1 2000-10-11 Allan Rae <rae@lyx.org>
3 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
5 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
7 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
9 2000-10-10 Allan Rae <rae@lyx.org>
12 * src/lyxfunc.C (Dispatch):
14 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
17 * src/lyxrc.C (output): Only write the differences between system lyxrc
18 and the users settings.
21 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
23 I'll rewrite this later, after 1.1.6 probably, to keep a single
24 LyXRC but two instances of a LyXRCStruct.
26 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
28 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
30 * src/tabular.h: add a few std:: qualifiers.
32 * src/encoding.C: add using directive.
33 * src/language.C: ditto.
35 * src/insets/insetquotes.C (Validate): use languages->lang()
36 instead of only language.
38 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
40 * lib/languages: New file.
42 * lib/encodings: New file.
44 * src/language.C (Languages): New class.
45 (read): New method. Reads the languages from the 'languages' file.
47 * src/encoding.C (Encodings): New class.
48 (read): New method. Reads the encodings from the 'encodings' file.
50 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
53 * src/bufferparams.h and a lot of files: Deleted the member language,
54 and renamed language_info to language
56 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
57 * src/lyxfont.C (latexWriteStartChanges): ditto.
58 * src/paragraph.C (validate,TeXOnePar): ditto.
60 * src/lyxfont.C (update): Restored deleted code.
62 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
64 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
66 * src/BufferView_pimpl.C (buffer): cleaned up a little.
68 * src/insets/figinset.[Ch]:
69 * src/insets/insetinclude.[Ch]:
70 * src/insets/insetinclude.[Ch]:
71 * src/insets/insetparent.[Ch]:
72 * src/insets/insetref.[Ch]:
73 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
76 * src/mathed/formula.[Ch]:
77 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
79 * src/buffer.C (parseSingleLyXformat2Token, readInset):
80 * src/lyx_cb.C (FigureApplyCB):
81 * src/lyxfunc.C (getStatus, Dispatch):
82 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
85 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
87 * src/converter.[Ch] (Formats::View):
88 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
90 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
91 *current_view->buffer(). This will change later, but this patch is way
94 2000-10-09 Juergen Vigna <jug@sad.it>
96 * src/text.C (GetRow): small fix.
98 * src/BufferView_pimpl.C (cursorPrevious):
99 (cursorNext): added LyXText parameter to function.
101 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
102 keypress depending on cursor position.
104 2000-10-06 Juergen Vigna <jug@sad.it>
106 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
107 (copySelection): redone this function and also copy ascii representa-
110 * src/tabular.C (Ascii):
114 (print_n_chars): new functions to realize the ascii export of tabulars.
116 2000-10-05 Juergen Vigna <jug@sad.it>
118 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
119 if we don't have a buffer.
121 2000-10-10 Allan Rae <rae@lyx.org>
123 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
124 with closing dialog. It seems that nested tabfolders require hiding
125 of inner tabfolders before hiding the dialog itself. Actually all I
126 did was hide the active outer folder.
128 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
129 unless there really is a buffer. hideBufferDependent is called
132 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
133 POTFILES.in stays in $(srcdir).
135 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
137 * lib/lyxrc.example: Few changes.
139 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
141 * src/BufferView_pimpl.C (buffer): only need one the
142 updateBufferDependent signal to be emitted once! Moved to the end of
143 the method to allow bv_->text to be updated first.
145 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
146 and hSignal_ with Dialogs * and BufferDependency variables.
147 New Buffer * parent_, initialised when the dialog is launched. Used to
148 check whether to update() or hide() dialog in the new, private
149 updateOrHide() method that is connected to the updateBufferDependent
150 signal. Daughter classes dictate what to do using the
151 ChangedBufferAction enum, passed to the c-tor.
153 * src/frontends/xforms/FormCitation.C:
154 * src/frontends/xforms/FormCommand.C:
155 * src/frontends/xforms/FormCopyright.C:
156 * src/frontends/xforms/FormDocument.C:
157 * src/frontends/xforms/FormError.C:
158 * src/frontends/xforms/FormIndex.C:
159 * src/frontends/xforms/FormPreferences.C:
160 * src/frontends/xforms/FormPrint.C:
161 * src/frontends/xforms/FormRef.C:
162 * src/frontends/xforms/FormToc.C:
163 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
166 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
167 ChangedBufferAction enum.
169 * src/frontends/xforms/FormParagraph.[Ch]
170 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
173 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
175 * lib/bind/cua.bind: fix a bit.
176 * lib/bind/emacs.bind: ditto.
178 * lib/bind/menus.bind: remove real menu entries from there.
180 * src/spellchecker.C: make sure we only include strings.h when
183 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
185 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
186 function. It enlarges the maximum number of pup when needed.
187 (add_toc2): Open a new menu if maximum number of items per menu has
190 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
192 * src/frontends/kde/FormPrint.C: fix error reporting
194 * src/frontends/xforms/FormDocument.C: fix compiler
197 * lib/.cvsignore: add Literate.nw
199 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
202 * bufferview_funcs.[Ch]
205 * text2.C: Add support for numbers in RTL text.
207 2000-10-06 Allan Rae <rae@lyx.org>
209 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
210 to be gettext.m4 friendly again. ext_l10n.h is now
211 generated into $top_srcdir instead of $top_builddir
212 so that lyx.pot will be built correctly -- without
213 duplicate parsing of ext_l10n.h.
215 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
217 * src/frontends/kde/FormCitation.C: make the dialog
220 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
222 * config/kde.m4: fix consecutive ./configure runs,
223 look for qtarch, fix library order
225 * src/frontends/kde/Makefile.am: tidy up,
226 add Print dialog, add .dlg dependencies
228 * src/frontends/kde/FormPrint.C:
229 * src/frontends/kde/FormPrint.h:
230 * src/frontends/kde/formprintdialog.C:
231 * src/frontends/kde/formprintdialog.h:
232 * src/frontends/kde/formprintdialogdata.C:
233 * src/frontends/kde/formprintdialogdata.h:
234 * src/frontends/kde/dlg/formprintdialog.dlg: add
237 * src/frontends/kde/dlg/README: Added explanatory readme
239 * src/frontends/kde/dlg/checkinitorder.pl: small perl
240 script to double-check qtarch's output
242 * src/frontends/kde/formindexdialog.C:
243 * src/frontends/kde/formindexdialogdata.C:
244 * src/frontends/kde/formindexdialogdata.h:
245 * src/frontends/kde/dlg/formindexdialog.dlg: update
246 for qtarch, minor fixes
248 2000-10-05 Allan Rae <rae@lyx.org>
250 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
251 dialogs when switching buffers update them instead. It's up to each
252 dialog to decide if it should still be visible or not.
253 update() should return a bool to control visiblity within show().
254 Or perhaps better to set a member variable and use that to control
257 * lib/build-listerrors: create an empty "listerrors" file just to stop
258 make trying to regenerate it all the time if you don't have noweb
261 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
263 * po/Makefile.in.in (ext_l10n.h): added a rule to build
264 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
265 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
266 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
267 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
269 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
271 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
273 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
274 deleting buffer. Closes all buffer-dependent dialogs.
276 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
278 * src/frontends/xforms/FormCitation.[Ch]:
279 * src/frontends/xforms/FormPreferences.[Ch]:
280 * src/frontends/xforms/FormPrint.[Ch]:
281 * src/frontends/xforms/FormRef.[Ch]:
282 * src/frontends/xforms/FormUrl.[Ch]: ditto
284 * src/frontends/xforms/FormDocument.[Ch]:
285 * src/frontends/xforms/forms/form_document.C.patch:
286 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
287 pass through a single input() function.
289 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
291 * lib/build-listerrors: return status as OK
293 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
295 * lib/lyxrc.example: Updated to new export code
297 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
299 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
302 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
305 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
307 * lib/layouts/amsbook.layout: ditto.
309 * boost/Makefile.am: fix typo.
311 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
313 (add_lastfiles): removed.
314 (add_documents): removed.
315 (add_formats): removed.
317 * src/frontends/Menubar.C: remove useless "using" directive.
319 * src/MenuBackend.h: add a new MenuItem constructor.
321 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
324 2000-10-04 Allan Rae <rae@lyx.org>
326 * lib/Makefile.am (listerrors):
327 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
328 I haven't got notangle installed so Kayvan please test. The output
329 should end up in $builddir. This also allows people who don't have
330 noweb installed to complete the make process without error.
332 * src/frontends/xforms/FormCommand.[Ch] (showInset):
333 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
334 by JMarc's picky compiler.
336 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
339 * src/insets/insettabular.C (setPos): change for loop to not use
340 sequencing operator. Please check this Jürgen.
342 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
344 * src/insets/insetcite.C (getScreenLabel): ditto
345 * src/support/filetools.C (QuoteName): ditto
346 (ChangeExtension): ditto
348 * src/BufferView_pimpl.C (scrollCB): make heigt int
350 * src/BufferView2.C (insertInset): comment out unused arg
352 * boost/Makefile.am (EXTRADIST): new variable
354 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
356 * src/exporter.C (IsExportable): Fixed
358 * lib/configure.m4: Small fix
360 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
362 * src/insets/insetbutton.C (width): Changed to work with no GUI.
363 * src/insets/insetbib.C (bibitemWidest): ditto.
364 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
366 2000-10-03 Juergen Vigna <jug@sad.it>
368 * src/BufferView2.C (theLockingInset): removed const because of
369 Agnus's compile problems.
371 * src/insets/insettext.C (LocalDispatch): set the language of the
372 surronding paragraph on inserting the first character.
374 * various files: changed use of BufferView::the_locking_inset.
376 * src/BufferView2.C (theLockingInset):
377 (theLockingInset): new functions.
379 * src/BufferView.h: removed the_locking_inset.
381 * src/lyxtext.h: added the_locking_inset
383 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
385 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
387 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
389 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
390 * src/mathed/math_cursor.C (IsAlpha): ditto.
391 * src/mathed/math_inset.C (strnew): ditto.
392 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
393 (IMetrics): cxp set but never used; removed.
394 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
395 that the variable in question has been removed also!
398 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
399 using the Buffer * passed to Latex(), using the BufferView * passed to
400 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
402 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
403 Linuxdoc() and DocBook() rather than the stored Buffer * master.
405 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
406 * src/buffer.C (readInset): used new InsetBibtex c-tor
407 * (getBibkeyList): used new InsetBibtex::getKeys
409 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
412 * lib/build-listerrors
414 * src/exporter.C: Add literate programming support to the export code
417 * src/lyx_cb.C: Remove old literate code.
419 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
422 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
423 * src/converter.C (View, Convert): Use QuoteName.
425 * src/insets/figinset.C (Preview): Use Formats::View.
427 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
429 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
431 * src/lyxfunc.C (Dispatch): move declaration of text variable at
432 the top of the function, because compaq cxx complains that the
433 "goto exit_with_message" when the function is disabled bypasses
435 (MenuNew): try a better fix for the generation of new file names.
436 This time, I used AddName() instead of AddPath(), hoping Juergen
439 2000-10-03 Allan Rae <rae@lyx.org>
441 * src/frontends/xforms/forms/form_preferences.fd:
442 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
443 nested tabfolders has begun. The old "Miscellaneous" was renamed as
444 "Look and Feel"->"General" but will need to be split up further into
445 general output and general input tabs. Current plan is for four outer
446 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
447 stuff; "Inputs" for input and import configuration; "Outputs" for
448 output and export configuration; and one more whatever is left over
449 called "General". The leftovers at present look like being which
450 viewers to use, spellchecker, language support and might be better
451 named "Support". I've put "Paths" in "Inputs" for the moment as this
452 seems reasonable for now at least.
453 One problem remains: X error kills LyX when you close Preferences.
455 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
457 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
458 qualifier from form()
459 * src/frontends/xforms/FormCitation.[Ch]:
460 * src/frontends/xforms/FormCopyright.[Ch]:
461 * src/frontends/xforms/FormDocument.[Ch]:
462 * src/frontends/xforms/FormError.[Ch]:
463 * src/frontends/xforms/FormIndex.[Ch]:
464 * src/frontends/xforms/FormPreferences.[Ch]:
465 * src/frontends/xforms/FormPrint.[Ch]:
466 * src/frontends/xforms/FormRef.[Ch]:
467 * src/frontends/xforms/FormToc.[Ch]:
468 * src/frontends/xforms/FormUrl.[Ch]: ditto.
470 * src/frontends/xforms/FormCitation.[Ch]:
471 * src/frontends/xforms/FormIndex.[Ch]:
472 * src/frontends/xforms/FormRef.[Ch]:
473 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
474 with Allan's naming policy
476 * src/frontends/xforms/FormCitation.C: some static casts to remove
479 2000-10-02 Juergen Vigna <jug@sad.it>
481 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
482 now you can type or do stuff inside the table-cell also when in dummy
483 position, fixed visible cursor.
485 * src/insets/insettext.C (Edit): fixing cursor-view position.
487 * src/lyxfunc.C (Dispatch): use * text variable so that it can
488 be used for equal functions in lyxfunc and insettext.
490 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
492 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
494 * src/frontends/gnome/FormCitation.h:
495 * src/frontends/gnome/FormCopyright.h:
496 * src/frontends/gnome/FormIndex.h:
497 * src/frontends/gnome/FormPrint.h:
498 * src/frontends/gnome/FormToc.h:
499 * src/frontends/gnome/FormUrl.h:
500 * src/frontends/kde/FormCitation.h:
501 * src/frontends/kde/FormCopyright.h:
502 * src/frontends/kde/FormIndex.h:
503 * src/frontends/kde/FormRef.h:
504 * src/frontends/kde/FormToc.h:
505 * src/frontends/kde/FormUrl.h: fix remaining users of
508 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
510 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
512 (DocBookHandleCaption): ditto.
513 (DocBookHandleFootnote): ditto.
514 (SimpleDocBookOnePar): ditto.
516 * src/frontends/xforms/FormDocument.h (form): remove extra
517 FormDocument:: qualifier.
519 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
521 * sigc++/handle.h: ditto.
523 * src/lyx_gui_misc.C: add "using" directive.
525 * src/cheaders/cstddef: new file, needed by the boost library (for
528 2000-10-02 Juergen Vigna <jug@sad.it>
530 * src/insets/insettext.C (SetFont): better support.
532 * src/insets/insettabular.C (draw): fixed drawing of single cell.
534 * src/screen.C (DrawOneRow): some uint refixes!
536 2000-10-02 Allan Rae <rae@lyx.org>
538 * boost/.cvsignore: ignore Makefile as well
540 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
541 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
543 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
544 Left this one out by accident.
546 * src/frontends/xforms/FormBase.h (restore): default to calling
547 update() since that will restore the original/currently-applied values.
548 Any input() triggered error messages will require the derived classes
549 to redefine restore().
551 * src/frontends/xforms/FormDocument.C: initialize a few variables to
552 avoid a segfault. combo_doc_class is the main concern.
554 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
556 * Simplify build-listerrors in view of GUI-less export ability!
558 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
560 * src/lyx_main.C (easyParse): Disable gui when exporting
562 * src/insets/figinset.C:
566 * src/tabular.C: Changes to allow no-gui.
568 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
570 * src/support/utility.hpp: removed file
571 * src/support/block.h: removed file
573 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
576 * src/mathed/formula.C: add support/lyxlib.h
577 * src/mathed/formulamacro.C: ditto
579 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
580 * src/lyxparagraph.h: ditto
582 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
583 * src/frontends/Makefile.am (INCLUDES): ditto
584 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
585 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
586 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
587 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
588 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
589 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
591 * src/BufferView.h: use boost/utility.hpp
592 * src/LColor.h: ditto
594 * src/LyXAction.h: ditto
595 * src/LyXView.h: ditto
596 * src/bufferlist.h: ditto
597 * src/lastfiles.h: ditto
598 * src/layout.h: ditto
599 * src/lyx_gui.h: ditto
600 * src/lyx_main.h: ditto
601 * src/lyxlex.h: ditto
603 * src/frontends/ButtonPolicies.h: ditto
604 * src/frontends/Dialogs.h: ditto
605 * src/frontends/xforms/FormBase.h: ditto
606 * src/frontends/xforms/FormGraphics.h: ditto
607 * src/frontends/xforms/FormParagraph.h: ditto
608 * src/frontends/xforms/FormTabular.h: ditto
609 * src/graphics/GraphicsCache.h: ditto
610 * src/graphics/Renderer.h: ditto
611 * src/insets/ExternalTemplate.h: ditto
612 * src/insets/insetcommand.h: ditto
613 * src/support/path.h: ditto
615 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
616 and introduce clause for 2.97.
618 * boost/libs/README: new file
620 * boost/boost/utility.hpp: new file
622 * boost/boost/config.hpp: new file
624 * boost/boost/array.hpp: new file
626 * boost/Makefile.am: new file
628 * boost/.cvsignore: new file
630 * configure.in (AC_OUTPUT): add boost/Makefile
632 * Makefile.am (SUBDIRS): add boost
634 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
636 * src/support/lstrings.C (suffixIs): Fixed.
638 2000-10-01 Allan Rae <rae@lyx.org>
640 * src/PrinterParams.h: moved things around to avoid the "can't
641 inline call" warning.
643 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
644 into doc++ documentation.
646 * src/frontends/xforms/FormCommand.[Ch]: support button policy
648 * src/frontends/xforms/FormRef.C: make use of button controller
649 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
650 cleaned up button controller usage.
651 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
652 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
653 use the button controller
655 * src/frontends/xforms/forms/*.fd: and associated generated files
656 updated to reflect changes to FormBase. Some other FormXxxx files
657 also got minor updates to reflect changes to FormBase.
659 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
660 (hide): made virtual.
661 (input): return a bool. true == valid input
662 (RestoreCB, restore): new
663 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
664 Changes to allow derived dialogs to use a ButtonController and
665 make sense when doing so: OK button calls ok() and so on.
667 * src/frontends/xforms/ButtonController.h (class ButtonController):
668 Switch from template implementation to taking Policy parameter.
669 Allows FormBase to provide a ButtonController for any dialog.
671 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
672 Probably should rename connect and disconnect.
673 (apply): use the radio button groups
674 (form): needed by FormBase
675 (build): setup the radio button groups
677 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
679 * several files: type changes to reduce the number of warnings and
680 to unify type hangling a bit. Still much to do.
682 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
684 * lib/images/*: rename a bunch of icons to match Dekel converter
687 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
690 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
692 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
694 * sigc++/handle.h: ditto for class Handle.
696 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
698 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
700 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
702 * src/intl.C (InitKeyMapper): Correct the value of n due to the
703 removal of the "default" language.
705 * src/combox.h (getline): Check that sel > 0
707 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
709 * lib/examples/docbook_example.lyx
710 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
712 * lib/layouts/docbook-book.layout: new docbook book layout.
714 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
716 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
718 * src/insets/figinset.C (DocBook):fixed small typo.
720 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
722 * src/insets/insetinclude.h: string include_label doesn't need to be
725 2000-09-29 Allan Rae <rae@lyx.org>
727 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
728 Allow derived type to control connection and disconnection from signals
729 of its choice if desired.
731 2000-09-28 Juergen Vigna <jug@sad.it>
733 * src/insets/insettabular.C (update): fixed cursor setting when
734 the_locking_inset changed.
735 (draw): made this a bit cleaner.
736 (InsetButtonPress): fixed!
738 * various files: added LyXText Parameter to fitCursor call.
740 * src/BufferView.C (fitCursor): added LyXText parameter.
742 * src/insets/insettabular.C (draw): small draw fix.
744 * src/tabular.C: right setting of left/right celllines.
746 * src/tabular.[Ch]: fixed various types in funcions and structures.
747 * src/insets/insettabular.C: ditto
748 * src/frontends/xforms/FormTabular.C: ditto
750 2000-09-28 Allan Rae <rae@lyx.org>
752 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
753 that the #ifdef's had been applied to part of what should have been
754 a complete condition. It's possible there are other tests that
755 were specific to tables that are also wrong now that InsetTabular is
756 being used. Now we need to fix the output of '\n' after a table in a
757 float for the same reason as the original condition:
758 "don't insert this if we would be adding it before or after a table
759 in a float. This little trick is needed in order to allow use of
760 tables in \subfigures or \subtables."
761 Juergen can you check this?
763 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
765 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
766 outputed to the ostream.
768 * several files: fixed types based on warnings from cxx
770 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
772 * src/frontends/kde/Makefile.am: fix rule for
773 formindexdialogdata_moc.C
775 * src/.cvsignore: add ext_l10n.h to ignore
777 * acconfig.h: stop messing with __STRICT_ANSI__
778 * config/gnome.m4: remove option to set -ansi
779 * config/kde.m4: remove option to set -ansi
780 * config/lyxinclude.m4: don't set -ansi
782 2000-09-27 Juergen Vigna <jug@sad.it>
784 * various files: remove "default" language check.
786 * src/insets/insetquotes.C: removed use of current_view.
788 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
789 the one should have red ears by now!
791 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
792 in more then one paragraph. Fixed cursor-movement/selection.
794 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
795 paragraphs inside a text inset.
797 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
798 text-inset if this owner is an inset.
800 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
802 * src/Bullet.h: changed type of font, character and size to int
804 * src/buffer.C (asciiParagraph): remove actcell and fname1.
806 * src/insets/inseturl.[Ch]:
807 * src/insets/insetref.[Ch]:
808 * src/insets/insetlabel.[Ch]: add linelen to Ascii
810 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
812 * src/buffer.C (readFile): block-if statement rearranged to minimise
813 bloat. Patch does not reverse Jean-Marc's change ;-)
815 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
816 Class rewritten to store pointers to hide/update signals directly,
817 rather than Dialogs *. Also defined an enum to ease use. All xforms
818 forms can now be derived from this class.
820 * src/frontends/xforms/FormCommand.[Ch]
821 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
823 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
826 * src/frontends/xforms/forms/form_citation.fd
827 * src/frontends/xforms/forms/form_copyright.fd
828 * src/frontends/xforms/forms/form_error.fd
829 * src/frontends/xforms/forms/form_index.fd
830 * src/frontends/xforms/forms/form_ref.fd
831 * src/frontends/xforms/forms/form_toc.fd
832 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
834 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
836 * src/insets/insetfoot.C: removed redundent using directive.
838 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
840 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
841 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
843 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
844 created in the constructors in different groups. Then set() just
845 have to show the groups as needed. This fixes the redraw problems
846 (and is how the old menu code worked).
848 * src/support/lyxlib.h: declare the methods as static when we do
851 2000-09-26 Juergen Vigna <jug@sad.it>
853 * src/buffer.C (asciiParagraph): new function.
854 (writeFileAscii): new function with parameter ostream.
855 (writeFileAscii): use now asciiParagraph.
857 * various inset files: added the linelen parameter to the Ascii-func.
859 * src/tabular.C (Write): fixed error in writing file introduced by
860 the last changes from Lars.
862 * lib/bind/menus.bind: removed not supported functions.
864 * src/insets/insettext.C (Ascii): implemented this function.
866 * src/insets/lyxinset.h (Ascii): added linelen parameter.
868 * src/tabular.C (write_attribute[int,string,bool]): new functions.
869 (Write): use of the write_attribute functions.
871 * src/bufferlist.C (close): fixed reasking question!
873 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
875 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
876 new files use the everwhere possible.
879 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
880 src/log_form.C src/lyx.C:
883 * src/buffer.C (runLaTeX): remove func
885 * src/PaperLayout.C: removed file
886 * src/ParagraphExtra.C: likewise
887 * src/bullet_forms.C: likewise
888 * src/bullet_forms.h: likewise
889 * src/bullet_forms_cb.C: likewise
891 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
892 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
895 * several files: remove all traces of the old fd_form_paragraph,
896 and functions belonging to that.
898 * several files: remove all traces of the old fd_form_document,
899 and functions belonging to that.
901 * several files: constify local variables were possible.
903 * several files: remove all code that was dead when NEW_EXPORT was
906 * several files: removed string::c_str in as many places as
909 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
910 (e): be a bit more outspoken when patching
911 (updatesrc): only move files if changed.
913 * forms/layout_forms.h.patch: regenerated
915 * forms/layout_forms.fd: remove form_document and form_paragraph
916 and form_quotes and form_paper and form_table_options and
919 * forms/form1.fd: remove form_table
921 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
922 the fdui->... rewrite. Update some comments to xforms 0.88
924 * forms/bullet_forms.C.patch: removed file
925 * forms/bullet_forms.fd: likewise
926 * forms/bullet_forms.h.patch: likewise
928 * development/Code_rules/Rules: added a section on switch
929 statements. Updated some comment to xforms 0.88.
931 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
933 * src/buffer.C (readFile): make sure that the whole version number
934 is read after \lyxformat (even when it contains a comma)
936 * lib/ui/default.ui: change shortcut of math menu to M-a.
938 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
940 * src/vspace.C (nextToken): use isStrDbl() to check for proper
943 * src/LyXView.C (updateWindowTitle): show the full files name in
944 window title, limited to 30 characters.
946 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
947 When a number of characters has been given, we should not assume
948 that the string is 0-terminated.
950 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
951 calls (fixes some memory leaks)
953 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
954 trans member on exit.
956 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
958 * src/converter.C (GetReachable): fix typo.
960 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
961 understand ',' instead of '.'.
962 (GetInteger): rewrite to use strToInt().
964 2000-09-26 Juergen Vigna <jug@sad.it>
966 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
967 better visibility and error-message on wrong VSpace input.
969 * src/language.C (initL): added english again.
971 2000-09-25 Juergen Vigna <jug@sad.it>
973 * src/frontends/kde/Dialogs.C (Dialogs):
974 * src/frontends/gnome/Dialogs.C (Dialogs):
975 * src/frontends/kde/Makefile.am:
976 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
978 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
980 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
982 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
984 * src/frontends/xforms/FormParagraph.C:
985 * src/frontends/xforms/FormParagraph.h:
986 * src/frontends/xforms/form_paragraph.C:
987 * src/frontends/xforms/form_paragraph.h:
988 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
991 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
993 * src/tabular.C (OldFormatRead): forgot to delete the temporary
994 Paragraph-Data after use.
996 * src/insets/insettext.C (LocalDispatch): don't set the layout on
997 non breakable paragraphs.
999 2000-09-25 Garst R. Reese <reese@isn.net>
1001 * src/language.C (initL): added missing language_country codes.
1003 2000-09-25 Juergen Vigna <jug@sad.it>
1005 * src/insets/insettext.C (InsetText):
1006 (deleteLyXText): remove the not released LyXText structure!
1008 2000-09-24 Marko Vendelin <markov@ioc.ee>
1010 * src/frontends/gnome/mainapp.C
1011 * src/frontends/gnome/mainapp.h: added support for keyboard
1014 * src/frontends/gnome/FormCitation.C
1015 * src/frontends/gnome/FormCitation.h
1016 * src/frontends/gnome/Makefile.am
1017 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1018 FormCitation to use "action area" in mainapp window
1020 * src/frontends/gnome/Menubar_pimpl.C
1021 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1024 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1026 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1027 width/descent/ascent values if name is empty.
1028 (mathed_string_height): Use std::max.
1030 2000-09-25 Allan Rae <rae@lyx.org>
1032 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1033 segfault. This will be completely redesigned soon.
1035 * sigc++: updated libsigc++. Fixes struct timespec bug.
1037 * development/tools/makeLyXsigc.sh: .cvsignore addition
1039 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1041 * several files: removed almost all traces of the old table
1044 * src/TableLayout.C: removed file
1046 2000-09-22 Juergen Vigna <jug@sad.it>
1048 * src/frontends/kde/Dialogs.C: added credits forms.
1050 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1052 * src/frontends/gnome/Dialogs.C: added some forms.
1054 * src/spellchecker.C (init_spell_checker): set language in pspell code
1055 (RunSpellChecker): some modifications for setting language string.
1057 * src/language.[Ch]: added language_country code.
1059 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1061 * src/frontends/Dialogs.h: added new signal showError.
1062 Rearranged existing signals in some sort of alphabetical order.
1064 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1065 FormError.[Ch], form_error.[Ch]
1066 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1067 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1069 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1070 dialogs. I think that this can be used as the base to all these
1073 * src/frontends/xforms/FormError.[Ch]
1074 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1075 implementation of InsetError dialog.
1077 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1079 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1080 * src/frontends/kde/Makefile.am: ditto
1082 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1084 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1085 macrobf. This fixes a bug of invisible text.
1087 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1089 * lib/doc/LaTeXConfig.lyx.in: updated.
1091 * src/language.C (initL): remove language "francais" and change a
1092 bit the names of the two other french variations.
1094 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1095 string that may not be 0-terminated.
1097 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1099 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1101 2000-09-20 Marko Vendelin <markov@ioc.ee>
1103 * src/frontends/gnome/FormCitation.C
1104 * src/frontends/gnome/FormIndex.C
1105 * src/frontends/gnome/FormToc.C
1106 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1107 the variable initialization to shut up the warnings
1109 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1111 * src/table.[Ch]: deleted files
1113 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1116 2000-09-18 Juergen Vigna <jug@sad.it>
1118 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1119 problems with selection. Inserted new LFUN_PASTESELECTION.
1120 (InsetButtonPress): inserted handling of middle mouse-button paste.
1122 * src/spellchecker.C: changed word to word.c_str().
1124 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1126 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1127 included in the ``make dist'' tarball.
1129 2000-09-15 Juergen Vigna <jug@sad.it>
1131 * src/CutAndPaste.C (cutSelection): small fix return the right
1132 end position after cut inside one paragraph only.
1134 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1135 we are locked as otherwise we don't have a valid cursor position!
1137 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1139 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1141 * src/frontends/kde/FormRef.C: added using directive.
1142 * src/frontends/kde/FormToc.C: ditto
1144 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1146 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1148 2000-09-19 Marko Vendelin <markov@ioc.ee>
1150 * src/frontends/gnome/Menubar_pimpl.C
1151 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1152 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1154 * src/frontends/gnome/mainapp.C
1155 * src/frontends/gnome/mainapp.h: support for menu update used
1158 * src/frontends/gnome/mainapp.C
1159 * src/frontends/gnome/mainapp.h: support for "action" area in the
1160 main window. This area is used by small simple dialogs, such as
1163 * src/frontends/gnome/FormIndex.C
1164 * src/frontends/gnome/FormIndex.h
1165 * src/frontends/gnome/FormUrl.C
1166 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1169 * src/frontends/gnome/FormCitation.C
1170 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1171 action area. Only "Insert new citation" is implemented.
1173 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1175 * src/buffer.C (Dispatch): fix call to Dispatch
1176 * src/insets/insetref.C (Edit): likewise
1177 * src/insets/insetparent.C (Edit): likewise
1178 * src/insets/insetinclude.C (include_cb): likewise
1179 * src/frontends/xforms/FormUrl.C (apply): likewise
1180 * src/frontends/xforms/FormToc.C (apply): likewise
1181 * src/frontends/xforms/FormRef.C (apply): likewise
1182 * src/frontends/xforms/FormIndex.C (apply): likewise
1183 * src/frontends/xforms/FormCitation.C (apply): likewise
1184 * src/lyxserver.C (callback): likewise
1185 * src/lyxfunc.C (processKeySym): likewise
1186 (Dispatch): likewise
1187 (Dispatch): likewise
1188 * src/lyx_cb.C (LayoutsCB): likewise
1190 * Makefile.am (sourcedoc): small change
1192 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1194 * src/main.C (main): Don't make an empty GUIRunTime object. all
1195 methods are static. constify a bit remove unneded using + headers.
1197 * src/tabular.C: some more const to local vars move some loop vars
1199 * src/spellchecker.C: added some c_str after some word for pspell
1201 * src/frontends/GUIRunTime.h: add new static method setDefaults
1202 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1203 * src/frontends/kde/GUIRunTime.C (setDefaults):
1204 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1206 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1207 with strnew in arg, use correct emptystring when calling SetName.
1209 * several files: remove all commented code with relation to
1210 HAVE_SSTREAM beeing false. We now only support stringstream and
1213 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1215 * src/lyxfunc.C: construct correctly the automatic new file
1218 * src/text2.C (IsStringInText): change type of variable i to shut
1221 * src/support/sstream.h: do not use namespaces if the compiler
1222 does not support them.
1224 2000-09-15 Marko Vendelin <markov@ioc.ee>
1225 * src/frontends/gnome/FormCitation.C
1226 * src/frontends/gnome/FormCitation.h
1227 * src/frontends/gnome/diainsertcitation_interface.c
1228 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1229 regexp support to FormCitation [Gnome].
