1 2000-09-27 Juergen Vigna <jug@sad.it>
3 * various files: remove "default" language check.
5 * src/insets/insetquotes.C: removed use of current_view.
7 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
8 the one should have red ears by now!
10 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
11 in more then one paragraph. Fixed cursor-movement/selection.
13 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
14 paragraphs inside a text inset.
16 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
17 text-inset if this owner is an inset.
19 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
21 * src/Bullet.h: changed type of font, character and size to int
23 * src/buffer.C (asciiParagraph): remove actcell and fname1.
25 * src/insets/inseturl.[Ch]:
26 * src/insets/insetref.[Ch]:
27 * src/insets/insetlabel.[Ch]: add linelen to Ascii
29 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
31 * src/buffer.C (readFile): block-if statement rearranged to minimise
32 bloat. Patch does not reverse Jean-Marc's change ;-)
34 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
35 Class rewritten to store pointers to hide/update signals directly,
36 rather than Dialogs *. Also defined an enum to ease use. All xforms
37 forms can now be derived from this class.
39 * src/frontends/xforms/FormCommand.[Ch]
40 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
42 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
45 * src/frontends/xforms/forms/form_citation.fd
46 * src/frontends/xforms/forms/form_copyright.fd
47 * src/frontends/xforms/forms/form_error.fd
48 * src/frontends/xforms/forms/form_index.fd
49 * src/frontends/xforms/forms/form_ref.fd
50 * src/frontends/xforms/forms/form_toc.fd
51 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
53 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
55 * src/insets/insetfoot.C: removed redundent using directive.
57 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
59 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
60 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
62 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
63 created in the constructors in different groups. Then set() just
64 have to show the groups as needed. This fixes the redraw problems
65 (and is how the old menu code worked).
67 * src/support/lyxlib.h: declare the methods as static when we do
70 2000-09-26 Juergen Vigna <jug@sad.it>
72 * src/buffer.C (asciiParagraph): new function.
73 (writeFileAscii): new function with parameter ostream.
74 (writeFileAscii): use now asciiParagraph.
76 * various inset files: added the linelen parameter to the Ascii-func.
78 * src/tabular.C (Write): fixed error in writing file introduced by
79 the last changes from Lars.
81 * lib/bind/menus.bind: removed not supported functions.
83 * src/insets/insettext.C (Ascii): implemented this function.
85 * src/insets/lyxinset.h (Ascii): added linelen parameter.
87 * src/tabular.C (write_attribute[int,string,bool]): new functions.
88 (Write): use of the write_attribute functions.
90 * src/bufferlist.C (close): fixed reasking question!
92 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
94 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
95 new files use the everwhere possible.
98 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
99 src/log_form.C src/lyx.C:
102 * src/buffer.C (runLaTeX): remove func
104 * src/PaperLayout.C: removed file
105 * src/ParagraphExtra.C: likewise
106 * src/bullet_forms.C: likewise
107 * src/bullet_forms.h: likewise
108 * src/bullet_forms_cb.C: likewise
110 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
111 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
114 * several files: remove all traces of the old fd_form_paragraph,
115 and functions belonging to that.
117 * several files: remove all traces of the old fd_form_document,
118 and functions belonging to that.
120 * several files: constify local variables were possible.
122 * several files: remove all code that was dead when NEW_EXPORT was
125 * several files: removed string::c_str in as many places as
128 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
129 (e): be a bit more outspoken when patching
130 (updatesrc): only move files if changed.
132 * forms/layout_forms.h.patch: regenerated
134 * forms/layout_forms.fd: remove form_document and form_paragraph
135 and form_quotes and form_paper and form_table_options and
138 * forms/form1.fd: remove form_table
140 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
141 the fdui->... rewrite. Update some comments to xforms 0.88
143 * forms/bullet_forms.C.patch: removed file
144 * forms/bullet_forms.fd: likewise
145 * forms/bullet_forms.h.patch: likewise
147 * development/Code_rules/Rules: added a section on switch
148 statements. Updated some comment to xforms 0.88.
150 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
152 * src/buffer.C (readFile): make sure that the whole version number
153 is read after \lyxformat (even when it contains a comma)
155 * lib/ui/default.ui: change shortcut of math menu to M-a.
157 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
159 * src/vspace.C (nextToken): use isStrDbl() to check for proper
162 * src/LyXView.C (updateWindowTitle): show the full files name in
163 window title, limited to 30 characters.
165 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
166 When a number of characters has been given, we should not assume
167 that the string is 0-terminated.
169 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
170 calls (fixes some memory leaks)
172 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
173 trans member on exit.
175 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
177 * src/converter.C (GetReachable): fix typo.
179 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
180 understand ',' instead of '.'.
181 (GetInteger): rewrite to use strToInt().
183 2000-09-26 Juergen Vigna <jug@sad.it>
185 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
186 better visibility and error-message on wrong VSpace input.
188 * src/language.C (initL): added english again.
190 2000-09-25 Juergen Vigna <jug@sad.it>
192 * src/frontends/kde/Dialogs.C (Dialogs):
193 * src/frontends/gnome/Dialogs.C (Dialogs):
194 * src/frontends/kde/Makefile.am:
195 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
197 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
199 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
201 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
203 * src/frontends/xforms/FormParagraph.C:
204 * src/frontends/xforms/FormParagraph.h:
205 * src/frontends/xforms/form_paragraph.C:
206 * src/frontends/xforms/form_paragraph.h:
207 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
210 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
212 * src/tabular.C (OldFormatRead): forgot to delete the temporary
213 Paragraph-Data after use.
215 * src/insets/insettext.C (LocalDispatch): don't set the layout on
216 non breakable paragraphs.
218 2000-09-25 Garst R. Reese <reese@isn.net>
220 * src/language.C (initL): added missing language_country codes.
222 2000-09-25 Juergen Vigna <jug@sad.it>
224 * src/insets/insettext.C (InsetText):
225 (deleteLyXText): remove the not released LyXText structure!
227 2000-09-24 Marko Vendelin <markov@ioc.ee>
229 * src/frontends/gnome/mainapp.C
230 * src/frontends/gnome/mainapp.h: added support for keyboard
233 * src/frontends/gnome/FormCitation.C
234 * src/frontends/gnome/FormCitation.h
235 * src/frontends/gnome/Makefile.am
236 * src/frontends/gnome/pixbutton.h: completed the rewrite of
237 FormCitation to use "action area" in mainapp window
239 * src/frontends/gnome/Menubar_pimpl.C
240 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
243 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
245 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
246 width/descent/ascent values if name is empty.
247 (mathed_string_height): Use std::max.
249 2000-09-25 Allan Rae <rae@lyx.org>
251 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
252 segfault. This will be completely redesigned soon.
254 * sigc++: updated libsigc++. Fixes struct timespec bug.
256 * development/tools/makeLyXsigc.sh: .cvsignore addition
258 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
260 * several files: removed almost all traces of the old table
263 * src/TableLayout.C: removed file
265 2000-09-22 Juergen Vigna <jug@sad.it>
267 * src/frontends/kde/Dialogs.C: added credits forms.
269 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
271 * src/frontends/gnome/Dialogs.C: added some forms.
273 * src/spellchecker.C (init_spell_checker): set language in pspell code
274 (RunSpellChecker): some modifications for setting language string.
276 * src/language.[Ch]: added language_country code.
278 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
280 * src/frontends/Dialogs.h: added new signal showError.
281 Rearranged existing signals in some sort of alphabetical order.
283 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
284 FormError.[Ch], form_error.[Ch]
285 * src/frontends/xforms/forms/makefile: added new file form_error.fd
286 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
288 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
289 dialogs. I think that this can be used as the base to all these
292 * src/frontends/xforms/FormError.[Ch]
293 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
294 implementation of InsetError dialog.
296 * src/insets/inseterror.[Ch]: rendered GUI-independent.
298 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
299 * src/frontends/kde/Makefile.am: ditto
301 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
303 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
304 macrobf. This fixes a bug of invisible text.
306 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
308 * lib/doc/LaTeXConfig.lyx.in: updated.
310 * src/language.C (initL): remove language "francais" and change a
311 bit the names of the two other french variations.
313 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
314 string that may not be 0-terminated.
316 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
318 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
320 2000-09-20 Marko Vendelin <markov@ioc.ee>
322 * src/frontends/gnome/FormCitation.C
323 * src/frontends/gnome/FormIndex.C
324 * src/frontends/gnome/FormToc.C
325 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
326 the variable initialization to shut up the warnings
328 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
330 * src/table.[Ch]: deleted files
332 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
335 2000-09-18 Juergen Vigna <jug@sad.it>
337 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
338 problems with selection. Inserted new LFUN_PASTESELECTION.
339 (InsetButtonPress): inserted handling of middle mouse-button paste.
341 * src/spellchecker.C: changed word to word.c_str().
343 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
345 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
346 included in the ``make dist'' tarball.
348 2000-09-15 Juergen Vigna <jug@sad.it>
350 * src/CutAndPaste.C (cutSelection): small fix return the right
351 end position after cut inside one paragraph only.
353 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
354 we are locked as otherwise we don't have a valid cursor position!
356 * src/insets/figinset.C (draw): small bugfix but why is this needed???
358 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
360 * src/frontends/kde/FormRef.C: added using directive.
361 * src/frontends/kde/FormToc.C: ditto
363 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
365 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
368 2000-09-19 Marko Vendelin <markov@ioc.ee>
370 * src/frontends/gnome/Menubar_pimpl.C
371 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
372 Toc, ViewFormats, UpdateFormats, and ExportFormats.
374 * src/frontends/gnome/mainapp.C
375 * src/frontends/gnome/mainapp.h: support for menu update used
378 * src/frontends/gnome/mainapp.C
379 * src/frontends/gnome/mainapp.h: support for "action" area in the
380 main window. This area is used by small simple dialogs, such as
383 * src/frontends/gnome/FormIndex.C
384 * src/frontends/gnome/FormIndex.h
385 * src/frontends/gnome/FormUrl.C
386 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
389 * src/frontends/gnome/FormCitation.C
390 * src/frontends/gnome/FormCitation.h: rewrite to use main window
391 action area. Only "Insert new citation" is implemented.
395 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
397 * src/buffer.C (Dispatch): fix call to Dispatch
398 * src/insets/insetref.C (Edit): likewise
399 * src/insets/insetparent.C (Edit): likewise
400 * src/insets/insetinclude.C (include_cb): likewise
401 * src/frontends/xforms/FormUrl.C (apply): likewise
402 * src/frontends/xforms/FormToc.C (apply): likewise
403 * src/frontends/xforms/FormRef.C (apply): likewise
404 * src/frontends/xforms/FormIndex.C (apply): likewise
405 * src/frontends/xforms/FormCitation.C (apply): likewise
406 * src/lyxserver.C (callback): likewise
407 * src/lyxfunc.C (processKeySym): likewise
410 * src/lyx_cb.C (LayoutsCB): likewise
412 * Makefile.am (sourcedoc): small change
414 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
416 * src/main.C (main): Don't make an empty GUIRunTime object. all
417 methods are static. constify a bit remove unneded using + headers.
419 * src/tabular.C: some more const to local vars move some loop vars
421 * src/spellchecker.C: added some c_str after some word for pspell
423 * src/frontends/GUIRunTime.h: add new static method setDefaults
424 * src/frontends/xforms/GUIRunTime.C (setDefaults):
425 * src/frontends/kde/GUIRunTime.C (setDefaults):
426 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
428 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
429 with strnew in arg, use correct emptystring when calling SetName.
431 * several files: remove all commented code with relation to
432 HAVE_SSTREAM beeing false. We now only support stringstream and
435 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
437 * src/lyxfunc.C: construct correctly the automatic new file
440 * src/text2.C (IsStringInText): change type of variable i to shut
443 * src/support/sstream.h: do not use namespaces if the compiler
444 does not support them.
446 2000-09-15 Marko Vendelin <markov@ioc.ee>
447 * src/frontends/gnome/FormCitation.C
448 * src/frontends/gnome/FormCitation.h
449 * src/frontends/gnome/diainsertcitation_interface.c
450 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
451 regexp support to FormCitation [Gnome].
453 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
456 * configure.in: remove unused KDE/GTKGUI define
458 * src/frontends/kde/FormRef.C
459 * src/frontends/kde/FormRef.h
460 * src/frontends/kde/formrefdialog.C
461 * src/frontends/kde/formrefdialog.h: double click will
462 go to reference, now it is possible to change a cross-ref
465 * src/frontends/kde/FormToc.C
466 * src/frontends/kde/FormToc.h
467 * src/frontends/kde/formtocdialog.C
468 * src/frontends/kde/formtocdialog.h: add a depth
471 * src/frontends/kde/Makefile.am: add QtLyXView.h
474 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
476 * src/frontends/kde/FormCitation.h: added some using directives.
478 * src/frontends/kde/FormToc.h: corrected definition of doTree.
480 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
483 * src/mathed/math_defs.h: redefine SetAlign to use string rather
486 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
488 * src/buffer.C (pop_tag): revert for the second time a change by
489 Lars, who seems to really hate having non-local loop variables :)
491 * src/Lsstream.h: add "using" statements.
493 * src/support/copy.C (copy): add a bunch of std:: qualifiers
494 * src/buffer.C (writeFile): ditto
496 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
498 * src/buffer.C (writeFile): try to fix the locale modified format
499 number to always be as we want it.
501 * src/WorkArea.C (work_area_handler): try to workaround the bugs
502 in XForms 0.89. C-space is now working again.
504 * src/Lsstream.h src/support/sstream.h: new files.
506 * also commented out all cases where strstream were used.
508 * src/Bullet.h (c_str): remove method.
510 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
512 * a lot of files: get rid of "char const *" and "char *" is as
513 many places as possible. We only want to use them in interaction
514 with system of other libraries, not inside lyx.
516 * a lot of files: return const object is not of pod type. This
517 helps ensure that temporary objects is not modified. And fits well
518 with "programming by contract".
520 * configure.in: check for the locale header too
522 * Makefile.am (sourcedoc): new tag for generation of doc++
525 2000-09-14 Juergen Vigna <jug@sad.it>
527 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
528 callback to check which combo called it and do the right action.
530 * src/combox.C (combo_cb): added combo * to the callbacks.
531 (Hide): moved call of callback after Ungrab of the pointer.
533 * src/intl.h: removed LCombo2 function.
535 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
536 function as this can now be handled in one function.
538 * src/combox.h: added Combox * to callback prototype.
540 * src/frontends/xforms/Toolbar_pimpl.C:
541 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
543 2000-09-14 Garst Reese <reese@isn.net>
545 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
546 moved usepackage{xxx}'s to beginning of file. Changed left margin
547 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
548 underlining from title. Thanks to John Culleton for useful suggestions.
550 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
552 * src/lyxlex_pimpl.C (setFile): change error message to debug
555 2000-09-13 Juergen Vigna <jug@sad.it>
557 * src/frontends/xforms/FormDocument.C: implemented choice_class
558 as combox and give callback to combo_language so OK/Apply is activated
561 * src/bufferlist.C (newFile): small fix so already named files
562 (via an open call) are not requested to be named again on the
565 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
567 * src/frontends/kde/Makefile.am
568 * src/frontends/kde/FormRef.C
569 * src/frontends/kde/FormRef.h
570 * src/frontends/kde/formrefdialog.C
571 * src/frontends/kde/formrefdialog.h: implement
574 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
576 * src/frontends/kde/formtocdialog.C
577 * src/frontends/kde/formtocdialog.h
578 * src/frontends/kde/FormToc.C
579 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
581 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
583 * src/frontends/kde/FormCitation.C: fix thinko
584 where we didn't always display the reference text
587 * src/frontends/kde/formurldialog.C
588 * src/frontends/kde/formurldialog.h
589 * src/frontends/kde/FormUrl.C
590 * src/frontends/kde/FormUrl.h: minor cleanups
592 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
594 * src/frontends/kde/Makefile.am
595 * src/frontends/kde/FormToc.C
596 * src/frontends/kde/FormToc.h
597 * src/frontends/kde/FormCitation.C
598 * src/frontends/kde/FormCitation.h
599 * src/frontends/kde/FormIndex.C
600 * src/frontends/kde/FormIndex.h
601 * src/frontends/kde/formtocdialog.C
602 * src/frontends/kde/formtocdialog.h
603 * src/frontends/kde/formcitationdialog.C
604 * src/frontends/kde/formcitationdialog.h
605 * src/frontends/kde/formindexdialog.C
606 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
608 2000-09-12 Juergen Vigna <jug@sad.it>
610 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
613 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
615 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
618 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
620 * src/converter.C (Add, Convert): Added support for converter flags:
621 needaux, resultdir, resultfile.
622 (Convert): Added new parameter view_file.
623 (dvips_options): Fixed letter paper option.
625 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
626 (Export, GetExportableFormats, GetViewableFormats): Added support
629 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
631 (easyParse): Fixed to work with new export code.
633 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
636 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
638 * lib/bind/*.bind: Replaced
639 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
640 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
642 2000-09-11 Juergen Vigna <jug@sad.it>
644 * src/lyx_gui.C (runTime): uses global guiruntime variable.
646 * src/main.C (main): now GUII defines global guiruntime!
648 * src/frontends/gnome/GUIRunTime.C (initApplication):
649 * src/frontends/kde/GUIRunTime.C (initApplication):
650 * src/frontends/xforms/GUIRunTime.C (initApplication):
651 * src/frontends/GUIRunTime.h: added new function initApplication.
653 * src/spellchecker.C (sc_accept_word): change to add_to_session.
655 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
657 2000-09-08 Juergen Vigna <jug@sad.it>
659 * src/lyx_gui.C (create_forms): don't display the "default" entry as
660 we have already "Reset".
662 * src/language.C (initL): inserted "default" language and made this
663 THE default language (and not american!)
665 * src/paragraph.C: inserted handling of "default" language!
667 * src/lyxfont.C: ditto
671 * src/paragraph.C: output the \\par only if we have a following
672 paragraph otherwise it's not needed.
674 2000-09-05 Juergen Vigna <jug@sad.it>
676 * config/pspell.m4: added entry to lyx-flags
678 * src/spellchecker.C: modified version from Kevin for using pspell
680 2000-09-01 Marko Vendelin <markov@ioc.ee>
681 * src/frontends/gnome/Makefile.am
682 * src/frontends/gnome/FormCitation.C
683 * src/frontends/gnome/FormCitation.h
684 * src/frontends/gnome/diainsertcitation_callbacks.c
685 * src/frontends/gnome/diainsertcitation_callbacks.h
686 * src/frontends/gnome/diainsertcitation_interface.c
687 * src/frontends/gnome/diainsertcitation_interface.h
688 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
689 dialog for Gnome frontend
691 * src/main.C: Gnome libraries require keeping application name
692 and its version as strings
694 * src/frontends/gnome/mainapp.C: Change the name of the main window
695 from GnomeLyX to PACKAGE
697 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
699 * src/frontends/Liason.C: add "using: declaration.
701 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
703 * src/mathed/math_macro.C (Metrics): Set the size of the template
705 * src/mathed/formulamacro.C (Latex): Fixed the returned value
707 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
709 * src/converter.C (add_options): New function.
710 (SetViewer): Change $$FName into '$$FName'.
711 (View): Add options when running xdvi
712 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
713 (Convert): The 3rd parameter is now the desired filename. Converts
714 calls to lyx::rename if necessary.
715 Add options when running dvips.
716 (dvi_papersize,dvips_options): New methods.
718 * src/exporter.C (Export): Use getLatexName() instead of fileName().
720 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
721 using a call to Converter::dvips_options.
722 Fixed to work with nex export code.
725 * src/support/rename.C: New files
727 * src/support/syscall.h
728 * src/support/syscall.C: Added Starttype SystemDontWait.
730 * lib/ui/default.ui: Changed to work with new export code
732 * lib/configure.m4: Changed to work with new export code
734 * src/encoding.C: Changed latex name for iso8859_7 encoding.
736 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
738 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
739 so that code compiles with DEC cxx.
741 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
742 to work correctly! Also now supports the additional elements
745 2000-09-01 Allan Rae <rae@lyx.org>
747 * src/frontends/ButtonPolicies.C: renamed all the references to
748 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
750 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
751 since it's a const not a type.
753 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
755 2000-08-31 Juergen Vigna <jug@sad.it>
757 * src/insets/figinset.C: Various changes to look if the filename has
758 an extension and if not add it for inline previewing.
760 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
762 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
763 make buttonStatus and isReadOnly be const methods. (also reflect
764 this in derived classes.)
766 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
767 (nextState): change to be static inline, pass the StateMachine as
769 (PreferencesPolicy): remove casts
770 (OkCancelPolicy): remvoe casts
771 (OkCancelReadOnlyPolicy): remove casts
772 (NoRepeatedApplyReadOnlyPolicy): remove casts
773 (OkApplyCancelReadOnlyPolicy): remove casts
774 (OkApplyCancelPolicy): remove casts
775 (NoRepeatedApplyPolicy): remove casts
777 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
779 * src/converter.C: added some using directives
781 * src/frontends/ButtonPolicies.C: changes to overcome
782 "need lvalue" error with DEC c++
784 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
785 to WMHideCB for DEC c++
787 * src/frontends/xforms/Menubar_pimpl.C: added using directive
789 * src/frontends/xforms/forms/form_document.C.patch: use C callback
790 to BulletBMTableCB for DEC c++
792 2000-08-31 Allan Rae <rae@lyx.org>
794 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
795 character dialog separately from old document dialogs combo_language.
798 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
800 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
801 Removed LFUN_REF_CREATE.
803 * src/MenuBackend.C: Added new tags: toc and references
805 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
806 (add_lastfiles, add_documents, add_formats): Removed the unused smn
808 (add_toc, add_references): New methods.
809 (create_submenu): Handle correctly the case when there is a
810 seperator after optional menu items.
812 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
813 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
814 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
816 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
818 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
820 * src/converter.[Ch]: New file for converting between different
823 * src/export.[Ch]: New file for exporting a LyX file to different
826 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
827 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
828 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
829 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
830 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
831 RunDocBook, MenuExport.
833 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
834 Exporter::Preview methods if NEW_EXPORT is defined.
836 * src/buffer.C (Dispatch): Use Exporter::Export.
838 * src/lyxrc.C: Added new tags: \converter and \viewer.
841 * src/LyXAction.C: Define new lyx-function: buffer-update.
842 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
843 when NEW_EXPORT is defined.
845 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
847 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
849 * lib/ui/default.ui: Added submenus "view" and "update" to the
852 * src/filetools.C (GetExtension): New function.
854 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
856 2000-08-29 Allan Rae <rae@lyx.org>
858 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
860 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
861 (EnableDocumentLayout): removed
862 (DisableDocumentLayout): removed
863 (build): make use of ButtonController's read-only handling to
864 de/activate various objects. Replaces both of the above functions.
866 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
867 (readOnly): was read_only
868 (refresh): fixed dumb mistakes with read_only_ handling
870 * src/frontends/xforms/forms/form_document.fd:
871 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
872 tabbed dialogs so the tabs look more like tabs and so its easier to
873 work out which is the current tab.
875 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
876 segfault with form_table
878 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
880 2000-08-28 Juergen Vigna <jug@sad.it>
882 * acconfig.h: added USE_PSPELL.
884 * src/config.h.in: added USE_PSPELL.
886 * autogen.sh: added pspell.m4
888 * config/pspell.m4: new file.
890 * src/spellchecker.C: implemented support for pspell libary.
892 2000-08-25 Juergen Vigna <jug@sad.it>
894 * src/LyXAction.C (init): renamed LFUN_TABLE to
895 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
897 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
899 * src/lyxscreen.h: add force_clear variable and fuction to force
900 a clear area when redrawing in LyXText.
902 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
904 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
906 * some whitespace and comment changes.
908 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
910 * src/buffer.C: up te LYX_FORMAT to 2.17
912 2000-08-23 Juergen Vigna <jug@sad.it>
914 * src/BufferView_pimpl.C (tripleClick): disable this when in a
917 * src/insets/insettabular.C (pasteSelection): delete the insets
918 LyXText as it is not valid anymore.
919 (copySelection): new function.
920 (pasteSelection): new function.
921 (cutSelection): new function.
922 (LocalDispatch): implemented cut/copy/paste of cell selections.
924 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
925 don't have a LyXText.
927 * src/LyXAction.C (init): a NEW_TABULAR define too much.
929 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
932 2000-08-22 Juergen Vigna <jug@sad.it>
934 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
935 ifdef form_table out if NEW_TABULAR.
937 2000-08-21 Juergen Vigna <jug@sad.it>
939 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
940 (draw): fixed draw position so that the cursor is positioned in the
942 (InsetMotionNotify): hide/show cursor so the position is updated.
943 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
944 using cellstart() function where it should be used.
946 * src/insets/insettext.C (draw): ditto.
948 * src/tabular.C: fixed initialization of some missing variables and
949 made BoxType into an enum.
951 2000-08-22 Marko Vendelin <markov@ioc.ee>
952 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
953 stock menu item using action numerical value, not its string
957 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
959 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
960 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
962 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
964 * src/frontends/xforms/GUIRunTime.C: new file
966 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
967 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
969 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
971 * src/frontends/kde/GUIRunTime.C: new file
973 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
974 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
976 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
978 * src/frontends/gnome/GUIRunTime.C: new file
980 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
983 * src/frontends/GUIRunTime.h: removed constructor and destructor,
984 small change to documetentation.
986 * src/frontends/GUIRunTime.C: removed file
988 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
990 * src/lyxparagraph.h: enable NEW_TABULAR as default
992 * src/lyxfunc.C (processKeySym): remove some commented code
994 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
995 NEW_TABULAR around the fd_form_table_options.
997 * src/lyx_gui.C (runTime): call the static member function as
998 GUIRunTime::runTime().
1000 2000-08-21 Allan Rae <rae@lyx.org>
1002 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1005 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1007 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1009 2000-08-21 Allan Rae <rae@lyx.org>
1011 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1012 keep Garst happy ;-)
1013 * src/frontends/xforms/FormPreferences.C (build): use setOK
1014 * src/frontends/xforms/FormDocument.C (build): use setOK
1015 (FormDocument): use the appropriate policy.
1017 2000-08-21 Allan Rae <rae@lyx.org>
1019 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1020 automatic [de]activation of arbitrary objects when in a read-only state.
1022 * src/frontends/ButtonPolicies.h: More documentation
1023 (isReadOnly): added to support the above.
1025 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1027 2000-08-18 Juergen Vigna <jug@sad.it>
1029 * src/insets/insettabular.C (getStatus): changed to return func_status.
1031 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1032 display toggle menu entries if they are.
1034 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1035 new document layout now.
1037 * src/lyxfunc.C: ditto
1039 * src/lyx_gui_misc.C: ditto
1041 * src/lyx_gui.C: ditto
1043 * lib/ui/default.ui: removed paper and quotes layout as they are now
1044 all in the document layout tabbed folder.
1046 * src/frontends/xforms/forms/form_document.fd: added Restore
1047 button and callbacks for all inputs for Allan's ButtonPolicy.
1049 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1050 (CheckChoiceClass): added missing params setting on class change.
1051 (UpdateLayoutDocument): added for updating the layout on params.
1052 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1053 (FormDocument): Implemented Allan's ButtonPolicy with the
1056 2000-08-17 Allan Rae <rae@lyx.org>
1058 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1059 so we can at least see the credits again.
1061 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1062 controller calls for the appropriate callbacks. Note that since Ok
1063 calls apply followed by cancel, and apply isn't a valid input for the
1064 APPLIED state, the bc_ calls have to be made in the static callback not
1065 within each of the real callbacks.
1067 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1068 (setOk): renamed from setOkay()
1070 2000-08-17 Juergen Vigna <jug@sad.it>
1072 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1073 in the implementation part.
1074 (composeUIInfo): don't show optional menu-items.
1076 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1078 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1080 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1081 text-state when in a text-inset.
1083 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1085 2000-08-17 Marko Vendelin <markov@ioc.ee>
1086 * src/frontends/gnome/FormIndex.C
1087 * src/frontends/gnome/FormIndex.h
1088 * src/frontends/gnome/FormToc.C
1089 * src/frontends/gnome/FormToc.h
1090 * src/frontends/gnome/dialogs
1091 * src/frontends/gnome/diatoc_callbacks.c
1092 * src/frontends/gnome/diatoc_callbacks.h
1093 * src/frontends/gnome/diainsertindex_callbacks.h
1094 * src/frontends/gnome/diainsertindex_callbacks.c
1095 * src/frontends/gnome/diainsertindex_interface.c
1096 * src/frontends/gnome/diainsertindex_interface.h
1097 * src/frontends/gnome/diatoc_interface.h
1098 * src/frontends/gnome/diatoc_interface.c
1099 * src/frontends/gnome/Makefile.am: Table of Contents and
1100 Insert Index dialogs implementation for Gnome frontend
1102 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1104 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1106 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1109 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1111 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1112 destructor. Don't definde if you don't need it
1113 (processEvents): made static, non-blocking events processing for
1115 (runTime): static method. event loop for xforms
1116 * similar as above for kde and gnome.
1118 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1119 new Pimpl is correct
1120 (runTime): new method calss the real frontends runtime func.
1122 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1124 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1126 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1128 2000-08-16 Juergen Vigna <jug@sad.it>
1130 * src/lyx_gui.C (runTime): added GUII RunTime support.
1132 * src/frontends/Makefile.am:
1133 * src/frontends/GUIRunTime.[Ch]:
1134 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1135 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1136 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1138 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1140 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1141 as this is already set in ${FRONTEND_INCLUDE} if needed.
