1 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
5 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
6 for variable assignment.
8 2000-11-07 Rob Lahaye <lahaye@postech.edu>
10 * src/lib/ui/default.ui: added sub/superscripts to menu as
11 Insert->Special characters and cleaned-up the file a bit
13 2000-11-07 Allan Rae <rae@lyx.org>
15 * src/frontends/xforms/FormPreferences.C (feedback): make sure
16 ob isn't 0 before using it. See comments in function.
18 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
20 * src/frontends/xforms/form_*.C: regenerated
22 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
24 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
26 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
27 compiling with gcc-2.96
29 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
31 * src/support/lyxstring.C: add a couple "using" directives.
33 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
34 a .c_str() here too for good measure.
35 * src/Spacing.C (set): ditto.
36 * src/lyxfunc.C (Dispatch): ditto.
38 * src/insets/insettabular.C (copySelection): change .str() to
39 .str().c_str() to fix problems with lyxstring.
40 * src/support/filetools.C (GetFileContents): ditto.
41 * src/buffer.C (asciiParagraph): ditto.
42 * src/paragraph.C (String): ditto.
44 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
45 * lib/bind/sciword.bind: ditto.
47 * src/LyXAction.C (init): remove "symbol-insert" function, which
48 shared LFUN_INSERT_MATH with "math-insert".
50 * lib/configure.m4: == is not a valid operator for command test.
52 * src/lyxrc.C: add using directive.
54 * src/converter.h: add std:: qualifier.
56 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
58 * src/converter.[Ch] and other files: Change the Format class to a
59 real class, and create two instances: formats and system_format.
61 * src/lyxrc.C (output): Output the difference between formats and
64 * src/frontends/xforms/FormPreferences.C (input): Simplify.
65 (buildFormats): Insert formats into browser.
66 (inputFormats): Made the browser and add button functional.
67 (applyFormats): Update formats from format_vec.
69 * src/converter.C: Changed all (*it). to it->
70 (Format::dummy): New method.
71 (Format::importer): New format flag.
72 (Formats::GetAllFormats): New method.
73 (Formats::Add): Delete format from the map if prettyname is empty.
74 (Converter::Convert): Print an error message if moving the file fails.
75 (Converter::GetReachableTo): New method
77 * src/MenuBackend.[Ch]: Add support for importformats tag.
79 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
81 * lib/configure.m4: Add word->tex and ps->fax converters.
83 * lib/ui/default.ui: Use ImportFormats on file->import menu.
84 Return fax to file menu.
88 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
90 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
93 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
96 * src/lyxfunc.C (processKeyEvent): removed
98 * src/bufferlist.C (emergencyWrite): removed the out commented
101 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
103 * src/LyXView.[Ch]: remove the outcommented raw_callback code
105 * many files: change formatting to be a bit more uniform for
106 if,while,for,switch statements, remove some parantesis not needed.
109 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
111 * config/kde.m4: make config more robust when KDEDIR is set
113 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
115 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
116 not returned a pixmap for "math-insert".
118 * src/LyXAction.C (init): sort the entries a bit.
120 2000-11-03 Juergen Vigna <jug@sad.it>
122 * src/insets/insettabular.h: added fixed number to update codes so
123 that update is only in one direction.
125 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
128 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
129 before call to edit because of redraw.
131 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
133 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
135 * lib/ui/default.ui: Populate "edit_float" menu
137 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
139 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
140 "floats-operate". The name is ugly (and the func also), but this
141 is just a band-aid until we switch to new insets.
143 2000-11-03 Rob Lahaye <lahaye@postech.edu>
145 * lib/ui/default.ui: update again the menu layout (fix some
148 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
150 * src/MenuBackend.h (fulllabel): new method.
152 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
153 the menu shortcuts of a menu are unique and whether they
154 correspond to a letter of the label.
155 (expand): call checkShortcuts when debugging.
157 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
159 * src/insets/insettext.C (InsetButtonPress): shut off warning.
161 2000-11-02 Lior Silberman <lior@Princeton.EDU>
163 * lib/examples/*.lyx : '\language default' => '\language english'
165 * lib/examples/it_splash.lyx : except where it should be italian
167 * lib/templates/*.lyx : the same
169 * doc/*.lyx* : the same
171 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
173 * lib/bind/menus.bind: remove the Layout menu entries, which I
174 somehow forgot earlier.
176 2000-11-03 Rob Lahaye <lahaye@postech.edu>
178 * lib/ui/old-default.ui: keep the old one here for reference (to
181 * lib/ui/default.ui: update the menu layout
183 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
185 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
186 Can now Apply to different insets without closing the dialog.
188 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
189 Can't actually DO anything with them yet, but I'd like a little
192 * src/frontends/xforms/input_validators.[ch]
193 (fl_lowercase_filter): new.
195 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
197 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
198 of MATH_CODE. This fixes a bug with math-macros in RTL text.
200 * src/text.C (PrepareToPrint): Show math-macros block aligned.
202 2000-11-02 Juergen Vigna <jug@sad.it>
204 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
205 on char insertion as it has already be updated by bv->updateInset().
207 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
208 if an inset inside was updated.
210 * lib/configure.cmd: commented out fax-search code
212 2000-11-01 Yves Bastide <stid@acm.org>
214 * src/tabular.C (OldFormatRead): set tabular language to the
217 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
219 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
220 class names with non-letter characters (from Yves Bastide).
222 * lib/ui/default.ui: change Item to OptItem in import menu.
223 Comment out fax stuff.
225 * lib/configure.m4: comment out fax-related stuff.
227 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
229 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
230 useful xforms helper functions. At present contains only formatted().
231 Input a string and it returns it with line breaks so that in fits
234 * src/frontends/xforms/Makefile.am: add new files.
236 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
237 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
240 * src/frontends/xforms/FormPreferences.[Ch]:
241 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
242 but lots of little clean ups. Removed enum State. Make use of
243 formatted(). Constify lots of methods. Perhaps best of all: removed
244 requirement for that horrible reinterpret_cast from pointer to long in
247 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
249 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
250 conditionalize build on xforms < 0.89
252 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
254 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
256 * src/LyXAction.C (init): comment out fax
258 * src/lyxrc.h: comment out the fax enums
259 comment out the fax variables
261 * src/commandtags.h: comment out LFUN_FAX
263 * src/lyxrc.C: disable fax variables.
264 (read): disable parsing of fax variables
265 (output): disable writing of fax variables
266 (getFeedback): now description for fax variables
268 * src/lyxfunc.C: comment out MenuFax
269 (Dispatch): disable LFUN_FAX
271 * src/lyx_cb.C (MenuFax): comment out
273 * src/WorkArea.C: add <cctype>
274 (work_area_handler): better key handling, should be ok now.
275 for accented chars + etc
277 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
278 lyx_sendfax.h and lyx_sendfax_man.C
280 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
281 (show): don't call InitLyXLookup when using xforms 0.89
283 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
285 * src/trans.C (AddDeadkey): better fix, the other one could crash...
287 * src/support/filetools.C (GetFileContents): close to dummy change
289 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
291 * src/trans.C (AddDeadkey): workaround stupid compilers.
293 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
295 * src/frontends/xforms/FormDocument.C (class_update): fix setting
296 of two-sided document.
298 2000-10-31 Juergen Vigna <jug@sad.it>
300 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
302 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
303 xposition to the Edit call.
305 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
307 * src/trans.C (AddDeadkey): cast explicitly to char.
309 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
311 * src/tabular.C (AsciiBottomHLine): simplify?
312 (AsciiTopHLine): simplify?
313 (print_n_chars): simplify
314 (DocBook): remove most of the << endl; we should flush the stream
315 as seldom as possible.
317 (TeXBottomHLine): ditto
320 (write_attribute): try a templified version.
321 (set_row_column_number_info): lesson scope of variables
323 * src/support/lstrings.h (tostr): new specialization of tostr
325 * src/trans.C (AddDeadkey): slightly cleaner fix.
327 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
329 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
330 '%%' in Toc menu labels.
333 * src/insets/insetlatexaccent.C (draw): Correct rendering when
334 font_norm is iso10646-1.
336 * src/font.C (ascent): Fixed for 16bit fonts
337 (descent,lbearing,rbearing): ditto
339 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
341 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
342 (getFeedback): new static method.
344 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
345 Now use combox rather than choice to display languages.
346 Feedback is now output using a new timer callback mechanism, identical
347 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
349 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
351 * src/minibuffer.C: fix for older compilers
353 2000-10-30 Juergen Vigna <jug@sad.it>
355 * src/insets/insettext.C (InsertInset): fixed this as the cursor
356 has to be Left of the inset otherwise LyXText won't find it!
358 * src/BufferView2.C (open_new_inset): delete the inset if it can
361 2000-10-30 Rob Lahaye <lahaye@postech.edu>
365 2000-10-29 Marko Vendelin <markov@ioc.ee>
366 * src/frontends/gnome/FormCitation.C
367 * src/frontends/gnome/FormCitation.h
368 * src/frontends/gnome/FormCopyright.C
369 * src/frontends/gnome/FormCopyright.h
370 * src/frontends/gnome/FormError.C
371 * src/frontends/gnome/FormError.h
372 * src/frontends/gnome/FormIndex.C
373 * src/frontends/gnome/FormIndex.h
374 * src/frontends/gnome/FormPrint.C
375 * src/frontends/gnome/FormPrint.h
376 * src/frontends/gnome/FormRef.C
377 * src/frontends/gnome/FormRef.h
378 * src/frontends/gnome/FormToc.C
379 * src/frontends/gnome/FormToc.h
380 * src/frontends/gnome/FormUrl.C
381 * src/frontends/gnome/FormUrl.h
382 * src/frontends/gnome/Menubar_pimpl.C
383 * src/frontends/gnome/mainapp.C
384 * src/frontends/gnome/mainapp.h
385 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
386 changing update() to updateSlot() where appropriate
388 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
390 * src/frontends/xforms/FormPreferences.[Ch]:
391 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
394 2000-10-28 Juergen Vigna <jug@sad.it>
396 * src/insets/insettabular.C (draw): fixed drawing bug.
398 * src/insets/insettext.C (clear):
400 (SetParagraphData): clearing the TEXT buffers when deleting the
401 paragraphs used by it.
403 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
405 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
407 2000-10-27 Juergen Vigna <jug@sad.it>
409 * src/tabular.C (~LyXTabular): removed not needed anymore.
411 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
414 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
416 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
419 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
422 * src/frontends/xforms/FormPreferences.[Ch]:
423 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
424 Reorganised as modules based on tabs. Much easier to follow the
425 flow and to add new tabs. Added warning and feedback messages.
428 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
430 * src/tabular.h (DocBook): add std:: qualifier.
432 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
434 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
435 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
438 * insettabular.C (DocBook): uses the tabular methods to export
441 * src/insets/insettext.h
442 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
444 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
446 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
449 * src/lyxfunc.C (MenuNew): lessen the scope of fname
450 moved misplaced AllowInput two lines up.
452 * src/buffer.C (readFile): compare float with float, not with int
454 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
456 * src/minibuffer.C: add "using SigC::slot" statement.
458 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
460 * src/frontends/xforms/forms/README: updated section about make.
462 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
463 Tidied some forms up, made two of form_tabular's tabs more
464 self-consistent, fixed Jean-Marc's size problem in form_preferences,
465 fixed translation problem with "Column".
467 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
469 * src/minibuffer.h: use Timeout instead of the xforms timer
471 (setTimer) rewrite for the Timeout, change to unsigned arg
472 (set): change to unsigned timer arg
475 * src/minibuffer.C (TimerCB): removed func
476 (C_MiniBuffer_TimerCB): removed func
477 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
478 (peek_event): use a switch statement
479 (add): don't use fl_add_timer.
480 (Set): rewrite to use the Timeout
483 * src/Timeout.[Ch] (setType): return a Timeout &
484 (setTimeout): ditto, change to unsigned arg for timeout
486 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
488 * src/mathed/formula.C (mathed_string_width): Use string instead
489 of a constant size char array.
491 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
493 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
494 the two recently added operator<< for SMInput and State.
496 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
498 (OkCancelPolicy): ditto
499 (OkCancelReadOnlyPolicy): ditto
500 (NoRepeatedApplyReadOnlyPolicy): ditto
501 (OkApplyCancelReadOnlyPolicy): ditto
502 (OkApplyCancelPolicy): ditto
503 (NoRepeatedApplyPolicy): ditto
505 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
507 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
508 add the usual std:: qualifiers.
510 2000-10-25 Juergen Vigna <jug@sad.it>
512 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
514 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
516 * src/support/filetools.C (MakeRelPath): change some types to
519 * src/frontends/ButtonPolicies.h (operator<<): new operator for
520 ButtonPolicy::SMInput and ButtonPolicy::State.
522 * src/FontLoader.C (reset): small cleanup
523 (unload): small cleanup
525 * src/FontInfo.C (getFontname): initialize error to 10000.0
527 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
529 * src/frontends/xforms/FormPreferences.[Ch]:
530 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
531 TeX encoding and default paper size sections.
533 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
535 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
538 * src/frontends/xforms/FormError.C (disconnect): use erase() to
539 make the message_ empty.
540 (FormError): don't initialize message_ in initializer list.
542 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
544 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
546 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
548 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
550 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
552 * src/frontends/kde/*data.[Ch]: _("") is not
555 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
557 * src/buffer.C: removed redundant using directive.
559 * src/frontends/DialogBase.h: revert to original definition of
562 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
563 stuff into two classes, one for each dialog, requires a new
564 element in the dialogs vector, FormTabularCreate.
566 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
569 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
570 method. Continues Allan's idea, but means that derived classes
571 don't need to worry about "update or hide?".
573 * src/frontends/xforms/FormError.C (showInset): add connection
576 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
577 one for each dialog. FormTabular now contains main tabular dialog
580 * src/frontends/xforms/FormTabularCreate.[Ch]:
581 * src/frontends/xforms/forms/form_tabular_create.fd: the create
584 * src/frontends/xforms/FormGraphics.[Ch]:
585 * src/frontends/xforms/forms/form_graphics.fd
586 * src/frontends/xforms/FormTabular.[Ch]:
587 * src/frontends/xforms/forms/form_tabular.fd: made daughter
588 classes of FormInset.
590 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
591 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
593 * src/frontends/xforms/Makefile.am:
594 * src/frontends/xforms/forms/makefile: added new files.
596 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
597 variable. added Signal0 hide signal, in keeping with other GUI-I
600 * src/support/lstrings.h: removed redundant std:: qualifier as
601 it's already declared in Lsstream.h.
603 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
605 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
609 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
611 * src/tabular.C (Ascii): minimize scope of cell.
613 * src/BufferView2.C (nextWord): return string() instead of 0;
615 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
617 * src/converter.h: add a std:: qualifier
619 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
621 * src/importer.[Ch]: New files. Used for importing files into LyX.
623 * src/lyxfunc.C (doImport): Use the new Importer class.
625 * src/converter.h: Add shortcut member to the Format class.
626 Used for holding the menu shortcut.
628 * src/converter.C and other files: Made a distinction between
629 format name and format extension. New formats can be defined using
630 the \format lyxrc tag.
631 Added two new converter flags: latex and disable.
633 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
635 * src/support/lyxlib.h: unify namespace/struct implementation.
636 Remove extra declarations.
638 * src/support/chdir.C (chdir): remove version taking char const *
640 * src/support/rename.C: ditto.
641 * src/support/lyxsum.C: ditto.
643 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
645 * src/frontends/xforms/FormBase.[Ch]:
646 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
647 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
648 work only for the next call to fl_show_form(). The correct place to set
649 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
650 done. FormBase also stores minw_, minh_ itself. All dialogs derived
651 from FormBase have the minimum size set; no more stupid crashes with
654 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
656 * lib/ui/default.ui: fix shortcut for Insert->Include File.
658 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
660 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
662 * src/support/lyxlib.h: changed second argument of mkdir to
663 unsigned long int (unsigned int would probably have been enough,
664 but...). Removed <sys/types.h> header.
665 * src/support/mkdir.C (mkdir): ditto.
669 2000-10-19 Juergen Vigna <jug@sad.it>
671 * src/lyxfunc.C (MenuNew): small fix (form John)
673 * src/screen.C (Update): removed unneeded code.
675 * src/tabular.C (Ascii): refixed int != uint bug!
677 * src/support/lyxlib.h: added sys/types.h include for now permits
678 compiling, but I don't like this!
680 2000-10-18 Juergen Vigna <jug@sad.it>
682 * src/text2.C (ClearSelection): if we clear the selection we need
683 more refresh so set the status apropriately
685 * src/insets/insettext.C (draw): hopefully finally fixed draw
688 2000-10-12 Juergen Vigna <jug@sad.it>
690 * src/insets/insettext.C (draw): another small fix and make a block
691 so that variables are localized.
693 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
695 * src/support/lstrings.C (lowercase, uppercase):
696 use explicit casts to remove compiler warnings.
698 * src/support/LRegex.C (Impl):
699 * src/support/StrPool.C (add):
700 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
701 (AddPath, MakeDisplayPath):
702 * src/support/lstrings.C (prefixIs, subst):
703 use correct type to remove compiler warnings.
705 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
707 * src/support/lyxlib.h:
708 * src/support/mkdir.C (mkdir): change parameter to mode_t for
709 portability and to remove compiler warning with DEC cxx.
711 * src/support/FileInfo.[Ch] (flagRWX): ditto.
713 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
715 * src/minibuffer.C (peek_event): retun 1 when there has been a
716 mouseclick in the minibuffer.
720 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
722 * src/frontends/xforms/FormParagraph.C: more space above/below
725 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
727 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
728 a char only if real_current_font was changed.
730 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
732 * NEWS: update somewhat for 1.1.6
734 * lib/ui/default.ui: clean up.
736 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
738 * lib/CREDITS: clean up
740 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
742 * src/combox.[Ch] (select): changed argument back to int
743 * src/combox.C (peek_event): removed num_bytes as it is declared but
746 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
747 modified calls to Combox::select() to remove warnings about type
750 * src/insets/insetbutton.C (width): explicit cast to remove warning
751 about type conversion.
753 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
756 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
757 sel_pos_end, refering to cursor position are changed to
758 LyXParagraph::size_type.
760 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
761 consistent with LyXCursor::pos().
762 (inset_pos): changed to LyXParagraph::size_type for same reason.
764 * src/insets/insettext.C (resizeLyXText): changed some temporary
765 variables refing to cursor position to LyXParagraph::size_type.
767 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
769 * src/frontends/kde/<various>: The Great Renaming,
772 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
774 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
776 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
778 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
779 0 when there are no arguments.
781 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
783 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
784 to segfaults when pressing Ok in InsetBibtex dialog.
786 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
788 * forms/layout_forms.fd:
789 * src/layout_forms.C (create_form_form_character): small change to use
790 labelframe rather than engraved frame + text
792 * src/lyx_gui.C (create_forms): initialise choice_language with some
793 arbitrary value to prevent segfault when dialog is shown.
795 2000-10-16 Baruch Even <baruch.even@writeme.com>
797 * src/converter.C (runLaTeX, scanLog): Added a warning when there
798 is no resulting file. This pertains only to LaTeX output.
800 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
802 * src/text.C (Backspace): Make sure that the row of the cursor is
805 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
808 * src/lyx_gui.C (init): Prevent a crash when only one font from
809 menu/popup fonts is not found.
811 * lib/lyxrc.example: Add an example for binding a key for language
814 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
816 * src/converter.C (GetReachable): Changed the returned type to
818 (IsReachable): New method
820 * src/MenuBackend.C (expand): Handle formats that appear more
823 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
825 * src/frontends/support/Makefile.am
826 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
829 * lib/CREDITS: add Garst Reese.
831 * src/support/snprintf.h: add extern "C" {} around the definitions.
833 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
835 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
838 * src/frontends/xforms/FormDocument.C:
839 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
840 compile without "conversion to integral type of smaller size"
843 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
845 * src/text.C (GetColumnNearX): Fixed disabled code.
847 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
849 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
852 * src/support/snprintf.[ch]: new files
854 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
856 * src/frontends/kde/formprintdialog.C: add
857 file browser for selecting postscript output
859 * src/frontends/kde/formprintdialogdata.C:
860 * src/frontends/kde/formprintdialogdata.h: re-generate
863 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
865 * src/frontends/gnome/Makefile.am:
866 * src/frontends/kde/Makefile.am: FormCommand.C
867 disappeared from xforms
869 * src/frontends/kde/FormCitation.C:
870 * src/frontends/kde/FormIndex.C: read-only
873 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
875 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
878 * src/bufferlist.C: add using directive.
880 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
882 * src/support/lyxfunctional.h: version of class_fun for void
883 returns added, const versions of back_inseter_fun and compare_fun
886 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
888 * src/frontends/xforms/FormInset.C (showInset): fix typo.
890 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
892 * ChangeLog: cleanup.
894 * lib/CREDITS: update to add all the contributors we've forgotten.
895 I have obviously missed some, so tell me whether there were
898 2000-10-13 Marko Vendelin <markov@ioc.ee>
900 * src/frontends/gnome/FormCitation.C
901 * src/frontends/gnome/FormCitation.h
902 * src/frontends/gnome/FormError.C
903 * src/frontends/gnome/FormIndex.C
904 * src/frontends/gnome/FormRef.C
905 * src/frontends/gnome/FormRef.h
906 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
908 * src/frontends/gnome/FormCitation.C
909 * src/frontends/gnome/FormCopyright.C
910 * src/frontends/gnome/FormError.C
911 * src/frontends/gnome/FormIndex.C
912 * src/frontends/gnome/FormRef.C
913 * src/frontends/gnome/FormToc.C
914 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
917 * src/frontends/gnome/Menubar_pimpl.C
918 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
921 2000-10-11 Baruch Even <baruch.even@writeme.com>
924 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
925 to convey its real action.
927 * src/minibuffer.C (peek_event): Added action when mouse clicks to
928 clear the minibuffer and prepare to enter a command.
930 * src/mathed/formula.C (LocalDispatch): Changed to conform with
931 the rename from ExecCommand to PrepareForCommand.
932 * src/lyxfunc.C (Dispatch): ditto.
934 2000-10-11 Baruch Even <baruch.even@writeme.com>
936 * src/buffer.C (writeFile): Added test for errors on writing, this
937 catches all errors and not only file system full errors as intended.
939 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
941 * src/lyx_gui.C (create_forms): better fix for crash with
942 translated interface.
944 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
946 * src/frontends/kde/Makefile.am:
947 * src/frontends/kde/FormCopyright.C:
948 * src/frontends/kde/formcopyrightdialog.C:
949 * src/frontends/kde/formcopyrightdialog.h:
950 * src/frontends/kde/formcopyrightdialogdata.C:
951 * src/frontends/kde/formcopyrightdialogdata.h:
952 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
953 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
954 copyright to use qtarch
956 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
958 * src/encoding.C (read): Fixed bug that caused an error message at
961 * po/Makefile.in.in: Fixed rule for ext_l10n.h
963 * lib/lyxrc.example: Fixed hebrew example.
965 2000-10-13 Allan Rae <rae@lyx.org>
967 * src/frontends/xforms/FormPreferences.C (input): reworking the
969 (build, update, apply): New inputs in various tabfolders
971 * src/frontends/xforms/FormToc.C: use new button policy.
972 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
973 dialogs that either can't use any existing policy or where it just
976 * src/frontends/xforms/FormTabular.h: removed copyright notice that
979 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
980 added a bool parameter which is ignored.
982 * src/buffer.C (setReadonly):
983 * src/BufferView_pimpl.C (buffer):
984 * src/frontends/kde/FormCopyright.h (update):
985 * src/frontends/kde/FormCitation.[Ch] (update):
986 * src/frontends/kde/FormIndex.[Ch] (update):
987 * src/frontends/kde/FormPrint.[Ch] (update):
988 * src/frontends/kde/FormRef.[Ch] (update):
989 * src/frontends/kde/FormToc.[Ch] (update):
990 * src/frontends/kde/FormUrl.[Ch] (update):
991 * src/frontends/gnome/FormCopyright.h (update):
992 * src/frontends/gnome/FormCitation.[Ch] (update):
993 * src/frontends/gnome/FormError.[Ch] (update):
994 * src/frontends/gnome/FormIndex.[Ch] (update):
995 * src/frontends/gnome/FormPrint.[Ch] (update):
996 * src/frontends/gnome/FormRef.h (update):
997 * src/frontends/gnome/FormToc.[Ch] (update):
998 * src/frontends/gnome/FormUrl.[Ch] (update):
999 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1000 to updateBufferDependent and DialogBase
1002 * src/frontends/xforms/FormCitation.[hC]:
1003 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1004 * src/frontends/xforms/FormError.[Ch]:
1005 * src/frontends/xforms/FormGraphics.[Ch]:
1006 * src/frontends/xforms/FormIndex.[Ch]:
1007 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1008 and fixed readOnly handling.
1009 * src/frontends/xforms/FormPrint.[Ch]:
1010 * src/frontends/xforms/FormRef.[Ch]:
1011 * src/frontends/xforms/FormTabular.[Ch]:
1012 * src/frontends/xforms/FormToc.[Ch]:
1013 * src/frontends/xforms/FormUrl.[Ch]:
1014 * src/frontends/xforms/FormInset.[Ch]:
1015 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1016 form of updateBufferDependent.
1018 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1019 if form()->visible just in case someone does stuff to the form in a
1022 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1023 the buttoncontroller for everything the enum used to be used for.
1024 (update) It would seem we need to force all dialogs to use a bool
1025 parameter or have two update functions. I chose to go with one.
1026 I did try removing update() from here and FormBase and defining the
1027 appropriate update signatures in FormBaseB[DI] but then ran into the
1028 problem of the update() call in FormBase::show(). Whatever I did
1029 to get around that would require another function and that just
1030 got more confusing. Hence the decision to make everyone have an
1031 update(bool). An alternative might have been to override show() in
1032 FormBaseB[DI] and that would allow the different and appropriate
1035 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1036 true == buffer change occurred. I decided against using a default
1037 template parameter since not all compilers support that at present.
1039 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1041 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1042 army knife" by removing functionality.
1043 (clearStore): removed. All such housekeeping on hide()ing the dialog
1044 is to be carried out by overloaded disconnect() methods.
1045 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1046 superceded by Baruch's neat test (FormGraphics) to update an existing
1047 dialog if a new signal is recieved rather than block all new signals
1049 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1050 only to Inset dialogs.
1051 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1052 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1054 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1056 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1057 as a base class to all inset dialogs. Used solely to connect/disconnect
1058 the Inset::hide signal and to define what action to take on receipt of
1059 a UpdateBufferDependent signal.
1060 (FormCommand): now derived from FormInset.
1062 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1065 * src/frontends/xforms/FormCopyright.[Ch]:
1066 * src/frontends/xforms/FormPreferences.[Ch]:
1067 now derived from FormBaseBI.
1069 * src/frontends/xforms/FormDocument.[Ch]:
1070 * src/frontends/xforms/FormParagraph.[Ch]:
1071 * src/frontends/xforms/FormPrint.[Ch]:
1072 now derived from FormBaseBD.
1074 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1076 * src/frontends/xforms/FormCitation.[Ch]:
1077 * src/frontends/xforms/FormError.[Ch]:
1078 * src/frontends/xforms/FormRef.[Ch]:
1079 * src/frontends/xforms/FormToc.[Ch]:
1080 (clearStore): reworked as disconnect().
1082 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1085 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1087 * src/converter.C (runLaTeX): constify buffer argument
1090 * src/frontends/support/Makefile.am (INCLUDES): fix.
1092 * src/buffer.h: add std:: qualifier
1093 * src/insets/figinset.C (addpidwait): ditto
1094 * src/MenuBackend.C: ditto
1095 * src/buffer.C: ditto
1096 * src/bufferlist.C: ditto
1097 * src/layout.C: ditto
1098 * src/lyxfunc.C: ditto
1100 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1102 * src/lyxtext.h (bidi_level): change return type to
1103 LyXParagraph::size_type.
1105 * src/lyxparagraph.h: change size_type to
1106 TextContainer::difference_type. This should really be
1107 TextContainer::size_type, but we need currently to support signed
1110 2000-10-11 Marko Vendelin <markov@ioc.ee>
1111 * src/frontends/gnome/FormError.h
1112 * src/frontends/gnome/FormRef.C
1113 * src/frontends/gnome/FormRef.h
1114 * src/frontends/gnome/FormError.C
1115 * src/frontends/gnome/Makefile.am
1116 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1117 to Gnome frontend. Both dialogs use "action" area.
1119 2000-10-12 Baruch Even <baruch.even@writeme.com>
1121 * src/graphics/GraphicsCacheItem_pimpl.C:
1122 * src/graphics/Renderer.C:
1123 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1126 2000-10-12 Juergen Vigna <jug@sad.it>
1128 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1129 visible when selecting).
1131 * development/Code_rules/Rules: fixed some typos.
1133 2000-10-09 Baruch Even <baruch.even@writeme.com>
1135 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1136 compiling on egcs 1.1.2 possible.
1138 * src/filedlg.C (comp_direntry::operator() ): ditto.
1140 2000-08-31 Baruch Even <baruch.even@writeme.com>
1142 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1145 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1146 transient it now only gets freed when the object is destructed.
1148 2000-08-24 Baruch Even <baruch.even@writeme.com>
1150 * src/frontends/FormGraphics.h:
1151 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1154 2000-08-20 Baruch Even <baruch.even@writeme.com>
1156 * src/insets/insetgraphics.C:
1157 (draw): Added messages to the drawn rectangle to report status.
1158 (updateInset): Disabled the use of the inline graphics,
1161 2000-08-17 Baruch Even <baruch.even@writeme.com>
1163 * src/frontends/support: Directory added for the support of GUII LyX.
1165 * src/frontends/support/LyXImage.h:
1166 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1169 * src/frontends/support/LyXImage_X.h:
1170 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1171 version of LyXImage, this uses the Xlib Pixmap.
1173 * src/PainterBase.h:
1174 * src/PainterBase.C:
1176 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1177 replacement to Pixmap.
1179 * src/insets/insetgraphics.h:
1180 * src/insets/insetgraphics.C:
1181 * src/graphics/GraphicsCacheItem.h:
1182 * src/graphics/GraphicsCacheItem.C:
1183 * src/graphics/GraphicsCacheItem_pimpl.h:
1184 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1187 * src/graphics/GraphicsCacheItem.h:
1188 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1189 another copy of the object.
1191 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1192 of cacheHandle, this fixed a bug that sent LyX crashing.
1194 * src/graphics/XPM_Renderer.h:
1195 * src/graphics/XPM_Renderer.C:
1196 * src/graphics/EPS_Renderer.h:
1197 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1199 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1201 * src/lyxfunc.C (processKeySym): only handle the
1202 lockinginset/inset stuff if we have a buffer and text loaded...
1204 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1206 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1208 * src/support/lyxfunctional.h: add operator= that takes a reference
1210 * src/lyxserver.C (mkfifo): make first arg const
1212 * src/layout.h: renamed name(...) to setName(...) to work around
1215 * src/buffer.C (setFileName): had to change name of function to
1216 work around bugs in egcs. (renamed from fileName)
1218 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1220 * src/support/translator.h: move helper template classes to
1221 lyxfunctional.h, include "support/lyxfunctional.h"
1223 * src/support/lyxmanip.h: add delaration of fmt
1225 * src/support/lyxfunctional.h: new file
1226 (class_fun_t): new template class
1227 (class_fun): helper template function
1228 (back_insert_fun_iterator): new template class
1229 (back_inserter_fun): helper template function
1230 (compare_memfun_t): new template class
1231 (compare_memfun): helper template function
1232 (equal_1st_in_pair): moved here from translator
1233 (equal_2nd_in_pair): moved here from translator
1235 * src/support/fmt.C: new file
1236 (fmt): new func, can be used for a printf substitute when still
1237 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1239 * src/support/StrPool.C: add some comments
1241 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1244 * src/insets/figinset.C (addpidwait): use std::copy with
1245 ostream_iterator to fill the pidwaitlist
1247 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1249 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1252 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1255 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1257 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1258 (class_update): ditto
1259 (BulletPanel): ditto
1260 (CheckChoiceClass): move initialization of tc and tct
1262 * src/tabular.C: remove current_view
1263 (OldFormatRead): similar to right below [istream::ignore]
1265 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1266 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1267 unused [istream::ignore]
1269 * src/lyxfunc.C: include "support/lyxfunctional.h"
1270 (getInsetByCode): use std::find_if and compare_memfun
1272 * src/lyxfont.C (stateText): remove c_str()
1274 * src/lyx_main.C (setDebuggingLevel): make static
1275 (commandLineHelp): make static
1277 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1278 Screen* together with fl_get_display() and fl_screen
1280 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1281 togheter with fl_get_display() and fl_screen
1282 (create_forms): remove c_str()
1284 * src/layout.C: include "support/lyxfunctional.h"
1285 (hasLayout): use std::find_if and compare_memfun
1286 (GetLayout): use std::find_if and comapre_memfun
1287 (delete_layout): use std::remove_if and compare_memfun
1288 (NumberOfClass): use std:.find_if and compare_memfun
1290 * src/gettext.h: change for the new functions
1292 * src/gettext.C: new file, make _(char const * str) and _(string
1293 const & str) real functions.
1295 * src/font.C (width): rewrite slightly to avoid one extra variable
1297 * src/debug.C: initialize Debug::ANY here
1299 * src/commandtags.h: update number comments
1301 * src/combox.h (get): make const func
1303 (getline): make const
1305 * src/combox.C (input_cb): handle case where fl_get_input can
1308 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1309 "support/lyxfunctional.h", remove current_view variable.
1310 (resize): use std::for_each with std::mem_fun
1311 (getFileNames): use std::copy with back_inserter_fun
1312 (getBuffer): change arg type to unsigned int
1313 (emergencyWriteAll): call emergencyWrite with std::for_each and
1315 (emergencyWrite): new method, the for loop in emergencyWriteAll
1317 (exists): use std::find_if with compare_memfun
1318 (getBuffer): use std::find_if and compare_memfun
1320 * src/buffer.h: add typedefs for iterator_category, value_type
1321 difference_type, pointer and reference for inset_iterator
1322 add postfix ++ for inset_iterator
1323 make inset_iterator::getPos() const
1325 * src/buffer.C: added support/lyxmanip.h
1326 (readFile): use lyxerr << fmt instead of printf
1327 (makeLaTeXFile): use std::copy to write out encodings
1329 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1331 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1332 free and the char * temp.
1333 (hasMenu): use std::find_if and compare_memfun
1336 * src/Makefile.am (lyx_SOURCES): added gettext.C
1338 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1339 string::insert small change to avoid temporary
1341 * src/LColor.C (getGUIName): remove c_str()
1343 * several files: change all occurrences of fl_display to
1346 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1347 that -pedantic is not used for gcc 2.97 (cvs gcc)
1349 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1351 2000-10-11 Allan Rae <rae@lyx.org>
1353 * src/frontends/xforms/FormPreferences.C (input): template path must be
1354 a readable directory. It doesn't need to be writeable.
1355 (build, delete, update, apply): New inputs in the various tabfolders
1357 * src/frontends/xforms/forms/form_preferences.fd:
1358 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1359 several new entries to existing folders. Shuffled some existing stuff
1362 * src/frontends/xforms/forms/form_print.fd:
1363 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1364 Should probably rework PrinterParams as well. Note that the switch to
1365 collated is effectively the same as !unsorted so changing PrinterParams
1366 will require a lot of fiddly changes to reverse the existing logic.
1368 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1370 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1372 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1374 2000-10-10 Allan Rae <rae@lyx.org>
1377 * src/lyxfunc.C (Dispatch):
1379 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1382 * src/lyxrc.C (output): Only write the differences between system lyxrc
1383 and the users settings.
1386 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1388 I'll rewrite this later, after 1.1.6 probably, to keep a single
1389 LyXRC but two instances of a LyXRCStruct.
1391 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1393 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1395 * src/tabular.h: add a few std:: qualifiers.
1397 * src/encoding.C: add using directive.
1398 * src/language.C: ditto.
1400 * src/insets/insetquotes.C (Validate): use languages->lang()
1401 instead of only language.
1403 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1405 * lib/languages: New file.
1407 * lib/encodings: New file.
1409 * src/language.C (Languages): New class.
1410 (read): New method. Reads the languages from the 'languages' file.
1412 * src/encoding.C (Encodings): New class.
1413 (read): New method. Reads the encodings from the 'encodings' file.
1415 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1418 * src/bufferparams.h and a lot of files: Deleted the member language,
1419 and renamed language_info to language
1421 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1422 * src/lyxfont.C (latexWriteStartChanges): ditto.
1423 * src/paragraph.C (validate,TeXOnePar): ditto.
1425 * src/lyxfont.C (update): Restored deleted code.
