1 2000-08-18 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (getStatus): changed to return func_status.
5 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
6 display toggle menu entries if they are.
8 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
9 new document layout now.
11 * src/lyxfunc.C: ditto
13 * src/lyx_gui_misc.C: ditto
15 * src/lyx_gui.C: ditto
17 * lib/ui/default.ui: removed paper and quotes layout as they are now
18 all in the document layout tabbed folder.
20 * src/frontends/xforms/forms/form_document.fd: added Restore
21 button and callbacks for all inputs for Allan's ButtonPolicy.
23 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
24 (CheckChoiceClass): added missing params setting on class change.
25 (UpdateLayoutDocument): added for updating the layout on params.
26 (build): forgot to RETURN_ALWAYS input_doc_spacing.
27 (FormDocument): Implemented Allan's ButtonPolicy with the
30 2000-08-17 Allan Rae <rae@lyx.org>
32 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
33 so we can at least see the credits again.
35 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
36 controller calls for the appropriate callbacks. Note that since Ok
37 calls apply followed by cancel, and apply isn't a valid input for the
38 APPLIED state, the bc_ calls have to be made in the static callback not
39 within each of the real callbacks.
41 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
42 (setOk): renamed from setOkay()
44 2000-08-17 Juergen Vigna <jug@sad.it>
46 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
47 in the implementation part.
48 (composeUIInfo): don't show optional menu-items.
50 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
52 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
54 * src/bufferview_funcs.C (CurrentState): fixed to show also the
55 text-state when in a text-inset.
57 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
59 2000-08-17 Marko Vendelin <markov@ioc.ee>
60 * src/frontends/gnome/FormIndex.C
61 * src/frontends/gnome/FormIndex.h
62 * src/frontends/gnome/FormToc.C
63 * src/frontends/gnome/FormToc.h
64 * src/frontends/gnome/dialogs
65 * src/frontends/gnome/diatoc_callbacks.c
66 * src/frontends/gnome/diatoc_callbacks.h
67 * src/frontends/gnome/diainsertindex_callbacks.h
68 * src/frontends/gnome/diainsertindex_callbacks.c
69 * src/frontends/gnome/diainsertindex_interface.c
70 * src/frontends/gnome/diainsertindex_interface.h
71 * src/frontends/gnome/diatoc_interface.h
72 * src/frontends/gnome/diatoc_interface.c
73 * src/frontends/gnome/Makefile.am: Table of Contents and
74 Insert Index dialogs implementation for Gnome frontend
76 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
78 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
80 * src/frontends/gnome/diainserturl_interface.c: make the dialog
83 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
85 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
86 destructor. Don't definde if you don't need it
87 (processEvents): made static, non-blocking events processing for
89 (runTime): static method. event loop for xforms
90 * similar as above for kde and gnome.
92 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
94 (runTime): new method calss the real frontends runtime func.
96 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
98 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
100 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
102 2000-08-16 Juergen Vigna <jug@sad.it>
104 * src/lyx_gui.C (runTime): added GUII RunTime support.
106 * src/frontends/Makefile.am:
107 * src/frontends/GUIRunTime.[Ch]:
108 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
109 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
110 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
112 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
114 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
115 as this is already set in ${FRONTEND_INCLUDE} if needed.
117 * configure.in (CPPFLAGS): setting the include dir for the frontend
118 directory and don't set FRONTEND=xforms for now as this is executed
121 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
123 * src/frontends/kde/Makefile.am:
124 * src/frontends/kde/FormUrl.C:
125 * src/frontends/kde/FormUrl.h:
126 * src/frontends/kde/formurldialog.h:
127 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
129 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
131 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
133 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
135 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
138 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
140 * src/WorkArea.C (work_area_handler): more work to get te
141 FL_KEYBOARD to work with xforms 0.88 too, please test.
143 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
145 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
147 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
150 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
152 * src/Timeout.h: remove Qt::emit hack.
154 * several files: changes to allo doc++ compilation
156 * src/lyxfunc.C (processKeySym): new method
157 (processKeyEvent): comment out if FL_REVISION < 89
159 * src/WorkArea.C: change some debugging levels.
160 (WorkArea): set wantkey to FL_KEY_ALL
161 (work_area_handler): enable the FL_KEYBOARD clause, this enables
162 clearer code and the use of compose with XForms 0.89. Change to
163 use signals instead of calling methods in bufferview directly.
165 * src/Painter.C: change some debugging levels.
167 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
170 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
171 (workAreaKeyPress): new method
173 2000-08-14 Juergen Vigna <jug@sad.it>
175 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
177 * config/kde.m4: addes some features
179 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
180 include missing xforms dialogs.
182 * src/Timeout.h: a hack to be able to compile with qt/kde.
184 * sigc++/.cvsignore: added acinclude.m4
186 * lib/.cvsignore: added listerros
188 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
189 xforms tree as objects are needed for other frontends.
191 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
192 linking with not yet implemented xforms objects.
194 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
196 2000-08-14 Baruch Even <baruch.even@writeme.com>
198 * src/frontends/xforms/FormGraphics.h:
199 * src/frontends/xforms/FormGraphics.C:
200 * src/frontends/xforms/RadioButtonGroup.h:
201 * src/frontends/xforms/RadioButtonGroup.C:
202 * src/insets/insetgraphics.h:
203 * src/insets/insetgraphics.C:
204 * src/insets/insetgraphicsParams.h:
205 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
206 instead of spaces, and various other indentation issues to make the
207 sources more consistent.
209 2000-08-14 Marko Vendelin <markov@ioc.ee>
211 * src/frontends/gnome/dialogs/diaprint.glade
212 * src/frontends/gnome/FormPrint.C
213 * src/frontends/gnome/FormPrint.h
214 * src/frontends/gnome/diaprint_callbacks.c
215 * src/frontends/gnome/diaprint_callbacks.h
216 * src/frontends/gnome/diaprint_interface.c
217 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
220 * src/frontends/gnome/dialogs/diainserturl.glade
221 * src/frontends/gnome/FormUrl.C
222 * src/frontends/gnome/FormUrl.h
223 * src/frontends/gnome/diainserturl_callbacks.c
224 * src/frontends/gnome/diainserturl_callbacks.h
225 * src/frontends/gnome/diainserturl_interface.c
226 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
229 * src/frontends/gnome/Dialogs.C
230 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
231 all other dialogs. Copy all unimplemented dialogs from Xforms
234 * src/frontends/gnome/support.c
235 * src/frontends/gnome/support.h: support files generated by Glade
239 * config/gnome.m4: Gnome configuration scripts
241 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
242 configure --help message
244 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
245 only if there are no events pendling in Gnome/Gtk. This enhances
246 the performance of menus.
249 2000-08-14 Allan Rae <rae@lyx.org>
251 * lib/Makefile.am: listerrors cleaning
253 * lib/listerrors: removed -- generated file
254 * acinclude.m4: ditto
255 * sigc++/acinclude.m4: ditto
257 * src/frontends/xforms/forms/form_citation.fd:
258 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
261 * src/frontends/xforms/forms/makefile: I renamed the `install` target
262 `updatesrc` and now we have a `test` target that does what `updatesrc`
263 used to do. I didn't like having an install target that wasn't related
266 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
267 on all except FormGraphics. This may yet happen. Followed by a major
268 cleanup including using FL_TRANSIENT for most of the dialogs. More
269 changes to come when the ButtonController below is introduced.
271 * src/frontends/xforms/ButtonController.h: New file for managing up to
272 four buttons on a dialog according to an externally defined policy.
273 * src/frontends/xforms/Makefile.am: added above
275 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
276 Apply and Cancel/Close buttons and everything in between and beyond.
277 * src/frontends/Makefile.am: added above.
279 * src/frontends/xforms/forms/form_preferences.fd:
280 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
281 and removed variable 'status' as a result. Fixed the set_minsize thing.
282 Use the new screen-font-update after checking screen fonts were changed
283 Added a "Restore" button to restore the original lyxrc values while
284 editing. This restores everything not just the last input changed.
285 That's still a tricky one. As is the "LyX: this shouldn't happen..."
287 * src/LyXAction.C: screen-font-update added for updating buffers after
288 screen font settings have been changed.
289 * src/commandtags.h: ditto
290 * src/lyxfunc.C: ditto
292 * forms/lyx.fd: removed screen fonts dialog.
293 * src/lyx_gui.C: ditto
294 * src/menus.[Ch]: ditto
295 * src/lyx.[Ch]: ditto
296 * src/lyx_cb.C: ditto + code from here moved to make
297 screen-font-update. And people wonder why progress on GUII is
298 slow. Look at how scattered this stuff was! It takes forever
301 * forms/fdfix.sh: Fixup the spacing after commas.
302 * forms/makefile: Remove date from generated files. Fewer clashes now.
303 * forms/bullet_forms.C.patch: included someones handwritten changes
305 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
306 once I've discovered why LyXRC was made noncopyable.
307 * src/lyx_main.C: ditto
309 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
311 * src/frontends/xforms/forms/fdfix.sh:
312 * src/frontends/xforms/forms/fdfixh.sed:
313 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
314 * src/frontends/xforms/Form*.[hC]:
315 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
316 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
317 provide a destructor for the struct FD_form_xxxx. Another version of
318 the set_[max|min]size workaround and a few other cleanups. Actually,
319 Angus' patch from 20000809.
321 2000-08-13 Baruch Even <baruch.even@writeme.com>
323 * src/insets/insetgraphics.C (Clone): Added several fields that needed
326 2000-08-11 Juergen Vigna <jug@sad.it>
328 * src/insets/insetgraphics.C (InsetGraphics): changing init
329 order because of warnings.
331 * src/frontends/xforms/forms/makefile: adding patching .C with
334 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
335 from .C.patch to .c.patch
337 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
338 order because of warning.
340 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
342 * src/frontends/Liason.C (setMinibuffer): new helper function
344 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
346 * src/lyxfunc.C (Dispatch): calling new Document-Layout
348 * lib/ui/default.ui: commented out PaperLayout entry
350 * src/frontends/xforms/form_document.[Ch]: new added files
352 * src/frontends/xforms/FormDocument.[Ch]: ditto
354 * src/frontends/xforms/forms/form_document.fd: ditto
356 * src/frontends/xforms/forms/form_document.C.patch: ditto
358 2000-08-10 Juergen Vigna <jug@sad.it>
360 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
361 (InsetGraphics): initialized cacheHandle to 0.
362 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
364 2000-08-10 Baruch Even <baruch.even@writeme.com>
366 * src/graphics/GraphicsCache.h:
367 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
368 correctly as a cache.
370 * src/graphics/GraphicsCacheItem.h:
371 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
374 * src/graphics/GraphicsCacheItem_pimpl.h:
375 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
378 * src/insets/insetgraphics.h:
379 * src/insets/insetgraphics.C: Changed from using a signal notification
380 to polling when image is not loaded.
382 2000-08-10 Allan Rae <rae@lyx.org>
384 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
385 that there are two functions that have to been taken out of line by
386 hand and aren't taken care of in the script. (Just a reminder note)
388 * sigc++/macros/*.h.m4: Updated as above.
390 2000-08-09 Juergen Vigna <jug@sad.it>
392 * src/insets/insettext.C (draw): small fix for clearing rectangle.
394 * src/insets/insettabular.C: make drawing of single cell smarter.
396 2000-08-09 Marko Vendelin <markov@ioc.ee>
397 * src/frontends/gnome/Menubar_pimpl.C
398 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
399 implementation: new files
401 * src/frontends/gnome/mainapp.C
402 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
405 * src/main.C: create Gnome main window
407 * src/frontends/xforms/Menubar_pimpl.h
408 * src/frontends/Menubar.C
409 * src/frontends/Menubar.h: added method Menubar::update that calls
410 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
412 * src/LyXView.C: calls Menubar::update to update the state
415 * src/frontends/gnome/Makefile.am: added new files
417 * src/frontends/Makefile.am: added frontend compiler options
419 2000-08-08 Juergen Vigna <jug@sad.it>
421 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
423 * src/bufferlist.C (close):
424 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
425 documents if exiting without saving.
427 * src/buffer.C (save): use removeAutosaveFile()
429 * src/support/filetools.C (removeAutosaveFile): new function.
431 * src/lyx_cb.C (MenuWrite): returns a bool now.
432 (MenuWriteAs): check if file could really be saved and revert to the
434 (MenuWriteAs): removing old autosavefile if existant.
436 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
437 before Goto toggle declaration, because of compiler warning.
439 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
441 * src/lyxfunc.C (MenuNew): small fix.
443 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
445 * src/bufferlist.C (newFile):
446 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
448 * src/lyxrc.C: added new_ask_filename tag
450 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
452 * src/lyx.fd: removed code pertaining to form_ref
453 * src/lyx.[Ch]: ditto
454 * src/lyx_cb.C: ditto
455 * src/lyx_gui.C: ditto
456 * src/lyx_gui_misc.C: ditto
458 * src/BufferView_pimpl.C (restorePosition): update buffer only
461 * src/commandtags.h (LFUN_REFTOGGLE): removed
462 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
463 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
464 (LFUN_REFBACK): renamed LFUN_REF_BACK
466 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
468 * src/lyxfunc.C (Dispatch): ditto.
469 InsertRef dialog is now GUI-independent.
471 * src/texrow.C: added using std::endl;
473 * src/insets/insetref.[Ch]: strip out large amounts of code.
474 The inset is now a container and this functionality is now
475 managed by a new FormRef dialog
477 * src/frontends/Dialogs.h (showRef, createRef): new signals
479 * src/frontends/xforms/FormIndex.[Ch],
480 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
481 when setting dialog's min/max size
482 * src/frontends/xforms/FormIndex.[Ch]: ditto
484 * src/frontends/xforms/FormRef.[Ch],
485 src/frontends/xforms/forms/form_ref.fd: new xforms
486 implementation of an InsetRef dialog
488 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
491 * src/graphics/XPM_Renderer.C (isImageFormatOK):
492 ios::nocreate is not part of the standard. Removed.
494 2000-08-07 Baruch Even <baruch.even@writeme.com>
496 * src/graphics/Renderer.h:
497 * src/graphics/Renderer.C: Added base class for rendering of different
498 image formats into Pixmaps.
500 * src/graphics/XPM_Renderer.h:
501 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
502 in a different class.
504 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
505 easily add support for other formats.
507 * src/insets/figinset.C: plugged a leak of an X resource.
509 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
511 * src/CutAndPaste.[Ch]: make all metods static.
513 * development/Code_rules/Rules: more work, added section on
514 Exceptions, and a References section.
516 * a lot of header files: work to make doc++ able to generate the
517 source documentation, some workarounds of doc++ problems. Doc++ is
518 now able to generate the documentation.
520 2000-08-07 Juergen Vigna <jug@sad.it>
522 * src/insets/insettabular.C (recomputeTextInsets): removed function
524 * src/tabular.C (SetWidthOfMulticolCell):
526 (calculate_width_of_column_NMC): fixed return value so that it really
527 only returns true if the column-width has changed (there where
528 problems with muliticolumn-cells in this column).
530 2000-08-04 Juergen Vigna <jug@sad.it>
532 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
533 also on the scrollstatus of the inset.
534 (workAreaMotionNotify): ditto.
536 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
538 2000-08-01 Juergen Vigna <jug@sad.it>
540 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
543 * src/LyXAction.C (init):
544 * src/insets/inset.C (LocalDispatch): added support for
547 * src/insets/inset.C (scroll): new functions.
549 * src/insets/insettext.C (removeNewlines): new function.
550 (SetAutoBreakRows): removes forced newlines in the text of the
551 paragraph if autoBreakRows is set to false.
553 * src/tabular.C (Latex): generates a parbox around the cell contents
556 * src/frontends/xforms/FormTabular.C (local_update): removed
557 the radio_useparbox button.
559 * src/tabular.C (UseParbox): new function
561 2000-08-06 Baruch Even <baruch.even@writeme.com>
563 * src/graphics/GraphicsCache.h:
564 * src/graphics/GraphicsCache.C:
565 * src/graphics/GraphicsCacheItem.h:
566 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
569 * src/insets/insetgraphics.h:
570 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
571 drawing of the inline image.
573 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
574 into the wrong position.
576 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
579 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
581 * src/support/translator.h: move all typedefs to public section
583 * src/support/filetools.C (MakeLatexName): return string const
586 (FileOpenSearch): ditto
588 (LibFileSearch): ditto
589 (i18nLibFileSearch): ditto
592 (CreateTmpDir): ditto
593 (CreateBufferTmpDir): ditto
594 (CreateLyXTmpDir): ditto
599 (OnlyFilename): ditto
601 (NormalizePath): ditto
603 (GetFileContents): ditto
604 (ReplaceEnvironmentPath): ditto
607 (ChangeExtension): ditto
608 (MakeDisplayPath): ditto
609 (do_popen): return cmdret const
610 (findtexfile): return string const
612 * src/support/DebugStream.h: add some /// to please doc++
614 * src/frontends/DialogBase.h (endif): add some /// to please doc++
616 * src/texrow.C (same_rownumber): functor to use with find_if
617 (getIdFromRow): rewritten to use find_if and to not update the
618 positions. return true if row is found
619 (increasePos): new method, use to update positions
621 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
623 * src/lyxlex_pimpl.C (verifyTable): new method
626 (GetString): return string const
627 (pushTable): rewrite to use std::stack
629 (setFile): better check
632 * src/lyxlex.h: make LyXLex noncopyable
634 * src/lyxlex.C (text): return char const * const
635 (GetString): return string const
636 (getLongString): return string const
638 * src/lyx_gui_misc.C (askForText): return pair<...> const
640 * src/lastfiles.[Ch] (operator): return string const
642 * src/buffer.C (parseSingleLyXformat2Token): pass string to
643 istringstream not char const *.
644 move token.end() out of loop.
645 (readFile): move initializaton of token
647 * src/BufferView2.C (insertErrors): run texrow.increasePos if
648 getIdFromRow is successful.
650 * lib/bind/emacs.bind: don't include menus bind
652 * development/Code_rules/Rules: the beginnings of making this
653 better and covering more of the unwritten rules that we have.
655 * development/Code_rules/Recommendations: a couple of wording
658 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
660 * src/support/strerror.c: remove C++ comment.
662 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
664 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
665 LFUN_INDEX_INSERT_LAST
667 * src/texrow.C (getIdFromRow): changed from const_iterator to
668 iterator, allowing code to compile with DEC cxx
670 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
671 stores part of the class, as suggested by Allan. Will allow
673 (apply): test to apply uses InsetCommandParams operator!=
675 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
676 (apply): test to apply uses InsetCommandParams operator!=
678 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
679 stores part of the class.
680 (update): removed limits on min/max size.
682 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
683 (apply): test to apply uses InsetCommandParams operator!=
685 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
686 (Read, Write, scanCommand, getCommand): moved functionality
687 into InsetCommandParams.
689 (getScreenLabel): made pure virtual
690 new InsetCommandParams operators== and !=
692 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
693 c-tors based on InsetCommandParams. Removed others.
694 * src/insets/insetinclude.[Ch]: ditto
695 * src/insets/insetlabel.[Ch]: ditto
696 * src/insets/insetparent.[Ch]: ditto
697 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
699 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
700 insets derived from InsetCommand created using similar c-tors
701 based on InsetCommandParams
702 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
703 * src/menus.C (ShowRefsMenu): ditto
704 * src/paragraph.C (Clone): ditto
705 * src/text2.C (SetCounter): ditto
706 * src/lyxfunc.C (Dispatch) ditto
707 Also recreated old InsetIndex behaviour exactly. Can now
708 index-insert at the start of a paragraph and index-insert-last
709 without launching the pop-up.
711 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
713 * lib/lyxrc.example: mark te pdf options as non functional.
715 * src/support/lstrings.C (strToInt): move initalization of tmpstr
716 (isStrDbl): move tmpstr.end() out of loop.
717 (strToDbl): move intialization of tmpstr
718 (lowercase): return string const and move tmp.end() out of loop.
719 (uppercase): return string const and move tmp.edn() out of loop.
720 (prefixIs): add assertion
725 (containsOnly): ditto
726 (containsOnly): ditto
727 (containsOnly): ditto
728 (countChar): make last arg char not char const
729 (token): return string const
730 (subst): return string const, move tmp.end() out of loop.
731 (subst): return string const, add assertion
732 (strip): return string const
733 (frontStrip): return string const, add assertion
734 (frontStrip): return string const
739 * src/support/lstrings.C: add inclde "LAssert.h"
740 (isStrInt): move tmpstr.end() out of loop.
742 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
743 toollist.end() out of loop.
744 (deactivate): move toollist.end() out of loop.
745 (update): move toollist.end() out of loop.
746 (updateLayoutList): move tc.end() out of loop.
747 (add): move toollist.end() out of loop.
749 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
750 md.end() out of loop.
752 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
754 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
757 * src/paragraph.C (Erase): move fontlist.end() out of loop.
758 (Erase): move insetlist.end() out of loop.
760 * src/lyx_sendfax_main.C: make show_logfile static and to take a
761 ref to const string as first arg. Move initialization of some
762 variables, whitespace changes.
764 * src/kbmap.C (defkey): move table.end() out of loop.
765 (kb_keymap): move table.end() out of loop.
766 (findbinding): move table.end() out of loop.
768 * src/MenuBackend.C (hasMenu): move end() out of loop.
769 (getMenu): move end() out of loop.
770 (getMenu): move menulist_.end() out of loop.
772 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
774 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
777 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
778 (getFromLyXName): move infotab.end() out of loop.
780 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
781 -fvtable-thunks -ffunction-sections -fdata-sections
783 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
785 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
788 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
790 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
792 * src/frontends/xforms/FormCitation.[Ch],
793 src/frontends/xforms/FormIndex.[Ch],
794 src/frontends/xforms/FormToc.[Ch],
795 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
797 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
799 * src/commandtags.h: renamed, created some flags for citation
802 * src/lyx_gui_misc.C: stripped out old FD_index_form code
804 * src/lyxfunc.C (dispatch): use signals to insert index entry
806 * src/frontends/Dialogs.h: new signal createIndex
808 * src/frontends/xforms/FormCommand.[Ch],
809 src/frontends/xforms/FormCitation.[Ch],
810 src/frontends/xforms/FormToc.[Ch],
811 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
813 * src/insets/insetindex.[Ch]: GUI-independent
815 * src/frontends/xforms/FormIndex.[Ch],
816 * src/frontends/xforms/forms/form_index.fd: xforms implementation
819 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
821 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
822 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
824 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
826 * src/insets/insetref.C (Latex): rewrite so that there is now
827 question that a initialization is requested.
829 * src/insets/insetcommand.h: reenable the hide signal
831 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
833 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
834 fix handling of shortcuts (many bugs :)
835 (add_lastfiles): ditto.
837 * lib/ui/default.ui: fix a few shortcuts.
839 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
841 * Makefile.am: Fix ``rpmdist'' target to return the exit
842 status of the ``rpm'' command, instead of the last command in
843 the chain (the ``rm lyx.xpm'' command, which always returns
846 2000-08-02 Allan Rae <rae@lyx.org>
848 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
849 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
850 * src/frontends/xforms/FormToc.C (FormToc): ditto
852 * src/frontends/xforms/Makefile.am: A few forgotten files
854 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
855 Signals-not-copyable-problem Lars' started commenting out.
857 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
859 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
861 * src/insets/insetcommand.h: Signals is not copyable so anoter
862 scheme for automatic hiding of forms must be used.
864 * src/frontends/xforms/FormCitation.h: don't inerit from
865 noncopyable, FormCommand already does that.
866 * src/frontends/xforms/FormToc.h: ditto
867 * src/frontends/xforms/FormUrl.h: ditto
869 * src/frontends/xforms/FormCitation.C: add include <algorithm>
871 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
873 * src/insets/insetcommand.h (hide): new SigC::Signal0
874 (d-tor) new virtual destructor emits hide signal
876 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
877 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
879 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
880 LOF and LOT. Inset is now GUI-independent
882 * src/insets/insetloa.[Ch]: redundant
883 * src/insets/insetlof.[Ch]: ditto
884 * src/insets/insetlot.[Ch]: ditto
886 * src/frontends/xforms/forms/form_url.fd: tweaked!
887 * src/frontends/xforms/forms/form_citation.fd: ditto
889 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
890 dialogs dealing with InsetCommand insets
892 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
893 FormCommand base class
894 * src/frontends/xforms/FormUrl.[Ch]: ditto
896 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
898 * src/frontends/xforms/FormToc.[Ch]: ditto
900 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
901 passed a generic InsetCommand pointer
902 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
904 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
905 and modified InsetTOC class
906 * src/buffer.C: ditto
908 * forms/lyx.fd: strip out old FD_form_toc code
909 * src/lyx_gui_misc.C: ditto
910 * src/lyx_gui.C: ditto
911 * src/lyx_cb.C: ditto
912 * src/lyx.[Ch]: ditto
914 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
916 * src/support/utility.hpp: tr -d '\r'
918 2000-08-01 Juergen Vigna <jug@sad.it>
920 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
923 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
924 LFUN_TABULAR_FEATURES.
926 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
929 * src/insets/insettabular.C (getStatus): implemented helper function.
931 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
933 2000-07-31 Juergen Vigna <jug@sad.it>
935 * src/text.C (draw): fixed screen update problem for text-insets.
937 * src/text2.C (SetParagrpah): call an update of the inset-owner when
938 something changed probably this has to be added in various other
941 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
943 2000-07-31 Baruch Even <baruch.even@writeme.com>
945 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
946 templates to satisfy compaq cxx.
949 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
951 * src/support/translator.h (equal_1st_in_pair::operator()): take
952 const ref pair_type as arg.
953 (equal_2nd_in_pair::operator()): ditto
954 (Translator::~Translator): remove empty d-tor.
956 * src/graphics/GraphicsCache.C: move include config.h to top, also
957 put initialization of GraphicsCache::singleton here.
958 (~GraphicsCache): move here
959 (addFile): take const ref as arg
962 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
964 * src/BufferView2.C (insertLyXFile): change te with/without header
967 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
969 * src/frontends/xforms/FormGraphics.C (apply): add some
970 static_cast. Not very nice, but required by compaq cxx.
972 * src/frontends/xforms/RadioButtonGroup.h: include header
973 <utility> instead of <pair.h>
975 * src/insets/insetgraphicsParams.C: add using directive.
976 (readResize): change return type to void.
979 * src/lyxfunc.C (getStatus): add missing break for build-program
980 function; add test for Literate for export functions.
982 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
983 entries in Options menu.