1143 * configure.in (CPPFLAGS): setting the include dir for the frontend
1144 directory and don't set FRONTEND=xforms for now as this is executed
1147 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1149 * src/frontends/kde/Makefile.am:
1150 * src/frontends/kde/FormUrl.C:
1151 * src/frontends/kde/FormUrl.h:
1152 * src/frontends/kde/formurldialog.h:
1153 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1155 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1157 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1159 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1161 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1164 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * src/WorkArea.C (work_area_handler): more work to get te
1167 FL_KEYBOARD to work with xforms 0.88 too, please test.
1169 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1171 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1173 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1176 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1178 * src/Timeout.h: remove Qt::emit hack.
1180 * several files: changes to allo doc++ compilation
1182 * src/lyxfunc.C (processKeySym): new method
1183 (processKeyEvent): comment out if FL_REVISION < 89
1185 * src/WorkArea.C: change some debugging levels.
1186 (WorkArea): set wantkey to FL_KEY_ALL
1187 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1188 clearer code and the use of compose with XForms 0.89. Change to
1189 use signals instead of calling methods in bufferview directly.
1191 * src/Painter.C: change some debugging levels.
1193 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1196 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1197 (workAreaKeyPress): new method
1199 2000-08-14 Juergen Vigna <jug@sad.it>
1201 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1203 * config/kde.m4: addes some features
1205 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1206 include missing xforms dialogs.
1208 * src/Timeout.h: a hack to be able to compile with qt/kde.
1210 * sigc++/.cvsignore: added acinclude.m4
1212 * lib/.cvsignore: added listerros
1214 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1215 xforms tree as objects are needed for other frontends.
1217 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1218 linking with not yet implemented xforms objects.
1220 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1222 2000-08-14 Baruch Even <baruch.even@writeme.com>
1224 * src/frontends/xforms/FormGraphics.h:
1225 * src/frontends/xforms/FormGraphics.C:
1226 * src/frontends/xforms/RadioButtonGroup.h:
1227 * src/frontends/xforms/RadioButtonGroup.C:
1228 * src/insets/insetgraphics.h:
1229 * src/insets/insetgraphics.C:
1230 * src/insets/insetgraphicsParams.h:
1231 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1232 instead of spaces, and various other indentation issues to make the
1233 sources more consistent.
1235 2000-08-14 Marko Vendelin <markov@ioc.ee>
1237 * src/frontends/gnome/dialogs/diaprint.glade
1238 * src/frontends/gnome/FormPrint.C
1239 * src/frontends/gnome/FormPrint.h
1240 * src/frontends/gnome/diaprint_callbacks.c
1241 * src/frontends/gnome/diaprint_callbacks.h
1242 * src/frontends/gnome/diaprint_interface.c
1243 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1246 * src/frontends/gnome/dialogs/diainserturl.glade
1247 * src/frontends/gnome/FormUrl.C
1248 * src/frontends/gnome/FormUrl.h
1249 * src/frontends/gnome/diainserturl_callbacks.c
1250 * src/frontends/gnome/diainserturl_callbacks.h
1251 * src/frontends/gnome/diainserturl_interface.c
1252 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1253 Gnome implementation
1255 * src/frontends/gnome/Dialogs.C
1256 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1257 all other dialogs. Copy all unimplemented dialogs from Xforms
1260 * src/frontends/gnome/support.c
1261 * src/frontends/gnome/support.h: support files generated by Glade
1265 * config/gnome.m4: Gnome configuration scripts
1267 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1268 configure --help message
1270 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1271 only if there are no events pendling in Gnome/Gtk. This enhances
1272 the performance of menus.
1275 2000-08-14 Allan Rae <rae@lyx.org>
1277 * lib/Makefile.am: listerrors cleaning
1279 * lib/listerrors: removed -- generated file
1280 * acinclude.m4: ditto
1281 * sigc++/acinclude.m4: ditto
1283 * src/frontends/xforms/forms/form_citation.fd:
1284 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1287 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1288 `updatesrc` and now we have a `test` target that does what `updatesrc`
1289 used to do. I didn't like having an install target that wasn't related
1292 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1293 on all except FormGraphics. This may yet happen. Followed by a major
1294 cleanup including using FL_TRANSIENT for most of the dialogs. More
1295 changes to come when the ButtonController below is introduced.
1297 * src/frontends/xforms/ButtonController.h: New file for managing up to
1298 four buttons on a dialog according to an externally defined policy.
1299 * src/frontends/xforms/Makefile.am: added above
1301 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1302 Apply and Cancel/Close buttons and everything in between and beyond.
1303 * src/frontends/Makefile.am: added above.
1305 * src/frontends/xforms/forms/form_preferences.fd:
1306 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1307 and removed variable 'status' as a result. Fixed the set_minsize thing.
1308 Use the new screen-font-update after checking screen fonts were changed
1309 Added a "Restore" button to restore the original lyxrc values while
1310 editing. This restores everything not just the last input changed.
1311 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1313 * src/LyXAction.C: screen-font-update added for updating buffers after
1314 screen font settings have been changed.
1315 * src/commandtags.h: ditto
1316 * src/lyxfunc.C: ditto
1318 * forms/lyx.fd: removed screen fonts dialog.
1319 * src/lyx_gui.C: ditto
1320 * src/menus.[Ch]: ditto
1321 * src/lyx.[Ch]: ditto
1322 * src/lyx_cb.C: ditto + code from here moved to make
1323 screen-font-update. And people wonder why progress on GUII is
1324 slow. Look at how scattered this stuff was! It takes forever
1327 * forms/fdfix.sh: Fixup the spacing after commas.
1328 * forms/makefile: Remove date from generated files. Fewer clashes now.
1329 * forms/bullet_forms.C.patch: included someones handwritten changes
1331 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1332 once I've discovered why LyXRC was made noncopyable.
1333 * src/lyx_main.C: ditto
1335 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1337 * src/frontends/xforms/forms/fdfix.sh:
1338 * src/frontends/xforms/forms/fdfixh.sed:
1339 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1340 * src/frontends/xforms/Form*.[hC]:
1341 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1342 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1343 provide a destructor for the struct FD_form_xxxx. Another version of
1344 the set_[max|min]size workaround and a few other cleanups. Actually,
1345 Angus' patch from 20000809.
1347 2000-08-13 Baruch Even <baruch.even@writeme.com>
1349 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1352 2000-08-11 Juergen Vigna <jug@sad.it>
1354 * src/insets/insetgraphics.C (InsetGraphics): changing init
1355 order because of warnings.
1357 * src/frontends/xforms/forms/makefile: adding patching .C with
1360 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1361 from .C.patch to .c.patch
1363 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1364 order because of warning.
1366 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1368 * src/frontends/Liason.C (setMinibuffer): new helper function
1370 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1372 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1374 * lib/ui/default.ui: commented out PaperLayout entry
1376 * src/frontends/xforms/form_document.[Ch]: new added files
1378 * src/frontends/xforms/FormDocument.[Ch]: ditto
1380 * src/frontends/xforms/forms/form_document.fd: ditto
1382 * src/frontends/xforms/forms/form_document.C.patch: ditto
1384 2000-08-10 Juergen Vigna <jug@sad.it>
1386 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1387 (InsetGraphics): initialized cacheHandle to 0.
1388 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1390 2000-08-10 Baruch Even <baruch.even@writeme.com>
1392 * src/graphics/GraphicsCache.h:
1393 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1394 correctly as a cache.
1396 * src/graphics/GraphicsCacheItem.h:
1397 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1400 * src/graphics/GraphicsCacheItem_pimpl.h:
1401 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1404 * src/insets/insetgraphics.h:
1405 * src/insets/insetgraphics.C: Changed from using a signal notification
1406 to polling when image is not loaded.
1408 2000-08-10 Allan Rae <rae@lyx.org>
1410 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1411 that there are two functions that have to been taken out of line by
1412 hand and aren't taken care of in the script. (Just a reminder note)
1414 * sigc++/macros/*.h.m4: Updated as above.
1416 2000-08-09 Juergen Vigna <jug@sad.it>
1418 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1420 * src/insets/insettabular.C: make drawing of single cell smarter.
1422 2000-08-09 Marko Vendelin <markov@ioc.ee>
1423 * src/frontends/gnome/Menubar_pimpl.C
1424 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1425 implementation: new files
1427 * src/frontends/gnome/mainapp.C
1428 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1431 * src/main.C: create Gnome main window
1433 * src/frontends/xforms/Menubar_pimpl.h
1434 * src/frontends/Menubar.C
1435 * src/frontends/Menubar.h: added method Menubar::update that calls
1436 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1438 * src/LyXView.C: calls Menubar::update to update the state
1441 * src/frontends/gnome/Makefile.am: added new files
1443 * src/frontends/Makefile.am: added frontend compiler options
1445 2000-08-08 Juergen Vigna <jug@sad.it>
1447 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1449 * src/bufferlist.C (close):
1450 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1451 documents if exiting without saving.
1453 * src/buffer.C (save): use removeAutosaveFile()
1455 * src/support/filetools.C (removeAutosaveFile): new function.
1457 * src/lyx_cb.C (MenuWrite): returns a bool now.
1458 (MenuWriteAs): check if file could really be saved and revert to the
1460 (MenuWriteAs): removing old autosavefile if existant.
1462 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1463 before Goto toggle declaration, because of compiler warning.
1465 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1467 * src/lyxfunc.C (MenuNew): small fix.
1469 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1471 * src/bufferlist.C (newFile):
1472 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1474 * src/lyxrc.C: added new_ask_filename tag
1476 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1478 * src/lyx.fd: removed code pertaining to form_ref
1479 * src/lyx.[Ch]: ditto
1480 * src/lyx_cb.C: ditto
1481 * src/lyx_gui.C: ditto
1482 * src/lyx_gui_misc.C: ditto
1484 * src/BufferView_pimpl.C (restorePosition): update buffer only
1487 * src/commandtags.h (LFUN_REFTOGGLE): removed
1488 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1489 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1490 (LFUN_REFBACK): renamed LFUN_REF_BACK
1492 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1493 * src/menus.C: ditto
1494 * src/lyxfunc.C (Dispatch): ditto.
1495 InsertRef dialog is now GUI-independent.
1497 * src/texrow.C: added using std::endl;
1499 * src/insets/insetref.[Ch]: strip out large amounts of code.
1500 The inset is now a container and this functionality is now
1501 managed by a new FormRef dialog
1503 * src/frontends/Dialogs.h (showRef, createRef): new signals
1505 * src/frontends/xforms/FormIndex.[Ch],
1506 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1507 when setting dialog's min/max size
1508 * src/frontends/xforms/FormIndex.[Ch]: ditto
1510 * src/frontends/xforms/FormRef.[Ch],
1511 src/frontends/xforms/forms/form_ref.fd: new xforms
1512 implementation of an InsetRef dialog
1514 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1517 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1518 ios::nocreate is not part of the standard. Removed.
1520 2000-08-07 Baruch Even <baruch.even@writeme.com>
1522 * src/graphics/Renderer.h:
1523 * src/graphics/Renderer.C: Added base class for rendering of different
1524 image formats into Pixmaps.
1526 * src/graphics/XPM_Renderer.h:
1527 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1528 in a different class.
1530 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1531 easily add support for other formats.
1533 * src/insets/figinset.C: plugged a leak of an X resource.
1535 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1537 * src/CutAndPaste.[Ch]: make all metods static.
1539 * development/Code_rules/Rules: more work, added section on
1540 Exceptions, and a References section.
1542 * a lot of header files: work to make doc++ able to generate the
1543 source documentation, some workarounds of doc++ problems. Doc++ is
1544 now able to generate the documentation.
1546 2000-08-07 Juergen Vigna <jug@sad.it>
1548 * src/insets/insettabular.C (recomputeTextInsets): removed function
1550 * src/tabular.C (SetWidthOfMulticolCell):
1552 (calculate_width_of_column_NMC): fixed return value so that it really
1553 only returns true if the column-width has changed (there where
1554 problems with muliticolumn-cells in this column).
1556 2000-08-04 Juergen Vigna <jug@sad.it>
1558 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1559 also on the scrollstatus of the inset.
1560 (workAreaMotionNotify): ditto.
1562 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1564 2000-08-01 Juergen Vigna <jug@sad.it>
1566 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1568 * src/commandtags.h:
1569 * src/LyXAction.C (init):
1570 * src/insets/inset.C (LocalDispatch): added support for
1573 * src/insets/inset.C (scroll): new functions.
1575 * src/insets/insettext.C (removeNewlines): new function.
1576 (SetAutoBreakRows): removes forced newlines in the text of the
1577 paragraph if autoBreakRows is set to false.
1579 * src/tabular.C (Latex): generates a parbox around the cell contents
1582 * src/frontends/xforms/FormTabular.C (local_update): removed
1583 the radio_useparbox button.
1585 * src/tabular.C (UseParbox): new function
1587 2000-08-06 Baruch Even <baruch.even@writeme.com>
1589 * src/graphics/GraphicsCache.h:
1590 * src/graphics/GraphicsCache.C:
1591 * src/graphics/GraphicsCacheItem.h:
1592 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1595 * src/insets/insetgraphics.h:
1596 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1597 drawing of the inline image.
1599 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1600 into the wrong position.
1602 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1605 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1607 * src/support/translator.h: move all typedefs to public section
1609 * src/support/filetools.C (MakeLatexName): return string const
1611 (TmpFileName): ditto
1612 (FileOpenSearch): ditto
1614 (LibFileSearch): ditto
1615 (i18nLibFileSearch): ditto
1618 (CreateTmpDir): ditto
1619 (CreateBufferTmpDir): ditto
1620 (CreateLyXTmpDir): ditto
1623 (MakeAbsPath): ditto
1625 (OnlyFilename): ditto
1627 (NormalizePath): ditto
1628 (CleanupPath): ditto
1629 (GetFileContents): ditto
1630 (ReplaceEnvironmentPath): ditto
1631 (MakeRelPath): ditto
1633 (ChangeExtension): ditto
1634 (MakeDisplayPath): ditto
1635 (do_popen): return cmdret const
1636 (findtexfile): return string const
1638 * src/support/DebugStream.h: add some /// to please doc++
1640 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1642 * src/texrow.C (same_rownumber): functor to use with find_if
1643 (getIdFromRow): rewritten to use find_if and to not update the
1644 positions. return true if row is found
1645 (increasePos): new method, use to update positions
1647 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1649 * src/lyxlex_pimpl.C (verifyTable): new method
1652 (GetString): return string const
1653 (pushTable): rewrite to use std::stack
1655 (setFile): better check
1658 * src/lyxlex.h: make LyXLex noncopyable
1660 * src/lyxlex.C (text): return char const * const
1661 (GetString): return string const
1662 (getLongString): return string const
1664 * src/lyx_gui_misc.C (askForText): return pair<...> const
1666 * src/lastfiles.[Ch] (operator): return string const
1668 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1669 istringstream not char const *.
1670 move token.end() out of loop.
1671 (readFile): move initializaton of token
1673 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1674 getIdFromRow is successful.
1676 * lib/bind/emacs.bind: don't include menus bind
1678 * development/Code_rules/Rules: the beginnings of making this
1679 better and covering more of the unwritten rules that we have.
1681 * development/Code_rules/Recommendations: a couple of wording
1684 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1686 * src/support/strerror.c: remove C++ comment.
1688 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1690 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1691 LFUN_INDEX_INSERT_LAST
1693 * src/texrow.C (getIdFromRow): changed from const_iterator to
1694 iterator, allowing code to compile with DEC cxx
1696 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1697 stores part of the class, as suggested by Allan. Will allow
1699 (apply): test to apply uses InsetCommandParams operator!=
1701 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1702 (apply): test to apply uses InsetCommandParams operator!=
1704 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1705 stores part of the class.
1706 (update): removed limits on min/max size.
1708 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1709 (apply): test to apply uses InsetCommandParams operator!=
1711 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1712 (Read, Write, scanCommand, getCommand): moved functionality
1713 into InsetCommandParams.
1715 (getScreenLabel): made pure virtual
1716 new InsetCommandParams operators== and !=
1718 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1719 c-tors based on InsetCommandParams. Removed others.
1720 * src/insets/insetinclude.[Ch]: ditto
1721 * src/insets/insetlabel.[Ch]: ditto
1722 * src/insets/insetparent.[Ch]: ditto
1723 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1725 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1726 insets derived from InsetCommand created using similar c-tors
1727 based on InsetCommandParams
1728 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1729 * src/menus.C (ShowRefsMenu): ditto
1730 * src/paragraph.C (Clone): ditto
1731 * src/text2.C (SetCounter): ditto
1732 * src/lyxfunc.C (Dispatch) ditto
1733 Also recreated old InsetIndex behaviour exactly. Can now
1734 index-insert at the start of a paragraph and index-insert-last
1735 without launching the pop-up.
1737 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1739 * lib/lyxrc.example: mark te pdf options as non functional.
1741 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1742 (isStrDbl): move tmpstr.end() out of loop.
1743 (strToDbl): move intialization of tmpstr
1744 (lowercase): return string const and move tmp.end() out of loop.
1745 (uppercase): return string const and move tmp.edn() out of loop.
1746 (prefixIs): add assertion
1751 (containsOnly): ditto
1752 (containsOnly): ditto
1753 (containsOnly): ditto
1754 (countChar): make last arg char not char const
1755 (token): return string const
1756 (subst): return string const, move tmp.end() out of loop.
1757 (subst): return string const, add assertion
1758 (strip): return string const
1759 (frontStrip): return string const, add assertion
1760 (frontStrip): return string const
1765 * src/support/lstrings.C: add inclde "LAssert.h"
1766 (isStrInt): move tmpstr.end() out of loop.
1768 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1769 toollist.end() out of loop.
1770 (deactivate): move toollist.end() out of loop.
1771 (update): move toollist.end() out of loop.
1772 (updateLayoutList): move tc.end() out of loop.
1773 (add): move toollist.end() out of loop.
1775 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1776 md.end() out of loop.
1778 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1780 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1783 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1784 (Erase): move insetlist.end() out of loop.
1786 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1787 ref to const string as first arg. Move initialization of some
1788 variables, whitespace changes.
1790 * src/kbmap.C (defkey): move table.end() out of loop.
1791 (kb_keymap): move table.end() out of loop.
1792 (findbinding): move table.end() out of loop.
1794 * src/MenuBackend.C (hasMenu): move end() out of loop.
1795 (getMenu): move end() out of loop.
1796 (getMenu): move menulist_.end() out of loop.
1798 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1800 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1803 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1804 (getFromLyXName): move infotab.end() out of loop.
1806 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1807 -fvtable-thunks -ffunction-sections -fdata-sections
1809 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1811 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1814 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1816 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1818 * src/frontends/xforms/FormCitation.[Ch],
1819 src/frontends/xforms/FormIndex.[Ch],
1820 src/frontends/xforms/FormToc.[Ch],
1821 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1823 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1825 * src/commandtags.h: renamed, created some flags for citation
1828 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1830 * src/lyxfunc.C (dispatch): use signals to insert index entry
1832 * src/frontends/Dialogs.h: new signal createIndex
1834 * src/frontends/xforms/FormCommand.[Ch],
1835 src/frontends/xforms/FormCitation.[Ch],
1836 src/frontends/xforms/FormToc.[Ch],
1837 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1839 * src/insets/insetindex.[Ch]: GUI-independent
1841 * src/frontends/xforms/FormIndex.[Ch],
1842 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1845 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1847 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1848 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1850 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1852 * src/insets/insetref.C (Latex): rewrite so that there is now
1853 question that a initialization is requested.
1855 * src/insets/insetcommand.h: reenable the hide signal
1857 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1859 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1860 fix handling of shortcuts (many bugs :)
1861 (add_lastfiles): ditto.
1863 * lib/ui/default.ui: fix a few shortcuts.
1865 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1867 * Makefile.am: Fix ``rpmdist'' target to return the exit
1868 status of the ``rpm'' command, instead of the last command in
1869 the chain (the ``rm lyx.xpm'' command, which always returns
1872 2000-08-02 Allan Rae <rae@lyx.org>
1874 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1875 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1876 * src/frontends/xforms/FormToc.C (FormToc): ditto
1878 * src/frontends/xforms/Makefile.am: A few forgotten files
1880 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1881 Signals-not-copyable-problem Lars' started commenting out.
1883 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1885 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1887 * src/insets/insetcommand.h: Signals is not copyable so anoter
1888 scheme for automatic hiding of forms must be used.
1890 * src/frontends/xforms/FormCitation.h: don't inerit from
1891 noncopyable, FormCommand already does that.
1892 * src/frontends/xforms/FormToc.h: ditto
1893 * src/frontends/xforms/FormUrl.h: ditto
1895 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1897 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1899 * src/insets/insetcommand.h (hide): new SigC::Signal0
1900 (d-tor) new virtual destructor emits hide signal
1902 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1903 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1905 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1906 LOF and LOT. Inset is now GUI-independent
1908 * src/insets/insetloa.[Ch]: redundant
1909 * src/insets/insetlof.[Ch]: ditto
1910 * src/insets/insetlot.[Ch]: ditto
1912 * src/frontends/xforms/forms/form_url.fd: tweaked!
1913 * src/frontends/xforms/forms/form_citation.fd: ditto
1915 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1916 dialogs dealing with InsetCommand insets
1918 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1919 FormCommand base class
1920 * src/frontends/xforms/FormUrl.[Ch]: ditto
1922 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1924 * src/frontends/xforms/FormToc.[Ch]: ditto
1926 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1927 passed a generic InsetCommand pointer
1928 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1930 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1931 and modified InsetTOC class
1932 * src/buffer.C: ditto
1934 * forms/lyx.fd: strip out old FD_form_toc code
1935 * src/lyx_gui_misc.C: ditto
1936 * src/lyx_gui.C: ditto
1937 * src/lyx_cb.C: ditto
1938 * src/lyx.[Ch]: ditto
1940 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1942 * src/support/utility.hpp: tr -d '\r'
1944 2000-08-01 Juergen Vigna <jug@sad.it>
1946 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1948 * src/commandtags.h:
1949 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1950 LFUN_TABULAR_FEATURES.
1952 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1953 LFUN_LAYOUT_TABULAR.
1955 * src/insets/insettabular.C (getStatus): implemented helper function.
1957 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1959 2000-07-31 Juergen Vigna <jug@sad.it>
1961 * src/text.C (draw): fixed screen update problem for text-insets.
1963 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1964 something changed probably this has to be added in various other
1967 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1969 2000-07-31 Baruch Even <baruch.even@writeme.com>
1971 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1972 templates to satisfy compaq cxx.
1975 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1977 * src/support/translator.h (equal_1st_in_pair::operator()): take
1978 const ref pair_type as arg.
1979 (equal_2nd_in_pair::operator()): ditto
1980 (Translator::~Translator): remove empty d-tor.
1982 * src/graphics/GraphicsCache.C: move include config.h to top, also
1983 put initialization of GraphicsCache::singleton here.
1984 (~GraphicsCache): move here
1985 (addFile): take const ref as arg
1988 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1990 * src/BufferView2.C (insertLyXFile): change te with/without header
1993 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1995 * src/frontends/xforms/FormGraphics.C (apply): add some
1996 static_cast. Not very nice, but required by compaq cxx.
1998 * src/frontends/xforms/RadioButtonGroup.h: include header
1999 <utility> instead of <pair.h>
2001 * src/insets/insetgraphicsParams.C: add using directive.
2002 (readResize): change return type to void.
2003 (readOrigin): ditto.
2005 * src/lyxfunc.C (getStatus): add missing break for build-program
2006 function; add test for Literate for export functions.
2008 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2009 entries in Options menu.
2011 2000-07-31 Baruch Even <baruch.even@writeme.com>
2013 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2014 protect against auto-allocation; release icon when needed.
2016 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2018 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2019 on usual typewriter.
2021 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2022 earlier czech.kmap), useful only for programming.
2024 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2026 * src/frontends/xforms/FormCitation.h: fix conditioning around
2029 2000-07-31 Juergen Vigna <jug@sad.it>
2031 * src/frontends/xforms/FormTabular.C (local_update): changed
2032 radio_linebreaks to radio_useparbox and added radio_useminipage.
2034 * src/tabular.C: made support for using minipages/parboxes.
2036 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2038 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2040 (descent): so the cursor is in the middle.
2041 (width): bit smaller box.
2043 * src/insets/insetgraphics.h: added display() function.
2045 2000-07-31 Baruch Even <baruch.even@writeme.com>
2047 * src/frontends/Dialogs.h: Added showGraphics signals.
2049 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2050 xforms form definition of the graphics dialog.
2052 * src/frontends/xforms/FormGraphics.h:
2053 * src/frontends/xforms/FormGraphics.C: Added files, the
2054 GUIndependent code of InsetGraphics
2056 * src/insets/insetgraphics.h:
2057 * src/insets/insetgraphics.C: Major writing to make it work.
2059 * src/insets/insetgraphicsParams.h:
2060 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2061 struct between InsetGraphics and GUI.
2063 * src/LaTeXFeatures.h:
2064 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2065 support for graphicx package.
2067 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2068 for the graphics inset.
2070 * src/support/translator.h: Added file, used in
2071 InsetGraphicsParams. this is a template to translate between two
2074 * src/frontends/xforms/RadioButtonGroup.h:
2075 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2076 way to easily control a radio button group.
2078 2000-07-28 Juergen Vigna <jug@sad.it>
2080 * src/insets/insettabular.C (LocalDispatch):
2081 (TabularFeatures): added support for lyx-functions of tabular features.
2082 (cellstart): refixed this function after someone wrongly changed it.
2084 * src/commandtags.h:
2085 * src/LyXAction.C (init): added support for tabular-features
2087 2000-07-28 Allan Rae <rae@lyx.org>
2089 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2090 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2091 triggers the callback for input checking. As a result we sometimes get
2092 "LyX: This shouldn't happen..." printed to cerr.
2093 (input): Started using status variable since I only free() on
2094 destruction. Some input checking for paths and font sizes.
2096 * src/frontends/xforms/FormPreferences.h: Use status to control
2097 activation of Ok and Apply
2099 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2100 callback. Also resized to stop segfaults with 0.88. The problem is
2101 that xforms-0.88 requires the folder to be wide enough to fit all the
2102 tabs. If it isn't it causes all sorts of problems.
2104 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2106 * src/frontends/xforms/forms/README: Reflect reality.
2108 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2109 * src/frontends/xforms/forms/makefile: ditto.
2111 * src/commandtags.h: Get access to new Preferences dialog
2112 * src/LyXAction.C: ditto
2113 * src/lyxfunc.C: ditto
2114 * lib/ui/default.ui: ditto
2116 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2118 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2120 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2123 * src/frontends/xforms/form_url.[Ch]: added.
2125 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2127 * src/insets/insetbib.h: fixed bug in previous commit
2129 * src/frontends/xforms/FormUrl.h: ditto
2131 * src/frontends/xforms/FormPrint.h: ditto
2133 * src/frontends/xforms/FormPreferences.h: ditto
2135 * src/frontends/xforms/FormCopyright.h: ditto
2137 * src/frontends/xforms/FormCitation.C: ditto
2139 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2140 private copyconstructor and private default contructor
2142 * src/support/Makefile.am: add utility.hpp
2144 * src/support/utility.hpp: new file from boost
2146 * src/insets/insetbib.h: set owner in clone
2148 * src/frontends/xforms/FormCitation.C: added missing include
2151 * src/insets/form_url.[Ch]: removed
2153 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2155 * development/lyx.spec.in
2156 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2157 file/directory re-organization.
2159 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2161 * src/insets/insetcommand.[Ch]: moved the string data and
2162 associated manipulation methods into a new stand-alone class
2163 InsetCommandParams. This class has two additional methods
2164 getAsString() and setFromString() allowing the contents to be
2165 moved around as a single string.
2166 (addContents) method removed.
2167 (setContents) method no longer virtual.
2169 * src/buffer.C (readInset): made use of new InsetCitation,
2170 InsetUrl constructors based on InsetCommandParams.
2172 * src/commandtags.h: add LFUN_INSERT_URL
2174 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2175 independent InsetUrl and use InsetCommandParams to extract
2176 string info and create new Insets.
2178 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2180 * src/frontends/xforms/FormCitation.C (apply): uses
2183 * src/frontends/xforms/form_url.C
2184 * src/frontends/xforms/form_url.h
2185 * src/frontends/xforms/FormUrl.h
2186 * src/frontends/xforms/FormUrl.C
2187 * src/frontends/xforms/forms/form_url.fd: new files
2189 * src/insets/insetcite.[Ch]: removed unused constructors.
2191 * src/insets/insetinclude.[Ch]: no longer store filename
2193 * src/insets/inseturl.[Ch]: GUI-independent.
2195 2000-07-26 Juergen Vigna <jug@sad.it>
2196 * renamed frontend from gtk to gnome as it is that what is realized
2197 and did the necessary changes in the files.
2199 2000-07-26 Marko Vendelin <markov@ioc.ee>
2201 * configure.in: cleaning up gnome configuration scripts
2203 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2205 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2206 shortcuts syndrom by redrawing them explicitely (a better solution
2207 would be appreciated).
2209 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2211 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2214 * src/lyx_cb.C (MenuExport): change html export to do the right
2215 thing depending of the document type (instead of having
2216 html-linuxdoc and html-docbook).
2217 * src/lyxfunc.C (getStatus): update for html
2218 * lib/ui/default.ui: simplify due to the above change.
2219 * src/menus.C (ShowFileMenu): update too (in case we need it).
2221 * src/MenuBackend.C (read): if a menu is defined twice, add the
2222 new entries to the exiting one.
2224 2000-07-26 Juergen Vigna <jug@sad.it>
2226 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2228 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2229 and return a bool if it did actual save the file.
2230 (AutoSave): don't autosave a unnamed doc.
2232 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2233 check if this is an UNNAMED new file and react to it.
2234 (newFile): set buffer to unnamed and change to not mark a new
2235 buffer dirty if I didn't do anything with it.
2237 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2239 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2241 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2242 friend as per Angus's patch posted to lyx-devel.