1231 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1234 * configure.in: remove unused KDE/GTKGUI define
1236 * src/frontends/kde/FormRef.C
1237 * src/frontends/kde/FormRef.h
1238 * src/frontends/kde/formrefdialog.C
1239 * src/frontends/kde/formrefdialog.h: double click will
1240 go to reference, now it is possible to change a cross-ref
1243 * src/frontends/kde/FormToc.C
1244 * src/frontends/kde/FormToc.h
1245 * src/frontends/kde/formtocdialog.C
1246 * src/frontends/kde/formtocdialog.h: add a depth
1249 * src/frontends/kde/Makefile.am: add QtLyXView.h
1252 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1254 * src/frontends/kde/FormCitation.h: added some using directives.
1256 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1258 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1261 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1264 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1266 * src/buffer.C (pop_tag): revert for the second time a change by
1267 Lars, who seems to really hate having non-local loop variables :)
1269 * src/Lsstream.h: add "using" statements.
1271 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1272 * src/buffer.C (writeFile): ditto
1274 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1276 * src/buffer.C (writeFile): try to fix the locale modified format
1277 number to always be as we want it.
1279 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1280 in XForms 0.89. C-space is now working again.
1282 * src/Lsstream.h src/support/sstream.h: new files.
1284 * also commented out all cases where strstream were used.
1286 * src/Bullet.h (c_str): remove method.
1288 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1290 * a lot of files: get rid of "char const *" and "char *" is as
1291 many places as possible. We only want to use them in interaction
1292 with system of other libraries, not inside lyx.
1294 * a lot of files: return const object is not of pod type. This
1295 helps ensure that temporary objects is not modified. And fits well
1296 with "programming by contract".
1298 * configure.in: check for the locale header too
1300 * Makefile.am (sourcedoc): new tag for generation of doc++
1303 2000-09-14 Juergen Vigna <jug@sad.it>
1305 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1306 callback to check which combo called it and do the right action.
1308 * src/combox.C (combo_cb): added combo * to the callbacks.
1309 (Hide): moved call of callback after Ungrab of the pointer.
1311 * src/intl.h: removed LCombo2 function.
1313 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1314 function as this can now be handled in one function.
1316 * src/combox.h: added Combox * to callback prototype.
1318 * src/frontends/xforms/Toolbar_pimpl.C:
1319 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1321 2000-09-14 Garst Reese <reese@isn.net>
1323 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1324 moved usepackage{xxx}'s to beginning of file. Changed left margin
1325 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1326 underlining from title. Thanks to John Culleton for useful suggestions.
1328 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/lyxlex_pimpl.C (setFile): change error message to debug
1333 2000-09-13 Juergen Vigna <jug@sad.it>
1335 * src/frontends/xforms/FormDocument.C: implemented choice_class
1336 as combox and give callback to combo_language so OK/Apply is activated
1339 * src/bufferlist.C (newFile): small fix so already named files
1340 (via an open call) are not requested to be named again on the
1343 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1345 * src/frontends/kde/Makefile.am
1346 * src/frontends/kde/FormRef.C
1347 * src/frontends/kde/FormRef.h
1348 * src/frontends/kde/formrefdialog.C
1349 * src/frontends/kde/formrefdialog.h: implement
1352 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1354 * src/frontends/kde/formtocdialog.C
1355 * src/frontends/kde/formtocdialog.h
1356 * src/frontends/kde/FormToc.C
1357 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1359 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1361 * src/frontends/kde/FormCitation.C: fix thinko
1362 where we didn't always display the reference text
1365 * src/frontends/kde/formurldialog.C
1366 * src/frontends/kde/formurldialog.h
1367 * src/frontends/kde/FormUrl.C
1368 * src/frontends/kde/FormUrl.h: minor cleanups
1370 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1372 * src/frontends/kde/Makefile.am
1373 * src/frontends/kde/FormToc.C
1374 * src/frontends/kde/FormToc.h
1375 * src/frontends/kde/FormCitation.C
1376 * src/frontends/kde/FormCitation.h
1377 * src/frontends/kde/FormIndex.C
1378 * src/frontends/kde/FormIndex.h
1379 * src/frontends/kde/formtocdialog.C
1380 * src/frontends/kde/formtocdialog.h
1381 * src/frontends/kde/formcitationdialog.C
1382 * src/frontends/kde/formcitationdialog.h
1383 * src/frontends/kde/formindexdialog.C
1384 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1386 2000-09-12 Juergen Vigna <jug@sad.it>
1388 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1391 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1393 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1396 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1398 * src/converter.C (Add, Convert): Added support for converter flags:
1399 needaux, resultdir, resultfile.
1400 (Convert): Added new parameter view_file.
1401 (dvips_options): Fixed letter paper option.
1403 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1404 (Export, GetExportableFormats, GetViewableFormats): Added support
1407 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1409 (easyParse): Fixed to work with new export code.
1411 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1414 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1416 * lib/bind/*.bind: Replaced
1417 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1418 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1420 2000-09-11 Juergen Vigna <jug@sad.it>
1422 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1424 * src/main.C (main): now GUII defines global guiruntime!
1426 * src/frontends/gnome/GUIRunTime.C (initApplication):
1427 * src/frontends/kde/GUIRunTime.C (initApplication):
1428 * src/frontends/xforms/GUIRunTime.C (initApplication):
1429 * src/frontends/GUIRunTime.h: added new function initApplication.
1431 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1433 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1435 2000-09-08 Juergen Vigna <jug@sad.it>
1437 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1438 we have already "Reset".
1440 * src/language.C (initL): inserted "default" language and made this
1441 THE default language (and not american!)
1443 * src/paragraph.C: inserted handling of "default" language!
1445 * src/lyxfont.C: ditto
1449 * src/paragraph.C: output the \\par only if we have a following
1450 paragraph otherwise it's not needed.
1452 2000-09-05 Juergen Vigna <jug@sad.it>
1454 * config/pspell.m4: added entry to lyx-flags
1456 * src/spellchecker.C: modified version from Kevin for using pspell
1458 2000-09-01 Marko Vendelin <markov@ioc.ee>
1459 * src/frontends/gnome/Makefile.am
1460 * src/frontends/gnome/FormCitation.C
1461 * src/frontends/gnome/FormCitation.h
1462 * src/frontends/gnome/diainsertcitation_callbacks.c
1463 * src/frontends/gnome/diainsertcitation_callbacks.h
1464 * src/frontends/gnome/diainsertcitation_interface.c
1465 * src/frontends/gnome/diainsertcitation_interface.h
1466 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1467 dialog for Gnome frontend
1469 * src/main.C: Gnome libraries require keeping application name
1470 and its version as strings
1472 * src/frontends/gnome/mainapp.C: Change the name of the main window
1473 from GnomeLyX to PACKAGE
1475 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1477 * src/frontends/Liason.C: add "using: declaration.
1479 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1481 * src/mathed/math_macro.C (Metrics): Set the size of the template
1483 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1485 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1487 * src/converter.C (add_options): New function.
1488 (SetViewer): Change $$FName into '$$FName'.
1489 (View): Add options when running xdvi
1490 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1491 (Convert): The 3rd parameter is now the desired filename. Converts
1492 calls to lyx::rename if necessary.
1493 Add options when running dvips.
1494 (dvi_papersize,dvips_options): New methods.
1496 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1498 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1499 using a call to Converter::dvips_options.
1500 Fixed to work with nex export code.
1502 * src/support/copy.C
1503 * src/support/rename.C: New files
1505 * src/support/syscall.h
1506 * src/support/syscall.C: Added Starttype SystemDontWait.
1508 * lib/ui/default.ui: Changed to work with new export code
1510 * lib/configure.m4: Changed to work with new export code
1512 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1514 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1516 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1517 so that code compiles with DEC cxx.
1519 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1520 to work correctly! Also now supports the additional elements
1523 2000-09-01 Allan Rae <rae@lyx.org>
1525 * src/frontends/ButtonPolicies.C: renamed all the references to
1526 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1528 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1529 since it's a const not a type.
1531 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1533 2000-08-31 Juergen Vigna <jug@sad.it>
1535 * src/insets/figinset.C: Various changes to look if the filename has
1536 an extension and if not add it for inline previewing.
1538 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1540 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1541 make buttonStatus and isReadOnly be const methods. (also reflect
1542 this in derived classes.)
1544 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1545 (nextState): change to be static inline, pass the StateMachine as
1547 (PreferencesPolicy): remove casts
1548 (OkCancelPolicy): remvoe casts
1549 (OkCancelReadOnlyPolicy): remove casts
1550 (NoRepeatedApplyReadOnlyPolicy): remove casts
1551 (OkApplyCancelReadOnlyPolicy): remove casts
1552 (OkApplyCancelPolicy): remove casts
1553 (NoRepeatedApplyPolicy): remove casts
1555 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1557 * src/converter.C: added some using directives
1559 * src/frontends/ButtonPolicies.C: changes to overcome
1560 "need lvalue" error with DEC c++
1562 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1563 to WMHideCB for DEC c++
1565 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1567 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1568 to BulletBMTableCB for DEC c++
1570 2000-08-31 Allan Rae <rae@lyx.org>
1572 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1573 character dialog separately from old document dialogs combo_language.
1576 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1578 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1579 Removed LFUN_REF_CREATE.
1581 * src/MenuBackend.C: Added new tags: toc and references
1583 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1584 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1586 (add_toc, add_references): New methods.
1587 (create_submenu): Handle correctly the case when there is a
1588 seperator after optional menu items.
1590 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1591 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1592 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1594 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1596 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1598 * src/converter.[Ch]: New file for converting between different
1601 * src/export.[Ch]: New file for exporting a LyX file to different
1604 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1605 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1606 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1607 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1608 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1609 RunDocBook, MenuExport.
1611 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1612 Exporter::Preview methods if NEW_EXPORT is defined.
1614 * src/buffer.C (Dispatch): Use Exporter::Export.
1616 * src/lyxrc.C: Added new tags: \converter and \viewer.
1619 * src/LyXAction.C: Define new lyx-function: buffer-update.
1620 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1621 when NEW_EXPORT is defined.
1623 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1625 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1627 * lib/ui/default.ui: Added submenus "view" and "update" to the
1630 * src/filetools.C (GetExtension): New function.
1632 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1634 2000-08-29 Allan Rae <rae@lyx.org>
1636 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1638 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1639 (EnableDocumentLayout): removed
1640 (DisableDocumentLayout): removed
1641 (build): make use of ButtonController's read-only handling to
1642 de/activate various objects. Replaces both of the above functions.
1644 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1645 (readOnly): was read_only
1646 (refresh): fixed dumb mistakes with read_only_ handling
1648 * src/frontends/xforms/forms/form_document.fd:
1649 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1650 tabbed dialogs so the tabs look more like tabs and so its easier to
1651 work out which is the current tab.
1653 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1654 segfault with form_table
1656 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1658 2000-08-28 Juergen Vigna <jug@sad.it>
1660 * acconfig.h: added USE_PSPELL.
1662 * src/config.h.in: added USE_PSPELL.
1664 * autogen.sh: added pspell.m4
1666 * config/pspell.m4: new file.
1668 * src/spellchecker.C: implemented support for pspell libary.
1670 2000-08-25 Juergen Vigna <jug@sad.it>
1672 * src/LyXAction.C (init): renamed LFUN_TABLE to
1673 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1675 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1677 * src/lyxscreen.h: add force_clear variable and fuction to force
1678 a clear area when redrawing in LyXText.
1680 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1682 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1684 * some whitespace and comment changes.
1686 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1688 * src/buffer.C: up te LYX_FORMAT to 2.17
1690 2000-08-23 Juergen Vigna <jug@sad.it>
1692 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1695 * src/insets/insettabular.C (pasteSelection): delete the insets
1696 LyXText as it is not valid anymore.
1697 (copySelection): new function.
1698 (pasteSelection): new function.
1699 (cutSelection): new function.
1700 (LocalDispatch): implemented cut/copy/paste of cell selections.
1702 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1703 don't have a LyXText.
1705 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1707 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1710 2000-08-22 Juergen Vigna <jug@sad.it>
1712 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1713 ifdef form_table out if NEW_TABULAR.
1715 2000-08-21 Juergen Vigna <jug@sad.it>
1717 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1718 (draw): fixed draw position so that the cursor is positioned in the
1720 (InsetMotionNotify): hide/show cursor so the position is updated.
1721 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1722 using cellstart() function where it should be used.
1724 * src/insets/insettext.C (draw): ditto.
1726 * src/tabular.C: fixed initialization of some missing variables and
1727 made BoxType into an enum.
1729 2000-08-22 Marko Vendelin <markov@ioc.ee>
1730 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1731 stock menu item using action numerical value, not its string
1735 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1737 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1738 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1740 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1742 * src/frontends/xforms/GUIRunTime.C: new file
1744 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1745 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1747 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1749 * src/frontends/kde/GUIRunTime.C: new file
1751 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1752 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1754 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1756 * src/frontends/gnome/GUIRunTime.C: new file
1758 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1761 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1762 small change to documetentation.
1764 * src/frontends/GUIRunTime.C: removed file
1766 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1768 * src/lyxparagraph.h: enable NEW_TABULAR as default
1770 * src/lyxfunc.C (processKeySym): remove some commented code
1772 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1773 NEW_TABULAR around the fd_form_table_options.
1775 * src/lyx_gui.C (runTime): call the static member function as
1776 GUIRunTime::runTime().
1778 2000-08-21 Allan Rae <rae@lyx.org>
1780 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1783 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1785 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1787 2000-08-21 Allan Rae <rae@lyx.org>
1789 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1790 keep Garst happy ;-)
1791 * src/frontends/xforms/FormPreferences.C (build): use setOK
1792 * src/frontends/xforms/FormDocument.C (build): use setOK
1793 (FormDocument): use the appropriate policy.
1795 2000-08-21 Allan Rae <rae@lyx.org>
1797 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1798 automatic [de]activation of arbitrary objects when in a read-only state.
1800 * src/frontends/ButtonPolicies.h: More documentation
1801 (isReadOnly): added to support the above.
1803 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1805 2000-08-18 Juergen Vigna <jug@sad.it>
1807 * src/insets/insettabular.C (getStatus): changed to return func_status.
1809 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1810 display toggle menu entries if they are.
1812 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1813 new document layout now.
1815 * src/lyxfunc.C: ditto
1817 * src/lyx_gui_misc.C: ditto
1819 * src/lyx_gui.C: ditto
1821 * lib/ui/default.ui: removed paper and quotes layout as they are now
1822 all in the document layout tabbed folder.
1824 * src/frontends/xforms/forms/form_document.fd: added Restore
1825 button and callbacks for all inputs for Allan's ButtonPolicy.
1827 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1828 (CheckChoiceClass): added missing params setting on class change.
1829 (UpdateLayoutDocument): added for updating the layout on params.
1830 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1831 (FormDocument): Implemented Allan's ButtonPolicy with the
1834 2000-08-17 Allan Rae <rae@lyx.org>
1836 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1837 so we can at least see the credits again.
1839 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1840 controller calls for the appropriate callbacks. Note that since Ok
1841 calls apply followed by cancel, and apply isn't a valid input for the
1842 APPLIED state, the bc_ calls have to be made in the static callback not
1843 within each of the real callbacks.
1845 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1846 (setOk): renamed from setOkay()
1848 2000-08-17 Juergen Vigna <jug@sad.it>
1850 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1851 in the implementation part.
1852 (composeUIInfo): don't show optional menu-items.
1854 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1856 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1858 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1859 text-state when in a text-inset.
1861 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1863 2000-08-17 Marko Vendelin <markov@ioc.ee>
1864 * src/frontends/gnome/FormIndex.C
1865 * src/frontends/gnome/FormIndex.h
1866 * src/frontends/gnome/FormToc.C
1867 * src/frontends/gnome/FormToc.h
1868 * src/frontends/gnome/dialogs
1869 * src/frontends/gnome/diatoc_callbacks.c
1870 * src/frontends/gnome/diatoc_callbacks.h
1871 * src/frontends/gnome/diainsertindex_callbacks.h
1872 * src/frontends/gnome/diainsertindex_callbacks.c
1873 * src/frontends/gnome/diainsertindex_interface.c
1874 * src/frontends/gnome/diainsertindex_interface.h
1875 * src/frontends/gnome/diatoc_interface.h
1876 * src/frontends/gnome/diatoc_interface.c
1877 * src/frontends/gnome/Makefile.am: Table of Contents and
1878 Insert Index dialogs implementation for Gnome frontend
1880 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1882 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1884 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1887 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1889 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1890 destructor. Don't definde if you don't need it
1891 (processEvents): made static, non-blocking events processing for
1893 (runTime): static method. event loop for xforms
1894 * similar as above for kde and gnome.
1896 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1897 new Pimpl is correct
1898 (runTime): new method calss the real frontends runtime func.
1900 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1902 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1904 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1906 2000-08-16 Juergen Vigna <jug@sad.it>
1908 * src/lyx_gui.C (runTime): added GUII RunTime support.
1910 * src/frontends/Makefile.am:
1911 * src/frontends/GUIRunTime.[Ch]:
1912 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1913 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1914 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1916 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1918 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1919 as this is already set in ${FRONTEND_INCLUDE} if needed.
1921 * configure.in (CPPFLAGS): setting the include dir for the frontend
1922 directory and don't set FRONTEND=xforms for now as this is executed
1925 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1927 * src/frontends/kde/Makefile.am:
1928 * src/frontends/kde/FormUrl.C:
1929 * src/frontends/kde/FormUrl.h:
1930 * src/frontends/kde/formurldialog.h:
1931 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1933 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1935 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1937 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1939 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1942 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1944 * src/WorkArea.C (work_area_handler): more work to get te
1945 FL_KEYBOARD to work with xforms 0.88 too, please test.
1947 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1949 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1951 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1954 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1956 * src/Timeout.h: remove Qt::emit hack.
1958 * several files: changes to allo doc++ compilation
1960 * src/lyxfunc.C (processKeySym): new method
1961 (processKeyEvent): comment out if FL_REVISION < 89
1963 * src/WorkArea.C: change some debugging levels.
1964 (WorkArea): set wantkey to FL_KEY_ALL
1965 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1966 clearer code and the use of compose with XForms 0.89. Change to
1967 use signals instead of calling methods in bufferview directly.
1969 * src/Painter.C: change some debugging levels.
1971 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1974 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1975 (workAreaKeyPress): new method
1977 2000-08-14 Juergen Vigna <jug@sad.it>
1979 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1981 * config/kde.m4: addes some features
1983 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1984 include missing xforms dialogs.
1986 * src/Timeout.h: a hack to be able to compile with qt/kde.
1988 * sigc++/.cvsignore: added acinclude.m4
1990 * lib/.cvsignore: added listerros
1992 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1993 xforms tree as objects are needed for other frontends.
1995 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1996 linking with not yet implemented xforms objects.
1998 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2000 2000-08-14 Baruch Even <baruch.even@writeme.com>
2002 * src/frontends/xforms/FormGraphics.h:
2003 * src/frontends/xforms/FormGraphics.C:
2004 * src/frontends/xforms/RadioButtonGroup.h:
2005 * src/frontends/xforms/RadioButtonGroup.C:
2006 * src/insets/insetgraphics.h:
2007 * src/insets/insetgraphics.C:
2008 * src/insets/insetgraphicsParams.h:
2009 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2010 instead of spaces, and various other indentation issues to make the
2011 sources more consistent.
2013 2000-08-14 Marko Vendelin <markov@ioc.ee>
2015 * src/frontends/gnome/dialogs/diaprint.glade
2016 * src/frontends/gnome/FormPrint.C
2017 * src/frontends/gnome/FormPrint.h
2018 * src/frontends/gnome/diaprint_callbacks.c
2019 * src/frontends/gnome/diaprint_callbacks.h
2020 * src/frontends/gnome/diaprint_interface.c
2021 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2024 * src/frontends/gnome/dialogs/diainserturl.glade
2025 * src/frontends/gnome/FormUrl.C
2026 * src/frontends/gnome/FormUrl.h
2027 * src/frontends/gnome/diainserturl_callbacks.c
2028 * src/frontends/gnome/diainserturl_callbacks.h
2029 * src/frontends/gnome/diainserturl_interface.c
2030 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2031 Gnome implementation
2033 * src/frontends/gnome/Dialogs.C
2034 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2035 all other dialogs. Copy all unimplemented dialogs from Xforms
2038 * src/frontends/gnome/support.c
2039 * src/frontends/gnome/support.h: support files generated by Glade
2043 * config/gnome.m4: Gnome configuration scripts
2045 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2046 configure --help message
2048 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2049 only if there are no events pendling in Gnome/Gtk. This enhances
2050 the performance of menus.
2053 2000-08-14 Allan Rae <rae@lyx.org>
2055 * lib/Makefile.am: listerrors cleaning
2057 * lib/listerrors: removed -- generated file
2058 * acinclude.m4: ditto
2059 * sigc++/acinclude.m4: ditto
2061 * src/frontends/xforms/forms/form_citation.fd:
2062 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2065 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2066 `updatesrc` and now we have a `test` target that does what `updatesrc`
2067 used to do. I didn't like having an install target that wasn't related
2070 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2071 on all except FormGraphics. This may yet happen. Followed by a major
2072 cleanup including using FL_TRANSIENT for most of the dialogs. More
2073 changes to come when the ButtonController below is introduced.
2075 * src/frontends/xforms/ButtonController.h: New file for managing up to
2076 four buttons on a dialog according to an externally defined policy.
2077 * src/frontends/xforms/Makefile.am: added above
2079 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2080 Apply and Cancel/Close buttons and everything in between and beyond.
2081 * src/frontends/Makefile.am: added above.
2083 * src/frontends/xforms/forms/form_preferences.fd:
2084 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2085 and removed variable 'status' as a result. Fixed the set_minsize thing.
2086 Use the new screen-font-update after checking screen fonts were changed
2087 Added a "Restore" button to restore the original lyxrc values while
2088 editing. This restores everything not just the last input changed.
2089 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2091 * src/LyXAction.C: screen-font-update added for updating buffers after
2092 screen font settings have been changed.
2093 * src/commandtags.h: ditto
2094 * src/lyxfunc.C: ditto
2096 * forms/lyx.fd: removed screen fonts dialog.
2097 * src/lyx_gui.C: ditto
2098 * src/menus.[Ch]: ditto
2099 * src/lyx.[Ch]: ditto
2100 * src/lyx_cb.C: ditto + code from here moved to make
2101 screen-font-update. And people wonder why progress on GUII is
2102 slow. Look at how scattered this stuff was! It takes forever
2105 * forms/fdfix.sh: Fixup the spacing after commas.
2106 * forms/makefile: Remove date from generated files. Fewer clashes now.
2107 * forms/bullet_forms.C.patch: included someones handwritten changes
2109 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2110 once I've discovered why LyXRC was made noncopyable.
2111 * src/lyx_main.C: ditto
2113 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2115 * src/frontends/xforms/forms/fdfix.sh:
2116 * src/frontends/xforms/forms/fdfixh.sed:
2117 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2118 * src/frontends/xforms/Form*.[hC]:
2119 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2120 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2121 provide a destructor for the struct FD_form_xxxx. Another version of
2122 the set_[max|min]size workaround and a few other cleanups. Actually,
2123 Angus' patch from 20000809.
2125 2000-08-13 Baruch Even <baruch.even@writeme.com>
2127 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2130 2000-08-11 Juergen Vigna <jug@sad.it>
2132 * src/insets/insetgraphics.C (InsetGraphics): changing init
2133 order because of warnings.
2135 * src/frontends/xforms/forms/makefile: adding patching .C with
2138 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2139 from .C.patch to .c.patch
2141 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2142 order because of warning.
2144 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2146 * src/frontends/Liason.C (setMinibuffer): new helper function
2148 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2150 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2152 * lib/ui/default.ui: commented out PaperLayout entry
2154 * src/frontends/xforms/form_document.[Ch]: new added files
2156 * src/frontends/xforms/FormDocument.[Ch]: ditto
2158 * src/frontends/xforms/forms/form_document.fd: ditto
2160 * src/frontends/xforms/forms/form_document.C.patch: ditto
2162 2000-08-10 Juergen Vigna <jug@sad.it>
2164 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2165 (InsetGraphics): initialized cacheHandle to 0.
2166 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2168 2000-08-10 Baruch Even <baruch.even@writeme.com>
2170 * src/graphics/GraphicsCache.h:
2171 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2172 correctly as a cache.
2174 * src/graphics/GraphicsCacheItem.h:
2175 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2178 * src/graphics/GraphicsCacheItem_pimpl.h:
2179 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2182 * src/insets/insetgraphics.h:
2183 * src/insets/insetgraphics.C: Changed from using a signal notification
2184 to polling when image is not loaded.
2186 2000-08-10 Allan Rae <rae@lyx.org>
2188 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2189 that there are two functions that have to been taken out of line by
2190 hand and aren't taken care of in the script. (Just a reminder note)
2192 * sigc++/macros/*.h.m4: Updated as above.
2194 2000-08-09 Juergen Vigna <jug@sad.it>
2196 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2198 * src/insets/insettabular.C: make drawing of single cell smarter.
2200 2000-08-09 Marko Vendelin <markov@ioc.ee>
2201 * src/frontends/gnome/Menubar_pimpl.C
2202 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2203 implementation: new files
2205 * src/frontends/gnome/mainapp.C
2206 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2209 * src/main.C: create Gnome main window
2211 * src/frontends/xforms/Menubar_pimpl.h
2212 * src/frontends/Menubar.C
2213 * src/frontends/Menubar.h: added method Menubar::update that calls
2214 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2216 * src/LyXView.C: calls Menubar::update to update the state
2219 * src/frontends/gnome/Makefile.am: added new files
2221 * src/frontends/Makefile.am: added frontend compiler options
2223 2000-08-08 Juergen Vigna <jug@sad.it>
2225 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2227 * src/bufferlist.C (close):
2228 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2229 documents if exiting without saving.
2231 * src/buffer.C (save): use removeAutosaveFile()
2233 * src/support/filetools.C (removeAutosaveFile): new function.
2235 * src/lyx_cb.C (MenuWrite): returns a bool now.
2236 (MenuWriteAs): check if file could really be saved and revert to the
2238 (MenuWriteAs): removing old autosavefile if existant.
2240 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2241 before Goto toggle declaration, because of compiler warning.
2243 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2245 * src/lyxfunc.C (MenuNew): small fix.
2247 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2249 * src/bufferlist.C (newFile):
2250 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2252 * src/lyxrc.C: added new_ask_filename tag
2254 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2256 * src/lyx.fd: removed code pertaining to form_ref
2257 * src/lyx.[Ch]: ditto
2258 * src/lyx_cb.C: ditto
2259 * src/lyx_gui.C: ditto
2260 * src/lyx_gui_misc.C: ditto
2262 * src/BufferView_pimpl.C (restorePosition): update buffer only
2265 * src/commandtags.h (LFUN_REFTOGGLE): removed
2266 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2267 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2268 (LFUN_REFBACK): renamed LFUN_REF_BACK
2270 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2271 * src/menus.C: ditto
2272 * src/lyxfunc.C (Dispatch): ditto.
2273 InsertRef dialog is now GUI-independent.
2275 * src/texrow.C: added using std::endl;
2277 * src/insets/insetref.[Ch]: strip out large amounts of code.
2278 The inset is now a container and this functionality is now
2279 managed by a new FormRef dialog
2281 * src/frontends/Dialogs.h (showRef, createRef): new signals
2283 * src/frontends/xforms/FormIndex.[Ch],
2284 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2285 when setting dialog's min/max size
2286 * src/frontends/xforms/FormIndex.[Ch]: ditto
2288 * src/frontends/xforms/FormRef.[Ch],
2289 src/frontends/xforms/forms/form_ref.fd: new xforms
2290 implementation of an InsetRef dialog
2292 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2295 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2296 ios::nocreate is not part of the standard. Removed.
2298 2000-08-07 Baruch Even <baruch.even@writeme.com>
2300 * src/graphics/Renderer.h:
2301 * src/graphics/Renderer.C: Added base class for rendering of different
2302 image formats into Pixmaps.
2304 * src/graphics/XPM_Renderer.h:
2305 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2306 in a different class.
2308 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2309 easily add support for other formats.
2311 * src/insets/figinset.C: plugged a leak of an X resource.
2313 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2315 * src/CutAndPaste.[Ch]: make all metods static.
2317 * development/Code_rules/Rules: more work, added section on
2318 Exceptions, and a References section.
2320 * a lot of header files: work to make doc++ able to generate the
2321 source documentation, some workarounds of doc++ problems. Doc++ is
2322 now able to generate the documentation.
2324 2000-08-07 Juergen Vigna <jug@sad.it>
2326 * src/insets/insettabular.C (recomputeTextInsets): removed function
2328 * src/tabular.C (SetWidthOfMulticolCell):
2330 (calculate_width_of_column_NMC): fixed return value so that it really
2331 only returns true if the column-width has changed (there where
2332 problems with muliticolumn-cells in this column).
2334 2000-08-04 Juergen Vigna <jug@sad.it>
2336 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2337 also on the scrollstatus of the inset.
2338 (workAreaMotionNotify): ditto.
2340 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2342 2000-08-01 Juergen Vigna <jug@sad.it>
2344 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2346 * src/commandtags.h:
2347 * src/LyXAction.C (init):
2348 * src/insets/inset.C (LocalDispatch): added support for
2351 * src/insets/inset.C (scroll): new functions.
2353 * src/insets/insettext.C (removeNewlines): new function.
2354 (SetAutoBreakRows): removes forced newlines in the text of the
2355 paragraph if autoBreakRows is set to false.
2357 * src/tabular.C (Latex): generates a parbox around the cell contents
2360 * src/frontends/xforms/FormTabular.C (local_update): removed
2361 the radio_useparbox button.
2363 * src/tabular.C (UseParbox): new function
2365 2000-08-06 Baruch Even <baruch.even@writeme.com>
2367 * src/graphics/GraphicsCache.h:
2368 * src/graphics/GraphicsCache.C:
2369 * src/graphics/GraphicsCacheItem.h:
2370 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2373 * src/insets/insetgraphics.h:
2374 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2375 drawing of the inline image.
2377 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2378 into the wrong position.
2380 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2383 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2385 * src/support/translator.h: move all typedefs to public section
2387 * src/support/filetools.C (MakeLatexName): return string const
2389 (TmpFileName): ditto
2390 (FileOpenSearch): ditto
2392 (LibFileSearch): ditto
2393 (i18nLibFileSearch): ditto
2396 (CreateTmpDir): ditto
2397 (CreateBufferTmpDir): ditto
2398 (CreateLyXTmpDir): ditto
2401 (MakeAbsPath): ditto
2403 (OnlyFilename): ditto
2405 (NormalizePath): ditto
2406 (CleanupPath): ditto
2407 (GetFileContents): ditto
2408 (ReplaceEnvironmentPath): ditto
2409 (MakeRelPath): ditto
2411 (ChangeExtension): ditto
2412 (MakeDisplayPath): ditto
2413 (do_popen): return cmdret const
2414 (findtexfile): return string const
2416 * src/support/DebugStream.h: add some /// to please doc++
2418 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2420 * src/texrow.C (same_rownumber): functor to use with find_if
2421 (getIdFromRow): rewritten to use find_if and to not update the
2422 positions. return true if row is found
2423 (increasePos): new method, use to update positions
2425 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2427 * src/lyxlex_pimpl.C (verifyTable): new method
2430 (GetString): return string const
2431 (pushTable): rewrite to use std::stack
2433 (setFile): better check
2436 * src/lyxlex.h: make LyXLex noncopyable
2438 * src/lyxlex.C (text): return char const * const
2439 (GetString): return string const
2440 (getLongString): return string const
2442 * src/lyx_gui_misc.C (askForText): return pair<...> const
2444 * src/lastfiles.[Ch] (operator): return string const
2446 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2447 istringstream not char const *.
2448 move token.end() out of loop.
2449 (readFile): move initializaton of token
2451 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2452 getIdFromRow is successful.
2454 * lib/bind/emacs.bind: don't include menus bind
2456 * development/Code_rules/Rules: the beginnings of making this
2457 better and covering more of the unwritten rules that we have.
