1 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/mathed/math_panel.C (deco_cb): check the decoration index is
6 * src/frontends/xforms/FormPreferences.C (feedback): apply
7 formatting to the translated string, not to the original one.
10 * src/gettext.C (_): translate empty string with empty string.
12 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
17 * UPGRADING: mention that tabular format has been changed.
19 2001-01-03 Juergen Vigna <jug@sad.it>
21 * src/insets/insettabular.C (InsetButtonPress): look for button==2
22 and do Clipboard Paste!
24 * src/insets/insettext.C (SetText): added function.
26 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
27 new LFUN_PASTESELECTION.
29 * src/insets/insettext.C (draw): don't clear if top_x changes.
31 * src/insets/insettabular.C (draw): clear only if the inset didn't
32 change in the draw routine.
34 * src/insets/insettext.C (width): make the width dependant on the
37 * src/text.C (draw): comment out the UpdateInset call.
39 * src/screen.C (DrawOneRow):
40 (DrawFromTo): check for bv->text->status not text->status.
42 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
43 dimensions of ascent-descent for the whole row.
45 * src/insets/insettext.C (draw): check also for need_update == INIT.
47 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
49 * Makefile.am (EXTRA_DIST): add autogen.sh
51 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
53 * development/OS2/quick_fix.patch:
54 * lib/configure.cmd: update OS/2 support files.
56 2001-01-02 Juergen Vigna <jug@sad.it>
58 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
60 * src/tabular.C (TeXTopHLine):
61 (TeXBottomHLine): fixed Lars new code.
63 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
65 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
66 from this function and added a BufferView * parameter.
68 * src/mathed/math_symbols.C (math_insert_symbol): ditto
70 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
72 * src/version.h: set to pre3
74 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
76 * src/Makefile.am (lyx_SOURCES): added Floating.C
78 * src/Floating.h: moved all the inlines to Floating.C
80 * src/Floating.C: new file
82 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
84 * src/frontends/xforms/FormPreferences.C (feedback): fix
85 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
87 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
92 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
94 * src/mathed/math_inset.h: move LString.h to be included first
96 * src/insets/insetfloat.C: adjust for change in private variable names
98 * src/frontends/xforms/xform_helpers.h : don't include config.h
100 * src/frontends/xforms/xform_helpers.C: adjust the order of
101 includes, some whitespace changes.
103 * src/trans.C (Load): constify filename and res
105 * src/text2.C (SetCounter): call Floating::name()
107 * src/screen.C: change to not use owner from WorkArea, but from
110 * src/lyxfunc.C: adjust because of changes in Intl.
112 * src/intl.h: make trans a object instead of pointer, inlucd
113 trans_mgr.h in this file.
114 (getTrans): return a reference to TransManager
116 * src/intl.C: don't include trans_mgr.h here
117 modify calls to trans to work on object instead of on pointer
119 * src/WorkArea.h: add using for Signal1
120 comment out forward decl of BufferView.
122 remove class variable owner_ and getter method for this.
124 * src/WorkArea.C: don't include BufferView.h
125 (WorkArea): change to not take a BufferView.h, use signals
127 (scroll_cb): emit signal
129 * src/LaTeXFeatures.C: include Floatlist.h
130 (getPackages): only load float.sty when needed
131 (getMacros): prepare for outputting the correct code to preamble.
133 * src/Floating.h: make all variables private + rename to var_.
134 (Floating): default ctor
135 (Floating): complex ctor to set a complete Floating
141 * src/FloatList.C (FloatList): use Floating's constructor
144 (newFloat): call type()
145 (defaultPlacement): call placement()
146 (operator): new operator
148 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
149 (scrollUp): call pimpl's scrollCB
151 (pasteClipboard): constify clip
153 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
154 (insertErrors): constify desctext, errortext, msgtxt and errorrow
155 (open_new_inset): delete some commented code.
157 * src/BufferView.[Ch] (enterView): comment out
160 (workAreaMotionNotify): ditto
161 (workAreaButtonPress): ditto
164 (workAreaButtonRelease): ditto
165 (workAreaExpose): ditto
167 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
168 to compile with cvs gcc (2.97).
170 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
172 * lib/ui/default.ui: menu structure cleanup.
174 * lib/languages: add description of entries.
176 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
178 * src/insets/ExternalTemplate.C (readTemplates): change debug
180 (readTemplate): use lyxlex.printError to report read errors.
183 * src/insets/insetexternal.C (Read): suppress debug message when
186 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
188 * src/insets/insetinclude.C (Ascii): New method. Currently
189 supports only verbatim input.
191 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
193 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
195 2000-12-22 Juergen Vigna <jug@sad.it>
197 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
198 have a selection and button == 3.
199 (UpdateLocal): if what == INIT clear selection if existent!
200 (InsetButtonPress): don't activate the cell inset on button==3
202 (LocalDispatch): move curor up/down if exiting an inset which this
205 2000-12-20 Juergen Vigna <jug@sad.it>
207 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
208 calling for the math-panel (do not unlock the math-inset if locked)!
210 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
211 text-insets (with x-offset).
213 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
214 alignment of multicolumn-cells.
216 2000-12-19 Juergen Vigna <jug@sad.it>
218 * src/lyxfunc.C (Dispatch):
219 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
222 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
224 * src/WorkArea.C (work_area_handler): simplify the key/keysym
225 handling for XForms 0.89, this might have rendered some cases
226 unusable. I have at least deadkeys, accent-xxx and KP_x working.
227 Please report proplems.
229 * src/lyxfunc.C (processKeySym): make the self-insert handling
232 2000-12-18 Baruch Even <baruch.even@writeme.com>
234 * src/LaTeX.C (deplog): fix spelling errors
235 * src/text2.C (CutSelection): ditto
236 * src/lyxfunc.C (Dispatch): ditto
238 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
240 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
242 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
243 and h_align in default init.
244 adjust calls to MathedRowSt
246 * src/mathed/math_iter.C: adjust calls to MathedRowSt
247 * src/mathed/math_iter.h (getAD): ditto
249 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
250 methods setBaseline, ascent, descent
251 (class MathMatrixInset): remove method GetAlign, change h_align
254 * src/lyxfunc.C (processKeySym): discover the correct argument if
255 the action is LFUN_SELFINSERT
257 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
259 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
262 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
264 * src/support/copy.C: don't include filetools.h
266 * lib/images: revert to old banner, drop the cucumber.
268 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
270 * src/converter.C (Formats::View): Change the current directory to
271 the directory of the file.
273 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
275 * src/kbsequence.C (addkey): also clear sequence and modifiers if
278 * src/BufferView2.C (theLockingInset): return 0 if text is 0
280 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
282 * Many files: Fix RTL support for insettext.
284 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
286 * README: add mention of broken ghostscript versions, remove
287 reference to non-existent BUGS file
289 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
291 * src/support/lstrings.C (compare_no_case): small fix. When passed
292 length, should use it in the size comparison.
294 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
296 * src/insets/insetexternal.C (getScreenLabel): Return a default
297 value if the template label is empty.
299 * src/lyxlookup.C: do not condition on FL_REVISION.
302 * src/sp_form.C: fix the font size of some text entries
304 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
305 after TOC when there is no TOC.
307 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
308 bind file if it has not been done yet.
309 (read): remove local bindFile variable. Try to fix the handling of
310 RC_BIND and RC_BINDFILE.
312 * src/lyx_main.C (init): use readBindFileIfNeeded().
314 * lib/languages: Change description of german to "German (new
317 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
319 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
320 "Apply" buttons if arg is non-zero.
322 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
323 launching the popup if sufficient info is passed to
324 LFUN_CITATION_CREATE.
326 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
328 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
329 labels (disabled in 1.1.6).
331 * src/lyxrc.[Ch]: New variable label_init_length
333 * mathed/formula.C (LocalDispatch): Preserve the label when
334 changing from display math to eqnarray (however, the label
335 do not appear at the first line, as one might expects, but at the
337 (LocalDispatch): When inserting a label to a formula which already
338 have a label, the old label is used as default value.
339 Also, if the label is changed, then all references to the label
342 * src/mathed/math_iter.C (setLabel): Allow to set the label
343 even if it is empty. This is needed to allow deletion of a label
346 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
347 refernces only if the old label appears once in the document.
349 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
351 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
352 <gehlert@Rcs1.urz.tu-dresden.de>
354 * src/frontends/xforms/FormBase.C: comment out debug.h
356 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
357 code in xform_helpers instead.
358 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
360 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
361 Use N_(), rather than _() when creating strings to pass to browseFile()
362 because browseFile calls gettext() itself now.
364 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
365 display the filename correctly.
367 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
369 * src/converter.C (Move): New method. Used to move file or files
370 from temp dir to the output dir. (this fixes the bug that
371 exporting linuxdoc/docbook document to html would not move all
372 html file from temp directory).
374 * src/support/filetools.C (DirList): Fixed.
376 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
378 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
380 * src/converter.C (Add): Remove $$i when setting latex_command.
382 * src/text.C (IsBoundary): Return false when pos = 0.
384 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
386 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
388 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
390 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
391 need to empty the fields to turn off use of the geometry package!
393 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
396 (Buffer const &), not a (BufferParams const &) and so fix a crash
397 caused by using current_view before it had been initialised. Not
398 the best way to do this, but much easier than changing
399 Inset::Clone(Buffer const &) to Inset::Clone().
402 * src/tabular.C: changed call to CopyIntoMinibuffer().
404 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
406 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
408 * src/lyxfunc.C (getStatus): disable insertion of floats in a
411 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
413 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
414 changed filter for screen fonts input filter from int to float
416 * src/frontends/xforms/input_validators.c: removed.
417 * src/frontends/xforms/input_validators.C: new file. Can now call C++
418 functions from within the filter functions.
420 * src/frontends/xforms/input_validators.[Ch]
421 (fl_unsigned_float_filter): new filter function.
423 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
424 confused now! And if you think I'm going to do this in
425 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
427 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
431 * src/WorkArea.C (work_area_handler): don't handle button requests
432 if xbutton.button == 0
434 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
436 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
437 It creates a lot of interesting problems.
439 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
441 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
442 the menu exists in the current menubar before opening it.
444 * src/MenuBackend.C (hasSubmenu): new method.
446 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
447 action value by offsetting actions by a large constant (so that
448 bogs choice result will be less than this constant).
450 * lib/bind/fi_menus.bind: more cleanup to menus.
451 * lib/bind/sciword.bind: ditto.
452 * lib/bind/xemacs.bind: ditto.
453 * lib/bind/emacs.bind: ditto.
454 * lib/bind/pt_menus.bind: ditto.
455 * lib/bind/hu_menus.bind: ditto.
457 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
459 * INSTALL: update PROBLEMS section.
461 * src/lyxlookup.h: remove condition on xforms version, since we
462 should not include it if not appropriate.
464 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
466 * src/LColor.C: "latex text" -> "latex inset" (from
469 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
471 * src/frontends/kde/FormTabularCreate.C:
472 * src/frontends/kde/citationdlg.C:
473 * src/frontends/kde/copyrightdlg.C:
474 * src/frontends/kde/paradlg.C:
475 * src/frontends/kde/paraextradlg.C:
476 * src/frontends/kde/parageneraldlg.C:
477 * src/frontends/kde/printdlg.C:
478 * src/frontends/kde/refdlg.C:
479 * src/frontends/kde/tabcreatedlg.C:
480 * src/frontends/kde/tocdlg.C:
481 * src/frontends/kde/urldlg.C: add necessary headers
484 * src/frontends/kde/dlg/emptytable.C:
485 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
486 default parameters (from Angus Leeming)
488 * src/frontends/kde/dlg/moc/.cvsignore:
489 * src/frontends/kde/dlg/.cvsignore:
490 * src/frontends/kde/moc/.cvsignore: fix the library name
493 * src/frontends/kde/paradlg.C:
494 * src/frontends/kde/parageneraldlg.C:
495 * src/frontends/kde/dlg/para.dlg:
496 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
498 * src/frontends/kde/dlg/README: clarified qtarch version
500 * src/frontends/kde/dlg/Makefile.am: removed the
501 dlg rules as they created spontaneous rebuilds
502 (not a good idea as it requires qtarch)
504 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
506 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
507 fixlevel along with xforms version.
509 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
510 xforms version is strictly less than 0.89.5.
511 * src/lyx_gui.C (LyXGUI): ditto.
512 * src/LyXView.C (show): ditto.
514 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
516 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
517 movement in inset in RTL text.
518 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
519 (workAreaButtonRelease): Do not open a float when there is a selection.
521 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
523 * src/spellchecker.C (RunSpellChecker): Open all floats before
526 * src/text.C (InsertChar): Consider "," as a part of a number
527 (for LTR numbers in RTL text code).
528 (IsBoundary): Fixed (and simplified).
529 (InsertChar): Recalculate cursor boundary.
532 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
534 * src/spellchecker.C: fix figures with pspell enabled
536 * src/insets/figinset.C: workaround for gs hang xforms bug
538 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
540 * lib/bind/??_menus.bind: comment out the entries corresponding to
541 real menus. They should be eventually removed, but I'll let the
542 language maintainers do that.
544 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
546 * src/frontends/kde/parageneraldlg.C:
547 * src/frontends/kde/parageneraldlg.h: don't use
548 a derived class for SpaceAbove/Below
550 * src/frontends/kde/dlg/README: add some info
552 * src/frontends/kde/dlg/*: update data files, update
555 * src/frontends/kde/dlg/moc/Makefile.am: add
558 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
560 * configure.in: add new KDE Makefiles
561 * src/vspace.h: return GlueLength not a normal one
562 * src/support/lstrings.h:
563 * src/support/lstrings.C: add isStrUnsignedInt(),
566 * src/frontends/kde/*: big reorganisation, update
567 FormParagraph, add FormTabCreate
569 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
571 * lib/ui/default.ui: small grammatical change.
573 * src/frontends/xforms/xform_macros.h: removed.
575 * src/frontends/xforms/FormBase.C:
576 * src/frontends/xforms/FormPreferences.C:
577 * src/frontends/xforms/Makefile.am: changes associated with removing
578 xform_macros.h. Should make Lars' debugging a little easier.
580 * src/frontends/xforms/FormPreferences.C:
581 * src/frontends/xforms/FormPreferences.h:
582 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
583 longer use X11 color name database. HSV and RGB dials/sliders.
584 Please let this be the end of this!
586 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
588 * Several files: Allow compilation when the compiler doesn't
591 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
594 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
595 command line options.
597 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
599 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
600 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
603 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
605 * src/frontends/xforms/FormRef.C (updateBrowser):
606 * src/frontends/xforms/forms/form_ref.fd: try clicking on
607 different insets with the sort key active. Now apply this patch!
609 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
611 * src/frontends/xforms/FormPrint.C: set to valid()
612 when we update from the passed parameters.
614 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
616 * src/LColor.C (getFromGUIName): internationalise the comparison.
618 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
619 FormPreferences choice.
621 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
624 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
626 * src/lyxrc.C: more detail for the printer program config
629 * src/LColor.C: ert->latex text. LColor needs a big revamp
630 but will have to wait till after 1.1.6
632 * src/buffer.C: bring up a dialog if we load a document
633 with an un-installed text class, rather than just complain
636 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
638 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
639 the browser form for a combox in a tabbed folder. Bug fix courtesy of
640 Steve Lamont <spl@ncmir.ucsd.edu>.
642 * src/frontends/xforms/FormDocument.C (build):
643 * src/frontends/xforms/FormPreferences.C (Language::build):
644 pass tabfolders to Combox::add() in order to use this work around.
646 * src/frontends/xforms/FormCitation.C (connect): remove max size
648 (update): sort list of bibliography keys.
650 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
652 No max size limitation. Same popup for new and existing insets. Fixes
653 bugs reported by Rob Lahaye.
655 * src/frontends/xforms/FormCitation.C (c-tor):
656 * src/frontends/xforms/FormCopyright.C (c-tor):
657 * src/frontends/xforms/FormError.C (c-tor):
658 * src/frontends/xforms/FormGraphics.C (c-tor):
659 * src/frontends/xforms/FormIndex.C (c-tor):
660 * src/frontends/xforms/FormRef.C (c-tor):
661 * src/frontends/xforms/FormToc.C (c-tor):
662 * src/frontends/xforms/FormUrl.C (c-tor):
663 use correct policy for ButtonController.
665 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
667 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
670 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
672 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
673 Some resizing changes.
675 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
677 * configure.in: fix typo
679 * lib/languages: add ukraninian and change no to no_NO
681 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
683 * src/bufferview_funcs.C (FontSize): use setLyXSize
685 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
687 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
688 to check for systems where mkstemp() is available but not declared
689 in headers. The new autoconf macro lyx_CHECK_DECL can be used
690 to check for declarations in headers.
692 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
694 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
696 * forms/makefile: added bibforms.fd, include_form.fd.
697 Removed lyx_sendfax.fd.
699 * src/LaTeXLog.C (ShowLatexLog):
700 * src/LyXAction.C (init):
701 * src/bufferparams.C (readLanguage): altered messages as suggested by
704 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
707 * src/credits.C: made fd_form_credits non-static, so that it can be
708 redrawn should the xforms colors be re-mapped.
709 * src/spellchecker.C ditto fd_form_spell_options.
711 * src/filedlg.[Ch] (redraw):
712 * src/intl.[Ch] (redraw):
713 * src/lyxfr0.[Ch] (redraw):
714 * src/insets/figinset.[Ch] (redraw):
715 * src/insets/insetexternal.[Ch] (redraw):
716 new methods, connected to Dialogs::redrawGUI.
718 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
719 to be connected to Dialogs::redrawGUI.
721 * src/frontends/xforms/FormCitation.C (build):
722 * src/frontends/xforms/FormCopyright.C (build):
723 * src/frontends/xforms/FormError.C (build):
724 * src/frontends/xforms/FormGraphics.C (build):
725 * src/frontends/xforms/FormIndex.C (build):
726 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
727 * src/frontends/xforms/FormToc.C (build):
728 * src/frontends/xforms/FormUrl.C (build):
729 use the ButtonController correctly.
731 * src/frontends/xforms/FormCopyright.C (build):
732 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
733 the .fd file and into build().
735 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
737 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
739 * src/frontends/xforms/forms/form_citation.fd:
740 * src/frontends/xforms/forms/form_copyright.fd:
741 * src/frontends/xforms/forms/form_error.fd:
742 * src/frontends/xforms/forms/form_graphics.fd:
743 * src/frontends/xforms/forms/form_index.fd:
744 * src/frontends/xforms/forms/form_toc.fd:
745 * src/frontends/xforms/forms/form_url.fd:
746 renamed some of the objects. Named others explicitly for the first time.
747 Added Restore and Apply buttons where appropriate.
749 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
752 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
754 * src/version.h: try the pre2 again
756 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
758 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
760 * src/frontends/kde/FormParagraph.C: added using directive.
762 * src/frontends/kde/paradlg.C: added config.h and using directive.
764 * src/frontends/kde/paradlg.h: added std::qualifier.
766 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
768 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
770 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
772 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
774 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
776 * src/version.h: set back to 1.1.6cvs
778 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
780 * src/version.h: set to 1.1.6pre2
782 2000-11-20 Marko Vendelin <markov@ioc.ee>
784 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
786 * src/frontends/gnome/Makefile.am: updated list of XForms object files
788 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
790 * src/LColor.C (init):
791 * src/lyxrc.C (getDescription): changed some comments as suggested by
794 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
795 disconnect the redrawGUI signal in best-practice fashion.
797 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
798 long_opts_tab to reflect the change in name of this tabfolder, as
799 suggested by John Levon.
800 (connect, disconnect): new methods. Don't do much at present other than
801 ensuring that we can't resize the dialog. This just makes xforms go
803 (lots of methods in Colors): made void rather than bool. The idea is
804 to have an isOk() function that keeps track of whether any input is
805 genuinely invalid and should therefore block Save, Apply.
806 Easier to manipulate the counters rapidly.
807 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
808 compiler will like this code. Much cleaner way of doing things.
810 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
812 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
813 rather than simple counters, following suggestion by John Levon.
815 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
816 than engraved frame + text.
818 * src/frontends/xforms/forms/makefile: removed spurious command.
820 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
822 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
824 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
827 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
829 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
830 see what Lars has changed and what is just white space!
831 Now used X directly to ascertain the RGB color associated with the
833 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
835 Added some sort capability.
836 The X11 color name database input is only displayed if the database
837 isn't found in the standard place.
838 Got rid of struct compare_converter; it wasn't used.
839 Probably some other stuff that I've forgotten.
841 * src/frontends/xforms/FormPreferences.h: changed the names of some
842 methods in the Colors struct. Added a couple of structs to help sort
843 colors by name and by RGBColor.
845 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
846 functions into a new class RWInfo.
848 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
849 The dialog is now almost navigable using the keyboard. Unfortunately,
850 the cursor has to be inside a browser for it to be activated. There is
851 no visual feedback for the key shortcuts to the arrow keys (use
852 Alt-appropriate arrow key, Alt-x).
854 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
857 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
858 xform_helpers.[Ch]. See above.
860 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
862 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
864 * src/screen.C (setCursorColor): new method. Sets the color of the
866 (ShowManualCursor): call it.
867 Constify some local variables.
869 * src/LColor.[Ch] (LColor): add entry for cursor
870 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
873 2000-11-19 Juergen Vigna <jug@sad.it>
875 * src/insets/insettabular.C (draw): fixed text border redraw problem.
876 (calculate_dimensions_of_cells): try to boost up when inserting chars.
878 2000-11-15 Rob Lahaye <lahaye@postech.edu>
880 * lib/ui/default.ui: OptItem used for Fax entry
882 2000-11-17 Matej Cepl <cepl@bigfoot.com>
884 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
886 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
888 * src/vspace.C (nextToken): fix so it can handle length phrases like
889 "10mm+-20mm", "40inplus16mmminus10cm" etc.
891 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
893 * src/frontends/xforms/FormPreferences.C: constify several variables
894 (BrowserLyX): rewrite to not need the choice variable
895 (Modify): rewrite to not need the choide variable
896 (compare_converter): make operator const
898 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
899 correct the writing of \set_color
900 (getDescription): return a const string
902 * src/kbsequence.[Ch] (addkey): remove dead code
904 * src/Painter.C (text): remove some commented code
906 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
908 * src/ColorHandler.[Ch]: removed some header files from .h file.
909 Included LColor.h in .C file.
911 * src/LColor.[Ch]: made class copyable so that I could create a
912 system_lcolor instance.
914 * src/Painter.h: removed LColor.h.
916 * src/lyx_gui.C (create_forms): used AddName.
918 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
919 of user preferences/lyxrc file.
921 * src/lyxrc.C (output): output changes to lcolor.
923 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
925 Moved class xformColor to files xform_helpers.[Ch]. These files,
926 Color.[Ch], could now be moved into src if they would be useful to
929 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
930 Also moved FormPreferences::browseFile here as it can be used by any
931 xform dialog with a "Browse" button. FormGraphics is a perfect example.
933 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
934 ReadableFile): changed the FormPreferences methods a little and moved
935 them here as they'll be useful elsewhere also.
937 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
938 Removed some header files and used forward declarations instead.
940 Removed some methods as they'll be useful elsewhere (see above).
942 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
943 Can also now modify the LyX LColors. However, for reasons that I don't
944 yet understand, it appears that we can use
945 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
946 present. The problem appears to lie in ColorHandler, because I can
947 change the color using LColor.SetColor(). Similarly, when reading in a
948 preferences file with some set_color instances, I'll get a warning
949 like: Color sea green is undefined or may not be redefined
950 Bad lyxrc set_color for sea green
952 Once the buffer is loaded, however, I can happily change to this color.
954 Finally, it appears that I have to set the color of "inset frame"
955 explicitly, or it oscillates from "black" to "indian red" with each
958 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
960 * ANNOUNCE: corrected a spelling mistake.
962 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
965 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
967 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
969 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
972 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
973 match the requirements from the standard better. This is required
974 to work with gnu libstdc++-v3
976 * src/frontends/xforms/FormPreferences.C: add explict pair
977 arguments to browse calls. include support/lyxmanip.h remvoe
978 extern fmt. whitespace changes. reorder variables in
979 FormPreferences.h, to match initalizaton order.
981 * several files: constify more local variables.
983 * src/buffer.C: remove some commented functions.
985 * src/DepTable.C (remove_files_with_extension): temporary
986 work around for gcc 2.97
987 * src/filedlg.C (find): ditto
988 * src/Variables.C (set): ditto
989 * src/LyXAction.C (searchActionArg): ditto
990 (retrieveActionArg): ditto
992 * configure.in: check for mktemp too
994 * UPGRADING: prepare for 1.1.6
996 * Makefile.am (lgbtags): add backup tags for when etags are
997 different than usual.
999 * ANNOUNCE: prepare for 1.1.6
1001 * src/support/tempname.C (make_tempfile): new function, wrapper
1002 around mkstemp and mktemp. Only mkstemp has been tested.
1003 (tempName): call it.
1005 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1007 * default.ui: capitalized some menu items to improve shortcuts.
1009 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1011 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1013 * src/frontends/xforms/Dialogs.C: add "using" directive.
1015 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1017 * src/filedlg.C (Select): highlight suggested file in browser, if
1020 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1021 each tab folder is encapsulated in its own class.
1022 The Language keymaps are now chosen using a text input and a
1023 browser button, rather than a Combox.
1024 All the browser buttons are now functional, although LyXFileDlg
1025 still needs to be modified to make it straighhtforward to return a
1026 directory if that is what is desired.
1028 * src/frontends/xforms/forms/form_preferences.fd: use text input
1029 and browse button to input the Language keymaps. Add a few
1030 callbacks for the browse buttons.
1032 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1034 * src/support/tempname.C (tempName): small changes to make it
1035 safer. remove the '.' before XXXXXX
1037 * src/support/filetools.C (TmpFileName): remove func
1040 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1041 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1042 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1043 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1045 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1046 (FormCommand): ditto
1048 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1051 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1052 for bp (this fixes a reproducible hard crash)
1054 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1057 * src/frontends/xforms/FormBase.h: make bp_ private
1058 (FormBaseBI): remove default for bp
1061 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1064 * src/frontends/xforms/Color.C (RGBColor): made several vars
1065 const, changed initialization of j to allow it to be const
1068 * several files: added const to local variables.
1070 * src/lyx_cb.C: removed several function prototypes and moved them
1074 (UpdateLayoutPreamble):
1076 (MenuInsertLabel): add BufferView as arguemnt
1077 (LayoutsCB): make tmp const
1079 * src/layout_forms.h: regenerated
1081 * src/debug.C: add Debug::FILES
1082 (showLevel) (showTags): translate the desc
1084 * src/debug.h: add FILES as debug target
1086 * src/bufferlist.C: use current_view as an interim measure becuase
1087 of added arguments to MenuWrite and MenuWriteAs
1089 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1091 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1093 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1094 libstdc++ is compiled with.
1096 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1098 * lib/layouts/docbook-book.layout
1099 * lib/layouts/docbook.layout
1100 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1101 those paragraphs are expresse as SGML comments <!-- -->.
1103 * src/LaTeXFeatures.h
1104 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1105 parameter, this allows to express all the include files as relative
1106 paths to the master buffer. The verbatim insert works as the other
1109 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1111 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1113 (MakeDocBookFile): top_element is always written. Some clean up, as
1114 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1116 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1117 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1118 a reference is written instead of the name.
1119 (Validate): use the relative path for the filename.
1121 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1124 * src/support/filetools.h
1125 * src/support/filetools.C (IsSGMLFilename): added.
1128 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1130 * development/OS2/quick_fix.patch:
1131 * lib/configure.cmd:
1132 * README.OS2: quick update to the OS/2 port.
1134 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1136 * src/converter.C: add "using" directive.
1138 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1139 (compare_converter): add "int" as return type.
1141 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1144 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1146 * src/lyx_gui.C (create_forms): map the xform colours, should a
1147 mapping exist. Ie, call XformColor::read().
1149 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1150 and struct HSV as HSVColor.
1151 (XformColor::read, XformColor::write) : new methods that
1152 input/output any changes to the cform GUI colors.
1154 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1157 * src/frontends/xforms/FormPreferences.C Lots of little changes
1158 associated with the changed name of the RGB and HSV structs. Can
1159 now save changes to xforms GUI to file. Commented out
1160 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1161 used currently anyway.
1163 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1165 * src/converter.C: A lot of changes:
1166 - It is no longer possible to choose between two or more ways to
1167 export to some format (the new code uses only the shortest path).
1168 However, it is still possible to choose between pdflatex/ps2pdf
1169 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1170 - Added several methods that makes the FormPreferences code simpler.
1171 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1173 * src/exporter.C (Export): lyxrc.use_pdf is set before
1174 makeLaTeXFile is called. This works but not very nice.
1176 * src/frontends/xforms/FormPreferences.C: The formats/converters
1177 tabs are now fully functional.
1179 * src/buffer.C (getTocList): Add numbers to the captions.
1181 * lib/lyxrc.example: Removed fax section
1183 * src/support/rename.C (rename): Delete the old file if lyx::copy
1186 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1188 * lib/ui/default.ui: minor polishing.
1190 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1192 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1195 * lib/Makefile.am (DOCINST): do not install everything in the
1196 documentation directory.
1198 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1200 * src/bufferlist.C (newFile): set the filename to the constructed
1203 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1204 constructed "newfileXX.lyx" name to the dialog
1206 * src/frontends/DialogBase.h: make update() non-abstract so
1207 KDE doesn't need to implement two update methods for every form
1209 * src/frontends/kde/Makefile.am: add missing xforms objects
1212 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1214 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1216 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1217 structs RGB and HSV. May not be the best place for these files.
1218 Perhaps move them into src ?
1220 * src/frontends/xforms/Makefile.am: added new files.
1222 * src/frontends/xforms/forms/form_preferences.fd:
1223 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1224 replaced all instances of "colour" with "color"!
1226 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1229 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1230 tab. Can now alter the colors of the xform's GUI on the fly. With
1231 the aid of a single static Signal (see below), can "Apply" these
1232 changes to all currently open dialogs. (Well, to all of the NEW
1233 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1234 subsequently opened dialogs will, of course, also have the new
1235 color scheme. Cannot yet save (or load) the choices to file, so
1236 they are lost when exiting LyX.
1238 * src/frontends/Dialogs.h:
1239 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1240 Used to trigger a redraw of any dialogs connected to it because,
1241 for example, the GUI colours have been re-mapped.
1243 * src/frontends/xforms/FormBase.[Ch]:
1244 * src/frontends/xforms/FormDocument.[Ch]:
1245 * src/frontends/xforms/FormParagraph.[Ch]:
1246 * src/frontends/xforms/FormPreferences.[Ch]:
1247 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1248 method, to be connected to Dialogs::redrawGUI. Method must be
1249 virtual, because dialogs with tabbed folders need to redraw the
1250 forms of each tab folder.
1252 * src/LyXView.C (d-tor):
1253 * src/frontends/xforms/FormBase.C (d-tor): connected
1254 Dialogs::redrawGUI signal to redraw().
1256 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1257 removed Assert, because it is identical to that in FormBase.
1259 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1261 * lib/ui/default.ui: minor polishing.
1263 2000-11-10 Juergen Vigna <jug@sad.it>
1265 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1266 (deleteLyXText): ditto
1268 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1269 selection on mouse-button-3.
1271 * src/insets/insettabular.h: new function clearSelection(), use this
1272 functions inside insettabular.C.
1274 * src/insets/insettabular.C (TabularFeatures): clear the selection
1275 on remove_row/column.
1277 * src/insets/inset.C (scroll): fixed some scroll stuff.
1279 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1281 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1283 * lib/CREDITS: add Yves Bastide
1285 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1287 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1288 check whether C library functions are in the global namespace.
1290 * configure.in: calls it.
1292 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1293 #ifndef __GLIBCPP__.
1295 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1297 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1298 iterators to prevent crash.
1300 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1302 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1304 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1305 shortcut for xforms CB to the preemptive or post-handler function.
1307 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1308 removed the HIDDEN_TIMER as it's no longer used.
1309 Various other small changes.
1311 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1312 preemptive handler to obtain feedback, rather than the post-handler.
1313 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1315 Formats tab is now complete. Converters tab is nearly so.
1317 2000-11-09 Juergen Vigna <jug@sad.it>
1319 * src/insets/insettext.C (~InsetText):
1322 (SetParagraphData): set cache.second to 0 after deleting it!
1323 (getLyXText): check if cache.second is not 0 if finding it.
1325 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1327 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1328 lyxlex to parse the rgb.txt file.
1331 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1332 replace the default '#' comment character.
1334 * src/support/tempname.C: add "using" directive
1335 * src/frontends/ButtonPolicies.C: ditto.
1337 * src/support/filetools.C (DirList): add an explicit cast to avoid
1338 a compile error (probably not the right fix)
1340 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1342 * src/support/filetools.C (DirList): implement using system functions
1344 * src/support/tempname.C: new file
1346 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1348 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1350 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1353 * src/frontends/xforms/ButtonController.C: new file
1355 * src/os2_defines.h: remove getcwd define
1357 * src/lyxvc.C: include support/lyxlib.h
1358 (showLog): use lyx::tempName
1360 * src/lyx_cb.C: comment out includes that we don't need
1361 (AutoSave): use lyx::tempName
1363 * src/filedlg.C: include support/lyxlib.h
1364 (Reread): use lyx::getcwd
1366 * src/converter.C: include support/filetools.h
1367 (add_options): change to static inline, make tail const
1368 (Add): make old_viewer const
1369 (GetAllFormats): make it a const method, use const_iterator
1370 (enable): make static inline
1371 (SplitFormat): make using_format const
1373 * src/LaTeX.C (run): use lyx::getcwd
1375 * configure.in: check for mkstemp as well
1377 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1379 * src/converter.[Ch] (GetAllCommands): new method.
1381 * src/support/filetools.[Ch] (DirList): new method.
1383 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1384 functionality to the converters tab.
1385 The formats tab is now nearly complete.
1386 The kbmap choices in Languages tab now display the contents of
1387 system_lyxdir/kbd/*.kmap in readable form.
1389 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1390 Moved some variables into the class.
1392 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1393 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1394 colour of active folder to lighter grey instead. Any takers?
1395 (form_colours): added an "Apply" button.
1396 (form_converters): added a "Flags" input field.
1397 (form_formats): added a "Shortcut" input field. Note that we can't use
1398 names such as "input_shortcut" as this buggers up the sed script stuff.
1400 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1408 * src/lyx_sendfax_main.C:
1411 * src/spellchecker.C:
1412 * src/insets/figinset.C:
1413 * src/insets/insetbib.C:
1414 * src/insets/insetexternal.C:
1415 * src/insets/insetinclude.C:
1416 * src/insets/insetinfo.C:
1417 * src/mathed/math_panel.C:
1418 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1419 all "daughter" dialogs now have identical "feel".
1421 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1423 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1424 used (and was only used in one place prior to this patch. Incorrectly!)
1426 * src/frontends/xforms/FormDocument.C: changed some instances of
1427 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1428 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1429 for options_->input_float_placement. This fixes a bug reported by
1432 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1433 functionality into d-tor.
1435 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1436 input of numerals also.
1438 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1439 fl_set_form_atclose(). Can now close dialog from window manager,
1440 fixing a bug reported by Rob Lahaye.
1442 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1444 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1445 are no longer dark. Haven't yet worked out how to lighten the colour of
1446 the active tabfolder. Any ideas anybody?
1447 Adjusted Colours tab a little.
1448 Added Shortcut field to converters tab. Note that we can't create an
1449 fdesign label like "input_shortcut" as this buggers up the sed-script
1452 * src/frontends/xforms/FormPreferences.[Ch]:
1453 (feedback): fixed crash due to to ob=0.
1454 (LanguagesXXX): the kbmap choices now contain the files
1455 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1456 be replaced by an input with a file browse button, but since the browse
1457 buttons don'y yet work, this'll do for the moment.
1458 (FormatsXXX): think that this is now nearly fully functional.
1459 Some points/questions though:
1460 1. Does "Apply" remove formats if no longer present?
1461 2. I think that the browser should list the GUI names rather than the
1463 3. Must ensure that we can't delete Formats used by an existing
1466 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1467 if this is the best way to do this.
1469 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1471 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1473 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1474 for variable assignment.
1476 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1478 * src/lib/ui/default.ui: added sub/superscripts to menu as
1479 Insert->Special characters and cleaned-up the file a bit
1481 2000-11-07 Allan Rae <rae@lyx.org>
1483 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1484 ob isn't 0 before using it. See comments in function.
1486 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1488 * src/frontends/xforms/form_*.C: regenerated
1490 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1492 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1494 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1495 compiling with gcc-2.96
1497 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1499 * src/support/lyxstring.C: add a couple "using" directives.
1501 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1502 a .c_str() here too for good measure.
1503 * src/Spacing.C (set): ditto.
1504 * src/lyxfunc.C (Dispatch): ditto.
1506 * src/insets/insettabular.C (copySelection): change .str() to
1507 .str().c_str() to fix problems with lyxstring.
1508 * src/support/filetools.C (GetFileContents): ditto.
1509 * src/buffer.C (asciiParagraph): ditto.
1510 * src/paragraph.C (String): ditto.
1512 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1513 * lib/bind/sciword.bind: ditto.
1515 * src/LyXAction.C (init): remove "symbol-insert" function, which
1516 shared LFUN_INSERT_MATH with "math-insert".
1518 * lib/configure.m4: == is not a valid operator for command test.
1520 * src/lyxrc.C: add using directive.
1522 * src/converter.h: add std:: qualifier.
1524 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1526 * src/converter.[Ch] and other files: Change the Format class to a
1527 real class, and create two instances: formats and system_format.
1529 * src/lyxrc.C (output): Output the difference between formats and
1532 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1533 (buildFormats): Insert formats into browser.
1534 (inputFormats): Made the browser and add button functional.
1535 (applyFormats): Update formats from format_vec.
1537 * src/converter.C: Changed all (*it). to it->
1538 (Format::dummy): New method.
1539 (Format::importer): New format flag.
1540 (Formats::GetAllFormats): New method.
1541 (Formats::Add): Delete format from the map if prettyname is empty.
1542 (Converter::Convert): Print an error message if moving the file fails.
1543 (Converter::GetReachableTo): New method
1545 * src/MenuBackend.[Ch]: Add support for importformats tag.
1547 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1549 * lib/configure.m4: Add word->tex and ps->fax converters.
1551 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1552 Return fax to file menu.
1556 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1558 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1561 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1564 * src/lyxfunc.C (processKeyEvent): removed
1566 * src/bufferlist.C (emergencyWrite): removed the out commented
1567 emergency write code.
1569 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1571 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1573 * many files: change formatting to be a bit more uniform for
1574 if,while,for,switch statements, remove some parantesis not needed.
1577 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1579 * config/kde.m4: make config more robust when KDEDIR is set
1581 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1583 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1584 not returned a pixmap for "math-insert".
1586 * src/LyXAction.C (init): sort the entries a bit.
1588 2000-11-03 Juergen Vigna <jug@sad.it>
1590 * src/insets/insettabular.h: added fixed number to update codes so
1591 that update is only in one direction.
1593 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1596 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1597 before call to edit because of redraw.
1599 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1601 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1603 * lib/ui/default.ui: Populate "edit_float" menu
1605 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1607 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1608 "floats-operate". The name is ugly (and the func also), but this
1609 is just a band-aid until we switch to new insets.
1611 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1613 * lib/ui/default.ui: update again the menu layout (fix some
1616 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1618 * src/MenuBackend.h (fulllabel): new method.
1620 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1621 the menu shortcuts of a menu are unique and whether they
1622 correspond to a letter of the label.
1623 (expand): call checkShortcuts when debugging.
1625 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1627 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1629 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1631 * lib/examples/*.lyx : '\language default' => '\language english'
1633 * lib/examples/it_splash.lyx : except where it should be italian
1635 * lib/templates/*.lyx : the same
1637 * doc/*.lyx* : the same
1639 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1641 * lib/bind/menus.bind: remove the Layout menu entries, which I
1642 somehow forgot earlier.
1644 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1646 * lib/ui/old-default.ui: keep the old one here for reference (to
1649 * lib/ui/default.ui: update the menu layout
1651 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1653 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1654 Can now Apply to different insets without closing the dialog.
1656 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1657 Can't actually DO anything with them yet, but I'd like a little
1660 * src/frontends/xforms/input_validators.[ch]
1661 (fl_lowercase_filter): new.
1663 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1665 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1666 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1668 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1670 2000-11-02 Juergen Vigna <jug@sad.it>
1672 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1673 on char insertion as it has already be updated by bv->updateInset().
1675 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1676 if an inset inside was updated.
1678 * lib/configure.cmd: commented out fax-search code
1680 2000-11-01 Yves Bastide <stid@acm.org>
1682 * src/tabular.C (OldFormatRead): set tabular language to the
1685 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1687 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1688 class names with non-letter characters (from Yves Bastide).
1690 * lib/ui/default.ui: change Item to OptItem in import menu.
1691 Comment out fax stuff.
1693 * lib/configure.m4: comment out fax-related stuff.
1695 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1697 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1698 useful xforms helper functions. At present contains only formatted().