2244 * src/ext_l10n.h: updated
2246 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2247 gettext on the style string right before inserting them into the
2250 * autogen.sh: add code to extract style strings form layout files,
2251 not good enough yet.
2253 * src/frontends/gtk/.cvsignore: add MAKEFILE
2255 * src/MenuBackend.C (read): run the label strings through gettext
2256 before storing them in the containers.
2258 * src/ext_l10n.h: new file
2260 * autogen.sh : generate the ext_l10n.h file here
2262 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2264 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2267 * lib/ui/default.ui: fix a couple of typos.
2269 * config/gnome/gtk.m4: added (and added to the list of files in
2272 * src/insets/insetinclude.C (unique_id): fix when we are using
2273 lyxstring instead of basic_string<>.
2274 * src/insets/insettext.C (LocalDispatch): ditto.
2275 * src/support/filetools.C: ditto.
2277 * lib/configure.m4: create the ui/ directory if necessary.
2279 * src/LyXView.[Ch] (updateToolbar): new method.
2281 * src/BufferView_pimpl.C (buffer): update the toolbar when
2282 opening/closing buffer.
2284 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2286 * src/LyXAction.C (getActionName): enhance to return also the name
2287 and options of pseudo-actions.
2288 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2290 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2291 as an example of what is possible). Used in File->Build too (more
2292 useful) and in the import/export menus (to mimick the complicated
2293 handling of linuxdoc and friends). Try to update all the entries.
2295 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2298 * src/MenuBackend.C (read): Parse the new OptItem tag.
2300 * src/MenuBackend.h: Add a new optional_ data member (used if the
2301 entry should be omitted when the lyxfunc is disabled).
2303 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2304 function, used as a shortcut.
2305 (create_submenu): align correctly the shortcuts on the widest
2308 * src/MenuBackend.h: MenuItem.label() only returns the label of
2309 the menu without shortcut; new method shortcut().
2311 2000-07-14 Marko Vendelin <markov@ioc.ee>
2313 * src/frontends/gtk/Dialogs.C:
2314 * src/frontends/gtk/FormCopyright.C:
2315 * src/frontends/gtk/FormCopyright.h:
2316 * src/frontends/gtk/Makefile.am: added these source-files for the
2317 Gtk/Gnome support of the Copyright-Dialog.
2319 * src/main.C: added Gnome::Main initialization if using
2320 Gtk/Gnome frontend-GUI.
2322 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2324 * config/gnome/aclocal-include.m4
2325 * config/gnome/compiler-flags.m4
2326 * config/gnome/curses.m4
2327 * config/gnome/gnome--.m4
2328 * config/gnome/gnome-bonobo-check.m4
2329 * config/gnome/gnome-common.m4
2330 * config/gnome/gnome-fileutils.m4
2331 * config/gnome/gnome-ghttp-check.m4
2332 * config/gnome/gnome-gnorba-check.m4
2333 * config/gnome/gnome-guile-checks.m4
2334 * config/gnome/gnome-libgtop-check.m4
2335 * config/gnome/gnome-objc-checks.m4
2336 * config/gnome/gnome-orbit-check.m4
2337 * config/gnome/gnome-print-check.m4
2338 * config/gnome/gnome-pthread-check.m4
2339 * config/gnome/gnome-support.m4
2340 * config/gnome/gnome-undelfs.m4
2341 * config/gnome/gnome-vfs.m4
2342 * config/gnome/gnome-x-checks.m4
2343 * config/gnome/gnome-xml-check.m4
2344 * config/gnome/gnome.m4
2345 * config/gnome/gperf-check.m4
2346 * config/gnome/gtk--.m4
2347 * config/gnome/linger.m4
2348 * config/gnome/need-declaration.m4: added configuration scripts
2349 for Gtk/Gnome frontend-GUI
2351 * configure.in: added support for the --with-frontend=gtk option
2353 * autogen.sh: added config/gnome/* to list of config-files
2355 * acconfig.h: added define for GTKGUI-support
2357 * config/lyxinclude.m4: added --with-frontend[=value] option value
2358 for Gtk/Gnome frontend-GUI support.
2360 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2362 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2366 * src/paragraph.C (GetChar): remove non-const version
2368 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2369 (search_kw): use it.
2371 * src/lyx_main.C (init): if "preferences" exist, read that instead
2373 (ReadRcFile): return bool if the file could be read ok.
2374 (ReadUIFile): add a check to see if lex file is set ok.
2376 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2377 bastring can be used instead of lyxstring (still uses the old code
2378 if std::string is good enough or if lyxstring is used.)
2380 * src/encoding.C: make the arrays static, move ininle functions
2382 * src/encoding.h: from here.
2384 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2385 (parseSingleLyXformat2Token): move inset parsing to separate method
2386 (readInset): new private method
2388 * src/Variables.h: remove virtual from get().
2390 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2391 access to NEW_INSETS and NEW_TABULAR
2393 * src/MenuBackend.h: remove superfluous forward declaration of
2394 MenuItem. Add documentations tags "///", remove empty MenuItem
2395 destructor, remove private default contructor.
2397 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2399 (read): more string mlabel and mname to where they are used
2400 (read): remove unused variables mlabel and mname
2401 (defaults): unconditional clear, make menusetup take advantage of
2402 add returning Menu &.
2404 * src/LyXView.h: define NEW_MENUBAR as default
2406 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2407 to NEW_INSETS and NEW_TABULAR.
2408 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2409 defined. Change some of the "xxxx-inset-insert" functions names to
2412 * several files: more enahncements to NEW_INSETS and the resulting
2415 * lib/lyxrc.example (\date_insert_format): move to misc section
2417 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2418 bastring and use AC_CACHE_CHECK.
2419 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2420 the system have the newest methods. uses AC_CACHE_CHECK
2421 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2422 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2423 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2425 * configure.in: add LYX_CXX_GOOD_STD_STRING
2427 * acinclude.m4: recreated
2429 2000-07-24 Amir Karger
2431 * README: add Hebrew, Arabic kmaps
2434 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2436 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2439 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2441 * Lot of files: add pragma interface/implementation.
2443 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2445 * lib/ui/default.ui: new file (ans new directory). Contains the
2446 default menu and toolbar.
2448 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2449 global space. Toolbars are now read (as menus) in ui files.
2451 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2453 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2454 is disabled because the document is read-only. We want to have the
2455 toggle state of the function anyway.
2456 (getStatus): add code for LFUN_VC* functions (mimicking what is
2457 done in old-style menus)
2459 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2460 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2462 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2463 * src/BufferView_pimpl.C: ditto.
2464 * src/lyxfunc.C: ditto.
2466 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2467 default). This replaces old-style menus by new ones.
2469 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2470 MenuItem. Contain the data structure of a menu.
2472 * src/insets/insettext.C: use LyXView::setLayout instead of
2473 accessing directly the toolbar combox.
2474 * src/lyxfunc.C (Dispatch): ditto.
2476 * src/LyXView.C (setLayout): new method, which just calls
2477 Toolbar::setLayout().
2478 (updateLayoutChoice): move part of this method in Toolbar.
2480 * src/toolbar.[Ch]: removed.
2482 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2483 implementation the toolbar.
2485 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2486 the toolbar. It might make sense to merge it with ToolbarDefaults
2488 (setLayout): new function.
2489 (updateLayoutList): ditto.
2490 (openLayoutList): ditto.
2492 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2493 xforms implementation of the toolbar.
2494 (get_toolbar_func): comment out, since I do not
2495 know what it is good for.
2497 * src/ToolbarDefaults.h: Add the ItemType enum.
2499 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2500 for a list of allocated C strings. Used in Menubar xforms
2501 implementation to avoid memory leaks.
2503 * src/support/lstrings.[Ch] (uppercase): new version taking and
2507 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2508 * lib/bind/emacs.bind: ditto.
2510 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2512 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2513 forward decl of LyXView.
2515 * src/toolbar.C (toolbarItem): moved from toolbar.h
2516 (toolbarItem::clean): ditto
2517 (toolbarItem::~toolbarItem): ditto
2518 (toolbarItem::operator): ditto
2520 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2522 * src/paragraph.h: control the NEW_TABULAR define from here
2524 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2525 USE_TABULAR_INSETS to NEW_TABULAR
2527 * src/ToolbarDefaults.C: add include "lyxlex.h"
2529 * files using the old table/tabular: use NEW_TABULAR to control
2530 compilation of old tabular stuff.
2532 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2535 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2536 planemet in reading of old style floats, fix the \end_deeper
2537 problem when reading old style floats.
2539 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2543 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2545 * lib/bind/sciword.bind: updated.
2547 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2549 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2550 layout write problem
2552 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2554 * src/Makefile.am (INCLUDES): remove image directory from include
2557 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2558 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2560 * src/LyXView.C (create_form_form_main): read the application icon
2563 * lib/images/*.xpm: change the icons to use transparent color for
2566 * src/toolbar.C (update): change the color of the button when it
2569 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2571 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2572 setting explicitely the minibuffer.
2573 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2575 * src/LyXView.C (showState): new function. Shows font information
2576 in minibuffer and update toolbar state.
2577 (LyXView): call Toolbar::update after creating the
2580 * src/toolbar.C: change toollist to be a vector instead of a
2582 (BubbleTimerCB): get help string directly from the callback
2583 argument of the corresponding icon (which is the action)
2584 (set): remove unnecessary ugliness.
2585 (update): new function. update the icons (depressed, disabled)
2586 depending of the status of the corresponding action.
2588 * src/toolbar.h: remove help in toolbarItem
2590 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2592 * src/Painter.C (text): Added code for using symbol glyphs from
2593 iso10646 fonts. Currently diabled.
2595 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2598 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2599 magyar,turkish and usorbian.
2601 * src/paragraph.C (isMultiLingual): Made more efficient.
2603 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2606 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2607 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2608 Also changed the prototype to "bool math_insert_greek(char)".
2610 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2612 * lots of files: apply the NEW_INSETS on all code that will not be
2613 needed when we move to use the new insets. Enable the define in
2614 lyxparagrah.h to try it.
2616 * src/insets/insettabular.C (cellstart): change to be a static
2618 (InsetTabular): initialize buffer in the initializer list.
2620 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2622 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2623 form_print.h out of the header file. Replaced with forward
2624 declarations of the relevant struct.
2626 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2629 * src/commandtags.h: do not include "debug.h" which does not
2630 belong there. #include it in some other places because of this
2633 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2635 * src/insets/insetcaption.C: add a couple "using" directives.
2637 * src/toolbar.C (add): get the help text directly from lyxaction.
2639 (setPixmap): new function. Loads from disk and sets a pixmap on a
2640 botton; the name of the pixmap file is derived from the command
2643 * src/toolbar.h: remove members isBitmap and pixmap from
2646 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2647 * lib/images/: move many files from images/banner.xpm.
2649 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2651 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2652 * src/toolbar.C: ditto.
2653 * configure.in: ditto.
2654 * INSTALL: document.
2656 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2657 the spellchecker popup is closed from the WM.
2659 2000-07-19 Juergen Vigna <jug@sad.it>
2661 * src/insets/insetfloat.C (Write): small fix because we use the
2662 insetname for the type now!
2664 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2666 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2669 * src/frontends/Dialogs.h: removed hideCitation signal
2671 * src/insets/insetcite.h: added hide signal
2673 * src/insets/insetcite.C (~InsetCitation): emits new signal
2674 (getScreenLabel): "intelligent" label should now fit on the screen!
2676 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2678 * src/frontends/xforms/FormCitation.C (showInset): connects
2679 hide() to the inset's hide signal
2680 (show): modified to use fl_set_object_position rather than
2681 fl_set_object_geometry wherever possible
2683 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2685 * src/insets/lyxinset.h: add caption code
2687 * src/insets/insetfloat.C (type): new method
2689 * src/insets/insetcaption.C (Write): new method
2691 (LyxCode): new method
2693 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2694 to get it right together with using the FloatList.
2696 * src/commandtags.h: add LFUN_INSET_CAPTION
2697 * src/lyxfunc.C (Dispatch): handle it
2699 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2702 * src/Variables.[Ch]: make expand take a const reference, remove
2703 the destructor, some whitespace changes.
2705 * src/LyXAction.C (init): add caption-inset-insert
2707 * src/FloatList.C (FloatList): update the default floats a bit.
2709 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2711 * src/Variables.[Ch]: new files. Intended to be used for language
2712 specific strings (like \chaptername) and filename substitution in
2715 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2717 * lib/kbd/american.kmap: update
2719 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2721 * src/bufferparams.[Ch]: remove member allowAccents.
2723 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2725 * src/LaTeXLog.C: use the log_form.h header.
2726 * src/lyx_gui.C: ditto.
2727 * src/lyx_gui_misc.C: ditto.
2728 * src/lyxvc.h: ditto.
2730 * forms/log_form.fd: new file, created from latexoptions.fd. I
2731 kept the log popup and nuked the options form.
2733 * src/{la,}texoptions.[Ch]: removed.
2734 * src/lyx_cb.C (LaTeXOptions): ditto
2736 * src/lyx_gui.C (create_forms): do not handle the
2737 fd_latex_options form.
2739 2000-07-18 Juergen Vigna <jug@sad.it>
2741 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2742 name of the inset so that it can be requested outside (text2.C).
2744 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2747 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2749 * src/mathed/formula.h (ConvertFont): constify
2751 * src/mathed/formula.C (Read): add warning if \end_inset is not
2752 found on expected place.
2754 * src/insets/lyxinset.h (ConvertFont): consify
2756 * src/insets/insetquotes.C (ConvertFont): constify
2757 * src/insets/insetquotes.h: ditto
2759 * src/insets/insetinfo.h: add labelfont
2761 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2762 (ascent): use labelfont
2766 (Write): make .lyx file a bit nicer
2768 * src/insets/insetfloat.C (Write): simplify somewhat...
2769 (Read): add warning if arg is not found
2771 * src/insets/insetcollapsable.C: add using std::max
2772 (Read): move string token and add warning in arg is not found
2773 (draw): use std::max to get the right ty
2774 (getMaxWidth): simplify by using std::max
2776 * src/insets/insetsection.h: new file
2777 * src/insets/insetsection.C: new file
2778 * src/insets/insetcaption.h: new file
2779 * src/insets/insetcaption.C: new file
2781 * src/insets/inset.C (ConvertFont): constify signature
2783 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2784 insetcaption.[Ch] and insetsection.[Ch]
2786 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2787 uses to use LABEL_COUNTER_CHAPTER instead.
2788 * src/text2.C (SetCounter): here
2790 * src/counters.h: new file
2791 * src/counters.C: new file
2792 * src/Sectioning.h: new file
2793 * src/Sectioning.C: new file
2795 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2797 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2799 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2802 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2805 2000-07-17 Juergen Vigna <jug@sad.it>
2807 * src/tabular.C (Validate): check if array-package is needed.
2808 (SetVAlignment): added support for vertical alignment.
2809 (SetLTFoot): better support for longtable header/footers
2810 (Latex): modified to support added features.
2812 * src/LaTeXFeatures.[Ch]: added array-package.
2814 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2816 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2819 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2821 * configure.in: do not forget to put a space after -isystem.
2823 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2825 * lib/kbd/arabic.kmap: a few fixes.
2827 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2829 * some whitespace chagnes to a number of files.
2831 * src/support/DebugStream.h: change to make it easier for
2832 doc++ to parse correctly.
2833 * src/support/lyxstring.h: ditto
2835 * src/mathed/math_utils.C (compara): change to have only one
2837 (MathedLookupBOP): change because of the above.
2839 * src/mathed/math_delim.C (math_deco_compare): change to have only
2841 (search_deco): change becasue of the above.
2843 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2844 instead of manually coded one.
2846 * src/insets/insetquotes.C (Read): read the \end_inset too
2848 * src/insets/insetlatex.h: remove file
2849 * src/insets/insetlatex.C: remove file
2851 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2853 (InsetPrintIndex): remove destructor
2855 * src/insets/insetinclude.h: remove default constructor
2857 * src/insets/insetfloat.C: work to make it work better
2859 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2861 * src/insets/insetcite.h (InsetCitation): remove default constructor
2863 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2865 * src/text.C (GetColumnNearX): comment out some currently unused code.
2867 * src/paragraph.C (writeFile): move some initializations closer to
2869 (CutIntoMinibuffer): small change to use new matchIT operator
2873 (InsertInset): ditto
2876 (InsetIterator): ditto
2877 (Erase): small change to use new matchFT operator
2879 (GetFontSettings): ditto
2880 (HighestFontInRange): ditto
2883 * src/lyxparagraph.h: some chars changed to value_type
2884 (matchIT): because of some stronger checking (perhaps too strong)
2885 in SGI STL, the two operator() unified to one.
2888 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2890 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2891 the last inset read added
2892 (parseSingleLyXformat2Token): some more (future) compability code added
2893 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2894 (parseSingleLyXformat2Token): set last_inset_read
2895 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2896 (parseSingleLyXformat2Token): don't double intializw string next_token
2898 * src/TextCache.C (text_fits::operator()): add const's to the signature
2899 (has_buffer::operator()): ditto
2901 * src/Floating.h: add some comments on the class
2903 * src/FloatList.[Ch] (typeExist): new method
2906 * src/BackStack.h: added default constructor, wanted by Gcc.
2908 2000-07-14 Juergen Vigna <jug@sad.it>
2910 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2912 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2914 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2915 do a redraw when the window is resized!
2916 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2918 * src/insets/insettext.C (resizeLyXText): added function to correctly
2919 being able to resize the LyXWindow.
2921 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2923 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2925 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2926 crashes when closing dialog to a deleted inset.
2928 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2929 method! Now similar to other insets.
2931 2000-07-13 Juergen Vigna <jug@sad.it>
2933 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2935 * lib/examples/Literate.lyx: small patch!
2937 * src/insets/insetbib.C (Read): added this function because of wrong
2938 Write (without [begin|end]_inset).
2940 2000-07-11 Juergen Vigna <jug@sad.it>
2942 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2943 as the insertInset could not be good!
2945 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2946 the bool param should not be last.
2948 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2950 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2951 did submit that to Karl).
2953 * configure.in: use -isystem instead of -I for X headers. This
2954 fixes a problem on solaris with a recent gcc;
2955 put the front-end code after the X detection code;
2956 configure in sigc++ before lib/
2958 * src/lyx_main.C (commandLineHelp): remove -display from command
2961 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2963 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2964 Also put in Makefile rules for building the ``listerrors''
2965 program for parsing errors from literate programs written in LyX.
2967 * lib/build-listerrors: Added small shell script as part of compile
2968 process. This builds a working ``listerrors'' binary if noweb is
2969 installed and either 1) the VNC X server is installed on the machine,
2970 or 2) the user is compiling from within a GUI. The existence of a GUI
2971 is necessary to use the ``lyx --export'' feature for now. This
2972 hack can be removed once ``lyx --export'' no longer requires a GUI to
2975 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2977 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2978 now passed back correctly from gcc and placed "under" error
2979 buttons in a Literate LyX source.
2981 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2983 * src/text.C (GetColumnNearX): Better behavior when a RTL
2984 paragraph is ended by LTR text.
2986 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2989 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2991 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2992 true when clipboard is empty.
2994 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2996 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2997 row of the paragraph.
2998 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2999 to prevent calculation of bidi tables
3001 2000-07-07 Juergen Vigna <jug@sad.it>
3003 * src/screen.C (ToggleSelection): added y_offset and x_offset
3006 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3009 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3011 * src/insets/insettext.C: fixed Layout-Display!
3013 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3015 * configure.in: add check for strings.h header.
3017 * src/spellchecker.C: include <strings.h> in order to have a
3018 definition for bzero().
3020 2000-07-07 Juergen Vigna <jug@sad.it>
3022 * src/insets/insettext.C (draw): set the status of the bv->text to
3023 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3025 * src/screen.C (DrawOneRow):
3026 (DrawFromTo): redraw the actual row if something has changed in it
3029 * src/text.C (draw): call an update of the toplevel-inset if something
3030 has changed inside while drawing.
3032 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3034 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3036 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3037 processing inside class.
3039 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3040 processing inside class.
3042 * src/insets/insetindex.h new struct Holder, consistent with other
3045 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3046 citation dialog from main code and placed it in src/frontends/xforms.
3047 Dialog launched through signals instead of callbacks
3049 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3051 * lyx.man: update the options description.
3053 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3055 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3056 handle neg values, set min width to 590, add doc about -display
3058 2000-07-05 Juergen Vigna <jug@sad.it>
3060 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3061 calls to BufferView *.
3063 * src/insets/insettext.C (checkAndActivateInset): small fix non
3064 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3066 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3067 their \end_inset token!
3069 2000-07-04 edscott <edscott@imp.mx>
3071 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3072 lib/lyxrc.example: added option \wheel_jump
3074 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3076 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3077 remove support for -width,-height,-xpos and -ypos.
3079 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3081 * src/encoding.[Ch]: New files.
3083 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3084 (text): Call to the underline() method only when needed.
3086 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3088 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3089 encoding(s) for the document.
3091 * src/bufferparams.C (BufferParams): Changed default value of
3094 * src/language.C (newLang): Removed.
3095 (items[]): Added encoding information for all defined languages.
3097 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3098 encoding choice button.
3100 * src/lyxrc.h (font_norm_type): New member variable.
3101 (set_font_norm_type): New method.
3103 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3104 paragraphs with different encodings.
3106 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3107 (TransformChar): Changed to work correctly with Arabic points.
3108 (draw): Added support for drawing Arabic points.
3109 (draw): Removed code for drawing underbars (this is done by
3112 * src/support/textutils.h (IsPrintableNonspace): New function.
3114 * src/BufferView_pimpl.h: Added "using SigC::Object".
3115 * src/LyXView.h: ditto.
3117 * src/insets/insetinclude.h (include_label): Changed to mutable.
3119 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3121 * src/mathed/math_iter.h: remove empty destructor
3123 * src/mathed/math_cursor.h: remove empty destructor
3125 * src/insets/lyxinset.h: add THEOREM_CODE
3127 * src/insets/insettheorem.[Ch]: new files
3129 * src/insets/insetminipage.C: (InsertInset): remove
3131 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3133 (InsertInset): remove
3135 * src/insets/insetlist.C: (InsertList): remove
3137 * src/insets/insetfootlike.[Ch]: new files
3139 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3142 (InsertInset): ditto
3144 * src/insets/insetert.C: remove include Painter.h, reindent
3145 (InsertInset): move to header
3147 * src/insets/insetcollapsable.h: remove explicit from default
3148 contructor, remove empty destructor, add InsertInset
3150 * src/insets/insetcollapsable.C (InsertInset): new func
3152 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3154 * src/vspace.h: add explicit to constructor
3156 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3157 \textcompwordmark, please test this.
3159 * src/lyxrc.C: set ascii_linelen to 65 by default
3161 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3163 * src/commandtags.h: add LFUN_INSET_THEOREM
3165 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3166 (makeLinuxDocFile): remove _some_ of the nice logic
3167 (makeDocBookFile): ditto
3169 * src/Painter.[Ch]: (~Painter): removed
3171 * src/LyXAction.C (init): entry for insettheorem added
3173 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3175 (deplog): code to detect files generated by LaTeX, needs testing
3178 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3180 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3182 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3184 * src/LaTeX.C (deplog): Add a check for files that are going to be
3185 created by the first latex run, part of the project to remove the
3188 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3189 contents to the extension list.
3191 2000-07-04 Juergen Vigna <jug@sad.it>
3193 * src/text.C (NextBreakPoint): added support for needFullRow()
3195 * src/insets/lyxinset.h: added needFullRow()
3197 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3200 * src/insets/insettext.C: lots of changes for update!
3202 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3204 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3206 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3208 * src/insets/insetinclude.C (InsetInclude): fixed
3209 initialization of include_label.
3210 (unique_id): now returns a string.
3212 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3214 * src/LaTeXFeatures.h: new member IncludedFiles, for
3215 a map of key, included file name.
3217 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3218 with the included files for inclusion in SGML preamble,
3219 i. e., linuxdoc and docbook.
3222 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3223 nice (is the generated linuxdoc code to be exported?), that
3224 allows to remove column, and only_body that will be true for
3225 slave documents. Insets are allowed inside SGML font type.
3226 New handling of the SGML preamble for included files.
3227 (makeDocBookFile): the same for docbook.
3229 * src/insets/insetinclude.h:
3230 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3232 (DocBook): new export methods.
3234 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3235 and makeDocBookFile.
3237 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3238 formats to export with command line argument -x.
3240 2000-06-29 Juergen Vigna <jug@sad.it>
3242 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3243 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3245 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3246 region could already been cleared by an inset!
3248 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3250 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3253 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3255 (cursorToggle): remove special handling of lyx focus.
3257 2000-06-28 Juergen Vigna <jug@sad.it>
3259 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3262 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3264 * src/insets/insetindex.C (Edit): add a callback when popup is
3267 * src/insets/insettext.C (LocalDispatch):
3268 * src/insets/insetmarginal.h:
3269 * src/insets/insetlist.h:
3270 * src/insets/insetfoot.h:
3271 * src/insets/insetfloat.h:
3272 * src/insets/insetert.h: add a missing std:: qualifier.
3274 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3276 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3279 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3281 * src/insets/insettext.C (Read): remove tmptok unused variable
3282 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3283 (InsertInset): change for new InsetInset code
3285 * src/insets/insettext.h: add TEXT inline method
3287 * src/insets/insettext.C: remove TEXT macro
3289 * src/insets/insetmarginal.C (Write): new method
3290 (Latex): change output slightly
3292 * src/insets/insetfoot.C (Write): new method
3293 (Latex): change output slightly (don't use endl when no need)
3295 * src/insets/insetert.C (Write): new method
3297 * src/insets/insetcollapsable.h: make button_length, button_top_y
3298 and button_bottm_y protected.
3300 * src/insets/insetcollapsable.C (Write): simplify code by using
3301 tostr. Also do not output the float name, the children class
3302 should to that to get control over own arguments
3304 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3305 src/insets/insetminipage.[Ch]:
3308 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3310 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3312 * src/Makefile.am (lyx_SOURCES): add the new files
3314 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3315 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3316 * src/commandtags.h: ditto
3318 * src/LaTeXFeatures.h: add a std::set of used floattypes
3320 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3322 * src/FloatList.[Ch] src/Floating.h: new files
3324 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3326 * src/lyx_cb.C (TableApplyCB): ditto
3328 * src/text2.C: ditto
3329 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3330 (parseSingleLyXformat2Token): ditto + add code for
3331 backwards compability for old float styles + add code for new insets
3333 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3335 (InsertInset(size_type, Inset *, LyXFont)): new method
3336 (InsetChar(size_type, char)): changed to use the other InsetChar
3337 with a LyXFont(ALL_INHERIT).
3338 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3339 insert the META_INSET.
3341 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3343 * sigc++/thread.h (Threads): from here
3345 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3346 definition out of line
3347 * sigc++/scope.h: from here
3349 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3351 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3352 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3354 * Makefile.am (bindist): new target.
3356 * INSTALL: add instructions for doing a binary distribution.
3358 * development/tools/README.bin.example: update a bit.
3360 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3363 * lib/lyxrc.example: new lyxrc tag \set_color.
3365 * src/lyxfunc.C (Dispatch):
3366 * src/commandtags.h:
3367 * src/LyXAction.C: new lyxfunc "set-color".
3369 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3370 and an x11name given as strings.
3372 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3373 cache when a color is changed.
3375 2000-06-26 Juergen Vigna <jug@sad.it>
3377 * src/lyxrow.C (width): added this functions and variable.
3379 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3382 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3384 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3386 * images/undo_bw.xpm: new icon.
3387 * images/redo_bw.xpm: ditto.
3389 * configure.in (INSTALL_SCRIPT): change value to
3390 ${INSTALL} to avoid failures of install-script target.
3391 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3393 * src/BufferView.h: add a magic "friend" declaration to please
3396 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3398 * forms/cite.fd: modified to allow resizing without messing
3401 * src/insetcite.C: Uses code from cite.fd almost without
3403 User can now resize dialog in the x-direction.
3404 Resizing the dialog in the y-direction is prevented, as the
3405 code does this intelligently already.
3407 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3409 * INSTALL: remove obsolete entry in "problems" section.
3411 * lib/examples/sl_*.lyx: update of the slovenian examples.
3413 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3415 2000-06-23 Juergen Vigna <jug@sad.it>
3417 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3419 * src/buffer.C (resize): delete the LyXText of textinsets.
3421 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3423 * src/insets/lyxinset.h: added another parameter 'cleared' to
3424 the draw() function.
3426 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3427 unlocking inset in inset.
3429 2000-06-22 Juergen Vigna <jug@sad.it>
3431 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3432 of insets and moved first to LyXText.
3434 * src/mathed/formulamacro.[Ch]:
3435 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3437 2000-06-21 Juergen Vigna <jug@sad.it>
3439 * src/text.C (GetVisibleRow): look if I should clear the area or not
3440 using Inset::doClearArea() function.
3442 * src/insets/lyxinset.h: added doClearArea() function and
3443 modified draw(Painter &, ...) to draw(BufferView *, ...)
3445 * src/text2.C (UpdateInset): return bool insted of int
3447 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3449 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3450 combox in the character popup
3452 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3453 BufferParams const & params
3455 2000-06-20 Juergen Vigna <jug@sad.it>
3457 * src/insets/insettext.C (SetParagraphData): set insetowner on
3460 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3462 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3463 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3465 (form_main_): remove
3467 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3468 (create_form_form_main): remove FD_form_main stuff, connect to
3469 autosave_timeout signal
3471 * src/LyXView.[Ch] (getMainForm): remove
3472 (UpdateTimerCB): remove
3473 * src/BufferView_pimpl.h: inherit from SigC::Object
3475 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3476 signal instead of callback
3478 * src/BufferView.[Ch] (cursorToggleCB): remove
3480 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3482 * src/BufferView_pimpl.C: changes because of the one below
3484 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3485 instead of storing a pointer to a LyXText.