2459 * development/Code_rules/Recommendations: a couple of wording
2462 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2464 * src/support/strerror.c: remove C++ comment.
2466 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2468 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2469 LFUN_INDEX_INSERT_LAST
2471 * src/texrow.C (getIdFromRow): changed from const_iterator to
2472 iterator, allowing code to compile with DEC cxx
2474 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2475 stores part of the class, as suggested by Allan. Will allow
2477 (apply): test to apply uses InsetCommandParams operator!=
2479 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2480 (apply): test to apply uses InsetCommandParams operator!=
2482 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2483 stores part of the class.
2484 (update): removed limits on min/max size.
2486 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2487 (apply): test to apply uses InsetCommandParams operator!=
2489 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2490 (Read, Write, scanCommand, getCommand): moved functionality
2491 into InsetCommandParams.
2493 (getScreenLabel): made pure virtual
2494 new InsetCommandParams operators== and !=
2496 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2497 c-tors based on InsetCommandParams. Removed others.
2498 * src/insets/insetinclude.[Ch]: ditto
2499 * src/insets/insetlabel.[Ch]: ditto
2500 * src/insets/insetparent.[Ch]: ditto
2501 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2503 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2504 insets derived from InsetCommand created using similar c-tors
2505 based on InsetCommandParams
2506 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2507 * src/menus.C (ShowRefsMenu): ditto
2508 * src/paragraph.C (Clone): ditto
2509 * src/text2.C (SetCounter): ditto
2510 * src/lyxfunc.C (Dispatch) ditto
2511 Also recreated old InsetIndex behaviour exactly. Can now
2512 index-insert at the start of a paragraph and index-insert-last
2513 without launching the pop-up.
2515 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2517 * lib/lyxrc.example: mark te pdf options as non functional.
2519 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2520 (isStrDbl): move tmpstr.end() out of loop.
2521 (strToDbl): move intialization of tmpstr
2522 (lowercase): return string const and move tmp.end() out of loop.
2523 (uppercase): return string const and move tmp.edn() out of loop.
2524 (prefixIs): add assertion
2529 (containsOnly): ditto
2530 (containsOnly): ditto
2531 (containsOnly): ditto
2532 (countChar): make last arg char not char const
2533 (token): return string const
2534 (subst): return string const, move tmp.end() out of loop.
2535 (subst): return string const, add assertion
2536 (strip): return string const
2537 (frontStrip): return string const, add assertion
2538 (frontStrip): return string const
2543 * src/support/lstrings.C: add inclde "LAssert.h"
2544 (isStrInt): move tmpstr.end() out of loop.
2546 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2547 toollist.end() out of loop.
2548 (deactivate): move toollist.end() out of loop.
2549 (update): move toollist.end() out of loop.
2550 (updateLayoutList): move tc.end() out of loop.
2551 (add): move toollist.end() out of loop.
2553 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2554 md.end() out of loop.
2556 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2558 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2561 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2562 (Erase): move insetlist.end() out of loop.
2564 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2565 ref to const string as first arg. Move initialization of some
2566 variables, whitespace changes.
2568 * src/kbmap.C (defkey): move table.end() out of loop.
2569 (kb_keymap): move table.end() out of loop.
2570 (findbinding): move table.end() out of loop.
2572 * src/MenuBackend.C (hasMenu): move end() out of loop.
2573 (getMenu): move end() out of loop.
2574 (getMenu): move menulist_.end() out of loop.
2576 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2578 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2581 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2582 (getFromLyXName): move infotab.end() out of loop.
2584 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2585 -fvtable-thunks -ffunction-sections -fdata-sections
2587 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2589 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2592 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2594 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2596 * src/frontends/xforms/FormCitation.[Ch],
2597 src/frontends/xforms/FormIndex.[Ch],
2598 src/frontends/xforms/FormToc.[Ch],
2599 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2601 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2603 * src/commandtags.h: renamed, created some flags for citation
2606 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2608 * src/lyxfunc.C (dispatch): use signals to insert index entry
2610 * src/frontends/Dialogs.h: new signal createIndex
2612 * src/frontends/xforms/FormCommand.[Ch],
2613 src/frontends/xforms/FormCitation.[Ch],
2614 src/frontends/xforms/FormToc.[Ch],
2615 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2617 * src/insets/insetindex.[Ch]: GUI-independent
2619 * src/frontends/xforms/FormIndex.[Ch],
2620 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2623 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2625 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2626 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2628 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2630 * src/insets/insetref.C (Latex): rewrite so that there is now
2631 question that a initialization is requested.
2633 * src/insets/insetcommand.h: reenable the hide signal
2635 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2637 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2638 fix handling of shortcuts (many bugs :)
2639 (add_lastfiles): ditto.
2641 * lib/ui/default.ui: fix a few shortcuts.
2643 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2645 * Makefile.am: Fix ``rpmdist'' target to return the exit
2646 status of the ``rpm'' command, instead of the last command in
2647 the chain (the ``rm lyx.xpm'' command, which always returns
2650 2000-08-02 Allan Rae <rae@lyx.org>
2652 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2653 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2654 * src/frontends/xforms/FormToc.C (FormToc): ditto
2656 * src/frontends/xforms/Makefile.am: A few forgotten files
2658 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2659 Signals-not-copyable-problem Lars' started commenting out.
2661 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2663 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2665 * src/insets/insetcommand.h: Signals is not copyable so anoter
2666 scheme for automatic hiding of forms must be used.
2668 * src/frontends/xforms/FormCitation.h: don't inerit from
2669 noncopyable, FormCommand already does that.
2670 * src/frontends/xforms/FormToc.h: ditto
2671 * src/frontends/xforms/FormUrl.h: ditto
2673 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2675 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2677 * src/insets/insetcommand.h (hide): new SigC::Signal0
2678 (d-tor) new virtual destructor emits hide signal
2680 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2681 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2683 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2684 LOF and LOT. Inset is now GUI-independent
2686 * src/insets/insetloa.[Ch]: redundant
2687 * src/insets/insetlof.[Ch]: ditto
2688 * src/insets/insetlot.[Ch]: ditto
2690 * src/frontends/xforms/forms/form_url.fd: tweaked!
2691 * src/frontends/xforms/forms/form_citation.fd: ditto
2693 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2694 dialogs dealing with InsetCommand insets
2696 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2697 FormCommand base class
2698 * src/frontends/xforms/FormUrl.[Ch]: ditto
2700 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2702 * src/frontends/xforms/FormToc.[Ch]: ditto
2704 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2705 passed a generic InsetCommand pointer
2706 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2708 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2709 and modified InsetTOC class
2710 * src/buffer.C: ditto
2712 * forms/lyx.fd: strip out old FD_form_toc code
2713 * src/lyx_gui_misc.C: ditto
2714 * src/lyx_gui.C: ditto
2715 * src/lyx_cb.C: ditto
2716 * src/lyx.[Ch]: ditto
2718 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2720 * src/support/utility.hpp: tr -d '\r'
2722 2000-08-01 Juergen Vigna <jug@sad.it>
2724 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2726 * src/commandtags.h:
2727 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2728 LFUN_TABULAR_FEATURES.
2730 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2731 LFUN_LAYOUT_TABULAR.
2733 * src/insets/insettabular.C (getStatus): implemented helper function.
2735 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2737 2000-07-31 Juergen Vigna <jug@sad.it>
2739 * src/text.C (draw): fixed screen update problem for text-insets.
2741 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2742 something changed probably this has to be added in various other
2745 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2747 2000-07-31 Baruch Even <baruch.even@writeme.com>
2749 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2750 templates to satisfy compaq cxx.
2753 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2755 * src/support/translator.h (equal_1st_in_pair::operator()): take
2756 const ref pair_type as arg.
2757 (equal_2nd_in_pair::operator()): ditto
2758 (Translator::~Translator): remove empty d-tor.
2760 * src/graphics/GraphicsCache.C: move include config.h to top, also
2761 put initialization of GraphicsCache::singleton here.
2762 (~GraphicsCache): move here
2763 (addFile): take const ref as arg
2766 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2768 * src/BufferView2.C (insertLyXFile): change te with/without header
2771 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2773 * src/frontends/xforms/FormGraphics.C (apply): add some
2774 static_cast. Not very nice, but required by compaq cxx.
2776 * src/frontends/xforms/RadioButtonGroup.h: include header
2777 <utility> instead of <pair.h>
2779 * src/insets/insetgraphicsParams.C: add using directive.
2780 (readResize): change return type to void.
2781 (readOrigin): ditto.
2783 * src/lyxfunc.C (getStatus): add missing break for build-program
2784 function; add test for Literate for export functions.
2786 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2787 entries in Options menu.
2789 2000-07-31 Baruch Even <baruch.even@writeme.com>
2791 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2792 protect against auto-allocation; release icon when needed.
2794 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2796 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2797 on usual typewriter.
2799 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2800 earlier czech.kmap), useful only for programming.
2802 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2804 * src/frontends/xforms/FormCitation.h: fix conditioning around
2807 2000-07-31 Juergen Vigna <jug@sad.it>
2809 * src/frontends/xforms/FormTabular.C (local_update): changed
2810 radio_linebreaks to radio_useparbox and added radio_useminipage.
2812 * src/tabular.C: made support for using minipages/parboxes.
2814 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2816 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2818 (descent): so the cursor is in the middle.
2819 (width): bit smaller box.
2821 * src/insets/insetgraphics.h: added display() function.
2823 2000-07-31 Baruch Even <baruch.even@writeme.com>
2825 * src/frontends/Dialogs.h: Added showGraphics signals.
2827 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2828 xforms form definition of the graphics dialog.
2830 * src/frontends/xforms/FormGraphics.h:
2831 * src/frontends/xforms/FormGraphics.C: Added files, the
2832 GUIndependent code of InsetGraphics
2834 * src/insets/insetgraphics.h:
2835 * src/insets/insetgraphics.C: Major writing to make it work.
2837 * src/insets/insetgraphicsParams.h:
2838 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2839 struct between InsetGraphics and GUI.
2841 * src/LaTeXFeatures.h:
2842 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2843 support for graphicx package.
2845 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2846 for the graphics inset.
2848 * src/support/translator.h: Added file, used in
2849 InsetGraphicsParams. this is a template to translate between two
2852 * src/frontends/xforms/RadioButtonGroup.h:
2853 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2854 way to easily control a radio button group.
2856 2000-07-28 Juergen Vigna <jug@sad.it>
2858 * src/insets/insettabular.C (LocalDispatch):
2859 (TabularFeatures): added support for lyx-functions of tabular features.
2860 (cellstart): refixed this function after someone wrongly changed it.
2862 * src/commandtags.h:
2863 * src/LyXAction.C (init): added support for tabular-features
2865 2000-07-28 Allan Rae <rae@lyx.org>
2867 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2868 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2869 triggers the callback for input checking. As a result we sometimes get
2870 "LyX: This shouldn't happen..." printed to cerr.
2871 (input): Started using status variable since I only free() on
2872 destruction. Some input checking for paths and font sizes.
2874 * src/frontends/xforms/FormPreferences.h: Use status to control
2875 activation of Ok and Apply
2877 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2878 callback. Also resized to stop segfaults with 0.88. The problem is
2879 that xforms-0.88 requires the folder to be wide enough to fit all the
2880 tabs. If it isn't it causes all sorts of problems.
2882 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2884 * src/frontends/xforms/forms/README: Reflect reality.
2886 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2887 * src/frontends/xforms/forms/makefile: ditto.
2889 * src/commandtags.h: Get access to new Preferences dialog
2890 * src/LyXAction.C: ditto
2891 * src/lyxfunc.C: ditto
2892 * lib/ui/default.ui: ditto
2894 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2896 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2898 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2901 * src/frontends/xforms/form_url.[Ch]: added.
2903 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2905 * src/insets/insetbib.h: fixed bug in previous commit
2907 * src/frontends/xforms/FormUrl.h: ditto
2909 * src/frontends/xforms/FormPrint.h: ditto
2911 * src/frontends/xforms/FormPreferences.h: ditto
2913 * src/frontends/xforms/FormCopyright.h: ditto
2915 * src/frontends/xforms/FormCitation.C: ditto
2917 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2918 private copyconstructor and private default contructor
2920 * src/support/Makefile.am: add utility.hpp
2922 * src/support/utility.hpp: new file from boost
2924 * src/insets/insetbib.h: set owner in clone
2926 * src/frontends/xforms/FormCitation.C: added missing include
2929 * src/insets/form_url.[Ch]: removed
2931 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2933 * development/lyx.spec.in
2934 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2935 file/directory re-organization.
2937 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2939 * src/insets/insetcommand.[Ch]: moved the string data and
2940 associated manipulation methods into a new stand-alone class
2941 InsetCommandParams. This class has two additional methods
2942 getAsString() and setFromString() allowing the contents to be
2943 moved around as a single string.
2944 (addContents) method removed.
2945 (setContents) method no longer virtual.
2947 * src/buffer.C (readInset): made use of new InsetCitation,
2948 InsetUrl constructors based on InsetCommandParams.
2950 * src/commandtags.h: add LFUN_INSERT_URL
2952 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2953 independent InsetUrl and use InsetCommandParams to extract
2954 string info and create new Insets.
2956 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2958 * src/frontends/xforms/FormCitation.C (apply): uses
2961 * src/frontends/xforms/form_url.C
2962 * src/frontends/xforms/form_url.h
2963 * src/frontends/xforms/FormUrl.h
2964 * src/frontends/xforms/FormUrl.C
2965 * src/frontends/xforms/forms/form_url.fd: new files
2967 * src/insets/insetcite.[Ch]: removed unused constructors.
2969 * src/insets/insetinclude.[Ch]: no longer store filename
2971 * src/insets/inseturl.[Ch]: GUI-independent.
2973 2000-07-26 Juergen Vigna <jug@sad.it>
2974 * renamed frontend from gtk to gnome as it is that what is realized
2975 and did the necessary changes in the files.
2977 2000-07-26 Marko Vendelin <markov@ioc.ee>
2979 * configure.in: cleaning up gnome configuration scripts
2981 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2983 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2984 shortcuts syndrom by redrawing them explicitely (a better solution
2985 would be appreciated).
2987 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2989 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2992 * src/lyx_cb.C (MenuExport): change html export to do the right
2993 thing depending of the document type (instead of having
2994 html-linuxdoc and html-docbook).
2995 * src/lyxfunc.C (getStatus): update for html
2996 * lib/ui/default.ui: simplify due to the above change.
2997 * src/menus.C (ShowFileMenu): update too (in case we need it).
2999 * src/MenuBackend.C (read): if a menu is defined twice, add the
3000 new entries to the exiting one.
3002 2000-07-26 Juergen Vigna <jug@sad.it>
3004 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3006 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3007 and return a bool if it did actual save the file.
3008 (AutoSave): don't autosave a unnamed doc.
3010 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3011 check if this is an UNNAMED new file and react to it.
3012 (newFile): set buffer to unnamed and change to not mark a new
3013 buffer dirty if I didn't do anything with it.
3015 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3017 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3019 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3020 friend as per Angus's patch posted to lyx-devel.
3022 * src/ext_l10n.h: updated
3024 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3025 gettext on the style string right before inserting them into the
3028 * autogen.sh: add code to extract style strings form layout files,
3029 not good enough yet.
3031 * src/frontends/gtk/.cvsignore: add MAKEFILE
3033 * src/MenuBackend.C (read): run the label strings through gettext
3034 before storing them in the containers.
3036 * src/ext_l10n.h: new file
3038 * autogen.sh : generate the ext_l10n.h file here
3040 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3042 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3045 * lib/ui/default.ui: fix a couple of typos.
3047 * config/gnome/gtk.m4: added (and added to the list of files in
3050 * src/insets/insetinclude.C (unique_id): fix when we are using
3051 lyxstring instead of basic_string<>.
3052 * src/insets/insettext.C (LocalDispatch): ditto.
3053 * src/support/filetools.C: ditto.
3055 * lib/configure.m4: create the ui/ directory if necessary.
3057 * src/LyXView.[Ch] (updateToolbar): new method.
3059 * src/BufferView_pimpl.C (buffer): update the toolbar when
3060 opening/closing buffer.
3062 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3064 * src/LyXAction.C (getActionName): enhance to return also the name
3065 and options of pseudo-actions.
3066 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3068 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3069 as an example of what is possible). Used in File->Build too (more
3070 useful) and in the import/export menus (to mimick the complicated
3071 handling of linuxdoc and friends). Try to update all the entries.
3073 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3076 * src/MenuBackend.C (read): Parse the new OptItem tag.
3078 * src/MenuBackend.h: Add a new optional_ data member (used if the
3079 entry should be omitted when the lyxfunc is disabled).
3081 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3082 function, used as a shortcut.
3083 (create_submenu): align correctly the shortcuts on the widest
3086 * src/MenuBackend.h: MenuItem.label() only returns the label of
3087 the menu without shortcut; new method shortcut().
3089 2000-07-14 Marko Vendelin <markov@ioc.ee>
3091 * src/frontends/gtk/Dialogs.C:
3092 * src/frontends/gtk/FormCopyright.C:
3093 * src/frontends/gtk/FormCopyright.h:
3094 * src/frontends/gtk/Makefile.am: added these source-files for the
3095 Gtk/Gnome support of the Copyright-Dialog.
3097 * src/main.C: added Gnome::Main initialization if using
3098 Gtk/Gnome frontend-GUI.
3100 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3102 * config/gnome/aclocal-include.m4
3103 * config/gnome/compiler-flags.m4
3104 * config/gnome/curses.m4
3105 * config/gnome/gnome--.m4
3106 * config/gnome/gnome-bonobo-check.m4
3107 * config/gnome/gnome-common.m4
3108 * config/gnome/gnome-fileutils.m4
3109 * config/gnome/gnome-ghttp-check.m4
3110 * config/gnome/gnome-gnorba-check.m4
3111 * config/gnome/gnome-guile-checks.m4
3112 * config/gnome/gnome-libgtop-check.m4
3113 * config/gnome/gnome-objc-checks.m4
3114 * config/gnome/gnome-orbit-check.m4
3115 * config/gnome/gnome-print-check.m4
3116 * config/gnome/gnome-pthread-check.m4
3117 * config/gnome/gnome-support.m4
3118 * config/gnome/gnome-undelfs.m4
3119 * config/gnome/gnome-vfs.m4
3120 * config/gnome/gnome-x-checks.m4
3121 * config/gnome/gnome-xml-check.m4
3122 * config/gnome/gnome.m4
3123 * config/gnome/gperf-check.m4
3124 * config/gnome/gtk--.m4
3125 * config/gnome/linger.m4
3126 * config/gnome/need-declaration.m4: added configuration scripts
3127 for Gtk/Gnome frontend-GUI
3129 * configure.in: added support for the --with-frontend=gtk option
3131 * autogen.sh: added config/gnome/* to list of config-files
3133 * acconfig.h: added define for GTKGUI-support
3135 * config/lyxinclude.m4: added --with-frontend[=value] option value
3136 for Gtk/Gnome frontend-GUI support.
3138 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3140 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3144 * src/paragraph.C (GetChar): remove non-const version
3146 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3147 (search_kw): use it.
3149 * src/lyx_main.C (init): if "preferences" exist, read that instead
3151 (ReadRcFile): return bool if the file could be read ok.
3152 (ReadUIFile): add a check to see if lex file is set ok.
3154 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3155 bastring can be used instead of lyxstring (still uses the old code
3156 if std::string is good enough or if lyxstring is used.)
3158 * src/encoding.C: make the arrays static, move ininle functions
3160 * src/encoding.h: from here.
3162 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3163 (parseSingleLyXformat2Token): move inset parsing to separate method
3164 (readInset): new private method
3166 * src/Variables.h: remove virtual from get().
3168 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3169 access to NEW_INSETS and NEW_TABULAR
3171 * src/MenuBackend.h: remove superfluous forward declaration of
3172 MenuItem. Add documentations tags "///", remove empty MenuItem
3173 destructor, remove private default contructor.
3175 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3177 (read): more string mlabel and mname to where they are used
3178 (read): remove unused variables mlabel and mname
3179 (defaults): unconditional clear, make menusetup take advantage of
3180 add returning Menu &.
3182 * src/LyXView.h: define NEW_MENUBAR as default
3184 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3185 to NEW_INSETS and NEW_TABULAR.
3186 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3187 defined. Change some of the "xxxx-inset-insert" functions names to
3190 * several files: more enahncements to NEW_INSETS and the resulting
3193 * lib/lyxrc.example (\date_insert_format): move to misc section
3195 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3196 bastring and use AC_CACHE_CHECK.
3197 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3198 the system have the newest methods. uses AC_CACHE_CHECK
3199 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3200 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3201 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3203 * configure.in: add LYX_CXX_GOOD_STD_STRING
3205 * acinclude.m4: recreated
3207 2000-07-24 Amir Karger
3209 * README: add Hebrew, Arabic kmaps
3212 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3214 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3217 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3219 * Lot of files: add pragma interface/implementation.
3221 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3223 * lib/ui/default.ui: new file (ans new directory). Contains the
3224 default menu and toolbar.
3226 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3227 global space. Toolbars are now read (as menus) in ui files.
3229 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3231 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3232 is disabled because the document is read-only. We want to have the
3233 toggle state of the function anyway.
3234 (getStatus): add code for LFUN_VC* functions (mimicking what is
3235 done in old-style menus)
3237 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3238 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3240 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3241 * src/BufferView_pimpl.C: ditto.
3242 * src/lyxfunc.C: ditto.
3244 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3245 default). This replaces old-style menus by new ones.
3247 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3248 MenuItem. Contain the data structure of a menu.
3250 * src/insets/insettext.C: use LyXView::setLayout instead of
3251 accessing directly the toolbar combox.
3252 * src/lyxfunc.C (Dispatch): ditto.
3254 * src/LyXView.C (setLayout): new method, which just calls
3255 Toolbar::setLayout().
3256 (updateLayoutChoice): move part of this method in Toolbar.
3258 * src/toolbar.[Ch]: removed.
3260 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3261 implementation the toolbar.
3263 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3264 the toolbar. It might make sense to merge it with ToolbarDefaults
3266 (setLayout): new function.
3267 (updateLayoutList): ditto.
3268 (openLayoutList): ditto.
3270 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3271 xforms implementation of the toolbar.
3272 (get_toolbar_func): comment out, since I do not
3273 know what it is good for.
3275 * src/ToolbarDefaults.h: Add the ItemType enum.
3277 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3278 for a list of allocated C strings. Used in Menubar xforms
3279 implementation to avoid memory leaks.
3281 * src/support/lstrings.[Ch] (uppercase): new version taking and
3285 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3286 * lib/bind/emacs.bind: ditto.
3288 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3290 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3291 forward decl of LyXView.
3293 * src/toolbar.C (toolbarItem): moved from toolbar.h
3294 (toolbarItem::clean): ditto
3295 (toolbarItem::~toolbarItem): ditto
3296 (toolbarItem::operator): ditto
3298 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3300 * src/paragraph.h: control the NEW_TABULAR define from here
3302 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3303 USE_TABULAR_INSETS to NEW_TABULAR
3305 * src/ToolbarDefaults.C: add include "lyxlex.h"
3307 * files using the old table/tabular: use NEW_TABULAR to control
3308 compilation of old tabular stuff.
3310 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3313 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3314 planemet in reading of old style floats, fix the \end_deeper
3315 problem when reading old style floats.
3317 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3319 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3321 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3323 * lib/bind/sciword.bind: updated.
3325 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3327 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3328 layout write problem
3330 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3332 * src/Makefile.am (INCLUDES): remove image directory from include
3335 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3336 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3338 * src/LyXView.C (create_form_form_main): read the application icon
3341 * lib/images/*.xpm: change the icons to use transparent color for
3344 * src/toolbar.C (update): change the color of the button when it
3347 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3349 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3350 setting explicitely the minibuffer.
3351 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3353 * src/LyXView.C (showState): new function. Shows font information
3354 in minibuffer and update toolbar state.
3355 (LyXView): call Toolbar::update after creating the
3358 * src/toolbar.C: change toollist to be a vector instead of a
3360 (BubbleTimerCB): get help string directly from the callback
3361 argument of the corresponding icon (which is the action)
3362 (set): remove unnecessary ugliness.
3363 (update): new function. update the icons (depressed, disabled)
3364 depending of the status of the corresponding action.
3366 * src/toolbar.h: remove help in toolbarItem
3368 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3370 * src/Painter.C (text): Added code for using symbol glyphs from
3371 iso10646 fonts. Currently diabled.
3373 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3376 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3377 magyar,turkish and usorbian.
3379 * src/paragraph.C (isMultiLingual): Made more efficient.
3381 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3384 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3385 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3386 Also changed the prototype to "bool math_insert_greek(char)".
3388 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3390 * lots of files: apply the NEW_INSETS on all code that will not be
3391 needed when we move to use the new insets. Enable the define in
3392 lyxparagrah.h to try it.
3394 * src/insets/insettabular.C (cellstart): change to be a static
3396 (InsetTabular): initialize buffer in the initializer list.
3398 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3400 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3401 form_print.h out of the header file. Replaced with forward
3402 declarations of the relevant struct.
3404 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3407 * src/commandtags.h: do not include "debug.h" which does not
3408 belong there. #include it in some other places because of this
3411 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3413 * src/insets/insetcaption.C: add a couple "using" directives.
3415 * src/toolbar.C (add): get the help text directly from lyxaction.
3417 (setPixmap): new function. Loads from disk and sets a pixmap on a
3418 botton; the name of the pixmap file is derived from the command
3421 * src/toolbar.h: remove members isBitmap and pixmap from
3424 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3425 * lib/images/: move many files from images/banner.xpm.
3427 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3429 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3430 * src/toolbar.C: ditto.
3431 * configure.in: ditto.
3432 * INSTALL: document.
3434 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3435 the spellchecker popup is closed from the WM.
3437 2000-07-19 Juergen Vigna <jug@sad.it>
3439 * src/insets/insetfloat.C (Write): small fix because we use the
3440 insetname for the type now!
3442 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3444 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3447 * src/frontends/Dialogs.h: removed hideCitation signal
3449 * src/insets/insetcite.h: added hide signal
3451 * src/insets/insetcite.C (~InsetCitation): emits new signal
3452 (getScreenLabel): "intelligent" label should now fit on the screen!
3454 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3456 * src/frontends/xforms/FormCitation.C (showInset): connects
3457 hide() to the inset's hide signal
3458 (show): modified to use fl_set_object_position rather than
3459 fl_set_object_geometry wherever possible
3461 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3463 * src/insets/lyxinset.h: add caption code
3465 * src/insets/insetfloat.C (type): new method
3467 * src/insets/insetcaption.C (Write): new method
3469 (LyxCode): new method
3471 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3472 to get it right together with using the FloatList.
3474 * src/commandtags.h: add LFUN_INSET_CAPTION
3475 * src/lyxfunc.C (Dispatch): handle it
3477 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3480 * src/Variables.[Ch]: make expand take a const reference, remove
3481 the destructor, some whitespace changes.
3483 * src/LyXAction.C (init): add caption-inset-insert
3485 * src/FloatList.C (FloatList): update the default floats a bit.
3487 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3489 * src/Variables.[Ch]: new files. Intended to be used for language
3490 specific strings (like \chaptername) and filename substitution in
3493 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3495 * lib/kbd/american.kmap: update
3497 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3499 * src/bufferparams.[Ch]: remove member allowAccents.
3501 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3503 * src/LaTeXLog.C: use the log_form.h header.
3504 * src/lyx_gui.C: ditto.
3505 * src/lyx_gui_misc.C: ditto.
3506 * src/lyxvc.h: ditto.
3508 * forms/log_form.fd: new file, created from latexoptions.fd. I
3509 kept the log popup and nuked the options form.
3511 * src/{la,}texoptions.[Ch]: removed.
3512 * src/lyx_cb.C (LaTeXOptions): ditto
3514 * src/lyx_gui.C (create_forms): do not handle the
3515 fd_latex_options form.
3517 2000-07-18 Juergen Vigna <jug@sad.it>
3519 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3520 name of the inset so that it can be requested outside (text2.C).
3522 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3525 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3527 * src/mathed/formula.h (ConvertFont): constify
3529 * src/mathed/formula.C (Read): add warning if \end_inset is not
3530 found on expected place.
3532 * src/insets/lyxinset.h (ConvertFont): consify
3534 * src/insets/insetquotes.C (ConvertFont): constify
3535 * src/insets/insetquotes.h: ditto
3537 * src/insets/insetinfo.h: add labelfont
3539 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3540 (ascent): use labelfont
3544 (Write): make .lyx file a bit nicer
3546 * src/insets/insetfloat.C (Write): simplify somewhat...
3547 (Read): add warning if arg is not found
3549 * src/insets/insetcollapsable.C: add using std::max
3550 (Read): move string token and add warning in arg is not found
3551 (draw): use std::max to get the right ty
3552 (getMaxWidth): simplify by using std::max
3554 * src/insets/insetsection.h: new file
3555 * src/insets/insetsection.C: new file
3556 * src/insets/insetcaption.h: new file
3557 * src/insets/insetcaption.C: new file
3559 * src/insets/inset.C (ConvertFont): constify signature
3561 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3562 insetcaption.[Ch] and insetsection.[Ch]
3564 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3565 uses to use LABEL_COUNTER_CHAPTER instead.
3566 * src/text2.C (SetCounter): here
3568 * src/counters.h: new file
3569 * src/counters.C: new file
3570 * src/Sectioning.h: new file
3571 * src/Sectioning.C: new file
3573 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3575 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3577 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3580 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3583 2000-07-17 Juergen Vigna <jug@sad.it>
3585 * src/tabular.C (Validate): check if array-package is needed.
3586 (SetVAlignment): added support for vertical alignment.
3587 (SetLTFoot): better support for longtable header/footers
3588 (Latex): modified to support added features.
3590 * src/LaTeXFeatures.[Ch]: added array-package.
3592 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3594 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3597 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3599 * configure.in: do not forget to put a space after -isystem.
3601 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3603 * lib/kbd/arabic.kmap: a few fixes.
3605 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3607 * some whitespace chagnes to a number of files.
3609 * src/support/DebugStream.h: change to make it easier for
3610 doc++ to parse correctly.
3611 * src/support/lyxstring.h: ditto
3613 * src/mathed/math_utils.C (compara): change to have only one
3615 (MathedLookupBOP): change because of the above.
3617 * src/mathed/math_delim.C (math_deco_compare): change to have only
3619 (search_deco): change becasue of the above.
3621 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3622 instead of manually coded one.
3624 * src/insets/insetquotes.C (Read): read the \end_inset too
3626 * src/insets/insetlatex.h: remove file
3627 * src/insets/insetlatex.C: remove file
3629 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3631 (InsetPrintIndex): remove destructor
3633 * src/insets/insetinclude.h: remove default constructor
3635 * src/insets/insetfloat.C: work to make it work better
3637 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3639 * src/insets/insetcite.h (InsetCitation): remove default constructor
3641 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3643 * src/text.C (GetColumnNearX): comment out some currently unused code.
3645 * src/paragraph.C (writeFile): move some initializations closer to
3647 (CutIntoMinibuffer): small change to use new matchIT operator
3651 (InsertInset): ditto
3654 (InsetIterator): ditto
3655 (Erase): small change to use new matchFT operator
3657 (GetFontSettings): ditto
3658 (HighestFontInRange): ditto
3661 * src/lyxparagraph.h: some chars changed to value_type
3662 (matchIT): because of some stronger checking (perhaps too strong)
3663 in SGI STL, the two operator() unified to one.
3666 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3668 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3669 the last inset read added
3670 (parseSingleLyXformat2Token): some more (future) compability code added
3671 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3672 (parseSingleLyXformat2Token): set last_inset_read
3673 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3674 (parseSingleLyXformat2Token): don't double intializw string next_token
3676 * src/TextCache.C (text_fits::operator()): add const's to the signature
3677 (has_buffer::operator()): ditto
3679 * src/Floating.h: add some comments on the class
3681 * src/FloatList.[Ch] (typeExist): new method
3684 * src/BackStack.h: added default constructor, wanted by Gcc.
3686 2000-07-14 Juergen Vigna <jug@sad.it>
3688 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3690 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3692 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3693 do a redraw when the window is resized!
3694 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3696 * src/insets/insettext.C (resizeLyXText): added function to correctly
3697 being able to resize the LyXWindow.