1427 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1429 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1431 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1433 * src/insets/figinset.[Ch]:
1434 * src/insets/insetinclude.[Ch]:
1435 * src/insets/insetinclude.[Ch]:
1436 * src/insets/insetparent.[Ch]:
1437 * src/insets/insetref.[Ch]:
1438 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1440 * src/insets/*.[Ch]:
1441 * src/mathed/formula.[Ch]:
1442 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1444 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1445 * src/lyx_cb.C (FigureApplyCB):
1446 * src/lyxfunc.C (getStatus, Dispatch):
1447 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1450 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1452 * src/converter.[Ch] (Formats::View):
1453 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1455 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1456 *current_view->buffer(). This will change later, but this patch is way
1459 2000-10-09 Juergen Vigna <jug@sad.it>
1461 * src/text.C (GetRow): small fix.
1463 * src/BufferView_pimpl.C (cursorPrevious):
1464 (cursorNext): added LyXText parameter to function.
1466 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1467 keypress depending on cursor position.
1469 2000-10-06 Juergen Vigna <jug@sad.it>
1471 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1472 (copySelection): redone this function and also copy ascii representa-
1475 * src/tabular.C (Ascii):
1479 (print_n_chars): new functions to realize the ascii export of tabulars.
1481 2000-10-05 Juergen Vigna <jug@sad.it>
1483 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1484 if we don't have a buffer.
1486 2000-10-10 Allan Rae <rae@lyx.org>
1488 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1489 with closing dialog. It seems that nested tabfolders require hiding
1490 of inner tabfolders before hiding the dialog itself. Actually all I
1491 did was hide the active outer folder.
1493 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1494 unless there really is a buffer. hideBufferDependent is called
1497 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1498 POTFILES.in stays in $(srcdir).
1500 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1502 * lib/lyxrc.example: Few changes.
1504 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1506 * src/BufferView_pimpl.C (buffer): only need one the
1507 updateBufferDependent signal to be emitted once! Moved to the end of
1508 the method to allow bv_->text to be updated first.
1510 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1511 and hSignal_ with Dialogs * and BufferDependency variables.
1512 New Buffer * parent_, initialised when the dialog is launched. Used to
1513 check whether to update() or hide() dialog in the new, private
1514 updateOrHide() method that is connected to the updateBufferDependent
1515 signal. Daughter classes dictate what to do using the
1516 ChangedBufferAction enum, passed to the c-tor.
1518 * src/frontends/xforms/FormCitation.C:
1519 * src/frontends/xforms/FormCommand.C:
1520 * src/frontends/xforms/FormCopyright.C:
1521 * src/frontends/xforms/FormDocument.C:
1522 * src/frontends/xforms/FormError.C:
1523 * src/frontends/xforms/FormIndex.C:
1524 * src/frontends/xforms/FormPreferences.C:
1525 * src/frontends/xforms/FormPrint.C:
1526 * src/frontends/xforms/FormRef.C:
1527 * src/frontends/xforms/FormToc.C:
1528 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1531 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1532 ChangedBufferAction enum.
1534 * src/frontends/xforms/FormParagraph.[Ch]
1535 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1538 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1540 * lib/bind/cua.bind: fix a bit.
1541 * lib/bind/emacs.bind: ditto.
1543 * lib/bind/menus.bind: remove real menu entries from there.
1545 * src/spellchecker.C: make sure we only include strings.h when
1548 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1550 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1551 function. It enlarges the maximum number of pup when needed.
1552 (add_toc2): Open a new menu if maximum number of items per menu has
1555 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1557 * src/frontends/kde/FormPrint.C: fix error reporting
1559 * src/frontends/xforms/FormDocument.C: fix compiler
1562 * lib/.cvsignore: add Literate.nw
1564 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1567 * bufferview_funcs.[Ch]
1570 * text2.C: Add support for numbers in RTL text.
1572 2000-10-06 Allan Rae <rae@lyx.org>
1574 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1575 to be gettext.m4 friendly again. ext_l10n.h is now
1576 generated into $top_srcdir instead of $top_builddir
1577 so that lyx.pot will be built correctly -- without
1578 duplicate parsing of ext_l10n.h.
1580 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1582 * src/frontends/kde/FormCitation.C: make the dialog
1583 behave more sensibly
1585 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1587 * config/kde.m4: fix consecutive ./configure runs,
1588 look for qtarch, fix library order
1590 * src/frontends/kde/Makefile.am: tidy up,
1591 add Print dialog, add .dlg dependencies
1593 * src/frontends/kde/FormPrint.C:
1594 * src/frontends/kde/FormPrint.h:
1595 * src/frontends/kde/formprintdialog.C:
1596 * src/frontends/kde/formprintdialog.h:
1597 * src/frontends/kde/formprintdialogdata.C:
1598 * src/frontends/kde/formprintdialogdata.h:
1599 * src/frontends/kde/dlg/formprintdialog.dlg: add
1602 * src/frontends/kde/dlg/README: Added explanatory readme
1604 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1605 script to double-check qtarch's output
1607 * src/frontends/kde/formindexdialog.C:
1608 * src/frontends/kde/formindexdialogdata.C:
1609 * src/frontends/kde/formindexdialogdata.h:
1610 * src/frontends/kde/dlg/formindexdialog.dlg: update
1611 for qtarch, minor fixes
1613 2000-10-05 Allan Rae <rae@lyx.org>
1615 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1616 dialogs when switching buffers update them instead. It's up to each
1617 dialog to decide if it should still be visible or not.
1618 update() should return a bool to control visiblity within show().
1619 Or perhaps better to set a member variable and use that to control
1622 * lib/build-listerrors: create an empty "listerrors" file just to stop
1623 make trying to regenerate it all the time if you don't have noweb
1626 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1628 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1629 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1630 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1631 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1632 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1634 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1636 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1638 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1639 deleting buffer. Closes all buffer-dependent dialogs.
1641 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1643 * src/frontends/xforms/FormCitation.[Ch]:
1644 * src/frontends/xforms/FormPreferences.[Ch]:
1645 * src/frontends/xforms/FormPrint.[Ch]:
1646 * src/frontends/xforms/FormRef.[Ch]:
1647 * src/frontends/xforms/FormUrl.[Ch]: ditto
1649 * src/frontends/xforms/FormDocument.[Ch]:
1650 * src/frontends/xforms/forms/form_document.C.patch:
1651 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1652 pass through a single input() function.
1654 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1656 * lib/build-listerrors: return status as OK
1658 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1660 * lib/lyxrc.example: Updated to new export code
1662 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1664 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1667 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1670 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1671 LyX-Code is defined.
1672 * lib/layouts/amsbook.layout: ditto.
1674 * boost/Makefile.am: fix typo.
1676 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1678 (add_lastfiles): removed.
1679 (add_documents): removed.
1680 (add_formats): removed.
1682 * src/frontends/Menubar.C: remove useless "using" directive.
1684 * src/MenuBackend.h: add a new MenuItem constructor.
1686 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1689 2000-10-04 Allan Rae <rae@lyx.org>
1691 * lib/Makefile.am (listerrors):
1692 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1693 I haven't got notangle installed so Kayvan please test. The output
1694 should end up in $builddir. This also allows people who don't have
1695 noweb installed to complete the make process without error.
1697 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1698 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1699 by JMarc's picky compiler.
1701 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1704 * src/insets/insettabular.C (setPos): change for loop to not use
1705 sequencing operator. Please check this Jürgen.
1707 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1709 * src/insets/insetcite.C (getScreenLabel): ditto
1710 * src/support/filetools.C (QuoteName): ditto
1711 (ChangeExtension): ditto
1713 * src/BufferView_pimpl.C (scrollCB): make heigt int
1715 * src/BufferView2.C (insertInset): comment out unused arg
1717 * boost/Makefile.am (EXTRADIST): new variable
1719 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1721 * src/exporter.C (IsExportable): Fixed
1723 * lib/configure.m4: Small fix
1725 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1727 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1728 * src/insets/insetbib.C (bibitemWidest): ditto.
1729 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1731 2000-10-03 Juergen Vigna <jug@sad.it>
1733 * src/BufferView2.C (theLockingInset): removed const because of
1734 Agnus's compile problems.
1736 * src/insets/insettext.C (LocalDispatch): set the language of the
1737 surronding paragraph on inserting the first character.
1739 * various files: changed use of BufferView::the_locking_inset.
1741 * src/BufferView2.C (theLockingInset):
1742 (theLockingInset): new functions.
1744 * src/BufferView.h: removed the_locking_inset.
1746 * src/lyxtext.h: added the_locking_inset
1748 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1750 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1752 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1754 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1755 * src/mathed/math_cursor.C (IsAlpha): ditto.
1756 * src/mathed/math_inset.C (strnew): ditto.
1757 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1758 (IMetrics): cxp set but never used; removed.
1759 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1760 that the variable in question has been removed also!
1763 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1764 using the Buffer * passed to Latex(), using the BufferView * passed to
1765 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1767 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1768 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1770 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1771 * src/buffer.C (readInset): used new InsetBibtex c-tor
1772 * (getBibkeyList): used new InsetBibtex::getKeys
1774 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1777 * lib/build-listerrors
1779 * src/exporter.C: Add literate programming support to the export code
1782 * src/lyx_cb.C: Remove old literate code.
1784 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1787 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1788 * src/converter.C (View, Convert): Use QuoteName.
1790 * src/insets/figinset.C (Preview): Use Formats::View.
1792 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1794 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1796 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1797 the top of the function, because compaq cxx complains that the
1798 "goto exit_with_message" when the function is disabled bypasses
1800 (MenuNew): try a better fix for the generation of new file names.
1801 This time, I used AddName() instead of AddPath(), hoping Juergen
1804 2000-10-03 Allan Rae <rae@lyx.org>
1806 * src/frontends/xforms/forms/form_preferences.fd:
1807 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1808 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1809 "Look and Feel"->"General" but will need to be split up further into
1810 general output and general input tabs. Current plan is for four outer
1811 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1812 stuff; "Inputs" for input and import configuration; "Outputs" for
1813 output and export configuration; and one more whatever is left over
1814 called "General". The leftovers at present look like being which
1815 viewers to use, spellchecker, language support and might be better
1816 named "Support". I've put "Paths" in "Inputs" for the moment as this
1817 seems reasonable for now at least.
1818 One problem remains: X error kills LyX when you close Preferences.
1820 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1822 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1823 qualifier from form()
1824 * src/frontends/xforms/FormCitation.[Ch]:
1825 * src/frontends/xforms/FormCopyright.[Ch]:
1826 * src/frontends/xforms/FormDocument.[Ch]:
1827 * src/frontends/xforms/FormError.[Ch]:
1828 * src/frontends/xforms/FormIndex.[Ch]:
1829 * src/frontends/xforms/FormPreferences.[Ch]:
1830 * src/frontends/xforms/FormPrint.[Ch]:
1831 * src/frontends/xforms/FormRef.[Ch]:
1832 * src/frontends/xforms/FormToc.[Ch]:
1833 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1835 * src/frontends/xforms/FormCitation.[Ch]:
1836 * src/frontends/xforms/FormIndex.[Ch]:
1837 * src/frontends/xforms/FormRef.[Ch]:
1838 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1839 with Allan's naming policy
1841 * src/frontends/xforms/FormCitation.C: some static casts to remove
1844 2000-10-02 Juergen Vigna <jug@sad.it>
1846 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1847 now you can type or do stuff inside the table-cell also when in dummy
1848 position, fixed visible cursor.
1850 * src/insets/insettext.C (Edit): fixing cursor-view position.
1852 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1853 be used for equal functions in lyxfunc and insettext.
1855 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1857 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1859 * src/frontends/gnome/FormCitation.h:
1860 * src/frontends/gnome/FormCopyright.h:
1861 * src/frontends/gnome/FormIndex.h:
1862 * src/frontends/gnome/FormPrint.h:
1863 * src/frontends/gnome/FormToc.h:
1864 * src/frontends/gnome/FormUrl.h:
1865 * src/frontends/kde/FormCitation.h:
1866 * src/frontends/kde/FormCopyright.h:
1867 * src/frontends/kde/FormIndex.h:
1868 * src/frontends/kde/FormRef.h:
1869 * src/frontends/kde/FormToc.h:
1870 * src/frontends/kde/FormUrl.h: fix remaining users of
1873 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1875 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1876 from depth argument.
1877 (DocBookHandleCaption): ditto.
1878 (DocBookHandleFootnote): ditto.
1879 (SimpleDocBookOnePar): ditto.
1881 * src/frontends/xforms/FormDocument.h (form): remove extra
1882 FormDocument:: qualifier.
1884 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1886 * sigc++/handle.h: ditto.
1888 * src/lyx_gui_misc.C: add "using" directive.
1890 * src/cheaders/cstddef: new file, needed by the boost library (for
1893 2000-10-02 Juergen Vigna <jug@sad.it>
1895 * src/insets/insettext.C (SetFont): better support.
1897 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1899 * src/screen.C (DrawOneRow): some uint refixes!
1901 2000-10-02 Allan Rae <rae@lyx.org>
1903 * boost/.cvsignore: ignore Makefile as well
1905 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1906 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1908 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1909 Left this one out by accident.
1911 * src/frontends/xforms/FormBase.h (restore): default to calling
1912 update() since that will restore the original/currently-applied values.
1913 Any input() triggered error messages will require the derived classes
1914 to redefine restore().
1916 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1917 avoid a segfault. combo_doc_class is the main concern.
1919 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1921 * Simplify build-listerrors in view of GUI-less export ability!
1923 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1925 * src/lyx_main.C (easyParse): Disable gui when exporting
1927 * src/insets/figinset.C:
1930 * src/lyx_gui_misc.C
1931 * src/tabular.C: Changes to allow no-gui.
1933 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1935 * src/support/utility.hpp: removed file
1936 * src/support/block.h: removed file
1938 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1941 * src/mathed/formula.C: add support/lyxlib.h
1942 * src/mathed/formulamacro.C: ditto
1944 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1945 * src/lyxparagraph.h: ditto
1947 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1948 * src/frontends/Makefile.am (INCLUDES): ditto
1949 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1950 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1951 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1952 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1953 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1954 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1956 * src/BufferView.h: use boost/utility.hpp
1957 * src/LColor.h: ditto
1958 * src/LaTeX.h: ditto
1959 * src/LyXAction.h: ditto
1960 * src/LyXView.h: ditto
1961 * src/bufferlist.h: ditto
1962 * src/lastfiles.h: ditto
1963 * src/layout.h: ditto
1964 * src/lyx_gui.h: ditto
1965 * src/lyx_main.h: ditto
1966 * src/lyxlex.h: ditto
1967 * src/lyxrc.h: ditto
1968 * src/frontends/ButtonPolicies.h: ditto
1969 * src/frontends/Dialogs.h: ditto
1970 * src/frontends/xforms/FormBase.h: ditto
1971 * src/frontends/xforms/FormGraphics.h: ditto
1972 * src/frontends/xforms/FormParagraph.h: ditto
1973 * src/frontends/xforms/FormTabular.h: ditto
1974 * src/graphics/GraphicsCache.h: ditto
1975 * src/graphics/Renderer.h: ditto
1976 * src/insets/ExternalTemplate.h: ditto
1977 * src/insets/insetcommand.h: ditto
1978 * src/support/path.h: ditto
1980 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1981 and introduce clause for 2.97.
1983 * boost/libs/README: new file
1985 * boost/boost/utility.hpp: new file
1987 * boost/boost/config.hpp: new file
1989 * boost/boost/array.hpp: new file
1991 * boost/Makefile.am: new file
1993 * boost/.cvsignore: new file
1995 * configure.in (AC_OUTPUT): add boost/Makefile
1997 * Makefile.am (SUBDIRS): add boost
1999 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2001 * src/support/lstrings.C (suffixIs): Fixed.
2003 2000-10-01 Allan Rae <rae@lyx.org>
2005 * src/PrinterParams.h: moved things around to avoid the "can't
2006 inline call" warning.
2008 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2009 into doc++ documentation.
2011 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2013 * src/frontends/xforms/FormRef.C: make use of button controller
2014 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2015 cleaned up button controller usage.
2016 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2017 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2018 use the button controller
2020 * src/frontends/xforms/forms/*.fd: and associated generated files
2021 updated to reflect changes to FormBase. Some other FormXxxx files
2022 also got minor updates to reflect changes to FormBase.
2024 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2025 (hide): made virtual.
2026 (input): return a bool. true == valid input
2027 (RestoreCB, restore): new
2028 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2029 Changes to allow derived dialogs to use a ButtonController and
2030 make sense when doing so: OK button calls ok() and so on.
2032 * src/frontends/xforms/ButtonController.h (class ButtonController):
2033 Switch from template implementation to taking Policy parameter.
2034 Allows FormBase to provide a ButtonController for any dialog.
2036 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2037 Probably should rename connect and disconnect.
2038 (apply): use the radio button groups
2039 (form): needed by FormBase
2040 (build): setup the radio button groups
2042 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2044 * several files: type changes to reduce the number of warnings and
2045 to unify type hangling a bit. Still much to do.
2047 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2049 * lib/images/*: rename a bunch of icons to match Dekel converter
2052 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2055 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2057 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2059 * sigc++/handle.h: ditto for class Handle.
2061 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2063 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2065 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2067 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2068 removal of the "default" language.
2070 * src/combox.h (getline): Check that sel > 0
2072 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2074 * lib/examples/docbook_example.lyx
2075 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2077 * lib/layouts/docbook-book.layout: new docbook book layout.
2079 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2081 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2083 * src/insets/figinset.C (DocBook):fixed small typo.
2085 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2087 * src/insets/insetinclude.h: string include_label doesn't need to be
2090 2000-09-29 Allan Rae <rae@lyx.org>
2092 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2093 Allow derived type to control connection and disconnection from signals
2094 of its choice if desired.
2096 2000-09-28 Juergen Vigna <jug@sad.it>
2098 * src/insets/insettabular.C (update): fixed cursor setting when
2099 the_locking_inset changed.
2100 (draw): made this a bit cleaner.
2101 (InsetButtonPress): fixed!
2103 * various files: added LyXText Parameter to fitCursor call.
2105 * src/BufferView.C (fitCursor): added LyXText parameter.
2107 * src/insets/insettabular.C (draw): small draw fix.
2109 * src/tabular.C: right setting of left/right celllines.
2111 * src/tabular.[Ch]: fixed various types in funcions and structures.
2112 * src/insets/insettabular.C: ditto
2113 * src/frontends/xforms/FormTabular.C: ditto
2115 2000-09-28 Allan Rae <rae@lyx.org>
2117 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2118 that the #ifdef's had been applied to part of what should have been
2119 a complete condition. It's possible there are other tests that
2120 were specific to tables that are also wrong now that InsetTabular is
2121 being used. Now we need to fix the output of '\n' after a table in a
2122 float for the same reason as the original condition:
2123 "don't insert this if we would be adding it before or after a table
2124 in a float. This little trick is needed in order to allow use of
2125 tables in \subfigures or \subtables."
2126 Juergen can you check this?
2128 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2130 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2131 output to the ostream.
2133 * several files: fixed types based on warnings from cxx
2135 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2137 * src/frontends/kde/Makefile.am: fix rule for
2138 formindexdialogdata_moc.C
2140 * src/.cvsignore: add ext_l10n.h to ignore
2142 * acconfig.h: stop messing with __STRICT_ANSI__
2143 * config/gnome.m4: remove option to set -ansi
2144 * config/kde.m4: remove option to set -ansi
2145 * config/lyxinclude.m4: don't set -ansi
2147 2000-09-27 Juergen Vigna <jug@sad.it>
2149 * various files: remove "default" language check.
2151 * src/insets/insetquotes.C: removed use of current_view.
2153 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2154 the one should have red ears by now!
2156 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2157 in more then one paragraph. Fixed cursor-movement/selection.
2159 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2160 paragraphs inside a text inset.
2162 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2163 text-inset if this owner is an inset.
2165 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2167 * src/Bullet.h: changed type of font, character and size to int
2169 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2171 * src/insets/inseturl.[Ch]:
2172 * src/insets/insetref.[Ch]:
2173 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2175 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2177 * src/buffer.C (readFile): block-if statement rearranged to minimise
2178 bloat. Patch does not reverse Jean-Marc's change ;-)
2180 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2181 Class rewritten to store pointers to hide/update signals directly,
2182 rather than Dialogs *. Also defined an enum to ease use. All xforms
2183 forms can now be derived from this class.
2185 * src/frontends/xforms/FormCommand.[Ch]
2186 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2188 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2191 * src/frontends/xforms/forms/form_citation.fd
2192 * src/frontends/xforms/forms/form_copyright.fd
2193 * src/frontends/xforms/forms/form_error.fd
2194 * src/frontends/xforms/forms/form_index.fd
2195 * src/frontends/xforms/forms/form_ref.fd
2196 * src/frontends/xforms/forms/form_toc.fd
2197 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2199 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2201 * src/insets/insetfoot.C: removed redundent using directive.
2203 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2205 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2206 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2208 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2209 created in the constructors in different groups. Then set() just
2210 have to show the groups as needed. This fixes the redraw problems
2211 (and is how the old menu code worked).
2213 * src/support/lyxlib.h: declare the methods as static when we do
2214 not have namespaces.
2216 2000-09-26 Juergen Vigna <jug@sad.it>
2218 * src/buffer.C (asciiParagraph): new function.
2219 (writeFileAscii): new function with parameter ostream.
2220 (writeFileAscii): use now asciiParagraph.
2222 * various inset files: added the linelen parameter to the Ascii-func.
2224 * src/tabular.C (Write): fixed error in writing file introduced by
2225 the last changes from Lars.
2227 * lib/bind/menus.bind: removed not supported functions.
2229 * src/insets/insettext.C (Ascii): implemented this function.
2231 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2233 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2234 (Write): use of the write_attribute functions.
2236 * src/bufferlist.C (close): fixed reasking question!
2238 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2240 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2241 new files use the everwhere possible.
2244 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2245 src/log_form.C src/lyx.C:
2248 * src/buffer.C (runLaTeX): remove func
2250 * src/PaperLayout.C: removed file
2251 * src/ParagraphExtra.C: likewise
2252 * src/bullet_forms.C: likewise
2253 * src/bullet_forms.h: likewise
2254 * src/bullet_forms_cb.C: likewise
2256 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2257 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2260 * several files: remove all traces of the old fd_form_paragraph,
2261 and functions belonging to that.
2263 * several files: remove all traces of the old fd_form_document,
2264 and functions belonging to that.
2266 * several files: constify local variables were possible.
2268 * several files: remove all code that was dead when NEW_EXPORT was
2271 * several files: removed string::c_str in as many places as
2274 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2275 (e): be a bit more outspoken when patching
2276 (updatesrc): only move files if changed.
2278 * forms/layout_forms.h.patch: regenerated
2280 * forms/layout_forms.fd: remove form_document and form_paragraph
2281 and form_quotes and form_paper and form_table_options and
2282 form_paragraph_extra
2284 * forms/form1.fd: remove form_table
2286 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2287 the fdui->... rewrite. Update some comments to xforms 0.88
2289 * forms/bullet_forms.C.patch: removed file
2290 * forms/bullet_forms.fd: likewise
2291 * forms/bullet_forms.h.patch: likewise
2293 * development/Code_rules/Rules: added a section on switch
2294 statements. Updated some comment to xforms 0.88.
2296 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2298 * src/buffer.C (readFile): make sure that the whole version number
2299 is read after \lyxformat (even when it contains a comma)
2301 * lib/ui/default.ui: change shortcut of math menu to M-a.
2303 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2305 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2308 * src/LyXView.C (updateWindowTitle): show the full files name in
2309 window title, limited to 30 characters.
2311 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2312 When a number of characters has been given, we should not assume
2313 that the string is 0-terminated.
2315 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2316 calls (fixes some memory leaks)
2318 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2319 trans member on exit.
2321 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2323 * src/converter.C (GetReachable): fix typo.
2325 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2326 understand ',' instead of '.'.
2327 (GetInteger): rewrite to use strToInt().
2329 2000-09-26 Juergen Vigna <jug@sad.it>
2331 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2332 better visibility and error-message on wrong VSpace input.
2334 * src/language.C (initL): added english again.
2336 2000-09-25 Juergen Vigna <jug@sad.it>
2338 * src/frontends/kde/Dialogs.C (Dialogs):
2339 * src/frontends/gnome/Dialogs.C (Dialogs):
2340 * src/frontends/kde/Makefile.am:
2341 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2343 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2345 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2347 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2349 * src/frontends/xforms/FormParagraph.C:
2350 * src/frontends/xforms/FormParagraph.h:
2351 * src/frontends/xforms/form_paragraph.C:
2352 * src/frontends/xforms/form_paragraph.h:
2353 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2356 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2358 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2359 Paragraph-Data after use.
2361 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2362 non breakable paragraphs.
2364 2000-09-25 Garst R. Reese <reese@isn.net>
2366 * src/language.C (initL): added missing language_country codes.
2368 2000-09-25 Juergen Vigna <jug@sad.it>
2370 * src/insets/insettext.C (InsetText):
2371 (deleteLyXText): remove the not released LyXText structure!
2373 2000-09-24 Marko Vendelin <markov@ioc.ee>
2375 * src/frontends/gnome/mainapp.C
2376 * src/frontends/gnome/mainapp.h: added support for keyboard
2379 * src/frontends/gnome/FormCitation.C
2380 * src/frontends/gnome/FormCitation.h
2381 * src/frontends/gnome/Makefile.am
2382 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2383 FormCitation to use "action area" in mainapp window
2385 * src/frontends/gnome/Menubar_pimpl.C
2386 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2389 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2391 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2392 width/descent/ascent values if name is empty.
2393 (mathed_string_height): Use std::max.
2395 2000-09-25 Allan Rae <rae@lyx.org>
2397 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2398 segfault. This will be completely redesigned soon.
2400 * sigc++: updated libsigc++. Fixes struct timespec bug.
2402 * development/tools/makeLyXsigc.sh: .cvsignore addition
2404 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2406 * several files: removed almost all traces of the old table
2409 * src/TableLayout.C: removed file
2411 2000-09-22 Juergen Vigna <jug@sad.it>
2413 * src/frontends/kde/Dialogs.C: added credits forms.
2415 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2417 * src/frontends/gnome/Dialogs.C: added some forms.
2419 * src/spellchecker.C (init_spell_checker): set language in pspell code
2420 (RunSpellChecker): some modifications for setting language string.
2422 * src/language.[Ch]: added language_country code.
2424 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2426 * src/frontends/Dialogs.h: added new signal showError.
2427 Rearranged existing signals in some sort of alphabetical order.
2429 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2430 FormError.[Ch], form_error.[Ch]
2431 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2432 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2434 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2435 dialogs. I think that this can be used as the base to all these
2438 * src/frontends/xforms/FormError.[Ch]
2439 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2440 implementation of InsetError dialog.
2442 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2444 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2445 * src/frontends/kde/Makefile.am: ditto
2447 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2449 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2450 macrobf. This fixes a bug of invisible text.
2452 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2454 * lib/doc/LaTeXConfig.lyx.in: updated.
2456 * src/language.C (initL): remove language "francais" and change a
2457 bit the names of the two other french variations.
2459 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2460 string that may not be 0-terminated.
2462 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2464 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2466 2000-09-20 Marko Vendelin <markov@ioc.ee>
2468 * src/frontends/gnome/FormCitation.C
2469 * src/frontends/gnome/FormIndex.C
2470 * src/frontends/gnome/FormToc.C
2471 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2472 the variable initialization to shut up the warnings
2474 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2476 * src/table.[Ch]: deleted files
2478 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2481 2000-09-18 Juergen Vigna <jug@sad.it>
2483 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2484 problems with selection. Inserted new LFUN_PASTESELECTION.
2485 (InsetButtonPress): inserted handling of middle mouse-button paste.
2487 * src/spellchecker.C: changed word to word.c_str().
2489 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2491 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2492 included in the ``make dist'' tarball.
2494 2000-09-15 Juergen Vigna <jug@sad.it>
2496 * src/CutAndPaste.C (cutSelection): small fix return the right
2497 end position after cut inside one paragraph only.
2499 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2500 we are locked as otherwise we don't have a valid cursor position!
2502 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2504 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2506 * src/frontends/kde/FormRef.C: added using directive.
2507 * src/frontends/kde/FormToc.C: ditto
2509 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2511 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2513 2000-09-19 Marko Vendelin <markov@ioc.ee>
2515 * src/frontends/gnome/Menubar_pimpl.C
2516 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2517 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2519 * src/frontends/gnome/mainapp.C
2520 * src/frontends/gnome/mainapp.h: support for menu update used
2523 * src/frontends/gnome/mainapp.C
2524 * src/frontends/gnome/mainapp.h: support for "action" area in the
2525 main window. This area is used by small simple dialogs, such as
2528 * src/frontends/gnome/FormIndex.C
2529 * src/frontends/gnome/FormIndex.h
2530 * src/frontends/gnome/FormUrl.C
2531 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2534 * src/frontends/gnome/FormCitation.C
2535 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2536 action area. Only "Insert new citation" is implemented.
2538 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2540 * src/buffer.C (Dispatch): fix call to Dispatch
2541 * src/insets/insetref.C (Edit): likewise
2542 * src/insets/insetparent.C (Edit): likewise
2543 * src/insets/insetinclude.C (include_cb): likewise
2544 * src/frontends/xforms/FormUrl.C (apply): likewise
2545 * src/frontends/xforms/FormToc.C (apply): likewise
2546 * src/frontends/xforms/FormRef.C (apply): likewise
2547 * src/frontends/xforms/FormIndex.C (apply): likewise
2548 * src/frontends/xforms/FormCitation.C (apply): likewise
2549 * src/lyxserver.C (callback): likewise
2550 * src/lyxfunc.C (processKeySym): likewise
2551 (Dispatch): likewise
2552 (Dispatch): likewise
2553 * src/lyx_cb.C (LayoutsCB): likewise
2555 * Makefile.am (sourcedoc): small change
2557 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2559 * src/main.C (main): Don't make an empty GUIRunTime object. all
2560 methods are static. constify a bit remove unneded using + headers.
2562 * src/tabular.C: some more const to local vars move some loop vars
2564 * src/spellchecker.C: added some c_str after some word for pspell
2566 * src/frontends/GUIRunTime.h: add new static method setDefaults
2567 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2568 * src/frontends/kde/GUIRunTime.C (setDefaults):
2569 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2571 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2572 with strnew in arg, use correct emptystring when calling SetName.
2574 * several files: remove all commented code with relation to
2575 HAVE_SSTREAM beeing false. We now only support stringstream and
2578 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2580 * src/lyxfunc.C: construct correctly the automatic new file
2583 * src/text2.C (IsStringInText): change type of variable i to shut
2586 * src/support/sstream.h: do not use namespaces if the compiler
2587 does not support them.
2589 2000-09-15 Marko Vendelin <markov@ioc.ee>
2590 * src/frontends/gnome/FormCitation.C
2591 * src/frontends/gnome/FormCitation.h
2592 * src/frontends/gnome/diainsertcitation_interface.c
2593 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2594 regexp support to FormCitation [Gnome].
2596 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2599 * configure.in: remove unused KDE/GTKGUI define
2601 * src/frontends/kde/FormRef.C
2602 * src/frontends/kde/FormRef.h
2603 * src/frontends/kde/formrefdialog.C
2604 * src/frontends/kde/formrefdialog.h: double click will
2605 go to reference, now it is possible to change a cross-ref
2608 * src/frontends/kde/FormToc.C
2609 * src/frontends/kde/FormToc.h
2610 * src/frontends/kde/formtocdialog.C
2611 * src/frontends/kde/formtocdialog.h: add a depth
2614 * src/frontends/kde/Makefile.am: add QtLyXView.h
2617 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2619 * src/frontends/kde/FormCitation.h: added some using directives.
2621 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2623 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2626 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2629 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2631 * src/buffer.C (pop_tag): revert for the second time a change by
2632 Lars, who seems to really hate having non-local loop variables :)
2634 * src/Lsstream.h: add "using" statements.
2636 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2637 * src/buffer.C (writeFile): ditto
2639 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2641 * src/buffer.C (writeFile): try to fix the locale modified format
2642 number to always be as we want it.
2644 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2645 in XForms 0.89. C-space is now working again.
2647 * src/Lsstream.h src/support/sstream.h: new files.
2649 * also commented out all cases where strstream were used.
2651 * src/Bullet.h (c_str): remove method.
2653 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2655 * a lot of files: get rid of "char const *" and "char *" is as
2656 many places as possible. We only want to use them in interaction
2657 with system of other libraries, not inside lyx.
2659 * a lot of files: return const object is not of pod type. This
2660 helps ensure that temporary objects is not modified. And fits well
2661 with "programming by contract".
2663 * configure.in: check for the locale header too
2665 * Makefile.am (sourcedoc): new tag for generation of doc++
2668 2000-09-14 Juergen Vigna <jug@sad.it>
2670 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2671 callback to check which combo called it and do the right action.
2673 * src/combox.C (combo_cb): added combo * to the callbacks.
2674 (Hide): moved call of callback after Ungrab of the pointer.
2676 * src/intl.h: removed LCombo2 function.
2678 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2679 function as this can now be handled in one function.
2681 * src/combox.h: added Combox * to callback prototype.
2683 * src/frontends/xforms/Toolbar_pimpl.C:
2684 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2686 2000-09-14 Garst Reese <reese@isn.net>
2688 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2689 moved usepackage{xxx}'s to beginning of file. Changed left margin
2690 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2691 underlining from title. Thanks to John Culleton for useful suggestions.
2693 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2695 * src/lyxlex_pimpl.C (setFile): change error message to debug
2698 2000-09-13 Juergen Vigna <jug@sad.it>
2700 * src/frontends/xforms/FormDocument.C: implemented choice_class
2701 as combox and give callback to combo_language so OK/Apply is activated
2704 * src/bufferlist.C (newFile): small fix so already named files
2705 (via an open call) are not requested to be named again on the
2708 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2710 * src/frontends/kde/Makefile.am
2711 * src/frontends/kde/FormRef.C
2712 * src/frontends/kde/FormRef.h
2713 * src/frontends/kde/formrefdialog.C
2714 * src/frontends/kde/formrefdialog.h: implement
2717 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2719 * src/frontends/kde/formtocdialog.C
2720 * src/frontends/kde/formtocdialog.h
2721 * src/frontends/kde/FormToc.C
2722 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2724 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2726 * src/frontends/kde/FormCitation.C: fix thinko
2727 where we didn't always display the reference text
2730 * src/frontends/kde/formurldialog.C
2731 * src/frontends/kde/formurldialog.h
2732 * src/frontends/kde/FormUrl.C
2733 * src/frontends/kde/FormUrl.h: minor cleanups
2735 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2737 * src/frontends/kde/Makefile.am
2738 * src/frontends/kde/FormToc.C
2739 * src/frontends/kde/FormToc.h
2740 * src/frontends/kde/FormCitation.C
2741 * src/frontends/kde/FormCitation.h
2742 * src/frontends/kde/FormIndex.C
2743 * src/frontends/kde/FormIndex.h
2744 * src/frontends/kde/formtocdialog.C
2745 * src/frontends/kde/formtocdialog.h
2746 * src/frontends/kde/formcitationdialog.C
2747 * src/frontends/kde/formcitationdialog.h
2748 * src/frontends/kde/formindexdialog.C
2749 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2751 2000-09-12 Juergen Vigna <jug@sad.it>
2753 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2756 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2758 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2761 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2763 * src/converter.C (Add, Convert): Added support for converter flags:
2764 needaux, resultdir, resultfile.
2765 (Convert): Added new parameter view_file.
2766 (dvips_options): Fixed letter paper option.
2768 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2769 (Export, GetExportableFormats, GetViewableFormats): Added support
2772 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2774 (easyParse): Fixed to work with new export code.
2776 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2779 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2781 * lib/bind/*.bind: Replaced
2782 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2783 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2785 2000-09-11 Juergen Vigna <jug@sad.it>
2787 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2789 * src/main.C (main): now GUII defines global guiruntime!
2791 * src/frontends/gnome/GUIRunTime.C (initApplication):
2792 * src/frontends/kde/GUIRunTime.C (initApplication):
2793 * src/frontends/xforms/GUIRunTime.C (initApplication):
2794 * src/frontends/GUIRunTime.h: added new function initApplication.
2796 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2798 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2800 2000-09-08 Juergen Vigna <jug@sad.it>
2802 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2803 we have already "Reset".
2805 * src/language.C (initL): inserted "default" language and made this
2806 THE default language (and not american!)
2808 * src/paragraph.C: inserted handling of "default" language!
2810 * src/lyxfont.C: ditto
2814 * src/paragraph.C: output the \\par only if we have a following
2815 paragraph otherwise it's not needed.