3487 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3489 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3491 * src/lyxparagraph.h
3493 * src/paragraph.C: Changed fontlist to a sorted vector.
3495 2000-06-19 Juergen Vigna <jug@sad.it>
3497 * src/BufferView.h: added screen() function.
3499 * src/insets/insettext.C (LocalDispatch): some selection code
3502 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3504 * src/insets/insettext.C (SetParagraphData):
3506 (InsetText): fixes for multiple paragraphs.
3508 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3510 * development/lyx.spec.in: Call configure with ``--without-warnings''
3511 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3512 This should be fine, however, since we generally don't want to be
3513 verbose when making an RPM.
3515 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3517 * lib/scripts/fig2pstex.py: New file
3519 2000-06-16 Juergen Vigna <jug@sad.it>
3521 * src/insets/insettabular.C (UpdateLocal):
3522 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3523 (LocalDispatch): Changed all functions to use LyXText.
3525 2000-06-15 Juergen Vigna <jug@sad.it>
3527 * src/text.C (SetHeightOfRow): call inset::update before requesting
3530 * src/insets/insettext.C (update):
3531 * src/insets/insettabular.C (update): added implementation
3533 * src/insets/lyxinset.h: added update function
3535 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3537 * src/text.C (SelectNextWord): protect against null pointers with
3538 old-style string streams. (fix from Paul Theo Gonciari
3541 * src/cite.[Ch]: remove erroneous files.
3543 * lib/configure.m4: update the list of created directories.
3545 * src/lyxrow.C: include <config.h>
3546 * src/lyxcursor.C: ditto.
3548 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3550 * lib/examples/decimal.lyx: new example file from Mike.
3552 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3553 to find template definitions (from Dekel)
3555 * src/frontends/.cvsignore: add a few things.
3557 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3559 * src/Timeout.C (TimeOut): remove default argument.
3561 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3564 * src/insets/ExternalTemplate.C: add a "using" directive.
3566 * src/lyx_main.h: remove the act_ struct, which seems unused
3569 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3571 * LyX Developers Meeting: All files changed, due to random C++ (by
3572 coincidence) code generator script.
3574 - external inset (cool!)
3575 - initial online editing of preferences
3576 - insettabular breaks insettext(s contents)
3578 - some DocBook fixes
3579 - example files update
3580 - other cool stuff, create a diff and look for yourself.
3582 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3584 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3585 -1 this is a non-line-breaking textinset.
3587 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3588 if there is no width set.
3590 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3592 * Lots of files: Merged the dialogbase branch.
3594 2000-06-09 Allan Rae <rae@lyx.org>
3596 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3597 and the Dispatch methods that used it.
3599 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3600 access to functions formerly kept in Dispatch.
3602 2000-05-19 Allan Rae <rae@lyx.org>
3604 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3605 made to_page and count_copies integers again. from_page remains a
3606 string however because I want to allow entry of a print range like
3607 "1,4,22-25" using this field.
3609 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3610 and printer-params-get. These aren't useful from the minibuffer but
3611 could be used by a script/LyXServer app provided it passes a suitable
3612 auto_mem_buffer. I guess I should take a look at how the LyXServer
3613 works and make it support xtl buffers.
3615 * sigc++/: updated to libsigc++-1.0.1
3617 * src/xtl/: updated to xtl-1.3.pl.11
3619 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3620 those changes done to the files in src/ are actually recreated when
3621 they get regenerated. Please don't ever accept a patch that changes a
3622 dialog unless that patch includes the changes to the corresponding *.fd
3625 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3626 stringOnlyContains, renamed it and generalised it.
3628 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3629 branch. Removed the remaining old form_print code.
3631 2000-04-26 Allan Rae <rae@lyx.org>
3633 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3634 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3636 2000-04-25 Allan Rae <rae@lyx.org>
3638 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3639 against a base of xtl-1.3.pl.4
3641 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3642 filter the Id: entries so they still show the xtl version number
3645 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3646 into the src/xtl code. Patch still pending with José (XTL)
3648 2000-04-24 Allan Rae <rae@lyx.org>
3650 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3651 both more generic and much safer. Use the new template functions.
3652 * src/buffer.[Ch] (Dispatch): ditto.
3654 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3655 and mem buffer more intelligently. Also a little general cleanup.
3658 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3659 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3660 * src/xtl/Makefile.am: ditto.
3661 * src/xtl/.cvsignore: ditto.
3662 * src/Makefile.am: ditto.
3664 * src/PrinterParams.h: Removed the macros member functions. Added a
3665 testInvariant member function. A bit of tidying up and commenting.
3666 Included Angus's idea for fixing operation with egcs-1.1.2.
3668 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3669 cool expansion of XTL's mem_buffer to support automatic memory
3670 management within the buffer itself. Removed the various macros and
3671 replaced them with template functions that use either auto_mem_buffer
3672 or mem_buffer depending on a #define. The mem_buffer support will
3673 disappear as soon as the auto_mem_buffer is confirmed to be good on
3674 other platforms/compilers. That is, it's there so you've got something
3677 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3678 effectively forked XTL. However I expect José will include my code
3679 into the next major release. Also fixed a memory leak.
3680 * src/xtl/text.h: ditto.
3681 * src/xtl/xdr.h: ditto.
3682 * src/xtl/giop.h: ditto.
3684 2000-04-16 Allan Rae <rae@lyx.org>
3686 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3687 by autogen.sh and removed by maintainer-clean anyway.
3688 * .cvsignore, sigc++/.cvsignore: Support the above.
3690 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3692 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3694 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3695 macros, renamed static callback-target member functions to suit new
3696 scheme and made them public.
3697 * src/frontends/xforms/forms/form_print.fd: ditto.
3698 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3700 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3703 * src/xtl/: New directory containing a minimal distribution of XTL.
3704 This is XTL-1.3.pl.4.
3706 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3708 2000-04-15 Allan Rae <rae@lyx.org>
3710 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3712 * sigc++/: Updated to libsigc++-1.0.0
3714 2000-04-14 Allan Rae <rae@lyx.org>
3716 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3717 use the generic ones in future. I'll modify my conversion script.
3719 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3721 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3722 (CloseAllBufferRelatedDialogs): Renamed.
3723 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3725 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3726 of the generic ones. These are the same ones my conversion script
3729 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3730 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3731 * src/buffer.C (Dispatch): ditto
3733 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3734 functions for updating and hiding buffer dependent dialogs.
3735 * src/BufferView.C (buffer): ditto
3736 * src/buffer.C (setReadonly): ditto
3737 * src/lyxfunc.C (CloseBuffer): ditto
3739 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3740 Dialogs.h, and hence all the SigC stuff, into every file that includes
3741 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3743 * src/BufferView2.C: reduce the number of headers included by buffer.h
3745 2000-04-11 Allan Rae <rae@lyx.org>
3747 * src/frontends/xforms/xform_macros.h: A small collection of macros
3748 for building C callbacks.
3750 * src/frontends/xforms/Makefile.am: Added above file.
3752 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3753 scheme again. This time it should work for JMarc. If this is
3754 successful I'll revise my conversion script to automate some of this.
3755 The static member functions in the class also have to be public for
3756 this scheme will work. If the scheme works (it's almost identical to
3757 the way BufferView::cursorToggleCB is handled so it should work) then
3758 FormCopyright and FormPrint will be ready for inclusion into the main
3759 trunk immediately after 1.1.5 is released -- provided we're prepared
3760 for complaints about lame compilers not handling XTL.
3762 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3764 2000-04-07 Allan Rae <rae@lyx.org>
3766 * config/lyxinclude.m4: A bit more tidying up (Angus)
3768 * src/LString.h: JMarc's <string> header fix
3770 * src/PrinterParams.h: Used string for most data to remove some
3771 ugly code in the Print dialog and avoid even uglier code when
3772 appending the ints to a string for output.
3774 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3775 and moved "default:" back to the end of switch statement. Cleaned
3776 up the printing so it uses the right function calls and so the
3777 "print to file" option actually puts the file in the right directory.
3779 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3781 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3782 and Ok+Apply button control into a separate method: input (Angus).
3783 (input) Cleaned it up and improved it to be very thorough now.
3784 (All CB) static_cast used instead of C style cast (Angus). This will
3785 probably change again once we've worked out how to keep gcc-2.8.1 happy
3786 with real C callbacks.
3787 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3788 ignore some of the bool settings and has random numbers instead. Needs
3789 some more investigation. Added other input length checks and checking
3790 of file and printer names.
3792 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3793 would link (Angus). Seems the old code doesn't compile with the pragma
3794 statement either. Separated callback entries from internal methods.
3796 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3798 2000-03-17 Allan Rae <rae@lyx.org>
3800 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3801 need it? Maybe it could go in Dialogs instead? I could make it a
3802 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3803 values to get the bool return value.
3804 (Dispatch): New overloaded method for xtl support.
3806 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3807 extern "C" callback instead of static member functions. Hopefully,
3808 JMarc will be able to compile this. I haven't changed
3809 forms/form_copyright.fd yet. Breaking one of my own rules already.
3811 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3812 because they aren't useful from the minibuffer. Maybe a LyXServer
3813 might want a help message though?
3815 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3817 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3818 xtl which needs both rtti and exceptions.
3820 * src/support/Makefile.am:
3821 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3823 * src/frontends/xforms/input_validators.[ch]: input filters and
3824 validators. These conrol what keys are valid in input boxes.
3825 Use them and write some more. Much better idea than waiting till
3826 after the user has pressed Ok to say that the input fields don't make
3829 * src/frontends/xforms/Makefile.am:
3830 * src/frontends/xforms/forms/form_print.fd:
3831 * src/frontends/xforms/forms/makefile:
3832 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3833 new scheme. Still have to make sure I haven't missed anything from
3834 the current implementation.
3836 * src/Makefile.am, src/PrinterParams.h: New data store.
3838 * other files: Added a couple of copyright notices.
3840 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3842 * src/insets/insetbib.h: move Holder struct in public space.
3844 * src/frontends/include/DialogBase.h: use SigC:: only when
3845 SIGC_CXX_NAMESPACES is defined.
3846 * src/frontends/include/Dialogs.h: ditto.
3848 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3850 * src/frontends/xforms/FormCopyright.[Ch]: do not
3851 mention SigC:: explicitely.
3853 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3855 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3856 deals with testing KDE in main configure.in
3857 * configure.in: ditto.
3859 2000-02-22 Allan Rae <rae@lyx.org>
3861 * Lots of files: Merged from HEAD
3863 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3864 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3866 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3868 * sigc++/: new minidist.
3870 2000-02-14 Allan Rae <rae@lyx.org>
3872 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3874 2000-02-08 Juergen Vigna <jug@sad.it>
3876 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3877 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3879 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3880 for this port and so it is much easier for other people to port
3881 dialogs in a common development environment.
3883 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3884 the QT/KDE implementation.
3886 * src/frontends/kde/Dialogs.C:
3887 * src/frontends/kde/FormCopyright.C:
3888 * src/frontends/kde/FormCopyright.h:
3889 * src/frontends/kde/Makefile.am:
3890 * src/frontends/kde/formcopyrightdialog.C:
3891 * src/frontends/kde/formcopyrightdialog.h:
3892 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3893 for the kde support of the Copyright-Dialog.
3895 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3896 subdir-substitution instead of hardcoded 'xforms' as we now have also
3899 * src/frontends/include/DialogBase.h (Object): just commented the
3900 label after #endif (nasty warning and I don't like warnings ;)
3902 * src/main.C (main): added KApplication initialization if using
3905 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3906 For now only the KDE event-loop is added if frontend==kde.
3908 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3910 * configure.in: added support for the --with-frontend[=value] option
3912 * autogen.sh: added kde.m4 file to list of config-files
3914 * acconfig.h: added define for KDEGUI-support
3916 * config/kde.m4: added configuration functions for KDE-port
3918 * config/lyxinclude.m4: added --with-frontend[=value] option with
3919 support for xforms and KDE.
3921 2000-02-08 Allan Rae <rae@lyx.org>
3923 * all Makefile.am: Fixed up so the make targets dist, distclean,
3924 install and uninstall all work even if builddir != srcdir. Still
3925 have a new sigc++ minidist update to come.
3927 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3929 2000-02-01 Allan Rae <rae@lyx.org>
3931 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3932 Many mods to get builddir != srcdir working.
3934 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3935 for building on NT and so we can do the builddir != srcdir stuff.
3937 2000-01-30 Allan Rae <rae@lyx.org>
3939 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3940 This will stay in "rae" branch. We probably don't really need it in
3941 the main trunk as anyone who wants to help programming it should get
3942 a full library installed also. So they can check both included and
3943 system supplied library compilation.
3945 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3946 Added a 'mini' distribution of libsigc++. If you feel the urge to
3947 change something in these directories - Resist it. If you can't
3948 resist the urge then you should modify the following script and rebuild
3949 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3950 all happen. Still uses a hacked version of libsigc++'s configure.in.
3951 I'm quite happy with the results. I'm not sure the extra work to turn
3952 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3953 worth the trouble and would probably lead to extra maintenance
3955 I haven't tested the following important make targets: install, dist.
3956 Not ready for prime time but very close. Maybe 1.1.5.
3958 * development/tools/makeLyXsigc.sh: A shell script to automatically
3959 generate our mini-dist of libsigc++. It can only be used with a CVS
3960 checkout of libsigc++ not a tarball distribution. It's well commented.
3961 This will end up as part of the libsigc++ distribution so other apps
3962 can easily have an included mini-dist. If someone makes mods to the
3963 sigc++ subpackage without modifying this script to generate those
3964 changes I'll be very upset!
3966 * src/frontends/: Started the gui/system indep structure.
3968 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3969 to access the gui-indep dialogs are in this class. Much improved
3970 design compared to previous revision. Lars, please refrain from
3971 moving this header into src/ like you did with Popups.h last time.
3973 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3975 * src/frontends/xforms/: Started the gui-indep system with a single
3976 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3979 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3980 Here you'll find a very useful makefile and automated fdfix.sh that
3981 makes updating dailogs a no-brainer -- provided you follow the rules
3982 set out in the README. I'm thinking about adding another script to
3983 automatically generate skeleton code for a new dialog given just the
3986 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3987 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3988 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3990 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3992 * src/support/LSubstring.C (operator): simplify
3994 * src/lyxtext.h: removed bparams, use buffer_->params instead
3996 * src/lyxrow.h: make Row a real class, move all variables to
3997 private and use accessors.
3999 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4001 (isRightToLeftPar): ditto
4002 (ChangeLanguage): ditto
4003 (isMultiLingual): ditto
4006 (SimpleTeXOnePar): ditto
4007 (TeXEnvironment): ditto
4008 (GetEndLabel): ditto
4010 (SetOnlyLayout): ditto
4011 (BreakParagraph): ditto
4012 (BreakParagraphConservative): ditto
4013 (GetFontSettings): ditto
4015 (CopyIntoMinibuffer): ditto
4016 (CutIntoMinibuffer): ditto
4017 (PasteParagraph): ditto
4018 (SetPExtraType): ditto
4019 (UnsetPExtraType): ditto
4020 (DocBookContTableRows): ditto
4021 (SimpleDocBookOneTablePar): ditto
4023 (TeXFootnote): ditto
4024 (SimpleTeXOneTablePar): ditto
4025 (TeXContTableRows): ditto
4026 (SimpleTeXSpecialChars): ditto
4029 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4030 to private and use accessors.
4032 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4033 this, we did not use it anymore and has not been for ages. Just a
4034 waste of cpu cycles.
4036 * src/language.h: make Language a real class, move all variables
4037 to private and use accessors.
4039 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4040 (create_view): remove
4041 (update): some changes for new timer
4042 (cursorToggle): use new timer
4043 (beforeChange): change for new timer
4045 * src/BufferView.h (cursorToggleCB): removed last paramter because
4048 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4049 (cursorToggleCB): change because of new timer code
4051 * lib/CREDITS: updated own mailaddress
4053 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4055 * src/support/filetools.C (PutEnv): fix the code in case neither
4056 putenv() nor setenv() have been found.
4058 * INSTALL: mention the install-strip Makefile target.
4060 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4061 read-only documents.
4063 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4065 * lib/reLyX/configure.in (VERSION): avoid using a previously
4066 generated reLyX wrapper to find out $prefix.
4068 * lib/examples/eu_adibide_lyx-atua.lyx:
4069 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4070 translation of the Tutorial (Dooteo)
4072 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4074 * forms/cite.fd: new citation dialog
4076 * src/insetcite.[Ch]: the new citation dialog is moved into
4079 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4082 * src/insets/insetcommand.h: data members made private.
4084 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4086 * LyX 1.1.5 released
4088 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4090 * src/version.h (LYX_RELEASE): to 1.1.5
4092 * src/spellchecker.C (RunSpellChecker): return false if the
4093 spellchecker dies upon creation.
4095 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4097 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4098 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4102 * lib/CREDITS: update entry for Martin Vermeer.
4104 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4106 * src/text.C (draw): Draw foreign language bars at the bottom of
4107 the row instead of at the baseline.
4109 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4111 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4113 * lib/bind/de_menus.bind: updated
4115 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4117 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4119 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4121 * src/menus.C (Limit_string_length): New function
4122 (ShowTocMenu): Limit the number of items/length of items in the
4125 * src/paragraph.C (String): Correct result for a paragraph inside
4128 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4130 * src/bufferlist.C (close): test of buf->getuser() == NULL
4132 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4134 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4135 Do not call to SetCursor when the paragraph is a closed footnote!
4137 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4139 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4142 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4144 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4147 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4148 reference popup, that activates the reference-back action
4150 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4152 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4153 the menus. Also fixed a bug.
4155 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4156 the math panels when switching buffers (unless new buffer is readonly).
4158 * src/BufferView.C (NoSavedPositions)
4159 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4161 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4163 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4164 less of dvi dirty or not.
4166 * src/trans_mgr.[Ch] (insert): change first parameter to string
4169 * src/chset.[Ch] (encodeString): add const to first parameter
4171 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4173 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4177 * src/LaTeX.C (deplog): better searching for dependency files in
4178 the latex log. Uses now regexps.
4180 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4181 instead of the box hack or \hfill.
4183 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4185 * src/lyxfunc.C (doImportHelper): do not create the file before
4186 doing the actual import.
4187 (doImportASCIIasLines): create a new file before doing the insert.
4188 (doImportASCIIasParagraphs): ditto.
4190 * lib/lyxrc.example: remove mention of non-existing commands
4192 * lyx.man: remove mention of color-related switches.
4194 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4196 * src/lyx_gui.C: remove all the color-related ressources, which
4197 are not used anymore.
4199 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4202 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4204 * src/lyxrc.C (read): Add a missing break in the switch
4206 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4208 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4210 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4213 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4215 * src/text.C (draw): draw bars under foreign language words.
4217 * src/LColor.[Ch]: add LColor::language
4219 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4221 * src/lyxcursor.h (boundary): New member variable
4223 * src/text.C (IsBoundary): New methods
4225 * src/text.C: Use the above for currect cursor movement when there
4226 is both RTL & LTR text.
4228 * src/text2.C: ditto
4230 * src/bufferview_funcs.C (ToggleAndShow): ditto
4232 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4234 * src/text.C (DeleteLineForward): set selection to true to avoid
4235 that DeleteEmptyParagraphMechanism does some magic. This is how it
4236 is done in all other functions, and seems reasonable.
4237 (DeleteWordForward): do not jump over non-word stuff, since
4238 CursorRightOneWord() already does it.
4240 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4241 DeleteWordBackward, since they seem safe to me (since selection is
4242 set to "true") DeleteEmptyParagraphMechanism does nothing.
4244 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4246 * src/lyx_main.C (easyParse): simplify the code by factoring the
4247 part that removes parameters from the command line.
4248 (LyX): check wether wrong command line options have been given.
4250 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4252 * src/lyx_main.C : add support for specifying user LyX
4253 directory via command line option -userdir.
4255 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4257 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4258 the number of items per popup.
4259 (Add_to_refs_menu): Ditto.
4261 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4263 * src/lyxparagraph.h: renamed ClearParagraph() to
4264 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4265 textclass as parameter, and do nothing if free_spacing is
4266 true. This fixes part of the line-delete-forward problems.
4268 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4269 (pasteSelection): ditto.
4270 (SwitchLayoutsBetweenClasses): more translatable strings.
4272 * src/text2.C (CutSelection): use StripLeadingSpaces.
4273 (PasteSelection): ditto.
4274 (DeleteEmptyParagraphMechanism): ditto.
4276 2000-05-26 Juergen Vigna <jug@sad.it>
4278 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4279 is not needed in tabular insets.
4281 * src/insets/insettabular.C (TabularFeatures): added missing features.
4283 * src/tabular.C (DeleteColumn):
4285 (AppendRow): implemented this functions
4286 (cellsturct::operator=): clone the inset too;
4288 2000-05-23 Juergen Vigna <jug@sad.it>
4290 * src/insets/insettabular.C (LocalDispatch): better selection support
4291 when having multicolumn-cells.
4293 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4295 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4297 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4299 * src/ColorHandler.C (getGCForeground): put more test into _()
4301 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4304 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4307 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4309 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4310 there are no labels, or when buffer is readonly.
4312 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4313 there are no labels, buffer is SGML, or when buffer is readonly.
4315 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4317 * src/LColor.C (LColor): change a couple of grey40 to grey60
4318 (LColor): rewore initalization to make compiles go some magnitude
4320 (getGUIName): don't use gettext until we need the string.
4322 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4324 * src/Bullet.[Ch]: Fixed a small bug.
4326 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4328 * src/paragraph.C (String): Several fixes/improvements
4330 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4332 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4334 * src/paragraph.C (String): give more correct output.
4336 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4338 * src/lyxfont.C (stateText) Do not output the language if it is
4339 eqaul to the language of the document.
4341 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4342 between two paragraphs with the same language.
4344 * src/paragraph.C (getParLanguage) Return a correct answer for an
4345 empty dummy paragraph.
4347 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4350 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4353 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4354 the menus/popup, if requested fonts are unavailable.
4356 2000-05-22 Juergen Vigna <jug@sad.it>
4358 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4359 movement support (Up/Down/Tab/Shift-Tab).
4360 (LocalDispatch): added also preliminari cursor-selection.
4362 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4364 * src/paragraph.C (PasteParagraph): Hopefully now right!
4366 2000-05-22 Garst R. Reese <reese@isn.net>
4368 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4369 of list, change all references to Environment to Command
4370 * tex/hollywood.cls : rewrite environments as commands, add
4371 \uppercase to interiorshot and exteriorshot to force uppecase.
4372 * tex/broadway.cls : rewrite environments as commands. Tweak
4375 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4377 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4378 size of items: use a constant intead of the hardcoded 40, and more
4379 importantly do not remove the %m and %x tags added at the end.
4380 (Add_to_refs_menu): use vector::size_type instead of
4381 unsigned int as basic types for the variables. _Please_ do not
4382 assume that size_t is equal to unsigned int. On an alpha, this is
4383 unsigned long, which is _not_ the same.
4385 * src/language.C (initL): remove language "hungarian", since it
4386 seems that "magyar" is better.
4388 2000-05-22 Juergen Vigna <jug@sad.it>
4390 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4392 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4395 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4396 next was deleted but not set to 0.
4398 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4400 * src/language.C (initL): change the initialization of languages
4401 so that compiles goes _fast_.
4403 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4406 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4408 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4412 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4414 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4416 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4420 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4423 * src/insets/insetlo*.[Ch]: Made editable
4425 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4427 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4428 the current selection.
4430 * src/BufferView_pimpl.C (stuffClipboard): new method
4432 * src/BufferView.C (stuffClipboard): new method
4434 * src/paragraph.C (String): new method
4436 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4437 LColor::ignore when lyxname is not found.
4439 * src/BufferView.C (pasteSelection): new method
4441 * src/BufferView_pimpl.C (pasteSelection): new method
4443 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4445 * src/WorkArea.C (request_clipboard_cb): new static function
4446 (getClipboard): new method
4447 (putClipboard): new method
4449 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4451 * LyX 1.1.5pre2 released
4453 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4455 * src/vspace.C (operator=): removed
4456 (operator=): removed
4458 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4460 * src/layout.C (NumberOfClass): manually set the type in make_pair
4461 (NumberOfLayout): ditto
4463 * src/language.C: use the Language constructor for ignore_lang
4465 * src/language.h: add constructors to struct Language
4467 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4469 * src/text2.C (SetCursorIntern): comment out #warning
4471 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4473 * src/mathed/math_iter.h: initialize sx and sw to 0
4475 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4477 * forms/lyx.fd: Redesign of form_ref
4479 * src/LaTeXFeatures.[Ch]
4483 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4486 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4487 and Buffer::inset_iterator.
4489 * src/menus.C: Added new menus: TOC and Refs.
4491 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4493 * src/buffer.C (getTocList): New method.
4495 * src/BufferView2.C (ChangeRefs): New method.
4497 * src/buffer.C (getLabelList): New method. It replaces the old
4498 getReferenceList. The return type is vector<string> instead of
4501 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4502 the old getLabel() and GetNumberOfLabels() methods.
4503 * src/insets/insetlabel.C (getLabelList): ditto
4504 * src/mathed/formula.C (getLabelList): ditto
4506 * src/paragraph.C (String): New method.
4508 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4509 Uses the new getTocList() method.
4510 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4511 which automatically updates the contents of the browser.
4512 (RefUpdateCB): Use the new getLabelList method.
4514 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4516 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4518 * src/spellchecker.C: Added using std::reverse;
4520 2000-05-19 Juergen Vigna <jug@sad.it>
4522 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4524 * src/insets/insettext.C (computeTextRows): small fix for display of
4525 1 character after a newline.
4527 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4530 2000-05-18 Juergen Vigna <jug@sad.it>
4532 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4533 when changing width of column.
4535 * src/tabular.C (set_row_column_number_info): setting of
4536 autobreak rows if necessary.
4538 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4540 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4542 * src/vc-backend.*: renamed stat() to status() and vcstat to
4543 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4544 compilation broke. The new name seems more relevant, anyway.
4546 2000-05-17 Juergen Vigna <jug@sad.it>
4548 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4549 which was wrong if the removing caused removing of rows!
4551 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4552 (pushToken): new function.
4554 * src/text2.C (CutSelection): fix problem discovered with purify
4556 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4558 * src/debug.C (showTags): enlarge the first column, now that we
4559 have 6-digits debug codes.
4561 * lib/layouts/hollywood.layout:
4562 * lib/tex/hollywood.cls:
4563 * lib/tex/brodway.cls:
4564 * lib/layouts/brodway.layout: more commands and fewer
4565 environments. Preambles moved in the .cls files. Broadway now has
4566 more options on scene numbering and less whitespace (from Garst)
4568 * src/insets/insetbib.C (getKeys): make sure that we are in the
4569 document directory, in case the bib file is there.
4571 * src/insets/insetbib.C (Latex): revert bogus change.
4573 2000-05-16 Juergen Vigna <jug@sad.it>
4575 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4576 the TabularLayout on cursor move.
4578 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4580 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4583 (draw): fixed cursor position and drawing so that the cursor is
4584 visible when before the tabular-inset.
4586 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4587 when creating from old insettext.
4589 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4591 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4593 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4594 * lib/tex/brodway.cls: ditto
4596 * lib/layouts/brodway.layout: change alignment of parenthical
4599 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4601 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4602 versions 0.88 and 0.89 are supported.
4604 2000-05-15 Juergen Vigna <jug@sad.it>
4606 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4609 * src/insets/insettext.C (computeTextRows): redone completely this
4610 function in a much cleaner way, because of problems when having a
4612 (draw): added a frame border when the inset is locked.
4613 (SetDrawLockedFrame): this sets if we draw the border or not.
4614 (SetFrameColor): this sets the frame color (default=insetframe).
4616 * src/insets/lyxinset.h: added x() and y() functions which return
4617 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4618 function which is needed to see if we have a locking inset of some
4619 type in this inset (needed for now in insettabular).
4621 * src/vspace.C (inPixels): the same function also without a BufferView
4622 parameter as so it is easier to use it in some ocasions.
4624 * src/lyxfunc.C: changed all places where insertInset was used so
4625 that now if it couldn't be inserted it is deleted!
4627 * src/TabularLayout.C:
4628 * src/TableLayout.C: added support for new tabular-inset!
4630 * src/BufferView2.C (insertInset): this now returns a bool if the
4631 inset was really inserted!!!
4633 * src/tabular.C (GetLastCellInRow):
4634 (GetFirstCellInRow): new helper functions.
4635 (Latex): implemented for new tabular class.
4639 (TeXTopHLine): new Latex() helper functions.
4641 2000-05-12 Juergen Vigna <jug@sad.it>
4643 * src/mathed/formulamacro.C (Read):
4644 * src/mathed/formula.C (Read): read also the \end_inset here!
4646 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4648 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4649 crush when saving formulae with unbalanced parenthesis.
4651 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4653 * src/layout.C: Add new keyword "endlabelstring" to layout file
4655 * src/text.C (GetVisibleRow): Draw endlabel string.
4657 * lib/layouts/broadway.layout
4658 * lib/layouts/hollywood.layout: Added endlabel for the
4659 Parenthetical layout.
4661 * lib/layouts/heb-article.layout: Do not use slanted font shape
4662 for Theorem like environments.
4664 * src/buffer.C (makeLaTeXFile): Always add "american" to
4665 the UsedLanguages list if document language is RTL.
4667 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4669 * add addendum to README.OS2 and small patch (from SMiyata)
4671 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4673 * many files: correct the calls to ChangeExtension().
4675 * src/support/filetools.C (ChangeExtension): remove the no_path
4676 argument, which does not belong there. Use OnlyFileName() instead.
4678 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4679 files when LaTeXing a non-nice latex file.
4681 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4682 a chain of "if". Return false when deadkeys are not handled.