985 2000-07-31 Baruch Even <baruch.even@writeme.com>
987 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
988 protect against auto-allocation; release icon when needed.
990 2000-07-31 Matej Cepl <CeplM@seznam.cz>
992 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
995 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
996 earlier czech.kmap), useful only for programming.
998 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1000 * src/frontends/xforms/FormCitation.h: fix conditioning around
1003 2000-07-31 Juergen Vigna <jug@sad.it>
1005 * src/frontends/xforms/FormTabular.C (local_update): changed
1006 radio_linebreaks to radio_useparbox and added radio_useminipage.
1008 * src/tabular.C: made support for using minipages/parboxes.
1010 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1012 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1014 (descent): so the cursor is in the middle.
1015 (width): bit smaller box.
1017 * src/insets/insetgraphics.h: added display() function.
1019 2000-07-31 Baruch Even <baruch.even@writeme.com>
1021 * src/frontends/Dialogs.h: Added showGraphics signals.
1023 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1024 xforms form definition of the graphics dialog.
1026 * src/frontends/xforms/FormGraphics.h:
1027 * src/frontends/xforms/FormGraphics.C: Added files, the
1028 GUIndependent code of InsetGraphics
1030 * src/insets/insetgraphics.h:
1031 * src/insets/insetgraphics.C: Major writing to make it work.
1033 * src/insets/insetgraphicsParams.h:
1034 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1035 struct between InsetGraphics and GUI.
1037 * src/LaTeXFeatures.h:
1038 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1039 support for graphicx package.
1041 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1042 for the graphics inset.
1044 * src/support/translator.h: Added file, used in
1045 InsetGraphicsParams. this is a template to translate between two
1048 * src/frontends/xforms/RadioButtonGroup.h:
1049 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1050 way to easily control a radio button group.
1052 2000-07-28 Juergen Vigna <jug@sad.it>
1054 * src/insets/insettabular.C (LocalDispatch):
1055 (TabularFeatures): added support for lyx-functions of tabular features.
1056 (cellstart): refixed this function after someone wrongly changed it.
1058 * src/commandtags.h:
1059 * src/LyXAction.C (init): added support for tabular-features
1061 2000-07-28 Allan Rae <rae@lyx.org>
1063 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1064 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1065 triggers the callback for input checking. As a result we sometimes get
1066 "LyX: This shouldn't happen..." printed to cerr.
1067 (input): Started using status variable since I only free() on
1068 destruction. Some input checking for paths and font sizes.
1070 * src/frontends/xforms/FormPreferences.h: Use status to control
1071 activation of Ok and Apply
1073 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1074 callback. Also resized to stop segfaults with 0.88. The problem is
1075 that xforms-0.88 requires the folder to be wide enough to fit all the
1076 tabs. If it isn't it causes all sorts of problems.
1078 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1080 * src/frontends/xforms/forms/README: Reflect reality.
1082 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1083 * src/frontends/xforms/forms/makefile: ditto.
1085 * src/commandtags.h: Get access to new Preferences dialog
1086 * src/LyXAction.C: ditto
1087 * src/lyxfunc.C: ditto
1088 * lib/ui/default.ui: ditto
1090 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1092 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1094 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1097 * src/frontends/xforms/form_url.[Ch]: added.
1099 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1101 * src/insets/insetbib.h: fixed bug in previous commit
1103 * src/frontends/xforms/FormUrl.h: ditto
1105 * src/frontends/xforms/FormPrint.h: ditto
1107 * src/frontends/xforms/FormPreferences.h: ditto
1109 * src/frontends/xforms/FormCopyright.h: ditto
1111 * src/frontends/xforms/FormCitation.C: ditto
1113 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1114 private copyconstructor and private default contructor
1116 * src/support/Makefile.am: add utility.hpp
1118 * src/support/utility.hpp: new file from boost
1120 * src/insets/insetbib.h: set owner in clone
1122 * src/frontends/xforms/FormCitation.C: added missing include
1125 * src/insets/form_url.[Ch]: removed
1127 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1129 * development/lyx.spec.in
1130 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1131 file/directory re-organization.
1133 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1135 * src/insets/insetcommand.[Ch]: moved the string data and
1136 associated manipulation methods into a new stand-alone class
1137 InsetCommandParams. This class has two additional methods
1138 getAsString() and setFromString() allowing the contents to be
1139 moved around as a single string.
1140 (addContents) method removed.
1141 (setContents) method no longer virtual.
1143 * src/buffer.C (readInset): made use of new InsetCitation,
1144 InsetUrl constructors based on InsetCommandParams.
1146 * src/commandtags.h: add LFUN_INSERT_URL
1148 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1149 independent InsetUrl and use InsetCommandParams to extract
1150 string info and create new Insets.
1152 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1154 * src/frontends/xforms/FormCitation.C (apply): uses
1157 * src/frontends/xforms/form_url.C
1158 * src/frontends/xforms/form_url.h
1159 * src/frontends/xforms/FormUrl.h
1160 * src/frontends/xforms/FormUrl.C
1161 * src/frontends/xforms/forms/form_url.fd: new files
1163 * src/insets/insetcite.[Ch]: removed unused constructors.
1165 * src/insets/insetinclude.[Ch]: no longer store filename
1167 * src/insets/inseturl.[Ch]: GUI-independent.
1169 2000-07-26 Juergen Vigna <jug@sad.it>
1170 * renamed frontend from gtk to gnome as it is that what is realized
1171 and did the necessary changes in the files.
1173 2000-07-26 Marko Vendelin <markov@ioc.ee>
1175 * configure.in: cleaning up gnome configuration scripts
1177 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1179 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1180 shortcuts syndrom by redrawing them explicitely (a better solution
1181 would be appreciated).
1183 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1185 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1188 * src/lyx_cb.C (MenuExport): change html export to do the right
1189 thing depending of the document type (instead of having
1190 html-linuxdoc and html-docbook).
1191 * src/lyxfunc.C (getStatus): update for html
1192 * lib/ui/default.ui: simplify due to the above change.
1193 * src/menus.C (ShowFileMenu): update too (in case we need it).
1195 * src/MenuBackend.C (read): if a menu is defined twice, add the
1196 new entries to the exiting one.
1198 2000-07-26 Juergen Vigna <jug@sad.it>
1200 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1202 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1203 and return a bool if it did actual save the file.
1204 (AutoSave): don't autosave a unnamed doc.
1206 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1207 check if this is an UNNAMED new file and react to it.
1208 (newFile): set buffer to unnamed and change to not mark a new
1209 buffer dirty if I didn't do anything with it.
1211 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1213 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1215 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1216 friend as per Angus's patch posted to lyx-devel.
1218 * src/ext_l10n.h: updated
1220 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1221 gettext on the style string right before inserting them into the
1224 * autogen.sh: add code to extract style strings form layout files,
1225 not good enough yet.
1227 * src/frontends/gtk/.cvsignore: add MAKEFILE
1229 * src/MenuBackend.C (read): run the label strings through gettext
1230 before storing them in the containers.
1232 * src/ext_l10n.h: new file
1234 * autogen.sh : generate the ext_l10n.h file here
1236 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1238 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1241 * lib/ui/default.ui: fix a couple of typos.
1243 * config/gnome/gtk.m4: added (and added to the list of files in
1246 * src/insets/insetinclude.C (unique_id): fix when we are using
1247 lyxstring instead of basic_string<>.
1248 * src/insets/insettext.C (LocalDispatch): ditto.
1249 * src/support/filetools.C: ditto.
1251 * lib/configure.m4: create the ui/ directory if necessary.
1253 * src/LyXView.[Ch] (updateToolbar): new method.
1255 * src/BufferView_pimpl.C (buffer): update the toolbar when
1256 opening/closing buffer.
1258 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1260 * src/LyXAction.C (getActionName): enhance to return also the name
1261 and options of pseudo-actions.
1262 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1264 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1265 as an example of what is possible). Used in File->Build too (more
1266 useful) and in the import/export menus (to mimick the complicated
1267 handling of linuxdoc and friends). Try to update all the entries.
1269 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1272 * src/MenuBackend.C (read): Parse the new OptItem tag.
1274 * src/MenuBackend.h: Add a new optional_ data member (used if the
1275 entry should be omitted when the lyxfunc is disabled).
1277 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1278 function, used as a shortcut.
1279 (create_submenu): align correctly the shortcuts on the widest
1282 * src/MenuBackend.h: MenuItem.label() only returns the label of
1283 the menu without shortcut; new method shortcut().
1285 2000-07-14 Marko Vendelin <markov@ioc.ee>
1287 * src/frontends/gtk/Dialogs.C:
1288 * src/frontends/gtk/FormCopyright.C:
1289 * src/frontends/gtk/FormCopyright.h:
1290 * src/frontends/gtk/Makefile.am: added these source-files for the
1291 Gtk/Gnome support of the Copyright-Dialog.
1293 * src/main.C: added Gnome::Main initialization if using
1294 Gtk/Gnome frontend-GUI.
1296 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1298 * config/gnome/aclocal-include.m4
1299 * config/gnome/compiler-flags.m4
1300 * config/gnome/curses.m4
1301 * config/gnome/gnome--.m4
1302 * config/gnome/gnome-bonobo-check.m4
1303 * config/gnome/gnome-common.m4
1304 * config/gnome/gnome-fileutils.m4
1305 * config/gnome/gnome-ghttp-check.m4
1306 * config/gnome/gnome-gnorba-check.m4
1307 * config/gnome/gnome-guile-checks.m4
1308 * config/gnome/gnome-libgtop-check.m4
1309 * config/gnome/gnome-objc-checks.m4
1310 * config/gnome/gnome-orbit-check.m4
1311 * config/gnome/gnome-print-check.m4
1312 * config/gnome/gnome-pthread-check.m4
1313 * config/gnome/gnome-support.m4
1314 * config/gnome/gnome-undelfs.m4
1315 * config/gnome/gnome-vfs.m4
1316 * config/gnome/gnome-x-checks.m4
1317 * config/gnome/gnome-xml-check.m4
1318 * config/gnome/gnome.m4
1319 * config/gnome/gperf-check.m4
1320 * config/gnome/gtk--.m4
1321 * config/gnome/linger.m4
1322 * config/gnome/need-declaration.m4: added configuration scripts
1323 for Gtk/Gnome frontend-GUI
1325 * configure.in: added support for the --with-frontend=gtk option
1327 * autogen.sh: added config/gnome/* to list of config-files
1329 * acconfig.h: added define for GTKGUI-support
1331 * config/lyxinclude.m4: added --with-frontend[=value] option value
1332 for Gtk/Gnome frontend-GUI support.
1334 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1336 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1340 * src/paragraph.C (GetChar): remove non-const version
1342 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1343 (search_kw): use it.
1345 * src/lyx_main.C (init): if "preferences" exist, read that instead
1347 (ReadRcFile): return bool if the file could be read ok.
1348 (ReadUIFile): add a check to see if lex file is set ok.
1350 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1351 bastring can be used instead of lyxstring (still uses the old code
1352 if std::string is good enough or if lyxstring is used.)
1354 * src/encoding.C: make the arrays static, move ininle functions
1356 * src/encoding.h: from here.
1358 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1359 (parseSingleLyXformat2Token): move inset parsing to separate method
1360 (readInset): new private method
1362 * src/Variables.h: remove virtual from get().
1364 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1365 access to NEW_INSETS and NEW_TABULAR
1367 * src/MenuBackend.h: remove superfluous forward declaration of
1368 MenuItem. Add documentations tags "///", remove empty MenuItem
1369 destructor, remove private default contructor.
1371 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1373 (read): more string mlabel and mname to where they are used
1374 (read): remove unused variables mlabel and mname
1375 (defaults): unconditional clear, make menusetup take advantage of
1376 add returning Menu &.
1378 * src/LyXView.h: define NEW_MENUBAR as default
1380 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1381 to NEW_INSETS and NEW_TABULAR.
1382 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1383 defined. Change some of the "xxxx-inset-insert" functions names to
1386 * several files: more enahncements to NEW_INSETS and the resulting
1389 * lib/lyxrc.example (\date_insert_format): move to misc section
1391 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1392 bastring and use AC_CACHE_CHECK.
1393 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1394 the system have the newest methods. uses AC_CACHE_CHECK
1395 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1396 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1397 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1399 * configure.in: add LYX_CXX_GOOD_STD_STRING
1401 * acinclude.m4: recreated
1403 2000-07-24 Amir Karger
1405 * README: add Hebrew, Arabic kmaps
1408 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1410 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1413 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1415 * Lot of files: add pragma interface/implementation.
1417 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1419 * lib/ui/default.ui: new file (ans new directory). Contains the
1420 default menu and toolbar.
1422 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1423 global space. Toolbars are now read (as menus) in ui files.
1425 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1427 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1428 is disabled because the document is read-only. We want to have the
1429 toggle state of the function anyway.
1430 (getStatus): add code for LFUN_VC* functions (mimicking what is
1431 done in old-style menus)
1433 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1434 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1436 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1437 * src/BufferView_pimpl.C: ditto.
1438 * src/lyxfunc.C: ditto.
1440 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1441 default). This replaces old-style menus by new ones.
1443 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1444 MenuItem. Contain the data structure of a menu.
1446 * src/insets/insettext.C: use LyXView::setLayout instead of
1447 accessing directly the toolbar combox.
1448 * src/lyxfunc.C (Dispatch): ditto.
1450 * src/LyXView.C (setLayout): new method, which just calls
1451 Toolbar::setLayout().
1452 (updateLayoutChoice): move part of this method in Toolbar.
1454 * src/toolbar.[Ch]: removed.
1456 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1457 implementation the toolbar.
1459 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1460 the toolbar. It might make sense to merge it with ToolbarDefaults
1462 (setLayout): new function.
1463 (updateLayoutList): ditto.
1464 (openLayoutList): ditto.
1466 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1467 xforms implementation of the toolbar.
1468 (get_toolbar_func): comment out, since I do not
1469 know what it is good for.
1471 * src/ToolbarDefaults.h: Add the ItemType enum.
1473 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1474 for a list of allocated C strings. Used in Menubar xforms
1475 implementation to avoid memory leaks.
1477 * src/support/lstrings.[Ch] (uppercase): new version taking and
1481 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1482 * lib/bind/emacs.bind: ditto.
1484 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1486 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1487 forward decl of LyXView.
1489 * src/toolbar.C (toolbarItem): moved from toolbar.h
1490 (toolbarItem::clean): ditto
1491 (toolbarItem::~toolbarItem): ditto
1492 (toolbarItem::operator): ditto
1494 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1496 * src/paragraph.h: control the NEW_TABULAR define from here
1498 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1499 USE_TABULAR_INSETS to NEW_TABULAR
1501 * src/ToolbarDefaults.C: add include "lyxlex.h"
1503 * files using the old table/tabular: use NEW_TABULAR to control
1504 compilation of old tabular stuff.
1506 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1509 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1510 planemet in reading of old style floats, fix the \end_deeper
1511 problem when reading old style floats.
1513 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1515 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1517 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1519 * lib/bind/sciword.bind: updated.
1521 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1523 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1524 layout write problem
1526 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1528 * src/Makefile.am (INCLUDES): remove image directory from include
1531 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1532 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1534 * src/LyXView.C (create_form_form_main): read the application icon
1537 * lib/images/*.xpm: change the icons to use transparent color for
1540 * src/toolbar.C (update): change the color of the button when it
1543 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1546 setting explicitely the minibuffer.
1547 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1549 * src/LyXView.C (showState): new function. Shows font information
1550 in minibuffer and update toolbar state.
1551 (LyXView): call Toolbar::update after creating the
1554 * src/toolbar.C: change toollist to be a vector instead of a
1556 (BubbleTimerCB): get help string directly from the callback
1557 argument of the corresponding icon (which is the action)
1558 (set): remove unnecessary ugliness.
1559 (update): new function. update the icons (depressed, disabled)
1560 depending of the status of the corresponding action.
1562 * src/toolbar.h: remove help in toolbarItem
1564 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1566 * src/Painter.C (text): Added code for using symbol glyphs from
1567 iso10646 fonts. Currently diabled.
1569 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1572 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1573 magyar,turkish and usorbian.
1575 * src/paragraph.C (isMultiLingual): Made more efficient.
1577 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1580 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1581 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1582 Also changed the prototype to "bool math_insert_greek(char)".
1584 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1586 * lots of files: apply the NEW_INSETS on all code that will not be
1587 needed when we move to use the new insets. Enable the define in
1588 lyxparagrah.h to try it.
1590 * src/insets/insettabular.C (cellstart): change to be a static
1592 (InsetTabular): initialize buffer in the initializer list.
1594 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1596 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1597 form_print.h out of the header file. Replaced with forward
1598 declarations of the relevant struct.
1600 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1603 * src/commandtags.h: do not include "debug.h" which does not
1604 belong there. #include it in some other places because of this
1607 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1609 * src/insets/insetcaption.C: add a couple "using" directives.
1611 * src/toolbar.C (add): get the help text directly from lyxaction.
1613 (setPixmap): new function. Loads from disk and sets a pixmap on a
1614 botton; the name of the pixmap file is derived from the command
1617 * src/toolbar.h: remove members isBitmap and pixmap from
1620 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1621 * lib/images/: move many files from images/banner.xpm.
1623 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1625 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1626 * src/toolbar.C: ditto.
1627 * configure.in: ditto.
1628 * INSTALL: document.
1630 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1631 the spellchecker popup is closed from the WM.
1633 2000-07-19 Juergen Vigna <jug@sad.it>
1635 * src/insets/insetfloat.C (Write): small fix because we use the
1636 insetname for the type now!
1638 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1640 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1643 * src/frontends/Dialogs.h: removed hideCitation signal
1645 * src/insets/insetcite.h: added hide signal
1647 * src/insets/insetcite.C (~InsetCitation): emits new signal
1648 (getScreenLabel): "intelligent" label should now fit on the screen!
1650 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1652 * src/frontends/xforms/FormCitation.C (showInset): connects
1653 hide() to the inset's hide signal
1654 (show): modified to use fl_set_object_position rather than
1655 fl_set_object_geometry wherever possible
1657 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1659 * src/insets/lyxinset.h: add caption code
1661 * src/insets/insetfloat.C (type): new method
1663 * src/insets/insetcaption.C (Write): new method
1665 (LyxCode): new method
1667 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1668 to get it right together with using the FloatList.
1670 * src/commandtags.h: add LFUN_INSET_CAPTION
1671 * src/lyxfunc.C (Dispatch): handle it
1673 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1676 * src/Variables.[Ch]: make expand take a const reference, remove
1677 the destructor, some whitespace changes.
1679 * src/LyXAction.C (init): add caption-inset-insert
1681 * src/FloatList.C (FloatList): update the default floats a bit.
1683 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1685 * src/Variables.[Ch]: new files. Intended to be used for language
1686 specific strings (like \chaptername) and filename substitution in
1689 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1691 * lib/kbd/american.kmap: update
1693 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1695 * src/bufferparams.[Ch]: remove member allowAccents.
1697 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1699 * src/LaTeXLog.C: use the log_form.h header.
1700 * src/lyx_gui.C: ditto.
1701 * src/lyx_gui_misc.C: ditto.
1702 * src/lyxvc.h: ditto.
1704 * forms/log_form.fd: new file, created from latexoptions.fd. I
1705 kept the log popup and nuked the options form.
1707 * src/{la,}texoptions.[Ch]: removed.
1708 * src/lyx_cb.C (LaTeXOptions): ditto
1710 * src/lyx_gui.C (create_forms): do not handle the
1711 fd_latex_options form.
1713 2000-07-18 Juergen Vigna <jug@sad.it>
1715 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1716 name of the inset so that it can be requested outside (text2.C).
1718 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1721 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1723 * src/mathed/formula.h (ConvertFont): constify
1725 * src/mathed/formula.C (Read): add warning if \end_inset is not
1726 found on expected place.
1728 * src/insets/lyxinset.h (ConvertFont): consify
1730 * src/insets/insetquotes.C (ConvertFont): constify
1731 * src/insets/insetquotes.h: ditto
1733 * src/insets/insetinfo.h: add labelfont
1735 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1736 (ascent): use labelfont
1740 (Write): make .lyx file a bit nicer
1742 * src/insets/insetfloat.C (Write): simplify somewhat...
1743 (Read): add warning if arg is not found
1745 * src/insets/insetcollapsable.C: add using std::max
1746 (Read): move string token and add warning in arg is not found
1747 (draw): use std::max to get the right ty
1748 (getMaxWidth): simplify by using std::max
1750 * src/insets/insetsection.h: new file
1751 * src/insets/insetsection.C: new file
1752 * src/insets/insetcaption.h: new file
1753 * src/insets/insetcaption.C: new file
1755 * src/insets/inset.C (ConvertFont): constify signature
1757 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1758 insetcaption.[Ch] and insetsection.[Ch]
1760 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1761 uses to use LABEL_COUNTER_CHAPTER instead.
1762 * src/text2.C (SetCounter): here
1764 * src/counters.h: new file
1765 * src/counters.C: new file
1766 * src/Sectioning.h: new file
1767 * src/Sectioning.C: new file
1769 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1771 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1773 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1776 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1779 2000-07-17 Juergen Vigna <jug@sad.it>
1781 * src/tabular.C (Validate): check if array-package is needed.
1782 (SetVAlignment): added support for vertical alignment.
1783 (SetLTFoot): better support for longtable header/footers
1784 (Latex): modified to support added features.
1786 * src/LaTeXFeatures.[Ch]: added array-package.
1788 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1790 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1793 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1795 * configure.in: do not forget to put a space after -isystem.
1797 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1799 * lib/kbd/arabic.kmap: a few fixes.
1801 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1803 * some whitespace chagnes to a number of files.
1805 * src/support/DebugStream.h: change to make it easier for
1806 doc++ to parse correctly.
1807 * src/support/lyxstring.h: ditto
1809 * src/mathed/math_utils.C (compara): change to have only one
1811 (MathedLookupBOP): change because of the above.
1813 * src/mathed/math_delim.C (math_deco_compare): change to have only
1815 (search_deco): change becasue of the above.
1817 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1818 instead of manually coded one.
1820 * src/insets/insetquotes.C (Read): read the \end_inset too
1822 * src/insets/insetlatex.h: remove file
1823 * src/insets/insetlatex.C: remove file
1825 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1827 (InsetPrintIndex): remove destructor
1829 * src/insets/insetinclude.h: remove default constructor
1831 * src/insets/insetfloat.C: work to make it work better
1833 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1835 * src/insets/insetcite.h (InsetCitation): remove default constructor
1837 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1839 * src/text.C (GetColumnNearX): comment out some currently unused code.
1841 * src/paragraph.C (writeFile): move some initializations closer to
1843 (CutIntoMinibuffer): small change to use new matchIT operator
1847 (InsertInset): ditto
1850 (InsetIterator): ditto
1851 (Erase): small change to use new matchFT operator
1853 (GetFontSettings): ditto
1854 (HighestFontInRange): ditto
1857 * src/lyxparagraph.h: some chars changed to value_type
1858 (matchIT): because of some stronger checking (perhaps too strong)
1859 in SGI STL, the two operator() unified to one.
1862 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1864 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1865 the last inset read added
1866 (parseSingleLyXformat2Token): some more (future) compability code added
1867 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1868 (parseSingleLyXformat2Token): set last_inset_read
1869 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1870 (parseSingleLyXformat2Token): don't double intializw string next_token
1872 * src/TextCache.C (text_fits::operator()): add const's to the signature
1873 (has_buffer::operator()): ditto
1875 * src/Floating.h: add some comments on the class
1877 * src/FloatList.[Ch] (typeExist): new method
1880 * src/BackStack.h: added default constructor, wanted by Gcc.
1882 2000-07-14 Juergen Vigna <jug@sad.it>
1884 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1886 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1888 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1889 do a redraw when the window is resized!
1890 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1892 * src/insets/insettext.C (resizeLyXText): added function to correctly
1893 being able to resize the LyXWindow.
1895 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1897 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1899 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1900 crashes when closing dialog to a deleted inset.
1902 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1903 method! Now similar to other insets.
1905 2000-07-13 Juergen Vigna <jug@sad.it>
1907 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1909 * lib/examples/Literate.lyx: small patch!
1911 * src/insets/insetbib.C (Read): added this function because of wrong
1912 Write (without [begin|end]_inset).
1914 2000-07-11 Juergen Vigna <jug@sad.it>
1916 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1917 as the insertInset could not be good!
1919 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1920 the bool param should not be last.
1922 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1924 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1925 did submit that to Karl).
1927 * configure.in: use -isystem instead of -I for X headers. This
1928 fixes a problem on solaris with a recent gcc;
1929 put the front-end code after the X detection code;
1930 configure in sigc++ before lib/
1932 * src/lyx_main.C (commandLineHelp): remove -display from command
1935 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1937 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1938 Also put in Makefile rules for building the ``listerrors''
1939 program for parsing errors from literate programs written in LyX.
1941 * lib/build-listerrors: Added small shell script as part of compile
1942 process. This builds a working ``listerrors'' binary if noweb is
1943 installed and either 1) the VNC X server is installed on the machine,
1944 or 2) the user is compiling from within a GUI. The existence of a GUI
1945 is necessary to use the ``lyx --export'' feature for now. This
1946 hack can be removed once ``lyx --export'' no longer requires a GUI to
1949 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1951 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1952 now passed back correctly from gcc and placed "under" error
1953 buttons in a Literate LyX source.
1955 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1957 * src/text.C (GetColumnNearX): Better behavior when a RTL
1958 paragraph is ended by LTR text.
1960 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1963 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1965 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1966 true when clipboard is empty.
1968 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1970 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1971 row of the paragraph.
1972 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1973 to prevent calculation of bidi tables
1975 2000-07-07 Juergen Vigna <jug@sad.it>
1977 * src/screen.C (ToggleSelection): added y_offset and x_offset
1980 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1983 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1985 * src/insets/insettext.C: fixed Layout-Display!
1987 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1989 * configure.in: add check for strings.h header.
1991 * src/spellchecker.C: include <strings.h> in order to have a
1992 definition for bzero().
1994 2000-07-07 Juergen Vigna <jug@sad.it>
1996 * src/insets/insettext.C (draw): set the status of the bv->text to
1997 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1999 * src/screen.C (DrawOneRow):
2000 (DrawFromTo): redraw the actual row if something has changed in it
2003 * src/text.C (draw): call an update of the toplevel-inset if something
2004 has changed inside while drawing.
2006 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2008 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2010 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2011 processing inside class.
2013 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2014 processing inside class.