1699 Input a string and it returns it with line breaks so that in fits
1702 * src/frontends/xforms/Makefile.am: add new files.
1704 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1705 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1708 * src/frontends/xforms/FormPreferences.[Ch]:
1709 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1710 but lots of little clean ups. Removed enum State. Make use of
1711 formatted(). Constify lots of methods. Perhaps best of all: removed
1712 requirement for that horrible reinterpret_cast from pointer to long in
1715 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1717 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1718 conditionalize build on xforms < 0.89
1720 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1722 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1724 * src/LyXAction.C (init): comment out fax
1726 * src/lyxrc.h: comment out the fax enums
1727 comment out the fax variables
1729 * src/commandtags.h: comment out LFUN_FAX
1731 * src/lyxrc.C: disable fax variables.
1732 (read): disable parsing of fax variables
1733 (output): disable writing of fax variables
1734 (getFeedback): now description for fax variables
1736 * src/lyxfunc.C: comment out MenuFax
1737 (Dispatch): disable LFUN_FAX
1739 * src/lyx_cb.C (MenuFax): comment out
1741 * src/WorkArea.C: add <cctype>
1742 (work_area_handler): better key handling, should be ok now.
1743 for accented chars + etc
1745 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1746 lyx_sendfax.h and lyx_sendfax_man.C
1748 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1749 (show): don't call InitLyXLookup when using xforms 0.89
1751 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1753 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1755 * src/support/filetools.C (GetFileContents): close to dummy change
1757 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1759 * src/trans.C (AddDeadkey): workaround stupid compilers.
1761 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1763 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1764 of two-sided document.
1766 2000-10-31 Juergen Vigna <jug@sad.it>
1768 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1770 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1771 xposition to the Edit call.
1773 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1775 * src/trans.C (AddDeadkey): cast explicitly to char.
1777 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1779 * src/tabular.C (AsciiBottomHLine): simplify?
1780 (AsciiTopHLine): simplify?
1781 (print_n_chars): simplify
1782 (DocBook): remove most of the << endl; we should flush the stream
1783 as seldom as possible.
1785 (TeXBottomHLine): ditto
1786 (TeXTopHLine): ditto
1788 (write_attribute): try a templified version.
1789 (set_row_column_number_info): lesson scope of variables
1791 * src/support/lstrings.h (tostr): new specialization of tostr
1793 * src/trans.C (AddDeadkey): slightly cleaner fix.
1795 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1797 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1798 '%%' in Toc menu labels.
1801 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1802 font_norm is iso10646-1.
1804 * src/font.C (ascent): Fixed for 16bit fonts
1805 (descent,lbearing,rbearing): ditto
1807 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1809 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1810 (getFeedback): new static method.
1812 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1813 Now use combox rather than choice to display languages.
1814 Feedback is now output using a new timer callback mechanism, identical
1815 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1817 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1819 * src/minibuffer.C: fix for older compilers
1821 2000-10-30 Juergen Vigna <jug@sad.it>
1823 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1824 has to be Left of the inset otherwise LyXText won't find it!
1826 * src/BufferView2.C (open_new_inset): delete the inset if it can
1829 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1831 * lyx.man: fix typo.
1833 2000-10-29 Marko Vendelin <markov@ioc.ee>
1834 * src/frontends/gnome/FormCitation.C
1835 * src/frontends/gnome/FormCitation.h
1836 * src/frontends/gnome/FormCopyright.C
1837 * src/frontends/gnome/FormCopyright.h
1838 * src/frontends/gnome/FormError.C
1839 * src/frontends/gnome/FormError.h
1840 * src/frontends/gnome/FormIndex.C
1841 * src/frontends/gnome/FormIndex.h
1842 * src/frontends/gnome/FormPrint.C
1843 * src/frontends/gnome/FormPrint.h
1844 * src/frontends/gnome/FormRef.C
1845 * src/frontends/gnome/FormRef.h
1846 * src/frontends/gnome/FormToc.C
1847 * src/frontends/gnome/FormToc.h
1848 * src/frontends/gnome/FormUrl.C
1849 * src/frontends/gnome/FormUrl.h
1850 * src/frontends/gnome/Menubar_pimpl.C
1851 * src/frontends/gnome/mainapp.C
1852 * src/frontends/gnome/mainapp.h
1853 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1854 changing update() to updateSlot() where appropriate
1856 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1858 * src/frontends/xforms/FormPreferences.[Ch]:
1859 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1862 2000-10-28 Juergen Vigna <jug@sad.it>
1864 * src/insets/insettabular.C (draw): fixed drawing bug.
1866 * src/insets/insettext.C (clear):
1868 (SetParagraphData): clearing the TEXT buffers when deleting the
1869 paragraphs used by it.
1871 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1873 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1875 2000-10-27 Juergen Vigna <jug@sad.it>
1877 * src/tabular.C (~LyXTabular): removed not needed anymore.
1879 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1882 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1884 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1887 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1890 * src/frontends/xforms/FormPreferences.[Ch]:
1891 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1892 Reorganised as modules based on tabs. Much easier to follow the
1893 flow and to add new tabs. Added warning and feedback messages.
1896 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1898 * src/tabular.h (DocBook): add std:: qualifier.
1900 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1902 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1903 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1906 * insettabular.C (DocBook): uses the tabular methods to export
1909 * src/insets/insettext.h
1910 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1912 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1914 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1917 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1918 moved misplaced AllowInput two lines up.
1920 * src/buffer.C (readFile): compare float with float, not with int
1922 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1924 * src/minibuffer.C: add "using SigC::slot" statement.
1926 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1928 * src/frontends/xforms/forms/README: updated section about make.
1930 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1931 Tidied some forms up, made two of form_tabular's tabs more
1932 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1933 fixed translation problem with "Column".
1935 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1937 * src/minibuffer.h: use Timeout instead of the xforms timer
1939 (setTimer) rewrite for the Timeout, change to unsigned arg
1940 (set): change to unsigned timer arg
1943 * src/minibuffer.C (TimerCB): removed func
1944 (C_MiniBuffer_TimerCB): removed func
1945 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1946 (peek_event): use a switch statement
1947 (add): don't use fl_add_timer.
1948 (Set): rewrite to use the Timeout
1951 * src/Timeout.[Ch] (setType): return a Timeout &
1952 (setTimeout): ditto, change to unsigned arg for timeout
1954 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1956 * src/mathed/formula.C (mathed_string_width): Use string instead
1957 of a constant size char array.
1959 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1961 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1962 the two recently added operator<< for SMInput and State.
1964 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1966 (OkCancelPolicy): ditto
1967 (OkCancelReadOnlyPolicy): ditto
1968 (NoRepeatedApplyReadOnlyPolicy): ditto
1969 (OkApplyCancelReadOnlyPolicy): ditto
1970 (OkApplyCancelPolicy): ditto
1971 (NoRepeatedApplyPolicy): ditto
1973 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1975 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1976 add the usual std:: qualifiers.
1978 2000-10-25 Juergen Vigna <jug@sad.it>
1980 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1982 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1984 * src/support/filetools.C (MakeRelPath): change some types to
1987 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1988 ButtonPolicy::SMInput and ButtonPolicy::State.
1990 * src/FontLoader.C (reset): small cleanup
1991 (unload): small cleanup
1993 * src/FontInfo.C (getFontname): initialize error to 10000.0
1995 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1997 * src/frontends/xforms/FormPreferences.[Ch]:
1998 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1999 TeX encoding and default paper size sections.
2001 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2003 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2006 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2007 make the message_ empty.
2008 (FormError): don't initialize message_ in initializer list.
2010 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2012 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2014 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2016 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2018 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2020 * src/frontends/kde/*data.[Ch]: _("") is not
2023 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2025 * src/buffer.C: removed redundant using directive.
2027 * src/frontends/DialogBase.h: revert to original definition of
2030 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2031 stuff into two classes, one for each dialog, requires a new
2032 element in the dialogs vector, FormTabularCreate.
2034 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2037 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2038 method. Continues Allan's idea, but means that derived classes
2039 don't need to worry about "update or hide?".
2041 * src/frontends/xforms/FormError.C (showInset): add connection
2044 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2045 one for each dialog. FormTabular now contains main tabular dialog
2048 * src/frontends/xforms/FormTabularCreate.[Ch]:
2049 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2052 * src/frontends/xforms/FormGraphics.[Ch]:
2053 * src/frontends/xforms/forms/form_graphics.fd
2054 * src/frontends/xforms/FormTabular.[Ch]:
2055 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2056 classes of FormInset.
2058 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2059 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2061 * src/frontends/xforms/Makefile.am:
2062 * src/frontends/xforms/forms/makefile: added new files.
2064 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2065 variable. added Signal0 hide signal, in keeping with other GUI-I
2068 * src/support/lstrings.h: removed redundant std:: qualifier as
2069 it's already declared in Lsstream.h.
2071 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2073 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2077 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2079 * src/tabular.C (Ascii): minimize scope of cell.
2081 * src/BufferView2.C (nextWord): return string() instead of 0;
2083 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2085 * src/converter.h: add a std:: qualifier
2087 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2089 * src/importer.[Ch]: New files. Used for importing files into LyX.
2091 * src/lyxfunc.C (doImport): Use the new Importer class.
2093 * src/converter.h: Add shortcut member to the Format class.
2094 Used for holding the menu shortcut.
2096 * src/converter.C and other files: Made a distinction between
2097 format name and format extension. New formats can be defined using
2098 the \format lyxrc tag.
2099 Added two new converter flags: latex and disable.
2101 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2103 * src/support/lyxlib.h: unify namespace/struct implementation.
2104 Remove extra declarations.
2106 * src/support/chdir.C (chdir): remove version taking char const *
2108 * src/support/rename.C: ditto.
2109 * src/support/lyxsum.C: ditto.
2111 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2113 * src/frontends/xforms/FormBase.[Ch]:
2114 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2115 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2116 work only for the next call to fl_show_form(). The correct place to set
2117 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2118 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2119 from FormBase have the minimum size set; no more stupid crashes with
2122 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2124 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2126 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2128 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2130 * src/support/lyxlib.h: changed second argument of mkdir to
2131 unsigned long int (unsigned int would probably have been enough,
2132 but...). Removed <sys/types.h> header.
2133 * src/support/mkdir.C (mkdir): ditto.
2137 2000-10-19 Juergen Vigna <jug@sad.it>
2139 * src/lyxfunc.C (MenuNew): small fix (form John)
2141 * src/screen.C (Update): removed unneeded code.
2143 * src/tabular.C (Ascii): refixed int != uint bug!
2145 * src/support/lyxlib.h: added sys/types.h include for now permits
2146 compiling, but I don't like this!
2148 2000-10-18 Juergen Vigna <jug@sad.it>
2150 * src/text2.C (ClearSelection): if we clear the selection we need
2151 more refresh so set the status apropriately
2153 * src/insets/insettext.C (draw): hopefully finally fixed draw
2156 2000-10-12 Juergen Vigna <jug@sad.it>
2158 * src/insets/insettext.C (draw): another small fix and make a block
2159 so that variables are localized.
2161 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2163 * src/support/lstrings.C (lowercase, uppercase):
2164 use explicit casts to remove compiler warnings.
2166 * src/support/LRegex.C (Impl):
2167 * src/support/StrPool.C (add):
2168 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2169 (AddPath, MakeDisplayPath):
2170 * src/support/lstrings.C (prefixIs, subst):
2171 use correct type to remove compiler warnings.
2173 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2175 * src/support/lyxlib.h:
2176 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2177 portability and to remove compiler warning with DEC cxx.
2179 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2181 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2183 * src/minibuffer.C (peek_event): retun 1 when there has been a
2184 mouseclick in the minibuffer.
2188 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2190 * src/frontends/xforms/FormParagraph.C: more space above/below
2193 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2195 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2196 a char only if real_current_font was changed.
2198 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2200 * NEWS: update somewhat for 1.1.6
2202 * lib/ui/default.ui: clean up.
2204 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2206 * lib/CREDITS: clean up
2208 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2210 * src/combox.[Ch] (select): changed argument back to int
2211 * src/combox.C (peek_event): removed num_bytes as it is declared but
2214 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2215 modified calls to Combox::select() to remove warnings about type
2218 * src/insets/insetbutton.C (width): explicit cast to remove warning
2219 about type conversion.
2221 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2224 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2225 sel_pos_end, refering to cursor position are changed to
2226 LyXParagraph::size_type.
2228 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2229 consistent with LyXCursor::pos().
2230 (inset_pos): changed to LyXParagraph::size_type for same reason.
2232 * src/insets/insettext.C (resizeLyXText): changed some temporary
2233 variables refing to cursor position to LyXParagraph::size_type.
2235 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2237 * src/frontends/kde/<various>: The Great Renaming,
2240 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2242 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2244 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2246 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2247 0 when there are no arguments.
2249 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2251 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2252 to segfaults when pressing Ok in InsetBibtex dialog.
2254 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2256 * forms/layout_forms.fd:
2257 * src/layout_forms.C (create_form_form_character): small change to use
2258 labelframe rather than engraved frame + text
2260 * src/lyx_gui.C (create_forms): initialise choice_language with some
2261 arbitrary value to prevent segfault when dialog is shown.
2263 2000-10-16 Baruch Even <baruch.even@writeme.com>
2265 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2266 is no resulting file. This pertains only to LaTeX output.
2268 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2270 * src/text.C (Backspace): Make sure that the row of the cursor is
2273 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2276 * src/lyx_gui.C (init): Prevent a crash when only one font from
2277 menu/popup fonts is not found.
2279 * lib/lyxrc.example: Add an example for binding a key for language
2282 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2284 * src/converter.C (GetReachable): Changed the returned type to
2286 (IsReachable): New method
2288 * src/MenuBackend.C (expand): Handle formats that appear more
2291 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2293 * src/frontends/support/Makefile.am
2294 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2297 * lib/CREDITS: add Garst Reese.
2299 * src/support/snprintf.h: add extern "C" {} around the definitions.
2301 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2303 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2306 * src/frontends/xforms/FormDocument.C:
2307 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2308 compile without "conversion to integral type of smaller size"
2311 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2313 * src/text.C (GetColumnNearX): Fixed disabled code.
2315 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2317 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2320 * src/support/snprintf.[ch]: new files
2322 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2324 * src/frontends/kde/formprintdialog.C: add
2325 file browser for selecting postscript output
2327 * src/frontends/kde/formprintdialogdata.C:
2328 * src/frontends/kde/formprintdialogdata.h: re-generate
2331 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2333 * src/frontends/gnome/Makefile.am:
2334 * src/frontends/kde/Makefile.am: FormCommand.C
2335 disappeared from xforms
2337 * src/frontends/kde/FormCitation.C:
2338 * src/frontends/kde/FormIndex.C: read-only
2341 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2343 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2346 * src/bufferlist.C: add using directive.
2348 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2350 * src/support/lyxfunctional.h: version of class_fun for void
2351 returns added, const versions of back_inseter_fun and compare_fun
2354 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2356 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2358 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2360 * ChangeLog: cleanup.
2362 * lib/CREDITS: update to add all the contributors we've forgotten.
2363 I have obviously missed some, so tell me whether there were
2366 2000-10-13 Marko Vendelin <markov@ioc.ee>
2368 * src/frontends/gnome/FormCitation.C
2369 * src/frontends/gnome/FormCitation.h
2370 * src/frontends/gnome/FormError.C
2371 * src/frontends/gnome/FormIndex.C
2372 * src/frontends/gnome/FormRef.C
2373 * src/frontends/gnome/FormRef.h
2374 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2376 * src/frontends/gnome/FormCitation.C
2377 * src/frontends/gnome/FormCopyright.C
2378 * src/frontends/gnome/FormError.C
2379 * src/frontends/gnome/FormIndex.C
2380 * src/frontends/gnome/FormRef.C
2381 * src/frontends/gnome/FormToc.C
2382 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2385 * src/frontends/gnome/Menubar_pimpl.C
2386 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2389 2000-10-11 Baruch Even <baruch.even@writeme.com>
2392 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2393 to convey its real action.
2395 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2396 clear the minibuffer and prepare to enter a command.
2398 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2399 the rename from ExecCommand to PrepareForCommand.
2400 * src/lyxfunc.C (Dispatch): ditto.
2402 2000-10-11 Baruch Even <baruch.even@writeme.com>
2404 * src/buffer.C (writeFile): Added test for errors on writing, this
2405 catches all errors and not only file system full errors as intended.
2407 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2409 * src/lyx_gui.C (create_forms): better fix for crash with
2410 translated interface.
2412 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2414 * src/frontends/kde/Makefile.am:
2415 * src/frontends/kde/FormCopyright.C:
2416 * src/frontends/kde/formcopyrightdialog.C:
2417 * src/frontends/kde/formcopyrightdialog.h:
2418 * src/frontends/kde/formcopyrightdialogdata.C:
2419 * src/frontends/kde/formcopyrightdialogdata.h:
2420 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2421 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2422 copyright to use qtarch
2424 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2426 * src/encoding.C (read): Fixed bug that caused an error message at
2427 the end of the file.
2429 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2431 * lib/lyxrc.example: Fixed hebrew example.
2433 2000-10-13 Allan Rae <rae@lyx.org>
2435 * src/frontends/xforms/FormPreferences.C (input): reworking the
2437 (build, update, apply): New inputs in various tabfolders
2439 * src/frontends/xforms/FormToc.C: use new button policy.
2440 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2441 dialogs that either can't use any existing policy or where it just
2444 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2447 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2448 added a bool parameter which is ignored.
2450 * src/buffer.C (setReadonly):
2451 * src/BufferView_pimpl.C (buffer):
2452 * src/frontends/kde/FormCopyright.h (update):
2453 * src/frontends/kde/FormCitation.[Ch] (update):
2454 * src/frontends/kde/FormIndex.[Ch] (update):
2455 * src/frontends/kde/FormPrint.[Ch] (update):
2456 * src/frontends/kde/FormRef.[Ch] (update):
2457 * src/frontends/kde/FormToc.[Ch] (update):
2458 * src/frontends/kde/FormUrl.[Ch] (update):
2459 * src/frontends/gnome/FormCopyright.h (update):
2460 * src/frontends/gnome/FormCitation.[Ch] (update):
2461 * src/frontends/gnome/FormError.[Ch] (update):
2462 * src/frontends/gnome/FormIndex.[Ch] (update):
2463 * src/frontends/gnome/FormPrint.[Ch] (update):
2464 * src/frontends/gnome/FormRef.h (update):
2465 * src/frontends/gnome/FormToc.[Ch] (update):
2466 * src/frontends/gnome/FormUrl.[Ch] (update):
2467 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2468 to updateBufferDependent and DialogBase
2470 * src/frontends/xforms/FormCitation.[hC]:
2471 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2472 * src/frontends/xforms/FormError.[Ch]:
2473 * src/frontends/xforms/FormGraphics.[Ch]:
2474 * src/frontends/xforms/FormIndex.[Ch]:
2475 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2476 and fixed readOnly handling.
2477 * src/frontends/xforms/FormPrint.[Ch]:
2478 * src/frontends/xforms/FormRef.[Ch]:
2479 * src/frontends/xforms/FormTabular.[Ch]:
2480 * src/frontends/xforms/FormToc.[Ch]:
2481 * src/frontends/xforms/FormUrl.[Ch]:
2482 * src/frontends/xforms/FormInset.[Ch]:
2483 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2484 form of updateBufferDependent.
2486 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2487 if form()->visible just in case someone does stuff to the form in a
2490 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2491 the buttoncontroller for everything the enum used to be used for.
2492 (update) It would seem we need to force all dialogs to use a bool
2493 parameter or have two update functions. I chose to go with one.
2494 I did try removing update() from here and FormBase and defining the
2495 appropriate update signatures in FormBaseB[DI] but then ran into the
2496 problem of the update() call in FormBase::show(). Whatever I did
2497 to get around that would require another function and that just
2498 got more confusing. Hence the decision to make everyone have an
2499 update(bool). An alternative might have been to override show() in
2500 FormBaseB[DI] and that would allow the different and appropriate
2503 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2504 true == buffer change occurred. I decided against using a default
2505 template parameter since not all compilers support that at present.
2507 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2509 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2510 army knife" by removing functionality.
2511 (clearStore): removed. All such housekeeping on hide()ing the dialog
2512 is to be carried out by overloaded disconnect() methods.
2513 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2514 superceded by Baruch's neat test (FormGraphics) to update an existing
2515 dialog if a new signal is recieved rather than block all new signals
2517 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2518 only to Inset dialogs.
2519 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2520 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2522 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2524 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2525 as a base class to all inset dialogs. Used solely to connect/disconnect
2526 the Inset::hide signal and to define what action to take on receipt of
2527 a UpdateBufferDependent signal.
2528 (FormCommand): now derived from FormInset.
2530 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2533 * src/frontends/xforms/FormCopyright.[Ch]:
2534 * src/frontends/xforms/FormPreferences.[Ch]:
2535 now derived from FormBaseBI.
2537 * src/frontends/xforms/FormDocument.[Ch]:
2538 * src/frontends/xforms/FormParagraph.[Ch]:
2539 * src/frontends/xforms/FormPrint.[Ch]:
2540 now derived from FormBaseBD.
2542 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2544 * src/frontends/xforms/FormCitation.[Ch]:
2545 * src/frontends/xforms/FormError.[Ch]:
2546 * src/frontends/xforms/FormRef.[Ch]:
2547 * src/frontends/xforms/FormToc.[Ch]:
2548 (clearStore): reworked as disconnect().
2550 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2553 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2555 * src/converter.C (runLaTeX): constify buffer argument
2558 * src/frontends/support/Makefile.am (INCLUDES): fix.
2560 * src/buffer.h: add std:: qualifier
2561 * src/insets/figinset.C (addpidwait): ditto
2562 * src/MenuBackend.C: ditto
2563 * src/buffer.C: ditto
2564 * src/bufferlist.C: ditto
2565 * src/layout.C: ditto
2566 * src/lyxfunc.C: ditto
2568 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2570 * src/lyxtext.h (bidi_level): change return type to
2571 LyXParagraph::size_type.
2573 * src/lyxparagraph.h: change size_type to
2574 TextContainer::difference_type. This should really be
2575 TextContainer::size_type, but we need currently to support signed
2578 2000-10-11 Marko Vendelin <markov@ioc.ee>
2579 * src/frontends/gnome/FormError.h
2580 * src/frontends/gnome/FormRef.C
2581 * src/frontends/gnome/FormRef.h
2582 * src/frontends/gnome/FormError.C
2583 * src/frontends/gnome/Makefile.am
2584 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2585 to Gnome frontend. Both dialogs use "action" area.
2587 2000-10-12 Baruch Even <baruch.even@writeme.com>
2589 * src/graphics/GraphicsCacheItem_pimpl.C:
2590 * src/graphics/Renderer.C:
2591 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2594 2000-10-12 Juergen Vigna <jug@sad.it>
2596 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2597 visible when selecting).
2599 * development/Code_rules/Rules: fixed some typos.
2601 2000-10-09 Baruch Even <baruch.even@writeme.com>
2603 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2604 compiling on egcs 1.1.2 possible.
2606 * src/filedlg.C (comp_direntry::operator() ): ditto.
2608 2000-08-31 Baruch Even <baruch.even@writeme.com>
2610 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2613 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2614 transient it now only gets freed when the object is destructed.
2616 2000-08-24 Baruch Even <baruch.even@writeme.com>
2618 * src/frontends/FormGraphics.h:
2619 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2622 2000-08-20 Baruch Even <baruch.even@writeme.com>
2624 * src/insets/insetgraphics.C:
2625 (draw): Added messages to the drawn rectangle to report status.
2626 (updateInset): Disabled the use of the inline graphics,
2629 2000-08-17 Baruch Even <baruch.even@writeme.com>
2631 * src/frontends/support: Directory added for the support of GUII LyX.
2633 * src/frontends/support/LyXImage.h:
2634 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2637 * src/frontends/support/LyXImage_X.h:
2638 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2639 version of LyXImage, this uses the Xlib Pixmap.
2641 * src/PainterBase.h:
2642 * src/PainterBase.C:
2644 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2645 replacement to Pixmap.
2647 * src/insets/insetgraphics.h:
2648 * src/insets/insetgraphics.C:
2649 * src/graphics/GraphicsCacheItem.h:
2650 * src/graphics/GraphicsCacheItem.C:
2651 * src/graphics/GraphicsCacheItem_pimpl.h:
2652 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2655 * src/graphics/GraphicsCacheItem.h:
2656 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2657 another copy of the object.
2659 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2660 of cacheHandle, this fixed a bug that sent LyX crashing.
2662 * src/graphics/XPM_Renderer.h:
2663 * src/graphics/XPM_Renderer.C:
2664 * src/graphics/EPS_Renderer.h:
2665 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2667 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2669 * src/lyxfunc.C (processKeySym): only handle the
2670 lockinginset/inset stuff if we have a buffer and text loaded...
2672 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2674 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2676 * src/support/lyxfunctional.h: add operator= that takes a reference
2678 * src/lyxserver.C (mkfifo): make first arg const
2680 * src/layout.h: renamed name(...) to setName(...) to work around
2683 * src/buffer.C (setFileName): had to change name of function to
2684 work around bugs in egcs. (renamed from fileName)
2686 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2688 * src/support/translator.h: move helper template classes to
2689 lyxfunctional.h, include "support/lyxfunctional.h"
2691 * src/support/lyxmanip.h: add delaration of fmt
2693 * src/support/lyxfunctional.h: new file
2694 (class_fun_t): new template class
2695 (class_fun): helper template function
2696 (back_insert_fun_iterator): new template class
2697 (back_inserter_fun): helper template function
2698 (compare_memfun_t): new template class
2699 (compare_memfun): helper template function
2700 (equal_1st_in_pair): moved here from translator
2701 (equal_2nd_in_pair): moved here from translator
2703 * src/support/fmt.C: new file
2704 (fmt): new func, can be used for a printf substitute when still
2705 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2707 * src/support/StrPool.C: add some comments
2709 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2712 * src/insets/figinset.C (addpidwait): use std::copy with
2713 ostream_iterator to fill the pidwaitlist
2715 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2717 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2720 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2723 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2725 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2726 (class_update): ditto
2727 (BulletPanel): ditto
2728 (CheckChoiceClass): move initialization of tc and tct
2730 * src/tabular.C: remove current_view
2731 (OldFormatRead): similar to right below [istream::ignore]
2733 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2734 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2735 unused [istream::ignore]
2737 * src/lyxfunc.C: include "support/lyxfunctional.h"
2738 (getInsetByCode): use std::find_if and compare_memfun
2740 * src/lyxfont.C (stateText): remove c_str()
2742 * src/lyx_main.C (setDebuggingLevel): make static
2743 (commandLineHelp): make static
2745 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2746 Screen* together with fl_get_display() and fl_screen
2748 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2749 togheter with fl_get_display() and fl_screen
2750 (create_forms): remove c_str()
2752 * src/layout.C: include "support/lyxfunctional.h"
2753 (hasLayout): use std::find_if and compare_memfun
2754 (GetLayout): use std::find_if and comapre_memfun
2755 (delete_layout): use std::remove_if and compare_memfun
2756 (NumberOfClass): use std:.find_if and compare_memfun
2758 * src/gettext.h: change for the new functions
2760 * src/gettext.C: new file, make _(char const * str) and _(string
2761 const & str) real functions.
2763 * src/font.C (width): rewrite slightly to avoid one extra variable
2765 * src/debug.C: initialize Debug::ANY here
2767 * src/commandtags.h: update number comments
2769 * src/combox.h (get): make const func
2771 (getline): make const
2773 * src/combox.C (input_cb): handle case where fl_get_input can
2776 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2777 "support/lyxfunctional.h", remove current_view variable.
2778 (resize): use std::for_each with std::mem_fun
2779 (getFileNames): use std::copy with back_inserter_fun
2780 (getBuffer): change arg type to unsigned int
2781 (emergencyWriteAll): call emergencyWrite with std::for_each and
2783 (emergencyWrite): new method, the for loop in emergencyWriteAll
2785 (exists): use std::find_if with compare_memfun
2786 (getBuffer): use std::find_if and compare_memfun
2788 * src/buffer.h: add typedefs for iterator_category, value_type
2789 difference_type, pointer and reference for inset_iterator
2790 add postfix ++ for inset_iterator
2791 make inset_iterator::getPos() const
2793 * src/buffer.C: added support/lyxmanip.h
2794 (readFile): use lyxerr << fmt instead of printf
2795 (makeLaTeXFile): use std::copy to write out encodings
2797 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2799 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2800 free and the char * temp.
2801 (hasMenu): use std::find_if and compare_memfun
2804 * src/Makefile.am (lyx_SOURCES): added gettext.C
2806 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2807 string::insert small change to avoid temporary
2809 * src/LColor.C (getGUIName): remove c_str()
2811 * several files: change all occurrences of fl_display to
2814 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2815 that -pedantic is not used for gcc 2.97 (cvs gcc)
2817 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2819 2000-10-11 Allan Rae <rae@lyx.org>
2821 * src/frontends/xforms/FormPreferences.C (input): template path must be
2822 a readable directory. It doesn't need to be writeable.
2823 (build, delete, update, apply): New inputs in the various tabfolders
2825 * src/frontends/xforms/forms/form_preferences.fd:
2826 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2827 several new entries to existing folders. Shuffled some existing stuff
2830 * src/frontends/xforms/forms/form_print.fd:
2831 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2832 Should probably rework PrinterParams as well. Note that the switch to
2833 collated is effectively the same as !unsorted so changing PrinterParams
2834 will require a lot of fiddly changes to reverse the existing logic.
2836 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2838 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2840 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2842 2000-10-10 Allan Rae <rae@lyx.org>
2845 * src/lyxfunc.C (Dispatch):
2847 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2850 * src/lyxrc.C (output): Only write the differences between system lyxrc
2851 and the users settings.
2854 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2856 I'll rewrite this later, after 1.1.6 probably, to keep a single
2857 LyXRC but two instances of a LyXRCStruct.
2859 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2861 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2863 * src/tabular.h: add a few std:: qualifiers.
2865 * src/encoding.C: add using directive.
2866 * src/language.C: ditto.
2868 * src/insets/insetquotes.C (Validate): use languages->lang()
2869 instead of only language.
2871 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2873 * lib/languages: New file.
2875 * lib/encodings: New file.
2877 * src/language.C (Languages): New class.
2878 (read): New method. Reads the languages from the 'languages' file.
2880 * src/encoding.C (Encodings): New class.
2881 (read): New method. Reads the encodings from the 'encodings' file.
2883 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2886 * src/bufferparams.h and a lot of files: Deleted the member language,
2887 and renamed language_info to language
2889 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2890 * src/lyxfont.C (latexWriteStartChanges): ditto.
2891 * src/paragraph.C (validate,TeXOnePar): ditto.
2893 * src/lyxfont.C (update): Restored deleted code.
2895 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2897 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2899 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2901 * src/insets/figinset.[Ch]:
2902 * src/insets/insetinclude.[Ch]:
2903 * src/insets/insetinclude.[Ch]:
2904 * src/insets/insetparent.[Ch]:
2905 * src/insets/insetref.[Ch]:
2906 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2908 * src/insets/*.[Ch]:
2909 * src/mathed/formula.[Ch]:
2910 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2912 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2913 * src/lyx_cb.C (FigureApplyCB):
2914 * src/lyxfunc.C (getStatus, Dispatch):
2915 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2918 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2920 * src/converter.[Ch] (Formats::View):
2921 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2923 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2924 *current_view->buffer(). This will change later, but this patch is way
2927 2000-10-09 Juergen Vigna <jug@sad.it>
2929 * src/text.C (GetRow): small fix.
2931 * src/BufferView_pimpl.C (cursorPrevious):
2932 (cursorNext): added LyXText parameter to function.
2934 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2935 keypress depending on cursor position.
2937 2000-10-06 Juergen Vigna <jug@sad.it>
2939 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2940 (copySelection): redone this function and also copy ascii representa-
2943 * src/tabular.C (Ascii):
2947 (print_n_chars): new functions to realize the ascii export of tabulars.
2949 2000-10-05 Juergen Vigna <jug@sad.it>
2951 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2952 if we don't have a buffer.
2954 2000-10-10 Allan Rae <rae@lyx.org>
2956 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2957 with closing dialog. It seems that nested tabfolders require hiding
2958 of inner tabfolders before hiding the dialog itself. Actually all I
2959 did was hide the active outer folder.
2961 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2962 unless there really is a buffer. hideBufferDependent is called
2965 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2966 POTFILES.in stays in $(srcdir).
2968 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2970 * lib/lyxrc.example: Few changes.
2972 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2974 * src/BufferView_pimpl.C (buffer): only need one the
2975 updateBufferDependent signal to be emitted once! Moved to the end of
2976 the method to allow bv_->text to be updated first.
2978 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2979 and hSignal_ with Dialogs * and BufferDependency variables.
2980 New Buffer * parent_, initialised when the dialog is launched. Used to
2981 check whether to update() or hide() dialog in the new, private
2982 updateOrHide() method that is connected to the updateBufferDependent
2983 signal. Daughter classes dictate what to do using the
2984 ChangedBufferAction enum, passed to the c-tor.
2986 * src/frontends/xforms/FormCitation.C:
2987 * src/frontends/xforms/FormCommand.C:
2988 * src/frontends/xforms/FormCopyright.C:
2989 * src/frontends/xforms/FormDocument.C:
2990 * src/frontends/xforms/FormError.C:
2991 * src/frontends/xforms/FormIndex.C:
2992 * src/frontends/xforms/FormPreferences.C:
2993 * src/frontends/xforms/FormPrint.C:
2994 * src/frontends/xforms/FormRef.C:
2995 * src/frontends/xforms/FormToc.C:
2996 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2999 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3000 ChangedBufferAction enum.
3002 * src/frontends/xforms/FormParagraph.[Ch]
3003 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3006 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3008 * lib/bind/cua.bind: fix a bit.
3009 * lib/bind/emacs.bind: ditto.
3011 * lib/bind/menus.bind: remove real menu entries from there.
3013 * src/spellchecker.C: make sure we only include strings.h when
3016 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3018 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3019 function. It enlarges the maximum number of pup when needed.
3020 (add_toc2): Open a new menu if maximum number of items per menu has
3023 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3025 * src/frontends/kde/FormPrint.C: fix error reporting
3027 * src/frontends/xforms/FormDocument.C: fix compiler
3030 * lib/.cvsignore: add Literate.nw
3032 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3035 * bufferview_funcs.[Ch]
3038 * text2.C: Add support for numbers in RTL text.
3040 2000-10-06 Allan Rae <rae@lyx.org>
3042 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3043 to be gettext.m4 friendly again. ext_l10n.h is now
3044 generated into $top_srcdir instead of $top_builddir
3045 so that lyx.pot will be built correctly -- without
3046 duplicate parsing of ext_l10n.h.
3048 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3050 * src/frontends/kde/FormCitation.C: make the dialog
3051 behave more sensibly
3053 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3055 * config/kde.m4: fix consecutive ./configure runs,
3056 look for qtarch, fix library order
3058 * src/frontends/kde/Makefile.am: tidy up,
3059 add Print dialog, add .dlg dependencies
3061 * src/frontends/kde/FormPrint.C:
3062 * src/frontends/kde/FormPrint.h:
3063 * src/frontends/kde/formprintdialog.C:
3064 * src/frontends/kde/formprintdialog.h:
3065 * src/frontends/kde/formprintdialogdata.C:
3066 * src/frontends/kde/formprintdialogdata.h:
3067 * src/frontends/kde/dlg/formprintdialog.dlg: add
3070 * src/frontends/kde/dlg/README: Added explanatory readme
3072 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3073 script to double-check qtarch's output
3075 * src/frontends/kde/formindexdialog.C:
3076 * src/frontends/kde/formindexdialogdata.C:
3077 * src/frontends/kde/formindexdialogdata.h:
3078 * src/frontends/kde/dlg/formindexdialog.dlg: update
3079 for qtarch, minor fixes
3081 2000-10-05 Allan Rae <rae@lyx.org>
3083 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3084 dialogs when switching buffers update them instead. It's up to each
3085 dialog to decide if it should still be visible or not.
3086 update() should return a bool to control visiblity within show().
3087 Or perhaps better to set a member variable and use that to control
3090 * lib/build-listerrors: create an empty "listerrors" file just to stop
3091 make trying to regenerate it all the time if you don't have noweb
3094 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3096 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3097 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3098 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3099 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3100 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3102 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3104 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3106 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3107 deleting buffer. Closes all buffer-dependent dialogs.
3109 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3111 * src/frontends/xforms/FormCitation.[Ch]:
3112 * src/frontends/xforms/FormPreferences.[Ch]:
3113 * src/frontends/xforms/FormPrint.[Ch]:
3114 * src/frontends/xforms/FormRef.[Ch]:
3115 * src/frontends/xforms/FormUrl.[Ch]: ditto
3117 * src/frontends/xforms/FormDocument.[Ch]:
3118 * src/frontends/xforms/forms/form_document.C.patch:
3119 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3120 pass through a single input() function.
3122 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3124 * lib/build-listerrors: return status as OK
3126 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3128 * lib/lyxrc.example: Updated to new export code
3130 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3132 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3135 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3138 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3139 LyX-Code is defined.
3140 * lib/layouts/amsbook.layout: ditto.
3142 * boost/Makefile.am: fix typo.
3144 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3146 (add_lastfiles): removed.
3147 (add_documents): removed.
3148 (add_formats): removed.
3150 * src/frontends/Menubar.C: remove useless "using" directive.
3152 * src/MenuBackend.h: add a new MenuItem constructor.
3154 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3157 2000-10-04 Allan Rae <rae@lyx.org>
3159 * lib/Makefile.am (listerrors):
3160 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3161 I haven't got notangle installed so Kayvan please test. The output
3162 should end up in $builddir. This also allows people who don't have
3163 noweb installed to complete the make process without error.
3165 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3166 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3167 by JMarc's picky compiler.
3169 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3172 * src/insets/insettabular.C (setPos): change for loop to not use
3173 sequencing operator. Please check this Jürgen.
3175 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3177 * src/insets/insetcite.C (getScreenLabel): ditto
3178 * src/support/filetools.C (QuoteName): ditto
3179 (ChangeExtension): ditto
3181 * src/BufferView_pimpl.C (scrollCB): make heigt int
3183 * src/BufferView2.C (insertInset): comment out unused arg
3185 * boost/Makefile.am (EXTRADIST): new variable
3187 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3189 * src/exporter.C (IsExportable): Fixed
3191 * lib/configure.m4: Small fix
3193 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3195 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3196 * src/insets/insetbib.C (bibitemWidest): ditto.
3197 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3199 2000-10-03 Juergen Vigna <jug@sad.it>
3201 * src/BufferView2.C (theLockingInset): removed const because of
3202 Agnus's compile problems.
3204 * src/insets/insettext.C (LocalDispatch): set the language of the
3205 surronding paragraph on inserting the first character.
3207 * various files: changed use of BufferView::the_locking_inset.
3209 * src/BufferView2.C (theLockingInset):
3210 (theLockingInset): new functions.
3212 * src/BufferView.h: removed the_locking_inset.
3214 * src/lyxtext.h: added the_locking_inset
3216 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3218 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3220 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3222 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3223 * src/mathed/math_cursor.C (IsAlpha): ditto.
3224 * src/mathed/math_inset.C (strnew): ditto.
3225 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3226 (IMetrics): cxp set but never used; removed.
3227 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3228 that the variable in question has been removed also!
3231 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3232 using the Buffer * passed to Latex(), using the BufferView * passed to
3233 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3235 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3236 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3238 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3239 * src/buffer.C (readInset): used new InsetBibtex c-tor
3240 * (getBibkeyList): used new InsetBibtex::getKeys
3242 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3245 * lib/build-listerrors
3247 * src/exporter.C: Add literate programming support to the export code
3250 * src/lyx_cb.C: Remove old literate code.
3252 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3255 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3256 * src/converter.C (View, Convert): Use QuoteName.
3258 * src/insets/figinset.C (Preview): Use Formats::View.
3260 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3262 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3264 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3265 the top of the function, because compaq cxx complains that the
3266 "goto exit_with_message" when the function is disabled bypasses
3268 (MenuNew): try a better fix for the generation of new file names.
3269 This time, I used AddName() instead of AddPath(), hoping Juergen
3272 2000-10-03 Allan Rae <rae@lyx.org>
3274 * src/frontends/xforms/forms/form_preferences.fd:
3275 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3276 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3277 "Look and Feel"->"General" but will need to be split up further into
3278 general output and general input tabs. Current plan is for four outer
3279 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3280 stuff; "Inputs" for input and import configuration; "Outputs" for
3281 output and export configuration; and one more whatever is left over
3282 called "General". The leftovers at present look like being which
3283 viewers to use, spellchecker, language support and might be better
3284 named "Support". I've put "Paths" in "Inputs" for the moment as this
3285 seems reasonable for now at least.