3699 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3701 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3703 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3704 crashes when closing dialog to a deleted inset.
3706 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3707 method! Now similar to other insets.
3709 2000-07-13 Juergen Vigna <jug@sad.it>
3711 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3713 * lib/examples/Literate.lyx: small patch!
3715 * src/insets/insetbib.C (Read): added this function because of wrong
3716 Write (without [begin|end]_inset).
3718 2000-07-11 Juergen Vigna <jug@sad.it>
3720 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3721 as the insertInset could not be good!
3723 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3724 the bool param should not be last.
3726 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3728 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3729 did submit that to Karl).
3731 * configure.in: use -isystem instead of -I for X headers. This
3732 fixes a problem on solaris with a recent gcc;
3733 put the front-end code after the X detection code;
3734 configure in sigc++ before lib/
3736 * src/lyx_main.C (commandLineHelp): remove -display from command
3739 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3741 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3742 Also put in Makefile rules for building the ``listerrors''
3743 program for parsing errors from literate programs written in LyX.
3745 * lib/build-listerrors: Added small shell script as part of compile
3746 process. This builds a working ``listerrors'' binary if noweb is
3747 installed and either 1) the VNC X server is installed on the machine,
3748 or 2) the user is compiling from within a GUI. The existence of a GUI
3749 is necessary to use the ``lyx --export'' feature for now. This
3750 hack can be removed once ``lyx --export'' no longer requires a GUI to
3753 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3755 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3756 now passed back correctly from gcc and placed "under" error
3757 buttons in a Literate LyX source.
3759 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3761 * src/text.C (GetColumnNearX): Better behavior when a RTL
3762 paragraph is ended by LTR text.
3764 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3767 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3769 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3770 true when clipboard is empty.
3772 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3774 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3775 row of the paragraph.
3776 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3777 to prevent calculation of bidi tables
3779 2000-07-07 Juergen Vigna <jug@sad.it>
3781 * src/screen.C (ToggleSelection): added y_offset and x_offset
3784 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3787 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3789 * src/insets/insettext.C: fixed Layout-Display!
3791 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3793 * configure.in: add check for strings.h header.
3795 * src/spellchecker.C: include <strings.h> in order to have a
3796 definition for bzero().
3798 2000-07-07 Juergen Vigna <jug@sad.it>
3800 * src/insets/insettext.C (draw): set the status of the bv->text to
3801 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3803 * src/screen.C (DrawOneRow):
3804 (DrawFromTo): redraw the actual row if something has changed in it
3807 * src/text.C (draw): call an update of the toplevel-inset if something
3808 has changed inside while drawing.
3810 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3812 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3814 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3815 processing inside class.
3817 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3818 processing inside class.
3820 * src/insets/insetindex.h new struct Holder, consistent with other
3823 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3824 citation dialog from main code and placed it in src/frontends/xforms.
3825 Dialog launched through signals instead of callbacks
3827 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3829 * lyx.man: update the options description.
3831 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3833 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3834 handle neg values, set min width to 590, add doc about -display
3836 2000-07-05 Juergen Vigna <jug@sad.it>
3838 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3839 calls to BufferView *.
3841 * src/insets/insettext.C (checkAndActivateInset): small fix non
3842 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3844 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3845 their \end_inset token!
3847 2000-07-04 edscott <edscott@imp.mx>
3849 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3850 lib/lyxrc.example: added option \wheel_jump
3852 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3854 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3855 remove support for -width,-height,-xpos and -ypos.
3857 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3859 * src/encoding.[Ch]: New files.
3861 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3862 (text): Call to the underline() method only when needed.
3864 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3866 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3867 encoding(s) for the document.
3869 * src/bufferparams.C (BufferParams): Changed default value of
3872 * src/language.C (newLang): Removed.
3873 (items[]): Added encoding information for all defined languages.
3875 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3876 encoding choice button.
3878 * src/lyxrc.h (font_norm_type): New member variable.
3879 (set_font_norm_type): New method.
3881 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3882 paragraphs with different encodings.
3884 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3885 (TransformChar): Changed to work correctly with Arabic points.
3886 (draw): Added support for drawing Arabic points.
3887 (draw): Removed code for drawing underbars (this is done by
3890 * src/support/textutils.h (IsPrintableNonspace): New function.
3892 * src/BufferView_pimpl.h: Added "using SigC::Object".
3893 * src/LyXView.h: ditto.
3895 * src/insets/insetinclude.h (include_label): Changed to mutable.
3897 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3899 * src/mathed/math_iter.h: remove empty destructor
3901 * src/mathed/math_cursor.h: remove empty destructor
3903 * src/insets/lyxinset.h: add THEOREM_CODE
3905 * src/insets/insettheorem.[Ch]: new files
3907 * src/insets/insetminipage.C: (InsertInset): remove
3909 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3911 (InsertInset): remove
3913 * src/insets/insetlist.C: (InsertList): remove
3915 * src/insets/insetfootlike.[Ch]: new files
3917 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3920 (InsertInset): ditto
3922 * src/insets/insetert.C: remove include Painter.h, reindent
3923 (InsertInset): move to header
3925 * src/insets/insetcollapsable.h: remove explicit from default
3926 contructor, remove empty destructor, add InsertInset
3928 * src/insets/insetcollapsable.C (InsertInset): new func
3930 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3932 * src/vspace.h: add explicit to constructor
3934 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3935 \textcompwordmark, please test this.
3937 * src/lyxrc.C: set ascii_linelen to 65 by default
3939 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3941 * src/commandtags.h: add LFUN_INSET_THEOREM
3943 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3944 (makeLinuxDocFile): remove _some_ of the nice logic
3945 (makeDocBookFile): ditto
3947 * src/Painter.[Ch]: (~Painter): removed
3949 * src/LyXAction.C (init): entry for insettheorem added
3951 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3953 (deplog): code to detect files generated by LaTeX, needs testing
3956 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3958 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3960 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3962 * src/LaTeX.C (deplog): Add a check for files that are going to be
3963 created by the first latex run, part of the project to remove the
3966 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3967 contents to the extension list.
3969 2000-07-04 Juergen Vigna <jug@sad.it>
3971 * src/text.C (NextBreakPoint): added support for needFullRow()
3973 * src/insets/lyxinset.h: added needFullRow()
3975 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3978 * src/insets/insettext.C: lots of changes for update!
3980 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3982 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3984 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3986 * src/insets/insetinclude.C (InsetInclude): fixed
3987 initialization of include_label.
3988 (unique_id): now returns a string.
3990 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3992 * src/LaTeXFeatures.h: new member IncludedFiles, for
3993 a map of key, included file name.
3995 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3996 with the included files for inclusion in SGML preamble,
3997 i. e., linuxdoc and docbook.
4000 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4001 nice (is the generated linuxdoc code to be exported?), that
4002 allows to remove column, and only_body that will be true for
4003 slave documents. Insets are allowed inside SGML font type.
4004 New handling of the SGML preamble for included files.
4005 (makeDocBookFile): the same for docbook.
4007 * src/insets/insetinclude.h:
4008 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4010 (DocBook): new export methods.
4012 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4013 and makeDocBookFile.
4015 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4016 formats to export with command line argument -x.
4018 2000-06-29 Juergen Vigna <jug@sad.it>
4020 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4021 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4023 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4024 region could already been cleared by an inset!
4026 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4028 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4031 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4033 (cursorToggle): remove special handling of lyx focus.
4035 2000-06-28 Juergen Vigna <jug@sad.it>
4037 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4040 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4042 * src/insets/insetindex.C (Edit): add a callback when popup is
4045 * src/insets/insettext.C (LocalDispatch):
4046 * src/insets/insetmarginal.h:
4047 * src/insets/insetlist.h:
4048 * src/insets/insetfoot.h:
4049 * src/insets/insetfloat.h:
4050 * src/insets/insetert.h: add a missing std:: qualifier.
4052 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4054 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4057 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4059 * src/insets/insettext.C (Read): remove tmptok unused variable
4060 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4061 (InsertInset): change for new InsetInset code
4063 * src/insets/insettext.h: add TEXT inline method
4065 * src/insets/insettext.C: remove TEXT macro
4067 * src/insets/insetmarginal.C (Write): new method
4068 (Latex): change output slightly
4070 * src/insets/insetfoot.C (Write): new method
4071 (Latex): change output slightly (don't use endl when no need)
4073 * src/insets/insetert.C (Write): new method
4075 * src/insets/insetcollapsable.h: make button_length, button_top_y
4076 and button_bottm_y protected.
4078 * src/insets/insetcollapsable.C (Write): simplify code by using
4079 tostr. Also do not output the float name, the children class
4080 should to that to get control over own arguments
4082 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4083 src/insets/insetminipage.[Ch]:
4086 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4088 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4090 * src/Makefile.am (lyx_SOURCES): add the new files
4092 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4093 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4094 * src/commandtags.h: ditto
4096 * src/LaTeXFeatures.h: add a std::set of used floattypes
4098 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4100 * src/FloatList.[Ch] src/Floating.h: new files
4102 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4104 * src/lyx_cb.C (TableApplyCB): ditto
4106 * src/text2.C: ditto
4107 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4108 (parseSingleLyXformat2Token): ditto + add code for
4109 backwards compability for old float styles + add code for new insets
4111 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4113 (InsertInset(size_type, Inset *, LyXFont)): new method
4114 (InsetChar(size_type, char)): changed to use the other InsetChar
4115 with a LyXFont(ALL_INHERIT).
4116 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4117 insert the META_INSET.
4119 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4121 * sigc++/thread.h (Threads): from here
4123 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4124 definition out of line
4125 * sigc++/scope.h: from here
4127 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4129 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4130 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4132 * Makefile.am (bindist): new target.
4134 * INSTALL: add instructions for doing a binary distribution.
4136 * development/tools/README.bin.example: update a bit.
4138 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4141 * lib/lyxrc.example: new lyxrc tag \set_color.
4143 * src/lyxfunc.C (Dispatch):
4144 * src/commandtags.h:
4145 * src/LyXAction.C: new lyxfunc "set-color".
4147 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4148 and an x11name given as strings.
4150 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4151 cache when a color is changed.
4153 2000-06-26 Juergen Vigna <jug@sad.it>
4155 * src/lyxrow.C (width): added this functions and variable.
4157 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4160 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4162 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4164 * images/undo_bw.xpm: new icon.
4165 * images/redo_bw.xpm: ditto.
4167 * configure.in (INSTALL_SCRIPT): change value to
4168 ${INSTALL} to avoid failures of install-script target.
4169 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4171 * src/BufferView.h: add a magic "friend" declaration to please
4174 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4176 * forms/cite.fd: modified to allow resizing without messing
4179 * src/insetcite.C: Uses code from cite.fd almost without
4181 User can now resize dialog in the x-direction.
4182 Resizing the dialog in the y-direction is prevented, as the
4183 code does this intelligently already.
4185 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4187 * INSTALL: remove obsolete entry in "problems" section.
4189 * lib/examples/sl_*.lyx: update of the slovenian examples.
4191 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4193 2000-06-23 Juergen Vigna <jug@sad.it>
4195 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4197 * src/buffer.C (resize): delete the LyXText of textinsets.
4199 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4201 * src/insets/lyxinset.h: added another parameter 'cleared' to
4202 the draw() function.
4204 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4205 unlocking inset in inset.
4207 2000-06-22 Juergen Vigna <jug@sad.it>
4209 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4210 of insets and moved first to LyXText.
4212 * src/mathed/formulamacro.[Ch]:
4213 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4215 2000-06-21 Juergen Vigna <jug@sad.it>
4217 * src/text.C (GetVisibleRow): look if I should clear the area or not
4218 using Inset::doClearArea() function.
4220 * src/insets/lyxinset.h: added doClearArea() function and
4221 modified draw(Painter &, ...) to draw(BufferView *, ...)
4223 * src/text2.C (UpdateInset): return bool insted of int
4225 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4227 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4228 combox in the character popup
4230 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4231 BufferParams const & params
4233 2000-06-20 Juergen Vigna <jug@sad.it>
4235 * src/insets/insettext.C (SetParagraphData): set insetowner on
4238 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4240 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4241 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4243 (form_main_): remove
4245 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4246 (create_form_form_main): remove FD_form_main stuff, connect to
4247 autosave_timeout signal
4249 * src/LyXView.[Ch] (getMainForm): remove
4250 (UpdateTimerCB): remove
4251 * src/BufferView_pimpl.h: inherit from SigC::Object
4253 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4254 signal instead of callback
4256 * src/BufferView.[Ch] (cursorToggleCB): remove
4258 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4260 * src/BufferView_pimpl.C: changes because of the one below
4262 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4263 instead of storing a pointer to a LyXText.
4265 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4267 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4269 * src/lyxparagraph.h
4271 * src/paragraph.C: Changed fontlist to a sorted vector.
4273 2000-06-19 Juergen Vigna <jug@sad.it>
4275 * src/BufferView.h: added screen() function.
4277 * src/insets/insettext.C (LocalDispatch): some selection code
4280 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4282 * src/insets/insettext.C (SetParagraphData):
4284 (InsetText): fixes for multiple paragraphs.
4286 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4288 * development/lyx.spec.in: Call configure with ``--without-warnings''
4289 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4290 This should be fine, however, since we generally don't want to be
4291 verbose when making an RPM.
4293 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4295 * lib/scripts/fig2pstex.py: New file
4297 2000-06-16 Juergen Vigna <jug@sad.it>
4299 * src/insets/insettabular.C (UpdateLocal):
4300 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4301 (LocalDispatch): Changed all functions to use LyXText.
4303 2000-06-15 Juergen Vigna <jug@sad.it>
4305 * src/text.C (SetHeightOfRow): call inset::update before requesting
4308 * src/insets/insettext.C (update):
4309 * src/insets/insettabular.C (update): added implementation
4311 * src/insets/lyxinset.h: added update function
4313 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4315 * src/text.C (SelectNextWord): protect against null pointers with
4316 old-style string streams. (fix from Paul Theo Gonciari
4319 * src/cite.[Ch]: remove erroneous files.
4321 * lib/configure.m4: update the list of created directories.
4323 * src/lyxrow.C: include <config.h>
4324 * src/lyxcursor.C: ditto.
4326 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4328 * lib/examples/decimal.lyx: new example file from Mike.
4330 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4331 to find template definitions (from Dekel)
4333 * src/frontends/.cvsignore: add a few things.
4335 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4337 * src/Timeout.C (TimeOut): remove default argument.
4339 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4342 * src/insets/ExternalTemplate.C: add a "using" directive.
4344 * src/lyx_main.h: remove the act_ struct, which seems unused
4347 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4349 * LyX Developers Meeting: All files changed, due to random C++ (by
4350 coincidence) code generator script.
4352 - external inset (cool!)
4353 - initial online editing of preferences
4354 - insettabular breaks insettext(s contents)
4356 - some DocBook fixes
4357 - example files update
4358 - other cool stuff, create a diff and look for yourself.
4360 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4362 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4363 -1 this is a non-line-breaking textinset.
4365 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4366 if there is no width set.
4368 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4370 * Lots of files: Merged the dialogbase branch.
4372 2000-06-09 Allan Rae <rae@lyx.org>
4374 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4375 and the Dispatch methods that used it.
4377 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4378 access to functions formerly kept in Dispatch.
4380 2000-05-19 Allan Rae <rae@lyx.org>
4382 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4383 made to_page and count_copies integers again. from_page remains a
4384 string however because I want to allow entry of a print range like
4385 "1,4,22-25" using this field.
4387 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4388 and printer-params-get. These aren't useful from the minibuffer but
4389 could be used by a script/LyXServer app provided it passes a suitable
4390 auto_mem_buffer. I guess I should take a look at how the LyXServer
4391 works and make it support xtl buffers.
4393 * sigc++/: updated to libsigc++-1.0.1
4395 * src/xtl/: updated to xtl-1.3.pl.11
4397 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4398 those changes done to the files in src/ are actually recreated when
4399 they get regenerated. Please don't ever accept a patch that changes a
4400 dialog unless that patch includes the changes to the corresponding *.fd
4403 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4404 stringOnlyContains, renamed it and generalised it.
4406 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4407 branch. Removed the remaining old form_print code.
4409 2000-04-26 Allan Rae <rae@lyx.org>
4411 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4412 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4414 2000-04-25 Allan Rae <rae@lyx.org>
4416 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4417 against a base of xtl-1.3.pl.4
4419 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4420 filter the Id: entries so they still show the xtl version number
4423 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4424 into the src/xtl code. Patch still pending with José (XTL)
4426 2000-04-24 Allan Rae <rae@lyx.org>
4428 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4429 both more generic and much safer. Use the new template functions.
4430 * src/buffer.[Ch] (Dispatch): ditto.
4432 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4433 and mem buffer more intelligently. Also a little general cleanup.
4436 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4437 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4438 * src/xtl/Makefile.am: ditto.
4439 * src/xtl/.cvsignore: ditto.
4440 * src/Makefile.am: ditto.
4442 * src/PrinterParams.h: Removed the macros member functions. Added a
4443 testInvariant member function. A bit of tidying up and commenting.
4444 Included Angus's idea for fixing operation with egcs-1.1.2.
4446 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4447 cool expansion of XTL's mem_buffer to support automatic memory
4448 management within the buffer itself. Removed the various macros and
4449 replaced them with template functions that use either auto_mem_buffer
4450 or mem_buffer depending on a #define. The mem_buffer support will
4451 disappear as soon as the auto_mem_buffer is confirmed to be good on
4452 other platforms/compilers. That is, it's there so you've got something
4455 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4456 effectively forked XTL. However I expect José will include my code
4457 into the next major release. Also fixed a memory leak.
4458 * src/xtl/text.h: ditto.
4459 * src/xtl/xdr.h: ditto.
4460 * src/xtl/giop.h: ditto.
4462 2000-04-16 Allan Rae <rae@lyx.org>
4464 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4465 by autogen.sh and removed by maintainer-clean anyway.
4466 * .cvsignore, sigc++/.cvsignore: Support the above.
4468 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4470 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4472 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4473 macros, renamed static callback-target member functions to suit new
4474 scheme and made them public.
4475 * src/frontends/xforms/forms/form_print.fd: ditto.
4476 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4478 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4481 * src/xtl/: New directory containing a minimal distribution of XTL.
4482 This is XTL-1.3.pl.4.
4484 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4486 2000-04-15 Allan Rae <rae@lyx.org>
4488 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4490 * sigc++/: Updated to libsigc++-1.0.0
4492 2000-04-14 Allan Rae <rae@lyx.org>
4494 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4495 use the generic ones in future. I'll modify my conversion script.
4497 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4499 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4500 (CloseAllBufferRelatedDialogs): Renamed.
4501 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4503 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4504 of the generic ones. These are the same ones my conversion script
4507 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4508 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4509 * src/buffer.C (Dispatch): ditto
4511 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4512 functions for updating and hiding buffer dependent dialogs.
4513 * src/BufferView.C (buffer): ditto
4514 * src/buffer.C (setReadonly): ditto
4515 * src/lyxfunc.C (CloseBuffer): ditto
4517 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4518 Dialogs.h, and hence all the SigC stuff, into every file that includes
4519 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4521 * src/BufferView2.C: reduce the number of headers included by buffer.h
4523 2000-04-11 Allan Rae <rae@lyx.org>
4525 * src/frontends/xforms/xform_macros.h: A small collection of macros
4526 for building C callbacks.
4528 * src/frontends/xforms/Makefile.am: Added above file.
4530 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4531 scheme again. This time it should work for JMarc. If this is
4532 successful I'll revise my conversion script to automate some of this.
4533 The static member functions in the class also have to be public for
4534 this scheme will work. If the scheme works (it's almost identical to
4535 the way BufferView::cursorToggleCB is handled so it should work) then
4536 FormCopyright and FormPrint will be ready for inclusion into the main
4537 trunk immediately after 1.1.5 is released -- provided we're prepared
4538 for complaints about lame compilers not handling XTL.
4540 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4542 2000-04-07 Allan Rae <rae@lyx.org>
4544 * config/lyxinclude.m4: A bit more tidying up (Angus)
4546 * src/LString.h: JMarc's <string> header fix
4548 * src/PrinterParams.h: Used string for most data to remove some
4549 ugly code in the Print dialog and avoid even uglier code when
4550 appending the ints to a string for output.
4552 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4553 and moved "default:" back to the end of switch statement. Cleaned
4554 up the printing so it uses the right function calls and so the
4555 "print to file" option actually puts the file in the right directory.
4557 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4559 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4560 and Ok+Apply button control into a separate method: input (Angus).
4561 (input) Cleaned it up and improved it to be very thorough now.
4562 (All CB) static_cast used instead of C style cast (Angus). This will
4563 probably change again once we've worked out how to keep gcc-2.8.1 happy
4564 with real C callbacks.
4565 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4566 ignore some of the bool settings and has random numbers instead. Needs
4567 some more investigation. Added other input length checks and checking
4568 of file and printer names.
4570 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4571 would link (Angus). Seems the old code doesn't compile with the pragma
4572 statement either. Separated callback entries from internal methods.
4574 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4576 2000-03-17 Allan Rae <rae@lyx.org>
4578 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4579 need it? Maybe it could go in Dialogs instead? I could make it a
4580 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4581 values to get the bool return value.
4582 (Dispatch): New overloaded method for xtl support.
4584 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4585 extern "C" callback instead of static member functions. Hopefully,
4586 JMarc will be able to compile this. I haven't changed
4587 forms/form_copyright.fd yet. Breaking one of my own rules already.
4589 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4590 because they aren't useful from the minibuffer. Maybe a LyXServer
4591 might want a help message though?
4593 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4595 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4596 xtl which needs both rtti and exceptions.
4598 * src/support/Makefile.am:
4599 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4601 * src/frontends/xforms/input_validators.[ch]: input filters and
4602 validators. These conrol what keys are valid in input boxes.
4603 Use them and write some more. Much better idea than waiting till
4604 after the user has pressed Ok to say that the input fields don't make
4607 * src/frontends/xforms/Makefile.am:
4608 * src/frontends/xforms/forms/form_print.fd:
4609 * src/frontends/xforms/forms/makefile:
4610 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4611 new scheme. Still have to make sure I haven't missed anything from
4612 the current implementation.
4614 * src/Makefile.am, src/PrinterParams.h: New data store.
4616 * other files: Added a couple of copyright notices.
4618 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4620 * src/insets/insetbib.h: move Holder struct in public space.
4622 * src/frontends/include/DialogBase.h: use SigC:: only when
4623 SIGC_CXX_NAMESPACES is defined.
4624 * src/frontends/include/Dialogs.h: ditto.
4626 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4628 * src/frontends/xforms/FormCopyright.[Ch]: do not
4629 mention SigC:: explicitely.
4631 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4633 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4634 deals with testing KDE in main configure.in
4635 * configure.in: ditto.
4637 2000-02-22 Allan Rae <rae@lyx.org>
4639 * Lots of files: Merged from HEAD
4641 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4642 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4644 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4646 * sigc++/: new minidist.
4648 2000-02-14 Allan Rae <rae@lyx.org>
4650 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4652 2000-02-08 Juergen Vigna <jug@sad.it>
4654 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4655 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4657 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4658 for this port and so it is much easier for other people to port
4659 dialogs in a common development environment.
4661 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4662 the QT/KDE implementation.
4664 * src/frontends/kde/Dialogs.C:
4665 * src/frontends/kde/FormCopyright.C:
4666 * src/frontends/kde/FormCopyright.h:
4667 * src/frontends/kde/Makefile.am:
4668 * src/frontends/kde/formcopyrightdialog.C:
4669 * src/frontends/kde/formcopyrightdialog.h:
4670 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4671 for the kde support of the Copyright-Dialog.
4673 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4674 subdir-substitution instead of hardcoded 'xforms' as we now have also
4677 * src/frontends/include/DialogBase.h (Object): just commented the
4678 label after #endif (nasty warning and I don't like warnings ;)
4680 * src/main.C (main): added KApplication initialization if using
4683 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4684 For now only the KDE event-loop is added if frontend==kde.
4686 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4688 * configure.in: added support for the --with-frontend[=value] option
4690 * autogen.sh: added kde.m4 file to list of config-files
4692 * acconfig.h: added define for KDEGUI-support
4694 * config/kde.m4: added configuration functions for KDE-port
4696 * config/lyxinclude.m4: added --with-frontend[=value] option with
4697 support for xforms and KDE.
4699 2000-02-08 Allan Rae <rae@lyx.org>
4701 * all Makefile.am: Fixed up so the make targets dist, distclean,
4702 install and uninstall all work even if builddir != srcdir. Still
4703 have a new sigc++ minidist update to come.
4705 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4707 2000-02-01 Allan Rae <rae@lyx.org>
4709 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4710 Many mods to get builddir != srcdir working.
4712 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4713 for building on NT and so we can do the builddir != srcdir stuff.
4715 2000-01-30 Allan Rae <rae@lyx.org>
4717 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4718 This will stay in "rae" branch. We probably don't really need it in
4719 the main trunk as anyone who wants to help programming it should get
4720 a full library installed also. So they can check both included and
4721 system supplied library compilation.
4723 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4724 Added a 'mini' distribution of libsigc++. If you feel the urge to
4725 change something in these directories - Resist it. If you can't
4726 resist the urge then you should modify the following script and rebuild
4727 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4728 all happen. Still uses a hacked version of libsigc++'s configure.in.
4729 I'm quite happy with the results. I'm not sure the extra work to turn
4730 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4731 worth the trouble and would probably lead to extra maintenance
4733 I haven't tested the following important make targets: install, dist.
4734 Not ready for prime time but very close. Maybe 1.1.5.
4736 * development/tools/makeLyXsigc.sh: A shell script to automatically
4737 generate our mini-dist of libsigc++. It can only be used with a CVS
4738 checkout of libsigc++ not a tarball distribution. It's well commented.
4739 This will end up as part of the libsigc++ distribution so other apps
4740 can easily have an included mini-dist. If someone makes mods to the
4741 sigc++ subpackage without modifying this script to generate those
4742 changes I'll be very upset!
4744 * src/frontends/: Started the gui/system indep structure.
4746 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4747 to access the gui-indep dialogs are in this class. Much improved
4748 design compared to previous revision. Lars, please refrain from
4749 moving this header into src/ like you did with Popups.h last time.
4751 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4753 * src/frontends/xforms/: Started the gui-indep system with a single
4754 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4757 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4758 Here you'll find a very useful makefile and automated fdfix.sh that
4759 makes updating dailogs a no-brainer -- provided you follow the rules
4760 set out in the README. I'm thinking about adding another script to
4761 automatically generate skeleton code for a new dialog given just the
4764 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4765 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4766 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4768 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4770 * src/support/LSubstring.C (operator): simplify
4772 * src/lyxtext.h: removed bparams, use buffer_->params instead
4774 * src/lyxrow.h: make Row a real class, move all variables to
4775 private and use accessors.
4777 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4779 (isRightToLeftPar): ditto
4780 (ChangeLanguage): ditto
4781 (isMultiLingual): ditto
4784 (SimpleTeXOnePar): ditto
4785 (TeXEnvironment): ditto
4786 (GetEndLabel): ditto
4788 (SetOnlyLayout): ditto
4789 (BreakParagraph): ditto
4790 (BreakParagraphConservative): ditto
4791 (GetFontSettings): ditto
4793 (CopyIntoMinibuffer): ditto
4794 (CutIntoMinibuffer): ditto
4795 (PasteParagraph): ditto
4796 (SetPExtraType): ditto
4797 (UnsetPExtraType): ditto
4798 (DocBookContTableRows): ditto
4799 (SimpleDocBookOneTablePar): ditto
4801 (TeXFootnote): ditto
4802 (SimpleTeXOneTablePar): ditto
4803 (TeXContTableRows): ditto
4804 (SimpleTeXSpecialChars): ditto
4807 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4808 to private and use accessors.
4810 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4811 this, we did not use it anymore and has not been for ages. Just a
4812 waste of cpu cycles.
4814 * src/language.h: make Language a real class, move all variables
4815 to private and use accessors.
4817 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4818 (create_view): remove
4819 (update): some changes for new timer
4820 (cursorToggle): use new timer
4821 (beforeChange): change for new timer
4823 * src/BufferView.h (cursorToggleCB): removed last paramter because
4826 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4827 (cursorToggleCB): change because of new timer code
4829 * lib/CREDITS: updated own mailaddress
4831 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4833 * src/support/filetools.C (PutEnv): fix the code in case neither
4834 putenv() nor setenv() have been found.
4836 * INSTALL: mention the install-strip Makefile target.
4838 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4839 read-only documents.
4841 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4843 * lib/reLyX/configure.in (VERSION): avoid using a previously
4844 generated reLyX wrapper to find out $prefix.
4846 * lib/examples/eu_adibide_lyx-atua.lyx:
4847 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4848 translation of the Tutorial (Dooteo)
4850 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4852 * forms/cite.fd: new citation dialog
4854 * src/insetcite.[Ch]: the new citation dialog is moved into
4857 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4860 * src/insets/insetcommand.h: data members made private.
4862 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4864 * LyX 1.1.5 released
4866 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4868 * src/version.h (LYX_RELEASE): to 1.1.5
4870 * src/spellchecker.C (RunSpellChecker): return false if the
4871 spellchecker dies upon creation.
4873 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4875 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4876 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4880 * lib/CREDITS: update entry for Martin Vermeer.
4882 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4884 * src/text.C (draw): Draw foreign language bars at the bottom of
4885 the row instead of at the baseline.
4887 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4889 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4891 * lib/bind/de_menus.bind: updated
4893 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4895 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4897 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4899 * src/menus.C (Limit_string_length): New function
4900 (ShowTocMenu): Limit the number of items/length of items in the
4903 * src/paragraph.C (String): Correct result for a paragraph inside
4906 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4908 * src/bufferlist.C (close): test of buf->getuser() == NULL
4910 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4912 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4913 Do not call to SetCursor when the paragraph is a closed footnote!
4915 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4917 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4920 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4922 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4925 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4926 reference popup, that activates the reference-back action
4928 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4930 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4931 the menus. Also fixed a bug.
4933 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4934 the math panels when switching buffers (unless new buffer is readonly).
4936 * src/BufferView.C (NoSavedPositions)
4937 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4939 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4941 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4942 less of dvi dirty or not.
4944 * src/trans_mgr.[Ch] (insert): change first parameter to string
4947 * src/chset.[Ch] (encodeString): add const to first parameter
4949 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4951 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4955 * src/LaTeX.C (deplog): better searching for dependency files in
4956 the latex log. Uses now regexps.
4958 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4959 instead of the box hack or \hfill.
4961 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4963 * src/lyxfunc.C (doImportHelper): do not create the file before
4964 doing the actual import.
4965 (doImportASCIIasLines): create a new file before doing the insert.
4966 (doImportASCIIasParagraphs): ditto.
4968 * lib/lyxrc.example: remove mention of non-existing commands
4970 * lyx.man: remove mention of color-related switches.
4972 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4974 * src/lyx_gui.C: remove all the color-related ressources, which
4975 are not used anymore.
4977 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4980 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4982 * src/lyxrc.C (read): Add a missing break in the switch
4984 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4986 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4988 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4991 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4993 * src/text.C (draw): draw bars under foreign language words.
4995 * src/LColor.[Ch]: add LColor::language
4997 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4999 * src/lyxcursor.h (boundary): New member variable
5001 * src/text.C (IsBoundary): New methods
5003 * src/text.C: Use the above for currect cursor movement when there
5004 is both RTL & LTR text.
5006 * src/text2.C: ditto
5008 * src/bufferview_funcs.C (ToggleAndShow): ditto
5010 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5012 * src/text.C (DeleteLineForward): set selection to true to avoid
5013 that DeleteEmptyParagraphMechanism does some magic. This is how it
5014 is done in all other functions, and seems reasonable.
5015 (DeleteWordForward): do not jump over non-word stuff, since
5016 CursorRightOneWord() already does it.
5018 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5019 DeleteWordBackward, since they seem safe to me (since selection is
5020 set to "true") DeleteEmptyParagraphMechanism does nothing.
5022 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5024 * src/lyx_main.C (easyParse): simplify the code by factoring the
5025 part that removes parameters from the command line.
5026 (LyX): check wether wrong command line options have been given.
5028 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5030 * src/lyx_main.C : add support for specifying user LyX
5031 directory via command line option -userdir.