2016 * src/insets/insetindex.h new struct Holder, consistent with other
2019 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2020 citation dialog from main code and placed it in src/frontends/xforms.
2021 Dialog launched through signals instead of callbacks
2023 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2025 * lyx.man: update the options description.
2027 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2029 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2030 handle neg values, set min width to 590, add doc about -display
2032 2000-07-05 Juergen Vigna <jug@sad.it>
2034 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2035 calls to BufferView *.
2037 * src/insets/insettext.C (checkAndActivateInset): small fix non
2038 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2040 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2041 their \end_inset token!
2043 2000-07-04 edscott <edscott@imp.mx>
2045 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2046 lib/lyxrc.example: added option \wheel_jump
2048 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2050 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2051 remove support for -width,-height,-xpos and -ypos.
2053 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2055 * src/encoding.[Ch]: New files.
2057 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2058 (text): Call to the underline() method only when needed.
2060 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2062 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2063 encoding(s) for the document.
2065 * src/bufferparams.C (BufferParams): Changed default value of
2068 * src/language.C (newLang): Removed.
2069 (items[]): Added encoding information for all defined languages.
2071 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2072 encoding choice button.
2074 * src/lyxrc.h (font_norm_type): New member variable.
2075 (set_font_norm_type): New method.
2077 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2078 paragraphs with different encodings.
2080 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2081 (TransformChar): Changed to work correctly with Arabic points.
2082 (draw): Added support for drawing Arabic points.
2083 (draw): Removed code for drawing underbars (this is done by
2086 * src/support/textutils.h (IsPrintableNonspace): New function.
2088 * src/BufferView_pimpl.h: Added "using SigC::Object".
2089 * src/LyXView.h: ditto.
2091 * src/insets/insetinclude.h (include_label): Changed to mutable.
2093 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2095 * src/mathed/math_iter.h: remove empty destructor
2097 * src/mathed/math_cursor.h: remove empty destructor
2099 * src/insets/lyxinset.h: add THEOREM_CODE
2101 * src/insets/insettheorem.[Ch]: new files
2103 * src/insets/insetminipage.C: (InsertInset): remove
2105 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2107 (InsertInset): remove
2109 * src/insets/insetlist.C: (InsertList): remove
2111 * src/insets/insetfootlike.[Ch]: new files
2113 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2116 (InsertInset): ditto
2118 * src/insets/insetert.C: remove include Painter.h, reindent
2119 (InsertInset): move to header
2121 * src/insets/insetcollapsable.h: remove explicit from default
2122 contructor, remove empty destructor, add InsertInset
2124 * src/insets/insetcollapsable.C (InsertInset): new func
2126 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2128 * src/vspace.h: add explicit to constructor
2130 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2131 \textcompwordmark, please test this.
2133 * src/lyxrc.C: set ascii_linelen to 65 by default
2135 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2137 * src/commandtags.h: add LFUN_INSET_THEOREM
2139 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2140 (makeLinuxDocFile): remove _some_ of the nice logic
2141 (makeDocBookFile): ditto
2143 * src/Painter.[Ch]: (~Painter): removed
2145 * src/LyXAction.C (init): entry for insettheorem added
2147 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2149 (deplog): code to detect files generated by LaTeX, needs testing
2152 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2154 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2156 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2158 * src/LaTeX.C (deplog): Add a check for files that are going to be
2159 created by the first latex run, part of the project to remove the
2162 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2163 contents to the extension list.
2165 2000-07-04 Juergen Vigna <jug@sad.it>
2167 * src/text.C (NextBreakPoint): added support for needFullRow()
2169 * src/insets/lyxinset.h: added needFullRow()
2171 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2174 * src/insets/insettext.C: lots of changes for update!
2176 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2178 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2180 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2182 * src/insets/insetinclude.C (InsetInclude): fixed
2183 initialization of include_label.
2184 (unique_id): now returns a string.
2186 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2188 * src/LaTeXFeatures.h: new member IncludedFiles, for
2189 a map of key, included file name.
2191 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2192 with the included files for inclusion in SGML preamble,
2193 i. e., linuxdoc and docbook.
2196 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2197 nice (is the generated linuxdoc code to be exported?), that
2198 allows to remove column, and only_body that will be true for
2199 slave documents. Insets are allowed inside SGML font type.
2200 New handling of the SGML preamble for included files.
2201 (makeDocBookFile): the same for docbook.
2203 * src/insets/insetinclude.h:
2204 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2206 (DocBook): new export methods.
2208 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2209 and makeDocBookFile.
2211 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2212 formats to export with command line argument -x.
2214 2000-06-29 Juergen Vigna <jug@sad.it>
2216 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2217 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2219 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2220 region could already been cleared by an inset!
2222 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2224 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2227 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2229 (cursorToggle): remove special handling of lyx focus.
2231 2000-06-28 Juergen Vigna <jug@sad.it>
2233 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2236 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2238 * src/insets/insetindex.C (Edit): add a callback when popup is
2241 * src/insets/insettext.C (LocalDispatch):
2242 * src/insets/insetmarginal.h:
2243 * src/insets/insetlist.h:
2244 * src/insets/insetfoot.h:
2245 * src/insets/insetfloat.h:
2246 * src/insets/insetert.h: add a missing std:: qualifier.
2248 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2250 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2253 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2255 * src/insets/insettext.C (Read): remove tmptok unused variable
2256 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2257 (InsertInset): change for new InsetInset code
2259 * src/insets/insettext.h: add TEXT inline method
2261 * src/insets/insettext.C: remove TEXT macro
2263 * src/insets/insetmarginal.C (Write): new method
2264 (Latex): change output slightly
2266 * src/insets/insetfoot.C (Write): new method
2267 (Latex): change output slightly (don't use endl when no need)
2269 * src/insets/insetert.C (Write): new method
2271 * src/insets/insetcollapsable.h: make button_length, button_top_y
2272 and button_bottm_y protected.
2274 * src/insets/insetcollapsable.C (Write): simplify code by using
2275 tostr. Also do not output the float name, the children class
2276 should to that to get control over own arguments
2278 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2279 src/insets/insetminipage.[Ch]:
2282 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2284 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2286 * src/Makefile.am (lyx_SOURCES): add the new files
2288 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2289 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2290 * src/commandtags.h: ditto
2292 * src/LaTeXFeatures.h: add a std::set of used floattypes
2294 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2296 * src/FloatList.[Ch] src/Floating.h: new files
2298 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2300 * src/lyx_cb.C (TableApplyCB): ditto
2302 * src/text2.C: ditto
2303 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2304 (parseSingleLyXformat2Token): ditto + add code for
2305 backwards compability for old float styles + add code for new insets
2307 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2309 (InsertInset(size_type, Inset *, LyXFont)): new method
2310 (InsetChar(size_type, char)): changed to use the other InsetChar
2311 with a LyXFont(ALL_INHERIT).
2312 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2313 insert the META_INSET.
2315 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2317 * sigc++/thread.h (Threads): from here
2319 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2320 definition out of line
2321 * sigc++/scope.h: from here
2323 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2325 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2326 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2328 * Makefile.am (bindist): new target.
2330 * INSTALL: add instructions for doing a binary distribution.
2332 * development/tools/README.bin.example: update a bit.
2334 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2337 * lib/lyxrc.example: new lyxrc tag \set_color.
2339 * src/lyxfunc.C (Dispatch):
2340 * src/commandtags.h:
2341 * src/LyXAction.C: new lyxfunc "set-color".
2343 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2344 and an x11name given as strings.
2346 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2347 cache when a color is changed.
2349 2000-06-26 Juergen Vigna <jug@sad.it>
2351 * src/lyxrow.C (width): added this functions and variable.
2353 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2356 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2358 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2360 * images/undo_bw.xpm: new icon.
2361 * images/redo_bw.xpm: ditto.
2363 * configure.in (INSTALL_SCRIPT): change value to
2364 ${INSTALL} to avoid failures of install-script target.
2365 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2367 * src/BufferView.h: add a magic "friend" declaration to please
2370 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2372 * forms/cite.fd: modified to allow resizing without messing
2375 * src/insetcite.C: Uses code from cite.fd almost without
2377 User can now resize dialog in the x-direction.
2378 Resizing the dialog in the y-direction is prevented, as the
2379 code does this intelligently already.
2381 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2383 * INSTALL: remove obsolete entry in "problems" section.
2385 * lib/examples/sl_*.lyx: update of the slovenian examples.
2387 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2389 2000-06-23 Juergen Vigna <jug@sad.it>
2391 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2393 * src/buffer.C (resize): delete the LyXText of textinsets.
2395 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2397 * src/insets/lyxinset.h: added another parameter 'cleared' to
2398 the draw() function.
2400 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2401 unlocking inset in inset.
2403 2000-06-22 Juergen Vigna <jug@sad.it>
2405 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2406 of insets and moved first to LyXText.
2408 * src/mathed/formulamacro.[Ch]:
2409 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2411 2000-06-21 Juergen Vigna <jug@sad.it>
2413 * src/text.C (GetVisibleRow): look if I should clear the area or not
2414 using Inset::doClearArea() function.
2416 * src/insets/lyxinset.h: added doClearArea() function and
2417 modified draw(Painter &, ...) to draw(BufferView *, ...)
2419 * src/text2.C (UpdateInset): return bool insted of int
2421 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2423 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2424 combox in the character popup
2426 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2427 BufferParams const & params
2429 2000-06-20 Juergen Vigna <jug@sad.it>
2431 * src/insets/insettext.C (SetParagraphData): set insetowner on
2434 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2436 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2437 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2439 (form_main_): remove
2441 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2442 (create_form_form_main): remove FD_form_main stuff, connect to
2443 autosave_timeout signal
2445 * src/LyXView.[Ch] (getMainForm): remove
2446 (UpdateTimerCB): remove
2447 * src/BufferView_pimpl.h: inherit from SigC::Object
2449 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2450 signal instead of callback
2452 * src/BufferView.[Ch] (cursorToggleCB): remove
2454 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2456 * src/BufferView_pimpl.C: changes because of the one below
2458 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2459 instead of storing a pointer to a LyXText.
2461 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2463 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2465 * src/lyxparagraph.h
2467 * src/paragraph.C: Changed fontlist to a sorted vector.
2469 2000-06-19 Juergen Vigna <jug@sad.it>
2471 * src/BufferView.h: added screen() function.
2473 * src/insets/insettext.C (LocalDispatch): some selection code
2476 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2478 * src/insets/insettext.C (SetParagraphData):
2480 (InsetText): fixes for multiple paragraphs.
2482 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2484 * development/lyx.spec.in: Call configure with ``--without-warnings''
2485 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2486 This should be fine, however, since we generally don't want to be
2487 verbose when making an RPM.
2489 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2491 * lib/scripts/fig2pstex.py: New file
2493 2000-06-16 Juergen Vigna <jug@sad.it>
2495 * src/insets/insettabular.C (UpdateLocal):
2496 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2497 (LocalDispatch): Changed all functions to use LyXText.
2499 2000-06-15 Juergen Vigna <jug@sad.it>
2501 * src/text.C (SetHeightOfRow): call inset::update before requesting
2504 * src/insets/insettext.C (update):
2505 * src/insets/insettabular.C (update): added implementation
2507 * src/insets/lyxinset.h: added update function
2509 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2511 * src/text.C (SelectNextWord): protect against null pointers with
2512 old-style string streams. (fix from Paul Theo Gonciari
2515 * src/cite.[Ch]: remove erroneous files.
2517 * lib/configure.m4: update the list of created directories.
2519 * src/lyxrow.C: include <config.h>
2520 * src/lyxcursor.C: ditto.
2522 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2524 * lib/examples/decimal.lyx: new example file from Mike.
2526 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2527 to find template definitions (from Dekel)
2529 * src/frontends/.cvsignore: add a few things.
2531 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2533 * src/Timeout.C (TimeOut): remove default argument.
2535 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2538 * src/insets/ExternalTemplate.C: add a "using" directive.
2540 * src/lyx_main.h: remove the act_ struct, which seems unused
2543 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2545 * LyX Developers Meeting: All files changed, due to random C++ (by
2546 coincidence) code generator script.
2548 - external inset (cool!)
2549 - initial online editing of preferences
2550 - insettabular breaks insettext(s contents)
2552 - some DocBook fixes
2553 - example files update
2554 - other cool stuff, create a diff and look for yourself.
2556 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2558 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2559 -1 this is a non-line-breaking textinset.
2561 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2562 if there is no width set.
2564 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2566 * Lots of files: Merged the dialogbase branch.
2568 2000-06-09 Allan Rae <rae@lyx.org>
2570 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2571 and the Dispatch methods that used it.
2573 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2574 access to functions formerly kept in Dispatch.
2576 2000-05-19 Allan Rae <rae@lyx.org>
2578 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2579 made to_page and count_copies integers again. from_page remains a
2580 string however because I want to allow entry of a print range like
2581 "1,4,22-25" using this field.
2583 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2584 and printer-params-get. These aren't useful from the minibuffer but
2585 could be used by a script/LyXServer app provided it passes a suitable
2586 auto_mem_buffer. I guess I should take a look at how the LyXServer
2587 works and make it support xtl buffers.
2589 * sigc++/: updated to libsigc++-1.0.1
2591 * src/xtl/: updated to xtl-1.3.pl.11
2593 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2594 those changes done to the files in src/ are actually recreated when
2595 they get regenerated. Please don't ever accept a patch that changes a
2596 dialog unless that patch includes the changes to the corresponding *.fd
2599 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2600 stringOnlyContains, renamed it and generalised it.
2602 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2603 branch. Removed the remaining old form_print code.
2605 2000-04-26 Allan Rae <rae@lyx.org>
2607 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2608 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2610 2000-04-25 Allan Rae <rae@lyx.org>
2612 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2613 against a base of xtl-1.3.pl.4
2615 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2616 filter the Id: entries so they still show the xtl version number
2619 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2620 into the src/xtl code. Patch still pending with José (XTL)
2622 2000-04-24 Allan Rae <rae@lyx.org>
2624 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2625 both more generic and much safer. Use the new template functions.
2626 * src/buffer.[Ch] (Dispatch): ditto.
2628 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2629 and mem buffer more intelligently. Also a little general cleanup.
2632 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2633 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2634 * src/xtl/Makefile.am: ditto.
2635 * src/xtl/.cvsignore: ditto.
2636 * src/Makefile.am: ditto.
2638 * src/PrinterParams.h: Removed the macros member functions. Added a
2639 testInvariant member function. A bit of tidying up and commenting.
2640 Included Angus's idea for fixing operation with egcs-1.1.2.
2642 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2643 cool expansion of XTL's mem_buffer to support automatic memory
2644 management within the buffer itself. Removed the various macros and
2645 replaced them with template functions that use either auto_mem_buffer
2646 or mem_buffer depending on a #define. The mem_buffer support will
2647 disappear as soon as the auto_mem_buffer is confirmed to be good on
2648 other platforms/compilers. That is, it's there so you've got something
2651 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2652 effectively forked XTL. However I expect José will include my code
2653 into the next major release. Also fixed a memory leak.
2654 * src/xtl/text.h: ditto.
2655 * src/xtl/xdr.h: ditto.
2656 * src/xtl/giop.h: ditto.
2658 2000-04-16 Allan Rae <rae@lyx.org>
2660 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2661 by autogen.sh and removed by maintainer-clean anyway.
2662 * .cvsignore, sigc++/.cvsignore: Support the above.
2664 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2666 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2668 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2669 macros, renamed static callback-target member functions to suit new
2670 scheme and made them public.
2671 * src/frontends/xforms/forms/form_print.fd: ditto.
2672 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2674 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2677 * src/xtl/: New directory containing a minimal distribution of XTL.
2678 This is XTL-1.3.pl.4.
2680 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2682 2000-04-15 Allan Rae <rae@lyx.org>
2684 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2686 * sigc++/: Updated to libsigc++-1.0.0
2688 2000-04-14 Allan Rae <rae@lyx.org>
2690 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2691 use the generic ones in future. I'll modify my conversion script.
2693 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2695 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2696 (CloseAllBufferRelatedDialogs): Renamed.
2697 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2699 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2700 of the generic ones. These are the same ones my conversion script
2703 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2704 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2705 * src/buffer.C (Dispatch): ditto
2707 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2708 functions for updating and hiding buffer dependent dialogs.
2709 * src/BufferView.C (buffer): ditto
2710 * src/buffer.C (setReadonly): ditto
2711 * src/lyxfunc.C (CloseBuffer): ditto
2713 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2714 Dialogs.h, and hence all the SigC stuff, into every file that includes
2715 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2717 * src/BufferView2.C: reduce the number of headers included by buffer.h
2719 2000-04-11 Allan Rae <rae@lyx.org>
2721 * src/frontends/xforms/xform_macros.h: A small collection of macros
2722 for building C callbacks.
2724 * src/frontends/xforms/Makefile.am: Added above file.
2726 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2727 scheme again. This time it should work for JMarc. If this is
2728 successful I'll revise my conversion script to automate some of this.
2729 The static member functions in the class also have to be public for
2730 this scheme will work. If the scheme works (it's almost identical to
2731 the way BufferView::cursorToggleCB is handled so it should work) then
2732 FormCopyright and FormPrint will be ready for inclusion into the main
2733 trunk immediately after 1.1.5 is released -- provided we're prepared
2734 for complaints about lame compilers not handling XTL.
2736 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2738 2000-04-07 Allan Rae <rae@lyx.org>
2740 * config/lyxinclude.m4: A bit more tidying up (Angus)
2742 * src/LString.h: JMarc's <string> header fix
2744 * src/PrinterParams.h: Used string for most data to remove some
2745 ugly code in the Print dialog and avoid even uglier code when
2746 appending the ints to a string for output.
2748 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2749 and moved "default:" back to the end of switch statement. Cleaned
2750 up the printing so it uses the right function calls and so the
2751 "print to file" option actually puts the file in the right directory.
2753 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2755 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2756 and Ok+Apply button control into a separate method: input (Angus).
2757 (input) Cleaned it up and improved it to be very thorough now.
2758 (All CB) static_cast used instead of C style cast (Angus). This will
2759 probably change again once we've worked out how to keep gcc-2.8.1 happy
2760 with real C callbacks.
2761 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2762 ignore some of the bool settings and has random numbers instead. Needs
2763 some more investigation. Added other input length checks and checking
2764 of file and printer names.
2766 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2767 would link (Angus). Seems the old code doesn't compile with the pragma
2768 statement either. Separated callback entries from internal methods.
2770 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2772 2000-03-17 Allan Rae <rae@lyx.org>
2774 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2775 need it? Maybe it could go in Dialogs instead? I could make it a
2776 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2777 values to get the bool return value.
2778 (Dispatch): New overloaded method for xtl support.
2780 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2781 extern "C" callback instead of static member functions. Hopefully,
2782 JMarc will be able to compile this. I haven't changed
2783 forms/form_copyright.fd yet. Breaking one of my own rules already.
2785 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2786 because they aren't useful from the minibuffer. Maybe a LyXServer
2787 might want a help message though?
2789 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2791 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2792 xtl which needs both rtti and exceptions.
2794 * src/support/Makefile.am:
2795 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2797 * src/frontends/xforms/input_validators.[ch]: input filters and
2798 validators. These conrol what keys are valid in input boxes.
2799 Use them and write some more. Much better idea than waiting till
2800 after the user has pressed Ok to say that the input fields don't make
2803 * src/frontends/xforms/Makefile.am:
2804 * src/frontends/xforms/forms/form_print.fd:
2805 * src/frontends/xforms/forms/makefile:
2806 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2807 new scheme. Still have to make sure I haven't missed anything from
2808 the current implementation.
2810 * src/Makefile.am, src/PrinterParams.h: New data store.
2812 * other files: Added a couple of copyright notices.
2814 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2816 * src/insets/insetbib.h: move Holder struct in public space.
2818 * src/frontends/include/DialogBase.h: use SigC:: only when
2819 SIGC_CXX_NAMESPACES is defined.
2820 * src/frontends/include/Dialogs.h: ditto.
2822 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2824 * src/frontends/xforms/FormCopyright.[Ch]: do not
2825 mention SigC:: explicitely.
2827 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2829 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2830 deals with testing KDE in main configure.in
2831 * configure.in: ditto.
2833 2000-02-22 Allan Rae <rae@lyx.org>
2835 * Lots of files: Merged from HEAD
2837 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2838 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2840 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2842 * sigc++/: new minidist.
2844 2000-02-14 Allan Rae <rae@lyx.org>
2846 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2848 2000-02-08 Juergen Vigna <jug@sad.it>
2850 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2851 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2853 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2854 for this port and so it is much easier for other people to port
2855 dialogs in a common development environment.
2857 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2858 the QT/KDE implementation.
2860 * src/frontends/kde/Dialogs.C:
2861 * src/frontends/kde/FormCopyright.C:
2862 * src/frontends/kde/FormCopyright.h:
2863 * src/frontends/kde/Makefile.am:
2864 * src/frontends/kde/formcopyrightdialog.C:
2865 * src/frontends/kde/formcopyrightdialog.h:
2866 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2867 for the kde support of the Copyright-Dialog.
2869 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2870 subdir-substitution instead of hardcoded 'xforms' as we now have also
2873 * src/frontends/include/DialogBase.h (Object): just commented the
2874 label after #endif (nasty warning and I don't like warnings ;)
2876 * src/main.C (main): added KApplication initialization if using
2879 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2880 For now only the KDE event-loop is added if frontend==kde.
2882 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2884 * configure.in: added support for the --with-frontend[=value] option
2886 * autogen.sh: added kde.m4 file to list of config-files
2888 * acconfig.h: added define for KDEGUI-support
2890 * config/kde.m4: added configuration functions for KDE-port
2892 * config/lyxinclude.m4: added --with-frontend[=value] option with
2893 support for xforms and KDE.
2895 2000-02-08 Allan Rae <rae@lyx.org>
2897 * all Makefile.am: Fixed up so the make targets dist, distclean,
2898 install and uninstall all work even if builddir != srcdir. Still
2899 have a new sigc++ minidist update to come.
2901 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2903 2000-02-01 Allan Rae <rae@lyx.org>
2905 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2906 Many mods to get builddir != srcdir working.
2908 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2909 for building on NT and so we can do the builddir != srcdir stuff.
2911 2000-01-30 Allan Rae <rae@lyx.org>
2913 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2914 This will stay in "rae" branch. We probably don't really need it in
2915 the main trunk as anyone who wants to help programming it should get
2916 a full library installed also. So they can check both included and
2917 system supplied library compilation.
2919 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2920 Added a 'mini' distribution of libsigc++. If you feel the urge to
2921 change something in these directories - Resist it. If you can't
2922 resist the urge then you should modify the following script and rebuild
2923 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2924 all happen. Still uses a hacked version of libsigc++'s configure.in.
2925 I'm quite happy with the results. I'm not sure the extra work to turn
2926 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2927 worth the trouble and would probably lead to extra maintenance
2929 I haven't tested the following important make targets: install, dist.
2930 Not ready for prime time but very close. Maybe 1.1.5.
2932 * development/tools/makeLyXsigc.sh: A shell script to automatically
2933 generate our mini-dist of libsigc++. It can only be used with a CVS
2934 checkout of libsigc++ not a tarball distribution. It's well commented.
2935 This will end up as part of the libsigc++ distribution so other apps
2936 can easily have an included mini-dist. If someone makes mods to the
2937 sigc++ subpackage without modifying this script to generate those
2938 changes I'll be very upset!
2940 * src/frontends/: Started the gui/system indep structure.
2942 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2943 to access the gui-indep dialogs are in this class. Much improved
2944 design compared to previous revision. Lars, please refrain from
2945 moving this header into src/ like you did with Popups.h last time.
2947 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2949 * src/frontends/xforms/: Started the gui-indep system with a single
2950 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2953 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2954 Here you'll find a very useful makefile and automated fdfix.sh that
2955 makes updating dailogs a no-brainer -- provided you follow the rules
2956 set out in the README. I'm thinking about adding another script to
2957 automatically generate skeleton code for a new dialog given just the
2960 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2961 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2962 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2964 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2966 * src/support/LSubstring.C (operator): simplify
2968 * src/lyxtext.h: removed bparams, use buffer_->params instead
2970 * src/lyxrow.h: make Row a real class, move all variables to
2971 private and use accessors.
2973 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2975 (isRightToLeftPar): ditto
2976 (ChangeLanguage): ditto
2977 (isMultiLingual): ditto
2980 (SimpleTeXOnePar): ditto
2981 (TeXEnvironment): ditto
2982 (GetEndLabel): ditto
2984 (SetOnlyLayout): ditto
2985 (BreakParagraph): ditto
2986 (BreakParagraphConservative): ditto
2987 (GetFontSettings): ditto
2989 (CopyIntoMinibuffer): ditto
2990 (CutIntoMinibuffer): ditto
2991 (PasteParagraph): ditto
2992 (SetPExtraType): ditto
2993 (UnsetPExtraType): ditto
2994 (DocBookContTableRows): ditto
2995 (SimpleDocBookOneTablePar): ditto
2997 (TeXFootnote): ditto
2998 (SimpleTeXOneTablePar): ditto
2999 (TeXContTableRows): ditto
3000 (SimpleTeXSpecialChars): ditto
3003 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3004 to private and use accessors.
3006 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3007 this, we did not use it anymore and has not been for ages. Just a
3008 waste of cpu cycles.
3010 * src/language.h: make Language a real class, move all variables
3011 to private and use accessors.
3013 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3014 (create_view): remove
3015 (update): some changes for new timer
3016 (cursorToggle): use new timer
3017 (beforeChange): change for new timer
3019 * src/BufferView.h (cursorToggleCB): removed last paramter because
3022 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3023 (cursorToggleCB): change because of new timer code
3025 * lib/CREDITS: updated own mailaddress
3027 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3029 * src/support/filetools.C (PutEnv): fix the code in case neither
3030 putenv() nor setenv() have been found.
3032 * INSTALL: mention the install-strip Makefile target.
3034 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3035 read-only documents.
3037 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3039 * lib/reLyX/configure.in (VERSION): avoid using a previously
3040 generated reLyX wrapper to find out $prefix.
3042 * lib/examples/eu_adibide_lyx-atua.lyx:
3043 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3044 translation of the Tutorial (Dooteo)
3046 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3048 * forms/cite.fd: new citation dialog
3050 * src/insetcite.[Ch]: the new citation dialog is moved into
3053 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3056 * src/insets/insetcommand.h: data members made private.
3058 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3060 * LyX 1.1.5 released
3062 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3064 * src/version.h (LYX_RELEASE): to 1.1.5
3066 * src/spellchecker.C (RunSpellChecker): return false if the
3067 spellchecker dies upon creation.