3286 One problem remains: X error kills LyX when you close Preferences.
3288 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3290 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3291 qualifier from form()
3292 * src/frontends/xforms/FormCitation.[Ch]:
3293 * src/frontends/xforms/FormCopyright.[Ch]:
3294 * src/frontends/xforms/FormDocument.[Ch]:
3295 * src/frontends/xforms/FormError.[Ch]:
3296 * src/frontends/xforms/FormIndex.[Ch]:
3297 * src/frontends/xforms/FormPreferences.[Ch]:
3298 * src/frontends/xforms/FormPrint.[Ch]:
3299 * src/frontends/xforms/FormRef.[Ch]:
3300 * src/frontends/xforms/FormToc.[Ch]:
3301 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3303 * src/frontends/xforms/FormCitation.[Ch]:
3304 * src/frontends/xforms/FormIndex.[Ch]:
3305 * src/frontends/xforms/FormRef.[Ch]:
3306 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3307 with Allan's naming policy
3309 * src/frontends/xforms/FormCitation.C: some static casts to remove
3312 2000-10-02 Juergen Vigna <jug@sad.it>
3314 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3315 now you can type or do stuff inside the table-cell also when in dummy
3316 position, fixed visible cursor.
3318 * src/insets/insettext.C (Edit): fixing cursor-view position.
3320 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3321 be used for equal functions in lyxfunc and insettext.
3323 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3325 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3327 * src/frontends/gnome/FormCitation.h:
3328 * src/frontends/gnome/FormCopyright.h:
3329 * src/frontends/gnome/FormIndex.h:
3330 * src/frontends/gnome/FormPrint.h:
3331 * src/frontends/gnome/FormToc.h:
3332 * src/frontends/gnome/FormUrl.h:
3333 * src/frontends/kde/FormCitation.h:
3334 * src/frontends/kde/FormCopyright.h:
3335 * src/frontends/kde/FormIndex.h:
3336 * src/frontends/kde/FormRef.h:
3337 * src/frontends/kde/FormToc.h:
3338 * src/frontends/kde/FormUrl.h: fix remaining users of
3341 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3343 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3344 from depth argument.
3345 (DocBookHandleCaption): ditto.
3346 (DocBookHandleFootnote): ditto.
3347 (SimpleDocBookOnePar): ditto.
3349 * src/frontends/xforms/FormDocument.h (form): remove extra
3350 FormDocument:: qualifier.
3352 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3354 * sigc++/handle.h: ditto.
3356 * src/lyx_gui_misc.C: add "using" directive.
3358 * src/cheaders/cstddef: new file, needed by the boost library (for
3361 2000-10-02 Juergen Vigna <jug@sad.it>
3363 * src/insets/insettext.C (SetFont): better support.
3365 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3367 * src/screen.C (DrawOneRow): some uint refixes!
3369 2000-10-02 Allan Rae <rae@lyx.org>
3371 * boost/.cvsignore: ignore Makefile as well
3373 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3374 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3376 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3377 Left this one out by accident.
3379 * src/frontends/xforms/FormBase.h (restore): default to calling
3380 update() since that will restore the original/currently-applied values.
3381 Any input() triggered error messages will require the derived classes
3382 to redefine restore().
3384 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3385 avoid a segfault. combo_doc_class is the main concern.
3387 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3389 * Simplify build-listerrors in view of GUI-less export ability!
3391 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3393 * src/lyx_main.C (easyParse): Disable gui when exporting
3395 * src/insets/figinset.C:
3398 * src/lyx_gui_misc.C
3399 * src/tabular.C: Changes to allow no-gui.
3401 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3403 * src/support/utility.hpp: removed file
3404 * src/support/block.h: removed file
3406 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3409 * src/mathed/formula.C: add support/lyxlib.h
3410 * src/mathed/formulamacro.C: ditto
3412 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3413 * src/lyxparagraph.h: ditto
3415 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3416 * src/frontends/Makefile.am (INCLUDES): ditto
3417 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3418 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3419 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3420 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3421 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3422 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3424 * src/BufferView.h: use boost/utility.hpp
3425 * src/LColor.h: ditto
3426 * src/LaTeX.h: ditto
3427 * src/LyXAction.h: ditto
3428 * src/LyXView.h: ditto
3429 * src/bufferlist.h: ditto
3430 * src/lastfiles.h: ditto
3431 * src/layout.h: ditto
3432 * src/lyx_gui.h: ditto
3433 * src/lyx_main.h: ditto
3434 * src/lyxlex.h: ditto
3435 * src/lyxrc.h: ditto
3436 * src/frontends/ButtonPolicies.h: ditto
3437 * src/frontends/Dialogs.h: ditto
3438 * src/frontends/xforms/FormBase.h: ditto
3439 * src/frontends/xforms/FormGraphics.h: ditto
3440 * src/frontends/xforms/FormParagraph.h: ditto
3441 * src/frontends/xforms/FormTabular.h: ditto
3442 * src/graphics/GraphicsCache.h: ditto
3443 * src/graphics/Renderer.h: ditto
3444 * src/insets/ExternalTemplate.h: ditto
3445 * src/insets/insetcommand.h: ditto
3446 * src/support/path.h: ditto
3448 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3449 and introduce clause for 2.97.
3451 * boost/libs/README: new file
3453 * boost/boost/utility.hpp: new file
3455 * boost/boost/config.hpp: new file
3457 * boost/boost/array.hpp: new file
3459 * boost/Makefile.am: new file
3461 * boost/.cvsignore: new file
3463 * configure.in (AC_OUTPUT): add boost/Makefile
3465 * Makefile.am (SUBDIRS): add boost
3467 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3469 * src/support/lstrings.C (suffixIs): Fixed.
3471 2000-10-01 Allan Rae <rae@lyx.org>
3473 * src/PrinterParams.h: moved things around to avoid the "can't
3474 inline call" warning.
3476 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3477 into doc++ documentation.
3479 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3481 * src/frontends/xforms/FormRef.C: make use of button controller
3482 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3483 cleaned up button controller usage.
3484 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3485 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3486 use the button controller
3488 * src/frontends/xforms/forms/*.fd: and associated generated files
3489 updated to reflect changes to FormBase. Some other FormXxxx files
3490 also got minor updates to reflect changes to FormBase.
3492 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3493 (hide): made virtual.
3494 (input): return a bool. true == valid input
3495 (RestoreCB, restore): new
3496 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3497 Changes to allow derived dialogs to use a ButtonController and
3498 make sense when doing so: OK button calls ok() and so on.
3500 * src/frontends/xforms/ButtonController.h (class ButtonController):
3501 Switch from template implementation to taking Policy parameter.
3502 Allows FormBase to provide a ButtonController for any dialog.
3504 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3505 Probably should rename connect and disconnect.
3506 (apply): use the radio button groups
3507 (form): needed by FormBase
3508 (build): setup the radio button groups
3510 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3512 * several files: type changes to reduce the number of warnings and
3513 to unify type hangling a bit. Still much to do.
3515 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3517 * lib/images/*: rename a bunch of icons to match Dekel converter
3520 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3523 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3525 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3527 * sigc++/handle.h: ditto for class Handle.
3529 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3531 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3533 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3535 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3536 removal of the "default" language.
3538 * src/combox.h (getline): Check that sel > 0
3540 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3542 * lib/examples/docbook_example.lyx
3543 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3545 * lib/layouts/docbook-book.layout: new docbook book layout.
3547 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3549 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3551 * src/insets/figinset.C (DocBook):fixed small typo.
3553 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3555 * src/insets/insetinclude.h: string include_label doesn't need to be
3558 2000-09-29 Allan Rae <rae@lyx.org>
3560 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3561 Allow derived type to control connection and disconnection from signals
3562 of its choice if desired.
3564 2000-09-28 Juergen Vigna <jug@sad.it>
3566 * src/insets/insettabular.C (update): fixed cursor setting when
3567 the_locking_inset changed.
3568 (draw): made this a bit cleaner.
3569 (InsetButtonPress): fixed!
3571 * various files: added LyXText Parameter to fitCursor call.
3573 * src/BufferView.C (fitCursor): added LyXText parameter.
3575 * src/insets/insettabular.C (draw): small draw fix.
3577 * src/tabular.C: right setting of left/right celllines.
3579 * src/tabular.[Ch]: fixed various types in funcions and structures.
3580 * src/insets/insettabular.C: ditto
3581 * src/frontends/xforms/FormTabular.C: ditto
3583 2000-09-28 Allan Rae <rae@lyx.org>
3585 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3586 that the #ifdef's had been applied to part of what should have been
3587 a complete condition. It's possible there are other tests that
3588 were specific to tables that are also wrong now that InsetTabular is
3589 being used. Now we need to fix the output of '\n' after a table in a
3590 float for the same reason as the original condition:
3591 "don't insert this if we would be adding it before or after a table
3592 in a float. This little trick is needed in order to allow use of
3593 tables in \subfigures or \subtables."
3594 Juergen can you check this?
3596 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3598 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3599 output to the ostream.
3601 * several files: fixed types based on warnings from cxx
3603 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3605 * src/frontends/kde/Makefile.am: fix rule for
3606 formindexdialogdata_moc.C
3608 * src/.cvsignore: add ext_l10n.h to ignore
3610 * acconfig.h: stop messing with __STRICT_ANSI__
3611 * config/gnome.m4: remove option to set -ansi
3612 * config/kde.m4: remove option to set -ansi
3613 * config/lyxinclude.m4: don't set -ansi
3615 2000-09-27 Juergen Vigna <jug@sad.it>
3617 * various files: remove "default" language check.
3619 * src/insets/insetquotes.C: removed use of current_view.
3621 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3622 the one should have red ears by now!
3624 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3625 in more then one paragraph. Fixed cursor-movement/selection.
3627 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3628 paragraphs inside a text inset.
3630 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3631 text-inset if this owner is an inset.
3633 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3635 * src/Bullet.h: changed type of font, character and size to int
3637 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3639 * src/insets/inseturl.[Ch]:
3640 * src/insets/insetref.[Ch]:
3641 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3643 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3645 * src/buffer.C (readFile): block-if statement rearranged to minimise
3646 bloat. Patch does not reverse Jean-Marc's change ;-)
3648 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3649 Class rewritten to store pointers to hide/update signals directly,
3650 rather than Dialogs *. Also defined an enum to ease use. All xforms
3651 forms can now be derived from this class.
3653 * src/frontends/xforms/FormCommand.[Ch]
3654 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3656 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3659 * src/frontends/xforms/forms/form_citation.fd
3660 * src/frontends/xforms/forms/form_copyright.fd
3661 * src/frontends/xforms/forms/form_error.fd
3662 * src/frontends/xforms/forms/form_index.fd
3663 * src/frontends/xforms/forms/form_ref.fd
3664 * src/frontends/xforms/forms/form_toc.fd
3665 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3667 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3669 * src/insets/insetfoot.C: removed redundent using directive.
3671 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3673 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3674 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3676 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3677 created in the constructors in different groups. Then set() just
3678 have to show the groups as needed. This fixes the redraw problems
3679 (and is how the old menu code worked).
3681 * src/support/lyxlib.h: declare the methods as static when we do
3682 not have namespaces.
3684 2000-09-26 Juergen Vigna <jug@sad.it>
3686 * src/buffer.C (asciiParagraph): new function.
3687 (writeFileAscii): new function with parameter ostream.
3688 (writeFileAscii): use now asciiParagraph.
3690 * various inset files: added the linelen parameter to the Ascii-func.
3692 * src/tabular.C (Write): fixed error in writing file introduced by
3693 the last changes from Lars.
3695 * lib/bind/menus.bind: removed not supported functions.
3697 * src/insets/insettext.C (Ascii): implemented this function.
3699 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3701 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3702 (Write): use of the write_attribute functions.
3704 * src/bufferlist.C (close): fixed reasking question!
3706 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3708 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3709 new files use the everwhere possible.
3712 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3713 src/log_form.C src/lyx.C:
3716 * src/buffer.C (runLaTeX): remove func
3718 * src/PaperLayout.C: removed file
3719 * src/ParagraphExtra.C: likewise
3720 * src/bullet_forms.C: likewise
3721 * src/bullet_forms.h: likewise
3722 * src/bullet_forms_cb.C: likewise
3724 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3725 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3728 * several files: remove all traces of the old fd_form_paragraph,
3729 and functions belonging to that.
3731 * several files: remove all traces of the old fd_form_document,
3732 and functions belonging to that.
3734 * several files: constify local variables were possible.
3736 * several files: remove all code that was dead when NEW_EXPORT was
3739 * several files: removed string::c_str in as many places as
3742 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3743 (e): be a bit more outspoken when patching
3744 (updatesrc): only move files if changed.
3746 * forms/layout_forms.h.patch: regenerated
3748 * forms/layout_forms.fd: remove form_document and form_paragraph
3749 and form_quotes and form_paper and form_table_options and
3750 form_paragraph_extra
3752 * forms/form1.fd: remove form_table
3754 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3755 the fdui->... rewrite. Update some comments to xforms 0.88
3757 * forms/bullet_forms.C.patch: removed file
3758 * forms/bullet_forms.fd: likewise
3759 * forms/bullet_forms.h.patch: likewise
3761 * development/Code_rules/Rules: added a section on switch
3762 statements. Updated some comment to xforms 0.88.
3764 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3766 * src/buffer.C (readFile): make sure that the whole version number
3767 is read after \lyxformat (even when it contains a comma)
3769 * lib/ui/default.ui: change shortcut of math menu to M-a.
3771 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3773 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3776 * src/LyXView.C (updateWindowTitle): show the full files name in
3777 window title, limited to 30 characters.
3779 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3780 When a number of characters has been given, we should not assume
3781 that the string is 0-terminated.
3783 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3784 calls (fixes some memory leaks)
3786 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3787 trans member on exit.
3789 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3791 * src/converter.C (GetReachable): fix typo.
3793 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3794 understand ',' instead of '.'.
3795 (GetInteger): rewrite to use strToInt().
3797 2000-09-26 Juergen Vigna <jug@sad.it>
3799 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3800 better visibility and error-message on wrong VSpace input.
3802 * src/language.C (initL): added english again.
3804 2000-09-25 Juergen Vigna <jug@sad.it>
3806 * src/frontends/kde/Dialogs.C (Dialogs):
3807 * src/frontends/gnome/Dialogs.C (Dialogs):
3808 * src/frontends/kde/Makefile.am:
3809 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3811 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3813 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3815 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3817 * src/frontends/xforms/FormParagraph.C:
3818 * src/frontends/xforms/FormParagraph.h:
3819 * src/frontends/xforms/form_paragraph.C:
3820 * src/frontends/xforms/form_paragraph.h:
3821 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3824 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3826 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3827 Paragraph-Data after use.
3829 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3830 non breakable paragraphs.
3832 2000-09-25 Garst R. Reese <reese@isn.net>
3834 * src/language.C (initL): added missing language_country codes.
3836 2000-09-25 Juergen Vigna <jug@sad.it>
3838 * src/insets/insettext.C (InsetText):
3839 (deleteLyXText): remove the not released LyXText structure!
3841 2000-09-24 Marko Vendelin <markov@ioc.ee>
3843 * src/frontends/gnome/mainapp.C
3844 * src/frontends/gnome/mainapp.h: added support for keyboard
3847 * src/frontends/gnome/FormCitation.C
3848 * src/frontends/gnome/FormCitation.h
3849 * src/frontends/gnome/Makefile.am
3850 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3851 FormCitation to use "action area" in mainapp window
3853 * src/frontends/gnome/Menubar_pimpl.C
3854 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3857 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3859 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3860 width/descent/ascent values if name is empty.
3861 (mathed_string_height): Use std::max.
3863 2000-09-25 Allan Rae <rae@lyx.org>
3865 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3866 segfault. This will be completely redesigned soon.
3868 * sigc++: updated libsigc++. Fixes struct timespec bug.
3870 * development/tools/makeLyXsigc.sh: .cvsignore addition
3872 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3874 * several files: removed almost all traces of the old table
3877 * src/TableLayout.C: removed file
3879 2000-09-22 Juergen Vigna <jug@sad.it>
3881 * src/frontends/kde/Dialogs.C: added credits forms.
3883 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3885 * src/frontends/gnome/Dialogs.C: added some forms.
3887 * src/spellchecker.C (init_spell_checker): set language in pspell code
3888 (RunSpellChecker): some modifications for setting language string.
3890 * src/language.[Ch]: added language_country code.
3892 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3894 * src/frontends/Dialogs.h: added new signal showError.
3895 Rearranged existing signals in some sort of alphabetical order.
3897 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3898 FormError.[Ch], form_error.[Ch]
3899 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3900 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3902 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3903 dialogs. I think that this can be used as the base to all these
3906 * src/frontends/xforms/FormError.[Ch]
3907 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3908 implementation of InsetError dialog.
3910 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3912 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3913 * src/frontends/kde/Makefile.am: ditto
3915 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3917 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3918 macrobf. This fixes a bug of invisible text.
3920 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3922 * lib/doc/LaTeXConfig.lyx.in: updated.
3924 * src/language.C (initL): remove language "francais" and change a
3925 bit the names of the two other french variations.
3927 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3928 string that may not be 0-terminated.
3930 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3932 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3934 2000-09-20 Marko Vendelin <markov@ioc.ee>
3936 * src/frontends/gnome/FormCitation.C
3937 * src/frontends/gnome/FormIndex.C
3938 * src/frontends/gnome/FormToc.C
3939 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3940 the variable initialization to shut up the warnings
3942 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3944 * src/table.[Ch]: deleted files
3946 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3949 2000-09-18 Juergen Vigna <jug@sad.it>
3951 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3952 problems with selection. Inserted new LFUN_PASTESELECTION.
3953 (InsetButtonPress): inserted handling of middle mouse-button paste.
3955 * src/spellchecker.C: changed word to word.c_str().
3957 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3959 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3960 included in the ``make dist'' tarball.
3962 2000-09-15 Juergen Vigna <jug@sad.it>
3964 * src/CutAndPaste.C (cutSelection): small fix return the right
3965 end position after cut inside one paragraph only.
3967 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3968 we are locked as otherwise we don't have a valid cursor position!
3970 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3972 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3974 * src/frontends/kde/FormRef.C: added using directive.
3975 * src/frontends/kde/FormToc.C: ditto
3977 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3979 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3981 2000-09-19 Marko Vendelin <markov@ioc.ee>
3983 * src/frontends/gnome/Menubar_pimpl.C
3984 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3985 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3987 * src/frontends/gnome/mainapp.C
3988 * src/frontends/gnome/mainapp.h: support for menu update used
3991 * src/frontends/gnome/mainapp.C
3992 * src/frontends/gnome/mainapp.h: support for "action" area in the
3993 main window. This area is used by small simple dialogs, such as
3996 * src/frontends/gnome/FormIndex.C
3997 * src/frontends/gnome/FormIndex.h
3998 * src/frontends/gnome/FormUrl.C
3999 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4002 * src/frontends/gnome/FormCitation.C
4003 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4004 action area. Only "Insert new citation" is implemented.
4006 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/buffer.C (Dispatch): fix call to Dispatch
4009 * src/insets/insetref.C (Edit): likewise
4010 * src/insets/insetparent.C (Edit): likewise
4011 * src/insets/insetinclude.C (include_cb): likewise
4012 * src/frontends/xforms/FormUrl.C (apply): likewise
4013 * src/frontends/xforms/FormToc.C (apply): likewise
4014 * src/frontends/xforms/FormRef.C (apply): likewise
4015 * src/frontends/xforms/FormIndex.C (apply): likewise
4016 * src/frontends/xforms/FormCitation.C (apply): likewise
4017 * src/lyxserver.C (callback): likewise
4018 * src/lyxfunc.C (processKeySym): likewise
4019 (Dispatch): likewise
4020 (Dispatch): likewise
4021 * src/lyx_cb.C (LayoutsCB): likewise
4023 * Makefile.am (sourcedoc): small change
4025 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4027 * src/main.C (main): Don't make an empty GUIRunTime object. all
4028 methods are static. constify a bit remove unneded using + headers.
4030 * src/tabular.C: some more const to local vars move some loop vars
4032 * src/spellchecker.C: added some c_str after some word for pspell
4034 * src/frontends/GUIRunTime.h: add new static method setDefaults
4035 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4036 * src/frontends/kde/GUIRunTime.C (setDefaults):
4037 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4039 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4040 with strnew in arg, use correct emptystring when calling SetName.
4042 * several files: remove all commented code with relation to
4043 HAVE_SSTREAM beeing false. We now only support stringstream and
4046 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4048 * src/lyxfunc.C: construct correctly the automatic new file
4051 * src/text2.C (IsStringInText): change type of variable i to shut
4054 * src/support/sstream.h: do not use namespaces if the compiler
4055 does not support them.
4057 2000-09-15 Marko Vendelin <markov@ioc.ee>
4058 * src/frontends/gnome/FormCitation.C
4059 * src/frontends/gnome/FormCitation.h
4060 * src/frontends/gnome/diainsertcitation_interface.c
4061 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4062 regexp support to FormCitation [Gnome].
4064 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4067 * configure.in: remove unused KDE/GTKGUI define
4069 * src/frontends/kde/FormRef.C
4070 * src/frontends/kde/FormRef.h
4071 * src/frontends/kde/formrefdialog.C
4072 * src/frontends/kde/formrefdialog.h: double click will
4073 go to reference, now it is possible to change a cross-ref
4076 * src/frontends/kde/FormToc.C
4077 * src/frontends/kde/FormToc.h
4078 * src/frontends/kde/formtocdialog.C
4079 * src/frontends/kde/formtocdialog.h: add a depth
4082 * src/frontends/kde/Makefile.am: add QtLyXView.h
4085 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4087 * src/frontends/kde/FormCitation.h: added some using directives.
4089 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4091 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4094 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4097 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4099 * src/buffer.C (pop_tag): revert for the second time a change by
4100 Lars, who seems to really hate having non-local loop variables :)
4102 * src/Lsstream.h: add "using" statements.
4104 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4105 * src/buffer.C (writeFile): ditto
4107 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4109 * src/buffer.C (writeFile): try to fix the locale modified format
4110 number to always be as we want it.
4112 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4113 in XForms 0.89. C-space is now working again.
4115 * src/Lsstream.h src/support/sstream.h: new files.
4117 * also commented out all cases where strstream were used.
4119 * src/Bullet.h (c_str): remove method.
4121 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4123 * a lot of files: get rid of "char const *" and "char *" is as
4124 many places as possible. We only want to use them in interaction
4125 with system of other libraries, not inside lyx.
4127 * a lot of files: return const object is not of pod type. This
4128 helps ensure that temporary objects is not modified. And fits well
4129 with "programming by contract".
4131 * configure.in: check for the locale header too
4133 * Makefile.am (sourcedoc): new tag for generation of doc++
4136 2000-09-14 Juergen Vigna <jug@sad.it>
4138 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4139 callback to check which combo called it and do the right action.
4141 * src/combox.C (combo_cb): added combo * to the callbacks.
4142 (Hide): moved call of callback after Ungrab of the pointer.
4144 * src/intl.h: removed LCombo2 function.
4146 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4147 function as this can now be handled in one function.
4149 * src/combox.h: added Combox * to callback prototype.
4151 * src/frontends/xforms/Toolbar_pimpl.C:
4152 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4154 2000-09-14 Garst Reese <reese@isn.net>
4156 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4157 moved usepackage{xxx}'s to beginning of file. Changed left margin
4158 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4159 underlining from title. Thanks to John Culleton for useful suggestions.
4161 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4163 * src/lyxlex_pimpl.C (setFile): change error message to debug
4166 2000-09-13 Juergen Vigna <jug@sad.it>
4168 * src/frontends/xforms/FormDocument.C: implemented choice_class
4169 as combox and give callback to combo_language so OK/Apply is activated
4172 * src/bufferlist.C (newFile): small fix so already named files
4173 (via an open call) are not requested to be named again on the
4176 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4178 * src/frontends/kde/Makefile.am
4179 * src/frontends/kde/FormRef.C
4180 * src/frontends/kde/FormRef.h
4181 * src/frontends/kde/formrefdialog.C
4182 * src/frontends/kde/formrefdialog.h: implement
4185 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4187 * src/frontends/kde/formtocdialog.C
4188 * src/frontends/kde/formtocdialog.h
4189 * src/frontends/kde/FormToc.C
4190 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4192 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4194 * src/frontends/kde/FormCitation.C: fix thinko
4195 where we didn't always display the reference text
4198 * src/frontends/kde/formurldialog.C
4199 * src/frontends/kde/formurldialog.h
4200 * src/frontends/kde/FormUrl.C
4201 * src/frontends/kde/FormUrl.h: minor cleanups
4203 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4205 * src/frontends/kde/Makefile.am
4206 * src/frontends/kde/FormToc.C
4207 * src/frontends/kde/FormToc.h
4208 * src/frontends/kde/FormCitation.C
4209 * src/frontends/kde/FormCitation.h
4210 * src/frontends/kde/FormIndex.C
4211 * src/frontends/kde/FormIndex.h
4212 * src/frontends/kde/formtocdialog.C
4213 * src/frontends/kde/formtocdialog.h
4214 * src/frontends/kde/formcitationdialog.C
4215 * src/frontends/kde/formcitationdialog.h
4216 * src/frontends/kde/formindexdialog.C
4217 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4219 2000-09-12 Juergen Vigna <jug@sad.it>
4221 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4224 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4226 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4229 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4231 * src/converter.C (Add, Convert): Added support for converter flags:
4232 needaux, resultdir, resultfile.
4233 (Convert): Added new parameter view_file.
4234 (dvips_options): Fixed letter paper option.
4236 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4237 (Export, GetExportableFormats, GetViewableFormats): Added support
4240 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4242 (easyParse): Fixed to work with new export code.
4244 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4247 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4249 * lib/bind/*.bind: Replaced
4250 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4251 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4253 2000-09-11 Juergen Vigna <jug@sad.it>
4255 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4257 * src/main.C (main): now GUII defines global guiruntime!
4259 * src/frontends/gnome/GUIRunTime.C (initApplication):
4260 * src/frontends/kde/GUIRunTime.C (initApplication):
4261 * src/frontends/xforms/GUIRunTime.C (initApplication):
4262 * src/frontends/GUIRunTime.h: added new function initApplication.
4264 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4266 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4268 2000-09-08 Juergen Vigna <jug@sad.it>
4270 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4271 we have already "Reset".
4273 * src/language.C (initL): inserted "default" language and made this
4274 THE default language (and not american!)
4276 * src/paragraph.C: inserted handling of "default" language!
4278 * src/lyxfont.C: ditto
4282 * src/paragraph.C: output the \\par only if we have a following
4283 paragraph otherwise it's not needed.
4285 2000-09-05 Juergen Vigna <jug@sad.it>
4287 * config/pspell.m4: added entry to lyx-flags
4289 * src/spellchecker.C: modified version from Kevin for using pspell
4291 2000-09-01 Marko Vendelin <markov@ioc.ee>
4292 * src/frontends/gnome/Makefile.am
4293 * src/frontends/gnome/FormCitation.C
4294 * src/frontends/gnome/FormCitation.h
4295 * src/frontends/gnome/diainsertcitation_callbacks.c
4296 * src/frontends/gnome/diainsertcitation_callbacks.h
4297 * src/frontends/gnome/diainsertcitation_interface.c
4298 * src/frontends/gnome/diainsertcitation_interface.h
4299 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4300 dialog for Gnome frontend
4302 * src/main.C: Gnome libraries require keeping application name
4303 and its version as strings
4305 * src/frontends/gnome/mainapp.C: Change the name of the main window
4306 from GnomeLyX to PACKAGE
4308 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4310 * src/frontends/Liason.C: add "using: declaration.
4312 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4314 * src/mathed/math_macro.C (Metrics): Set the size of the template
4316 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4318 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4320 * src/converter.C (add_options): New function.
4321 (SetViewer): Change $$FName into '$$FName'.
4322 (View): Add options when running xdvi
4323 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4324 (Convert): The 3rd parameter is now the desired filename. Converts
4325 calls to lyx::rename if necessary.
4326 Add options when running dvips.
4327 (dvi_papersize,dvips_options): New methods.
4329 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4331 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4332 using a call to Converter::dvips_options.
4333 Fixed to work with nex export code.
4335 * src/support/copy.C
4336 * src/support/rename.C: New files
4338 * src/support/syscall.h
4339 * src/support/syscall.C: Added Starttype SystemDontWait.
4341 * lib/ui/default.ui: Changed to work with new export code
4343 * lib/configure.m4: Changed to work with new export code
4345 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4347 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4349 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4350 so that code compiles with DEC cxx.
4352 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4353 to work correctly! Also now supports the additional elements
4356 2000-09-01 Allan Rae <rae@lyx.org>
4358 * src/frontends/ButtonPolicies.C: renamed all the references to
4359 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4361 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4362 since it's a const not a type.
4364 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4366 2000-08-31 Juergen Vigna <jug@sad.it>
4368 * src/insets/figinset.C: Various changes to look if the filename has
4369 an extension and if not add it for inline previewing.
4371 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4373 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4374 make buttonStatus and isReadOnly be const methods. (also reflect
4375 this in derived classes.)
4377 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4378 (nextState): change to be static inline, pass the StateMachine as
4380 (PreferencesPolicy): remove casts
4381 (OkCancelPolicy): remvoe casts
4382 (OkCancelReadOnlyPolicy): remove casts
4383 (NoRepeatedApplyReadOnlyPolicy): remove casts
4384 (OkApplyCancelReadOnlyPolicy): remove casts
4385 (OkApplyCancelPolicy): remove casts
4386 (NoRepeatedApplyPolicy): remove casts
4388 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4390 * src/converter.C: added some using directives
4392 * src/frontends/ButtonPolicies.C: changes to overcome
4393 "need lvalue" error with DEC c++
4395 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4396 to WMHideCB for DEC c++
4398 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4400 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4401 to BulletBMTableCB for DEC c++
4403 2000-08-31 Allan Rae <rae@lyx.org>
4405 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4406 character dialog separately from old document dialogs combo_language.
4409 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4411 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4412 Removed LFUN_REF_CREATE.
4414 * src/MenuBackend.C: Added new tags: toc and references
4416 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4417 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4419 (add_toc, add_references): New methods.
4420 (create_submenu): Handle correctly the case when there is a
4421 seperator after optional menu items.
4423 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4424 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4425 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4427 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4429 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4431 * src/converter.[Ch]: New file for converting between different
4434 * src/export.[Ch]: New file for exporting a LyX file to different
4437 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4438 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4439 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4440 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4441 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4442 RunDocBook, MenuExport.
4444 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4445 Exporter::Preview methods if NEW_EXPORT is defined.
4447 * src/buffer.C (Dispatch): Use Exporter::Export.
4449 * src/lyxrc.C: Added new tags: \converter and \viewer.
4452 * src/LyXAction.C: Define new lyx-function: buffer-update.
4453 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4454 when NEW_EXPORT is defined.
4456 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4458 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4460 * lib/ui/default.ui: Added submenus "view" and "update" to the
4463 * src/filetools.C (GetExtension): New function.
4465 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4467 2000-08-29 Allan Rae <rae@lyx.org>
4469 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4471 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4472 (EnableDocumentLayout): removed
4473 (DisableDocumentLayout): removed
4474 (build): make use of ButtonController's read-only handling to
4475 de/activate various objects. Replaces both of the above functions.
4477 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4478 (readOnly): was read_only
4479 (refresh): fixed dumb mistakes with read_only_ handling
4481 * src/frontends/xforms/forms/form_document.fd:
4482 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4483 tabbed dialogs so the tabs look more like tabs and so its easier to
4484 work out which is the current tab.
4486 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4487 segfault with form_table
4489 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4491 2000-08-28 Juergen Vigna <jug@sad.it>
4493 * acconfig.h: added USE_PSPELL.
4495 * src/config.h.in: added USE_PSPELL.
4497 * autogen.sh: added pspell.m4
4499 * config/pspell.m4: new file.
4501 * src/spellchecker.C: implemented support for pspell libary.
4503 2000-08-25 Juergen Vigna <jug@sad.it>
4505 * src/LyXAction.C (init): renamed LFUN_TABLE to
4506 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4508 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4510 * src/lyxscreen.h: add force_clear variable and fuction to force
4511 a clear area when redrawing in LyXText.
4513 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4515 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4517 * some whitespace and comment changes.
4519 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4521 * src/buffer.C: up te LYX_FORMAT to 2.17
4523 2000-08-23 Juergen Vigna <jug@sad.it>
4525 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4528 * src/insets/insettabular.C (pasteSelection): delete the insets
4529 LyXText as it is not valid anymore.
4530 (copySelection): new function.
4531 (pasteSelection): new function.
4532 (cutSelection): new function.
4533 (LocalDispatch): implemented cut/copy/paste of cell selections.
4535 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4536 don't have a LyXText.
4538 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4540 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4543 2000-08-22 Juergen Vigna <jug@sad.it>
4545 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4546 ifdef form_table out if NEW_TABULAR.
4548 2000-08-21 Juergen Vigna <jug@sad.it>
4550 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4551 (draw): fixed draw position so that the cursor is positioned in the
4553 (InsetMotionNotify): hide/show cursor so the position is updated.
4554 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4555 using cellstart() function where it should be used.
4557 * src/insets/insettext.C (draw): ditto.
4559 * src/tabular.C: fixed initialization of some missing variables and
4560 made BoxType into an enum.
4562 2000-08-22 Marko Vendelin <markov@ioc.ee>
4563 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4564 stock menu item using action numerical value, not its string
4568 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4570 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4571 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4573 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4575 * src/frontends/xforms/GUIRunTime.C: new file
4577 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4578 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4580 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4582 * src/frontends/kde/GUIRunTime.C: new file
4584 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4585 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4587 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4589 * src/frontends/gnome/GUIRunTime.C: new file
4591 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4594 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4595 small change to documetentation.
4597 * src/frontends/GUIRunTime.C: removed file
4599 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4601 * src/lyxparagraph.h: enable NEW_TABULAR as default
4603 * src/lyxfunc.C (processKeySym): remove some commented code
4605 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4606 NEW_TABULAR around the fd_form_table_options.
4608 * src/lyx_gui.C (runTime): call the static member function as
4609 GUIRunTime::runTime().
4611 2000-08-21 Allan Rae <rae@lyx.org>
4613 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4616 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4618 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4620 2000-08-21 Allan Rae <rae@lyx.org>
4622 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4623 keep Garst happy ;-)
4624 * src/frontends/xforms/FormPreferences.C (build): use setOK
4625 * src/frontends/xforms/FormDocument.C (build): use setOK
4626 (FormDocument): use the appropriate policy.
4628 2000-08-21 Allan Rae <rae@lyx.org>
4630 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4631 automatic [de]activation of arbitrary objects when in a read-only state.
4633 * src/frontends/ButtonPolicies.h: More documentation
4634 (isReadOnly): added to support the above.
4636 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4638 2000-08-18 Juergen Vigna <jug@sad.it>
4640 * src/insets/insettabular.C (getStatus): changed to return func_status.
4642 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4643 display toggle menu entries if they are.
4645 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4646 new document layout now.
4648 * src/lyxfunc.C: ditto
4650 * src/lyx_gui_misc.C: ditto
4652 * src/lyx_gui.C: ditto
4654 * lib/ui/default.ui: removed paper and quotes layout as they are now
4655 all in the document layout tabbed folder.
4657 * src/frontends/xforms/forms/form_document.fd: added Restore
4658 button and callbacks for all inputs for Allan's ButtonPolicy.
4660 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4661 (CheckChoiceClass): added missing params setting on class change.
4662 (UpdateLayoutDocument): added for updating the layout on params.
4663 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4664 (FormDocument): Implemented Allan's ButtonPolicy with the
4667 2000-08-17 Allan Rae <rae@lyx.org>
4669 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4670 so we can at least see the credits again.
4672 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4673 controller calls for the appropriate callbacks. Note that since Ok
4674 calls apply followed by cancel, and apply isn't a valid input for the
4675 APPLIED state, the bc_ calls have to be made in the static callback not
4676 within each of the real callbacks.
4678 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4679 (setOk): renamed from setOkay()
4681 2000-08-17 Juergen Vigna <jug@sad.it>
4683 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4684 in the implementation part.
4685 (composeUIInfo): don't show optional menu-items.
4687 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4689 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4691 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4692 text-state when in a text-inset.
4694 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4696 2000-08-17 Marko Vendelin <markov@ioc.ee>
4697 * src/frontends/gnome/FormIndex.C
4698 * src/frontends/gnome/FormIndex.h
4699 * src/frontends/gnome/FormToc.C
4700 * src/frontends/gnome/FormToc.h
4701 * src/frontends/gnome/dialogs
4702 * src/frontends/gnome/diatoc_callbacks.c
4703 * src/frontends/gnome/diatoc_callbacks.h
4704 * src/frontends/gnome/diainsertindex_callbacks.h
4705 * src/frontends/gnome/diainsertindex_callbacks.c
4706 * src/frontends/gnome/diainsertindex_interface.c
4707 * src/frontends/gnome/diainsertindex_interface.h
4708 * src/frontends/gnome/diatoc_interface.h
4709 * src/frontends/gnome/diatoc_interface.c
4710 * src/frontends/gnome/Makefile.am: Table of Contents and
4711 Insert Index dialogs implementation for Gnome frontend
4713 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4715 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4717 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4720 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4722 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4723 destructor. Don't definde if you don't need it
4724 (processEvents): made static, non-blocking events processing for
4726 (runTime): static method. event loop for xforms
4727 * similar as above for kde and gnome.
4729 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4730 new Pimpl is correct
4731 (runTime): new method calss the real frontends runtime func.
4733 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4735 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4737 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4739 2000-08-16 Juergen Vigna <jug@sad.it>
4741 * src/lyx_gui.C (runTime): added GUII RunTime support.
4743 * src/frontends/Makefile.am:
4744 * src/frontends/GUIRunTime.[Ch]:
4745 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4746 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4747 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4749 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4751 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4752 as this is already set in ${FRONTEND_INCLUDE} if needed.
4754 * configure.in (CPPFLAGS): setting the include dir for the frontend
4755 directory and don't set FRONTEND=xforms for now as this is executed
4758 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4760 * src/frontends/kde/Makefile.am:
4761 * src/frontends/kde/FormUrl.C:
4762 * src/frontends/kde/FormUrl.h:
4763 * src/frontends/kde/formurldialog.h:
4764 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4766 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4768 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4770 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4775 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4777 * src/WorkArea.C (work_area_handler): more work to get te
4778 FL_KEYBOARD to work with xforms 0.88 too, please test.
4780 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4782 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4784 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4787 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4789 * src/Timeout.h: remove Qt::emit hack.
4791 * several files: changes to allo doc++ compilation
4793 * src/lyxfunc.C (processKeySym): new method
4794 (processKeyEvent): comment out if FL_REVISION < 89
4796 * src/WorkArea.C: change some debugging levels.
4797 (WorkArea): set wantkey to FL_KEY_ALL
4798 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4799 clearer code and the use of compose with XForms 0.89. Change to
4800 use signals instead of calling methods in bufferview directly.
4802 * src/Painter.C: change some debugging levels.
4804 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4807 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4808 (workAreaKeyPress): new method
4810 2000-08-14 Juergen Vigna <jug@sad.it>
4812 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4814 * config/kde.m4: addes some features
4816 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4817 include missing xforms dialogs.
4819 * src/Timeout.h: a hack to be able to compile with qt/kde.
4821 * sigc++/.cvsignore: added acinclude.m4
4823 * lib/.cvsignore: added listerros
4825 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4826 xforms tree as objects are needed for other frontends.
4828 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4829 linking with not yet implemented xforms objects.
4831 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4833 2000-08-14 Baruch Even <baruch.even@writeme.com>
4835 * src/frontends/xforms/FormGraphics.h:
4836 * src/frontends/xforms/FormGraphics.C:
4837 * src/frontends/xforms/RadioButtonGroup.h:
4838 * src/frontends/xforms/RadioButtonGroup.C:
4839 * src/insets/insetgraphics.h:
4840 * src/insets/insetgraphics.C:
4841 * src/insets/insetgraphicsParams.h:
4842 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4843 instead of spaces, and various other indentation issues to make the
4844 sources more consistent.
4846 2000-08-14 Marko Vendelin <markov@ioc.ee>
4848 * src/frontends/gnome/dialogs/diaprint.glade
4849 * src/frontends/gnome/FormPrint.C
4850 * src/frontends/gnome/FormPrint.h
4851 * src/frontends/gnome/diaprint_callbacks.c
4852 * src/frontends/gnome/diaprint_callbacks.h
4853 * src/frontends/gnome/diaprint_interface.c
4854 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4857 * src/frontends/gnome/dialogs/diainserturl.glade
4858 * src/frontends/gnome/FormUrl.C
4859 * src/frontends/gnome/FormUrl.h
4860 * src/frontends/gnome/diainserturl_callbacks.c
4861 * src/frontends/gnome/diainserturl_callbacks.h
4862 * src/frontends/gnome/diainserturl_interface.c
4863 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4864 Gnome implementation
4866 * src/frontends/gnome/Dialogs.C
4867 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4868 all other dialogs. Copy all unimplemented dialogs from Xforms
4871 * src/frontends/gnome/support.c
4872 * src/frontends/gnome/support.h: support files generated by Glade
4876 * config/gnome.m4: Gnome configuration scripts
4878 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4879 configure --help message
4881 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4882 only if there are no events pendling in Gnome/Gtk. This enhances
4883 the performance of menus.