2817 2000-09-05 Juergen Vigna <jug@sad.it>
2819 * config/pspell.m4: added entry to lyx-flags
2821 * src/spellchecker.C: modified version from Kevin for using pspell
2823 2000-09-01 Marko Vendelin <markov@ioc.ee>
2824 * src/frontends/gnome/Makefile.am
2825 * src/frontends/gnome/FormCitation.C
2826 * src/frontends/gnome/FormCitation.h
2827 * src/frontends/gnome/diainsertcitation_callbacks.c
2828 * src/frontends/gnome/diainsertcitation_callbacks.h
2829 * src/frontends/gnome/diainsertcitation_interface.c
2830 * src/frontends/gnome/diainsertcitation_interface.h
2831 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2832 dialog for Gnome frontend
2834 * src/main.C: Gnome libraries require keeping application name
2835 and its version as strings
2837 * src/frontends/gnome/mainapp.C: Change the name of the main window
2838 from GnomeLyX to PACKAGE
2840 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2842 * src/frontends/Liason.C: add "using: declaration.
2844 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2846 * src/mathed/math_macro.C (Metrics): Set the size of the template
2848 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2850 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2852 * src/converter.C (add_options): New function.
2853 (SetViewer): Change $$FName into '$$FName'.
2854 (View): Add options when running xdvi
2855 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2856 (Convert): The 3rd parameter is now the desired filename. Converts
2857 calls to lyx::rename if necessary.
2858 Add options when running dvips.
2859 (dvi_papersize,dvips_options): New methods.
2861 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2863 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2864 using a call to Converter::dvips_options.
2865 Fixed to work with nex export code.
2867 * src/support/copy.C
2868 * src/support/rename.C: New files
2870 * src/support/syscall.h
2871 * src/support/syscall.C: Added Starttype SystemDontWait.
2873 * lib/ui/default.ui: Changed to work with new export code
2875 * lib/configure.m4: Changed to work with new export code
2877 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2879 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2881 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2882 so that code compiles with DEC cxx.
2884 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2885 to work correctly! Also now supports the additional elements
2888 2000-09-01 Allan Rae <rae@lyx.org>
2890 * src/frontends/ButtonPolicies.C: renamed all the references to
2891 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2893 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2894 since it's a const not a type.
2896 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2898 2000-08-31 Juergen Vigna <jug@sad.it>
2900 * src/insets/figinset.C: Various changes to look if the filename has
2901 an extension and if not add it for inline previewing.
2903 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2905 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2906 make buttonStatus and isReadOnly be const methods. (also reflect
2907 this in derived classes.)
2909 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2910 (nextState): change to be static inline, pass the StateMachine as
2912 (PreferencesPolicy): remove casts
2913 (OkCancelPolicy): remvoe casts
2914 (OkCancelReadOnlyPolicy): remove casts
2915 (NoRepeatedApplyReadOnlyPolicy): remove casts
2916 (OkApplyCancelReadOnlyPolicy): remove casts
2917 (OkApplyCancelPolicy): remove casts
2918 (NoRepeatedApplyPolicy): remove casts
2920 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2922 * src/converter.C: added some using directives
2924 * src/frontends/ButtonPolicies.C: changes to overcome
2925 "need lvalue" error with DEC c++
2927 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2928 to WMHideCB for DEC c++
2930 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2932 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2933 to BulletBMTableCB for DEC c++
2935 2000-08-31 Allan Rae <rae@lyx.org>
2937 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2938 character dialog separately from old document dialogs combo_language.
2941 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2943 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2944 Removed LFUN_REF_CREATE.
2946 * src/MenuBackend.C: Added new tags: toc and references
2948 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2949 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2951 (add_toc, add_references): New methods.
2952 (create_submenu): Handle correctly the case when there is a
2953 seperator after optional menu items.
2955 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2956 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2957 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2959 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2961 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2963 * src/converter.[Ch]: New file for converting between different
2966 * src/export.[Ch]: New file for exporting a LyX file to different
2969 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2970 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2971 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2972 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2973 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2974 RunDocBook, MenuExport.
2976 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2977 Exporter::Preview methods if NEW_EXPORT is defined.
2979 * src/buffer.C (Dispatch): Use Exporter::Export.
2981 * src/lyxrc.C: Added new tags: \converter and \viewer.
2984 * src/LyXAction.C: Define new lyx-function: buffer-update.
2985 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2986 when NEW_EXPORT is defined.
2988 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2990 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2992 * lib/ui/default.ui: Added submenus "view" and "update" to the
2995 * src/filetools.C (GetExtension): New function.
2997 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2999 2000-08-29 Allan Rae <rae@lyx.org>
3001 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3003 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3004 (EnableDocumentLayout): removed
3005 (DisableDocumentLayout): removed
3006 (build): make use of ButtonController's read-only handling to
3007 de/activate various objects. Replaces both of the above functions.
3009 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3010 (readOnly): was read_only
3011 (refresh): fixed dumb mistakes with read_only_ handling
3013 * src/frontends/xforms/forms/form_document.fd:
3014 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3015 tabbed dialogs so the tabs look more like tabs and so its easier to
3016 work out which is the current tab.
3018 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3019 segfault with form_table
3021 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3023 2000-08-28 Juergen Vigna <jug@sad.it>
3025 * acconfig.h: added USE_PSPELL.
3027 * src/config.h.in: added USE_PSPELL.
3029 * autogen.sh: added pspell.m4
3031 * config/pspell.m4: new file.
3033 * src/spellchecker.C: implemented support for pspell libary.
3035 2000-08-25 Juergen Vigna <jug@sad.it>
3037 * src/LyXAction.C (init): renamed LFUN_TABLE to
3038 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3040 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3042 * src/lyxscreen.h: add force_clear variable and fuction to force
3043 a clear area when redrawing in LyXText.
3045 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3047 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3049 * some whitespace and comment changes.
3051 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3053 * src/buffer.C: up te LYX_FORMAT to 2.17
3055 2000-08-23 Juergen Vigna <jug@sad.it>
3057 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3060 * src/insets/insettabular.C (pasteSelection): delete the insets
3061 LyXText as it is not valid anymore.
3062 (copySelection): new function.
3063 (pasteSelection): new function.
3064 (cutSelection): new function.
3065 (LocalDispatch): implemented cut/copy/paste of cell selections.
3067 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3068 don't have a LyXText.
3070 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3072 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3075 2000-08-22 Juergen Vigna <jug@sad.it>
3077 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3078 ifdef form_table out if NEW_TABULAR.
3080 2000-08-21 Juergen Vigna <jug@sad.it>
3082 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3083 (draw): fixed draw position so that the cursor is positioned in the
3085 (InsetMotionNotify): hide/show cursor so the position is updated.
3086 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3087 using cellstart() function where it should be used.
3089 * src/insets/insettext.C (draw): ditto.
3091 * src/tabular.C: fixed initialization of some missing variables and
3092 made BoxType into an enum.
3094 2000-08-22 Marko Vendelin <markov@ioc.ee>
3095 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3096 stock menu item using action numerical value, not its string
3100 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3102 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3103 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3105 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3107 * src/frontends/xforms/GUIRunTime.C: new file
3109 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3110 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3112 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3114 * src/frontends/kde/GUIRunTime.C: new file
3116 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3117 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3119 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3121 * src/frontends/gnome/GUIRunTime.C: new file
3123 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3126 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3127 small change to documetentation.
3129 * src/frontends/GUIRunTime.C: removed file
3131 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3133 * src/lyxparagraph.h: enable NEW_TABULAR as default
3135 * src/lyxfunc.C (processKeySym): remove some commented code
3137 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3138 NEW_TABULAR around the fd_form_table_options.
3140 * src/lyx_gui.C (runTime): call the static member function as
3141 GUIRunTime::runTime().
3143 2000-08-21 Allan Rae <rae@lyx.org>
3145 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3148 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3150 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3152 2000-08-21 Allan Rae <rae@lyx.org>
3154 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3155 keep Garst happy ;-)
3156 * src/frontends/xforms/FormPreferences.C (build): use setOK
3157 * src/frontends/xforms/FormDocument.C (build): use setOK
3158 (FormDocument): use the appropriate policy.
3160 2000-08-21 Allan Rae <rae@lyx.org>
3162 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3163 automatic [de]activation of arbitrary objects when in a read-only state.
3165 * src/frontends/ButtonPolicies.h: More documentation
3166 (isReadOnly): added to support the above.
3168 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3170 2000-08-18 Juergen Vigna <jug@sad.it>
3172 * src/insets/insettabular.C (getStatus): changed to return func_status.
3174 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3175 display toggle menu entries if they are.
3177 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3178 new document layout now.
3180 * src/lyxfunc.C: ditto
3182 * src/lyx_gui_misc.C: ditto
3184 * src/lyx_gui.C: ditto
3186 * lib/ui/default.ui: removed paper and quotes layout as they are now
3187 all in the document layout tabbed folder.
3189 * src/frontends/xforms/forms/form_document.fd: added Restore
3190 button and callbacks for all inputs for Allan's ButtonPolicy.
3192 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3193 (CheckChoiceClass): added missing params setting on class change.
3194 (UpdateLayoutDocument): added for updating the layout on params.
3195 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3196 (FormDocument): Implemented Allan's ButtonPolicy with the
3199 2000-08-17 Allan Rae <rae@lyx.org>
3201 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3202 so we can at least see the credits again.
3204 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3205 controller calls for the appropriate callbacks. Note that since Ok
3206 calls apply followed by cancel, and apply isn't a valid input for the
3207 APPLIED state, the bc_ calls have to be made in the static callback not
3208 within each of the real callbacks.
3210 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3211 (setOk): renamed from setOkay()
3213 2000-08-17 Juergen Vigna <jug@sad.it>
3215 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3216 in the implementation part.
3217 (composeUIInfo): don't show optional menu-items.
3219 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3221 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3223 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3224 text-state when in a text-inset.
3226 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3228 2000-08-17 Marko Vendelin <markov@ioc.ee>
3229 * src/frontends/gnome/FormIndex.C
3230 * src/frontends/gnome/FormIndex.h
3231 * src/frontends/gnome/FormToc.C
3232 * src/frontends/gnome/FormToc.h
3233 * src/frontends/gnome/dialogs
3234 * src/frontends/gnome/diatoc_callbacks.c
3235 * src/frontends/gnome/diatoc_callbacks.h
3236 * src/frontends/gnome/diainsertindex_callbacks.h
3237 * src/frontends/gnome/diainsertindex_callbacks.c
3238 * src/frontends/gnome/diainsertindex_interface.c
3239 * src/frontends/gnome/diainsertindex_interface.h
3240 * src/frontends/gnome/diatoc_interface.h
3241 * src/frontends/gnome/diatoc_interface.c
3242 * src/frontends/gnome/Makefile.am: Table of Contents and
3243 Insert Index dialogs implementation for Gnome frontend
3245 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3247 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3249 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3252 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3254 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3255 destructor. Don't definde if you don't need it
3256 (processEvents): made static, non-blocking events processing for
3258 (runTime): static method. event loop for xforms
3259 * similar as above for kde and gnome.
3261 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3262 new Pimpl is correct
3263 (runTime): new method calss the real frontends runtime func.
3265 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3267 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3269 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3271 2000-08-16 Juergen Vigna <jug@sad.it>
3273 * src/lyx_gui.C (runTime): added GUII RunTime support.
3275 * src/frontends/Makefile.am:
3276 * src/frontends/GUIRunTime.[Ch]:
3277 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3278 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3279 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3281 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3283 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3284 as this is already set in ${FRONTEND_INCLUDE} if needed.
3286 * configure.in (CPPFLAGS): setting the include dir for the frontend
3287 directory and don't set FRONTEND=xforms for now as this is executed
3290 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3292 * src/frontends/kde/Makefile.am:
3293 * src/frontends/kde/FormUrl.C:
3294 * src/frontends/kde/FormUrl.h:
3295 * src/frontends/kde/formurldialog.h:
3296 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3298 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3300 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3302 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3304 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3307 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3309 * src/WorkArea.C (work_area_handler): more work to get te
3310 FL_KEYBOARD to work with xforms 0.88 too, please test.
3312 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3314 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3316 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3319 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3321 * src/Timeout.h: remove Qt::emit hack.
3323 * several files: changes to allo doc++ compilation
3325 * src/lyxfunc.C (processKeySym): new method
3326 (processKeyEvent): comment out if FL_REVISION < 89
3328 * src/WorkArea.C: change some debugging levels.
3329 (WorkArea): set wantkey to FL_KEY_ALL
3330 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3331 clearer code and the use of compose with XForms 0.89. Change to
3332 use signals instead of calling methods in bufferview directly.
3334 * src/Painter.C: change some debugging levels.
3336 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3339 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3340 (workAreaKeyPress): new method
3342 2000-08-14 Juergen Vigna <jug@sad.it>
3344 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3346 * config/kde.m4: addes some features
3348 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3349 include missing xforms dialogs.
3351 * src/Timeout.h: a hack to be able to compile with qt/kde.
3353 * sigc++/.cvsignore: added acinclude.m4
3355 * lib/.cvsignore: added listerros
3357 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3358 xforms tree as objects are needed for other frontends.
3360 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3361 linking with not yet implemented xforms objects.
3363 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3365 2000-08-14 Baruch Even <baruch.even@writeme.com>
3367 * src/frontends/xforms/FormGraphics.h:
3368 * src/frontends/xforms/FormGraphics.C:
3369 * src/frontends/xforms/RadioButtonGroup.h:
3370 * src/frontends/xforms/RadioButtonGroup.C:
3371 * src/insets/insetgraphics.h:
3372 * src/insets/insetgraphics.C:
3373 * src/insets/insetgraphicsParams.h:
3374 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3375 instead of spaces, and various other indentation issues to make the
3376 sources more consistent.
3378 2000-08-14 Marko Vendelin <markov@ioc.ee>
3380 * src/frontends/gnome/dialogs/diaprint.glade
3381 * src/frontends/gnome/FormPrint.C
3382 * src/frontends/gnome/FormPrint.h
3383 * src/frontends/gnome/diaprint_callbacks.c
3384 * src/frontends/gnome/diaprint_callbacks.h
3385 * src/frontends/gnome/diaprint_interface.c
3386 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3389 * src/frontends/gnome/dialogs/diainserturl.glade
3390 * src/frontends/gnome/FormUrl.C
3391 * src/frontends/gnome/FormUrl.h
3392 * src/frontends/gnome/diainserturl_callbacks.c
3393 * src/frontends/gnome/diainserturl_callbacks.h
3394 * src/frontends/gnome/diainserturl_interface.c
3395 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3396 Gnome implementation
3398 * src/frontends/gnome/Dialogs.C
3399 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3400 all other dialogs. Copy all unimplemented dialogs from Xforms
3403 * src/frontends/gnome/support.c
3404 * src/frontends/gnome/support.h: support files generated by Glade
3408 * config/gnome.m4: Gnome configuration scripts
3410 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3411 configure --help message
3413 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3414 only if there are no events pendling in Gnome/Gtk. This enhances
3415 the performance of menus.
3418 2000-08-14 Allan Rae <rae@lyx.org>
3420 * lib/Makefile.am: listerrors cleaning
3422 * lib/listerrors: removed -- generated file
3423 * acinclude.m4: ditto
3424 * sigc++/acinclude.m4: ditto
3426 * src/frontends/xforms/forms/form_citation.fd:
3427 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3430 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3431 `updatesrc` and now we have a `test` target that does what `updatesrc`
3432 used to do. I didn't like having an install target that wasn't related
3435 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3436 on all except FormGraphics. This may yet happen. Followed by a major
3437 cleanup including using FL_TRANSIENT for most of the dialogs. More
3438 changes to come when the ButtonController below is introduced.
3440 * src/frontends/xforms/ButtonController.h: New file for managing up to
3441 four buttons on a dialog according to an externally defined policy.
3442 * src/frontends/xforms/Makefile.am: added above
3444 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3445 Apply and Cancel/Close buttons and everything in between and beyond.
3446 * src/frontends/Makefile.am: added above.
3448 * src/frontends/xforms/forms/form_preferences.fd:
3449 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3450 and removed variable 'status' as a result. Fixed the set_minsize thing.
3451 Use the new screen-font-update after checking screen fonts were changed
3452 Added a "Restore" button to restore the original lyxrc values while
3453 editing. This restores everything not just the last input changed.
3454 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3456 * src/LyXAction.C: screen-font-update added for updating buffers after
3457 screen font settings have been changed.
3458 * src/commandtags.h: ditto
3459 * src/lyxfunc.C: ditto
3461 * forms/lyx.fd: removed screen fonts dialog.
3462 * src/lyx_gui.C: ditto
3463 * src/menus.[Ch]: ditto
3464 * src/lyx.[Ch]: ditto
3465 * src/lyx_cb.C: ditto + code from here moved to make
3466 screen-font-update. And people wonder why progress on GUII is
3467 slow. Look at how scattered this stuff was! It takes forever
3470 * forms/fdfix.sh: Fixup the spacing after commas.
3471 * forms/makefile: Remove date from generated files. Fewer clashes now.
3472 * forms/bullet_forms.C.patch: included someones handwritten changes
3474 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3475 once I've discovered why LyXRC was made noncopyable.
3476 * src/lyx_main.C: ditto
3478 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3480 * src/frontends/xforms/forms/fdfix.sh:
3481 * src/frontends/xforms/forms/fdfixh.sed:
3482 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3483 * src/frontends/xforms/Form*.[hC]:
3484 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3485 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3486 provide a destructor for the struct FD_form_xxxx. Another version of
3487 the set_[max|min]size workaround and a few other cleanups. Actually,
3488 Angus' patch from 20000809.
3490 2000-08-13 Baruch Even <baruch.even@writeme.com>
3492 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3495 2000-08-11 Juergen Vigna <jug@sad.it>
3497 * src/insets/insetgraphics.C (InsetGraphics): changing init
3498 order because of warnings.
3500 * src/frontends/xforms/forms/makefile: adding patching .C with
3503 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3504 from .C.patch to .c.patch
3506 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3507 order because of warning.
3509 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3511 * src/frontends/Liason.C (setMinibuffer): new helper function
3513 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3515 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3517 * lib/ui/default.ui: commented out PaperLayout entry
3519 * src/frontends/xforms/form_document.[Ch]: new added files
3521 * src/frontends/xforms/FormDocument.[Ch]: ditto
3523 * src/frontends/xforms/forms/form_document.fd: ditto
3525 * src/frontends/xforms/forms/form_document.C.patch: ditto
3527 2000-08-10 Juergen Vigna <jug@sad.it>
3529 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3530 (InsetGraphics): initialized cacheHandle to 0.
3531 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3533 2000-08-10 Baruch Even <baruch.even@writeme.com>
3535 * src/graphics/GraphicsCache.h:
3536 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3537 correctly as a cache.
3539 * src/graphics/GraphicsCacheItem.h:
3540 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3543 * src/graphics/GraphicsCacheItem_pimpl.h:
3544 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3547 * src/insets/insetgraphics.h:
3548 * src/insets/insetgraphics.C: Changed from using a signal notification
3549 to polling when image is not loaded.
3551 2000-08-10 Allan Rae <rae@lyx.org>
3553 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3554 that there are two functions that have to been taken out of line by
3555 hand and aren't taken care of in the script. (Just a reminder note)
3557 * sigc++/macros/*.h.m4: Updated as above.
3559 2000-08-09 Juergen Vigna <jug@sad.it>
3561 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3563 * src/insets/insettabular.C: make drawing of single cell smarter.
3565 2000-08-09 Marko Vendelin <markov@ioc.ee>
3566 * src/frontends/gnome/Menubar_pimpl.C
3567 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3568 implementation: new files
3570 * src/frontends/gnome/mainapp.C
3571 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3574 * src/main.C: create Gnome main window
3576 * src/frontends/xforms/Menubar_pimpl.h
3577 * src/frontends/Menubar.C
3578 * src/frontends/Menubar.h: added method Menubar::update that calls
3579 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3581 * src/LyXView.C: calls Menubar::update to update the state
3584 * src/frontends/gnome/Makefile.am: added new files
3586 * src/frontends/Makefile.am: added frontend compiler options
3588 2000-08-08 Juergen Vigna <jug@sad.it>
3590 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3592 * src/bufferlist.C (close):
3593 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3594 documents if exiting without saving.
3596 * src/buffer.C (save): use removeAutosaveFile()
3598 * src/support/filetools.C (removeAutosaveFile): new function.
3600 * src/lyx_cb.C (MenuWrite): returns a bool now.
3601 (MenuWriteAs): check if file could really be saved and revert to the
3603 (MenuWriteAs): removing old autosavefile if existant.
3605 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3606 before Goto toggle declaration, because of compiler warning.
3608 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3610 * src/lyxfunc.C (MenuNew): small fix.
3612 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3614 * src/bufferlist.C (newFile):
3615 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3617 * src/lyxrc.C: added new_ask_filename tag
3619 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3621 * src/lyx.fd: removed code pertaining to form_ref
3622 * src/lyx.[Ch]: ditto
3623 * src/lyx_cb.C: ditto
3624 * src/lyx_gui.C: ditto
3625 * src/lyx_gui_misc.C: ditto
3627 * src/BufferView_pimpl.C (restorePosition): update buffer only
3630 * src/commandtags.h (LFUN_REFTOGGLE): removed
3631 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3632 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3633 (LFUN_REFBACK): renamed LFUN_REF_BACK
3635 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3636 * src/menus.C: ditto
3637 * src/lyxfunc.C (Dispatch): ditto.
3638 InsertRef dialog is now GUI-independent.
3640 * src/texrow.C: added using std::endl;
3642 * src/insets/insetref.[Ch]: strip out large amounts of code.
3643 The inset is now a container and this functionality is now
3644 managed by a new FormRef dialog
3646 * src/frontends/Dialogs.h (showRef, createRef): new signals
3648 * src/frontends/xforms/FormIndex.[Ch],
3649 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3650 when setting dialog's min/max size
3651 * src/frontends/xforms/FormIndex.[Ch]: ditto
3653 * src/frontends/xforms/FormRef.[Ch],
3654 src/frontends/xforms/forms/form_ref.fd: new xforms
3655 implementation of an InsetRef dialog
3657 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3660 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3661 ios::nocreate is not part of the standard. Removed.
3663 2000-08-07 Baruch Even <baruch.even@writeme.com>
3665 * src/graphics/Renderer.h:
3666 * src/graphics/Renderer.C: Added base class for rendering of different
3667 image formats into Pixmaps.
3669 * src/graphics/XPM_Renderer.h:
3670 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3671 in a different class.
3673 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3674 easily add support for other formats.
3676 * src/insets/figinset.C: plugged a leak of an X resource.
3678 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3680 * src/CutAndPaste.[Ch]: make all metods static.
3682 * development/Code_rules/Rules: more work, added section on
3683 Exceptions, and a References section.
3685 * a lot of header files: work to make doc++ able to generate the
3686 source documentation, some workarounds of doc++ problems. Doc++ is
3687 now able to generate the documentation.
3689 2000-08-07 Juergen Vigna <jug@sad.it>
3691 * src/insets/insettabular.C (recomputeTextInsets): removed function
3693 * src/tabular.C (SetWidthOfMulticolCell):
3695 (calculate_width_of_column_NMC): fixed return value so that it really
3696 only returns true if the column-width has changed (there where
3697 problems with muliticolumn-cells in this column).
3699 2000-08-04 Juergen Vigna <jug@sad.it>
3701 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3702 also on the scrollstatus of the inset.
3703 (workAreaMotionNotify): ditto.
3705 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3707 2000-08-01 Juergen Vigna <jug@sad.it>
3709 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3711 * src/commandtags.h:
3712 * src/LyXAction.C (init):
3713 * src/insets/inset.C (LocalDispatch): added support for
3716 * src/insets/inset.C (scroll): new functions.
3718 * src/insets/insettext.C (removeNewlines): new function.
3719 (SetAutoBreakRows): removes forced newlines in the text of the
3720 paragraph if autoBreakRows is set to false.
3722 * src/tabular.C (Latex): generates a parbox around the cell contents
3725 * src/frontends/xforms/FormTabular.C (local_update): removed
3726 the radio_useparbox button.
3728 * src/tabular.C (UseParbox): new function
3730 2000-08-06 Baruch Even <baruch.even@writeme.com>
3732 * src/graphics/GraphicsCache.h:
3733 * src/graphics/GraphicsCache.C:
3734 * src/graphics/GraphicsCacheItem.h:
3735 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3738 * src/insets/insetgraphics.h:
3739 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3740 and the drawing of the inline image.
3742 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3743 loaded into the wrong position.
3745 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3748 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/support/translator.h: move all typedefs to public section
3752 * src/support/filetools.C (MakeLatexName): return string const
3754 (TmpFileName): ditto
3755 (FileOpenSearch): ditto
3757 (LibFileSearch): ditto
3758 (i18nLibFileSearch): ditto
3761 (CreateTmpDir): ditto
3762 (CreateBufferTmpDir): ditto
3763 (CreateLyXTmpDir): ditto
3766 (MakeAbsPath): ditto
3768 (OnlyFilename): ditto
3770 (NormalizePath): ditto
3771 (CleanupPath): ditto
3772 (GetFileContents): ditto
3773 (ReplaceEnvironmentPath): ditto
3774 (MakeRelPath): ditto
3776 (ChangeExtension): ditto
3777 (MakeDisplayPath): ditto
3778 (do_popen): return cmdret const
3779 (findtexfile): return string const
3781 * src/support/DebugStream.h: add some /// to please doc++
3783 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3785 * src/texrow.C (same_rownumber): functor to use with find_if
3786 (getIdFromRow): rewritten to use find_if and to not update the
3787 positions. return true if row is found
3788 (increasePos): new method, use to update positions
3790 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3792 * src/lyxlex_pimpl.C (verifyTable): new method
3795 (GetString): return string const
3796 (pushTable): rewrite to use std::stack
3798 (setFile): better check
3801 * src/lyxlex.h: make LyXLex noncopyable
3803 * src/lyxlex.C (text): return char const * const
3804 (GetString): return string const
3805 (getLongString): return string const
3807 * src/lyx_gui_misc.C (askForText): return pair<...> const
3809 * src/lastfiles.[Ch] (operator): return string const
3811 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3812 istringstream not char const *.
3813 move token.end() out of loop.
3814 (readFile): move initializaton of token
3816 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3817 getIdFromRow is successful.
3819 * lib/bind/emacs.bind: don't include menus bind
3821 * development/Code_rules/Rules: the beginnings of making this
3822 better and covering more of the unwritten rules that we have.
3824 * development/Code_rules/Recommendations: a couple of wording
3827 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3829 * src/support/strerror.c: remove C++ comment.
3831 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3833 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3834 LFUN_INDEX_INSERT_LAST
3836 * src/texrow.C (getIdFromRow): changed from const_iterator to
3837 iterator, allowing code to compile with DEC cxx
3839 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3840 stores part of the class, as suggested by Allan. Will allow
3842 (apply): test to apply uses InsetCommandParams operator!=
3844 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3845 (apply): test to apply uses InsetCommandParams operator!=
3847 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3848 stores part of the class.
3849 (update): removed limits on min/max size.
3851 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3852 (apply): test to apply uses InsetCommandParams operator!=
3854 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3855 (Read, Write, scanCommand, getCommand): moved functionality
3856 into InsetCommandParams.
3858 (getScreenLabel): made pure virtual
3859 new InsetCommandParams operators== and !=
3861 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3862 c-tors based on InsetCommandParams. Removed others.
3863 * src/insets/insetinclude.[Ch]: ditto
3864 * src/insets/insetlabel.[Ch]: ditto
3865 * src/insets/insetparent.[Ch]: ditto
3866 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3868 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3869 insets derived from InsetCommand created using similar c-tors
3870 based on InsetCommandParams
3871 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3872 * src/menus.C (ShowRefsMenu): ditto
3873 * src/paragraph.C (Clone): ditto
3874 * src/text2.C (SetCounter): ditto
3875 * src/lyxfunc.C (Dispatch) ditto
3876 Also recreated old InsetIndex behaviour exactly. Can now
3877 index-insert at the start of a paragraph and index-insert-last
3878 without launching the pop-up.
3880 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3882 * lib/lyxrc.example: mark te pdf options as non functional.
3884 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3885 (isStrDbl): move tmpstr.end() out of loop.
3886 (strToDbl): move intialization of tmpstr
3887 (lowercase): return string const and move tmp.end() out of loop.
3888 (uppercase): return string const and move tmp.edn() out of loop.
3889 (prefixIs): add assertion
3894 (containsOnly): ditto
3895 (containsOnly): ditto
3896 (containsOnly): ditto
3897 (countChar): make last arg char not char const
3898 (token): return string const
3899 (subst): return string const, move tmp.end() out of loop.
3900 (subst): return string const, add assertion
3901 (strip): return string const
3902 (frontStrip): return string const, add assertion
3903 (frontStrip): return string const
3908 * src/support/lstrings.C: add inclde "LAssert.h"
3909 (isStrInt): move tmpstr.end() out of loop.
3911 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3912 toollist.end() out of loop.
3913 (deactivate): move toollist.end() out of loop.
3914 (update): move toollist.end() out of loop.
3915 (updateLayoutList): move tc.end() out of loop.
3916 (add): move toollist.end() out of loop.
3918 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3919 md.end() out of loop.
3921 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3923 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3926 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3927 (Erase): move insetlist.end() out of loop.
3929 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3930 ref to const string as first arg. Move initialization of some
3931 variables, whitespace changes.
3933 * src/kbmap.C (defkey): move table.end() out of loop.
3934 (kb_keymap): move table.end() out of loop.
3935 (findbinding): move table.end() out of loop.
3937 * src/MenuBackend.C (hasMenu): move end() out of loop.
3938 (getMenu): move end() out of loop.
3939 (getMenu): move menulist_.end() out of loop.
3941 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3943 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3946 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3947 (getFromLyXName): move infotab.end() out of loop.
3949 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3950 -fvtable-thunks -ffunction-sections -fdata-sections
3952 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3954 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3957 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3959 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3961 * src/frontends/xforms/FormCitation.[Ch],
3962 src/frontends/xforms/FormIndex.[Ch],
3963 src/frontends/xforms/FormToc.[Ch],
3964 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3966 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3968 * src/commandtags.h: renamed, created some flags for citation
3971 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3973 * src/lyxfunc.C (dispatch): use signals to insert index entry
3975 * src/frontends/Dialogs.h: new signal createIndex
3977 * src/frontends/xforms/FormCommand.[Ch],
3978 src/frontends/xforms/FormCitation.[Ch],
3979 src/frontends/xforms/FormToc.[Ch],
3980 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3982 * src/insets/insetindex.[Ch]: GUI-independent
3984 * src/frontends/xforms/FormIndex.[Ch],
3985 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3988 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3990 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3991 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3993 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3995 * src/insets/insetref.C (Latex): rewrite so that there is now
3996 question that a initialization is requested.
3998 * src/insets/insetcommand.h: reenable the hide signal
4000 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4002 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4003 fix handling of shortcuts (many bugs :)
4004 (add_lastfiles): ditto.
4006 * lib/ui/default.ui: fix a few shortcuts.
4008 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4010 * Makefile.am: Fix ``rpmdist'' target to return the exit
4011 status of the ``rpm'' command, instead of the last command in
4012 the chain (the ``rm lyx.xpm'' command, which always returns
4015 2000-08-02 Allan Rae <rae@lyx.org>
4017 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4018 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4019 * src/frontends/xforms/FormToc.C (FormToc): ditto
4021 * src/frontends/xforms/Makefile.am: A few forgotten files
4023 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4024 Signals-not-copyable-problem Lars' started commenting out.
4026 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4028 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4030 * src/insets/insetcommand.h: Signals is not copyable so anoter
4031 scheme for automatic hiding of forms must be used.
4033 * src/frontends/xforms/FormCitation.h: don't inerit from
4034 noncopyable, FormCommand already does that.
4035 * src/frontends/xforms/FormToc.h: ditto
4036 * src/frontends/xforms/FormUrl.h: ditto
4038 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4040 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4042 * src/insets/insetcommand.h (hide): new SigC::Signal0
4043 (d-tor) new virtual destructor emits hide signal
4045 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4046 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4048 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4049 LOF and LOT. Inset is now GUI-independent
4051 * src/insets/insetloa.[Ch]: redundant
4052 * src/insets/insetlof.[Ch]: ditto
4053 * src/insets/insetlot.[Ch]: ditto
4055 * src/frontends/xforms/forms/form_url.fd: tweaked!
4056 * src/frontends/xforms/forms/form_citation.fd: ditto
4058 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4059 dialogs dealing with InsetCommand insets
4061 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4062 FormCommand base class
4063 * src/frontends/xforms/FormUrl.[Ch]: ditto
4065 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4067 * src/frontends/xforms/FormToc.[Ch]: ditto
4069 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4070 passed a generic InsetCommand pointer
4071 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4073 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4074 and modified InsetTOC class
4075 * src/buffer.C: ditto
4077 * forms/lyx.fd: strip out old FD_form_toc code
4078 * src/lyx_gui_misc.C: ditto
4079 * src/lyx_gui.C: ditto
4080 * src/lyx_cb.C: ditto
4081 * src/lyx.[Ch]: ditto
4083 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4085 * src/support/utility.hpp: tr -d '\r'
4087 2000-08-01 Juergen Vigna <jug@sad.it>
4089 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4091 * src/commandtags.h:
4092 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4093 LFUN_TABULAR_FEATURES.
4095 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4096 LFUN_LAYOUT_TABULAR.
4098 * src/insets/insettabular.C (getStatus): implemented helper function.
4100 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4102 2000-07-31 Juergen Vigna <jug@sad.it>
4104 * src/text.C (draw): fixed screen update problem for text-insets.
4106 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4107 something changed probably this has to be added in various other
4110 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4112 2000-07-31 Baruch Even <baruch.even@writeme.com>
4114 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4115 templates to satisfy compaq cxx.
4118 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4120 * src/support/translator.h (equal_1st_in_pair::operator()): take
4121 const ref pair_type as arg.
4122 (equal_2nd_in_pair::operator()): ditto
4123 (Translator::~Translator): remove empty d-tor.
4125 * src/graphics/GraphicsCache.C: move include config.h to top, also
4126 put initialization of GraphicsCache::singleton here.
4127 (~GraphicsCache): move here
4128 (addFile): take const ref as arg
4131 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4133 * src/BufferView2.C (insertLyXFile): change te with/without header
4136 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4138 * src/frontends/xforms/FormGraphics.C (apply): add some
4139 static_cast. Not very nice, but required by compaq cxx.
4141 * src/frontends/xforms/RadioButtonGroup.h: include header
4142 <utility> instead of <pair.h>
4144 * src/insets/insetgraphicsParams.C: add using directive.
4145 (readResize): change return type to void.
4146 (readOrigin): ditto.
4148 * src/lyxfunc.C (getStatus): add missing break for build-program
4149 function; add test for Literate for export functions.
4151 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4152 entries in Options menu.
4154 2000-07-31 Baruch Even <baruch.even@writeme.com>
4156 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4157 protect against auto-allocation; release icon when needed.
4159 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4161 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4162 on usual typewriter.
4164 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4165 earlier czech.kmap), useful only for programming.
4167 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4169 * src/frontends/xforms/FormCitation.h: fix conditioning around
4172 2000-07-31 Juergen Vigna <jug@sad.it>
4174 * src/frontends/xforms/FormTabular.C (local_update): changed
4175 radio_linebreaks to radio_useparbox and added radio_useminipage.
4177 * src/tabular.C: made support for using minipages/parboxes.
4179 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4181 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4183 (descent): so the cursor is in the middle.
4184 (width): bit smaller box.
4186 * src/insets/insetgraphics.h: added display() function.
4188 2000-07-31 Baruch Even <baruch.even@writeme.com>
4190 * src/frontends/Dialogs.h: Added showGraphics signals.
4192 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4193 xforms form definition of the graphics dialog.
4195 * src/frontends/xforms/FormGraphics.h:
4196 * src/frontends/xforms/FormGraphics.C: Added files, the
4197 GUIndependent code of InsetGraphics
4199 * src/insets/insetgraphics.h:
4200 * src/insets/insetgraphics.C: Major writing to make it work.
4202 * src/insets/insetgraphicsParams.h:
4203 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4204 struct between InsetGraphics and GUI.
4206 * src/LaTeXFeatures.h:
4207 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4208 support for graphicx package.
4210 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4211 for the graphics inset.
4213 * src/support/translator.h: Added file, used in
4214 InsetGraphicsParams. this is a template to translate between two
4217 * src/frontends/xforms/RadioButtonGroup.h:
4218 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4219 way to easily control a radio button group.
4221 2000-07-28 Juergen Vigna <jug@sad.it>
4223 * src/insets/insettabular.C (LocalDispatch):
4224 (TabularFeatures): added support for lyx-functions of tabular features.