3069 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3071 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3072 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3076 * lib/CREDITS: update entry for Martin Vermeer.
3078 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3080 * src/text.C (draw): Draw foreign language bars at the bottom of
3081 the row instead of at the baseline.
3083 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3085 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3087 * lib/bind/de_menus.bind: updated
3089 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3091 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3093 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3095 * src/menus.C (Limit_string_length): New function
3096 (ShowTocMenu): Limit the number of items/length of items in the
3099 * src/paragraph.C (String): Correct result for a paragraph inside
3102 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3104 * src/bufferlist.C (close): test of buf->getuser() == NULL
3106 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3108 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3109 Do not call to SetCursor when the paragraph is a closed footnote!
3111 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3113 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3116 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3118 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3121 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3122 reference popup, that activates the reference-back action
3124 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3126 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3127 the menus. Also fixed a bug.
3129 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3130 the math panels when switching buffers (unless new buffer is readonly).
3132 * src/BufferView.C (NoSavedPositions)
3133 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3135 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3137 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3138 less of dvi dirty or not.
3140 * src/trans_mgr.[Ch] (insert): change first parameter to string
3143 * src/chset.[Ch] (encodeString): add const to first parameter
3145 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3147 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3151 * src/LaTeX.C (deplog): better searching for dependency files in
3152 the latex log. Uses now regexps.
3154 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3155 instead of the box hack or \hfill.
3157 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3159 * src/lyxfunc.C (doImportHelper): do not create the file before
3160 doing the actual import.
3161 (doImportASCIIasLines): create a new file before doing the insert.
3162 (doImportASCIIasParagraphs): ditto.
3164 * lib/lyxrc.example: remove mention of non-existing commands
3166 * lyx.man: remove mention of color-related switches.
3168 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3170 * src/lyx_gui.C: remove all the color-related ressources, which
3171 are not used anymore.
3173 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3176 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3178 * src/lyxrc.C (read): Add a missing break in the switch
3180 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3182 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3184 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3187 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3189 * src/text.C (draw): draw bars under foreign language words.
3191 * src/LColor.[Ch]: add LColor::language
3193 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3195 * src/lyxcursor.h (boundary): New member variable
3197 * src/text.C (IsBoundary): New methods
3199 * src/text.C: Use the above for currect cursor movement when there
3200 is both RTL & LTR text.
3202 * src/text2.C: ditto
3204 * src/bufferview_funcs.C (ToggleAndShow): ditto
3206 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3208 * src/text.C (DeleteLineForward): set selection to true to avoid
3209 that DeleteEmptyParagraphMechanism does some magic. This is how it
3210 is done in all other functions, and seems reasonable.
3211 (DeleteWordForward): do not jump over non-word stuff, since
3212 CursorRightOneWord() already does it.
3214 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3215 DeleteWordBackward, since they seem safe to me (since selection is
3216 set to "true") DeleteEmptyParagraphMechanism does nothing.
3218 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3220 * src/lyx_main.C (easyParse): simplify the code by factoring the
3221 part that removes parameters from the command line.
3222 (LyX): check wether wrong command line options have been given.
3224 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3226 * src/lyx_main.C : add support for specifying user LyX
3227 directory via command line option -userdir.
3229 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3231 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3232 the number of items per popup.
3233 (Add_to_refs_menu): Ditto.
3235 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3237 * src/lyxparagraph.h: renamed ClearParagraph() to
3238 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3239 textclass as parameter, and do nothing if free_spacing is
3240 true. This fixes part of the line-delete-forward problems.
3242 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3243 (pasteSelection): ditto.
3244 (SwitchLayoutsBetweenClasses): more translatable strings.
3246 * src/text2.C (CutSelection): use StripLeadingSpaces.
3247 (PasteSelection): ditto.
3248 (DeleteEmptyParagraphMechanism): ditto.
3250 2000-05-26 Juergen Vigna <jug@sad.it>
3252 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3253 is not needed in tabular insets.
3255 * src/insets/insettabular.C (TabularFeatures): added missing features.
3257 * src/tabular.C (DeleteColumn):
3259 (AppendRow): implemented this functions
3260 (cellsturct::operator=): clone the inset too;
3262 2000-05-23 Juergen Vigna <jug@sad.it>
3264 * src/insets/insettabular.C (LocalDispatch): better selection support
3265 when having multicolumn-cells.
3267 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3269 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3271 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3273 * src/ColorHandler.C (getGCForeground): put more test into _()
3275 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3278 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3281 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3283 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3284 there are no labels, or when buffer is readonly.
3286 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3287 there are no labels, buffer is SGML, or when buffer is readonly.
3289 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3291 * src/LColor.C (LColor): change a couple of grey40 to grey60
3292 (LColor): rewore initalization to make compiles go some magnitude
3294 (getGUIName): don't use gettext until we need the string.
3296 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3298 * src/Bullet.[Ch]: Fixed a small bug.
3300 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3302 * src/paragraph.C (String): Several fixes/improvements
3304 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3306 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3308 * src/paragraph.C (String): give more correct output.
3310 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3312 * src/lyxfont.C (stateText) Do not output the language if it is
3313 eqaul to the language of the document.
3315 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3316 between two paragraphs with the same language.
3318 * src/paragraph.C (getParLanguage) Return a correct answer for an
3319 empty dummy paragraph.
3321 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3324 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3327 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3328 the menus/popup, if requested fonts are unavailable.
3330 2000-05-22 Juergen Vigna <jug@sad.it>
3332 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3333 movement support (Up/Down/Tab/Shift-Tab).
3334 (LocalDispatch): added also preliminari cursor-selection.
3336 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3338 * src/paragraph.C (PasteParagraph): Hopefully now right!
3340 2000-05-22 Garst R. Reese <reese@isn.net>
3342 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3343 of list, change all references to Environment to Command
3344 * tex/hollywood.cls : rewrite environments as commands, add
3345 \uppercase to interiorshot and exteriorshot to force uppecase.
3346 * tex/broadway.cls : rewrite environments as commands. Tweak
3349 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3351 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3352 size of items: use a constant intead of the hardcoded 40, and more
3353 importantly do not remove the %m and %x tags added at the end.
3354 (Add_to_refs_menu): use vector::size_type instead of
3355 unsigned int as basic types for the variables. _Please_ do not
3356 assume that size_t is equal to unsigned int. On an alpha, this is
3357 unsigned long, which is _not_ the same.
3359 * src/language.C (initL): remove language "hungarian", since it
3360 seems that "magyar" is better.
3362 2000-05-22 Juergen Vigna <jug@sad.it>
3364 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3366 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3369 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3370 next was deleted but not set to 0.
3372 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3374 * src/language.C (initL): change the initialization of languages
3375 so that compiles goes _fast_.
3377 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3380 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3382 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3386 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3388 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3390 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3394 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3397 * src/insets/insetlo*.[Ch]: Made editable
3399 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3401 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3402 the current selection.
3404 * src/BufferView_pimpl.C (stuffClipboard): new method
3406 * src/BufferView.C (stuffClipboard): new method
3408 * src/paragraph.C (String): new method
3410 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3411 LColor::ignore when lyxname is not found.
3413 * src/BufferView.C (pasteSelection): new method
3415 * src/BufferView_pimpl.C (pasteSelection): new method
3417 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3419 * src/WorkArea.C (request_clipboard_cb): new static function
3420 (getClipboard): new method
3421 (putClipboard): new method
3423 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3425 * LyX 1.1.5pre2 released
3427 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3429 * src/vspace.C (operator=): removed
3430 (operator=): removed
3432 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3434 * src/layout.C (NumberOfClass): manually set the type in make_pair
3435 (NumberOfLayout): ditto
3437 * src/language.C: use the Language constructor for ignore_lang
3439 * src/language.h: add constructors to struct Language
3441 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3443 * src/text2.C (SetCursorIntern): comment out #warning
3445 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3447 * src/mathed/math_iter.h: initialize sx and sw to 0
3449 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3451 * forms/lyx.fd: Redesign of form_ref
3453 * src/LaTeXFeatures.[Ch]
3457 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3460 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3461 and Buffer::inset_iterator.
3463 * src/menus.C: Added new menus: TOC and Refs.
3465 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3467 * src/buffer.C (getTocList): New method.
3469 * src/BufferView2.C (ChangeRefs): New method.
3471 * src/buffer.C (getLabelList): New method. It replaces the old
3472 getReferenceList. The return type is vector<string> instead of
3475 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3476 the old getLabel() and GetNumberOfLabels() methods.
3477 * src/insets/insetlabel.C (getLabelList): ditto
3478 * src/mathed/formula.C (getLabelList): ditto
3480 * src/paragraph.C (String): New method.
3482 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3483 Uses the new getTocList() method.
3484 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3485 which automatically updates the contents of the browser.
3486 (RefUpdateCB): Use the new getLabelList method.
3488 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3490 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3492 * src/spellchecker.C: Added using std::reverse;
3494 2000-05-19 Juergen Vigna <jug@sad.it>
3496 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3498 * src/insets/insettext.C (computeTextRows): small fix for display of
3499 1 character after a newline.
3501 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3504 2000-05-18 Juergen Vigna <jug@sad.it>
3506 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3507 when changing width of column.
3509 * src/tabular.C (set_row_column_number_info): setting of
3510 autobreak rows if necessary.
3512 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3514 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3516 * src/vc-backend.*: renamed stat() to status() and vcstat to
3517 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3518 compilation broke. The new name seems more relevant, anyway.
3520 2000-05-17 Juergen Vigna <jug@sad.it>
3522 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3523 which was wrong if the removing caused removing of rows!
3525 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3526 (pushToken): new function.
3528 * src/text2.C (CutSelection): fix problem discovered with purify
3530 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3532 * src/debug.C (showTags): enlarge the first column, now that we
3533 have 6-digits debug codes.
3535 * lib/layouts/hollywood.layout:
3536 * lib/tex/hollywood.cls:
3537 * lib/tex/brodway.cls:
3538 * lib/layouts/brodway.layout: more commands and fewer
3539 environments. Preambles moved in the .cls files. Broadway now has
3540 more options on scene numbering and less whitespace (from Garst)
3542 * src/insets/insetbib.C (getKeys): make sure that we are in the
3543 document directory, in case the bib file is there.
3545 * src/insets/insetbib.C (Latex): revert bogus change.
3547 2000-05-16 Juergen Vigna <jug@sad.it>
3549 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3550 the TabularLayout on cursor move.
3552 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3554 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3557 (draw): fixed cursor position and drawing so that the cursor is
3558 visible when before the tabular-inset.
3560 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3561 when creating from old insettext.
3563 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3565 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3567 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3568 * lib/tex/brodway.cls: ditto
3570 * lib/layouts/brodway.layout: change alignment of parenthical
3573 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3575 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3576 versions 0.88 and 0.89 are supported.
3578 2000-05-15 Juergen Vigna <jug@sad.it>
3580 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3583 * src/insets/insettext.C (computeTextRows): redone completely this
3584 function in a much cleaner way, because of problems when having a
3586 (draw): added a frame border when the inset is locked.
3587 (SetDrawLockedFrame): this sets if we draw the border or not.
3588 (SetFrameColor): this sets the frame color (default=insetframe).
3590 * src/insets/lyxinset.h: added x() and y() functions which return
3591 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3592 function which is needed to see if we have a locking inset of some
3593 type in this inset (needed for now in insettabular).
3595 * src/vspace.C (inPixels): the same function also without a BufferView
3596 parameter as so it is easier to use it in some ocasions.
3598 * src/lyxfunc.C: changed all places where insertInset was used so
3599 that now if it couldn't be inserted it is deleted!
3601 * src/TabularLayout.C:
3602 * src/TableLayout.C: added support for new tabular-inset!
3604 * src/BufferView2.C (insertInset): this now returns a bool if the
3605 inset was really inserted!!!
3607 * src/tabular.C (GetLastCellInRow):
3608 (GetFirstCellInRow): new helper functions.
3609 (Latex): implemented for new tabular class.
3613 (TeXTopHLine): new Latex() helper functions.
3615 2000-05-12 Juergen Vigna <jug@sad.it>
3617 * src/mathed/formulamacro.C (Read):
3618 * src/mathed/formula.C (Read): read also the \end_inset here!
3620 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3622 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3623 crush when saving formulae with unbalanced parenthesis.
3625 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3627 * src/layout.C: Add new keyword "endlabelstring" to layout file
3629 * src/text.C (GetVisibleRow): Draw endlabel string.
3631 * lib/layouts/broadway.layout
3632 * lib/layouts/hollywood.layout: Added endlabel for the
3633 Parenthetical layout.
3635 * lib/layouts/heb-article.layout: Do not use slanted font shape
3636 for Theorem like environments.
3638 * src/buffer.C (makeLaTeXFile): Always add "american" to
3639 the UsedLanguages list if document language is RTL.
3641 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3643 * add addendum to README.OS2 and small patch (from SMiyata)
3645 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3647 * many files: correct the calls to ChangeExtension().
3649 * src/support/filetools.C (ChangeExtension): remove the no_path
3650 argument, which does not belong there. Use OnlyFileName() instead.
3652 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3653 files when LaTeXing a non-nice latex file.
3655 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3656 a chain of "if". Return false when deadkeys are not handled.
3658 * src/lyx_main.C (LyX): adapted the code for default bindings.
3660 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3661 bindings for basic functionality (except deadkeys).
3662 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3664 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3665 several methods: handle override_x_deadkeys.
3667 * src/lyxrc.h: remove the "bindings" map, which did not make much
3668 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3670 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3672 * src/lyxfont.C (stateText): use a saner method to determine
3673 whether the font is "default". Seems to fix the crash with DEC
3676 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3678 2000-05-08 Juergen Vigna <jug@sad.it>
3680 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3681 TabularLayoutMenu with mouse-button-3
3682 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3684 * src/TabularLayout.C: added this file for having a Layout for
3687 2000-05-05 Juergen Vigna <jug@sad.it>
3689 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3690 recalculating inset-widths.
3691 (TabularFeatures): activated this function so that I can change
3692 tabular-features via menu.
3694 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3695 that I can test some functions with the Table menu.
3697 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3699 * src/lyxfont.C (stateText): guard against stupid c++libs.
3701 * src/tabular.C: add using std::vector
3702 some whitespace changes, + removed som autogenerated code.
3704 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3706 2000-05-05 Juergen Vigna <jug@sad.it>
3708 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3709 row, columns and cellstructures.
3711 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3713 * lib/lyxrc.example: remove obsolete entries.
3715 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3716 reading of protected_separator for free_spacing.
3718 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3720 * src/text.C (draw): do not display an exclamation mark in the
3721 margin for margin notes. This is confusing, ugly and
3724 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3725 AMS math' is checked.
3727 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3728 name to see whether including the amsmath package is needed.
3730 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3732 * src/paragraph.C (validate): Compute UsedLanguages correctly
3733 (don't insert the american language if it doesn't appear in the
3736 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3737 The argument of \thanks{} command is considered moving argument
3739 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3742 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3744 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3745 for appendix/minipage/depth. The lines can be now both in the footnote
3746 frame, and outside the frame.
3748 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3751 2000-05-05 Juergen Vigna <jug@sad.it>
3753 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3754 neede only in tabular.[Ch].
3756 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3758 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3760 (Write): write '~' for PROTECTED_SEPARATOR
3762 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3764 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3767 * src/mathed/formula.C (drawStr): rename size to siz.
3769 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3770 possibly fix a bug by not changing the pflags = flags to piflags =
3773 2000-05-05 Juergen Vigna <jug@sad.it>
3775 * src/insets/insetbib.C: moved using directive
3777 * src/ImportNoweb.C: small fix for being able to compile (missing
3780 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3782 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3783 to use clear, since we don't depend on this in the code. Add test
3786 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3788 * (various *.C files): add using std::foo directives to please dec
3791 * replace calls to string::clear() to string::erase() (Angus)
3793 * src/cheaders/cmath: modified to provide std::abs.
3795 2000-05-04 Juergen Vigna <jug@sad.it>
3797 * src/insets/insettext.C: Prepared all for inserting of multiple
3798 paragraphs. Still display stuff to do (alignment and other things),
3799 but I would like to use LyXText to do this when we cleaned out the
3800 table-support stuff.
3802 * src/insets/insettabular.C: Changed lot of stuff and added lots
3803 of functionality still a lot to do.
3805 * src/tabular.C: Various functions changed name and moved to be
3806 const functions. Added new Read and Write functions and changed
3807 lots of things so it works good with tabular-insets (also removed
3808 some stuff which is not needed anymore * hacks *).
3810 * src/lyxcursor.h: added operators == and != which just look if
3811 par and pos are (not) equal.
3813 * src/buffer.C (latexParagraphs): inserted this function to latex
3814 all paragraphs form par to endpar as then I can use this too for
3817 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3818 so that I can call this to from text insets with their own cursor.
3820 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3821 output off all paragraphs (because of the fix below)!
3823 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3824 the very last paragraph (this could be also the last paragraph of an
3827 * src/texrow.h: added rows() call which returns the count-variable.
3829 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3831 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3833 * lib/configure.m4: better autodetection of DocBook tools.
3835 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3837 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3839 * src/lyx_cb.C: add using std::reverse;
3841 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3844 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3845 selected files. Should fix repeated errors from generated files.
3847 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3849 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3851 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3852 the spellchecker popup.
3854 * lib/lyxrc.example: Removed the \number_inset section
3856 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * src/insets/figinset.C (various): Use IsFileReadable() to make
3859 sure that the file actually exist. Relying on ghostscripts errors
3860 is a bad idea since they can lead to X server crashes.
3862 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3864 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3867 * lib/lyxrc.example: smallish typo in description of
3868 \view_dvi_paper_option
3870 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3873 * src/lyxfunc.C: doImportHelper to factor out common code of the
3874 various import methods. New functions doImportASCIIasLines,
3875 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3876 doImportLinuxDoc for the format specific parts.
3879 * buffer.C: Dispatch returns now a bool to indicate success
3882 * lyx_gui.C: Add getLyXView() for member access
3884 * lyx_main.C: Change logic for batch commands: First try
3885 Buffer::Dispatch (possibly without GUI), if that fails, use
3888 * lyx_main.C: Add support for --import command line switch.
3889 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3890 Available Formats: Everything accepted by 'buffer-import <format>'
3892 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3894 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3897 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3898 documents will be reformatted upon reentry.
3900 2000-04-27 Juergen Vigna <jug@sad.it>
3902 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3903 correctly only last pos this was a bug.
3905 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3907 * release of lyx-1.1.5pre1
3909 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3911 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3913 * src/menus.C: revert the change of naming (Figure->Graphic...)
3914 from 2000-04-11. It was incomplete and bad.
3916 * src/LColor.[Ch]: add LColor::depthbar.
3917 * src/text.C (GetVisibleRow): use it.
3919 * README: update the languages list.
3921 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3923 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3926 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3928 * README: remove sections that were just wrong.
3930 * src/text2.C (GetRowNearY): remove currentrow code
3932 * src/text.C (GetRow): remove currentrow code
3934 * src/screen.C (Update): rewritten a bit.
3935 (SmallUpdate): removed func
3937 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3939 (FullRebreak): return bool
3940 (currentrow): remove var
3941 (currentrow_y): ditto
3943 * src/lyxscreen.h (Draw): change arg to unsigned long
3944 (FitCursor): return bool
3945 (FitManualCursor): ditto
3946 (Smallpdate): remove func
3947 (first): change to unsigned long
3948 (DrawOneRow): change second arg to long (from long &)
3949 (screen_refresh_y): remove var
3950 (scree_refresh_row): ditto
3952 * src/lyxrow.h: change baseline to usigned int from unsigned
3953 short, this brings some implicit/unsigned issues out in the open.
3955 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3957 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3958 instead of smallUpdate.
3960 * src/lyxcursor.h: change y to unsigned long
3962 * src/buffer.h: don't call updateScrollbar after fitcursor
3964 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3965 where they are used. Removed "\\direction", this was not present
3966 in 1.1.4 and is already obsolete. Commented out some code that I
3967 believe to never be called.
3968 (runLiterate): don't call updateScrollbar after fitCursor
3970 (buildProgram): ditto
3973 * src/WorkArea.h (workWidth): change return val to unsigned
3976 (redraw): remove the button redraws
3977 (setScrollbarValue): change for scrollbar
3978 (getScrollbarValue): change for scrollbar
3979 (getScrollbarBounds): change for scrollbar
3981 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3982 (C_WorkArea_down_cb): removed func
3983 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3984 (resize): change for scrollbar
3985 (setScrollbar): ditto
3986 (setScrollbarBounds): ditto
3987 (setScrollbarIncrements): ditto
3988 (up_cb): removed func
3989 (down_cb): removed func
3990 (scroll_cb): change for scrollbar
3991 (work_area_handler): ditto
3993 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3994 when FitCursor did something.
3995 (updateScrollbar): some unsigned changes
3996 (downCB): removed func
3997 (scrollUpOnePage): removed func
3998 (scrollDownOnePage): remvoed func
3999 (workAreaMotionNotify): don't call screen->FitCursor but use
4000 fitCursor instead. and bool return val
4001 (workAreaButtonPress): ditto
4002 (workAreaButtonRelease): some unsigned changes
4003 (checkInsetHit): ditto
4004 (workAreaExpose): ditto
4005 (update): parts rewritten, comments about the signed char arg added
4006 (smallUpdate): removed func
4007 (cursorPrevious): call needed updateScrollbar
4010 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4013 * src/BufferView.[Ch] (upCB): removed func
4014 (downCB): removed func
4015 (smallUpdate): removed func
4017 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4019 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4020 currentrow, currentrow_y optimization. This did not help a lot and
4021 if we want to do this kind of optimization we should rather use
4022 cursor.row instead of the currentrow.
4024 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4025 buffer spacing and klyx spacing support.
4027 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4029 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4032 2000-04-26 Juergen Vigna <jug@sad.it>
4034 * src/insets/figinset.C: fixes to Lars sstream changes!
4036 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4038 * A lot of files: Added Ascii(ostream &) methods to all inset
4039 classes. Used when exporting to ASCII.
4041 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4042 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4045 * src/text2.C (ToggleFree): Disabled implicit word selection when
4046 there is a change in the language
4048 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4049 no output was generated for end-of-sentence inset.
4051 * src/insets/lyxinset.h
4054 * src/paragraph.C: Removed the insetnumber code
4056 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4058 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4060 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4061 no_babel and no_epsfig completely from the file.
4062 (parseSingleLyXformat2Token): add handling for per-paragraph
4063 spacing as written by klyx.
4065 * src/insets/figinset.C: applied patch by Andre. Made it work with
4068 2000-04-20 Juergen Vigna <jug@sad.it>
4070 * src/insets/insettext.C (cutSelection):
4071 (copySelection): Fixed with selection from right to left.
4072 (draw): now the rows are not recalculated at every draw.
4073 (computeTextRows): for now reset the inset-owner here (this is
4074 important for an undo or copy where the inset-owner is not set
4077 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4078 motion to the_locking_inset screen->first was forgotten, this was
4079 not important till we got multiline insets.
4081 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4083 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4084 code seems to be alright (it is code changed by Dekel, and the
4085 intent is indeed that all macros should be defined \protect'ed)
4087 * NEWS: a bit of reorganisation of the new user-visible features.
4089 2000-04-19 Juergen Vigna <jug@sad.it>
4091 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4092 position. Set the inset_owner of the used paragraph so that it knows
4093 that it is inside an inset. Fixed cursor handling with mouse and
4094 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4095 and cleanups to make TextInsets work better.
4097 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4098 Changed parameters of various functions and added LockInsetInInset().
4100 * src/insets/insettext.C:
4102 * src/insets/insetcollapsable.h:
4103 * src/insets/insetcollapsable.C:
4104 * src/insets/insetfoot.h:
4105 * src/insets/insetfoot.C:
4106 * src/insets/insetert.h:
4107 * src/insets/insetert.C: cleaned up the code so that it works now
4108 correctly with insettext.
4110 * src/insets/inset.C:
4111 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4112 that insets in insets are supported right.
4115 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4117 * src/paragraph.C: some small fixes
4119 * src/debug.h: inserted INSETS debug info
4121 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4122 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4124 * src/commandtags.h:
4125 * src/LyXAction.C: insert code for InsetTabular.
4127 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4128 not Button1MotionMask.
4129 (workAreaButtonRelease): send always a InsetButtonRelease event to
4131 (checkInsetHit): some setCursor fixes (always with insets).
4133 * src/BufferView2.C (lockInset): returns a bool now and extended for
4134 locking insets inside insets.
4135 (showLockedInsetCursor): it is important to have the cursor always
4136 before the locked inset.
4137 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4139 * src/BufferView.h: made lockInset return a bool.
4141 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4143 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4144 that is used also internally but can be called as public to have back
4145 a cursor pos which is not set internally.
4146 (SetCursorIntern): Changed to use above function.
4148 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4150 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4155 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4156 patches for things that should be in or should be changed.
4158 * src/* [insetfiles]: change "usigned char fragile" to bool
4159 fragile. There was only one point that could that be questioned
4160 and that is commented in formulamacro.C. Grep for "CHECK".
4162 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4163 (DeleteBuffer): take it out of CutAndPaste and make it static.
4165 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4167 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4168 output the spacing envir commands. Also the new commands used in
4169 the LaTeX output makes the result better.
4171 * src/Spacing.C (writeEnvirBegin): new method
4172 (writeEnvirEnd): new method
4174 2000-04-18 Juergen Vigna <jug@sad.it>
4176 * src/CutAndPaste.C: made textclass a static member of the class
4177 as otherwise it is not accesed right!!!
4179 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4181 * forms/layout_forms.fd
4182 * src/layout_forms.h
4183 * src/layout_forms.C (create_form_form_character)
4184 * src/lyx_cb.C (UserFreeFont)
4185 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4186 documents (in the layout->character popup).
4188 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4190 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4191 \spell_command was in fact not honored (from Kevin Atkinson).
4193 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4196 * src/lyx_gui.h: make lyxViews private (Angus)
4198 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4200 * src/mathed/math_write.C
4201 (MathMatrixInset::Write) Put \protect before \begin{array} and
4202 \end{array} if fragile
4203 (MathParInset::Write): Put \protect before \\ if fragile
4205 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4207 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4208 initialization if the LyXColorHandler must be done after the
4209 connections to the XServer has been established.
4211 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4212 get the background pixel from the lyxColorhandler so that the
4213 figures are rendered with the correct background color.
4214 (NextToken): removed functions.