4886 2000-08-14 Allan Rae <rae@lyx.org>
4888 * lib/Makefile.am: listerrors cleaning
4890 * lib/listerrors: removed -- generated file
4891 * acinclude.m4: ditto
4892 * sigc++/acinclude.m4: ditto
4894 * src/frontends/xforms/forms/form_citation.fd:
4895 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4898 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4899 `updatesrc` and now we have a `test` target that does what `updatesrc`
4900 used to do. I didn't like having an install target that wasn't related
4903 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4904 on all except FormGraphics. This may yet happen. Followed by a major
4905 cleanup including using FL_TRANSIENT for most of the dialogs. More
4906 changes to come when the ButtonController below is introduced.
4908 * src/frontends/xforms/ButtonController.h: New file for managing up to
4909 four buttons on a dialog according to an externally defined policy.
4910 * src/frontends/xforms/Makefile.am: added above
4912 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4913 Apply and Cancel/Close buttons and everything in between and beyond.
4914 * src/frontends/Makefile.am: added above.
4916 * src/frontends/xforms/forms/form_preferences.fd:
4917 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4918 and removed variable 'status' as a result. Fixed the set_minsize thing.
4919 Use the new screen-font-update after checking screen fonts were changed
4920 Added a "Restore" button to restore the original lyxrc values while
4921 editing. This restores everything not just the last input changed.
4922 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4924 * src/LyXAction.C: screen-font-update added for updating buffers after
4925 screen font settings have been changed.
4926 * src/commandtags.h: ditto
4927 * src/lyxfunc.C: ditto
4929 * forms/lyx.fd: removed screen fonts dialog.
4930 * src/lyx_gui.C: ditto
4931 * src/menus.[Ch]: ditto
4932 * src/lyx.[Ch]: ditto
4933 * src/lyx_cb.C: ditto + code from here moved to make
4934 screen-font-update. And people wonder why progress on GUII is
4935 slow. Look at how scattered this stuff was! It takes forever
4938 * forms/fdfix.sh: Fixup the spacing after commas.
4939 * forms/makefile: Remove date from generated files. Fewer clashes now.
4940 * forms/bullet_forms.C.patch: included someones handwritten changes
4942 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4943 once I've discovered why LyXRC was made noncopyable.
4944 * src/lyx_main.C: ditto
4946 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4948 * src/frontends/xforms/forms/fdfix.sh:
4949 * src/frontends/xforms/forms/fdfixh.sed:
4950 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4951 * src/frontends/xforms/Form*.[hC]:
4952 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4953 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4954 provide a destructor for the struct FD_form_xxxx. Another version of
4955 the set_[max|min]size workaround and a few other cleanups. Actually,
4956 Angus' patch from 20000809.
4958 2000-08-13 Baruch Even <baruch.even@writeme.com>
4960 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4963 2000-08-11 Juergen Vigna <jug@sad.it>
4965 * src/insets/insetgraphics.C (InsetGraphics): changing init
4966 order because of warnings.
4968 * src/frontends/xforms/forms/makefile: adding patching .C with
4971 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4972 from .C.patch to .c.patch
4974 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4975 order because of warning.
4977 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4979 * src/frontends/Liason.C (setMinibuffer): new helper function
4981 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4983 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4985 * lib/ui/default.ui: commented out PaperLayout entry
4987 * src/frontends/xforms/form_document.[Ch]: new added files
4989 * src/frontends/xforms/FormDocument.[Ch]: ditto
4991 * src/frontends/xforms/forms/form_document.fd: ditto
4993 * src/frontends/xforms/forms/form_document.C.patch: ditto
4995 2000-08-10 Juergen Vigna <jug@sad.it>
4997 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4998 (InsetGraphics): initialized cacheHandle to 0.
4999 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5001 2000-08-10 Baruch Even <baruch.even@writeme.com>
5003 * src/graphics/GraphicsCache.h:
5004 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5005 correctly as a cache.
5007 * src/graphics/GraphicsCacheItem.h:
5008 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5011 * src/graphics/GraphicsCacheItem_pimpl.h:
5012 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5015 * src/insets/insetgraphics.h:
5016 * src/insets/insetgraphics.C: Changed from using a signal notification
5017 to polling when image is not loaded.
5019 2000-08-10 Allan Rae <rae@lyx.org>
5021 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5022 that there are two functions that have to been taken out of line by
5023 hand and aren't taken care of in the script. (Just a reminder note)
5025 * sigc++/macros/*.h.m4: Updated as above.
5027 2000-08-09 Juergen Vigna <jug@sad.it>
5029 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5031 * src/insets/insettabular.C: make drawing of single cell smarter.
5033 2000-08-09 Marko Vendelin <markov@ioc.ee>
5034 * src/frontends/gnome/Menubar_pimpl.C
5035 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5036 implementation: new files
5038 * src/frontends/gnome/mainapp.C
5039 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5042 * src/main.C: create Gnome main window
5044 * src/frontends/xforms/Menubar_pimpl.h
5045 * src/frontends/Menubar.C
5046 * src/frontends/Menubar.h: added method Menubar::update that calls
5047 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5049 * src/LyXView.C: calls Menubar::update to update the state
5052 * src/frontends/gnome/Makefile.am: added new files
5054 * src/frontends/Makefile.am: added frontend compiler options
5056 2000-08-08 Juergen Vigna <jug@sad.it>
5058 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5060 * src/bufferlist.C (close):
5061 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5062 documents if exiting without saving.
5064 * src/buffer.C (save): use removeAutosaveFile()
5066 * src/support/filetools.C (removeAutosaveFile): new function.
5068 * src/lyx_cb.C (MenuWrite): returns a bool now.
5069 (MenuWriteAs): check if file could really be saved and revert to the
5071 (MenuWriteAs): removing old autosavefile if existant.
5073 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5074 before Goto toggle declaration, because of compiler warning.
5076 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5078 * src/lyxfunc.C (MenuNew): small fix.
5080 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5082 * src/bufferlist.C (newFile):
5083 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5085 * src/lyxrc.C: added new_ask_filename tag
5087 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5089 * src/lyx.fd: removed code pertaining to form_ref
5090 * src/lyx.[Ch]: ditto
5091 * src/lyx_cb.C: ditto
5092 * src/lyx_gui.C: ditto
5093 * src/lyx_gui_misc.C: ditto
5095 * src/BufferView_pimpl.C (restorePosition): update buffer only
5098 * src/commandtags.h (LFUN_REFTOGGLE): removed
5099 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5100 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5101 (LFUN_REFBACK): renamed LFUN_REF_BACK
5103 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5104 * src/menus.C: ditto
5105 * src/lyxfunc.C (Dispatch): ditto.
5106 InsertRef dialog is now GUI-independent.
5108 * src/texrow.C: added using std::endl;
5110 * src/insets/insetref.[Ch]: strip out large amounts of code.
5111 The inset is now a container and this functionality is now
5112 managed by a new FormRef dialog
5114 * src/frontends/Dialogs.h (showRef, createRef): new signals
5116 * src/frontends/xforms/FormIndex.[Ch],
5117 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5118 when setting dialog's min/max size
5119 * src/frontends/xforms/FormIndex.[Ch]: ditto
5121 * src/frontends/xforms/FormRef.[Ch],
5122 src/frontends/xforms/forms/form_ref.fd: new xforms
5123 implementation of an InsetRef dialog
5125 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5128 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5129 ios::nocreate is not part of the standard. Removed.
5131 2000-08-07 Baruch Even <baruch.even@writeme.com>
5133 * src/graphics/Renderer.h:
5134 * src/graphics/Renderer.C: Added base class for rendering of different
5135 image formats into Pixmaps.
5137 * src/graphics/XPM_Renderer.h:
5138 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5139 in a different class.
5141 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5142 easily add support for other formats.
5144 * src/insets/figinset.C: plugged a leak of an X resource.
5146 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5148 * src/CutAndPaste.[Ch]: make all metods static.
5150 * development/Code_rules/Rules: more work, added section on
5151 Exceptions, and a References section.
5153 * a lot of header files: work to make doc++ able to generate the
5154 source documentation, some workarounds of doc++ problems. Doc++ is
5155 now able to generate the documentation.
5157 2000-08-07 Juergen Vigna <jug@sad.it>
5159 * src/insets/insettabular.C (recomputeTextInsets): removed function
5161 * src/tabular.C (SetWidthOfMulticolCell):
5163 (calculate_width_of_column_NMC): fixed return value so that it really
5164 only returns true if the column-width has changed (there where
5165 problems with muliticolumn-cells in this column).
5167 2000-08-04 Juergen Vigna <jug@sad.it>
5169 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5170 also on the scrollstatus of the inset.
5171 (workAreaMotionNotify): ditto.
5173 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5175 2000-08-01 Juergen Vigna <jug@sad.it>
5177 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5179 * src/commandtags.h:
5180 * src/LyXAction.C (init):
5181 * src/insets/inset.C (LocalDispatch): added support for
5184 * src/insets/inset.C (scroll): new functions.
5186 * src/insets/insettext.C (removeNewlines): new function.
5187 (SetAutoBreakRows): removes forced newlines in the text of the
5188 paragraph if autoBreakRows is set to false.
5190 * src/tabular.C (Latex): generates a parbox around the cell contents
5193 * src/frontends/xforms/FormTabular.C (local_update): removed
5194 the radio_useparbox button.
5196 * src/tabular.C (UseParbox): new function
5198 2000-08-06 Baruch Even <baruch.even@writeme.com>
5200 * src/graphics/GraphicsCache.h:
5201 * src/graphics/GraphicsCache.C:
5202 * src/graphics/GraphicsCacheItem.h:
5203 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5206 * src/insets/insetgraphics.h:
5207 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5208 and the drawing of the inline image.
5210 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5211 loaded into the wrong position.
5213 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5216 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5218 * src/support/translator.h: move all typedefs to public section
5220 * src/support/filetools.C (MakeLatexName): return string const
5222 (TmpFileName): ditto
5223 (FileOpenSearch): ditto
5225 (LibFileSearch): ditto
5226 (i18nLibFileSearch): ditto
5229 (CreateTmpDir): ditto
5230 (CreateBufferTmpDir): ditto
5231 (CreateLyXTmpDir): ditto
5234 (MakeAbsPath): ditto
5236 (OnlyFilename): ditto
5238 (NormalizePath): ditto
5239 (CleanupPath): ditto
5240 (GetFileContents): ditto
5241 (ReplaceEnvironmentPath): ditto
5242 (MakeRelPath): ditto
5244 (ChangeExtension): ditto
5245 (MakeDisplayPath): ditto
5246 (do_popen): return cmdret const
5247 (findtexfile): return string const
5249 * src/support/DebugStream.h: add some /// to please doc++
5251 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5253 * src/texrow.C (same_rownumber): functor to use with find_if
5254 (getIdFromRow): rewritten to use find_if and to not update the
5255 positions. return true if row is found
5256 (increasePos): new method, use to update positions
5258 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5260 * src/lyxlex_pimpl.C (verifyTable): new method
5263 (GetString): return string const
5264 (pushTable): rewrite to use std::stack
5266 (setFile): better check
5269 * src/lyxlex.h: make LyXLex noncopyable
5271 * src/lyxlex.C (text): return char const * const
5272 (GetString): return string const
5273 (getLongString): return string const
5275 * src/lyx_gui_misc.C (askForText): return pair<...> const
5277 * src/lastfiles.[Ch] (operator): return string const
5279 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5280 istringstream not char const *.
5281 move token.end() out of loop.
5282 (readFile): move initializaton of token
5284 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5285 getIdFromRow is successful.
5287 * lib/bind/emacs.bind: don't include menus bind
5289 * development/Code_rules/Rules: the beginnings of making this
5290 better and covering more of the unwritten rules that we have.
5292 * development/Code_rules/Recommendations: a couple of wording
5295 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5297 * src/support/strerror.c: remove C++ comment.
5299 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5301 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5302 LFUN_INDEX_INSERT_LAST
5304 * src/texrow.C (getIdFromRow): changed from const_iterator to
5305 iterator, allowing code to compile with DEC cxx
5307 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5308 stores part of the class, as suggested by Allan. Will allow
5310 (apply): test to apply uses InsetCommandParams operator!=
5312 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5313 (apply): test to apply uses InsetCommandParams operator!=
5315 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5316 stores part of the class.
5317 (update): removed limits on min/max size.
5319 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5320 (apply): test to apply uses InsetCommandParams operator!=
5322 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5323 (Read, Write, scanCommand, getCommand): moved functionality
5324 into InsetCommandParams.
5326 (getScreenLabel): made pure virtual
5327 new InsetCommandParams operators== and !=
5329 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5330 c-tors based on InsetCommandParams. Removed others.
5331 * src/insets/insetinclude.[Ch]: ditto
5332 * src/insets/insetlabel.[Ch]: ditto
5333 * src/insets/insetparent.[Ch]: ditto
5334 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5336 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5337 insets derived from InsetCommand created using similar c-tors
5338 based on InsetCommandParams
5339 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5340 * src/menus.C (ShowRefsMenu): ditto
5341 * src/paragraph.C (Clone): ditto
5342 * src/text2.C (SetCounter): ditto
5343 * src/lyxfunc.C (Dispatch) ditto
5344 Also recreated old InsetIndex behaviour exactly. Can now
5345 index-insert at the start of a paragraph and index-insert-last
5346 without launching the pop-up.
5348 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5350 * lib/lyxrc.example: mark te pdf options as non functional.
5352 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5353 (isStrDbl): move tmpstr.end() out of loop.
5354 (strToDbl): move intialization of tmpstr
5355 (lowercase): return string const and move tmp.end() out of loop.
5356 (uppercase): return string const and move tmp.edn() out of loop.
5357 (prefixIs): add assertion
5362 (containsOnly): ditto
5363 (containsOnly): ditto
5364 (containsOnly): ditto
5365 (countChar): make last arg char not char const
5366 (token): return string const
5367 (subst): return string const, move tmp.end() out of loop.
5368 (subst): return string const, add assertion
5369 (strip): return string const
5370 (frontStrip): return string const, add assertion
5371 (frontStrip): return string const
5376 * src/support/lstrings.C: add inclde "LAssert.h"
5377 (isStrInt): move tmpstr.end() out of loop.
5379 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5380 toollist.end() out of loop.
5381 (deactivate): move toollist.end() out of loop.
5382 (update): move toollist.end() out of loop.
5383 (updateLayoutList): move tc.end() out of loop.
5384 (add): move toollist.end() out of loop.
5386 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5387 md.end() out of loop.
5389 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5391 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5394 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5395 (Erase): move insetlist.end() out of loop.
5397 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5398 ref to const string as first arg. Move initialization of some
5399 variables, whitespace changes.
5401 * src/kbmap.C (defkey): move table.end() out of loop.
5402 (kb_keymap): move table.end() out of loop.
5403 (findbinding): move table.end() out of loop.
5405 * src/MenuBackend.C (hasMenu): move end() out of loop.
5406 (getMenu): move end() out of loop.
5407 (getMenu): move menulist_.end() out of loop.
5409 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5411 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5414 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5415 (getFromLyXName): move infotab.end() out of loop.
5417 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5418 -fvtable-thunks -ffunction-sections -fdata-sections
5420 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5422 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5425 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5427 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5429 * src/frontends/xforms/FormCitation.[Ch],
5430 src/frontends/xforms/FormIndex.[Ch],
5431 src/frontends/xforms/FormToc.[Ch],
5432 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5434 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5436 * src/commandtags.h: renamed, created some flags for citation
5439 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5441 * src/lyxfunc.C (dispatch): use signals to insert index entry
5443 * src/frontends/Dialogs.h: new signal createIndex
5445 * src/frontends/xforms/FormCommand.[Ch],
5446 src/frontends/xforms/FormCitation.[Ch],
5447 src/frontends/xforms/FormToc.[Ch],
5448 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5450 * src/insets/insetindex.[Ch]: GUI-independent
5452 * src/frontends/xforms/FormIndex.[Ch],
5453 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5456 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5458 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5459 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5461 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5463 * src/insets/insetref.C (Latex): rewrite so that there is now
5464 question that a initialization is requested.
5466 * src/insets/insetcommand.h: reenable the hide signal
5468 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5470 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5471 fix handling of shortcuts (many bugs :)
5472 (add_lastfiles): ditto.
5474 * lib/ui/default.ui: fix a few shortcuts.
5476 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5478 * Makefile.am: Fix ``rpmdist'' target to return the exit
5479 status of the ``rpm'' command, instead of the last command in
5480 the chain (the ``rm lyx.xpm'' command, which always returns
5483 2000-08-02 Allan Rae <rae@lyx.org>
5485 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5486 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5487 * src/frontends/xforms/FormToc.C (FormToc): ditto
5489 * src/frontends/xforms/Makefile.am: A few forgotten files
5491 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5492 Signals-not-copyable-problem Lars' started commenting out.
5494 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5496 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5498 * src/insets/insetcommand.h: Signals is not copyable so anoter
5499 scheme for automatic hiding of forms must be used.
5501 * src/frontends/xforms/FormCitation.h: don't inerit from
5502 noncopyable, FormCommand already does that.
5503 * src/frontends/xforms/FormToc.h: ditto
5504 * src/frontends/xforms/FormUrl.h: ditto
5506 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5508 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5510 * src/insets/insetcommand.h (hide): new SigC::Signal0
5511 (d-tor) new virtual destructor emits hide signal
5513 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5514 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5516 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5517 LOF and LOT. Inset is now GUI-independent
5519 * src/insets/insetloa.[Ch]: redundant
5520 * src/insets/insetlof.[Ch]: ditto
5521 * src/insets/insetlot.[Ch]: ditto
5523 * src/frontends/xforms/forms/form_url.fd: tweaked!
5524 * src/frontends/xforms/forms/form_citation.fd: ditto
5526 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5527 dialogs dealing with InsetCommand insets
5529 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5530 FormCommand base class
5531 * src/frontends/xforms/FormUrl.[Ch]: ditto
5533 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5535 * src/frontends/xforms/FormToc.[Ch]: ditto
5537 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5538 passed a generic InsetCommand pointer
5539 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5541 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5542 and modified InsetTOC class
5543 * src/buffer.C: ditto
5545 * forms/lyx.fd: strip out old FD_form_toc code
5546 * src/lyx_gui_misc.C: ditto
5547 * src/lyx_gui.C: ditto
5548 * src/lyx_cb.C: ditto
5549 * src/lyx.[Ch]: ditto
5551 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5553 * src/support/utility.hpp: tr -d '\r'
5555 2000-08-01 Juergen Vigna <jug@sad.it>
5557 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5559 * src/commandtags.h:
5560 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5561 LFUN_TABULAR_FEATURES.
5563 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5564 LFUN_LAYOUT_TABULAR.
5566 * src/insets/insettabular.C (getStatus): implemented helper function.
5568 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5570 2000-07-31 Juergen Vigna <jug@sad.it>
5572 * src/text.C (draw): fixed screen update problem for text-insets.
5574 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5575 something changed probably this has to be added in various other
5578 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5580 2000-07-31 Baruch Even <baruch.even@writeme.com>
5582 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5583 templates to satisfy compaq cxx.
5586 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5588 * src/support/translator.h (equal_1st_in_pair::operator()): take
5589 const ref pair_type as arg.
5590 (equal_2nd_in_pair::operator()): ditto
5591 (Translator::~Translator): remove empty d-tor.
5593 * src/graphics/GraphicsCache.C: move include config.h to top, also
5594 put initialization of GraphicsCache::singleton here.
5595 (~GraphicsCache): move here
5596 (addFile): take const ref as arg
5599 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5601 * src/BufferView2.C (insertLyXFile): change te with/without header
5604 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5606 * src/frontends/xforms/FormGraphics.C (apply): add some
5607 static_cast. Not very nice, but required by compaq cxx.
5609 * src/frontends/xforms/RadioButtonGroup.h: include header
5610 <utility> instead of <pair.h>
5612 * src/insets/insetgraphicsParams.C: add using directive.
5613 (readResize): change return type to void.
5614 (readOrigin): ditto.
5616 * src/lyxfunc.C (getStatus): add missing break for build-program
5617 function; add test for Literate for export functions.
5619 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5620 entries in Options menu.
5622 2000-07-31 Baruch Even <baruch.even@writeme.com>
5624 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5625 protect against auto-allocation; release icon when needed.
5627 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5629 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5630 on usual typewriter.
5632 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5633 earlier czech.kmap), useful only for programming.
5635 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * src/frontends/xforms/FormCitation.h: fix conditioning around
5640 2000-07-31 Juergen Vigna <jug@sad.it>
5642 * src/frontends/xforms/FormTabular.C (local_update): changed
5643 radio_linebreaks to radio_useparbox and added radio_useminipage.
5645 * src/tabular.C: made support for using minipages/parboxes.
5647 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5649 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5651 (descent): so the cursor is in the middle.
5652 (width): bit smaller box.
5654 * src/insets/insetgraphics.h: added display() function.
5656 2000-07-31 Baruch Even <baruch.even@writeme.com>
5658 * src/frontends/Dialogs.h: Added showGraphics signals.
5660 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5661 xforms form definition of the graphics dialog.
5663 * src/frontends/xforms/FormGraphics.h:
5664 * src/frontends/xforms/FormGraphics.C: Added files, the
5665 GUIndependent code of InsetGraphics
5667 * src/insets/insetgraphics.h:
5668 * src/insets/insetgraphics.C: Major writing to make it work.
5670 * src/insets/insetgraphicsParams.h:
5671 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5672 struct between InsetGraphics and GUI.
5674 * src/LaTeXFeatures.h:
5675 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5676 support for graphicx package.
5678 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5679 for the graphics inset.
5681 * src/support/translator.h: Added file, used in
5682 InsetGraphicsParams. this is a template to translate between two
5685 * src/frontends/xforms/RadioButtonGroup.h:
5686 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5687 way to easily control a radio button group.
5689 2000-07-28 Juergen Vigna <jug@sad.it>
5691 * src/insets/insettabular.C (LocalDispatch):
5692 (TabularFeatures): added support for lyx-functions of tabular features.
5693 (cellstart): refixed this function after someone wrongly changed it.
5695 * src/commandtags.h:
5696 * src/LyXAction.C (init): added support for tabular-features
5698 2000-07-28 Allan Rae <rae@lyx.org>
5700 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5701 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5702 triggers the callback for input checking. As a result we sometimes get
5703 "LyX: This shouldn't happen..." printed to cerr.
5704 (input): Started using status variable since I only free() on
5705 destruction. Some input checking for paths and font sizes.
5707 * src/frontends/xforms/FormPreferences.h: Use status to control
5708 activation of Ok and Apply
5710 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5711 callback. Also resized to stop segfaults with 0.88. The problem is
5712 that xforms-0.88 requires the folder to be wide enough to fit all the
5713 tabs. If it isn't it causes all sorts of problems.
5715 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5717 * src/frontends/xforms/forms/README: Reflect reality.
5719 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5720 * src/frontends/xforms/forms/makefile: ditto.
5722 * src/commandtags.h: Get access to new Preferences dialog
5723 * src/LyXAction.C: ditto
5724 * src/lyxfunc.C: ditto
5725 * lib/ui/default.ui: ditto
5727 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5729 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5731 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5734 * src/frontends/xforms/form_url.[Ch]: added.
5736 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5738 * src/insets/insetbib.h: fixed bug in previous commit
5740 * src/frontends/xforms/FormUrl.h: ditto
5742 * src/frontends/xforms/FormPrint.h: ditto
5744 * src/frontends/xforms/FormPreferences.h: ditto
5746 * src/frontends/xforms/FormCopyright.h: ditto
5748 * src/frontends/xforms/FormCitation.C: ditto
5750 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5751 private copyconstructor and private default contructor
5753 * src/support/Makefile.am: add utility.hpp
5755 * src/support/utility.hpp: new file from boost
5757 * src/insets/insetbib.h: set owner in clone
5759 * src/frontends/xforms/FormCitation.C: added missing include
5762 * src/insets/form_url.[Ch]: removed
5764 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5766 * development/lyx.spec.in
5767 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5768 file/directory re-organization.
5770 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5772 * src/insets/insetcommand.[Ch]: moved the string data and
5773 associated manipulation methods into a new stand-alone class
5774 InsetCommandParams. This class has two additional methods
5775 getAsString() and setFromString() allowing the contents to be
5776 moved around as a single string.
5777 (addContents) method removed.
5778 (setContents) method no longer virtual.
5780 * src/buffer.C (readInset): made use of new InsetCitation,
5781 InsetUrl constructors based on InsetCommandParams.
5783 * src/commandtags.h: add LFUN_INSERT_URL
5785 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5786 independent InsetUrl and use InsetCommandParams to extract
5787 string info and create new Insets.
5789 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5791 * src/frontends/xforms/FormCitation.C (apply): uses
5794 * src/frontends/xforms/form_url.C
5795 * src/frontends/xforms/form_url.h
5796 * src/frontends/xforms/FormUrl.h
5797 * src/frontends/xforms/FormUrl.C
5798 * src/frontends/xforms/forms/form_url.fd: new files
5800 * src/insets/insetcite.[Ch]: removed unused constructors.
5802 * src/insets/insetinclude.[Ch]: no longer store filename
5804 * src/insets/inseturl.[Ch]: GUI-independent.
5806 2000-07-26 Juergen Vigna <jug@sad.it>
5807 * renamed frontend from gtk to gnome as it is that what is realized
5808 and did the necessary changes in the files.
5810 2000-07-26 Marko Vendelin <markov@ioc.ee>
5812 * configure.in: cleaning up gnome configuration scripts
5814 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5816 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5817 shortcuts syndrom by redrawing them explicitely (a better solution
5818 would be appreciated).
5820 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5822 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5825 * src/lyx_cb.C (MenuExport): change html export to do the right
5826 thing depending of the document type (instead of having
5827 html-linuxdoc and html-docbook).
5828 * src/lyxfunc.C (getStatus): update for html
5829 * lib/ui/default.ui: simplify due to the above change.
5830 * src/menus.C (ShowFileMenu): update too (in case we need it).
5832 * src/MenuBackend.C (read): if a menu is defined twice, add the
5833 new entries to the exiting one.
5835 2000-07-26 Juergen Vigna <jug@sad.it>
5837 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5839 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5840 and return a bool if it did actual save the file.
5841 (AutoSave): don't autosave a unnamed doc.
5843 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5844 check if this is an UNNAMED new file and react to it.
5845 (newFile): set buffer to unnamed and change to not mark a new
5846 buffer dirty if I didn't do anything with it.
5848 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5850 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5852 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5853 friend as per Angus's patch posted to lyx-devel.
5855 * src/ext_l10n.h: updated
5857 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5858 gettext on the style string right before inserting them into the
5861 * autogen.sh: add code to extract style strings form layout files,
5862 not good enough yet.
5864 * src/frontends/gtk/.cvsignore: add MAKEFILE
5866 * src/MenuBackend.C (read): run the label strings through gettext
5867 before storing them in the containers.
5869 * src/ext_l10n.h: new file
5871 * autogen.sh : generate the ext_l10n.h file here
5873 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5875 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5878 * lib/ui/default.ui: fix a couple of typos.
5880 * config/gnome/gtk.m4: added (and added to the list of files in
5883 * src/insets/insetinclude.C (unique_id): fix when we are using
5884 lyxstring instead of basic_string<>.
5885 * src/insets/insettext.C (LocalDispatch): ditto.
5886 * src/support/filetools.C: ditto.
5888 * lib/configure.m4: create the ui/ directory if necessary.
5890 * src/LyXView.[Ch] (updateToolbar): new method.
5892 * src/BufferView_pimpl.C (buffer): update the toolbar when
5893 opening/closing buffer.
5895 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5897 * src/LyXAction.C (getActionName): enhance to return also the name
5898 and options of pseudo-actions.
5899 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5901 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5902 as an example of what is possible). Used in File->Build too (more
5903 useful) and in the import/export menus (to mimick the complicated
5904 handling of linuxdoc and friends). Try to update all the entries.
5906 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5909 * src/MenuBackend.C (read): Parse the new OptItem tag.
5911 * src/MenuBackend.h: Add a new optional_ data member (used if the
5912 entry should be omitted when the lyxfunc is disabled).
5914 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5915 function, used as a shortcut.
5916 (create_submenu): align correctly the shortcuts on the widest
5919 * src/MenuBackend.h: MenuItem.label() only returns the label of
5920 the menu without shortcut; new method shortcut().
5922 2000-07-14 Marko Vendelin <markov@ioc.ee>
5924 * src/frontends/gtk/Dialogs.C:
5925 * src/frontends/gtk/FormCopyright.C:
5926 * src/frontends/gtk/FormCopyright.h:
5927 * src/frontends/gtk/Makefile.am: added these source-files for the
5928 Gtk/Gnome support of the Copyright-Dialog.
5930 * src/main.C: added Gnome::Main initialization if using
5931 Gtk/Gnome frontend-GUI.
5933 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5935 * config/gnome/aclocal-include.m4
5936 * config/gnome/compiler-flags.m4
5937 * config/gnome/curses.m4
5938 * config/gnome/gnome--.m4
5939 * config/gnome/gnome-bonobo-check.m4
5940 * config/gnome/gnome-common.m4
5941 * config/gnome/gnome-fileutils.m4
5942 * config/gnome/gnome-ghttp-check.m4
5943 * config/gnome/gnome-gnorba-check.m4
5944 * config/gnome/gnome-guile-checks.m4
5945 * config/gnome/gnome-libgtop-check.m4
5946 * config/gnome/gnome-objc-checks.m4
5947 * config/gnome/gnome-orbit-check.m4
5948 * config/gnome/gnome-print-check.m4
5949 * config/gnome/gnome-pthread-check.m4
5950 * config/gnome/gnome-support.m4
5951 * config/gnome/gnome-undelfs.m4
5952 * config/gnome/gnome-vfs.m4
5953 * config/gnome/gnome-x-checks.m4
5954 * config/gnome/gnome-xml-check.m4
5955 * config/gnome/gnome.m4
5956 * config/gnome/gperf-check.m4
5957 * config/gnome/gtk--.m4
5958 * config/gnome/linger.m4
5959 * config/gnome/need-declaration.m4: added configuration scripts
5960 for Gtk/Gnome frontend-GUI
5962 * configure.in: added support for the --with-frontend=gtk option
5964 * autogen.sh: added config/gnome/* to list of config-files
5966 * acconfig.h: added define for GTKGUI-support
5968 * config/lyxinclude.m4: added --with-frontend[=value] option value
5969 for Gtk/Gnome frontend-GUI support.
5971 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5973 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5977 * src/paragraph.C (GetChar): remove non-const version
5979 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5980 (search_kw): use it.
5982 * src/lyx_main.C (init): if "preferences" exist, read that instead
5984 (ReadRcFile): return bool if the file could be read ok.
5985 (ReadUIFile): add a check to see if lex file is set ok.
5987 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5988 bastring can be used instead of lyxstring (still uses the old code
5989 if std::string is good enough or if lyxstring is used.)
5991 * src/encoding.C: make the arrays static, move ininle functions
5993 * src/encoding.h: from here.
5995 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5996 (parseSingleLyXformat2Token): move inset parsing to separate method
5997 (readInset): new private method
5999 * src/Variables.h: remove virtual from get().
6001 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6002 access to NEW_INSETS and NEW_TABULAR
6004 * src/MenuBackend.h: remove superfluous forward declaration of
6005 MenuItem. Add documentations tags "///", remove empty MenuItem
6006 destructor, remove private default contructor.
6008 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6010 (read): more string mlabel and mname to where they are used
6011 (read): remove unused variables mlabel and mname
6012 (defaults): unconditional clear, make menusetup take advantage of
6013 add returning Menu &.
6015 * src/LyXView.h: define NEW_MENUBAR as default
6017 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6018 to NEW_INSETS and NEW_TABULAR.
6019 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6020 defined. Change some of the "xxxx-inset-insert" functions names to
6023 * several files: more enahncements to NEW_INSETS and the resulting
6026 * lib/lyxrc.example (\date_insert_format): move to misc section
6028 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6029 bastring and use AC_CACHE_CHECK.
6030 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6031 the system have the newest methods. uses AC_CACHE_CHECK
6032 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6033 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6034 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6036 * configure.in: add LYX_CXX_GOOD_STD_STRING
6038 * acinclude.m4: recreated
6040 2000-07-24 Amir Karger <karger@lyx.org>
6042 * README: add Hebrew, Arabic kmaps
6045 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6047 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6050 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6052 * Lot of files: add pragma interface/implementation.
6054 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6056 * lib/ui/default.ui: new file (ans new directory). Contains the
6057 default menu and toolbar.
6059 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6060 global space. Toolbars are now read (as menus) in ui files.
6062 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6064 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6065 is disabled because the document is read-only. We want to have the
6066 toggle state of the function anyway.
6067 (getStatus): add code for LFUN_VC* functions (mimicking what is
6068 done in old-style menus)
6070 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6071 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6073 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6074 * src/BufferView_pimpl.C: ditto.
6075 * src/lyxfunc.C: ditto.
6077 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6078 default). This replaces old-style menus by new ones.
6080 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6081 MenuItem. Contain the data structure of a menu.
6083 * src/insets/insettext.C: use LyXView::setLayout instead of
6084 accessing directly the toolbar combox.
6085 * src/lyxfunc.C (Dispatch): ditto.
6087 * src/LyXView.C (setLayout): new method, which just calls
6088 Toolbar::setLayout().
6089 (updateLayoutChoice): move part of this method in Toolbar.
6091 * src/toolbar.[Ch]: removed.
6093 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6094 implementation the toolbar.
6096 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6097 the toolbar. It might make sense to merge it with ToolbarDefaults
6099 (setLayout): new function.
6100 (updateLayoutList): ditto.
6101 (openLayoutList): ditto.
6103 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6104 xforms implementation of the toolbar.
6105 (get_toolbar_func): comment out, since I do not
6106 know what it is good for.
6108 * src/ToolbarDefaults.h: Add the ItemType enum.
6110 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6111 for a list of allocated C strings. Used in Menubar xforms
6112 implementation to avoid memory leaks.
6114 * src/support/lstrings.[Ch] (uppercase): new version taking and
6118 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6119 * lib/bind/emacs.bind: ditto.
6121 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6123 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6124 forward decl of LyXView.
6126 * src/toolbar.C (toolbarItem): moved from toolbar.h
6127 (toolbarItem::clean): ditto
6128 (toolbarItem::~toolbarItem): ditto
6129 (toolbarItem::operator): ditto
6131 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6133 * src/paragraph.h: control the NEW_TABULAR define from here
6135 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6136 USE_TABULAR_INSETS to NEW_TABULAR
6138 * src/ToolbarDefaults.C: add include "lyxlex.h"
6140 * files using the old table/tabular: use NEW_TABULAR to control
6141 compilation of old tabular stuff.
6143 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6146 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6147 planemet in reading of old style floats, fix the \end_deeper
6148 problem when reading old style floats.
6150 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6152 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6154 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6156 * lib/bind/sciword.bind: updated.
6158 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6160 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6161 layout write problem
6163 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6165 * src/Makefile.am (INCLUDES): remove image directory from include
6168 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6169 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6171 * src/LyXView.C (create_form_form_main): read the application icon
6174 * lib/images/*.xpm: change the icons to use transparent color for
6177 * src/toolbar.C (update): change the color of the button when it
6180 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6182 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6183 setting explicitely the minibuffer.
6184 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6186 * src/LyXView.C (showState): new function. Shows font information
6187 in minibuffer and update toolbar state.
6188 (LyXView): call Toolbar::update after creating the
6191 * src/toolbar.C: change toollist to be a vector instead of a
6193 (BubbleTimerCB): get help string directly from the callback
6194 argument of the corresponding icon (which is the action)
6195 (set): remove unnecessary ugliness.
6196 (update): new function. update the icons (depressed, disabled)
6197 depending of the status of the corresponding action.
6199 * src/toolbar.h: remove help in toolbarItem
6201 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6203 * src/Painter.C (text): Added code for using symbol glyphs from
6204 iso10646 fonts. Currently diabled.
6206 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6209 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6210 magyar,turkish and usorbian.
6212 * src/paragraph.C (isMultiLingual): Made more efficient.
6214 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6217 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6218 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6219 Also changed the prototype to "bool math_insert_greek(char)".
6221 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * lots of files: apply the NEW_INSETS on all code that will not be
6224 needed when we move to use the new insets. Enable the define in
6225 lyxparagrah.h to try it.
6227 * src/insets/insettabular.C (cellstart): change to be a static
6229 (InsetTabular): initialize buffer in the initializer list.
6231 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6233 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6234 form_print.h out of the header file. Replaced with forward
6235 declarations of the relevant struct.
6237 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6240 * src/commandtags.h: do not include "debug.h" which does not
6241 belong there. #include it in some other places because of this
6244 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6246 * src/insets/insetcaption.C: add a couple "using" directives.
6248 * src/toolbar.C (add): get the help text directly from lyxaction.
6250 (setPixmap): new function. Loads from disk and sets a pixmap on a
6251 botton; the name of the pixmap file is derived from the command
6254 * src/toolbar.h: remove members isBitmap and pixmap from
6257 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6258 * lib/images/: move many files from images/banner.xpm.
6260 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6262 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6263 * src/toolbar.C: ditto.
6264 * configure.in: ditto.
6265 * INSTALL: document.
6267 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6268 the spellchecker popup is closed from the WM.
6270 2000-07-19 Juergen Vigna <jug@sad.it>
6272 * src/insets/insetfloat.C (Write): small fix because we use the
6273 insetname for the type now!
6275 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6277 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6280 * src/frontends/Dialogs.h: removed hideCitation signal
6282 * src/insets/insetcite.h: added hide signal
6284 * src/insets/insetcite.C (~InsetCitation): emits new signal
6285 (getScreenLabel): "intelligent" label should now fit on the screen!
6287 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6289 * src/frontends/xforms/FormCitation.C (showInset): connects
6290 hide() to the inset's hide signal
6291 (show): modified to use fl_set_object_position rather than
6292 fl_set_object_geometry wherever possible
6294 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6296 * src/insets/lyxinset.h: add caption code
6298 * src/insets/insetfloat.C (type): new method
6300 * src/insets/insetcaption.C (Write): new method
6302 (LyxCode): new method
6304 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6305 to get it right together with using the FloatList.
6307 * src/commandtags.h: add LFUN_INSET_CAPTION
6308 * src/lyxfunc.C (Dispatch): handle it
6310 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6313 * src/Variables.[Ch]: make expand take a const reference, remove
6314 the destructor, some whitespace changes.
6316 * src/LyXAction.C (init): add caption-inset-insert
6318 * src/FloatList.C (FloatList): update the default floats a bit.
6320 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6322 * src/Variables.[Ch]: new files. Intended to be used for language
6323 specific strings (like \chaptername) and filename substitution in
6326 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6328 * lib/kbd/american.kmap: update
6330 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6332 * src/bufferparams.[Ch]: remove member allowAccents.
6334 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6336 * src/LaTeXLog.C: use the log_form.h header.
6337 * src/lyx_gui.C: ditto.
6338 * src/lyx_gui_misc.C: ditto.
6339 * src/lyxvc.h: ditto.
6341 * forms/log_form.fd: new file, created from latexoptions.fd. I
6342 kept the log popup and nuked the options form.
6344 * src/{la,}texoptions.[Ch]: removed.
6345 * src/lyx_cb.C (LaTeXOptions): ditto
6347 * src/lyx_gui.C (create_forms): do not handle the
6348 fd_latex_options form.
6350 2000-07-18 Juergen Vigna <jug@sad.it>
6352 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6353 name of the inset so that it can be requested outside (text2.C).
6355 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6358 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6360 * src/mathed/formula.h (ConvertFont): constify
6362 * src/mathed/formula.C (Read): add warning if \end_inset is not
6363 found on expected place.
6365 * src/insets/lyxinset.h (ConvertFont): consify
6367 * src/insets/insetquotes.C (ConvertFont): constify
6368 * src/insets/insetquotes.h: ditto
6370 * src/insets/insetinfo.h: add labelfont
6372 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6373 (ascent): use labelfont
6377 (Write): make .lyx file a bit nicer
6379 * src/insets/insetfloat.C (Write): simplify somewhat...
6380 (Read): add warning if arg is not found
6382 * src/insets/insetcollapsable.C: add using std::max
6383 (Read): move string token and add warning in arg is not found
6384 (draw): use std::max to get the right ty
6385 (getMaxWidth): simplify by using std::max
6387 * src/insets/insetsection.h: new file
6388 * src/insets/insetsection.C: new file
6389 * src/insets/insetcaption.h: new file
6390 * src/insets/insetcaption.C: new file
6392 * src/insets/inset.C (ConvertFont): constify signature
6394 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6395 insetcaption.[Ch] and insetsection.[Ch]
6397 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6398 uses to use LABEL_COUNTER_CHAPTER instead.
6399 * src/text2.C (SetCounter): here
6401 * src/counters.h: new file
6402 * src/counters.C: new file
6403 * src/Sectioning.h: new file
6404 * src/Sectioning.C: new file
6406 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6408 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6410 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6413 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6416 2000-07-17 Juergen Vigna <jug@sad.it>
6418 * src/tabular.C (Validate): check if array-package is needed.