4225 (cellstart): refixed this function after someone wrongly changed it.
4227 * src/commandtags.h:
4228 * src/LyXAction.C (init): added support for tabular-features
4230 2000-07-28 Allan Rae <rae@lyx.org>
4232 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4233 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4234 triggers the callback for input checking. As a result we sometimes get
4235 "LyX: This shouldn't happen..." printed to cerr.
4236 (input): Started using status variable since I only free() on
4237 destruction. Some input checking for paths and font sizes.
4239 * src/frontends/xforms/FormPreferences.h: Use status to control
4240 activation of Ok and Apply
4242 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4243 callback. Also resized to stop segfaults with 0.88. The problem is
4244 that xforms-0.88 requires the folder to be wide enough to fit all the
4245 tabs. If it isn't it causes all sorts of problems.
4247 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4249 * src/frontends/xforms/forms/README: Reflect reality.
4251 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4252 * src/frontends/xforms/forms/makefile: ditto.
4254 * src/commandtags.h: Get access to new Preferences dialog
4255 * src/LyXAction.C: ditto
4256 * src/lyxfunc.C: ditto
4257 * lib/ui/default.ui: ditto
4259 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4261 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4263 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4266 * src/frontends/xforms/form_url.[Ch]: added.
4268 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4270 * src/insets/insetbib.h: fixed bug in previous commit
4272 * src/frontends/xforms/FormUrl.h: ditto
4274 * src/frontends/xforms/FormPrint.h: ditto
4276 * src/frontends/xforms/FormPreferences.h: ditto
4278 * src/frontends/xforms/FormCopyright.h: ditto
4280 * src/frontends/xforms/FormCitation.C: ditto
4282 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4283 private copyconstructor and private default contructor
4285 * src/support/Makefile.am: add utility.hpp
4287 * src/support/utility.hpp: new file from boost
4289 * src/insets/insetbib.h: set owner in clone
4291 * src/frontends/xforms/FormCitation.C: added missing include
4294 * src/insets/form_url.[Ch]: removed
4296 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4298 * development/lyx.spec.in
4299 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4300 file/directory re-organization.
4302 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4304 * src/insets/insetcommand.[Ch]: moved the string data and
4305 associated manipulation methods into a new stand-alone class
4306 InsetCommandParams. This class has two additional methods
4307 getAsString() and setFromString() allowing the contents to be
4308 moved around as a single string.
4309 (addContents) method removed.
4310 (setContents) method no longer virtual.
4312 * src/buffer.C (readInset): made use of new InsetCitation,
4313 InsetUrl constructors based on InsetCommandParams.
4315 * src/commandtags.h: add LFUN_INSERT_URL
4317 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4318 independent InsetUrl and use InsetCommandParams to extract
4319 string info and create new Insets.
4321 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4323 * src/frontends/xforms/FormCitation.C (apply): uses
4326 * src/frontends/xforms/form_url.C
4327 * src/frontends/xforms/form_url.h
4328 * src/frontends/xforms/FormUrl.h
4329 * src/frontends/xforms/FormUrl.C
4330 * src/frontends/xforms/forms/form_url.fd: new files
4332 * src/insets/insetcite.[Ch]: removed unused constructors.
4334 * src/insets/insetinclude.[Ch]: no longer store filename
4336 * src/insets/inseturl.[Ch]: GUI-independent.
4338 2000-07-26 Juergen Vigna <jug@sad.it>
4339 * renamed frontend from gtk to gnome as it is that what is realized
4340 and did the necessary changes in the files.
4342 2000-07-26 Marko Vendelin <markov@ioc.ee>
4344 * configure.in: cleaning up gnome configuration scripts
4346 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4348 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4349 shortcuts syndrom by redrawing them explicitely (a better solution
4350 would be appreciated).
4352 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4354 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4357 * src/lyx_cb.C (MenuExport): change html export to do the right
4358 thing depending of the document type (instead of having
4359 html-linuxdoc and html-docbook).
4360 * src/lyxfunc.C (getStatus): update for html
4361 * lib/ui/default.ui: simplify due to the above change.
4362 * src/menus.C (ShowFileMenu): update too (in case we need it).
4364 * src/MenuBackend.C (read): if a menu is defined twice, add the
4365 new entries to the exiting one.
4367 2000-07-26 Juergen Vigna <jug@sad.it>
4369 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4371 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4372 and return a bool if it did actual save the file.
4373 (AutoSave): don't autosave a unnamed doc.
4375 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4376 check if this is an UNNAMED new file and react to it.
4377 (newFile): set buffer to unnamed and change to not mark a new
4378 buffer dirty if I didn't do anything with it.
4380 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4382 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4384 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4385 friend as per Angus's patch posted to lyx-devel.
4387 * src/ext_l10n.h: updated
4389 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4390 gettext on the style string right before inserting them into the
4393 * autogen.sh: add code to extract style strings form layout files,
4394 not good enough yet.
4396 * src/frontends/gtk/.cvsignore: add MAKEFILE
4398 * src/MenuBackend.C (read): run the label strings through gettext
4399 before storing them in the containers.
4401 * src/ext_l10n.h: new file
4403 * autogen.sh : generate the ext_l10n.h file here
4405 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4407 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4410 * lib/ui/default.ui: fix a couple of typos.
4412 * config/gnome/gtk.m4: added (and added to the list of files in
4415 * src/insets/insetinclude.C (unique_id): fix when we are using
4416 lyxstring instead of basic_string<>.
4417 * src/insets/insettext.C (LocalDispatch): ditto.
4418 * src/support/filetools.C: ditto.
4420 * lib/configure.m4: create the ui/ directory if necessary.
4422 * src/LyXView.[Ch] (updateToolbar): new method.
4424 * src/BufferView_pimpl.C (buffer): update the toolbar when
4425 opening/closing buffer.
4427 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4429 * src/LyXAction.C (getActionName): enhance to return also the name
4430 and options of pseudo-actions.
4431 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4433 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4434 as an example of what is possible). Used in File->Build too (more
4435 useful) and in the import/export menus (to mimick the complicated
4436 handling of linuxdoc and friends). Try to update all the entries.
4438 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4441 * src/MenuBackend.C (read): Parse the new OptItem tag.
4443 * src/MenuBackend.h: Add a new optional_ data member (used if the
4444 entry should be omitted when the lyxfunc is disabled).
4446 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4447 function, used as a shortcut.
4448 (create_submenu): align correctly the shortcuts on the widest
4451 * src/MenuBackend.h: MenuItem.label() only returns the label of
4452 the menu without shortcut; new method shortcut().
4454 2000-07-14 Marko Vendelin <markov@ioc.ee>
4456 * src/frontends/gtk/Dialogs.C:
4457 * src/frontends/gtk/FormCopyright.C:
4458 * src/frontends/gtk/FormCopyright.h:
4459 * src/frontends/gtk/Makefile.am: added these source-files for the
4460 Gtk/Gnome support of the Copyright-Dialog.
4462 * src/main.C: added Gnome::Main initialization if using
4463 Gtk/Gnome frontend-GUI.
4465 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4467 * config/gnome/aclocal-include.m4
4468 * config/gnome/compiler-flags.m4
4469 * config/gnome/curses.m4
4470 * config/gnome/gnome--.m4
4471 * config/gnome/gnome-bonobo-check.m4
4472 * config/gnome/gnome-common.m4
4473 * config/gnome/gnome-fileutils.m4
4474 * config/gnome/gnome-ghttp-check.m4
4475 * config/gnome/gnome-gnorba-check.m4
4476 * config/gnome/gnome-guile-checks.m4
4477 * config/gnome/gnome-libgtop-check.m4
4478 * config/gnome/gnome-objc-checks.m4
4479 * config/gnome/gnome-orbit-check.m4
4480 * config/gnome/gnome-print-check.m4
4481 * config/gnome/gnome-pthread-check.m4
4482 * config/gnome/gnome-support.m4
4483 * config/gnome/gnome-undelfs.m4
4484 * config/gnome/gnome-vfs.m4
4485 * config/gnome/gnome-x-checks.m4
4486 * config/gnome/gnome-xml-check.m4
4487 * config/gnome/gnome.m4
4488 * config/gnome/gperf-check.m4
4489 * config/gnome/gtk--.m4
4490 * config/gnome/linger.m4
4491 * config/gnome/need-declaration.m4: added configuration scripts
4492 for Gtk/Gnome frontend-GUI
4494 * configure.in: added support for the --with-frontend=gtk option
4496 * autogen.sh: added config/gnome/* to list of config-files
4498 * acconfig.h: added define for GTKGUI-support
4500 * config/lyxinclude.m4: added --with-frontend[=value] option value
4501 for Gtk/Gnome frontend-GUI support.
4503 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4505 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4509 * src/paragraph.C (GetChar): remove non-const version
4511 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4512 (search_kw): use it.
4514 * src/lyx_main.C (init): if "preferences" exist, read that instead
4516 (ReadRcFile): return bool if the file could be read ok.
4517 (ReadUIFile): add a check to see if lex file is set ok.
4519 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4520 bastring can be used instead of lyxstring (still uses the old code
4521 if std::string is good enough or if lyxstring is used.)
4523 * src/encoding.C: make the arrays static, move ininle functions
4525 * src/encoding.h: from here.
4527 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4528 (parseSingleLyXformat2Token): move inset parsing to separate method
4529 (readInset): new private method
4531 * src/Variables.h: remove virtual from get().
4533 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4534 access to NEW_INSETS and NEW_TABULAR
4536 * src/MenuBackend.h: remove superfluous forward declaration of
4537 MenuItem. Add documentations tags "///", remove empty MenuItem
4538 destructor, remove private default contructor.
4540 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4542 (read): more string mlabel and mname to where they are used
4543 (read): remove unused variables mlabel and mname
4544 (defaults): unconditional clear, make menusetup take advantage of
4545 add returning Menu &.
4547 * src/LyXView.h: define NEW_MENUBAR as default
4549 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4550 to NEW_INSETS and NEW_TABULAR.
4551 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4552 defined. Change some of the "xxxx-inset-insert" functions names to
4555 * several files: more enahncements to NEW_INSETS and the resulting
4558 * lib/lyxrc.example (\date_insert_format): move to misc section
4560 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4561 bastring and use AC_CACHE_CHECK.
4562 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4563 the system have the newest methods. uses AC_CACHE_CHECK
4564 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4565 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4566 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4568 * configure.in: add LYX_CXX_GOOD_STD_STRING
4570 * acinclude.m4: recreated
4572 2000-07-24 Amir Karger <karger@lyx.org>
4574 * README: add Hebrew, Arabic kmaps
4577 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4579 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4582 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4584 * Lot of files: add pragma interface/implementation.
4586 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4588 * lib/ui/default.ui: new file (ans new directory). Contains the
4589 default menu and toolbar.
4591 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4592 global space. Toolbars are now read (as menus) in ui files.
4594 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4596 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4597 is disabled because the document is read-only. We want to have the
4598 toggle state of the function anyway.
4599 (getStatus): add code for LFUN_VC* functions (mimicking what is
4600 done in old-style menus)
4602 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4603 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4605 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4606 * src/BufferView_pimpl.C: ditto.
4607 * src/lyxfunc.C: ditto.
4609 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4610 default). This replaces old-style menus by new ones.
4612 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4613 MenuItem. Contain the data structure of a menu.
4615 * src/insets/insettext.C: use LyXView::setLayout instead of
4616 accessing directly the toolbar combox.
4617 * src/lyxfunc.C (Dispatch): ditto.
4619 * src/LyXView.C (setLayout): new method, which just calls
4620 Toolbar::setLayout().
4621 (updateLayoutChoice): move part of this method in Toolbar.
4623 * src/toolbar.[Ch]: removed.
4625 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4626 implementation the toolbar.
4628 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4629 the toolbar. It might make sense to merge it with ToolbarDefaults
4631 (setLayout): new function.
4632 (updateLayoutList): ditto.
4633 (openLayoutList): ditto.
4635 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4636 xforms implementation of the toolbar.
4637 (get_toolbar_func): comment out, since I do not
4638 know what it is good for.
4640 * src/ToolbarDefaults.h: Add the ItemType enum.
4642 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4643 for a list of allocated C strings. Used in Menubar xforms
4644 implementation to avoid memory leaks.
4646 * src/support/lstrings.[Ch] (uppercase): new version taking and
4650 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4651 * lib/bind/emacs.bind: ditto.
4653 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4655 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4656 forward decl of LyXView.
4658 * src/toolbar.C (toolbarItem): moved from toolbar.h
4659 (toolbarItem::clean): ditto
4660 (toolbarItem::~toolbarItem): ditto
4661 (toolbarItem::operator): ditto
4663 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4665 * src/paragraph.h: control the NEW_TABULAR define from here
4667 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4668 USE_TABULAR_INSETS to NEW_TABULAR
4670 * src/ToolbarDefaults.C: add include "lyxlex.h"
4672 * files using the old table/tabular: use NEW_TABULAR to control
4673 compilation of old tabular stuff.
4675 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4678 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4679 planemet in reading of old style floats, fix the \end_deeper
4680 problem when reading old style floats.
4682 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4684 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4686 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4688 * lib/bind/sciword.bind: updated.
4690 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4692 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4693 layout write problem
4695 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4697 * src/Makefile.am (INCLUDES): remove image directory from include
4700 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4701 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4703 * src/LyXView.C (create_form_form_main): read the application icon
4706 * lib/images/*.xpm: change the icons to use transparent color for
4709 * src/toolbar.C (update): change the color of the button when it
4712 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4714 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4715 setting explicitely the minibuffer.
4716 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4718 * src/LyXView.C (showState): new function. Shows font information
4719 in minibuffer and update toolbar state.
4720 (LyXView): call Toolbar::update after creating the
4723 * src/toolbar.C: change toollist to be a vector instead of a
4725 (BubbleTimerCB): get help string directly from the callback
4726 argument of the corresponding icon (which is the action)
4727 (set): remove unnecessary ugliness.
4728 (update): new function. update the icons (depressed, disabled)
4729 depending of the status of the corresponding action.
4731 * src/toolbar.h: remove help in toolbarItem
4733 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4735 * src/Painter.C (text): Added code for using symbol glyphs from
4736 iso10646 fonts. Currently diabled.
4738 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4741 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4742 magyar,turkish and usorbian.
4744 * src/paragraph.C (isMultiLingual): Made more efficient.
4746 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4749 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4750 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4751 Also changed the prototype to "bool math_insert_greek(char)".
4753 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4755 * lots of files: apply the NEW_INSETS on all code that will not be
4756 needed when we move to use the new insets. Enable the define in
4757 lyxparagrah.h to try it.
4759 * src/insets/insettabular.C (cellstart): change to be a static
4761 (InsetTabular): initialize buffer in the initializer list.
4763 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4765 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4766 form_print.h out of the header file. Replaced with forward
4767 declarations of the relevant struct.
4769 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4772 * src/commandtags.h: do not include "debug.h" which does not
4773 belong there. #include it in some other places because of this
4776 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4778 * src/insets/insetcaption.C: add a couple "using" directives.
4780 * src/toolbar.C (add): get the help text directly from lyxaction.
4782 (setPixmap): new function. Loads from disk and sets a pixmap on a
4783 botton; the name of the pixmap file is derived from the command
4786 * src/toolbar.h: remove members isBitmap and pixmap from
4789 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4790 * lib/images/: move many files from images/banner.xpm.
4792 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4794 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4795 * src/toolbar.C: ditto.
4796 * configure.in: ditto.
4797 * INSTALL: document.
4799 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4800 the spellchecker popup is closed from the WM.
4802 2000-07-19 Juergen Vigna <jug@sad.it>
4804 * src/insets/insetfloat.C (Write): small fix because we use the
4805 insetname for the type now!
4807 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4809 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4812 * src/frontends/Dialogs.h: removed hideCitation signal
4814 * src/insets/insetcite.h: added hide signal
4816 * src/insets/insetcite.C (~InsetCitation): emits new signal
4817 (getScreenLabel): "intelligent" label should now fit on the screen!
4819 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4821 * src/frontends/xforms/FormCitation.C (showInset): connects
4822 hide() to the inset's hide signal
4823 (show): modified to use fl_set_object_position rather than
4824 fl_set_object_geometry wherever possible
4826 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4828 * src/insets/lyxinset.h: add caption code
4830 * src/insets/insetfloat.C (type): new method
4832 * src/insets/insetcaption.C (Write): new method
4834 (LyxCode): new method
4836 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4837 to get it right together with using the FloatList.
4839 * src/commandtags.h: add LFUN_INSET_CAPTION
4840 * src/lyxfunc.C (Dispatch): handle it
4842 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4845 * src/Variables.[Ch]: make expand take a const reference, remove
4846 the destructor, some whitespace changes.
4848 * src/LyXAction.C (init): add caption-inset-insert
4850 * src/FloatList.C (FloatList): update the default floats a bit.
4852 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4854 * src/Variables.[Ch]: new files. Intended to be used for language
4855 specific strings (like \chaptername) and filename substitution in
4858 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4860 * lib/kbd/american.kmap: update
4862 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4864 * src/bufferparams.[Ch]: remove member allowAccents.
4866 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4868 * src/LaTeXLog.C: use the log_form.h header.
4869 * src/lyx_gui.C: ditto.
4870 * src/lyx_gui_misc.C: ditto.
4871 * src/lyxvc.h: ditto.
4873 * forms/log_form.fd: new file, created from latexoptions.fd. I
4874 kept the log popup and nuked the options form.
4876 * src/{la,}texoptions.[Ch]: removed.
4877 * src/lyx_cb.C (LaTeXOptions): ditto
4879 * src/lyx_gui.C (create_forms): do not handle the
4880 fd_latex_options form.
4882 2000-07-18 Juergen Vigna <jug@sad.it>
4884 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4885 name of the inset so that it can be requested outside (text2.C).
4887 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4890 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4892 * src/mathed/formula.h (ConvertFont): constify
4894 * src/mathed/formula.C (Read): add warning if \end_inset is not
4895 found on expected place.
4897 * src/insets/lyxinset.h (ConvertFont): consify
4899 * src/insets/insetquotes.C (ConvertFont): constify
4900 * src/insets/insetquotes.h: ditto
4902 * src/insets/insetinfo.h: add labelfont
4904 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4905 (ascent): use labelfont
4909 (Write): make .lyx file a bit nicer
4911 * src/insets/insetfloat.C (Write): simplify somewhat...
4912 (Read): add warning if arg is not found
4914 * src/insets/insetcollapsable.C: add using std::max
4915 (Read): move string token and add warning in arg is not found
4916 (draw): use std::max to get the right ty
4917 (getMaxWidth): simplify by using std::max
4919 * src/insets/insetsection.h: new file
4920 * src/insets/insetsection.C: new file
4921 * src/insets/insetcaption.h: new file
4922 * src/insets/insetcaption.C: new file
4924 * src/insets/inset.C (ConvertFont): constify signature
4926 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4927 insetcaption.[Ch] and insetsection.[Ch]
4929 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4930 uses to use LABEL_COUNTER_CHAPTER instead.
4931 * src/text2.C (SetCounter): here
4933 * src/counters.h: new file
4934 * src/counters.C: new file
4935 * src/Sectioning.h: new file
4936 * src/Sectioning.C: new file
4938 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4940 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4942 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4945 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4948 2000-07-17 Juergen Vigna <jug@sad.it>
4950 * src/tabular.C (Validate): check if array-package is needed.
4951 (SetVAlignment): added support for vertical alignment.
4952 (SetLTFoot): better support for longtable header/footers
4953 (Latex): modified to support added features.
4955 * src/LaTeXFeatures.[Ch]: added array-package.
4957 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4959 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4962 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4964 * configure.in: do not forget to put a space after -isystem.
4966 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4968 * lib/kbd/arabic.kmap: a few fixes.
4970 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4972 * some whitespace chagnes to a number of files.
4974 * src/support/DebugStream.h: change to make it easier for
4975 doc++ to parse correctly.
4976 * src/support/lyxstring.h: ditto
4978 * src/mathed/math_utils.C (compara): change to have only one
4980 (MathedLookupBOP): change because of the above.
4982 * src/mathed/math_delim.C (math_deco_compare): change to have only
4984 (search_deco): change becasue of the above.
4986 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4987 instead of manually coded one.
4989 * src/insets/insetquotes.C (Read): read the \end_inset too
4991 * src/insets/insetlatex.h: remove file
4992 * src/insets/insetlatex.C: remove file
4994 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4996 (InsetPrintIndex): remove destructor
4998 * src/insets/insetinclude.h: remove default constructor
5000 * src/insets/insetfloat.C: work to make it work better
5002 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5004 * src/insets/insetcite.h (InsetCitation): remove default constructor
5006 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5008 * src/text.C (GetColumnNearX): comment out some currently unused code.
5010 * src/paragraph.C (writeFile): move some initializations closer to
5012 (CutIntoMinibuffer): small change to use new matchIT operator
5016 (InsertInset): ditto
5019 (InsetIterator): ditto
5020 (Erase): small change to use new matchFT operator
5022 (GetFontSettings): ditto
5023 (HighestFontInRange): ditto
5026 * src/lyxparagraph.h: some chars changed to value_type
5027 (matchIT): because of some stronger checking (perhaps too strong)
5028 in SGI STL, the two operator() unified to one.
5031 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5033 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5034 the last inset read added
5035 (parseSingleLyXformat2Token): some more (future) compability code added
5036 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5037 (parseSingleLyXformat2Token): set last_inset_read
5038 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5039 (parseSingleLyXformat2Token): don't double intializw string next_token
5041 * src/TextCache.C (text_fits::operator()): add const's to the signature
5042 (has_buffer::operator()): ditto
5044 * src/Floating.h: add some comments on the class
5046 * src/FloatList.[Ch] (typeExist): new method
5049 * src/BackStack.h: added default constructor, wanted by Gcc.
5051 2000-07-14 Juergen Vigna <jug@sad.it>
5053 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5055 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5057 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5058 do a redraw when the window is resized!
5059 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5061 * src/insets/insettext.C (resizeLyXText): added function to correctly
5062 being able to resize the LyXWindow.
5064 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5066 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5068 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5069 crashes when closing dialog to a deleted inset.
5071 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5072 method! Now similar to other insets.
5074 2000-07-13 Juergen Vigna <jug@sad.it>
5076 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5078 * lib/examples/Literate.lyx: small patch!
5080 * src/insets/insetbib.C (Read): added this function because of wrong
5081 Write (without [begin|end]_inset).
5083 2000-07-11 Juergen Vigna <jug@sad.it>
5085 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5086 as the insertInset could not be good!
5088 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5089 the bool param should not be last.
5091 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5093 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5094 did submit that to Karl).
5096 * configure.in: use -isystem instead of -I for X headers. This
5097 fixes a problem on solaris with a recent gcc;
5098 put the front-end code after the X detection code;
5099 configure in sigc++ before lib/
5101 * src/lyx_main.C (commandLineHelp): remove -display from command
5104 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5106 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5107 Also put in Makefile rules for building the ``listerrors''
5108 program for parsing errors from literate programs written in LyX.
5110 * lib/build-listerrors: Added small shell script as part of compile
5111 process. This builds a working ``listerrors'' binary if noweb is
5112 installed and either 1) the VNC X server is installed on the machine,
5113 or 2) the user is compiling from within a GUI. The existence of a GUI
5114 is necessary to use the ``lyx --export'' feature for now. This
5115 hack can be removed once ``lyx --export'' no longer requires a GUI to
5118 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5120 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5121 now passed back correctly from gcc and placed "under" error
5122 buttons in a Literate LyX source.
5124 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5126 * src/text.C (GetColumnNearX): Better behavior when a RTL
5127 paragraph is ended by LTR text.
5129 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5132 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5134 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5135 true when clipboard is empty.
5137 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5139 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5140 row of the paragraph.
5141 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5142 to prevent calculation of bidi tables
5144 2000-07-07 Juergen Vigna <jug@sad.it>
5146 * src/screen.C (ToggleSelection): added y_offset and x_offset
5149 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5152 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5154 * src/insets/insettext.C: fixed Layout-Display!
5156 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5158 * configure.in: add check for strings.h header.
5160 * src/spellchecker.C: include <strings.h> in order to have a
5161 definition for bzero().
5163 2000-07-07 Juergen Vigna <jug@sad.it>
5165 * src/insets/insettext.C (draw): set the status of the bv->text to
5166 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5168 * src/screen.C (DrawOneRow):
5169 (DrawFromTo): redraw the actual row if something has changed in it
5172 * src/text.C (draw): call an update of the toplevel-inset if something
5173 has changed inside while drawing.
5175 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5177 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5179 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5180 processing inside class.
5182 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5183 processing inside class.
5185 * src/insets/insetindex.h new struct Holder, consistent with other
5188 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5189 citation dialog from main code and placed it in src/frontends/xforms.
5190 Dialog launched through signals instead of callbacks
5192 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5194 * lyx.man: update the options description.
5196 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5198 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5199 handle neg values, set min width to 590, add doc about -display
5201 2000-07-05 Juergen Vigna <jug@sad.it>
5203 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5204 calls to BufferView *.
5206 * src/insets/insettext.C (checkAndActivateInset): small fix non
5207 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5209 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5210 their \end_inset token!
5212 2000-07-04 edscott <edscott@imp.mx>
5214 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5215 lib/lyxrc.example: added option \wheel_jump
5217 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5219 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5220 remove support for -width,-height,-xpos and -ypos.
5222 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5224 * src/encoding.[Ch]: New files.
5226 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5227 (text): Call to the underline() method only when needed.
5229 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5231 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5232 encoding(s) for the document.
5234 * src/bufferparams.C (BufferParams): Changed default value of
5237 * src/language.C (newLang): Removed.
5238 (items[]): Added encoding information for all defined languages.
5240 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5241 encoding choice button.
5243 * src/lyxrc.h (font_norm_type): New member variable.
5244 (set_font_norm_type): New method.
5246 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5247 paragraphs with different encodings.
5249 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5250 (TransformChar): Changed to work correctly with Arabic points.
5251 (draw): Added support for drawing Arabic points.
5252 (draw): Removed code for drawing underbars (this is done by
5255 * src/support/textutils.h (IsPrintableNonspace): New function.
5257 * src/BufferView_pimpl.h: Added "using SigC::Object".
5258 * src/LyXView.h: ditto.
5260 * src/insets/insetinclude.h (include_label): Changed to mutable.
5262 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5264 * src/mathed/math_iter.h: remove empty destructor
5266 * src/mathed/math_cursor.h: remove empty destructor
5268 * src/insets/lyxinset.h: add THEOREM_CODE
5270 * src/insets/insettheorem.[Ch]: new files
5272 * src/insets/insetminipage.C: (InsertInset): remove
5274 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5276 (InsertInset): remove
5278 * src/insets/insetlist.C: (InsertList): remove
5280 * src/insets/insetfootlike.[Ch]: new files
5282 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5285 (InsertInset): ditto
5287 * src/insets/insetert.C: remove include Painter.h, reindent
5288 (InsertInset): move to header
5290 * src/insets/insetcollapsable.h: remove explicit from default
5291 contructor, remove empty destructor, add InsertInset
5293 * src/insets/insetcollapsable.C (InsertInset): new func
5295 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5297 * src/vspace.h: add explicit to constructor
5299 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5300 \textcompwordmark, please test this.
5302 * src/lyxrc.C: set ascii_linelen to 65 by default
5304 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5306 * src/commandtags.h: add LFUN_INSET_THEOREM
5308 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5309 (makeLinuxDocFile): remove _some_ of the nice logic
5310 (makeDocBookFile): ditto
5312 * src/Painter.[Ch]: (~Painter): removed
5314 * src/LyXAction.C (init): entry for insettheorem added
5316 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5318 (deplog): code to detect files generated by LaTeX, needs testing
5321 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5323 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5325 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5327 * src/LaTeX.C (deplog): Add a check for files that are going to be
5328 created by the first latex run, part of the project to remove the
5331 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5332 contents to the extension list.
5334 2000-07-04 Juergen Vigna <jug@sad.it>
5336 * src/text.C (NextBreakPoint): added support for needFullRow()
5338 * src/insets/lyxinset.h: added needFullRow()
5340 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5343 * src/insets/insettext.C: lots of changes for update!
5345 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5347 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5349 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5351 * src/insets/insetinclude.C (InsetInclude): fixed
5352 initialization of include_label.
5353 (unique_id): now returns a string.
5355 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5357 * src/LaTeXFeatures.h: new member IncludedFiles, for
5358 a map of key, included file name.
5360 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5361 with the included files for inclusion in SGML preamble,
5362 i. e., linuxdoc and docbook.
5365 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5366 nice (is the generated linuxdoc code to be exported?), that
5367 allows to remove column, and only_body that will be true for
5368 slave documents. Insets are allowed inside SGML font type.
5369 New handling of the SGML preamble for included files.
5370 (makeDocBookFile): the same for docbook.
5372 * src/insets/insetinclude.h:
5373 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5375 (DocBook): new export methods.
5377 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5378 and makeDocBookFile.
5380 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5381 formats to export with command line argument -x.
5383 2000-06-29 Juergen Vigna <jug@sad.it>
5385 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5386 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5388 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5389 region could already been cleared by an inset!
5391 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5393 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5396 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5398 (cursorToggle): remove special handling of lyx focus.
5400 2000-06-28 Juergen Vigna <jug@sad.it>
5402 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5405 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5407 * src/insets/insetindex.C (Edit): add a callback when popup is
5410 * src/insets/insettext.C (LocalDispatch):
5411 * src/insets/insetmarginal.h:
5412 * src/insets/insetlist.h:
5413 * src/insets/insetfoot.h:
5414 * src/insets/insetfloat.h:
5415 * src/insets/insetert.h: add a missing std:: qualifier.
5417 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5422 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5424 * src/insets/insettext.C (Read): remove tmptok unused variable
5425 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5426 (InsertInset): change for new InsetInset code
5428 * src/insets/insettext.h: add TEXT inline method
5430 * src/insets/insettext.C: remove TEXT macro
5432 * src/insets/insetmarginal.C (Write): new method
5433 (Latex): change output slightly
5435 * src/insets/insetfoot.C (Write): new method
5436 (Latex): change output slightly (don't use endl when no need)
5438 * src/insets/insetert.C (Write): new method
5440 * src/insets/insetcollapsable.h: make button_length, button_top_y
5441 and button_bottm_y protected.
5443 * src/insets/insetcollapsable.C (Write): simplify code by using
5444 tostr. Also do not output the float name, the children class
5445 should to that to get control over own arguments
5447 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5448 src/insets/insetminipage.[Ch]:
5451 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5453 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5455 * src/Makefile.am (lyx_SOURCES): add the new files
5457 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5458 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5459 * src/commandtags.h: ditto
5461 * src/LaTeXFeatures.h: add a std::set of used floattypes
5463 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5465 * src/FloatList.[Ch] src/Floating.h: new files
5467 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5469 * src/lyx_cb.C (TableApplyCB): ditto
5471 * src/text2.C: ditto
5472 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5473 (parseSingleLyXformat2Token): ditto + add code for
5474 backwards compability for old float styles + add code for new insets
5476 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5478 (InsertInset(size_type, Inset *, LyXFont)): new method
5479 (InsetChar(size_type, char)): changed to use the other InsetChar
5480 with a LyXFont(ALL_INHERIT).
5481 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5482 insert the META_INSET.
5484 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5486 * sigc++/thread.h (Threads): from here
5488 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5489 definition out of line
5490 * sigc++/scope.h: from here
5492 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5494 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5495 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5497 * Makefile.am (bindist): new target.
5499 * INSTALL: add instructions for doing a binary distribution.
5501 * development/tools/README.bin.example: update a bit.
5503 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5506 * lib/lyxrc.example: new lyxrc tag \set_color.
5508 * src/lyxfunc.C (Dispatch):
5509 * src/commandtags.h:
5510 * src/LyXAction.C: new lyxfunc "set-color".
5512 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5513 and an x11name given as strings.
5515 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5516 cache when a color is changed.
5518 2000-06-26 Juergen Vigna <jug@sad.it>
5520 * src/lyxrow.C (width): added this functions and variable.
5522 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5525 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5527 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5529 * images/undo_bw.xpm: new icon.
5530 * images/redo_bw.xpm: ditto.
5532 * configure.in (INSTALL_SCRIPT): change value to
5533 ${INSTALL} to avoid failures of install-script target.
5534 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5536 * src/BufferView.h: add a magic "friend" declaration to please
5539 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5541 * forms/cite.fd: modified to allow resizing without messing
5544 * src/insetcite.C: Uses code from cite.fd almost without
5546 User can now resize dialog in the x-direction.
5547 Resizing the dialog in the y-direction is prevented, as the
5548 code does this intelligently already.
5550 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5552 * INSTALL: remove obsolete entry in "problems" section.
5554 * lib/examples/sl_*.lyx: update of the slovenian examples.
5556 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5558 2000-06-23 Juergen Vigna <jug@sad.it>
5560 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5562 * src/buffer.C (resize): delete the LyXText of textinsets.
5564 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5566 * src/insets/lyxinset.h: added another parameter 'cleared' to
5567 the draw() function.
5569 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5570 unlocking inset in inset.
5572 2000-06-22 Juergen Vigna <jug@sad.it>
5574 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5575 of insets and moved first to LyXText.
5577 * src/mathed/formulamacro.[Ch]:
5578 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5580 2000-06-21 Juergen Vigna <jug@sad.it>
5582 * src/text.C (GetVisibleRow): look if I should clear the area or not
5583 using Inset::doClearArea() function.
5585 * src/insets/lyxinset.h: added doClearArea() function and
5586 modified draw(Painter &, ...) to draw(BufferView *, ...)
5588 * src/text2.C (UpdateInset): return bool insted of int
5590 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5592 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5593 combox in the character popup
5595 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5596 BufferParams const & params
5598 2000-06-20 Juergen Vigna <jug@sad.it>
5600 * src/insets/insettext.C (SetParagraphData): set insetowner on
5603 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5605 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5606 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5608 (form_main_): remove
5610 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5611 (create_form_form_main): remove FD_form_main stuff, connect to
5612 autosave_timeout signal
5614 * src/LyXView.[Ch] (getMainForm): remove
5615 (UpdateTimerCB): remove
5616 * src/BufferView_pimpl.h: inherit from SigC::Object
5618 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5619 signal instead of callback
5621 * src/BufferView.[Ch] (cursorToggleCB): remove
5623 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5625 * src/BufferView_pimpl.C: changes because of the one below
5627 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5628 instead of storing a pointer to a LyXText.
5630 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5632 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5634 * src/lyxparagraph.h
5636 * src/paragraph.C: Changed fontlist to a sorted vector.
5638 2000-06-19 Juergen Vigna <jug@sad.it>
5640 * src/BufferView.h: added screen() function.
5642 * src/insets/insettext.C (LocalDispatch): some selection code
5645 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5647 * src/insets/insettext.C (SetParagraphData):
5649 (InsetText): fixes for multiple paragraphs.
5651 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5653 * development/lyx.spec.in: Call configure with ``--without-warnings''
5654 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5655 This should be fine, however, since we generally don't want to be
5656 verbose when making an RPM.
5658 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5660 * lib/scripts/fig2pstex.py: New file
5662 2000-06-16 Juergen Vigna <jug@sad.it>
5664 * src/insets/insettabular.C (UpdateLocal):
5665 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5666 (LocalDispatch): Changed all functions to use LyXText.
5668 2000-06-15 Juergen Vigna <jug@sad.it>
5670 * src/text.C (SetHeightOfRow): call inset::update before requesting
5673 * src/insets/insettext.C (update):
5674 * src/insets/insettabular.C (update): added implementation
5676 * src/insets/lyxinset.h: added update function
5678 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5680 * src/text.C (SelectNextWord): protect against null pointers with
5681 old-style string streams. (fix from Paul Theo Gonciari
5684 * src/cite.[Ch]: remove erroneous files.
5686 * lib/configure.m4: update the list of created directories.
5688 * src/lyxrow.C: include <config.h>
5689 * src/lyxcursor.C: ditto.
5691 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5693 * lib/examples/decimal.lyx: new example file from Mike.
5695 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5696 to find template definitions (from Dekel)
5698 * src/frontends/.cvsignore: add a few things.
5700 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5702 * src/Timeout.C (TimeOut): remove default argument.
5704 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5707 * src/insets/ExternalTemplate.C: add a "using" directive.
5709 * src/lyx_main.h: remove the act_ struct, which seems unused
5712 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5714 * LyX Developers Meeting: All files changed, due to random C++ (by
5715 coincidence) code generator script.
5717 - external inset (cool!)
5718 - initial online editing of preferences
5719 - insettabular breaks insettext(s contents)
5721 - some DocBook fixes
5722 - example files update
5723 - other cool stuff, create a diff and look for yourself.