4215 (GetPSSizes): use ifs >> string instead of NextToken.
4217 * src/Painter.[Ch]: the color cache moved out of this file.
4219 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4222 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4224 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4225 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4227 * src/BufferView.C (enterView): new func
4228 (leaveView): new func
4230 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4232 (leaveView): new func, undefines xterm cursor when approp.
4234 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4235 (AllowInput): delete the Workarea cursor handling from this func.
4237 * src/Painter.C (underline): draw a slimer underline in most cases.
4239 * src/lyx_main.C (error_handler): use extern "C"
4241 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4244 sent directly to me.
4246 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4247 to the list by Dekel.
4249 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4252 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4253 methods from lyx_cb.here.
4255 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4258 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4260 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4261 instead of using current_view directly.
4263 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4265 * src/LyXAction.C (init): add the paragraph-spacing command.
4267 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4269 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4271 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4272 different from the documents.
4274 * src/text.C (SetHeightOfRow): take paragraph spacing into
4275 account, paragraph spacing takes precedence over buffer spacing
4276 (GetVisibleRow): ditto
4278 * src/paragraph.C (writeFile): output the spacing parameter too.
4279 (validate): set the correct features if spacing is used in the
4281 (Clear): set spacing to default
4282 (MakeSameLayout): spacing too
4283 (HasSameLayout): spacing too
4284 (SetLayout): spacing too
4285 (TeXOnePar): output the spacing commands
4287 * src/lyxparagraph.h: added a spacing variable for use with
4288 per-paragraph spacing.
4290 * src/Spacing.h: add a Default spacing and a method to check if
4291 the current spacing is default. also added an operator==
4293 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4296 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4298 * src/lyxserver.C (callback): fix dispatch of functions
4300 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4301 printf() into lyxerr call.
4303 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4306 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4307 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4308 the "Float" from each of the subitems.
4309 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4311 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4312 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4313 documented the change so that the workaround can be nuked later.
4315 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4318 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4320 * src/buffer.C (getLatexName): ditto
4321 (setReadonly): ditto
4323 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4325 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4326 avoid some uses of current_view. Added also a bufferParams()
4327 method to get at this.
4329 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4331 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4333 * src/lyxparagraph.[Ch]: removed
4334 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4335 with operators used by lower_bound and
4336 upper_bound in InsetTable's
4337 Make struct InsetTable private again. Used matchpos.
4339 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4341 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4342 document, the language of existing text is changed (unless the
4343 document is multi-lingual)
4345 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4347 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4349 * A lot of files: A rewrite of the Right-to-Left support.
4351 2000-04-10 Juergen Vigna <jug@sad.it>
4353 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4354 misplaced cursor when inset in inset is locked.
4356 * src/insets/insettext.C (LocalDispatch): small fix so that a
4357 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4359 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4360 footnote font should be decreased in size twice when displaying.
4362 * src/insets/insettext.C (GetDrawFont): inserted this function as
4363 the drawing-font may differ from the real paragraph font.
4365 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4366 insets (inset in inset!).
4368 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4369 function here because we don't want footnotes inside footnotes.
4371 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4373 (init): now set the inset_owner in paragraph.C
4374 (LocalDispatch): added some resetPos() in the right position
4377 (pasteSelection): changed to use the new CutAndPaste-Class.
4379 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4380 which tells if it is allowed to insert another inset inside this one.
4382 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4383 SwitchLayoutsBetweenClasses.
4385 * src/text2.C (InsertInset): checking of the new paragraph-function
4387 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4388 is not needed anymore here!
4391 (PasteSelection): redone (also with #ifdef) so that now this uses
4392 the CutAndPaste-Class.
4393 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4396 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4397 from/to text/insets.
4399 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4400 so that the paragraph knows if it is inside an (text)-inset.
4401 (InsertFromMinibuffer): changed return-value to bool as now it
4402 may happen that an inset is not inserted in the paragraph.
4403 (InsertInsetAllowed): this checks if it is allowed to insert an
4404 inset in this paragraph.
4406 (BreakParagraphConservative):
4407 (BreakParagraph) : small change for the above change of the return
4408 value of InsertFromMinibuffer.
4410 * src/lyxparagraph.h: added inset_owner and the functions to handle
4411 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4413 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4415 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4416 functions from BufferView to BufferView::Pimpl to ease maintence.
4418 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4419 correctly. Also use SetCursorIntern instead of SetCursor.
4421 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4424 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4426 * src/WorkArea.C (belowMouse): manually implement below mouse.
4428 * src/*: Add "explicit" on several constructors, I added probably
4429 some unneeded ones. A couple of changes to code because of this.
4431 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4432 implementation and private parts from the users of BufferView. Not
4435 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4436 implementation and private parts from the users of LyXLex. Not
4439 * src/BufferView_pimpl.[Ch]: new files
4441 * src/lyxlex_pimpl.[Ch]: new files
4443 * src/LyXView.[Ch]: some inline functions move out-of-line
4445 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4447 * src/lyxparagraph.h: make struct InsetTable public.
4449 * src/support/lyxstring.h: change lyxstring::difference_type to be
4450 ptrdiff_t. Add std:: modifiers to streams.
4452 * src/font.C: include the <cctype> header, for islower() and
4455 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4457 * src/font.[Ch]: new files. Contains the metric functions for
4458 fonts, takes a LyXFont as parameter. Better separation of concepts.
4460 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4461 changes because of this.
4463 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4465 * src/*: compile with -Winline and move functions that don't
4468 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4471 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4474 (various files changed because of this)
4476 * src/Painter.C (text): fixed the drawing of smallcaps.
4478 * src/lyxfont.[Ch] (drawText): removed unused member func.
4481 * src/*.C: added needed "using" statements and "std::" qualifiers.
4483 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/*.h: removed all use of "using" from header files use
4486 qualifier std:: instead.
4488 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4490 * src/text.C (Backspace): some additional cleanups (we already
4491 know whether cursor.pos is 0 or not).
4493 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4494 automake does not provide one).
4496 * src/bmtable.h: replace C++ comments with C comments.
4498 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4500 * src/screen.C (ShowCursor): Change the shape of the cursor if
4501 the current language is not equal to the language of the document.
4502 (If the cursor change its shape unexpectedly, then you've found a bug)
4504 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4507 * src/insets/insetnumber.[Ch]: New files.
4509 * src/LyXAction.C (init)
4510 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4513 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4515 * src/lyxparagraph.h
4516 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4517 (the vector is kept sorted).
4519 * src/text.C (GetVisibleRow): Draw selection correctly when there
4520 is both LTR and RTL text.
4522 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4523 which is much faster.
4525 * src/text.C (GetVisibleRow and other): Do not draw the last space
4526 in a row if the direction of the last letter is not equal to the
4527 direction of the paragraph.
4529 * src/lyxfont.C (latexWriteStartChanges):
4530 Check that font language is not equal to basefont language.
4531 (latexWriteEndChanges): ditto
4533 * src/lyx_cb.C (StyleReset): Don't change the language while using
4534 the font-default command.
4536 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4537 empty paragraph before a footnote.
4539 * src/insets/insetcommand.C (draw): Increase x correctly.
4541 * src/screen.C (ShowCursor): Change cursor shape if
4542 current language != document language.
4544 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4546 2000-03-31 Juergen Vigna <jug@sad.it>
4548 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4549 (Clone): changed mode how the paragraph-data is copied to the
4550 new clone-paragraph.
4552 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4553 GetInset(pos) with no inset anymore there (in inset UNDO)
4555 * src/insets/insetcommand.C (draw): small fix as here x is
4556 incremented not as much as width() returns (2 before, 2 behind = 4)
4558 2000-03-30 Juergen Vigna <jug@sad.it>
4560 * src/insets/insettext.C (InsetText): small fix in initialize
4561 widthOffset (should not be done in the init() function)
4563 2000-03-29 Amir Karger <karger@lyx.org>
4565 * lib/examples/it_ItemizeBullets.lyx: translation by
4568 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4570 2000-03-29 Juergen Vigna <jug@sad.it>
4572 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4574 * src/insets/insetfoot.C (Clone): small change as for the below
4575 new init function in the text-inset
4577 * src/insets/insettext.C (init): new function as I've seen that
4578 clone did not copy the Paragraph-Data!
4579 (LocalDispatch): Added code so that now we have some sort of Undo
4580 functionality (well actually we HAVE Undo ;)
4582 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4584 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4586 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4589 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4591 * src/main.C: added a runtime check that verifies that the xforms
4592 header used when building LyX and the library used when running
4593 LyX match. Exit with a message if they don't match. This is a
4594 version number check only.
4596 * src/buffer.C (save): Don't allocate memory on the heap for
4597 struct utimbuf times.
4599 * *: some using changes, use iosfwd instead of the real headers.
4601 * src/lyxfont.C use char const * instead of string for the static
4602 strings. Rewrite some functions to use sstream.
4604 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4606 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4609 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4611 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4612 of Geodesy (from Martin Vermeer)
4614 * lib/layouts/svjour.inc: include file for the Springer svjour
4615 class. It can be used to support journals other than JoG.
4617 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4618 Miskiewicz <misiek@pld.org.pl>)
4619 * lib/reLyX/Makefile.am: ditto.
4621 2000-03-27 Juergen Vigna <jug@sad.it>
4623 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4624 also some modifications with operations on selected text.
4626 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4627 problems with clicking on insets (last famous words ;)
4629 * src/insets/insetcommand.C (draw):
4630 (width): Changed to have a bit of space before and after the inset so
4631 that the blinking cursor can be seen (otherwise it was hidden)
4633 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4635 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4636 would not be added to the link list when an installed gettext (not
4637 part of libc) is found.
4639 2000-03-24 Juergen Vigna <jug@sad.it>
4641 * src/insets/insetcollapsable.C (Edit):
4642 * src/mathed/formula.C (InsetButtonRelease):
4643 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4646 * src/BufferView.C (workAreaButtonPress):
4647 (workAreaButtonRelease):
4648 (checkInsetHit): Finally fixed the clicking on insets be handled
4651 * src/insets/insetert.C (Edit): inserted this call so that ERT
4652 insets work always with LaTeX-font
4654 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4656 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4657 caused lyx to startup with no GUI in place, causing in a crash
4658 upon startup when called with arguments.
4660 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4662 * src/FontLoader.C: better initialization of dummyXFontStruct.
4664 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4666 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4667 for linuxdoc and docbook import and export format options.
4669 * lib/lyxrc.example Example of default values for the previous flags.
4671 * src/lyx_cb.C Use those flags instead of the hardwired values for
4672 linuxdoc and docbook export.
4674 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4677 * src/menus.C Added menus entries for the new import/exports formats.
4679 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4681 * src/lyxrc.*: Added support for running without Gui
4684 * src/FontLoader.C: sensible defaults if no fonts are needed
4686 * src/lyx_cb.C: New function ShowMessage (writes either to the
4687 minibuffer or cout in case of no gui
4688 New function AskOverwrite for common stuff
4689 Consequently various changes to call these functions
4691 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4692 wild guess at sensible screen resolution when having no gui
4694 * src/lyxfont.C: no gui, no fonts... set some defaults
4696 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4698 * src/LColor.C: made the command inset background a bit lighter.
4700 2000-03-20 Hartmut Goebel <goebel@noris.net>
4702 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4703 stdstruct.inc. Koma-Script added some title elements which
4704 otherwise have been listed below "bibliography". This split allows
4705 adding title elements to where they belong.
4707 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4708 define the additional tilte elements and then include
4711 * many other layout files: changed to include stdtitle.inc just
4712 before stdstruct.inc.
4714 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4716 * src/buffer.C: (save) Added the option to store all backup files
4717 in a single directory
4719 * src/lyxrc.[Ch]: Added variable \backupdir_path
4721 * lib/lyxrc.example: Added descriptions of recently added variables
4723 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4724 bibtex inset, not closing the bibtex popup when deleting the inset)
4726 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4728 * src/lyx_cb.C: add a couple using directives.
4730 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4731 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4732 import based on the filename.
4734 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4735 file would be imported at start, if the filename where of a sgml file.
4737 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4739 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4741 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4742 * src/lyxfont.h Replaced the member variable bits.direction by the
4743 member variable lang. Made many changes in other files.
4744 This allows having a multi-lingual document
4746 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4747 that change the current language to <l>.
4748 Removed the command "font-rtl"
4750 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4751 format for Hebrew documents)
4753 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4754 When auto_mathmode is "true", pressing a digit key in normal mode
4755 will cause entering into mathmode.
4756 If auto_mathmode is "rtl" then this behavior will be active only
4757 when writing right-to-left text.
4759 * src/text2.C (InsertStringA) The string is inserted using the
4762 * src/paragraph.C (GetEndLabel) Gives a correct result for
4763 footnote paragraphs.
4765 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4767 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4769 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4770 front of PasteParagraph. Never insert a ' '. This should at least
4771 fix some cause for the segfaults that we have been experiencing,
4772 it also fixes backspace behaviour slightly. (Phu!)
4774 * src/support/lstrings.C (compare_no_case): some change to make it
4775 compile with gcc 2.95.2 and stdlibc++-v3
4777 * src/text2.C (MeltFootnoteEnvironment): change type o
4778 first_footnote_par_is_not_empty to bool.
4780 * src/lyxparagraph.h: make text private. Changes in other files
4782 (fitToSize): new function
4783 (setContentsFromPar): new function
4784 (clearContents): new function
4785 (SetChar): new function
4787 * src/paragraph.C (readSimpleWholeFile): deleted.
4789 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4790 the file, just use a simple string instead. Also read the file in
4791 a more maintainable manner.
4793 * src/text2.C (InsertStringA): deleted.
4794 (InsertStringB): deleted.
4796 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4798 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4799 RedoParagraphs from the doublespace handling part, just set status
4800 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4801 done, but perhaps not like this.)
4803 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4805 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4806 character when inserting an inset.
4808 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4810 * src/bufferparams.C (readLanguage): now takes "default" into
4813 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4814 also initialize the toplevel_keymap with the default bindings from
4817 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4819 * all files using lyxrc: have lyxrc as a real variable and not a
4820 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4823 * src/lyxrc.C: remove double call to defaultKeyBindings
4825 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4826 toolbar defauls using lyxlex. Remove enums, structs, functions
4829 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4830 toolbar defaults. Also store default keybindings in a map.
4832 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4833 storing the toolbar defaults without any xforms dependencies.
4835 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4836 applied. Changed to use iterators.
4838 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4840 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4841 systems that don't have LINGUAS set to begin with.
4843 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4845 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4846 the list by Dekel Tsur.
4848 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4850 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4851 * src/insets/form_graphics.C: ditto.
4853 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4855 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4857 * src/bufferparams.C (readLanguage): use the new language map
4859 * src/intl.C (InitKeyMapper): use the new language map
4861 * src/lyx_gui.C (create_forms): use the new language map
4863 * src/language.[Ch]: New files. Used for holding the information
4864 about each language. Now! Use this new language map enhance it and
4865 make it really usable for our needs.
4867 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4869 * screen.C (ShowCursor): Removed duplicate code.
4870 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4871 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4873 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4876 * src/text.C Added TransformChar method. Used for rendering Arabic
4877 text correctly (change the glyphs of the letter according to the
4878 position in the word)
4883 * src/lyxrc.C Added lyxrc command {language_command_begin,
4884 language_command_end,language_command_ltr,language_command_rtl,
4885 language_package} which allows the use of either arabtex or Omega
4888 * src/lyx_gui.C (init)
4890 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4891 to use encoding for menu fonts which is different than the encoding
4894 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4895 do not load the babel package.
4896 To write an English document with Hebrew/Arabic, change the document
4897 language to "english".
4899 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4900 (alphaCounter): changed to return char
4901 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4903 * lib/lyxrc.example Added examples for Hebrew/Arabic
4906 * src/layout.C Added layout command endlabeltype
4908 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4910 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4912 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * src/mathed/math_delim.C (search_deco): return a
4915 math_deco_struct* instead of index.
4917 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4919 * All files with a USE_OSTREAM_ONLY within: removed all code that
4920 was unused when USE_OSTREAM_ONLY is defined.
4922 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4923 of any less. Removed header and using.
4925 * src/text.C (GetVisibleRow): draw the string "Page Break
4926 (top/bottom)" on screen when drawing a pagebreak line.
4928 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4930 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4932 * src/mathed/math_macro.C (draw): do some cast magic.
4935 * src/mathed/math_defs.h: change byte* argument to byte const*.
4937 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4939 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4940 know it is right to return InsetFoot* too, but cxx does not like
4943 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4945 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4947 * src/mathed/math_delim.C: change == to proper assignment.
4949 2000-03-09 Juergen Vigna <jug@sad.it>
4951 * src/insets/insettext.C (setPos): fixed various cursor positioning
4952 problems (via mouse and cursor-keys)
4953 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4954 inset (still a small display problem but it works ;)
4956 * src/insets/insetcollapsable.C (draw): added button_top_y and
4957 button_bottom_y to have correct values for clicking on the inset.
4959 * src/support/lyxalgo.h: commented out 'using std::less'
4961 2000-03-08 Juergen Vigna <jug@sad.it>
4963 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4964 Button-Release event closes as it is alos the Release-Event
4967 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4969 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4971 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4972 can add multiple spaces in Scrap (literate programming) styles...
4973 which, by the way, is how I got hooked on LyX to begin with.
4975 * src/mathed/formula.C (Write): Added dummy variable to an
4976 inset::Latex() call.
4977 (Latex): Add free_spacing boolean to inset::Latex()
4979 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4981 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4982 virtual function to include the free_spacing boolean from
4983 the containing paragraph's style.
4985 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4986 Added free_spacing boolean arg to match inset.h
4988 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4989 Added free_spacing boolean arg to match inset.h
4991 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4992 Added free_spacing boolean and made sure that if in a free_spacing
4993 paragraph, that we output normal space if there is a protected space.
4995 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4996 Added free_spacing boolean arg to match inset.h
4998 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4999 Added free_spacing boolean arg to match inset.h
5001 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5002 Added free_spacing boolean arg to match inset.h
5004 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5005 Added free_spacing boolean arg to match inset.h
5007 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5008 Added free_spacing boolean arg to match inset.h
5010 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5011 free_spacing boolean arg to match inset.h
5013 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5014 Added free_spacing boolean arg to match inset.h
5016 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5017 Added free_spacing boolean arg to match inset.h
5019 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5020 Added free_spacing boolean arg to match inset.h
5022 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5023 Added free_spacing boolean arg to match inset.h
5025 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5026 Added free_spacing boolean arg to match inset.h
5028 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5029 free_spacing boolean arg to match inset.h
5031 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5032 free_spacing boolean arg to match inset.h
5034 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5035 ignore free_spacing paragraphs. The user's spaces are left
5038 * src/text.C (InsertChar): Fixed the free_spacing layout
5039 attribute behavior. Now, if free_spacing is set, you can
5040 add multiple spaces in a paragraph with impunity (and they
5041 get output verbatim).
5042 (SelectSelectedWord): Added dummy argument to inset::Latex()
5045 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5048 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5049 paragraph layouts now only input a simple space instead.
5050 Special character insets don't make any sense in free-spacing
5053 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5054 hard-spaces in the *input* file to simple spaces if the layout
5055 is free-spacing. This converts old files which had to have
5056 hard-spaces in free-spacing layouts where a simple space was
5058 (writeFileAscii): Added free_spacing check to pass to the newly
5059 reworked inset::Latex(...) methods. The inset::Latex() code
5060 ensures that hard-spaces in free-spacing paragraphs get output
5061 as spaces (rather than "~").
5063 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/mathed/math_delim.C (draw): draw the empty placeholder
5066 delims with a onoffdash line.
5067 (struct math_deco_compare): struct that holds the "functors" used
5068 for the sort and the binary search in math_deco_table.
5069 (class init_deco_table): class used for initial sort of the
5071 (search_deco): use lower_bound to do a binary search in the
5074 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5076 * src/lyxrc.C: a small secret thingie...
5078 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5079 and to not flush the stream as often as it used to.
5081 * src/support/lyxalgo.h: new file
5082 (sorted): template function used for checking if a sequence is
5083 sorted or not. Two versions with and without user supplied
5084 compare. Uses same compare as std::sort.
5086 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5087 it and give warning on lyxerr.
5089 (struct compare_tags): struct with function operators used for
5090 checking if sorted, sorting and lower_bound.
5091 (search_kw): use lower_bound instead of manually implemented
5094 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5096 * src/insets/insetcollapsable.h: fix Clone() declaration.
5097 * src/insets/insetfoot.h: ditto.
5099 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5101 2000-03-08 Juergen Vigna <jug@sad.it>
5103 * src/insets/lyxinset.h: added owner call which tells us if
5104 this inset is inside another inset. Changed also the return-type
5105 of Editable to an enum so it tells clearer what the return-value is.
5107 * src/insets/insettext.C (computeTextRows): fixed computing of
5108 textinsets which split automatically on more rows.
5110 * src/insets/insetert.[Ch]: changed this to be of BaseType
5113 * src/insets/insetfoot.[Ch]: added footnote inset
5115 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5116 collapsable insets (like footnote, ert, ...)
5118 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5120 * src/lyxdraw.h: remvoe file
5122 * src/lyxdraw.C: remove file
5124 * src/insets/insettext.C: added <algorithm>.
5126 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5128 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5129 (matrix_cb): case MM_OK use string stream
5131 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5134 * src/mathed/math_macro.C (draw): use string stream
5135 (Metrics): use string stream
5137 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5138 directly to the ostream.
5140 * src/vspace.C (asString): use string stream.
5141 (asString): use string stream
5142 (asLatexString): use string stream
5144 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5145 setting Spacing::Other.
5147 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5148 sprintf when creating the stretch vale.
5150 * src/text2.C (alphaCounter): changed to return a string and to
5151 not use a static variable internally. Also fixed a one-off bug.
5152 (SetCounter): changed the drawing of the labels to use string
5153 streams instead of sprintf.
5155 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5156 manipulator to use a scheme that does not require library support.
5157 This is also the way it is done in the new GNU libstdc++. Should
5158 work with DEC cxx now.
5160 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5162 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5163 end. This fixes a bug.
5165 * src/mathed (all files concerned with file writing): apply the
5166 USE_OSTREAM_ONLY changes to mathed too.
5168 * src/support/DebugStream.h: make the constructor explicit.
5170 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5171 count and ostream squashed.
5173 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5175 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5177 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5178 ostringstream uses STL strings, and we might not.
5180 * src/insets/insetspecialchar.C: add using directive.
5181 * src/insets/insettext.C: ditto.
5183 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5185 * lib/layouts/seminar.layout: feeble attempt at a layout for
5186 seminar.cls, far from completet and could really use some looking
5187 at from people used to write layout files.
5189 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5190 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5191 a lot nicer and works nicely with ostreams.
5193 * src/mathed/formula.C (draw): a slightly different solution that
5194 the one posted to the list, but I think this one works too. (font
5195 size wrong in headers.)
5197 * src/insets/insettext.C (computeTextRows): some fiddling on
5198 Jürgens turf, added some comments that he should read.
5200 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5201 used and it gave compiler warnings.
5202 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5205 * src/lyx_gui.C (create_forms): do the right thing when
5206 show_banner is true/false.
5208 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5209 show_banner is false.
5211 * most file writing files: Now use iostreams to do almost all of
5212 the writing. Also instead of passing string &, we now use
5213 stringstreams. mathed output is still not adapted to iostreams.
5214 This change can be turned off by commenting out all the occurences
5215 of the "#define USE_OSTREAM_ONLY 1" lines.
5217 * src/WorkArea.C (createPixmap): don't output debug messages.
5218 (WorkArea): don't output debug messages.
5220 * lib/lyxrc.example: added a comment about the new variable
5223 * development/Code_rules/Rules: Added some more commente about how
5224 to build class interfaces and on how better encapsulation can be
5227 2000-03-03 Juergen Vigna <jug@sad.it>
5229 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5230 automatically with the width of the LyX-Window
5232 * src/insets/insettext.C (computeTextRows): fixed update bug in
5233 displaying text-insets (scrollvalues where not initialized!)
5235 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5237 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5238 id in the check of the result from lower_bound is not enough since
5239 lower_bound can return last too, and then res->id will not be a
5242 * all insets and some code that use them: I have conditionalized
5243 removed the Latex(string & out, ...) this means that only the
5244 Latex(ostream &, ...) will be used. This is a work in progress to
5245 move towards using streams for all output of files.
5247 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5250 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5252 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5253 routine (this fixes bug where greek letters were surrounded by too
5256 * src/support/filetools.C (findtexfile): change a bit the search
5257 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5258 no longer passed to kpsewhich, we may have to change that later.
5260 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5261 warning options to avoid problems with X header files (from Angus
5263 * acinclude.m4: regenerated.
5265 2000-03-02 Juergen Vigna <jug@sad.it>
5267 * src/insets/insettext.C (WriteParagraphData): Using the
5268 par->writeFile() function for writing paragraph-data.
5269 (Read): Using buffer->parseSingleLyXformat2Token()-function
5270 for parsing paragraph data!
5272 * src/buffer.C (readLyXformat2): removed all parse data and using
5273 the new parseSingleLyXformat2Token()-function.
5274 (parseSingleLyXformat2Token): added this function to parse (read)
5275 lyx-file-format (this is called also from text-insets now!)
5277 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5279 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5282 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5283 directly instead of going through a func. One very bad thing: a
5284 static LyXFindReplace, but I don't know where to place it.
5286 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5287 string instead of char[]. Also changed to static.
5288 (GetSelectionOrWordAtCursor): changed to static inline
5289 (SetSelectionOverLenChars): ditto.
5291 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5292 current_view and global variables. both classes has changed names
5293 and LyXFindReplace is not inherited from SearchForm.
5295 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5296 fl_form_search form.
5298 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5300 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5302 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5303 bound (from Kayvan).
5305 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5307 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5309 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5311 * some things that I should comment but the local pub says head to
5314 * comment out all code that belongs to the Roff code for Ascii
5315 export of tables. (this is unused)
5317 * src/LyXView.C: use correct type for global variable
5318 current_layout. (LyXTextClass::size_type)
5320 * some code to get the new insetgraphics closer to working I'd be
5321 grateful for any help.
5323 * src/BufferView2.C (insertInset): use the return type of
5324 NumberOfLayout properly. (also changes in other files)
5326 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5327 this as a test. I want to know what breaks because of this.
5329 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5331 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5334 to use a \makebox in the label, this allows proper justification
5335 with out using protected spaces or multiple hfills. Now it is
5336 "label" for left justified, "\hfill label\hfill" for center, and
5337 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5338 should be changed accordingly.