4684 * src/lyx_main.C (LyX): adapted the code for default bindings.
4686 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4687 bindings for basic functionality (except deadkeys).
4688 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4690 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4691 several methods: handle override_x_deadkeys.
4693 * src/lyxrc.h: remove the "bindings" map, which did not make much
4694 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4696 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4698 * src/lyxfont.C (stateText): use a saner method to determine
4699 whether the font is "default". Seems to fix the crash with DEC
4702 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4704 2000-05-08 Juergen Vigna <jug@sad.it>
4706 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4707 TabularLayoutMenu with mouse-button-3
4708 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4710 * src/TabularLayout.C: added this file for having a Layout for
4713 2000-05-05 Juergen Vigna <jug@sad.it>
4715 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4716 recalculating inset-widths.
4717 (TabularFeatures): activated this function so that I can change
4718 tabular-features via menu.
4720 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4721 that I can test some functions with the Table menu.
4723 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4725 * src/lyxfont.C (stateText): guard against stupid c++libs.
4727 * src/tabular.C: add using std::vector
4728 some whitespace changes, + removed som autogenerated code.
4730 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4732 2000-05-05 Juergen Vigna <jug@sad.it>
4734 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4735 row, columns and cellstructures.
4737 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4739 * lib/lyxrc.example: remove obsolete entries.
4741 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4742 reading of protected_separator for free_spacing.
4744 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4746 * src/text.C (draw): do not display an exclamation mark in the
4747 margin for margin notes. This is confusing, ugly and
4750 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4751 AMS math' is checked.
4753 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4754 name to see whether including the amsmath package is needed.
4756 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4758 * src/paragraph.C (validate): Compute UsedLanguages correctly
4759 (don't insert the american language if it doesn't appear in the
4762 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4763 The argument of \thanks{} command is considered moving argument
4765 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4768 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4770 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4771 for appendix/minipage/depth. The lines can be now both in the footnote
4772 frame, and outside the frame.
4774 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4777 2000-05-05 Juergen Vigna <jug@sad.it>
4779 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4780 neede only in tabular.[Ch].
4782 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4784 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4786 (Write): write '~' for PROTECTED_SEPARATOR
4788 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4790 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4793 * src/mathed/formula.C (drawStr): rename size to siz.
4795 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4796 possibly fix a bug by not changing the pflags = flags to piflags =
4799 2000-05-05 Juergen Vigna <jug@sad.it>
4801 * src/insets/insetbib.C: moved using directive
4803 * src/ImportNoweb.C: small fix for being able to compile (missing
4806 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4808 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4809 to use clear, since we don't depend on this in the code. Add test
4812 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4814 * (various *.C files): add using std::foo directives to please dec
4817 * replace calls to string::clear() to string::erase() (Angus)
4819 * src/cheaders/cmath: modified to provide std::abs.
4821 2000-05-04 Juergen Vigna <jug@sad.it>
4823 * src/insets/insettext.C: Prepared all for inserting of multiple
4824 paragraphs. Still display stuff to do (alignment and other things),
4825 but I would like to use LyXText to do this when we cleaned out the
4826 table-support stuff.
4828 * src/insets/insettabular.C: Changed lot of stuff and added lots
4829 of functionality still a lot to do.
4831 * src/tabular.C: Various functions changed name and moved to be
4832 const functions. Added new Read and Write functions and changed
4833 lots of things so it works good with tabular-insets (also removed
4834 some stuff which is not needed anymore * hacks *).
4836 * src/lyxcursor.h: added operators == and != which just look if
4837 par and pos are (not) equal.
4839 * src/buffer.C (latexParagraphs): inserted this function to latex
4840 all paragraphs form par to endpar as then I can use this too for
4843 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4844 so that I can call this to from text insets with their own cursor.
4846 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4847 output off all paragraphs (because of the fix below)!
4849 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4850 the very last paragraph (this could be also the last paragraph of an
4853 * src/texrow.h: added rows() call which returns the count-variable.
4855 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4857 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4859 * lib/configure.m4: better autodetection of DocBook tools.
4861 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4863 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4865 * src/lyx_cb.C: add using std::reverse;
4867 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4870 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4871 selected files. Should fix repeated errors from generated files.
4873 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4875 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4877 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4878 the spellchecker popup.
4880 * lib/lyxrc.example: Removed the \number_inset section
4882 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4884 * src/insets/figinset.C (various): Use IsFileReadable() to make
4885 sure that the file actually exist. Relying on ghostscripts errors
4886 is a bad idea since they can lead to X server crashes.
4888 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4890 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4893 * lib/lyxrc.example: smallish typo in description of
4894 \view_dvi_paper_option
4896 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4899 * src/lyxfunc.C: doImportHelper to factor out common code of the
4900 various import methods. New functions doImportASCIIasLines,
4901 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4902 doImportLinuxDoc for the format specific parts.
4905 * buffer.C: Dispatch returns now a bool to indicate success
4908 * lyx_gui.C: Add getLyXView() for member access
4910 * lyx_main.C: Change logic for batch commands: First try
4911 Buffer::Dispatch (possibly without GUI), if that fails, use
4914 * lyx_main.C: Add support for --import command line switch.
4915 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4916 Available Formats: Everything accepted by 'buffer-import <format>'
4918 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4920 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4923 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4924 documents will be reformatted upon reentry.
4926 2000-04-27 Juergen Vigna <jug@sad.it>
4928 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4929 correctly only last pos this was a bug.
4931 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4933 * release of lyx-1.1.5pre1
4935 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4937 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4939 * src/menus.C: revert the change of naming (Figure->Graphic...)
4940 from 2000-04-11. It was incomplete and bad.
4942 * src/LColor.[Ch]: add LColor::depthbar.
4943 * src/text.C (GetVisibleRow): use it.
4945 * README: update the languages list.
4947 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4949 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4952 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4954 * README: remove sections that were just wrong.
4956 * src/text2.C (GetRowNearY): remove currentrow code
4958 * src/text.C (GetRow): remove currentrow code
4960 * src/screen.C (Update): rewritten a bit.
4961 (SmallUpdate): removed func
4963 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4965 (FullRebreak): return bool
4966 (currentrow): remove var
4967 (currentrow_y): ditto
4969 * src/lyxscreen.h (Draw): change arg to unsigned long
4970 (FitCursor): return bool
4971 (FitManualCursor): ditto
4972 (Smallpdate): remove func
4973 (first): change to unsigned long
4974 (DrawOneRow): change second arg to long (from long &)
4975 (screen_refresh_y): remove var
4976 (scree_refresh_row): ditto
4978 * src/lyxrow.h: change baseline to usigned int from unsigned
4979 short, this brings some implicit/unsigned issues out in the open.
4981 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4983 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4984 instead of smallUpdate.
4986 * src/lyxcursor.h: change y to unsigned long
4988 * src/buffer.h: don't call updateScrollbar after fitcursor
4990 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4991 where they are used. Removed "\\direction", this was not present
4992 in 1.1.4 and is already obsolete. Commented out some code that I
4993 believe to never be called.
4994 (runLiterate): don't call updateScrollbar after fitCursor
4996 (buildProgram): ditto
4999 * src/WorkArea.h (workWidth): change return val to unsigned
5002 (redraw): remove the button redraws
5003 (setScrollbarValue): change for scrollbar
5004 (getScrollbarValue): change for scrollbar
5005 (getScrollbarBounds): change for scrollbar
5007 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5008 (C_WorkArea_down_cb): removed func
5009 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5010 (resize): change for scrollbar
5011 (setScrollbar): ditto
5012 (setScrollbarBounds): ditto
5013 (setScrollbarIncrements): ditto
5014 (up_cb): removed func
5015 (down_cb): removed func
5016 (scroll_cb): change for scrollbar
5017 (work_area_handler): ditto
5019 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5020 when FitCursor did something.
5021 (updateScrollbar): some unsigned changes
5022 (downCB): removed func
5023 (scrollUpOnePage): removed func
5024 (scrollDownOnePage): remvoed func
5025 (workAreaMotionNotify): don't call screen->FitCursor but use
5026 fitCursor instead. and bool return val
5027 (workAreaButtonPress): ditto
5028 (workAreaButtonRelease): some unsigned changes
5029 (checkInsetHit): ditto
5030 (workAreaExpose): ditto
5031 (update): parts rewritten, comments about the signed char arg added
5032 (smallUpdate): removed func
5033 (cursorPrevious): call needed updateScrollbar
5036 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5039 * src/BufferView.[Ch] (upCB): removed func
5040 (downCB): removed func
5041 (smallUpdate): removed func
5043 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5045 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5046 currentrow, currentrow_y optimization. This did not help a lot and
5047 if we want to do this kind of optimization we should rather use
5048 cursor.row instead of the currentrow.
5050 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5051 buffer spacing and klyx spacing support.
5053 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5055 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5058 2000-04-26 Juergen Vigna <jug@sad.it>
5060 * src/insets/figinset.C: fixes to Lars sstream changes!
5062 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5064 * A lot of files: Added Ascii(ostream &) methods to all inset
5065 classes. Used when exporting to ASCII.
5067 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5068 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5071 * src/text2.C (ToggleFree): Disabled implicit word selection when
5072 there is a change in the language
5074 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5075 no output was generated for end-of-sentence inset.
5077 * src/insets/lyxinset.h
5080 * src/paragraph.C: Removed the insetnumber code
5082 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5084 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5086 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5087 no_babel and no_epsfig completely from the file.
5088 (parseSingleLyXformat2Token): add handling for per-paragraph
5089 spacing as written by klyx.
5091 * src/insets/figinset.C: applied patch by Andre. Made it work with
5094 2000-04-20 Juergen Vigna <jug@sad.it>
5096 * src/insets/insettext.C (cutSelection):
5097 (copySelection): Fixed with selection from right to left.
5098 (draw): now the rows are not recalculated at every draw.
5099 (computeTextRows): for now reset the inset-owner here (this is
5100 important for an undo or copy where the inset-owner is not set
5103 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5104 motion to the_locking_inset screen->first was forgotten, this was
5105 not important till we got multiline insets.
5107 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5109 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5110 code seems to be alright (it is code changed by Dekel, and the
5111 intent is indeed that all macros should be defined \protect'ed)
5113 * NEWS: a bit of reorganisation of the new user-visible features.
5115 2000-04-19 Juergen Vigna <jug@sad.it>
5117 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5118 position. Set the inset_owner of the used paragraph so that it knows
5119 that it is inside an inset. Fixed cursor handling with mouse and
5120 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5121 and cleanups to make TextInsets work better.
5123 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5124 Changed parameters of various functions and added LockInsetInInset().
5126 * src/insets/insettext.C:
5128 * src/insets/insetcollapsable.h:
5129 * src/insets/insetcollapsable.C:
5130 * src/insets/insetfoot.h:
5131 * src/insets/insetfoot.C:
5132 * src/insets/insetert.h:
5133 * src/insets/insetert.C: cleaned up the code so that it works now
5134 correctly with insettext.
5136 * src/insets/inset.C:
5137 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5138 that insets in insets are supported right.
5141 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5143 * src/paragraph.C: some small fixes
5145 * src/debug.h: inserted INSETS debug info
5147 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5148 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5150 * src/commandtags.h:
5151 * src/LyXAction.C: insert code for InsetTabular.
5153 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5154 not Button1MotionMask.
5155 (workAreaButtonRelease): send always a InsetButtonRelease event to
5157 (checkInsetHit): some setCursor fixes (always with insets).
5159 * src/BufferView2.C (lockInset): returns a bool now and extended for
5160 locking insets inside insets.
5161 (showLockedInsetCursor): it is important to have the cursor always
5162 before the locked inset.
5163 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5165 * src/BufferView.h: made lockInset return a bool.
5167 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5169 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5170 that is used also internally but can be called as public to have back
5171 a cursor pos which is not set internally.
5172 (SetCursorIntern): Changed to use above function.
5174 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5176 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5181 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5182 patches for things that should be in or should be changed.
5184 * src/* [insetfiles]: change "usigned char fragile" to bool
5185 fragile. There was only one point that could that be questioned
5186 and that is commented in formulamacro.C. Grep for "CHECK".
5188 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5189 (DeleteBuffer): take it out of CutAndPaste and make it static.
5191 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5193 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5194 output the spacing envir commands. Also the new commands used in
5195 the LaTeX output makes the result better.
5197 * src/Spacing.C (writeEnvirBegin): new method
5198 (writeEnvirEnd): new method
5200 2000-04-18 Juergen Vigna <jug@sad.it>
5202 * src/CutAndPaste.C: made textclass a static member of the class
5203 as otherwise it is not accesed right!!!
5205 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5207 * forms/layout_forms.fd
5208 * src/layout_forms.h
5209 * src/layout_forms.C (create_form_form_character)
5210 * src/lyx_cb.C (UserFreeFont)
5211 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5212 documents (in the layout->character popup).
5214 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5216 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5217 \spell_command was in fact not honored (from Kevin Atkinson).
5219 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5222 * src/lyx_gui.h: make lyxViews private (Angus)
5224 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5226 * src/mathed/math_write.C
5227 (MathMatrixInset::Write) Put \protect before \begin{array} and
5228 \end{array} if fragile
5229 (MathParInset::Write): Put \protect before \\ if fragile
5231 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5233 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5234 initialization if the LyXColorHandler must be done after the
5235 connections to the XServer has been established.
5237 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5238 get the background pixel from the lyxColorhandler so that the
5239 figures are rendered with the correct background color.
5240 (NextToken): removed functions.
5241 (GetPSSizes): use ifs >> string instead of NextToken.
5243 * src/Painter.[Ch]: the color cache moved out of this file.
5245 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5248 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5250 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5251 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5253 * src/BufferView.C (enterView): new func
5254 (leaveView): new func
5256 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5258 (leaveView): new func, undefines xterm cursor when approp.
5260 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5261 (AllowInput): delete the Workarea cursor handling from this func.
5263 * src/Painter.C (underline): draw a slimer underline in most cases.
5265 * src/lyx_main.C (error_handler): use extern "C"
5267 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5269 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5270 sent directly to me.
5272 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5273 to the list by Dekel.
5275 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5278 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5279 methods from lyx_cb.here.
5281 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5284 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5286 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5287 instead of using current_view directly.
5289 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5291 * src/LyXAction.C (init): add the paragraph-spacing command.
5293 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5295 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5297 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5298 different from the documents.
5300 * src/text.C (SetHeightOfRow): take paragraph spacing into
5301 account, paragraph spacing takes precedence over buffer spacing
5302 (GetVisibleRow): ditto
5304 * src/paragraph.C (writeFile): output the spacing parameter too.
5305 (validate): set the correct features if spacing is used in the
5307 (Clear): set spacing to default
5308 (MakeSameLayout): spacing too
5309 (HasSameLayout): spacing too
5310 (SetLayout): spacing too
5311 (TeXOnePar): output the spacing commands
5313 * src/lyxparagraph.h: added a spacing variable for use with
5314 per-paragraph spacing.
5316 * src/Spacing.h: add a Default spacing and a method to check if
5317 the current spacing is default. also added an operator==
5319 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5322 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5324 * src/lyxserver.C (callback): fix dispatch of functions
5326 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5327 printf() into lyxerr call.
5329 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5332 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5333 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5334 the "Float" from each of the subitems.
5335 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5337 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5338 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5339 documented the change so that the workaround can be nuked later.
5341 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5344 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5346 * src/buffer.C (getLatexName): ditto
5347 (setReadonly): ditto
5349 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5351 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5352 avoid some uses of current_view. Added also a bufferParams()
5353 method to get at this.
5355 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5357 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5359 * src/lyxparagraph.[Ch]: removed
5360 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5361 with operators used by lower_bound and
5362 upper_bound in InsetTable's
5363 Make struct InsetTable private again. Used matchpos.
5365 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5367 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5368 document, the language of existing text is changed (unless the
5369 document is multi-lingual)
5371 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5373 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5375 * A lot of files: A rewrite of the Right-to-Left support.
5377 2000-04-10 Juergen Vigna <jug@sad.it>
5379 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5380 misplaced cursor when inset in inset is locked.
5382 * src/insets/insettext.C (LocalDispatch): small fix so that a
5383 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5385 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5386 footnote font should be decreased in size twice when displaying.
5388 * src/insets/insettext.C (GetDrawFont): inserted this function as
5389 the drawing-font may differ from the real paragraph font.
5391 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5392 insets (inset in inset!).
5394 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5395 function here because we don't want footnotes inside footnotes.
5397 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5399 (init): now set the inset_owner in paragraph.C
5400 (LocalDispatch): added some resetPos() in the right position
5403 (pasteSelection): changed to use the new CutAndPaste-Class.
5405 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5406 which tells if it is allowed to insert another inset inside this one.
5408 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5409 SwitchLayoutsBetweenClasses.
5411 * src/text2.C (InsertInset): checking of the new paragraph-function
5413 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5414 is not needed anymore here!
5417 (PasteSelection): redone (also with #ifdef) so that now this uses
5418 the CutAndPaste-Class.
5419 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5422 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5423 from/to text/insets.
5425 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5426 so that the paragraph knows if it is inside an (text)-inset.
5427 (InsertFromMinibuffer): changed return-value to bool as now it
5428 may happen that an inset is not inserted in the paragraph.
5429 (InsertInsetAllowed): this checks if it is allowed to insert an
5430 inset in this paragraph.
5432 (BreakParagraphConservative):
5433 (BreakParagraph) : small change for the above change of the return
5434 value of InsertFromMinibuffer.
5436 * src/lyxparagraph.h: added inset_owner and the functions to handle
5437 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5439 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5441 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5442 functions from BufferView to BufferView::Pimpl to ease maintence.
5444 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5445 correctly. Also use SetCursorIntern instead of SetCursor.
5447 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5450 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5452 * src/WorkArea.C (belowMouse): manually implement below mouse.
5454 * src/*: Add "explicit" on several constructors, I added probably
5455 some unneeded ones. A couple of changes to code because of this.
5457 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5458 implementation and private parts from the users of BufferView. Not
5461 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5462 implementation and private parts from the users of LyXLex. Not
5465 * src/BufferView_pimpl.[Ch]: new files
5467 * src/lyxlex_pimpl.[Ch]: new files
5469 * src/LyXView.[Ch]: some inline functions move out-of-line
5471 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5473 * src/lyxparagraph.h: make struct InsetTable public.
5475 * src/support/lyxstring.h: change lyxstring::difference_type to be
5476 ptrdiff_t. Add std:: modifiers to streams.
5478 * src/font.C: include the <cctype> header, for islower() and
5481 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5483 * src/font.[Ch]: new files. Contains the metric functions for
5484 fonts, takes a LyXFont as parameter. Better separation of concepts.
5486 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5487 changes because of this.
5489 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5491 * src/*: compile with -Winline and move functions that don't
5494 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5497 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5499 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5500 (various files changed because of this)
5502 * src/Painter.C (text): fixed the drawing of smallcaps.
5504 * src/lyxfont.[Ch] (drawText): removed unused member func.
5507 * src/*.C: added needed "using" statements and "std::" qualifiers.
5509 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * src/*.h: removed all use of "using" from header files use
5512 qualifier std:: instead.
5514 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5516 * src/text.C (Backspace): some additional cleanups (we already
5517 know whether cursor.pos is 0 or not).
5519 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5520 automake does not provide one).
5522 * src/bmtable.h: replace C++ comments with C comments.
5524 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5526 * src/screen.C (ShowCursor): Change the shape of the cursor if
5527 the current language is not equal to the language of the document.
5528 (If the cursor change its shape unexpectedly, then you've found a bug)
5530 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5533 * src/insets/insetnumber.[Ch]: New files.
5535 * src/LyXAction.C (init)
5536 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5539 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5541 * src/lyxparagraph.h
5542 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5543 (the vector is kept sorted).
5545 * src/text.C (GetVisibleRow): Draw selection correctly when there
5546 is both LTR and RTL text.
5548 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5549 which is much faster.
5551 * src/text.C (GetVisibleRow and other): Do not draw the last space
5552 in a row if the direction of the last letter is not equal to the
5553 direction of the paragraph.
5555 * src/lyxfont.C (latexWriteStartChanges):
5556 Check that font language is not equal to basefont language.
5557 (latexWriteEndChanges): ditto
5559 * src/lyx_cb.C (StyleReset): Don't change the language while using
5560 the font-default command.
5562 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5563 empty paragraph before a footnote.
5565 * src/insets/insetcommand.C (draw): Increase x correctly.
5567 * src/screen.C (ShowCursor): Change cursor shape if
5568 current language != document language.
5570 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5572 2000-03-31 Juergen Vigna <jug@sad.it>
5574 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5575 (Clone): changed mode how the paragraph-data is copied to the
5576 new clone-paragraph.
5578 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5579 GetInset(pos) with no inset anymore there (in inset UNDO)
5581 * src/insets/insetcommand.C (draw): small fix as here x is
5582 incremented not as much as width() returns (2 before, 2 behind = 4)
5584 2000-03-30 Juergen Vigna <jug@sad.it>
5586 * src/insets/insettext.C (InsetText): small fix in initialize
5587 widthOffset (should not be done in the init() function)
5589 2000-03-29 Amir Karger <karger@lyx.org>
5591 * lib/examples/it_ItemizeBullets.lyx: translation by
5594 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5596 2000-03-29 Juergen Vigna <jug@sad.it>
5598 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5600 * src/insets/insetfoot.C (Clone): small change as for the below
5601 new init function in the text-inset
5603 * src/insets/insettext.C (init): new function as I've seen that
5604 clone did not copy the Paragraph-Data!
5605 (LocalDispatch): Added code so that now we have some sort of Undo
5606 functionality (well actually we HAVE Undo ;)
5608 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5610 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5612 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5615 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5617 * src/main.C: added a runtime check that verifies that the xforms
5618 header used when building LyX and the library used when running
5619 LyX match. Exit with a message if they don't match. This is a
5620 version number check only.
5622 * src/buffer.C (save): Don't allocate memory on the heap for
5623 struct utimbuf times.
5625 * *: some using changes, use iosfwd instead of the real headers.
5627 * src/lyxfont.C use char const * instead of string for the static
5628 strings. Rewrite some functions to use sstream.
5630 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5632 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5635 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5638 of Geodesy (from Martin Vermeer)
5640 * lib/layouts/svjour.inc: include file for the Springer svjour
5641 class. It can be used to support journals other than JoG.
5643 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5644 Miskiewicz <misiek@pld.org.pl>)
5645 * lib/reLyX/Makefile.am: ditto.
5647 2000-03-27 Juergen Vigna <jug@sad.it>
5649 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5650 also some modifications with operations on selected text.
5652 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5653 problems with clicking on insets (last famous words ;)
5655 * src/insets/insetcommand.C (draw):
5656 (width): Changed to have a bit of space before and after the inset so
5657 that the blinking cursor can be seen (otherwise it was hidden)
5659 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5661 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5662 would not be added to the link list when an installed gettext (not
5663 part of libc) is found.
5665 2000-03-24 Juergen Vigna <jug@sad.it>
5667 * src/insets/insetcollapsable.C (Edit):
5668 * src/mathed/formula.C (InsetButtonRelease):
5669 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5672 * src/BufferView.C (workAreaButtonPress):
5673 (workAreaButtonRelease):
5674 (checkInsetHit): Finally fixed the clicking on insets be handled
5677 * src/insets/insetert.C (Edit): inserted this call so that ERT
5678 insets work always with LaTeX-font
5680 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5682 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5683 caused lyx to startup with no GUI in place, causing in a crash
5684 upon startup when called with arguments.
5686 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5688 * src/FontLoader.C: better initialization of dummyXFontStruct.
5690 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5692 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5693 for linuxdoc and docbook import and export format options.
5695 * lib/lyxrc.example Example of default values for the previous flags.
5697 * src/lyx_cb.C Use those flags instead of the hardwired values for
5698 linuxdoc and docbook export.
5700 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5703 * src/menus.C Added menus entries for the new import/exports formats.
5705 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5707 * src/lyxrc.*: Added support for running without Gui
5710 * src/FontLoader.C: sensible defaults if no fonts are needed
5712 * src/lyx_cb.C: New function ShowMessage (writes either to the
5713 minibuffer or cout in case of no gui
5714 New function AskOverwrite for common stuff
5715 Consequently various changes to call these functions
5717 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5718 wild guess at sensible screen resolution when having no gui
5720 * src/lyxfont.C: no gui, no fonts... set some defaults
5722 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5724 * src/LColor.C: made the command inset background a bit lighter.
5726 2000-03-20 Hartmut Goebel <goebel@noris.net>
5728 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5729 stdstruct.inc. Koma-Script added some title elements which
5730 otherwise have been listed below "bibliography". This split allows
5731 adding title elements to where they belong.
5733 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5734 define the additional tilte elements and then include
5737 * many other layout files: changed to include stdtitle.inc just
5738 before stdstruct.inc.
5740 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5742 * src/buffer.C: (save) Added the option to store all backup files
5743 in a single directory
5745 * src/lyxrc.[Ch]: Added variable \backupdir_path
5747 * lib/lyxrc.example: Added descriptions of recently added variables
5749 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5750 bibtex inset, not closing the bibtex popup when deleting the inset)
5752 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5754 * src/lyx_cb.C: add a couple using directives.
5756 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5757 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5758 import based on the filename.
5760 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5761 file would be imported at start, if the filename where of a sgml file.
5763 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5765 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5767 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5768 * src/lyxfont.h Replaced the member variable bits.direction by the
5769 member variable lang. Made many changes in other files.
5770 This allows having a multi-lingual document
5772 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5773 that change the current language to <l>.
5774 Removed the command "font-rtl"
5776 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5777 format for Hebrew documents)
5779 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5780 When auto_mathmode is "true", pressing a digit key in normal mode
5781 will cause entering into mathmode.
5782 If auto_mathmode is "rtl" then this behavior will be active only
5783 when writing right-to-left text.
5785 * src/text2.C (InsertStringA) The string is inserted using the
5788 * src/paragraph.C (GetEndLabel) Gives a correct result for
5789 footnote paragraphs.
5791 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5793 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5795 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5796 front of PasteParagraph. Never insert a ' '. This should at least
5797 fix some cause for the segfaults that we have been experiencing,
5798 it also fixes backspace behaviour slightly. (Phu!)
5800 * src/support/lstrings.C (compare_no_case): some change to make it
5801 compile with gcc 2.95.2 and stdlibc++-v3
5803 * src/text2.C (MeltFootnoteEnvironment): change type o
5804 first_footnote_par_is_not_empty to bool.
5806 * src/lyxparagraph.h: make text private. Changes in other files
5808 (fitToSize): new function
5809 (setContentsFromPar): new function
5810 (clearContents): new function
5811 (SetChar): new function
5813 * src/paragraph.C (readSimpleWholeFile): deleted.
5815 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5816 the file, just use a simple string instead. Also read the file in
5817 a more maintainable manner.
5819 * src/text2.C (InsertStringA): deleted.
5820 (InsertStringB): deleted.
5822 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5824 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5825 RedoParagraphs from the doublespace handling part, just set status
5826 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5827 done, but perhaps not like this.)
5829 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5831 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5832 character when inserting an inset.
5834 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5836 * src/bufferparams.C (readLanguage): now takes "default" into
5839 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5840 also initialize the toplevel_keymap with the default bindings from
5843 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5845 * all files using lyxrc: have lyxrc as a real variable and not a
5846 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5849 * src/lyxrc.C: remove double call to defaultKeyBindings
5851 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5852 toolbar defauls using lyxlex. Remove enums, structs, functions
5855 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5856 toolbar defaults. Also store default keybindings in a map.
5858 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5859 storing the toolbar defaults without any xforms dependencies.
5861 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5862 applied. Changed to use iterators.
5864 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5866 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5867 systems that don't have LINGUAS set to begin with.
5869 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5871 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5872 the list by Dekel Tsur.
5874 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5876 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5877 * src/insets/form_graphics.C: ditto.
5879 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5881 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5883 * src/bufferparams.C (readLanguage): use the new language map
5885 * src/intl.C (InitKeyMapper): use the new language map
5887 * src/lyx_gui.C (create_forms): use the new language map
5889 * src/language.[Ch]: New files. Used for holding the information
5890 about each language. Now! Use this new language map enhance it and
5891 make it really usable for our needs.
5893 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5895 * screen.C (ShowCursor): Removed duplicate code.
5896 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5897 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5899 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5902 * src/text.C Added TransformChar method. Used for rendering Arabic
5903 text correctly (change the glyphs of the letter according to the
5904 position in the word)
5909 * src/lyxrc.C Added lyxrc command {language_command_begin,
5910 language_command_end,language_command_ltr,language_command_rtl,
5911 language_package} which allows the use of either arabtex or Omega
5914 * src/lyx_gui.C (init)
5916 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5917 to use encoding for menu fonts which is different than the encoding
5920 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5921 do not load the babel package.
5922 To write an English document with Hebrew/Arabic, change the document
5923 language to "english".
5925 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5926 (alphaCounter): changed to return char
5927 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5929 * lib/lyxrc.example Added examples for Hebrew/Arabic
5932 * src/layout.C Added layout command endlabeltype
5934 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5936 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5938 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5940 * src/mathed/math_delim.C (search_deco): return a
5941 math_deco_struct* instead of index.
5943 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5945 * All files with a USE_OSTREAM_ONLY within: removed all code that
5946 was unused when USE_OSTREAM_ONLY is defined.
5948 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5949 of any less. Removed header and using.
5951 * src/text.C (GetVisibleRow): draw the string "Page Break
5952 (top/bottom)" on screen when drawing a pagebreak line.
5954 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5956 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5958 * src/mathed/math_macro.C (draw): do some cast magic.
5961 * src/mathed/math_defs.h: change byte* argument to byte const*.
5963 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5965 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5966 know it is right to return InsetFoot* too, but cxx does not like
5969 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5971 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5973 * src/mathed/math_delim.C: change == to proper assignment.