5725 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5727 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5728 -1 this is a non-line-breaking textinset.
5730 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5731 if there is no width set.
5733 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5735 * Lots of files: Merged the dialogbase branch.
5737 2000-06-09 Allan Rae <rae@lyx.org>
5739 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5740 and the Dispatch methods that used it.
5742 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5743 access to functions formerly kept in Dispatch.
5745 2000-05-19 Allan Rae <rae@lyx.org>
5747 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5748 made to_page and count_copies integers again. from_page remains a
5749 string however because I want to allow entry of a print range like
5750 "1,4,22-25" using this field.
5752 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5753 and printer-params-get. These aren't useful from the minibuffer but
5754 could be used by a script/LyXServer app provided it passes a suitable
5755 auto_mem_buffer. I guess I should take a look at how the LyXServer
5756 works and make it support xtl buffers.
5758 * sigc++/: updated to libsigc++-1.0.1
5760 * src/xtl/: updated to xtl-1.3.pl.11
5762 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5763 those changes done to the files in src/ are actually recreated when
5764 they get regenerated. Please don't ever accept a patch that changes a
5765 dialog unless that patch includes the changes to the corresponding *.fd
5768 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5769 stringOnlyContains, renamed it and generalised it.
5771 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5772 branch. Removed the remaining old form_print code.
5774 2000-04-26 Allan Rae <rae@lyx.org>
5776 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5777 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5779 2000-04-25 Allan Rae <rae@lyx.org>
5781 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5782 against a base of xtl-1.3.pl.4
5784 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5785 filter the Id: entries so they still show the xtl version number
5788 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5789 into the src/xtl code. Patch still pending with José (XTL)
5791 2000-04-24 Allan Rae <rae@lyx.org>
5793 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5794 both more generic and much safer. Use the new template functions.
5795 * src/buffer.[Ch] (Dispatch): ditto.
5797 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5798 and mem buffer more intelligently. Also a little general cleanup.
5801 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5802 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5803 * src/xtl/Makefile.am: ditto.
5804 * src/xtl/.cvsignore: ditto.
5805 * src/Makefile.am: ditto.
5807 * src/PrinterParams.h: Removed the macros member functions. Added a
5808 testInvariant member function. A bit of tidying up and commenting.
5809 Included Angus's idea for fixing operation with egcs-1.1.2.
5811 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5812 cool expansion of XTL's mem_buffer to support automatic memory
5813 management within the buffer itself. Removed the various macros and
5814 replaced them with template functions that use either auto_mem_buffer
5815 or mem_buffer depending on a #define. The mem_buffer support will
5816 disappear as soon as the auto_mem_buffer is confirmed to be good on
5817 other platforms/compilers. That is, it's there so you've got something
5820 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5821 effectively forked XTL. However I expect José will include my code
5822 into the next major release. Also fixed a memory leak.
5823 * src/xtl/text.h: ditto.
5824 * src/xtl/xdr.h: ditto.
5825 * src/xtl/giop.h: ditto.
5827 2000-04-16 Allan Rae <rae@lyx.org>
5829 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5830 by autogen.sh and removed by maintainer-clean anyway.
5831 * .cvsignore, sigc++/.cvsignore: Support the above.
5833 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5835 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5837 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5838 macros, renamed static callback-target member functions to suit new
5839 scheme and made them public.
5840 * src/frontends/xforms/forms/form_print.fd: ditto.
5841 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5843 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5846 * src/xtl/: New directory containing a minimal distribution of XTL.
5847 This is XTL-1.3.pl.4.
5849 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5851 2000-04-15 Allan Rae <rae@lyx.org>
5853 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5855 * sigc++/: Updated to libsigc++-1.0.0
5857 2000-04-14 Allan Rae <rae@lyx.org>
5859 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5860 use the generic ones in future. I'll modify my conversion script.
5862 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5864 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5865 (CloseAllBufferRelatedDialogs): Renamed.
5866 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5868 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5869 of the generic ones. These are the same ones my conversion script
5872 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5873 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5874 * src/buffer.C (Dispatch): ditto
5876 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5877 functions for updating and hiding buffer dependent dialogs.
5878 * src/BufferView.C (buffer): ditto
5879 * src/buffer.C (setReadonly): ditto
5880 * src/lyxfunc.C (CloseBuffer): ditto
5882 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5883 Dialogs.h, and hence all the SigC stuff, into every file that includes
5884 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5886 * src/BufferView2.C: reduce the number of headers included by buffer.h
5888 2000-04-11 Allan Rae <rae@lyx.org>
5890 * src/frontends/xforms/xform_macros.h: A small collection of macros
5891 for building C callbacks.
5893 * src/frontends/xforms/Makefile.am: Added above file.
5895 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5896 scheme again. This time it should work for JMarc. If this is
5897 successful I'll revise my conversion script to automate some of this.
5898 The static member functions in the class also have to be public for
5899 this scheme will work. If the scheme works (it's almost identical to
5900 the way BufferView::cursorToggleCB is handled so it should work) then
5901 FormCopyright and FormPrint will be ready for inclusion into the main
5902 trunk immediately after 1.1.5 is released -- provided we're prepared
5903 for complaints about lame compilers not handling XTL.
5905 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5907 2000-04-07 Allan Rae <rae@lyx.org>
5909 * config/lyxinclude.m4: A bit more tidying up (Angus)
5911 * src/LString.h: JMarc's <string> header fix
5913 * src/PrinterParams.h: Used string for most data to remove some
5914 ugly code in the Print dialog and avoid even uglier code when
5915 appending the ints to a string for output.
5917 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5918 and moved "default:" back to the end of switch statement. Cleaned
5919 up the printing so it uses the right function calls and so the
5920 "print to file" option actually puts the file in the right directory.
5922 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5924 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5925 and Ok+Apply button control into a separate method: input (Angus).
5926 (input) Cleaned it up and improved it to be very thorough now.
5927 (All CB) static_cast used instead of C style cast (Angus). This will
5928 probably change again once we've worked out how to keep gcc-2.8.1 happy
5929 with real C callbacks.
5930 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5931 ignore some of the bool settings and has random numbers instead. Needs
5932 some more investigation. Added other input length checks and checking
5933 of file and printer names.
5935 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5936 would link (Angus). Seems the old code doesn't compile with the pragma
5937 statement either. Separated callback entries from internal methods.
5939 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5941 2000-03-17 Allan Rae <rae@lyx.org>
5943 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5944 need it? Maybe it could go in Dialogs instead? I could make it a
5945 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5946 values to get the bool return value.
5947 (Dispatch): New overloaded method for xtl support.
5949 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5950 extern "C" callback instead of static member functions. Hopefully,
5951 JMarc will be able to compile this. I haven't changed
5952 forms/form_copyright.fd yet. Breaking one of my own rules already.
5954 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5955 because they aren't useful from the minibuffer. Maybe a LyXServer
5956 might want a help message though?
5958 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5960 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5961 xtl which needs both rtti and exceptions.
5963 * src/support/Makefile.am:
5964 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5966 * src/frontends/xforms/input_validators.[ch]: input filters and
5967 validators. These conrol what keys are valid in input boxes.
5968 Use them and write some more. Much better idea than waiting till
5969 after the user has pressed Ok to say that the input fields don't make
5972 * src/frontends/xforms/Makefile.am:
5973 * src/frontends/xforms/forms/form_print.fd:
5974 * src/frontends/xforms/forms/makefile:
5975 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5976 new scheme. Still have to make sure I haven't missed anything from
5977 the current implementation.
5979 * src/Makefile.am, src/PrinterParams.h: New data store.
5981 * other files: Added a couple of copyright notices.
5983 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5985 * src/insets/insetbib.h: move Holder struct in public space.
5987 * src/frontends/include/DialogBase.h: use SigC:: only when
5988 SIGC_CXX_NAMESPACES is defined.
5989 * src/frontends/include/Dialogs.h: ditto.
5991 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5993 * src/frontends/xforms/FormCopyright.[Ch]: do not
5994 mention SigC:: explicitely.
5996 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5998 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5999 deals with testing KDE in main configure.in
6000 * configure.in: ditto.
6002 2000-02-22 Allan Rae <rae@lyx.org>
6004 * Lots of files: Merged from HEAD
6006 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6007 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6009 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6011 * sigc++/: new minidist.
6013 2000-02-14 Allan Rae <rae@lyx.org>
6015 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6017 2000-02-08 Juergen Vigna <jug@sad.it>
6019 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6020 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6022 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6023 for this port and so it is much easier for other people to port
6024 dialogs in a common development environment.
6026 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6027 the QT/KDE implementation.
6029 * src/frontends/kde/Dialogs.C:
6030 * src/frontends/kde/FormCopyright.C:
6031 * src/frontends/kde/FormCopyright.h:
6032 * src/frontends/kde/Makefile.am:
6033 * src/frontends/kde/formcopyrightdialog.C:
6034 * src/frontends/kde/formcopyrightdialog.h:
6035 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6036 for the kde support of the Copyright-Dialog.
6038 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6039 subdir-substitution instead of hardcoded 'xforms' as we now have also
6042 * src/frontends/include/DialogBase.h (Object): just commented the
6043 label after #endif (nasty warning and I don't like warnings ;)
6045 * src/main.C (main): added KApplication initialization if using
6048 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6049 For now only the KDE event-loop is added if frontend==kde.
6051 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6053 * configure.in: added support for the --with-frontend[=value] option
6055 * autogen.sh: added kde.m4 file to list of config-files
6057 * acconfig.h: added define for KDEGUI-support
6059 * config/kde.m4: added configuration functions for KDE-port
6061 * config/lyxinclude.m4: added --with-frontend[=value] option with
6062 support for xforms and KDE.
6064 2000-02-08 Allan Rae <rae@lyx.org>
6066 * all Makefile.am: Fixed up so the make targets dist, distclean,
6067 install and uninstall all work even if builddir != srcdir. Still
6068 have a new sigc++ minidist update to come.
6070 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6072 2000-02-01 Allan Rae <rae@lyx.org>
6074 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6075 Many mods to get builddir != srcdir working.
6077 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6078 for building on NT and so we can do the builddir != srcdir stuff.
6080 2000-01-30 Allan Rae <rae@lyx.org>
6082 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6083 This will stay in "rae" branch. We probably don't really need it in
6084 the main trunk as anyone who wants to help programming it should get
6085 a full library installed also. So they can check both included and
6086 system supplied library compilation.
6088 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6089 Added a 'mini' distribution of libsigc++. If you feel the urge to
6090 change something in these directories - Resist it. If you can't
6091 resist the urge then you should modify the following script and rebuild
6092 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6093 all happen. Still uses a hacked version of libsigc++'s configure.in.
6094 I'm quite happy with the results. I'm not sure the extra work to turn
6095 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6096 worth the trouble and would probably lead to extra maintenance
6098 I haven't tested the following important make targets: install, dist.
6099 Not ready for prime time but very close. Maybe 1.1.5.
6101 * development/tools/makeLyXsigc.sh: A shell script to automatically
6102 generate our mini-dist of libsigc++. It can only be used with a CVS
6103 checkout of libsigc++ not a tarball distribution. It's well commented.
6104 This will end up as part of the libsigc++ distribution so other apps
6105 can easily have an included mini-dist. If someone makes mods to the
6106 sigc++ subpackage without modifying this script to generate those
6107 changes I'll be very upset!
6109 * src/frontends/: Started the gui/system indep structure.
6111 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6112 to access the gui-indep dialogs are in this class. Much improved
6113 design compared to previous revision. Lars, please refrain from
6114 moving this header into src/ like you did with Popups.h last time.
6116 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6118 * src/frontends/xforms/: Started the gui-indep system with a single
6119 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6122 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6123 Here you'll find a very useful makefile and automated fdfix.sh that
6124 makes updating dailogs a no-brainer -- provided you follow the rules
6125 set out in the README. I'm thinking about adding another script to
6126 automatically generate skeleton code for a new dialog given just the
6129 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6130 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6131 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6133 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6135 * src/support/LSubstring.C (operator): simplify
6137 * src/lyxtext.h: removed bparams, use buffer_->params instead
6139 * src/lyxrow.h: make Row a real class, move all variables to
6140 private and use accessors.
6142 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6144 (isRightToLeftPar): ditto
6145 (ChangeLanguage): ditto
6146 (isMultiLingual): ditto
6149 (SimpleTeXOnePar): ditto
6150 (TeXEnvironment): ditto
6151 (GetEndLabel): ditto
6153 (SetOnlyLayout): ditto
6154 (BreakParagraph): ditto
6155 (BreakParagraphConservative): ditto
6156 (GetFontSettings): ditto
6158 (CopyIntoMinibuffer): ditto
6159 (CutIntoMinibuffer): ditto
6160 (PasteParagraph): ditto
6161 (SetPExtraType): ditto
6162 (UnsetPExtraType): ditto
6163 (DocBookContTableRows): ditto
6164 (SimpleDocBookOneTablePar): ditto
6166 (TeXFootnote): ditto
6167 (SimpleTeXOneTablePar): ditto
6168 (TeXContTableRows): ditto
6169 (SimpleTeXSpecialChars): ditto
6172 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6173 to private and use accessors.
6175 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6176 this, we did not use it anymore and has not been for ages. Just a
6177 waste of cpu cycles.
6179 * src/language.h: make Language a real class, move all variables
6180 to private and use accessors.
6182 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6183 (create_view): remove
6184 (update): some changes for new timer
6185 (cursorToggle): use new timer
6186 (beforeChange): change for new timer
6188 * src/BufferView.h (cursorToggleCB): removed last paramter because
6191 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6192 (cursorToggleCB): change because of new timer code
6194 * lib/CREDITS: updated own mailaddress
6196 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6198 * src/support/filetools.C (PutEnv): fix the code in case neither
6199 putenv() nor setenv() have been found.
6201 * INSTALL: mention the install-strip Makefile target.
6203 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6204 read-only documents.
6206 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6208 * lib/reLyX/configure.in (VERSION): avoid using a previously
6209 generated reLyX wrapper to find out $prefix.
6211 * lib/examples/eu_adibide_lyx-atua.lyx:
6212 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6213 translation of the Tutorial (Dooteo)
6215 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6217 * forms/cite.fd: new citation dialog
6219 * src/insetcite.[Ch]: the new citation dialog is moved into
6222 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6225 * src/insets/insetcommand.h: data members made private.
6227 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * LyX 1.1.5 released
6231 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * src/version.h (LYX_RELEASE): to 1.1.5
6235 * src/spellchecker.C (RunSpellChecker): return false if the
6236 spellchecker dies upon creation.
6238 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6240 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6241 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6245 * lib/CREDITS: update entry for Martin Vermeer.
6247 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6249 * src/text.C (draw): Draw foreign language bars at the bottom of
6250 the row instead of at the baseline.
6252 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6254 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6256 * lib/bind/de_menus.bind: updated
6258 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6260 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6262 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6264 * src/menus.C (Limit_string_length): New function
6265 (ShowTocMenu): Limit the number of items/length of items in the
6268 * src/paragraph.C (String): Correct result for a paragraph inside
6271 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6273 * src/bufferlist.C (close): test of buf->getuser() == NULL
6275 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6277 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6278 Do not call to SetCursor when the paragraph is a closed footnote!
6280 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6282 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6285 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6287 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6290 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6291 reference popup, that activates the reference-back action
6293 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6295 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6296 the menus. Also fixed a bug.
6298 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6299 the math panels when switching buffers (unless new buffer is readonly).
6301 * src/BufferView.C (NoSavedPositions)
6302 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6304 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6306 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6307 less of dvi dirty or not.
6309 * src/trans_mgr.[Ch] (insert): change first parameter to string
6312 * src/chset.[Ch] (encodeString): add const to first parameter
6314 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6316 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6320 * src/LaTeX.C (deplog): better searching for dependency files in
6321 the latex log. Uses now regexps.
6323 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6324 instead of the box hack or \hfill.
6326 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6328 * src/lyxfunc.C (doImportHelper): do not create the file before
6329 doing the actual import.
6330 (doImportASCIIasLines): create a new file before doing the insert.
6331 (doImportASCIIasParagraphs): ditto.
6333 * lib/lyxrc.example: remove mention of non-existing commands
6335 * lyx.man: remove mention of color-related switches.
6337 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6339 * src/lyx_gui.C: remove all the color-related ressources, which
6340 are not used anymore.
6342 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6345 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6347 * src/lyxrc.C (read): Add a missing break in the switch
6349 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6351 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6353 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6356 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6358 * src/text.C (draw): draw bars under foreign language words.
6360 * src/LColor.[Ch]: add LColor::language
6362 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6364 * src/lyxcursor.h (boundary): New member variable
6366 * src/text.C (IsBoundary): New methods
6368 * src/text.C: Use the above for currect cursor movement when there
6369 is both RTL & LTR text.
6371 * src/text2.C: ditto
6373 * src/bufferview_funcs.C (ToggleAndShow): ditto
6375 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6377 * src/text.C (DeleteLineForward): set selection to true to avoid
6378 that DeleteEmptyParagraphMechanism does some magic. This is how it
6379 is done in all other functions, and seems reasonable.
6380 (DeleteWordForward): do not jump over non-word stuff, since
6381 CursorRightOneWord() already does it.
6383 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6384 DeleteWordBackward, since they seem safe to me (since selection is
6385 set to "true") DeleteEmptyParagraphMechanism does nothing.
6387 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6389 * src/lyx_main.C (easyParse): simplify the code by factoring the
6390 part that removes parameters from the command line.
6391 (LyX): check wether wrong command line options have been given.
6393 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6395 * src/lyx_main.C : add support for specifying user LyX
6396 directory via command line option -userdir.
6398 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6400 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6401 the number of items per popup.
6402 (Add_to_refs_menu): Ditto.
6404 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6406 * src/lyxparagraph.h: renamed ClearParagraph() to
6407 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6408 textclass as parameter, and do nothing if free_spacing is
6409 true. This fixes part of the line-delete-forward problems.
6411 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6412 (pasteSelection): ditto.
6413 (SwitchLayoutsBetweenClasses): more translatable strings.
6415 * src/text2.C (CutSelection): use StripLeadingSpaces.
6416 (PasteSelection): ditto.
6417 (DeleteEmptyParagraphMechanism): ditto.
6419 2000-05-26 Juergen Vigna <jug@sad.it>
6421 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6422 is not needed in tabular insets.
6424 * src/insets/insettabular.C (TabularFeatures): added missing features.
6426 * src/tabular.C (DeleteColumn):
6428 (AppendRow): implemented this functions
6429 (cellsturct::operator=): clone the inset too;
6431 2000-05-23 Juergen Vigna <jug@sad.it>
6433 * src/insets/insettabular.C (LocalDispatch): better selection support
6434 when having multicolumn-cells.
6436 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6438 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6440 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6442 * src/ColorHandler.C (getGCForeground): put more test into _()
6444 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6447 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6450 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6452 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6453 there are no labels, or when buffer is readonly.
6455 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6456 there are no labels, buffer is SGML, or when buffer is readonly.
6458 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6460 * src/LColor.C (LColor): change a couple of grey40 to grey60
6461 (LColor): rewore initalization to make compiles go some magnitude
6463 (getGUIName): don't use gettext until we need the string.
6465 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6467 * src/Bullet.[Ch]: Fixed a small bug.
6469 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6471 * src/paragraph.C (String): Several fixes/improvements
6473 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6475 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6477 * src/paragraph.C (String): give more correct output.
6479 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6481 * src/lyxfont.C (stateText) Do not output the language if it is
6482 eqaul to the language of the document.
6484 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6485 between two paragraphs with the same language.
6487 * src/paragraph.C (getParLanguage) Return a correct answer for an
6488 empty dummy paragraph.
6490 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6493 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6496 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6497 the menus/popup, if requested fonts are unavailable.
6499 2000-05-22 Juergen Vigna <jug@sad.it>
6501 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6502 movement support (Up/Down/Tab/Shift-Tab).
6503 (LocalDispatch): added also preliminari cursor-selection.
6505 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6507 * src/paragraph.C (PasteParagraph): Hopefully now right!
6509 2000-05-22 Garst R. Reese <reese@isn.net>
6511 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6512 of list, change all references to Environment to Command
6513 * tex/hollywood.cls : rewrite environments as commands, add
6514 \uppercase to interiorshot and exteriorshot to force uppecase.
6515 * tex/broadway.cls : rewrite environments as commands. Tweak
6518 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6520 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6521 size of items: use a constant intead of the hardcoded 40, and more
6522 importantly do not remove the %m and %x tags added at the end.
6523 (Add_to_refs_menu): use vector::size_type instead of
6524 unsigned int as basic types for the variables. _Please_ do not
6525 assume that size_t is equal to unsigned int. On an alpha, this is
6526 unsigned long, which is _not_ the same.
6528 * src/language.C (initL): remove language "hungarian", since it
6529 seems that "magyar" is better.
6531 2000-05-22 Juergen Vigna <jug@sad.it>
6533 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6535 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6538 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6539 next was deleted but not set to 0.
6541 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6543 * src/language.C (initL): change the initialization of languages
6544 so that compiles goes _fast_.
6546 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6549 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6551 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6555 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6557 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6559 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6563 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6566 * src/insets/insetlo*.[Ch]: Made editable
6568 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6570 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6571 the current selection.
6573 * src/BufferView_pimpl.C (stuffClipboard): new method
6575 * src/BufferView.C (stuffClipboard): new method
6577 * src/paragraph.C (String): new method
6579 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6580 LColor::ignore when lyxname is not found.
6582 * src/BufferView.C (pasteSelection): new method
6584 * src/BufferView_pimpl.C (pasteSelection): new method
6586 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6588 * src/WorkArea.C (request_clipboard_cb): new static function
6589 (getClipboard): new method
6590 (putClipboard): new method
6592 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6594 * LyX 1.1.5pre2 released
6596 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6598 * src/vspace.C (operator=): removed
6599 (operator=): removed
6601 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6603 * src/layout.C (NumberOfClass): manually set the type in make_pair
6604 (NumberOfLayout): ditto
6606 * src/language.C: use the Language constructor for ignore_lang
6608 * src/language.h: add constructors to struct Language
6610 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6612 * src/text2.C (SetCursorIntern): comment out #warning
6614 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6616 * src/mathed/math_iter.h: initialize sx and sw to 0
6618 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6620 * forms/lyx.fd: Redesign of form_ref
6622 * src/LaTeXFeatures.[Ch]
6626 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6629 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6630 and Buffer::inset_iterator.
6632 * src/menus.C: Added new menus: TOC and Refs.
6634 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6636 * src/buffer.C (getTocList): New method.
6638 * src/BufferView2.C (ChangeRefs): New method.
6640 * src/buffer.C (getLabelList): New method. It replaces the old
6641 getReferenceList. The return type is vector<string> instead of
6644 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6645 the old getLabel() and GetNumberOfLabels() methods.
6646 * src/insets/insetlabel.C (getLabelList): ditto
6647 * src/mathed/formula.C (getLabelList): ditto
6649 * src/paragraph.C (String): New method.
6651 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6652 Uses the new getTocList() method.
6653 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6654 which automatically updates the contents of the browser.
6655 (RefUpdateCB): Use the new getLabelList method.
6657 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6659 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6661 * src/spellchecker.C: Added using std::reverse;
6663 2000-05-19 Juergen Vigna <jug@sad.it>
6665 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6667 * src/insets/insettext.C (computeTextRows): small fix for display of
6668 1 character after a newline.
6670 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6673 2000-05-18 Juergen Vigna <jug@sad.it>
6675 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6676 when changing width of column.
6678 * src/tabular.C (set_row_column_number_info): setting of
6679 autobreak rows if necessary.
6681 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6683 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6685 * src/vc-backend.*: renamed stat() to status() and vcstat to
6686 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6687 compilation broke. The new name seems more relevant, anyway.
6689 2000-05-17 Juergen Vigna <jug@sad.it>
6691 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6692 which was wrong if the removing caused removing of rows!
6694 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6695 (pushToken): new function.
6697 * src/text2.C (CutSelection): fix problem discovered with purify
6699 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6701 * src/debug.C (showTags): enlarge the first column, now that we
6702 have 6-digits debug codes.
6704 * lib/layouts/hollywood.layout:
6705 * lib/tex/hollywood.cls:
6706 * lib/tex/brodway.cls:
6707 * lib/layouts/brodway.layout: more commands and fewer
6708 environments. Preambles moved in the .cls files. Broadway now has
6709 more options on scene numbering and less whitespace (from Garst)
6711 * src/insets/insetbib.C (getKeys): make sure that we are in the
6712 document directory, in case the bib file is there.
6714 * src/insets/insetbib.C (Latex): revert bogus change.
6716 2000-05-16 Juergen Vigna <jug@sad.it>
6718 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6719 the TabularLayout on cursor move.
6721 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6723 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6726 (draw): fixed cursor position and drawing so that the cursor is
6727 visible when before the tabular-inset.
6729 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6730 when creating from old insettext.
6732 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6734 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6736 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6737 * lib/tex/brodway.cls: ditto
6739 * lib/layouts/brodway.layout: change alignment of parenthical
6742 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6744 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6745 versions 0.88 and 0.89 are supported.
6747 2000-05-15 Juergen Vigna <jug@sad.it>
6749 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6752 * src/insets/insettext.C (computeTextRows): redone completely this
6753 function in a much cleaner way, because of problems when having a
6755 (draw): added a frame border when the inset is locked.
6756 (SetDrawLockedFrame): this sets if we draw the border or not.
6757 (SetFrameColor): this sets the frame color (default=insetframe).
6759 * src/insets/lyxinset.h: added x() and y() functions which return
6760 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6761 function which is needed to see if we have a locking inset of some
6762 type in this inset (needed for now in insettabular).
6764 * src/vspace.C (inPixels): the same function also without a BufferView
6765 parameter as so it is easier to use it in some ocasions.
6767 * src/lyxfunc.C: changed all places where insertInset was used so
6768 that now if it couldn't be inserted it is deleted!
6770 * src/TabularLayout.C:
6771 * src/TableLayout.C: added support for new tabular-inset!
6773 * src/BufferView2.C (insertInset): this now returns a bool if the
6774 inset was really inserted!!!
6776 * src/tabular.C (GetLastCellInRow):
6777 (GetFirstCellInRow): new helper functions.
6778 (Latex): implemented for new tabular class.
6782 (TeXTopHLine): new Latex() helper functions.
6784 2000-05-12 Juergen Vigna <jug@sad.it>
6786 * src/mathed/formulamacro.C (Read):
6787 * src/mathed/formula.C (Read): read also the \end_inset here!
6789 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6791 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6792 crush when saving formulae with unbalanced parenthesis.
6794 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6796 * src/layout.C: Add new keyword "endlabelstring" to layout file
6798 * src/text.C (GetVisibleRow): Draw endlabel string.
6800 * lib/layouts/broadway.layout
6801 * lib/layouts/hollywood.layout: Added endlabel for the
6802 Parenthetical layout.
6804 * lib/layouts/heb-article.layout: Do not use slanted font shape
6805 for Theorem like environments.
6807 * src/buffer.C (makeLaTeXFile): Always add "american" to
6808 the UsedLanguages list if document language is RTL.
6810 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6812 * add addendum to README.OS2 and small patch (from SMiyata)
6814 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6816 * many files: correct the calls to ChangeExtension().
6818 * src/support/filetools.C (ChangeExtension): remove the no_path
6819 argument, which does not belong there. Use OnlyFileName() instead.
6821 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6822 files when LaTeXing a non-nice latex file.
6824 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6825 a chain of "if". Return false when deadkeys are not handled.
6827 * src/lyx_main.C (LyX): adapted the code for default bindings.
6829 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6830 bindings for basic functionality (except deadkeys).
6831 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6833 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6834 several methods: handle override_x_deadkeys.
6836 * src/lyxrc.h: remove the "bindings" map, which did not make much
6837 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6839 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6841 * src/lyxfont.C (stateText): use a saner method to determine
6842 whether the font is "default". Seems to fix the crash with DEC
6845 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6847 2000-05-08 Juergen Vigna <jug@sad.it>
6849 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6850 TabularLayoutMenu with mouse-button-3
6851 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6853 * src/TabularLayout.C: added this file for having a Layout for
6856 2000-05-05 Juergen Vigna <jug@sad.it>
6858 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6859 recalculating inset-widths.
6860 (TabularFeatures): activated this function so that I can change
6861 tabular-features via menu.
6863 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6864 that I can test some functions with the Table menu.
6866 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6868 * src/lyxfont.C (stateText): guard against stupid c++libs.
6870 * src/tabular.C: add using std::vector
6871 some whitespace changes, + removed som autogenerated code.
6873 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6875 2000-05-05 Juergen Vigna <jug@sad.it>
6877 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6878 row, columns and cellstructures.
6880 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6882 * lib/lyxrc.example: remove obsolete entries.
6884 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6885 reading of protected_separator for free_spacing.
6887 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6889 * src/text.C (draw): do not display an exclamation mark in the
6890 margin for margin notes. This is confusing, ugly and
6893 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6894 AMS math' is checked.
6896 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6897 name to see whether including the amsmath package is needed.
6899 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6901 * src/paragraph.C (validate): Compute UsedLanguages correctly
6902 (don't insert the american language if it doesn't appear in the
6905 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6906 The argument of \thanks{} command is considered moving argument
6908 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6911 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6913 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6914 for appendix/minipage/depth. The lines can be now both in the footnote
6915 frame, and outside the frame.
6917 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6920 2000-05-05 Juergen Vigna <jug@sad.it>
6922 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6923 neede only in tabular.[Ch].
6925 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6927 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6929 (Write): write '~' for PROTECTED_SEPARATOR
6931 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6933 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6936 * src/mathed/formula.C (drawStr): rename size to siz.
6938 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6939 possibly fix a bug by not changing the pflags = flags to piflags =
6942 2000-05-05 Juergen Vigna <jug@sad.it>
6944 * src/insets/insetbib.C: moved using directive
6946 * src/ImportNoweb.C: small fix for being able to compile (missing
6949 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6951 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6952 to use clear, since we don't depend on this in the code. Add test
6955 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6957 * (various *.C files): add using std::foo directives to please dec
6960 * replace calls to string::clear() to string::erase() (Angus)
6962 * src/cheaders/cmath: modified to provide std::abs.
6964 2000-05-04 Juergen Vigna <jug@sad.it>
6966 * src/insets/insettext.C: Prepared all for inserting of multiple
6967 paragraphs. Still display stuff to do (alignment and other things),
6968 but I would like to use LyXText to do this when we cleaned out the
6969 table-support stuff.
6971 * src/insets/insettabular.C: Changed lot of stuff and added lots
6972 of functionality still a lot to do.
6974 * src/tabular.C: Various functions changed name and moved to be
6975 const functions. Added new Read and Write functions and changed
6976 lots of things so it works good with tabular-insets (also removed
6977 some stuff which is not needed anymore * hacks *).
6979 * src/lyxcursor.h: added operators == and != which just look if
6980 par and pos are (not) equal.
6982 * src/buffer.C (latexParagraphs): inserted this function to latex
6983 all paragraphs form par to endpar as then I can use this too for
6986 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6987 so that I can call this to from text insets with their own cursor.
6989 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6990 output off all paragraphs (because of the fix below)!
6992 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6993 the very last paragraph (this could be also the last paragraph of an
6996 * src/texrow.h: added rows() call which returns the count-variable.
6998 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7000 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7002 * lib/configure.m4: better autodetection of DocBook tools.
7004 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7006 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7008 * src/lyx_cb.C: add using std::reverse;
7010 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7013 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7014 selected files. Should fix repeated errors from generated files.
7016 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7018 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7020 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7021 the spellchecker popup.
7023 * lib/lyxrc.example: Removed the \number_inset section
7025 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7027 * src/insets/figinset.C (various): Use IsFileReadable() to make
7028 sure that the file actually exist. Relying on ghostscripts errors
7029 is a bad idea since they can lead to X server crashes.
7031 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7033 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7036 * lib/lyxrc.example: smallish typo in description of
7037 \view_dvi_paper_option
7039 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7042 * src/lyxfunc.C: doImportHelper to factor out common code of the
7043 various import methods. New functions doImportASCIIasLines,
7044 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7045 doImportLinuxDoc for the format specific parts.
7048 * buffer.C: Dispatch returns now a bool to indicate success
7051 * lyx_gui.C: Add getLyXView() for member access
7053 * lyx_main.C: Change logic for batch commands: First try
7054 Buffer::Dispatch (possibly without GUI), if that fails, use
7057 * lyx_main.C: Add support for --import command line switch.
7058 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7059 Available Formats: Everything accepted by 'buffer-import <format>'
7061 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7063 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7066 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7067 documents will be reformatted upon reentry.
7069 2000-04-27 Juergen Vigna <jug@sad.it>
7071 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7072 correctly only last pos this was a bug.
7074 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7076 * release of lyx-1.1.5pre1
7078 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7080 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7082 * src/menus.C: revert the change of naming (Figure->Graphic...)
7083 from 2000-04-11. It was incomplete and bad.
7085 * src/LColor.[Ch]: add LColor::depthbar.
7086 * src/text.C (GetVisibleRow): use it.
7088 * README: update the languages list.
7090 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7092 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7095 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * README: remove sections that were just wrong.
7099 * src/text2.C (GetRowNearY): remove currentrow code
7101 * src/text.C (GetRow): remove currentrow code
7103 * src/screen.C (Update): rewritten a bit.
7104 (SmallUpdate): removed func
7106 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7108 (FullRebreak): return bool
7109 (currentrow): remove var
7110 (currentrow_y): ditto
7112 * src/lyxscreen.h (Draw): change arg to unsigned long
7113 (FitCursor): return bool
7114 (FitManualCursor): ditto
7115 (Smallpdate): remove func
7116 (first): change to unsigned long
7117 (DrawOneRow): change second arg to long (from long &)
7118 (screen_refresh_y): remove var
7119 (scree_refresh_row): ditto
7121 * src/lyxrow.h: change baseline to usigned int from unsigned
7122 short, this brings some implicit/unsigned issues out in the open.
7124 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7126 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7127 instead of smallUpdate.
7129 * src/lyxcursor.h: change y to unsigned long
7131 * src/buffer.h: don't call updateScrollbar after fitcursor
7133 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7134 where they are used. Removed "\\direction", this was not present
7135 in 1.1.4 and is already obsolete. Commented out some code that I
7136 believe to never be called.
7137 (runLiterate): don't call updateScrollbar after fitCursor
7139 (buildProgram): ditto
7142 * src/WorkArea.h (workWidth): change return val to unsigned
7145 (redraw): remove the button redraws
7146 (setScrollbarValue): change for scrollbar
7147 (getScrollbarValue): change for scrollbar
7148 (getScrollbarBounds): change for scrollbar
7150 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7151 (C_WorkArea_down_cb): removed func
7152 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7153 (resize): change for scrollbar
7154 (setScrollbar): ditto
7155 (setScrollbarBounds): ditto
7156 (setScrollbarIncrements): ditto
7157 (up_cb): removed func
7158 (down_cb): removed func
7159 (scroll_cb): change for scrollbar
7160 (work_area_handler): ditto
7162 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7163 when FitCursor did something.
7164 (updateScrollbar): some unsigned changes
7165 (downCB): removed func
7166 (scrollUpOnePage): removed func
7167 (scrollDownOnePage): remvoed func
7168 (workAreaMotionNotify): don't call screen->FitCursor but use
7169 fitCursor instead. and bool return val
7170 (workAreaButtonPress): ditto
7171 (workAreaButtonRelease): some unsigned changes
7172 (checkInsetHit): ditto
7173 (workAreaExpose): ditto
7174 (update): parts rewritten, comments about the signed char arg added
7175 (smallUpdate): removed func
7176 (cursorPrevious): call needed updateScrollbar
7179 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7182 * src/BufferView.[Ch] (upCB): removed func
7183 (downCB): removed func
7184 (smallUpdate): removed func
7186 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7188 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7189 currentrow, currentrow_y optimization. This did not help a lot and
7190 if we want to do this kind of optimization we should rather use
7191 cursor.row instead of the currentrow.
7193 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7194 buffer spacing and klyx spacing support.
7196 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7198 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7201 2000-04-26 Juergen Vigna <jug@sad.it>
7203 * src/insets/figinset.C: fixes to Lars sstream changes!
7205 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7207 * A lot of files: Added Ascii(ostream &) methods to all inset
7208 classes. Used when exporting to ASCII.
7210 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7211 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7214 * src/text2.C (ToggleFree): Disabled implicit word selection when
7215 there is a change in the language
7217 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7218 no output was generated for end-of-sentence inset.
7220 * src/insets/lyxinset.h
7223 * src/paragraph.C: Removed the insetnumber code
7225 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7227 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7230 no_babel and no_epsfig completely from the file.
7231 (parseSingleLyXformat2Token): add handling for per-paragraph
7232 spacing as written by klyx.