5340 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5342 * src/lyxtext.h: change SetLayout() to take a
5343 LyXTextClass::size_type instead of a char (when there is more than
5344 127 layouts in a class); also change type of copylayouttype.
5345 * src/text2.C (SetLayout): ditto.
5346 * src/LyXView.C (updateLayoutChoice): ditto.
5348 * src/LaTeX.C (scanLogFile): errors where the line number was not
5349 given just after the '!'-line were ignored (from Dekel Tsur).
5351 * lib/lyxrc.example: fix description of \date_insert_format
5353 * lib/layouts/llncs.layout: new layout, contributed by Martin
5356 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5358 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5359 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5360 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5361 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5362 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5363 paragraph.C, text.C, text2.C)
5365 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5367 * src/insets/insettext.C (LocalDispatch): remove extra break
5370 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5371 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5373 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5374 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5376 * src/insets/insetbib.h: move InsetBibkey::Holder and
5377 InsetCitation::Holder in public space.
5379 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5381 * src/insets/insettext.h: small change to get the new files from
5382 Juergen to compile (use "string", not "class string").
5384 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5385 const & as parameter to LocalDispatch, use LyXFont const & as
5386 paramter to some other func. This also had impacto on lyxinsets.h
5387 and the two mathed insets.
5389 2000-02-24 Juergen Vigna <jug@sad.it>
5392 * src/commandtags.h:
5394 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5398 * src/BufferView2.C: added/updated code for various inset-functions
5400 * src/insets/insetert.[Ch]: added implementation of InsetERT
5402 * src/insets/insettext.[Ch]: added implementation of InsetText
5404 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5405 (draw): added preliminary code for inset scrolling not finshed yet
5407 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5408 as it is in lyxfunc.C now
5410 * src/insets/lyxinset.h: Added functions for text-insets
5412 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5414 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5415 BufferView and reimplement the list as a queue put inside its own
5418 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5420 * several files: use the new interface to the "updateinsetlist"
5422 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5424 (work_area_handler): call BufferView::trippleClick on trippleclick.
5426 * src/BufferView.C (doubleClick): new function, selects word on
5428 (trippleClick): new function, selects line on trippleclick.
5430 2000-02-22 Allan Rae <rae@lyx.org>
5432 * lib/bind/xemacs.bind: buffer-previous not supported
5434 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5436 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5439 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5441 * src/bufferlist.C: get rid of current_view from this file
5443 * src/spellchecker.C: get rid of current_view from this file
5445 * src/vspace.C: get rid of current_view from this file
5446 (inPixels): added BufferView parameter for this func
5447 (asLatexCommand): added a BufferParams for this func
5449 * src/text.C src/text2.C: get rid of current_view from these
5452 * src/lyxfont.C (getFontDirection): move this function here from
5455 * src/bufferparams.C (getDocumentDirection): move this function
5458 * src/paragraph.C (getParDirection): move this function here from
5460 (getLetterDirection): ditto
5462 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5464 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5465 resize due to wrong pixmap beeing used. Also took the opurtunity
5466 to make the LyXScreen stateless on regard to WorkArea and some
5467 general cleanup in the same files.
5469 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5471 * src/Makefile.am: add missing direction.h
5473 * src/PainterBase.h: made the width functions const.
5475 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5478 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5480 * src/insets/insetlatexaccent.C (draw): make the accents draw
5481 better, at present this will only work well with iso8859-1.
5483 * several files: remove the old drawing code, now we use the new
5486 * several files: remove support for mono_video, reverse_video and
5489 2000-02-17 Juergen Vigna <jug@sad.it>
5491 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5492 int ** as we have to return the pointer, otherwise we have only
5493 NULL pointers in the returning function.
5495 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/LaTeX.C (operator()): quote file name when running latex.
5499 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5501 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5502 (bubble tip), this removes our special handling of this.
5504 * Remove all code that is unused now that we have the new
5505 workarea. (Code that are not active when NEW_WA is defined.)
5507 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5509 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5511 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5512 nonexisting layout; correctly redirect obsoleted layouts.
5514 * lib/lyxrc.example: document \view_dvi_paper_option
5516 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5519 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5520 (PreviewDVI): handle the view_dvi_paper_option variable.
5521 [Both from Roland Krause]
5523 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5525 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5526 char const *, int, LyXFont)
5527 (text(int, int, string, LyXFont)): ditto
5529 * src/text.C (InsertCharInTable): attempt to fix the double-space
5530 feature in tables too.
5531 (BackspaceInTable): ditto.
5532 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5534 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5536 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5538 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5539 newly found text in textcache to this.
5540 (buffer): set the owner of the text put into the textcache to 0
5542 * src/insets/figinset.C (draw): fixed the drawing of figures with
5545 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5546 drawing of mathframe, hfills, protected space, table lines. I have
5547 now no outstanding drawing problems with the new Painter code.
5549 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/PainterBase.C (ellipse, circle): do not specify the default
5554 * src/LColor.h: add using directive.
5556 * src/Painter.[Ch]: change return type of methods from Painter& to
5557 PainterBase&. Add a using directive.
5559 * src/WorkArea.C: wrap xforms callbacks in C functions
5562 * lib/layouts/foils.layout: font fix and simplifications from Carl
5565 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5567 * a lot of files: The Painter, LColor and WorkArea from the old
5568 devel branch has been ported to lyx-devel. Some new files and a
5569 lot of #ifdeffed code. The new workarea is enabled by default, but
5570 if you want to test the new Painter and LColor you have to compile
5571 with USE_PAINTER defined (do this in config.h f.ex.) There are
5572 still some rought edges, and I'd like some help to clear those
5573 out. It looks stable (loads and displays the Userguide very well).
5576 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5578 * src/buffer.C (pop_tag): revert to the previous implementation
5579 (use a global variable for both loops).
5581 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5583 * src/lyxrc.C (LyXRC): change slightly default date format.
5585 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5586 there is an English text with a footnote that starts with a Hebrew
5587 paragraph, or vice versa.
5588 (TeXFootnote): ditto.
5590 * src/text.C (LeftMargin): allow for negative values for
5591 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5594 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5595 for input encoding (cyrillic)
5597 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5599 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5602 * src/toolbar.C (set): ditto
5603 * src/insets/insetbib.C (create_form_citation_form): ditto
5605 * lib/CREDITS: added Dekel Tsur.
5607 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5608 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5609 hebrew supports files from Dekel Tsur.
5611 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5612 <tzafrir@technion.ac.il>
5614 * src/lyxrc.C: put \date_insert_format at the right place.
5616 * src/buffer.C (makeLaTeXFile): fix the handling of
5617 BufferParams::sides when writing out latex files.
5619 * src/BufferView2.C: add a "using" directive.
5621 * src/support/lyxsum.C (sum): when we use lyxstring,
5622 ostringstream::str needs an additional .c_str().
5624 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5626 * src/support/filetools.C (ChangeExtension): patch from Etienne
5629 * src/TextCache.C (show): remove const_cast and make second
5630 parameter non-const LyXText *.
5632 * src/TextCache.h: use non const LyXText in show.
5634 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5637 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5639 * src/support/lyxsum.C: rework to be more flexible.
5641 * several places: don't check if a pointer is 0 if you are going
5644 * src/text.C: remove some dead code.
5646 * src/insets/figinset.C: remove some dead code
5648 * src/buffer.C: move the BufferView funcs to BufferView2.C
5649 remove all support for insetlatexdel
5650 remove support for oldpapersize stuff
5651 made some member funcs const
5653 * src/kbmap.C: use a std::list to store the bindings in.
5655 * src/BufferView2.C: new file
5657 * src/kbsequence.[Ch]: new files
5659 * src/LyXAction.C + others: remove all trace of buffer-previous
5661 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5662 only have one copy in the binary of this table.
5664 * hebrew patch: moved some functions from LyXText to more
5665 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5667 * several files: remove support for XForms older than 0.88
5669 remove some #if 0 #endif code
5671 * src/TextCache.[Ch]: new file. Holds the textcache.
5673 * src/BufferView.C: changes to use the new TextCache interface.
5674 (waitForX): remove the now unused code.
5676 * src/BackStack.h: remove some commented code
5678 * lib/bind/emacs.bind: remove binding for buffer-previous
5680 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5682 * applied the hebrew patch.
5684 * src/lyxrow.h: make sure that all Row variables are initialized.
5686 * src/text2.C (TextHandleUndo): comment out a delete, this might
5687 introduce a memory leak, but should also help us to not try to
5688 read freed memory. We need to look at this one.
5690 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5691 (LyXParagraph): initalize footnotekind.
5693 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5694 forgot this when applying the patch. Please heed the warnings.
5696 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5697 (aka. reformat problem)
5699 * src/bufferlist.C (exists): made const, and use const_iterator
5700 (isLoaded): new func.
5701 (release): use std::find to find the correct buffer.
5703 * src/bufferlist.h: made getState a const func.
5704 made empty a const func.
5705 made exists a const func.
5708 2000-02-01 Juergen Vigna <jug@sad.it>
5710 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5712 * po/it.po: updated a bit the italian po file and also changed the
5713 'file nuovo' for newfile to 'filenuovo' without a space, this did
5716 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5717 for the new insert_date command.
5719 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5720 from jdblair, to insert a date into the current text conforming to
5721 a strftime format (for now only considering the locale-set and not
5722 the document-language).
5724 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5726 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5727 Bounds Read error seen by purify. The problem was that islower is
5728 a macros which takes an unsigned char and uses it as an index for
5729 in array of characters properties (and is thus subject to the
5733 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5734 correctly the paper sides radio buttons.
5735 (UpdateDocumentButtons): ditto.
5737 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5739 * src/kbmap.C (getsym + others): change to return unsigned int,
5740 returning a long can give problems on 64 bit systems. (I assume
5741 that int is 32bit on 64bit systems)
5743 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5745 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5746 LyXLookupString to be zero-terminated. Really fixes problems seen
5749 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5752 write a (char*)0 to the lyxerr stream.
5754 * src/lastfiles.C: move algorithm before the using statemets.
5756 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5758 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5759 complains otherwise).
5760 * src/table.C: ditto
5762 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5765 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5766 that I removed earlier... It is really needed.
5768 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5770 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5772 * INSTALL: update xforms home page URL.
5774 * lib/configure.m4: fix a bug with unreadable layout files.
5776 * src/table.C (calculate_width_of_column): add "using std::max"
5779 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5781 * several files: marked several lines with "DEL LINE", this is
5782 lines that can be deleted without changing anything.
5783 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5784 checks this anyway */
5787 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5789 * src/DepTable.C (update): add a "+" at the end when the checksum
5790 is different. (debugging string only)
5792 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5793 the next inset to not be displayed. This should also fix the list
5794 of labels in the "Insert Crossreference" dialog.
5796 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5798 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5799 when regex was not found.
5801 * src/support/lstrings.C (lowercase): use handcoded transform always.
5804 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5805 old_cursor.par->prev could be 0.
5807 * several files: changed post inc/dec to pre inc/dec
5809 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5810 write the lastfiles to file.
5812 * src/BufferView.C (buffer): only show TextCache info when debugging
5814 (resizeCurrentBuffer): ditto
5815 (workAreaExpose): ditto
5817 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5819 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5821 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5822 a bit better by removing the special case for \i and \j.
5824 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5826 * src/lyx_main.C (easyParse): remove test for bad comand line
5827 options, since this broke all xforms-related parsing.
5829 * src/kbmap.C (getsym): set return type to unsigned long, as
5830 declared in header. On an alpha, long is _not_ the same as int.
5832 * src/support/LOstream.h: add a "using std::flush;"
5834 * src/insets/figinset.C: ditto.
5836 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5838 * src/bufferlist.C (write): use blinding fast file copy instead of
5839 "a char at a time", now we are doing it the C++ way.
5841 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5842 std::list<int> instead.
5843 (addpidwait): reflect move to std::list<int>
5844 (sigchldchecker): ditto
5846 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5849 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5850 that obviously was wrong...
5852 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5853 c, this avoids warnings with purify and islower.
5855 * src/insets/figinset.C: rename struct queue to struct
5856 queue_element and rewrite to use a std::queue. gsqueue is now a
5857 std::queue<queue_element>
5858 (runqueue): reflect move to std::queue
5861 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5862 we would get "1" "0" instead of "true" "false. Also make the tostr
5865 2000-01-21 Juergen Vigna <jug@sad.it>
5867 * src/buffer.C (writeFileAscii): Disabled code for special groff
5868 handling of tabulars till I fix this in table.C
5870 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5872 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5874 * src/support/lyxlib.h: ditto.
5876 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5878 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5879 and 'j' look better. This might fix the "macron" bug that has been
5882 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5883 functions as one template function. Delete the old versions.
5885 * src/support/lyxsum.C: move using std::ifstream inside
5888 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5891 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5893 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5895 * src/insets/figinset.C (InitFigures): use new instead of malloc
5896 to allocate memory for figures and bitmaps.
5897 (DoneFigures): use delete[] instead of free to deallocate memory
5898 for figures and bitmaps.
5899 (runqueue): use new to allocate
5900 (getfigdata): use new/delete[] instead of malloc/free
5901 (RegisterFigure): ditto
5903 * some files: moved some declarations closer to first use, small
5904 whitespace changes use preincrement instead of postincrement where
5905 it does not make a difference.
5907 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5908 step on the way to use stl::containers for key maps.
5910 * src/bufferlist.h: add a typedef for const_iterator and const
5911 versions of begin and end.
5913 * src/bufferlist.[Ch]: change name of member variable _state to
5914 state_. (avoid reserved names)
5916 (getFileNames): returns the filenames of the buffers in a vector.
5918 * configure.in (ALL_LINGUAS): added ro
5920 * src/support/putenv.C: new file
5922 * src/support/mkdir.C: new file
5924 2000-01-20 Allan Rae <rae@lyx.org>
5926 * lib/layouts/IEEEtran.layout: Added several theorem environments
5928 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5929 couple of minor additions.
5931 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5932 (except for those in footnotes of course)
5934 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5936 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5938 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5939 std::sort and std::lower_bound instead of qsort and handwritten
5941 (struct compara): struct that holds the functors used by std::sort
5942 and std::lower_bound in MathedLookupBOP.
5944 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5946 * src/support/LAssert.h: do not do partial specialization. We do
5949 * src/support/lyxlib.h: note that lyx::getUserName() and
5950 lyx::date() are not in use right now. Should these be suppressed?
5952 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5953 (makeLinuxDocFile): do not put date and user name in linuxdoc
5956 * src/support/lyxlib.h (kill): change first argument to long int,
5957 since that's what solaris uses.
5959 * src/support/kill.C (kill): fix declaration to match prototype.
5961 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5962 actually check whether namespaces are supported. This is not what
5965 * src/support/lyxsum.C: add a using directive.
5967 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5969 * src/support/kill.C: if we have namespace support we don't have
5970 to include lyxlib.h.
5972 * src/support/lyxlib.h: use namespace lyx if supported.
5974 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5976 * src/support/date.C: new file
5978 * src/support/chdir.C: new file
5980 * src/support/getUserName.C: new file
5982 * src/support/getcwd.C: new file
5984 * src/support/abort.C: new file
5986 * src/support/kill.C: new file
5988 * src/support/lyxlib.h: moved all the functions in this file
5989 insede struct lyx. Added also kill and abort to this struct. This
5990 is a way to avoid the "kill is not defined in <csignal>", we make
5991 C++ wrappers for functions that are not ANSI C or ANSI C++.
5993 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5994 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5995 lyx it has been renamed to sum.
5997 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5999 * src/text.C: add using directives for std::min and std::max.
6001 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6003 * src/texrow.C (getIdFromRow): actually return something useful in
6004 id and pos. Hopefully fixes the bug with positionning of errorbox
6007 * src/lyx_main.C (easyParse): output an error and exit if an
6008 incorrect command line option has been given.
6010 * src/spellchecker.C (ispell_check_word): document a memory leak.
6012 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6013 where a "struct utimbuf" is allocated with "new" and deleted with
6016 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6018 * src/text2.C (CutSelection): don't delete double spaces.
6019 (PasteSelection): ditto
6020 (CopySelection): ditto
6022 * src/text.C (Backspace): don't delete double spaces.
6024 * src/lyxlex.C (next): fix a bug that were only present with
6025 conformant std::istream::get to read comment lines, use
6026 std::istream::getline instead. This seems to fix the problem.
6028 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6030 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6031 allowed to insert space before space" editing problem. Please read
6032 commends at the beginning of the function. Comments about usage
6035 * src/text.C (InsertChar): fix for the "not allowed to insert
6036 space before space" editing problem.
6038 * src/text2.C (DeleteEmptyParagraphMechanism): when
6039 IsEmptyTableRow can only return false this last "else if" will
6040 always be a no-op. Commented out.
6042 * src/text.C (RedoParagraph): As far as I can understand tmp
6043 cursor is not really needed.
6045 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6046 present it could only return false anyway.
6047 (several functions): Did something not so smart...added a const
6048 specifier on a lot of methods.
6050 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6051 and add a tmp->text.resize. The LyXParagraph constructor does the
6053 (BreakParagraphConservative): ditto
6055 * src/support/path.h (Path): add a define so that the wrong usage
6056 "Path("/tmp") will be flagged as a compilation error:
6057 "`unnamed_Path' undeclared (first use this function)"
6059 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6061 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6062 which was bogus for several reasons.
6064 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6068 * autogen.sh: do not use "type -path" (what's that anyway?).
6070 * src/support/filetools.C (findtexfile): remove extraneous space
6071 which caused a kpsewhich warning (at least with kpathsea version
6074 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6076 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6078 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6080 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6082 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6084 * src/paragraph.C (BreakParagraph): do not reserve space on text
6085 if we don't need to (otherwise, if pos_end < pos, we end up
6086 reserving huge amounts of memory due to bad unsigned karma).
6087 (BreakParagraphConservative): ditto, although I have not seen
6088 evidence the bug can happen here.
6090 * src/lyxparagraph.h: add a using std::list.
6092 2000-01-11 Juergen Vigna <jug@sad.it>
6094 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6097 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6099 * src/vc-backend.C (doVCCommand): change to be static and take one
6100 more parameter: the path to chdir too be fore executing the command.
6101 (retrive): new function equiv to "co -r"
6103 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6104 file_not_found_hook is true.
6106 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6108 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6109 if a file is readwrite,readonly...anything else.
6111 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6113 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6114 (CreatePostscript): name change from MenuRunDVIPS (or something)
6115 (PreviewPostscript): name change from MenuPreviewPS
6116 (PreviewDVI): name change from MenuPreviewDVI
6118 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6119 \view_pdf_command., \pdf_to_ps_command
6121 * lib/configure.m4: added search for PDF viewer, and search for
6122 PDF to PS converter.
6123 (lyxrc.defaults output): add \pdflatex_command,
6124 \view_pdf_command and \pdf_to_ps_command.
6126 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6128 * src/bufferlist.C (write): we don't use blocksize for anything so
6131 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6133 * src/support/block.h: disable operator T* (), since it causes
6134 problems with both compilers I tried. See comments in the file.
6136 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6139 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6140 variable LYX_DIR_10x to LYX_DIR_11x.
6142 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6144 * INSTALL: document --with-lyxname.
6147 * configure.in: new configure flag --with-lyxname which allows to
6148 choose the name under which lyx is installed. Default is "lyx", of
6149 course. It used to be possible to do this with --program-suffix,
6150 but the later has in fact a different meaning for autoconf.
6152 * src/support/lstrings.h (lstrchr): reformat a bit.
6154 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6155 * src/mathed/math_defs.h: ditto.
6157 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6159 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6160 true, decides if we create a backup file or not when saving. New
6161 tag and variable \pdf_mode, defaults to false. New tag and
6162 variable \pdflatex_command, defaults to pdflatex. New tag and
6163 variable \view_pdf_command, defaults to xpdf. New tag and variable
6164 \pdf_to_ps_command, defaults to pdf2ps.
6166 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6168 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6169 does not have a BufferView.
6170 (unlockInset): ditto + don't access the_locking_inset if the
6171 buffer does not have a BufferView.
6173 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6174 certain circumstances so that we don't continue a keyboard
6175 operation long after the key was released. Try f.ex. to load a
6176 large document, press PageDown for some seconds and then release
6177 it. Before this change the document would contine to scroll for
6178 some time, with this change it stops imidiatly.
6180 * src/support/block.h: don't allocate more space than needed. As
6181 long as we don't try to write to the arr[x] in a array_type arr[x]
6182 it is perfectly ok. (if you write to it you might segfault).
6183 added operator value_type*() so that is possible to pass the array
6184 to functions expecting a C-pointer.
6186 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6189 * intl/*: updated to gettext 0.10.35, tried to add our own
6190 required modifications. Please verify.
6192 * po/*: updated to gettext 0.10.35, tried to add our own required
6193 modifications. Please verify.
6195 * src/support/lstrings.C (tostr): go at fixing the problem with
6196 cxx and stringstream. When stringstream is used return
6197 oss.str().c_str() so that problems with lyxstring and basic_string
6198 are avoided. Note that the best solution would be for cxx to use
6199 basic_string all the way, but it is not conformant yet. (it seems)
6201 * src/lyx_cb.C + other files: moved several global functions to
6202 class BufferView, some have been moved to BufferView.[Ch] others
6203 are still located in lyx_cb.C. Code changes because of this. (part
6204 of "get rid of current_view project".)
6206 * src/buffer.C + other files: moved several Buffer functions to
6207 class BufferView, the functions are still present in buffer.C.
6208 Code changes because of this.
6210 * config/lcmessage.m4: updated to most recent. used when creating
6213 * config/progtest.m4: updated to most recent. used when creating
6216 * config/gettext.m4: updated to most recent. applied patch for
6219 * config/gettext.m4.patch: new file that shows what changes we
6220 have done to the local copy of gettext.m4.
6222 * config/libtool.m4: new file, used in creation of acinclude.m4
6224 * config/lyxinclude.m4: new file, this is the lyx created m4
6225 macros, used in making acinclude.m4.
6227 * autogen.sh: GNU m4 discovered as a separate task not as part of
6228 the lib/configure creation.
6229 Generate acinlucde from files in config. Actually cat
6230 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6231 easier to upgrade .m4 files that really are external.
6233 * src/Spacing.h: moved using std::istringstream to right after
6234 <sstream>. This should fix the problem seen with some compilers.
6236 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6238 * src/lyx_cb.C: began some work to remove the dependency a lot of
6239 functions have on BufferView::text, even if not really needed.
6240 (GetCurrentTextClass): removed this func, it only hid the
6243 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6244 forgot this in last commit.
6246 * src/Bullet.C (bulletEntry): use static char const *[] for the
6247 tables, becuase of this the return arg had to change to string.
6249 (~Bullet): removed unneeded destructor
6251 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6252 (insetSleep): moved from Buffer
6253 (insetWakeup): moved from Buffer
6254 (insetUnlock): moved from Buffer
6256 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6257 from Buffer to BufferView.
6259 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6261 * config/ltmain.sh: updated to version 1.3.4 of libtool
6263 * config/ltconfig: updated to version 1.3.4 of libtool
6265 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6268 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6269 Did I get that right?
6271 * src/lyxlex.h: add a "using" directive or two.
6272 * src/Spacing.h: ditto.
6273 * src/insets/figinset.C: ditto.
6274 * src/support/filetools.C: ditto.
6275 * src/support/lstrings.C: ditto.
6276 * src/BufferView.C: ditto.
6277 * src/bufferlist.C: ditto.
6278 * src/lyx_cb.C: ditto.
6279 * src/lyxlex.C: ditto.
6281 * NEWS: add some changes for 1.1.4.
6283 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/BufferView.C: first go at a TextCache to speed up switching
6288 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6290 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6291 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6292 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6293 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6296 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6297 members of the struct are correctly initialized to 0 (detected by
6299 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6300 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6302 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6303 pidwait, since it was allocated with "new". This was potentially
6304 very bad. Thanks to Michael Schmitt for running purify for us.
6307 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6309 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6311 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6313 1999-12-30 Allan Rae <rae@lyx.org>
6315 * lib/templates/IEEEtran.lyx: minor change
6317 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6318 src/mathed/formula.C (LocalDispatch): askForText changes
6320 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6321 know when a user has cancelled input. Fixes annoying problems with
6322 inserting labels and version control.
6324 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6326 * src/support/lstrings.C (tostr): rewritten to use strstream and
6329 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6331 * src/support/filetools.C (IsFileWriteable): use fstream to check
6332 (IsDirWriteable): use fileinfo to check
6334 * src/support/filetools.h (FilePtr): whole class deleted
6336 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6338 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6340 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6342 * src/bufferlist.C (write): use ifstream and ofstream instead of
6345 * src/Spacing.h: use istrstream instead of sscanf
6347 * src/mathed/math_defs.h: change first arg to istream from FILE*
6349 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6351 * src/mathed/math_parser.C: have yyis to be an istream
6352 (LexGetArg): use istream (yyis)
6354 (mathed_parse): ditto
6355 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6357 * src/mathed/formula.C (Read): rewritten to use istream
6359 * src/mathed/formulamacro.C (Read): rewritten to use istream
6361 * src/lyxlex.h (~LyXLex): deleted desturctor
6362 (getStream): new function, returns an istream
6363 (getFile): deleted funtion
6364 (IsOK): return is.good();
6366 * src/lyxlex.C (LyXLex): delete file and owns_file
6367 (setFile): open an filebuf and assign that to a istream instead of
6369 (setStream): new function, takes an istream as arg.
6370 (setFile): deleted function
6371 (EatLine): rewritten us use istream instead of FILE*
6375 * src/table.C (LyXTable): use istream instead of FILE*
6376 (Read): rewritten to take an istream instead of FILE*
6378 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6380 * src/buffer.C (Dispatch): remove an extraneous break statement.
6382 * src/support/filetools.C (QuoteName): change to do simple
6383 'quoting'. More work is necessary. Also changed to do nothing
6384 under emx (needs fix too).
6385 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6387 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6388 config.h.in to the AC_DEFINE_UNQUOTED() call.
6389 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6390 needs char * as argument (because Solaris 7 declares it like
6393 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6394 remove definition of BZERO.
6396 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6398 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6399 defined, "lyxregex.h" if not.
6401 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6403 (REGEX): new variable that is set to regex.c lyxregex.h when
6404 AM_CONDITIONAL USE_REGEX is set.
6405 (libsupport_la_SOURCES): add $(REGEX)
6407 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6410 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6413 * configure.in: add call to LYX_REGEX
6415 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6416 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6418 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6420 * lib/bind/fi_menus.bind: new file, from
6421 pauli.virtanen@saunalahti.fi.
