src/buffer.C (RoffAsciiTable): subst fix
8800 * src/lyx_cb.C (MenuFax): subst fix.
8802 * src/layout.[hC] + some other files: rewrote to use
8803 std::container to store textclasses and layouts in.
8804 Simplified, removed a lot of code. Make all classes
8805 assignable. Further simplifications and review of type
8806 use still to be one.
8808 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8809 lastfiles to create the lastfiles partr of the menu.
8811 * src/lastfiles.[Ch]: rewritten to use deque to store the
8812 lastfiles in. Uses fstream for reading and writing. Simplifies
8815 * src/support/syscall.C: remove explicit cast.
8817 * src/BufferView.C (CursorToggleCB): removed code snippets that
8819 use explicat C++ style casts instead of C style casts. also use
8820 u_vdata instea of passing pointers in longs.
8822 * src/PaperLayout.C: removed code snippets that were commented out.
8824 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8826 * src/lyx_main.C: removed code snippets that wer commented out.
8828 * src/paragraph.C: removed code snippets that were commented out.
8830 * src/lyxvc.C (logClose): use static_cast
8832 (viewLog): remove explicit cast to void*
8833 (showLog): removed old commented code
8835 * src/menus.C: use static_cast instead of C style casts. use
8836 u_vdata instead of u_ldata. remove explicit cast to (long) for
8837 pointers. Removed old code that was commented out.
8839 * src/insets/inset.C: removed old commented func
8841 * src/insets/insetref.C (InsetRef): removed old code that had been
8842 commented out for a long time.
8844 (escape): removed C style cast
8846 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8848 * src/insets/insetlatex.C (Draw): removed old commented code
8849 (Read): rewritten to use string
8851 * src/insets/insetlabel.C (escape): removed C style cast
8853 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8855 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8858 * src/insets/insetinclude.h: removed a couple of stupid bools
8860 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8861 (Clone): remove C style cast
8862 (getKeys): changed list to lst because of std::list
8864 * src/insets/inseterror.C (Draw): removed som old commented code.
8866 * src/insets/insetcommand.C (Draw): removed some old commented code.
8868 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8869 commented out forever.
8870 (bibitem_cb): use static_cast instead of C style cast
8871 use of vdata changed to u_vdata.
8873 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8875 (CloseUrlCB): use static_cast instead of C style cast.
8876 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8878 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8879 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8880 (CloseInfoCB): static_cast from ob->u_vdata instead.
8881 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8884 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8885 (C_InsetError_CloseErrorCB): forward the ob parameter
8886 (CloseErrorCB): static_cast from ob->u_vdata instead.
8888 * src/vspace.h: include LString.h since we use string in this class.
8890 * src/vspace.C (lyx_advance): changed name from advance because of
8891 nameclash with stl. And since we cannot use namespaces yet...I
8892 used a lyx_ prefix instead. Expect this to change when we begin
8895 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8897 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8898 and removed now defunct constructor and deconstructor.
8900 * src/BufferView.h: have backstack as a object not as a pointer.
8901 removed initialization from constructor. added include for BackStack
8903 * development/lyx.spec.in (%build): add CFLAGS also.
8905 * src/screen.C (drawFrame): removed another warning.
8907 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8909 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8910 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8911 README and ANNOUNCE a bit for the next release. More work is
8914 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8915 unbreakable if we are in freespacing mode (LyX-Code), but not in
8918 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/BackStack.h: fixed initialization order in constructor
8922 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8924 * acinclude.m4 (VERSION): new rules for when a version is
8925 development, added also a variable for prerelease.
8926 (warnings): we set with_warnings=yes for prereleases
8927 (lyx_opt): prereleases compile with same optimization as development
8928 (CXXFLAGS): only use pedantic if we are a development version
8930 * src/BufferView.C (restorePosition): don't do anything if the
8933 * src/BackStack.h: added member empty, use this to test if there
8934 is anything to pop...
8936 1999-10-25 Juergen Vigna <jug@sad.it>
8939 * forms/layout_forms.fd +
8940 * forms/latexoptions.fd +
8941 * lyx.fd: changed for various form resize issues
8943 * src/mathed/math_panel.C +
8944 * src/insets/inseterror.C +
8945 * src/insets/insetinfo.C +
8946 * src/insets/inseturl.C +
8947 * src/insets/inseturl.h +
8950 * src/PaperLayout.C +
8951 * src/ParagraphExtra.C +
8952 * src/TableLayout.C +
8954 * src/layout_forms.C +
8961 * src/menus.C: fixed various resize issues. So now forms can be
8962 resized savely or not be resized at all.