5975 2000-03-09 Juergen Vigna <jug@sad.it>
5977 * src/insets/insettext.C (setPos): fixed various cursor positioning
5978 problems (via mouse and cursor-keys)
5979 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5980 inset (still a small display problem but it works ;)
5982 * src/insets/insetcollapsable.C (draw): added button_top_y and
5983 button_bottom_y to have correct values for clicking on the inset.
5985 * src/support/lyxalgo.h: commented out 'using std::less'
5987 2000-03-08 Juergen Vigna <jug@sad.it>
5989 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5990 Button-Release event closes as it is alos the Release-Event
5993 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5995 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5997 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5998 can add multiple spaces in Scrap (literate programming) styles...
5999 which, by the way, is how I got hooked on LyX to begin with.
6001 * src/mathed/formula.C (Write): Added dummy variable to an
6002 inset::Latex() call.
6003 (Latex): Add free_spacing boolean to inset::Latex()
6005 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6007 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6008 virtual function to include the free_spacing boolean from
6009 the containing paragraph's style.
6011 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6012 Added free_spacing boolean arg to match inset.h
6014 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6015 Added free_spacing boolean arg to match inset.h
6017 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6018 Added free_spacing boolean and made sure that if in a free_spacing
6019 paragraph, that we output normal space if there is a protected space.
6021 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6022 Added free_spacing boolean arg to match inset.h
6024 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6025 Added free_spacing boolean arg to match inset.h
6027 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6028 Added free_spacing boolean arg to match inset.h
6030 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6031 Added free_spacing boolean arg to match inset.h
6033 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6034 Added free_spacing boolean arg to match inset.h
6036 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6037 free_spacing boolean arg to match inset.h
6039 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6040 Added free_spacing boolean arg to match inset.h
6042 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6043 Added free_spacing boolean arg to match inset.h
6045 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6046 Added free_spacing boolean arg to match inset.h
6048 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6049 Added free_spacing boolean arg to match inset.h
6051 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6052 Added free_spacing boolean arg to match inset.h
6054 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6055 free_spacing boolean arg to match inset.h
6057 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6058 free_spacing boolean arg to match inset.h
6060 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6061 ignore free_spacing paragraphs. The user's spaces are left
6064 * src/text.C (InsertChar): Fixed the free_spacing layout
6065 attribute behavior. Now, if free_spacing is set, you can
6066 add multiple spaces in a paragraph with impunity (and they
6067 get output verbatim).
6068 (SelectSelectedWord): Added dummy argument to inset::Latex()
6071 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6074 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6075 paragraph layouts now only input a simple space instead.
6076 Special character insets don't make any sense in free-spacing
6079 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6080 hard-spaces in the *input* file to simple spaces if the layout
6081 is free-spacing. This converts old files which had to have
6082 hard-spaces in free-spacing layouts where a simple space was
6084 (writeFileAscii): Added free_spacing check to pass to the newly
6085 reworked inset::Latex(...) methods. The inset::Latex() code
6086 ensures that hard-spaces in free-spacing paragraphs get output
6087 as spaces (rather than "~").
6089 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6091 * src/mathed/math_delim.C (draw): draw the empty placeholder
6092 delims with a onoffdash line.
6093 (struct math_deco_compare): struct that holds the "functors" used
6094 for the sort and the binary search in math_deco_table.
6095 (class init_deco_table): class used for initial sort of the
6097 (search_deco): use lower_bound to do a binary search in the
6100 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6102 * src/lyxrc.C: a small secret thingie...
6104 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6105 and to not flush the stream as often as it used to.
6107 * src/support/lyxalgo.h: new file
6108 (sorted): template function used for checking if a sequence is
6109 sorted or not. Two versions with and without user supplied
6110 compare. Uses same compare as std::sort.
6112 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6113 it and give warning on lyxerr.
6115 (struct compare_tags): struct with function operators used for
6116 checking if sorted, sorting and lower_bound.
6117 (search_kw): use lower_bound instead of manually implemented
6120 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6122 * src/insets/insetcollapsable.h: fix Clone() declaration.
6123 * src/insets/insetfoot.h: ditto.
6125 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6127 2000-03-08 Juergen Vigna <jug@sad.it>
6129 * src/insets/lyxinset.h: added owner call which tells us if
6130 this inset is inside another inset. Changed also the return-type
6131 of Editable to an enum so it tells clearer what the return-value is.
6133 * src/insets/insettext.C (computeTextRows): fixed computing of
6134 textinsets which split automatically on more rows.
6136 * src/insets/insetert.[Ch]: changed this to be of BaseType
6139 * src/insets/insetfoot.[Ch]: added footnote inset
6141 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6142 collapsable insets (like footnote, ert, ...)
6144 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6146 * src/lyxdraw.h: remvoe file
6148 * src/lyxdraw.C: remove file
6150 * src/insets/insettext.C: added <algorithm>.
6152 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6154 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6155 (matrix_cb): case MM_OK use string stream
6157 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6160 * src/mathed/math_macro.C (draw): use string stream
6161 (Metrics): use string stream
6163 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6164 directly to the ostream.
6166 * src/vspace.C (asString): use string stream.
6167 (asString): use string stream
6168 (asLatexString): use string stream
6170 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6171 setting Spacing::Other.
6173 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6174 sprintf when creating the stretch vale.
6176 * src/text2.C (alphaCounter): changed to return a string and to
6177 not use a static variable internally. Also fixed a one-off bug.
6178 (SetCounter): changed the drawing of the labels to use string
6179 streams instead of sprintf.
6181 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6182 manipulator to use a scheme that does not require library support.
6183 This is also the way it is done in the new GNU libstdc++. Should
6184 work with DEC cxx now.
6186 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6188 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6189 end. This fixes a bug.
6191 * src/mathed (all files concerned with file writing): apply the
6192 USE_OSTREAM_ONLY changes to mathed too.
6194 * src/support/DebugStream.h: make the constructor explicit.
6196 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6197 count and ostream squashed.
6199 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6201 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6203 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6204 ostringstream uses STL strings, and we might not.
6206 * src/insets/insetspecialchar.C: add using directive.
6207 * src/insets/insettext.C: ditto.
6209 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6211 * lib/layouts/seminar.layout: feeble attempt at a layout for
6212 seminar.cls, far from completet and could really use some looking
6213 at from people used to write layout files.
6215 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6216 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6217 a lot nicer and works nicely with ostreams.
6219 * src/mathed/formula.C (draw): a slightly different solution that
6220 the one posted to the list, but I think this one works too. (font
6221 size wrong in headers.)
6223 * src/insets/insettext.C (computeTextRows): some fiddling on
6224 Jürgens turf, added some comments that he should read.
6226 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6227 used and it gave compiler warnings.
6228 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6231 * src/lyx_gui.C (create_forms): do the right thing when
6232 show_banner is true/false.
6234 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6235 show_banner is false.
6237 * most file writing files: Now use iostreams to do almost all of
6238 the writing. Also instead of passing string &, we now use
6239 stringstreams. mathed output is still not adapted to iostreams.
6240 This change can be turned off by commenting out all the occurences
6241 of the "#define USE_OSTREAM_ONLY 1" lines.
6243 * src/WorkArea.C (createPixmap): don't output debug messages.
6244 (WorkArea): don't output debug messages.
6246 * lib/lyxrc.example: added a comment about the new variable
6249 * development/Code_rules/Rules: Added some more commente about how
6250 to build class interfaces and on how better encapsulation can be
6253 2000-03-03 Juergen Vigna <jug@sad.it>
6255 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6256 automatically with the width of the LyX-Window
6258 * src/insets/insettext.C (computeTextRows): fixed update bug in
6259 displaying text-insets (scrollvalues where not initialized!)
6261 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6264 id in the check of the result from lower_bound is not enough since
6265 lower_bound can return last too, and then res->id will not be a
6268 * all insets and some code that use them: I have conditionalized
6269 removed the Latex(string & out, ...) this means that only the
6270 Latex(ostream &, ...) will be used. This is a work in progress to
6271 move towards using streams for all output of files.
6273 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6276 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6278 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6279 routine (this fixes bug where greek letters were surrounded by too
6282 * src/support/filetools.C (findtexfile): change a bit the search
6283 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6284 no longer passed to kpsewhich, we may have to change that later.
6286 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6287 warning options to avoid problems with X header files (from Angus
6289 * acinclude.m4: regenerated.
6291 2000-03-02 Juergen Vigna <jug@sad.it>
6293 * src/insets/insettext.C (WriteParagraphData): Using the
6294 par->writeFile() function for writing paragraph-data.
6295 (Read): Using buffer->parseSingleLyXformat2Token()-function
6296 for parsing paragraph data!
6298 * src/buffer.C (readLyXformat2): removed all parse data and using
6299 the new parseSingleLyXformat2Token()-function.
6300 (parseSingleLyXformat2Token): added this function to parse (read)
6301 lyx-file-format (this is called also from text-insets now!)
6303 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6305 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6308 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6309 directly instead of going through a func. One very bad thing: a
6310 static LyXFindReplace, but I don't know where to place it.
6312 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6313 string instead of char[]. Also changed to static.
6314 (GetSelectionOrWordAtCursor): changed to static inline
6315 (SetSelectionOverLenChars): ditto.
6317 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6318 current_view and global variables. both classes has changed names
6319 and LyXFindReplace is not inherited from SearchForm.
6321 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6322 fl_form_search form.
6324 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6326 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6328 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6329 bound (from Kayvan).
6331 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6333 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6335 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6337 * some things that I should comment but the local pub says head to
6340 * comment out all code that belongs to the Roff code for Ascii
6341 export of tables. (this is unused)
6343 * src/LyXView.C: use correct type for global variable
6344 current_layout. (LyXTextClass::size_type)
6346 * some code to get the new insetgraphics closer to working I'd be
6347 grateful for any help.
6349 * src/BufferView2.C (insertInset): use the return type of
6350 NumberOfLayout properly. (also changes in other files)
6352 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6353 this as a test. I want to know what breaks because of this.
6355 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6357 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6359 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6360 to use a \makebox in the label, this allows proper justification
6361 with out using protected spaces or multiple hfills. Now it is
6362 "label" for left justified, "\hfill label\hfill" for center, and
6363 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6364 should be changed accordingly.
6366 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6368 * src/lyxtext.h: change SetLayout() to take a
6369 LyXTextClass::size_type instead of a char (when there is more than
6370 127 layouts in a class); also change type of copylayouttype.
6371 * src/text2.C (SetLayout): ditto.
6372 * src/LyXView.C (updateLayoutChoice): ditto.
6374 * src/LaTeX.C (scanLogFile): errors where the line number was not
6375 given just after the '!'-line were ignored (from Dekel Tsur).
6377 * lib/lyxrc.example: fix description of \date_insert_format
6379 * lib/layouts/llncs.layout: new layout, contributed by Martin
6382 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6384 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6385 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6386 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6387 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6388 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6389 paragraph.C, text.C, text2.C)
6391 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6393 * src/insets/insettext.C (LocalDispatch): remove extra break
6396 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6397 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6399 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6400 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6402 * src/insets/insetbib.h: move InsetBibkey::Holder and
6403 InsetCitation::Holder in public space.
6405 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6407 * src/insets/insettext.h: small change to get the new files from
6408 Juergen to compile (use "string", not "class string").
6410 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6411 const & as parameter to LocalDispatch, use LyXFont const & as
6412 paramter to some other func. This also had impacto on lyxinsets.h
6413 and the two mathed insets.
6415 2000-02-24 Juergen Vigna <jug@sad.it>
6418 * src/commandtags.h:
6420 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6424 * src/BufferView2.C: added/updated code for various inset-functions
6426 * src/insets/insetert.[Ch]: added implementation of InsetERT
6428 * src/insets/insettext.[Ch]: added implementation of InsetText
6430 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6431 (draw): added preliminary code for inset scrolling not finshed yet
6433 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6434 as it is in lyxfunc.C now
6436 * src/insets/lyxinset.h: Added functions for text-insets
6438 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6440 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6441 BufferView and reimplement the list as a queue put inside its own
6444 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6446 * several files: use the new interface to the "updateinsetlist"
6448 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6450 (work_area_handler): call BufferView::trippleClick on trippleclick.
6452 * src/BufferView.C (doubleClick): new function, selects word on
6454 (trippleClick): new function, selects line on trippleclick.
6456 2000-02-22 Allan Rae <rae@lyx.org>
6458 * lib/bind/xemacs.bind: buffer-previous not supported
6460 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6462 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6465 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6467 * src/bufferlist.C: get rid of current_view from this file
6469 * src/spellchecker.C: get rid of current_view from this file
6471 * src/vspace.C: get rid of current_view from this file
6472 (inPixels): added BufferView parameter for this func
6473 (asLatexCommand): added a BufferParams for this func
6475 * src/text.C src/text2.C: get rid of current_view from these
6478 * src/lyxfont.C (getFontDirection): move this function here from
6481 * src/bufferparams.C (getDocumentDirection): move this function
6484 * src/paragraph.C (getParDirection): move this function here from
6486 (getLetterDirection): ditto
6488 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6490 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6491 resize due to wrong pixmap beeing used. Also took the opurtunity
6492 to make the LyXScreen stateless on regard to WorkArea and some
6493 general cleanup in the same files.
6495 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6497 * src/Makefile.am: add missing direction.h
6499 * src/PainterBase.h: made the width functions const.
6501 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6504 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6506 * src/insets/insetlatexaccent.C (draw): make the accents draw
6507 better, at present this will only work well with iso8859-1.
6509 * several files: remove the old drawing code, now we use the new
6512 * several files: remove support for mono_video, reverse_video and
6515 2000-02-17 Juergen Vigna <jug@sad.it>
6517 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6518 int ** as we have to return the pointer, otherwise we have only
6519 NULL pointers in the returning function.
6521 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6523 * src/LaTeX.C (operator()): quote file name when running latex.
6525 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6527 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6528 (bubble tip), this removes our special handling of this.
6530 * Remove all code that is unused now that we have the new
6531 workarea. (Code that are not active when NEW_WA is defined.)
6533 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6535 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6537 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6538 nonexisting layout; correctly redirect obsoleted layouts.
6540 * lib/lyxrc.example: document \view_dvi_paper_option
6542 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6545 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6546 (PreviewDVI): handle the view_dvi_paper_option variable.
6547 [Both from Roland Krause]
6549 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6551 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6552 char const *, int, LyXFont)
6553 (text(int, int, string, LyXFont)): ditto
6555 * src/text.C (InsertCharInTable): attempt to fix the double-space
6556 feature in tables too.
6557 (BackspaceInTable): ditto.
6558 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6560 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6562 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6564 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6565 newly found text in textcache to this.
6566 (buffer): set the owner of the text put into the textcache to 0
6568 * src/insets/figinset.C (draw): fixed the drawing of figures with
6571 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6572 drawing of mathframe, hfills, protected space, table lines. I have
6573 now no outstanding drawing problems with the new Painter code.
6575 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6577 * src/PainterBase.C (ellipse, circle): do not specify the default
6580 * src/LColor.h: add using directive.
6582 * src/Painter.[Ch]: change return type of methods from Painter& to
6583 PainterBase&. Add a using directive.
6585 * src/WorkArea.C: wrap xforms callbacks in C functions
6588 * lib/layouts/foils.layout: font fix and simplifications from Carl
6591 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6593 * a lot of files: The Painter, LColor and WorkArea from the old
6594 devel branch has been ported to lyx-devel. Some new files and a
6595 lot of #ifdeffed code. The new workarea is enabled by default, but
6596 if you want to test the new Painter and LColor you have to compile
6597 with USE_PAINTER defined (do this in config.h f.ex.) There are
6598 still some rought edges, and I'd like some help to clear those
6599 out. It looks stable (loads and displays the Userguide very well).
6602 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6604 * src/buffer.C (pop_tag): revert to the previous implementation
6605 (use a global variable for both loops).
6607 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6609 * src/lyxrc.C (LyXRC): change slightly default date format.
6611 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6612 there is an English text with a footnote that starts with a Hebrew
6613 paragraph, or vice versa.
6614 (TeXFootnote): ditto.
6616 * src/text.C (LeftMargin): allow for negative values for
6617 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6620 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6621 for input encoding (cyrillic)
6623 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6625 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6628 * src/toolbar.C (set): ditto
6629 * src/insets/insetbib.C (create_form_citation_form): ditto
6631 * lib/CREDITS: added Dekel Tsur.
6633 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6634 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6635 hebrew supports files from Dekel Tsur.
6637 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6638 <tzafrir@technion.ac.il>
6640 * src/lyxrc.C: put \date_insert_format at the right place.
6642 * src/buffer.C (makeLaTeXFile): fix the handling of
6643 BufferParams::sides when writing out latex files.
6645 * src/BufferView2.C: add a "using" directive.
6647 * src/support/lyxsum.C (sum): when we use lyxstring,
6648 ostringstream::str needs an additional .c_str().
6650 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6652 * src/support/filetools.C (ChangeExtension): patch from Etienne
6655 * src/TextCache.C (show): remove const_cast and make second
6656 parameter non-const LyXText *.
6658 * src/TextCache.h: use non const LyXText in show.
6660 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6663 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6665 * src/support/lyxsum.C: rework to be more flexible.
6667 * several places: don't check if a pointer is 0 if you are going
6670 * src/text.C: remove some dead code.
6672 * src/insets/figinset.C: remove some dead code
6674 * src/buffer.C: move the BufferView funcs to BufferView2.C
6675 remove all support for insetlatexdel
6676 remove support for oldpapersize stuff
6677 made some member funcs const
6679 * src/kbmap.C: use a std::list to store the bindings in.
6681 * src/BufferView2.C: new file
6683 * src/kbsequence.[Ch]: new files
6685 * src/LyXAction.C + others: remove all trace of buffer-previous
6687 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6688 only have one copy in the binary of this table.
6690 * hebrew patch: moved some functions from LyXText to more
6691 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6693 * several files: remove support for XForms older than 0.88
6695 remove some #if 0 #endif code
6697 * src/TextCache.[Ch]: new file. Holds the textcache.
6699 * src/BufferView.C: changes to use the new TextCache interface.
6700 (waitForX): remove the now unused code.
6702 * src/BackStack.h: remove some commented code
6704 * lib/bind/emacs.bind: remove binding for buffer-previous
6706 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6708 * applied the hebrew patch.
6710 * src/lyxrow.h: make sure that all Row variables are initialized.
6712 * src/text2.C (TextHandleUndo): comment out a delete, this might
6713 introduce a memory leak, but should also help us to not try to
6714 read freed memory. We need to look at this one.
6716 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6717 (LyXParagraph): initalize footnotekind.
6719 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6720 forgot this when applying the patch. Please heed the warnings.
6722 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6723 (aka. reformat problem)
6725 * src/bufferlist.C (exists): made const, and use const_iterator
6726 (isLoaded): new func.
6727 (release): use std::find to find the correct buffer.
6729 * src/bufferlist.h: made getState a const func.
6730 made empty a const func.
6731 made exists a const func.
6734 2000-02-01 Juergen Vigna <jug@sad.it>
6736 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6738 * po/it.po: updated a bit the italian po file and also changed the
6739 'file nuovo' for newfile to 'filenuovo' without a space, this did
6742 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6743 for the new insert_date command.
6745 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6746 from jdblair, to insert a date into the current text conforming to
6747 a strftime format (for now only considering the locale-set and not
6748 the document-language).
6750 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6752 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6753 Bounds Read error seen by purify. The problem was that islower is
6754 a macros which takes an unsigned char and uses it as an index for
6755 in array of characters properties (and is thus subject to the
6759 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6760 correctly the paper sides radio buttons.
6761 (UpdateDocumentButtons): ditto.
6763 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6765 * src/kbmap.C (getsym + others): change to return unsigned int,
6766 returning a long can give problems on 64 bit systems. (I assume
6767 that int is 32bit on 64bit systems)
6769 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6771 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6772 LyXLookupString to be zero-terminated. Really fixes problems seen
6775 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6777 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6778 write a (char*)0 to the lyxerr stream.
6780 * src/lastfiles.C: move algorithm before the using statemets.
6782 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6784 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6785 complains otherwise).
6786 * src/table.C: ditto
6788 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6791 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6792 that I removed earlier... It is really needed.
6794 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6796 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6798 * INSTALL: update xforms home page URL.
6800 * lib/configure.m4: fix a bug with unreadable layout files.
6802 * src/table.C (calculate_width_of_column): add "using std::max"
6805 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6807 * several files: marked several lines with "DEL LINE", this is
6808 lines that can be deleted without changing anything.
6809 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6810 checks this anyway */
6813 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6815 * src/DepTable.C (update): add a "+" at the end when the checksum
6816 is different. (debugging string only)
6818 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6819 the next inset to not be displayed. This should also fix the list
6820 of labels in the "Insert Crossreference" dialog.
6822 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6824 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6825 when regex was not found.
6827 * src/support/lstrings.C (lowercase): use handcoded transform always.
6830 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6831 old_cursor.par->prev could be 0.
6833 * several files: changed post inc/dec to pre inc/dec
6835 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6836 write the lastfiles to file.
6838 * src/BufferView.C (buffer): only show TextCache info when debugging
6840 (resizeCurrentBuffer): ditto
6841 (workAreaExpose): ditto
6843 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6845 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6847 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6848 a bit better by removing the special case for \i and \j.
6850 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6852 * src/lyx_main.C (easyParse): remove test for bad comand line
6853 options, since this broke all xforms-related parsing.
6855 * src/kbmap.C (getsym): set return type to unsigned long, as
6856 declared in header. On an alpha, long is _not_ the same as int.
6858 * src/support/LOstream.h: add a "using std::flush;"
6860 * src/insets/figinset.C: ditto.
6862 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * src/bufferlist.C (write): use blinding fast file copy instead of
6865 "a char at a time", now we are doing it the C++ way.
6867 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6868 std::list<int> instead.
6869 (addpidwait): reflect move to std::list<int>
6870 (sigchldchecker): ditto
6872 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6875 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6876 that obviously was wrong...
6878 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6879 c, this avoids warnings with purify and islower.
6881 * src/insets/figinset.C: rename struct queue to struct
6882 queue_element and rewrite to use a std::queue. gsqueue is now a
6883 std::queue<queue_element>
6884 (runqueue): reflect move to std::queue
6887 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6888 we would get "1" "0" instead of "true" "false. Also make the tostr
6891 2000-01-21 Juergen Vigna <jug@sad.it>
6893 * src/buffer.C (writeFileAscii): Disabled code for special groff
6894 handling of tabulars till I fix this in table.C
6896 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6898 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6900 * src/support/lyxlib.h: ditto.
6902 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6905 and 'j' look better. This might fix the "macron" bug that has been
6908 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6909 functions as one template function. Delete the old versions.
6911 * src/support/lyxsum.C: move using std::ifstream inside
6914 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6917 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6919 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6921 * src/insets/figinset.C (InitFigures): use new instead of malloc
6922 to allocate memory for figures and bitmaps.
6923 (DoneFigures): use delete[] instead of free to deallocate memory
6924 for figures and bitmaps.
6925 (runqueue): use new to allocate
6926 (getfigdata): use new/delete[] instead of malloc/free
6927 (RegisterFigure): ditto
6929 * some files: moved some declarations closer to first use, small
6930 whitespace changes use preincrement instead of postincrement where
6931 it does not make a difference.
6933 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6934 step on the way to use stl::containers for key maps.
6936 * src/bufferlist.h: add a typedef for const_iterator and const
6937 versions of begin and end.
6939 * src/bufferlist.[Ch]: change name of member variable _state to
6940 state_. (avoid reserved names)
6942 (getFileNames): returns the filenames of the buffers in a vector.
6944 * configure.in (ALL_LINGUAS): added ro
6946 * src/support/putenv.C: new file
6948 * src/support/mkdir.C: new file
6950 2000-01-20 Allan Rae <rae@lyx.org>
6952 * lib/layouts/IEEEtran.layout: Added several theorem environments
6954 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6955 couple of minor additions.
6957 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6958 (except for those in footnotes of course)
6960 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6962 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6964 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6965 std::sort and std::lower_bound instead of qsort and handwritten
6967 (struct compara): struct that holds the functors used by std::sort
6968 and std::lower_bound in MathedLookupBOP.
6970 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6972 * src/support/LAssert.h: do not do partial specialization. We do
6975 * src/support/lyxlib.h: note that lyx::getUserName() and
6976 lyx::date() are not in use right now. Should these be suppressed?
6978 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6979 (makeLinuxDocFile): do not put date and user name in linuxdoc
6982 * src/support/lyxlib.h (kill): change first argument to long int,
6983 since that's what solaris uses.
6985 * src/support/kill.C (kill): fix declaration to match prototype.
6987 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6988 actually check whether namespaces are supported. This is not what
6991 * src/support/lyxsum.C: add a using directive.
6993 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6995 * src/support/kill.C: if we have namespace support we don't have
6996 to include lyxlib.h.
6998 * src/support/lyxlib.h: use namespace lyx if supported.
7000 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7002 * src/support/date.C: new file
7004 * src/support/chdir.C: new file
7006 * src/support/getUserName.C: new file
7008 * src/support/getcwd.C: new file
7010 * src/support/abort.C: new file
7012 * src/support/kill.C: new file
7014 * src/support/lyxlib.h: moved all the functions in this file
7015 insede struct lyx. Added also kill and abort to this struct. This
7016 is a way to avoid the "kill is not defined in <csignal>", we make
7017 C++ wrappers for functions that are not ANSI C or ANSI C++.
7019 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7020 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7021 lyx it has been renamed to sum.
7023 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7025 * src/text.C: add using directives for std::min and std::max.
7027 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7029 * src/texrow.C (getIdFromRow): actually return something useful in
7030 id and pos. Hopefully fixes the bug with positionning of errorbox
7033 * src/lyx_main.C (easyParse): output an error and exit if an
7034 incorrect command line option has been given.
7036 * src/spellchecker.C (ispell_check_word): document a memory leak.
7038 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7039 where a "struct utimbuf" is allocated with "new" and deleted with
7042 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7044 * src/text2.C (CutSelection): don't delete double spaces.
7045 (PasteSelection): ditto
7046 (CopySelection): ditto
7048 * src/text.C (Backspace): don't delete double spaces.
7050 * src/lyxlex.C (next): fix a bug that were only present with
7051 conformant std::istream::get to read comment lines, use
7052 std::istream::getline instead. This seems to fix the problem.
7054 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7057 allowed to insert space before space" editing problem. Please read
7058 commends at the beginning of the function. Comments about usage
7061 * src/text.C (InsertChar): fix for the "not allowed to insert
7062 space before space" editing problem.
7064 * src/text2.C (DeleteEmptyParagraphMechanism): when
7065 IsEmptyTableRow can only return false this last "else if" will
7066 always be a no-op. Commented out.
7068 * src/text.C (RedoParagraph): As far as I can understand tmp
7069 cursor is not really needed.
7071 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7072 present it could only return false anyway.
7073 (several functions): Did something not so smart...added a const
7074 specifier on a lot of methods.
7076 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7077 and add a tmp->text.resize. The LyXParagraph constructor does the
7079 (BreakParagraphConservative): ditto
7081 * src/support/path.h (Path): add a define so that the wrong usage
7082 "Path("/tmp") will be flagged as a compilation error:
7083 "`unnamed_Path' undeclared (first use this function)"
7085 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7087 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7088 which was bogus for several reasons.
7090 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7094 * autogen.sh: do not use "type -path" (what's that anyway?).
7096 * src/support/filetools.C (findtexfile): remove extraneous space
7097 which caused a kpsewhich warning (at least with kpathsea version
7100 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7102 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7104 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7106 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7108 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7110 * src/paragraph.C (BreakParagraph): do not reserve space on text
7111 if we don't need to (otherwise, if pos_end < pos, we end up
7112 reserving huge amounts of memory due to bad unsigned karma).
7113 (BreakParagraphConservative): ditto, although I have not seen
7114 evidence the bug can happen here.
7116 * src/lyxparagraph.h: add a using std::list.
7118 2000-01-11 Juergen Vigna <jug@sad.it>
7120 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7123 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7125 * src/vc-backend.C (doVCCommand): change to be static and take one
7126 more parameter: the path to chdir too be fore executing the command.
7127 (retrive): new function equiv to "co -r"
7129 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7130 file_not_found_hook is true.
7132 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7134 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7135 if a file is readwrite,readonly...anything else.
7137 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7139 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7140 (CreatePostscript): name change from MenuRunDVIPS (or something)
7141 (PreviewPostscript): name change from MenuPreviewPS
7142 (PreviewDVI): name change from MenuPreviewDVI
7144 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7145 \view_pdf_command., \pdf_to_ps_command
7147 * lib/configure.m4: added search for PDF viewer, and search for
7148 PDF to PS converter.
7149 (lyxrc.defaults output): add \pdflatex_command,
7150 \view_pdf_command and \pdf_to_ps_command.
7152 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7154 * src/bufferlist.C (write): we don't use blocksize for anything so
7157 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7159 * src/support/block.h: disable operator T* (), since it causes
7160 problems with both compilers I tried. See comments in the file.
7162 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7165 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7166 variable LYX_DIR_10x to LYX_DIR_11x.
7168 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7170 * INSTALL: document --with-lyxname.
7173 * configure.in: new configure flag --with-lyxname which allows to
7174 choose the name under which lyx is installed. Default is "lyx", of
7175 course. It used to be possible to do this with --program-suffix,
7176 but the later has in fact a different meaning for autoconf.
7178 * src/support/lstrings.h (lstrchr): reformat a bit.
7180 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7181 * src/mathed/math_defs.h: ditto.
7183 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7186 true, decides if we create a backup file or not when saving. New
7187 tag and variable \pdf_mode, defaults to false. New tag and
7188 variable \pdflatex_command, defaults to pdflatex. New tag and
7189 variable \view_pdf_command, defaults to xpdf. New tag and variable
7190 \pdf_to_ps_command, defaults to pdf2ps.