6419 (SetVAlignment): added support for vertical alignment.
6420 (SetLTFoot): better support for longtable header/footers
6421 (Latex): modified to support added features.
6423 * src/LaTeXFeatures.[Ch]: added array-package.
6425 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6427 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6430 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6432 * configure.in: do not forget to put a space after -isystem.
6434 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6436 * lib/kbd/arabic.kmap: a few fixes.
6438 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6440 * some whitespace chagnes to a number of files.
6442 * src/support/DebugStream.h: change to make it easier for
6443 doc++ to parse correctly.
6444 * src/support/lyxstring.h: ditto
6446 * src/mathed/math_utils.C (compara): change to have only one
6448 (MathedLookupBOP): change because of the above.
6450 * src/mathed/math_delim.C (math_deco_compare): change to have only
6452 (search_deco): change becasue of the above.
6454 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6455 instead of manually coded one.
6457 * src/insets/insetquotes.C (Read): read the \end_inset too
6459 * src/insets/insetlatex.h: remove file
6460 * src/insets/insetlatex.C: remove file
6462 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6464 (InsetPrintIndex): remove destructor
6466 * src/insets/insetinclude.h: remove default constructor
6468 * src/insets/insetfloat.C: work to make it work better
6470 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6472 * src/insets/insetcite.h (InsetCitation): remove default constructor
6474 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6476 * src/text.C (GetColumnNearX): comment out some currently unused code.
6478 * src/paragraph.C (writeFile): move some initializations closer to
6480 (CutIntoMinibuffer): small change to use new matchIT operator
6484 (InsertInset): ditto
6487 (InsetIterator): ditto
6488 (Erase): small change to use new matchFT operator
6490 (GetFontSettings): ditto
6491 (HighestFontInRange): ditto
6494 * src/lyxparagraph.h: some chars changed to value_type
6495 (matchIT): because of some stronger checking (perhaps too strong)
6496 in SGI STL, the two operator() unified to one.
6499 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6501 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6502 the last inset read added
6503 (parseSingleLyXformat2Token): some more (future) compability code added
6504 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6505 (parseSingleLyXformat2Token): set last_inset_read
6506 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6507 (parseSingleLyXformat2Token): don't double intializw string next_token
6509 * src/TextCache.C (text_fits::operator()): add const's to the signature
6510 (has_buffer::operator()): ditto
6512 * src/Floating.h: add some comments on the class
6514 * src/FloatList.[Ch] (typeExist): new method
6517 * src/BackStack.h: added default constructor, wanted by Gcc.
6519 2000-07-14 Juergen Vigna <jug@sad.it>
6521 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6523 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6525 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6526 do a redraw when the window is resized!
6527 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6529 * src/insets/insettext.C (resizeLyXText): added function to correctly
6530 being able to resize the LyXWindow.
6532 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6534 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6536 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6537 crashes when closing dialog to a deleted inset.
6539 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6540 method! Now similar to other insets.
6542 2000-07-13 Juergen Vigna <jug@sad.it>
6544 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6546 * lib/examples/Literate.lyx: small patch!
6548 * src/insets/insetbib.C (Read): added this function because of wrong
6549 Write (without [begin|end]_inset).
6551 2000-07-11 Juergen Vigna <jug@sad.it>
6553 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6554 as the insertInset could not be good!
6556 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6557 the bool param should not be last.
6559 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6561 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6562 did submit that to Karl).
6564 * configure.in: use -isystem instead of -I for X headers. This
6565 fixes a problem on solaris with a recent gcc;
6566 put the front-end code after the X detection code;
6567 configure in sigc++ before lib/
6569 * src/lyx_main.C (commandLineHelp): remove -display from command
6572 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6574 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6575 Also put in Makefile rules for building the ``listerrors''
6576 program for parsing errors from literate programs written in LyX.
6578 * lib/build-listerrors: Added small shell script as part of compile
6579 process. This builds a working ``listerrors'' binary if noweb is
6580 installed and either 1) the VNC X server is installed on the machine,
6581 or 2) the user is compiling from within a GUI. The existence of a GUI
6582 is necessary to use the ``lyx --export'' feature for now. This
6583 hack can be removed once ``lyx --export'' no longer requires a GUI to
6586 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6588 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6589 now passed back correctly from gcc and placed "under" error
6590 buttons in a Literate LyX source.
6592 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6594 * src/text.C (GetColumnNearX): Better behavior when a RTL
6595 paragraph is ended by LTR text.
6597 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6600 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6602 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6603 true when clipboard is empty.
6605 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6607 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6608 row of the paragraph.
6609 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6610 to prevent calculation of bidi tables
6612 2000-07-07 Juergen Vigna <jug@sad.it>
6614 * src/screen.C (ToggleSelection): added y_offset and x_offset
6617 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6620 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6622 * src/insets/insettext.C: fixed Layout-Display!
6624 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6626 * configure.in: add check for strings.h header.
6628 * src/spellchecker.C: include <strings.h> in order to have a
6629 definition for bzero().
6631 2000-07-07 Juergen Vigna <jug@sad.it>
6633 * src/insets/insettext.C (draw): set the status of the bv->text to
6634 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6636 * src/screen.C (DrawOneRow):
6637 (DrawFromTo): redraw the actual row if something has changed in it
6640 * src/text.C (draw): call an update of the toplevel-inset if something
6641 has changed inside while drawing.
6643 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6645 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6647 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6648 processing inside class.
6650 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6651 processing inside class.
6653 * src/insets/insetindex.h new struct Holder, consistent with other
6656 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6657 citation dialog from main code and placed it in src/frontends/xforms.
6658 Dialog launched through signals instead of callbacks
6660 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6662 * lyx.man: update the options description.
6664 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6666 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6667 handle neg values, set min width to 590, add doc about -display
6669 2000-07-05 Juergen Vigna <jug@sad.it>
6671 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6672 calls to BufferView *.
6674 * src/insets/insettext.C (checkAndActivateInset): small fix non
6675 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6677 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6678 their \end_inset token!
6680 2000-07-04 edscott <edscott@imp.mx>
6682 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6683 lib/lyxrc.example: added option \wheel_jump
6685 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6687 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6688 remove support for -width,-height,-xpos and -ypos.
6690 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6692 * src/encoding.[Ch]: New files.
6694 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6695 (text): Call to the underline() method only when needed.
6697 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6699 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6700 encoding(s) for the document.
6702 * src/bufferparams.C (BufferParams): Changed default value of
6705 * src/language.C (newLang): Removed.
6706 (items[]): Added encoding information for all defined languages.
6708 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6709 encoding choice button.
6711 * src/lyxrc.h (font_norm_type): New member variable.
6712 (set_font_norm_type): New method.
6714 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6715 paragraphs with different encodings.
6717 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6718 (TransformChar): Changed to work correctly with Arabic points.
6719 (draw): Added support for drawing Arabic points.
6720 (draw): Removed code for drawing underbars (this is done by
6723 * src/support/textutils.h (IsPrintableNonspace): New function.
6725 * src/BufferView_pimpl.h: Added "using SigC::Object".
6726 * src/LyXView.h: ditto.
6728 * src/insets/insetinclude.h (include_label): Changed to mutable.
6730 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6732 * src/mathed/math_iter.h: remove empty destructor
6734 * src/mathed/math_cursor.h: remove empty destructor
6736 * src/insets/lyxinset.h: add THEOREM_CODE
6738 * src/insets/insettheorem.[Ch]: new files
6740 * src/insets/insetminipage.C: (InsertInset): remove
6742 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6744 (InsertInset): remove
6746 * src/insets/insetlist.C: (InsertList): remove
6748 * src/insets/insetfootlike.[Ch]: new files
6750 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6753 (InsertInset): ditto
6755 * src/insets/insetert.C: remove include Painter.h, reindent
6756 (InsertInset): move to header
6758 * src/insets/insetcollapsable.h: remove explicit from default
6759 contructor, remove empty destructor, add InsertInset
6761 * src/insets/insetcollapsable.C (InsertInset): new func
6763 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6765 * src/vspace.h: add explicit to constructor
6767 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6768 \textcompwordmark, please test this.
6770 * src/lyxrc.C: set ascii_linelen to 65 by default
6772 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6774 * src/commandtags.h: add LFUN_INSET_THEOREM
6776 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6777 (makeLinuxDocFile): remove _some_ of the nice logic
6778 (makeDocBookFile): ditto
6780 * src/Painter.[Ch]: (~Painter): removed
6782 * src/LyXAction.C (init): entry for insettheorem added
6784 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6786 (deplog): code to detect files generated by LaTeX, needs testing
6789 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6791 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6793 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6795 * src/LaTeX.C (deplog): Add a check for files that are going to be
6796 created by the first latex run, part of the project to remove the
6799 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6800 contents to the extension list.
6802 2000-07-04 Juergen Vigna <jug@sad.it>
6804 * src/text.C (NextBreakPoint): added support for needFullRow()
6806 * src/insets/lyxinset.h: added needFullRow()
6808 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6811 * src/insets/insettext.C: lots of changes for update!
6813 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6815 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6817 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6819 * src/insets/insetinclude.C (InsetInclude): fixed
6820 initialization of include_label.
6821 (unique_id): now returns a string.
6823 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6825 * src/LaTeXFeatures.h: new member IncludedFiles, for
6826 a map of key, included file name.
6828 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6829 with the included files for inclusion in SGML preamble,
6830 i. e., linuxdoc and docbook.
6833 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6834 nice (is the generated linuxdoc code to be exported?), that
6835 allows to remove column, and only_body that will be true for
6836 slave documents. Insets are allowed inside SGML font type.
6837 New handling of the SGML preamble for included files.
6838 (makeDocBookFile): the same for docbook.
6840 * src/insets/insetinclude.h:
6841 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6843 (DocBook): new export methods.
6845 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6846 and makeDocBookFile.
6848 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6849 formats to export with command line argument -x.
6851 2000-06-29 Juergen Vigna <jug@sad.it>
6853 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6854 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6856 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6857 region could already been cleared by an inset!
6859 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6861 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6864 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6866 (cursorToggle): remove special handling of lyx focus.
6868 2000-06-28 Juergen Vigna <jug@sad.it>
6870 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6873 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6875 * src/insets/insetindex.C (Edit): add a callback when popup is
6878 * src/insets/insettext.C (LocalDispatch):
6879 * src/insets/insetmarginal.h:
6880 * src/insets/insetlist.h:
6881 * src/insets/insetfoot.h:
6882 * src/insets/insetfloat.h:
6883 * src/insets/insetert.h: add a missing std:: qualifier.
6885 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6887 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6890 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6892 * src/insets/insettext.C (Read): remove tmptok unused variable
6893 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6894 (InsertInset): change for new InsetInset code
6896 * src/insets/insettext.h: add TEXT inline method
6898 * src/insets/insettext.C: remove TEXT macro
6900 * src/insets/insetmarginal.C (Write): new method
6901 (Latex): change output slightly
6903 * src/insets/insetfoot.C (Write): new method
6904 (Latex): change output slightly (don't use endl when no need)
6906 * src/insets/insetert.C (Write): new method
6908 * src/insets/insetcollapsable.h: make button_length, button_top_y
6909 and button_bottm_y protected.
6911 * src/insets/insetcollapsable.C (Write): simplify code by using
6912 tostr. Also do not output the float name, the children class
6913 should to that to get control over own arguments
6915 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6916 src/insets/insetminipage.[Ch]:
6919 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6921 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6923 * src/Makefile.am (lyx_SOURCES): add the new files
6925 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6926 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6927 * src/commandtags.h: ditto
6929 * src/LaTeXFeatures.h: add a std::set of used floattypes
6931 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6933 * src/FloatList.[Ch] src/Floating.h: new files
6935 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6937 * src/lyx_cb.C (TableApplyCB): ditto
6939 * src/text2.C: ditto
6940 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6941 (parseSingleLyXformat2Token): ditto + add code for
6942 backwards compability for old float styles + add code for new insets
6944 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6946 (InsertInset(size_type, Inset *, LyXFont)): new method
6947 (InsetChar(size_type, char)): changed to use the other InsetChar
6948 with a LyXFont(ALL_INHERIT).
6949 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6950 insert the META_INSET.
6952 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6954 * sigc++/thread.h (Threads): from here
6956 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6957 definition out of line
6958 * sigc++/scope.h: from here
6960 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6962 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6963 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6965 * Makefile.am (bindist): new target.
6967 * INSTALL: add instructions for doing a binary distribution.
6969 * development/tools/README.bin.example: update a bit.
6971 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6974 * lib/lyxrc.example: new lyxrc tag \set_color.
6976 * src/lyxfunc.C (Dispatch):
6977 * src/commandtags.h:
6978 * src/LyXAction.C: new lyxfunc "set-color".
6980 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6981 and an x11name given as strings.
6983 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6984 cache when a color is changed.
6986 2000-06-26 Juergen Vigna <jug@sad.it>
6988 * src/lyxrow.C (width): added this functions and variable.
6990 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6993 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6995 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6997 * images/undo_bw.xpm: new icon.
6998 * images/redo_bw.xpm: ditto.
7000 * configure.in (INSTALL_SCRIPT): change value to
7001 ${INSTALL} to avoid failures of install-script target.
7002 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7004 * src/BufferView.h: add a magic "friend" declaration to please
7007 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7009 * forms/cite.fd: modified to allow resizing without messing
7012 * src/insetcite.C: Uses code from cite.fd almost without
7014 User can now resize dialog in the x-direction.
7015 Resizing the dialog in the y-direction is prevented, as the
7016 code does this intelligently already.
7018 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7020 * INSTALL: remove obsolete entry in "problems" section.
7022 * lib/examples/sl_*.lyx: update of the slovenian examples.
7024 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7026 2000-06-23 Juergen Vigna <jug@sad.it>
7028 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7030 * src/buffer.C (resize): delete the LyXText of textinsets.
7032 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7034 * src/insets/lyxinset.h: added another parameter 'cleared' to
7035 the draw() function.
7037 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7038 unlocking inset in inset.
7040 2000-06-22 Juergen Vigna <jug@sad.it>
7042 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7043 of insets and moved first to LyXText.
7045 * src/mathed/formulamacro.[Ch]:
7046 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7048 2000-06-21 Juergen Vigna <jug@sad.it>
7050 * src/text.C (GetVisibleRow): look if I should clear the area or not
7051 using Inset::doClearArea() function.
7053 * src/insets/lyxinset.h: added doClearArea() function and
7054 modified draw(Painter &, ...) to draw(BufferView *, ...)
7056 * src/text2.C (UpdateInset): return bool insted of int
7058 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7060 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7061 combox in the character popup
7063 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7064 BufferParams const & params
7066 2000-06-20 Juergen Vigna <jug@sad.it>
7068 * src/insets/insettext.C (SetParagraphData): set insetowner on
7071 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7073 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7074 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7076 (form_main_): remove
7078 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7079 (create_form_form_main): remove FD_form_main stuff, connect to
7080 autosave_timeout signal
7082 * src/LyXView.[Ch] (getMainForm): remove
7083 (UpdateTimerCB): remove
7084 * src/BufferView_pimpl.h: inherit from SigC::Object
7086 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7087 signal instead of callback
7089 * src/BufferView.[Ch] (cursorToggleCB): remove
7091 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7093 * src/BufferView_pimpl.C: changes because of the one below
7095 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7096 instead of storing a pointer to a LyXText.
7098 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7100 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7102 * src/lyxparagraph.h
7104 * src/paragraph.C: Changed fontlist to a sorted vector.
7106 2000-06-19 Juergen Vigna <jug@sad.it>
7108 * src/BufferView.h: added screen() function.
7110 * src/insets/insettext.C (LocalDispatch): some selection code
7113 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7115 * src/insets/insettext.C (SetParagraphData):
7117 (InsetText): fixes for multiple paragraphs.
7119 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7121 * development/lyx.spec.in: Call configure with ``--without-warnings''
7122 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7123 This should be fine, however, since we generally don't want to be
7124 verbose when making an RPM.
7126 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7128 * lib/scripts/fig2pstex.py: New file
7130 2000-06-16 Juergen Vigna <jug@sad.it>
7132 * src/insets/insettabular.C (UpdateLocal):
7133 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7134 (LocalDispatch): Changed all functions to use LyXText.
7136 2000-06-15 Juergen Vigna <jug@sad.it>
7138 * src/text.C (SetHeightOfRow): call inset::update before requesting
7141 * src/insets/insettext.C (update):
7142 * src/insets/insettabular.C (update): added implementation
7144 * src/insets/lyxinset.h: added update function
7146 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7148 * src/text.C (SelectNextWord): protect against null pointers with
7149 old-style string streams. (fix from Paul Theo Gonciari
7152 * src/cite.[Ch]: remove erroneous files.
7154 * lib/configure.m4: update the list of created directories.
7156 * src/lyxrow.C: include <config.h>
7157 * src/lyxcursor.C: ditto.
7159 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7161 * lib/examples/decimal.lyx: new example file from Mike.
7163 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7164 to find template definitions (from Dekel)
7166 * src/frontends/.cvsignore: add a few things.
7168 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7170 * src/Timeout.C (TimeOut): remove default argument.
7172 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7175 * src/insets/ExternalTemplate.C: add a "using" directive.
7177 * src/lyx_main.h: remove the act_ struct, which seems unused
7180 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7182 * LyX Developers Meeting: All files changed, due to random C++ (by
7183 coincidence) code generator script.
7185 - external inset (cool!)
7186 - initial online editing of preferences
7187 - insettabular breaks insettext(s contents)
7189 - some DocBook fixes
7190 - example files update
7191 - other cool stuff, create a diff and look for yourself.
7193 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7195 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7196 -1 this is a non-line-breaking textinset.
7198 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7199 if there is no width set.
7201 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7203 * Lots of files: Merged the dialogbase branch.
7205 2000-06-09 Allan Rae <rae@lyx.org>
7207 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7208 and the Dispatch methods that used it.
7210 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7211 access to functions formerly kept in Dispatch.
7213 2000-05-19 Allan Rae <rae@lyx.org>
7215 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7216 made to_page and count_copies integers again. from_page remains a
7217 string however because I want to allow entry of a print range like
7218 "1,4,22-25" using this field.
7220 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7221 and printer-params-get. These aren't useful from the minibuffer but
7222 could be used by a script/LyXServer app provided it passes a suitable
7223 auto_mem_buffer. I guess I should take a look at how the LyXServer
7224 works and make it support xtl buffers.
7226 * sigc++/: updated to libsigc++-1.0.1
7228 * src/xtl/: updated to xtl-1.3.pl.11
7230 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7231 those changes done to the files in src/ are actually recreated when
7232 they get regenerated. Please don't ever accept a patch that changes a
7233 dialog unless that patch includes the changes to the corresponding *.fd
7236 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7237 stringOnlyContains, renamed it and generalised it.
7239 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7240 branch. Removed the remaining old form_print code.
7242 2000-04-26 Allan Rae <rae@lyx.org>
7244 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7245 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7247 2000-04-25 Allan Rae <rae@lyx.org>
7249 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7250 against a base of xtl-1.3.pl.4
7252 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7253 filter the Id: entries so they still show the xtl version number
7256 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7257 into the src/xtl code. Patch still pending with José (XTL)
7259 2000-04-24 Allan Rae <rae@lyx.org>
7261 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7262 both more generic and much safer. Use the new template functions.
7263 * src/buffer.[Ch] (Dispatch): ditto.
7265 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7266 and mem buffer more intelligently. Also a little general cleanup.
7269 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7270 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7271 * src/xtl/Makefile.am: ditto.
7272 * src/xtl/.cvsignore: ditto.
7273 * src/Makefile.am: ditto.
7275 * src/PrinterParams.h: Removed the macros member functions. Added a
7276 testInvariant member function. A bit of tidying up and commenting.
7277 Included Angus's idea for fixing operation with egcs-1.1.2.
7279 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7280 cool expansion of XTL's mem_buffer to support automatic memory
7281 management within the buffer itself. Removed the various macros and
7282 replaced them with template functions that use either auto_mem_buffer
7283 or mem_buffer depending on a #define. The mem_buffer support will
7284 disappear as soon as the auto_mem_buffer is confirmed to be good on
7285 other platforms/compilers. That is, it's there so you've got something
7288 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7289 effectively forked XTL. However I expect José will include my code
7290 into the next major release. Also fixed a memory leak.
7291 * src/xtl/text.h: ditto.
7292 * src/xtl/xdr.h: ditto.
7293 * src/xtl/giop.h: ditto.
7295 2000-04-16 Allan Rae <rae@lyx.org>
7297 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7298 by autogen.sh and removed by maintainer-clean anyway.
7299 * .cvsignore, sigc++/.cvsignore: Support the above.
7301 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7303 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7305 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7306 macros, renamed static callback-target member functions to suit new
7307 scheme and made them public.
7308 * src/frontends/xforms/forms/form_print.fd: ditto.
7309 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7311 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7314 * src/xtl/: New directory containing a minimal distribution of XTL.
7315 This is XTL-1.3.pl.4.
7317 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7319 2000-04-15 Allan Rae <rae@lyx.org>
7321 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7323 * sigc++/: Updated to libsigc++-1.0.0
7325 2000-04-14 Allan Rae <rae@lyx.org>
7327 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7328 use the generic ones in future. I'll modify my conversion script.
7330 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7332 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7333 (CloseAllBufferRelatedDialogs): Renamed.
7334 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7336 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7337 of the generic ones. These are the same ones my conversion script
7340 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7341 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7342 * src/buffer.C (Dispatch): ditto
7344 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7345 functions for updating and hiding buffer dependent dialogs.
7346 * src/BufferView.C (buffer): ditto
7347 * src/buffer.C (setReadonly): ditto
7348 * src/lyxfunc.C (CloseBuffer): ditto
7350 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7351 Dialogs.h, and hence all the SigC stuff, into every file that includes
7352 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7354 * src/BufferView2.C: reduce the number of headers included by buffer.h
7356 2000-04-11 Allan Rae <rae@lyx.org>
7358 * src/frontends/xforms/xform_macros.h: A small collection of macros
7359 for building C callbacks.
7361 * src/frontends/xforms/Makefile.am: Added above file.
7363 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7364 scheme again. This time it should work for JMarc. If this is
7365 successful I'll revise my conversion script to automate some of this.
7366 The static member functions in the class also have to be public for
7367 this scheme will work. If the scheme works (it's almost identical to
7368 the way BufferView::cursorToggleCB is handled so it should work) then
7369 FormCopyright and FormPrint will be ready for inclusion into the main
7370 trunk immediately after 1.1.5 is released -- provided we're prepared
7371 for complaints about lame compilers not handling XTL.
7373 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7375 2000-04-07 Allan Rae <rae@lyx.org>
7377 * config/lyxinclude.m4: A bit more tidying up (Angus)
7379 * src/LString.h: JMarc's <string> header fix
7381 * src/PrinterParams.h: Used string for most data to remove some
7382 ugly code in the Print dialog and avoid even uglier code when
7383 appending the ints to a string for output.
7385 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7386 and moved "default:" back to the end of switch statement. Cleaned
7387 up the printing so it uses the right function calls and so the
7388 "print to file" option actually puts the file in the right directory.
7390 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7392 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7393 and Ok+Apply button control into a separate method: input (Angus).
7394 (input) Cleaned it up and improved it to be very thorough now.
7395 (All CB) static_cast used instead of C style cast (Angus). This will
7396 probably change again once we've worked out how to keep gcc-2.8.1 happy
7397 with real C callbacks.
7398 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7399 ignore some of the bool settings and has random numbers instead. Needs
7400 some more investigation. Added other input length checks and checking
7401 of file and printer names.
7403 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7404 would link (Angus). Seems the old code doesn't compile with the pragma
7405 statement either. Separated callback entries from internal methods.
7407 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7409 2000-03-17 Allan Rae <rae@lyx.org>
7411 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7412 need it? Maybe it could go in Dialogs instead? I could make it a
7413 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7414 values to get the bool return value.
7415 (Dispatch): New overloaded method for xtl support.
7417 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7418 extern "C" callback instead of static member functions. Hopefully,
7419 JMarc will be able to compile this. I haven't changed
7420 forms/form_copyright.fd yet. Breaking one of my own rules already.
7422 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7423 because they aren't useful from the minibuffer. Maybe a LyXServer
7424 might want a help message though?
7426 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7428 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7429 xtl which needs both rtti and exceptions.
7431 * src/support/Makefile.am:
7432 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7434 * src/frontends/xforms/input_validators.[ch]: input filters and
7435 validators. These conrol what keys are valid in input boxes.
7436 Use them and write some more. Much better idea than waiting till
7437 after the user has pressed Ok to say that the input fields don't make
7440 * src/frontends/xforms/Makefile.am:
7441 * src/frontends/xforms/forms/form_print.fd:
7442 * src/frontends/xforms/forms/makefile:
7443 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7444 new scheme. Still have to make sure I haven't missed anything from
7445 the current implementation.
7447 * src/Makefile.am, src/PrinterParams.h: New data store.
7449 * other files: Added a couple of copyright notices.
7451 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * src/insets/insetbib.h: move Holder struct in public space.
7455 * src/frontends/include/DialogBase.h: use SigC:: only when
7456 SIGC_CXX_NAMESPACES is defined.
7457 * src/frontends/include/Dialogs.h: ditto.
7459 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7461 * src/frontends/xforms/FormCopyright.[Ch]: do not
7462 mention SigC:: explicitely.
7464 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7466 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7467 deals with testing KDE in main configure.in
7468 * configure.in: ditto.
7470 2000-02-22 Allan Rae <rae@lyx.org>
7472 * Lots of files: Merged from HEAD
7474 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7475 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7477 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7479 * sigc++/: new minidist.
7481 2000-02-14 Allan Rae <rae@lyx.org>
7483 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7485 2000-02-08 Juergen Vigna <jug@sad.it>
7487 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7488 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7490 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7491 for this port and so it is much easier for other people to port
7492 dialogs in a common development environment.
7494 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7495 the QT/KDE implementation.
7497 * src/frontends/kde/Dialogs.C:
7498 * src/frontends/kde/FormCopyright.C:
7499 * src/frontends/kde/FormCopyright.h:
7500 * src/frontends/kde/Makefile.am:
7501 * src/frontends/kde/formcopyrightdialog.C:
7502 * src/frontends/kde/formcopyrightdialog.h:
7503 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7504 for the kde support of the Copyright-Dialog.
7506 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7507 subdir-substitution instead of hardcoded 'xforms' as we now have also
7510 * src/frontends/include/DialogBase.h (Object): just commented the
7511 label after #endif (nasty warning and I don't like warnings ;)
7513 * src/main.C (main): added KApplication initialization if using
7516 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7517 For now only the KDE event-loop is added if frontend==kde.
7519 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7521 * configure.in: added support for the --with-frontend[=value] option
7523 * autogen.sh: added kde.m4 file to list of config-files
7525 * acconfig.h: added define for KDEGUI-support
7527 * config/kde.m4: added configuration functions for KDE-port
7529 * config/lyxinclude.m4: added --with-frontend[=value] option with
7530 support for xforms and KDE.
7532 2000-02-08 Allan Rae <rae@lyx.org>
7534 * all Makefile.am: Fixed up so the make targets dist, distclean,
7535 install and uninstall all work even if builddir != srcdir. Still
7536 have a new sigc++ minidist update to come.
7538 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7540 2000-02-01 Allan Rae <rae@lyx.org>
7542 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7543 Many mods to get builddir != srcdir working.
7545 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7546 for building on NT and so we can do the builddir != srcdir stuff.
7548 2000-01-30 Allan Rae <rae@lyx.org>
7550 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7551 This will stay in "rae" branch. We probably don't really need it in
7552 the main trunk as anyone who wants to help programming it should get
7553 a full library installed also. So they can check both included and
7554 system supplied library compilation.
7556 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7557 Added a 'mini' distribution of libsigc++. If you feel the urge to
7558 change something in these directories - Resist it. If you can't
7559 resist the urge then you should modify the following script and rebuild
7560 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7561 all happen. Still uses a hacked version of libsigc++'s configure.in.
7562 I'm quite happy with the results. I'm not sure the extra work to turn
7563 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7564 worth the trouble and would probably lead to extra maintenance
7566 I haven't tested the following important make targets: install, dist.
7567 Not ready for prime time but very close. Maybe 1.1.5.
7569 * development/tools/makeLyXsigc.sh: A shell script to automatically
7570 generate our mini-dist of libsigc++. It can only be used with a CVS
7571 checkout of libsigc++ not a tarball distribution. It's well commented.
7572 This will end up as part of the libsigc++ distribution so other apps
7573 can easily have an included mini-dist. If someone makes mods to the
7574 sigc++ subpackage without modifying this script to generate those
7575 changes I'll be very upset!
7577 * src/frontends/: Started the gui/system indep structure.
7579 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7580 to access the gui-indep dialogs are in this class. Much improved
7581 design compared to previous revision. Lars, please refrain from
7582 moving this header into src/ like you did with Popups.h last time.
7584 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7586 * src/frontends/xforms/: Started the gui-indep system with a single
7587 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7590 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7591 Here you'll find a very useful makefile and automated fdfix.sh that
7592 makes updating dailogs a no-brainer -- provided you follow the rules
7593 set out in the README. I'm thinking about adding another script to
7594 automatically generate skeleton code for a new dialog given just the
7597 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7598 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7599 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7601 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7603 * src/support/LSubstring.C (operator): simplify
7605 * src/lyxtext.h: removed bparams, use buffer_->params instead
7607 * src/lyxrow.h: make Row a real class, move all variables to
7608 private and use accessors.
7610 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7612 (isRightToLeftPar): ditto
7613 (ChangeLanguage): ditto
7614 (isMultiLingual): ditto
7617 (SimpleTeXOnePar): ditto
7618 (TeXEnvironment): ditto
7619 (GetEndLabel): ditto
7621 (SetOnlyLayout): ditto
7622 (BreakParagraph): ditto
7623 (BreakParagraphConservative): ditto
7624 (GetFontSettings): ditto
7626 (CopyIntoMinibuffer): ditto
7627 (CutIntoMinibuffer): ditto
7628 (PasteParagraph): ditto
7629 (SetPExtraType): ditto
7630 (UnsetPExtraType): ditto
7631 (DocBookContTableRows): ditto
7632 (SimpleDocBookOneTablePar): ditto
7634 (TeXFootnote): ditto
7635 (SimpleTeXOneTablePar): ditto
7636 (TeXContTableRows): ditto
7637 (SimpleTeXSpecialChars): ditto
7640 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7641 to private and use accessors.
7643 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7644 this, we did not use it anymore and has not been for ages. Just a
7645 waste of cpu cycles.
7647 * src/language.h: make Language a real class, move all variables
7648 to private and use accessors.
7650 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7651 (create_view): remove
7652 (update): some changes for new timer
7653 (cursorToggle): use new timer
7654 (beforeChange): change for new timer
7656 * src/BufferView.h (cursorToggleCB): removed last paramter because
7659 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7660 (cursorToggleCB): change because of new timer code
7662 * lib/CREDITS: updated own mailaddress
7664 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7666 * src/support/filetools.C (PutEnv): fix the code in case neither
7667 putenv() nor setenv() have been found.
7669 * INSTALL: mention the install-strip Makefile target.
7671 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7672 read-only documents.
7674 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7676 * lib/reLyX/configure.in (VERSION): avoid using a previously
7677 generated reLyX wrapper to find out $prefix.
7679 * lib/examples/eu_adibide_lyx-atua.lyx:
7680 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7681 translation of the Tutorial (Dooteo)
7683 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7685 * forms/cite.fd: new citation dialog
7687 * src/insetcite.[Ch]: the new citation dialog is moved into
7690 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7693 * src/insets/insetcommand.h: data members made private.
7695 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * LyX 1.1.5 released
7699 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7701 * src/version.h (LYX_RELEASE): to 1.1.5
7703 * src/spellchecker.C (RunSpellChecker): return false if the
7704 spellchecker dies upon creation.
7706 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7708 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7709 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7713 * lib/CREDITS: update entry for Martin Vermeer.
7715 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7717 * src/text.C (draw): Draw foreign language bars at the bottom of
7718 the row instead of at the baseline.
7720 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7722 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * lib/bind/de_menus.bind: updated
7726 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7728 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7730 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7732 * src/menus.C (Limit_string_length): New function
7733 (ShowTocMenu): Limit the number of items/length of items in the
7736 * src/paragraph.C (String): Correct result for a paragraph inside
7739 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7741 * src/bufferlist.C (close): test of buf->getuser() == NULL
7743 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7745 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7746 Do not call to SetCursor when the paragraph is a closed footnote!
7748 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7750 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7753 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7755 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7758 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7759 reference popup, that activates the reference-back action
7761 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7763 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7764 the menus. Also fixed a bug.
7766 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7767 the math panels when switching buffers (unless new buffer is readonly).
7769 * src/BufferView.C (NoSavedPositions)
7770 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7772 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7774 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7775 less of dvi dirty or not.
7777 * src/trans_mgr.[Ch] (insert): change first parameter to string
7780 * src/chset.[Ch] (encodeString): add const to first parameter
7782 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7784 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7788 * src/LaTeX.C (deplog): better searching for dependency files in
7789 the latex log. Uses now regexps.
7791 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7792 instead of the box hack or \hfill.
7794 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7796 * src/lyxfunc.C (doImportHelper): do not create the file before
7797 doing the actual import.
7798 (doImportASCIIasLines): create a new file before doing the insert.
7799 (doImportASCIIasParagraphs): ditto.
7801 * lib/lyxrc.example: remove mention of non-existing commands
7803 * lyx.man: remove mention of color-related switches.
7805 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7807 * src/lyx_gui.C: remove all the color-related ressources, which
7808 are not used anymore.
7810 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7813 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7815 * src/lyxrc.C (read): Add a missing break in the switch
7817 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7819 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7821 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7824 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7826 * src/text.C (draw): draw bars under foreign language words.
7828 * src/LColor.[Ch]: add LColor::language
7830 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7832 * src/lyxcursor.h (boundary): New member variable
7834 * src/text.C (IsBoundary): New methods
7836 * src/text.C: Use the above for currect cursor movement when there
7837 is both RTL & LTR text.
7839 * src/text2.C: ditto
7841 * src/bufferview_funcs.C (ToggleAndShow): ditto
7843 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7845 * src/text.C (DeleteLineForward): set selection to true to avoid
7846 that DeleteEmptyParagraphMechanism does some magic. This is how it
7847 is done in all other functions, and seems reasonable.
7848 (DeleteWordForward): do not jump over non-word stuff, since
7849 CursorRightOneWord() already does it.
7851 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7852 DeleteWordBackward, since they seem safe to me (since selection is
7853 set to "true") DeleteEmptyParagraphMechanism does nothing.
7855 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7857 * src/lyx_main.C (easyParse): simplify the code by factoring the
7858 part that removes parameters from the command line.
7859 (LyX): check wether wrong command line options have been given.
7861 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7863 * src/lyx_main.C : add support for specifying user LyX
7864 directory via command line option -userdir.
7866 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7868 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7869 the number of items per popup.
7870 (Add_to_refs_menu): Ditto.
7872 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7874 * src/lyxparagraph.h: renamed ClearParagraph() to
7875 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7876 textclass as parameter, and do nothing if free_spacing is
7877 true. This fixes part of the line-delete-forward problems.
7879 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7880 (pasteSelection): ditto.
7881 (SwitchLayoutsBetweenClasses): more translatable strings.
7883 * src/text2.C (CutSelection): use StripLeadingSpaces.
7884 (PasteSelection): ditto.
7885 (DeleteEmptyParagraphMechanism): ditto.
7887 2000-05-26 Juergen Vigna <jug@sad.it>
7889 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7890 is not needed in tabular insets.
7892 * src/insets/insettabular.C (TabularFeatures): added missing features.
7894 * src/tabular.C (DeleteColumn):
7896 (AppendRow): implemented this functions
7897 (cellsturct::operator=): clone the inset too;
7899 2000-05-23 Juergen Vigna <jug@sad.it>
7901 * src/insets/insettabular.C (LocalDispatch): better selection support
7902 when having multicolumn-cells.
7904 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7906 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7908 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7910 * src/ColorHandler.C (getGCForeground): put more test into _()
7912 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7915 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7918 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7920 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7921 there are no labels, or when buffer is readonly.
7923 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7924 there are no labels, buffer is SGML, or when buffer is readonly.
7926 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7928 * src/LColor.C (LColor): change a couple of grey40 to grey60
7929 (LColor): rewore initalization to make compiles go some magnitude
7931 (getGUIName): don't use gettext until we need the string.
7933 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7935 * src/Bullet.[Ch]: Fixed a small bug.
7937 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7939 * src/paragraph.C (String): Several fixes/improvements
7941 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7943 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7945 * src/paragraph.C (String): give more correct output.
7947 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7949 * src/lyxfont.C (stateText) Do not output the language if it is
7950 eqaul to the language of the document.
7952 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7953 between two paragraphs with the same language.
7955 * src/paragraph.C (getParLanguage) Return a correct answer for an
7956 empty dummy paragraph.
7958 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7961 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7964 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7965 the menus/popup, if requested fonts are unavailable.
7967 2000-05-22 Juergen Vigna <jug@sad.it>
7969 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7970 movement support (Up/Down/Tab/Shift-Tab).
7971 (LocalDispatch): added also preliminari cursor-selection.
7973 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7975 * src/paragraph.C (PasteParagraph): Hopefully now right!
7977 2000-05-22 Garst R. Reese <reese@isn.net>
7979 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7980 of list, change all references to Environment to Command
7981 * tex/hollywood.cls : rewrite environments as commands, add
7982 \uppercase to interiorshot and exteriorshot to force uppecase.
7983 * tex/broadway.cls : rewrite environments as commands. Tweak
7986 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7988 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7989 size of items: use a constant intead of the hardcoded 40, and more
7990 importantly do not remove the %m and %x tags added at the end.
7991 (Add_to_refs_menu): use vector::size_type instead of
7992 unsigned int as basic types for the variables. _Please_ do not
7993 assume that size_t is equal to unsigned int. On an alpha, this is
7994 unsigned long, which is _not_ the same.
7996 * src/language.C (initL): remove language "hungarian", since it
7997 seems that "magyar" is better.
7999 2000-05-22 Juergen Vigna <jug@sad.it>
8001 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8003 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8006 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8007 next was deleted but not set to 0.
8009 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8011 * src/language.C (initL): change the initialization of languages
8012 so that compiles goes _fast_.
8014 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8017 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8019 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8023 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8025 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8027 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8031 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8034 * src/insets/insetlo*.[Ch]: Made editable
8036 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8039 the current selection.
8041 * src/BufferView_pimpl.C (stuffClipboard): new method
8043 * src/BufferView.C (stuffClipboard): new method
8045 * src/paragraph.C (String): new method
8047 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8048 LColor::ignore when lyxname is not found.
8050 * src/BufferView.C (pasteSelection): new method
8052 * src/BufferView_pimpl.C (pasteSelection): new method
8054 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8056 * src/WorkArea.C (request_clipboard_cb): new static function
8057 (getClipboard): new method
8058 (putClipboard): new method
8060 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * LyX 1.1.5pre2 released
8064 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8066 * src/vspace.C (operator=): removed
8067 (operator=): removed
8069 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8071 * src/layout.C (NumberOfClass): manually set the type in make_pair
8072 (NumberOfLayout): ditto
8074 * src/language.C: use the Language constructor for ignore_lang
8076 * src/language.h: add constructors to struct Language
8078 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8080 * src/text2.C (SetCursorIntern): comment out #warning
8082 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8084 * src/mathed/math_iter.h: initialize sx and sw to 0
8086 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8088 * forms/lyx.fd: Redesign of form_ref
8090 * src/LaTeXFeatures.[Ch]
8094 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8097 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8098 and Buffer::inset_iterator.
8100 * src/menus.C: Added new menus: TOC and Refs.
8102 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8104 * src/buffer.C (getTocList): New method.
8106 * src/BufferView2.C (ChangeRefs): New method.
8108 * src/buffer.C (getLabelList): New method. It replaces the old
8109 getReferenceList. The return type is vector<string> instead of
8112 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8113 the old getLabel() and GetNumberOfLabels() methods.
8114 * src/insets/insetlabel.C (getLabelList): ditto
8115 * src/mathed/formula.C (getLabelList): ditto
8117 * src/paragraph.C (String): New method.
8119 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8120 Uses the new getTocList() method.
8121 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8122 which automatically updates the contents of the browser.
8123 (RefUpdateCB): Use the new getLabelList method.
8125 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8127 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8129 * src/spellchecker.C: Added using std::reverse;
8131 2000-05-19 Juergen Vigna <jug@sad.it>
8133 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8135 * src/insets/insettext.C (computeTextRows): small fix for display of
8136 1 character after a newline.
8138 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8141 2000-05-18 Juergen Vigna <jug@sad.it>
8143 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8144 when changing width of column.
8146 * src/tabular.C (set_row_column_number_info): setting of
8147 autobreak rows if necessary.
8149 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8153 * src/vc-backend.*: renamed stat() to status() and vcstat to
8154 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8155 compilation broke. The new name seems more relevant, anyway.
8157 2000-05-17 Juergen Vigna <jug@sad.it>
8159 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8160 which was wrong if the removing caused removing of rows!