8964 * forms/form_url.fd +
8965 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8968 * src/insets/Makefile.am: added files form_url.[Ch]
8970 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8972 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8973 (and presumably 6.2).
8975 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8976 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8977 remaining static member callbacks.
8979 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8982 * src/support/lyxstring.h: declare struct Srep as friend of
8983 lyxstring, since DEC cxx complains otherwise.
8985 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8987 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8989 * src/LaTeX.C (run): made run_bibtex also depend on files with
8991 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8992 are put into the dependency file.
8994 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8995 the code has shown itself to work
8996 (create_ispell_pipe): removed another warning, added a comment
8999 * src/minibuffer.C (ExecutingCB): removed code that has been
9000 commented out a long time
9002 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9003 out code + a warning.
9005 * src/support/lyxstring.h: comment out the three private
9006 operators, when compiling with string ansi conforming compilers
9009 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9011 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9012 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9015 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9018 * src/mathed/math_panel.C (create_math_panel): remove explicit
9021 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9024 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9025 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9026 to XCreatePixmapFromBitmapData
9027 (fl_set_bmtable_data): change the last argument to be unsigned
9029 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9030 and bh to be unsigned int, remove explicit casts in call to
9031 XReadBitmapFileData.
9033 * images/arrows.xbm: made the arrays unsigned char *
9034 * images/varsz.xbm: ditto
9035 * images/misc.xbm: ditto
9036 * images/greek.xbm: ditto
9037 * images/dots.xbm: ditto
9038 * images/brel.xbm: ditto
9039 * images/bop.xbm: ditto
9041 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9043 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9044 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9045 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9047 (LYX_CXX_CHEADERS): added <clocale> to the test.
9049 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9053 * src/support/lyxstring.C (append): fixed something that must be a
9054 bug, rep->assign was used instead of rep->append.
9056 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9059 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9060 lyx insert double chars. Fix spotted by Kayvan.
9062 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9064 * Fixed the tth support. I messed up with the Emacs patch apply feature
9065 and omitted the changes in lyxrc.C.
9067 1999-10-22 Juergen Vigna <jug@sad.it>
9069 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9071 * src/lyx_cb.C (MenuInsertRef) +
9072 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9073 the form cannot be resized under it limits (fixes a segfault)
9075 * src/lyx.C (create_form_form_ref) +
9076 * forms/lyx.fd: Changed Gravity on name input field so that it is
9079 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9081 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9082 <ostream> and <istream>.
9084 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9085 whether <fstream> provides the latest standard features, or if we
9086 have an oldstyle library (like in egcs).
9087 (LYX_CXX_STL_STRING): fix the test.
9089 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9090 code on MODERN_STL_STREAM.
9092 * src/support/lyxstring.h: use L{I,O}stream.h.
9094 * src/support/L{I,O}stream.h: new files, designed to setup
9095 correctly streams for our use
9096 - includes the right header depending on STL capabilities
9097 - puts std::ostream and std::endl (for LOStream.h) or
9098 std::istream (LIStream.h) in toplevel namespace.
9100 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9103 was a bib file that had been changed we ensure that bibtex is run.
9104 (runBibTeX): enhanced to extract the names of the bib files and
9105 getting their absolute path and enter them into the dep file.
9106 (findtexfile): static func that is used to look for tex-files,
9107 checks for absolute patchs and tries also with kpsewhich.
9108 Alternative ways of finding the correct files are wanted. Will
9110 (do_popen): function that runs a command using popen and returns
9111 the whole output of that command in a string. Should be moved to
9114 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9115 file with extension ext has changed.
9117 * src/insets/figinset.C: added ifdef guards around the fl_free
9118 code that jug commented out. Now it is commented out when
9119 compiling with XForms == 0.89.
9121 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9122 to lyxstring.C, and only keep a forward declaration in
9123 lyxstring.h. Simplifies the header file a bit and should help a
9124 bit on compile time too. Also changes to Srep will not mandate a
9125 recompile of code just using string.
9126 (~lyxstring): definition moved here since it uses srep.
9127 (size): definition moved here since it uses srep.
9129 * src/support/lyxstring.h: removed a couple of "inline" that should
9132 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9134 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9137 1999-10-21 Juergen Vigna <jug@sad.it>
9139 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9140 set to left if I just remove the width entry (or it is empty).
9142 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9143 paragraph when having dummy paragraphs.