7192 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7194 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7195 does not have a BufferView.
7196 (unlockInset): ditto + don't access the_locking_inset if the
7197 buffer does not have a BufferView.
7199 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7200 certain circumstances so that we don't continue a keyboard
7201 operation long after the key was released. Try f.ex. to load a
7202 large document, press PageDown for some seconds and then release
7203 it. Before this change the document would contine to scroll for
7204 some time, with this change it stops imidiatly.
7206 * src/support/block.h: don't allocate more space than needed. As
7207 long as we don't try to write to the arr[x] in a array_type arr[x]
7208 it is perfectly ok. (if you write to it you might segfault).
7209 added operator value_type*() so that is possible to pass the array
7210 to functions expecting a C-pointer.
7212 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7215 * intl/*: updated to gettext 0.10.35, tried to add our own
7216 required modifications. Please verify.
7218 * po/*: updated to gettext 0.10.35, tried to add our own required
7219 modifications. Please verify.
7221 * src/support/lstrings.C (tostr): go at fixing the problem with
7222 cxx and stringstream. When stringstream is used return
7223 oss.str().c_str() so that problems with lyxstring and basic_string
7224 are avoided. Note that the best solution would be for cxx to use
7225 basic_string all the way, but it is not conformant yet. (it seems)
7227 * src/lyx_cb.C + other files: moved several global functions to
7228 class BufferView, some have been moved to BufferView.[Ch] others
7229 are still located in lyx_cb.C. Code changes because of this. (part
7230 of "get rid of current_view project".)
7232 * src/buffer.C + other files: moved several Buffer functions to
7233 class BufferView, the functions are still present in buffer.C.
7234 Code changes because of this.
7236 * config/lcmessage.m4: updated to most recent. used when creating
7239 * config/progtest.m4: updated to most recent. used when creating
7242 * config/gettext.m4: updated to most recent. applied patch for
7245 * config/gettext.m4.patch: new file that shows what changes we
7246 have done to the local copy of gettext.m4.
7248 * config/libtool.m4: new file, used in creation of acinclude.m4
7250 * config/lyxinclude.m4: new file, this is the lyx created m4
7251 macros, used in making acinclude.m4.
7253 * autogen.sh: GNU m4 discovered as a separate task not as part of
7254 the lib/configure creation.
7255 Generate acinlucde from files in config. Actually cat
7256 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7257 easier to upgrade .m4 files that really are external.
7259 * src/Spacing.h: moved using std::istringstream to right after
7260 <sstream>. This should fix the problem seen with some compilers.
7262 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7264 * src/lyx_cb.C: began some work to remove the dependency a lot of
7265 functions have on BufferView::text, even if not really needed.
7266 (GetCurrentTextClass): removed this func, it only hid the
7269 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7270 forgot this in last commit.
7272 * src/Bullet.C (bulletEntry): use static char const *[] for the
7273 tables, becuase of this the return arg had to change to string.
7275 (~Bullet): removed unneeded destructor
7277 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7278 (insetSleep): moved from Buffer
7279 (insetWakeup): moved from Buffer
7280 (insetUnlock): moved from Buffer
7282 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7283 from Buffer to BufferView.
7285 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7287 * config/ltmain.sh: updated to version 1.3.4 of libtool
7289 * config/ltconfig: updated to version 1.3.4 of libtool
7291 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7294 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7295 Did I get that right?
7297 * src/lyxlex.h: add a "using" directive or two.
7298 * src/Spacing.h: ditto.
7299 * src/insets/figinset.C: ditto.
7300 * src/support/filetools.C: ditto.
7301 * src/support/lstrings.C: ditto.
7302 * src/BufferView.C: ditto.
7303 * src/bufferlist.C: ditto.
7304 * src/lyx_cb.C: ditto.
7305 * src/lyxlex.C: ditto.
7307 * NEWS: add some changes for 1.1.4.
7309 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * src/BufferView.C: first go at a TextCache to speed up switching
7314 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7316 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7317 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7318 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7319 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7322 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7323 members of the struct are correctly initialized to 0 (detected by
7325 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7326 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7328 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7329 pidwait, since it was allocated with "new". This was potentially
7330 very bad. Thanks to Michael Schmitt for running purify for us.
7333 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7337 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7339 1999-12-30 Allan Rae <rae@lyx.org>
7341 * lib/templates/IEEEtran.lyx: minor change
7343 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7344 src/mathed/formula.C (LocalDispatch): askForText changes
7346 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7347 know when a user has cancelled input. Fixes annoying problems with
7348 inserting labels and version control.
7350 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7352 * src/support/lstrings.C (tostr): rewritten to use strstream and
7355 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7357 * src/support/filetools.C (IsFileWriteable): use fstream to check
7358 (IsDirWriteable): use fileinfo to check
7360 * src/support/filetools.h (FilePtr): whole class deleted
7362 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7364 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7366 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7368 * src/bufferlist.C (write): use ifstream and ofstream instead of
7371 * src/Spacing.h: use istrstream instead of sscanf
7373 * src/mathed/math_defs.h: change first arg to istream from FILE*
7375 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7377 * src/mathed/math_parser.C: have yyis to be an istream
7378 (LexGetArg): use istream (yyis)
7380 (mathed_parse): ditto
7381 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7383 * src/mathed/formula.C (Read): rewritten to use istream
7385 * src/mathed/formulamacro.C (Read): rewritten to use istream
7387 * src/lyxlex.h (~LyXLex): deleted desturctor
7388 (getStream): new function, returns an istream
7389 (getFile): deleted funtion
7390 (IsOK): return is.good();
7392 * src/lyxlex.C (LyXLex): delete file and owns_file
7393 (setFile): open an filebuf and assign that to a istream instead of
7395 (setStream): new function, takes an istream as arg.
7396 (setFile): deleted function
7397 (EatLine): rewritten us use istream instead of FILE*
7401 * src/table.C (LyXTable): use istream instead of FILE*
7402 (Read): rewritten to take an istream instead of FILE*
7404 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7406 * src/buffer.C (Dispatch): remove an extraneous break statement.
7408 * src/support/filetools.C (QuoteName): change to do simple
7409 'quoting'. More work is necessary. Also changed to do nothing
7410 under emx (needs fix too).
7411 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7413 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7414 config.h.in to the AC_DEFINE_UNQUOTED() call.
7415 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7416 needs char * as argument (because Solaris 7 declares it like
7419 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7420 remove definition of BZERO.
7422 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7424 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7425 defined, "lyxregex.h" if not.
7427 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7429 (REGEX): new variable that is set to regex.c lyxregex.h when
7430 AM_CONDITIONAL USE_REGEX is set.
7431 (libsupport_la_SOURCES): add $(REGEX)
7433 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7436 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7439 * configure.in: add call to LYX_REGEX
7441 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7442 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7444 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7446 * lib/bind/fi_menus.bind: new file, from
7447 pauli.virtanen@saunalahti.fi.
7449 * src/buffer.C (getBibkeyList): pass the parameter delim to
7450 InsetInclude::getKeys and InsetBibtex::getKeys.
7452 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7453 is passed to Buffer::getBibkeyList
7455 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7456 instead of the hardcoded comma.
7458 * src/insets/insetbib.C (getKeys): make sure that there are not
7459 leading blanks in bibtex keys. Normal latex does not care, but
7460 harvard.sty seems to dislike blanks at the beginning of citation
7461 keys. In particular, the retturn value of the function is
7463 * INSTALL: make it clear that libstdc++ is needed and that gcc
7464 2.7.x probably does not work.
7466 * src/support/filetools.C (findtexfile): make debug message go to
7468 * src/insets/insetbib.C (getKeys): ditto
7470 * src/debug.C (showTags): make sure that the output is correctly
7473 * configure.in: add a comment for TWO_COLOR_ICON define.
7475 * acconfig.h: remove all the entries that already defined in
7476 configure.in or acinclude.m4.
7478 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7479 to avoid user name, date and copyright.
7481 1999-12-21 Juergen Vigna <jug@sad.it>
7483 * src/table.C (Read): Now read bogus row format informations
7484 if the format is < 5 so that afterwards the table can
7485 be read by lyx but without any format-info. Fixed the
7486 crash we experienced when not doing this.
7488 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7490 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7491 (RedoDrawingOfParagraph): ditto
7492 (RedoParagraphs): ditto
7493 (RemoveTableRow): ditto
7495 * src/text.C (Fill): rename arg paperwidth -> paper_width
7497 * src/buffer.C (insertLyXFile): rename var filename -> fname
7498 (writeFile): rename arg filename -> fname
7499 (writeFileAscii): ditto
7500 (makeLaTeXFile): ditto
7501 (makeLinuxDocFile): ditto
7502 (makeDocBookFile): ditto
7504 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7507 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7509 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7512 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7513 compiled by a C compiler not C++.
7515 * src/layout.h (LyXTextClass): added typedef for const_iterator
7516 (LyXTextClassList): added typedef for const_iterator + member
7517 functions begin and end.
7519 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7520 iterators to fill the choice_class.
7521 (updateLayoutChoice): rewritten to use iterators to fill the
7522 layoutlist in the toolbar.
7524 * src/BufferView.h (BufferView::work_area_width): removed unused
7527 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7529 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7530 (sgmlCloseTag): ditto
7532 * src/support/lstrings.h: return type of countChar changed to
7535 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7536 what version of this func to use. Also made to return unsigned int.
7538 * configure.in: call LYX_STD_COUNT
7540 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7541 conforming std::count.
7543 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7545 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7546 and a subscript would give bad display (patch from Dekel Tsur
7547 <dekel@math.tau.ac.il>).
7549 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7551 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7554 * src/chset.h: add a few 'using' directives
7556 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7557 triggered when no buffer is active
7559 * src/layout.C: removed `break' after `return' in switch(), since
7562 * src/lyx_main.C (init): make sure LyX can be ran in place even
7563 when libtool has done its magic with shared libraries. Fix the
7564 test for the case when the system directory has not been found.
7566 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7567 name for the latex file.
7568 (MenuMakeHTML): ditto
7570 * src/buffer.h: add an optional boolean argument, which is passed
7573 1999-12-20 Allan Rae <rae@lyx.org>
7575 * lib/templates/IEEEtran.lyx: small correction and update.
7577 * configure.in: Attempted to use LYX_PATH_HEADER
7579 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7581 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7582 input from JMarc. Now use preprocessor to find the header.
7583 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7584 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7585 LYX_STL_STRING_FWD. See comments in file.
7587 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7589 * The global MiniBuffer * minibuffer variable is dead.
7591 * The global FD_form_main * fd_form_main variable is dead.
7593 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7595 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7597 * src/table.h: add the LOstream.h header
7598 * src/debug.h: ditto
7600 * src/LyXAction.h: change the explaination of the ReadOnly
7601 attribute: is indicates that the function _can_ be used.
7603 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7606 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7608 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7614 * src/paragraph.C (GetWord): assert on pos>=0
7617 * src/support/lyxstring.C: condition the use of an invariant on
7619 * src/support/lyxstring.h: ditto
7621 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7622 Use LAssert.h instead of plain assert().
7624 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7626 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7627 * src/support/filetools.C: ditto
7629 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7632 * INSTALL: document the new configure flags
7634 * configure.in: suppress --with-debug; add --enable-assertions
7636 * acinclude.m4: various changes in alignment of help strings.
7638 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7640 * src/kbmap.C: commented out the use of the hash map in kb_map,
7641 beginning of movement to a stl::container.
7643 * several files: removed code that was not in effect when
7644 MOVE_TEXT was defined.
7646 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7647 for escaping should not be used. We can discuss if the string
7648 should be enclosed in f.ex. [] instead of "".
7650 * src/trans_mgr.C (insert): use the new returned value from
7651 encodeString to get deadkeys and keymaps done correctly.
7653 * src/chset.C (encodeString): changed to return a pair, to tell
7654 what to use if we know the string.
7656 * src/lyxscreen.h (fillArc): new function.
7658 * src/FontInfo.C (resize): rewritten to use more std::string like
7659 structore, especially string::replace.
7661 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7664 * configure.in (chmod +x some scripts): remove config/gcc-hack
7666 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7668 * src/buffer.C (writeFile): change once again the top comment in a
7669 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7670 instead of an hardcoded version number.
7671 (makeDocBookFile): ditto
7673 * src/version.h: add new define LYX_DOCVERSION
7675 * po/de.po: update from Pit Sütterlin
7676 * lib/bind/de_menus.bind: ditto.
7678 * src/lyxfunc.C (Dispatch): call MenuExport()
7679 * src/buffer.C (Dispatch): ditto
7681 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7682 LyXFunc::Dispatch().
7683 (MenuExport): new function, moved from
7684 LyXFunc::Dispatch().
7686 * src/trans_mgr.C (insert): small cleanup
7687 * src/chset.C (loadFile): ditto
7689 * lib/kbd/iso8859-1.cdef: add missing backslashes
7691 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7693 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7694 help with placing the manually drawn accents better.
7696 (Draw): x2 and hg changed to float to minimize rounding errors and
7697 help place the accents better.
7699 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7700 unsigned short to char is just wrong...cast the char to unsigned
7701 char instead so that the two values can compare sanely. This
7702 should also make the display of insetlatexaccents better and
7703 perhaps also some other insets.
7705 (lbearing): new function
7708 1999-12-15 Allan Rae <rae@lyx.org>
7710 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7711 header that provides a wrapper around the very annoying SGI STL header
7714 * src/support/lyxstring.C, src/LString.h:
7715 removed old SGI-STL-compatability attempts.
7717 * configure.in: Use LYX_STL_STRING_FWD.
7719 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7720 stl_string_fwd.h is around and try to determine it's location.
7721 Major improvement over previous SGI STL 3.2 compatability.
7722 Three small problems remain with this function due to my zero
7723 knowledge of autoconf. JMarc and lgb see the comments in the code.
7725 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * src/broken_const.h, config/hack-gcc, config/README: removed
7729 * configure.in: remove --with-gcc-hack option; do not call
7732 * INSTALL: remove documentation of --with-broken-const and
7735 * acconfig.h: remove all trace of BROKEN_CONST define
7737 * src/buffer.C (makeDocBookFile): update version number in output
7739 (SimpleDocBookOnePar): fix an assert when trying to a character
7740 access beyond string length
7743 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7745 * po/de.po: fix the Export menu
7747 * lyx.man: update the description of -dbg
7749 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7750 (commandLineHelp): updated
7751 (easyParse): show list of available debug levels if -dbg is passed
7754 * src/Makefile.am: add debug.C
7756 * src/debug.h: moved some code to debug.C
7758 * src/debug.C: new file. Contains code to set and show debug
7761 * src/layout.C: remove 'break' after 'continue' in switch
7762 statements, since these cannot be reached.
7764 1999-12-13 Allan Rae <rae@lyx.org>
7766 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7767 (in_word_set): hash() -> math_hash()
7769 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7771 * acconfig.h: Added a test for whether we are using exceptions in the
7772 current compilation run. If so USING_EXCEPTIONS is defined.
7774 * config.in: Check for existance of stl_string_fwd.h
7775 * src/LString.h: If compiling --with-included-string and SGI's
7776 STL version 3.2 is present (see above test) we need to block their
7777 forward declaration of string and supply a __get_c_string().
7778 However, it turns out this is only necessary if compiling with
7779 exceptions enabled so I've a bit more to add yet.
7781 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7782 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7783 src/support/LRegex.h, src/undo.h:
7784 Shuffle the order of the included files a little to ensure that
7785 LString.h gets included before anything that includes stl_string_fwd.h
7787 * src/support/lyxstring.C: We need to #include LString.h instead of
7788 lyxstring.h to get the necessary definition of __get_c_string.
7789 (__get_c_string): New function. This is defined static just like SGI's
7790 although why they need to do this I'm not sure. Perhaps it should be
7791 in lstrings.C instead.
7793 * lib/templates/IEEEtran.lyx: New template file.
7795 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7797 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7798 * intl/Makefile.in (MKINSTALLDIRS): ditto
7800 * src/LyXAction.C (init): changed to hold the LFUN data in a
7801 automatic array in stead of in callso to newFunc, this speeds up
7802 compilation a lot. Also all the memory used by the array is
7803 returned when the init is completed.
7805 * a lot of files: compiled with -Wold-style-cast, changed most of
7806 the reported offenders to C++ style casts. Did not change the
7807 offenders in C files.
7809 * src/trans.h (Match): change argument type to unsigned int.
7811 * src/support/DebugStream.C: fix some types on the streambufs so
7812 that it works on a conforming implementation.
7814 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7816 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7818 * src/support/lyxstring.C: remove the inline added earlier since
7819 they cause a bunch of unsatisfied symbols when linking with dec
7820 cxx. Cxx likes to have the body of inlines at the place where they
7823 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7824 accessing negative bounds in array. This fixes the crash when
7825 inserting accented characters.
7826 * src/trans.h (Match): ditto
7828 * src/buffer.C (Dispatch): since this is a void, it should not try
7829 to return anything...
7831 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7833 * src/buffer.h: removed the two friends from Buffer. Some changes
7834 because of this. Buffer::getFileName and Buffer::setFileName
7835 renamed to Buffer::fileName() and Buffer::fileName(...).
7837 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7839 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7840 and Buffer::update(short) to BufferView. This move is currently
7841 controlled by a define MOVE_TEXT, this will be removed when all
7842 shows to be ok. This move paves the way for better separation
7843 between buffer contents and buffer view. One side effect is that
7844 the BufferView needs a rebreak when swiching buffers, if we want
7845 to avoid this we can add a cache that holds pointers to LyXText's
7846 that is not currently in use.
7848 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7851 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7853 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7855 * lyx_main.C: new command line option -x (or --execute) and
7856 -e (or --export). Now direct conversion from .lyx to .tex
7857 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7858 Unfortunately, X is still needed and the GUI pops up during the
7861 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7863 * src/Spacing.C: add a using directive to bring stream stuff into
7865 * src/paragraph.C: ditto
7866 * src/buffer.C: ditto
7868 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7869 from Lars' announcement).
7871 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7872 example files from Tino Meinen.
7874 1999-12-06 Allan Rae <rae@lyx.org>
7876 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7878 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * src/support/lyxstring.C: added a lot of inline for no good
7883 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7884 latexWriteEndChanges, they were not used.
7886 * src/layout.h (operator<<): output operator for PageSides
7888 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7890 * some example files: loaded in LyX 1.0.4 and saved again to update
7891 certain constructs (table format)
7893 * a lot of files: did the change to use fstream/iostream for all
7894 writing of files. Done with a close look at Andre Poenitz's patch.
7896 * some files: whitespace changes.
7898 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7901 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7902 architecture, we provide our own. It is used unconditionnally, but
7903 I do not think this is a performance problem. Thanks to Angus
7904 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7905 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7907 (GetInset): use my_memcpy.
7911 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7912 it is easier to understand, but it uses less TeX-only constructs now.
7914 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7915 elements contain spaces
7917 * lib/configure: regenerated
7919 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7920 elements contain spaces; display the list of programs that are
7923 * autogen.sh: make sure lib/configure is executable
7925 * lib/examples/*: rename the tutorial examples to begin with the
7926 two-letters language code.
7928 * src/lyxfunc.C (getStatus): do not query current font if no
7931 * src/lyx_cb.C (RunScript): use QuoteName
7932 (MenuRunDvips): ditto
7933 (PrintApplyCB): ditto
7935 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7936 around argument, so that it works well with the current shell.
7937 Does not work properly with OS/2 shells currently.
7939 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7940 * src/LyXSendto.C (SendtoApplyCB): ditto
7941 * src/lyxfunc.C (Dispatch): ditto
7942 * src/buffer.C (runLaTeX): ditto
7943 (runLiterate): ditto
7944 (buildProgram): ditto
7946 * src/lyx_cb.C (RunScript): ditto
7947 (MenuMakeLaTeX): ditto
7949 * src/buffer.h (getLatexName): new method
7951 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7953 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7955 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7956 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7957 (create_math_panel): ditto
7959 * src/lyxfunc.C (getStatus): re-activate the code which gets
7960 current font and cursor; add test for export to html.
7962 * src/lyxrc.C (read): remove unreachable break statements; add a
7965 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7967 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7969 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7970 introduced by faulty regex.
7971 * src/buffer.C: ditto
7972 * src/lastfiles.C: ditto
7973 * src/paragraph.C: ditto
7974 * src/table.C: ditto
7975 * src/vspace.C: ditto
7976 * src/insets/figinset.C: ditto
7977 Note: most of these is absolutely harmless, except the one in
7978 src/mathed formula.C.
7980 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7982 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7983 operation, yielding correct results for the reLyX command.
7985 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7987 * src/support/filetools.C (ExpandPath): removed an over eager
7989 (ReplaceEnvironmentPath): ditto
7991 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7992 shows that we are doing something fishy in our code...
7996 * src/lyxrc.C (read): use a double switch trick to get more help
7997 from the compiler. (the same trick is used in layout.C)
7998 (write): new function. opens a ofstream and pass that to output
7999 (output): new function, takes a ostream and writes the lyxrc
8000 elemts to it. uses a dummy switch to make sure no elements are
8003 * src/lyxlex.h: added a struct pushpophelper for use in functions
8004 with more than one exit point.
8006 * src/lyxlex.[Ch] (GetInteger): made it const
8010 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8012 * src/layout.[hC] : LayoutTags splitted into several enums, new
8013 methods created, better error handling cleaner use of lyxlex. Read
8016 * src/bmtable.[Ch]: change some member prototypes because of the
8017 image const changes.
8019 * commandtags.h, src/LyXAction.C (init): new function:
8020 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8021 This file is not read automatically but you can add \input
8022 preferences to your lyxrc if you want to. We need to discuss how
8025 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8026 in .aux, also remove .bib and .bst files from dependencies when
8029 * src/BufferView.C, src/LyXView.C: add const_cast several places
8030 because of changes to images.
8032 * lib/images/*: same change as for images/*
8034 * lib/lyxrc.example: Default for accept_compound is false not no.
8036 * images/*: changed to be const, however I have som misgivings
8037 about this change so it might be changed back.
8039 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8041 * lib/configure, po/POTFILES.in: regenerated
8043 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8045 * config/lib_configure.m4: removed
8047 * lib/configure.m4: new file (was config/lib_configure.m4)
8049 * configure.in: do not test for rtti, since we do not use it.
8051 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8054 doubling of allocated space scheme. This makes it faster for large
8055 strings end to use less memory for small strings. xtra rememoved.
8057 * src/insets/figinset.C (waitalarm): commented out.
8058 (GhostscriptMsg): use static_cast
8059 (GhostscriptMsg): use new instead of malloc to allocate memory for
8060 cmap. also delete the memory after use.
8062 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8064 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8065 for changes in bibtex database or style.
8066 (runBibTeX): remove all .bib and .bst files from dep before we
8068 (run): use scanAuc in when dep file already exist.
8070 * src/DepTable.C (remove_files_with_extension): new method
8073 * src/DepTable.[Ch]: made many of the methods const.
8075 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8077 * src/bufferparams.C: make sure that the default textclass is
8078 "article". It used to be the first one by description order, but
8079 now the first one is "docbook".
8081 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8082 string; call Debug::value.
8083 (easyParse): pass complete argument to setDebuggingLevel().
8085 * src/debug.h (value): fix the code that parses debug levels.
8087 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8090 * src/LyXAction.C: use Debug::ACTION as debug channel.
8092 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8094 * NEWS: updated for the future 1.1.3 release.
8096 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8097 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8098 it should. This is of course a controversial change (since many
8099 people will find that their lyx workscreen is suddenly full of
8100 red), but done for the sake of correctness.
8102 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8103 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8105 * src/insets/inseterror.h, src/insets/inseturl.h,
8106 src/insets/insetinfo.h, src/insets/figinset.h,
8107 src/mathed/formulamacro.h, src/mathed/math_macro.h
8108 (EditMessage): add a missing const and add _() to make sure that
8111 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8112 src/insets/insetbib.C, src/support/filetools.C: add `using'
8115 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8116 doing 'Insert index of last word' at the beginning of a paragraph.
8118 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8120 * several files: white-space changes.
8122 * src/mathed/formula.C: removed IsAlpha and IsDigit
8124 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8125 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8128 * src/insets/figinset.C (GetPSSizes): don't break when
8129 "EndComments" is seen. But break when a boundingbox is read.
8131 * all classes inherited from Inset: return value of Clone
8132 changed back to Inset *.
8134 * all classes inherited form MathInset: return value of Clone
8135 changed back to MathedInset *.
8137 * src/insets/figinset.C (runqueue): use a ofstream to output the
8138 gs/ps file. Might need some setpresicion or setw. However I can
8139 see no problem with the current code.
8140 (runqueue): use sleep instead of the alarm/signal code. I just
8141 can't see the difference.
8143 * src/paragraph.C (LyXParagraph): reserve space in the new
8144 paragraph and resize the inserted paragraph to just fit.
8146 * src/lyxfunc.h (operator|=): added operator for func_status.
8148 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8149 check for readable file.
8151 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8152 check for readable file.
8153 (MenuMakeLinuxDoc): ditto
8154 (MenuMakeDocBook): ditto
8155 (MenuMakeAscii): ditto
8156 (InsertAsciiFile): split the test for openable and readable
8158 * src/bmtable.C (draw_bitmaptable): use
8159 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8161 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8162 findtexfile from LaTeX to filetools.
8164 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8165 instead of FilePtr. Needs to be verified by a literate user.
8167 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8169 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8170 (EditMessage): likewise.
8172 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8173 respectively as \textasciitilde and \textasciicircum.
8175 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * src/support/lyxstring.h: made the methods that take iterators
8180 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8181 (regexMatch): made is use the real regex class.
8183 * src/support/Makefile.am: changed to use libtool
8185 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8187 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8189 (MathIsInset ++): changed several macros to be inline functions
8192 * src/mathed/Makefile.am: changed to use libtool
8194 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8196 * src/insets/inset* : Clone changed to const and return type is
8197 the true insettype not just Inset*.
8199 * src/insets/Makefile.am: changed to use libtool
8201 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8203 * src/undo.[Ch] : added empty() and changed some of the method
8206 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8208 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8209 setID use block<> for the bullets array, added const several places.
8211 * src/lyxfunc.C (getStatus): new function
8213 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8214 LyXAction, added const to several funtions.
8216 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8217 a std::map, and to store the dir items in a vector.
8219 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8222 * src/LyXView.[Ch] + other files : changed currentView to view.
8224 * src/LyXAction.[Ch] : ported from the old devel branch.
8226 * src/.cvsignore: added .libs and a.out
8228 * configure.in : changes to use libtool.
8230 * acinclude.m4 : inserted libtool.m4
8232 * .cvsignore: added libtool
8234 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8236 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8237 file name in insets and mathed directories (otherwise the
8238 dependency is not taken in account under cygwin).
8240 * src/text2.C (InsertString[AB]): make sure that we do not try to
8241 read characters past the string length.
8243 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8245 * lib/doc/LaTeXConfig.lyx.in,
8246 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8248 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8249 file saying who created them and when this heppened; this is
8250 useless and annoys tools like cvs.
8252 * lib/layouts/g-brief-{en,de}.layout,
8253 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8254 from Thomas Hartkens <thomas@hartkens.de>.
8256 * src/{insets,mathed}/Makefile.am: do not declare an empty
8257 LDFLAGS, so that it can be set at configure time (useful on Irix
8260 * lib/reLyX/configure.in: make sure that the prefix is set
8261 correctly in LYX_DIR.
8263 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8265 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8266 be used by 'command-sequence' this allows to bind a key to a
8267 sequence of LyX-commands
8268 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8270 * src/LyXAction.C: add "command-sequence"
8272 * src/LyXFunction.C: handling of "command-sequence"
8274 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8275 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8277 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8279 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8281 * src/buffer.C (writeFile): Do not output a comment giving user
8282 and date at the beginning of a .lyx file. This is useless and
8283 annoys cvs anyway; update version number to 1.1.
8285 * src/Makefile.am (LYX_DIR): add this definition, so that a
8286 default path is hardcoded in LyX.
8288 * configure.in: Use LYX_GNU_GETTEXT.
8290 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8291 AM_GNU_GETTEXT with a bug fixed.
8293 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8295 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8297 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8298 which is used to point to LyX data is now LYX_DIR_11x.
8300 * lyx.man: convert to a unix text file; small updates.
8302 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8304 * src/support/LSubstring.[Ch]: made the second arg of most of the
8305 constructors be a const reference.
8307 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8310 * src/support/lyxstring.[Ch] (swap): added missing member function
8311 and specialization of swap(str, str);
8313 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8315 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8316 trace of the old one.
8318 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8319 put the member definitions in undo.C.
8321 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8322 NEW_TEXT and have now only code that was included when this was
8325 * src/intl.C (LCombo): use static_cast
8327 (DispatchCallback): ditto
8329 * src/definitions.h: removed whole file
8331 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8333 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8334 parsing and stores in a std:map. a regex defines the file format.
8335 removed unneeded members.
8337 * src/bufferparams.h: added several enums from definitions.h here.
8338 Removed unsused destructor. Changed some types to use proper enum
8339 types. use block to have the temp_bullets and user_defined_bullets
8340 and to make the whole class assignable.
8342 * src/bufferparams.C (Copy): removed this functions, use a default
8345 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8348 * src/buffer.C (readLyXformat2): commend out all that have with
8349 oldpapersize to do. also comment out all that hve to do with
8350 insetlatex and insetlatexdel.
8351 (setOldPaperStuff): commented out
8353 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8355 * src/LyXAction.C: remove use of inset-latex-insert
8357 * src/mathed/math_panel.C (button_cb): use static_cast
8359 * src/insets/Makefile.am (insets_o_SOURCES): removed
8362 * src/support/lyxstring.C (helper): use the unsigned long
8363 specifier, UL, instead of a static_cast.