5033 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5035 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5036 the number of items per popup.
5037 (Add_to_refs_menu): Ditto.
5039 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5041 * src/lyxparagraph.h: renamed ClearParagraph() to
5042 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5043 textclass as parameter, and do nothing if free_spacing is
5044 true. This fixes part of the line-delete-forward problems.
5046 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5047 (pasteSelection): ditto.
5048 (SwitchLayoutsBetweenClasses): more translatable strings.
5050 * src/text2.C (CutSelection): use StripLeadingSpaces.
5051 (PasteSelection): ditto.
5052 (DeleteEmptyParagraphMechanism): ditto.
5054 2000-05-26 Juergen Vigna <jug@sad.it>
5056 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5057 is not needed in tabular insets.
5059 * src/insets/insettabular.C (TabularFeatures): added missing features.
5061 * src/tabular.C (DeleteColumn):
5063 (AppendRow): implemented this functions
5064 (cellsturct::operator=): clone the inset too;
5066 2000-05-23 Juergen Vigna <jug@sad.it>
5068 * src/insets/insettabular.C (LocalDispatch): better selection support
5069 when having multicolumn-cells.
5071 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5073 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5075 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5077 * src/ColorHandler.C (getGCForeground): put more test into _()
5079 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5082 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5085 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5087 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5088 there are no labels, or when buffer is readonly.
5090 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5091 there are no labels, buffer is SGML, or when buffer is readonly.
5093 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5095 * src/LColor.C (LColor): change a couple of grey40 to grey60
5096 (LColor): rewore initalization to make compiles go some magnitude
5098 (getGUIName): don't use gettext until we need the string.
5100 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5102 * src/Bullet.[Ch]: Fixed a small bug.
5104 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5106 * src/paragraph.C (String): Several fixes/improvements
5108 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5110 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5112 * src/paragraph.C (String): give more correct output.
5114 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5116 * src/lyxfont.C (stateText) Do not output the language if it is
5117 eqaul to the language of the document.
5119 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5120 between two paragraphs with the same language.
5122 * src/paragraph.C (getParLanguage) Return a correct answer for an
5123 empty dummy paragraph.
5125 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5128 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5131 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5132 the menus/popup, if requested fonts are unavailable.
5134 2000-05-22 Juergen Vigna <jug@sad.it>
5136 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5137 movement support (Up/Down/Tab/Shift-Tab).
5138 (LocalDispatch): added also preliminari cursor-selection.
5140 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5142 * src/paragraph.C (PasteParagraph): Hopefully now right!
5144 2000-05-22 Garst R. Reese <reese@isn.net>
5146 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5147 of list, change all references to Environment to Command
5148 * tex/hollywood.cls : rewrite environments as commands, add
5149 \uppercase to interiorshot and exteriorshot to force uppecase.
5150 * tex/broadway.cls : rewrite environments as commands. Tweak
5153 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5155 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5156 size of items: use a constant intead of the hardcoded 40, and more
5157 importantly do not remove the %m and %x tags added at the end.
5158 (Add_to_refs_menu): use vector::size_type instead of
5159 unsigned int as basic types for the variables. _Please_ do not
5160 assume that size_t is equal to unsigned int. On an alpha, this is
5161 unsigned long, which is _not_ the same.
5163 * src/language.C (initL): remove language "hungarian", since it
5164 seems that "magyar" is better.
5166 2000-05-22 Juergen Vigna <jug@sad.it>
5168 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5170 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5173 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5174 next was deleted but not set to 0.
5176 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5178 * src/language.C (initL): change the initialization of languages
5179 so that compiles goes _fast_.
5181 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5184 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5186 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5190 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5192 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5194 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5198 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5201 * src/insets/insetlo*.[Ch]: Made editable
5203 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5205 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5206 the current selection.
5208 * src/BufferView_pimpl.C (stuffClipboard): new method
5210 * src/BufferView.C (stuffClipboard): new method
5212 * src/paragraph.C (String): new method
5214 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5215 LColor::ignore when lyxname is not found.
5217 * src/BufferView.C (pasteSelection): new method
5219 * src/BufferView_pimpl.C (pasteSelection): new method
5221 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5223 * src/WorkArea.C (request_clipboard_cb): new static function
5224 (getClipboard): new method
5225 (putClipboard): new method
5227 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5229 * LyX 1.1.5pre2 released
5231 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5233 * src/vspace.C (operator=): removed
5234 (operator=): removed
5236 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5238 * src/layout.C (NumberOfClass): manually set the type in make_pair
5239 (NumberOfLayout): ditto
5241 * src/language.C: use the Language constructor for ignore_lang
5243 * src/language.h: add constructors to struct Language
5245 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5247 * src/text2.C (SetCursorIntern): comment out #warning
5249 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5251 * src/mathed/math_iter.h: initialize sx and sw to 0
5253 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5255 * forms/lyx.fd: Redesign of form_ref
5257 * src/LaTeXFeatures.[Ch]
5261 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5264 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5265 and Buffer::inset_iterator.
5267 * src/menus.C: Added new menus: TOC and Refs.
5269 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5271 * src/buffer.C (getTocList): New method.
5273 * src/BufferView2.C (ChangeRefs): New method.
5275 * src/buffer.C (getLabelList): New method. It replaces the old
5276 getReferenceList. The return type is vector<string> instead of
5279 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5280 the old getLabel() and GetNumberOfLabels() methods.
5281 * src/insets/insetlabel.C (getLabelList): ditto
5282 * src/mathed/formula.C (getLabelList): ditto
5284 * src/paragraph.C (String): New method.
5286 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5287 Uses the new getTocList() method.
5288 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5289 which automatically updates the contents of the browser.
5290 (RefUpdateCB): Use the new getLabelList method.
5292 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5294 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5296 * src/spellchecker.C: Added using std::reverse;
5298 2000-05-19 Juergen Vigna <jug@sad.it>
5300 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5302 * src/insets/insettext.C (computeTextRows): small fix for display of
5303 1 character after a newline.
5305 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5308 2000-05-18 Juergen Vigna <jug@sad.it>
5310 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5311 when changing width of column.
5313 * src/tabular.C (set_row_column_number_info): setting of
5314 autobreak rows if necessary.
5316 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5318 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5320 * src/vc-backend.*: renamed stat() to status() and vcstat to
5321 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5322 compilation broke. The new name seems more relevant, anyway.
5324 2000-05-17 Juergen Vigna <jug@sad.it>
5326 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5327 which was wrong if the removing caused removing of rows!
5329 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5330 (pushToken): new function.
5332 * src/text2.C (CutSelection): fix problem discovered with purify
5334 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5336 * src/debug.C (showTags): enlarge the first column, now that we
5337 have 6-digits debug codes.
5339 * lib/layouts/hollywood.layout:
5340 * lib/tex/hollywood.cls:
5341 * lib/tex/brodway.cls:
5342 * lib/layouts/brodway.layout: more commands and fewer
5343 environments. Preambles moved in the .cls files. Broadway now has
5344 more options on scene numbering and less whitespace (from Garst)
5346 * src/insets/insetbib.C (getKeys): make sure that we are in the
5347 document directory, in case the bib file is there.
5349 * src/insets/insetbib.C (Latex): revert bogus change.
5351 2000-05-16 Juergen Vigna <jug@sad.it>
5353 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5354 the TabularLayout on cursor move.
5356 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5358 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5361 (draw): fixed cursor position and drawing so that the cursor is
5362 visible when before the tabular-inset.
5364 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5365 when creating from old insettext.
5367 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5369 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5371 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5372 * lib/tex/brodway.cls: ditto
5374 * lib/layouts/brodway.layout: change alignment of parenthical
5377 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5379 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5380 versions 0.88 and 0.89 are supported.
5382 2000-05-15 Juergen Vigna <jug@sad.it>
5384 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5387 * src/insets/insettext.C (computeTextRows): redone completely this
5388 function in a much cleaner way, because of problems when having a
5390 (draw): added a frame border when the inset is locked.
5391 (SetDrawLockedFrame): this sets if we draw the border or not.
5392 (SetFrameColor): this sets the frame color (default=insetframe).
5394 * src/insets/lyxinset.h: added x() and y() functions which return
5395 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5396 function which is needed to see if we have a locking inset of some
5397 type in this inset (needed for now in insettabular).
5399 * src/vspace.C (inPixels): the same function also without a BufferView
5400 parameter as so it is easier to use it in some ocasions.
5402 * src/lyxfunc.C: changed all places where insertInset was used so
5403 that now if it couldn't be inserted it is deleted!
5405 * src/TabularLayout.C:
5406 * src/TableLayout.C: added support for new tabular-inset!
5408 * src/BufferView2.C (insertInset): this now returns a bool if the
5409 inset was really inserted!!!
5411 * src/tabular.C (GetLastCellInRow):
5412 (GetFirstCellInRow): new helper functions.
5413 (Latex): implemented for new tabular class.
5417 (TeXTopHLine): new Latex() helper functions.
5419 2000-05-12 Juergen Vigna <jug@sad.it>
5421 * src/mathed/formulamacro.C (Read):
5422 * src/mathed/formula.C (Read): read also the \end_inset here!
5424 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5426 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5427 crush when saving formulae with unbalanced parenthesis.
5429 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5431 * src/layout.C: Add new keyword "endlabelstring" to layout file
5433 * src/text.C (GetVisibleRow): Draw endlabel string.
5435 * lib/layouts/broadway.layout
5436 * lib/layouts/hollywood.layout: Added endlabel for the
5437 Parenthetical layout.
5439 * lib/layouts/heb-article.layout: Do not use slanted font shape
5440 for Theorem like environments.
5442 * src/buffer.C (makeLaTeXFile): Always add "american" to
5443 the UsedLanguages list if document language is RTL.
5445 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5447 * add addendum to README.OS2 and small patch (from SMiyata)
5449 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5451 * many files: correct the calls to ChangeExtension().
5453 * src/support/filetools.C (ChangeExtension): remove the no_path
5454 argument, which does not belong there. Use OnlyFileName() instead.
5456 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5457 files when LaTeXing a non-nice latex file.
5459 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5460 a chain of "if". Return false when deadkeys are not handled.
5462 * src/lyx_main.C (LyX): adapted the code for default bindings.
5464 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5465 bindings for basic functionality (except deadkeys).
5466 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5468 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5469 several methods: handle override_x_deadkeys.
5471 * src/lyxrc.h: remove the "bindings" map, which did not make much
5472 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5474 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5476 * src/lyxfont.C (stateText): use a saner method to determine
5477 whether the font is "default". Seems to fix the crash with DEC
5480 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5482 2000-05-08 Juergen Vigna <jug@sad.it>
5484 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5485 TabularLayoutMenu with mouse-button-3
5486 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5488 * src/TabularLayout.C: added this file for having a Layout for
5491 2000-05-05 Juergen Vigna <jug@sad.it>
5493 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5494 recalculating inset-widths.
5495 (TabularFeatures): activated this function so that I can change
5496 tabular-features via menu.
5498 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5499 that I can test some functions with the Table menu.
5501 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5503 * src/lyxfont.C (stateText): guard against stupid c++libs.
5505 * src/tabular.C: add using std::vector
5506 some whitespace changes, + removed som autogenerated code.
5508 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5510 2000-05-05 Juergen Vigna <jug@sad.it>
5512 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5513 row, columns and cellstructures.
5515 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5517 * lib/lyxrc.example: remove obsolete entries.
5519 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5520 reading of protected_separator for free_spacing.
5522 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5524 * src/text.C (draw): do not display an exclamation mark in the
5525 margin for margin notes. This is confusing, ugly and
5528 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5529 AMS math' is checked.
5531 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5532 name to see whether including the amsmath package is needed.
5534 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5536 * src/paragraph.C (validate): Compute UsedLanguages correctly
5537 (don't insert the american language if it doesn't appear in the
5540 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5541 The argument of \thanks{} command is considered moving argument
5543 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5546 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5548 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5549 for appendix/minipage/depth. The lines can be now both in the footnote
5550 frame, and outside the frame.
5552 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5555 2000-05-05 Juergen Vigna <jug@sad.it>
5557 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5558 neede only in tabular.[Ch].
5560 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5562 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5564 (Write): write '~' for PROTECTED_SEPARATOR
5566 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5568 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5571 * src/mathed/formula.C (drawStr): rename size to siz.
5573 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5574 possibly fix a bug by not changing the pflags = flags to piflags =
5577 2000-05-05 Juergen Vigna <jug@sad.it>
5579 * src/insets/insetbib.C: moved using directive
5581 * src/ImportNoweb.C: small fix for being able to compile (missing
5584 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5586 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5587 to use clear, since we don't depend on this in the code. Add test
5590 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5592 * (various *.C files): add using std::foo directives to please dec
5595 * replace calls to string::clear() to string::erase() (Angus)
5597 * src/cheaders/cmath: modified to provide std::abs.
5599 2000-05-04 Juergen Vigna <jug@sad.it>
5601 * src/insets/insettext.C: Prepared all for inserting of multiple
5602 paragraphs. Still display stuff to do (alignment and other things),
5603 but I would like to use LyXText to do this when we cleaned out the
5604 table-support stuff.
5606 * src/insets/insettabular.C: Changed lot of stuff and added lots
5607 of functionality still a lot to do.
5609 * src/tabular.C: Various functions changed name and moved to be
5610 const functions. Added new Read and Write functions and changed
5611 lots of things so it works good with tabular-insets (also removed
5612 some stuff which is not needed anymore * hacks *).
5614 * src/lyxcursor.h: added operators == and != which just look if
5615 par and pos are (not) equal.
5617 * src/buffer.C (latexParagraphs): inserted this function to latex
5618 all paragraphs form par to endpar as then I can use this too for
5621 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5622 so that I can call this to from text insets with their own cursor.
5624 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5625 output off all paragraphs (because of the fix below)!
5627 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5628 the very last paragraph (this could be also the last paragraph of an
5631 * src/texrow.h: added rows() call which returns the count-variable.
5633 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5635 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5637 * lib/configure.m4: better autodetection of DocBook tools.
5639 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5641 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5643 * src/lyx_cb.C: add using std::reverse;
5645 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5648 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5649 selected files. Should fix repeated errors from generated files.
5651 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5653 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5655 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5656 the spellchecker popup.
5658 * lib/lyxrc.example: Removed the \number_inset section
5660 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5662 * src/insets/figinset.C (various): Use IsFileReadable() to make
5663 sure that the file actually exist. Relying on ghostscripts errors
5664 is a bad idea since they can lead to X server crashes.
5666 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5668 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5671 * lib/lyxrc.example: smallish typo in description of
5672 \view_dvi_paper_option
5674 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5677 * src/lyxfunc.C: doImportHelper to factor out common code of the
5678 various import methods. New functions doImportASCIIasLines,
5679 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5680 doImportLinuxDoc for the format specific parts.
5683 * buffer.C: Dispatch returns now a bool to indicate success
5686 * lyx_gui.C: Add getLyXView() for member access
5688 * lyx_main.C: Change logic for batch commands: First try
5689 Buffer::Dispatch (possibly without GUI), if that fails, use
5692 * lyx_main.C: Add support for --import command line switch.
5693 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5694 Available Formats: Everything accepted by 'buffer-import <format>'
5696 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5698 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5701 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5702 documents will be reformatted upon reentry.
5704 2000-04-27 Juergen Vigna <jug@sad.it>
5706 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5707 correctly only last pos this was a bug.
5709 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5711 * release of lyx-1.1.5pre1
5713 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5715 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5717 * src/menus.C: revert the change of naming (Figure->Graphic...)
5718 from 2000-04-11. It was incomplete and bad.
5720 * src/LColor.[Ch]: add LColor::depthbar.
5721 * src/text.C (GetVisibleRow): use it.
5723 * README: update the languages list.
5725 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5727 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5730 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5732 * README: remove sections that were just wrong.
5734 * src/text2.C (GetRowNearY): remove currentrow code
5736 * src/text.C (GetRow): remove currentrow code
5738 * src/screen.C (Update): rewritten a bit.
5739 (SmallUpdate): removed func
5741 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5743 (FullRebreak): return bool
5744 (currentrow): remove var
5745 (currentrow_y): ditto
5747 * src/lyxscreen.h (Draw): change arg to unsigned long
5748 (FitCursor): return bool
5749 (FitManualCursor): ditto
5750 (Smallpdate): remove func
5751 (first): change to unsigned long
5752 (DrawOneRow): change second arg to long (from long &)
5753 (screen_refresh_y): remove var
5754 (scree_refresh_row): ditto
5756 * src/lyxrow.h: change baseline to usigned int from unsigned
5757 short, this brings some implicit/unsigned issues out in the open.
5759 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5761 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5762 instead of smallUpdate.
5764 * src/lyxcursor.h: change y to unsigned long
5766 * src/buffer.h: don't call updateScrollbar after fitcursor
5768 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5769 where they are used. Removed "\\direction", this was not present
5770 in 1.1.4 and is already obsolete. Commented out some code that I
5771 believe to never be called.
5772 (runLiterate): don't call updateScrollbar after fitCursor
5774 (buildProgram): ditto
5777 * src/WorkArea.h (workWidth): change return val to unsigned
5780 (redraw): remove the button redraws
5781 (setScrollbarValue): change for scrollbar
5782 (getScrollbarValue): change for scrollbar
5783 (getScrollbarBounds): change for scrollbar
5785 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5786 (C_WorkArea_down_cb): removed func
5787 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5788 (resize): change for scrollbar
5789 (setScrollbar): ditto
5790 (setScrollbarBounds): ditto
5791 (setScrollbarIncrements): ditto
5792 (up_cb): removed func
5793 (down_cb): removed func
5794 (scroll_cb): change for scrollbar
5795 (work_area_handler): ditto
5797 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5798 when FitCursor did something.
5799 (updateScrollbar): some unsigned changes
5800 (downCB): removed func
5801 (scrollUpOnePage): removed func
5802 (scrollDownOnePage): remvoed func
5803 (workAreaMotionNotify): don't call screen->FitCursor but use
5804 fitCursor instead. and bool return val
5805 (workAreaButtonPress): ditto
5806 (workAreaButtonRelease): some unsigned changes
5807 (checkInsetHit): ditto
5808 (workAreaExpose): ditto
5809 (update): parts rewritten, comments about the signed char arg added
5810 (smallUpdate): removed func
5811 (cursorPrevious): call needed updateScrollbar
5814 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5817 * src/BufferView.[Ch] (upCB): removed func
5818 (downCB): removed func
5819 (smallUpdate): removed func
5821 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5823 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5824 currentrow, currentrow_y optimization. This did not help a lot and
5825 if we want to do this kind of optimization we should rather use
5826 cursor.row instead of the currentrow.
5828 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5829 buffer spacing and klyx spacing support.
5831 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5833 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5836 2000-04-26 Juergen Vigna <jug@sad.it>
5838 * src/insets/figinset.C: fixes to Lars sstream changes!
5840 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5842 * A lot of files: Added Ascii(ostream &) methods to all inset
5843 classes. Used when exporting to ASCII.
5845 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5846 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5849 * src/text2.C (ToggleFree): Disabled implicit word selection when
5850 there is a change in the language
5852 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5853 no output was generated for end-of-sentence inset.
5855 * src/insets/lyxinset.h
5858 * src/paragraph.C: Removed the insetnumber code
5860 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5862 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5864 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5865 no_babel and no_epsfig completely from the file.
5866 (parseSingleLyXformat2Token): add handling for per-paragraph
5867 spacing as written by klyx.
5869 * src/insets/figinset.C: applied patch by Andre. Made it work with
5872 2000-04-20 Juergen Vigna <jug@sad.it>
5874 * src/insets/insettext.C (cutSelection):
5875 (copySelection): Fixed with selection from right to left.
5876 (draw): now the rows are not recalculated at every draw.
5877 (computeTextRows): for now reset the inset-owner here (this is
5878 important for an undo or copy where the inset-owner is not set
5881 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5882 motion to the_locking_inset screen->first was forgotten, this was
5883 not important till we got multiline insets.
5885 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5888 code seems to be alright (it is code changed by Dekel, and the
5889 intent is indeed that all macros should be defined \protect'ed)
5891 * NEWS: a bit of reorganisation of the new user-visible features.
5893 2000-04-19 Juergen Vigna <jug@sad.it>
5895 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5896 position. Set the inset_owner of the used paragraph so that it knows
5897 that it is inside an inset. Fixed cursor handling with mouse and
5898 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5899 and cleanups to make TextInsets work better.
5901 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5902 Changed parameters of various functions and added LockInsetInInset().
5904 * src/insets/insettext.C:
5906 * src/insets/insetcollapsable.h:
5907 * src/insets/insetcollapsable.C:
5908 * src/insets/insetfoot.h:
5909 * src/insets/insetfoot.C:
5910 * src/insets/insetert.h:
5911 * src/insets/insetert.C: cleaned up the code so that it works now
5912 correctly with insettext.
5914 * src/insets/inset.C:
5915 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5916 that insets in insets are supported right.
5919 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5921 * src/paragraph.C: some small fixes
5923 * src/debug.h: inserted INSETS debug info
5925 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5926 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5928 * src/commandtags.h:
5929 * src/LyXAction.C: insert code for InsetTabular.
5931 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5932 not Button1MotionMask.
5933 (workAreaButtonRelease): send always a InsetButtonRelease event to
5935 (checkInsetHit): some setCursor fixes (always with insets).
5937 * src/BufferView2.C (lockInset): returns a bool now and extended for
5938 locking insets inside insets.
5939 (showLockedInsetCursor): it is important to have the cursor always
5940 before the locked inset.
5941 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5943 * src/BufferView.h: made lockInset return a bool.
5945 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5947 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5948 that is used also internally but can be called as public to have back
5949 a cursor pos which is not set internally.
5950 (SetCursorIntern): Changed to use above function.
5952 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5954 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5959 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5960 patches for things that should be in or should be changed.
5962 * src/* [insetfiles]: change "usigned char fragile" to bool
5963 fragile. There was only one point that could that be questioned
5964 and that is commented in formulamacro.C. Grep for "CHECK".
5966 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5967 (DeleteBuffer): take it out of CutAndPaste and make it static.
5969 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5971 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5972 output the spacing envir commands. Also the new commands used in
5973 the LaTeX output makes the result better.
5975 * src/Spacing.C (writeEnvirBegin): new method
5976 (writeEnvirEnd): new method
5978 2000-04-18 Juergen Vigna <jug@sad.it>
5980 * src/CutAndPaste.C: made textclass a static member of the class
5981 as otherwise it is not accesed right!!!
5983 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5985 * forms/layout_forms.fd
5986 * src/layout_forms.h
5987 * src/layout_forms.C (create_form_form_character)
5988 * src/lyx_cb.C (UserFreeFont)
5989 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5990 documents (in the layout->character popup).
5992 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5994 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5995 \spell_command was in fact not honored (from Kevin Atkinson).
5997 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6000 * src/lyx_gui.h: make lyxViews private (Angus)
6002 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6004 * src/mathed/math_write.C
6005 (MathMatrixInset::Write) Put \protect before \begin{array} and
6006 \end{array} if fragile
6007 (MathParInset::Write): Put \protect before \\ if fragile
6009 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6011 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6012 initialization if the LyXColorHandler must be done after the
6013 connections to the XServer has been established.
6015 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6016 get the background pixel from the lyxColorhandler so that the
6017 figures are rendered with the correct background color.
6018 (NextToken): removed functions.
6019 (GetPSSizes): use ifs >> string instead of NextToken.
6021 * src/Painter.[Ch]: the color cache moved out of this file.
6023 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6026 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6028 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6029 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6031 * src/BufferView.C (enterView): new func
6032 (leaveView): new func
6034 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6036 (leaveView): new func, undefines xterm cursor when approp.
6038 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6039 (AllowInput): delete the Workarea cursor handling from this func.
6041 * src/Painter.C (underline): draw a slimer underline in most cases.
6043 * src/lyx_main.C (error_handler): use extern "C"
6045 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6048 sent directly to me.
6050 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6051 to the list by Dekel.
6053 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6056 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6057 methods from lyx_cb.here.
6059 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6062 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6064 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6065 instead of using current_view directly.
6067 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6069 * src/LyXAction.C (init): add the paragraph-spacing command.
6071 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6073 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6075 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6076 different from the documents.
6078 * src/text.C (SetHeightOfRow): take paragraph spacing into
6079 account, paragraph spacing takes precedence over buffer spacing
6080 (GetVisibleRow): ditto
6082 * src/paragraph.C (writeFile): output the spacing parameter too.
6083 (validate): set the correct features if spacing is used in the
6085 (Clear): set spacing to default
6086 (MakeSameLayout): spacing too
6087 (HasSameLayout): spacing too
6088 (SetLayout): spacing too
6089 (TeXOnePar): output the spacing commands
6091 * src/lyxparagraph.h: added a spacing variable for use with
6092 per-paragraph spacing.
6094 * src/Spacing.h: add a Default spacing and a method to check if
6095 the current spacing is default. also added an operator==
6097 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6100 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6102 * src/lyxserver.C (callback): fix dispatch of functions
6104 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6105 printf() into lyxerr call.
6107 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6110 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6111 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6112 the "Float" from each of the subitems.
6113 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6115 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6116 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6117 documented the change so that the workaround can be nuked later.
6119 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6122 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6124 * src/buffer.C (getLatexName): ditto
6125 (setReadonly): ditto
6127 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6129 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6130 avoid some uses of current_view. Added also a bufferParams()
6131 method to get at this.
6133 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6135 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6137 * src/lyxparagraph.[Ch]: removed
6138 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6139 with operators used by lower_bound and
6140 upper_bound in InsetTable's
6141 Make struct InsetTable private again. Used matchpos.
6143 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6145 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6146 document, the language of existing text is changed (unless the
6147 document is multi-lingual)
6149 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6151 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6153 * A lot of files: A rewrite of the Right-to-Left support.
6155 2000-04-10 Juergen Vigna <jug@sad.it>
6157 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6158 misplaced cursor when inset in inset is locked.
6160 * src/insets/insettext.C (LocalDispatch): small fix so that a
6161 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6163 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6164 footnote font should be decreased in size twice when displaying.
6166 * src/insets/insettext.C (GetDrawFont): inserted this function as
6167 the drawing-font may differ from the real paragraph font.
6169 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6170 insets (inset in inset!).
6172 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6173 function here because we don't want footnotes inside footnotes.
6175 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6177 (init): now set the inset_owner in paragraph.C
6178 (LocalDispatch): added some resetPos() in the right position
6181 (pasteSelection): changed to use the new CutAndPaste-Class.
6183 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6184 which tells if it is allowed to insert another inset inside this one.
6186 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6187 SwitchLayoutsBetweenClasses.
6189 * src/text2.C (InsertInset): checking of the new paragraph-function
6191 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6192 is not needed anymore here!
6195 (PasteSelection): redone (also with #ifdef) so that now this uses
6196 the CutAndPaste-Class.
6197 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6200 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6201 from/to text/insets.
6203 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6204 so that the paragraph knows if it is inside an (text)-inset.
6205 (InsertFromMinibuffer): changed return-value to bool as now it
6206 may happen that an inset is not inserted in the paragraph.
6207 (InsertInsetAllowed): this checks if it is allowed to insert an
6208 inset in this paragraph.
6210 (BreakParagraphConservative):
6211 (BreakParagraph) : small change for the above change of the return
6212 value of InsertFromMinibuffer.
6214 * src/lyxparagraph.h: added inset_owner and the functions to handle
6215 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6217 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6219 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6220 functions from BufferView to BufferView::Pimpl to ease maintence.
6222 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6223 correctly. Also use SetCursorIntern instead of SetCursor.
6225 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6228 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6230 * src/WorkArea.C (belowMouse): manually implement below mouse.
6232 * src/*: Add "explicit" on several constructors, I added probably
6233 some unneeded ones. A couple of changes to code because of this.
6235 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6236 implementation and private parts from the users of BufferView. Not
6239 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6240 implementation and private parts from the users of LyXLex. Not
6243 * src/BufferView_pimpl.[Ch]: new files
6245 * src/lyxlex_pimpl.[Ch]: new files
6247 * src/LyXView.[Ch]: some inline functions move out-of-line
6249 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6251 * src/lyxparagraph.h: make struct InsetTable public.
6253 * src/support/lyxstring.h: change lyxstring::difference_type to be
6254 ptrdiff_t. Add std:: modifiers to streams.
6256 * src/font.C: include the <cctype> header, for islower() and
6259 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6261 * src/font.[Ch]: new files. Contains the metric functions for
6262 fonts, takes a LyXFont as parameter. Better separation of concepts.
6264 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6265 changes because of this.
6267 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6269 * src/*: compile with -Winline and move functions that don't
6272 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6275 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6277 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6278 (various files changed because of this)
6280 * src/Painter.C (text): fixed the drawing of smallcaps.
6282 * src/lyxfont.[Ch] (drawText): removed unused member func.
6285 * src/*.C: added needed "using" statements and "std::" qualifiers.
6287 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6289 * src/*.h: removed all use of "using" from header files use
6290 qualifier std:: instead.
6292 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6294 * src/text.C (Backspace): some additional cleanups (we already
6295 know whether cursor.pos is 0 or not).
6297 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6298 automake does not provide one).
6300 * src/bmtable.h: replace C++ comments with C comments.
6302 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6304 * src/screen.C (ShowCursor): Change the shape of the cursor if
6305 the current language is not equal to the language of the document.
6306 (If the cursor change its shape unexpectedly, then you've found a bug)
6308 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6311 * src/insets/insetnumber.[Ch]: New files.
6313 * src/LyXAction.C (init)
6314 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6317 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6319 * src/lyxparagraph.h
6320 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6321 (the vector is kept sorted).
6323 * src/text.C (GetVisibleRow): Draw selection correctly when there
6324 is both LTR and RTL text.
6326 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6327 which is much faster.
6329 * src/text.C (GetVisibleRow and other): Do not draw the last space
6330 in a row if the direction of the last letter is not equal to the
6331 direction of the paragraph.
6333 * src/lyxfont.C (latexWriteStartChanges):
6334 Check that font language is not equal to basefont language.
6335 (latexWriteEndChanges): ditto
6337 * src/lyx_cb.C (StyleReset): Don't change the language while using
6338 the font-default command.
6340 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6341 empty paragraph before a footnote.
6343 * src/insets/insetcommand.C (draw): Increase x correctly.
6345 * src/screen.C (ShowCursor): Change cursor shape if
6346 current language != document language.
6348 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6350 2000-03-31 Juergen Vigna <jug@sad.it>
6352 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6353 (Clone): changed mode how the paragraph-data is copied to the
6354 new clone-paragraph.
6356 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6357 GetInset(pos) with no inset anymore there (in inset UNDO)
6359 * src/insets/insetcommand.C (draw): small fix as here x is
6360 incremented not as much as width() returns (2 before, 2 behind = 4)
6362 2000-03-30 Juergen Vigna <jug@sad.it>
6364 * src/insets/insettext.C (InsetText): small fix in initialize
6365 widthOffset (should not be done in the init() function)
6367 2000-03-29 Amir Karger <karger@lyx.org>
6369 * lib/examples/it_ItemizeBullets.lyx: translation by
6372 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6374 2000-03-29 Juergen Vigna <jug@sad.it>
6376 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6378 * src/insets/insetfoot.C (Clone): small change as for the below
6379 new init function in the text-inset
6381 * src/insets/insettext.C (init): new function as I've seen that
6382 clone did not copy the Paragraph-Data!
6383 (LocalDispatch): Added code so that now we have some sort of Undo
6384 functionality (well actually we HAVE Undo ;)
6386 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6388 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6390 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6393 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * src/main.C: added a runtime check that verifies that the xforms
6396 header used when building LyX and the library used when running
6397 LyX match. Exit with a message if they don't match. This is a
6398 version number check only.
6400 * src/buffer.C (save): Don't allocate memory on the heap for
6401 struct utimbuf times.
6403 * *: some using changes, use iosfwd instead of the real headers.
6405 * src/lyxfont.C use char const * instead of string for the static
6406 strings. Rewrite some functions to use sstream.
6408 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6410 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6413 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6415 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6416 of Geodesy (from Martin Vermeer)
6418 * lib/layouts/svjour.inc: include file for the Springer svjour
6419 class. It can be used to support journals other than JoG.
6421 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6422 Miskiewicz <misiek@pld.org.pl>)
6423 * lib/reLyX/Makefile.am: ditto.