6423 * src/buffer.C (getBibkeyList): pass the parameter delim to
6424 InsetInclude::getKeys and InsetBibtex::getKeys.
6426 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6427 is passed to Buffer::getBibkeyList
6429 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6430 instead of the hardcoded comma.
6432 * src/insets/insetbib.C (getKeys): make sure that there are not
6433 leading blanks in bibtex keys. Normal latex does not care, but
6434 harvard.sty seems to dislike blanks at the beginning of citation
6435 keys. In particular, the retturn value of the function is
6437 * INSTALL: make it clear that libstdc++ is needed and that gcc
6438 2.7.x probably does not work.
6440 * src/support/filetools.C (findtexfile): make debug message go to
6442 * src/insets/insetbib.C (getKeys): ditto
6444 * src/debug.C (showTags): make sure that the output is correctly
6447 * configure.in: add a comment for TWO_COLOR_ICON define.
6449 * acconfig.h: remove all the entries that already defined in
6450 configure.in or acinclude.m4.
6452 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6453 to avoid user name, date and copyright.
6455 1999-12-21 Juergen Vigna <jug@sad.it>
6457 * src/table.C (Read): Now read bogus row format informations
6458 if the format is < 5 so that afterwards the table can
6459 be read by lyx but without any format-info. Fixed the
6460 crash we experienced when not doing this.
6462 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6464 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6465 (RedoDrawingOfParagraph): ditto
6466 (RedoParagraphs): ditto
6467 (RemoveTableRow): ditto
6469 * src/text.C (Fill): rename arg paperwidth -> paper_width
6471 * src/buffer.C (insertLyXFile): rename var filename -> fname
6472 (writeFile): rename arg filename -> fname
6473 (writeFileAscii): ditto
6474 (makeLaTeXFile): ditto
6475 (makeLinuxDocFile): ditto
6476 (makeDocBookFile): ditto
6478 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6481 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6483 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6486 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6487 compiled by a C compiler not C++.
6489 * src/layout.h (LyXTextClass): added typedef for const_iterator
6490 (LyXTextClassList): added typedef for const_iterator + member
6491 functions begin and end.
6493 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6494 iterators to fill the choice_class.
6495 (updateLayoutChoice): rewritten to use iterators to fill the
6496 layoutlist in the toolbar.
6498 * src/BufferView.h (BufferView::work_area_width): removed unused
6501 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6503 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6504 (sgmlCloseTag): ditto
6506 * src/support/lstrings.h: return type of countChar changed to
6509 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6510 what version of this func to use. Also made to return unsigned int.
6512 * configure.in: call LYX_STD_COUNT
6514 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6515 conforming std::count.
6517 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6519 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6520 and a subscript would give bad display (patch from Dekel Tsur
6521 <dekel@math.tau.ac.il>).
6523 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6525 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6528 * src/chset.h: add a few 'using' directives
6530 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6531 triggered when no buffer is active
6533 * src/layout.C: removed `break' after `return' in switch(), since
6536 * src/lyx_main.C (init): make sure LyX can be ran in place even
6537 when libtool has done its magic with shared libraries. Fix the
6538 test for the case when the system directory has not been found.
6540 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6541 name for the latex file.
6542 (MenuMakeHTML): ditto
6544 * src/buffer.h: add an optional boolean argument, which is passed
6547 1999-12-20 Allan Rae <rae@lyx.org>
6549 * lib/templates/IEEEtran.lyx: small correction and update.
6551 * configure.in: Attempted to use LYX_PATH_HEADER
6553 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6555 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6556 input from JMarc. Now use preprocessor to find the header.
6557 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6558 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6559 LYX_STL_STRING_FWD. See comments in file.
6561 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6563 * The global MiniBuffer * minibuffer variable is dead.
6565 * The global FD_form_main * fd_form_main variable is dead.
6567 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6569 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6571 * src/table.h: add the LOstream.h header
6572 * src/debug.h: ditto
6574 * src/LyXAction.h: change the explaination of the ReadOnly
6575 attribute: is indicates that the function _can_ be used.
6577 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6580 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6582 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6588 * src/paragraph.C (GetWord): assert on pos>=0
6591 * src/support/lyxstring.C: condition the use of an invariant on
6593 * src/support/lyxstring.h: ditto
6595 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6596 Use LAssert.h instead of plain assert().
6598 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6600 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6601 * src/support/filetools.C: ditto
6603 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6606 * INSTALL: document the new configure flags
6608 * configure.in: suppress --with-debug; add --enable-assertions
6610 * acinclude.m4: various changes in alignment of help strings.
6612 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6614 * src/kbmap.C: commented out the use of the hash map in kb_map,
6615 beginning of movement to a stl::container.
6617 * several files: removed code that was not in effect when
6618 MOVE_TEXT was defined.
6620 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6621 for escaping should not be used. We can discuss if the string
6622 should be enclosed in f.ex. [] instead of "".
6624 * src/trans_mgr.C (insert): use the new returned value from
6625 encodeString to get deadkeys and keymaps done correctly.
6627 * src/chset.C (encodeString): changed to return a pair, to tell
6628 what to use if we know the string.
6630 * src/lyxscreen.h (fillArc): new function.
6632 * src/FontInfo.C (resize): rewritten to use more std::string like
6633 structore, especially string::replace.
6635 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6638 * configure.in (chmod +x some scripts): remove config/gcc-hack
6640 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6642 * src/buffer.C (writeFile): change once again the top comment in a
6643 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6644 instead of an hardcoded version number.
6645 (makeDocBookFile): ditto
6647 * src/version.h: add new define LYX_DOCVERSION
6649 * po/de.po: update from Pit Sütterlin
6650 * lib/bind/de_menus.bind: ditto.
6652 * src/lyxfunc.C (Dispatch): call MenuExport()
6653 * src/buffer.C (Dispatch): ditto
6655 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6656 LyXFunc::Dispatch().
6657 (MenuExport): new function, moved from
6658 LyXFunc::Dispatch().
6660 * src/trans_mgr.C (insert): small cleanup
6661 * src/chset.C (loadFile): ditto
6663 * lib/kbd/iso8859-1.cdef: add missing backslashes
6665 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6667 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6668 help with placing the manually drawn accents better.
6670 (Draw): x2 and hg changed to float to minimize rounding errors and
6671 help place the accents better.
6673 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6674 unsigned short to char is just wrong...cast the char to unsigned
6675 char instead so that the two values can compare sanely. This
6676 should also make the display of insetlatexaccents better and
6677 perhaps also some other insets.
6679 (lbearing): new function
6682 1999-12-15 Allan Rae <rae@lyx.org>
6684 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6685 header that provides a wrapper around the very annoying SGI STL header
6688 * src/support/lyxstring.C, src/LString.h:
6689 removed old SGI-STL-compatability attempts.
6691 * configure.in: Use LYX_STL_STRING_FWD.
6693 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6694 stl_string_fwd.h is around and try to determine it's location.
6695 Major improvement over previous SGI STL 3.2 compatability.
6696 Three small problems remain with this function due to my zero
6697 knowledge of autoconf. JMarc and lgb see the comments in the code.
6699 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6701 * src/broken_const.h, config/hack-gcc, config/README: removed
6703 * configure.in: remove --with-gcc-hack option; do not call
6706 * INSTALL: remove documentation of --with-broken-const and
6709 * acconfig.h: remove all trace of BROKEN_CONST define
6711 * src/buffer.C (makeDocBookFile): update version number in output
6713 (SimpleDocBookOnePar): fix an assert when trying to a character
6714 access beyond string length
6717 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6719 * po/de.po: fix the Export menu
6721 * lyx.man: update the description of -dbg
6723 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6724 (commandLineHelp): updated
6725 (easyParse): show list of available debug levels if -dbg is passed
6728 * src/Makefile.am: add debug.C
6730 * src/debug.h: moved some code to debug.C
6732 * src/debug.C: new file. Contains code to set and show debug
6735 * src/layout.C: remove 'break' after 'continue' in switch
6736 statements, since these cannot be reached.
6738 1999-12-13 Allan Rae <rae@lyx.org>
6740 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6741 (in_word_set): hash() -> math_hash()
6743 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6745 * acconfig.h: Added a test for whether we are using exceptions in the
6746 current compilation run. If so USING_EXCEPTIONS is defined.
6748 * config.in: Check for existance of stl_string_fwd.h
6749 * src/LString.h: If compiling --with-included-string and SGI's
6750 STL version 3.2 is present (see above test) we need to block their
6751 forward declaration of string and supply a __get_c_string().
6752 However, it turns out this is only necessary if compiling with
6753 exceptions enabled so I've a bit more to add yet.
6755 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6756 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6757 src/support/LRegex.h, src/undo.h:
6758 Shuffle the order of the included files a little to ensure that
6759 LString.h gets included before anything that includes stl_string_fwd.h
6761 * src/support/lyxstring.C: We need to #include LString.h instead of
6762 lyxstring.h to get the necessary definition of __get_c_string.
6763 (__get_c_string): New function. This is defined static just like SGI's
6764 although why they need to do this I'm not sure. Perhaps it should be
6765 in lstrings.C instead.
6767 * lib/templates/IEEEtran.lyx: New template file.
6769 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6771 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6772 * intl/Makefile.in (MKINSTALLDIRS): ditto
6774 * src/LyXAction.C (init): changed to hold the LFUN data in a
6775 automatic array in stead of in callso to newFunc, this speeds up
6776 compilation a lot. Also all the memory used by the array is
6777 returned when the init is completed.
6779 * a lot of files: compiled with -Wold-style-cast, changed most of
6780 the reported offenders to C++ style casts. Did not change the
6781 offenders in C files.
6783 * src/trans.h (Match): change argument type to unsigned int.
6785 * src/support/DebugStream.C: fix some types on the streambufs so
6786 that it works on a conforming implementation.
6788 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6790 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6792 * src/support/lyxstring.C: remove the inline added earlier since
6793 they cause a bunch of unsatisfied symbols when linking with dec
6794 cxx. Cxx likes to have the body of inlines at the place where they
6797 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6798 accessing negative bounds in array. This fixes the crash when
6799 inserting accented characters.
6800 * src/trans.h (Match): ditto
6802 * src/buffer.C (Dispatch): since this is a void, it should not try
6803 to return anything...
6805 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6807 * src/buffer.h: removed the two friends from Buffer. Some changes
6808 because of this. Buffer::getFileName and Buffer::setFileName
6809 renamed to Buffer::fileName() and Buffer::fileName(...).
6811 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6814 and Buffer::update(short) to BufferView. This move is currently
6815 controlled by a define MOVE_TEXT, this will be removed when all
6816 shows to be ok. This move paves the way for better separation
6817 between buffer contents and buffer view. One side effect is that
6818 the BufferView needs a rebreak when swiching buffers, if we want
6819 to avoid this we can add a cache that holds pointers to LyXText's
6820 that is not currently in use.
6822 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6825 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6827 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6829 * lyx_main.C: new command line option -x (or --execute) and
6830 -e (or --export). Now direct conversion from .lyx to .tex
6831 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6832 Unfortunately, X is still needed and the GUI pops up during the
6835 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6837 * src/Spacing.C: add a using directive to bring stream stuff into
6839 * src/paragraph.C: ditto
6840 * src/buffer.C: ditto
6842 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6843 from Lars' announcement).
6845 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6846 example files from Tino Meinen.
6848 1999-12-06 Allan Rae <rae@lyx.org>
6850 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6852 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6854 * src/support/lyxstring.C: added a lot of inline for no good
6857 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6858 latexWriteEndChanges, they were not used.
6860 * src/layout.h (operator<<): output operator for PageSides
6862 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6864 * some example files: loaded in LyX 1.0.4 and saved again to update
6865 certain constructs (table format)
6867 * a lot of files: did the change to use fstream/iostream for all
6868 writing of files. Done with a close look at Andre Poenitz's patch.
6870 * some files: whitespace changes.
6872 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6874 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6875 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6876 architecture, we provide our own. It is used unconditionnally, but
6877 I do not think this is a performance problem. Thanks to Angus
6878 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6879 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6881 (GetInset): use my_memcpy.
6885 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6886 it is easier to understand, but it uses less TeX-only constructs now.
6888 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6889 elements contain spaces
6891 * lib/configure: regenerated
6893 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6894 elements contain spaces; display the list of programs that are
6897 * autogen.sh: make sure lib/configure is executable
6899 * lib/examples/*: rename the tutorial examples to begin with the
6900 two-letters language code.
6902 * src/lyxfunc.C (getStatus): do not query current font if no
6905 * src/lyx_cb.C (RunScript): use QuoteName
6906 (MenuRunDvips): ditto
6907 (PrintApplyCB): ditto
6909 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6910 around argument, so that it works well with the current shell.
6911 Does not work properly with OS/2 shells currently.
6913 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6914 * src/LyXSendto.C (SendtoApplyCB): ditto
6915 * src/lyxfunc.C (Dispatch): ditto
6916 * src/buffer.C (runLaTeX): ditto
6917 (runLiterate): ditto
6918 (buildProgram): ditto
6920 * src/lyx_cb.C (RunScript): ditto
6921 (MenuMakeLaTeX): ditto
6923 * src/buffer.h (getLatexName): new method
6925 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6927 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6929 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6930 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6931 (create_math_panel): ditto
6933 * src/lyxfunc.C (getStatus): re-activate the code which gets
6934 current font and cursor; add test for export to html.
6936 * src/lyxrc.C (read): remove unreachable break statements; add a
6939 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6941 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6944 introduced by faulty regex.
6945 * src/buffer.C: ditto
6946 * src/lastfiles.C: ditto
6947 * src/paragraph.C: ditto
6948 * src/table.C: ditto
6949 * src/vspace.C: ditto
6950 * src/insets/figinset.C: ditto
6951 Note: most of these is absolutely harmless, except the one in
6952 src/mathed formula.C.
6954 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6956 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6957 operation, yielding correct results for the reLyX command.
6959 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6961 * src/support/filetools.C (ExpandPath): removed an over eager
6963 (ReplaceEnvironmentPath): ditto
6965 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6966 shows that we are doing something fishy in our code...
6970 * src/lyxrc.C (read): use a double switch trick to get more help
6971 from the compiler. (the same trick is used in layout.C)
6972 (write): new function. opens a ofstream and pass that to output
6973 (output): new function, takes a ostream and writes the lyxrc
6974 elemts to it. uses a dummy switch to make sure no elements are
6977 * src/lyxlex.h: added a struct pushpophelper for use in functions
6978 with more than one exit point.
6980 * src/lyxlex.[Ch] (GetInteger): made it const
6984 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6986 * src/layout.[hC] : LayoutTags splitted into several enums, new
6987 methods created, better error handling cleaner use of lyxlex. Read
6990 * src/bmtable.[Ch]: change some member prototypes because of the
6991 image const changes.
6993 * commandtags.h, src/LyXAction.C (init): new function:
6994 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6995 This file is not read automatically but you can add \input
6996 preferences to your lyxrc if you want to. We need to discuss how
6999 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7000 in .aux, also remove .bib and .bst files from dependencies when
7003 * src/BufferView.C, src/LyXView.C: add const_cast several places
7004 because of changes to images.
7006 * lib/images/*: same change as for images/*
7008 * lib/lyxrc.example: Default for accept_compound is false not no.
7010 * images/*: changed to be const, however I have som misgivings
7011 about this change so it might be changed back.
7013 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * lib/configure, po/POTFILES.in: regenerated
7017 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7019 * config/lib_configure.m4: removed
7021 * lib/configure.m4: new file (was config/lib_configure.m4)
7023 * configure.in: do not test for rtti, since we do not use it.
7025 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7027 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7028 doubling of allocated space scheme. This makes it faster for large
7029 strings end to use less memory for small strings. xtra rememoved.
7031 * src/insets/figinset.C (waitalarm): commented out.
7032 (GhostscriptMsg): use static_cast
7033 (GhostscriptMsg): use new instead of malloc to allocate memory for
7034 cmap. also delete the memory after use.
7036 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7038 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7039 for changes in bibtex database or style.
7040 (runBibTeX): remove all .bib and .bst files from dep before we
7042 (run): use scanAuc in when dep file already exist.
7044 * src/DepTable.C (remove_files_with_extension): new method
7047 * src/DepTable.[Ch]: made many of the methods const.
7049 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7051 * src/bufferparams.C: make sure that the default textclass is
7052 "article". It used to be the first one by description order, but
7053 now the first one is "docbook".
7055 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7056 string; call Debug::value.
7057 (easyParse): pass complete argument to setDebuggingLevel().
7059 * src/debug.h (value): fix the code that parses debug levels.
7061 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7064 * src/LyXAction.C: use Debug::ACTION as debug channel.
7066 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7068 * NEWS: updated for the future 1.1.3 release.
7070 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7071 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7072 it should. This is of course a controversial change (since many
7073 people will find that their lyx workscreen is suddenly full of
7074 red), but done for the sake of correctness.
7076 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7077 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7079 * src/insets/inseterror.h, src/insets/inseturl.h,
7080 src/insets/insetinfo.h, src/insets/figinset.h,
7081 src/mathed/formulamacro.h, src/mathed/math_macro.h
7082 (EditMessage): add a missing const and add _() to make sure that
7085 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7086 src/insets/insetbib.C, src/support/filetools.C: add `using'
7089 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7090 doing 'Insert index of last word' at the beginning of a paragraph.
7092 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7094 * several files: white-space changes.
7096 * src/mathed/formula.C: removed IsAlpha and IsDigit
7098 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7099 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7102 * src/insets/figinset.C (GetPSSizes): don't break when
7103 "EndComments" is seen. But break when a boundingbox is read.
7105 * all classes inherited from Inset: return value of Clone
7106 changed back to Inset *.
7108 * all classes inherited form MathInset: return value of Clone
7109 changed back to MathedInset *.
7111 * src/insets/figinset.C (runqueue): use a ofstream to output the
7112 gs/ps file. Might need some setpresicion or setw. However I can
7113 see no problem with the current code.
7114 (runqueue): use sleep instead of the alarm/signal code. I just
7115 can't see the difference.
7117 * src/paragraph.C (LyXParagraph): reserve space in the new
7118 paragraph and resize the inserted paragraph to just fit.
7120 * src/lyxfunc.h (operator|=): added operator for func_status.
7122 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7123 check for readable file.
7125 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7126 check for readable file.
7127 (MenuMakeLinuxDoc): ditto
7128 (MenuMakeDocBook): ditto
7129 (MenuMakeAscii): ditto
7130 (InsertAsciiFile): split the test for openable and readable
7132 * src/bmtable.C (draw_bitmaptable): use
7133 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7135 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7136 findtexfile from LaTeX to filetools.
7138 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7139 instead of FilePtr. Needs to be verified by a literate user.
7141 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7143 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7144 (EditMessage): likewise.
7146 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7147 respectively as \textasciitilde and \textasciicircum.
7149 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7151 * src/support/lyxstring.h: made the methods that take iterators
7154 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7155 (regexMatch): made is use the real regex class.
7157 * src/support/Makefile.am: changed to use libtool
7159 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7161 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7163 (MathIsInset ++): changed several macros to be inline functions
7166 * src/mathed/Makefile.am: changed to use libtool
7168 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7170 * src/insets/inset* : Clone changed to const and return type is
7171 the true insettype not just Inset*.
7173 * src/insets/Makefile.am: changed to use libtool
7175 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7177 * src/undo.[Ch] : added empty() and changed some of the method
7180 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7182 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7183 setID use block<> for the bullets array, added const several places.
7185 * src/lyxfunc.C (getStatus): new function
7187 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7188 LyXAction, added const to several funtions.
7190 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7191 a std::map, and to store the dir items in a vector.
7193 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7196 * src/LyXView.[Ch] + other files : changed currentView to view.
7198 * src/LyXAction.[Ch] : ported from the old devel branch.
7200 * src/.cvsignore: added .libs and a.out
7202 * configure.in : changes to use libtool.
7204 * acinclude.m4 : inserted libtool.m4
7206 * .cvsignore: added libtool
7208 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7210 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7211 file name in insets and mathed directories (otherwise the
7212 dependency is not taken in account under cygwin).
7214 * src/text2.C (InsertString[AB]): make sure that we do not try to
7215 read characters past the string length.
7217 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7219 * lib/doc/LaTeXConfig.lyx.in,
7220 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7222 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7223 file saying who created them and when this heppened; this is
7224 useless and annoys tools like cvs.
7226 * lib/layouts/g-brief-{en,de}.layout,
7227 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7228 from Thomas Hartkens <thomas@hartkens.de>.
7230 * src/{insets,mathed}/Makefile.am: do not declare an empty
7231 LDFLAGS, so that it can be set at configure time (useful on Irix
7234 * lib/reLyX/configure.in: make sure that the prefix is set
7235 correctly in LYX_DIR.
7237 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7239 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7240 be used by 'command-sequence' this allows to bind a key to a
7241 sequence of LyX-commands
7242 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7244 * src/LyXAction.C: add "command-sequence"
7246 * src/LyXFunction.C: handling of "command-sequence"
7248 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7249 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7251 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7253 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7255 * src/buffer.C (writeFile): Do not output a comment giving user
7256 and date at the beginning of a .lyx file. This is useless and
7257 annoys cvs anyway; update version number to 1.1.
7259 * src/Makefile.am (LYX_DIR): add this definition, so that a
7260 default path is hardcoded in LyX.
7262 * configure.in: Use LYX_GNU_GETTEXT.
7264 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7265 AM_GNU_GETTEXT with a bug fixed.
7267 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7269 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7271 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7272 which is used to point to LyX data is now LYX_DIR_11x.
7274 * lyx.man: convert to a unix text file; small updates.
7276 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7278 * src/support/LSubstring.[Ch]: made the second arg of most of the
7279 constructors be a const reference.
7281 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7284 * src/support/lyxstring.[Ch] (swap): added missing member function
7285 and specialization of swap(str, str);
7287 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7289 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7290 trace of the old one.
7292 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7293 put the member definitions in undo.C.
7295 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7296 NEW_TEXT and have now only code that was included when this was
7299 * src/intl.C (LCombo): use static_cast
7301 (DispatchCallback): ditto
7303 * src/definitions.h: removed whole file
7305 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7307 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7308 parsing and stores in a std:map. a regex defines the file format.
7309 removed unneeded members.
7311 * src/bufferparams.h: added several enums from definitions.h here.
7312 Removed unsused destructor. Changed some types to use proper enum
7313 types. use block to have the temp_bullets and user_defined_bullets
7314 and to make the whole class assignable.
7316 * src/bufferparams.C (Copy): removed this functions, use a default
7319 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7322 * src/buffer.C (readLyXformat2): commend out all that have with
7323 oldpapersize to do. also comment out all that hve to do with
7324 insetlatex and insetlatexdel.
7325 (setOldPaperStuff): commented out
7327 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7329 * src/LyXAction.C: remove use of inset-latex-insert
7331 * src/mathed/math_panel.C (button_cb): use static_cast
7333 * src/insets/Makefile.am (insets_o_SOURCES): removed
7336 * src/support/lyxstring.C (helper): use the unsigned long
7337 specifier, UL, instead of a static_cast.
7339 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7341 * src/support/block.h: new file. to be used as a c-style array in
7342 classes, so that the class can be assignable.
7344 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7346 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7347 NULL, make sure to return an empty string (it is not possible to
7348 set a string to NULL).
7350 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7352 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7354 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7356 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7357 link line, so that Irix users (for example) can set it explicitely to
7360 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7361 it can be overidden at make time (static or dynamic link, for
7364 * src/vc-backend.C, src/LaTeXFeatures.h,
7365 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7366 statements to bring templates to global namespace.
7368 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7370 * src/support/lyxstring.C (operator[] const): make it standard
7373 * src/minibuffer.C (Init): changed to reflect that more
7374 information is given from the lyxvc and need not be provided here.
7376 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7378 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7380 * src/LyXView.C (UpdateTimerCB): use static_cast
7381 (KeyPressMask_raw_callback): ditto
7383 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7384 buffer_, a lot of changes because of this. currentBuffer() ->
7385 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7386 also changes to other files because of this.
7388 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7390 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7391 have no support for RCS and partial support for CVS, will be
7394 * src/insets/ several files: changes because of function name
7395 changes in Bufferview and LyXView.
7397 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7399 * src/support/LSubstring.[Ch]: new files. These implement a
7400 Substring that can be very convenient to use. i.e. is this
7402 string a = "Mary had a little sheep";
7403 Substring(a, "sheep") = "lamb";
7404 a is now "Mary has a little lamb".
7406 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7407 out patterns and subpatterns of strings. It is used by LSubstring
7408 and also by vc-backend.C
7410 * src/support/lyxstring.C: went over all the assertions used and
7411 tried to correct the wrong ones and flag which of them is required
7412 by the standard. some bugs found because of this. Also removed a
7413 couple of assertions.
7415 * src/support/Makefile.am (libsupport_a_SOURCES): added
7416 LSubstring.[Ch] and LRegex.[Ch]
7418 * src/support/FileInfo.h: have struct stat buf as an object and
7419 not a pointer to one, some changes because of this.
7421 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7422 information in layout when adding the layouts preamble to the
7425 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7428 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7429 because of bug in OS/2.
7431 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7433 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7434 \verbatim@font instead of \ttfamily, so that it can be redefined.
7436 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7437 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7438 src/layout.h, src/text2.C: add 'using' directive to bring the
7439 STL templates we need from the std:: namespace to the global one.
7440 Needed by DEC cxx in strict ansi mode.
7442 * src/support/LIstream.h,src/support/LOstream.h,
7443 src/support/lyxstring.h,src/table.h,
7444 src/lyxlookup.h: do not include <config.h> in header
7445 files. This should be done in the .C files only.
7447 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7451 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7454 from Kayvan to fix the tth invokation.
7456 * development/lyx.spec.in: updates from Kayvan to reflect the
7457 changes of file names.
7459 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7461 * src/text2.C (InsertStringB): use std::copy
7462 (InsertStringA): use std::copy
7464 * src/bufferlist.C: use a vector to store the buffers in. This is
7465 an internal change and should not affect any other thing.
7467 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7470 * src/text.C (Fill): fix potential bug, one off bug.
7472 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7474 * src/Makefile.am (lyx_main.o): add more files it depends on.
7476 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7478 * src/support/lyxstring.C: use size_t for the reference count,
7479 size, reserved memory and xtra.