8365 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8367 * src/support/block.h: new file. to be used as a c-style array in
8368 classes, so that the class can be assignable.
8370 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8373 NULL, make sure to return an empty string (it is not possible to
8374 set a string to NULL).
8376 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8378 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8380 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8382 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8383 link line, so that Irix users (for example) can set it explicitely to
8386 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8387 it can be overidden at make time (static or dynamic link, for
8390 * src/vc-backend.C, src/LaTeXFeatures.h,
8391 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8392 statements to bring templates to global namespace.
8394 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8396 * src/support/lyxstring.C (operator[] const): make it standard
8399 * src/minibuffer.C (Init): changed to reflect that more
8400 information is given from the lyxvc and need not be provided here.
8402 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8404 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8406 * src/LyXView.C (UpdateTimerCB): use static_cast
8407 (KeyPressMask_raw_callback): ditto
8409 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8410 buffer_, a lot of changes because of this. currentBuffer() ->
8411 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8412 also changes to other files because of this.
8414 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8416 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8417 have no support for RCS and partial support for CVS, will be
8420 * src/insets/ several files: changes because of function name
8421 changes in Bufferview and LyXView.
8423 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8425 * src/support/LSubstring.[Ch]: new files. These implement a
8426 Substring that can be very convenient to use. i.e. is this
8428 string a = "Mary had a little sheep";
8429 Substring(a, "sheep") = "lamb";
8430 a is now "Mary has a little lamb".
8432 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8433 out patterns and subpatterns of strings. It is used by LSubstring
8434 and also by vc-backend.C
8436 * src/support/lyxstring.C: went over all the assertions used and
8437 tried to correct the wrong ones and flag which of them is required
8438 by the standard. some bugs found because of this. Also removed a
8439 couple of assertions.
8441 * src/support/Makefile.am (libsupport_a_SOURCES): added
8442 LSubstring.[Ch] and LRegex.[Ch]
8444 * src/support/FileInfo.h: have struct stat buf as an object and
8445 not a pointer to one, some changes because of this.
8447 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8448 information in layout when adding the layouts preamble to the
8451 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8454 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8455 because of bug in OS/2.
8457 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8459 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8460 \verbatim@font instead of \ttfamily, so that it can be redefined.
8462 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8463 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8464 src/layout.h, src/text2.C: add 'using' directive to bring the
8465 STL templates we need from the std:: namespace to the global one.
8466 Needed by DEC cxx in strict ansi mode.
8468 * src/support/LIstream.h,src/support/LOstream.h,
8469 src/support/lyxstring.h,src/table.h,
8470 src/lyxlookup.h: do not include <config.h> in header
8471 files. This should be done in the .C files only.
8473 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8477 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8479 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8480 from Kayvan to fix the tth invokation.
8482 * development/lyx.spec.in: updates from Kayvan to reflect the
8483 changes of file names.
8485 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/text2.C (InsertStringB): use std::copy
8488 (InsertStringA): use std::copy
8490 * src/bufferlist.C: use a vector to store the buffers in. This is
8491 an internal change and should not affect any other thing.
8493 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8496 * src/text.C (Fill): fix potential bug, one off bug.
8498 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8500 * src/Makefile.am (lyx_main.o): add more files it depends on.
8502 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8504 * src/support/lyxstring.C: use size_t for the reference count,
8505 size, reserved memory and xtra.
8506 (internal_compare): new private member function. Now the compare
8507 functions should work for std::strings that have embedded '\0'
8509 (compare): all compare functions rewritten to use
8512 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8514 * src/support/lyxstring.C (compare): pass c_str()
8515 (compare): pass c_str
8516 (compare): pass c_str
8518 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8520 * src/support/DebugStream.C: <config.h> was not included correctly.
8522 * lib/configure: forgot to re-generate it :( I'll make this file
8523 auto generated soon.
8525 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8527 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8530 * src/support/lyxstring.C: some changes from length() to rep->sz.
8531 avoids a function call.
8533 * src/support/filetools.C (SpaceLess): yet another version of the
8534 algorithm...now per Jean-Marc's suggestions.
8536 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8538 * src/layout.C (less_textclass_desc): functor for use in sorting
8540 (LyXTextClass::Read): sort the textclasses after reading.
8542 * src/support/filetools.C (SpaceLess): new version of the
8543 SpaceLess functions. What problems does this one give? Please
8546 * images/banner_bw.xbm: made the arrays unsigned char *
8548 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8550 * src/support/lyxstring.C (find): remove bogus assertion in the
8551 two versions of find where this has not been done yet.
8553 * src/support/lyxlib.h: add missing int return type to
8556 * src/menus.C (ShowFileMenu): disable exporting to html if no
8557 html export command is present.
8559 * config/lib_configure.m4: add a test for an HTML converter. The
8560 programs checked for are, in this order: tth, latex2html and
8563 * lib/configure: generated from config/lib_configure.m4.
8565 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8566 html converter. The parameters are now passed through $$FName and
8567 $$OutName, instead of standard input/output.
8569 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8571 * lib/lyxrc.example: update description of \html_command.
8572 add "quotes" around \screen_font_xxx font setting examples to help
8573 people who use fonts with spaces in their names.
8575 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8577 * Distribution files: updates for v1.1.2
8579 * src/support/lyxstring.C (find): remove bogus assert and return
8580 npos for the same condition.
8582 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8584 * added patch for OS/2 from SMiyata.
8586 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8588 * src/text2.C (CutSelection): make space_wrapped a bool
8589 (CutSelection): dont declare int i until we have to.
8590 (alphaCounter): return a char const *.
8592 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8594 * src/support/syscall.C (Systemcalls::kill):
8595 src/support/filetools.C (PutEnv, PutEnvPath):
8596 src/lyx_cb.C (addNewlineAndDepth):
8597 src/FontInfo.C (FontInfo::resize): condition some #warning
8598 directives with WITH_WARNINGS.
8601 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8603 * src/layout.[Ch] + several files: access to class variables
8604 limited and made accessor functions instead a lot of code changed
8605 becuase of this. Also instead of returning pointers often a const
8606 reference is returned instead.
8608 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8610 * src/Makefile.am (dist-hook): added used to remove the CVS from
8611 cheaders upon creating a dist
8612 (EXTRA_DIST): added cheaders
8614 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8615 a character not as a small integer.
8617 * src/support/lyxstring.C (find): removed Assert and added i >=
8618 rep->sz to the first if.
8620 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8622 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8623 src/LyXView.C src/buffer.C src/bufferparams.C
8624 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8625 src/text2.C src/insets/insetinclude.C:
8626 lyxlayout renamed to textclasslist.
8628 * src/layout.C: some lyxerr changes.
8630 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8631 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8632 (LyXLayoutList): removed all traces of this class.
8633 (LyXTextClass::Read): rewrote LT_STYLE
8634 (LyXTextClass::hasLayout): new function
8635 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8636 both const and nonconst version.
8637 (LyXTextClass::delete_layout): new function.
8638 (LyXTextClassList::Style): bug fix. do the right thing if layout
8640 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8641 (LyXTextClassList::NameOfLayout): ditto
8642 (LyXTextClassList::Load): ditto
8644 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8646 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8648 * src/LyXAction.C (LookupFunc): added a workaround for sun
8649 compiler, on the other hand...we don't know if the current code
8650 compiles on sun at all...
8652 * src/support/filetools.C (CleanupPath): subst fix
8654 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8657 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8658 complained about this one?
8660 * src/insets/insetinclude.C (Latex): subst fix
8662 * src/insets/insetbib.C (getKeys): subst fix
8664 * src/LyXSendto.C (SendtoApplyCB): subst fix
8666 * src/lyx_main.C (init): subst fix
8668 * src/layout.C (Read): subst fix
8670 * src/lyx_sendfax_main.C (button_send): subst fix
8672 * src/buffer.C (RoffAsciiTable): subst fix
8674 * src/lyx_cb.C (MenuFax): subst fix
8675 (PrintApplyCB): subst fix
8677 1999-10-26 Juergen Vigna <jug@sad.it>
8679 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8681 (Read): Cleaned up this code so now we read only format vestion >= 5
8683 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8686 come nobody has complained about this one?
8688 * src/insets/insetinclude.C (Latex): subst fix
8690 * src/insets/insetbib.C (getKeys): subst fix
8692 * src/lyx_main.C (init): subst fix
8694 * src/layout.C (Read): subst fix
8696 * src/buffer.C (RoffAsciiTable): subst fix
8698 * src/lyx_cb.C (MenuFax): subst fix.
8700 * src/layout.[hC] + some other files: rewrote to use
8701 std::container to store textclasses and layouts in.
8702 Simplified, removed a lot of code. Make all classes
8703 assignable. Further simplifications and review of type
8704 use still to be one.
8706 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8707 lastfiles to create the lastfiles partr of the menu.
8709 * src/lastfiles.[Ch]: rewritten to use deque to store the
8710 lastfiles in. Uses fstream for reading and writing. Simplifies
8713 * src/support/syscall.C: remove explicit cast.
8715 * src/BufferView.C (CursorToggleCB): removed code snippets that
8717 use explicat C++ style casts instead of C style casts. also use
8718 u_vdata instea of passing pointers in longs.
8720 * src/PaperLayout.C: removed code snippets that were commented out.
8722 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8724 * src/lyx_main.C: removed code snippets that wer commented out.
8726 * src/paragraph.C: removed code snippets that were commented out.
8728 * src/lyxvc.C (logClose): use static_cast
8730 (viewLog): remove explicit cast to void*
8731 (showLog): removed old commented code
8733 * src/menus.C: use static_cast instead of C style casts. use
8734 u_vdata instead of u_ldata. remove explicit cast to (long) for
8735 pointers. Removed old code that was commented out.
8737 * src/insets/inset.C: removed old commented func
8739 * src/insets/insetref.C (InsetRef): removed old code that had been
8740 commented out for a long time.
8742 (escape): removed C style cast
8744 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8746 * src/insets/insetlatex.C (Draw): removed old commented code
8747 (Read): rewritten to use string
8749 * src/insets/insetlabel.C (escape): removed C style cast
8751 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8753 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8756 * src/insets/insetinclude.h: removed a couple of stupid bools
8758 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8759 (Clone): remove C style cast
8760 (getKeys): changed list to lst because of std::list
8762 * src/insets/inseterror.C (Draw): removed som old commented code.
8764 * src/insets/insetcommand.C (Draw): removed some old commented code.
8766 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8767 commented out forever.
8768 (bibitem_cb): use static_cast instead of C style cast
8769 use of vdata changed to u_vdata.
8771 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8773 (CloseUrlCB): use static_cast instead of C style cast.
8774 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8776 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8777 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8778 (CloseInfoCB): static_cast from ob->u_vdata instead.
8779 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8782 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8783 (C_InsetError_CloseErrorCB): forward the ob parameter
8784 (CloseErrorCB): static_cast from ob->u_vdata instead.
8786 * src/vspace.h: include LString.h since we use string in this class.
8788 * src/vspace.C (lyx_advance): changed name from advance because of
8789 nameclash with stl. And since we cannot use namespaces yet...I
8790 used a lyx_ prefix instead. Expect this to change when we begin
8793 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8795 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8796 and removed now defunct constructor and deconstructor.
8798 * src/BufferView.h: have backstack as a object not as a pointer.
8799 removed initialization from constructor. added include for BackStack
8801 * development/lyx.spec.in (%build): add CFLAGS also.
8803 * src/screen.C (drawFrame): removed another warning.
8805 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8807 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8808 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8809 README and ANNOUNCE a bit for the next release. More work is
8812 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8813 unbreakable if we are in freespacing mode (LyX-Code), but not in
8816 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * src/BackStack.h: fixed initialization order in constructor
8820 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8822 * acinclude.m4 (VERSION): new rules for when a version is
8823 development, added also a variable for prerelease.
8824 (warnings): we set with_warnings=yes for prereleases
8825 (lyx_opt): prereleases compile with same optimization as development
8826 (CXXFLAGS): only use pedantic if we are a development version
8828 * src/BufferView.C (restorePosition): don't do anything if the
8831 * src/BackStack.h: added member empty, use this to test if there
8832 is anything to pop...
8834 1999-10-25 Juergen Vigna <jug@sad.it>
8837 * forms/layout_forms.fd +
8838 * forms/latexoptions.fd +
8839 * lyx.fd: changed for various form resize issues
8841 * src/mathed/math_panel.C +
8842 * src/insets/inseterror.C +
8843 * src/insets/insetinfo.C +
8844 * src/insets/inseturl.C +
8845 * src/insets/inseturl.h +
8848 * src/PaperLayout.C +
8849 * src/ParagraphExtra.C +
8850 * src/TableLayout.C +
8852 * src/layout_forms.C +
8859 * src/menus.C: fixed various resize issues. So now forms can be
8860 resized savely or not be resized at all.
8862 * forms/form_url.fd +
8863 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8866 * src/insets/Makefile.am: added files form_url.[Ch]
8868 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8870 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8871 (and presumably 6.2).
8873 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8874 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8875 remaining static member callbacks.
8877 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8880 * src/support/lyxstring.h: declare struct Srep as friend of
8881 lyxstring, since DEC cxx complains otherwise.
8883 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8885 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8887 * src/LaTeX.C (run): made run_bibtex also depend on files with
8889 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8890 are put into the dependency file.
8892 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8893 the code has shown itself to work
8894 (create_ispell_pipe): removed another warning, added a comment
8897 * src/minibuffer.C (ExecutingCB): removed code that has been
8898 commented out a long time
8900 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8901 out code + a warning.
8903 * src/support/lyxstring.h: comment out the three private
8904 operators, when compiling with string ansi conforming compilers
8907 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8909 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8910 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8913 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8916 * src/mathed/math_panel.C (create_math_panel): remove explicit
8919 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8922 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8923 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8924 to XCreatePixmapFromBitmapData
8925 (fl_set_bmtable_data): change the last argument to be unsigned
8927 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8928 and bh to be unsigned int, remove explicit casts in call to
8929 XReadBitmapFileData.
8931 * images/arrows.xbm: made the arrays unsigned char *
8932 * images/varsz.xbm: ditto
8933 * images/misc.xbm: ditto
8934 * images/greek.xbm: ditto
8935 * images/dots.xbm: ditto
8936 * images/brel.xbm: ditto
8937 * images/bop.xbm: ditto
8939 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8941 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8942 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8943 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8945 (LYX_CXX_CHEADERS): added <clocale> to the test.
8947 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8949 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8951 * src/support/lyxstring.C (append): fixed something that must be a
8952 bug, rep->assign was used instead of rep->append.
8954 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8957 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8958 lyx insert double chars. Fix spotted by Kayvan.
8960 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8962 * Fixed the tth support. I messed up with the Emacs patch apply feature
8963 and omitted the changes in lyxrc.C.
8965 1999-10-22 Juergen Vigna <jug@sad.it>
8967 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8969 * src/lyx_cb.C (MenuInsertRef) +
8970 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8971 the form cannot be resized under it limits (fixes a segfault)
8973 * src/lyx.C (create_form_form_ref) +
8974 * forms/lyx.fd: Changed Gravity on name input field so that it is
8977 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8979 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8980 <ostream> and <istream>.
8982 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8983 whether <fstream> provides the latest standard features, or if we
8984 have an oldstyle library (like in egcs).
8985 (LYX_CXX_STL_STRING): fix the test.
8987 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8988 code on MODERN_STL_STREAM.
8990 * src/support/lyxstring.h: use L{I,O}stream.h.
8992 * src/support/L{I,O}stream.h: new files, designed to setup
8993 correctly streams for our use
8994 - includes the right header depending on STL capabilities
8995 - puts std::ostream and std::endl (for LOStream.h) or
8996 std::istream (LIStream.h) in toplevel namespace.
8998 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9000 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9001 was a bib file that had been changed we ensure that bibtex is run.
9002 (runBibTeX): enhanced to extract the names of the bib files and
9003 getting their absolute path and enter them into the dep file.
9004 (findtexfile): static func that is used to look for tex-files,
9005 checks for absolute patchs and tries also with kpsewhich.
9006 Alternative ways of finding the correct files are wanted. Will
9008 (do_popen): function that runs a command using popen and returns
9009 the whole output of that command in a string. Should be moved to
9012 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9013 file with extension ext has changed.
9015 * src/insets/figinset.C: added ifdef guards around the fl_free
9016 code that jug commented out. Now it is commented out when
9017 compiling with XForms == 0.89.
9019 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9020 to lyxstring.C, and only keep a forward declaration in
9021 lyxstring.h. Simplifies the header file a bit and should help a
9022 bit on compile time too. Also changes to Srep will not mandate a
9023 recompile of code just using string.
9024 (~lyxstring): definition moved here since it uses srep.
9025 (size): definition moved here since it uses srep.
9027 * src/support/lyxstring.h: removed a couple of "inline" that should
9030 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9032 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9035 1999-10-21 Juergen Vigna <jug@sad.it>
9037 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9038 set to left if I just remove the width entry (or it is empty).
9040 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9041 paragraph when having dummy paragraphs.
9043 1999-10-20 Juergen Vigna <jug@sad.it>
9045 * src/insets/figinset.C: just commented some fl_free_form calls
9046 and added warnings so that this calls should be activated later
9047 again. This avoids for now a segfault, but we have a memory leak!
9049 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9050 'const char * argument' to 'string argument', this should
9051 fix some Asserts() in lyxstring.C.
9053 * src/lyxfunc.h: Removed the function argAsString(const char *)
9054 as it is not used anymore.
9056 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9058 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9061 * src/Literate.h: some funcs moved from public to private to make
9062 interface clearer. Unneeded args removed.
9064 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9066 (scanBuildLogFile): ditto
9068 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9069 normal TeX Error. Still room for improvement.
9071 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9073 * src/buffer.C (insertErrors): changes to make the error
9074 desctription show properly.
9076 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9079 * src/support/lyxstring.C (helper): changed to use
9080 sizeof(object->rep->ref).
9081 (operator>>): changed to use a pointer instead.
9083 * src/support/lyxstring.h: changed const reference & to value_type
9084 const & lets see if that helps.
9086 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9088 * Makefile.am (rpmdist): fixed to have non static package and
9091 * src/support/lyxstring.C: removed the compilation guards
9093 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9096 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9097 conditional compile of lyxstring.Ch
9099 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9100 stupid check, but it is a lot better than the bastring hack.
9101 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9103 * several files: changed string::erase into string::clear. Not
9106 * src/chset.C (encodeString): use a char temporary instead
9108 * src/table.C (TexEndOfCell): added tostr around
9109 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9110 (TexEndOfCell): ditto
9111 (TexEndOfCell): ditto
9112 (TexEndOfCell): ditto
9113 (DocBookEndOfCell): ditto
9114 (DocBookEndOfCell): ditto
9115 (DocBookEndOfCell): ditto
9116 (DocBookEndOfCell): ditto
9118 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9120 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9122 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9123 (MenuBuildProg): added tostr around ret
9124 (MenuRunChktex): added tostr around ret
9125 (DocumentApplyCB): added tostr around ret
9127 * src/chset.C (encodeString): added tostr around t->ic
9129 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9130 (makeLaTeXFile): added tostr around tocdepth
9131 (makeLaTeXFile): added tostr around ftcound - 1
9133 * src/insets/insetbib.C (setCounter): added tostr around counter.
9135 * src/support/lyxstring.h: added an operator+=(int) to catch more
9138 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9139 (lyxstring): We DON'T allow NULL pointers.
9141 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9143 * src/mathed/math_macro.C (MathMacroArgument::Write,
9144 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9145 when writing them out.
9147 * src/LString.C: remove, since it is not used anymore.
9149 * src/support/lyxstring.C: condition the content to
9150 USE_INCLUDED_STRING macro.
9152 * src/mathed/math_symbols.C, src/support/lstrings.C,
9153 src/support/lyxstring.C: add `using' directive to specify what
9154 we need in <algorithm>. I do not think that we need to
9155 conditionalize this, but any thought is appreciated.
9157 * many files: change all callback functions to "C" linkage
9158 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9159 strict_ansi. Those who were static are now global.
9160 The case of callbacks which are static class members is
9161 trickier, since we have to make C wrappers around them (see
9162 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9163 did not finish this yet, since it defeats the purpose of
9164 encapsulation, and I am not sure what the best route is.
9166 1999-10-19 Juergen Vigna <jug@sad.it>
9168 * src/support/lyxstring.C (lyxstring): we permit to have a null
9169 pointer as assignment value and just don't assign it.
9171 * src/vspace.C (nextToken): corrected this function substituting
9172 find_first(_not)_of with find_last_of.
9174 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9175 (TableOptCloseCB) (TableSpeCloseCB):
9176 inserted fl_set_focus call for problem with fl_hide_form() in
9179 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9181 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9184 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9186 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9187 LyXLex::next() and not eatline() to get its argument.
9189 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9191 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9192 instead, use fstreams for io of the depfile, removed unneeded
9193 functions and variables.
9195 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9196 vector instead, removed all functions and variables that is not in
9199 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9201 * src/buffer.C (insertErrors): use new interface to TeXError
9203 * Makefile.am (rpmdist): added a rpmdist target
9205 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9206 per Kayvan's instructions.
9208 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9210 * src/Makefile.am: add a definition for localedir, so that locales
9211 are found after installation (Kayvan)
9213 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9215 * development/.cvsignore: new file.
9217 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9220 C++ compiler provides wrappers for C headers and use our alternate
9223 * configure.in: use LYX_CXX_CHEADERS.
9225 * src/cheader/: new directory, populated with cname headers from
9226 libstdc++-2.8.1. They are a bit old, but probably good enough for
9227 what we want (support compilers who lack them).
9229 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9230 from includes. It turns out is was stupid.
9232 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9234 * lib/Makefile.am (install-data-local): forgot a ';'
9235 (install-data-local): forgot a '\'
9236 (libinstalldirs): needed after all. reintroduced.
9238 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9240 * configure.in (AC_OUTPUT): added lyx.spec
9242 * development/lyx.spec: removed file
9244 * development/lyx.spec.in: new file
9246 * po/*.po: merged with lyx.pot becuase of make distcheck
9248 * lib/Makefile.am (dist-hook): added dist-hook so that
9249 documentation files will be included when doing a make
9250 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9251 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9253 more: tried to make install do the right thing, exclude CVS dirs
9256 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9257 Path would fit in more nicely.
9259 * all files that used to use pathstack: uses now Path instead.
9260 This change was a lot easier than expected.
9262 * src/support/path.h: new file
9264 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9266 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9268 * src/support/lyxstring.C (getline): Default arg was given for
9271 * Configure.cmd: removed file
9273 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9275 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9276 streams classes and types, add the proper 'using' statements when
9277 MODERN_STL is defined.
9279 * src/debug.h: move the << operator definition after the inclusion
9282 * src/support/filetools.C: include "LAssert.h", which is needed
9285 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9288 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9289 include "debug.h" to define a proper ostream.
9291 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9293 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9294 method to the SystemCall class which can kill a process, but it's
9295 not fully implemented yet.
9297 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9299 * src/support/FileInfo.h: Better documentation
9301 * src/lyxfunc.C: Added support for buffer-export html
9303 * src/menus.C: Added Export->As HTML...
9305 * lib/bind/*.bind: Added short-cut for buffer-export html
9307 * src/lyxrc.*: Added support for new \tth_command
9309 * lib/lyxrc.example: Added stuff for new \tth_command
9311 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9313 * lib/Makefile.am (IMAGES): removed images/README
9314 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9315 installes in correct place. Check permisions is installed
9318 * src/LaTeX.C: some no-op changes moved declaration of some
9321 * src/LaTeX.h (LATEX_H): changed include guard name
9323 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9325 * lib/reLyX/Makefile.am: install noweb2lyx.
9327 * lib/Makefile.am: install configure.
9329 * lib/reLyX/configure.in: declare a config aux dir; set package
9330 name to lyx (not sure what the best solution is); generate noweb2lyx.
9332 * lib/layouts/egs.layout: fix the bibliography layout.
9334 1999-10-08 Jürgen Vigna <jug@sad.it>
9336 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9337 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9338 it returned without continuing to search the path.
9340 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9342 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9343 also fixes a bug. It is not allowed to do tricks with std::strings
9344 like: string a("hei"); &a[e]; this will not give what you
9345 think... Any reason for the complexity in this func?
9347 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9349 * Updated README and INSTALL a bit, mostly to check that my
9350 CVS rights are correctly set up.
9352 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9354 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9355 does not allow '\0' chars but lyxstring and std::string does.
9357 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9359 * autogen.sh (AUTOCONF): let the autogen script create the
9360 POTFILES.in file too. POTFILES.in should perhaps now not be
9361 included in the cvs module.
9363 * some more files changed to use C++ includes instead of C ones.
9365 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9367 (Reread): added tostr to nlink. buggy output otherwise.
9368 (Reread): added a string() around szMode when assigning to Buffer,
9369 without this I got a log of garbled info strings.
9371 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9374 * I have added several ostream & operator<<(ostream &, some_type)
9375 functions. This has been done to avoid casting and warnings when
9376 outputting enums to lyxerr. This as thus eliminated a lot of
9377 explicit casts and has made the code clearer. Among the enums
9378 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9379 mathed enums, some font enum the Debug::type enum.
9381 * src/support/lyxstring.h (clear): missing method. equivalent of
9384 * all files that contained "stderr": rewrote constructs that used
9385 stderr to use lyxerr instead. (except bmtable)
9387 * src/support/DebugStream.h (level): and the passed t with
9388 Debug::ANY to avoid spurious bits set.
9390 * src/debug.h (Debug::type value): made it accept strings of the
9393 * configure.in (Check for programs): Added a check for kpsewhich,
9394 the latex generation will use this later to better the dicovery of
9397 * src/BufferView.C (create_view): we don't need to cast this to
9398 (void*) that is done automatically.
9399 (WorkAreaButtonPress): removed some dead code.
9401 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9403 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9404 is not overwritten when translated (David Sua'rez de Lis).
9406 * lib/CREDITS: Added David Sua'rez de Lis
9408 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9410 * src/bufferparams.C (BufferParams): default input encoding is now
9413 * acinclude.m4 (cross_compiling): comment out macro
9414 LYX_GXX_STRENGTH_REDUCE.
9416 * acconfig.h: make sure that const is not defined (to empty) when
9417 we are compiling C++. Remove commented out code using SIZEOF_xx
9420 * configure.in : move the test for const and inline as late as
9421 possible so that these C tests do not interefere with C++ ones.
9422 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9423 has not been proven.
9425 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9427 * src/table.C (getDocBookAlign): remove bad default value for
9430 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9432 (ShowFileMenu2): ditto.
9434 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9437 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * Most files: finished the change from the old error code to use
9440 DebugStream for all lyxerr debugging. Only minor changes remain
9441 (e.g. the setting of debug levels using strings instead of number)
9443 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9445 * src/layout.C (Add): Changed to use compare_no_case instead of
9448 * src/FontInfo.C: changed loop variable type too string::size_type.
9450 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9452 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9453 set ETAGS_ARGS to --c++
9455 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9457 * src/table.C (DocBookEndOfCell): commented out two unused variables
9459 * src/paragraph.C: commented out four unused variables.
9461 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9462 insed a if clause with type string::size_type.
9464 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9467 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9469 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9470 variable, also changed loop to go from 0 to lenght + 1, instead of
9471 -1 to length. This should be correct.
9473 * src/LaTeX.C (scanError): use string::size_type as loop variable
9476 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9477 (l.896) since y_tmp and row was not used anyway.
9479 * src/insets/insetref.C (escape): use string::size_type as loop
9482 * src/insets/insetquotes.C (Width): use string::size_type as loop
9484 (Draw): use string::size_type as loop variable type.
9486 * src/insets/insetlatexaccent.C (checkContents): use
9487 string::size_type as loop variable type.
9489 * src/insets/insetlabel.C (escape): use string::size_type as loop
9492 * src/insets/insetinfo.C: added an extern for current_view.
9494 * src/insets/insetcommand.C (scanCommand): use string::size_type
9495 as loop variable type.
9497 * most files: removed the RCS tags. With them we had to recompile
9498 a lot of files after a simple cvs commit. Also we have never used
9499 them for anything meaningful.
9501 * most files: tags-query-replace NULL 0. As adviced several plases
9502 we now use "0" instead of "NULL" in our code.
9504 * src/support/filetools.C (SpaceLess): use string::size_type as
9507 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9509 * src/paragraph.C: fixed up some more string stuff.
9511 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9513 * src/support/filetools.h: make modestr a std::string.
9515 * src/filetools.C (GetEnv): made ch really const.
9517 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9518 made code that used these use max/min from <algorithm> instead.
9520 * changed several c library include files to their equivalent c++
9521 library include files. All is not changed yet.
9523 * created a support subdir in src, put lyxstring and lstrings
9524 there + the extra files atexit, fileblock, strerror. Created
9525 Makefile.am. edited configure.in and src/Makefile.am to use this
9526 new subdir. More files moved to support.
9528 * imported som of the functions from repository lyx, filetools
9530 * ran tags-query-replace on LString -> string, corrected the bogus
9531 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9532 is still some errors in there. This is errors where too much or
9533 too litle get deleted from strings (string::erase, string::substr,
9534 string::replace), there can also be some off by one errors, or
9535 just plain wrong use of functions from lstrings. Viewing of quotes
9538 * LyX is now running fairly well with string, but there are
9539 certainly some bugs yet (see above) also string is quite different
9540 from LString among others in that it does not allow null pointers
9541 passed in and will abort if it gets any.
9543 * Added the revtex4 files I forgot when setting up the repository.
9545 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9547 * All over: Tried to clean everything up so that only the files
9548 that we really need are included in the cvs repository.
9549 * Switched to use automake.
9550 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9551 * Install has not been checked.
9553 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9555 * po/pt.po: Three errors:
9556 l.533 and l.538 format specification error
9557 l. 402 duplicate entry, I just deleted it.