8162 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8163 (pushToken): new function.
8165 * src/text2.C (CutSelection): fix problem discovered with purify
8167 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8169 * src/debug.C (showTags): enlarge the first column, now that we
8170 have 6-digits debug codes.
8172 * lib/layouts/hollywood.layout:
8173 * lib/tex/hollywood.cls:
8174 * lib/tex/brodway.cls:
8175 * lib/layouts/brodway.layout: more commands and fewer
8176 environments. Preambles moved in the .cls files. Broadway now has
8177 more options on scene numbering and less whitespace (from Garst)
8179 * src/insets/insetbib.C (getKeys): make sure that we are in the
8180 document directory, in case the bib file is there.
8182 * src/insets/insetbib.C (Latex): revert bogus change.
8184 2000-05-16 Juergen Vigna <jug@sad.it>
8186 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8187 the TabularLayout on cursor move.
8189 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8191 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8194 (draw): fixed cursor position and drawing so that the cursor is
8195 visible when before the tabular-inset.
8197 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8198 when creating from old insettext.
8200 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8202 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8204 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8205 * lib/tex/brodway.cls: ditto
8207 * lib/layouts/brodway.layout: change alignment of parenthical
8210 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8212 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8213 versions 0.88 and 0.89 are supported.
8215 2000-05-15 Juergen Vigna <jug@sad.it>
8217 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8220 * src/insets/insettext.C (computeTextRows): redone completely this
8221 function in a much cleaner way, because of problems when having a
8223 (draw): added a frame border when the inset is locked.
8224 (SetDrawLockedFrame): this sets if we draw the border or not.
8225 (SetFrameColor): this sets the frame color (default=insetframe).
8227 * src/insets/lyxinset.h: added x() and y() functions which return
8228 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8229 function which is needed to see if we have a locking inset of some
8230 type in this inset (needed for now in insettabular).
8232 * src/vspace.C (inPixels): the same function also without a BufferView
8233 parameter as so it is easier to use it in some ocasions.
8235 * src/lyxfunc.C: changed all places where insertInset was used so
8236 that now if it couldn't be inserted it is deleted!
8238 * src/TabularLayout.C:
8239 * src/TableLayout.C: added support for new tabular-inset!
8241 * src/BufferView2.C (insertInset): this now returns a bool if the
8242 inset was really inserted!!!
8244 * src/tabular.C (GetLastCellInRow):
8245 (GetFirstCellInRow): new helper functions.
8246 (Latex): implemented for new tabular class.
8250 (TeXTopHLine): new Latex() helper functions.
8252 2000-05-12 Juergen Vigna <jug@sad.it>
8254 * src/mathed/formulamacro.C (Read):
8255 * src/mathed/formula.C (Read): read also the \end_inset here!
8257 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8259 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8260 crush when saving formulae with unbalanced parenthesis.
8262 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8264 * src/layout.C: Add new keyword "endlabelstring" to layout file
8266 * src/text.C (GetVisibleRow): Draw endlabel string.
8268 * lib/layouts/broadway.layout
8269 * lib/layouts/hollywood.layout: Added endlabel for the
8270 Parenthetical layout.
8272 * lib/layouts/heb-article.layout: Do not use slanted font shape
8273 for Theorem like environments.
8275 * src/buffer.C (makeLaTeXFile): Always add "american" to
8276 the UsedLanguages list if document language is RTL.
8278 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8280 * add addendum to README.OS2 and small patch (from SMiyata)
8282 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8284 * many files: correct the calls to ChangeExtension().
8286 * src/support/filetools.C (ChangeExtension): remove the no_path
8287 argument, which does not belong there. Use OnlyFileName() instead.
8289 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8290 files when LaTeXing a non-nice latex file.
8292 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8293 a chain of "if". Return false when deadkeys are not handled.
8295 * src/lyx_main.C (LyX): adapted the code for default bindings.
8297 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8298 bindings for basic functionality (except deadkeys).
8299 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8301 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8302 several methods: handle override_x_deadkeys.
8304 * src/lyxrc.h: remove the "bindings" map, which did not make much
8305 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8307 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8309 * src/lyxfont.C (stateText): use a saner method to determine
8310 whether the font is "default". Seems to fix the crash with DEC
8313 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8315 2000-05-08 Juergen Vigna <jug@sad.it>
8317 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8318 TabularLayoutMenu with mouse-button-3
8319 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8321 * src/TabularLayout.C: added this file for having a Layout for
8324 2000-05-05 Juergen Vigna <jug@sad.it>
8326 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8327 recalculating inset-widths.
8328 (TabularFeatures): activated this function so that I can change
8329 tabular-features via menu.
8331 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8332 that I can test some functions with the Table menu.
8334 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8336 * src/lyxfont.C (stateText): guard against stupid c++libs.
8338 * src/tabular.C: add using std::vector
8339 some whitespace changes, + removed som autogenerated code.
8341 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8343 2000-05-05 Juergen Vigna <jug@sad.it>
8345 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8346 row, columns and cellstructures.
8348 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8350 * lib/lyxrc.example: remove obsolete entries.
8352 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8353 reading of protected_separator for free_spacing.
8355 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8357 * src/text.C (draw): do not display an exclamation mark in the
8358 margin for margin notes. This is confusing, ugly and
8361 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8362 AMS math' is checked.
8364 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8365 name to see whether including the amsmath package is needed.
8367 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8369 * src/paragraph.C (validate): Compute UsedLanguages correctly
8370 (don't insert the american language if it doesn't appear in the
8373 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8374 The argument of \thanks{} command is considered moving argument
8376 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8379 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8381 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8382 for appendix/minipage/depth. The lines can be now both in the footnote
8383 frame, and outside the frame.
8385 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8388 2000-05-05 Juergen Vigna <jug@sad.it>
8390 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8391 neede only in tabular.[Ch].
8393 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8395 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8397 (Write): write '~' for PROTECTED_SEPARATOR
8399 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8404 * src/mathed/formula.C (drawStr): rename size to siz.
8406 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8407 possibly fix a bug by not changing the pflags = flags to piflags =
8410 2000-05-05 Juergen Vigna <jug@sad.it>
8412 * src/insets/insetbib.C: moved using directive
8414 * src/ImportNoweb.C: small fix for being able to compile (missing
8417 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8419 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8420 to use clear, since we don't depend on this in the code. Add test
8423 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8425 * (various *.C files): add using std::foo directives to please dec
8428 * replace calls to string::clear() to string::erase() (Angus)
8430 * src/cheaders/cmath: modified to provide std::abs.
8432 2000-05-04 Juergen Vigna <jug@sad.it>
8434 * src/insets/insettext.C: Prepared all for inserting of multiple
8435 paragraphs. Still display stuff to do (alignment and other things),
8436 but I would like to use LyXText to do this when we cleaned out the
8437 table-support stuff.
8439 * src/insets/insettabular.C: Changed lot of stuff and added lots
8440 of functionality still a lot to do.
8442 * src/tabular.C: Various functions changed name and moved to be
8443 const functions. Added new Read and Write functions and changed
8444 lots of things so it works good with tabular-insets (also removed
8445 some stuff which is not needed anymore * hacks *).
8447 * src/lyxcursor.h: added operators == and != which just look if
8448 par and pos are (not) equal.
8450 * src/buffer.C (latexParagraphs): inserted this function to latex
8451 all paragraphs form par to endpar as then I can use this too for
8454 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8455 so that I can call this to from text insets with their own cursor.
8457 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8458 output off all paragraphs (because of the fix below)!
8460 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8461 the very last paragraph (this could be also the last paragraph of an
8464 * src/texrow.h: added rows() call which returns the count-variable.
8466 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8468 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8470 * lib/configure.m4: better autodetection of DocBook tools.
8472 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8474 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8476 * src/lyx_cb.C: add using std::reverse;
8478 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8481 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8482 selected files. Should fix repeated errors from generated files.
8484 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8486 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8488 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8489 the spellchecker popup.
8491 * lib/lyxrc.example: Removed the \number_inset section
8493 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8495 * src/insets/figinset.C (various): Use IsFileReadable() to make
8496 sure that the file actually exist. Relying on ghostscripts errors
8497 is a bad idea since they can lead to X server crashes.
8499 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8501 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8504 * lib/lyxrc.example: smallish typo in description of
8505 \view_dvi_paper_option
8507 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8510 * src/lyxfunc.C: doImportHelper to factor out common code of the
8511 various import methods. New functions doImportASCIIasLines,
8512 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8513 doImportLinuxDoc for the format specific parts.
8516 * buffer.C: Dispatch returns now a bool to indicate success
8519 * lyx_gui.C: Add getLyXView() for member access
8521 * lyx_main.C: Change logic for batch commands: First try
8522 Buffer::Dispatch (possibly without GUI), if that fails, use
8525 * lyx_main.C: Add support for --import command line switch.
8526 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8527 Available Formats: Everything accepted by 'buffer-import <format>'
8529 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8531 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8534 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8535 documents will be reformatted upon reentry.
8537 2000-04-27 Juergen Vigna <jug@sad.it>
8539 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8540 correctly only last pos this was a bug.
8542 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8544 * release of lyx-1.1.5pre1
8546 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8548 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8550 * src/menus.C: revert the change of naming (Figure->Graphic...)
8551 from 2000-04-11. It was incomplete and bad.
8553 * src/LColor.[Ch]: add LColor::depthbar.
8554 * src/text.C (GetVisibleRow): use it.
8556 * README: update the languages list.
8558 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8560 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8563 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8565 * README: remove sections that were just wrong.
8567 * src/text2.C (GetRowNearY): remove currentrow code
8569 * src/text.C (GetRow): remove currentrow code
8571 * src/screen.C (Update): rewritten a bit.
8572 (SmallUpdate): removed func
8574 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8576 (FullRebreak): return bool
8577 (currentrow): remove var
8578 (currentrow_y): ditto
8580 * src/lyxscreen.h (Draw): change arg to unsigned long
8581 (FitCursor): return bool
8582 (FitManualCursor): ditto
8583 (Smallpdate): remove func
8584 (first): change to unsigned long
8585 (DrawOneRow): change second arg to long (from long &)
8586 (screen_refresh_y): remove var
8587 (scree_refresh_row): ditto
8589 * src/lyxrow.h: change baseline to usigned int from unsigned
8590 short, this brings some implicit/unsigned issues out in the open.
8592 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8594 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8595 instead of smallUpdate.
8597 * src/lyxcursor.h: change y to unsigned long
8599 * src/buffer.h: don't call updateScrollbar after fitcursor
8601 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8602 where they are used. Removed "\\direction", this was not present
8603 in 1.1.4 and is already obsolete. Commented out some code that I
8604 believe to never be called.
8605 (runLiterate): don't call updateScrollbar after fitCursor
8607 (buildProgram): ditto
8610 * src/WorkArea.h (workWidth): change return val to unsigned
8613 (redraw): remove the button redraws
8614 (setScrollbarValue): change for scrollbar
8615 (getScrollbarValue): change for scrollbar
8616 (getScrollbarBounds): change for scrollbar
8618 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8619 (C_WorkArea_down_cb): removed func
8620 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8621 (resize): change for scrollbar
8622 (setScrollbar): ditto
8623 (setScrollbarBounds): ditto
8624 (setScrollbarIncrements): ditto
8625 (up_cb): removed func
8626 (down_cb): removed func
8627 (scroll_cb): change for scrollbar
8628 (work_area_handler): ditto
8630 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8631 when FitCursor did something.
8632 (updateScrollbar): some unsigned changes
8633 (downCB): removed func
8634 (scrollUpOnePage): removed func
8635 (scrollDownOnePage): remvoed func
8636 (workAreaMotionNotify): don't call screen->FitCursor but use
8637 fitCursor instead. and bool return val
8638 (workAreaButtonPress): ditto
8639 (workAreaButtonRelease): some unsigned changes
8640 (checkInsetHit): ditto
8641 (workAreaExpose): ditto
8642 (update): parts rewritten, comments about the signed char arg added
8643 (smallUpdate): removed func
8644 (cursorPrevious): call needed updateScrollbar
8647 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8650 * src/BufferView.[Ch] (upCB): removed func
8651 (downCB): removed func
8652 (smallUpdate): removed func
8654 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8656 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8657 currentrow, currentrow_y optimization. This did not help a lot and
8658 if we want to do this kind of optimization we should rather use
8659 cursor.row instead of the currentrow.
8661 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8662 buffer spacing and klyx spacing support.
8664 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8666 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8669 2000-04-26 Juergen Vigna <jug@sad.it>
8671 * src/insets/figinset.C: fixes to Lars sstream changes!
8673 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8675 * A lot of files: Added Ascii(ostream &) methods to all inset
8676 classes. Used when exporting to ASCII.
8678 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8679 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8682 * src/text2.C (ToggleFree): Disabled implicit word selection when
8683 there is a change in the language
8685 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8686 no output was generated for end-of-sentence inset.
8688 * src/insets/lyxinset.h
8691 * src/paragraph.C: Removed the insetnumber code
8693 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8695 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8697 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8698 no_babel and no_epsfig completely from the file.
8699 (parseSingleLyXformat2Token): add handling for per-paragraph
8700 spacing as written by klyx.
8702 * src/insets/figinset.C: applied patch by Andre. Made it work with
8705 2000-04-20 Juergen Vigna <jug@sad.it>
8707 * src/insets/insettext.C (cutSelection):
8708 (copySelection): Fixed with selection from right to left.
8709 (draw): now the rows are not recalculated at every draw.
8710 (computeTextRows): for now reset the inset-owner here (this is
8711 important for an undo or copy where the inset-owner is not set
8714 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8715 motion to the_locking_inset screen->first was forgotten, this was
8716 not important till we got multiline insets.
8718 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8720 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8721 code seems to be alright (it is code changed by Dekel, and the
8722 intent is indeed that all macros should be defined \protect'ed)
8724 * NEWS: a bit of reorganisation of the new user-visible features.
8726 2000-04-19 Juergen Vigna <jug@sad.it>
8728 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8729 position. Set the inset_owner of the used paragraph so that it knows
8730 that it is inside an inset. Fixed cursor handling with mouse and
8731 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8732 and cleanups to make TextInsets work better.
8734 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8735 Changed parameters of various functions and added LockInsetInInset().
8737 * src/insets/insettext.C:
8739 * src/insets/insetcollapsable.h:
8740 * src/insets/insetcollapsable.C:
8741 * src/insets/insetfoot.h:
8742 * src/insets/insetfoot.C:
8743 * src/insets/insetert.h:
8744 * src/insets/insetert.C: cleaned up the code so that it works now
8745 correctly with insettext.
8747 * src/insets/inset.C:
8748 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8749 that insets in insets are supported right.
8752 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8754 * src/paragraph.C: some small fixes
8756 * src/debug.h: inserted INSETS debug info
8758 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8759 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8761 * src/commandtags.h:
8762 * src/LyXAction.C: insert code for InsetTabular.
8764 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8765 not Button1MotionMask.
8766 (workAreaButtonRelease): send always a InsetButtonRelease event to
8768 (checkInsetHit): some setCursor fixes (always with insets).
8770 * src/BufferView2.C (lockInset): returns a bool now and extended for
8771 locking insets inside insets.
8772 (showLockedInsetCursor): it is important to have the cursor always
8773 before the locked inset.
8774 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8776 * src/BufferView.h: made lockInset return a bool.
8778 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8780 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8781 that is used also internally but can be called as public to have back
8782 a cursor pos which is not set internally.
8783 (SetCursorIntern): Changed to use above function.
8785 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8787 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8792 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8793 patches for things that should be in or should be changed.
8795 * src/* [insetfiles]: change "usigned char fragile" to bool
8796 fragile. There was only one point that could that be questioned
8797 and that is commented in formulamacro.C. Grep for "CHECK".
8799 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8800 (DeleteBuffer): take it out of CutAndPaste and make it static.
8802 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8804 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8805 output the spacing envir commands. Also the new commands used in
8806 the LaTeX output makes the result better.
8808 * src/Spacing.C (writeEnvirBegin): new method
8809 (writeEnvirEnd): new method
8811 2000-04-18 Juergen Vigna <jug@sad.it>
8813 * src/CutAndPaste.C: made textclass a static member of the class
8814 as otherwise it is not accesed right!!!
8816 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8818 * forms/layout_forms.fd
8819 * src/layout_forms.h
8820 * src/layout_forms.C (create_form_form_character)
8821 * src/lyx_cb.C (UserFreeFont)
8822 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8823 documents (in the layout->character popup).
8825 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8827 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8828 \spell_command was in fact not honored (from Kevin Atkinson).
8830 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8833 * src/lyx_gui.h: make lyxViews private (Angus)
8835 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8837 * src/mathed/math_write.C
8838 (MathMatrixInset::Write) Put \protect before \begin{array} and
8839 \end{array} if fragile
8840 (MathParInset::Write): Put \protect before \\ if fragile
8842 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8844 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8845 initialization if the LyXColorHandler must be done after the
8846 connections to the XServer has been established.
8848 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8849 get the background pixel from the lyxColorhandler so that the
8850 figures are rendered with the correct background color.
8851 (NextToken): removed functions.
8852 (GetPSSizes): use ifs >> string instead of NextToken.
8854 * src/Painter.[Ch]: the color cache moved out of this file.
8856 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8859 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8861 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8862 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8864 * src/BufferView.C (enterView): new func
8865 (leaveView): new func
8867 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8869 (leaveView): new func, undefines xterm cursor when approp.
8871 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8872 (AllowInput): delete the Workarea cursor handling from this func.
8874 * src/Painter.C (underline): draw a slimer underline in most cases.
8876 * src/lyx_main.C (error_handler): use extern "C"
8878 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8880 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8881 sent directly to me.
8883 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8884 to the list by Dekel.
8886 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8889 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8890 methods from lyx_cb.here.
8892 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8895 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8897 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8898 instead of using current_view directly.
8900 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8902 * src/LyXAction.C (init): add the paragraph-spacing command.
8904 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8906 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8908 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8909 different from the documents.
8911 * src/text.C (SetHeightOfRow): take paragraph spacing into
8912 account, paragraph spacing takes precedence over buffer spacing
8913 (GetVisibleRow): ditto
8915 * src/paragraph.C (writeFile): output the spacing parameter too.
8916 (validate): set the correct features if spacing is used in the
8918 (Clear): set spacing to default
8919 (MakeSameLayout): spacing too
8920 (HasSameLayout): spacing too
8921 (SetLayout): spacing too
8922 (TeXOnePar): output the spacing commands
8924 * src/lyxparagraph.h: added a spacing variable for use with
8925 per-paragraph spacing.
8927 * src/Spacing.h: add a Default spacing and a method to check if
8928 the current spacing is default. also added an operator==
8930 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8933 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8935 * src/lyxserver.C (callback): fix dispatch of functions
8937 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8938 printf() into lyxerr call.
8940 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8943 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8944 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8945 the "Float" from each of the subitems.
8946 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8948 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8949 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8950 documented the change so that the workaround can be nuked later.
8952 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8955 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8957 * src/buffer.C (getLatexName): ditto
8958 (setReadonly): ditto
8960 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8962 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8963 avoid some uses of current_view. Added also a bufferParams()
8964 method to get at this.
8966 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8968 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8970 * src/lyxparagraph.[Ch]: removed
8971 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8972 with operators used by lower_bound and
8973 upper_bound in InsetTable's
8974 Make struct InsetTable private again. Used matchpos.
8976 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8978 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8979 document, the language of existing text is changed (unless the
8980 document is multi-lingual)
8982 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8984 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8986 * A lot of files: A rewrite of the Right-to-Left support.
8988 2000-04-10 Juergen Vigna <jug@sad.it>
8990 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8991 misplaced cursor when inset in inset is locked.
8993 * src/insets/insettext.C (LocalDispatch): small fix so that a
8994 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8996 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8997 footnote font should be decreased in size twice when displaying.
8999 * src/insets/insettext.C (GetDrawFont): inserted this function as
9000 the drawing-font may differ from the real paragraph font.
9002 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9003 insets (inset in inset!).
9005 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9006 function here because we don't want footnotes inside footnotes.
9008 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9010 (init): now set the inset_owner in paragraph.C
9011 (LocalDispatch): added some resetPos() in the right position
9014 (pasteSelection): changed to use the new CutAndPaste-Class.
9016 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9017 which tells if it is allowed to insert another inset inside this one.
9019 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9020 SwitchLayoutsBetweenClasses.
9022 * src/text2.C (InsertInset): checking of the new paragraph-function
9024 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9025 is not needed anymore here!
9028 (PasteSelection): redone (also with #ifdef) so that now this uses
9029 the CutAndPaste-Class.
9030 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9033 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9034 from/to text/insets.
9036 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9037 so that the paragraph knows if it is inside an (text)-inset.
9038 (InsertFromMinibuffer): changed return-value to bool as now it
9039 may happen that an inset is not inserted in the paragraph.
9040 (InsertInsetAllowed): this checks if it is allowed to insert an
9041 inset in this paragraph.
9043 (BreakParagraphConservative):
9044 (BreakParagraph) : small change for the above change of the return
9045 value of InsertFromMinibuffer.
9047 * src/lyxparagraph.h: added inset_owner and the functions to handle
9048 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9050 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9052 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9053 functions from BufferView to BufferView::Pimpl to ease maintence.
9055 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9056 correctly. Also use SetCursorIntern instead of SetCursor.
9058 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9061 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9063 * src/WorkArea.C (belowMouse): manually implement below mouse.
9065 * src/*: Add "explicit" on several constructors, I added probably
9066 some unneeded ones. A couple of changes to code because of this.
9068 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9069 implementation and private parts from the users of BufferView. Not
9072 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9073 implementation and private parts from the users of LyXLex. Not
9076 * src/BufferView_pimpl.[Ch]: new files
9078 * src/lyxlex_pimpl.[Ch]: new files
9080 * src/LyXView.[Ch]: some inline functions move out-of-line
9082 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9084 * src/lyxparagraph.h: make struct InsetTable public.
9086 * src/support/lyxstring.h: change lyxstring::difference_type to be
9087 ptrdiff_t. Add std:: modifiers to streams.
9089 * src/font.C: include the <cctype> header, for islower() and
9092 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9094 * src/font.[Ch]: new files. Contains the metric functions for
9095 fonts, takes a LyXFont as parameter. Better separation of concepts.
9097 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9098 changes because of this.
9100 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9102 * src/*: compile with -Winline and move functions that don't
9105 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9108 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9110 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9111 (various files changed because of this)
9113 * src/Painter.C (text): fixed the drawing of smallcaps.
9115 * src/lyxfont.[Ch] (drawText): removed unused member func.
9118 * src/*.C: added needed "using" statements and "std::" qualifiers.
9120 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9122 * src/*.h: removed all use of "using" from header files use
9123 qualifier std:: instead.
9125 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9127 * src/text.C (Backspace): some additional cleanups (we already
9128 know whether cursor.pos is 0 or not).
9130 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9131 automake does not provide one).
9133 * src/bmtable.h: replace C++ comments with C comments.
9135 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9137 * src/screen.C (ShowCursor): Change the shape of the cursor if
9138 the current language is not equal to the language of the document.
9139 (If the cursor change its shape unexpectedly, then you've found a bug)
9141 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9144 * src/insets/insetnumber.[Ch]: New files.
9146 * src/LyXAction.C (init)
9147 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9150 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9152 * src/lyxparagraph.h
9153 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9154 (the vector is kept sorted).
9156 * src/text.C (GetVisibleRow): Draw selection correctly when there
9157 is both LTR and RTL text.
9159 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9160 which is much faster.
9162 * src/text.C (GetVisibleRow and other): Do not draw the last space
9163 in a row if the direction of the last letter is not equal to the
9164 direction of the paragraph.
9166 * src/lyxfont.C (latexWriteStartChanges):
9167 Check that font language is not equal to basefont language.
9168 (latexWriteEndChanges): ditto
9170 * src/lyx_cb.C (StyleReset): Don't change the language while using
9171 the font-default command.
9173 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9174 empty paragraph before a footnote.
9176 * src/insets/insetcommand.C (draw): Increase x correctly.
9178 * src/screen.C (ShowCursor): Change cursor shape if
9179 current language != document language.
9181 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9183 2000-03-31 Juergen Vigna <jug@sad.it>
9185 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9186 (Clone): changed mode how the paragraph-data is copied to the
9187 new clone-paragraph.
9189 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9190 GetInset(pos) with no inset anymore there (in inset UNDO)
9192 * src/insets/insetcommand.C (draw): small fix as here x is
9193 incremented not as much as width() returns (2 before, 2 behind = 4)
9195 2000-03-30 Juergen Vigna <jug@sad.it>
9197 * src/insets/insettext.C (InsetText): small fix in initialize
9198 widthOffset (should not be done in the init() function)
9200 2000-03-29 Amir Karger <karger@lyx.org>
9202 * lib/examples/it_ItemizeBullets.lyx: translation by
9205 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9207 2000-03-29 Juergen Vigna <jug@sad.it>
9209 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9211 * src/insets/insetfoot.C (Clone): small change as for the below
9212 new init function in the text-inset
9214 * src/insets/insettext.C (init): new function as I've seen that
9215 clone did not copy the Paragraph-Data!
9216 (LocalDispatch): Added code so that now we have some sort of Undo
9217 functionality (well actually we HAVE Undo ;)
9219 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9221 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9223 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9226 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9228 * src/main.C: added a runtime check that verifies that the xforms
9229 header used when building LyX and the library used when running
9230 LyX match. Exit with a message if they don't match. This is a
9231 version number check only.
9233 * src/buffer.C (save): Don't allocate memory on the heap for
9234 struct utimbuf times.
9236 * *: some using changes, use iosfwd instead of the real headers.
9238 * src/lyxfont.C use char const * instead of string for the static
9239 strings. Rewrite some functions to use sstream.
9241 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9243 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9246 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9248 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9249 of Geodesy (from Martin Vermeer)
9251 * lib/layouts/svjour.inc: include file for the Springer svjour
9252 class. It can be used to support journals other than JoG.
9254 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9255 Miskiewicz <misiek@pld.org.pl>)
9256 * lib/reLyX/Makefile.am: ditto.
9258 2000-03-27 Juergen Vigna <jug@sad.it>
9260 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9261 also some modifications with operations on selected text.
9263 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9264 problems with clicking on insets (last famous words ;)
9266 * src/insets/insetcommand.C (draw):
9267 (width): Changed to have a bit of space before and after the inset so
9268 that the blinking cursor can be seen (otherwise it was hidden)
9270 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9272 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9273 would not be added to the link list when an installed gettext (not
9274 part of libc) is found.
9276 2000-03-24 Juergen Vigna <jug@sad.it>
9278 * src/insets/insetcollapsable.C (Edit):
9279 * src/mathed/formula.C (InsetButtonRelease):
9280 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9283 * src/BufferView.C (workAreaButtonPress):
9284 (workAreaButtonRelease):
9285 (checkInsetHit): Finally fixed the clicking on insets be handled
9288 * src/insets/insetert.C (Edit): inserted this call so that ERT
9289 insets work always with LaTeX-font
9291 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9293 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9294 caused lyx to startup with no GUI in place, causing in a crash
9295 upon startup when called with arguments.
9297 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9299 * src/FontLoader.C: better initialization of dummyXFontStruct.
9301 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9303 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9304 for linuxdoc and docbook import and export format options.
9306 * lib/lyxrc.example Example of default values for the previous flags.
9308 * src/lyx_cb.C Use those flags instead of the hardwired values for
9309 linuxdoc and docbook export.
9311 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9314 * src/menus.C Added menus entries for the new import/exports formats.
9316 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9318 * src/lyxrc.*: Added support for running without Gui
9321 * src/FontLoader.C: sensible defaults if no fonts are needed
9323 * src/lyx_cb.C: New function ShowMessage (writes either to the
9324 minibuffer or cout in case of no gui
9325 New function AskOverwrite for common stuff
9326 Consequently various changes to call these functions
9328 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9329 wild guess at sensible screen resolution when having no gui
9331 * src/lyxfont.C: no gui, no fonts... set some defaults
9333 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9335 * src/LColor.C: made the command inset background a bit lighter.
9337 2000-03-20 Hartmut Goebel <goebel@noris.net>
9339 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9340 stdstruct.inc. Koma-Script added some title elements which
9341 otherwise have been listed below "bibliography". This split allows
9342 adding title elements to where they belong.
9344 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9345 define the additional title elements and then include
9348 * many other layout files: changed to include stdtitle.inc just
9349 before stdstruct.inc.
9351 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9353 * src/buffer.C: (save) Added the option to store all backup files
9354 in a single directory
9356 * src/lyxrc.[Ch]: Added variable \backupdir_path
9358 * lib/lyxrc.example: Added descriptions of recently added variables
9360 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9361 bibtex inset, not closing the bibtex popup when deleting the inset)
9363 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9365 * src/lyx_cb.C: add a couple using directives.
9367 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9368 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9369 import based on the filename.
9371 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9372 file would be imported at start, if the filename where of a sgml file.
9374 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9376 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9378 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9379 * src/lyxfont.h Replaced the member variable bits.direction by the
9380 member variable lang. Made many changes in other files.
9381 This allows having a multi-lingual document
9383 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9384 that change the current language to <l>.
9385 Removed the command "font-rtl"
9387 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9388 format for Hebrew documents)
9390 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9391 When auto_mathmode is "true", pressing a digit key in normal mode
9392 will cause entering into mathmode.
9393 If auto_mathmode is "rtl" then this behavior will be active only
9394 when writing right-to-left text.
9396 * src/text2.C (InsertStringA) The string is inserted using the
9399 * src/paragraph.C (GetEndLabel) Gives a correct result for
9400 footnote paragraphs.
9402 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9404 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9406 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9407 front of PasteParagraph. Never insert a ' '. This should at least
9408 fix some cause for the segfaults that we have been experiencing,
9409 it also fixes backspace behaviour slightly. (Phu!)
9411 * src/support/lstrings.C (compare_no_case): some change to make it
9412 compile with gcc 2.95.2 and stdlibc++-v3
9414 * src/text2.C (MeltFootnoteEnvironment): change type o
9415 first_footnote_par_is_not_empty to bool.
9417 * src/lyxparagraph.h: make text private. Changes in other files
9419 (fitToSize): new function
9420 (setContentsFromPar): new function
9421 (clearContents): new function
9422 (SetChar): new function
9424 * src/paragraph.C (readSimpleWholeFile): deleted.
9426 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9427 the file, just use a simple string instead. Also read the file in
9428 a more maintainable manner.
9430 * src/text2.C (InsertStringA): deleted.
9431 (InsertStringB): deleted.
9433 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9435 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9436 RedoParagraphs from the doublespace handling part, just set status
9437 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9438 done, but perhaps not like this.)
9440 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9442 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9443 character when inserting an inset.
9445 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9447 * src/bufferparams.C (readLanguage): now takes "default" into
9450 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9451 also initialize the toplevel_keymap with the default bindings from
9454 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9456 * all files using lyxrc: have lyxrc as a real variable and not a
9457 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9460 * src/lyxrc.C: remove double call to defaultKeyBindings
9462 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9463 toolbar defauls using lyxlex. Remove enums, structs, functions
9466 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9467 toolbar defaults. Also store default keybindings in a map.
9469 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9470 storing the toolbar defaults without any xforms dependencies.
9472 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9473 applied. Changed to use iterators.
9475 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9477 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9478 systems that don't have LINGUAS set to begin with.
9480 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9483 the list by Dekel Tsur.
9485 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9487 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9488 * src/insets/form_graphics.C: ditto.
9490 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9492 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9494 * src/bufferparams.C (readLanguage): use the new language map
9496 * src/intl.C (InitKeyMapper): use the new language map
9498 * src/lyx_gui.C (create_forms): use the new language map
9500 * src/language.[Ch]: New files. Used for holding the information
9501 about each language. Now! Use this new language map enhance it and
9502 make it really usable for our needs.
9504 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9506 * screen.C (ShowCursor): Removed duplicate code.
9507 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9508 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9510 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9513 * src/text.C Added TransformChar method. Used for rendering Arabic
9514 text correctly (change the glyphs of the letter according to the
9515 position in the word)
9520 * src/lyxrc.C Added lyxrc command {language_command_begin,
9521 language_command_end,language_command_ltr,language_command_rtl,
9522 language_package} which allows the use of either arabtex or Omega
9525 * src/lyx_gui.C (init)
9527 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9528 to use encoding for menu fonts which is different than the encoding
9531 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9532 do not load the babel package.
9533 To write an English document with Hebrew/Arabic, change the document
9534 language to "english".
9536 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9537 (alphaCounter): changed to return char
9538 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9540 * lib/lyxrc.example Added examples for Hebrew/Arabic
9543 * src/layout.C Added layout command endlabeltype
9545 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9547 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9549 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9551 * src/mathed/math_delim.C (search_deco): return a
9552 math_deco_struct* instead of index.
9554 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9556 * All files with a USE_OSTREAM_ONLY within: removed all code that
9557 was unused when USE_OSTREAM_ONLY is defined.
9559 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9560 of any less. Removed header and using.
9562 * src/text.C (GetVisibleRow): draw the string "Page Break
9563 (top/bottom)" on screen when drawing a pagebreak line.
9565 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9567 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9569 * src/mathed/math_macro.C (draw): do some cast magic.
9572 * src/mathed/math_defs.h: change byte* argument to byte const*.
9574 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9576 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9577 know it is right to return InsetFoot* too, but cxx does not like
9580 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9582 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9584 * src/mathed/math_delim.C: change == to proper assignment.
9586 2000-03-09 Juergen Vigna <jug@sad.it>
9588 * src/insets/insettext.C (setPos): fixed various cursor positioning
9589 problems (via mouse and cursor-keys)
9590 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9591 inset (still a small display problem but it works ;)
9593 * src/insets/insetcollapsable.C (draw): added button_top_y and
9594 button_bottom_y to have correct values for clicking on the inset.
9596 * src/support/lyxalgo.h: commented out 'using std::less'
9598 2000-03-08 Juergen Vigna <jug@sad.it>
9600 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9601 Button-Release event closes as it is alos the Release-Event
9604 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9606 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9608 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9609 can add multiple spaces in Scrap (literate programming) styles...
9610 which, by the way, is how I got hooked on LyX to begin with.
9612 * src/mathed/formula.C (Write): Added dummy variable to an
9613 inset::Latex() call.
9614 (Latex): Add free_spacing boolean to inset::Latex()
9616 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9618 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9619 virtual function to include the free_spacing boolean from
9620 the containing paragraph's style.
9622 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9623 Added free_spacing boolean arg to match inset.h
9625 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9626 Added free_spacing boolean arg to match inset.h
9628 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9629 Added free_spacing boolean and made sure that if in a free_spacing
9630 paragraph, that we output normal space if there is a protected space.
9632 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9633 Added free_spacing boolean arg to match inset.h
9635 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9636 Added free_spacing boolean arg to match inset.h
9638 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9639 Added free_spacing boolean arg to match inset.h
9641 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9642 Added free_spacing boolean arg to match inset.h
9644 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9645 Added free_spacing boolean arg to match inset.h
9647 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9648 free_spacing boolean arg to match inset.h
9650 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9651 Added free_spacing boolean arg to match inset.h
9653 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9654 Added free_spacing boolean arg to match inset.h
9656 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9657 Added free_spacing boolean arg to match inset.h
9659 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9660 Added free_spacing boolean arg to match inset.h
9662 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9663 Added free_spacing boolean arg to match inset.h
9665 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9666 free_spacing boolean arg to match inset.h
9668 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9669 free_spacing boolean arg to match inset.h
9671 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9672 ignore free_spacing paragraphs. The user's spaces are left
9675 * src/text.C (InsertChar): Fixed the free_spacing layout
9676 attribute behavior. Now, if free_spacing is set, you can
9677 add multiple spaces in a paragraph with impunity (and they
9678 get output verbatim).
9679 (SelectSelectedWord): Added dummy argument to inset::Latex()
9682 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9685 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9686 paragraph layouts now only input a simple space instead.
9687 Special character insets don't make any sense in free-spacing
9690 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9691 hard-spaces in the *input* file to simple spaces if the layout
9692 is free-spacing. This converts old files which had to have
9693 hard-spaces in free-spacing layouts where a simple space was
9695 (writeFileAscii): Added free_spacing check to pass to the newly
9696 reworked inset::Latex(...) methods. The inset::Latex() code
9697 ensures that hard-spaces in free-spacing paragraphs get output
9698 as spaces (rather than "~").
9700 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9702 * src/mathed/math_delim.C (draw): draw the empty placeholder
9703 delims with a onoffdash line.
9704 (struct math_deco_compare): struct that holds the "functors" used
9705 for the sort and the binary search in math_deco_table.
9706 (class init_deco_table): class used for initial sort of the
9708 (search_deco): use lower_bound to do a binary search in the
9711 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9713 * src/lyxrc.C: a small secret thingie...
9715 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9716 and to not flush the stream as often as it used to.
9718 * src/support/lyxalgo.h: new file
9719 (sorted): template function used for checking if a sequence is
9720 sorted or not. Two versions with and without user supplied
9721 compare. Uses same compare as std::sort.
9723 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9724 it and give warning on lyxerr.
9726 (struct compare_tags): struct with function operators used for
9727 checking if sorted, sorting and lower_bound.
9728 (search_kw): use lower_bound instead of manually implemented
9731 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9733 * src/insets/insetcollapsable.h: fix Clone() declaration.
9734 * src/insets/insetfoot.h: ditto.
9736 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9738 2000-03-08 Juergen Vigna <jug@sad.it>
9740 * src/insets/lyxinset.h: added owner call which tells us if
9741 this inset is inside another inset. Changed also the return-type
9742 of Editable to an enum so it tells clearer what the return-value is.
9744 * src/insets/insettext.C (computeTextRows): fixed computing of
9745 textinsets which split automatically on more rows.
9747 * src/insets/insetert.[Ch]: changed this to be of BaseType
9750 * src/insets/insetfoot.[Ch]: added footnote inset
9752 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9753 collapsable insets (like footnote, ert, ...)
9755 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9757 * src/lyxdraw.h: remvoe file
9759 * src/lyxdraw.C: remove file
9761 * src/insets/insettext.C: added <algorithm>.
9763 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9765 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9766 (matrix_cb): case MM_OK use string stream
9768 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9771 * src/mathed/math_macro.C (draw): use string stream
9772 (Metrics): use string stream
9774 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9775 directly to the ostream.
9777 * src/vspace.C (asString): use string stream.
9778 (asString): use string stream
9779 (asLatexString): use string stream
9781 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9782 setting Spacing::Other.
9784 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9785 sprintf when creating the stretch vale.
9787 * src/text2.C (alphaCounter): changed to return a string and to
9788 not use a static variable internally. Also fixed a one-off bug.
9789 (SetCounter): changed the drawing of the labels to use string
9790 streams instead of sprintf.
9792 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9793 manipulator to use a scheme that does not require library support.
9794 This is also the way it is done in the new GNU libstdc++. Should
9795 work with DEC cxx now.
9797 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9799 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9800 end. This fixes a bug.
9802 * src/mathed (all files concerned with file writing): apply the
9803 USE_OSTREAM_ONLY changes to mathed too.
9805 * src/support/DebugStream.h: make the constructor explicit.
9807 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9808 count and ostream squashed.
9810 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9812 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9814 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9815 ostringstream uses STL strings, and we might not.
9817 * src/insets/insetspecialchar.C: add using directive.
9818 * src/insets/insettext.C: ditto.
9820 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9822 * lib/layouts/seminar.layout: feeble attempt at a layout for
9823 seminar.cls, far from completet and could really use some looking
9824 at from people used to write layout files.
9826 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9827 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9828 a lot nicer and works nicely with ostreams.
9830 * src/mathed/formula.C (draw): a slightly different solution that
9831 the one posted to the list, but I think this one works too. (font
9832 size wrong in headers.)
9834 * src/insets/insettext.C (computeTextRows): some fiddling on
9835 Jürgens turf, added some comments that he should read.
9837 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9838 used and it gave compiler warnings.
9839 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9842 * src/lyx_gui.C (create_forms): do the right thing when
9843 show_banner is true/false.
9845 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9846 show_banner is false.
9848 * most file writing files: Now use iostreams to do almost all of
9849 the writing. Also instead of passing string &, we now use
9850 stringstreams. mathed output is still not adapted to iostreams.
9851 This change can be turned off by commenting out all the occurences
9852 of the "#define USE_OSTREAM_ONLY 1" lines.
9854 * src/WorkArea.C (createPixmap): don't output debug messages.
9855 (WorkArea): don't output debug messages.
9857 * lib/lyxrc.example: added a comment about the new variable
9860 * development/Code_rules/Rules: Added some more commente about how
9861 to build class interfaces and on how better encapsulation can be
9864 2000-03-03 Juergen Vigna <jug@sad.it>
9866 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9867 automatically with the width of the LyX-Window
9869 * src/insets/insettext.C (computeTextRows): fixed update bug in
9870 displaying text-insets (scrollvalues where not initialized!)
9872 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9874 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9875 id in the check of the result from lower_bound is not enough since
9876 lower_bound can return last too, and then res->id will not be a
9879 * all insets and some code that use them: I have conditionalized
9880 removed the Latex(string & out, ...) this means that only the
9881 Latex(ostream &, ...) will be used. This is a work in progress to
9882 move towards using streams for all output of files.