6425 2000-03-27 Juergen Vigna <jug@sad.it>
6427 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6428 also some modifications with operations on selected text.
6430 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6431 problems with clicking on insets (last famous words ;)
6433 * src/insets/insetcommand.C (draw):
6434 (width): Changed to have a bit of space before and after the inset so
6435 that the blinking cursor can be seen (otherwise it was hidden)
6437 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6439 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6440 would not be added to the link list when an installed gettext (not
6441 part of libc) is found.
6443 2000-03-24 Juergen Vigna <jug@sad.it>
6445 * src/insets/insetcollapsable.C (Edit):
6446 * src/mathed/formula.C (InsetButtonRelease):
6447 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6450 * src/BufferView.C (workAreaButtonPress):
6451 (workAreaButtonRelease):
6452 (checkInsetHit): Finally fixed the clicking on insets be handled
6455 * src/insets/insetert.C (Edit): inserted this call so that ERT
6456 insets work always with LaTeX-font
6458 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6460 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6461 caused lyx to startup with no GUI in place, causing in a crash
6462 upon startup when called with arguments.
6464 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6466 * src/FontLoader.C: better initialization of dummyXFontStruct.
6468 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6470 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6471 for linuxdoc and docbook import and export format options.
6473 * lib/lyxrc.example Example of default values for the previous flags.
6475 * src/lyx_cb.C Use those flags instead of the hardwired values for
6476 linuxdoc and docbook export.
6478 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6481 * src/menus.C Added menus entries for the new import/exports formats.
6483 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6485 * src/lyxrc.*: Added support for running without Gui
6488 * src/FontLoader.C: sensible defaults if no fonts are needed
6490 * src/lyx_cb.C: New function ShowMessage (writes either to the
6491 minibuffer or cout in case of no gui
6492 New function AskOverwrite for common stuff
6493 Consequently various changes to call these functions
6495 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6496 wild guess at sensible screen resolution when having no gui
6498 * src/lyxfont.C: no gui, no fonts... set some defaults
6500 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6502 * src/LColor.C: made the command inset background a bit lighter.
6504 2000-03-20 Hartmut Goebel <goebel@noris.net>
6506 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6507 stdstruct.inc. Koma-Script added some title elements which
6508 otherwise have been listed below "bibliography". This split allows
6509 adding title elements to where they belong.
6511 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6512 define the additional tilte elements and then include
6515 * many other layout files: changed to include stdtitle.inc just
6516 before stdstruct.inc.
6518 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6520 * src/buffer.C: (save) Added the option to store all backup files
6521 in a single directory
6523 * src/lyxrc.[Ch]: Added variable \backupdir_path
6525 * lib/lyxrc.example: Added descriptions of recently added variables
6527 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6528 bibtex inset, not closing the bibtex popup when deleting the inset)
6530 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6532 * src/lyx_cb.C: add a couple using directives.
6534 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6535 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6536 import based on the filename.
6538 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6539 file would be imported at start, if the filename where of a sgml file.
6541 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6543 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6545 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6546 * src/lyxfont.h Replaced the member variable bits.direction by the
6547 member variable lang. Made many changes in other files.
6548 This allows having a multi-lingual document
6550 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6551 that change the current language to <l>.
6552 Removed the command "font-rtl"
6554 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6555 format for Hebrew documents)
6557 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6558 When auto_mathmode is "true", pressing a digit key in normal mode
6559 will cause entering into mathmode.
6560 If auto_mathmode is "rtl" then this behavior will be active only
6561 when writing right-to-left text.
6563 * src/text2.C (InsertStringA) The string is inserted using the
6566 * src/paragraph.C (GetEndLabel) Gives a correct result for
6567 footnote paragraphs.
6569 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6571 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6574 front of PasteParagraph. Never insert a ' '. This should at least
6575 fix some cause for the segfaults that we have been experiencing,
6576 it also fixes backspace behaviour slightly. (Phu!)
6578 * src/support/lstrings.C (compare_no_case): some change to make it
6579 compile with gcc 2.95.2 and stdlibc++-v3
6581 * src/text2.C (MeltFootnoteEnvironment): change type o
6582 first_footnote_par_is_not_empty to bool.
6584 * src/lyxparagraph.h: make text private. Changes in other files
6586 (fitToSize): new function
6587 (setContentsFromPar): new function
6588 (clearContents): new function
6589 (SetChar): new function
6591 * src/paragraph.C (readSimpleWholeFile): deleted.
6593 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6594 the file, just use a simple string instead. Also read the file in
6595 a more maintainable manner.
6597 * src/text2.C (InsertStringA): deleted.
6598 (InsertStringB): deleted.
6600 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6602 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6603 RedoParagraphs from the doublespace handling part, just set status
6604 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6605 done, but perhaps not like this.)
6607 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6609 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6610 character when inserting an inset.
6612 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6614 * src/bufferparams.C (readLanguage): now takes "default" into
6617 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6618 also initialize the toplevel_keymap with the default bindings from
6621 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6623 * all files using lyxrc: have lyxrc as a real variable and not a
6624 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6627 * src/lyxrc.C: remove double call to defaultKeyBindings
6629 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6630 toolbar defauls using lyxlex. Remove enums, structs, functions
6633 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6634 toolbar defaults. Also store default keybindings in a map.
6636 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6637 storing the toolbar defaults without any xforms dependencies.
6639 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6640 applied. Changed to use iterators.
6642 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6644 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6645 systems that don't have LINGUAS set to begin with.
6647 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6649 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6650 the list by Dekel Tsur.
6652 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6655 * src/insets/form_graphics.C: ditto.
6657 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6659 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6661 * src/bufferparams.C (readLanguage): use the new language map
6663 * src/intl.C (InitKeyMapper): use the new language map
6665 * src/lyx_gui.C (create_forms): use the new language map
6667 * src/language.[Ch]: New files. Used for holding the information
6668 about each language. Now! Use this new language map enhance it and
6669 make it really usable for our needs.
6671 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6673 * screen.C (ShowCursor): Removed duplicate code.
6674 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6675 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6677 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6680 * src/text.C Added TransformChar method. Used for rendering Arabic
6681 text correctly (change the glyphs of the letter according to the
6682 position in the word)
6687 * src/lyxrc.C Added lyxrc command {language_command_begin,
6688 language_command_end,language_command_ltr,language_command_rtl,
6689 language_package} which allows the use of either arabtex or Omega
6692 * src/lyx_gui.C (init)
6694 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6695 to use encoding for menu fonts which is different than the encoding
6698 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6699 do not load the babel package.
6700 To write an English document with Hebrew/Arabic, change the document
6701 language to "english".
6703 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6704 (alphaCounter): changed to return char
6705 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6707 * lib/lyxrc.example Added examples for Hebrew/Arabic
6710 * src/layout.C Added layout command endlabeltype
6712 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6714 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6716 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/mathed/math_delim.C (search_deco): return a
6719 math_deco_struct* instead of index.
6721 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6723 * All files with a USE_OSTREAM_ONLY within: removed all code that
6724 was unused when USE_OSTREAM_ONLY is defined.
6726 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6727 of any less. Removed header and using.
6729 * src/text.C (GetVisibleRow): draw the string "Page Break
6730 (top/bottom)" on screen when drawing a pagebreak line.
6732 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6734 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6736 * src/mathed/math_macro.C (draw): do some cast magic.
6739 * src/mathed/math_defs.h: change byte* argument to byte const*.
6741 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6743 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6744 know it is right to return InsetFoot* too, but cxx does not like
6747 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6749 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6751 * src/mathed/math_delim.C: change == to proper assignment.
6753 2000-03-09 Juergen Vigna <jug@sad.it>
6755 * src/insets/insettext.C (setPos): fixed various cursor positioning
6756 problems (via mouse and cursor-keys)
6757 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6758 inset (still a small display problem but it works ;)
6760 * src/insets/insetcollapsable.C (draw): added button_top_y and
6761 button_bottom_y to have correct values for clicking on the inset.
6763 * src/support/lyxalgo.h: commented out 'using std::less'
6765 2000-03-08 Juergen Vigna <jug@sad.it>
6767 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6768 Button-Release event closes as it is alos the Release-Event
6771 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6773 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6775 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6776 can add multiple spaces in Scrap (literate programming) styles...
6777 which, by the way, is how I got hooked on LyX to begin with.
6779 * src/mathed/formula.C (Write): Added dummy variable to an
6780 inset::Latex() call.
6781 (Latex): Add free_spacing boolean to inset::Latex()
6783 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6785 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6786 virtual function to include the free_spacing boolean from
6787 the containing paragraph's style.
6789 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6790 Added free_spacing boolean arg to match inset.h
6792 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6793 Added free_spacing boolean arg to match inset.h
6795 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6796 Added free_spacing boolean and made sure that if in a free_spacing
6797 paragraph, that we output normal space if there is a protected space.
6799 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6800 Added free_spacing boolean arg to match inset.h
6802 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6803 Added free_spacing boolean arg to match inset.h
6805 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6806 Added free_spacing boolean arg to match inset.h
6808 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6809 Added free_spacing boolean arg to match inset.h
6811 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6812 Added free_spacing boolean arg to match inset.h
6814 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6815 free_spacing boolean arg to match inset.h
6817 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6818 Added free_spacing boolean arg to match inset.h
6820 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6821 Added free_spacing boolean arg to match inset.h
6823 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6824 Added free_spacing boolean arg to match inset.h
6826 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6827 Added free_spacing boolean arg to match inset.h
6829 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6830 Added free_spacing boolean arg to match inset.h
6832 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6833 free_spacing boolean arg to match inset.h
6835 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6836 free_spacing boolean arg to match inset.h
6838 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6839 ignore free_spacing paragraphs. The user's spaces are left
6842 * src/text.C (InsertChar): Fixed the free_spacing layout
6843 attribute behavior. Now, if free_spacing is set, you can
6844 add multiple spaces in a paragraph with impunity (and they
6845 get output verbatim).
6846 (SelectSelectedWord): Added dummy argument to inset::Latex()
6849 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6852 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6853 paragraph layouts now only input a simple space instead.
6854 Special character insets don't make any sense in free-spacing
6857 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6858 hard-spaces in the *input* file to simple spaces if the layout
6859 is free-spacing. This converts old files which had to have
6860 hard-spaces in free-spacing layouts where a simple space was
6862 (writeFileAscii): Added free_spacing check to pass to the newly
6863 reworked inset::Latex(...) methods. The inset::Latex() code
6864 ensures that hard-spaces in free-spacing paragraphs get output
6865 as spaces (rather than "~").
6867 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/mathed/math_delim.C (draw): draw the empty placeholder
6870 delims with a onoffdash line.
6871 (struct math_deco_compare): struct that holds the "functors" used
6872 for the sort and the binary search in math_deco_table.
6873 (class init_deco_table): class used for initial sort of the
6875 (search_deco): use lower_bound to do a binary search in the
6878 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6880 * src/lyxrc.C: a small secret thingie...
6882 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6883 and to not flush the stream as often as it used to.
6885 * src/support/lyxalgo.h: new file
6886 (sorted): template function used for checking if a sequence is
6887 sorted or not. Two versions with and without user supplied
6888 compare. Uses same compare as std::sort.
6890 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6891 it and give warning on lyxerr.
6893 (struct compare_tags): struct with function operators used for
6894 checking if sorted, sorting and lower_bound.
6895 (search_kw): use lower_bound instead of manually implemented
6898 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6900 * src/insets/insetcollapsable.h: fix Clone() declaration.
6901 * src/insets/insetfoot.h: ditto.
6903 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6905 2000-03-08 Juergen Vigna <jug@sad.it>
6907 * src/insets/lyxinset.h: added owner call which tells us if
6908 this inset is inside another inset. Changed also the return-type
6909 of Editable to an enum so it tells clearer what the return-value is.
6911 * src/insets/insettext.C (computeTextRows): fixed computing of
6912 textinsets which split automatically on more rows.
6914 * src/insets/insetert.[Ch]: changed this to be of BaseType
6917 * src/insets/insetfoot.[Ch]: added footnote inset
6919 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6920 collapsable insets (like footnote, ert, ...)
6922 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6924 * src/lyxdraw.h: remvoe file
6926 * src/lyxdraw.C: remove file
6928 * src/insets/insettext.C: added <algorithm>.
6930 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6932 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6933 (matrix_cb): case MM_OK use string stream
6935 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6938 * src/mathed/math_macro.C (draw): use string stream
6939 (Metrics): use string stream
6941 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6942 directly to the ostream.
6944 * src/vspace.C (asString): use string stream.
6945 (asString): use string stream
6946 (asLatexString): use string stream
6948 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6949 setting Spacing::Other.
6951 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6952 sprintf when creating the stretch vale.
6954 * src/text2.C (alphaCounter): changed to return a string and to
6955 not use a static variable internally. Also fixed a one-off bug.
6956 (SetCounter): changed the drawing of the labels to use string
6957 streams instead of sprintf.
6959 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6960 manipulator to use a scheme that does not require library support.
6961 This is also the way it is done in the new GNU libstdc++. Should
6962 work with DEC cxx now.
6964 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6966 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6967 end. This fixes a bug.
6969 * src/mathed (all files concerned with file writing): apply the
6970 USE_OSTREAM_ONLY changes to mathed too.
6972 * src/support/DebugStream.h: make the constructor explicit.
6974 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6975 count and ostream squashed.
6977 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6979 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6981 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6982 ostringstream uses STL strings, and we might not.
6984 * src/insets/insetspecialchar.C: add using directive.
6985 * src/insets/insettext.C: ditto.
6987 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6989 * lib/layouts/seminar.layout: feeble attempt at a layout for
6990 seminar.cls, far from completet and could really use some looking
6991 at from people used to write layout files.
6993 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6994 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6995 a lot nicer and works nicely with ostreams.
6997 * src/mathed/formula.C (draw): a slightly different solution that
6998 the one posted to the list, but I think this one works too. (font
6999 size wrong in headers.)
7001 * src/insets/insettext.C (computeTextRows): some fiddling on
7002 Jürgens turf, added some comments that he should read.
7004 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7005 used and it gave compiler warnings.
7006 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7009 * src/lyx_gui.C (create_forms): do the right thing when
7010 show_banner is true/false.
7012 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7013 show_banner is false.
7015 * most file writing files: Now use iostreams to do almost all of
7016 the writing. Also instead of passing string &, we now use
7017 stringstreams. mathed output is still not adapted to iostreams.
7018 This change can be turned off by commenting out all the occurences
7019 of the "#define USE_OSTREAM_ONLY 1" lines.
7021 * src/WorkArea.C (createPixmap): don't output debug messages.
7022 (WorkArea): don't output debug messages.
7024 * lib/lyxrc.example: added a comment about the new variable
7027 * development/Code_rules/Rules: Added some more commente about how
7028 to build class interfaces and on how better encapsulation can be
7031 2000-03-03 Juergen Vigna <jug@sad.it>
7033 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7034 automatically with the width of the LyX-Window
7036 * src/insets/insettext.C (computeTextRows): fixed update bug in
7037 displaying text-insets (scrollvalues where not initialized!)
7039 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7041 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7042 id in the check of the result from lower_bound is not enough since
7043 lower_bound can return last too, and then res->id will not be a
7046 * all insets and some code that use them: I have conditionalized
7047 removed the Latex(string & out, ...) this means that only the
7048 Latex(ostream &, ...) will be used. This is a work in progress to
7049 move towards using streams for all output of files.
7051 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7054 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7056 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7057 routine (this fixes bug where greek letters were surrounded by too
7060 * src/support/filetools.C (findtexfile): change a bit the search
7061 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7062 no longer passed to kpsewhich, we may have to change that later.
7064 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7065 warning options to avoid problems with X header files (from Angus
7067 * acinclude.m4: regenerated.
7069 2000-03-02 Juergen Vigna <jug@sad.it>
7071 * src/insets/insettext.C (WriteParagraphData): Using the
7072 par->writeFile() function for writing paragraph-data.
7073 (Read): Using buffer->parseSingleLyXformat2Token()-function
7074 for parsing paragraph data!
7076 * src/buffer.C (readLyXformat2): removed all parse data and using
7077 the new parseSingleLyXformat2Token()-function.
7078 (parseSingleLyXformat2Token): added this function to parse (read)
7079 lyx-file-format (this is called also from text-insets now!)
7081 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7083 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7086 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7087 directly instead of going through a func. One very bad thing: a
7088 static LyXFindReplace, but I don't know where to place it.
7090 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7091 string instead of char[]. Also changed to static.
7092 (GetSelectionOrWordAtCursor): changed to static inline
7093 (SetSelectionOverLenChars): ditto.
7095 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7096 current_view and global variables. both classes has changed names
7097 and LyXFindReplace is not inherited from SearchForm.
7099 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7100 fl_form_search form.
7102 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7104 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7107 bound (from Kayvan).
7109 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7111 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7113 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7115 * some things that I should comment but the local pub says head to
7118 * comment out all code that belongs to the Roff code for Ascii
7119 export of tables. (this is unused)
7121 * src/LyXView.C: use correct type for global variable
7122 current_layout. (LyXTextClass::size_type)
7124 * some code to get the new insetgraphics closer to working I'd be
7125 grateful for any help.
7127 * src/BufferView2.C (insertInset): use the return type of
7128 NumberOfLayout properly. (also changes in other files)
7130 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7131 this as a test. I want to know what breaks because of this.
7133 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7135 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7137 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7138 to use a \makebox in the label, this allows proper justification
7139 with out using protected spaces or multiple hfills. Now it is
7140 "label" for left justified, "\hfill label\hfill" for center, and
7141 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7142 should be changed accordingly.
7144 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7146 * src/lyxtext.h: change SetLayout() to take a
7147 LyXTextClass::size_type instead of a char (when there is more than
7148 127 layouts in a class); also change type of copylayouttype.
7149 * src/text2.C (SetLayout): ditto.
7150 * src/LyXView.C (updateLayoutChoice): ditto.
7152 * src/LaTeX.C (scanLogFile): errors where the line number was not
7153 given just after the '!'-line were ignored (from Dekel Tsur).
7155 * lib/lyxrc.example: fix description of \date_insert_format
7157 * lib/layouts/llncs.layout: new layout, contributed by Martin
7160 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7162 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7163 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7164 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7165 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7166 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7167 paragraph.C, text.C, text2.C)
7169 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7171 * src/insets/insettext.C (LocalDispatch): remove extra break
7174 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7175 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7177 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7178 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7180 * src/insets/insetbib.h: move InsetBibkey::Holder and
7181 InsetCitation::Holder in public space.
7183 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * src/insets/insettext.h: small change to get the new files from
7186 Juergen to compile (use "string", not "class string").
7188 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7189 const & as parameter to LocalDispatch, use LyXFont const & as
7190 paramter to some other func. This also had impacto on lyxinsets.h
7191 and the two mathed insets.
7193 2000-02-24 Juergen Vigna <jug@sad.it>
7196 * src/commandtags.h:
7198 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7202 * src/BufferView2.C: added/updated code for various inset-functions
7204 * src/insets/insetert.[Ch]: added implementation of InsetERT
7206 * src/insets/insettext.[Ch]: added implementation of InsetText
7208 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7209 (draw): added preliminary code for inset scrolling not finshed yet
7211 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7212 as it is in lyxfunc.C now
7214 * src/insets/lyxinset.h: Added functions for text-insets
7216 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7218 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7219 BufferView and reimplement the list as a queue put inside its own
7222 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7224 * several files: use the new interface to the "updateinsetlist"
7226 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7228 (work_area_handler): call BufferView::trippleClick on trippleclick.
7230 * src/BufferView.C (doubleClick): new function, selects word on
7232 (trippleClick): new function, selects line on trippleclick.
7234 2000-02-22 Allan Rae <rae@lyx.org>
7236 * lib/bind/xemacs.bind: buffer-previous not supported
7238 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7240 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7243 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7245 * src/bufferlist.C: get rid of current_view from this file
7247 * src/spellchecker.C: get rid of current_view from this file
7249 * src/vspace.C: get rid of current_view from this file
7250 (inPixels): added BufferView parameter for this func
7251 (asLatexCommand): added a BufferParams for this func
7253 * src/text.C src/text2.C: get rid of current_view from these
7256 * src/lyxfont.C (getFontDirection): move this function here from
7259 * src/bufferparams.C (getDocumentDirection): move this function
7262 * src/paragraph.C (getParDirection): move this function here from
7264 (getLetterDirection): ditto
7266 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7268 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7269 resize due to wrong pixmap beeing used. Also took the opurtunity
7270 to make the LyXScreen stateless on regard to WorkArea and some
7271 general cleanup in the same files.
7273 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7275 * src/Makefile.am: add missing direction.h
7277 * src/PainterBase.h: made the width functions const.
7279 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7282 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7284 * src/insets/insetlatexaccent.C (draw): make the accents draw
7285 better, at present this will only work well with iso8859-1.
7287 * several files: remove the old drawing code, now we use the new
7290 * several files: remove support for mono_video, reverse_video and
7293 2000-02-17 Juergen Vigna <jug@sad.it>
7295 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7296 int ** as we have to return the pointer, otherwise we have only
7297 NULL pointers in the returning function.
7299 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7301 * src/LaTeX.C (operator()): quote file name when running latex.
7303 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7305 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7306 (bubble tip), this removes our special handling of this.
7308 * Remove all code that is unused now that we have the new
7309 workarea. (Code that are not active when NEW_WA is defined.)
7311 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7313 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7315 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7316 nonexisting layout; correctly redirect obsoleted layouts.
7318 * lib/lyxrc.example: document \view_dvi_paper_option
7320 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7323 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7324 (PreviewDVI): handle the view_dvi_paper_option variable.
7325 [Both from Roland Krause]
7327 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7329 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7330 char const *, int, LyXFont)
7331 (text(int, int, string, LyXFont)): ditto
7333 * src/text.C (InsertCharInTable): attempt to fix the double-space
7334 feature in tables too.
7335 (BackspaceInTable): ditto.
7336 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7338 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7340 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7342 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7343 newly found text in textcache to this.
7344 (buffer): set the owner of the text put into the textcache to 0
7346 * src/insets/figinset.C (draw): fixed the drawing of figures with
7349 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7350 drawing of mathframe, hfills, protected space, table lines. I have
7351 now no outstanding drawing problems with the new Painter code.
7353 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7355 * src/PainterBase.C (ellipse, circle): do not specify the default
7358 * src/LColor.h: add using directive.
7360 * src/Painter.[Ch]: change return type of methods from Painter& to
7361 PainterBase&. Add a using directive.
7363 * src/WorkArea.C: wrap xforms callbacks in C functions
7366 * lib/layouts/foils.layout: font fix and simplifications from Carl
7369 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * a lot of files: The Painter, LColor and WorkArea from the old
7372 devel branch has been ported to lyx-devel. Some new files and a
7373 lot of #ifdeffed code. The new workarea is enabled by default, but
7374 if you want to test the new Painter and LColor you have to compile
7375 with USE_PAINTER defined (do this in config.h f.ex.) There are
7376 still some rought edges, and I'd like some help to clear those
7377 out. It looks stable (loads and displays the Userguide very well).
7380 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7382 * src/buffer.C (pop_tag): revert to the previous implementation
7383 (use a global variable for both loops).
7385 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7387 * src/lyxrc.C (LyXRC): change slightly default date format.
7389 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7390 there is an English text with a footnote that starts with a Hebrew
7391 paragraph, or vice versa.
7392 (TeXFootnote): ditto.
7394 * src/text.C (LeftMargin): allow for negative values for
7395 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7398 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7399 for input encoding (cyrillic)
7401 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7403 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7406 * src/toolbar.C (set): ditto
7407 * src/insets/insetbib.C (create_form_citation_form): ditto
7409 * lib/CREDITS: added Dekel Tsur.
7411 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7412 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7413 hebrew supports files from Dekel Tsur.
7415 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7416 <tzafrir@technion.ac.il>
7418 * src/lyxrc.C: put \date_insert_format at the right place.
7420 * src/buffer.C (makeLaTeXFile): fix the handling of
7421 BufferParams::sides when writing out latex files.
7423 * src/BufferView2.C: add a "using" directive.
7425 * src/support/lyxsum.C (sum): when we use lyxstring,
7426 ostringstream::str needs an additional .c_str().
7428 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7430 * src/support/filetools.C (ChangeExtension): patch from Etienne
7433 * src/TextCache.C (show): remove const_cast and make second
7434 parameter non-const LyXText *.
7436 * src/TextCache.h: use non const LyXText in show.
7438 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7441 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * src/support/lyxsum.C: rework to be more flexible.
7445 * several places: don't check if a pointer is 0 if you are going
7448 * src/text.C: remove some dead code.
7450 * src/insets/figinset.C: remove some dead code
7452 * src/buffer.C: move the BufferView funcs to BufferView2.C
7453 remove all support for insetlatexdel
7454 remove support for oldpapersize stuff
7455 made some member funcs const
7457 * src/kbmap.C: use a std::list to store the bindings in.
7459 * src/BufferView2.C: new file
7461 * src/kbsequence.[Ch]: new files
7463 * src/LyXAction.C + others: remove all trace of buffer-previous
7465 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7466 only have one copy in the binary of this table.
7468 * hebrew patch: moved some functions from LyXText to more
7469 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7471 * several files: remove support for XForms older than 0.88
7473 remove some #if 0 #endif code
7475 * src/TextCache.[Ch]: new file. Holds the textcache.
7477 * src/BufferView.C: changes to use the new TextCache interface.
7478 (waitForX): remove the now unused code.
7480 * src/BackStack.h: remove some commented code
7482 * lib/bind/emacs.bind: remove binding for buffer-previous
7484 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7486 * applied the hebrew patch.
7488 * src/lyxrow.h: make sure that all Row variables are initialized.
7490 * src/text2.C (TextHandleUndo): comment out a delete, this might
7491 introduce a memory leak, but should also help us to not try to
7492 read freed memory. We need to look at this one.
7494 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7495 (LyXParagraph): initalize footnotekind.
7497 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7498 forgot this when applying the patch. Please heed the warnings.
7500 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7501 (aka. reformat problem)
7503 * src/bufferlist.C (exists): made const, and use const_iterator
7504 (isLoaded): new func.
7505 (release): use std::find to find the correct buffer.
7507 * src/bufferlist.h: made getState a const func.
7508 made empty a const func.
7509 made exists a const func.
7512 2000-02-01 Juergen Vigna <jug@sad.it>
7514 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7516 * po/it.po: updated a bit the italian po file and also changed the
7517 'file nuovo' for newfile to 'filenuovo' without a space, this did
7520 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7521 for the new insert_date command.
7523 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7524 from jdblair, to insert a date into the current text conforming to
7525 a strftime format (for now only considering the locale-set and not
7526 the document-language).
7528 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7530 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7531 Bounds Read error seen by purify. The problem was that islower is
7532 a macros which takes an unsigned char and uses it as an index for
7533 in array of characters properties (and is thus subject to the
7537 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7538 correctly the paper sides radio buttons.
7539 (UpdateDocumentButtons): ditto.
7541 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7543 * src/kbmap.C (getsym + others): change to return unsigned int,
7544 returning a long can give problems on 64 bit systems. (I assume
7545 that int is 32bit on 64bit systems)
7547 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7549 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7550 LyXLookupString to be zero-terminated. Really fixes problems seen
7553 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7555 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7556 write a (char*)0 to the lyxerr stream.
7558 * src/lastfiles.C: move algorithm before the using statemets.
7560 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7562 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7563 complains otherwise).
7564 * src/table.C: ditto
7566 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7569 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7570 that I removed earlier... It is really needed.
7572 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7574 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7576 * INSTALL: update xforms home page URL.
7578 * lib/configure.m4: fix a bug with unreadable layout files.
7580 * src/table.C (calculate_width_of_column): add "using std::max"
7583 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7585 * several files: marked several lines with "DEL LINE", this is
7586 lines that can be deleted without changing anything.
7587 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7588 checks this anyway */
7591 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7593 * src/DepTable.C (update): add a "+" at the end when the checksum
7594 is different. (debugging string only)
7596 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7597 the next inset to not be displayed. This should also fix the list
7598 of labels in the "Insert Crossreference" dialog.
7600 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7602 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7603 when regex was not found.
7605 * src/support/lstrings.C (lowercase): use handcoded transform always.
7608 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7609 old_cursor.par->prev could be 0.
7611 * several files: changed post inc/dec to pre inc/dec
7613 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7614 write the lastfiles to file.
7616 * src/BufferView.C (buffer): only show TextCache info when debugging
7618 (resizeCurrentBuffer): ditto
7619 (workAreaExpose): ditto
7621 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7623 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7625 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7626 a bit better by removing the special case for \i and \j.
7628 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7630 * src/lyx_main.C (easyParse): remove test for bad comand line
7631 options, since this broke all xforms-related parsing.
7633 * src/kbmap.C (getsym): set return type to unsigned long, as
7634 declared in header. On an alpha, long is _not_ the same as int.
7636 * src/support/LOstream.h: add a "using std::flush;"
7638 * src/insets/figinset.C: ditto.
7640 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * src/bufferlist.C (write): use blinding fast file copy instead of
7643 "a char at a time", now we are doing it the C++ way.
7645 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7646 std::list<int> instead.
7647 (addpidwait): reflect move to std::list<int>
7648 (sigchldchecker): ditto
7650 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7653 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7654 that obviously was wrong...
7656 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7657 c, this avoids warnings with purify and islower.
7659 * src/insets/figinset.C: rename struct queue to struct
7660 queue_element and rewrite to use a std::queue. gsqueue is now a
7661 std::queue<queue_element>
7662 (runqueue): reflect move to std::queue
7665 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7666 we would get "1" "0" instead of "true" "false. Also make the tostr
7669 2000-01-21 Juergen Vigna <jug@sad.it>
7671 * src/buffer.C (writeFileAscii): Disabled code for special groff
7672 handling of tabulars till I fix this in table.C
7674 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7676 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7678 * src/support/lyxlib.h: ditto.
7680 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7682 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7683 and 'j' look better. This might fix the "macron" bug that has been
7686 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7687 functions as one template function. Delete the old versions.
7689 * src/support/lyxsum.C: move using std::ifstream inside
7692 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7695 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7697 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7699 * src/insets/figinset.C (InitFigures): use new instead of malloc
7700 to allocate memory for figures and bitmaps.
7701 (DoneFigures): use delete[] instead of free to deallocate memory
7702 for figures and bitmaps.
7703 (runqueue): use new to allocate
7704 (getfigdata): use new/delete[] instead of malloc/free
7705 (RegisterFigure): ditto
7707 * some files: moved some declarations closer to first use, small
7708 whitespace changes use preincrement instead of postincrement where
7709 it does not make a difference.
7711 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7712 step on the way to use stl::containers for key maps.
7714 * src/bufferlist.h: add a typedef for const_iterator and const
7715 versions of begin and end.
7717 * src/bufferlist.[Ch]: change name of member variable _state to
7718 state_. (avoid reserved names)
7720 (getFileNames): returns the filenames of the buffers in a vector.
7722 * configure.in (ALL_LINGUAS): added ro
7724 * src/support/putenv.C: new file
7726 * src/support/mkdir.C: new file
7728 2000-01-20 Allan Rae <rae@lyx.org>
7730 * lib/layouts/IEEEtran.layout: Added several theorem environments
7732 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7733 couple of minor additions.
7735 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7736 (except for those in footnotes of course)
7738 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7740 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7742 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7743 std::sort and std::lower_bound instead of qsort and handwritten
7745 (struct compara): struct that holds the functors used by std::sort
7746 and std::lower_bound in MathedLookupBOP.
7748 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7750 * src/support/LAssert.h: do not do partial specialization. We do
7753 * src/support/lyxlib.h: note that lyx::getUserName() and
7754 lyx::date() are not in use right now. Should these be suppressed?
7756 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7757 (makeLinuxDocFile): do not put date and user name in linuxdoc
7760 * src/support/lyxlib.h (kill): change first argument to long int,
7761 since that's what solaris uses.
7763 * src/support/kill.C (kill): fix declaration to match prototype.
7765 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7766 actually check whether namespaces are supported. This is not what
7769 * src/support/lyxsum.C: add a using directive.
7771 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7773 * src/support/kill.C: if we have namespace support we don't have
7774 to include lyxlib.h.
7776 * src/support/lyxlib.h: use namespace lyx if supported.