7480 (internal_compare): new private member function. Now the compare
7481 functions should work for std::strings that have embedded '\0'
7483 (compare): all compare functions rewritten to use
7486 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7488 * src/support/lyxstring.C (compare): pass c_str()
7489 (compare): pass c_str
7490 (compare): pass c_str
7492 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7494 * src/support/DebugStream.C: <config.h> was not included correctly.
7496 * lib/configure: forgot to re-generate it :( I'll make this file
7497 auto generated soon.
7499 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7501 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7504 * src/support/lyxstring.C: some changes from length() to rep->sz.
7505 avoids a function call.
7507 * src/support/filetools.C (SpaceLess): yet another version of the
7508 algorithm...now per Jean-Marc's suggestions.
7510 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7512 * src/layout.C (less_textclass_desc): functor for use in sorting
7514 (LyXTextClass::Read): sort the textclasses after reading.
7516 * src/support/filetools.C (SpaceLess): new version of the
7517 SpaceLess functions. What problems does this one give? Please
7520 * images/banner_bw.xbm: made the arrays unsigned char *
7522 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7524 * src/support/lyxstring.C (find): remove bogus assertion in the
7525 two versions of find where this has not been done yet.
7527 * src/support/lyxlib.h: add missing int return type to
7530 * src/menus.C (ShowFileMenu): disable exporting to html if no
7531 html export command is present.
7533 * config/lib_configure.m4: add a test for an HTML converter. The
7534 programs checked for are, in this order: tth, latex2html and
7537 * lib/configure: generated from config/lib_configure.m4.
7539 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7540 html converter. The parameters are now passed through $$FName and
7541 $$OutName, instead of standard input/output.
7543 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7545 * lib/lyxrc.example: update description of \html_command.
7546 add "quotes" around \screen_font_xxx font setting examples to help
7547 people who use fonts with spaces in their names.
7549 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7551 * Distribution files: updates for v1.1.2
7553 * src/support/lyxstring.C (find): remove bogus assert and return
7554 npos for the same condition.
7556 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7558 * added patch for OS/2 from SMiyata.
7560 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7562 * src/text2.C (CutSelection): make space_wrapped a bool
7563 (CutSelection): dont declare int i until we have to.
7564 (alphaCounter): return a char const *.
7566 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7568 * src/support/syscall.C (Systemcalls::kill):
7569 src/support/filetools.C (PutEnv, PutEnvPath):
7570 src/lyx_cb.C (addNewlineAndDepth):
7571 src/FontInfo.C (FontInfo::resize): condition some #warning
7572 directives with WITH_WARNINGS.
7575 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * src/layout.[Ch] + several files: access to class variables
7578 limited and made accessor functions instead a lot of code changed
7579 becuase of this. Also instead of returning pointers often a const
7580 reference is returned instead.
7582 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7584 * src/Makefile.am (dist-hook): added used to remove the CVS from
7585 cheaders upon creating a dist
7586 (EXTRA_DIST): added cheaders
7588 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7589 a character not as a small integer.
7591 * src/support/lyxstring.C (find): removed Assert and added i >=
7592 rep->sz to the first if.
7594 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7596 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7597 src/LyXView.C src/buffer.C src/bufferparams.C
7598 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7599 src/text2.C src/insets/insetinclude.C:
7600 lyxlayout renamed to textclasslist.
7602 * src/layout.C: some lyxerr changes.
7604 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7605 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7606 (LyXLayoutList): removed all traces of this class.
7607 (LyXTextClass::Read): rewrote LT_STYLE
7608 (LyXTextClass::hasLayout): new function
7609 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7610 both const and nonconst version.
7611 (LyXTextClass::delete_layout): new function.
7612 (LyXTextClassList::Style): bug fix. do the right thing if layout
7614 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7615 (LyXTextClassList::NameOfLayout): ditto
7616 (LyXTextClassList::Load): ditto
7618 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7620 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7622 * src/LyXAction.C (LookupFunc): added a workaround for sun
7623 compiler, on the other hand...we don't know if the current code
7624 compiles on sun at all...
7626 * src/support/filetools.C (CleanupPath): subst fix
7628 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7631 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7632 complained about this one?
7634 * src/insets/insetinclude.C (Latex): subst fix
7636 * src/insets/insetbib.C (getKeys): subst fix
7638 * src/LyXSendto.C (SendtoApplyCB): subst fix
7640 * src/lyx_main.C (init): subst fix
7642 * src/layout.C (Read): subst fix
7644 * src/lyx_sendfax_main.C (button_send): subst fix
7646 * src/buffer.C (RoffAsciiTable): subst fix
7648 * src/lyx_cb.C (MenuFax): subst fix
7649 (PrintApplyCB): subst fix
7651 1999-10-26 Juergen Vigna <jug@sad.it>
7653 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7655 (Read): Cleaned up this code so now we read only format vestion >= 5
7657 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7659 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7660 come nobody has complained about this one?
7662 * src/insets/insetinclude.C (Latex): subst fix
7664 * src/insets/insetbib.C (getKeys): subst fix
7666 * src/lyx_main.C (init): subst fix
7668 * src/layout.C (Read): subst fix
7670 * src/buffer.C (RoffAsciiTable): subst fix
7672 * src/lyx_cb.C (MenuFax): subst fix.
7674 * src/layout.[hC] + some other files: rewrote to use
7675 std::container to store textclasses and layouts in.
7676 Simplified, removed a lot of code. Make all classes
7677 assignable. Further simplifications and review of type
7678 use still to be one.
7680 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7681 lastfiles to create the lastfiles partr of the menu.
7683 * src/lastfiles.[Ch]: rewritten to use deque to store the
7684 lastfiles in. Uses fstream for reading and writing. Simplifies
7687 * src/support/syscall.C: remove explicit cast.
7689 * src/BufferView.C (CursorToggleCB): removed code snippets that
7691 use explicat C++ style casts instead of C style casts. also use
7692 u_vdata instea of passing pointers in longs.
7694 * src/PaperLayout.C: removed code snippets that were commented out.
7696 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7698 * src/lyx_main.C: removed code snippets that wer commented out.
7700 * src/paragraph.C: removed code snippets that were commented out.
7702 * src/lyxvc.C (logClose): use static_cast
7704 (viewLog): remove explicit cast to void*
7705 (showLog): removed old commented code
7707 * src/menus.C: use static_cast instead of C style casts. use
7708 u_vdata instead of u_ldata. remove explicit cast to (long) for
7709 pointers. Removed old code that was commented out.
7711 * src/insets/inset.C: removed old commented func
7713 * src/insets/insetref.C (InsetRef): removed old code that had been
7714 commented out for a long time.
7716 (escape): removed C style cast
7718 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7720 * src/insets/insetlatex.C (Draw): removed old commented code
7721 (Read): rewritten to use string
7723 * src/insets/insetlabel.C (escape): removed C style cast
7725 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7727 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7730 * src/insets/insetinclude.h: removed a couple of stupid bools
7732 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7733 (Clone): remove C style cast
7734 (getKeys): changed list to lst because of std::list
7736 * src/insets/inseterror.C (Draw): removed som old commented code.
7738 * src/insets/insetcommand.C (Draw): removed some old commented code.
7740 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7741 commented out forever.
7742 (bibitem_cb): use static_cast instead of C style cast
7743 use of vdata changed to u_vdata.
7745 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7747 (CloseUrlCB): use static_cast instead of C style cast.
7748 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7750 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7751 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7752 (CloseInfoCB): static_cast from ob->u_vdata instead.
7753 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7756 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7757 (C_InsetError_CloseErrorCB): forward the ob parameter
7758 (CloseErrorCB): static_cast from ob->u_vdata instead.
7760 * src/vspace.h: include LString.h since we use string in this class.
7762 * src/vspace.C (lyx_advance): changed name from advance because of
7763 nameclash with stl. And since we cannot use namespaces yet...I
7764 used a lyx_ prefix instead. Expect this to change when we begin
7767 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7769 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7770 and removed now defunct constructor and deconstructor.
7772 * src/BufferView.h: have backstack as a object not as a pointer.
7773 removed initialization from constructor. added include for BackStack
7775 * development/lyx.spec.in (%build): add CFLAGS also.
7777 * src/screen.C (drawFrame): removed another warning.
7779 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7781 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7782 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7783 README and ANNOUNCE a bit for the next release. More work is
7786 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7787 unbreakable if we are in freespacing mode (LyX-Code), but not in
7790 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7792 * src/BackStack.h: fixed initialization order in constructor
7794 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7796 * acinclude.m4 (VERSION): new rules for when a version is
7797 development, added also a variable for prerelease.
7798 (warnings): we set with_warnings=yes for prereleases
7799 (lyx_opt): prereleases compile with same optimization as development
7800 (CXXFLAGS): only use pedantic if we are a development version
7802 * src/BufferView.C (restorePosition): don't do anything if the
7805 * src/BackStack.h: added member empty, use this to test if there
7806 is anything to pop...
7808 1999-10-25 Juergen Vigna <jug@sad.it>
7811 * forms/layout_forms.fd +
7812 * forms/latexoptions.fd +
7813 * lyx.fd: changed for various form resize issues
7815 * src/mathed/math_panel.C +
7816 * src/insets/inseterror.C +
7817 * src/insets/insetinfo.C +
7818 * src/insets/inseturl.C +
7819 * src/insets/inseturl.h +
7822 * src/PaperLayout.C +
7823 * src/ParagraphExtra.C +
7824 * src/TableLayout.C +
7826 * src/layout_forms.C +
7833 * src/menus.C: fixed various resize issues. So now forms can be
7834 resized savely or not be resized at all.
7836 * forms/form_url.fd +
7837 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7840 * src/insets/Makefile.am: added files form_url.[Ch]
7842 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7845 (and presumably 6.2).
7847 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7848 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7849 remaining static member callbacks.
7851 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7854 * src/support/lyxstring.h: declare struct Srep as friend of
7855 lyxstring, since DEC cxx complains otherwise.
7857 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7859 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7861 * src/LaTeX.C (run): made run_bibtex also depend on files with
7863 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7864 are put into the dependency file.
7866 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7867 the code has shown itself to work
7868 (create_ispell_pipe): removed another warning, added a comment
7871 * src/minibuffer.C (ExecutingCB): removed code that has been
7872 commented out a long time
7874 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7875 out code + a warning.
7877 * src/support/lyxstring.h: comment out the three private
7878 operators, when compiling with string ansi conforming compilers
7881 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7883 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7884 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7887 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7890 * src/mathed/math_panel.C (create_math_panel): remove explicit
7893 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7896 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7897 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7898 to XCreatePixmapFromBitmapData
7899 (fl_set_bmtable_data): change the last argument to be unsigned
7901 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7902 and bh to be unsigned int, remove explicit casts in call to
7903 XReadBitmapFileData.
7905 * images/arrows.xbm: made the arrays unsigned char *
7906 * images/varsz.xbm: ditto
7907 * images/misc.xbm: ditto
7908 * images/greek.xbm: ditto
7909 * images/dots.xbm: ditto
7910 * images/brel.xbm: ditto
7911 * images/bop.xbm: ditto
7913 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7915 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7916 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7917 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7919 (LYX_CXX_CHEADERS): added <clocale> to the test.
7921 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7923 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7925 * src/support/lyxstring.C (append): fixed something that must be a
7926 bug, rep->assign was used instead of rep->append.
7928 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7931 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7932 lyx insert double chars. Fix spotted by Kayvan.
7934 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7936 * Fixed the tth support. I messed up with the Emacs patch apply feature
7937 and omitted the changes in lyxrc.C.
7939 1999-10-22 Juergen Vigna <jug@sad.it>
7941 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7943 * src/lyx_cb.C (MenuInsertRef) +
7944 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7945 the form cannot be resized under it limits (fixes a segfault)
7947 * src/lyx.C (create_form_form_ref) +
7948 * forms/lyx.fd: Changed Gravity on name input field so that it is
7951 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7953 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7954 <ostream> and <istream>.
7956 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7957 whether <fstream> provides the latest standard features, or if we
7958 have an oldstyle library (like in egcs).
7959 (LYX_CXX_STL_STRING): fix the test.
7961 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7962 code on MODERN_STL_STREAM.
7964 * src/support/lyxstring.h: use L{I,O}stream.h.
7966 * src/support/L{I,O}stream.h: new files, designed to setup
7967 correctly streams for our use
7968 - includes the right header depending on STL capabilities
7969 - puts std::ostream and std::endl (for LOStream.h) or
7970 std::istream (LIStream.h) in toplevel namespace.
7972 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7974 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7975 was a bib file that had been changed we ensure that bibtex is run.
7976 (runBibTeX): enhanced to extract the names of the bib files and
7977 getting their absolute path and enter them into the dep file.
7978 (findtexfile): static func that is used to look for tex-files,
7979 checks for absolute patchs and tries also with kpsewhich.
7980 Alternative ways of finding the correct files are wanted. Will
7982 (do_popen): function that runs a command using popen and returns
7983 the whole output of that command in a string. Should be moved to
7986 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7987 file with extension ext has changed.
7989 * src/insets/figinset.C: added ifdef guards around the fl_free
7990 code that jug commented out. Now it is commented out when
7991 compiling with XForms == 0.89.
7993 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7994 to lyxstring.C, and only keep a forward declaration in
7995 lyxstring.h. Simplifies the header file a bit and should help a
7996 bit on compile time too. Also changes to Srep will not mandate a
7997 recompile of code just using string.
7998 (~lyxstring): definition moved here since it uses srep.
7999 (size): definition moved here since it uses srep.
8001 * src/support/lyxstring.h: removed a couple of "inline" that should
8004 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8006 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8009 1999-10-21 Juergen Vigna <jug@sad.it>
8011 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8012 set to left if I just remove the width entry (or it is empty).
8014 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8015 paragraph when having dummy paragraphs.
8017 1999-10-20 Juergen Vigna <jug@sad.it>
8019 * src/insets/figinset.C: just commented some fl_free_form calls
8020 and added warnings so that this calls should be activated later
8021 again. This avoids for now a segfault, but we have a memory leak!
8023 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8024 'const char * argument' to 'string argument', this should
8025 fix some Asserts() in lyxstring.C.
8027 * src/lyxfunc.h: Removed the function argAsString(const char *)
8028 as it is not used anymore.
8030 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8032 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8035 * src/Literate.h: some funcs moved from public to private to make
8036 interface clearer. Unneeded args removed.
8038 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8040 (scanBuildLogFile): ditto
8042 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8043 normal TeX Error. Still room for improvement.
8045 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8047 * src/buffer.C (insertErrors): changes to make the error
8048 desctription show properly.
8050 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8053 * src/support/lyxstring.C (helper): changed to use
8054 sizeof(object->rep->ref).
8055 (operator>>): changed to use a pointer instead.
8057 * src/support/lyxstring.h: changed const reference & to value_type
8058 const & lets see if that helps.
8060 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * Makefile.am (rpmdist): fixed to have non static package and
8065 * src/support/lyxstring.C: removed the compilation guards
8067 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8070 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8071 conditional compile of lyxstring.Ch
8073 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8074 stupid check, but it is a lot better than the bastring hack.
8075 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8077 * several files: changed string::erase into string::clear. Not
8080 * src/chset.C (encodeString): use a char temporary instead
8082 * src/table.C (TexEndOfCell): added tostr around
8083 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8084 (TexEndOfCell): ditto
8085 (TexEndOfCell): ditto
8086 (TexEndOfCell): ditto
8087 (DocBookEndOfCell): ditto
8088 (DocBookEndOfCell): ditto
8089 (DocBookEndOfCell): ditto
8090 (DocBookEndOfCell): ditto
8092 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8094 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8096 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8097 (MenuBuildProg): added tostr around ret
8098 (MenuRunChktex): added tostr around ret
8099 (DocumentApplyCB): added tostr around ret
8101 * src/chset.C (encodeString): added tostr around t->ic
8103 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8104 (makeLaTeXFile): added tostr around tocdepth
8105 (makeLaTeXFile): added tostr around ftcound - 1
8107 * src/insets/insetbib.C (setCounter): added tostr around counter.
8109 * src/support/lyxstring.h: added an operator+=(int) to catch more
8112 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8113 (lyxstring): We DON'T allow NULL pointers.
8115 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8117 * src/mathed/math_macro.C (MathMacroArgument::Write,
8118 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8119 when writing them out.
8121 * src/LString.C: remove, since it is not used anymore.
8123 * src/support/lyxstring.C: condition the content to
8124 USE_INCLUDED_STRING macro.
8126 * src/mathed/math_symbols.C, src/support/lstrings.C,
8127 src/support/lyxstring.C: add `using' directive to specify what
8128 we need in <algorithm>. I do not think that we need to
8129 conditionalize this, but any thought is appreciated.
8131 * many files: change all callback functions to "C" linkage
8132 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8133 strict_ansi. Those who were static are now global.
8134 The case of callbacks which are static class members is
8135 trickier, since we have to make C wrappers around them (see
8136 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8137 did not finish this yet, since it defeats the purpose of
8138 encapsulation, and I am not sure what the best route is.
8140 1999-10-19 Juergen Vigna <jug@sad.it>
8142 * src/support/lyxstring.C (lyxstring): we permit to have a null
8143 pointer as assignment value and just don't assign it.
8145 * src/vspace.C (nextToken): corrected this function substituting
8146 find_first(_not)_of with find_last_of.
8148 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8149 (TableOptCloseCB) (TableSpeCloseCB):
8150 inserted fl_set_focus call for problem with fl_hide_form() in
8153 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8155 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8158 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8160 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8161 LyXLex::next() and not eatline() to get its argument.
8163 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8165 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8166 instead, use fstreams for io of the depfile, removed unneeded
8167 functions and variables.
8169 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8170 vector instead, removed all functions and variables that is not in
8173 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8175 * src/buffer.C (insertErrors): use new interface to TeXError
8177 * Makefile.am (rpmdist): added a rpmdist target
8179 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8180 per Kayvan's instructions.
8182 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8184 * src/Makefile.am: add a definition for localedir, so that locales
8185 are found after installation (Kayvan)
8187 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * development/.cvsignore: new file.
8191 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8193 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8194 C++ compiler provides wrappers for C headers and use our alternate
8197 * configure.in: use LYX_CXX_CHEADERS.
8199 * src/cheader/: new directory, populated with cname headers from
8200 libstdc++-2.8.1. They are a bit old, but probably good enough for
8201 what we want (support compilers who lack them).
8203 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8204 from includes. It turns out is was stupid.
8206 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8208 * lib/Makefile.am (install-data-local): forgot a ';'
8209 (install-data-local): forgot a '\'
8210 (libinstalldirs): needed after all. reintroduced.
8212 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8214 * configure.in (AC_OUTPUT): added lyx.spec
8216 * development/lyx.spec: removed file
8218 * development/lyx.spec.in: new file
8220 * po/*.po: merged with lyx.pot becuase of make distcheck
8222 * lib/Makefile.am (dist-hook): added dist-hook so that
8223 documentation files will be included when doing a make
8224 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8225 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8227 more: tried to make install do the right thing, exclude CVS dirs
8230 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8231 Path would fit in more nicely.
8233 * all files that used to use pathstack: uses now Path instead.
8234 This change was a lot easier than expected.
8236 * src/support/path.h: new file
8238 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8240 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8242 * src/support/lyxstring.C (getline): Default arg was given for
8245 * Configure.cmd: removed file
8247 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8249 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8250 streams classes and types, add the proper 'using' statements when
8251 MODERN_STL is defined.
8253 * src/debug.h: move the << operator definition after the inclusion
8256 * src/support/filetools.C: include "LAssert.h", which is needed
8259 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8262 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8263 include "debug.h" to define a proper ostream.
8265 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8267 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8268 method to the SystemCall class which can kill a process, but it's
8269 not fully implemented yet.
8271 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8273 * src/support/FileInfo.h: Better documentation
8275 * src/lyxfunc.C: Added support for buffer-export html
8277 * src/menus.C: Added Export->As HTML...
8279 * lib/bind/*.bind: Added short-cut for buffer-export html
8281 * src/lyxrc.*: Added support for new \tth_command
8283 * lib/lyxrc.example: Added stuff for new \tth_command
8285 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * lib/Makefile.am (IMAGES): removed images/README
8288 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8289 installes in correct place. Check permisions is installed
8292 * src/LaTeX.C: some no-op changes moved declaration of some
8295 * src/LaTeX.h (LATEX_H): changed include guard name
8297 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8299 * lib/reLyX/Makefile.am: install noweb2lyx.
8301 * lib/Makefile.am: install configure.
8303 * lib/reLyX/configure.in: declare a config aux dir; set package
8304 name to lyx (not sure what the best solution is); generate noweb2lyx.
8306 * lib/layouts/egs.layout: fix the bibliography layout.
8308 1999-10-08 Jürgen Vigna <jug@sad.it>
8310 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8311 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8312 it returned without continuing to search the path.
8314 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8316 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8317 also fixes a bug. It is not allowed to do tricks with std::strings
8318 like: string a("hei"); &a[e]; this will not give what you
8319 think... Any reason for the complexity in this func?
8321 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8323 * Updated README and INSTALL a bit, mostly to check that my
8324 CVS rights are correctly set up.
8326 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8328 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8329 does not allow '\0' chars but lyxstring and std::string does.
8331 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8333 * autogen.sh (AUTOCONF): let the autogen script create the
8334 POTFILES.in file too. POTFILES.in should perhaps now not be
8335 included in the cvs module.
8337 * some more files changed to use C++ includes instead of C ones.
8339 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8341 (Reread): added tostr to nlink. buggy output otherwise.
8342 (Reread): added a string() around szMode when assigning to Buffer,
8343 without this I got a log of garbled info strings.
8345 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8348 * I have added several ostream & operator<<(ostream &, some_type)
8349 functions. This has been done to avoid casting and warnings when
8350 outputting enums to lyxerr. This as thus eliminated a lot of
8351 explicit casts and has made the code clearer. Among the enums
8352 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8353 mathed enums, some font enum the Debug::type enum.
8355 * src/support/lyxstring.h (clear): missing method. equivalent of
8358 * all files that contained "stderr": rewrote constructs that used
8359 stderr to use lyxerr instead. (except bmtable)
8361 * src/support/DebugStream.h (level): and the passed t with
8362 Debug::ANY to avoid spurious bits set.
8364 * src/debug.h (Debug::type value): made it accept strings of the
8367 * configure.in (Check for programs): Added a check for kpsewhich,
8368 the latex generation will use this later to better the dicovery of
8371 * src/BufferView.C (create_view): we don't need to cast this to
8372 (void*) that is done automatically.
8373 (WorkAreaButtonPress): removed some dead code.
8375 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8377 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8378 is not overwritten when translated (David Sua'rez de Lis).
8380 * lib/CREDITS: Added David Sua'rez de Lis
8382 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8384 * src/bufferparams.C (BufferParams): default input encoding is now
8387 * acinclude.m4 (cross_compiling): comment out macro
8388 LYX_GXX_STRENGTH_REDUCE.
8390 * acconfig.h: make sure that const is not defined (to empty) when
8391 we are compiling C++. Remove commented out code using SIZEOF_xx
8394 * configure.in : move the test for const and inline as late as
8395 possible so that these C tests do not interefere with C++ ones.
8396 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8397 has not been proven.
8399 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8401 * src/table.C (getDocBookAlign): remove bad default value for
8404 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8406 (ShowFileMenu2): ditto.
8408 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8411 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8413 * Most files: finished the change from the old error code to use
8414 DebugStream for all lyxerr debugging. Only minor changes remain
8415 (e.g. the setting of debug levels using strings instead of number)
8417 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8419 * src/layout.C (Add): Changed to use compare_no_case instead of
8422 * src/FontInfo.C: changed loop variable type too string::size_type.
8424 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8426 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8427 set ETAGS_ARGS to --c++
8429 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/table.C (DocBookEndOfCell): commented out two unused variables
8433 * src/paragraph.C: commented out four unused variables.
8435 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8436 insed a if clause with type string::size_type.
8438 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8441 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8443 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8444 variable, also changed loop to go from 0 to lenght + 1, instead of
8445 -1 to length. This should be correct.
8447 * src/LaTeX.C (scanError): use string::size_type as loop variable
8450 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8451 (l.896) since y_tmp and row was not used anyway.
8453 * src/insets/insetref.C (escape): use string::size_type as loop
8456 * src/insets/insetquotes.C (Width): use string::size_type as loop
8458 (Draw): use string::size_type as loop variable type.
8460 * src/insets/insetlatexaccent.C (checkContents): use
8461 string::size_type as loop variable type.
8463 * src/insets/insetlabel.C (escape): use string::size_type as loop
8466 * src/insets/insetinfo.C: added an extern for current_view.
8468 * src/insets/insetcommand.C (scanCommand): use string::size_type
8469 as loop variable type.
8471 * most files: removed the RCS tags. With them we had to recompile
8472 a lot of files after a simple cvs commit. Also we have never used
8473 them for anything meaningful.
8475 * most files: tags-query-replace NULL 0. As adviced several plases
8476 we now use "0" instead of "NULL" in our code.
8478 * src/support/filetools.C (SpaceLess): use string::size_type as
8481 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8483 * src/paragraph.C: fixed up some more string stuff.
8485 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/support/filetools.h: make modestr a std::string.
8489 * src/filetools.C (GetEnv): made ch really const.
8491 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8492 made code that used these use max/min from <algorithm> instead.
8494 * changed several c library include files to their equivalent c++
8495 library include files. All is not changed yet.
8497 * created a support subdir in src, put lyxstring and lstrings
8498 there + the extra files atexit, fileblock, strerror. Created
8499 Makefile.am. edited configure.in and src/Makefile.am to use this
8500 new subdir. More files moved to support.
8502 * imported som of the functions from repository lyx, filetools
8504 * ran tags-query-replace on LString -> string, corrected the bogus
8505 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8506 is still some errors in there. This is errors where too much or
8507 too litle get deleted from strings (string::erase, string::substr,
8508 string::replace), there can also be some off by one errors, or
8509 just plain wrong use of functions from lstrings. Viewing of quotes
8512 * LyX is now running fairly well with string, but there are
8513 certainly some bugs yet (see above) also string is quite different
8514 from LString among others in that it does not allow null pointers
8515 passed in and will abort if it gets any.
8517 * Added the revtex4 files I forgot when setting up the repository.
8519 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8521 * All over: Tried to clean everything up so that only the files
8522 that we really need are included in the cvs repository.
8523 * Switched to use automake.
8524 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8525 * Install has not been checked.
8527 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8529 * po/pt.po: Three errors:
8530 l.533 and l.538 format specification error
8531 l. 402 duplicate entry, I just deleted it.