7234 * src/insets/figinset.C: applied patch by Andre. Made it work with
7237 2000-04-20 Juergen Vigna <jug@sad.it>
7239 * src/insets/insettext.C (cutSelection):
7240 (copySelection): Fixed with selection from right to left.
7241 (draw): now the rows are not recalculated at every draw.
7242 (computeTextRows): for now reset the inset-owner here (this is
7243 important for an undo or copy where the inset-owner is not set
7246 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7247 motion to the_locking_inset screen->first was forgotten, this was
7248 not important till we got multiline insets.
7250 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7252 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7253 code seems to be alright (it is code changed by Dekel, and the
7254 intent is indeed that all macros should be defined \protect'ed)
7256 * NEWS: a bit of reorganisation of the new user-visible features.
7258 2000-04-19 Juergen Vigna <jug@sad.it>
7260 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7261 position. Set the inset_owner of the used paragraph so that it knows
7262 that it is inside an inset. Fixed cursor handling with mouse and
7263 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7264 and cleanups to make TextInsets work better.
7266 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7267 Changed parameters of various functions and added LockInsetInInset().
7269 * src/insets/insettext.C:
7271 * src/insets/insetcollapsable.h:
7272 * src/insets/insetcollapsable.C:
7273 * src/insets/insetfoot.h:
7274 * src/insets/insetfoot.C:
7275 * src/insets/insetert.h:
7276 * src/insets/insetert.C: cleaned up the code so that it works now
7277 correctly with insettext.
7279 * src/insets/inset.C:
7280 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7281 that insets in insets are supported right.
7284 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7286 * src/paragraph.C: some small fixes
7288 * src/debug.h: inserted INSETS debug info
7290 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7291 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7293 * src/commandtags.h:
7294 * src/LyXAction.C: insert code for InsetTabular.
7296 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7297 not Button1MotionMask.
7298 (workAreaButtonRelease): send always a InsetButtonRelease event to
7300 (checkInsetHit): some setCursor fixes (always with insets).
7302 * src/BufferView2.C (lockInset): returns a bool now and extended for
7303 locking insets inside insets.
7304 (showLockedInsetCursor): it is important to have the cursor always
7305 before the locked inset.
7306 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7308 * src/BufferView.h: made lockInset return a bool.
7310 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7312 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7313 that is used also internally but can be called as public to have back
7314 a cursor pos which is not set internally.
7315 (SetCursorIntern): Changed to use above function.
7317 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7319 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7324 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7325 patches for things that should be in or should be changed.
7327 * src/* [insetfiles]: change "usigned char fragile" to bool
7328 fragile. There was only one point that could that be questioned
7329 and that is commented in formulamacro.C. Grep for "CHECK".
7331 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7332 (DeleteBuffer): take it out of CutAndPaste and make it static.
7334 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7336 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7337 output the spacing envir commands. Also the new commands used in
7338 the LaTeX output makes the result better.
7340 * src/Spacing.C (writeEnvirBegin): new method
7341 (writeEnvirEnd): new method
7343 2000-04-18 Juergen Vigna <jug@sad.it>
7345 * src/CutAndPaste.C: made textclass a static member of the class
7346 as otherwise it is not accesed right!!!
7348 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7350 * forms/layout_forms.fd
7351 * src/layout_forms.h
7352 * src/layout_forms.C (create_form_form_character)
7353 * src/lyx_cb.C (UserFreeFont)
7354 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7355 documents (in the layout->character popup).
7357 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7359 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7360 \spell_command was in fact not honored (from Kevin Atkinson).
7362 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7365 * src/lyx_gui.h: make lyxViews private (Angus)
7367 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7369 * src/mathed/math_write.C
7370 (MathMatrixInset::Write) Put \protect before \begin{array} and
7371 \end{array} if fragile
7372 (MathParInset::Write): Put \protect before \\ if fragile
7374 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7377 initialization if the LyXColorHandler must be done after the
7378 connections to the XServer has been established.
7380 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7381 get the background pixel from the lyxColorhandler so that the
7382 figures are rendered with the correct background color.
7383 (NextToken): removed functions.
7384 (GetPSSizes): use ifs >> string instead of NextToken.
7386 * src/Painter.[Ch]: the color cache moved out of this file.
7388 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7391 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7393 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7394 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7396 * src/BufferView.C (enterView): new func
7397 (leaveView): new func
7399 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7401 (leaveView): new func, undefines xterm cursor when approp.
7403 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7404 (AllowInput): delete the Workarea cursor handling from this func.
7406 * src/Painter.C (underline): draw a slimer underline in most cases.
7408 * src/lyx_main.C (error_handler): use extern "C"
7410 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7412 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7413 sent directly to me.
7415 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7416 to the list by Dekel.
7418 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7421 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7422 methods from lyx_cb.here.
7424 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7427 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7429 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7430 instead of using current_view directly.
7432 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7434 * src/LyXAction.C (init): add the paragraph-spacing command.
7436 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7438 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7440 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7441 different from the documents.
7443 * src/text.C (SetHeightOfRow): take paragraph spacing into
7444 account, paragraph spacing takes precedence over buffer spacing
7445 (GetVisibleRow): ditto
7447 * src/paragraph.C (writeFile): output the spacing parameter too.
7448 (validate): set the correct features if spacing is used in the
7450 (Clear): set spacing to default
7451 (MakeSameLayout): spacing too
7452 (HasSameLayout): spacing too
7453 (SetLayout): spacing too
7454 (TeXOnePar): output the spacing commands
7456 * src/lyxparagraph.h: added a spacing variable for use with
7457 per-paragraph spacing.
7459 * src/Spacing.h: add a Default spacing and a method to check if
7460 the current spacing is default. also added an operator==
7462 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7465 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7467 * src/lyxserver.C (callback): fix dispatch of functions
7469 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7470 printf() into lyxerr call.
7472 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7475 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7476 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7477 the "Float" from each of the subitems.
7478 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7480 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7481 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7482 documented the change so that the workaround can be nuked later.
7484 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7487 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7489 * src/buffer.C (getLatexName): ditto
7490 (setReadonly): ditto
7492 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7495 avoid some uses of current_view. Added also a bufferParams()
7496 method to get at this.
7498 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7500 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7502 * src/lyxparagraph.[Ch]: removed
7503 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7504 with operators used by lower_bound and
7505 upper_bound in InsetTable's
7506 Make struct InsetTable private again. Used matchpos.
7508 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7510 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7511 document, the language of existing text is changed (unless the
7512 document is multi-lingual)
7514 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7516 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7518 * A lot of files: A rewrite of the Right-to-Left support.
7520 2000-04-10 Juergen Vigna <jug@sad.it>
7522 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7523 misplaced cursor when inset in inset is locked.
7525 * src/insets/insettext.C (LocalDispatch): small fix so that a
7526 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7528 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7529 footnote font should be decreased in size twice when displaying.
7531 * src/insets/insettext.C (GetDrawFont): inserted this function as
7532 the drawing-font may differ from the real paragraph font.
7534 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7535 insets (inset in inset!).
7537 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7538 function here because we don't want footnotes inside footnotes.
7540 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7542 (init): now set the inset_owner in paragraph.C
7543 (LocalDispatch): added some resetPos() in the right position
7546 (pasteSelection): changed to use the new CutAndPaste-Class.
7548 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7549 which tells if it is allowed to insert another inset inside this one.
7551 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7552 SwitchLayoutsBetweenClasses.
7554 * src/text2.C (InsertInset): checking of the new paragraph-function
7556 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7557 is not needed anymore here!
7560 (PasteSelection): redone (also with #ifdef) so that now this uses
7561 the CutAndPaste-Class.
7562 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7565 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7566 from/to text/insets.
7568 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7569 so that the paragraph knows if it is inside an (text)-inset.
7570 (InsertFromMinibuffer): changed return-value to bool as now it
7571 may happen that an inset is not inserted in the paragraph.
7572 (InsertInsetAllowed): this checks if it is allowed to insert an
7573 inset in this paragraph.
7575 (BreakParagraphConservative):
7576 (BreakParagraph) : small change for the above change of the return
7577 value of InsertFromMinibuffer.
7579 * src/lyxparagraph.h: added inset_owner and the functions to handle
7580 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7582 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7584 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7585 functions from BufferView to BufferView::Pimpl to ease maintence.
7587 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7588 correctly. Also use SetCursorIntern instead of SetCursor.
7590 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7593 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7595 * src/WorkArea.C (belowMouse): manually implement below mouse.
7597 * src/*: Add "explicit" on several constructors, I added probably
7598 some unneeded ones. A couple of changes to code because of this.
7600 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7601 implementation and private parts from the users of BufferView. Not
7604 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7605 implementation and private parts from the users of LyXLex. Not
7608 * src/BufferView_pimpl.[Ch]: new files
7610 * src/lyxlex_pimpl.[Ch]: new files
7612 * src/LyXView.[Ch]: some inline functions move out-of-line
7614 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7616 * src/lyxparagraph.h: make struct InsetTable public.
7618 * src/support/lyxstring.h: change lyxstring::difference_type to be
7619 ptrdiff_t. Add std:: modifiers to streams.
7621 * src/font.C: include the <cctype> header, for islower() and
7624 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7626 * src/font.[Ch]: new files. Contains the metric functions for
7627 fonts, takes a LyXFont as parameter. Better separation of concepts.
7629 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7630 changes because of this.
7632 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7634 * src/*: compile with -Winline and move functions that don't
7637 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7640 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7643 (various files changed because of this)
7645 * src/Painter.C (text): fixed the drawing of smallcaps.
7647 * src/lyxfont.[Ch] (drawText): removed unused member func.
7650 * src/*.C: added needed "using" statements and "std::" qualifiers.
7652 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/*.h: removed all use of "using" from header files use
7655 qualifier std:: instead.
7657 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7659 * src/text.C (Backspace): some additional cleanups (we already
7660 know whether cursor.pos is 0 or not).
7662 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7663 automake does not provide one).
7665 * src/bmtable.h: replace C++ comments with C comments.
7667 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7669 * src/screen.C (ShowCursor): Change the shape of the cursor if
7670 the current language is not equal to the language of the document.
7671 (If the cursor change its shape unexpectedly, then you've found a bug)
7673 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7676 * src/insets/insetnumber.[Ch]: New files.
7678 * src/LyXAction.C (init)
7679 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7682 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7684 * src/lyxparagraph.h
7685 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7686 (the vector is kept sorted).
7688 * src/text.C (GetVisibleRow): Draw selection correctly when there
7689 is both LTR and RTL text.
7691 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7692 which is much faster.
7694 * src/text.C (GetVisibleRow and other): Do not draw the last space
7695 in a row if the direction of the last letter is not equal to the
7696 direction of the paragraph.
7698 * src/lyxfont.C (latexWriteStartChanges):
7699 Check that font language is not equal to basefont language.
7700 (latexWriteEndChanges): ditto
7702 * src/lyx_cb.C (StyleReset): Don't change the language while using
7703 the font-default command.
7705 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7706 empty paragraph before a footnote.
7708 * src/insets/insetcommand.C (draw): Increase x correctly.
7710 * src/screen.C (ShowCursor): Change cursor shape if
7711 current language != document language.
7713 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7715 2000-03-31 Juergen Vigna <jug@sad.it>
7717 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7718 (Clone): changed mode how the paragraph-data is copied to the
7719 new clone-paragraph.
7721 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7722 GetInset(pos) with no inset anymore there (in inset UNDO)
7724 * src/insets/insetcommand.C (draw): small fix as here x is
7725 incremented not as much as width() returns (2 before, 2 behind = 4)
7727 2000-03-30 Juergen Vigna <jug@sad.it>
7729 * src/insets/insettext.C (InsetText): small fix in initialize
7730 widthOffset (should not be done in the init() function)
7732 2000-03-29 Amir Karger <karger@lyx.org>
7734 * lib/examples/it_ItemizeBullets.lyx: translation by
7737 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7739 2000-03-29 Juergen Vigna <jug@sad.it>
7741 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7743 * src/insets/insetfoot.C (Clone): small change as for the below
7744 new init function in the text-inset
7746 * src/insets/insettext.C (init): new function as I've seen that
7747 clone did not copy the Paragraph-Data!
7748 (LocalDispatch): Added code so that now we have some sort of Undo
7749 functionality (well actually we HAVE Undo ;)
7751 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7753 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7755 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7758 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7760 * src/main.C: added a runtime check that verifies that the xforms
7761 header used when building LyX and the library used when running
7762 LyX match. Exit with a message if they don't match. This is a
7763 version number check only.
7765 * src/buffer.C (save): Don't allocate memory on the heap for
7766 struct utimbuf times.
7768 * *: some using changes, use iosfwd instead of the real headers.
7770 * src/lyxfont.C use char const * instead of string for the static
7771 strings. Rewrite some functions to use sstream.
7773 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7775 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7778 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7780 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7781 of Geodesy (from Martin Vermeer)
7783 * lib/layouts/svjour.inc: include file for the Springer svjour
7784 class. It can be used to support journals other than JoG.
7786 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7787 Miskiewicz <misiek@pld.org.pl>)
7788 * lib/reLyX/Makefile.am: ditto.
7790 2000-03-27 Juergen Vigna <jug@sad.it>
7792 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7793 also some modifications with operations on selected text.
7795 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7796 problems with clicking on insets (last famous words ;)
7798 * src/insets/insetcommand.C (draw):
7799 (width): Changed to have a bit of space before and after the inset so
7800 that the blinking cursor can be seen (otherwise it was hidden)
7802 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7804 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7805 would not be added to the link list when an installed gettext (not
7806 part of libc) is found.
7808 2000-03-24 Juergen Vigna <jug@sad.it>
7810 * src/insets/insetcollapsable.C (Edit):
7811 * src/mathed/formula.C (InsetButtonRelease):
7812 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7815 * src/BufferView.C (workAreaButtonPress):
7816 (workAreaButtonRelease):
7817 (checkInsetHit): Finally fixed the clicking on insets be handled
7820 * src/insets/insetert.C (Edit): inserted this call so that ERT
7821 insets work always with LaTeX-font
7823 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7825 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7826 caused lyx to startup with no GUI in place, causing in a crash
7827 upon startup when called with arguments.
7829 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7831 * src/FontLoader.C: better initialization of dummyXFontStruct.
7833 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7835 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7836 for linuxdoc and docbook import and export format options.
7838 * lib/lyxrc.example Example of default values for the previous flags.
7840 * src/lyx_cb.C Use those flags instead of the hardwired values for
7841 linuxdoc and docbook export.
7843 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7846 * src/menus.C Added menus entries for the new import/exports formats.
7848 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7850 * src/lyxrc.*: Added support for running without Gui
7853 * src/FontLoader.C: sensible defaults if no fonts are needed
7855 * src/lyx_cb.C: New function ShowMessage (writes either to the
7856 minibuffer or cout in case of no gui
7857 New function AskOverwrite for common stuff
7858 Consequently various changes to call these functions
7860 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7861 wild guess at sensible screen resolution when having no gui
7863 * src/lyxfont.C: no gui, no fonts... set some defaults
7865 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7867 * src/LColor.C: made the command inset background a bit lighter.
7869 2000-03-20 Hartmut Goebel <goebel@noris.net>
7871 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7872 stdstruct.inc. Koma-Script added some title elements which
7873 otherwise have been listed below "bibliography". This split allows
7874 adding title elements to where they belong.
7876 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7877 define the additional title elements and then include
7880 * many other layout files: changed to include stdtitle.inc just
7881 before stdstruct.inc.
7883 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7885 * src/buffer.C: (save) Added the option to store all backup files
7886 in a single directory
7888 * src/lyxrc.[Ch]: Added variable \backupdir_path
7890 * lib/lyxrc.example: Added descriptions of recently added variables
7892 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7893 bibtex inset, not closing the bibtex popup when deleting the inset)
7895 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7897 * src/lyx_cb.C: add a couple using directives.
7899 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7900 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7901 import based on the filename.
7903 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7904 file would be imported at start, if the filename where of a sgml file.
7906 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7908 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7910 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7911 * src/lyxfont.h Replaced the member variable bits.direction by the
7912 member variable lang. Made many changes in other files.
7913 This allows having a multi-lingual document
7915 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7916 that change the current language to <l>.
7917 Removed the command "font-rtl"
7919 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7920 format for Hebrew documents)
7922 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7923 When auto_mathmode is "true", pressing a digit key in normal mode
7924 will cause entering into mathmode.
7925 If auto_mathmode is "rtl" then this behavior will be active only
7926 when writing right-to-left text.
7928 * src/text2.C (InsertStringA) The string is inserted using the
7931 * src/paragraph.C (GetEndLabel) Gives a correct result for
7932 footnote paragraphs.
7934 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7936 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7939 front of PasteParagraph. Never insert a ' '. This should at least
7940 fix some cause for the segfaults that we have been experiencing,
7941 it also fixes backspace behaviour slightly. (Phu!)
7943 * src/support/lstrings.C (compare_no_case): some change to make it
7944 compile with gcc 2.95.2 and stdlibc++-v3
7946 * src/text2.C (MeltFootnoteEnvironment): change type o
7947 first_footnote_par_is_not_empty to bool.
7949 * src/lyxparagraph.h: make text private. Changes in other files
7951 (fitToSize): new function
7952 (setContentsFromPar): new function
7953 (clearContents): new function
7954 (SetChar): new function
7956 * src/paragraph.C (readSimpleWholeFile): deleted.
7958 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7959 the file, just use a simple string instead. Also read the file in
7960 a more maintainable manner.
7962 * src/text2.C (InsertStringA): deleted.
7963 (InsertStringB): deleted.
7965 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7967 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7968 RedoParagraphs from the doublespace handling part, just set status
7969 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7970 done, but perhaps not like this.)
7972 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7974 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7975 character when inserting an inset.
7977 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7979 * src/bufferparams.C (readLanguage): now takes "default" into
7982 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7983 also initialize the toplevel_keymap with the default bindings from
7986 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7988 * all files using lyxrc: have lyxrc as a real variable and not a
7989 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7992 * src/lyxrc.C: remove double call to defaultKeyBindings
7994 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7995 toolbar defauls using lyxlex. Remove enums, structs, functions
7998 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7999 toolbar defaults. Also store default keybindings in a map.
8001 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8002 storing the toolbar defaults without any xforms dependencies.
8004 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8005 applied. Changed to use iterators.
8007 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8009 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8010 systems that don't have LINGUAS set to begin with.
8012 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8014 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8015 the list by Dekel Tsur.
8017 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8019 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8020 * src/insets/form_graphics.C: ditto.
8022 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8024 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8026 * src/bufferparams.C (readLanguage): use the new language map
8028 * src/intl.C (InitKeyMapper): use the new language map
8030 * src/lyx_gui.C (create_forms): use the new language map
8032 * src/language.[Ch]: New files. Used for holding the information
8033 about each language. Now! Use this new language map enhance it and
8034 make it really usable for our needs.
8036 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8038 * screen.C (ShowCursor): Removed duplicate code.
8039 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8040 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8042 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8045 * src/text.C Added TransformChar method. Used for rendering Arabic
8046 text correctly (change the glyphs of the letter according to the
8047 position in the word)
8052 * src/lyxrc.C Added lyxrc command {language_command_begin,
8053 language_command_end,language_command_ltr,language_command_rtl,
8054 language_package} which allows the use of either arabtex or Omega
8057 * src/lyx_gui.C (init)
8059 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8060 to use encoding for menu fonts which is different than the encoding
8063 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8064 do not load the babel package.
8065 To write an English document with Hebrew/Arabic, change the document
8066 language to "english".
8068 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8069 (alphaCounter): changed to return char
8070 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8072 * lib/lyxrc.example Added examples for Hebrew/Arabic
8075 * src/layout.C Added layout command endlabeltype
8077 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8079 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8081 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8083 * src/mathed/math_delim.C (search_deco): return a
8084 math_deco_struct* instead of index.
8086 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * All files with a USE_OSTREAM_ONLY within: removed all code that
8089 was unused when USE_OSTREAM_ONLY is defined.
8091 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8092 of any less. Removed header and using.
8094 * src/text.C (GetVisibleRow): draw the string "Page Break
8095 (top/bottom)" on screen when drawing a pagebreak line.
8097 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8099 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8101 * src/mathed/math_macro.C (draw): do some cast magic.
8104 * src/mathed/math_defs.h: change byte* argument to byte const*.
8106 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8108 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8109 know it is right to return InsetFoot* too, but cxx does not like
8112 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8114 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8116 * src/mathed/math_delim.C: change == to proper assignment.
8118 2000-03-09 Juergen Vigna <jug@sad.it>
8120 * src/insets/insettext.C (setPos): fixed various cursor positioning
8121 problems (via mouse and cursor-keys)
8122 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8123 inset (still a small display problem but it works ;)
8125 * src/insets/insetcollapsable.C (draw): added button_top_y and
8126 button_bottom_y to have correct values for clicking on the inset.
8128 * src/support/lyxalgo.h: commented out 'using std::less'
8130 2000-03-08 Juergen Vigna <jug@sad.it>
8132 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8133 Button-Release event closes as it is alos the Release-Event
8136 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8138 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8140 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8141 can add multiple spaces in Scrap (literate programming) styles...
8142 which, by the way, is how I got hooked on LyX to begin with.
8144 * src/mathed/formula.C (Write): Added dummy variable to an
8145 inset::Latex() call.
8146 (Latex): Add free_spacing boolean to inset::Latex()
8148 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8150 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8151 virtual function to include the free_spacing boolean from
8152 the containing paragraph's style.
8154 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8155 Added free_spacing boolean arg to match inset.h
8157 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8158 Added free_spacing boolean arg to match inset.h
8160 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8161 Added free_spacing boolean and made sure that if in a free_spacing
8162 paragraph, that we output normal space if there is a protected space.
8164 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8165 Added free_spacing boolean arg to match inset.h
8167 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8168 Added free_spacing boolean arg to match inset.h
8170 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8171 Added free_spacing boolean arg to match inset.h
8173 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8174 Added free_spacing boolean arg to match inset.h
8176 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8177 Added free_spacing boolean arg to match inset.h
8179 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8180 free_spacing boolean arg to match inset.h
8182 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8183 Added free_spacing boolean arg to match inset.h
8185 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8186 Added free_spacing boolean arg to match inset.h
8188 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8189 Added free_spacing boolean arg to match inset.h
8191 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8192 Added free_spacing boolean arg to match inset.h
8194 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8195 Added free_spacing boolean arg to match inset.h
8197 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8198 free_spacing boolean arg to match inset.h
8200 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8201 free_spacing boolean arg to match inset.h
8203 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8204 ignore free_spacing paragraphs. The user's spaces are left
8207 * src/text.C (InsertChar): Fixed the free_spacing layout
8208 attribute behavior. Now, if free_spacing is set, you can
8209 add multiple spaces in a paragraph with impunity (and they
8210 get output verbatim).
8211 (SelectSelectedWord): Added dummy argument to inset::Latex()
8214 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8217 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8218 paragraph layouts now only input a simple space instead.
8219 Special character insets don't make any sense in free-spacing
8222 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8223 hard-spaces in the *input* file to simple spaces if the layout
8224 is free-spacing. This converts old files which had to have
8225 hard-spaces in free-spacing layouts where a simple space was
8227 (writeFileAscii): Added free_spacing check to pass to the newly
8228 reworked inset::Latex(...) methods. The inset::Latex() code
8229 ensures that hard-spaces in free-spacing paragraphs get output
8230 as spaces (rather than "~").
8232 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8234 * src/mathed/math_delim.C (draw): draw the empty placeholder
8235 delims with a onoffdash line.
8236 (struct math_deco_compare): struct that holds the "functors" used
8237 for the sort and the binary search in math_deco_table.
8238 (class init_deco_table): class used for initial sort of the
8240 (search_deco): use lower_bound to do a binary search in the
8243 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8245 * src/lyxrc.C: a small secret thingie...
8247 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8248 and to not flush the stream as often as it used to.
8250 * src/support/lyxalgo.h: new file
8251 (sorted): template function used for checking if a sequence is
8252 sorted or not. Two versions with and without user supplied
8253 compare. Uses same compare as std::sort.
8255 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8256 it and give warning on lyxerr.
8258 (struct compare_tags): struct with function operators used for
8259 checking if sorted, sorting and lower_bound.
8260 (search_kw): use lower_bound instead of manually implemented
8263 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8265 * src/insets/insetcollapsable.h: fix Clone() declaration.
8266 * src/insets/insetfoot.h: ditto.
8268 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8270 2000-03-08 Juergen Vigna <jug@sad.it>
8272 * src/insets/lyxinset.h: added owner call which tells us if
8273 this inset is inside another inset. Changed also the return-type
8274 of Editable to an enum so it tells clearer what the return-value is.
8276 * src/insets/insettext.C (computeTextRows): fixed computing of
8277 textinsets which split automatically on more rows.
8279 * src/insets/insetert.[Ch]: changed this to be of BaseType
8282 * src/insets/insetfoot.[Ch]: added footnote inset
8284 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8285 collapsable insets (like footnote, ert, ...)
8287 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8289 * src/lyxdraw.h: remvoe file
8291 * src/lyxdraw.C: remove file
8293 * src/insets/insettext.C: added <algorithm>.
8295 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8297 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8298 (matrix_cb): case MM_OK use string stream
8300 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8303 * src/mathed/math_macro.C (draw): use string stream
8304 (Metrics): use string stream
8306 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8307 directly to the ostream.
8309 * src/vspace.C (asString): use string stream.
8310 (asString): use string stream
8311 (asLatexString): use string stream
8313 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8314 setting Spacing::Other.
8316 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8317 sprintf when creating the stretch vale.
8319 * src/text2.C (alphaCounter): changed to return a string and to
8320 not use a static variable internally. Also fixed a one-off bug.
8321 (SetCounter): changed the drawing of the labels to use string
8322 streams instead of sprintf.
8324 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8325 manipulator to use a scheme that does not require library support.
8326 This is also the way it is done in the new GNU libstdc++. Should
8327 work with DEC cxx now.
8329 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8332 end. This fixes a bug.
8334 * src/mathed (all files concerned with file writing): apply the
8335 USE_OSTREAM_ONLY changes to mathed too.
8337 * src/support/DebugStream.h: make the constructor explicit.
8339 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8340 count and ostream squashed.
8342 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8344 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8346 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8347 ostringstream uses STL strings, and we might not.
8349 * src/insets/insetspecialchar.C: add using directive.
8350 * src/insets/insettext.C: ditto.
8352 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8354 * lib/layouts/seminar.layout: feeble attempt at a layout for
8355 seminar.cls, far from completet and could really use some looking
8356 at from people used to write layout files.
8358 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8359 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8360 a lot nicer and works nicely with ostreams.
8362 * src/mathed/formula.C (draw): a slightly different solution that
8363 the one posted to the list, but I think this one works too. (font
8364 size wrong in headers.)
8366 * src/insets/insettext.C (computeTextRows): some fiddling on
8367 Jürgens turf, added some comments that he should read.
8369 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8370 used and it gave compiler warnings.
8371 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8374 * src/lyx_gui.C (create_forms): do the right thing when
8375 show_banner is true/false.
8377 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8378 show_banner is false.
8380 * most file writing files: Now use iostreams to do almost all of
8381 the writing. Also instead of passing string &, we now use
8382 stringstreams. mathed output is still not adapted to iostreams.
8383 This change can be turned off by commenting out all the occurences
8384 of the "#define USE_OSTREAM_ONLY 1" lines.
8386 * src/WorkArea.C (createPixmap): don't output debug messages.
8387 (WorkArea): don't output debug messages.
8389 * lib/lyxrc.example: added a comment about the new variable
8392 * development/Code_rules/Rules: Added some more commente about how
8393 to build class interfaces and on how better encapsulation can be
8396 2000-03-03 Juergen Vigna <jug@sad.it>
8398 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8399 automatically with the width of the LyX-Window
8401 * src/insets/insettext.C (computeTextRows): fixed update bug in
8402 displaying text-insets (scrollvalues where not initialized!)
8404 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8406 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8407 id in the check of the result from lower_bound is not enough since
8408 lower_bound can return last too, and then res->id will not be a
8411 * all insets and some code that use them: I have conditionalized
8412 removed the Latex(string & out, ...) this means that only the
8413 Latex(ostream &, ...) will be used. This is a work in progress to
8414 move towards using streams for all output of files.
8416 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8419 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8421 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8422 routine (this fixes bug where greek letters were surrounded by too
8425 * src/support/filetools.C (findtexfile): change a bit the search
8426 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8427 no longer passed to kpsewhich, we may have to change that later.
8429 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8430 warning options to avoid problems with X header files (from Angus
8432 * acinclude.m4: regenerated.
8434 2000-03-02 Juergen Vigna <jug@sad.it>
8436 * src/insets/insettext.C (WriteParagraphData): Using the
8437 par->writeFile() function for writing paragraph-data.
8438 (Read): Using buffer->parseSingleLyXformat2Token()-function
8439 for parsing paragraph data!
8441 * src/buffer.C (readLyXformat2): removed all parse data and using
8442 the new parseSingleLyXformat2Token()-function.
8443 (parseSingleLyXformat2Token): added this function to parse (read)
8444 lyx-file-format (this is called also from text-insets now!)
8446 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8448 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8451 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8452 directly instead of going through a func. One very bad thing: a
8453 static LyXFindReplace, but I don't know where to place it.
8455 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8456 string instead of char[]. Also changed to static.
8457 (GetSelectionOrWordAtCursor): changed to static inline
8458 (SetSelectionOverLenChars): ditto.
8460 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8461 current_view and global variables. both classes has changed names
8462 and LyXFindReplace is not inherited from SearchForm.
8464 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8465 fl_form_search form.
8467 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8469 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8471 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8472 bound (from Kayvan).
8474 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8476 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8478 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8480 * some things that I should comment but the local pub says head to
8483 * comment out all code that belongs to the Roff code for Ascii
8484 export of tables. (this is unused)
8486 * src/LyXView.C: use correct type for global variable
8487 current_layout. (LyXTextClass::size_type)
8489 * some code to get the new insetgraphics closer to working I'd be
8490 grateful for any help.
8492 * src/BufferView2.C (insertInset): use the return type of
8493 NumberOfLayout properly. (also changes in other files)
8495 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8496 this as a test. I want to know what breaks because of this.
8498 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8500 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8502 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8503 to use a \makebox in the label, this allows proper justification
8504 with out using protected spaces or multiple hfills. Now it is
8505 "label" for left justified, "\hfill label\hfill" for center, and
8506 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8507 should be changed accordingly.
8509 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8511 * src/lyxtext.h: change SetLayout() to take a
8512 LyXTextClass::size_type instead of a char (when there is more than
8513 127 layouts in a class); also change type of copylayouttype.
8514 * src/text2.C (SetLayout): ditto.
8515 * src/LyXView.C (updateLayoutChoice): ditto.
8517 * src/LaTeX.C (scanLogFile): errors where the line number was not
8518 given just after the '!'-line were ignored (from Dekel Tsur).
8520 * lib/lyxrc.example: fix description of \date_insert_format
8522 * lib/layouts/llncs.layout: new layout, contributed by Martin
8525 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8527 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8528 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8529 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8530 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8531 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8532 paragraph.C, text.C, text2.C)
8534 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8536 * src/insets/insettext.C (LocalDispatch): remove extra break
8539 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8540 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8542 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8543 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8545 * src/insets/insetbib.h: move InsetBibkey::Holder and
8546 InsetCitation::Holder in public space.
8548 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8550 * src/insets/insettext.h: small change to get the new files from
8551 Juergen to compile (use "string", not "class string").
8553 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8554 const & as parameter to LocalDispatch, use LyXFont const & as
8555 paramter to some other func. This also had impacto on lyxinsets.h
8556 and the two mathed insets.
8558 2000-02-24 Juergen Vigna <jug@sad.it>
8561 * src/commandtags.h:
8563 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8567 * src/BufferView2.C: added/updated code for various inset-functions
8569 * src/insets/insetert.[Ch]: added implementation of InsetERT
8571 * src/insets/insettext.[Ch]: added implementation of InsetText
8573 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8574 (draw): added preliminary code for inset scrolling not finshed yet
8576 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8577 as it is in lyxfunc.C now
8579 * src/insets/lyxinset.h: Added functions for text-insets
8581 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8584 BufferView and reimplement the list as a queue put inside its own
8587 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8589 * several files: use the new interface to the "updateinsetlist"
8591 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8593 (work_area_handler): call BufferView::trippleClick on trippleclick.
8595 * src/BufferView.C (doubleClick): new function, selects word on
8597 (trippleClick): new function, selects line on trippleclick.
8599 2000-02-22 Allan Rae <rae@lyx.org>
8601 * lib/bind/xemacs.bind: buffer-previous not supported
8603 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8605 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8608 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8610 * src/bufferlist.C: get rid of current_view from this file
8612 * src/spellchecker.C: get rid of current_view from this file
8614 * src/vspace.C: get rid of current_view from this file
8615 (inPixels): added BufferView parameter for this func
8616 (asLatexCommand): added a BufferParams for this func
8618 * src/text.C src/text2.C: get rid of current_view from these
8621 * src/lyxfont.C (getFontDirection): move this function here from
8624 * src/bufferparams.C (getDocumentDirection): move this function
8627 * src/paragraph.C (getParDirection): move this function here from
8629 (getLetterDirection): ditto
8631 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8633 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8634 resize due to wrong pixmap beeing used. Also took the opurtunity
8635 to make the LyXScreen stateless on regard to WorkArea and some
8636 general cleanup in the same files.
8638 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8640 * src/Makefile.am: add missing direction.h
8642 * src/PainterBase.h: made the width functions const.
8644 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8647 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8649 * src/insets/insetlatexaccent.C (draw): make the accents draw
8650 better, at present this will only work well with iso8859-1.
8652 * several files: remove the old drawing code, now we use the new
8655 * several files: remove support for mono_video, reverse_video and
8658 2000-02-17 Juergen Vigna <jug@sad.it>
8660 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8661 int ** as we have to return the pointer, otherwise we have only
8662 NULL pointers in the returning function.
8664 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8666 * src/LaTeX.C (operator()): quote file name when running latex.
8668 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8670 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8671 (bubble tip), this removes our special handling of this.
8673 * Remove all code that is unused now that we have the new
8674 workarea. (Code that are not active when NEW_WA is defined.)
8676 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8678 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8680 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8681 nonexisting layout; correctly redirect obsoleted layouts.
8683 * lib/lyxrc.example: document \view_dvi_paper_option
8685 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8688 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8689 (PreviewDVI): handle the view_dvi_paper_option variable.
8690 [Both from Roland Krause]
8692 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8694 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8695 char const *, int, LyXFont)
8696 (text(int, int, string, LyXFont)): ditto
8698 * src/text.C (InsertCharInTable): attempt to fix the double-space
8699 feature in tables too.
8700 (BackspaceInTable): ditto.
8701 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8703 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8707 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8708 newly found text in textcache to this.
8709 (buffer): set the owner of the text put into the textcache to 0
8711 * src/insets/figinset.C (draw): fixed the drawing of figures with
8714 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8715 drawing of mathframe, hfills, protected space, table lines. I have
8716 now no outstanding drawing problems with the new Painter code.
8718 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8720 * src/PainterBase.C (ellipse, circle): do not specify the default
8723 * src/LColor.h: add using directive.
8725 * src/Painter.[Ch]: change return type of methods from Painter& to
8726 PainterBase&. Add a using directive.
8728 * src/WorkArea.C: wrap xforms callbacks in C functions
8731 * lib/layouts/foils.layout: font fix and simplifications from Carl
8734 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * a lot of files: The Painter, LColor and WorkArea from the old
8737 devel branch has been ported to lyx-devel. Some new files and a
8738 lot of #ifdeffed code. The new workarea is enabled by default, but
8739 if you want to test the new Painter and LColor you have to compile
8740 with USE_PAINTER defined (do this in config.h f.ex.) There are
8741 still some rought edges, and I'd like some help to clear those
8742 out. It looks stable (loads and displays the Userguide very well).
8745 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8747 * src/buffer.C (pop_tag): revert to the previous implementation
8748 (use a global variable for both loops).
8750 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8752 * src/lyxrc.C (LyXRC): change slightly default date format.
8754 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8755 there is an English text with a footnote that starts with a Hebrew
8756 paragraph, or vice versa.
8757 (TeXFootnote): ditto.
8759 * src/text.C (LeftMargin): allow for negative values for
8760 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8763 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8764 for input encoding (cyrillic)
8766 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8768 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8771 * src/toolbar.C (set): ditto
8772 * src/insets/insetbib.C (create_form_citation_form): ditto
8774 * lib/CREDITS: added Dekel Tsur.
8776 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8777 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8778 hebrew supports files from Dekel Tsur.