9884 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9887 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9889 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9890 routine (this fixes bug where greek letters were surrounded by too
9893 * src/support/filetools.C (findtexfile): change a bit the search
9894 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9895 no longer passed to kpsewhich, we may have to change that later.
9897 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9898 warning options to avoid problems with X header files (from Angus
9900 * acinclude.m4: regenerated.
9902 2000-03-02 Juergen Vigna <jug@sad.it>
9904 * src/insets/insettext.C (WriteParagraphData): Using the
9905 par->writeFile() function for writing paragraph-data.
9906 (Read): Using buffer->parseSingleLyXformat2Token()-function
9907 for parsing paragraph data!
9909 * src/buffer.C (readLyXformat2): removed all parse data and using
9910 the new parseSingleLyXformat2Token()-function.
9911 (parseSingleLyXformat2Token): added this function to parse (read)
9912 lyx-file-format (this is called also from text-insets now!)
9914 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9916 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9919 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9920 directly instead of going through a func. One very bad thing: a
9921 static LyXFindReplace, but I don't know where to place it.
9923 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9924 string instead of char[]. Also changed to static.
9925 (GetSelectionOrWordAtCursor): changed to static inline
9926 (SetSelectionOverLenChars): ditto.
9928 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9929 current_view and global variables. both classes has changed names
9930 and LyXFindReplace is not inherited from SearchForm.
9932 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9933 fl_form_search form.
9935 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9937 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9939 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9940 bound (from Kayvan).
9942 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9944 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9946 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9948 * some things that I should comment but the local pub says head to
9951 * comment out all code that belongs to the Roff code for Ascii
9952 export of tables. (this is unused)
9954 * src/LyXView.C: use correct type for global variable
9955 current_layout. (LyXTextClass::size_type)
9957 * some code to get the new insetgraphics closer to working I'd be
9958 grateful for any help.
9960 * src/BufferView2.C (insertInset): use the return type of
9961 NumberOfLayout properly. (also changes in other files)
9963 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9964 this as a test. I want to know what breaks because of this.
9966 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9968 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9970 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9971 to use a \makebox in the label, this allows proper justification
9972 with out using protected spaces or multiple hfills. Now it is
9973 "label" for left justified, "\hfill label\hfill" for center, and
9974 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9975 should be changed accordingly.
9977 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9979 * src/lyxtext.h: change SetLayout() to take a
9980 LyXTextClass::size_type instead of a char (when there is more than
9981 127 layouts in a class); also change type of copylayouttype.
9982 * src/text2.C (SetLayout): ditto.
9983 * src/LyXView.C (updateLayoutChoice): ditto.
9985 * src/LaTeX.C (scanLogFile): errors where the line number was not
9986 given just after the '!'-line were ignored (from Dekel Tsur).
9988 * lib/lyxrc.example: fix description of \date_insert_format
9990 * lib/layouts/llncs.layout: new layout, contributed by Martin
9993 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9995 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9996 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9997 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9998 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9999 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10000 paragraph.C, text.C, text2.C)
10002 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10004 * src/insets/insettext.C (LocalDispatch): remove extra break
10007 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10008 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10010 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10011 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10013 * src/insets/insetbib.h: move InsetBibkey::Holder and
10014 InsetCitation::Holder in public space.
10016 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10018 * src/insets/insettext.h: small change to get the new files from
10019 Juergen to compile (use "string", not "class string").
10021 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10022 const & as parameter to LocalDispatch, use LyXFont const & as
10023 paramter to some other func. This also had impacto on lyxinsets.h
10024 and the two mathed insets.
10026 2000-02-24 Juergen Vigna <jug@sad.it>
10029 * src/commandtags.h:
10031 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10035 * src/BufferView2.C: added/updated code for various inset-functions
10037 * src/insets/insetert.[Ch]: added implementation of InsetERT
10039 * src/insets/insettext.[Ch]: added implementation of InsetText
10041 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10042 (draw): added preliminary code for inset scrolling not finshed yet
10044 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10045 as it is in lyxfunc.C now
10047 * src/insets/lyxinset.h: Added functions for text-insets
10049 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10051 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10052 BufferView and reimplement the list as a queue put inside its own
10055 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10057 * several files: use the new interface to the "updateinsetlist"
10059 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10061 (work_area_handler): call BufferView::trippleClick on trippleclick.
10063 * src/BufferView.C (doubleClick): new function, selects word on
10065 (trippleClick): new function, selects line on trippleclick.
10067 2000-02-22 Allan Rae <rae@lyx.org>
10069 * lib/bind/xemacs.bind: buffer-previous not supported
10071 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10073 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10076 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10078 * src/bufferlist.C: get rid of current_view from this file
10080 * src/spellchecker.C: get rid of current_view from this file
10082 * src/vspace.C: get rid of current_view from this file
10083 (inPixels): added BufferView parameter for this func
10084 (asLatexCommand): added a BufferParams for this func
10086 * src/text.C src/text2.C: get rid of current_view from these
10089 * src/lyxfont.C (getFontDirection): move this function here from
10092 * src/bufferparams.C (getDocumentDirection): move this function
10095 * src/paragraph.C (getParDirection): move this function here from
10097 (getLetterDirection): ditto
10099 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10101 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10102 resize due to wrong pixmap beeing used. Also took the opurtunity
10103 to make the LyXScreen stateless on regard to WorkArea and some
10104 general cleanup in the same files.
10106 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10108 * src/Makefile.am: add missing direction.h
10110 * src/PainterBase.h: made the width functions const.
10112 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10115 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10117 * src/insets/insetlatexaccent.C (draw): make the accents draw
10118 better, at present this will only work well with iso8859-1.
10120 * several files: remove the old drawing code, now we use the new
10123 * several files: remove support for mono_video, reverse_video and
10126 2000-02-17 Juergen Vigna <jug@sad.it>
10128 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10129 int ** as we have to return the pointer, otherwise we have only
10130 NULL pointers in the returning function.
10132 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10134 * src/LaTeX.C (operator()): quote file name when running latex.
10136 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10138 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10139 (bubble tip), this removes our special handling of this.
10141 * Remove all code that is unused now that we have the new
10142 workarea. (Code that are not active when NEW_WA is defined.)
10144 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10146 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10148 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10149 nonexisting layout; correctly redirect obsoleted layouts.
10151 * lib/lyxrc.example: document \view_dvi_paper_option
10153 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10156 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10157 (PreviewDVI): handle the view_dvi_paper_option variable.
10158 [Both from Roland Krause]
10160 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10162 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10163 char const *, int, LyXFont)
10164 (text(int, int, string, LyXFont)): ditto
10166 * src/text.C (InsertCharInTable): attempt to fix the double-space
10167 feature in tables too.
10168 (BackspaceInTable): ditto.
10169 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10171 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10173 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10175 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10176 newly found text in textcache to this.
10177 (buffer): set the owner of the text put into the textcache to 0
10179 * src/insets/figinset.C (draw): fixed the drawing of figures with
10182 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10183 drawing of mathframe, hfills, protected space, table lines. I have
10184 now no outstanding drawing problems with the new Painter code.
10186 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10188 * src/PainterBase.C (ellipse, circle): do not specify the default
10191 * src/LColor.h: add using directive.
10193 * src/Painter.[Ch]: change return type of methods from Painter& to
10194 PainterBase&. Add a using directive.
10196 * src/WorkArea.C: wrap xforms callbacks in C functions
10199 * lib/layouts/foils.layout: font fix and simplifications from Carl
10202 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10204 * a lot of files: The Painter, LColor and WorkArea from the old
10205 devel branch has been ported to lyx-devel. Some new files and a
10206 lot of #ifdeffed code. The new workarea is enabled by default, but
10207 if you want to test the new Painter and LColor you have to compile
10208 with USE_PAINTER defined (do this in config.h f.ex.) There are
10209 still some rought edges, and I'd like some help to clear those
10210 out. It looks stable (loads and displays the Userguide very well).
10213 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10215 * src/buffer.C (pop_tag): revert to the previous implementation
10216 (use a global variable for both loops).
10218 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10220 * src/lyxrc.C (LyXRC): change slightly default date format.
10222 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10223 there is an English text with a footnote that starts with a Hebrew
10224 paragraph, or vice versa.
10225 (TeXFootnote): ditto.
10227 * src/text.C (LeftMargin): allow for negative values for
10228 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10231 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10232 for input encoding (cyrillic)
10234 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10236 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10239 * src/toolbar.C (set): ditto
10240 * src/insets/insetbib.C (create_form_citation_form): ditto
10242 * lib/CREDITS: added Dekel Tsur.
10244 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10245 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10246 hebrew supports files from Dekel Tsur.
10248 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10249 <tzafrir@technion.ac.il>
10251 * src/lyxrc.C: put \date_insert_format at the right place.
10253 * src/buffer.C (makeLaTeXFile): fix the handling of
10254 BufferParams::sides when writing out latex files.
10256 * src/BufferView2.C: add a "using" directive.
10258 * src/support/lyxsum.C (sum): when we use lyxstring,
10259 ostringstream::str needs an additional .c_str().
10261 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10263 * src/support/filetools.C (ChangeExtension): patch from Etienne
10266 * src/TextCache.C (show): remove const_cast and make second
10267 parameter non-const LyXText *.
10269 * src/TextCache.h: use non const LyXText in show.
10271 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10274 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10276 * src/support/lyxsum.C: rework to be more flexible.
10278 * several places: don't check if a pointer is 0 if you are going
10281 * src/text.C: remove some dead code.
10283 * src/insets/figinset.C: remove some dead code
10285 * src/buffer.C: move the BufferView funcs to BufferView2.C
10286 remove all support for insetlatexdel
10287 remove support for oldpapersize stuff
10288 made some member funcs const
10290 * src/kbmap.C: use a std::list to store the bindings in.
10292 * src/BufferView2.C: new file
10294 * src/kbsequence.[Ch]: new files
10296 * src/LyXAction.C + others: remove all trace of buffer-previous
10298 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10299 only have one copy in the binary of this table.
10301 * hebrew patch: moved some functions from LyXText to more
10302 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10304 * several files: remove support for XForms older than 0.88
10305 whitespace changes.
10306 remove some #if 0 #endif code
10308 * src/TextCache.[Ch]: new file. Holds the textcache.
10310 * src/BufferView.C: changes to use the new TextCache interface.
10311 (waitForX): remove the now unused code.
10313 * src/BackStack.h: remove some commented code
10315 * lib/bind/emacs.bind: remove binding for buffer-previous
10317 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10319 * applied the hebrew patch.
10321 * src/lyxrow.h: make sure that all Row variables are initialized.
10323 * src/text2.C (TextHandleUndo): comment out a delete, this might
10324 introduce a memory leak, but should also help us to not try to
10325 read freed memory. We need to look at this one.
10327 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10328 (LyXParagraph): initalize footnotekind.
10330 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10331 forgot this when applying the patch. Please heed the warnings.
10333 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10334 (aka. reformat problem)
10336 * src/bufferlist.C (exists): made const, and use const_iterator
10337 (isLoaded): new func.
10338 (release): use std::find to find the correct buffer.
10340 * src/bufferlist.h: made getState a const func.
10341 made empty a const func.
10342 made exists a const func.
10345 2000-02-01 Juergen Vigna <jug@sad.it>
10347 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10349 * po/it.po: updated a bit the italian po file and also changed the
10350 'file nuovo' for newfile to 'filenuovo' without a space, this did
10353 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10354 for the new insert_date command.
10356 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10357 from jdblair, to insert a date into the current text conforming to
10358 a strftime format (for now only considering the locale-set and not
10359 the document-language).
10361 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10363 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10364 Bounds Read error seen by purify. The problem was that islower is
10365 a macros which takes an unsigned char and uses it as an index for
10366 in array of characters properties (and is thus subject to the
10370 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10371 correctly the paper sides radio buttons.
10372 (UpdateDocumentButtons): ditto.
10374 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10376 * src/kbmap.C (getsym + others): change to return unsigned int,
10377 returning a long can give problems on 64 bit systems. (I assume
10378 that int is 32bit on 64bit systems)
10380 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10382 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10383 LyXLookupString to be zero-terminated. Really fixes problems seen
10384 by purify, I think.
10386 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10388 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10389 write a (char*)0 to the lyxerr stream.
10391 * src/lastfiles.C: move algorithm before the using statemets.
10393 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10395 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10396 complains otherwise).
10397 * src/table.C: ditto
10399 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10402 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10403 that I removed earlier... It is really needed.
10405 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10407 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10409 * INSTALL: update xforms home page URL.
10411 * lib/configure.m4: fix a bug with unreadable layout files.
10413 * src/table.C (calculate_width_of_column): add "using std::max"
10416 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10418 * several files: marked several lines with "DEL LINE", this is
10419 lines that can be deleted without changing anything.
10420 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10421 checks this anyway */
10424 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10426 * src/DepTable.C (update): add a "+" at the end when the checksum
10427 is different. (debugging string only)
10429 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10430 the next inset to not be displayed. This should also fix the list
10431 of labels in the "Insert Crossreference" dialog.
10433 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10435 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10436 when regex was not found.
10438 * src/support/lstrings.C (lowercase): use handcoded transform always.
10441 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10442 old_cursor.par->prev could be 0.
10444 * several files: changed post inc/dec to pre inc/dec
10446 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10447 write the lastfiles to file.
10449 * src/BufferView.C (buffer): only show TextCache info when debugging
10451 (resizeCurrentBuffer): ditto
10452 (workAreaExpose): ditto
10454 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10456 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10458 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10459 a bit better by removing the special case for \i and \j.
10461 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10463 * src/lyx_main.C (easyParse): remove test for bad comand line
10464 options, since this broke all xforms-related parsing.
10466 * src/kbmap.C (getsym): set return type to unsigned long, as
10467 declared in header. On an alpha, long is _not_ the same as int.
10469 * src/support/LOstream.h: add a "using std::flush;"
10471 * src/insets/figinset.C: ditto.
10473 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10475 * src/bufferlist.C (write): use blinding fast file copy instead of
10476 "a char at a time", now we are doing it the C++ way.
10478 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10479 std::list<int> instead.
10480 (addpidwait): reflect move to std::list<int>
10481 (sigchldchecker): ditto
10483 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10486 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10487 that obviously was wrong...
10489 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10490 c, this avoids warnings with purify and islower.
10492 * src/insets/figinset.C: rename struct queue to struct
10493 queue_element and rewrite to use a std::queue. gsqueue is now a
10494 std::queue<queue_element>
10495 (runqueue): reflect move to std::queue
10498 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10499 we would get "1" "0" instead of "true" "false. Also make the tostr
10502 2000-01-21 Juergen Vigna <jug@sad.it>
10504 * src/buffer.C (writeFileAscii): Disabled code for special groff
10505 handling of tabulars till I fix this in table.C
10507 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10509 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10511 * src/support/lyxlib.h: ditto.
10513 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10515 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10516 and 'j' look better. This might fix the "macron" bug that has been
10519 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10520 functions as one template function. Delete the old versions.
10522 * src/support/lyxsum.C: move using std::ifstream inside
10525 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10528 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10530 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10532 * src/insets/figinset.C (InitFigures): use new instead of malloc
10533 to allocate memory for figures and bitmaps.
10534 (DoneFigures): use delete[] instead of free to deallocate memory
10535 for figures and bitmaps.
10536 (runqueue): use new to allocate
10537 (getfigdata): use new/delete[] instead of malloc/free
10538 (RegisterFigure): ditto
10540 * some files: moved some declarations closer to first use, small
10541 whitespace changes use preincrement instead of postincrement where
10542 it does not make a difference.
10544 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10545 step on the way to use stl::containers for key maps.
10547 * src/bufferlist.h: add a typedef for const_iterator and const
10548 versions of begin and end.
10550 * src/bufferlist.[Ch]: change name of member variable _state to
10551 state_. (avoid reserved names)
10553 (getFileNames): returns the filenames of the buffers in a vector.
10555 * configure.in (ALL_LINGUAS): added ro
10557 * src/support/putenv.C: new file
10559 * src/support/mkdir.C: new file
10561 2000-01-20 Allan Rae <rae@lyx.org>
10563 * lib/layouts/IEEEtran.layout: Added several theorem environments
10565 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10566 couple of minor additions.
10568 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10569 (except for those in footnotes of course)
10571 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10573 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10575 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10576 std::sort and std::lower_bound instead of qsort and handwritten
10578 (struct compara): struct that holds the functors used by std::sort
10579 and std::lower_bound in MathedLookupBOP.
10581 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10583 * src/support/LAssert.h: do not do partial specialization. We do
10584 not really need it.
10586 * src/support/lyxlib.h: note that lyx::getUserName() and
10587 lyx::date() are not in use right now. Should these be suppressed?
10589 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10590 (makeLinuxDocFile): do not put date and user name in linuxdoc
10593 * src/support/lyxlib.h (kill): change first argument to long int,
10594 since that's what solaris uses.
10596 * src/support/kill.C (kill): fix declaration to match prototype.
10598 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10599 actually check whether namespaces are supported. This is not what
10602 * src/support/lyxsum.C: add a using directive.
10604 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10606 * src/support/kill.C: if we have namespace support we don't have
10607 to include lyxlib.h.
10609 * src/support/lyxlib.h: use namespace lyx if supported.
10611 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10613 * src/support/date.C: new file
10615 * src/support/chdir.C: new file
10617 * src/support/getUserName.C: new file
10619 * src/support/getcwd.C: new file
10621 * src/support/abort.C: new file
10623 * src/support/kill.C: new file
10625 * src/support/lyxlib.h: moved all the functions in this file
10626 insede struct lyx. Added also kill and abort to this struct. This
10627 is a way to avoid the "kill is not defined in <csignal>", we make
10628 C++ wrappers for functions that are not ANSI C or ANSI C++.
10630 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10631 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10632 lyx it has been renamed to sum.
10634 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10636 * src/text.C: add using directives for std::min and std::max.
10638 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10640 * src/texrow.C (getIdFromRow): actually return something useful in
10641 id and pos. Hopefully fixes the bug with positionning of errorbox
10644 * src/lyx_main.C (easyParse): output an error and exit if an
10645 incorrect command line option has been given.
10647 * src/spellchecker.C (ispell_check_word): document a memory leak.
10649 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10650 where a "struct utimbuf" is allocated with "new" and deleted with
10653 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10655 * src/text2.C (CutSelection): don't delete double spaces.
10656 (PasteSelection): ditto
10657 (CopySelection): ditto
10659 * src/text.C (Backspace): don't delete double spaces.
10661 * src/lyxlex.C (next): fix a bug that were only present with
10662 conformant std::istream::get to read comment lines, use
10663 std::istream::getline instead. This seems to fix the problem.
10665 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10667 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10668 allowed to insert space before space" editing problem. Please read
10669 commends at the beginning of the function. Comments about usage
10672 * src/text.C (InsertChar): fix for the "not allowed to insert
10673 space before space" editing problem.
10675 * src/text2.C (DeleteEmptyParagraphMechanism): when
10676 IsEmptyTableRow can only return false this last "else if" will
10677 always be a no-op. Commented out.
10679 * src/text.C (RedoParagraph): As far as I can understand tmp
10680 cursor is not really needed.
10682 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10683 present it could only return false anyway.
10684 (several functions): Did something not so smart...added a const
10685 specifier on a lot of methods.
10687 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10688 and add a tmp->text.resize. The LyXParagraph constructor does the
10690 (BreakParagraphConservative): ditto
10692 * src/support/path.h (Path): add a define so that the wrong usage
10693 "Path("/tmp") will be flagged as a compilation error:
10694 "`unnamed_Path' undeclared (first use this function)"
10696 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10698 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10699 which was bogus for several reasons.
10701 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10703 (runBibTeX): ditto.
10705 * autogen.sh: do not use "type -path" (what's that anyway?).
10707 * src/support/filetools.C (findtexfile): remove extraneous space
10708 which caused a kpsewhich warning (at least with kpathsea version
10711 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10713 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10715 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10717 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10719 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10721 * src/paragraph.C (BreakParagraph): do not reserve space on text
10722 if we don't need to (otherwise, if pos_end < pos, we end up
10723 reserving huge amounts of memory due to bad unsigned karma).
10724 (BreakParagraphConservative): ditto, although I have not seen
10725 evidence the bug can happen here.
10727 * src/lyxparagraph.h: add a using std::list.
10729 2000-01-11 Juergen Vigna <jug@sad.it>
10731 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10732 could not be found.
10734 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 * src/vc-backend.C (doVCCommand): change to be static and take one
10737 more parameter: the path to chdir too be fore executing the command.
10738 (retrive): new function equiv to "co -r"
10740 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10741 file_not_found_hook is true.
10743 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10745 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10746 if a file is readwrite,readonly...anything else.
10748 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10750 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10751 (CreatePostscript): name change from MenuRunDVIPS (or something)
10752 (PreviewPostscript): name change from MenuPreviewPS
10753 (PreviewDVI): name change from MenuPreviewDVI
10755 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10756 \view_pdf_command., \pdf_to_ps_command
10758 * lib/configure.m4: added search for PDF viewer, and search for
10759 PDF to PS converter.
10760 (lyxrc.defaults output): add \pdflatex_command,
10761 \view_pdf_command and \pdf_to_ps_command.
10763 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10765 * src/bufferlist.C (write): we don't use blocksize for anything so
10768 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10770 * src/support/block.h: disable operator T* (), since it causes
10771 problems with both compilers I tried. See comments in the file.
10773 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10776 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10777 variable LYX_DIR_10x to LYX_DIR_11x.
10779 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10781 * INSTALL: document --with-lyxname.
10784 * configure.in: new configure flag --with-lyxname which allows to
10785 choose the name under which lyx is installed. Default is "lyx", of
10786 course. It used to be possible to do this with --program-suffix,
10787 but the later has in fact a different meaning for autoconf.
10789 * src/support/lstrings.h (lstrchr): reformat a bit.
10791 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10792 * src/mathed/math_defs.h: ditto.
10794 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10796 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10797 true, decides if we create a backup file or not when saving. New
10798 tag and variable \pdf_mode, defaults to false. New tag and
10799 variable \pdflatex_command, defaults to pdflatex. New tag and
10800 variable \view_pdf_command, defaults to xpdf. New tag and variable
10801 \pdf_to_ps_command, defaults to pdf2ps.
10803 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10805 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10806 does not have a BufferView.
10807 (unlockInset): ditto + don't access the_locking_inset if the
10808 buffer does not have a BufferView.
10810 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10811 certain circumstances so that we don't continue a keyboard
10812 operation long after the key was released. Try f.ex. to load a
10813 large document, press PageDown for some seconds and then release
10814 it. Before this change the document would contine to scroll for
10815 some time, with this change it stops imidiatly.
10817 * src/support/block.h: don't allocate more space than needed. As
10818 long as we don't try to write to the arr[x] in a array_type arr[x]
10819 it is perfectly ok. (if you write to it you might segfault).
10820 added operator value_type*() so that is possible to pass the array
10821 to functions expecting a C-pointer.
10823 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10826 * intl/*: updated to gettext 0.10.35, tried to add our own
10827 required modifications. Please verify.
10829 * po/*: updated to gettext 0.10.35, tried to add our own required
10830 modifications. Please verify.
10832 * src/support/lstrings.C (tostr): go at fixing the problem with
10833 cxx and stringstream. When stringstream is used return
10834 oss.str().c_str() so that problems with lyxstring and basic_string
10835 are avoided. Note that the best solution would be for cxx to use
10836 basic_string all the way, but it is not conformant yet. (it seems)
10838 * src/lyx_cb.C + other files: moved several global functions to
10839 class BufferView, some have been moved to BufferView.[Ch] others
10840 are still located in lyx_cb.C. Code changes because of this. (part
10841 of "get rid of current_view project".)
10843 * src/buffer.C + other files: moved several Buffer functions to
10844 class BufferView, the functions are still present in buffer.C.
10845 Code changes because of this.
10847 * config/lcmessage.m4: updated to most recent. used when creating
10850 * config/progtest.m4: updated to most recent. used when creating
10853 * config/gettext.m4: updated to most recent. applied patch for
10856 * config/gettext.m4.patch: new file that shows what changes we
10857 have done to the local copy of gettext.m4.
10859 * config/libtool.m4: new file, used in creation of acinclude.m4
10861 * config/lyxinclude.m4: new file, this is the lyx created m4
10862 macros, used in making acinclude.m4.
10864 * autogen.sh: GNU m4 discovered as a separate task not as part of
10865 the lib/configure creation.
10866 Generate acinlucde from files in config. Actually cat
10867 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10868 easier to upgrade .m4 files that really are external.
10870 * src/Spacing.h: moved using std::istringstream to right after
10871 <sstream>. This should fix the problem seen with some compilers.
10873 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10875 * src/lyx_cb.C: began some work to remove the dependency a lot of
10876 functions have on BufferView::text, even if not really needed.
10877 (GetCurrentTextClass): removed this func, it only hid the
10880 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10881 forgot this in last commit.
10883 * src/Bullet.C (bulletEntry): use static char const *[] for the
10884 tables, becuase of this the return arg had to change to string.
10885 (bulletSize): ditto
10886 (~Bullet): removed unneeded destructor
10888 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10889 (insetSleep): moved from Buffer
10890 (insetWakeup): moved from Buffer
10891 (insetUnlock): moved from Buffer
10893 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10894 from Buffer to BufferView.
10896 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10898 * config/ltmain.sh: updated to version 1.3.4 of libtool
10900 * config/ltconfig: updated to version 1.3.4 of libtool
10902 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10905 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10906 Did I get that right?
10908 * src/lyxlex.h: add a "using" directive or two.
10909 * src/Spacing.h: ditto.
10910 * src/insets/figinset.C: ditto.
10911 * src/support/filetools.C: ditto.
10912 * src/support/lstrings.C: ditto.
10913 * src/BufferView.C: ditto.
10914 * src/bufferlist.C: ditto.
10915 * src/lyx_cb.C: ditto.
10916 * src/lyxlex.C: ditto.
10918 * NEWS: add some changes for 1.1.4.
10920 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10922 * src/BufferView.C: first go at a TextCache to speed up switching
10925 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10927 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10928 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10929 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10930 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10933 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10934 members of the struct are correctly initialized to 0 (detected by
10936 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10937 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10939 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10940 pidwait, since it was allocated with "new". This was potentially
10941 very bad. Thanks to Michael Schmitt for running purify for us.
10944 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10946 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10948 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10950 1999-12-30 Allan Rae <rae@lyx.org>
10952 * lib/templates/IEEEtran.lyx: minor change
10954 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10955 src/mathed/formula.C (LocalDispatch): askForText changes
10957 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10958 know when a user has cancelled input. Fixes annoying problems with
10959 inserting labels and version control.
10961 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10963 * src/support/lstrings.C (tostr): rewritten to use strstream and
10966 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10968 * src/support/filetools.C (IsFileWriteable): use fstream to check
10969 (IsDirWriteable): use fileinfo to check
10971 * src/support/filetools.h (FilePtr): whole class deleted
10973 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10975 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10977 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10979 * src/bufferlist.C (write): use ifstream and ofstream instead of
10982 * src/Spacing.h: use istrstream instead of sscanf
10984 * src/mathed/math_defs.h: change first arg to istream from FILE*
10986 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10988 * src/mathed/math_parser.C: have yyis to be an istream
10989 (LexGetArg): use istream (yyis)
10991 (mathed_parse): ditto
10992 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10994 * src/mathed/formula.C (Read): rewritten to use istream
10996 * src/mathed/formulamacro.C (Read): rewritten to use istream
10998 * src/lyxlex.h (~LyXLex): deleted desturctor
10999 (getStream): new function, returns an istream
11000 (getFile): deleted funtion
11001 (IsOK): return is.good();
11003 * src/lyxlex.C (LyXLex): delete file and owns_file
11004 (setFile): open an filebuf and assign that to a istream instead of
11006 (setStream): new function, takes an istream as arg.
11007 (setFile): deleted function
11008 (EatLine): rewritten us use istream instead of FILE*
11012 * src/table.C (LyXTable): use istream instead of FILE*
11013 (Read): rewritten to take an istream instead of FILE*
11015 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11017 * src/buffer.C (Dispatch): remove an extraneous break statement.
11019 * src/support/filetools.C (QuoteName): change to do simple
11020 'quoting'. More work is necessary. Also changed to do nothing
11021 under emx (needs fix too).
11022 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11024 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11025 config.h.in to the AC_DEFINE_UNQUOTED() call.
11026 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11027 needs char * as argument (because Solaris 7 declares it like
11030 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11031 remove definition of BZERO.
11033 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11035 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11036 defined, "lyxregex.h" if not.
11038 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11040 (REGEX): new variable that is set to regex.c lyxregex.h when
11041 AM_CONDITIONAL USE_REGEX is set.
11042 (libsupport_la_SOURCES): add $(REGEX)
11044 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11047 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11050 * configure.in: add call to LYX_REGEX
11052 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11053 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11055 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11057 * lib/bind/fi_menus.bind: new file, from
11058 pauli.virtanen@saunalahti.fi.
11060 * src/buffer.C (getBibkeyList): pass the parameter delim to
11061 InsetInclude::getKeys and InsetBibtex::getKeys.
11063 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11064 is passed to Buffer::getBibkeyList
11066 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11067 instead of the hardcoded comma.
11069 * src/insets/insetbib.C (getKeys): make sure that there are not
11070 leading blanks in bibtex keys. Normal latex does not care, but
11071 harvard.sty seems to dislike blanks at the beginning of citation
11072 keys. In particular, the retturn value of the function is
11074 * INSTALL: make it clear that libstdc++ is needed and that gcc
11075 2.7.x probably does not work.
11077 * src/support/filetools.C (findtexfile): make debug message go to
11079 * src/insets/insetbib.C (getKeys): ditto
11081 * src/debug.C (showTags): make sure that the output is correctly
11084 * configure.in: add a comment for TWO_COLOR_ICON define.
11086 * acconfig.h: remove all the entries that already defined in
11087 configure.in or acinclude.m4.
11089 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11090 to avoid user name, date and copyright.
11092 1999-12-21 Juergen Vigna <jug@sad.it>
11094 * src/table.C (Read): Now read bogus row format informations
11095 if the format is < 5 so that afterwards the table can
11096 be read by lyx but without any format-info. Fixed the
11097 crash we experienced when not doing this.
11099 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11101 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11102 (RedoDrawingOfParagraph): ditto
11103 (RedoParagraphs): ditto
11104 (RemoveTableRow): ditto
11106 * src/text.C (Fill): rename arg paperwidth -> paper_width
11108 * src/buffer.C (insertLyXFile): rename var filename -> fname
11109 (writeFile): rename arg filename -> fname
11110 (writeFileAscii): ditto
11111 (makeLaTeXFile): ditto
11112 (makeLinuxDocFile): ditto
11113 (makeDocBookFile): ditto
11115 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11118 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11120 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11123 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11124 compiled by a C compiler not C++.
11126 * src/layout.h (LyXTextClass): added typedef for const_iterator
11127 (LyXTextClassList): added typedef for const_iterator + member
11128 functions begin and end.
11130 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11131 iterators to fill the choice_class.
11132 (updateLayoutChoice): rewritten to use iterators to fill the
11133 layoutlist in the toolbar.
11135 * src/BufferView.h (BufferView::work_area_width): removed unused
11138 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11140 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11141 (sgmlCloseTag): ditto
11143 * src/support/lstrings.h: return type of countChar changed to
11146 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11147 what version of this func to use. Also made to return unsigned int.
11149 * configure.in: call LYX_STD_COUNT
11151 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11152 conforming std::count.
11154 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11156 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11157 and a subscript would give bad display (patch from Dekel Tsur
11158 <dekel@math.tau.ac.il>).
11160 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11162 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11165 * src/chset.h: add a few 'using' directives
11167 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11168 triggered when no buffer is active
11170 * src/layout.C: removed `break' after `return' in switch(), since
11173 * src/lyx_main.C (init): make sure LyX can be ran in place even
11174 when libtool has done its magic with shared libraries. Fix the
11175 test for the case when the system directory has not been found.
11177 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11178 name for the latex file.
11179 (MenuMakeHTML): ditto
11181 * src/buffer.h: add an optional boolean argument, which is passed
11182 to ChangeExtension.
11184 1999-12-20 Allan Rae <rae@lyx.org>
11186 * lib/templates/IEEEtran.lyx: small correction and update.
11188 * configure.in: Attempted to use LYX_PATH_HEADER
11190 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11192 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11193 input from JMarc. Now use preprocessor to find the header.
11194 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11195 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11196 LYX_STL_STRING_FWD. See comments in file.
11198 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11200 * The global MiniBuffer * minibuffer variable is dead.
11202 * The global FD_form_main * fd_form_main variable is dead.
11204 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11206 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11208 * src/table.h: add the LOstream.h header
11209 * src/debug.h: ditto
11211 * src/LyXAction.h: change the explaination of the ReadOnly
11212 attribute: is indicates that the function _can_ be used.
11214 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11217 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11219 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11225 * src/paragraph.C (GetWord): assert on pos>=0
11228 * src/support/lyxstring.C: condition the use of an invariant on
11230 * src/support/lyxstring.h: ditto
11232 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11233 Use LAssert.h instead of plain assert().
11235 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11237 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11238 * src/support/filetools.C: ditto
11240 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11243 * INSTALL: document the new configure flags
11245 * configure.in: suppress --with-debug; add --enable-assertions
11247 * acinclude.m4: various changes in alignment of help strings.
11249 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11251 * src/kbmap.C: commented out the use of the hash map in kb_map,
11252 beginning of movement to a stl::container.
11254 * several files: removed code that was not in effect when
11255 MOVE_TEXT was defined.
11257 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11258 for escaping should not be used. We can discuss if the string
11259 should be enclosed in f.ex. [] instead of "".
11261 * src/trans_mgr.C (insert): use the new returned value from
11262 encodeString to get deadkeys and keymaps done correctly.
11264 * src/chset.C (encodeString): changed to return a pair, to tell
11265 what to use if we know the string.
11267 * src/lyxscreen.h (fillArc): new function.
11269 * src/FontInfo.C (resize): rewritten to use more std::string like
11270 structore, especially string::replace.
11272 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11275 * configure.in (chmod +x some scripts): remove config/gcc-hack
11277 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11279 * src/buffer.C (writeFile): change once again the top comment in a
11280 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11281 instead of an hardcoded version number.
11282 (makeDocBookFile): ditto
11284 * src/version.h: add new define LYX_DOCVERSION
11286 * po/de.po: update from Pit Sütterlin
11287 * lib/bind/de_menus.bind: ditto.
11289 * src/lyxfunc.C (Dispatch): call MenuExport()
11290 * src/buffer.C (Dispatch): ditto
11292 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11293 LyXFunc::Dispatch().
11294 (MenuExport): new function, moved from
11295 LyXFunc::Dispatch().
11297 * src/trans_mgr.C (insert): small cleanup
11298 * src/chset.C (loadFile): ditto
11300 * lib/kbd/iso8859-1.cdef: add missing backslashes
11302 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11304 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11305 help with placing the manually drawn accents better.
11307 (Draw): x2 and hg changed to float to minimize rounding errors and
11308 help place the accents better.
11310 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11311 unsigned short to char is just wrong...cast the char to unsigned
11312 char instead so that the two values can compare sanely. This
11313 should also make the display of insetlatexaccents better and
11314 perhaps also some other insets.
11316 (lbearing): new function
11319 1999-12-15 Allan Rae <rae@lyx.org>
11321 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11322 header that provides a wrapper around the very annoying SGI STL header
11325 * src/support/lyxstring.C, src/LString.h:
11326 removed old SGI-STL-compatability attempts.
11328 * configure.in: Use LYX_STL_STRING_FWD.
11330 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11331 stl_string_fwd.h is around and try to determine it's location.
11332 Major improvement over previous SGI STL 3.2 compatability.
11333 Three small problems remain with this function due to my zero
11334 knowledge of autoconf. JMarc and lgb see the comments in the code.
11336 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11338 * src/broken_const.h, config/hack-gcc, config/README: removed
11340 * configure.in: remove --with-gcc-hack option; do not call
11343 * INSTALL: remove documentation of --with-broken-const and
11346 * acconfig.h: remove all trace of BROKEN_CONST define
11348 * src/buffer.C (makeDocBookFile): update version number in output
11350 (SimpleDocBookOnePar): fix an assert when trying to a character
11351 access beyond string length
11354 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11356 * po/de.po: fix the Export menu
11358 * lyx.man: update the description of -dbg
11360 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11361 (commandLineHelp): updated
11362 (easyParse): show list of available debug levels if -dbg is passed
11365 * src/Makefile.am: add debug.C
11367 * src/debug.h: moved some code to debug.C
11369 * src/debug.C: new file. Contains code to set and show debug
11372 * src/layout.C: remove 'break' after 'continue' in switch
11373 statements, since these cannot be reached.
11375 1999-12-13 Allan Rae <rae@lyx.org>
11377 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11378 (in_word_set): hash() -> math_hash()
11380 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11382 * acconfig.h: Added a test for whether we are using exceptions in the
11383 current compilation run. If so USING_EXCEPTIONS is defined.
11385 * config.in: Check for existance of stl_string_fwd.h
11386 * src/LString.h: If compiling --with-included-string and SGI's
11387 STL version 3.2 is present (see above test) we need to block their
11388 forward declaration of string and supply a __get_c_string().
11389 However, it turns out this is only necessary if compiling with
11390 exceptions enabled so I've a bit more to add yet.
11392 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11393 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11394 src/support/LRegex.h, src/undo.h:
11395 Shuffle the order of the included files a little to ensure that
11396 LString.h gets included before anything that includes stl_string_fwd.h
11398 * src/support/lyxstring.C: We need to #include LString.h instead of
11399 lyxstring.h to get the necessary definition of __get_c_string.
11400 (__get_c_string): New function. This is defined static just like SGI's
11401 although why they need to do this I'm not sure. Perhaps it should be
11402 in lstrings.C instead.
11404 * lib/templates/IEEEtran.lyx: New template file.
11406 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11408 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11409 * intl/Makefile.in (MKINSTALLDIRS): ditto
11411 * src/LyXAction.C (init): changed to hold the LFUN data in a
11412 automatic array in stead of in callso to newFunc, this speeds up
11413 compilation a lot. Also all the memory used by the array is
11414 returned when the init is completed.
11416 * a lot of files: compiled with -Wold-style-cast, changed most of
11417 the reported offenders to C++ style casts. Did not change the
11418 offenders in C files.
11420 * src/trans.h (Match): change argument type to unsigned int.
11422 * src/support/DebugStream.C: fix some types on the streambufs so
11423 that it works on a conforming implementation.
11425 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11427 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11429 * src/support/lyxstring.C: remove the inline added earlier since
11430 they cause a bunch of unsatisfied symbols when linking with dec
11431 cxx. Cxx likes to have the body of inlines at the place where they
11434 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11435 accessing negative bounds in array. This fixes the crash when
11436 inserting accented characters.
11437 * src/trans.h (Match): ditto
11439 * src/buffer.C (Dispatch): since this is a void, it should not try
11440 to return anything...
11442 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11444 * src/buffer.h: removed the two friends from Buffer. Some changes
11445 because of this. Buffer::getFileName and Buffer::setFileName
11446 renamed to Buffer::fileName() and Buffer::fileName(...).
11448 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11450 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11451 and Buffer::update(short) to BufferView. This move is currently
11452 controlled by a define MOVE_TEXT, this will be removed when all
11453 shows to be ok. This move paves the way for better separation
11454 between buffer contents and buffer view. One side effect is that
11455 the BufferView needs a rebreak when swiching buffers, if we want
11456 to avoid this we can add a cache that holds pointers to LyXText's
11457 that is not currently in use.
11459 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11462 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11464 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11466 * lyx_main.C: new command line option -x (or --execute) and
11467 -e (or --export). Now direct conversion from .lyx to .tex
11468 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11469 Unfortunately, X is still needed and the GUI pops up during the
11472 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11474 * src/Spacing.C: add a using directive to bring stream stuff into
11476 * src/paragraph.C: ditto
11477 * src/buffer.C: ditto
11479 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11480 from Lars' announcement).
11482 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11483 example files from Tino Meinen.
11485 1999-12-06 Allan Rae <rae@lyx.org>
11487 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11489 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11491 * src/support/lyxstring.C: added a lot of inline for no good
11494 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11495 latexWriteEndChanges, they were not used.
11497 * src/layout.h (operator<<): output operator for PageSides
11499 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11501 * some example files: loaded in LyX 1.0.4 and saved again to update
11502 certain constructs (table format)
11504 * a lot of files: did the change to use fstream/iostream for all
11505 writing of files. Done with a close look at Andre Poenitz's patch.
11507 * some files: whitespace changes.
11509 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11511 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11512 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11513 architecture, we provide our own. It is used unconditionnally, but
11514 I do not think this is a performance problem. Thanks to Angus
11515 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11516 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11518 (GetInset): use my_memcpy.
11522 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11523 it is easier to understand, but it uses less TeX-only constructs now.