7778 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7780 * src/support/date.C: new file
7782 * src/support/chdir.C: new file
7784 * src/support/getUserName.C: new file
7786 * src/support/getcwd.C: new file
7788 * src/support/abort.C: new file
7790 * src/support/kill.C: new file
7792 * src/support/lyxlib.h: moved all the functions in this file
7793 insede struct lyx. Added also kill and abort to this struct. This
7794 is a way to avoid the "kill is not defined in <csignal>", we make
7795 C++ wrappers for functions that are not ANSI C or ANSI C++.
7797 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7798 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7799 lyx it has been renamed to sum.
7801 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7803 * src/text.C: add using directives for std::min and std::max.
7805 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7807 * src/texrow.C (getIdFromRow): actually return something useful in
7808 id and pos. Hopefully fixes the bug with positionning of errorbox
7811 * src/lyx_main.C (easyParse): output an error and exit if an
7812 incorrect command line option has been given.
7814 * src/spellchecker.C (ispell_check_word): document a memory leak.
7816 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7817 where a "struct utimbuf" is allocated with "new" and deleted with
7820 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7822 * src/text2.C (CutSelection): don't delete double spaces.
7823 (PasteSelection): ditto
7824 (CopySelection): ditto
7826 * src/text.C (Backspace): don't delete double spaces.
7828 * src/lyxlex.C (next): fix a bug that were only present with
7829 conformant std::istream::get to read comment lines, use
7830 std::istream::getline instead. This seems to fix the problem.
7832 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7834 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7835 allowed to insert space before space" editing problem. Please read
7836 commends at the beginning of the function. Comments about usage
7839 * src/text.C (InsertChar): fix for the "not allowed to insert
7840 space before space" editing problem.
7842 * src/text2.C (DeleteEmptyParagraphMechanism): when
7843 IsEmptyTableRow can only return false this last "else if" will
7844 always be a no-op. Commented out.
7846 * src/text.C (RedoParagraph): As far as I can understand tmp
7847 cursor is not really needed.
7849 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7850 present it could only return false anyway.
7851 (several functions): Did something not so smart...added a const
7852 specifier on a lot of methods.
7854 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7855 and add a tmp->text.resize. The LyXParagraph constructor does the
7857 (BreakParagraphConservative): ditto
7859 * src/support/path.h (Path): add a define so that the wrong usage
7860 "Path("/tmp") will be flagged as a compilation error:
7861 "`unnamed_Path' undeclared (first use this function)"
7863 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7865 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7866 which was bogus for several reasons.
7868 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7872 * autogen.sh: do not use "type -path" (what's that anyway?).
7874 * src/support/filetools.C (findtexfile): remove extraneous space
7875 which caused a kpsewhich warning (at least with kpathsea version
7878 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7882 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7884 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7886 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * src/paragraph.C (BreakParagraph): do not reserve space on text
7889 if we don't need to (otherwise, if pos_end < pos, we end up
7890 reserving huge amounts of memory due to bad unsigned karma).
7891 (BreakParagraphConservative): ditto, although I have not seen
7892 evidence the bug can happen here.
7894 * src/lyxparagraph.h: add a using std::list.
7896 2000-01-11 Juergen Vigna <jug@sad.it>
7898 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7901 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7903 * src/vc-backend.C (doVCCommand): change to be static and take one
7904 more parameter: the path to chdir too be fore executing the command.
7905 (retrive): new function equiv to "co -r"
7907 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7908 file_not_found_hook is true.
7910 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7912 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7913 if a file is readwrite,readonly...anything else.
7915 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7917 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7918 (CreatePostscript): name change from MenuRunDVIPS (or something)
7919 (PreviewPostscript): name change from MenuPreviewPS
7920 (PreviewDVI): name change from MenuPreviewDVI
7922 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7923 \view_pdf_command., \pdf_to_ps_command
7925 * lib/configure.m4: added search for PDF viewer, and search for
7926 PDF to PS converter.
7927 (lyxrc.defaults output): add \pdflatex_command,
7928 \view_pdf_command and \pdf_to_ps_command.
7930 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7932 * src/bufferlist.C (write): we don't use blocksize for anything so
7935 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7937 * src/support/block.h: disable operator T* (), since it causes
7938 problems with both compilers I tried. See comments in the file.
7940 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7943 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7944 variable LYX_DIR_10x to LYX_DIR_11x.
7946 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7948 * INSTALL: document --with-lyxname.
7951 * configure.in: new configure flag --with-lyxname which allows to
7952 choose the name under which lyx is installed. Default is "lyx", of
7953 course. It used to be possible to do this with --program-suffix,
7954 but the later has in fact a different meaning for autoconf.
7956 * src/support/lstrings.h (lstrchr): reformat a bit.
7958 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7959 * src/mathed/math_defs.h: ditto.
7961 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7964 true, decides if we create a backup file or not when saving. New
7965 tag and variable \pdf_mode, defaults to false. New tag and
7966 variable \pdflatex_command, defaults to pdflatex. New tag and
7967 variable \view_pdf_command, defaults to xpdf. New tag and variable
7968 \pdf_to_ps_command, defaults to pdf2ps.
7970 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7972 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7973 does not have a BufferView.
7974 (unlockInset): ditto + don't access the_locking_inset if the
7975 buffer does not have a BufferView.
7977 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7978 certain circumstances so that we don't continue a keyboard
7979 operation long after the key was released. Try f.ex. to load a
7980 large document, press PageDown for some seconds and then release
7981 it. Before this change the document would contine to scroll for
7982 some time, with this change it stops imidiatly.
7984 * src/support/block.h: don't allocate more space than needed. As
7985 long as we don't try to write to the arr[x] in a array_type arr[x]
7986 it is perfectly ok. (if you write to it you might segfault).
7987 added operator value_type*() so that is possible to pass the array
7988 to functions expecting a C-pointer.
7990 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7993 * intl/*: updated to gettext 0.10.35, tried to add our own
7994 required modifications. Please verify.
7996 * po/*: updated to gettext 0.10.35, tried to add our own required
7997 modifications. Please verify.
7999 * src/support/lstrings.C (tostr): go at fixing the problem with
8000 cxx and stringstream. When stringstream is used return
8001 oss.str().c_str() so that problems with lyxstring and basic_string
8002 are avoided. Note that the best solution would be for cxx to use
8003 basic_string all the way, but it is not conformant yet. (it seems)
8005 * src/lyx_cb.C + other files: moved several global functions to
8006 class BufferView, some have been moved to BufferView.[Ch] others
8007 are still located in lyx_cb.C. Code changes because of this. (part
8008 of "get rid of current_view project".)
8010 * src/buffer.C + other files: moved several Buffer functions to
8011 class BufferView, the functions are still present in buffer.C.
8012 Code changes because of this.
8014 * config/lcmessage.m4: updated to most recent. used when creating
8017 * config/progtest.m4: updated to most recent. used when creating
8020 * config/gettext.m4: updated to most recent. applied patch for
8023 * config/gettext.m4.patch: new file that shows what changes we
8024 have done to the local copy of gettext.m4.
8026 * config/libtool.m4: new file, used in creation of acinclude.m4
8028 * config/lyxinclude.m4: new file, this is the lyx created m4
8029 macros, used in making acinclude.m4.
8031 * autogen.sh: GNU m4 discovered as a separate task not as part of
8032 the lib/configure creation.
8033 Generate acinlucde from files in config. Actually cat
8034 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8035 easier to upgrade .m4 files that really are external.
8037 * src/Spacing.h: moved using std::istringstream to right after
8038 <sstream>. This should fix the problem seen with some compilers.
8040 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8042 * src/lyx_cb.C: began some work to remove the dependency a lot of
8043 functions have on BufferView::text, even if not really needed.
8044 (GetCurrentTextClass): removed this func, it only hid the
8047 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8048 forgot this in last commit.
8050 * src/Bullet.C (bulletEntry): use static char const *[] for the
8051 tables, becuase of this the return arg had to change to string.
8053 (~Bullet): removed unneeded destructor
8055 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8056 (insetSleep): moved from Buffer
8057 (insetWakeup): moved from Buffer
8058 (insetUnlock): moved from Buffer
8060 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8061 from Buffer to BufferView.
8063 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8065 * config/ltmain.sh: updated to version 1.3.4 of libtool
8067 * config/ltconfig: updated to version 1.3.4 of libtool
8069 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8072 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8073 Did I get that right?
8075 * src/lyxlex.h: add a "using" directive or two.
8076 * src/Spacing.h: ditto.
8077 * src/insets/figinset.C: ditto.
8078 * src/support/filetools.C: ditto.
8079 * src/support/lstrings.C: ditto.
8080 * src/BufferView.C: ditto.
8081 * src/bufferlist.C: ditto.
8082 * src/lyx_cb.C: ditto.
8083 * src/lyxlex.C: ditto.
8085 * NEWS: add some changes for 1.1.4.
8087 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * src/BufferView.C: first go at a TextCache to speed up switching
8092 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8094 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8095 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8096 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8097 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8100 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8101 members of the struct are correctly initialized to 0 (detected by
8103 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8104 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8106 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8107 pidwait, since it was allocated with "new". This was potentially
8108 very bad. Thanks to Michael Schmitt for running purify for us.
8111 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8113 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8115 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8117 1999-12-30 Allan Rae <rae@lyx.org>
8119 * lib/templates/IEEEtran.lyx: minor change
8121 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8122 src/mathed/formula.C (LocalDispatch): askForText changes
8124 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8125 know when a user has cancelled input. Fixes annoying problems with
8126 inserting labels and version control.
8128 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8130 * src/support/lstrings.C (tostr): rewritten to use strstream and
8133 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8135 * src/support/filetools.C (IsFileWriteable): use fstream to check
8136 (IsDirWriteable): use fileinfo to check
8138 * src/support/filetools.h (FilePtr): whole class deleted
8140 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8142 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8144 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8146 * src/bufferlist.C (write): use ifstream and ofstream instead of
8149 * src/Spacing.h: use istrstream instead of sscanf
8151 * src/mathed/math_defs.h: change first arg to istream from FILE*
8153 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8155 * src/mathed/math_parser.C: have yyis to be an istream
8156 (LexGetArg): use istream (yyis)
8158 (mathed_parse): ditto
8159 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8161 * src/mathed/formula.C (Read): rewritten to use istream
8163 * src/mathed/formulamacro.C (Read): rewritten to use istream
8165 * src/lyxlex.h (~LyXLex): deleted desturctor
8166 (getStream): new function, returns an istream
8167 (getFile): deleted funtion
8168 (IsOK): return is.good();
8170 * src/lyxlex.C (LyXLex): delete file and owns_file
8171 (setFile): open an filebuf and assign that to a istream instead of
8173 (setStream): new function, takes an istream as arg.
8174 (setFile): deleted function
8175 (EatLine): rewritten us use istream instead of FILE*
8179 * src/table.C (LyXTable): use istream instead of FILE*
8180 (Read): rewritten to take an istream instead of FILE*
8182 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8184 * src/buffer.C (Dispatch): remove an extraneous break statement.
8186 * src/support/filetools.C (QuoteName): change to do simple
8187 'quoting'. More work is necessary. Also changed to do nothing
8188 under emx (needs fix too).
8189 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8191 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8192 config.h.in to the AC_DEFINE_UNQUOTED() call.
8193 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8194 needs char * as argument (because Solaris 7 declares it like
8197 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8198 remove definition of BZERO.
8200 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8202 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8203 defined, "lyxregex.h" if not.
8205 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8207 (REGEX): new variable that is set to regex.c lyxregex.h when
8208 AM_CONDITIONAL USE_REGEX is set.
8209 (libsupport_la_SOURCES): add $(REGEX)
8211 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8214 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8217 * configure.in: add call to LYX_REGEX
8219 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8220 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8222 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8224 * lib/bind/fi_menus.bind: new file, from
8225 pauli.virtanen@saunalahti.fi.
8227 * src/buffer.C (getBibkeyList): pass the parameter delim to
8228 InsetInclude::getKeys and InsetBibtex::getKeys.
8230 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8231 is passed to Buffer::getBibkeyList
8233 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8234 instead of the hardcoded comma.
8236 * src/insets/insetbib.C (getKeys): make sure that there are not
8237 leading blanks in bibtex keys. Normal latex does not care, but
8238 harvard.sty seems to dislike blanks at the beginning of citation
8239 keys. In particular, the retturn value of the function is
8241 * INSTALL: make it clear that libstdc++ is needed and that gcc
8242 2.7.x probably does not work.
8244 * src/support/filetools.C (findtexfile): make debug message go to
8246 * src/insets/insetbib.C (getKeys): ditto
8248 * src/debug.C (showTags): make sure that the output is correctly
8251 * configure.in: add a comment for TWO_COLOR_ICON define.
8253 * acconfig.h: remove all the entries that already defined in
8254 configure.in or acinclude.m4.
8256 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8257 to avoid user name, date and copyright.
8259 1999-12-21 Juergen Vigna <jug@sad.it>
8261 * src/table.C (Read): Now read bogus row format informations
8262 if the format is < 5 so that afterwards the table can
8263 be read by lyx but without any format-info. Fixed the
8264 crash we experienced when not doing this.
8266 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8268 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8269 (RedoDrawingOfParagraph): ditto
8270 (RedoParagraphs): ditto
8271 (RemoveTableRow): ditto
8273 * src/text.C (Fill): rename arg paperwidth -> paper_width
8275 * src/buffer.C (insertLyXFile): rename var filename -> fname
8276 (writeFile): rename arg filename -> fname
8277 (writeFileAscii): ditto
8278 (makeLaTeXFile): ditto
8279 (makeLinuxDocFile): ditto
8280 (makeDocBookFile): ditto
8282 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8285 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8287 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8290 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8291 compiled by a C compiler not C++.
8293 * src/layout.h (LyXTextClass): added typedef for const_iterator
8294 (LyXTextClassList): added typedef for const_iterator + member
8295 functions begin and end.
8297 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8298 iterators to fill the choice_class.
8299 (updateLayoutChoice): rewritten to use iterators to fill the
8300 layoutlist in the toolbar.
8302 * src/BufferView.h (BufferView::work_area_width): removed unused
8305 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8307 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8308 (sgmlCloseTag): ditto
8310 * src/support/lstrings.h: return type of countChar changed to
8313 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8314 what version of this func to use. Also made to return unsigned int.
8316 * configure.in: call LYX_STD_COUNT
8318 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8319 conforming std::count.
8321 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8323 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8324 and a subscript would give bad display (patch from Dekel Tsur
8325 <dekel@math.tau.ac.il>).
8327 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8329 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8332 * src/chset.h: add a few 'using' directives
8334 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8335 triggered when no buffer is active
8337 * src/layout.C: removed `break' after `return' in switch(), since
8340 * src/lyx_main.C (init): make sure LyX can be ran in place even
8341 when libtool has done its magic with shared libraries. Fix the
8342 test for the case when the system directory has not been found.
8344 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8345 name for the latex file.
8346 (MenuMakeHTML): ditto
8348 * src/buffer.h: add an optional boolean argument, which is passed
8351 1999-12-20 Allan Rae <rae@lyx.org>
8353 * lib/templates/IEEEtran.lyx: small correction and update.
8355 * configure.in: Attempted to use LYX_PATH_HEADER
8357 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8359 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8360 input from JMarc. Now use preprocessor to find the header.
8361 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8362 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8363 LYX_STL_STRING_FWD. See comments in file.
8365 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8367 * The global MiniBuffer * minibuffer variable is dead.
8369 * The global FD_form_main * fd_form_main variable is dead.
8371 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8373 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8375 * src/table.h: add the LOstream.h header
8376 * src/debug.h: ditto
8378 * src/LyXAction.h: change the explaination of the ReadOnly
8379 attribute: is indicates that the function _can_ be used.
8381 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8384 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8386 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8392 * src/paragraph.C (GetWord): assert on pos>=0
8395 * src/support/lyxstring.C: condition the use of an invariant on
8397 * src/support/lyxstring.h: ditto
8399 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8400 Use LAssert.h instead of plain assert().
8402 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8404 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8405 * src/support/filetools.C: ditto
8407 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8410 * INSTALL: document the new configure flags
8412 * configure.in: suppress --with-debug; add --enable-assertions
8414 * acinclude.m4: various changes in alignment of help strings.
8416 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * src/kbmap.C: commented out the use of the hash map in kb_map,
8419 beginning of movement to a stl::container.
8421 * several files: removed code that was not in effect when
8422 MOVE_TEXT was defined.
8424 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8425 for escaping should not be used. We can discuss if the string
8426 should be enclosed in f.ex. [] instead of "".
8428 * src/trans_mgr.C (insert): use the new returned value from
8429 encodeString to get deadkeys and keymaps done correctly.
8431 * src/chset.C (encodeString): changed to return a pair, to tell
8432 what to use if we know the string.
8434 * src/lyxscreen.h (fillArc): new function.
8436 * src/FontInfo.C (resize): rewritten to use more std::string like
8437 structore, especially string::replace.
8439 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8442 * configure.in (chmod +x some scripts): remove config/gcc-hack
8444 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8446 * src/buffer.C (writeFile): change once again the top comment in a
8447 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8448 instead of an hardcoded version number.
8449 (makeDocBookFile): ditto
8451 * src/version.h: add new define LYX_DOCVERSION
8453 * po/de.po: update from Pit Sütterlin
8454 * lib/bind/de_menus.bind: ditto.
8456 * src/lyxfunc.C (Dispatch): call MenuExport()
8457 * src/buffer.C (Dispatch): ditto
8459 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8460 LyXFunc::Dispatch().
8461 (MenuExport): new function, moved from
8462 LyXFunc::Dispatch().
8464 * src/trans_mgr.C (insert): small cleanup
8465 * src/chset.C (loadFile): ditto
8467 * lib/kbd/iso8859-1.cdef: add missing backslashes
8469 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8471 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8472 help with placing the manually drawn accents better.
8474 (Draw): x2 and hg changed to float to minimize rounding errors and
8475 help place the accents better.
8477 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8478 unsigned short to char is just wrong...cast the char to unsigned
8479 char instead so that the two values can compare sanely. This
8480 should also make the display of insetlatexaccents better and
8481 perhaps also some other insets.
8483 (lbearing): new function
8486 1999-12-15 Allan Rae <rae@lyx.org>
8488 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8489 header that provides a wrapper around the very annoying SGI STL header
8492 * src/support/lyxstring.C, src/LString.h:
8493 removed old SGI-STL-compatability attempts.
8495 * configure.in: Use LYX_STL_STRING_FWD.
8497 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8498 stl_string_fwd.h is around and try to determine it's location.
8499 Major improvement over previous SGI STL 3.2 compatability.
8500 Three small problems remain with this function due to my zero
8501 knowledge of autoconf. JMarc and lgb see the comments in the code.
8503 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8505 * src/broken_const.h, config/hack-gcc, config/README: removed
8507 * configure.in: remove --with-gcc-hack option; do not call
8510 * INSTALL: remove documentation of --with-broken-const and
8513 * acconfig.h: remove all trace of BROKEN_CONST define
8515 * src/buffer.C (makeDocBookFile): update version number in output
8517 (SimpleDocBookOnePar): fix an assert when trying to a character
8518 access beyond string length
8521 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8523 * po/de.po: fix the Export menu
8525 * lyx.man: update the description of -dbg
8527 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8528 (commandLineHelp): updated
8529 (easyParse): show list of available debug levels if -dbg is passed
8532 * src/Makefile.am: add debug.C
8534 * src/debug.h: moved some code to debug.C
8536 * src/debug.C: new file. Contains code to set and show debug
8539 * src/layout.C: remove 'break' after 'continue' in switch
8540 statements, since these cannot be reached.
8542 1999-12-13 Allan Rae <rae@lyx.org>
8544 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8545 (in_word_set): hash() -> math_hash()
8547 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8549 * acconfig.h: Added a test for whether we are using exceptions in the
8550 current compilation run. If so USING_EXCEPTIONS is defined.
8552 * config.in: Check for existance of stl_string_fwd.h
8553 * src/LString.h: If compiling --with-included-string and SGI's
8554 STL version 3.2 is present (see above test) we need to block their
8555 forward declaration of string and supply a __get_c_string().
8556 However, it turns out this is only necessary if compiling with
8557 exceptions enabled so I've a bit more to add yet.
8559 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8560 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8561 src/support/LRegex.h, src/undo.h:
8562 Shuffle the order of the included files a little to ensure that
8563 LString.h gets included before anything that includes stl_string_fwd.h
8565 * src/support/lyxstring.C: We need to #include LString.h instead of
8566 lyxstring.h to get the necessary definition of __get_c_string.
8567 (__get_c_string): New function. This is defined static just like SGI's
8568 although why they need to do this I'm not sure. Perhaps it should be
8569 in lstrings.C instead.
8571 * lib/templates/IEEEtran.lyx: New template file.
8573 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8575 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8576 * intl/Makefile.in (MKINSTALLDIRS): ditto
8578 * src/LyXAction.C (init): changed to hold the LFUN data in a
8579 automatic array in stead of in callso to newFunc, this speeds up
8580 compilation a lot. Also all the memory used by the array is
8581 returned when the init is completed.
8583 * a lot of files: compiled with -Wold-style-cast, changed most of
8584 the reported offenders to C++ style casts. Did not change the
8585 offenders in C files.
8587 * src/trans.h (Match): change argument type to unsigned int.
8589 * src/support/DebugStream.C: fix some types on the streambufs so
8590 that it works on a conforming implementation.
8592 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8594 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8596 * src/support/lyxstring.C: remove the inline added earlier since
8597 they cause a bunch of unsatisfied symbols when linking with dec
8598 cxx. Cxx likes to have the body of inlines at the place where they
8601 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8602 accessing negative bounds in array. This fixes the crash when
8603 inserting accented characters.
8604 * src/trans.h (Match): ditto
8606 * src/buffer.C (Dispatch): since this is a void, it should not try
8607 to return anything...
8609 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8611 * src/buffer.h: removed the two friends from Buffer. Some changes
8612 because of this. Buffer::getFileName and Buffer::setFileName
8613 renamed to Buffer::fileName() and Buffer::fileName(...).
8615 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8618 and Buffer::update(short) to BufferView. This move is currently
8619 controlled by a define MOVE_TEXT, this will be removed when all
8620 shows to be ok. This move paves the way for better separation
8621 between buffer contents and buffer view. One side effect is that
8622 the BufferView needs a rebreak when swiching buffers, if we want
8623 to avoid this we can add a cache that holds pointers to LyXText's
8624 that is not currently in use.
8626 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8629 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8631 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8633 * lyx_main.C: new command line option -x (or --execute) and
8634 -e (or --export). Now direct conversion from .lyx to .tex
8635 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8636 Unfortunately, X is still needed and the GUI pops up during the
8639 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8641 * src/Spacing.C: add a using directive to bring stream stuff into
8643 * src/paragraph.C: ditto
8644 * src/buffer.C: ditto
8646 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8647 from Lars' announcement).
8649 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8650 example files from Tino Meinen.
8652 1999-12-06 Allan Rae <rae@lyx.org>
8654 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8656 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8658 * src/support/lyxstring.C: added a lot of inline for no good
8661 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8662 latexWriteEndChanges, they were not used.
8664 * src/layout.h (operator<<): output operator for PageSides
8666 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8668 * some example files: loaded in LyX 1.0.4 and saved again to update
8669 certain constructs (table format)
8671 * a lot of files: did the change to use fstream/iostream for all
8672 writing of files. Done with a close look at Andre Poenitz's patch.
8674 * some files: whitespace changes.
8676 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8678 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8679 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8680 architecture, we provide our own. It is used unconditionnally, but
8681 I do not think this is a performance problem. Thanks to Angus
8682 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8683 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8685 (GetInset): use my_memcpy.
8689 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8690 it is easier to understand, but it uses less TeX-only constructs now.
8692 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8693 elements contain spaces
8695 * lib/configure: regenerated
8697 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8698 elements contain spaces; display the list of programs that are
8701 * autogen.sh: make sure lib/configure is executable
8703 * lib/examples/*: rename the tutorial examples to begin with the
8704 two-letters language code.
8706 * src/lyxfunc.C (getStatus): do not query current font if no
8709 * src/lyx_cb.C (RunScript): use QuoteName
8710 (MenuRunDvips): ditto
8711 (PrintApplyCB): ditto
8713 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8714 around argument, so that it works well with the current shell.
8715 Does not work properly with OS/2 shells currently.
8717 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8718 * src/LyXSendto.C (SendtoApplyCB): ditto
8719 * src/lyxfunc.C (Dispatch): ditto
8720 * src/buffer.C (runLaTeX): ditto
8721 (runLiterate): ditto
8722 (buildProgram): ditto
8724 * src/lyx_cb.C (RunScript): ditto
8725 (MenuMakeLaTeX): ditto
8727 * src/buffer.h (getLatexName): new method
8729 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8731 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8734 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8735 (create_math_panel): ditto
8737 * src/lyxfunc.C (getStatus): re-activate the code which gets
8738 current font and cursor; add test for export to html.
8740 * src/lyxrc.C (read): remove unreachable break statements; add a
8743 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8745 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8747 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8748 introduced by faulty regex.
8749 * src/buffer.C: ditto
8750 * src/lastfiles.C: ditto
8751 * src/paragraph.C: ditto
8752 * src/table.C: ditto
8753 * src/vspace.C: ditto
8754 * src/insets/figinset.C: ditto
8755 Note: most of these is absolutely harmless, except the one in
8756 src/mathed formula.C.
8758 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8760 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8761 operation, yielding correct results for the reLyX command.
8763 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8765 * src/support/filetools.C (ExpandPath): removed an over eager
8767 (ReplaceEnvironmentPath): ditto
8769 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8770 shows that we are doing something fishy in our code...
8774 * src/lyxrc.C (read): use a double switch trick to get more help
8775 from the compiler. (the same trick is used in layout.C)
8776 (write): new function. opens a ofstream and pass that to output
8777 (output): new function, takes a ostream and writes the lyxrc
8778 elemts to it. uses a dummy switch to make sure no elements are
8781 * src/lyxlex.h: added a struct pushpophelper for use in functions
8782 with more than one exit point.
8784 * src/lyxlex.[Ch] (GetInteger): made it const
8788 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8790 * src/layout.[hC] : LayoutTags splitted into several enums, new
8791 methods created, better error handling cleaner use of lyxlex. Read
8794 * src/bmtable.[Ch]: change some member prototypes because of the
8795 image const changes.
8797 * commandtags.h, src/LyXAction.C (init): new function:
8798 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8799 This file is not read automatically but you can add \input
8800 preferences to your lyxrc if you want to. We need to discuss how
8803 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8804 in .aux, also remove .bib and .bst files from dependencies when
8807 * src/BufferView.C, src/LyXView.C: add const_cast several places
8808 because of changes to images.
8810 * lib/images/*: same change as for images/*
8812 * lib/lyxrc.example: Default for accept_compound is false not no.
8814 * images/*: changed to be const, however I have som misgivings
8815 about this change so it might be changed back.
8817 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8819 * lib/configure, po/POTFILES.in: regenerated
8821 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8823 * config/lib_configure.m4: removed
8825 * lib/configure.m4: new file (was config/lib_configure.m4)
8827 * configure.in: do not test for rtti, since we do not use it.
8829 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8832 doubling of allocated space scheme. This makes it faster for large
8833 strings end to use less memory for small strings. xtra rememoved.
8835 * src/insets/figinset.C (waitalarm): commented out.
8836 (GhostscriptMsg): use static_cast
8837 (GhostscriptMsg): use new instead of malloc to allocate memory for
8838 cmap. also delete the memory after use.
8840 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8842 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8843 for changes in bibtex database or style.
8844 (runBibTeX): remove all .bib and .bst files from dep before we
8846 (run): use scanAuc in when dep file already exist.
8848 * src/DepTable.C (remove_files_with_extension): new method
8851 * src/DepTable.[Ch]: made many of the methods const.
8853 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8855 * src/bufferparams.C: make sure that the default textclass is
8856 "article". It used to be the first one by description order, but
8857 now the first one is "docbook".
8859 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8860 string; call Debug::value.
8861 (easyParse): pass complete argument to setDebuggingLevel().
8863 * src/debug.h (value): fix the code that parses debug levels.
8865 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8868 * src/LyXAction.C: use Debug::ACTION as debug channel.
8870 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8872 * NEWS: updated for the future 1.1.3 release.
8874 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8875 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8876 it should. This is of course a controversial change (since many
8877 people will find that their lyx workscreen is suddenly full of
8878 red), but done for the sake of correctness.
8880 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8881 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8883 * src/insets/inseterror.h, src/insets/inseturl.h,
8884 src/insets/insetinfo.h, src/insets/figinset.h,
8885 src/mathed/formulamacro.h, src/mathed/math_macro.h
8886 (EditMessage): add a missing const and add _() to make sure that
8889 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8890 src/insets/insetbib.C, src/support/filetools.C: add `using'
8893 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8894 doing 'Insert index of last word' at the beginning of a paragraph.
8896 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * several files: white-space changes.
8900 * src/mathed/formula.C: removed IsAlpha and IsDigit
8902 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8903 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8906 * src/insets/figinset.C (GetPSSizes): don't break when
8907 "EndComments" is seen. But break when a boundingbox is read.
8909 * all classes inherited from Inset: return value of Clone
8910 changed back to Inset *.
8912 * all classes inherited form MathInset: return value of Clone
8913 changed back to MathedInset *.
8915 * src/insets/figinset.C (runqueue): use a ofstream to output the
8916 gs/ps file. Might need some setpresicion or setw. However I can
8917 see no problem with the current code.
8918 (runqueue): use sleep instead of the alarm/signal code. I just
8919 can't see the difference.
8921 * src/paragraph.C (LyXParagraph): reserve space in the new
8922 paragraph and resize the inserted paragraph to just fit.
8924 * src/lyxfunc.h (operator|=): added operator for func_status.
8926 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8927 check for readable file.
8929 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8930 check for readable file.
8931 (MenuMakeLinuxDoc): ditto
8932 (MenuMakeDocBook): ditto
8933 (MenuMakeAscii): ditto
8934 (InsertAsciiFile): split the test for openable and readable
8936 * src/bmtable.C (draw_bitmaptable): use
8937 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8939 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8940 findtexfile from LaTeX to filetools.
8942 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8943 instead of FilePtr. Needs to be verified by a literate user.
8945 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8947 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8948 (EditMessage): likewise.
8950 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8951 respectively as \textasciitilde and \textasciicircum.
8953 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8955 * src/support/lyxstring.h: made the methods that take iterators
8958 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8959 (regexMatch): made is use the real regex class.
8961 * src/support/Makefile.am: changed to use libtool
8963 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8965 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8967 (MathIsInset ++): changed several macros to be inline functions
8970 * src/mathed/Makefile.am: changed to use libtool
8972 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8974 * src/insets/inset* : Clone changed to const and return type is
8975 the true insettype not just Inset*.
8977 * src/insets/Makefile.am: changed to use libtool
8979 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8981 * src/undo.[Ch] : added empty() and changed some of the method
8984 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8986 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8987 setID use block<> for the bullets array, added const several places.
8989 * src/lyxfunc.C (getStatus): new function
8991 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8992 LyXAction, added const to several funtions.
8994 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8995 a std::map, and to store the dir items in a vector.
8997 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9000 * src/LyXView.[Ch] + other files : changed currentView to view.
9002 * src/LyXAction.[Ch] : ported from the old devel branch.
9004 * src/.cvsignore: added .libs and a.out
9006 * configure.in : changes to use libtool.
9008 * acinclude.m4 : inserted libtool.m4
9010 * .cvsignore: added libtool
9012 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9014 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9015 file name in insets and mathed directories (otherwise the
9016 dependency is not taken in account under cygwin).
9018 * src/text2.C (InsertString[AB]): make sure that we do not try to
9019 read characters past the string length.
9021 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9023 * lib/doc/LaTeXConfig.lyx.in,
9024 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9026 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9027 file saying who created them and when this heppened; this is
9028 useless and annoys tools like cvs.
9030 * lib/layouts/g-brief-{en,de}.layout,
9031 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9032 from Thomas Hartkens <thomas@hartkens.de>.
9034 * src/{insets,mathed}/Makefile.am: do not declare an empty
9035 LDFLAGS, so that it can be set at configure time (useful on Irix
9038 * lib/reLyX/configure.in: make sure that the prefix is set
9039 correctly in LYX_DIR.