9145 1999-10-20 Juergen Vigna <jug@sad.it>
9147 * src/insets/figinset.C: just commented some fl_free_form calls
9148 and added warnings so that this calls should be activated later
9149 again. This avoids for now a segfault, but we have a memory leak!
9151 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9152 'const char * argument' to 'string argument', this should
9153 fix some Asserts() in lyxstring.C.
9155 * src/lyxfunc.h: Removed the function argAsString(const char *)
9156 as it is not used anymore.
9158 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9160 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9163 * src/Literate.h: some funcs moved from public to private to make
9164 interface clearer. Unneeded args removed.
9166 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9168 (scanBuildLogFile): ditto
9170 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9171 normal TeX Error. Still room for improvement.
9173 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9175 * src/buffer.C (insertErrors): changes to make the error
9176 desctription show properly.
9178 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9181 * src/support/lyxstring.C (helper): changed to use
9182 sizeof(object->rep->ref).
9183 (operator>>): changed to use a pointer instead.
9185 * src/support/lyxstring.h: changed const reference & to value_type
9186 const & lets see if that helps.
9188 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * Makefile.am (rpmdist): fixed to have non static package and
9193 * src/support/lyxstring.C: removed the compilation guards
9195 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9198 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9199 conditional compile of lyxstring.Ch
9201 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9202 stupid check, but it is a lot better than the bastring hack.
9203 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9205 * several files: changed string::erase into string::clear. Not
9208 * src/chset.C (encodeString): use a char temporary instead
9210 * src/table.C (TexEndOfCell): added tostr around
9211 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9212 (TexEndOfCell): ditto
9213 (TexEndOfCell): ditto
9214 (TexEndOfCell): ditto
9215 (DocBookEndOfCell): ditto
9216 (DocBookEndOfCell): ditto
9217 (DocBookEndOfCell): ditto
9218 (DocBookEndOfCell): ditto
9220 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9222 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9224 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9225 (MenuBuildProg): added tostr around ret
9226 (MenuRunChktex): added tostr around ret
9227 (DocumentApplyCB): added tostr around ret
9229 * src/chset.C (encodeString): added tostr around t->ic
9231 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9232 (makeLaTeXFile): added tostr around tocdepth
9233 (makeLaTeXFile): added tostr around ftcound - 1
9235 * src/insets/insetbib.C (setCounter): added tostr around counter.
9237 * src/support/lyxstring.h: added an operator+=(int) to catch more
9240 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9241 (lyxstring): We DON'T allow NULL pointers.
9243 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9245 * src/mathed/math_macro.C (MathMacroArgument::Write,
9246 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9247 when writing them out.
9249 * src/LString.C: remove, since it is not used anymore.
9251 * src/support/lyxstring.C: condition the content to
9252 USE_INCLUDED_STRING macro.
9254 * src/mathed/math_symbols.C, src/support/lstrings.C,
9255 src/support/lyxstring.C: add `using' directive to specify what
9256 we need in <algorithm>. I do not think that we need to
9257 conditionalize this, but any thought is appreciated.
9259 * many files: change all callback functions to "C" linkage
9260 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9261 strict_ansi. Those who were static are now global.
9262 The case of callbacks which are static class members is
9263 trickier, since we have to make C wrappers around them (see
9264 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9265 did not finish this yet, since it defeats the purpose of
9266 encapsulation, and I am not sure what the best route is.
9268 1999-10-19 Juergen Vigna <jug@sad.it>
9270 * src/support/lyxstring.C (lyxstring): we permit to have a null
9271 pointer as assignment value and just don't assign it.
9273 * src/vspace.C (nextToken): corrected this function substituting
9274 find_first(_not)_of with find_last_of.
9276 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9277 (TableOptCloseCB) (TableSpeCloseCB):
9278 inserted fl_set_focus call for problem with fl_hide_form() in
9281 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9283 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9286 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9288 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9289 LyXLex::next() and not eatline() to get its argument.
9291 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9293 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9294 instead, use fstreams for io of the depfile, removed unneeded
9295 functions and variables.
9297 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9298 vector instead, removed all functions and variables that is not in
9301 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9303 * src/buffer.C (insertErrors): use new interface to TeXError
9305 * Makefile.am (rpmdist): added a rpmdist target
9307 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9308 per Kayvan's instructions.
9310 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9312 * src/Makefile.am: add a definition for localedir, so that locales
9313 are found after installation (Kayvan)
9315 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9317 * development/.cvsignore: new file.