8780 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8781 <tzafrir@technion.ac.il>
8783 * src/lyxrc.C: put \date_insert_format at the right place.
8785 * src/buffer.C (makeLaTeXFile): fix the handling of
8786 BufferParams::sides when writing out latex files.
8788 * src/BufferView2.C: add a "using" directive.
8790 * src/support/lyxsum.C (sum): when we use lyxstring,
8791 ostringstream::str needs an additional .c_str().
8793 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * src/support/filetools.C (ChangeExtension): patch from Etienne
8798 * src/TextCache.C (show): remove const_cast and make second
8799 parameter non-const LyXText *.
8801 * src/TextCache.h: use non const LyXText in show.
8803 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8806 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8808 * src/support/lyxsum.C: rework to be more flexible.
8810 * several places: don't check if a pointer is 0 if you are going
8813 * src/text.C: remove some dead code.
8815 * src/insets/figinset.C: remove some dead code
8817 * src/buffer.C: move the BufferView funcs to BufferView2.C
8818 remove all support for insetlatexdel
8819 remove support for oldpapersize stuff
8820 made some member funcs const
8822 * src/kbmap.C: use a std::list to store the bindings in.
8824 * src/BufferView2.C: new file
8826 * src/kbsequence.[Ch]: new files
8828 * src/LyXAction.C + others: remove all trace of buffer-previous
8830 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8831 only have one copy in the binary of this table.
8833 * hebrew patch: moved some functions from LyXText to more
8834 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8836 * several files: remove support for XForms older than 0.88
8838 remove some #if 0 #endif code
8840 * src/TextCache.[Ch]: new file. Holds the textcache.
8842 * src/BufferView.C: changes to use the new TextCache interface.
8843 (waitForX): remove the now unused code.
8845 * src/BackStack.h: remove some commented code
8847 * lib/bind/emacs.bind: remove binding for buffer-previous
8849 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8851 * applied the hebrew patch.
8853 * src/lyxrow.h: make sure that all Row variables are initialized.
8855 * src/text2.C (TextHandleUndo): comment out a delete, this might
8856 introduce a memory leak, but should also help us to not try to
8857 read freed memory. We need to look at this one.
8859 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8860 (LyXParagraph): initalize footnotekind.
8862 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8863 forgot this when applying the patch. Please heed the warnings.
8865 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8866 (aka. reformat problem)
8868 * src/bufferlist.C (exists): made const, and use const_iterator
8869 (isLoaded): new func.
8870 (release): use std::find to find the correct buffer.
8872 * src/bufferlist.h: made getState a const func.
8873 made empty a const func.
8874 made exists a const func.
8877 2000-02-01 Juergen Vigna <jug@sad.it>
8879 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8881 * po/it.po: updated a bit the italian po file and also changed the
8882 'file nuovo' for newfile to 'filenuovo' without a space, this did
8885 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8886 for the new insert_date command.
8888 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8889 from jdblair, to insert a date into the current text conforming to
8890 a strftime format (for now only considering the locale-set and not
8891 the document-language).
8893 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8895 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8896 Bounds Read error seen by purify. The problem was that islower is
8897 a macros which takes an unsigned char and uses it as an index for
8898 in array of characters properties (and is thus subject to the
8902 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8903 correctly the paper sides radio buttons.
8904 (UpdateDocumentButtons): ditto.
8906 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/kbmap.C (getsym + others): change to return unsigned int,
8909 returning a long can give problems on 64 bit systems. (I assume
8910 that int is 32bit on 64bit systems)
8912 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8914 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8915 LyXLookupString to be zero-terminated. Really fixes problems seen
8918 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8921 write a (char*)0 to the lyxerr stream.
8923 * src/lastfiles.C: move algorithm before the using statemets.
8925 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8927 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8928 complains otherwise).
8929 * src/table.C: ditto
8931 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8934 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8935 that I removed earlier... It is really needed.
8937 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8939 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8941 * INSTALL: update xforms home page URL.
8943 * lib/configure.m4: fix a bug with unreadable layout files.
8945 * src/table.C (calculate_width_of_column): add "using std::max"
8948 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8950 * several files: marked several lines with "DEL LINE", this is
8951 lines that can be deleted without changing anything.
8952 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8953 checks this anyway */
8956 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8958 * src/DepTable.C (update): add a "+" at the end when the checksum
8959 is different. (debugging string only)
8961 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8962 the next inset to not be displayed. This should also fix the list
8963 of labels in the "Insert Crossreference" dialog.
8965 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8967 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8968 when regex was not found.
8970 * src/support/lstrings.C (lowercase): use handcoded transform always.
8973 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8974 old_cursor.par->prev could be 0.
8976 * several files: changed post inc/dec to pre inc/dec
8978 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8979 write the lastfiles to file.
8981 * src/BufferView.C (buffer): only show TextCache info when debugging
8983 (resizeCurrentBuffer): ditto
8984 (workAreaExpose): ditto
8986 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8988 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8990 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8991 a bit better by removing the special case for \i and \j.
8993 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8995 * src/lyx_main.C (easyParse): remove test for bad comand line
8996 options, since this broke all xforms-related parsing.
8998 * src/kbmap.C (getsym): set return type to unsigned long, as
8999 declared in header. On an alpha, long is _not_ the same as int.
9001 * src/support/LOstream.h: add a "using std::flush;"
9003 * src/insets/figinset.C: ditto.
9005 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9007 * src/bufferlist.C (write): use blinding fast file copy instead of
9008 "a char at a time", now we are doing it the C++ way.
9010 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9011 std::list<int> instead.
9012 (addpidwait): reflect move to std::list<int>
9013 (sigchldchecker): ditto
9015 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9018 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9019 that obviously was wrong...
9021 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9022 c, this avoids warnings with purify and islower.
9024 * src/insets/figinset.C: rename struct queue to struct
9025 queue_element and rewrite to use a std::queue. gsqueue is now a
9026 std::queue<queue_element>
9027 (runqueue): reflect move to std::queue
9030 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9031 we would get "1" "0" instead of "true" "false. Also make the tostr
9034 2000-01-21 Juergen Vigna <jug@sad.it>
9036 * src/buffer.C (writeFileAscii): Disabled code for special groff
9037 handling of tabulars till I fix this in table.C
9039 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9041 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9043 * src/support/lyxlib.h: ditto.
9045 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9048 and 'j' look better. This might fix the "macron" bug that has been
9051 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9052 functions as one template function. Delete the old versions.
9054 * src/support/lyxsum.C: move using std::ifstream inside
9057 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9060 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9062 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9064 * src/insets/figinset.C (InitFigures): use new instead of malloc
9065 to allocate memory for figures and bitmaps.
9066 (DoneFigures): use delete[] instead of free to deallocate memory
9067 for figures and bitmaps.
9068 (runqueue): use new to allocate
9069 (getfigdata): use new/delete[] instead of malloc/free
9070 (RegisterFigure): ditto
9072 * some files: moved some declarations closer to first use, small
9073 whitespace changes use preincrement instead of postincrement where
9074 it does not make a difference.
9076 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9077 step on the way to use stl::containers for key maps.
9079 * src/bufferlist.h: add a typedef for const_iterator and const
9080 versions of begin and end.
9082 * src/bufferlist.[Ch]: change name of member variable _state to
9083 state_. (avoid reserved names)
9085 (getFileNames): returns the filenames of the buffers in a vector.
9087 * configure.in (ALL_LINGUAS): added ro
9089 * src/support/putenv.C: new file
9091 * src/support/mkdir.C: new file
9093 2000-01-20 Allan Rae <rae@lyx.org>
9095 * lib/layouts/IEEEtran.layout: Added several theorem environments
9097 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9098 couple of minor additions.
9100 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9101 (except for those in footnotes of course)
9103 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9105 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9107 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9108 std::sort and std::lower_bound instead of qsort and handwritten
9110 (struct compara): struct that holds the functors used by std::sort
9111 and std::lower_bound in MathedLookupBOP.
9113 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9115 * src/support/LAssert.h: do not do partial specialization. We do
9118 * src/support/lyxlib.h: note that lyx::getUserName() and
9119 lyx::date() are not in use right now. Should these be suppressed?
9121 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9122 (makeLinuxDocFile): do not put date and user name in linuxdoc
9125 * src/support/lyxlib.h (kill): change first argument to long int,
9126 since that's what solaris uses.
9128 * src/support/kill.C (kill): fix declaration to match prototype.
9130 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9131 actually check whether namespaces are supported. This is not what
9134 * src/support/lyxsum.C: add a using directive.
9136 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9138 * src/support/kill.C: if we have namespace support we don't have
9139 to include lyxlib.h.
9141 * src/support/lyxlib.h: use namespace lyx if supported.
9143 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9145 * src/support/date.C: new file
9147 * src/support/chdir.C: new file
9149 * src/support/getUserName.C: new file
9151 * src/support/getcwd.C: new file
9153 * src/support/abort.C: new file
9155 * src/support/kill.C: new file
9157 * src/support/lyxlib.h: moved all the functions in this file
9158 insede struct lyx. Added also kill and abort to this struct. This
9159 is a way to avoid the "kill is not defined in <csignal>", we make
9160 C++ wrappers for functions that are not ANSI C or ANSI C++.
9162 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9163 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9164 lyx it has been renamed to sum.
9166 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9168 * src/text.C: add using directives for std::min and std::max.
9170 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9172 * src/texrow.C (getIdFromRow): actually return something useful in
9173 id and pos. Hopefully fixes the bug with positionning of errorbox
9176 * src/lyx_main.C (easyParse): output an error and exit if an
9177 incorrect command line option has been given.
9179 * src/spellchecker.C (ispell_check_word): document a memory leak.
9181 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9182 where a "struct utimbuf" is allocated with "new" and deleted with
9185 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9187 * src/text2.C (CutSelection): don't delete double spaces.
9188 (PasteSelection): ditto
9189 (CopySelection): ditto
9191 * src/text.C (Backspace): don't delete double spaces.
9193 * src/lyxlex.C (next): fix a bug that were only present with
9194 conformant std::istream::get to read comment lines, use
9195 std::istream::getline instead. This seems to fix the problem.
9197 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9199 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9200 allowed to insert space before space" editing problem. Please read
9201 commends at the beginning of the function. Comments about usage
9204 * src/text.C (InsertChar): fix for the "not allowed to insert
9205 space before space" editing problem.
9207 * src/text2.C (DeleteEmptyParagraphMechanism): when
9208 IsEmptyTableRow can only return false this last "else if" will
9209 always be a no-op. Commented out.
9211 * src/text.C (RedoParagraph): As far as I can understand tmp
9212 cursor is not really needed.
9214 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9215 present it could only return false anyway.
9216 (several functions): Did something not so smart...added a const
9217 specifier on a lot of methods.
9219 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9220 and add a tmp->text.resize. The LyXParagraph constructor does the
9222 (BreakParagraphConservative): ditto
9224 * src/support/path.h (Path): add a define so that the wrong usage
9225 "Path("/tmp") will be flagged as a compilation error:
9226 "`unnamed_Path' undeclared (first use this function)"
9228 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9230 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9231 which was bogus for several reasons.
9233 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9237 * autogen.sh: do not use "type -path" (what's that anyway?).
9239 * src/support/filetools.C (findtexfile): remove extraneous space
9240 which caused a kpsewhich warning (at least with kpathsea version
9243 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9245 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9247 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9249 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9251 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9253 * src/paragraph.C (BreakParagraph): do not reserve space on text
9254 if we don't need to (otherwise, if pos_end < pos, we end up
9255 reserving huge amounts of memory due to bad unsigned karma).
9256 (BreakParagraphConservative): ditto, although I have not seen
9257 evidence the bug can happen here.
9259 * src/lyxparagraph.h: add a using std::list.
9261 2000-01-11 Juergen Vigna <jug@sad.it>
9263 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9266 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9268 * src/vc-backend.C (doVCCommand): change to be static and take one
9269 more parameter: the path to chdir too be fore executing the command.
9270 (retrive): new function equiv to "co -r"
9272 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9273 file_not_found_hook is true.
9275 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9277 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9278 if a file is readwrite,readonly...anything else.
9280 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9282 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9283 (CreatePostscript): name change from MenuRunDVIPS (or something)
9284 (PreviewPostscript): name change from MenuPreviewPS
9285 (PreviewDVI): name change from MenuPreviewDVI
9287 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9288 \view_pdf_command., \pdf_to_ps_command
9290 * lib/configure.m4: added search for PDF viewer, and search for
9291 PDF to PS converter.
9292 (lyxrc.defaults output): add \pdflatex_command,
9293 \view_pdf_command and \pdf_to_ps_command.
9295 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9297 * src/bufferlist.C (write): we don't use blocksize for anything so
9300 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9302 * src/support/block.h: disable operator T* (), since it causes
9303 problems with both compilers I tried. See comments in the file.
9305 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9308 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9309 variable LYX_DIR_10x to LYX_DIR_11x.
9311 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9313 * INSTALL: document --with-lyxname.
9316 * configure.in: new configure flag --with-lyxname which allows to
9317 choose the name under which lyx is installed. Default is "lyx", of
9318 course. It used to be possible to do this with --program-suffix,
9319 but the later has in fact a different meaning for autoconf.
9321 * src/support/lstrings.h (lstrchr): reformat a bit.
9323 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9324 * src/mathed/math_defs.h: ditto.
9326 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9328 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9329 true, decides if we create a backup file or not when saving. New
9330 tag and variable \pdf_mode, defaults to false. New tag and
9331 variable \pdflatex_command, defaults to pdflatex. New tag and
9332 variable \view_pdf_command, defaults to xpdf. New tag and variable
9333 \pdf_to_ps_command, defaults to pdf2ps.
9335 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9337 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9338 does not have a BufferView.
9339 (unlockInset): ditto + don't access the_locking_inset if the
9340 buffer does not have a BufferView.
9342 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9343 certain circumstances so that we don't continue a keyboard
9344 operation long after the key was released. Try f.ex. to load a
9345 large document, press PageDown for some seconds and then release
9346 it. Before this change the document would contine to scroll for
9347 some time, with this change it stops imidiatly.
9349 * src/support/block.h: don't allocate more space than needed. As
9350 long as we don't try to write to the arr[x] in a array_type arr[x]
9351 it is perfectly ok. (if you write to it you might segfault).
9352 added operator value_type*() so that is possible to pass the array
9353 to functions expecting a C-pointer.
9355 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9358 * intl/*: updated to gettext 0.10.35, tried to add our own
9359 required modifications. Please verify.
9361 * po/*: updated to gettext 0.10.35, tried to add our own required
9362 modifications. Please verify.
9364 * src/support/lstrings.C (tostr): go at fixing the problem with
9365 cxx and stringstream. When stringstream is used return
9366 oss.str().c_str() so that problems with lyxstring and basic_string
9367 are avoided. Note that the best solution would be for cxx to use
9368 basic_string all the way, but it is not conformant yet. (it seems)
9370 * src/lyx_cb.C + other files: moved several global functions to
9371 class BufferView, some have been moved to BufferView.[Ch] others
9372 are still located in lyx_cb.C. Code changes because of this. (part
9373 of "get rid of current_view project".)
9375 * src/buffer.C + other files: moved several Buffer functions to
9376 class BufferView, the functions are still present in buffer.C.
9377 Code changes because of this.
9379 * config/lcmessage.m4: updated to most recent. used when creating
9382 * config/progtest.m4: updated to most recent. used when creating
9385 * config/gettext.m4: updated to most recent. applied patch for
9388 * config/gettext.m4.patch: new file that shows what changes we
9389 have done to the local copy of gettext.m4.
9391 * config/libtool.m4: new file, used in creation of acinclude.m4
9393 * config/lyxinclude.m4: new file, this is the lyx created m4
9394 macros, used in making acinclude.m4.
9396 * autogen.sh: GNU m4 discovered as a separate task not as part of
9397 the lib/configure creation.
9398 Generate acinlucde from files in config. Actually cat
9399 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9400 easier to upgrade .m4 files that really are external.
9402 * src/Spacing.h: moved using std::istringstream to right after
9403 <sstream>. This should fix the problem seen with some compilers.
9405 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9407 * src/lyx_cb.C: began some work to remove the dependency a lot of
9408 functions have on BufferView::text, even if not really needed.
9409 (GetCurrentTextClass): removed this func, it only hid the
9412 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9413 forgot this in last commit.
9415 * src/Bullet.C (bulletEntry): use static char const *[] for the
9416 tables, becuase of this the return arg had to change to string.
9418 (~Bullet): removed unneeded destructor
9420 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9421 (insetSleep): moved from Buffer
9422 (insetWakeup): moved from Buffer
9423 (insetUnlock): moved from Buffer
9425 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9426 from Buffer to BufferView.
9428 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9430 * config/ltmain.sh: updated to version 1.3.4 of libtool
9432 * config/ltconfig: updated to version 1.3.4 of libtool
9434 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9437 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9438 Did I get that right?
9440 * src/lyxlex.h: add a "using" directive or two.
9441 * src/Spacing.h: ditto.
9442 * src/insets/figinset.C: ditto.
9443 * src/support/filetools.C: ditto.
9444 * src/support/lstrings.C: ditto.
9445 * src/BufferView.C: ditto.
9446 * src/bufferlist.C: ditto.
9447 * src/lyx_cb.C: ditto.
9448 * src/lyxlex.C: ditto.
9450 * NEWS: add some changes for 1.1.4.
9452 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9454 * src/BufferView.C: first go at a TextCache to speed up switching
9457 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9459 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9460 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9461 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9462 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9465 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9466 members of the struct are correctly initialized to 0 (detected by
9468 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9469 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9471 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9472 pidwait, since it was allocated with "new". This was potentially
9473 very bad. Thanks to Michael Schmitt for running purify for us.
9476 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9478 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9480 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9482 1999-12-30 Allan Rae <rae@lyx.org>
9484 * lib/templates/IEEEtran.lyx: minor change
9486 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9487 src/mathed/formula.C (LocalDispatch): askForText changes
9489 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9490 know when a user has cancelled input. Fixes annoying problems with
9491 inserting labels and version control.
9493 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9495 * src/support/lstrings.C (tostr): rewritten to use strstream and
9498 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9500 * src/support/filetools.C (IsFileWriteable): use fstream to check
9501 (IsDirWriteable): use fileinfo to check
9503 * src/support/filetools.h (FilePtr): whole class deleted
9505 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9507 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9509 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9511 * src/bufferlist.C (write): use ifstream and ofstream instead of
9514 * src/Spacing.h: use istrstream instead of sscanf
9516 * src/mathed/math_defs.h: change first arg to istream from FILE*
9518 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9520 * src/mathed/math_parser.C: have yyis to be an istream
9521 (LexGetArg): use istream (yyis)
9523 (mathed_parse): ditto
9524 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9526 * src/mathed/formula.C (Read): rewritten to use istream
9528 * src/mathed/formulamacro.C (Read): rewritten to use istream
9530 * src/lyxlex.h (~LyXLex): deleted desturctor
9531 (getStream): new function, returns an istream
9532 (getFile): deleted funtion
9533 (IsOK): return is.good();
9535 * src/lyxlex.C (LyXLex): delete file and owns_file
9536 (setFile): open an filebuf and assign that to a istream instead of
9538 (setStream): new function, takes an istream as arg.
9539 (setFile): deleted function
9540 (EatLine): rewritten us use istream instead of FILE*
9544 * src/table.C (LyXTable): use istream instead of FILE*
9545 (Read): rewritten to take an istream instead of FILE*
9547 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9549 * src/buffer.C (Dispatch): remove an extraneous break statement.
9551 * src/support/filetools.C (QuoteName): change to do simple
9552 'quoting'. More work is necessary. Also changed to do nothing
9553 under emx (needs fix too).
9554 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9556 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9557 config.h.in to the AC_DEFINE_UNQUOTED() call.
9558 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9559 needs char * as argument (because Solaris 7 declares it like
9562 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9563 remove definition of BZERO.
9565 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9567 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9568 defined, "lyxregex.h" if not.
9570 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9572 (REGEX): new variable that is set to regex.c lyxregex.h when
9573 AM_CONDITIONAL USE_REGEX is set.
9574 (libsupport_la_SOURCES): add $(REGEX)
9576 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9579 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9582 * configure.in: add call to LYX_REGEX
9584 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9585 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9587 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9589 * lib/bind/fi_menus.bind: new file, from
9590 pauli.virtanen@saunalahti.fi.
9592 * src/buffer.C (getBibkeyList): pass the parameter delim to
9593 InsetInclude::getKeys and InsetBibtex::getKeys.
9595 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9596 is passed to Buffer::getBibkeyList
9598 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9599 instead of the hardcoded comma.
9601 * src/insets/insetbib.C (getKeys): make sure that there are not
9602 leading blanks in bibtex keys. Normal latex does not care, but
9603 harvard.sty seems to dislike blanks at the beginning of citation
9604 keys. In particular, the retturn value of the function is
9606 * INSTALL: make it clear that libstdc++ is needed and that gcc
9607 2.7.x probably does not work.
9609 * src/support/filetools.C (findtexfile): make debug message go to
9611 * src/insets/insetbib.C (getKeys): ditto
9613 * src/debug.C (showTags): make sure that the output is correctly
9616 * configure.in: add a comment for TWO_COLOR_ICON define.
9618 * acconfig.h: remove all the entries that already defined in
9619 configure.in or acinclude.m4.
9621 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9622 to avoid user name, date and copyright.
9624 1999-12-21 Juergen Vigna <jug@sad.it>
9626 * src/table.C (Read): Now read bogus row format informations
9627 if the format is < 5 so that afterwards the table can
9628 be read by lyx but without any format-info. Fixed the
9629 crash we experienced when not doing this.
9631 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9633 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9634 (RedoDrawingOfParagraph): ditto
9635 (RedoParagraphs): ditto
9636 (RemoveTableRow): ditto
9638 * src/text.C (Fill): rename arg paperwidth -> paper_width
9640 * src/buffer.C (insertLyXFile): rename var filename -> fname
9641 (writeFile): rename arg filename -> fname
9642 (writeFileAscii): ditto
9643 (makeLaTeXFile): ditto
9644 (makeLinuxDocFile): ditto
9645 (makeDocBookFile): ditto
9647 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9650 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9652 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9655 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9656 compiled by a C compiler not C++.
9658 * src/layout.h (LyXTextClass): added typedef for const_iterator
9659 (LyXTextClassList): added typedef for const_iterator + member
9660 functions begin and end.
9662 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9663 iterators to fill the choice_class.
9664 (updateLayoutChoice): rewritten to use iterators to fill the
9665 layoutlist in the toolbar.
9667 * src/BufferView.h (BufferView::work_area_width): removed unused
9670 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9672 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9673 (sgmlCloseTag): ditto
9675 * src/support/lstrings.h: return type of countChar changed to
9678 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9679 what version of this func to use. Also made to return unsigned int.
9681 * configure.in: call LYX_STD_COUNT
9683 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9684 conforming std::count.
9686 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9688 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9689 and a subscript would give bad display (patch from Dekel Tsur
9690 <dekel@math.tau.ac.il>).
9692 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9694 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9697 * src/chset.h: add a few 'using' directives
9699 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9700 triggered when no buffer is active
9702 * src/layout.C: removed `break' after `return' in switch(), since
9705 * src/lyx_main.C (init): make sure LyX can be ran in place even
9706 when libtool has done its magic with shared libraries. Fix the
9707 test for the case when the system directory has not been found.
9709 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9710 name for the latex file.
9711 (MenuMakeHTML): ditto
9713 * src/buffer.h: add an optional boolean argument, which is passed
9716 1999-12-20 Allan Rae <rae@lyx.org>
9718 * lib/templates/IEEEtran.lyx: small correction and update.
9720 * configure.in: Attempted to use LYX_PATH_HEADER
9722 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9724 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9725 input from JMarc. Now use preprocessor to find the header.
9726 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9727 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9728 LYX_STL_STRING_FWD. See comments in file.
9730 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9732 * The global MiniBuffer * minibuffer variable is dead.
9734 * The global FD_form_main * fd_form_main variable is dead.
9736 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9738 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9740 * src/table.h: add the LOstream.h header
9741 * src/debug.h: ditto
9743 * src/LyXAction.h: change the explaination of the ReadOnly
9744 attribute: is indicates that the function _can_ be used.
9746 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9749 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9751 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9757 * src/paragraph.C (GetWord): assert on pos>=0
9760 * src/support/lyxstring.C: condition the use of an invariant on
9762 * src/support/lyxstring.h: ditto
9764 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9765 Use LAssert.h instead of plain assert().
9767 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9769 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9770 * src/support/filetools.C: ditto
9772 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9775 * INSTALL: document the new configure flags
9777 * configure.in: suppress --with-debug; add --enable-assertions
9779 * acinclude.m4: various changes in alignment of help strings.
9781 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9783 * src/kbmap.C: commented out the use of the hash map in kb_map,
9784 beginning of movement to a stl::container.
9786 * several files: removed code that was not in effect when
9787 MOVE_TEXT was defined.
9789 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9790 for escaping should not be used. We can discuss if the string
9791 should be enclosed in f.ex. [] instead of "".
9793 * src/trans_mgr.C (insert): use the new returned value from
9794 encodeString to get deadkeys and keymaps done correctly.
9796 * src/chset.C (encodeString): changed to return a pair, to tell
9797 what to use if we know the string.
9799 * src/lyxscreen.h (fillArc): new function.
9801 * src/FontInfo.C (resize): rewritten to use more std::string like
9802 structore, especially string::replace.
9804 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9807 * configure.in (chmod +x some scripts): remove config/gcc-hack
9809 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9811 * src/buffer.C (writeFile): change once again the top comment in a
9812 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9813 instead of an hardcoded version number.
9814 (makeDocBookFile): ditto
9816 * src/version.h: add new define LYX_DOCVERSION
9818 * po/de.po: update from Pit Sütterlin
9819 * lib/bind/de_menus.bind: ditto.
9821 * src/lyxfunc.C (Dispatch): call MenuExport()
9822 * src/buffer.C (Dispatch): ditto
9824 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9825 LyXFunc::Dispatch().
9826 (MenuExport): new function, moved from
9827 LyXFunc::Dispatch().
9829 * src/trans_mgr.C (insert): small cleanup
9830 * src/chset.C (loadFile): ditto
9832 * lib/kbd/iso8859-1.cdef: add missing backslashes
9834 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9837 help with placing the manually drawn accents better.
9839 (Draw): x2 and hg changed to float to minimize rounding errors and
9840 help place the accents better.
9842 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9843 unsigned short to char is just wrong...cast the char to unsigned
9844 char instead so that the two values can compare sanely. This
9845 should also make the display of insetlatexaccents better and
9846 perhaps also some other insets.
9848 (lbearing): new function
9851 1999-12-15 Allan Rae <rae@lyx.org>
9853 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9854 header that provides a wrapper around the very annoying SGI STL header
9857 * src/support/lyxstring.C, src/LString.h:
9858 removed old SGI-STL-compatability attempts.
9860 * configure.in: Use LYX_STL_STRING_FWD.
9862 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9863 stl_string_fwd.h is around and try to determine it's location.
9864 Major improvement over previous SGI STL 3.2 compatability.
9865 Three small problems remain with this function due to my zero
9866 knowledge of autoconf. JMarc and lgb see the comments in the code.
9868 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9870 * src/broken_const.h, config/hack-gcc, config/README: removed
9872 * configure.in: remove --with-gcc-hack option; do not call
9875 * INSTALL: remove documentation of --with-broken-const and
9878 * acconfig.h: remove all trace of BROKEN_CONST define
9880 * src/buffer.C (makeDocBookFile): update version number in output
9882 (SimpleDocBookOnePar): fix an assert when trying to a character
9883 access beyond string length
9886 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9888 * po/de.po: fix the Export menu
9890 * lyx.man: update the description of -dbg
9892 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9893 (commandLineHelp): updated
9894 (easyParse): show list of available debug levels if -dbg is passed
9897 * src/Makefile.am: add debug.C
9899 * src/debug.h: moved some code to debug.C
9901 * src/debug.C: new file. Contains code to set and show debug
9904 * src/layout.C: remove 'break' after 'continue' in switch
9905 statements, since these cannot be reached.
9907 1999-12-13 Allan Rae <rae@lyx.org>
9909 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9910 (in_word_set): hash() -> math_hash()
9912 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9914 * acconfig.h: Added a test for whether we are using exceptions in the
9915 current compilation run. If so USING_EXCEPTIONS is defined.
9917 * config.in: Check for existance of stl_string_fwd.h
9918 * src/LString.h: If compiling --with-included-string and SGI's
9919 STL version 3.2 is present (see above test) we need to block their
9920 forward declaration of string and supply a __get_c_string().
9921 However, it turns out this is only necessary if compiling with
9922 exceptions enabled so I've a bit more to add yet.
9924 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9925 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9926 src/support/LRegex.h, src/undo.h:
9927 Shuffle the order of the included files a little to ensure that
9928 LString.h gets included before anything that includes stl_string_fwd.h
9930 * src/support/lyxstring.C: We need to #include LString.h instead of
9931 lyxstring.h to get the necessary definition of __get_c_string.
9932 (__get_c_string): New function. This is defined static just like SGI's
9933 although why they need to do this I'm not sure. Perhaps it should be
9934 in lstrings.C instead.
9936 * lib/templates/IEEEtran.lyx: New template file.
9938 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9940 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9941 * intl/Makefile.in (MKINSTALLDIRS): ditto
9943 * src/LyXAction.C (init): changed to hold the LFUN data in a
9944 automatic array in stead of in callso to newFunc, this speeds up
9945 compilation a lot. Also all the memory used by the array is
9946 returned when the init is completed.
9948 * a lot of files: compiled with -Wold-style-cast, changed most of
9949 the reported offenders to C++ style casts. Did not change the
9950 offenders in C files.
9952 * src/trans.h (Match): change argument type to unsigned int.
9954 * src/support/DebugStream.C: fix some types on the streambufs so
9955 that it works on a conforming implementation.
9957 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9959 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9961 * src/support/lyxstring.C: remove the inline added earlier since
9962 they cause a bunch of unsatisfied symbols when linking with dec
9963 cxx. Cxx likes to have the body of inlines at the place where they
9966 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9967 accessing negative bounds in array. This fixes the crash when
9968 inserting accented characters.
9969 * src/trans.h (Match): ditto
9971 * src/buffer.C (Dispatch): since this is a void, it should not try
9972 to return anything...
9974 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9976 * src/buffer.h: removed the two friends from Buffer. Some changes
9977 because of this. Buffer::getFileName and Buffer::setFileName
9978 renamed to Buffer::fileName() and Buffer::fileName(...).
9980 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9982 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9983 and Buffer::update(short) to BufferView. This move is currently
9984 controlled by a define MOVE_TEXT, this will be removed when all
9985 shows to be ok. This move paves the way for better separation
9986 between buffer contents and buffer view. One side effect is that
9987 the BufferView needs a rebreak when swiching buffers, if we want
9988 to avoid this we can add a cache that holds pointers to LyXText's
9989 that is not currently in use.
9991 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9994 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9996 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9998 * lyx_main.C: new command line option -x (or --execute) and
9999 -e (or --export). Now direct conversion from .lyx to .tex
10000 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10001 Unfortunately, X is still needed and the GUI pops up during the
10004 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10006 * src/Spacing.C: add a using directive to bring stream stuff into
10008 * src/paragraph.C: ditto
10009 * src/buffer.C: ditto
10011 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10012 from Lars' announcement).
10014 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10015 example files from Tino Meinen.
10017 1999-12-06 Allan Rae <rae@lyx.org>
10019 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10021 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10023 * src/support/lyxstring.C: added a lot of inline for no good
10026 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10027 latexWriteEndChanges, they were not used.
10029 * src/layout.h (operator<<): output operator for PageSides
10031 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10033 * some example files: loaded in LyX 1.0.4 and saved again to update
10034 certain constructs (table format)
10036 * a lot of files: did the change to use fstream/iostream for all
10037 writing of files. Done with a close look at Andre Poenitz's patch.
10039 * some files: whitespace changes.
10041 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10043 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10044 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10045 architecture, we provide our own. It is used unconditionnally, but
10046 I do not think this is a performance problem. Thanks to Angus
10047 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10048 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10050 (GetInset): use my_memcpy.
10054 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10055 it is easier to understand, but it uses less TeX-only constructs now.
10057 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10058 elements contain spaces
10060 * lib/configure: regenerated
10062 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10063 elements contain spaces; display the list of programs that are
10066 * autogen.sh: make sure lib/configure is executable
10068 * lib/examples/*: rename the tutorial examples to begin with the
10069 two-letters language code.
10071 * src/lyxfunc.C (getStatus): do not query current font if no
10074 * src/lyx_cb.C (RunScript): use QuoteName
10075 (MenuRunDvips): ditto
10076 (PrintApplyCB): ditto
10078 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10079 around argument, so that it works well with the current shell.
10080 Does not work properly with OS/2 shells currently.
10082 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10083 * src/LyXSendto.C (SendtoApplyCB): ditto
10084 * src/lyxfunc.C (Dispatch): ditto
10085 * src/buffer.C (runLaTeX): ditto
10086 (runLiterate): ditto
10087 (buildProgram): ditto
10089 * src/lyx_cb.C (RunScript): ditto
10090 (MenuMakeLaTeX): ditto
10092 * src/buffer.h (getLatexName): new method
10094 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10096 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10098 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10099 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10100 (create_math_panel): ditto
10102 * src/lyxfunc.C (getStatus): re-activate the code which gets
10103 current font and cursor; add test for export to html.
10105 * src/lyxrc.C (read): remove unreachable break statements; add a
10108 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10110 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10112 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10113 introduced by faulty regex.
10114 * src/buffer.C: ditto
10115 * src/lastfiles.C: ditto
10116 * src/paragraph.C: ditto
10117 * src/table.C: ditto
10118 * src/vspace.C: ditto
10119 * src/insets/figinset.C: ditto
10120 Note: most of these is absolutely harmless, except the one in
10121 src/mathed formula.C.
10123 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10125 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10126 operation, yielding correct results for the reLyX command.
10128 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10130 * src/support/filetools.C (ExpandPath): removed an over eager
10132 (ReplaceEnvironmentPath): ditto
10134 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10135 shows that we are doing something fishy in our code...
10136 (BubblePost): ditto
10139 * src/lyxrc.C (read): use a double switch trick to get more help
10140 from the compiler. (the same trick is used in layout.C)
10141 (write): new function. opens a ofstream and pass that to output
10142 (output): new function, takes a ostream and writes the lyxrc
10143 elemts to it. uses a dummy switch to make sure no elements are
10146 * src/lyxlex.h: added a struct pushpophelper for use in functions
10147 with more than one exit point.
10149 * src/lyxlex.[Ch] (GetInteger): made it const
10153 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10155 * src/layout.[hC] : LayoutTags splitted into several enums, new
10156 methods created, better error handling cleaner use of lyxlex. Read
10159 * src/bmtable.[Ch]: change some member prototypes because of the
10160 image const changes.
10162 * commandtags.h, src/LyXAction.C (init): new function:
10163 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10164 This file is not read automatically but you can add \input
10165 preferences to your lyxrc if you want to. We need to discuss how
10168 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10169 in .aux, also remove .bib and .bst files from dependencies when
10172 * src/BufferView.C, src/LyXView.C: add const_cast several places
10173 because of changes to images.
10175 * lib/images/*: same change as for images/*
10177 * lib/lyxrc.example: Default for accept_compound is false not no.
10179 * images/*: changed to be const, however I have som misgivings
10180 about this change so it might be changed back.
10182 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10184 * lib/configure, po/POTFILES.in: regenerated
10186 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10188 * config/lib_configure.m4: removed
10190 * lib/configure.m4: new file (was config/lib_configure.m4)
10192 * configure.in: do not test for rtti, since we do not use it.
10194 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10196 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10197 doubling of allocated space scheme. This makes it faster for large
10198 strings end to use less memory for small strings. xtra rememoved.
10200 * src/insets/figinset.C (waitalarm): commented out.
10201 (GhostscriptMsg): use static_cast
10202 (GhostscriptMsg): use new instead of malloc to allocate memory for
10203 cmap. also delete the memory after use.
10205 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10207 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10208 for changes in bibtex database or style.
10209 (runBibTeX): remove all .bib and .bst files from dep before we
10211 (run): use scanAuc in when dep file already exist.
10213 * src/DepTable.C (remove_files_with_extension): new method
10214 (exist): new method
10216 * src/DepTable.[Ch]: made many of the methods const.
10218 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10220 * src/bufferparams.C: make sure that the default textclass is
10221 "article". It used to be the first one by description order, but
10222 now the first one is "docbook".
10224 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10225 string; call Debug::value.
10226 (easyParse): pass complete argument to setDebuggingLevel().
10228 * src/debug.h (value): fix the code that parses debug levels.