9041 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9043 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9044 be used by 'command-sequence' this allows to bind a key to a
9045 sequence of LyX-commands
9046 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9048 * src/LyXAction.C: add "command-sequence"
9050 * src/LyXFunction.C: handling of "command-sequence"
9052 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9053 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9055 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9057 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9059 * src/buffer.C (writeFile): Do not output a comment giving user
9060 and date at the beginning of a .lyx file. This is useless and
9061 annoys cvs anyway; update version number to 1.1.
9063 * src/Makefile.am (LYX_DIR): add this definition, so that a
9064 default path is hardcoded in LyX.
9066 * configure.in: Use LYX_GNU_GETTEXT.
9068 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9069 AM_GNU_GETTEXT with a bug fixed.
9071 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9073 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9075 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9076 which is used to point to LyX data is now LYX_DIR_11x.
9078 * lyx.man: convert to a unix text file; small updates.
9080 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9082 * src/support/LSubstring.[Ch]: made the second arg of most of the
9083 constructors be a const reference.
9085 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9088 * src/support/lyxstring.[Ch] (swap): added missing member function
9089 and specialization of swap(str, str);
9091 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9093 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9094 trace of the old one.
9096 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9097 put the member definitions in undo.C.
9099 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9100 NEW_TEXT and have now only code that was included when this was
9103 * src/intl.C (LCombo): use static_cast
9105 (DispatchCallback): ditto
9107 * src/definitions.h: removed whole file
9109 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9111 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9112 parsing and stores in a std:map. a regex defines the file format.
9113 removed unneeded members.
9115 * src/bufferparams.h: added several enums from definitions.h here.
9116 Removed unsused destructor. Changed some types to use proper enum
9117 types. use block to have the temp_bullets and user_defined_bullets
9118 and to make the whole class assignable.
9120 * src/bufferparams.C (Copy): removed this functions, use a default
9123 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9126 * src/buffer.C (readLyXformat2): commend out all that have with
9127 oldpapersize to do. also comment out all that hve to do with
9128 insetlatex and insetlatexdel.
9129 (setOldPaperStuff): commented out
9131 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9133 * src/LyXAction.C: remove use of inset-latex-insert
9135 * src/mathed/math_panel.C (button_cb): use static_cast
9137 * src/insets/Makefile.am (insets_o_SOURCES): removed
9140 * src/support/lyxstring.C (helper): use the unsigned long
9141 specifier, UL, instead of a static_cast.
9143 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9145 * src/support/block.h: new file. to be used as a c-style array in
9146 classes, so that the class can be assignable.
9148 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9150 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9151 NULL, make sure to return an empty string (it is not possible to
9152 set a string to NULL).
9154 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9156 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9158 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9160 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9161 link line, so that Irix users (for example) can set it explicitely to
9164 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9165 it can be overidden at make time (static or dynamic link, for
9168 * src/vc-backend.C, src/LaTeXFeatures.h,
9169 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9170 statements to bring templates to global namespace.
9172 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9174 * src/support/lyxstring.C (operator[] const): make it standard
9177 * src/minibuffer.C (Init): changed to reflect that more
9178 information is given from the lyxvc and need not be provided here.
9180 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9182 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9184 * src/LyXView.C (UpdateTimerCB): use static_cast
9185 (KeyPressMask_raw_callback): ditto
9187 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9188 buffer_, a lot of changes because of this. currentBuffer() ->
9189 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9190 also changes to other files because of this.
9192 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9194 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9195 have no support for RCS and partial support for CVS, will be
9198 * src/insets/ several files: changes because of function name
9199 changes in Bufferview and LyXView.
9201 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9203 * src/support/LSubstring.[Ch]: new files. These implement a
9204 Substring that can be very convenient to use. i.e. is this
9206 string a = "Mary had a little sheep";
9207 Substring(a, "sheep") = "lamb";
9208 a is now "Mary has a little lamb".
9210 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9211 out patterns and subpatterns of strings. It is used by LSubstring
9212 and also by vc-backend.C
9214 * src/support/lyxstring.C: went over all the assertions used and
9215 tried to correct the wrong ones and flag which of them is required
9216 by the standard. some bugs found because of this. Also removed a
9217 couple of assertions.
9219 * src/support/Makefile.am (libsupport_a_SOURCES): added
9220 LSubstring.[Ch] and LRegex.[Ch]
9222 * src/support/FileInfo.h: have struct stat buf as an object and
9223 not a pointer to one, some changes because of this.
9225 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9226 information in layout when adding the layouts preamble to the
9229 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9232 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9233 because of bug in OS/2.
9235 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9237 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9238 \verbatim@font instead of \ttfamily, so that it can be redefined.
9240 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9241 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9242 src/layout.h, src/text2.C: add 'using' directive to bring the
9243 STL templates we need from the std:: namespace to the global one.
9244 Needed by DEC cxx in strict ansi mode.
9246 * src/support/LIstream.h,src/support/LOstream.h,
9247 src/support/lyxstring.h,src/table.h,
9248 src/lyxlookup.h: do not include <config.h> in header
9249 files. This should be done in the .C files only.
9251 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9255 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9257 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9258 from Kayvan to fix the tth invokation.
9260 * development/lyx.spec.in: updates from Kayvan to reflect the
9261 changes of file names.
9263 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9265 * src/text2.C (InsertStringB): use std::copy
9266 (InsertStringA): use std::copy
9268 * src/bufferlist.C: use a vector to store the buffers in. This is
9269 an internal change and should not affect any other thing.
9271 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9274 * src/text.C (Fill): fix potential bug, one off bug.
9276 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/Makefile.am (lyx_main.o): add more files it depends on.
9280 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9282 * src/support/lyxstring.C: use size_t for the reference count,
9283 size, reserved memory and xtra.
9284 (internal_compare): new private member function. Now the compare
9285 functions should work for std::strings that have embedded '\0'
9287 (compare): all compare functions rewritten to use
9290 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9292 * src/support/lyxstring.C (compare): pass c_str()
9293 (compare): pass c_str
9294 (compare): pass c_str
9296 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9298 * src/support/DebugStream.C: <config.h> was not included correctly.
9300 * lib/configure: forgot to re-generate it :( I'll make this file
9301 auto generated soon.
9303 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9305 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9308 * src/support/lyxstring.C: some changes from length() to rep->sz.
9309 avoids a function call.
9311 * src/support/filetools.C (SpaceLess): yet another version of the
9312 algorithm...now per Jean-Marc's suggestions.
9314 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9316 * src/layout.C (less_textclass_desc): functor for use in sorting
9318 (LyXTextClass::Read): sort the textclasses after reading.
9320 * src/support/filetools.C (SpaceLess): new version of the
9321 SpaceLess functions. What problems does this one give? Please
9324 * images/banner_bw.xbm: made the arrays unsigned char *
9326 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9328 * src/support/lyxstring.C (find): remove bogus assertion in the
9329 two versions of find where this has not been done yet.
9331 * src/support/lyxlib.h: add missing int return type to
9334 * src/menus.C (ShowFileMenu): disable exporting to html if no
9335 html export command is present.
9337 * config/lib_configure.m4: add a test for an HTML converter. The
9338 programs checked for are, in this order: tth, latex2html and
9341 * lib/configure: generated from config/lib_configure.m4.
9343 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9344 html converter. The parameters are now passed through $$FName and
9345 $$OutName, instead of standard input/output.
9347 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9349 * lib/lyxrc.example: update description of \html_command.
9350 add "quotes" around \screen_font_xxx font setting examples to help
9351 people who use fonts with spaces in their names.
9353 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9355 * Distribution files: updates for v1.1.2
9357 * src/support/lyxstring.C (find): remove bogus assert and return
9358 npos for the same condition.
9360 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9362 * added patch for OS/2 from SMiyata.
9364 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9366 * src/text2.C (CutSelection): make space_wrapped a bool
9367 (CutSelection): dont declare int i until we have to.
9368 (alphaCounter): return a char const *.
9370 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9372 * src/support/syscall.C (Systemcalls::kill):
9373 src/support/filetools.C (PutEnv, PutEnvPath):
9374 src/lyx_cb.C (addNewlineAndDepth):
9375 src/FontInfo.C (FontInfo::resize): condition some #warning
9376 directives with WITH_WARNINGS.
9379 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9381 * src/layout.[Ch] + several files: access to class variables
9382 limited and made accessor functions instead a lot of code changed
9383 becuase of this. Also instead of returning pointers often a const
9384 reference is returned instead.
9386 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9388 * src/Makefile.am (dist-hook): added used to remove the CVS from
9389 cheaders upon creating a dist
9390 (EXTRA_DIST): added cheaders
9392 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9393 a character not as a small integer.
9395 * src/support/lyxstring.C (find): removed Assert and added i >=
9396 rep->sz to the first if.
9398 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9400 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9401 src/LyXView.C src/buffer.C src/bufferparams.C
9402 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9403 src/text2.C src/insets/insetinclude.C:
9404 lyxlayout renamed to textclasslist.
9406 * src/layout.C: some lyxerr changes.
9408 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9409 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9410 (LyXLayoutList): removed all traces of this class.
9411 (LyXTextClass::Read): rewrote LT_STYLE
9412 (LyXTextClass::hasLayout): new function
9413 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9414 both const and nonconst version.
9415 (LyXTextClass::delete_layout): new function.
9416 (LyXTextClassList::Style): bug fix. do the right thing if layout
9418 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9419 (LyXTextClassList::NameOfLayout): ditto
9420 (LyXTextClassList::Load): ditto
9422 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9424 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9426 * src/LyXAction.C (LookupFunc): added a workaround for sun
9427 compiler, on the other hand...we don't know if the current code
9428 compiles on sun at all...
9430 * src/support/filetools.C (CleanupPath): subst fix
9432 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9435 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9436 complained about this one?
9438 * src/insets/insetinclude.C (Latex): subst fix
9440 * src/insets/insetbib.C (getKeys): subst fix
9442 * src/LyXSendto.C (SendtoApplyCB): subst fix
9444 * src/lyx_main.C (init): subst fix
9446 * src/layout.C (Read): subst fix
9448 * src/lyx_sendfax_main.C (button_send): subst fix
9450 * src/buffer.C (RoffAsciiTable): subst fix
9452 * src/lyx_cb.C (MenuFax): subst fix
9453 (PrintApplyCB): subst fix
9455 1999-10-26 Juergen Vigna <jug@sad.it>
9457 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9459 (Read): Cleaned up this code so now we read only format vestion >= 5
9461 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9463 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9464 come nobody has complained about this one?
9466 * src/insets/insetinclude.C (Latex): subst fix
9468 * src/insets/insetbib.C (getKeys): subst fix
9470 * src/lyx_main.C (init): subst fix
9472 * src/layout.C (Read): subst fix
9474 * src/buffer.C (RoffAsciiTable): subst fix
9476 * src/lyx_cb.C (MenuFax): subst fix.
9478 * src/layout.[hC] + some other files: rewrote to use
9479 std::container to store textclasses and layouts in.
9480 Simplified, removed a lot of code. Make all classes
9481 assignable. Further simplifications and review of type
9482 use still to be one.
9484 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9485 lastfiles to create the lastfiles partr of the menu.
9487 * src/lastfiles.[Ch]: rewritten to use deque to store the
9488 lastfiles in. Uses fstream for reading and writing. Simplifies
9491 * src/support/syscall.C: remove explicit cast.
9493 * src/BufferView.C (CursorToggleCB): removed code snippets that
9495 use explicat C++ style casts instead of C style casts. also use
9496 u_vdata instea of passing pointers in longs.
9498 * src/PaperLayout.C: removed code snippets that were commented out.
9500 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9502 * src/lyx_main.C: removed code snippets that wer commented out.
9504 * src/paragraph.C: removed code snippets that were commented out.
9506 * src/lyxvc.C (logClose): use static_cast
9508 (viewLog): remove explicit cast to void*
9509 (showLog): removed old commented code
9511 * src/menus.C: use static_cast instead of C style casts. use
9512 u_vdata instead of u_ldata. remove explicit cast to (long) for
9513 pointers. Removed old code that was commented out.
9515 * src/insets/inset.C: removed old commented func
9517 * src/insets/insetref.C (InsetRef): removed old code that had been
9518 commented out for a long time.
9520 (escape): removed C style cast
9522 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9524 * src/insets/insetlatex.C (Draw): removed old commented code
9525 (Read): rewritten to use string
9527 * src/insets/insetlabel.C (escape): removed C style cast
9529 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9531 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9534 * src/insets/insetinclude.h: removed a couple of stupid bools
9536 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9537 (Clone): remove C style cast
9538 (getKeys): changed list to lst because of std::list
9540 * src/insets/inseterror.C (Draw): removed som old commented code.
9542 * src/insets/insetcommand.C (Draw): removed some old commented code.
9544 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9545 commented out forever.
9546 (bibitem_cb): use static_cast instead of C style cast
9547 use of vdata changed to u_vdata.
9549 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9551 (CloseUrlCB): use static_cast instead of C style cast.
9552 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9554 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9555 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9556 (CloseInfoCB): static_cast from ob->u_vdata instead.
9557 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9560 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9561 (C_InsetError_CloseErrorCB): forward the ob parameter
9562 (CloseErrorCB): static_cast from ob->u_vdata instead.
9564 * src/vspace.h: include LString.h since we use string in this class.
9566 * src/vspace.C (lyx_advance): changed name from advance because of
9567 nameclash with stl. And since we cannot use namespaces yet...I
9568 used a lyx_ prefix instead. Expect this to change when we begin
9571 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9573 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9574 and removed now defunct constructor and deconstructor.
9576 * src/BufferView.h: have backstack as a object not as a pointer.
9577 removed initialization from constructor. added include for BackStack
9579 * development/lyx.spec.in (%build): add CFLAGS also.
9581 * src/screen.C (drawFrame): removed another warning.
9583 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9585 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9586 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9587 README and ANNOUNCE a bit for the next release. More work is
9590 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9591 unbreakable if we are in freespacing mode (LyX-Code), but not in
9594 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9596 * src/BackStack.h: fixed initialization order in constructor
9598 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9600 * acinclude.m4 (VERSION): new rules for when a version is
9601 development, added also a variable for prerelease.
9602 (warnings): we set with_warnings=yes for prereleases
9603 (lyx_opt): prereleases compile with same optimization as development
9604 (CXXFLAGS): only use pedantic if we are a development version
9606 * src/BufferView.C (restorePosition): don't do anything if the
9609 * src/BackStack.h: added member empty, use this to test if there
9610 is anything to pop...
9612 1999-10-25 Juergen Vigna <jug@sad.it>
9615 * forms/layout_forms.fd +
9616 * forms/latexoptions.fd +
9617 * lyx.fd: changed for various form resize issues
9619 * src/mathed/math_panel.C +
9620 * src/insets/inseterror.C +
9621 * src/insets/insetinfo.C +
9622 * src/insets/inseturl.C +
9623 * src/insets/inseturl.h +
9626 * src/PaperLayout.C +
9627 * src/ParagraphExtra.C +
9628 * src/TableLayout.C +
9630 * src/layout_forms.C +
9637 * src/menus.C: fixed various resize issues. So now forms can be
9638 resized savely or not be resized at all.
9640 * forms/form_url.fd +
9641 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9644 * src/insets/Makefile.am: added files form_url.[Ch]
9646 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9648 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9649 (and presumably 6.2).
9651 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9652 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9653 remaining static member callbacks.
9655 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9658 * src/support/lyxstring.h: declare struct Srep as friend of
9659 lyxstring, since DEC cxx complains otherwise.
9661 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9663 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9665 * src/LaTeX.C (run): made run_bibtex also depend on files with
9667 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9668 are put into the dependency file.
9670 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9671 the code has shown itself to work
9672 (create_ispell_pipe): removed another warning, added a comment
9675 * src/minibuffer.C (ExecutingCB): removed code that has been
9676 commented out a long time
9678 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9679 out code + a warning.
9681 * src/support/lyxstring.h: comment out the three private
9682 operators, when compiling with string ansi conforming compilers
9685 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9687 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9688 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9691 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9694 * src/mathed/math_panel.C (create_math_panel): remove explicit
9697 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9700 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9701 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9702 to XCreatePixmapFromBitmapData
9703 (fl_set_bmtable_data): change the last argument to be unsigned
9705 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9706 and bh to be unsigned int, remove explicit casts in call to
9707 XReadBitmapFileData.
9709 * images/arrows.xbm: made the arrays unsigned char *
9710 * images/varsz.xbm: ditto
9711 * images/misc.xbm: ditto
9712 * images/greek.xbm: ditto
9713 * images/dots.xbm: ditto
9714 * images/brel.xbm: ditto
9715 * images/bop.xbm: ditto
9717 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9719 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9720 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9721 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9723 (LYX_CXX_CHEADERS): added <clocale> to the test.
9725 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9727 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9729 * src/support/lyxstring.C (append): fixed something that must be a
9730 bug, rep->assign was used instead of rep->append.
9732 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9735 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9736 lyx insert double chars. Fix spotted by Kayvan.
9738 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9740 * Fixed the tth support. I messed up with the Emacs patch apply feature
9741 and omitted the changes in lyxrc.C.
9743 1999-10-22 Juergen Vigna <jug@sad.it>
9745 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9747 * src/lyx_cb.C (MenuInsertRef) +
9748 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9749 the form cannot be resized under it limits (fixes a segfault)
9751 * src/lyx.C (create_form_form_ref) +
9752 * forms/lyx.fd: Changed Gravity on name input field so that it is
9755 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9757 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9758 <ostream> and <istream>.
9760 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9761 whether <fstream> provides the latest standard features, or if we
9762 have an oldstyle library (like in egcs).
9763 (LYX_CXX_STL_STRING): fix the test.
9765 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9766 code on MODERN_STL_STREAM.
9768 * src/support/lyxstring.h: use L{I,O}stream.h.
9770 * src/support/L{I,O}stream.h: new files, designed to setup
9771 correctly streams for our use
9772 - includes the right header depending on STL capabilities
9773 - puts std::ostream and std::endl (for LOStream.h) or
9774 std::istream (LIStream.h) in toplevel namespace.
9776 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9778 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9779 was a bib file that had been changed we ensure that bibtex is run.
9780 (runBibTeX): enhanced to extract the names of the bib files and
9781 getting their absolute path and enter them into the dep file.
9782 (findtexfile): static func that is used to look for tex-files,
9783 checks for absolute patchs and tries also with kpsewhich.
9784 Alternative ways of finding the correct files are wanted. Will
9786 (do_popen): function that runs a command using popen and returns
9787 the whole output of that command in a string. Should be moved to
9790 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9791 file with extension ext has changed.
9793 * src/insets/figinset.C: added ifdef guards around the fl_free
9794 code that jug commented out. Now it is commented out when
9795 compiling with XForms == 0.89.
9797 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9798 to lyxstring.C, and only keep a forward declaration in
9799 lyxstring.h. Simplifies the header file a bit and should help a
9800 bit on compile time too. Also changes to Srep will not mandate a
9801 recompile of code just using string.
9802 (~lyxstring): definition moved here since it uses srep.
9803 (size): definition moved here since it uses srep.
9805 * src/support/lyxstring.h: removed a couple of "inline" that should
9808 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9813 1999-10-21 Juergen Vigna <jug@sad.it>
9815 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9816 set to left if I just remove the width entry (or it is empty).
9818 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9819 paragraph when having dummy paragraphs.
9821 1999-10-20 Juergen Vigna <jug@sad.it>
9823 * src/insets/figinset.C: just commented some fl_free_form calls
9824 and added warnings so that this calls should be activated later
9825 again. This avoids for now a segfault, but we have a memory leak!
9827 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9828 'const char * argument' to 'string argument', this should
9829 fix some Asserts() in lyxstring.C.
9831 * src/lyxfunc.h: Removed the function argAsString(const char *)
9832 as it is not used anymore.
9834 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9839 * src/Literate.h: some funcs moved from public to private to make
9840 interface clearer. Unneeded args removed.
9842 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9844 (scanBuildLogFile): ditto
9846 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9847 normal TeX Error. Still room for improvement.
9849 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9851 * src/buffer.C (insertErrors): changes to make the error
9852 desctription show properly.
9854 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9857 * src/support/lyxstring.C (helper): changed to use
9858 sizeof(object->rep->ref).
9859 (operator>>): changed to use a pointer instead.
9861 * src/support/lyxstring.h: changed const reference & to value_type
9862 const & lets see if that helps.
9864 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9866 * Makefile.am (rpmdist): fixed to have non static package and
9869 * src/support/lyxstring.C: removed the compilation guards
9871 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9874 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9875 conditional compile of lyxstring.Ch
9877 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9878 stupid check, but it is a lot better than the bastring hack.
9879 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9881 * several files: changed string::erase into string::clear. Not
9884 * src/chset.C (encodeString): use a char temporary instead
9886 * src/table.C (TexEndOfCell): added tostr around
9887 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9888 (TexEndOfCell): ditto
9889 (TexEndOfCell): ditto
9890 (TexEndOfCell): ditto
9891 (DocBookEndOfCell): ditto
9892 (DocBookEndOfCell): ditto
9893 (DocBookEndOfCell): ditto
9894 (DocBookEndOfCell): ditto
9896 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9898 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9900 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9901 (MenuBuildProg): added tostr around ret
9902 (MenuRunChktex): added tostr around ret
9903 (DocumentApplyCB): added tostr around ret
9905 * src/chset.C (encodeString): added tostr around t->ic
9907 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9908 (makeLaTeXFile): added tostr around tocdepth
9909 (makeLaTeXFile): added tostr around ftcound - 1
9911 * src/insets/insetbib.C (setCounter): added tostr around counter.
9913 * src/support/lyxstring.h: added an operator+=(int) to catch more
9916 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9917 (lyxstring): We DON'T allow NULL pointers.
9919 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9921 * src/mathed/math_macro.C (MathMacroArgument::Write,
9922 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9923 when writing them out.
9925 * src/LString.C: remove, since it is not used anymore.
9927 * src/support/lyxstring.C: condition the content to
9928 USE_INCLUDED_STRING macro.
9930 * src/mathed/math_symbols.C, src/support/lstrings.C,
9931 src/support/lyxstring.C: add `using' directive to specify what
9932 we need in <algorithm>. I do not think that we need to
9933 conditionalize this, but any thought is appreciated.
9935 * many files: change all callback functions to "C" linkage
9936 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9937 strict_ansi. Those who were static are now global.
9938 The case of callbacks which are static class members is
9939 trickier, since we have to make C wrappers around them (see
9940 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9941 did not finish this yet, since it defeats the purpose of
9942 encapsulation, and I am not sure what the best route is.
9944 1999-10-19 Juergen Vigna <jug@sad.it>
9946 * src/support/lyxstring.C (lyxstring): we permit to have a null
9947 pointer as assignment value and just don't assign it.
9949 * src/vspace.C (nextToken): corrected this function substituting
9950 find_first(_not)_of with find_last_of.
9952 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9953 (TableOptCloseCB) (TableSpeCloseCB):
9954 inserted fl_set_focus call for problem with fl_hide_form() in
9957 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9959 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9962 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9964 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9965 LyXLex::next() and not eatline() to get its argument.
9967 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9969 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9970 instead, use fstreams for io of the depfile, removed unneeded
9971 functions and variables.
9973 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9974 vector instead, removed all functions and variables that is not in
9977 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9979 * src/buffer.C (insertErrors): use new interface to TeXError
9981 * Makefile.am (rpmdist): added a rpmdist target
9983 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9984 per Kayvan's instructions.
9986 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9988 * src/Makefile.am: add a definition for localedir, so that locales
9989 are found after installation (Kayvan)
9991 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9993 * development/.cvsignore: new file.
9995 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9997 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9998 C++ compiler provides wrappers for C headers and use our alternate
10001 * configure.in: use LYX_CXX_CHEADERS.
10003 * src/cheader/: new directory, populated with cname headers from
10004 libstdc++-2.8.1. They are a bit old, but probably good enough for
10005 what we want (support compilers who lack them).
10007 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10008 from includes. It turns out is was stupid.
10010 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10012 * lib/Makefile.am (install-data-local): forgot a ';'
10013 (install-data-local): forgot a '\'
10014 (libinstalldirs): needed after all. reintroduced.
10016 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10018 * configure.in (AC_OUTPUT): added lyx.spec
10020 * development/lyx.spec: removed file
10022 * development/lyx.spec.in: new file
10024 * po/*.po: merged with lyx.pot becuase of make distcheck
10026 * lib/Makefile.am (dist-hook): added dist-hook so that
10027 documentation files will be included when doing a make
10028 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10029 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10031 more: tried to make install do the right thing, exclude CVS dirs
10034 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10035 Path would fit in more nicely.
10037 * all files that used to use pathstack: uses now Path instead.
10038 This change was a lot easier than expected.
10040 * src/support/path.h: new file
10042 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10044 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10046 * src/support/lyxstring.C (getline): Default arg was given for
10049 * Configure.cmd: removed file
10051 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10053 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10054 streams classes and types, add the proper 'using' statements when
10055 MODERN_STL is defined.
10057 * src/debug.h: move the << operator definition after the inclusion
10060 * src/support/filetools.C: include "LAssert.h", which is needed
10063 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10066 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10067 include "debug.h" to define a proper ostream.
10069 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10071 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10072 method to the SystemCall class which can kill a process, but it's
10073 not fully implemented yet.
10075 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10077 * src/support/FileInfo.h: Better documentation
10079 * src/lyxfunc.C: Added support for buffer-export html
10081 * src/menus.C: Added Export->As HTML...
10083 * lib/bind/*.bind: Added short-cut for buffer-export html
10085 * src/lyxrc.*: Added support for new \tth_command
10087 * lib/lyxrc.example: Added stuff for new \tth_command
10089 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10091 * lib/Makefile.am (IMAGES): removed images/README
10092 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10093 installes in correct place. Check permisions is installed
10096 * src/LaTeX.C: some no-op changes moved declaration of some
10099 * src/LaTeX.h (LATEX_H): changed include guard name
10101 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10103 * lib/reLyX/Makefile.am: install noweb2lyx.
10105 * lib/Makefile.am: install configure.
10107 * lib/reLyX/configure.in: declare a config aux dir; set package
10108 name to lyx (not sure what the best solution is); generate noweb2lyx.
10110 * lib/layouts/egs.layout: fix the bibliography layout.
10112 1999-10-08 Jürgen Vigna <jug@sad.it>
10114 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10115 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10116 it returned without continuing to search the path.
10118 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10120 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10121 also fixes a bug. It is not allowed to do tricks with std::strings
10122 like: string a("hei"); &a[e]; this will not give what you
10123 think... Any reason for the complexity in this func?
10125 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10127 * Updated README and INSTALL a bit, mostly to check that my
10128 CVS rights are correctly set up.
10130 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10132 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10133 does not allow '\0' chars but lyxstring and std::string does.
10135 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10137 * autogen.sh (AUTOCONF): let the autogen script create the
10138 POTFILES.in file too. POTFILES.in should perhaps now not be
10139 included in the cvs module.
10141 * some more files changed to use C++ includes instead of C ones.
10143 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10145 (Reread): added tostr to nlink. buggy output otherwise.
10146 (Reread): added a string() around szMode when assigning to Buffer,
10147 without this I got a log of garbled info strings.
10149 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10152 * I have added several ostream & operator<<(ostream &, some_type)
10153 functions. This has been done to avoid casting and warnings when
10154 outputting enums to lyxerr. This as thus eliminated a lot of
10155 explicit casts and has made the code clearer. Among the enums
10156 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10157 mathed enums, some font enum the Debug::type enum.
10159 * src/support/lyxstring.h (clear): missing method. equivalent of
10162 * all files that contained "stderr": rewrote constructs that used
10163 stderr to use lyxerr instead. (except bmtable)
10165 * src/support/DebugStream.h (level): and the passed t with
10166 Debug::ANY to avoid spurious bits set.
10168 * src/debug.h (Debug::type value): made it accept strings of the
10169 type INFO,INIT,KEY.
10171 * configure.in (Check for programs): Added a check for kpsewhich,
10172 the latex generation will use this later to better the dicovery of
10175 * src/BufferView.C (create_view): we don't need to cast this to
10176 (void*) that is done automatically.
10177 (WorkAreaButtonPress): removed some dead code.
10179 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10181 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10182 is not overwritten when translated (David Sua'rez de Lis).
10184 * lib/CREDITS: Added David Sua'rez de Lis
10186 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10188 * src/bufferparams.C (BufferParams): default input encoding is now
10191 * acinclude.m4 (cross_compiling): comment out macro
10192 LYX_GXX_STRENGTH_REDUCE.
10194 * acconfig.h: make sure that const is not defined (to empty) when
10195 we are compiling C++. Remove commented out code using SIZEOF_xx
10198 * configure.in : move the test for const and inline as late as
10199 possible so that these C tests do not interefere with C++ ones.
10200 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10201 has not been proven.
10203 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10205 * src/table.C (getDocBookAlign): remove bad default value for
10206 isColumn parameter.
10208 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10210 (ShowFileMenu2): ditto.
10212 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10213 of files to ignore.
10215 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10217 * Most files: finished the change from the old error code to use
10218 DebugStream for all lyxerr debugging. Only minor changes remain
10219 (e.g. the setting of debug levels using strings instead of number)
10221 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10223 * src/layout.C (Add): Changed to use compare_no_case instead of
10226 * src/FontInfo.C: changed loop variable type too string::size_type.
10228 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10230 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10231 set ETAGS_ARGS to --c++
10233 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10235 * src/table.C (DocBookEndOfCell): commented out two unused variables
10237 * src/paragraph.C: commented out four unused variables.
10239 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10240 insed a if clause with type string::size_type.
10242 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10245 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10247 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10248 variable, also changed loop to go from 0 to lenght + 1, instead of
10249 -1 to length. This should be correct.
10251 * src/LaTeX.C (scanError): use string::size_type as loop variable
10254 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10255 (l.896) since y_tmp and row was not used anyway.
10257 * src/insets/insetref.C (escape): use string::size_type as loop
10260 * src/insets/insetquotes.C (Width): use string::size_type as loop
10262 (Draw): use string::size_type as loop variable type.
10264 * src/insets/insetlatexaccent.C (checkContents): use
10265 string::size_type as loop variable type.
10267 * src/insets/insetlabel.C (escape): use string::size_type as loop
10270 * src/insets/insetinfo.C: added an extern for current_view.
10272 * src/insets/insetcommand.C (scanCommand): use string::size_type
10273 as loop variable type.
10275 * most files: removed the RCS tags. With them we had to recompile
10276 a lot of files after a simple cvs commit. Also we have never used
10277 them for anything meaningful.
10279 * most files: tags-query-replace NULL 0. As adviced several plases
10280 we now use "0" instead of "NULL" in our code.
10282 * src/support/filetools.C (SpaceLess): use string::size_type as
10283 loop variable type.
10285 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10287 * src/paragraph.C: fixed up some more string stuff.
10289 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10291 * src/support/filetools.h: make modestr a std::string.
10293 * src/filetools.C (GetEnv): made ch really const.
10295 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10296 made code that used these use max/min from <algorithm> instead.
10298 * changed several c library include files to their equivalent c++
10299 library include files. All is not changed yet.
10301 * created a support subdir in src, put lyxstring and lstrings
10302 there + the extra files atexit, fileblock, strerror. Created
10303 Makefile.am. edited configure.in and src/Makefile.am to use this
10304 new subdir. More files moved to support.
10306 * imported som of the functions from repository lyx, filetools
10308 * ran tags-query-replace on LString -> string, corrected the bogus
10309 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10310 is still some errors in there. This is errors where too much or
10311 too litle get deleted from strings (string::erase, string::substr,
10312 string::replace), there can also be some off by one errors, or
10313 just plain wrong use of functions from lstrings. Viewing of quotes
10316 * LyX is now running fairly well with string, but there are
10317 certainly some bugs yet (see above) also string is quite different
10318 from LString among others in that it does not allow null pointers
10319 passed in and will abort if it gets any.
10321 * Added the revtex4 files I forgot when setting up the repository.
10323 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10325 * All over: Tried to clean everything up so that only the files
10326 that we really need are included in the cvs repository.
10327 * Switched to use automake.
10328 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10329 * Install has not been checked.
10331 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * po/pt.po: Three errors:
10334 l.533 and l.538 format specification error
10335 l. 402 duplicate entry, I just deleted it.