9319 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9321 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9322 C++ compiler provides wrappers for C headers and use our alternate
9325 * configure.in: use LYX_CXX_CHEADERS.
9327 * src/cheader/: new directory, populated with cname headers from
9328 libstdc++-2.8.1. They are a bit old, but probably good enough for
9329 what we want (support compilers who lack them).
9331 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9332 from includes. It turns out is was stupid.
9334 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9336 * lib/Makefile.am (install-data-local): forgot a ';'
9337 (install-data-local): forgot a '\'
9338 (libinstalldirs): needed after all. reintroduced.
9340 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9342 * configure.in (AC_OUTPUT): added lyx.spec
9344 * development/lyx.spec: removed file
9346 * development/lyx.spec.in: new file
9348 * po/*.po: merged with lyx.pot becuase of make distcheck
9350 * lib/Makefile.am (dist-hook): added dist-hook so that
9351 documentation files will be included when doing a make
9352 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9353 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9355 more: tried to make install do the right thing, exclude CVS dirs
9358 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9359 Path would fit in more nicely.
9361 * all files that used to use pathstack: uses now Path instead.
9362 This change was a lot easier than expected.
9364 * src/support/path.h: new file
9366 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9368 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9370 * src/support/lyxstring.C (getline): Default arg was given for
9373 * Configure.cmd: removed file
9375 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9377 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9378 streams classes and types, add the proper 'using' statements when
9379 MODERN_STL is defined.
9381 * src/debug.h: move the << operator definition after the inclusion
9384 * src/support/filetools.C: include "LAssert.h", which is needed
9387 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9390 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9391 include "debug.h" to define a proper ostream.
9393 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9395 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9396 method to the SystemCall class which can kill a process, but it's
9397 not fully implemented yet.
9399 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9401 * src/support/FileInfo.h: Better documentation
9403 * src/lyxfunc.C: Added support for buffer-export html
9405 * src/menus.C: Added Export->As HTML...
9407 * lib/bind/*.bind: Added short-cut for buffer-export html
9409 * src/lyxrc.*: Added support for new \tth_command
9411 * lib/lyxrc.example: Added stuff for new \tth_command
9413 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9415 * lib/Makefile.am (IMAGES): removed images/README
9416 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9417 installes in correct place. Check permisions is installed
9420 * src/LaTeX.C: some no-op changes moved declaration of some
9423 * src/LaTeX.h (LATEX_H): changed include guard name
9425 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9427 * lib/reLyX/Makefile.am: install noweb2lyx.
9429 * lib/Makefile.am: install configure.
9431 * lib/reLyX/configure.in: declare a config aux dir; set package
9432 name to lyx (not sure what the best solution is); generate noweb2lyx.
9434 * lib/layouts/egs.layout: fix the bibliography layout.
9436 1999-10-08 Jürgen Vigna <jug@sad.it>
9438 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9439 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9440 it returned without continuing to search the path.
9442 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9444 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9445 also fixes a bug. It is not allowed to do tricks with std::strings
9446 like: string a("hei"); &a[e]; this will not give what you
9447 think... Any reason for the complexity in this func?
9449 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9451 * Updated README and INSTALL a bit, mostly to check that my
9452 CVS rights are correctly set up.
9454 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9456 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9457 does not allow '\0' chars but lyxstring and std::string does.
9459 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * autogen.sh (AUTOCONF): let the autogen script create the
9462 POTFILES.in file too. POTFILES.in should perhaps now not be
9463 included in the cvs module.
9465 * some more files changed to use C++ includes instead of C ones.
9467 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9469 (Reread): added tostr to nlink. buggy output otherwise.
9470 (Reread): added a string() around szMode when assigning to Buffer,
9471 without this I got a log of garbled info strings.
9473 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9476 * I have added several ostream & operator<<(ostream &, some_type)
9477 functions. This has been done to avoid casting and warnings when
9478 outputting enums to lyxerr. This as thus eliminated a lot of
9479 explicit casts and has made the code clearer. Among the enums
9480 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9481 mathed enums, some font enum the Debug::type enum.
9483 * src/support/lyxstring.h (clear): missing method. equivalent of
9486 * all files that contained "stderr": rewrote constructs that used
9487 stderr to use lyxerr instead. (except bmtable)
9489 * src/support/DebugStream.h (level): and the passed t with
9490 Debug::ANY to avoid spurious bits set.
9492 * src/debug.h (Debug::type value): made it accept strings of the
9495 * configure.in (Check for programs): Added a check for kpsewhich,
9496 the latex generation will use this later to better the dicovery of
9499 * src/BufferView.C (create_view): we don't need to cast this to
9500 (void*) that is done automatically.