10230 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10233 * src/LyXAction.C: use Debug::ACTION as debug channel.
10235 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10237 * NEWS: updated for the future 1.1.3 release.
10239 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10240 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10241 it should. This is of course a controversial change (since many
10242 people will find that their lyx workscreen is suddenly full of
10243 red), but done for the sake of correctness.
10245 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10246 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10248 * src/insets/inseterror.h, src/insets/inseturl.h,
10249 src/insets/insetinfo.h, src/insets/figinset.h,
10250 src/mathed/formulamacro.h, src/mathed/math_macro.h
10251 (EditMessage): add a missing const and add _() to make sure that
10252 translation happens
10254 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10255 src/insets/insetbib.C, src/support/filetools.C: add `using'
10256 directives for cxx.
10258 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10259 doing 'Insert index of last word' at the beginning of a paragraph.
10261 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10263 * several files: white-space changes.
10265 * src/mathed/formula.C: removed IsAlpha and IsDigit
10267 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10268 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10271 * src/insets/figinset.C (GetPSSizes): don't break when
10272 "EndComments" is seen. But break when a boundingbox is read.
10274 * all classes inherited from Inset: return value of Clone
10275 changed back to Inset *.
10277 * all classes inherited form MathInset: return value of Clone
10278 changed back to MathedInset *.
10280 * src/insets/figinset.C (runqueue): use a ofstream to output the
10281 gs/ps file. Might need some setpresicion or setw. However I can
10282 see no problem with the current code.
10283 (runqueue): use sleep instead of the alarm/signal code. I just
10284 can't see the difference.
10286 * src/paragraph.C (LyXParagraph): reserve space in the new
10287 paragraph and resize the inserted paragraph to just fit.
10289 * src/lyxfunc.h (operator|=): added operator for func_status.
10291 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10292 check for readable file.
10294 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10295 check for readable file.
10296 (MenuMakeLinuxDoc): ditto
10297 (MenuMakeDocBook): ditto
10298 (MenuMakeAscii): ditto
10299 (InsertAsciiFile): split the test for openable and readable
10301 * src/bmtable.C (draw_bitmaptable): use
10302 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10304 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10305 findtexfile from LaTeX to filetools.
10307 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10308 instead of FilePtr. Needs to be verified by a literate user.
10310 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10312 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10313 (EditMessage): likewise.
10315 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10316 respectively as \textasciitilde and \textasciicircum.
10318 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10320 * src/support/lyxstring.h: made the methods that take iterators
10321 use const_iterator.
10323 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10324 (regexMatch): made is use the real regex class.
10326 * src/support/Makefile.am: changed to use libtool
10328 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10330 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10332 (MathIsInset ++): changed several macros to be inline functions
10335 * src/mathed/Makefile.am: changed to use libtool
10337 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10339 * src/insets/inset* : Clone changed to const and return type is
10340 the true insettype not just Inset*.
10342 * src/insets/Makefile.am: changed to use libtool
10344 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10346 * src/undo.[Ch] : added empty() and changed some of the method
10349 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10351 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10352 setID use block<> for the bullets array, added const several places.
10354 * src/lyxfunc.C (getStatus): new function
10356 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10357 LyXAction, added const to several funtions.
10359 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10360 a std::map, and to store the dir items in a vector.
10362 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10365 * src/LyXView.[Ch] + other files : changed currentView to view.
10367 * src/LyXAction.[Ch] : ported from the old devel branch.
10369 * src/.cvsignore: added .libs and a.out
10371 * configure.in : changes to use libtool.
10373 * acinclude.m4 : inserted libtool.m4
10375 * .cvsignore: added libtool
10377 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10379 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10380 file name in insets and mathed directories (otherwise the
10381 dependency is not taken in account under cygwin).
10383 * src/text2.C (InsertString[AB]): make sure that we do not try to
10384 read characters past the string length.
10386 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10388 * lib/doc/LaTeXConfig.lyx.in,
10389 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10391 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10392 file saying who created them and when this heppened; this is
10393 useless and annoys tools like cvs.
10395 * lib/layouts/g-brief-{en,de}.layout,
10396 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10397 from Thomas Hartkens <thomas@hartkens.de>.
10399 * src/{insets,mathed}/Makefile.am: do not declare an empty
10400 LDFLAGS, so that it can be set at configure time (useful on Irix
10403 * lib/reLyX/configure.in: make sure that the prefix is set
10404 correctly in LYX_DIR.
10406 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10408 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10409 be used by 'command-sequence' this allows to bind a key to a
10410 sequence of LyX-commands
10411 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10413 * src/LyXAction.C: add "command-sequence"
10415 * src/LyXFunction.C: handling of "command-sequence"
10417 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10418 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10420 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10422 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10424 * src/buffer.C (writeFile): Do not output a comment giving user
10425 and date at the beginning of a .lyx file. This is useless and
10426 annoys cvs anyway; update version number to 1.1.
10428 * src/Makefile.am (LYX_DIR): add this definition, so that a
10429 default path is hardcoded in LyX.
10431 * configure.in: Use LYX_GNU_GETTEXT.
10433 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10434 AM_GNU_GETTEXT with a bug fixed.
10436 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10438 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10440 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10441 which is used to point to LyX data is now LYX_DIR_11x.
10443 * lyx.man: convert to a unix text file; small updates.
10445 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10447 * src/support/LSubstring.[Ch]: made the second arg of most of the
10448 constructors be a const reference.
10450 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10453 * src/support/lyxstring.[Ch] (swap): added missing member function
10454 and specialization of swap(str, str);
10456 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10458 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10459 trace of the old one.
10461 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10462 put the member definitions in undo.C.
10464 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10465 NEW_TEXT and have now only code that was included when this was
10468 * src/intl.C (LCombo): use static_cast
10470 (DispatchCallback): ditto
10472 * src/definitions.h: removed whole file
10474 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10476 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10477 parsing and stores in a std:map. a regex defines the file format.
10478 removed unneeded members.
10480 * src/bufferparams.h: added several enums from definitions.h here.
10481 Removed unsused destructor. Changed some types to use proper enum
10482 types. use block to have the temp_bullets and user_defined_bullets
10483 and to make the whole class assignable.
10485 * src/bufferparams.C (Copy): removed this functions, use a default
10486 assignment instead.
10488 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10491 * src/buffer.C (readLyXformat2): commend out all that have with
10492 oldpapersize to do. also comment out all that hve to do with
10493 insetlatex and insetlatexdel.
10494 (setOldPaperStuff): commented out
10496 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10498 * src/LyXAction.C: remove use of inset-latex-insert
10500 * src/mathed/math_panel.C (button_cb): use static_cast
10502 * src/insets/Makefile.am (insets_o_SOURCES): removed
10505 * src/support/lyxstring.C (helper): use the unsigned long
10506 specifier, UL, instead of a static_cast.
10508 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10510 * src/support/block.h: new file. to be used as a c-style array in
10511 classes, so that the class can be assignable.
10513 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10515 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10516 NULL, make sure to return an empty string (it is not possible to
10517 set a string to NULL).
10519 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10521 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10523 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10525 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10526 link line, so that Irix users (for example) can set it explicitely to
10529 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10530 it can be overidden at make time (static or dynamic link, for
10533 * src/vc-backend.C, src/LaTeXFeatures.h,
10534 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10535 statements to bring templates to global namespace.
10537 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10539 * src/support/lyxstring.C (operator[] const): make it standard
10542 * src/minibuffer.C (Init): changed to reflect that more
10543 information is given from the lyxvc and need not be provided here.
10545 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10547 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10549 * src/LyXView.C (UpdateTimerCB): use static_cast
10550 (KeyPressMask_raw_callback): ditto
10552 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10553 buffer_, a lot of changes because of this. currentBuffer() ->
10554 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10555 also changes to other files because of this.
10557 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10559 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10560 have no support for RCS and partial support for CVS, will be
10563 * src/insets/ several files: changes because of function name
10564 changes in Bufferview and LyXView.
10566 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10568 * src/support/LSubstring.[Ch]: new files. These implement a
10569 Substring that can be very convenient to use. i.e. is this
10571 string a = "Mary had a little sheep";
10572 Substring(a, "sheep") = "lamb";
10573 a is now "Mary has a little lamb".
10575 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10576 out patterns and subpatterns of strings. It is used by LSubstring
10577 and also by vc-backend.C
10579 * src/support/lyxstring.C: went over all the assertions used and
10580 tried to correct the wrong ones and flag which of them is required
10581 by the standard. some bugs found because of this. Also removed a
10582 couple of assertions.
10584 * src/support/Makefile.am (libsupport_a_SOURCES): added
10585 LSubstring.[Ch] and LRegex.[Ch]
10587 * src/support/FileInfo.h: have struct stat buf as an object and
10588 not a pointer to one, some changes because of this.
10590 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10591 information in layout when adding the layouts preamble to the
10592 textclass preamble.
10594 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10597 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10598 because of bug in OS/2.
10600 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10602 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10603 \verbatim@font instead of \ttfamily, so that it can be redefined.
10605 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10606 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10607 src/layout.h, src/text2.C: add 'using' directive to bring the
10608 STL templates we need from the std:: namespace to the global one.
10609 Needed by DEC cxx in strict ansi mode.
10611 * src/support/LIstream.h,src/support/LOstream.h,
10612 src/support/lyxstring.h,src/table.h,
10613 src/lyxlookup.h: do not include <config.h> in header
10614 files. This should be done in the .C files only.
10616 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10620 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10622 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10623 from Kayvan to fix the tth invokation.
10625 * development/lyx.spec.in: updates from Kayvan to reflect the
10626 changes of file names.
10628 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10630 * src/text2.C (InsertStringB): use std::copy
10631 (InsertStringA): use std::copy
10633 * src/bufferlist.C: use a vector to store the buffers in. This is
10634 an internal change and should not affect any other thing.
10636 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10639 * src/text.C (Fill): fix potential bug, one off bug.
10641 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10643 * src/Makefile.am (lyx_main.o): add more files it depends on.
10645 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10647 * src/support/lyxstring.C: use size_t for the reference count,
10648 size, reserved memory and xtra.
10649 (internal_compare): new private member function. Now the compare
10650 functions should work for std::strings that have embedded '\0'
10652 (compare): all compare functions rewritten to use
10655 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10657 * src/support/lyxstring.C (compare): pass c_str()
10658 (compare): pass c_str
10659 (compare): pass c_str
10661 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10663 * src/support/DebugStream.C: <config.h> was not included correctly.
10665 * lib/configure: forgot to re-generate it :( I'll make this file
10666 auto generated soon.
10668 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10670 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10673 * src/support/lyxstring.C: some changes from length() to rep->sz.
10674 avoids a function call.
10676 * src/support/filetools.C (SpaceLess): yet another version of the
10677 algorithm...now per Jean-Marc's suggestions.
10679 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10681 * src/layout.C (less_textclass_desc): functor for use in sorting
10683 (LyXTextClass::Read): sort the textclasses after reading.
10685 * src/support/filetools.C (SpaceLess): new version of the
10686 SpaceLess functions. What problems does this one give? Please
10689 * images/banner_bw.xbm: made the arrays unsigned char *
10691 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * src/support/lyxstring.C (find): remove bogus assertion in the
10694 two versions of find where this has not been done yet.
10696 * src/support/lyxlib.h: add missing int return type to
10699 * src/menus.C (ShowFileMenu): disable exporting to html if no
10700 html export command is present.
10702 * config/lib_configure.m4: add a test for an HTML converter. The
10703 programs checked for are, in this order: tth, latex2html and
10706 * lib/configure: generated from config/lib_configure.m4.
10708 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10709 html converter. The parameters are now passed through $$FName and
10710 $$OutName, instead of standard input/output.
10712 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10714 * lib/lyxrc.example: update description of \html_command.
10715 add "quotes" around \screen_font_xxx font setting examples to help
10716 people who use fonts with spaces in their names.
10718 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10720 * Distribution files: updates for v1.1.2
10722 * src/support/lyxstring.C (find): remove bogus assert and return
10723 npos for the same condition.
10725 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10727 * added patch for OS/2 from SMiyata.
10729 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10731 * src/text2.C (CutSelection): make space_wrapped a bool
10732 (CutSelection): dont declare int i until we have to.
10733 (alphaCounter): return a char const *.
10735 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10737 * src/support/syscall.C (Systemcalls::kill):
10738 src/support/filetools.C (PutEnv, PutEnvPath):
10739 src/lyx_cb.C (addNewlineAndDepth):
10740 src/FontInfo.C (FontInfo::resize): condition some #warning
10741 directives with WITH_WARNINGS.
10744 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10746 * src/layout.[Ch] + several files: access to class variables
10747 limited and made accessor functions instead a lot of code changed
10748 becuase of this. Also instead of returning pointers often a const
10749 reference is returned instead.
10751 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10753 * src/Makefile.am (dist-hook): added used to remove the CVS from
10754 cheaders upon creating a dist
10755 (EXTRA_DIST): added cheaders
10757 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10758 a character not as a small integer.
10760 * src/support/lyxstring.C (find): removed Assert and added i >=
10761 rep->sz to the first if.
10763 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10765 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10766 src/LyXView.C src/buffer.C src/bufferparams.C
10767 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10768 src/text2.C src/insets/insetinclude.C:
10769 lyxlayout renamed to textclasslist.
10771 * src/layout.C: some lyxerr changes.
10773 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10774 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10775 (LyXLayoutList): removed all traces of this class.
10776 (LyXTextClass::Read): rewrote LT_STYLE
10777 (LyXTextClass::hasLayout): new function
10778 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10779 both const and nonconst version.
10780 (LyXTextClass::delete_layout): new function.
10781 (LyXTextClassList::Style): bug fix. do the right thing if layout
10783 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10784 (LyXTextClassList::NameOfLayout): ditto
10785 (LyXTextClassList::Load): ditto
10787 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10789 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10791 * src/LyXAction.C (LookupFunc): added a workaround for sun
10792 compiler, on the other hand...we don't know if the current code
10793 compiles on sun at all...
10795 * src/support/filetools.C (CleanupPath): subst fix
10797 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10800 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10801 complained about this one?
10803 * src/insets/insetinclude.C (Latex): subst fix
10805 * src/insets/insetbib.C (getKeys): subst fix
10807 * src/LyXSendto.C (SendtoApplyCB): subst fix
10809 * src/lyx_main.C (init): subst fix
10811 * src/layout.C (Read): subst fix
10813 * src/lyx_sendfax_main.C (button_send): subst fix
10815 * src/buffer.C (RoffAsciiTable): subst fix
10817 * src/lyx_cb.C (MenuFax): subst fix
10818 (PrintApplyCB): subst fix
10820 1999-10-26 Juergen Vigna <jug@sad.it>
10822 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10824 (Read): Cleaned up this code so now we read only format vestion >= 5
10826 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10828 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10829 come nobody has complained about this one?
10831 * src/insets/insetinclude.C (Latex): subst fix
10833 * src/insets/insetbib.C (getKeys): subst fix
10835 * src/lyx_main.C (init): subst fix
10837 * src/layout.C (Read): subst fix
10839 * src/buffer.C (RoffAsciiTable): subst fix
10841 * src/lyx_cb.C (MenuFax): subst fix.
10843 * src/layout.[hC] + some other files: rewrote to use
10844 std::container to store textclasses and layouts in.
10845 Simplified, removed a lot of code. Make all classes
10846 assignable. Further simplifications and review of type
10847 use still to be one.
10849 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10850 lastfiles to create the lastfiles partr of the menu.
10852 * src/lastfiles.[Ch]: rewritten to use deque to store the
10853 lastfiles in. Uses fstream for reading and writing. Simplifies
10856 * src/support/syscall.C: remove explicit cast.
10858 * src/BufferView.C (CursorToggleCB): removed code snippets that
10859 were commented out.
10860 use explicat C++ style casts instead of C style casts. also use
10861 u_vdata instea of passing pointers in longs.
10863 * src/PaperLayout.C: removed code snippets that were commented out.
10865 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10867 * src/lyx_main.C: removed code snippets that wer commented out.
10869 * src/paragraph.C: removed code snippets that were commented out.
10871 * src/lyxvc.C (logClose): use static_cast
10873 (viewLog): remove explicit cast to void*
10874 (showLog): removed old commented code
10876 * src/menus.C: use static_cast instead of C style casts. use
10877 u_vdata instead of u_ldata. remove explicit cast to (long) for
10878 pointers. Removed old code that was commented out.
10880 * src/insets/inset.C: removed old commented func
10882 * src/insets/insetref.C (InsetRef): removed old code that had been
10883 commented out for a long time.
10885 (escape): removed C style cast
10887 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10889 * src/insets/insetlatex.C (Draw): removed old commented code
10890 (Read): rewritten to use string
10892 * src/insets/insetlabel.C (escape): removed C style cast
10894 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10896 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10897 old commented code.
10899 * src/insets/insetinclude.h: removed a couple of stupid bools
10901 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10902 (Clone): remove C style cast
10903 (getKeys): changed list to lst because of std::list
10905 * src/insets/inseterror.C (Draw): removed som old commented code.
10907 * src/insets/insetcommand.C (Draw): removed some old commented code.
10909 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10910 commented out forever.
10911 (bibitem_cb): use static_cast instead of C style cast
10912 use of vdata changed to u_vdata.
10914 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10916 (CloseUrlCB): use static_cast instead of C style cast.
10917 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10919 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10920 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10921 (CloseInfoCB): static_cast from ob->u_vdata instead.
10922 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10925 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10926 (C_InsetError_CloseErrorCB): forward the ob parameter
10927 (CloseErrorCB): static_cast from ob->u_vdata instead.
10929 * src/vspace.h: include LString.h since we use string in this class.
10931 * src/vspace.C (lyx_advance): changed name from advance because of
10932 nameclash with stl. And since we cannot use namespaces yet...I
10933 used a lyx_ prefix instead. Expect this to change when we begin
10936 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10938 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10939 and removed now defunct constructor and deconstructor.
10941 * src/BufferView.h: have backstack as a object not as a pointer.
10942 removed initialization from constructor. added include for BackStack
10944 * development/lyx.spec.in (%build): add CFLAGS also.
10946 * src/screen.C (drawFrame): removed another warning.
10948 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10950 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10951 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10952 README and ANNOUNCE a bit for the next release. More work is
10955 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10956 unbreakable if we are in freespacing mode (LyX-Code), but not in
10959 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10961 * src/BackStack.h: fixed initialization order in constructor
10963 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10965 * acinclude.m4 (VERSION): new rules for when a version is
10966 development, added also a variable for prerelease.
10967 (warnings): we set with_warnings=yes for prereleases
10968 (lyx_opt): prereleases compile with same optimization as development
10969 (CXXFLAGS): only use pedantic if we are a development version
10971 * src/BufferView.C (restorePosition): don't do anything if the
10972 backstack is empty.
10974 * src/BackStack.h: added member empty, use this to test if there
10975 is anything to pop...
10977 1999-10-25 Juergen Vigna <jug@sad.it>
10980 * forms/layout_forms.fd +
10981 * forms/latexoptions.fd +
10982 * lyx.fd: changed for various form resize issues
10984 * src/mathed/math_panel.C +
10985 * src/insets/inseterror.C +
10986 * src/insets/insetinfo.C +
10987 * src/insets/inseturl.C +
10988 * src/insets/inseturl.h +
10990 * src/LyXSendto.C +
10991 * src/PaperLayout.C +
10992 * src/ParagraphExtra.C +
10993 * src/TableLayout.C +
10995 * src/layout_forms.C +
11002 * src/menus.C: fixed various resize issues. So now forms can be
11003 resized savely or not be resized at all.
11005 * forms/form_url.fd +
11006 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11009 * src/insets/Makefile.am: added files form_url.[Ch]
11011 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11013 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11014 (and presumably 6.2).
11016 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11017 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11018 remaining static member callbacks.
11020 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11023 * src/support/lyxstring.h: declare struct Srep as friend of
11024 lyxstring, since DEC cxx complains otherwise.
11026 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11028 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11030 * src/LaTeX.C (run): made run_bibtex also depend on files with
11032 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11033 are put into the dependency file.
11035 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11036 the code has shown itself to work
11037 (create_ispell_pipe): removed another warning, added a comment
11040 * src/minibuffer.C (ExecutingCB): removed code that has been
11041 commented out a long time
11043 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11044 out code + a warning.
11046 * src/support/lyxstring.h: comment out the three private
11047 operators, when compiling with string ansi conforming compilers
11048 they make problems.
11050 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11052 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11053 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11056 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11059 * src/mathed/math_panel.C (create_math_panel): remove explicit
11062 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11065 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11066 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11067 to XCreatePixmapFromBitmapData
11068 (fl_set_bmtable_data): change the last argument to be unsigned
11070 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11071 and bh to be unsigned int, remove explicit casts in call to
11072 XReadBitmapFileData.
11074 * images/arrows.xbm: made the arrays unsigned char *
11075 * images/varsz.xbm: ditto
11076 * images/misc.xbm: ditto
11077 * images/greek.xbm: ditto
11078 * images/dots.xbm: ditto
11079 * images/brel.xbm: ditto
11080 * images/bop.xbm: ditto
11082 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11084 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11085 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11086 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11088 (LYX_CXX_CHEADERS): added <clocale> to the test.
11090 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11092 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11094 * src/support/lyxstring.C (append): fixed something that must be a
11095 bug, rep->assign was used instead of rep->append.
11097 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11100 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11101 lyx insert double chars. Fix spotted by Kayvan.
11103 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11105 * Fixed the tth support. I messed up with the Emacs patch apply feature
11106 and omitted the changes in lyxrc.C.
11108 1999-10-22 Juergen Vigna <jug@sad.it>
11110 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11112 * src/lyx_cb.C (MenuInsertRef) +
11113 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11114 the form cannot be resized under it limits (fixes a segfault)
11116 * src/lyx.C (create_form_form_ref) +
11117 * forms/lyx.fd: Changed Gravity on name input field so that it is
11120 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11122 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11123 <ostream> and <istream>.
11125 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11126 whether <fstream> provides the latest standard features, or if we
11127 have an oldstyle library (like in egcs).
11128 (LYX_CXX_STL_STRING): fix the test.
11130 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11131 code on MODERN_STL_STREAM.
11133 * src/support/lyxstring.h: use L{I,O}stream.h.
11135 * src/support/L{I,O}stream.h: new files, designed to setup
11136 correctly streams for our use
11137 - includes the right header depending on STL capabilities
11138 - puts std::ostream and std::endl (for LOStream.h) or
11139 std::istream (LIStream.h) in toplevel namespace.
11141 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11143 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11144 was a bib file that had been changed we ensure that bibtex is run.
11145 (runBibTeX): enhanced to extract the names of the bib files and
11146 getting their absolute path and enter them into the dep file.
11147 (findtexfile): static func that is used to look for tex-files,
11148 checks for absolute patchs and tries also with kpsewhich.
11149 Alternative ways of finding the correct files are wanted. Will
11151 (do_popen): function that runs a command using popen and returns
11152 the whole output of that command in a string. Should be moved to
11155 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11156 file with extension ext has changed.
11158 * src/insets/figinset.C: added ifdef guards around the fl_free
11159 code that jug commented out. Now it is commented out when
11160 compiling with XForms == 0.89.
11162 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11163 to lyxstring.C, and only keep a forward declaration in
11164 lyxstring.h. Simplifies the header file a bit and should help a
11165 bit on compile time too. Also changes to Srep will not mandate a
11166 recompile of code just using string.
11167 (~lyxstring): definition moved here since it uses srep.
11168 (size): definition moved here since it uses srep.
11170 * src/support/lyxstring.h: removed a couple of "inline" that should
11173 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11175 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11178 1999-10-21 Juergen Vigna <jug@sad.it>
11180 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11181 set to left if I just remove the width entry (or it is empty).
11183 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11184 paragraph when having dummy paragraphs.
11186 1999-10-20 Juergen Vigna <jug@sad.it>
11188 * src/insets/figinset.C: just commented some fl_free_form calls
11189 and added warnings so that this calls should be activated later
11190 again. This avoids for now a segfault, but we have a memory leak!
11192 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11193 'const char * argument' to 'string argument', this should
11194 fix some Asserts() in lyxstring.C.
11196 * src/lyxfunc.h: Removed the function argAsString(const char *)
11197 as it is not used anymore.
11199 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11201 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11204 * src/Literate.h: some funcs moved from public to private to make
11205 interface clearer. Unneeded args removed.
11207 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11209 (scanBuildLogFile): ditto
11211 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11212 normal TeX Error. Still room for improvement.
11214 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11216 * src/buffer.C (insertErrors): changes to make the error
11217 desctription show properly.
11219 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11222 * src/support/lyxstring.C (helper): changed to use
11223 sizeof(object->rep->ref).
11224 (operator>>): changed to use a pointer instead.
11226 * src/support/lyxstring.h: changed const reference & to value_type
11227 const & lets see if that helps.
11229 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11231 * Makefile.am (rpmdist): fixed to have non static package and
11234 * src/support/lyxstring.C: removed the compilation guards
11236 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11239 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11240 conditional compile of lyxstring.Ch
11242 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11243 stupid check, but it is a lot better than the bastring hack.
11244 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11246 * several files: changed string::erase into string::clear. Not
11249 * src/chset.C (encodeString): use a char temporary instead
11251 * src/table.C (TexEndOfCell): added tostr around
11252 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11253 (TexEndOfCell): ditto
11254 (TexEndOfCell): ditto
11255 (TexEndOfCell): ditto
11256 (DocBookEndOfCell): ditto
11257 (DocBookEndOfCell): ditto
11258 (DocBookEndOfCell): ditto
11259 (DocBookEndOfCell): ditto
11261 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11263 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11265 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11266 (MenuBuildProg): added tostr around ret
11267 (MenuRunChktex): added tostr around ret
11268 (DocumentApplyCB): added tostr around ret
11270 * src/chset.C (encodeString): added tostr around t->ic
11272 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11273 (makeLaTeXFile): added tostr around tocdepth
11274 (makeLaTeXFile): added tostr around ftcound - 1
11276 * src/insets/insetbib.C (setCounter): added tostr around counter.
11278 * src/support/lyxstring.h: added an operator+=(int) to catch more
11281 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11282 (lyxstring): We DON'T allow NULL pointers.
11284 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11286 * src/mathed/math_macro.C (MathMacroArgument::Write,
11287 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11288 when writing them out.
11290 * src/LString.C: remove, since it is not used anymore.
11292 * src/support/lyxstring.C: condition the content to
11293 USE_INCLUDED_STRING macro.
11295 * src/mathed/math_symbols.C, src/support/lstrings.C,
11296 src/support/lyxstring.C: add `using' directive to specify what
11297 we need in <algorithm>. I do not think that we need to
11298 conditionalize this, but any thought is appreciated.
11300 * many files: change all callback functions to "C" linkage
11301 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11302 strict_ansi. Those who were static are now global.
11303 The case of callbacks which are static class members is
11304 trickier, since we have to make C wrappers around them (see
11305 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11306 did not finish this yet, since it defeats the purpose of
11307 encapsulation, and I am not sure what the best route is.
11309 1999-10-19 Juergen Vigna <jug@sad.it>
11311 * src/support/lyxstring.C (lyxstring): we permit to have a null
11312 pointer as assignment value and just don't assign it.
11314 * src/vspace.C (nextToken): corrected this function substituting
11315 find_first(_not)_of with find_last_of.
11317 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11318 (TableOptCloseCB) (TableSpeCloseCB):
11319 inserted fl_set_focus call for problem with fl_hide_form() in
11322 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11324 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11327 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11329 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11330 LyXLex::next() and not eatline() to get its argument.
11332 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11334 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11335 instead, use fstreams for io of the depfile, removed unneeded
11336 functions and variables.
11338 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11339 vector instead, removed all functions and variables that is not in
11342 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11344 * src/buffer.C (insertErrors): use new interface to TeXError
11346 * Makefile.am (rpmdist): added a rpmdist target
11348 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11349 per Kayvan's instructions.
11351 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11353 * src/Makefile.am: add a definition for localedir, so that locales
11354 are found after installation (Kayvan)
11356 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11358 * development/.cvsignore: new file.
11360 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11362 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11363 C++ compiler provides wrappers for C headers and use our alternate
11366 * configure.in: use LYX_CXX_CHEADERS.
11368 * src/cheader/: new directory, populated with cname headers from
11369 libstdc++-2.8.1. They are a bit old, but probably good enough for
11370 what we want (support compilers who lack them).
11372 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11373 from includes. It turns out is was stupid.
11375 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11377 * lib/Makefile.am (install-data-local): forgot a ';'
11378 (install-data-local): forgot a '\'
11379 (libinstalldirs): needed after all. reintroduced.
11381 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11383 * configure.in (AC_OUTPUT): added lyx.spec
11385 * development/lyx.spec: removed file
11387 * development/lyx.spec.in: new file
11389 * po/*.po: merged with lyx.pot becuase of make distcheck
11391 * lib/Makefile.am (dist-hook): added dist-hook so that
11392 documentation files will be included when doing a make
11393 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11394 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11396 more: tried to make install do the right thing, exclude CVS dirs
11399 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11400 Path would fit in more nicely.
11402 * all files that used to use pathstack: uses now Path instead.
11403 This change was a lot easier than expected.
11405 * src/support/path.h: new file
11407 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11409 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11411 * src/support/lyxstring.C (getline): Default arg was given for
11414 * Configure.cmd: removed file
11416 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11418 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11419 streams classes and types, add the proper 'using' statements when
11420 MODERN_STL is defined.
11422 * src/debug.h: move the << operator definition after the inclusion
11425 * src/support/filetools.C: include "LAssert.h", which is needed
11428 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11431 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11432 include "debug.h" to define a proper ostream.
11434 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11436 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11437 method to the SystemCall class which can kill a process, but it's
11438 not fully implemented yet.
11440 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11442 * src/support/FileInfo.h: Better documentation
11444 * src/lyxfunc.C: Added support for buffer-export html
11446 * src/menus.C: Added Export->As HTML...
11448 * lib/bind/*.bind: Added short-cut for buffer-export html
11450 * src/lyxrc.*: Added support for new \tth_command
11452 * lib/lyxrc.example: Added stuff for new \tth_command
11454 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11456 * lib/Makefile.am (IMAGES): removed images/README
11457 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11458 installes in correct place. Check permisions is installed
11461 * src/LaTeX.C: some no-op changes moved declaration of some
11464 * src/LaTeX.h (LATEX_H): changed include guard name
11466 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11468 * lib/reLyX/Makefile.am: install noweb2lyx.
11470 * lib/Makefile.am: install configure.
11472 * lib/reLyX/configure.in: declare a config aux dir; set package
11473 name to lyx (not sure what the best solution is); generate noweb2lyx.
11475 * lib/layouts/egs.layout: fix the bibliography layout.
11477 1999-10-08 Jürgen Vigna <jug@sad.it>
11479 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11480 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11481 it returned without continuing to search the path.
11483 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11485 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11486 also fixes a bug. It is not allowed to do tricks with std::strings
11487 like: string a("hei"); &a[e]; this will not give what you
11488 think... Any reason for the complexity in this func?
11490 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11492 * Updated README and INSTALL a bit, mostly to check that my
11493 CVS rights are correctly set up.
11495 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11497 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11498 does not allow '\0' chars but lyxstring and std::string does.
11500 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11502 * autogen.sh (AUTOCONF): let the autogen script create the
11503 POTFILES.in file too. POTFILES.in should perhaps now not be
11504 included in the cvs module.
11506 * some more files changed to use C++ includes instead of C ones.
11508 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11510 (Reread): added tostr to nlink. buggy output otherwise.
11511 (Reread): added a string() around szMode when assigning to Buffer,
11512 without this I got a log of garbled info strings.
11514 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11517 * I have added several ostream & operator<<(ostream &, some_type)
11518 functions. This has been done to avoid casting and warnings when
11519 outputting enums to lyxerr. This as thus eliminated a lot of
11520 explicit casts and has made the code clearer. Among the enums
11521 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11522 mathed enums, some font enum the Debug::type enum.
11524 * src/support/lyxstring.h (clear): missing method. equivalent of
11527 * all files that contained "stderr": rewrote constructs that used
11528 stderr to use lyxerr instead. (except bmtable)
11530 * src/support/DebugStream.h (level): and the passed t with
11531 Debug::ANY to avoid spurious bits set.
11533 * src/debug.h (Debug::type value): made it accept strings of the
11534 type INFO,INIT,KEY.
11536 * configure.in (Check for programs): Added a check for kpsewhich,
11537 the latex generation will use this later to better the dicovery of
11540 * src/BufferView.C (create_view): we don't need to cast this to
11541 (void*) that is done automatically.
11542 (WorkAreaButtonPress): removed some dead code.
11544 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11546 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11547 is not overwritten when translated (David Sua'rez de Lis).
11549 * lib/CREDITS: Added David Sua'rez de Lis
11551 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11553 * src/bufferparams.C (BufferParams): default input encoding is now
11556 * acinclude.m4 (cross_compiling): comment out macro
11557 LYX_GXX_STRENGTH_REDUCE.
11559 * acconfig.h: make sure that const is not defined (to empty) when
11560 we are compiling C++. Remove commented out code using SIZEOF_xx
11563 * configure.in : move the test for const and inline as late as
11564 possible so that these C tests do not interefere with C++ ones.
11565 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11566 has not been proven.
11568 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11570 * src/table.C (getDocBookAlign): remove bad default value for
11571 isColumn parameter.
11573 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11575 (ShowFileMenu2): ditto.
11577 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11578 of files to ignore.
11580 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11582 * Most files: finished the change from the old error code to use
11583 DebugStream for all lyxerr debugging. Only minor changes remain
11584 (e.g. the setting of debug levels using strings instead of number)
11586 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11588 * src/layout.C (Add): Changed to use compare_no_case instead of
11591 * src/FontInfo.C: changed loop variable type too string::size_type.
11593 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11595 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11596 set ETAGS_ARGS to --c++
11598 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11600 * src/table.C (DocBookEndOfCell): commented out two unused variables
11602 * src/paragraph.C: commented out four unused variables.
11604 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11605 insed a if clause with type string::size_type.
11607 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11610 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11612 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11613 variable, also changed loop to go from 0 to lenght + 1, instead of
11614 -1 to length. This should be correct.
11616 * src/LaTeX.C (scanError): use string::size_type as loop variable
11619 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11620 (l.896) since y_tmp and row was not used anyway.
11622 * src/insets/insetref.C (escape): use string::size_type as loop
11625 * src/insets/insetquotes.C (Width): use string::size_type as loop
11627 (Draw): use string::size_type as loop variable type.
11629 * src/insets/insetlatexaccent.C (checkContents): use
11630 string::size_type as loop variable type.
11632 * src/insets/insetlabel.C (escape): use string::size_type as loop
11635 * src/insets/insetinfo.C: added an extern for current_view.
11637 * src/insets/insetcommand.C (scanCommand): use string::size_type
11638 as loop variable type.
11640 * most files: removed the RCS tags. With them we had to recompile
11641 a lot of files after a simple cvs commit. Also we have never used
11642 them for anything meaningful.
11644 * most files: tags-query-replace NULL 0. As adviced several plases
11645 we now use "0" instead of "NULL" in our code.
11647 * src/support/filetools.C (SpaceLess): use string::size_type as
11648 loop variable type.
11650 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11652 * src/paragraph.C: fixed up some more string stuff.
11654 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11656 * src/support/filetools.h: make modestr a std::string.
11658 * src/filetools.C (GetEnv): made ch really const.
11660 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11661 made code that used these use max/min from <algorithm> instead.
11663 * changed several c library include files to their equivalent c++
11664 library include files. All is not changed yet.
11666 * created a support subdir in src, put lyxstring and lstrings
11667 there + the extra files atexit, fileblock, strerror. Created
11668 Makefile.am. edited configure.in and src/Makefile.am to use this
11669 new subdir. More files moved to support.
11671 * imported som of the functions from repository lyx, filetools
11673 * ran tags-query-replace on LString -> string, corrected the bogus
11674 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11675 is still some errors in there. This is errors where too much or
11676 too litle get deleted from strings (string::erase, string::substr,
11677 string::replace), there can also be some off by one errors, or
11678 just plain wrong use of functions from lstrings. Viewing of quotes
11681 * LyX is now running fairly well with string, but there are
11682 certainly some bugs yet (see above) also string is quite different
11683 from LString among others in that it does not allow null pointers
11684 passed in and will abort if it gets any.
11686 * Added the revtex4 files I forgot when setting up the repository.
11688 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11690 * All over: Tried to clean everything up so that only the files
11691 that we really need are included in the cvs repository.
11692 * Switched to use automake.
11693 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11694 * Install has not been checked.
11696 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11698 * po/pt.po: Three errors:
11699 l.533 and l.538 format specification error
11700 l. 402 duplicate entry, I just deleted it.