11525 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11526 elements contain spaces
11528 * lib/configure: regenerated
11530 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11531 elements contain spaces; display the list of programs that are
11534 * autogen.sh: make sure lib/configure is executable
11536 * lib/examples/*: rename the tutorial examples to begin with the
11537 two-letters language code.
11539 * src/lyxfunc.C (getStatus): do not query current font if no
11542 * src/lyx_cb.C (RunScript): use QuoteName
11543 (MenuRunDvips): ditto
11544 (PrintApplyCB): ditto
11546 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11547 around argument, so that it works well with the current shell.
11548 Does not work properly with OS/2 shells currently.
11550 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11551 * src/LyXSendto.C (SendtoApplyCB): ditto
11552 * src/lyxfunc.C (Dispatch): ditto
11553 * src/buffer.C (runLaTeX): ditto
11554 (runLiterate): ditto
11555 (buildProgram): ditto
11557 * src/lyx_cb.C (RunScript): ditto
11558 (MenuMakeLaTeX): ditto
11560 * src/buffer.h (getLatexName): new method
11562 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11564 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11566 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11567 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11568 (create_math_panel): ditto
11570 * src/lyxfunc.C (getStatus): re-activate the code which gets
11571 current font and cursor; add test for export to html.
11573 * src/lyxrc.C (read): remove unreachable break statements; add a
11576 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11578 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11580 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11581 introduced by faulty regex.
11582 * src/buffer.C: ditto
11583 * src/lastfiles.C: ditto
11584 * src/paragraph.C: ditto
11585 * src/table.C: ditto
11586 * src/vspace.C: ditto
11587 * src/insets/figinset.C: ditto
11588 Note: most of these is absolutely harmless, except the one in
11589 src/mathed formula.C.
11591 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11593 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11594 operation, yielding correct results for the reLyX command.
11596 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11598 * src/support/filetools.C (ExpandPath): removed an over eager
11600 (ReplaceEnvironmentPath): ditto
11602 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11603 shows that we are doing something fishy in our code...
11604 (BubblePost): ditto
11607 * src/lyxrc.C (read): use a double switch trick to get more help
11608 from the compiler. (the same trick is used in layout.C)
11609 (write): new function. opens a ofstream and pass that to output
11610 (output): new function, takes a ostream and writes the lyxrc
11611 elemts to it. uses a dummy switch to make sure no elements are
11614 * src/lyxlex.h: added a struct pushpophelper for use in functions
11615 with more than one exit point.
11617 * src/lyxlex.[Ch] (GetInteger): made it const
11621 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11623 * src/layout.[hC] : LayoutTags splitted into several enums, new
11624 methods created, better error handling cleaner use of lyxlex. Read
11627 * src/bmtable.[Ch]: change some member prototypes because of the
11628 image const changes.
11630 * commandtags.h, src/LyXAction.C (init): new function:
11631 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11632 This file is not read automatically but you can add \input
11633 preferences to your lyxrc if you want to. We need to discuss how
11636 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11637 in .aux, also remove .bib and .bst files from dependencies when
11640 * src/BufferView.C, src/LyXView.C: add const_cast several places
11641 because of changes to images.
11643 * lib/images/*: same change as for images/*
11645 * lib/lyxrc.example: Default for accept_compound is false not no.
11647 * images/*: changed to be const, however I have som misgivings
11648 about this change so it might be changed back.
11650 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11652 * lib/configure, po/POTFILES.in: regenerated
11654 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11656 * config/lib_configure.m4: removed
11658 * lib/configure.m4: new file (was config/lib_configure.m4)
11660 * configure.in: do not test for rtti, since we do not use it.
11662 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11664 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11665 doubling of allocated space scheme. This makes it faster for large
11666 strings end to use less memory for small strings. xtra rememoved.
11668 * src/insets/figinset.C (waitalarm): commented out.
11669 (GhostscriptMsg): use static_cast
11670 (GhostscriptMsg): use new instead of malloc to allocate memory for
11671 cmap. also delete the memory after use.
11673 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11675 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11676 for changes in bibtex database or style.
11677 (runBibTeX): remove all .bib and .bst files from dep before we
11679 (run): use scanAuc in when dep file already exist.
11681 * src/DepTable.C (remove_files_with_extension): new method
11682 (exist): new method
11684 * src/DepTable.[Ch]: made many of the methods const.
11686 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11688 * src/bufferparams.C: make sure that the default textclass is
11689 "article". It used to be the first one by description order, but
11690 now the first one is "docbook".
11692 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11693 string; call Debug::value.
11694 (easyParse): pass complete argument to setDebuggingLevel().
11696 * src/debug.h (value): fix the code that parses debug levels.
11698 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11701 * src/LyXAction.C: use Debug::ACTION as debug channel.
11703 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11705 * NEWS: updated for the future 1.1.3 release.
11707 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11708 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11709 it should. This is of course a controversial change (since many
11710 people will find that their lyx workscreen is suddenly full of
11711 red), but done for the sake of correctness.
11713 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11714 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11716 * src/insets/inseterror.h, src/insets/inseturl.h,
11717 src/insets/insetinfo.h, src/insets/figinset.h,
11718 src/mathed/formulamacro.h, src/mathed/math_macro.h
11719 (EditMessage): add a missing const and add _() to make sure that
11720 translation happens
11722 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11723 src/insets/insetbib.C, src/support/filetools.C: add `using'
11724 directives for cxx.
11726 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11727 doing 'Insert index of last word' at the beginning of a paragraph.
11729 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11731 * several files: white-space changes.
11733 * src/mathed/formula.C: removed IsAlpha and IsDigit
11735 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11736 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11739 * src/insets/figinset.C (GetPSSizes): don't break when
11740 "EndComments" is seen. But break when a boundingbox is read.
11742 * all classes inherited from Inset: return value of Clone
11743 changed back to Inset *.
11745 * all classes inherited form MathInset: return value of Clone
11746 changed back to MathedInset *.
11748 * src/insets/figinset.C (runqueue): use a ofstream to output the
11749 gs/ps file. Might need some setpresicion or setw. However I can
11750 see no problem with the current code.
11751 (runqueue): use sleep instead of the alarm/signal code. I just
11752 can't see the difference.
11754 * src/paragraph.C (LyXParagraph): reserve space in the new
11755 paragraph and resize the inserted paragraph to just fit.
11757 * src/lyxfunc.h (operator|=): added operator for func_status.
11759 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11760 check for readable file.
11762 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11763 check for readable file.
11764 (MenuMakeLinuxDoc): ditto
11765 (MenuMakeDocBook): ditto
11766 (MenuMakeAscii): ditto
11767 (InsertAsciiFile): split the test for openable and readable
11769 * src/bmtable.C (draw_bitmaptable): use
11770 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11772 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11773 findtexfile from LaTeX to filetools.
11775 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11776 instead of FilePtr. Needs to be verified by a literate user.
11778 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11780 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11781 (EditMessage): likewise.
11783 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11784 respectively as \textasciitilde and \textasciicircum.
11786 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11788 * src/support/lyxstring.h: made the methods that take iterators
11789 use const_iterator.
11791 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11792 (regexMatch): made is use the real regex class.
11794 * src/support/Makefile.am: changed to use libtool
11796 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11798 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11800 (MathIsInset ++): changed several macros to be inline functions
11803 * src/mathed/Makefile.am: changed to use libtool
11805 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11807 * src/insets/inset* : Clone changed to const and return type is
11808 the true insettype not just Inset*.
11810 * src/insets/Makefile.am: changed to use libtool
11812 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11814 * src/undo.[Ch] : added empty() and changed some of the method
11817 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11819 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11820 setID use block<> for the bullets array, added const several places.
11822 * src/lyxfunc.C (getStatus): new function
11824 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11825 LyXAction, added const to several funtions.
11827 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11828 a std::map, and to store the dir items in a vector.
11830 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11833 * src/LyXView.[Ch] + other files : changed currentView to view.
11835 * src/LyXAction.[Ch] : ported from the old devel branch.
11837 * src/.cvsignore: added .libs and a.out
11839 * configure.in : changes to use libtool.
11841 * acinclude.m4 : inserted libtool.m4
11843 * .cvsignore: added libtool
11845 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11847 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11848 file name in insets and mathed directories (otherwise the
11849 dependency is not taken in account under cygwin).
11851 * src/text2.C (InsertString[AB]): make sure that we do not try to
11852 read characters past the string length.
11854 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11856 * lib/doc/LaTeXConfig.lyx.in,
11857 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11859 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11860 file saying who created them and when this heppened; this is
11861 useless and annoys tools like cvs.
11863 * lib/layouts/g-brief-{en,de}.layout,
11864 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11865 from Thomas Hartkens <thomas@hartkens.de>.
11867 * src/{insets,mathed}/Makefile.am: do not declare an empty
11868 LDFLAGS, so that it can be set at configure time (useful on Irix
11871 * lib/reLyX/configure.in: make sure that the prefix is set
11872 correctly in LYX_DIR.
11874 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11876 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11877 be used by 'command-sequence' this allows to bind a key to a
11878 sequence of LyX-commands
11879 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11881 * src/LyXAction.C: add "command-sequence"
11883 * src/LyXFunction.C: handling of "command-sequence"
11885 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11886 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11888 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11890 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11892 * src/buffer.C (writeFile): Do not output a comment giving user
11893 and date at the beginning of a .lyx file. This is useless and
11894 annoys cvs anyway; update version number to 1.1.
11896 * src/Makefile.am (LYX_DIR): add this definition, so that a
11897 default path is hardcoded in LyX.
11899 * configure.in: Use LYX_GNU_GETTEXT.
11901 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11902 AM_GNU_GETTEXT with a bug fixed.
11904 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11906 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11908 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11909 which is used to point to LyX data is now LYX_DIR_11x.
11911 * lyx.man: convert to a unix text file; small updates.
11913 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11915 * src/support/LSubstring.[Ch]: made the second arg of most of the
11916 constructors be a const reference.
11918 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11921 * src/support/lyxstring.[Ch] (swap): added missing member function
11922 and specialization of swap(str, str);
11924 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11926 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11927 trace of the old one.
11929 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11930 put the member definitions in undo.C.
11932 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11933 NEW_TEXT and have now only code that was included when this was
11936 * src/intl.C (LCombo): use static_cast
11938 (DispatchCallback): ditto
11940 * src/definitions.h: removed whole file
11942 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11944 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11945 parsing and stores in a std:map. a regex defines the file format.
11946 removed unneeded members.
11948 * src/bufferparams.h: added several enums from definitions.h here.
11949 Removed unsused destructor. Changed some types to use proper enum
11950 types. use block to have the temp_bullets and user_defined_bullets
11951 and to make the whole class assignable.
11953 * src/bufferparams.C (Copy): removed this functions, use a default
11954 assignment instead.
11956 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11959 * src/buffer.C (readLyXformat2): commend out all that have with
11960 oldpapersize to do. also comment out all that hve to do with
11961 insetlatex and insetlatexdel.
11962 (setOldPaperStuff): commented out
11964 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11966 * src/LyXAction.C: remove use of inset-latex-insert
11968 * src/mathed/math_panel.C (button_cb): use static_cast
11970 * src/insets/Makefile.am (insets_o_SOURCES): removed
11973 * src/support/lyxstring.C (helper): use the unsigned long
11974 specifier, UL, instead of a static_cast.
11976 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11978 * src/support/block.h: new file. to be used as a c-style array in
11979 classes, so that the class can be assignable.
11981 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11983 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11984 NULL, make sure to return an empty string (it is not possible to
11985 set a string to NULL).
11987 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11989 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11991 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11993 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11994 link line, so that Irix users (for example) can set it explicitely to
11997 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11998 it can be overidden at make time (static or dynamic link, for
12001 * src/vc-backend.C, src/LaTeXFeatures.h,
12002 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12003 statements to bring templates to global namespace.
12005 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12007 * src/support/lyxstring.C (operator[] const): make it standard
12010 * src/minibuffer.C (Init): changed to reflect that more
12011 information is given from the lyxvc and need not be provided here.
12013 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12015 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12017 * src/LyXView.C (UpdateTimerCB): use static_cast
12018 (KeyPressMask_raw_callback): ditto
12020 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12021 buffer_, a lot of changes because of this. currentBuffer() ->
12022 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12023 also changes to other files because of this.
12025 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12027 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12028 have no support for RCS and partial support for CVS, will be
12031 * src/insets/ several files: changes because of function name
12032 changes in Bufferview and LyXView.
12034 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12036 * src/support/LSubstring.[Ch]: new files. These implement a
12037 Substring that can be very convenient to use. i.e. is this
12039 string a = "Mary had a little sheep";
12040 Substring(a, "sheep") = "lamb";
12041 a is now "Mary has a little lamb".
12043 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12044 out patterns and subpatterns of strings. It is used by LSubstring
12045 and also by vc-backend.C
12047 * src/support/lyxstring.C: went over all the assertions used and
12048 tried to correct the wrong ones and flag which of them is required
12049 by the standard. some bugs found because of this. Also removed a
12050 couple of assertions.
12052 * src/support/Makefile.am (libsupport_a_SOURCES): added
12053 LSubstring.[Ch] and LRegex.[Ch]
12055 * src/support/FileInfo.h: have struct stat buf as an object and
12056 not a pointer to one, some changes because of this.
12058 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12059 information in layout when adding the layouts preamble to the
12060 textclass preamble.
12062 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12065 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12066 because of bug in OS/2.
12068 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12070 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12071 \verbatim@font instead of \ttfamily, so that it can be redefined.
12073 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12074 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12075 src/layout.h, src/text2.C: add 'using' directive to bring the
12076 STL templates we need from the std:: namespace to the global one.
12077 Needed by DEC cxx in strict ansi mode.
12079 * src/support/LIstream.h,src/support/LOstream.h,
12080 src/support/lyxstring.h,src/table.h,
12081 src/lyxlookup.h: do not include <config.h> in header
12082 files. This should be done in the .C files only.
12084 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12088 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12090 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12091 from Kayvan to fix the tth invokation.
12093 * development/lyx.spec.in: updates from Kayvan to reflect the
12094 changes of file names.
12096 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12098 * src/text2.C (InsertStringB): use std::copy
12099 (InsertStringA): use std::copy
12101 * src/bufferlist.C: use a vector to store the buffers in. This is
12102 an internal change and should not affect any other thing.
12104 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12107 * src/text.C (Fill): fix potential bug, one off bug.
12109 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12111 * src/Makefile.am (lyx_main.o): add more files it depends on.
12113 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12115 * src/support/lyxstring.C: use size_t for the reference count,
12116 size, reserved memory and xtra.
12117 (internal_compare): new private member function. Now the compare
12118 functions should work for std::strings that have embedded '\0'
12120 (compare): all compare functions rewritten to use
12123 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12125 * src/support/lyxstring.C (compare): pass c_str()
12126 (compare): pass c_str
12127 (compare): pass c_str
12129 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12131 * src/support/DebugStream.C: <config.h> was not included correctly.
12133 * lib/configure: forgot to re-generate it :( I'll make this file
12134 auto generated soon.
12136 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12138 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12141 * src/support/lyxstring.C: some changes from length() to rep->sz.
12142 avoids a function call.
12144 * src/support/filetools.C (SpaceLess): yet another version of the
12145 algorithm...now per Jean-Marc's suggestions.
12147 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12149 * src/layout.C (less_textclass_desc): functor for use in sorting
12151 (LyXTextClass::Read): sort the textclasses after reading.
12153 * src/support/filetools.C (SpaceLess): new version of the
12154 SpaceLess functions. What problems does this one give? Please
12157 * images/banner_bw.xbm: made the arrays unsigned char *
12159 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12161 * src/support/lyxstring.C (find): remove bogus assertion in the
12162 two versions of find where this has not been done yet.
12164 * src/support/lyxlib.h: add missing int return type to
12167 * src/menus.C (ShowFileMenu): disable exporting to html if no
12168 html export command is present.
12170 * config/lib_configure.m4: add a test for an HTML converter. The
12171 programs checked for are, in this order: tth, latex2html and
12174 * lib/configure: generated from config/lib_configure.m4.
12176 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12177 html converter. The parameters are now passed through $$FName and
12178 $$OutName, instead of standard input/output.
12180 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12182 * lib/lyxrc.example: update description of \html_command.
12183 add "quotes" around \screen_font_xxx font setting examples to help
12184 people who use fonts with spaces in their names.
12186 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12188 * Distribution files: updates for v1.1.2
12190 * src/support/lyxstring.C (find): remove bogus assert and return
12191 npos for the same condition.
12193 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12195 * added patch for OS/2 from SMiyata.
12197 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12199 * src/text2.C (CutSelection): make space_wrapped a bool
12200 (CutSelection): dont declare int i until we have to.
12201 (alphaCounter): return a char const *.
12203 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12205 * src/support/syscall.C (Systemcalls::kill):
12206 src/support/filetools.C (PutEnv, PutEnvPath):
12207 src/lyx_cb.C (addNewlineAndDepth):
12208 src/FontInfo.C (FontInfo::resize): condition some #warning
12209 directives with WITH_WARNINGS.
12212 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12214 * src/layout.[Ch] + several files: access to class variables
12215 limited and made accessor functions instead a lot of code changed
12216 becuase of this. Also instead of returning pointers often a const
12217 reference is returned instead.
12219 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12221 * src/Makefile.am (dist-hook): added used to remove the CVS from
12222 cheaders upon creating a dist
12223 (EXTRA_DIST): added cheaders
12225 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12226 a character not as a small integer.
12228 * src/support/lyxstring.C (find): removed Assert and added i >=
12229 rep->sz to the first if.
12231 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12233 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12234 src/LyXView.C src/buffer.C src/bufferparams.C
12235 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12236 src/text2.C src/insets/insetinclude.C:
12237 lyxlayout renamed to textclasslist.
12239 * src/layout.C: some lyxerr changes.
12241 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12242 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12243 (LyXLayoutList): removed all traces of this class.
12244 (LyXTextClass::Read): rewrote LT_STYLE
12245 (LyXTextClass::hasLayout): new function
12246 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12247 both const and nonconst version.
12248 (LyXTextClass::delete_layout): new function.
12249 (LyXTextClassList::Style): bug fix. do the right thing if layout
12251 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12252 (LyXTextClassList::NameOfLayout): ditto
12253 (LyXTextClassList::Load): ditto
12255 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12257 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12259 * src/LyXAction.C (LookupFunc): added a workaround for sun
12260 compiler, on the other hand...we don't know if the current code
12261 compiles on sun at all...
12263 * src/support/filetools.C (CleanupPath): subst fix
12265 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12268 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12269 complained about this one?
12271 * src/insets/insetinclude.C (Latex): subst fix
12273 * src/insets/insetbib.C (getKeys): subst fix
12275 * src/LyXSendto.C (SendtoApplyCB): subst fix
12277 * src/lyx_main.C (init): subst fix
12279 * src/layout.C (Read): subst fix
12281 * src/lyx_sendfax_main.C (button_send): subst fix
12283 * src/buffer.C (RoffAsciiTable): subst fix
12285 * src/lyx_cb.C (MenuFax): subst fix
12286 (PrintApplyCB): subst fix
12288 1999-10-26 Juergen Vigna <jug@sad.it>
12290 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12292 (Read): Cleaned up this code so now we read only format vestion >= 5
12294 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12296 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12297 come nobody has complained about this one?
12299 * src/insets/insetinclude.C (Latex): subst fix
12301 * src/insets/insetbib.C (getKeys): subst fix
12303 * src/lyx_main.C (init): subst fix
12305 * src/layout.C (Read): subst fix
12307 * src/buffer.C (RoffAsciiTable): subst fix
12309 * src/lyx_cb.C (MenuFax): subst fix.
12311 * src/layout.[hC] + some other files: rewrote to use
12312 std::container to store textclasses and layouts in.
12313 Simplified, removed a lot of code. Make all classes
12314 assignable. Further simplifications and review of type
12315 use still to be one.
12317 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12318 lastfiles to create the lastfiles partr of the menu.
12320 * src/lastfiles.[Ch]: rewritten to use deque to store the
12321 lastfiles in. Uses fstream for reading and writing. Simplifies
12324 * src/support/syscall.C: remove explicit cast.
12326 * src/BufferView.C (CursorToggleCB): removed code snippets that
12327 were commented out.
12328 use explicat C++ style casts instead of C style casts. also use
12329 u_vdata instea of passing pointers in longs.
12331 * src/PaperLayout.C: removed code snippets that were commented out.
12333 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12335 * src/lyx_main.C: removed code snippets that wer commented out.
12337 * src/paragraph.C: removed code snippets that were commented out.
12339 * src/lyxvc.C (logClose): use static_cast
12341 (viewLog): remove explicit cast to void*
12342 (showLog): removed old commented code
12344 * src/menus.C: use static_cast instead of C style casts. use
12345 u_vdata instead of u_ldata. remove explicit cast to (long) for
12346 pointers. Removed old code that was commented out.
12348 * src/insets/inset.C: removed old commented func
12350 * src/insets/insetref.C (InsetRef): removed old code that had been
12351 commented out for a long time.
12353 (escape): removed C style cast
12355 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12357 * src/insets/insetlatex.C (Draw): removed old commented code
12358 (Read): rewritten to use string
12360 * src/insets/insetlabel.C (escape): removed C style cast
12362 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12364 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12365 old commented code.
12367 * src/insets/insetinclude.h: removed a couple of stupid bools
12369 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12370 (Clone): remove C style cast
12371 (getKeys): changed list to lst because of std::list
12373 * src/insets/inseterror.C (Draw): removed som old commented code.
12375 * src/insets/insetcommand.C (Draw): removed some old commented code.
12377 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12378 commented out forever.
12379 (bibitem_cb): use static_cast instead of C style cast
12380 use of vdata changed to u_vdata.
12382 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12384 (CloseUrlCB): use static_cast instead of C style cast.
12385 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12387 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12388 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12389 (CloseInfoCB): static_cast from ob->u_vdata instead.
12390 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12393 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12394 (C_InsetError_CloseErrorCB): forward the ob parameter
12395 (CloseErrorCB): static_cast from ob->u_vdata instead.
12397 * src/vspace.h: include LString.h since we use string in this class.
12399 * src/vspace.C (lyx_advance): changed name from advance because of
12400 nameclash with stl. And since we cannot use namespaces yet...I
12401 used a lyx_ prefix instead. Expect this to change when we begin
12404 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12406 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12407 and removed now defunct constructor and deconstructor.
12409 * src/BufferView.h: have backstack as a object not as a pointer.
12410 removed initialization from constructor. added include for BackStack
12412 * development/lyx.spec.in (%build): add CFLAGS also.
12414 * src/screen.C (drawFrame): removed another warning.
12416 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12418 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12419 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12420 README and ANNOUNCE a bit for the next release. More work is
12423 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12424 unbreakable if we are in freespacing mode (LyX-Code), but not in
12427 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12429 * src/BackStack.h: fixed initialization order in constructor
12431 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12433 * acinclude.m4 (VERSION): new rules for when a version is
12434 development, added also a variable for prerelease.
12435 (warnings): we set with_warnings=yes for prereleases
12436 (lyx_opt): prereleases compile with same optimization as development
12437 (CXXFLAGS): only use pedantic if we are a development version
12439 * src/BufferView.C (restorePosition): don't do anything if the
12440 backstack is empty.
12442 * src/BackStack.h: added member empty, use this to test if there
12443 is anything to pop...
12445 1999-10-25 Juergen Vigna <jug@sad.it>
12448 * forms/layout_forms.fd +
12449 * forms/latexoptions.fd +
12450 * lyx.fd: changed for various form resize issues
12452 * src/mathed/math_panel.C +
12453 * src/insets/inseterror.C +
12454 * src/insets/insetinfo.C +
12455 * src/insets/inseturl.C +
12456 * src/insets/inseturl.h +
12458 * src/LyXSendto.C +
12459 * src/PaperLayout.C +
12460 * src/ParagraphExtra.C +
12461 * src/TableLayout.C +
12463 * src/layout_forms.C +
12470 * src/menus.C: fixed various resize issues. So now forms can be
12471 resized savely or not be resized at all.
12473 * forms/form_url.fd +
12474 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12477 * src/insets/Makefile.am: added files form_url.[Ch]
12479 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12481 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12482 (and presumably 6.2).
12484 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12485 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12486 remaining static member callbacks.
12488 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12491 * src/support/lyxstring.h: declare struct Srep as friend of
12492 lyxstring, since DEC cxx complains otherwise.
12494 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12496 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12498 * src/LaTeX.C (run): made run_bibtex also depend on files with
12500 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12501 are put into the dependency file.
12503 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12504 the code has shown itself to work
12505 (create_ispell_pipe): removed another warning, added a comment
12508 * src/minibuffer.C (ExecutingCB): removed code that has been
12509 commented out a long time
12511 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12512 out code + a warning.
12514 * src/support/lyxstring.h: comment out the three private
12515 operators, when compiling with string ansi conforming compilers
12516 they make problems.
12518 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12520 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12521 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12524 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12527 * src/mathed/math_panel.C (create_math_panel): remove explicit
12530 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12533 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12534 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12535 to XCreatePixmapFromBitmapData
12536 (fl_set_bmtable_data): change the last argument to be unsigned
12538 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12539 and bh to be unsigned int, remove explicit casts in call to
12540 XReadBitmapFileData.
12542 * images/arrows.xbm: made the arrays unsigned char *
12543 * images/varsz.xbm: ditto
12544 * images/misc.xbm: ditto
12545 * images/greek.xbm: ditto
12546 * images/dots.xbm: ditto
12547 * images/brel.xbm: ditto
12548 * images/bop.xbm: ditto
12550 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12552 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12553 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12554 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12556 (LYX_CXX_CHEADERS): added <clocale> to the test.
12558 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12560 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12562 * src/support/lyxstring.C (append): fixed something that must be a
12563 bug, rep->assign was used instead of rep->append.
12565 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12568 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12569 lyx insert double chars. Fix spotted by Kayvan.
12571 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12573 * Fixed the tth support. I messed up with the Emacs patch apply feature
12574 and omitted the changes in lyxrc.C.
12576 1999-10-22 Juergen Vigna <jug@sad.it>
12578 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12580 * src/lyx_cb.C (MenuInsertRef) +
12581 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12582 the form cannot be resized under it limits (fixes a segfault)
12584 * src/lyx.C (create_form_form_ref) +
12585 * forms/lyx.fd: Changed Gravity on name input field so that it is
12588 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12590 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12591 <ostream> and <istream>.
12593 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12594 whether <fstream> provides the latest standard features, or if we
12595 have an oldstyle library (like in egcs).
12596 (LYX_CXX_STL_STRING): fix the test.
12598 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12599 code on MODERN_STL_STREAM.
12601 * src/support/lyxstring.h: use L{I,O}stream.h.
12603 * src/support/L{I,O}stream.h: new files, designed to setup
12604 correctly streams for our use
12605 - includes the right header depending on STL capabilities
12606 - puts std::ostream and std::endl (for LOStream.h) or
12607 std::istream (LIStream.h) in toplevel namespace.
12609 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12611 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12612 was a bib file that had been changed we ensure that bibtex is run.
12613 (runBibTeX): enhanced to extract the names of the bib files and
12614 getting their absolute path and enter them into the dep file.
12615 (findtexfile): static func that is used to look for tex-files,
12616 checks for absolute patchs and tries also with kpsewhich.
12617 Alternative ways of finding the correct files are wanted. Will
12619 (do_popen): function that runs a command using popen and returns
12620 the whole output of that command in a string. Should be moved to
12623 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12624 file with extension ext has changed.
12626 * src/insets/figinset.C: added ifdef guards around the fl_free
12627 code that jug commented out. Now it is commented out when
12628 compiling with XForms == 0.89.
12630 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12631 to lyxstring.C, and only keep a forward declaration in
12632 lyxstring.h. Simplifies the header file a bit and should help a
12633 bit on compile time too. Also changes to Srep will not mandate a
12634 recompile of code just using string.
12635 (~lyxstring): definition moved here since it uses srep.
12636 (size): definition moved here since it uses srep.
12638 * src/support/lyxstring.h: removed a couple of "inline" that should
12641 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12643 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12646 1999-10-21 Juergen Vigna <jug@sad.it>
12648 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12649 set to left if I just remove the width entry (or it is empty).
12651 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12652 paragraph when having dummy paragraphs.
12654 1999-10-20 Juergen Vigna <jug@sad.it>
12656 * src/insets/figinset.C: just commented some fl_free_form calls
12657 and added warnings so that this calls should be activated later
12658 again. This avoids for now a segfault, but we have a memory leak!
12660 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12661 'const char * argument' to 'string argument', this should
12662 fix some Asserts() in lyxstring.C.
12664 * src/lyxfunc.h: Removed the function argAsString(const char *)
12665 as it is not used anymore.
12667 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12669 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12672 * src/Literate.h: some funcs moved from public to private to make
12673 interface clearer. Unneeded args removed.
12675 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12677 (scanBuildLogFile): ditto
12679 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12680 normal TeX Error. Still room for improvement.
12682 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12684 * src/buffer.C (insertErrors): changes to make the error
12685 desctription show properly.
12687 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12690 * src/support/lyxstring.C (helper): changed to use
12691 sizeof(object->rep->ref).
12692 (operator>>): changed to use a pointer instead.
12694 * src/support/lyxstring.h: changed const reference & to value_type
12695 const & lets see if that helps.
12697 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12699 * Makefile.am (rpmdist): fixed to have non static package and
12702 * src/support/lyxstring.C: removed the compilation guards
12704 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12707 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12708 conditional compile of lyxstring.Ch
12710 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12711 stupid check, but it is a lot better than the bastring hack.
12712 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12714 * several files: changed string::erase into string::clear. Not
12717 * src/chset.C (encodeString): use a char temporary instead
12719 * src/table.C (TexEndOfCell): added tostr around
12720 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12721 (TexEndOfCell): ditto
12722 (TexEndOfCell): ditto
12723 (TexEndOfCell): ditto
12724 (DocBookEndOfCell): ditto
12725 (DocBookEndOfCell): ditto
12726 (DocBookEndOfCell): ditto
12727 (DocBookEndOfCell): ditto
12729 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12731 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12733 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12734 (MenuBuildProg): added tostr around ret
12735 (MenuRunChktex): added tostr around ret
12736 (DocumentApplyCB): added tostr around ret
12738 * src/chset.C (encodeString): added tostr around t->ic
12740 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12741 (makeLaTeXFile): added tostr around tocdepth
12742 (makeLaTeXFile): added tostr around ftcound - 1
12744 * src/insets/insetbib.C (setCounter): added tostr around counter.
12746 * src/support/lyxstring.h: added an operator+=(int) to catch more
12749 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12750 (lyxstring): We DON'T allow NULL pointers.
12752 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12754 * src/mathed/math_macro.C (MathMacroArgument::Write,
12755 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12756 when writing them out.
12758 * src/LString.C: remove, since it is not used anymore.
12760 * src/support/lyxstring.C: condition the content to
12761 USE_INCLUDED_STRING macro.
12763 * src/mathed/math_symbols.C, src/support/lstrings.C,
12764 src/support/lyxstring.C: add `using' directive to specify what
12765 we need in <algorithm>. I do not think that we need to
12766 conditionalize this, but any thought is appreciated.
12768 * many files: change all callback functions to "C" linkage
12769 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12770 strict_ansi. Those who were static are now global.
12771 The case of callbacks which are static class members is
12772 trickier, since we have to make C wrappers around them (see
12773 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12774 did not finish this yet, since it defeats the purpose of
12775 encapsulation, and I am not sure what the best route is.
12777 1999-10-19 Juergen Vigna <jug@sad.it>
12779 * src/support/lyxstring.C (lyxstring): we permit to have a null
12780 pointer as assignment value and just don't assign it.
12782 * src/vspace.C (nextToken): corrected this function substituting
12783 find_first(_not)_of with find_last_of.
12785 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12786 (TableOptCloseCB) (TableSpeCloseCB):
12787 inserted fl_set_focus call for problem with fl_hide_form() in
12790 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12792 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12795 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12797 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12798 LyXLex::next() and not eatline() to get its argument.
12800 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12802 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12803 instead, use fstreams for io of the depfile, removed unneeded
12804 functions and variables.
12806 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12807 vector instead, removed all functions and variables that is not in
12810 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12812 * src/buffer.C (insertErrors): use new interface to TeXError
12814 * Makefile.am (rpmdist): added a rpmdist target
12816 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12817 per Kayvan's instructions.
12819 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12821 * src/Makefile.am: add a definition for localedir, so that locales
12822 are found after installation (Kayvan)
12824 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12826 * development/.cvsignore: new file.
12828 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12830 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12831 C++ compiler provides wrappers for C headers and use our alternate
12834 * configure.in: use LYX_CXX_CHEADERS.
12836 * src/cheader/: new directory, populated with cname headers from
12837 libstdc++-2.8.1. They are a bit old, but probably good enough for
12838 what we want (support compilers who lack them).
12840 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12841 from includes. It turns out is was stupid.
12843 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12845 * lib/Makefile.am (install-data-local): forgot a ';'
12846 (install-data-local): forgot a '\'
12847 (libinstalldirs): needed after all. reintroduced.
12849 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12851 * configure.in (AC_OUTPUT): added lyx.spec
12853 * development/lyx.spec: removed file
12855 * development/lyx.spec.in: new file
12857 * po/*.po: merged with lyx.pot becuase of make distcheck
12859 * lib/Makefile.am (dist-hook): added dist-hook so that
12860 documentation files will be included when doing a make
12861 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12862 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12864 more: tried to make install do the right thing, exclude CVS dirs
12867 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12868 Path would fit in more nicely.
12870 * all files that used to use pathstack: uses now Path instead.
12871 This change was a lot easier than expected.
12873 * src/support/path.h: new file
12875 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12877 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12879 * src/support/lyxstring.C (getline): Default arg was given for
12882 * Configure.cmd: removed file
12884 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12886 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12887 streams classes and types, add the proper 'using' statements when
12888 MODERN_STL is defined.
12890 * src/debug.h: move the << operator definition after the inclusion
12893 * src/support/filetools.C: include "LAssert.h", which is needed
12896 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12899 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12900 include "debug.h" to define a proper ostream.
12902 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12904 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12905 method to the SystemCall class which can kill a process, but it's
12906 not fully implemented yet.
12908 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12910 * src/support/FileInfo.h: Better documentation
12912 * src/lyxfunc.C: Added support for buffer-export html
12914 * src/menus.C: Added Export->As HTML...
12916 * lib/bind/*.bind: Added short-cut for buffer-export html
12918 * src/lyxrc.*: Added support for new \tth_command
12920 * lib/lyxrc.example: Added stuff for new \tth_command
12922 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12924 * lib/Makefile.am (IMAGES): removed images/README
12925 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12926 installes in correct place. Check permisions is installed
12929 * src/LaTeX.C: some no-op changes moved declaration of some
12932 * src/LaTeX.h (LATEX_H): changed include guard name
12934 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12936 * lib/reLyX/Makefile.am: install noweb2lyx.
12938 * lib/Makefile.am: install configure.
12940 * lib/reLyX/configure.in: declare a config aux dir; set package
12941 name to lyx (not sure what the best solution is); generate noweb2lyx.
12943 * lib/layouts/egs.layout: fix the bibliography layout.
12945 1999-10-08 Jürgen Vigna <jug@sad.it>
12947 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12948 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12949 it returned without continuing to search the path.
12951 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12953 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12954 also fixes a bug. It is not allowed to do tricks with std::strings
12955 like: string a("hei"); &a[e]; this will not give what you
12956 think... Any reason for the complexity in this func?
12958 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12960 * Updated README and INSTALL a bit, mostly to check that my
12961 CVS rights are correctly set up.
12963 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12965 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12966 does not allow '\0' chars but lyxstring and std::string does.
12968 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12970 * autogen.sh (AUTOCONF): let the autogen script create the
12971 POTFILES.in file too. POTFILES.in should perhaps now not be
12972 included in the cvs module.
12974 * some more files changed to use C++ includes instead of C ones.
12976 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12978 (Reread): added tostr to nlink. buggy output otherwise.
12979 (Reread): added a string() around szMode when assigning to Buffer,
12980 without this I got a log of garbled info strings.
12982 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12985 * I have added several ostream & operator<<(ostream &, some_type)
12986 functions. This has been done to avoid casting and warnings when
12987 outputting enums to lyxerr. This as thus eliminated a lot of
12988 explicit casts and has made the code clearer. Among the enums
12989 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12990 mathed enums, some font enum the Debug::type enum.
12992 * src/support/lyxstring.h (clear): missing method. equivalent of
12995 * all files that contained "stderr": rewrote constructs that used
12996 stderr to use lyxerr instead. (except bmtable)
12998 * src/support/DebugStream.h (level): and the passed t with
12999 Debug::ANY to avoid spurious bits set.
13001 * src/debug.h (Debug::type value): made it accept strings of the
13002 type INFO,INIT,KEY.
13004 * configure.in (Check for programs): Added a check for kpsewhich,
13005 the latex generation will use this later to better the dicovery of
13008 * src/BufferView.C (create_view): we don't need to cast this to
13009 (void*) that is done automatically.
13010 (WorkAreaButtonPress): removed some dead code.
13012 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13014 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13015 is not overwritten when translated (David Sua'rez de Lis).
13017 * lib/CREDITS: Added David Sua'rez de Lis
13019 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13021 * src/bufferparams.C (BufferParams): default input encoding is now
13024 * acinclude.m4 (cross_compiling): comment out macro
13025 LYX_GXX_STRENGTH_REDUCE.
13027 * acconfig.h: make sure that const is not defined (to empty) when
13028 we are compiling C++. Remove commented out code using SIZEOF_xx
13031 * configure.in : move the test for const and inline as late as
13032 possible so that these C tests do not interefere with C++ ones.
13033 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13034 has not been proven.
13036 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13038 * src/table.C (getDocBookAlign): remove bad default value for
13039 isColumn parameter.
13041 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13043 (ShowFileMenu2): ditto.
13045 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13046 of files to ignore.
13048 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13050 * Most files: finished the change from the old error code to use
13051 DebugStream for all lyxerr debugging. Only minor changes remain
13052 (e.g. the setting of debug levels using strings instead of number)
13054 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13056 * src/layout.C (Add): Changed to use compare_no_case instead of
13059 * src/FontInfo.C: changed loop variable type too string::size_type.
13061 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13063 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13064 set ETAGS_ARGS to --c++
13066 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13068 * src/table.C (DocBookEndOfCell): commented out two unused variables
13070 * src/paragraph.C: commented out four unused variables.
13072 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13073 insed a if clause with type string::size_type.
13075 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13078 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13080 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13081 variable, also changed loop to go from 0 to lenght + 1, instead of
13082 -1 to length. This should be correct.
13084 * src/LaTeX.C (scanError): use string::size_type as loop variable
13087 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13088 (l.896) since y_tmp and row was not used anyway.
13090 * src/insets/insetref.C (escape): use string::size_type as loop
13093 * src/insets/insetquotes.C (Width): use string::size_type as loop
13095 (Draw): use string::size_type as loop variable type.
13097 * src/insets/insetlatexaccent.C (checkContents): use
13098 string::size_type as loop variable type.
13100 * src/insets/insetlabel.C (escape): use string::size_type as loop
13103 * src/insets/insetinfo.C: added an extern for current_view.
13105 * src/insets/insetcommand.C (scanCommand): use string::size_type
13106 as loop variable type.
13108 * most files: removed the RCS tags. With them we had to recompile
13109 a lot of files after a simple cvs commit. Also we have never used
13110 them for anything meaningful.
13112 * most files: tags-query-replace NULL 0. As adviced several plases
13113 we now use "0" instead of "NULL" in our code.
13115 * src/support/filetools.C (SpaceLess): use string::size_type as
13116 loop variable type.
13118 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13120 * src/paragraph.C: fixed up some more string stuff.
13122 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13124 * src/support/filetools.h: make modestr a std::string.
13126 * src/filetools.C (GetEnv): made ch really const.
13128 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13129 made code that used these use max/min from <algorithm> instead.
13131 * changed several c library include files to their equivalent c++
13132 library include files. All is not changed yet.
13134 * created a support subdir in src, put lyxstring and lstrings
13135 there + the extra files atexit, fileblock, strerror. Created
13136 Makefile.am. edited configure.in and src/Makefile.am to use this
13137 new subdir. More files moved to support.
13139 * imported som of the functions from repository lyx, filetools
13141 * ran tags-query-replace on LString -> string, corrected the bogus
13142 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13143 is still some errors in there. This is errors where too much or
13144 too litle get deleted from strings (string::erase, string::substr,
13145 string::replace), there can also be some off by one errors, or
13146 just plain wrong use of functions from lstrings. Viewing of quotes
13149 * LyX is now running fairly well with string, but there are
13150 certainly some bugs yet (see above) also string is quite different
13151 from LString among others in that it does not allow null pointers
13152 passed in and will abort if it gets any.
13154 * Added the revtex4 files I forgot when setting up the repository.
13156 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13158 * All over: Tried to clean everything up so that only the files
13159 that we really need are included in the cvs repository.
13160 * Switched to use automake.
13161 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13162 * Install has not been checked.
13164 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13166 * po/pt.po: Three errors:
13167 l.533 and l.538 format specification error
13168 l. 402 duplicate entry, I just deleted it.