9501 (WorkAreaButtonPress): removed some dead code.
9503 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9505 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9506 is not overwritten when translated (David Sua'rez de Lis).
9508 * lib/CREDITS: Added David Sua'rez de Lis
9510 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9512 * src/bufferparams.C (BufferParams): default input encoding is now
9515 * acinclude.m4 (cross_compiling): comment out macro
9516 LYX_GXX_STRENGTH_REDUCE.
9518 * acconfig.h: make sure that const is not defined (to empty) when
9519 we are compiling C++. Remove commented out code using SIZEOF_xx
9522 * configure.in : move the test for const and inline as late as
9523 possible so that these C tests do not interefere with C++ ones.
9524 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9525 has not been proven.
9527 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9529 * src/table.C (getDocBookAlign): remove bad default value for
9532 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9534 (ShowFileMenu2): ditto.
9536 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9539 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9541 * Most files: finished the change from the old error code to use
9542 DebugStream for all lyxerr debugging. Only minor changes remain
9543 (e.g. the setting of debug levels using strings instead of number)
9545 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9547 * src/layout.C (Add): Changed to use compare_no_case instead of
9550 * src/FontInfo.C: changed loop variable type too string::size_type.
9552 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9554 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9555 set ETAGS_ARGS to --c++
9557 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9559 * src/table.C (DocBookEndOfCell): commented out two unused variables
9561 * src/paragraph.C: commented out four unused variables.
9563 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9564 insed a if clause with type string::size_type.
9566 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9569 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9571 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9572 variable, also changed loop to go from 0 to lenght + 1, instead of
9573 -1 to length. This should be correct.
9575 * src/LaTeX.C (scanError): use string::size_type as loop variable
9578 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9579 (l.896) since y_tmp and row was not used anyway.
9581 * src/insets/insetref.C (escape): use string::size_type as loop
9584 * src/insets/insetquotes.C (Width): use string::size_type as loop
9586 (Draw): use string::size_type as loop variable type.
9588 * src/insets/insetlatexaccent.C (checkContents): use
9589 string::size_type as loop variable type.
9591 * src/insets/insetlabel.C (escape): use string::size_type as loop
9594 * src/insets/insetinfo.C: added an extern for current_view.
9596 * src/insets/insetcommand.C (scanCommand): use string::size_type
9597 as loop variable type.
9599 * most files: removed the RCS tags. With them we had to recompile
9600 a lot of files after a simple cvs commit. Also we have never used
9601 them for anything meaningful.
9603 * most files: tags-query-replace NULL 0. As adviced several plases
9604 we now use "0" instead of "NULL" in our code.
9606 * src/support/filetools.C (SpaceLess): use string::size_type as
9609 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9611 * src/paragraph.C: fixed up some more string stuff.
9613 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9615 * src/support/filetools.h: make modestr a std::string.
9617 * src/filetools.C (GetEnv): made ch really const.
9619 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9620 made code that used these use max/min from <algorithm> instead.
9622 * changed several c library include files to their equivalent c++
9623 library include files. All is not changed yet.
9625 * created a support subdir in src, put lyxstring and lstrings
9626 there + the extra files atexit, fileblock, strerror. Created
9627 Makefile.am. edited configure.in and src/Makefile.am to use this
9628 new subdir. More files moved to support.
9630 * imported som of the functions from repository lyx, filetools
9632 * ran tags-query-replace on LString -> string, corrected the bogus
9633 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9634 is still some errors in there. This is errors where too much or
9635 too litle get deleted from strings (string::erase, string::substr,
9636 string::replace), there can also be some off by one errors, or
9637 just plain wrong use of functions from lstrings. Viewing of quotes
9640 * LyX is now running fairly well with string, but there are
9641 certainly some bugs yet (see above) also string is quite different
9642 from LString among others in that it does not allow null pointers
9643 passed in and will abort if it gets any.
9645 * Added the revtex4 files I forgot when setting up the repository.
9647 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9649 * All over: Tried to clean everything up so that only the files
9650 that we really need are included in the cvs repository.
9651 * Switched to use automake.
9652 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9653 * Install has not been checked.
9655 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9657 * po/pt.po: Three errors:
9658 l.533 and l.538 format specification error
9659 l. 402 duplicate entry, I just deleted it.